aboutsummaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
-rw-r--r--.gitignore3
-rw-r--r--INSTALL.md6
-rw-r--r--Makefile.in90
-rw-r--r--bootstrap/bin/start.bootbin5330 -> 5324 bytes
-rw-r--r--bootstrap/bin/start.script8
-rw-r--r--bootstrap/bin/start_clean.bootbin5330 -> 5324 bytes
-rw-r--r--bootstrap/bin/start_clean.script8
-rw-r--r--bootstrap/lib/compiler/ebin/beam_asm.beambin9028 -> 11096 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_block.beambin13136 -> 14388 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_bool.beambin14880 -> 16160 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_bsm.beambin12172 -> 13728 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_clean.beambin10128 -> 11468 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_dead.beambin11264 -> 11880 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_dict.beambin3956 -> 5360 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_disasm.beambin23268 -> 24976 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_flatten.beambin3252 -> 3448 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_jump.beambin8936 -> 9516 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_listing.beambin2720 -> 2904 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_opcodes.beambin6756 -> 6812 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_peep.beambin2356 -> 2456 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_receive.beambin5392 -> 5832 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_trim.beambin7764 -> 8568 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_type.beambin13016 -> 13820 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_utils.beambin12848 -> 14532 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/beam_validator.beambin31328 -> 34328 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/cerl.beambin28236 -> 30264 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/cerl_clauses.beambin2676 -> 2876 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/cerl_inline.beambin33288 -> 37300 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/cerl_trees.beambin15824 -> 18960 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/compile.beambin33652 -> 36380 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/compiler.app4
-rw-r--r--bootstrap/lib/compiler/ebin/core_lib.beambin5072 -> 5468 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/core_lint.beambin10944 -> 11632 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/core_parse.beambin35288 -> 37644 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/core_pp.beambin11148 -> 12124 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/core_scan.beambin6268 -> 6628 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/erl_bifs.beambin2100 -> 2100 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/rec_env.beambin4312 -> 4780 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/sys_core_dsetel.beambin6352 -> 6996 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/sys_core_fold.beambin43932 -> 47520 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/sys_core_inline.beambin3996 -> 4212 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/sys_expand_pmod.beambin7616 -> 8396 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/sys_pre_attributes.beambin3028 -> 3360 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/sys_pre_expand.beambin14156 -> 15848 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/v3_codegen.beambin47920 -> 53752 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/v3_core.beambin45460 -> 50836 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/v3_kernel.beambin40848 -> 44748 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/v3_kernel_pp.beambin10868 -> 11828 bytes
-rw-r--r--bootstrap/lib/compiler/ebin/v3_life.beambin21568 -> 23528 bytes
-rw-r--r--bootstrap/lib/compiler/egen/beam_opcodes.erl6
-rw-r--r--bootstrap/lib/compiler/egen/core_parse.erl6
-rw-r--r--bootstrap/lib/kernel/ebin/application.beambin2708 -> 2940 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/application_controller.beambin27960 -> 30684 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/application_master.beambin5944 -> 6352 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/application_starter.beambin1204 -> 1264 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/auth.beambin5908 -> 6328 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/code.beambin6284 -> 6732 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/code_server.beambin23736 -> 25896 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/disk_log.beambin32824 -> 36248 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/disk_log_1.beambin22804 -> 24896 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/disk_log_server.beambin5948 -> 6408 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/disk_log_sup.beambin552 -> 564 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/dist_ac.beambin24568 -> 26708 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/dist_util.beambin9544 -> 10508 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/erl_boot_server.beambin5268 -> 5696 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/erl_ddll.beambin2464 -> 2560 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/erl_distribution.beambin1748 -> 1836 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/erl_epmd.beambin6576 -> 7064 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/erl_reply.beambin868 -> 912 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/error_handler.beambin1828 -> 1952 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/error_logger.beambin4084 -> 4344 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/erts_debug.beambin2608 -> 2808 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/file.beambin11368 -> 12212 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/file_io_server.beambin13104 -> 14196 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/file_server.beambin4828 -> 5124 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/gen_sctp.beambin3164 -> 3372 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/gen_tcp.beambin2284 -> 2432 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/gen_udp.beambin1536 -> 1644 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/global.beambin29312 -> 32236 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/global_group.beambin16160 -> 17728 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/global_search.beambin2768 -> 3088 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/group.beambin10884 -> 11776 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/heart.beambin3624 -> 3912 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/hipe_unified_loader.beambin11460 -> 12540 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet.beambin18124 -> 19688 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet6_sctp.beambin1340 -> 1408 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet6_tcp.beambin2524 -> 2664 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet6_tcp_dist.beambin5832 -> 6256 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet6_udp.beambin1640 -> 1720 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_config.beambin8280 -> 8192 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_db.beambin24664 -> 26424 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_dns.beambin18712 -> 19748 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_gethost_native.beambin9680 -> 10500 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_hosts.beambin2016 -> 2112 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_parse.beambin11968 -> 13056 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_res.beambin13856 -> 14816 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_sctp.beambin2068 -> 2168 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_tcp.beambin2332 -> 2472 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_tcp_dist.beambin6116 -> 6540 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/inet_udp.beambin1808 -> 1904 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/kernel.app4
-rw-r--r--bootstrap/lib/kernel/ebin/kernel.appup2
-rw-r--r--bootstrap/lib/kernel/ebin/kernel.beambin3596 -> 3792 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/kernel_config.beambin2556 -> 2720 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/net.beambin584 -> 616 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/net_adm.beambin2864 -> 3064 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/net_kernel.beambin21036 -> 22720 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/os.beambin4872 -> 5228 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/packages.beambin2096 -> 2244 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/pg2.beambin6984 -> 7696 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/ram_file.beambin6512 -> 6800 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/rpc.beambin8204 -> 8748 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/seq_trace.beambin1256 -> 1336 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/standard_error.beambin3460 -> 3636 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/user.beambin11460 -> 12360 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/user_drv.beambin9324 -> 10084 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/user_sup.beambin1676 -> 1768 bytes
-rw-r--r--bootstrap/lib/kernel/ebin/wrap_log_reader.beambin3156 -> 3384 bytes
-rw-r--r--bootstrap/lib/kernel/include/inet_sctp.hrl2
-rw-r--r--bootstrap/lib/orber/include/Makefile2
-rw-r--r--bootstrap/lib/orber/include/corba.hrl2
-rw-r--r--bootstrap/lib/orber/include/orber_pi.hrl2
-rw-r--r--bootstrap/lib/stdlib/ebin/array.beambin10720 -> 12036 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/base64.beambin4096 -> 4540 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/beam_lib.beambin16504 -> 18192 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/binary.beambin2480 -> 2640 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/c.beambin12752 -> 13932 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/calendar.beambin4696 -> 5176 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dets.beambin48400 -> 53204 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dets_server.beambin6432 -> 7020 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dets_sup.beambin540 -> 552 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dets_utils.beambin25752 -> 28864 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dets_v8.beambin25132 -> 27508 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dets_v9.beambin45776 -> 50272 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/dict.beambin8392 -> 9140 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/digraph.beambin7664 -> 8320 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/digraph_utils.beambin6252 -> 6800 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/edlin.beambin7392 -> 7912 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/edlin_expand.beambin2816 -> 3044 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/epp.beambin22132 -> 24216 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_bits.beambin2468 -> 2568 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_compile.beambin4736 -> 5140 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_eval.beambin21544 -> 23480 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_expand_records.beambin19888 -> 21812 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_internal.beambin4980 -> 4996 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_lint.beambin77224 -> 83840 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_parse.beambin66332 -> 70760 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_posix_msg.beambin4992 -> 5008 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_pp.beambin21384 -> 23228 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_scan.beambin30424 -> 31776 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/erl_tar.beambin14320 -> 15352 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/error_logger_file_h.beambin4588 -> 5056 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/error_logger_tty_h.beambin4332 -> 4772 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/escript.beambin15428 -> 17044 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/ets.beambin18268 -> 20048 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/eval_bits.beambin6136 -> 6748 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/file_sorter.beambin28196 -> 30608 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/filelib.beambin6728 -> 7280 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/filename.beambin11628 -> 12560 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/gb_sets.beambin7544 -> 8256 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/gb_trees.beambin4624 -> 4992 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/gen.beambin3592 -> 3864 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/gen_event.beambin12064 -> 12900 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/gen_fsm.beambin8880 -> 9412 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/gen_server.beambin11776 -> 12508 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/io.beambin6172 -> 6608 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/io_lib.beambin8300 -> 8900 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/io_lib_format.beambin10928 -> 11960 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/io_lib_fread.beambin6836 -> 7404 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/io_lib_pretty.beambin11260 -> 12372 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/lib.beambin8148 -> 9072 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/lists.beambin27432 -> 29204 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/log_mf_h.beambin2444 -> 2644 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/math.beambin296 -> 308 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/ms_transform.beambin18684 -> 20316 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/orddict.beambin2620 -> 2748 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/ordsets.beambin1808 -> 1900 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/otp_internal.beambin8928 -> 9052 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/pg.beambin1932 -> 2064 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/pool.beambin3616 -> 3848 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/proc_lib.beambin8472 -> 9200 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/proplists.beambin4560 -> 4852 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/qlc.beambin64240 -> 69344 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/qlc_pt.beambin65960 -> 71592 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/queue.beambin5552 -> 5900 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/random.beambin1400 -> 1580 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/re.beambin11268 -> 12376 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/regexp.beambin7860 -> 8524 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/sets.beambin6456 -> 7020 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/shell.beambin28172 -> 30568 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/shell_default.beambin3552 -> 3884 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/slave.beambin4100 -> 4424 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/sofs.beambin37972 -> 41096 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/stdlib.app4
-rw-r--r--bootstrap/lib/stdlib/ebin/stdlib.appup2
-rw-r--r--bootstrap/lib/stdlib/ebin/string.beambin4328 -> 4744 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/supervisor.beambin16400 -> 18064 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/supervisor_bridge.beambin1908 -> 1980 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/sys.beambin6828 -> 7328 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/timer.beambin4924 -> 5452 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/unicode.beambin10808 -> 11552 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/win32reg.beambin5292 -> 5652 bytes
-rw-r--r--bootstrap/lib/stdlib/ebin/zip.beambin24552 -> 26824 bytes
-rw-r--r--bootstrap/lib/stdlib/egen/erl_parse.erl178
-rw-r--r--bootstrap/lib/stdlib/include/erl_bits.hrl2
-rw-r--r--bootstrap/lib/stdlib/include/erl_compile.hrl2
-rw-r--r--bootstrap/lib/stdlib/include/ms_transform.hrl2
-rw-r--r--bootstrap/lib/stdlib/include/qlc.hrl2
-rw-r--r--erts/Makefile.in3
-rw-r--r--erts/configure.in16
-rw-r--r--erts/doc/src/erl.xml7
-rw-r--r--erts/doc/src/erlang.xml66
-rw-r--r--erts/doc/src/zlib.xml60
-rw-r--r--erts/emulator/Makefile.in28
-rw-r--r--erts/emulator/beam/atom.names2
-rw-r--r--erts/emulator/beam/beam_bif_load.c30
-rw-r--r--erts/emulator/beam/beam_emu.c140
-rw-r--r--erts/emulator/beam/beam_load.c506
-rw-r--r--erts/emulator/beam/beam_load.h7
-rw-r--r--erts/emulator/beam/bif.c88
-rw-r--r--erts/emulator/beam/bif.tab6
-rw-r--r--erts/emulator/beam/erl_bif_info.c151
-rw-r--r--erts/emulator/beam/erl_gc.c40
-rw-r--r--erts/emulator/beam/erl_init.c6
-rw-r--r--erts/emulator/beam/global.h14
-rw-r--r--erts/emulator/beam/ops.tab33
-rw-r--r--erts/emulator/drivers/common/inet_drv.c4
-rw-r--r--erts/emulator/hipe/hipe_mode_switch.c13
-rw-r--r--erts/emulator/pcre/Makefile26
-rw-r--r--erts/emulator/pcre/Makefile.in165
-rw-r--r--erts/emulator/pcre/pcre.mk113
-rw-r--r--erts/emulator/test/bs_match_misc_SUITE.erl14
-rw-r--r--erts/emulator/test/call_trace_SUITE.erl26
-rw-r--r--erts/emulator/test/code_SUITE.erl32
-rw-r--r--erts/emulator/test/exception_SUITE.erl246
-rw-r--r--erts/emulator/test/guard_SUITE.erl8
-rw-r--r--erts/emulator/test/hibernate_SUITE.erl31
-rw-r--r--erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c46
-rw-r--r--erts/emulator/test/nif_SUITE_data/nif_SUITE.c38
-rw-r--r--erts/emulator/test/process_SUITE.erl99
-rw-r--r--erts/emulator/test/trace_local_SUITE.erl32
-rw-r--r--erts/epmd/src/epmd.c6
-rw-r--r--erts/epmd/src/epmd_cli.c5
-rw-r--r--erts/example/matrix_nif.c85
-rw-r--r--erts/lib_src/common/erl_misc_utils.c2
-rw-r--r--erts/lib_src/common/erl_printf_format.c4
-rw-r--r--erts/preloaded/ebin/zlib.beambin12016 -> 12608 bytes
-rw-r--r--erts/preloaded/src/zlib.erl115
-rw-r--r--lib/Makefile25
-rw-r--r--lib/asn1/c_src/Makefile12
-rw-r--r--lib/common_test/doc/src/common_test_app.xml2
-rw-r--r--lib/common_test/doc/src/ct_hooks.xml8
-rw-r--r--lib/common_test/doc/src/ct_hooks_chapter.xml19
-rw-r--r--lib/common_test/doc/src/run_test_chapter.xml2
-rw-r--r--lib/common_test/include/ct.hrl3
-rw-r--r--lib/common_test/src/Makefile4
-rw-r--r--lib/common_test/src/common_test.app.src1
-rw-r--r--lib/common_test/src/ct_framework.erl12
-rw-r--r--lib/common_test/src/ct_hooks.erl145
-rw-r--r--lib/common_test/src/ct_line.erl266
-rw-r--r--lib/common_test/src/ct_run.erl25
-rw-r--r--lib/common_test/test/ct_error_SUITE.erl79
-rw-r--r--lib/common_test/test/ct_hooks_SUITE.erl80
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl62
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl11
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl74
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl2
-rw-r--r--lib/common_test/test/ct_repeat_1_SUITE.erl7
-rw-r--r--lib/common_test/test/ct_skip_SUITE.erl9
-rw-r--r--lib/compiler/doc/src/compile.xml8
-rw-r--r--lib/compiler/src/beam_asm.erl61
-rw-r--r--lib/compiler/src/beam_block.erl35
-rw-r--r--lib/compiler/src/beam_bsm.erl9
-rw-r--r--lib/compiler/src/beam_clean.erl26
-rw-r--r--lib/compiler/src/beam_dead.erl10
-rw-r--r--lib/compiler/src/beam_dict.erl53
-rw-r--r--lib/compiler/src/beam_disasm.erl31
-rw-r--r--lib/compiler/src/beam_jump.erl49
-rw-r--r--lib/compiler/src/beam_listing.erl2
-rw-r--r--lib/compiler/src/beam_receive.erl2
-rw-r--r--lib/compiler/src/beam_trim.erl13
-rw-r--r--lib/compiler/src/beam_type.erl1
-rw-r--r--lib/compiler/src/beam_utils.erl16
-rw-r--r--lib/compiler/src/beam_validator.erl15
-rw-r--r--lib/compiler/src/compile.erl6
-rw-r--r--lib/compiler/src/genop.tab4
-rw-r--r--lib/compiler/src/v3_codegen.erl108
-rw-r--r--lib/compiler/src/v3_core.erl38
-rw-r--r--lib/compiler/src/v3_kernel.erl13
-rw-r--r--lib/compiler/src/v3_life.erl4
-rw-r--r--lib/compiler/test/bs_match_SUITE.erl4
-rw-r--r--lib/compiler/test/compile_SUITE.erl1
-rw-r--r--lib/compiler/test/guard_SUITE.erl29
-rw-r--r--lib/compiler/test/inline_SUITE.erl3
-rw-r--r--lib/compiler/test/lc_SUITE.erl4
-rw-r--r--lib/compiler/test/misc_SUITE.erl4
-rw-r--r--lib/compiler/test/trycatch_SUITE.erl16
-rw-r--r--lib/cosEvent/src/Makefile12
-rw-r--r--lib/cosEvent/test/Makefile14
-rw-r--r--lib/cosEventDomain/src/Makefile7
-rw-r--r--lib/cosFileTransfer/src/Makefile7
-rw-r--r--lib/cosNotification/src/Makefile29
-rw-r--r--lib/cosNotification/test/Makefile11
-rw-r--r--lib/cosProperty/src/Makefile6
-rw-r--r--lib/cosTime/src/Makefile11
-rw-r--r--lib/cosTransactions/src/Makefile7
-rw-r--r--lib/cosTransactions/test/Makefile11
-rw-r--r--lib/crypto/c_src/Makefile.in8
-rw-r--r--lib/debugger/doc/src/debugger_chapter.xml42
-rw-r--r--lib/debugger/doc/src/int.xml4
-rw-r--r--lib/debugger/src/Makefile1
-rw-r--r--lib/debugger/src/dbg_debugged.erl15
-rw-r--r--lib/debugger/src/dbg_icmd.erl16
-rw-r--r--lib/debugger/src/dbg_ieval.erl555
-rw-r--r--lib/debugger/src/dbg_ieval.hrl8
-rw-r--r--lib/debugger/src/dbg_iload.erl347
-rw-r--r--lib/debugger/src/dbg_iserver.erl5
-rw-r--r--lib/debugger/src/dbg_istk.erl245
-rw-r--r--lib/debugger/src/debugger.app.src1
-rw-r--r--lib/debugger/test/Makefile1
-rw-r--r--lib/debugger/test/bs_construct_SUITE.erl395
-rw-r--r--lib/debugger/test/bs_match_bin_SUITE.erl141
-rw-r--r--lib/debugger/test/bs_match_int_SUITE.erl206
-rw-r--r--lib/debugger/test/bs_match_misc_SUITE.erl453
-rw-r--r--lib/debugger/test/bs_match_tail_SUITE.erl12
-rw-r--r--lib/debugger/test/bug_SUITE.erl4
-rw-r--r--lib/debugger/test/exception_SUITE.erl264
-rw-r--r--lib/debugger/test/guard_SUITE.erl217
-rw-r--r--lib/debugger/test/int_eval_SUITE.erl47
-rw-r--r--lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl4
-rw-r--r--lib/debugger/test/int_eval_SUITE_data/stacktrace.erl130
-rw-r--r--lib/debugger/test/lc_SUITE.erl119
-rw-r--r--lib/debugger/test/line_number_SUITE.erl220
-rw-r--r--lib/debugger/test/test_lib.erl2
-rw-r--r--lib/debugger/test/trycatch_SUITE.erl17
-rw-r--r--lib/dialyzer/src/dialyzer_dataflow.erl13
-rw-r--r--lib/dialyzer/src/dialyzer_typesig.erl9
-rw-r--r--lib/dialyzer/test/Makefile2
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/asn12
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/inets23
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/mnesia5
-rw-r--r--lib/dialyzer/test/race_SUITE_data/results/extract_translations4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/flatten2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl8
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/codec_can.erl35
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl21
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl42
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl7
-rw-r--r--lib/diameter/doc/src/diameter_dict.xml9
-rw-r--r--lib/diameter/src/app/Makefile11
-rw-r--r--lib/diameter/src/compiler/diameter_codegen.erl78
-rw-r--r--lib/diameter/src/compiler/diameter_spec_util.erl50
-rw-r--r--lib/diameter/test/Makefile2
-rw-r--r--lib/docbuilder/src/docb_gen.erl4
-rw-r--r--lib/docbuilder/src/docb_main.erl12
-rw-r--r--lib/docbuilder/src/docb_transform.erl2
-rw-r--r--lib/docbuilder/src/docb_xml_check.erl1
-rw-r--r--lib/docbuilder/vsn.mk2
-rw-r--r--lib/edoc/Makefile2
-rw-r--r--lib/edoc/doc/Makefile2
-rw-r--r--lib/edoc/doc/overview.edoc7
-rw-r--r--lib/edoc/doc/src/Makefile2
-rw-r--r--lib/edoc/include/Makefile2
-rw-r--r--lib/edoc/priv/edoc_generate.src3
-rw-r--r--lib/edoc/src/Makefile2
-rw-r--r--lib/edoc/src/edoc.erl19
-rw-r--r--lib/edoc/src/edoc_data.erl2
-rw-r--r--lib/edoc/src/edoc_doclet.erl4
-rw-r--r--lib/edoc/src/edoc_extract.erl10
-rw-r--r--lib/edoc/src/edoc_layout.erl20
-rw-r--r--lib/edoc/src/edoc_lib.erl6
-rw-r--r--lib/edoc/src/edoc_parser.yrl7
-rw-r--r--lib/edoc/src/edoc_report.erl2
-rw-r--r--lib/edoc/src/edoc_run.erl2
-rw-r--r--lib/edoc/src/edoc_scanner.erl2
-rw-r--r--lib/edoc/src/edoc_specs.erl8
-rw-r--r--lib/edoc/src/edoc_tags.erl2
-rw-r--r--lib/edoc/src/edoc_types.erl6
-rw-r--r--lib/edoc/src/edoc_wiki.erl8
-rw-r--r--lib/edoc/src/otpsgml_layout.erl4
-rw-r--r--lib/edoc/test/edoc_SUITE.erl2
-rw-r--r--lib/erl_interface/src/Makefile.in34
-rw-r--r--lib/et/src/et_wx_viewer.erl4
-rw-r--r--lib/eunit/doc/overview.edoc2
-rw-r--r--lib/eunit/include/eunit.hrl102
-rw-r--r--lib/eunit/src/Makefile13
-rw-r--r--lib/eunit/src/eunit.app.src16
-rw-r--r--lib/eunit/src/eunit.erl2
-rw-r--r--lib/eunit/src/eunit_data.erl70
-rw-r--r--lib/eunit/src/eunit_server.erl7
-rw-r--r--lib/eunit/src/eunit_surefire.erl58
-rw-r--r--lib/eunit/src/eunit_test.erl72
-rw-r--r--lib/eunit/src/eunit_tests.erl26
-rw-r--r--lib/eunit/vsn.mk2
-rw-r--r--lib/gs/src/Makefile4
-rw-r--r--lib/hipe/cerl/erl_bif_types.erl13
-rw-r--r--lib/hipe/icode/hipe_beam_to_icode.erl11
-rw-r--r--lib/hipe/main/hipe.hrl.src7
-rw-r--r--lib/ic/c_src/Makefile.in8
-rw-r--r--lib/ic/doc/src/notes.xml18
-rw-r--r--lib/ic/examples/pre_post_condition/Makefile7
-rw-r--r--lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf1
-rw-r--r--lib/ic/src/ic_pp.erl472
-rw-r--r--lib/ic/src/ic_pragma.erl19
-rw-r--r--lib/ic/vsn.mk2
-rw-r--r--lib/jinterface/java_src/Makefile16
-rw-r--r--lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile (renamed from lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile.otp)2
-rw-r--r--lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf1
-rw-r--r--lib/kernel/doc/src/gen_sctp.xml146
-rw-r--r--lib/kernel/doc/src/gen_tcp.xml25
-rw-r--r--lib/kernel/doc/src/gen_udp.xml21
-rw-r--r--lib/kernel/doc/src/inet.xml58
-rw-r--r--lib/kernel/src/code_server.erl17
-rw-r--r--lib/kernel/src/error_handler.erl9
-rw-r--r--lib/kernel/src/file.erl7
-rw-r--r--lib/kernel/src/gen_sctp.erl174
-rw-r--r--lib/kernel/src/gen_tcp.erl120
-rw-r--r--lib/kernel/src/gen_udp.erl87
-rw-r--r--lib/kernel/src/inet.erl147
-rw-r--r--lib/kernel/src/inet_res.erl4
-rw-r--r--lib/kernel/test/application_SUITE.erl44
-rw-r--r--lib/kernel/test/code_SUITE.erl34
-rw-r--r--lib/kernel/test/disk_log_SUITE.erl4
-rw-r--r--lib/kernel/test/erl_prim_loader_SUITE.erl2
-rw-r--r--lib/kernel/test/gen_tcp_api_SUITE.erl8
-rw-r--r--lib/kernel/test/gen_udp_SUITE.erl15
-rw-r--r--lib/kernel/test/global_group_SUITE.erl16
-rw-r--r--lib/kernel/test/init_SUITE.erl2
-rw-r--r--lib/kernel/test/ram_file_SUITE.erl4
-rw-r--r--lib/kernel/test/zlib_SUITE.erl12
-rw-r--r--lib/megaco/src/binary/depend.mk180
-rw-r--r--lib/megaco/src/flex/Makefile.in11
-rw-r--r--lib/mnesia/src/mnesia_lib.erl2
-rw-r--r--lib/mnesia/src/mnesia_loader.erl2
-rw-r--r--lib/observer/src/Makefile9
-rw-r--r--lib/odbc/c_src/odbcserver.c1
-rw-r--r--lib/odbc/test/mysql.erl17
-rw-r--r--lib/odbc/test/odbc_connect_SUITE.erl34
-rw-r--r--lib/odbc/test/odbc_data_type_SUITE.erl24
-rw-r--r--lib/odbc/test/odbc_query_SUITE.erl16
-rw-r--r--lib/odbc/test/odbc_start_SUITE.erl17
-rw-r--r--lib/odbc/test/odbc_test.hrl6
-rw-r--r--lib/odbc/test/odbc_test_lib.erl36
-rw-r--r--lib/odbc/test/postgres.erl9
-rw-r--r--lib/orber/COSS/CosNaming/Makefile6
-rw-r--r--lib/orber/doc/src/Orber/ignore_config_record.inf1
-rw-r--r--lib/orber/examples/Stack/Makefile10
-rw-r--r--lib/orber/src/Makefile11
-rw-r--r--lib/orber/src/corba.erl4
-rw-r--r--lib/orber/src/orber_diagnostics.erl4
-rw-r--r--lib/orber/src/orber_ifr.erl2
-rw-r--r--lib/orber/test/Makefile26
-rw-r--r--lib/os_mon/c_src/Makefile.in8
-rw-r--r--lib/os_mon/mibs/Makefile3
-rw-r--r--lib/parsetools/doc/src/yecc.xml8
-rw-r--r--lib/parsetools/include/yeccpre.hrl4
-rw-r--r--lib/parsetools/src/yeccparser.erl4
-rw-r--r--lib/percept/src/percept_db.erl11
-rw-r--r--lib/public_key/asn1/Makefile2
-rw-r--r--lib/public_key/asn1/README2
-rw-r--r--lib/public_key/doc/src/public_key.xml16
-rw-r--r--lib/public_key/src/public_key.erl7
-rw-r--r--lib/runtime_tools/c_src/Makefile.in15
-rw-r--r--lib/runtime_tools/doc/src/dbg.xml25
-rw-r--r--lib/runtime_tools/src/dbg.erl13
-rw-r--r--lib/sasl/examples/src/Makefile2
-rw-r--r--lib/sasl/test/Makefile2
-rw-r--r--lib/snmp/mibs/Makefile.in34
-rw-r--r--lib/snmp/src/agent/snmpa_set_lib.erl8
-rw-r--r--lib/snmp/test/Makefile4
-rw-r--r--lib/snmp/test/test_config/Makefile18
-rw-r--r--lib/ssh/doc/src/notes.xml14
-rw-r--r--lib/ssh/src/Makefile9
-rw-r--r--lib/ssh/src/ssh.appup.src10
-rwxr-xr-xlib/ssh/src/ssh_sftp.erl12
-rw-r--r--lib/ssh/test/Makefile2
-rw-r--r--lib/ssh/vsn.mk2
-rw-r--r--lib/ssl/c_src/Makefile.in8
-rw-r--r--lib/ssl/c_src/esock_openssl.c2
-rw-r--r--lib/ssl/doc/src/notes.xml6
-rw-r--r--lib/ssl/doc/src/ssl.xml31
-rw-r--r--lib/ssl/doc/src/ssl_protocol.xml4
-rw-r--r--lib/ssl/doc/src/using_ssl.xml8
-rw-r--r--lib/ssl/src/ssl.erl42
-rw-r--r--lib/ssl/src/ssl_connection.erl16
-rw-r--r--lib/ssl/src/ssl_handshake.erl14
-rw-r--r--lib/ssl/src/ssl_internal.hrl3
-rw-r--r--lib/ssl/src/ssl_manager.erl12
-rw-r--r--lib/ssl/src/ssl_record.erl2
-rw-r--r--lib/ssl/src/ssl_session.erl4
-rw-r--r--lib/ssl/src/ssl_session_cache.erl4
-rw-r--r--lib/ssl/src/ssl_ssl2.erl2
-rw-r--r--lib/stdlib/doc/src/dets.xml2
-rw-r--r--lib/stdlib/doc/src/gen_fsm.xml8
-rw-r--r--lib/stdlib/doc/src/supervisor.xml9
-rw-r--r--lib/stdlib/doc/src/unicode_usage.xml2
-rw-r--r--lib/stdlib/src/beam_lib.erl19
-rw-r--r--lib/stdlib/src/c.erl2
-rw-r--r--lib/stdlib/src/dets.erl13
-rw-r--r--lib/stdlib/src/epp.erl9
-rw-r--r--lib/stdlib/src/erl_eval.erl10
-rw-r--r--lib/stdlib/src/erl_internal.erl1
-rw-r--r--lib/stdlib/src/escript.erl8
-rw-r--r--lib/stdlib/src/eval_bits.erl55
-rw-r--r--lib/stdlib/src/gen_event.erl8
-rw-r--r--lib/stdlib/src/gen_fsm.erl6
-rw-r--r--lib/stdlib/src/gen_server.erl6
-rw-r--r--lib/stdlib/src/io_lib.erl4
-rw-r--r--lib/stdlib/src/lib.erl46
-rw-r--r--lib/stdlib/src/otp_internal.erl8
-rw-r--r--lib/stdlib/src/proplists.erl3
-rw-r--r--lib/stdlib/src/qlc.erl7
-rw-r--r--lib/stdlib/src/re.erl16
-rw-r--r--lib/stdlib/src/shell.erl2
-rw-r--r--lib/stdlib/src/sofs.erl5
-rw-r--r--lib/stdlib/src/supervisor.erl7
-rw-r--r--lib/stdlib/src/sys.erl4
-rw-r--r--lib/stdlib/src/timer.erl2
-rw-r--r--lib/stdlib/src/unicode.erl12
-rw-r--r--lib/stdlib/src/zip.erl10
-rw-r--r--lib/stdlib/test/beam_lib_SUITE.erl37
-rw-r--r--lib/stdlib/test/dets_SUITE.erl103
-rw-r--r--lib/stdlib/test/epp_SUITE.erl4
-rw-r--r--lib/stdlib/test/erl_eval_SUITE.erl2
-rw-r--r--lib/stdlib/test/erl_lint_SUITE.erl2
-rw-r--r--lib/stdlib/test/ets_SUITE.erl10
-rw-r--r--lib/stdlib/test/file_sorter_SUITE.erl16
-rw-r--r--lib/stdlib/test/filelib_SUITE.erl11
-rw-r--r--lib/stdlib/test/proc_lib_SUITE.erl2
-rw-r--r--lib/stdlib/test/re_SUITE.erl92
-rw-r--r--lib/stdlib/test/shell_SUITE.erl6
-rw-r--r--lib/stdlib/test/sofs_SUITE.erl6
-rw-r--r--lib/stdlib/test/string_SUITE.erl4
-rw-r--r--lib/stdlib/test/supervisor_SUITE.erl35
-rw-r--r--lib/stdlib/test/supervisor_bridge_SUITE.erl2
-rw-r--r--lib/stdlib/test/sys_SUITE.erl2
-rw-r--r--lib/stdlib/test/tar_SUITE.erl18
-rw-r--r--lib/stdlib/test/zip_SUITE.erl3
-rw-r--r--lib/test_server/include/test_server.hrl5
-rw-r--r--lib/test_server/include/test_server_line.hrl3
-rw-r--r--lib/test_server/src/Makefile1
-rw-r--r--lib/test_server/src/test_server.app.src1
-rw-r--r--lib/test_server/src/test_server.erl209
-rw-r--r--lib/test_server/src/test_server_line.erl387
-rw-r--r--lib/test_server/src/test_server_sup.erl11
-rw-r--r--lib/test_server/src/ts_install_cth.erl17
-rw-r--r--lib/test_server/test/Makefile2
-rw-r--r--lib/tools/emacs/erlang.el84
-rw-r--r--lib/tv/src/tv_main.erl2
-rw-r--r--lib/tv/src/tv_mnesia_rpc.erl2
-rw-r--r--lib/webtool/priv/Makefile8
-rw-r--r--lib/wx/src/wx_object.erl6
-rw-r--r--lib/wx/test/wxt.erl4
-rw-r--r--lib/xmerl/include/xmerl_xsd.hrl1
-rw-r--r--lib/xmerl/src/xmerl.erl2
-rw-r--r--lib/xmerl/src/xmerl_scan.erl2
-rw-r--r--lib/xmerl/src/xmerl_xsd.erl43
-rw-r--r--lib/xmerl/test/Makefile2
-rw-r--r--lib/xmerl/test/xmerl_SUITE.erl13
-rw-r--r--lib/xmerl/test/xmerl_SUITE_data/misc.tar.gzbin47121 -> 47340 bytes
-rw-r--r--lib/xmerl/test/xmerl_xsd_SUITE.erl7
-rw-r--r--make/otp_subdir.mk7
-rw-r--r--system/doc/getting_started/seq_prog.xml22
-rw-r--r--system/doc/reference_manual/distributed.xml2
565 files changed, 8004 insertions, 4373 deletions
diff --git a/.gitignore b/.gitignore
index 592ac6668b..4f56040f94 100644
--- a/.gitignore
+++ b/.gitignore
@@ -91,6 +91,9 @@ lib/wx/priv/win32/
lib/wx/win32/
make/win32/
+# Used by ic & orber & cos* applications.
+IDL-GENERATED
+
# Anchored from $ERL_TOP
/bin
/config.log
diff --git a/INSTALL.md b/INSTALL.md
index a19e35b01f..8a3b71e4ec 100644
--- a/INSTALL.md
+++ b/INSTALL.md
@@ -27,7 +27,7 @@ on Unix. For detailed instructions on how to
Binary releases for Windows can be found at
<http://www.erlang.org/download.html>.
-Before reading the above mensioned documents you are in any case advised to
+Before reading the above mentioned documents you are in any case advised to
read this document first, since it covers building Erlang/OTP in general as
well as other important information.
@@ -418,7 +418,7 @@ as before, but the build process will take a much longer time.
### Building in Git ###
When building in a Git working directory you also have to have a GNU `autoconf`
-of at least version 2.59 on your system. This since you need to generate the
+of at least version 2.59 on your system, because you need to generate the
`configure` scripts before you can start building.
The `configure` scripts are generated by invoking `./otp_build autoconf` in
@@ -430,7 +430,7 @@ when checking out a branch. Regenerated `configure` scripts imply that you
have to run `configure` and build again.
> *NOTE*: Running `./otp_build autoconf` is **not** needed when building
-> an unmodified version the released source.
+> an unmodified version of the released source.
Other useful information can be found at our github wiki:
<http://wiki.github.com/erlang/otp>
diff --git a/Makefile.in b/Makefile.in
index 5acd390333..b0a00d098a 100644
--- a/Makefile.in
+++ b/Makefile.in
@@ -19,6 +19,8 @@
# Toplevel makefile for building the Erlang system
#
+.NOTPARALLEL:
+
# ----------------------------------------------------------------------
# And you'd think that this would be obvious... :-)
@@ -309,13 +311,13 @@ ifeq ($(BOOTSTRAP_ONLY),yes)
all: bootstrap
else
# The normal case; not cross compiling, and not bootstrap only build.
-all: bootstrap libs local_setup dialyzer
+all: bootstrap libs local_setup
endif
else
# Cross compiling
-all: cross_check_erl depend emulator libs start_scripts dialyzer
+all: cross_check_erl depend emulator libs start_scripts
endif
@@ -374,17 +376,6 @@ else
cd $(ERL_TOP)/lib && \
ERL_TOP=$(ERL_TOP) PATH=$(INST_PATH_PREFIX)$${PATH} \
$(MAKE) BUILD_ALL=1 TESTROOT=$(RELEASE_ROOT) release
-ifneq ($(findstring vxworks,$(TARGET)),vxworks)
- @if test -f lib/dialyzer/SKIP ; then \
- echo "=== Skipping dialyzer, reason:" ; \
- cat lib/dialyzer/SKIP ; \
- echo "===" ; \
- else \
- cd $(ERL_TOP)/lib/dialyzer && \
- ERL_TOP=$(ERL_TOP) PATH=$(INST_PATH_PREFIX)$${PATH} \
- $(MAKE) BUILD_ALL=1 TESTROOT=$(RELEASE_ROOT) release ; \
- fi
-endif
endif
cd $(ERL_TOP)/erts && \
ERL_TOP=$(ERL_TOP) PATH=$(INST_PATH_PREFIX)$${PATH} \
@@ -402,9 +393,6 @@ else
cd $(ERL_TOP)/lib && \
PATH=$(ERL_TOP)/bin:$${PATH} ERL_TOP=$(ERL_TOP) \
$(MAKE) BUILD_ALL=1 TESTROOT=$(RELEASE_ROOT) $@
- cd $(ERL_TOP)/lib/dialyzer && \
- PATH=$(ERL_TOP)/bin:$${PATH} ERL_TOP=$(ERL_TOP) \
- $(MAKE) BUILD_ALL=1 TESTROOT=$(RELEASE_ROOT) $@
endif
cd $(ERL_TOP)/erts && \
PATH=$(ERL_TOP)/bin:$${PATH} ERL_TOP=$(ERL_TOP) \
@@ -423,7 +411,7 @@ BOOT_BINDIR=$(BOOTSTRAP_ROOT)/bootstrap/erts/bin
BEAM_EVM=$(ERL_TOP)/bin/$(TARGET)/beam_evm
BOOTSTRAP_COMPILER = $(BOOTSTRAP_TOP)/primary_compiler
-.PHONY: emulator libs kernel stdlib compiler hipe dialyzer typer syntax_tools preloaded
+.PHONY: emulator libs kernel stdlib compiler hipe typer syntax_tools preloaded
emulator:
cd erts && ERL_TOP=$(ERL_TOP) $(MAKE) NO_START_SCRIPTS=true $(TYPE) FLAVOR=$(FLAVOR)
@@ -458,19 +446,6 @@ hipe:
ERL_TOP=$(ERL_TOP) PATH=$(BOOT_PREFIX)$${PATH} \
$(MAKE) opt BUILD_ALL=true
-dialyzer:
-ifneq ($(OTP_SMALL_BUILD),true)
- @if test -f lib/dialyzer/SKIP ; then \
- echo "=== Skipping dialyzer, reason:" ; \
- cat lib/dialyzer/SKIP ; \
- echo "===" ; \
- else \
- cd lib/dialyzer && \
- ERL_TOP=$(ERL_TOP) PATH=$(BOOT_PREFIX)$${PATH} \
- $(MAKE) opt BUILD_ALL=true ; \
- fi
-endif
-
typer:
cd lib/typer && \
ERL_TOP=$(ERL_TOP) PATH=$(BOOT_PREFIX)$${PATH} \
@@ -487,7 +462,8 @@ preloaded:
$(MAKE) opt BUILD_ALL=true
dep depend:
- test X"$$ERTS_SKIP_DEPEND" = X"true" || (cd erts/emulator && ERL_TOP=$(ERL_TOP) $(MAKE) generate depend)
+ test X"$$ERTS_SKIP_DEPEND" = X"true" || (cd erts/emulator && ERL_TOP=$(ERL_TOP) $(MAKE) generate)
+ test X"$$ERTS_SKIP_DEPEND" = X"true" || (cd erts/emulator && ERL_TOP=$(ERL_TOP) $(MAKE) depend)
test X"$$ERTS_SKIP_DEPEND" = X"true" || (cd erts/lib_src && ERL_TOP=$(ERL_TOP) $(MAKE) depend)
# Creates "erl" and "erlc" in bootstrap/bin which uses the precompiled
@@ -877,48 +853,6 @@ $(TEST_DIRS):
if test -f $@/Makefile; then \
(cd $@; $(MAKE) TESTROOT=$(TESTSUITE_ROOT) release_tests) || exit $$?; \
fi
-
-# ----------------------------------------------------------------------
-# Obsolete type of bootstrap where all stages where built with installed sytem
-# shuld no longer be used and is soon to be removed.
-# Abbreviations: OC = Old Compiler, NC = New Compiler,
-# OE = Old Emulator, NE = New Emulator
-
-old_com_bootstrap: old_bootstrap_nc_for_ne_all_stages old_bootstrap_ne old_bootstrap_scripts
-
-#
-# Builds the New Compiler for the New Emulator (using existing erlc
-# and possibly new compiler) then copy everything to the release area.
-# Use to create the commerciall bootstrap version, which should be obsolete.
-#
-old_bootstrap_nc_for_ne_all_stages:
- test -d $(TESTROOT) || mkdir -p $(TESTROOT)
- cd lib && $(MAKE) BOOTSTRAP=1 TYPE=release release
- cd lib && $(MAKE) SECONDARY_BOOTSTRAP=1 TYPE=release release
- cd lib && $(MAKE) TERTIARY_BOOTSTRAP=1 TYPE=release release
- cd lib && $(MAKE) FOURTH_BOOTSTRAP=1 TYPE=release release
-
-
-
-old_bootstrap_ne:
- cd erts && $(MAKE) release
-
-old_bootstrap_scripts:
- cd erts/start_scripts && $(MAKE) release
-
-
-# This is one strange name for a target, this actually builds and strips only
-# the primary bootstrap, a minimal set of beam files to be able to continue
-# bootstrap builds. It's used by other makefiles, so I refrain from
-# changing the name right now...
-bootstrap_nc_for_ne_no_debug_sym:
- test -d $(TESTROOT) || mkdir -p $(TESTROOT)
- cd lib && $(MAKE) ERLC_FLAGS='-pa $(BOOTSTRAP_COMPILER)/ebin' \
- BOOTSTRAP_TOP=$(BOOTSTRAP_TOP) BOOTSTRAP=1 TYPE=release release
- $(ERL_TOP)/erts/emulator/utils/beam_strip $(TESTROOT)/lib/*/ebin/*.beam
-
-# ----------------------------------------------------------------------
-
#
# Install
#
@@ -947,15 +881,6 @@ else
cd lib && \
ERL_TOP=$(ERL_TOP) PATH=$(INST_PATH_PREFIX)$${PATH} \
$(MAKE) TESTROOT=$(ERLANG_LIBDIR) BUILD_ALL=true release
- @if test -f lib/dialyzer/SKIP ; then \
- echo "=== Skipping dialyzer, reason:" ; \
- cat lib/dialyzer/SKIP ; \
- echo "===" ; \
- else \
- cd lib/dialyzer && \
- ERL_TOP=$(ERL_TOP) PATH=$(INST_PATH_PREFIX)$${PATH} \
- $(MAKE) TESTROOT=$(ERLANG_LIBDIR) BUILD_ALL=true release ; \
- fi
endif
install.Install:
@@ -1007,7 +932,6 @@ clean: check_recreate_primary_bootstrap
find . -type f -name SKIP -print | xargs $(RM)
cd erts && ERL_TOP=$(ERL_TOP) $(MAKE) clean
cd lib && ERL_TOP=$(ERL_TOP) $(MAKE) clean BUILD_ALL=true
- cd lib/dialyzer && ERL_TOP=$(ERL_TOP) $(MAKE) clean
#
# Just wipe out emulator, not libraries
diff --git a/bootstrap/bin/start.boot b/bootstrap/bin/start.boot
index 875f1b1c8b..0b1fd8e039 100644
--- a/bootstrap/bin/start.boot
+++ b/bootstrap/bin/start.boot
Binary files differ
diff --git a/bootstrap/bin/start.script b/bootstrap/bin/start.script
index 9b447c34a9..451eb55054 100644
--- a/bootstrap/bin/start.script
+++ b/bootstrap/bin/start.script
@@ -1,6 +1,6 @@
-%% script generated at {2011,5,20} {15,43,53}
+%% script generated at {2011,8,25} {11,38,20}
{script,
- {"OTP APN 181 01","R14B03"},
+ {"OTP APN 181 01","R15A"},
[{preLoaded,
[erl_prim_loader,erlang,init,otp_ring0,prim_file,prim_inet,prim_zip,
zlib]},
@@ -43,7 +43,7 @@
{application_controller,start,
[{application,kernel,
[{description,"ERTS CXC 138 10"},
- {vsn,"2.14.4"},
+ {vsn,"2.15"},
{id,[]},
{modules,
[application,application_controller,application_master,
@@ -80,7 +80,7 @@
{application,load,
[{application,stdlib,
[{description,"ERTS CXC 138 10"},
- {vsn,"1.17.4"},
+ {vsn,"1.18"},
{id,[]},
{modules,
[array,base64,beam_lib,binary,c,calendar,dets,
diff --git a/bootstrap/bin/start_clean.boot b/bootstrap/bin/start_clean.boot
index 875f1b1c8b..0b1fd8e039 100644
--- a/bootstrap/bin/start_clean.boot
+++ b/bootstrap/bin/start_clean.boot
Binary files differ
diff --git a/bootstrap/bin/start_clean.script b/bootstrap/bin/start_clean.script
index 9b447c34a9..451eb55054 100644
--- a/bootstrap/bin/start_clean.script
+++ b/bootstrap/bin/start_clean.script
@@ -1,6 +1,6 @@
-%% script generated at {2011,5,20} {15,43,53}
+%% script generated at {2011,8,25} {11,38,20}
{script,
- {"OTP APN 181 01","R14B03"},
+ {"OTP APN 181 01","R15A"},
[{preLoaded,
[erl_prim_loader,erlang,init,otp_ring0,prim_file,prim_inet,prim_zip,
zlib]},
@@ -43,7 +43,7 @@
{application_controller,start,
[{application,kernel,
[{description,"ERTS CXC 138 10"},
- {vsn,"2.14.4"},
+ {vsn,"2.15"},
{id,[]},
{modules,
[application,application_controller,application_master,
@@ -80,7 +80,7 @@
{application,load,
[{application,stdlib,
[{description,"ERTS CXC 138 10"},
- {vsn,"1.17.4"},
+ {vsn,"1.18"},
{id,[]},
{modules,
[array,base64,beam_lib,binary,c,calendar,dets,
diff --git a/bootstrap/lib/compiler/ebin/beam_asm.beam b/bootstrap/lib/compiler/ebin/beam_asm.beam
index 5719592cae..2679b0993f 100644
--- a/bootstrap/lib/compiler/ebin/beam_asm.beam
+++ b/bootstrap/lib/compiler/ebin/beam_asm.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_block.beam b/bootstrap/lib/compiler/ebin/beam_block.beam
index 41be7667fc..8983932f86 100644
--- a/bootstrap/lib/compiler/ebin/beam_block.beam
+++ b/bootstrap/lib/compiler/ebin/beam_block.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_bool.beam b/bootstrap/lib/compiler/ebin/beam_bool.beam
index ef6e7823cc..e540fe227b 100644
--- a/bootstrap/lib/compiler/ebin/beam_bool.beam
+++ b/bootstrap/lib/compiler/ebin/beam_bool.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_bsm.beam b/bootstrap/lib/compiler/ebin/beam_bsm.beam
index 48302c39d2..bde0cff4cb 100644
--- a/bootstrap/lib/compiler/ebin/beam_bsm.beam
+++ b/bootstrap/lib/compiler/ebin/beam_bsm.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_clean.beam b/bootstrap/lib/compiler/ebin/beam_clean.beam
index 0b28815f2a..b902d84ffa 100644
--- a/bootstrap/lib/compiler/ebin/beam_clean.beam
+++ b/bootstrap/lib/compiler/ebin/beam_clean.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_dead.beam b/bootstrap/lib/compiler/ebin/beam_dead.beam
index 652e2b44ea..449ce06f60 100644
--- a/bootstrap/lib/compiler/ebin/beam_dead.beam
+++ b/bootstrap/lib/compiler/ebin/beam_dead.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_dict.beam b/bootstrap/lib/compiler/ebin/beam_dict.beam
index b65ebca3cd..2811a0e705 100644
--- a/bootstrap/lib/compiler/ebin/beam_dict.beam
+++ b/bootstrap/lib/compiler/ebin/beam_dict.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_disasm.beam b/bootstrap/lib/compiler/ebin/beam_disasm.beam
index c8e2b27623..49b49871dd 100644
--- a/bootstrap/lib/compiler/ebin/beam_disasm.beam
+++ b/bootstrap/lib/compiler/ebin/beam_disasm.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_flatten.beam b/bootstrap/lib/compiler/ebin/beam_flatten.beam
index 402f2a14ae..0ac0dc7b92 100644
--- a/bootstrap/lib/compiler/ebin/beam_flatten.beam
+++ b/bootstrap/lib/compiler/ebin/beam_flatten.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_jump.beam b/bootstrap/lib/compiler/ebin/beam_jump.beam
index 1ee7b725fb..ea93fca2a0 100644
--- a/bootstrap/lib/compiler/ebin/beam_jump.beam
+++ b/bootstrap/lib/compiler/ebin/beam_jump.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_listing.beam b/bootstrap/lib/compiler/ebin/beam_listing.beam
index b282af5fce..f0503e4674 100644
--- a/bootstrap/lib/compiler/ebin/beam_listing.beam
+++ b/bootstrap/lib/compiler/ebin/beam_listing.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_opcodes.beam b/bootstrap/lib/compiler/ebin/beam_opcodes.beam
index 6ded472cb0..2c414f1c7d 100644
--- a/bootstrap/lib/compiler/ebin/beam_opcodes.beam
+++ b/bootstrap/lib/compiler/ebin/beam_opcodes.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_peep.beam b/bootstrap/lib/compiler/ebin/beam_peep.beam
index 279dd272b5..aaba79046c 100644
--- a/bootstrap/lib/compiler/ebin/beam_peep.beam
+++ b/bootstrap/lib/compiler/ebin/beam_peep.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_receive.beam b/bootstrap/lib/compiler/ebin/beam_receive.beam
index 4d88e80acd..0836e118c9 100644
--- a/bootstrap/lib/compiler/ebin/beam_receive.beam
+++ b/bootstrap/lib/compiler/ebin/beam_receive.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_trim.beam b/bootstrap/lib/compiler/ebin/beam_trim.beam
index 5c0d405843..04d3416ef2 100644
--- a/bootstrap/lib/compiler/ebin/beam_trim.beam
+++ b/bootstrap/lib/compiler/ebin/beam_trim.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_type.beam b/bootstrap/lib/compiler/ebin/beam_type.beam
index cccf58b7a4..e0a09eb146 100644
--- a/bootstrap/lib/compiler/ebin/beam_type.beam
+++ b/bootstrap/lib/compiler/ebin/beam_type.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_utils.beam b/bootstrap/lib/compiler/ebin/beam_utils.beam
index c335748e8a..a8bb6ec1a2 100644
--- a/bootstrap/lib/compiler/ebin/beam_utils.beam
+++ b/bootstrap/lib/compiler/ebin/beam_utils.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/beam_validator.beam b/bootstrap/lib/compiler/ebin/beam_validator.beam
index 32e75091f4..02226a600a 100644
--- a/bootstrap/lib/compiler/ebin/beam_validator.beam
+++ b/bootstrap/lib/compiler/ebin/beam_validator.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/cerl.beam b/bootstrap/lib/compiler/ebin/cerl.beam
index 9f45f9f441..399aeb6442 100644
--- a/bootstrap/lib/compiler/ebin/cerl.beam
+++ b/bootstrap/lib/compiler/ebin/cerl.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/cerl_clauses.beam b/bootstrap/lib/compiler/ebin/cerl_clauses.beam
index 5004b4d4c2..e4db75d0e0 100644
--- a/bootstrap/lib/compiler/ebin/cerl_clauses.beam
+++ b/bootstrap/lib/compiler/ebin/cerl_clauses.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/cerl_inline.beam b/bootstrap/lib/compiler/ebin/cerl_inline.beam
index e0cfce01ae..e6f76ad0d4 100644
--- a/bootstrap/lib/compiler/ebin/cerl_inline.beam
+++ b/bootstrap/lib/compiler/ebin/cerl_inline.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/cerl_trees.beam b/bootstrap/lib/compiler/ebin/cerl_trees.beam
index d46cfe54b7..b2d79c924c 100644
--- a/bootstrap/lib/compiler/ebin/cerl_trees.beam
+++ b/bootstrap/lib/compiler/ebin/cerl_trees.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/compile.beam b/bootstrap/lib/compiler/ebin/compile.beam
index c4b31874cc..da1d7a2922 100644
--- a/bootstrap/lib/compiler/ebin/compile.beam
+++ b/bootstrap/lib/compiler/ebin/compile.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/compiler.app b/bootstrap/lib/compiler/ebin/compiler.app
index fffb64c3a0..6c16ac7589 100644
--- a/bootstrap/lib/compiler/ebin/compiler.app
+++ b/bootstrap/lib/compiler/ebin/compiler.app
@@ -1,7 +1,7 @@
% This is an -*- erlang -*- file.
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2010. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -18,7 +18,7 @@
{application, compiler,
[{description, "ERTS CXC 138 10"},
- {vsn, "4.7.3"},
+ {vsn, "4.7.4"},
{modules, [
beam_asm,
beam_block,
diff --git a/bootstrap/lib/compiler/ebin/core_lib.beam b/bootstrap/lib/compiler/ebin/core_lib.beam
index 8796f7e13e..2421df60bd 100644
--- a/bootstrap/lib/compiler/ebin/core_lib.beam
+++ b/bootstrap/lib/compiler/ebin/core_lib.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/core_lint.beam b/bootstrap/lib/compiler/ebin/core_lint.beam
index 813c444d9c..de6f3e5c25 100644
--- a/bootstrap/lib/compiler/ebin/core_lint.beam
+++ b/bootstrap/lib/compiler/ebin/core_lint.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/core_parse.beam b/bootstrap/lib/compiler/ebin/core_parse.beam
index 973659b27b..11926c4a16 100644
--- a/bootstrap/lib/compiler/ebin/core_parse.beam
+++ b/bootstrap/lib/compiler/ebin/core_parse.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/core_pp.beam b/bootstrap/lib/compiler/ebin/core_pp.beam
index fb9001c52f..9d812001b8 100644
--- a/bootstrap/lib/compiler/ebin/core_pp.beam
+++ b/bootstrap/lib/compiler/ebin/core_pp.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/core_scan.beam b/bootstrap/lib/compiler/ebin/core_scan.beam
index cd2146d722..e0e4859095 100644
--- a/bootstrap/lib/compiler/ebin/core_scan.beam
+++ b/bootstrap/lib/compiler/ebin/core_scan.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/erl_bifs.beam b/bootstrap/lib/compiler/ebin/erl_bifs.beam
index 128f8a88d2..b411e06c08 100644
--- a/bootstrap/lib/compiler/ebin/erl_bifs.beam
+++ b/bootstrap/lib/compiler/ebin/erl_bifs.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/rec_env.beam b/bootstrap/lib/compiler/ebin/rec_env.beam
index 8a1de81396..c04176da61 100644
--- a/bootstrap/lib/compiler/ebin/rec_env.beam
+++ b/bootstrap/lib/compiler/ebin/rec_env.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/sys_core_dsetel.beam b/bootstrap/lib/compiler/ebin/sys_core_dsetel.beam
index 2975d77648..4a44c53aed 100644
--- a/bootstrap/lib/compiler/ebin/sys_core_dsetel.beam
+++ b/bootstrap/lib/compiler/ebin/sys_core_dsetel.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/sys_core_fold.beam b/bootstrap/lib/compiler/ebin/sys_core_fold.beam
index c7b247762c..2ed16cc07a 100644
--- a/bootstrap/lib/compiler/ebin/sys_core_fold.beam
+++ b/bootstrap/lib/compiler/ebin/sys_core_fold.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/sys_core_inline.beam b/bootstrap/lib/compiler/ebin/sys_core_inline.beam
index 919b616c62..3d6f3103e0 100644
--- a/bootstrap/lib/compiler/ebin/sys_core_inline.beam
+++ b/bootstrap/lib/compiler/ebin/sys_core_inline.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/sys_expand_pmod.beam b/bootstrap/lib/compiler/ebin/sys_expand_pmod.beam
index 3323279d7d..5142cdde01 100644
--- a/bootstrap/lib/compiler/ebin/sys_expand_pmod.beam
+++ b/bootstrap/lib/compiler/ebin/sys_expand_pmod.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/sys_pre_attributes.beam b/bootstrap/lib/compiler/ebin/sys_pre_attributes.beam
index 9708cff55e..4b3e984ed4 100644
--- a/bootstrap/lib/compiler/ebin/sys_pre_attributes.beam
+++ b/bootstrap/lib/compiler/ebin/sys_pre_attributes.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/sys_pre_expand.beam b/bootstrap/lib/compiler/ebin/sys_pre_expand.beam
index 7b4d278e30..b4129dc7aa 100644
--- a/bootstrap/lib/compiler/ebin/sys_pre_expand.beam
+++ b/bootstrap/lib/compiler/ebin/sys_pre_expand.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/v3_codegen.beam b/bootstrap/lib/compiler/ebin/v3_codegen.beam
index 51fac17844..dbc5fb5e3a 100644
--- a/bootstrap/lib/compiler/ebin/v3_codegen.beam
+++ b/bootstrap/lib/compiler/ebin/v3_codegen.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/v3_core.beam b/bootstrap/lib/compiler/ebin/v3_core.beam
index 87cb60e41c..817938781d 100644
--- a/bootstrap/lib/compiler/ebin/v3_core.beam
+++ b/bootstrap/lib/compiler/ebin/v3_core.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/v3_kernel.beam b/bootstrap/lib/compiler/ebin/v3_kernel.beam
index 18790f80a6..a52d44b32e 100644
--- a/bootstrap/lib/compiler/ebin/v3_kernel.beam
+++ b/bootstrap/lib/compiler/ebin/v3_kernel.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/v3_kernel_pp.beam b/bootstrap/lib/compiler/ebin/v3_kernel_pp.beam
index b7d2a409b5..4bec626689 100644
--- a/bootstrap/lib/compiler/ebin/v3_kernel_pp.beam
+++ b/bootstrap/lib/compiler/ebin/v3_kernel_pp.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/ebin/v3_life.beam b/bootstrap/lib/compiler/ebin/v3_life.beam
index 3f0a409447..d3ffc45a26 100644
--- a/bootstrap/lib/compiler/ebin/v3_life.beam
+++ b/bootstrap/lib/compiler/ebin/v3_life.beam
Binary files differ
diff --git a/bootstrap/lib/compiler/egen/beam_opcodes.erl b/bootstrap/lib/compiler/egen/beam_opcodes.erl
index fda227f90f..147f04ad71 100644
--- a/bootstrap/lib/compiler/egen/beam_opcodes.erl
+++ b/bootstrap/lib/compiler/egen/beam_opcodes.erl
@@ -8,7 +8,7 @@
-spec format_number() -> 0.
format_number() -> 0.
--spec opcode(atom(), 0..8) -> 1..152.
+-spec opcode(atom(), 0..8) -> 1..153.
opcode(label, 1) -> 1;
opcode(func_info, 3) -> 2;
opcode(int_code_end, 0) -> 3;
@@ -161,9 +161,10 @@ opcode(on_load, 0) -> 149;
opcode(recv_mark, 1) -> 150;
opcode(recv_set, 1) -> 151;
opcode(gc_bif3, 7) -> 152;
+opcode(line, 1) -> 153;
opcode(Name, Arity) -> erlang:error(badarg, [Name,Arity]).
--spec opname(1..152) -> {atom(),0..8}.
+-spec opname(1..153) -> {atom(),0..8}.
opname(1) -> {label,1};
opname(2) -> {func_info,3};
opname(3) -> {int_code_end,0};
@@ -316,4 +317,5 @@ opname(149) -> {on_load,0};
opname(150) -> {recv_mark,1};
opname(151) -> {recv_set,1};
opname(152) -> {gc_bif3,7};
+opname(153) -> {line,1};
opname(Number) -> erlang:error(badarg, [Number]).
diff --git a/bootstrap/lib/compiler/egen/core_parse.erl b/bootstrap/lib/compiler/egen/core_parse.erl
index 399d61109f..fab545133c 100644
--- a/bootstrap/lib/compiler/egen/core_parse.erl
+++ b/bootstrap/lib/compiler/egen/core_parse.erl
@@ -13,11 +13,11 @@
tok_val(T) -> element(3, T).
tok_line(T) -> element(2, T).
--file("/opt/installs/lib/erlang/lib/parsetools-2.0.5/include/yeccpre.hrl", 0).
+-file("/usr/local/otp/releases/sles10_32_R14B03_patched/lib/parsetools-2.0.5/include/yeccpre.hrl", 0).
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -196,7 +196,7 @@ yecctoken2string(Other) ->
--file("/ldisk/egil/git/otp/bootstrap/lib/compiler/egen/core_parse.erl", 199).
+-file("/ldisk/bjorn/otp/bootstrap/lib/compiler/egen/core_parse.erl", 199).
yeccpars2(0=S, Cat, Ss, Stack, T, Ts, Tzr) ->
yeccpars2_0(S, Cat, Ss, Stack, T, Ts, Tzr);
diff --git a/bootstrap/lib/kernel/ebin/application.beam b/bootstrap/lib/kernel/ebin/application.beam
index ca16b97197..be05505c35 100644
--- a/bootstrap/lib/kernel/ebin/application.beam
+++ b/bootstrap/lib/kernel/ebin/application.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/application_controller.beam b/bootstrap/lib/kernel/ebin/application_controller.beam
index 113faeda01..996836d78e 100644
--- a/bootstrap/lib/kernel/ebin/application_controller.beam
+++ b/bootstrap/lib/kernel/ebin/application_controller.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/application_master.beam b/bootstrap/lib/kernel/ebin/application_master.beam
index 602dc36104..98bd12a42f 100644
--- a/bootstrap/lib/kernel/ebin/application_master.beam
+++ b/bootstrap/lib/kernel/ebin/application_master.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/application_starter.beam b/bootstrap/lib/kernel/ebin/application_starter.beam
index 405d2f388a..14ff4dc088 100644
--- a/bootstrap/lib/kernel/ebin/application_starter.beam
+++ b/bootstrap/lib/kernel/ebin/application_starter.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/auth.beam b/bootstrap/lib/kernel/ebin/auth.beam
index 3c038f87aa..3796221d6b 100644
--- a/bootstrap/lib/kernel/ebin/auth.beam
+++ b/bootstrap/lib/kernel/ebin/auth.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/code.beam b/bootstrap/lib/kernel/ebin/code.beam
index 960b96ce4c..580dc1f888 100644
--- a/bootstrap/lib/kernel/ebin/code.beam
+++ b/bootstrap/lib/kernel/ebin/code.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/code_server.beam b/bootstrap/lib/kernel/ebin/code_server.beam
index 3d66c1c282..55f7fbdc9d 100644
--- a/bootstrap/lib/kernel/ebin/code_server.beam
+++ b/bootstrap/lib/kernel/ebin/code_server.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/disk_log.beam b/bootstrap/lib/kernel/ebin/disk_log.beam
index 0b9ee6fb8d..15953c9931 100644
--- a/bootstrap/lib/kernel/ebin/disk_log.beam
+++ b/bootstrap/lib/kernel/ebin/disk_log.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/disk_log_1.beam b/bootstrap/lib/kernel/ebin/disk_log_1.beam
index bbc42326cb..a61ef2ad3f 100644
--- a/bootstrap/lib/kernel/ebin/disk_log_1.beam
+++ b/bootstrap/lib/kernel/ebin/disk_log_1.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/disk_log_server.beam b/bootstrap/lib/kernel/ebin/disk_log_server.beam
index 089b5d578b..96c17f1586 100644
--- a/bootstrap/lib/kernel/ebin/disk_log_server.beam
+++ b/bootstrap/lib/kernel/ebin/disk_log_server.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/disk_log_sup.beam b/bootstrap/lib/kernel/ebin/disk_log_sup.beam
index a98998064d..4e68c9af84 100644
--- a/bootstrap/lib/kernel/ebin/disk_log_sup.beam
+++ b/bootstrap/lib/kernel/ebin/disk_log_sup.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/dist_ac.beam b/bootstrap/lib/kernel/ebin/dist_ac.beam
index 29be008e0c..d20390087d 100644
--- a/bootstrap/lib/kernel/ebin/dist_ac.beam
+++ b/bootstrap/lib/kernel/ebin/dist_ac.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/dist_util.beam b/bootstrap/lib/kernel/ebin/dist_util.beam
index 93f0a3754a..094d909535 100644
--- a/bootstrap/lib/kernel/ebin/dist_util.beam
+++ b/bootstrap/lib/kernel/ebin/dist_util.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/erl_boot_server.beam b/bootstrap/lib/kernel/ebin/erl_boot_server.beam
index d88224b5d0..19f6ceeda2 100644
--- a/bootstrap/lib/kernel/ebin/erl_boot_server.beam
+++ b/bootstrap/lib/kernel/ebin/erl_boot_server.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/erl_ddll.beam b/bootstrap/lib/kernel/ebin/erl_ddll.beam
index c83b5e393c..b909dd2786 100644
--- a/bootstrap/lib/kernel/ebin/erl_ddll.beam
+++ b/bootstrap/lib/kernel/ebin/erl_ddll.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/erl_distribution.beam b/bootstrap/lib/kernel/ebin/erl_distribution.beam
index d4e52d01a9..b084e63a0d 100644
--- a/bootstrap/lib/kernel/ebin/erl_distribution.beam
+++ b/bootstrap/lib/kernel/ebin/erl_distribution.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/erl_epmd.beam b/bootstrap/lib/kernel/ebin/erl_epmd.beam
index 847ed69e23..8ae4bbaf14 100644
--- a/bootstrap/lib/kernel/ebin/erl_epmd.beam
+++ b/bootstrap/lib/kernel/ebin/erl_epmd.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/erl_reply.beam b/bootstrap/lib/kernel/ebin/erl_reply.beam
index 97b027a67d..c492a19d6f 100644
--- a/bootstrap/lib/kernel/ebin/erl_reply.beam
+++ b/bootstrap/lib/kernel/ebin/erl_reply.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/error_handler.beam b/bootstrap/lib/kernel/ebin/error_handler.beam
index 5a17c845eb..6d56c98c67 100644
--- a/bootstrap/lib/kernel/ebin/error_handler.beam
+++ b/bootstrap/lib/kernel/ebin/error_handler.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/error_logger.beam b/bootstrap/lib/kernel/ebin/error_logger.beam
index c89e4d36c9..e07bef5657 100644
--- a/bootstrap/lib/kernel/ebin/error_logger.beam
+++ b/bootstrap/lib/kernel/ebin/error_logger.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/erts_debug.beam b/bootstrap/lib/kernel/ebin/erts_debug.beam
index 9108d7e6d5..b812127f18 100644
--- a/bootstrap/lib/kernel/ebin/erts_debug.beam
+++ b/bootstrap/lib/kernel/ebin/erts_debug.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/file.beam b/bootstrap/lib/kernel/ebin/file.beam
index 39af418b30..19251f8a4f 100644
--- a/bootstrap/lib/kernel/ebin/file.beam
+++ b/bootstrap/lib/kernel/ebin/file.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/file_io_server.beam b/bootstrap/lib/kernel/ebin/file_io_server.beam
index f7c170fd28..b35b96d8f0 100644
--- a/bootstrap/lib/kernel/ebin/file_io_server.beam
+++ b/bootstrap/lib/kernel/ebin/file_io_server.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/file_server.beam b/bootstrap/lib/kernel/ebin/file_server.beam
index 70bdb58805..71e2ad8c0d 100644
--- a/bootstrap/lib/kernel/ebin/file_server.beam
+++ b/bootstrap/lib/kernel/ebin/file_server.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/gen_sctp.beam b/bootstrap/lib/kernel/ebin/gen_sctp.beam
index 1d51915a4f..8777d4fd26 100644
--- a/bootstrap/lib/kernel/ebin/gen_sctp.beam
+++ b/bootstrap/lib/kernel/ebin/gen_sctp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/gen_tcp.beam b/bootstrap/lib/kernel/ebin/gen_tcp.beam
index f684fe1bf2..02103cc215 100644
--- a/bootstrap/lib/kernel/ebin/gen_tcp.beam
+++ b/bootstrap/lib/kernel/ebin/gen_tcp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/gen_udp.beam b/bootstrap/lib/kernel/ebin/gen_udp.beam
index 1591c85048..3b9ca85608 100644
--- a/bootstrap/lib/kernel/ebin/gen_udp.beam
+++ b/bootstrap/lib/kernel/ebin/gen_udp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/global.beam b/bootstrap/lib/kernel/ebin/global.beam
index 7cfbafb942..a9e0e2c0d1 100644
--- a/bootstrap/lib/kernel/ebin/global.beam
+++ b/bootstrap/lib/kernel/ebin/global.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/global_group.beam b/bootstrap/lib/kernel/ebin/global_group.beam
index ec789e71ff..c6fe47b456 100644
--- a/bootstrap/lib/kernel/ebin/global_group.beam
+++ b/bootstrap/lib/kernel/ebin/global_group.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/global_search.beam b/bootstrap/lib/kernel/ebin/global_search.beam
index fe18f8f49a..aa70042058 100644
--- a/bootstrap/lib/kernel/ebin/global_search.beam
+++ b/bootstrap/lib/kernel/ebin/global_search.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/group.beam b/bootstrap/lib/kernel/ebin/group.beam
index b72a13dbc7..b8d55c4e29 100644
--- a/bootstrap/lib/kernel/ebin/group.beam
+++ b/bootstrap/lib/kernel/ebin/group.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/heart.beam b/bootstrap/lib/kernel/ebin/heart.beam
index 9d381acaff..b20f872241 100644
--- a/bootstrap/lib/kernel/ebin/heart.beam
+++ b/bootstrap/lib/kernel/ebin/heart.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/hipe_unified_loader.beam b/bootstrap/lib/kernel/ebin/hipe_unified_loader.beam
index a53e6f8800..873b717651 100644
--- a/bootstrap/lib/kernel/ebin/hipe_unified_loader.beam
+++ b/bootstrap/lib/kernel/ebin/hipe_unified_loader.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet.beam b/bootstrap/lib/kernel/ebin/inet.beam
index faac3fc921..cb028e612a 100644
--- a/bootstrap/lib/kernel/ebin/inet.beam
+++ b/bootstrap/lib/kernel/ebin/inet.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet6_sctp.beam b/bootstrap/lib/kernel/ebin/inet6_sctp.beam
index d9917f0347..46d213bf9a 100644
--- a/bootstrap/lib/kernel/ebin/inet6_sctp.beam
+++ b/bootstrap/lib/kernel/ebin/inet6_sctp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet6_tcp.beam b/bootstrap/lib/kernel/ebin/inet6_tcp.beam
index c573bc2821..f9377be91b 100644
--- a/bootstrap/lib/kernel/ebin/inet6_tcp.beam
+++ b/bootstrap/lib/kernel/ebin/inet6_tcp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet6_tcp_dist.beam b/bootstrap/lib/kernel/ebin/inet6_tcp_dist.beam
index 05d8da8751..145e039f7e 100644
--- a/bootstrap/lib/kernel/ebin/inet6_tcp_dist.beam
+++ b/bootstrap/lib/kernel/ebin/inet6_tcp_dist.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet6_udp.beam b/bootstrap/lib/kernel/ebin/inet6_udp.beam
index 74cbff87c0..582bf6e7c0 100644
--- a/bootstrap/lib/kernel/ebin/inet6_udp.beam
+++ b/bootstrap/lib/kernel/ebin/inet6_udp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_config.beam b/bootstrap/lib/kernel/ebin/inet_config.beam
index b3061fffa1..d937ef4a7b 100644
--- a/bootstrap/lib/kernel/ebin/inet_config.beam
+++ b/bootstrap/lib/kernel/ebin/inet_config.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_db.beam b/bootstrap/lib/kernel/ebin/inet_db.beam
index 095d624ea7..ee3fbaa584 100644
--- a/bootstrap/lib/kernel/ebin/inet_db.beam
+++ b/bootstrap/lib/kernel/ebin/inet_db.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_dns.beam b/bootstrap/lib/kernel/ebin/inet_dns.beam
index cfd46c29da..be1c7c4766 100644
--- a/bootstrap/lib/kernel/ebin/inet_dns.beam
+++ b/bootstrap/lib/kernel/ebin/inet_dns.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_gethost_native.beam b/bootstrap/lib/kernel/ebin/inet_gethost_native.beam
index 0b901a8f27..c53ecfb42a 100644
--- a/bootstrap/lib/kernel/ebin/inet_gethost_native.beam
+++ b/bootstrap/lib/kernel/ebin/inet_gethost_native.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_hosts.beam b/bootstrap/lib/kernel/ebin/inet_hosts.beam
index 03a48175dd..c73b477683 100644
--- a/bootstrap/lib/kernel/ebin/inet_hosts.beam
+++ b/bootstrap/lib/kernel/ebin/inet_hosts.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_parse.beam b/bootstrap/lib/kernel/ebin/inet_parse.beam
index 5afff695e5..f8d3102da7 100644
--- a/bootstrap/lib/kernel/ebin/inet_parse.beam
+++ b/bootstrap/lib/kernel/ebin/inet_parse.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_res.beam b/bootstrap/lib/kernel/ebin/inet_res.beam
index 61fe96d055..c0f00a0c12 100644
--- a/bootstrap/lib/kernel/ebin/inet_res.beam
+++ b/bootstrap/lib/kernel/ebin/inet_res.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_sctp.beam b/bootstrap/lib/kernel/ebin/inet_sctp.beam
index bfd6b4b252..ed8ced75b0 100644
--- a/bootstrap/lib/kernel/ebin/inet_sctp.beam
+++ b/bootstrap/lib/kernel/ebin/inet_sctp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_tcp.beam b/bootstrap/lib/kernel/ebin/inet_tcp.beam
index 59abaedf6e..20340e02b9 100644
--- a/bootstrap/lib/kernel/ebin/inet_tcp.beam
+++ b/bootstrap/lib/kernel/ebin/inet_tcp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_tcp_dist.beam b/bootstrap/lib/kernel/ebin/inet_tcp_dist.beam
index 6c98977be5..b382eebf92 100644
--- a/bootstrap/lib/kernel/ebin/inet_tcp_dist.beam
+++ b/bootstrap/lib/kernel/ebin/inet_tcp_dist.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/inet_udp.beam b/bootstrap/lib/kernel/ebin/inet_udp.beam
index 7bd4848f07..a9f7fbb7fa 100644
--- a/bootstrap/lib/kernel/ebin/inet_udp.beam
+++ b/bootstrap/lib/kernel/ebin/inet_udp.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/kernel.app b/bootstrap/lib/kernel/ebin/kernel.app
index 9b5bff5033..59e4aa8055 100644
--- a/bootstrap/lib/kernel/ebin/kernel.app
+++ b/bootstrap/lib/kernel/ebin/kernel.app
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -21,7 +21,7 @@
{application, kernel,
[
{description, "ERTS CXC 138 10"},
- {vsn, "2.14.4"},
+ {vsn, "2.15"},
{modules, [application,
application_controller,
application_master,
diff --git a/bootstrap/lib/kernel/ebin/kernel.appup b/bootstrap/lib/kernel/ebin/kernel.appup
index f287e992f1..96f6e27774 100644
--- a/bootstrap/lib/kernel/ebin/kernel.appup
+++ b/bootstrap/lib/kernel/ebin/kernel.appup
@@ -1 +1 @@
-{"2.14.3",[],[]}.
+{"2.15",[],[]}.
diff --git a/bootstrap/lib/kernel/ebin/kernel.beam b/bootstrap/lib/kernel/ebin/kernel.beam
index e1db5986dc..8321a999c1 100644
--- a/bootstrap/lib/kernel/ebin/kernel.beam
+++ b/bootstrap/lib/kernel/ebin/kernel.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/kernel_config.beam b/bootstrap/lib/kernel/ebin/kernel_config.beam
index da5fa04de5..40228eeeee 100644
--- a/bootstrap/lib/kernel/ebin/kernel_config.beam
+++ b/bootstrap/lib/kernel/ebin/kernel_config.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/net.beam b/bootstrap/lib/kernel/ebin/net.beam
index 21df570be5..ae7db397e1 100644
--- a/bootstrap/lib/kernel/ebin/net.beam
+++ b/bootstrap/lib/kernel/ebin/net.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/net_adm.beam b/bootstrap/lib/kernel/ebin/net_adm.beam
index 21d54cac85..182c2cd0fc 100644
--- a/bootstrap/lib/kernel/ebin/net_adm.beam
+++ b/bootstrap/lib/kernel/ebin/net_adm.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/net_kernel.beam b/bootstrap/lib/kernel/ebin/net_kernel.beam
index b53dd9295a..8c8786eeb9 100644
--- a/bootstrap/lib/kernel/ebin/net_kernel.beam
+++ b/bootstrap/lib/kernel/ebin/net_kernel.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/os.beam b/bootstrap/lib/kernel/ebin/os.beam
index de55c53503..df333e054e 100644
--- a/bootstrap/lib/kernel/ebin/os.beam
+++ b/bootstrap/lib/kernel/ebin/os.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/packages.beam b/bootstrap/lib/kernel/ebin/packages.beam
index cbe6bc6590..c507624578 100644
--- a/bootstrap/lib/kernel/ebin/packages.beam
+++ b/bootstrap/lib/kernel/ebin/packages.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/pg2.beam b/bootstrap/lib/kernel/ebin/pg2.beam
index a669e64bea..4e6817fc97 100644
--- a/bootstrap/lib/kernel/ebin/pg2.beam
+++ b/bootstrap/lib/kernel/ebin/pg2.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/ram_file.beam b/bootstrap/lib/kernel/ebin/ram_file.beam
index 402c7ea2d3..02baece827 100644
--- a/bootstrap/lib/kernel/ebin/ram_file.beam
+++ b/bootstrap/lib/kernel/ebin/ram_file.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/rpc.beam b/bootstrap/lib/kernel/ebin/rpc.beam
index 38ae0f4694..19391982e8 100644
--- a/bootstrap/lib/kernel/ebin/rpc.beam
+++ b/bootstrap/lib/kernel/ebin/rpc.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/seq_trace.beam b/bootstrap/lib/kernel/ebin/seq_trace.beam
index ce4f50c6f3..ceb4e14324 100644
--- a/bootstrap/lib/kernel/ebin/seq_trace.beam
+++ b/bootstrap/lib/kernel/ebin/seq_trace.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/standard_error.beam b/bootstrap/lib/kernel/ebin/standard_error.beam
index 62ab951bff..e0232d9e54 100644
--- a/bootstrap/lib/kernel/ebin/standard_error.beam
+++ b/bootstrap/lib/kernel/ebin/standard_error.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/user.beam b/bootstrap/lib/kernel/ebin/user.beam
index 76e9973a93..df47a14304 100644
--- a/bootstrap/lib/kernel/ebin/user.beam
+++ b/bootstrap/lib/kernel/ebin/user.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/user_drv.beam b/bootstrap/lib/kernel/ebin/user_drv.beam
index ddb0442f28..c2b4fef911 100644
--- a/bootstrap/lib/kernel/ebin/user_drv.beam
+++ b/bootstrap/lib/kernel/ebin/user_drv.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/user_sup.beam b/bootstrap/lib/kernel/ebin/user_sup.beam
index 5632210843..b68c8979ff 100644
--- a/bootstrap/lib/kernel/ebin/user_sup.beam
+++ b/bootstrap/lib/kernel/ebin/user_sup.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/ebin/wrap_log_reader.beam b/bootstrap/lib/kernel/ebin/wrap_log_reader.beam
index 9f648c9a42..1af9de5e72 100644
--- a/bootstrap/lib/kernel/ebin/wrap_log_reader.beam
+++ b/bootstrap/lib/kernel/ebin/wrap_log_reader.beam
Binary files differ
diff --git a/bootstrap/lib/kernel/include/inet_sctp.hrl b/bootstrap/lib/kernel/include/inet_sctp.hrl
index 3c072cc1db..169ba013aa 100644
--- a/bootstrap/lib/kernel/include/inet_sctp.hrl
+++ b/bootstrap/lib/kernel/include/inet_sctp.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2007-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2007-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/orber/include/Makefile b/bootstrap/lib/orber/include/Makefile
index 5aaeed1015..219b7085e6 100644
--- a/bootstrap/lib/orber/include/Makefile
+++ b/bootstrap/lib/orber/include/Makefile
@@ -1,7 +1,7 @@
#
# %CopyrightBegin%
#
-# Copyright Ericsson AB 1998-2011. All Rights Reserved.
+# Copyright Ericsson AB 1998-2009. All Rights Reserved.
#
# The contents of this file are subject to the Erlang Public License,
# Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/orber/include/corba.hrl b/bootstrap/lib/orber/include/corba.hrl
index 526662d59d..b9869855bf 100644
--- a/bootstrap/lib/orber/include/corba.hrl
+++ b/bootstrap/lib/orber/include/corba.hrl
@@ -2,7 +2,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/orber/include/orber_pi.hrl b/bootstrap/lib/orber/include/orber_pi.hrl
index 69f14a5165..84231758fe 100644
--- a/bootstrap/lib/orber/include/orber_pi.hrl
+++ b/bootstrap/lib/orber/include/orber_pi.hrl
@@ -2,7 +2,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2000-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2000-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/stdlib/ebin/array.beam b/bootstrap/lib/stdlib/ebin/array.beam
index 5e309a9842..ea41ab7a42 100644
--- a/bootstrap/lib/stdlib/ebin/array.beam
+++ b/bootstrap/lib/stdlib/ebin/array.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/base64.beam b/bootstrap/lib/stdlib/ebin/base64.beam
index 3d429d9de0..04a1388637 100644
--- a/bootstrap/lib/stdlib/ebin/base64.beam
+++ b/bootstrap/lib/stdlib/ebin/base64.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/beam_lib.beam b/bootstrap/lib/stdlib/ebin/beam_lib.beam
index d29c13189a..c2592e3dbc 100644
--- a/bootstrap/lib/stdlib/ebin/beam_lib.beam
+++ b/bootstrap/lib/stdlib/ebin/beam_lib.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/binary.beam b/bootstrap/lib/stdlib/ebin/binary.beam
index 5180c122d2..0cc6c6fce9 100644
--- a/bootstrap/lib/stdlib/ebin/binary.beam
+++ b/bootstrap/lib/stdlib/ebin/binary.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/c.beam b/bootstrap/lib/stdlib/ebin/c.beam
index 7a31c9bfef..bd37facf37 100644
--- a/bootstrap/lib/stdlib/ebin/c.beam
+++ b/bootstrap/lib/stdlib/ebin/c.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/calendar.beam b/bootstrap/lib/stdlib/ebin/calendar.beam
index 09cd444a79..3f4f14abc3 100644
--- a/bootstrap/lib/stdlib/ebin/calendar.beam
+++ b/bootstrap/lib/stdlib/ebin/calendar.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dets.beam b/bootstrap/lib/stdlib/ebin/dets.beam
index 002b3c9229..9cd59e7a76 100644
--- a/bootstrap/lib/stdlib/ebin/dets.beam
+++ b/bootstrap/lib/stdlib/ebin/dets.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dets_server.beam b/bootstrap/lib/stdlib/ebin/dets_server.beam
index 5978a933ed..c120ee12e3 100644
--- a/bootstrap/lib/stdlib/ebin/dets_server.beam
+++ b/bootstrap/lib/stdlib/ebin/dets_server.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dets_sup.beam b/bootstrap/lib/stdlib/ebin/dets_sup.beam
index 9bc79d6468..35b8c8a799 100644
--- a/bootstrap/lib/stdlib/ebin/dets_sup.beam
+++ b/bootstrap/lib/stdlib/ebin/dets_sup.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dets_utils.beam b/bootstrap/lib/stdlib/ebin/dets_utils.beam
index 817ded2d62..0a9420daa2 100644
--- a/bootstrap/lib/stdlib/ebin/dets_utils.beam
+++ b/bootstrap/lib/stdlib/ebin/dets_utils.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dets_v8.beam b/bootstrap/lib/stdlib/ebin/dets_v8.beam
index 968b9bcb28..3ede6f8d47 100644
--- a/bootstrap/lib/stdlib/ebin/dets_v8.beam
+++ b/bootstrap/lib/stdlib/ebin/dets_v8.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dets_v9.beam b/bootstrap/lib/stdlib/ebin/dets_v9.beam
index 355c5819cf..1ac657a547 100644
--- a/bootstrap/lib/stdlib/ebin/dets_v9.beam
+++ b/bootstrap/lib/stdlib/ebin/dets_v9.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/dict.beam b/bootstrap/lib/stdlib/ebin/dict.beam
index 9b65b345ff..c5676edc4a 100644
--- a/bootstrap/lib/stdlib/ebin/dict.beam
+++ b/bootstrap/lib/stdlib/ebin/dict.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/digraph.beam b/bootstrap/lib/stdlib/ebin/digraph.beam
index 79c25f5a30..78814b1ad3 100644
--- a/bootstrap/lib/stdlib/ebin/digraph.beam
+++ b/bootstrap/lib/stdlib/ebin/digraph.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/digraph_utils.beam b/bootstrap/lib/stdlib/ebin/digraph_utils.beam
index 18ebd2e30c..ac2c41d2b7 100644
--- a/bootstrap/lib/stdlib/ebin/digraph_utils.beam
+++ b/bootstrap/lib/stdlib/ebin/digraph_utils.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/edlin.beam b/bootstrap/lib/stdlib/ebin/edlin.beam
index 9fc93d042c..874bc4e107 100644
--- a/bootstrap/lib/stdlib/ebin/edlin.beam
+++ b/bootstrap/lib/stdlib/ebin/edlin.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/edlin_expand.beam b/bootstrap/lib/stdlib/ebin/edlin_expand.beam
index 0ca05e1bc3..04177ed645 100644
--- a/bootstrap/lib/stdlib/ebin/edlin_expand.beam
+++ b/bootstrap/lib/stdlib/ebin/edlin_expand.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/epp.beam b/bootstrap/lib/stdlib/ebin/epp.beam
index 528692fb81..d809fc21f6 100644
--- a/bootstrap/lib/stdlib/ebin/epp.beam
+++ b/bootstrap/lib/stdlib/ebin/epp.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_bits.beam b/bootstrap/lib/stdlib/ebin/erl_bits.beam
index d338fe3778..595be6a76a 100644
--- a/bootstrap/lib/stdlib/ebin/erl_bits.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_bits.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_compile.beam b/bootstrap/lib/stdlib/ebin/erl_compile.beam
index 18693b47a3..6435fcbab5 100644
--- a/bootstrap/lib/stdlib/ebin/erl_compile.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_compile.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_eval.beam b/bootstrap/lib/stdlib/ebin/erl_eval.beam
index 184918e97d..6aff9793a6 100644
--- a/bootstrap/lib/stdlib/ebin/erl_eval.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_eval.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_expand_records.beam b/bootstrap/lib/stdlib/ebin/erl_expand_records.beam
index e292c379b0..a5431e7f04 100644
--- a/bootstrap/lib/stdlib/ebin/erl_expand_records.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_expand_records.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_internal.beam b/bootstrap/lib/stdlib/ebin/erl_internal.beam
index 8d080bdacc..592989520b 100644
--- a/bootstrap/lib/stdlib/ebin/erl_internal.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_internal.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_lint.beam b/bootstrap/lib/stdlib/ebin/erl_lint.beam
index 552c418ee8..c2b6549490 100644
--- a/bootstrap/lib/stdlib/ebin/erl_lint.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_lint.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_parse.beam b/bootstrap/lib/stdlib/ebin/erl_parse.beam
index 27e760de1f..d885821f52 100644
--- a/bootstrap/lib/stdlib/ebin/erl_parse.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_parse.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_posix_msg.beam b/bootstrap/lib/stdlib/ebin/erl_posix_msg.beam
index 7d934adb92..48f3d58dbb 100644
--- a/bootstrap/lib/stdlib/ebin/erl_posix_msg.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_posix_msg.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_pp.beam b/bootstrap/lib/stdlib/ebin/erl_pp.beam
index 9dbed0af01..4416e29c9f 100644
--- a/bootstrap/lib/stdlib/ebin/erl_pp.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_pp.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_scan.beam b/bootstrap/lib/stdlib/ebin/erl_scan.beam
index 51082779b8..c331d61d21 100644
--- a/bootstrap/lib/stdlib/ebin/erl_scan.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_scan.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/erl_tar.beam b/bootstrap/lib/stdlib/ebin/erl_tar.beam
index 7cf0571935..d9c3186502 100644
--- a/bootstrap/lib/stdlib/ebin/erl_tar.beam
+++ b/bootstrap/lib/stdlib/ebin/erl_tar.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/error_logger_file_h.beam b/bootstrap/lib/stdlib/ebin/error_logger_file_h.beam
index 13a91def18..f5609d124c 100644
--- a/bootstrap/lib/stdlib/ebin/error_logger_file_h.beam
+++ b/bootstrap/lib/stdlib/ebin/error_logger_file_h.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/error_logger_tty_h.beam b/bootstrap/lib/stdlib/ebin/error_logger_tty_h.beam
index 50dd448b1b..e1542991b2 100644
--- a/bootstrap/lib/stdlib/ebin/error_logger_tty_h.beam
+++ b/bootstrap/lib/stdlib/ebin/error_logger_tty_h.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/escript.beam b/bootstrap/lib/stdlib/ebin/escript.beam
index a76250e466..ed0e6b0d66 100644
--- a/bootstrap/lib/stdlib/ebin/escript.beam
+++ b/bootstrap/lib/stdlib/ebin/escript.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/ets.beam b/bootstrap/lib/stdlib/ebin/ets.beam
index 1e0742e341..bcd7a65cc8 100644
--- a/bootstrap/lib/stdlib/ebin/ets.beam
+++ b/bootstrap/lib/stdlib/ebin/ets.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/eval_bits.beam b/bootstrap/lib/stdlib/ebin/eval_bits.beam
index 1db24ccfc9..ac375672f6 100644
--- a/bootstrap/lib/stdlib/ebin/eval_bits.beam
+++ b/bootstrap/lib/stdlib/ebin/eval_bits.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/file_sorter.beam b/bootstrap/lib/stdlib/ebin/file_sorter.beam
index 281c66b3ee..95fba9495b 100644
--- a/bootstrap/lib/stdlib/ebin/file_sorter.beam
+++ b/bootstrap/lib/stdlib/ebin/file_sorter.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/filelib.beam b/bootstrap/lib/stdlib/ebin/filelib.beam
index 7c1ba41e59..5d8a6f7b07 100644
--- a/bootstrap/lib/stdlib/ebin/filelib.beam
+++ b/bootstrap/lib/stdlib/ebin/filelib.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/filename.beam b/bootstrap/lib/stdlib/ebin/filename.beam
index d8c81df4d9..35031334c4 100644
--- a/bootstrap/lib/stdlib/ebin/filename.beam
+++ b/bootstrap/lib/stdlib/ebin/filename.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/gb_sets.beam b/bootstrap/lib/stdlib/ebin/gb_sets.beam
index 1928430e56..d42fed4c30 100644
--- a/bootstrap/lib/stdlib/ebin/gb_sets.beam
+++ b/bootstrap/lib/stdlib/ebin/gb_sets.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/gb_trees.beam b/bootstrap/lib/stdlib/ebin/gb_trees.beam
index 7bebf1a54e..bbe958dc66 100644
--- a/bootstrap/lib/stdlib/ebin/gb_trees.beam
+++ b/bootstrap/lib/stdlib/ebin/gb_trees.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/gen.beam b/bootstrap/lib/stdlib/ebin/gen.beam
index 71733a69cf..806515e2e0 100644
--- a/bootstrap/lib/stdlib/ebin/gen.beam
+++ b/bootstrap/lib/stdlib/ebin/gen.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/gen_event.beam b/bootstrap/lib/stdlib/ebin/gen_event.beam
index 321d3e7733..8137fe9570 100644
--- a/bootstrap/lib/stdlib/ebin/gen_event.beam
+++ b/bootstrap/lib/stdlib/ebin/gen_event.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/gen_fsm.beam b/bootstrap/lib/stdlib/ebin/gen_fsm.beam
index 3467b05cd6..5f46d56d18 100644
--- a/bootstrap/lib/stdlib/ebin/gen_fsm.beam
+++ b/bootstrap/lib/stdlib/ebin/gen_fsm.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/gen_server.beam b/bootstrap/lib/stdlib/ebin/gen_server.beam
index 8354aabd1c..d5ab30b170 100644
--- a/bootstrap/lib/stdlib/ebin/gen_server.beam
+++ b/bootstrap/lib/stdlib/ebin/gen_server.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/io.beam b/bootstrap/lib/stdlib/ebin/io.beam
index 7af592caa0..0a2ae3490c 100644
--- a/bootstrap/lib/stdlib/ebin/io.beam
+++ b/bootstrap/lib/stdlib/ebin/io.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/io_lib.beam b/bootstrap/lib/stdlib/ebin/io_lib.beam
index c0af612d77..07cefba99e 100644
--- a/bootstrap/lib/stdlib/ebin/io_lib.beam
+++ b/bootstrap/lib/stdlib/ebin/io_lib.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/io_lib_format.beam b/bootstrap/lib/stdlib/ebin/io_lib_format.beam
index cfebe1597a..5fb023c5e1 100644
--- a/bootstrap/lib/stdlib/ebin/io_lib_format.beam
+++ b/bootstrap/lib/stdlib/ebin/io_lib_format.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/io_lib_fread.beam b/bootstrap/lib/stdlib/ebin/io_lib_fread.beam
index bebe0a6c75..5ecd664026 100644
--- a/bootstrap/lib/stdlib/ebin/io_lib_fread.beam
+++ b/bootstrap/lib/stdlib/ebin/io_lib_fread.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/io_lib_pretty.beam b/bootstrap/lib/stdlib/ebin/io_lib_pretty.beam
index 9a8b68c6e0..ea2de10690 100644
--- a/bootstrap/lib/stdlib/ebin/io_lib_pretty.beam
+++ b/bootstrap/lib/stdlib/ebin/io_lib_pretty.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/lib.beam b/bootstrap/lib/stdlib/ebin/lib.beam
index 07740547ed..f2f40ef868 100644
--- a/bootstrap/lib/stdlib/ebin/lib.beam
+++ b/bootstrap/lib/stdlib/ebin/lib.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/lists.beam b/bootstrap/lib/stdlib/ebin/lists.beam
index fe06dc3b4a..3d422580e9 100644
--- a/bootstrap/lib/stdlib/ebin/lists.beam
+++ b/bootstrap/lib/stdlib/ebin/lists.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/log_mf_h.beam b/bootstrap/lib/stdlib/ebin/log_mf_h.beam
index 4afaff66d4..25a8d64b78 100644
--- a/bootstrap/lib/stdlib/ebin/log_mf_h.beam
+++ b/bootstrap/lib/stdlib/ebin/log_mf_h.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/math.beam b/bootstrap/lib/stdlib/ebin/math.beam
index 0103016730..e97284ca1e 100644
--- a/bootstrap/lib/stdlib/ebin/math.beam
+++ b/bootstrap/lib/stdlib/ebin/math.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/ms_transform.beam b/bootstrap/lib/stdlib/ebin/ms_transform.beam
index 898ee9861d..1ca5210612 100644
--- a/bootstrap/lib/stdlib/ebin/ms_transform.beam
+++ b/bootstrap/lib/stdlib/ebin/ms_transform.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/orddict.beam b/bootstrap/lib/stdlib/ebin/orddict.beam
index d6bed77761..76245fcd5e 100644
--- a/bootstrap/lib/stdlib/ebin/orddict.beam
+++ b/bootstrap/lib/stdlib/ebin/orddict.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/ordsets.beam b/bootstrap/lib/stdlib/ebin/ordsets.beam
index c3f2c3b7b1..6228f1b5d6 100644
--- a/bootstrap/lib/stdlib/ebin/ordsets.beam
+++ b/bootstrap/lib/stdlib/ebin/ordsets.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/otp_internal.beam b/bootstrap/lib/stdlib/ebin/otp_internal.beam
index 2fbda80a5e..c0c236fecb 100644
--- a/bootstrap/lib/stdlib/ebin/otp_internal.beam
+++ b/bootstrap/lib/stdlib/ebin/otp_internal.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/pg.beam b/bootstrap/lib/stdlib/ebin/pg.beam
index 026d102a75..0b08fb57ca 100644
--- a/bootstrap/lib/stdlib/ebin/pg.beam
+++ b/bootstrap/lib/stdlib/ebin/pg.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/pool.beam b/bootstrap/lib/stdlib/ebin/pool.beam
index 29e5f83b5e..43c8763e8f 100644
--- a/bootstrap/lib/stdlib/ebin/pool.beam
+++ b/bootstrap/lib/stdlib/ebin/pool.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/proc_lib.beam b/bootstrap/lib/stdlib/ebin/proc_lib.beam
index d2fb37b8ea..704bd8a23d 100644
--- a/bootstrap/lib/stdlib/ebin/proc_lib.beam
+++ b/bootstrap/lib/stdlib/ebin/proc_lib.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/proplists.beam b/bootstrap/lib/stdlib/ebin/proplists.beam
index bed96c6b1a..6f0e5d6409 100644
--- a/bootstrap/lib/stdlib/ebin/proplists.beam
+++ b/bootstrap/lib/stdlib/ebin/proplists.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/qlc.beam b/bootstrap/lib/stdlib/ebin/qlc.beam
index e250a375dd..4e1b8a80d1 100644
--- a/bootstrap/lib/stdlib/ebin/qlc.beam
+++ b/bootstrap/lib/stdlib/ebin/qlc.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/qlc_pt.beam b/bootstrap/lib/stdlib/ebin/qlc_pt.beam
index d405d8483f..805f63930b 100644
--- a/bootstrap/lib/stdlib/ebin/qlc_pt.beam
+++ b/bootstrap/lib/stdlib/ebin/qlc_pt.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/queue.beam b/bootstrap/lib/stdlib/ebin/queue.beam
index 19d24cfaa6..663b1a49ff 100644
--- a/bootstrap/lib/stdlib/ebin/queue.beam
+++ b/bootstrap/lib/stdlib/ebin/queue.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/random.beam b/bootstrap/lib/stdlib/ebin/random.beam
index 9f2361d586..1ee81ea68e 100644
--- a/bootstrap/lib/stdlib/ebin/random.beam
+++ b/bootstrap/lib/stdlib/ebin/random.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/re.beam b/bootstrap/lib/stdlib/ebin/re.beam
index da228c5542..22d753562d 100644
--- a/bootstrap/lib/stdlib/ebin/re.beam
+++ b/bootstrap/lib/stdlib/ebin/re.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/regexp.beam b/bootstrap/lib/stdlib/ebin/regexp.beam
index d021c5779b..023f2fb9b2 100644
--- a/bootstrap/lib/stdlib/ebin/regexp.beam
+++ b/bootstrap/lib/stdlib/ebin/regexp.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/sets.beam b/bootstrap/lib/stdlib/ebin/sets.beam
index 5ef47425a0..a08222f3d3 100644
--- a/bootstrap/lib/stdlib/ebin/sets.beam
+++ b/bootstrap/lib/stdlib/ebin/sets.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/shell.beam b/bootstrap/lib/stdlib/ebin/shell.beam
index a8a03d5f3b..50a60ed5b4 100644
--- a/bootstrap/lib/stdlib/ebin/shell.beam
+++ b/bootstrap/lib/stdlib/ebin/shell.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/shell_default.beam b/bootstrap/lib/stdlib/ebin/shell_default.beam
index 57ac5f2046..fa64e33080 100644
--- a/bootstrap/lib/stdlib/ebin/shell_default.beam
+++ b/bootstrap/lib/stdlib/ebin/shell_default.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/slave.beam b/bootstrap/lib/stdlib/ebin/slave.beam
index ceb4f0e60f..dfc8cad9d6 100644
--- a/bootstrap/lib/stdlib/ebin/slave.beam
+++ b/bootstrap/lib/stdlib/ebin/slave.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/sofs.beam b/bootstrap/lib/stdlib/ebin/sofs.beam
index 8cbcfb55de..90bbb671eb 100644
--- a/bootstrap/lib/stdlib/ebin/sofs.beam
+++ b/bootstrap/lib/stdlib/ebin/sofs.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/stdlib.app b/bootstrap/lib/stdlib/ebin/stdlib.app
index bcce209e27..de50a882d3 100644
--- a/bootstrap/lib/stdlib/ebin/stdlib.app
+++ b/bootstrap/lib/stdlib/ebin/stdlib.app
@@ -2,7 +2,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -19,7 +19,7 @@
%%
{application, stdlib,
[{description, "ERTS CXC 138 10"},
- {vsn, "1.17.4"},
+ {vsn, "1.18"},
{modules, [array,
base64,
beam_lib,
diff --git a/bootstrap/lib/stdlib/ebin/stdlib.appup b/bootstrap/lib/stdlib/ebin/stdlib.appup
index 1b03a40251..75ae6bb22e 100644
--- a/bootstrap/lib/stdlib/ebin/stdlib.appup
+++ b/bootstrap/lib/stdlib/ebin/stdlib.appup
@@ -1 +1 @@
-{"1.17.3",[],[]}.
+{"1.18",[],[]}.
diff --git a/bootstrap/lib/stdlib/ebin/string.beam b/bootstrap/lib/stdlib/ebin/string.beam
index 0de0b44cb8..5086591504 100644
--- a/bootstrap/lib/stdlib/ebin/string.beam
+++ b/bootstrap/lib/stdlib/ebin/string.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/supervisor.beam b/bootstrap/lib/stdlib/ebin/supervisor.beam
index 4e46676a20..b9d50e231b 100644
--- a/bootstrap/lib/stdlib/ebin/supervisor.beam
+++ b/bootstrap/lib/stdlib/ebin/supervisor.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/supervisor_bridge.beam b/bootstrap/lib/stdlib/ebin/supervisor_bridge.beam
index 686078826d..2fa7bc7050 100644
--- a/bootstrap/lib/stdlib/ebin/supervisor_bridge.beam
+++ b/bootstrap/lib/stdlib/ebin/supervisor_bridge.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/sys.beam b/bootstrap/lib/stdlib/ebin/sys.beam
index e972bcbd14..499d558dc0 100644
--- a/bootstrap/lib/stdlib/ebin/sys.beam
+++ b/bootstrap/lib/stdlib/ebin/sys.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/timer.beam b/bootstrap/lib/stdlib/ebin/timer.beam
index 0bfe233ad7..f60983e084 100644
--- a/bootstrap/lib/stdlib/ebin/timer.beam
+++ b/bootstrap/lib/stdlib/ebin/timer.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/unicode.beam b/bootstrap/lib/stdlib/ebin/unicode.beam
index 62e348b3a5..28e3c03640 100644
--- a/bootstrap/lib/stdlib/ebin/unicode.beam
+++ b/bootstrap/lib/stdlib/ebin/unicode.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/win32reg.beam b/bootstrap/lib/stdlib/ebin/win32reg.beam
index 45b268ebac..9c7893f7ff 100644
--- a/bootstrap/lib/stdlib/ebin/win32reg.beam
+++ b/bootstrap/lib/stdlib/ebin/win32reg.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/ebin/zip.beam b/bootstrap/lib/stdlib/ebin/zip.beam
index 74f7c6a208..59d4697510 100644
--- a/bootstrap/lib/stdlib/ebin/zip.beam
+++ b/bootstrap/lib/stdlib/ebin/zip.beam
Binary files differ
diff --git a/bootstrap/lib/stdlib/egen/erl_parse.erl b/bootstrap/lib/stdlib/egen/erl_parse.erl
index 97952dcb46..1e11007ec9 100644
--- a/bootstrap/lib/stdlib/egen/erl_parse.erl
+++ b/bootstrap/lib/stdlib/egen/erl_parse.erl
@@ -593,11 +593,11 @@ get_attribute(L, Name) ->
get_attributes(L) ->
erl_scan:attributes_info(L).
--file("/opt/installs/lib/erlang/lib/parsetools-2.0.5/include/yeccpre.hrl", 0).
+-file("/usr/local/otp/releases/sles10_32_R14B03_patched/lib/parsetools-2.0.5/include/yeccpre.hrl", 0).
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -776,7 +776,7 @@ yecctoken2string(Other) ->
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 779).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 779).
yeccpars2(0=S, Cat, Ss, Stack, T, Ts, Tzr) ->
yeccpars2_0(S, Cat, Ss, Stack, T, Ts, Tzr);
@@ -8232,7 +8232,7 @@ yeccpars2_39_(__Stack0) ->
[ __1 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8235).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8235).
-compile({inline,yeccpars2_46_/1}).
-file("erl_parse.yrl", 434).
yeccpars2_46_(__Stack0) ->
@@ -8241,7 +8241,7 @@ yeccpars2_46_(__Stack0) ->
{ [ ] , ? line ( __1 ) }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8244).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8244).
-compile({inline,yeccpars2_70_/1}).
-file("erl_parse.yrl", 325).
yeccpars2_70_(__Stack0) ->
@@ -8250,7 +8250,7 @@ yeccpars2_70_(__Stack0) ->
{ tuple , ? line ( __1 ) , [ ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8253).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8253).
-compile({inline,yeccpars2_71_/1}).
-file("erl_parse.yrl", 326).
yeccpars2_71_(__Stack0) ->
@@ -8259,7 +8259,7 @@ yeccpars2_71_(__Stack0) ->
{ tuple , ? line ( __1 ) , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8262).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8262).
-compile({inline,yeccpars2_73_/1}).
-file("erl_parse.yrl", 408).
yeccpars2_73_(__Stack0) ->
@@ -8291,7 +8291,7 @@ yeccpars2_81_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8294).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8294).
-compile({inline,yeccpars2_82_/1}).
-file("erl_parse.yrl", 406).
yeccpars2_82_(__Stack0) ->
@@ -8324,7 +8324,7 @@ yeccpars2_88_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8327).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8327).
-compile({inline,yeccpars2_89_/1}).
-file("erl_parse.yrl", 381).
yeccpars2_89_(__Stack0) ->
@@ -8363,7 +8363,7 @@ yeccpars2_98_(__Stack0) ->
[ ]
end | __Stack0].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8366).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8366).
-compile({inline,yeccpars2_100_/1}).
-file("erl_parse.yrl", 427).
yeccpars2_100_(__Stack0) ->
@@ -8380,7 +8380,7 @@ yeccpars2_102_(__Stack0) ->
[ ]
end | __Stack0].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8383).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8383).
-compile({inline,yeccpars2_104_/1}).
-file("erl_parse.yrl", 424).
yeccpars2_104_(__Stack0) ->
@@ -8390,7 +8390,7 @@ yeccpars2_104_(__Stack0) ->
{ clause , L , [ { tuple , L , [ __1 , __3 , { var , L , '_' } ] } ] , __4 , __5 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8393).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8393).
-compile({inline,yeccpars2_106_/1}).
-file("erl_parse.yrl", 421).
yeccpars2_106_(__Stack0) ->
@@ -8432,7 +8432,7 @@ yeccpars2_114_(__Stack0) ->
{ [ ] , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8435).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8435).
-compile({inline,yeccpars2_115_/1}).
-file("erl_parse.yrl", 452).
yeccpars2_115_(__Stack0) ->
@@ -8441,7 +8441,7 @@ yeccpars2_115_(__Stack0) ->
{ string , ? line ( __1 ) , element ( 3 , __1 ) ++ element ( 3 , __2 ) }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8444).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8444).
-compile({inline,yeccpars2_120_/1}).
-file("erl_parse.yrl", 386).
yeccpars2_120_(__Stack0) ->
@@ -8450,7 +8450,7 @@ yeccpars2_120_(__Stack0) ->
{ 'receive' , ? line ( __1 ) , [ ] , __3 , __4 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8453).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8453).
-compile({inline,yeccpars2_122_/1}).
-file("erl_parse.yrl", 384).
yeccpars2_122_(__Stack0) ->
@@ -8459,7 +8459,7 @@ yeccpars2_122_(__Stack0) ->
{ 'receive' , ? line ( __1 ) , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8462).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8462).
-compile({inline,yeccpars2_125_/1}).
-file("erl_parse.yrl", 388).
yeccpars2_125_(__Stack0) ->
@@ -8476,7 +8476,7 @@ yeccpars2_131_(__Stack0) ->
[ __1 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8479).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8479).
-compile({inline,yeccpars2_135_/1}).
-file("erl_parse.yrl", 323).
yeccpars2_135_(__Stack0) ->
@@ -8485,7 +8485,7 @@ yeccpars2_135_(__Stack0) ->
{ b_generate , ? line ( __2 ) , __1 , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8488).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8488).
-compile({inline,yeccpars2_137_/1}).
-file("erl_parse.yrl", 322).
yeccpars2_137_(__Stack0) ->
@@ -8502,7 +8502,7 @@ yeccpars2_139_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8505).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8505).
-compile({inline,yeccpars2_140_/1}).
-file("erl_parse.yrl", 315).
yeccpars2_140_(__Stack0) ->
@@ -8511,7 +8511,7 @@ yeccpars2_140_(__Stack0) ->
{ lc , ? line ( __1 ) , __2 , __4 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8514).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8514).
-compile({inline,yeccpars2_141_/1}).
-file("erl_parse.yrl", 431).
yeccpars2_141_(__Stack0) ->
@@ -8528,7 +8528,7 @@ yeccpars2_143_(__Stack0) ->
[ __1 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8531).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8531).
-compile({inline,yeccpars2_145_/1}).
-file("erl_parse.yrl", 371).
yeccpars2_145_(__Stack0) ->
@@ -8545,7 +8545,7 @@ yeccpars2_147_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8548).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8548).
-compile({inline,yeccpars2_148_/1}).
-file("erl_parse.yrl", 365).
yeccpars2_148_(__Stack0) ->
@@ -8569,7 +8569,7 @@ yeccpars2_151_(__Stack0) ->
[ ]
end | __Stack0].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8572).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8572).
-compile({inline,yeccpars2_157_/1}).
-file("erl_parse.yrl", 394).
yeccpars2_157_(__Stack0) ->
@@ -8578,7 +8578,7 @@ yeccpars2_157_(__Stack0) ->
{ 'fun' , ? line ( __1 ) , { function , element ( 3 , __2 ) , element ( 3 , __4 ) , element ( 3 , __6 ) } }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8581).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8581).
-compile({inline,yeccpars2_158_/1}).
-file("erl_parse.yrl", 392).
yeccpars2_158_(__Stack0) ->
@@ -8604,7 +8604,7 @@ yeccpars2_162_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8607).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8607).
-compile({inline,yeccpars2_163_/1}).
-file("erl_parse.yrl", 396).
yeccpars2_163_(__Stack0) ->
@@ -8613,7 +8613,7 @@ yeccpars2_163_(__Stack0) ->
build_fun ( ? line ( __1 ) , __2 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8616).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8616).
-compile({inline,yeccpars2_164_/1}).
-file("erl_parse.yrl", 214).
yeccpars2_164_(__Stack0) ->
@@ -8622,7 +8622,7 @@ yeccpars2_164_(__Stack0) ->
{ 'catch' , ? line ( __1 ) , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8625).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8625).
-compile({inline,yeccpars2_168_/1}).
-file("erl_parse.yrl", 375).
yeccpars2_168_(__Stack0) ->
@@ -8631,7 +8631,7 @@ yeccpars2_168_(__Stack0) ->
{ 'case' , ? line ( __1 ) , __2 , __4 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8634).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8634).
-compile({inline,yeccpars2_170_/1}).
-file("erl_parse.yrl", 270).
yeccpars2_170_(__Stack0) ->
@@ -8640,7 +8640,7 @@ yeccpars2_170_(__Stack0) ->
{ block , ? line ( __1 ) , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8643).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8643).
-compile({inline,yeccpars2_172_/1}).
-file("erl_parse.yrl", 279).
yeccpars2_172_(__Stack0) ->
@@ -8649,7 +8649,7 @@ yeccpars2_172_(__Stack0) ->
{ nil , ? line ( __1 ) }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8652).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8652).
-compile({inline,yeccpars2_173_/1}).
-file("erl_parse.yrl", 280).
yeccpars2_173_(__Stack0) ->
@@ -8658,7 +8658,7 @@ yeccpars2_173_(__Stack0) ->
{ cons , ? line ( __1 ) , __2 , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8661).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8661).
-compile({inline,yeccpars2_175_/1}).
-file("erl_parse.yrl", 282).
yeccpars2_175_(__Stack0) ->
@@ -8675,7 +8675,7 @@ yeccpars2_178_(__Stack0) ->
__2
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8678).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8678).
-compile({inline,yeccpars2_180_/1}).
-file("erl_parse.yrl", 284).
yeccpars2_180_(__Stack0) ->
@@ -8699,7 +8699,7 @@ yeccpars2_186_(__Stack0) ->
[ __1 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8702).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8702).
-compile({inline,yeccpars2_187_/1}).
-file("erl_parse.yrl", 287).
yeccpars2_187_(__Stack0) ->
@@ -8716,7 +8716,7 @@ yeccpars2_189_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8719).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8719).
-compile({inline,yeccpars2_190_/1}).
-file("erl_parse.yrl", 288).
yeccpars2_190_(__Stack0) ->
@@ -8725,7 +8725,7 @@ yeccpars2_190_(__Stack0) ->
{ bin , ? line ( __1 ) , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8728).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8728).
-compile({inline,yeccpars2_193_/1}).
-file("erl_parse.yrl", 317).
yeccpars2_193_(__Stack0) ->
@@ -8749,7 +8749,7 @@ yeccpars2_197_(__Stack0) ->
__2
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8752).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8752).
-compile({inline,yeccpars2_198_/1}).
-file("erl_parse.yrl", 294).
yeccpars2_198_(__Stack0) ->
@@ -8798,7 +8798,7 @@ yeccpars2_206_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8801).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8801).
-compile({inline,yeccpars2_207_/1}).
-file("erl_parse.yrl", 296).
yeccpars2_207_(__Stack0) ->
@@ -8807,7 +8807,7 @@ yeccpars2_207_(__Stack0) ->
? mkop1 ( __1 , __2 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8810).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8810).
-compile({inline,yeccpars2_208_/1}).
-file("erl_parse.yrl", 256).
yeccpars2_208_(__Stack0) ->
@@ -8824,7 +8824,7 @@ yeccpars2_210_(__Stack0) ->
__2
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8827).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8827).
-compile({inline,yeccpars2_212_/1}).
-file("erl_parse.yrl", 340).
yeccpars2_212_(__Stack0) ->
@@ -8849,7 +8849,7 @@ yeccpars2_219_(__Stack0) ->
[ ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8852).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8852).
-compile({inline,yeccpars2_221_/1}).
-file("erl_parse.yrl", 356).
yeccpars2_221_(__Stack0) ->
@@ -8858,7 +8858,7 @@ yeccpars2_221_(__Stack0) ->
{ record_field , ? line ( __1 ) , __1 , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8861).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8861).
-compile({inline,yeccpars2_223_/1}).
-file("erl_parse.yrl", 357).
yeccpars2_223_(__Stack0) ->
@@ -8883,7 +8883,7 @@ yeccpars2_226_(__Stack0) ->
__2
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8886).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8886).
-compile({inline,yeccpars2_227_/1}).
-file("erl_parse.yrl", 338).
yeccpars2_227_(__Stack0) ->
@@ -8900,7 +8900,7 @@ yeccpars2_229_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8903).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8903).
-compile({inline,yeccpars2_232_/1}).
-file("erl_parse.yrl", 217).
yeccpars2_232_(__Stack0) ->
@@ -8909,7 +8909,7 @@ yeccpars2_232_(__Stack0) ->
{ match , ? line ( __2 ) , __1 , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8912).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8912).
-compile({inline,yeccpars2_233_/1}).
-file("erl_parse.yrl", 218).
yeccpars2_233_(__Stack0) ->
@@ -8918,7 +8918,7 @@ yeccpars2_233_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8921).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8921).
-compile({inline,yeccpars2_235_/1}).
-file("erl_parse.yrl", 221).
yeccpars2_235_(__Stack0) ->
@@ -8927,7 +8927,7 @@ yeccpars2_235_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8930).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8930).
-compile({inline,yeccpars2_237_/1}).
-file("erl_parse.yrl", 224).
yeccpars2_237_(__Stack0) ->
@@ -8936,7 +8936,7 @@ yeccpars2_237_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8939).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8939).
-compile({inline,yeccpars2_247_/1}).
-file("erl_parse.yrl", 228).
yeccpars2_247_(__Stack0) ->
@@ -8945,7 +8945,7 @@ yeccpars2_247_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8948).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8948).
-compile({inline,yeccpars2_260_/1}).
-file("erl_parse.yrl", 236).
yeccpars2_260_(__Stack0) ->
@@ -8954,7 +8954,7 @@ yeccpars2_260_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8957).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8957).
-compile({inline,yeccpars2_268_/1}).
-file("erl_parse.yrl", 240).
yeccpars2_268_(__Stack0) ->
@@ -8963,7 +8963,7 @@ yeccpars2_268_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8966).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8966).
-compile({inline,yeccpars2_269_/1}).
-file("erl_parse.yrl", 232).
yeccpars2_269_(__Stack0) ->
@@ -8972,7 +8972,7 @@ yeccpars2_269_(__Stack0) ->
? mkop2 ( __1 , __2 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8975).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8975).
-compile({inline,yeccpars2_270_/1}).
-file("erl_parse.yrl", 362).
yeccpars2_270_(__Stack0) ->
@@ -8981,7 +8981,7 @@ yeccpars2_270_(__Stack0) ->
{ call , ? line ( __1 ) , __1 , element ( 1 , __2 ) }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8984).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8984).
-compile({inline,yeccpars2_273_/1}).
-file("erl_parse.yrl", 252).
yeccpars2_273_(__Stack0) ->
@@ -8990,7 +8990,7 @@ yeccpars2_273_(__Stack0) ->
{ remote , ? line ( __2 ) , __1 , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8993).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 8993).
-compile({inline,yeccpars2_274_/1}).
-file("erl_parse.yrl", 258).
yeccpars2_274_(__Stack0) ->
@@ -8999,7 +8999,7 @@ yeccpars2_274_(__Stack0) ->
{ record_field , ? line ( __2 ) , __1 , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9002).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9002).
-compile({inline,yeccpars2_277_/1}).
-file("erl_parse.yrl", 344).
yeccpars2_277_(__Stack0) ->
@@ -9008,7 +9008,7 @@ yeccpars2_277_(__Stack0) ->
{ record , ? line ( __2 ) , __1 , element ( 3 , __3 ) , __4 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9011).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9011).
-compile({inline,yeccpars2_279_/1}).
-file("erl_parse.yrl", 342).
yeccpars2_279_(__Stack0) ->
@@ -9017,7 +9017,7 @@ yeccpars2_279_(__Stack0) ->
{ record_field , ? line ( __2 ) , __1 , element ( 3 , __3 ) , __5 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9020).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9020).
-compile({inline,yeccpars2_280_/1}).
-file("erl_parse.yrl", 435).
yeccpars2_280_(__Stack0) ->
@@ -9026,7 +9026,7 @@ yeccpars2_280_(__Stack0) ->
{ __2 , ? line ( __1 ) }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9029).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9029).
-compile({inline,yeccpars2_281_/1}).
-file("erl_parse.yrl", 244).
yeccpars2_281_(__Stack0) ->
@@ -9035,7 +9035,7 @@ yeccpars2_281_(__Stack0) ->
? mkop1 ( __1 , __2 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9038).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9038).
-compile({inline,yeccpars2_284_/1}).
-file("erl_parse.yrl", 348).
yeccpars2_284_(__Stack0) ->
@@ -9044,7 +9044,7 @@ yeccpars2_284_(__Stack0) ->
{ record , ? line ( __2 ) , __1 , element ( 3 , __3 ) , __4 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9047).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9047).
-compile({inline,yeccpars2_286_/1}).
-file("erl_parse.yrl", 346).
yeccpars2_286_(__Stack0) ->
@@ -9053,7 +9053,7 @@ yeccpars2_286_(__Stack0) ->
{ record_field , ? line ( __2 ) , __1 , element ( 3 , __3 ) , __5 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9056).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9056).
-compile({inline,yeccpars2_288_/1}).
-file("erl_parse.yrl", 493).
yeccpars2_288_(__Stack0) ->
@@ -9062,7 +9062,7 @@ yeccpars2_288_(__Stack0) ->
{ clause , ? line ( __1 ) , element ( 3 , __1 ) , __2 , __3 , __4 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9065).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9065).
-compile({inline,yeccpars2_289_/1}).
-file("erl_parse.yrl", 203).
yeccpars2_289_(__Stack0) ->
@@ -9127,7 +9127,7 @@ yeccpars2_318_(__Stack0) ->
[ __1 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9130).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9130).
-compile({inline,yeccpars2_332_/1}).
-file("erl_parse.yrl", 152).
yeccpars2_332_(__Stack0) ->
@@ -9136,7 +9136,7 @@ yeccpars2_332_(__Stack0) ->
{ type , ? line ( __1 ) , tuple , [ ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9139).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9139).
-compile({inline,yeccpars2_333_/1}).
-file("erl_parse.yrl", 153).
yeccpars2_333_(__Stack0) ->
@@ -9145,7 +9145,7 @@ yeccpars2_333_(__Stack0) ->
{ type , ? line ( __1 ) , tuple , __2 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9148).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9148).
-compile({inline,yeccpars2_335_/1}).
-file("erl_parse.yrl", 116).
yeccpars2_335_(__Stack0) ->
@@ -9154,7 +9154,7 @@ yeccpars2_335_(__Stack0) ->
{ ann_type , ? line ( __1 ) , [ __1 , __3 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9157).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9157).
-compile({inline,yeccpars2_341_/1}).
-file("erl_parse.yrl", 159).
yeccpars2_341_(__Stack0) ->
@@ -9163,7 +9163,7 @@ yeccpars2_341_(__Stack0) ->
{ type , ? line ( __1 ) , 'fun' , [ ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9166).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9166).
-compile({inline,yeccpars2_345_/1}).
-file("erl_parse.yrl", 163).
yeccpars2_345_(__Stack0) ->
@@ -9181,7 +9181,7 @@ yeccpars2_346_(__Stack0) ->
__3
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9184).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9184).
-compile({inline,yeccpars2_352_/1}).
-file("erl_parse.yrl", 144).
yeccpars2_352_(__Stack0) ->
@@ -9191,7 +9191,7 @@ yeccpars2_352_(__Stack0) ->
[ __1 , __3 , [ ] ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9194).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9194).
-compile({inline,yeccpars2_353_/1}).
-file("erl_parse.yrl", 146).
yeccpars2_353_(__Stack0) ->
@@ -9209,7 +9209,7 @@ yeccpars2_355_(__Stack0) ->
build_gen_type ( __1 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9212).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9212).
-compile({inline,yeccpars2_356_/1}).
-file("erl_parse.yrl", 142).
yeccpars2_356_(__Stack0) ->
@@ -9219,7 +9219,7 @@ yeccpars2_356_(__Stack0) ->
normalise ( __1 ) , __3 }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9222).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9222).
-compile({inline,yeccpars2_358_/1}).
-file("erl_parse.yrl", 148).
yeccpars2_358_(__Stack0) ->
@@ -9228,7 +9228,7 @@ yeccpars2_358_(__Stack0) ->
{ type , ? line ( __1 ) , nil , [ ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9231).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9231).
-compile({inline,yeccpars2_360_/1}).
-file("erl_parse.yrl", 149).
yeccpars2_360_(__Stack0) ->
@@ -9237,7 +9237,7 @@ yeccpars2_360_(__Stack0) ->
{ type , ? line ( __1 ) , list , [ __2 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9240).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9240).
-compile({inline,yeccpars2_362_/1}).
-file("erl_parse.yrl", 150).
yeccpars2_362_(__Stack0) ->
@@ -9247,7 +9247,7 @@ yeccpars2_362_(__Stack0) ->
nonempty_list , [ __2 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9250).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9250).
-compile({inline,yeccpars2_365_/1}).
-file("erl_parse.yrl", 179).
yeccpars2_365_(__Stack0) ->
@@ -9274,7 +9274,7 @@ yeccpars2_371_(__Stack0) ->
build_bin_type ( [ __1 , __3 ] , __5 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9277).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9277).
-compile({inline,yeccpars2_373_/1}).
-file("erl_parse.yrl", 182).
yeccpars2_373_(__Stack0) ->
@@ -9284,7 +9284,7 @@ yeccpars2_373_(__Stack0) ->
[ __2 , abstract ( 0 , ? line ( __1 ) ) ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9287).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9287).
-compile({inline,yeccpars2_378_/1}).
-file("erl_parse.yrl", 187).
yeccpars2_378_(__Stack0) ->
@@ -9293,7 +9293,7 @@ yeccpars2_378_(__Stack0) ->
{ type , ? line ( __1 ) , binary , [ __2 , __4 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9296).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9296).
-compile({inline,yeccpars2_379_/1}).
-file("erl_parse.yrl", 184).
yeccpars2_379_(__Stack0) ->
@@ -9303,7 +9303,7 @@ yeccpars2_379_(__Stack0) ->
[ abstract ( 0 , ? line ( __1 ) ) , __2 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9306).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9306).
-compile({inline,yeccpars2_381_/1}).
-file("erl_parse.yrl", 167).
yeccpars2_381_(__Stack0) ->
@@ -9313,7 +9313,7 @@ yeccpars2_381_(__Stack0) ->
[ { type , ? line ( __1 ) , product , [ ] } , __4 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9316).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9316).
-compile({inline,yeccpars2_383_/1}).
-file("erl_parse.yrl", 138).
yeccpars2_383_(__Stack0) ->
@@ -9330,7 +9330,7 @@ yeccpars2_387_(__Stack0) ->
[ __1 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9333).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9333).
-compile({inline,yeccpars2_389_/1}).
-file("erl_parse.yrl", 154).
yeccpars2_389_(__Stack0) ->
@@ -9339,7 +9339,7 @@ yeccpars2_389_(__Stack0) ->
{ type , ? line ( __1 ) , record , [ __2 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9342).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9342).
-compile({inline,yeccpars2_391_/1}).
-file("erl_parse.yrl", 176).
yeccpars2_391_(__Stack0) ->
@@ -9357,7 +9357,7 @@ yeccpars2_393_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9360).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9360).
-compile({inline,yeccpars2_394_/1}).
-file("erl_parse.yrl", 155).
yeccpars2_394_(__Stack0) ->
@@ -9367,7 +9367,7 @@ yeccpars2_394_(__Stack0) ->
record , [ __2 | __4 ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9370).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9370).
-compile({inline,yeccpars2_395_/1}).
-file("erl_parse.yrl", 135).
yeccpars2_395_(__Stack0) ->
@@ -9384,7 +9384,7 @@ yeccpars2_397_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9387).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9387).
-compile({inline,yeccpars2_400_/1}).
-file("erl_parse.yrl", 170).
yeccpars2_400_(__Stack0) ->
@@ -9402,7 +9402,7 @@ yeccpars2_402_(__Stack0) ->
lift_unions ( __1 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9405).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9405).
-compile({inline,yeccpars2_405_/1}).
-file("erl_parse.yrl", 122).
yeccpars2_405_(__Stack0) ->
@@ -9413,7 +9413,7 @@ yeccpars2_405_(__Stack0) ->
skip_paren ( __3 ) ] }
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9416).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9416).
-compile({inline,yeccpars2_406_/1}).
-file("erl_parse.yrl", 127).
yeccpars2_406_(__Stack0) ->
@@ -9423,7 +9423,7 @@ yeccpars2_406_(__Stack0) ->
__2 , skip_paren ( __3 ) )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9426).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9426).
-compile({inline,yeccpars2_408_/1}).
-file("erl_parse.yrl", 131).
yeccpars2_408_(__Stack0) ->
@@ -9433,7 +9433,7 @@ yeccpars2_408_(__Stack0) ->
__2 , skip_paren ( __3 ) )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9436).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9436).
-compile({inline,yeccpars2_410_/1}).
-file("erl_parse.yrl", 103).
yeccpars2_410_(__Stack0) ->
@@ -9459,7 +9459,7 @@ yeccpars2_415_(__Stack0) ->
build_def ( __1 , __3 )
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9462).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9462).
-compile({inline,yeccpars2_418_/1}).
-file("erl_parse.yrl", 109).
yeccpars2_418_(__Stack0) ->
@@ -9589,7 +9589,7 @@ yeccpars2_446_(__Stack0) ->
[ __1 | __3 ]
end | __Stack].
--file("/ldisk/egil/git/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9592).
+-file("/ldisk/bjorn/otp/bootstrap/lib/stdlib/egen/erl_parse.erl", 9592).
-compile({inline,yeccpars2_447_/1}).
-file("erl_parse.yrl", 90).
yeccpars2_447_(__Stack0) ->
diff --git a/bootstrap/lib/stdlib/include/erl_bits.hrl b/bootstrap/lib/stdlib/include/erl_bits.hrl
index aca213c08c..54ebe58585 100644
--- a/bootstrap/lib/stdlib/include/erl_bits.hrl
+++ b/bootstrap/lib/stdlib/include/erl_bits.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1999-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1999-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/stdlib/include/erl_compile.hrl b/bootstrap/lib/stdlib/include/erl_compile.hrl
index 2e0d90dfad..f779c4382c 100644
--- a/bootstrap/lib/stdlib/include/erl_compile.hrl
+++ b/bootstrap/lib/stdlib/include/erl_compile.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/stdlib/include/ms_transform.hrl b/bootstrap/lib/stdlib/include/ms_transform.hrl
index 2b89a4df2f..9937d48fef 100644
--- a/bootstrap/lib/stdlib/include/ms_transform.hrl
+++ b/bootstrap/lib/stdlib/include/ms_transform.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2002-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2002-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/bootstrap/lib/stdlib/include/qlc.hrl b/bootstrap/lib/stdlib/include/qlc.hrl
index cccedcbd2c..067fb83060 100644
--- a/bootstrap/lib/stdlib/include/qlc.hrl
+++ b/bootstrap/lib/stdlib/include/qlc.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2009. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
diff --git a/erts/Makefile.in b/erts/Makefile.in
index 2e63fc469e..8b86fbadf2 100644
--- a/erts/Makefile.in
+++ b/erts/Makefile.in
@@ -16,6 +16,9 @@
#
# %CopyrightEnd%
#
+
+.NOTPARALLEL:
+
include $(ERL_TOP)/make/target.mk
include vsn.mk
diff --git a/erts/configure.in b/erts/configure.in
index fac07f8b6a..3dbf98b876 100644
--- a/erts/configure.in
+++ b/erts/configure.in
@@ -1673,6 +1673,15 @@ esac
AC_C_BIGENDIAN
+dnl fdatasync syscall (Unix only)
+AC_CHECK_FUNCS([fdatasync])
+
+dnl Find which C libraries are required to use fdatasync
+dnl TODO: Remove check once SunOS >= 5.11 is required by erts.
+dnl fdatasync requires linking against -lrt on SunOS <= 5.10.
+dnl OpenSolaris 2009.06 is SunOS 5.11 and does not require -lrt.
+AC_SEARCH_LIBS(fdatasync, [rt])
+
dnl ----------------------------------------------------------------------
dnl Checks for library functions.
dnl ----------------------------------------------------------------------
@@ -1860,12 +1869,6 @@ fi
dnl Need by run_erl.
AC_CHECK_FUNCS([openpty])
-dnl fdatasync syscall (Unix only)
-AC_CHECK_FUNCS([fdatasync])
-
-dnl Find which C libraries are required to use fdatasync
-AC_SEARCH_LIBS(fdatasync, [rt])
-
AC_CHECK_HEADERS(net/if_dl.h ifaddrs.h netpacket/packet.h)
AC_CHECK_FUNCS([getifaddrs])
@@ -4309,7 +4312,6 @@ dnl Note that the output files are relative to $srcdir
AC_OUTPUT(
emulator/$host/Makefile:emulator/Makefile.in
emulator/zlib/$host/Makefile:emulator/zlib/Makefile.in
- emulator/pcre/$host/Makefile:emulator/pcre/Makefile.in
epmd/src/$host/Makefile:epmd/src/Makefile.in
etc/common/$host/Makefile:etc/common/Makefile.in
include/internal/$host/ethread.mk:include/internal/ethread.mk.in
diff --git a/erts/doc/src/erl.xml b/erts/doc/src/erl.xml
index 02082e57c6..8502ceadd2 100644
--- a/erts/doc/src/erl.xml
+++ b/erts/doc/src/erl.xml
@@ -587,6 +587,13 @@
<p>Enables auto load tracing, displaying info while loading
code.</p>
</item>
+ <tag><c><![CDATA[+L]]></c></tag>
+ <item>
+ <p>Don't load information about source filenames and line numbers.
+ This will save some memory, but exceptions will not contain
+ information about the filenames and line numbers.
+ </p>
+ </item>
<tag><marker id="erts_alloc"><c><![CDATA[+MFlag Value]]></c></marker></tag>
<item>
<p>Memory allocator specific flags, see
diff --git a/erts/doc/src/erlang.xml b/erts/doc/src/erlang.xml
index b7d775541f..79dc6838a6 100644
--- a/erts/doc/src/erlang.xml
+++ b/erts/doc/src/erlang.xml
@@ -518,6 +518,18 @@
</func>
<func>
+ <name>check_old_code(Module) -> boolean()</name>
+ <fsummary>Check if a module has old code</fsummary>
+ <type>
+ <v>Module = atom()</v>
+ </type>
+ <desc>
+ <p>Returns <c>true</c> if the <c>Module</c> has old code,
+ and <c>false</c> otherwise.</p>
+ <p>See also <seealso marker="kernel:code">code(3)</seealso>.</p>
+ </desc>
+ </func>
+ <func>
<name>check_process_code(Pid, Module) -> boolean()</name>
<fsummary>Check if a process is executing old code for a module</fsummary>
<type>
@@ -1282,17 +1294,18 @@ b</pre>
</desc>
</func>
<func>
- <name>erlang:get_stacktrace() -> [{Module, Function, Arity | Args}]</name>
+ <name>erlang:get_stacktrace() -> [{Module, Function, Arity | Args, Location}]</name>
<fsummary>Get the call stack back-trace of the last exception</fsummary>
<type>
<v>Module = Function = atom()</v>
<v>Arity = arity()</v>
<v>Args = [term()]</v>
+ <v>Location = [{atom(),term()}]</v>
</type>
<desc>
<p>Get the call stack back-trace (<em>stacktrace</em>) of the last
exception in the calling process as a list of
- <c>{Module,Function,Arity}</c> tuples.
+ <c>{Module,Function,Arity,Location}</c> tuples.
The <c>Arity</c> field in the first tuple may be the argument
list of that function call instead of an arity integer,
depending on the exception.</p>
@@ -1302,6 +1315,25 @@ b</pre>
<p>The stacktrace is the same data as the <c>catch</c> operator
returns, for example:</p>
<p><c>{'EXIT',{badarg,Stacktrace}} = catch abs(x)</c></p>
+ <p><c>Location</c> is a (possibly empty) list of two-tuples that
+ may indicate the location in the source code of the function.
+ The first element is an atom that describes the type of
+ information in the second element. Currently the following
+ items may occur:</p>
+ <taglist>
+ <tag><c>file</c></tag>
+ <item>
+ <p>The second element of the tuple is a string (list of
+ characters) representing the filename of the source file
+ of the function.</p>
+ </item>
+ <tag><c>line</c></tag>
+ <item>
+ <p>The second element of the tuple is the line number
+ (an integer greater than zero) in the source file
+ where the exception occurred or the function was called.</p>
+ </item>
+ </taglist>
<p>See also
<seealso marker="#error/1">erlang:error/1</seealso> and
<seealso marker="#error/2">erlang:error/2</seealso>.</p>
@@ -3809,11 +3841,26 @@ os_prompt%</pre>
catches in this process. This <c>InfoTuple</c> may be
changed or removed without prior notice.</p>
</item>
- <tag><c>{current_function, {Module, Function, Args}}</c></tag>
+ <tag><c>{current_function, {Module, Function, Arity}}</c></tag>
<item>
- <p><c>Module</c>, <c>Function</c>, <c>Args</c> is
+ <p><c>Module</c>, <c>Function</c>, <c>Arity</c> is
the current function call of the process.</p>
</item>
+ <tag><c>{current_location, {Module, Function, Arity, Location}}</c></tag>
+ <item>
+ <p><c>Module</c>, <c>Function</c>, <c>Arity</c> is
+ the current function call of the process.
+ <c>Location</c> is a list of two-tuples that describes the
+ location in the source code.
+ </p>
+ </item>
+ <tag><c>{current_stacktrace, Stack}</c></tag>
+ <item>
+ <p>Return the current call stack back-trace (<em>stacktrace</em>)
+ of the process. The stack has the same format as returned by
+ <seealso marker="#get_stacktrace/1">erlang:get_stacktrace/0</seealso>.
+ </p>
+ </item>
<tag><c>{dictionary, Dictionary}</c></tag>
<item>
<p><c>Dictionary</c> is the dictionary of the process.</p>
@@ -4080,11 +4127,14 @@ os_prompt%</pre>
equivalent to <c>erlang:Class(Reason)</c>.
<c>Reason</c> is any term and <c>Stacktrace</c> is a list as
returned from <c>get_stacktrace()</c>, that is a list of
- 3-tuples <c>{Module, Function, Arity | Args}</c> where
- <c>Module</c> and <c>Function</c> are atoms and the third
- element is an integer arity or an argument list. The
- stacktrace may also contain <c>{Fun, Args}</c> tuples where
+ 4-tuples <c>{Module, Function, Arity | Args,
+ Location}</c> where <c>Module</c> and <c>Function</c>
+ are atoms and the third element is an integer arity or an
+ argument list. The stacktrace may also contain <c>{Fun,
+ Args, Location}</c> tuples where
<c>Fun</c> is a local fun and <c>Args</c> is an argument list.</p>
+ <p>The <c>Location</c> element at the end is optional.
+ Omitting it is equivalent to specifying an empty list.</p>
<p>The stacktrace is used as the exception stacktrace for the
calling process; it will be truncated to the current
maximum stacktrace depth.</p>
diff --git a/erts/doc/src/zlib.xml b/erts/doc/src/zlib.xml
index 47a649af02..8917ab5c3a 100644
--- a/erts/doc/src/zlib.xml
+++ b/erts/doc/src/zlib.xml
@@ -378,31 +378,31 @@ unpack(Z, Compressed, Dict) ->
<name name="crc32" arity="2"/>
<fsummary>Calculate CRC</fsummary>
<desc>
- <p>Calculate the CRC checksum for <c><anno>Binary</anno></c>.</p>
+ <p>Calculate the CRC checksum for <c><anno>Data</anno></c>.</p>
</desc>
</func>
<func>
<name name="crc32" arity="3"/>
<fsummary>Calculate CRC</fsummary>
<desc>
- <p>Update a running CRC checksum for <c><anno>Binary</anno></c>.
- If <c><anno>Binary</anno></c> is the empty binary, this function returns
+ <p>Update a running CRC checksum for <c><anno>Data</anno></c>.
+ If <c><anno>Data</anno></c> is the empty binary or the empty iolist, this function returns
the required initial value for the crc.</p>
<pre>
-Crc = lists:foldl(fun(Bin,Crc0) ->
- zlib:crc32(Z, Crc0, Bin),
- end, zlib:crc32(Z,&lt;&lt; &gt;&gt;), Bins)</pre>
+Crc = lists:foldl(fun(Data,Crc0) ->
+ zlib:crc32(Z, Crc0, Data),
+ end, zlib:crc32(Z,&lt;&lt; &gt;&gt;), Datas)</pre>
</desc>
</func>
<func>
<name name="crc32_combine" arity="4"/>
<fsummary>Combine two CRC's</fsummary>
<desc>
- <p>Combine two CRC checksums into one. For two binaries,
- <c>Bin1</c> and <c>Bin2</c> with sizes of <c>Size1</c> and
+ <p>Combine two CRC checksums into one. For two binaries or iolists,
+ <c>Data1</c> and <c>Data2</c> with sizes of <c>Size1</c> and
<c><anno>Size2</anno></c>, with CRC checksums <c><anno>CRC1</anno></c> and
<c><anno>CRC2</anno></c>. <c>crc32_combine/4</c> returns the <c><anno>CRC</anno></c>
- checksum of <c>&lt;&lt;Bin1/binary,Bin2/binary&gt;&gt;</c>, requiring
+ checksum of <c>[Data1,Data2]</c>, requiring
only <c><anno>CRC1</anno></c>, <c><anno>CRC2</anno></c>, and <c><anno>Size2</anno></c>.
</p>
</desc>
@@ -411,75 +411,75 @@ Crc = lists:foldl(fun(Bin,Crc0) ->
<name name="adler32" arity="2"/>
<fsummary>Calculate the adler checksum</fsummary>
<desc>
- <p>Calculate the Adler-32 checksum for <c><anno>Binary</anno></c>.</p>
+ <p>Calculate the Adler-32 checksum for <c><anno>Data</anno></c>.</p>
</desc>
</func>
<func>
<name name="adler32" arity="3"/>
<fsummary>Calculate the adler checksum</fsummary>
<desc>
- <p>Update a running Adler-32 checksum for <c><anno>Binary</anno></c>.
- If <c><anno>Binary</anno></c> is the empty binary, this function returns
+ <p>Update a running Adler-32 checksum for <c><anno>Data</anno></c>.
+ If <c><anno>Data</anno></c> is the empty binary or the empty iolist, this function returns
the required initial value for the checksum.</p>
<pre>
-Crc = lists:foldl(fun(Bin,Crc0) ->
- zlib:adler32(Z, Crc0, Bin),
- end, zlib:adler32(Z,&lt;&lt; &gt;&gt;), Bins)</pre>
+Crc = lists:foldl(fun(Data,Crc0) ->
+ zlib:adler32(Z, Crc0, Data),
+ end, zlib:adler32(Z,&lt;&lt; &gt;&gt;), Datas)</pre>
</desc>
</func>
<func>
<name name="adler32_combine" arity="4"/>
<fsummary>Combine two Adler-32 checksums</fsummary>
<desc>
- <p>Combine two Adler-32 checksums into one. For two binaries,
- <c>Bin1</c> and <c>Bin2</c> with sizes of <c>Size1</c> and
+ <p>Combine two Adler-32 checksums into one. For two binaries or iolists,
+ <c>Data1</c> and <c>Data2</c> with sizes of <c>Size1</c> and
<c><anno>Size2</anno></c>, with Adler-32 checksums <c><anno>Adler1</anno></c> and
<c><anno>Adler2</anno></c>. <c>adler32_combine/4</c> returns the <c><anno>Adler</anno></c>
- checksum of <c>&lt;&lt;Bin1/binary,Bin2/binary&gt;&gt;</c>, requiring
+ checksum of <c>[Data1,Data2]</c>, requiring
only <c><anno>Adler1</anno></c>, <c><anno>Adler2</anno></c>, and <c><anno>Size2</anno></c>.
</p>
</desc>
</func>
<func>
<name name="compress" arity="1"/>
- <fsummary>Compress a binary with standard zlib functionality</fsummary>
+ <fsummary>Compress data with standard zlib functionality</fsummary>
<desc>
- <p>Compress a binary (with zlib headers and checksum).</p>
+ <p>Compress data (with zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="uncompress" arity="1"/>
- <fsummary>Uncompress a binary with standard zlib functionality</fsummary>
+ <fsummary>Uncompress data with standard zlib functionality</fsummary>
<desc>
- <p>Uncompress a binary (with zlib headers and checksum).</p>
+ <p>Uncompress data (with zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="zip" arity="1"/>
- <fsummary>Compress a binary without the zlib headers</fsummary>
+ <fsummary>Compress data without the zlib headers</fsummary>
<desc>
- <p>Compress a binary (without zlib headers and checksum).</p>
+ <p>Compress data (without zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="unzip" arity="1"/>
- <fsummary>Uncompress a binary without the zlib headers</fsummary>
+ <fsummary>Uncompress data without the zlib headers</fsummary>
<desc>
- <p>Uncompress a binary (without zlib headers and checksum).</p>
+ <p>Uncompress data (without zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="gzip" arity="1"/>
- <fsummary>Compress a binary with gz header</fsummary>
+ <fsummary>Compress data with gz header</fsummary>
<desc>
- <p>Compress a binary (with gz headers and checksum).</p>
+ <p>Compress data (with gz headers and checksum).</p>
</desc>
</func>
<func>
<name name="gunzip" arity="1"/>
- <fsummary>Uncompress a binary with gz header</fsummary>
+ <fsummary>Uncompress data with gz header</fsummary>
<desc>
- <p>Uncompress a binary (with gz headers and checksum).</p>
+ <p>Uncompress data (with gz headers and checksum).</p>
</desc>
</func>
</funcs>
diff --git a/erts/emulator/Makefile.in b/erts/emulator/Makefile.in
index b658e79378..1ecda6bfa2 100644
--- a/erts/emulator/Makefile.in
+++ b/erts/emulator/Makefile.in
@@ -291,7 +291,8 @@ else
LIBS += $(ERL_TOP)/erts/emulator/pcre/obj/$(TARGET)/$(TYPE)/$(LIB_PREFIX)epcre$(LIB_SUFFIX)
endif
-DEPLIBS += $(ERL_TOP)/erts/emulator/pcre/obj/$(TARGET)/$(TYPE)/$(LIB_PREFIX)epcre$(LIB_SUFFIX)
+EPCRE_LIB = $(ERL_TOP)/erts/emulator/pcre/obj/$(TARGET)/$(TYPE)/$(LIB_PREFIX)epcre$(LIB_SUFFIX)
+DEPLIBS += $(EPCRE_LIB)
PERFCTR_PATH=@PERFCTR_PATH@
USE_PERFCTR=@USE_PERFCTR@
@@ -382,7 +383,7 @@ ifeq ($(FLAVOR)-@ERTS_BUILD_SMP_EMU@,smp-no)
all:
@echo '*** Omitted build of emulator with smp support'
else
-all: generate erts_lib zlib pcre $(BINDIR)/$(EMULATOR_EXECUTABLE) $(UNIX_ONLY_BUILDS)
+all: generate erts_lib zlib $(BINDIR)/$(EMULATOR_EXECUTABLE) $(UNIX_ONLY_BUILDS)
ifeq ($(OMIT_OMIT_FP),yes)
@echo '* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *'
@echo '* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *'
@@ -403,8 +404,8 @@ zlib:
@set -e ; cd zlib && $(MAKE) TYPE=$(TYPE) $(TYPE)
endif
-pcre:
- @set -e ; cd pcre && $(MAKE) TYPE=$(TYPE) $(TYPE)
+
+include pcre/pcre.mk
erts_lib:
cd $(ERL_TOP)/erts/lib_src && $(MAKE) $(TYPE)
@@ -420,9 +421,9 @@ endif
$(RM) -rf $(BINDIR)/child_setup $(BINDIR)/child_setup.*
$(RM) -f $(BINDIR)/hipe_mkliterals $(BINDIR)/hipe_mkliterals.*
@set -e ; cd zlib && $(MAKE) clean
- @set -e ; cd pcre && $(MAKE) clean
+ rm -f $(OBJS) $(OBJDIR)/libepcre.a
-.PHONY: all zlib pcre clean
+.PHONY: all zlib clean
docs:
@@ -467,10 +468,11 @@ release_docs_spec:
# Generated source code. Put in $(TARGET) directory
#
+_create_dirs := $(shell mkdir -p $(CREATE_DIRS))
+
.PHONY : generate
-GENERATE= $(CREATE_DIRS) \
- $(TTF_DIR)/beam_opcodes.h \
+GENERATE= $(TTF_DIR)/beam_opcodes.h \
$(TARGET)/erl_bif_table.c \
$(TARGET)/erl_version.h \
$(TTF_DIR)/driver_tab.c \
@@ -672,14 +674,8 @@ endif
# rebuilding (is this a good idea?) add a dummy dependency to this target.
#
-ifeq ($(findstring clearmake,$(MAKE)),clearmake)
-BEAMFILE_MAKEFLAG=-T
-else
-BEAMFILE_MAKEFLAG=
-endif
-
$(ERL_TOP)/lib/%.beam:
- cd $(@D)/../src && $(MAKE) $(BEAMFILE_MAKEFLAG) ../ebin/$(@F)
+ cd $(@D)/../src && $(MAKE) ../ebin/$(@F)
# ----------------------------------------------------------------------
@@ -857,7 +853,7 @@ $(OBJDIR)/%.o: hipe/%.c
$(BINDIR)/hipe_mkliterals$(TF_MARKER): $(OBJDIR)/hipe_mkliterals.o
$(CC) $(CFLAGS) $(INCLUDES) -o $@ $<
-$(OBJDIR)/hipe_mkliterals.o: $(TTF_DIR)/hipe_x86_asm.h $(TTF_DIR)/hipe_ppc_asm.h
+$(OBJDIR)/hipe_mkliterals.o: $(TTF_DIR)/hipe_x86_asm.h $(TTF_DIR)/hipe_ppc_asm.h $(TTF_DIR)/beam_opcodes.h
$(TTF_DIR)/hipe_literals.h: $(BINDIR)/hipe_mkliterals$(TF_MARKER)
$(BINDIR)/hipe_mkliterals$(TF_MARKER) -c > $@
diff --git a/erts/emulator/beam/atom.names b/erts/emulator/beam/atom.names
index 68d64fb7b0..e7308dbf43 100644
--- a/erts/emulator/beam/atom.names
+++ b/erts/emulator/beam/atom.names
@@ -156,6 +156,8 @@ atom cr
atom crlf
atom creation
atom current_function
+atom current_location
+atom current_stacktrace
atom data
atom debug_flags
atom delay_trap
diff --git a/erts/emulator/beam/beam_bif_load.c b/erts/emulator/beam/beam_bif_load.c
index d76a7d8e9f..2561d7a630 100644
--- a/erts/emulator/beam/beam_bif_load.c
+++ b/erts/emulator/beam/beam_bif_load.c
@@ -162,6 +162,23 @@ BIF_RETTYPE code_make_stub_module_3(BIF_ALIST_3)
return res;
}
+BIF_RETTYPE
+check_old_code_1(BIF_ALIST_1)
+{
+ Module* modp;
+
+ if (is_not_atom(BIF_ARG_1)) {
+ BIF_ERROR(BIF_P, BADARG);
+ }
+ modp = erts_get_module(BIF_ARG_1);
+ if (modp == NULL) { /* Doesn't exist. */
+ BIF_RET(am_false);
+ } else if (modp->old_code == NULL) { /* No old code. */
+ BIF_RET(am_false);
+ }
+ BIF_RET(am_true);
+}
+
Eterm
check_process_code_2(BIF_ALIST_2)
{
@@ -175,6 +192,13 @@ check_process_code_2(BIF_ALIST_2)
Eterm res;
if (internal_pid_index(BIF_ARG_1) >= erts_max_processes)
goto error;
+ modp = erts_get_module(BIF_ARG_2);
+ if (modp == NULL) { /* Doesn't exist. */
+ return am_false;
+ } else if (modp->old_code == NULL) { /* No old code. */
+ return am_false;
+ }
+
#ifdef ERTS_SMP
rp = erts_pid2proc_suspend(BIF_P, ERTS_PROC_LOCK_MAIN,
BIF_ARG_1, ERTS_PROC_LOCK_MAIN);
@@ -188,7 +212,6 @@ check_process_code_2(BIF_ALIST_2)
ERTS_BIF_YIELD2(bif_export[BIF_check_process_code_2], BIF_P,
BIF_ARG_1, BIF_ARG_2);
}
- modp = erts_get_module(BIF_ARG_2);
res = check_process_code(rp, modp);
#ifdef ERTS_SMP
if (BIF_P != rp) {
@@ -412,11 +435,6 @@ check_process_code(Process* rp, Module* modp)
#endif
#define INSIDE(a) (start <= (a) && (a) < end)
- if (modp == NULL) { /* Doesn't exist. */
- return am_false;
- } else if (modp->old_code == NULL) { /* No old code. */
- return am_false;
- }
/*
* Pick up limits for the module.
diff --git a/erts/emulator/beam/beam_emu.c b/erts/emulator/beam/beam_emu.c
index 937b3d9e53..afdbd65bb5 100644
--- a/erts/emulator/beam/beam_emu.c
+++ b/erts/emulator/beam/beam_emu.c
@@ -5270,6 +5270,7 @@ void process_main(void)
OpCase(label_L):
OpCase(too_old_compiler):
OpCase(on_load):
+ OpCase(line_I):
erl_exit(1, "meta op\n");
/*
@@ -5686,6 +5687,25 @@ expand_error_value(Process* c_p, Uint freason, Eterm Value) {
* that c_p->ftrace will point to a cons cell which holds the given args
* and the saved data (encoded as a bignum).
*
+ * There is an issue with line number information. Line number
+ * information is associated with the address *before* an operation
+ * that may fail or be stored stored on the stack. But continuation
+ * pointers point after its call instruction, not before. To avoid
+ * finding the wrong line number, we'll need to adjust them so that
+ * they point at the beginning of the call instruction or inside the
+ * call instruction. Since its impractical to point at the beginning,
+ * we'll do the simplest thing and decrement the continuation pointers
+ * by one.
+ *
+ * Here is an example of what can go wrong. Without the adjustment
+ * of continuation pointers, the call at line 42 below would seem to
+ * be at line 43:
+ *
+ * line 42
+ * call ...
+ * line 43
+ * gc_bif ...
+ *
* (It would be much better to put the arglist - when it exists - in the
* error value instead of in the actual trace; e.g. '{badarg, Args}'
* instead of using 'badarg' with Args in the trace. The arglist may
@@ -5752,7 +5772,7 @@ save_stacktrace(Process* c_p, BeamInstr* pc, Eterm* reg, BifFunction bf,
}
/* Save second stack entry if CP is valid and different from pc */
if (depth > 0 && c_p->cp != 0 && c_p->cp != pc) {
- s->trace[s->depth++] = c_p->cp;
+ s->trace[s->depth++] = c_p->cp - 1;
depth--;
}
s->pc = NULL;
@@ -5772,13 +5792,13 @@ save_stacktrace(Process* c_p, BeamInstr* pc, Eterm* reg, BifFunction bf,
/* Save first stack entry */
ASSERT(c_p->cp);
if (depth > 0) {
- s->trace[s->depth++] = c_p->cp;
+ s->trace[s->depth++] = c_p->cp - 1;
depth--;
}
s->pc = NULL; /* Ignore pc */
} else {
if (depth > 0 && c_p->cp != 0 && c_p->cp != pc) {
- s->trace[s->depth++] = c_p->cp;
+ s->trace[s->depth++] = c_p->cp - 1;
depth--;
}
s->pc = pc;
@@ -5793,24 +5813,31 @@ save_stacktrace(Process* c_p, BeamInstr* pc, Eterm* reg, BifFunction bf,
}
/* Save the actual stack trace */
+ erts_save_stacktrace(c_p, s, depth);
+}
+
+void
+erts_save_stacktrace(Process* p, struct StackTrace* s, int depth)
+{
if (depth > 0) {
Eterm *ptr;
BeamInstr *prev = s->depth ? s->trace[s->depth-1] : NULL;
BeamInstr i_return_trace = beam_return_trace[0];
BeamInstr i_return_to_trace = beam_return_to_trace[0];
+
/*
* Traverse the stack backwards and add all unique continuation
* pointers to the buffer, up to the maximum stack trace size.
*
* Skip trace stack frames.
*/
- ptr = c_p->stop;
- if (ptr < STACK_START(c_p)
- && (is_not_CP(*ptr)|| (*cp_val(*ptr) != i_return_trace &&
- *cp_val(*ptr) != i_return_to_trace))
- && c_p->cp) {
- /* Can not follow cp here - code may be unloaded */
- BeamInstr *cpp = c_p->cp;
+ ptr = p->stop;
+ if (ptr < STACK_START(p) &&
+ (is_not_CP(*ptr)|| (*cp_val(*ptr) != i_return_trace &&
+ *cp_val(*ptr) != i_return_to_trace)) &&
+ p->cp) {
+ /* Cannot follow cp here - code may be unloaded */
+ BeamInstr *cpp = p->cp;
if (cpp == beam_exception_trace || cpp == beam_return_trace) {
/* Skip return_trace parameters */
ptr += 2;
@@ -5819,7 +5846,7 @@ save_stacktrace(Process* c_p, BeamInstr* pc, Eterm* reg, BifFunction bf,
ptr += 1;
}
}
- while (ptr < STACK_START(c_p) && depth > 0) {
+ while (ptr < STACK_START(p) && depth > 0) {
if (is_CP(*ptr)) {
if (*cp_val(*ptr) == i_return_trace) {
/* Skip stack frame variables */
@@ -5834,7 +5861,7 @@ save_stacktrace(Process* c_p, BeamInstr* pc, Eterm* reg, BifFunction bf,
if (cp != prev) {
/* Record non-duplicates only */
prev = cp;
- s->trace[s->depth++] = cp;
+ s->trace[s->depth++] = cp - 1;
depth--;
}
ptr++;
@@ -5902,9 +5929,14 @@ build_stacktrace(Process* c_p, Eterm exc) {
struct StackTrace* s;
Eterm args;
int depth;
- BeamInstr* current;
- Eterm Where = NIL;
- Eterm *next_p = &Where;
+ FunctionInfo fi;
+ FunctionInfo* stk;
+ FunctionInfo* stkp;
+ Eterm res = NIL;
+ Uint heap_size;
+ Eterm* hp;
+ Eterm mfa;
+ int i;
if (! (s = get_trace_from_exc(exc))) {
return NIL;
@@ -5923,64 +5955,56 @@ build_stacktrace(Process* c_p, Eterm exc) {
* saved s->current should already contain the proper value.
*/
if (s->pc != NULL) {
- current = find_function_from_pc(s->pc);
+ erts_lookup_function_info(&fi, s->pc, 1);
+ } else if (GET_EXC_INDEX(s->freason) ==
+ GET_EXC_INDEX(EXC_FUNCTION_CLAUSE)) {
+ erts_lookup_function_info(&fi, s->current, 1);
} else {
- current = s->current;
+ erts_set_current_function(&fi, s->current);
}
+
/*
- * If current is still NULL, default to the initial function
+ * If fi.current is still NULL, default to the initial function
* (e.g. spawn_link(erlang, abs, [1])).
*/
- if (current == NULL) {
- current = c_p->initial;
+ if (fi.current == NULL) {
+ erts_set_current_function(&fi, c_p->initial);
args = am_true; /* Just in case */
} else {
args = get_args_from_exc(exc);
}
- depth = s->depth;
-
/*
- * Add the {M,F,A} for the current function
- * (where A is arity or [Argument]).
+ * Look up all saved continuation pointers and calculate
+ * needed heap space.
*/
- {
- int i;
- Eterm mfa;
- Uint heap_size = 6*(depth+1);
- Eterm* hp = HAlloc(c_p, heap_size);
- Eterm* hp_end = hp + heap_size;
-
- if (args != am_true) {
- /* We have an arglist - use it */
- mfa = TUPLE3(hp, current[0], current[1], args);
- } else {
- Eterm arity = make_small(current[2]);
- mfa = TUPLE3(hp, current[0], current[1], arity);
+ depth = s->depth;
+ stk = stkp = (FunctionInfo *) erts_alloc(ERTS_ALC_T_TMP,
+ depth*sizeof(FunctionInfo));
+ heap_size = fi.needed + 2;
+ for (i = 0; i < depth; i++) {
+ erts_lookup_function_info(stkp, s->trace[i], 1);
+ if (stkp->current) {
+ heap_size += stkp->needed + 2;
+ stkp++;
}
- hp += 4;
- ASSERT(*next_p == NIL);
- *next_p = CONS(hp, mfa, NIL);
- next_p = &CDR(list_val(*next_p));
- hp += 2;
+ }
- /*
- * Finally, we go through the saved continuation pointers.
- */
- for (i = 0; i < depth; i++) {
- BeamInstr *fi = find_function_from_pc((BeamInstr *) s->trace[i]);
- if (fi == NULL) continue;
- mfa = TUPLE3(hp, fi[0], fi[1], make_small(fi[2]));
- hp += 4;
- ASSERT(*next_p == NIL);
- *next_p = CONS(hp, mfa, NIL);
- next_p = &CDR(list_val(*next_p));
- hp += 2;
- }
- ASSERT(hp <= hp_end);
- HRelease(c_p, hp_end, hp);
+ /*
+ * Allocate heap space and build the stacktrace.
+ */
+ hp = HAlloc(c_p, heap_size);
+ while (stkp > stk) {
+ stkp--;
+ hp = erts_build_mfa_item(stkp, hp, am_true, &mfa);
+ res = CONS(hp, mfa, res);
+ hp += 2;
}
- return Where;
+ hp = erts_build_mfa_item(&fi, hp, args, &mfa);
+ res = CONS(hp, mfa, res);
+
+ erts_free(ERTS_ALC_T_TMP, (void *) stk);
+ return res;
}
diff --git a/erts/emulator/beam/beam_load.c b/erts/emulator/beam/beam_load.c
index eb10ae59a8..fad81e24d6 100644
--- a/erts/emulator/beam/beam_load.c
+++ b/erts/emulator/beam/beam_load.c
@@ -158,6 +158,7 @@ typedef struct {
#define LITERAL_CHUNK 6
#define ATTR_CHUNK 7
#define COMPILE_CHUNK 8
+#define LINE_CHUNK 9
#define NUM_CHUNK_TYPES (sizeof(chunk_types)/sizeof(chunk_types[0]))
@@ -182,6 +183,7 @@ static Uint chunk_types[] = {
MakeIffId('L', 'i', 't', 'T'), /* 6 */
MakeIffId('A', 't', 't', 'r'), /* 7 */
MakeIffId('C', 'I', 'n', 'f'), /* 8 */
+ MakeIffId('L', 'i', 'n', 'e'), /* 9 */
};
/*
@@ -231,6 +233,15 @@ struct string_patch {
};
/*
+ * This structure associates a code offset with a source code location.
+ */
+
+typedef struct {
+ int pos; /* Position in code */
+ Uint32 loc; /* Location in source code */
+} LineInstr;
+
+/*
* This structure contains all information about the module being loaded.
*/
@@ -325,6 +336,19 @@ typedef struct {
Literal* literals; /* Array of literals. */
LiteralPatch* literal_patches; /* Operands that need to be patched. */
Uint total_literal_size; /* Total heap size for all literals. */
+
+ /*
+ * Line table.
+ */
+ BeamInstr* line_item; /* Line items from the BEAM file. */
+ int num_line_items; /* Number of line items. */
+ LineInstr* line_instr; /* Line instructions */
+ int num_line_instrs; /* Maximum number of line instructions */
+ int current_li; /* Current line instruction */
+ int* func_line; /* Mapping from function to first line instr */
+ Eterm* fname; /* List of file names */
+ int num_fnames; /* Number of filenames in fname table */
+ int loc_size; /* Size of location info in bytes (2/4) */
} LoaderState;
typedef struct {
@@ -332,6 +356,27 @@ typedef struct {
Eterm* func_tab[1]; /* Pointers to each function. */
} LoadedCode;
+/*
+ * Layout of the line table.
+ */
+
+#define MI_LINE_FNAME_PTR 0
+#define MI_LINE_LOC_TAB 1
+#define MI_LINE_LOC_SIZE 2
+#define MI_LINE_FUNC_TAB 3
+
+#define LINE_INVALID_LOCATION (0)
+
+/*
+ * Macros for manipulating locations.
+ */
+
+#define IS_VALID_LOCATION(File, Line) \
+ ((unsigned) (File) < 255 && (unsigned) (Line) < ((1 << 24) - 1))
+#define MAKE_LOCATION(File, Line) (((File) << 24) | (Line))
+#define LOC_FILE(Loc) ((Loc) >> 24)
+#define LOC_LINE(Loc) ((Loc) & ((1 << 24)-1))
+
#define GetTagAndValue(Stp, Tag, Val) \
do { \
BeamInstr __w; \
@@ -468,6 +513,7 @@ static int load_import_table(LoaderState* stp);
static int read_export_table(LoaderState* stp);
static int read_lambda_table(LoaderState* stp);
static int read_literal_table(LoaderState* stp);
+static int read_line_table(LoaderState* stp);
static int read_code_header(LoaderState* stp);
static int load_code(LoaderState* stp);
static GenOp* gen_element(LoaderState* stp, GenOpArg Fail, GenOpArg Index,
@@ -506,6 +552,8 @@ static Eterm native_addresses(Process* p, Eterm mod);
int patch_funentries(Eterm Patchlist);
int patch(Eterm Addresses, Uint fe);
static int safe_mul(UWord a, UWord b, UWord* resp);
+static void lookup_loc(FunctionInfo* fi, BeamInstr* pc,
+ BeamInstr* modp, int idx);
static int must_swap_floats;
@@ -679,6 +727,18 @@ bin_load(Process *c_p, ErtsProcLocks c_p_locks,
}
/*
+ * Read the line table (if present).
+ */
+
+ CHKBLK(ERTS_ALC_T_CODE,state.code);
+ if (state.chunks[LINE_CHUNK].size > 0) {
+ define_file(&state, "line table", LINE_CHUNK);
+ if (!read_line_table(&state)) {
+ goto load_error;
+ }
+ }
+
+ /*
* Load the code chunk.
*/
@@ -786,6 +846,22 @@ bin_load(Process *c_p, ErtsProcLocks c_p_locks,
state.genop_blocks = next;
}
+ if (state.line_item != 0) {
+ erts_free(ERTS_ALC_T_LOADER_TMP, state.line_item);
+ }
+
+ if (state.line_instr != 0) {
+ erts_free(ERTS_ALC_T_LOADER_TMP, state.line_instr);
+ }
+
+ if (state.func_line != 0) {
+ erts_free(ERTS_ALC_T_LOADER_TMP, state.func_line);
+ }
+
+ if (state.fname != 0) {
+ erts_free(ERTS_ALC_T_LOADER_TMP, state.fname);
+ }
+
return rval;
}
@@ -816,6 +892,10 @@ init_state(LoaderState* stp)
stp->string_patches = 0;
stp->may_load_nif = 0;
stp->on_load = 0;
+ stp->line_item = 0;
+ stp->line_instr = 0;
+ stp->func_line = 0;
+ stp->fname = 0;
}
static int
@@ -1305,6 +1385,138 @@ read_literal_table(LoaderState* stp)
return 0;
}
+static int
+read_line_table(LoaderState* stp)
+{
+ unsigned version;
+ unsigned flags;
+ int num_line_items;
+ BeamInstr* lp;
+ int i;
+ BeamInstr fname_index;
+ BeamInstr tag;
+
+ /*
+ * If the emulator flag ignoring the line information was given,
+ * return immediately.
+ */
+
+ if (erts_no_line_info) {
+ return 1;
+ }
+
+ /*
+ * Check version of line table.
+ */
+
+ GetInt(stp, 4, version);
+ if (version != 0) {
+ /*
+ * Wrong version. Silently ignore the line number chunk.
+ */
+ return 1;
+ }
+
+ /*
+ * Read the remaining header words. The flag word is reserved
+ * for possible future use; for the moment we ignore it.
+ */
+ GetInt(stp, 4, flags);
+ GetInt(stp, 4, stp->num_line_instrs);
+ GetInt(stp, 4, num_line_items);
+ GetInt(stp, 4, stp->num_fnames);
+
+ /*
+ * Calculate space and allocate memory for the line item table.
+ */
+
+ num_line_items++;
+ lp = (BeamInstr *) erts_alloc(ERTS_ALC_T_LOADER_TMP,
+ num_line_items * sizeof(BeamInstr));
+ stp->line_item = lp;
+ stp->num_line_items = num_line_items;
+
+ /*
+ * The zeroth entry in the line item table is special.
+ * It contains the undefined location.
+ */
+
+ *lp++ = LINE_INVALID_LOCATION;
+ num_line_items--;
+
+ /*
+ * Read all the line items.
+ */
+
+ stp->loc_size = stp->num_fnames ? 4 : 2;
+ fname_index = 0;
+ while (num_line_items-- > 0) {
+ BeamInstr val;
+ BeamInstr loc;
+
+ GetTagAndValue(stp, tag, val);
+ if (tag == TAG_i) {
+ if (IS_VALID_LOCATION(fname_index, val)) {
+ loc = MAKE_LOCATION(fname_index, val);
+ } else {
+ /*
+ * Too many files or huge line number. Silently invalidate
+ * the location.
+ */
+ loc = LINE_INVALID_LOCATION;
+ }
+ *lp++ = loc;
+ if (val > 0xFFFF) {
+ stp->loc_size = 4;
+ }
+ } else if (tag == TAG_a) {
+ if (val > stp->num_fnames) {
+ LoadError2(stp, "file index overflow (%d/%d)",
+ val, stp->num_fnames);
+ }
+ fname_index = val;
+ num_line_items++;
+ } else {
+ LoadError1(stp, "bad tag '%c' (expected 'a' or 'i')",
+ tag_to_letter[tag]);
+ }
+ }
+
+ /*
+ * Read all filenames.
+ */
+
+ if (stp->num_fnames != 0) {
+ stp->fname = (Eterm *) erts_alloc(ERTS_ALC_T_LOADER_TMP,
+ stp->num_fnames *
+ sizeof(Eterm));
+ for (i = 0; i < stp->num_fnames; i++) {
+ byte* fname;
+ Uint n;
+
+ GetInt(stp, 2, n);
+ GetString(stp, fname, n);
+ stp->fname[i] = am_atom_put((char*)fname, n);
+ }
+ }
+
+ /*
+ * Allocate the arrays to be filled while code is being loaded.
+ */
+ stp->line_instr = (LineInstr *) erts_alloc(ERTS_ALC_T_LOADER_TMP,
+ stp->num_line_instrs *
+ sizeof(LineInstr));
+ stp->current_li = 0;
+ stp->func_line = (int *) erts_alloc(ERTS_ALC_T_LOADER_TMP,
+ stp->num_functions *
+ sizeof(int));
+
+ return 1;
+
+ load_error:
+ return 0;
+}
+
static int
read_code_header(LoaderState* stp)
@@ -1414,7 +1626,7 @@ load_code(LoaderState* stp)
{
int i;
int ci;
- int last_func_start = 0;
+ int last_func_start = 0; /* Needed by nif loading and line instructions */
char* sign;
int arg; /* Number of current argument. */
int num_specific; /* Number of specific ops for current. */
@@ -1427,6 +1639,14 @@ load_code(LoaderState* stp)
GenOp** last_op_next = NULL;
int arity;
+ /*
+ * The size of the loaded func_info instruction is needed
+ * by both the nif functionality and line instructions.
+ */
+ enum {
+ FUNC_INFO_SZ = 5
+ };
+
code = stp->code;
code_buffer_size = stp->code_buffer_size;
ci = stp->ci;
@@ -2013,7 +2233,6 @@ load_code(LoaderState* stp)
case op_i_func_info_IaaI:
{
Uint offset;
- enum { FINFO_SZ = 5 };
if (function_number >= stp->num_functions) {
LoadError1(stp, "too many functions in module (header said %d)",
@@ -2021,27 +2240,37 @@ load_code(LoaderState* stp)
}
if (stp->may_load_nif) {
- const int finfo_ix = ci - FINFO_SZ;
+ const int finfo_ix = ci - FUNC_INFO_SZ;
enum { MIN_FUNC_SZ = 3 };
if (finfo_ix - last_func_start < MIN_FUNC_SZ && last_func_start) {
/* Must make room for call_nif op */
int pad = MIN_FUNC_SZ - (finfo_ix - last_func_start);
ASSERT(pad > 0 && pad < MIN_FUNC_SZ);
CodeNeed(pad);
- sys_memmove(&code[finfo_ix+pad], &code[finfo_ix], FINFO_SZ*sizeof(BeamInstr));
+ sys_memmove(&code[finfo_ix+pad], &code[finfo_ix],
+ FUNC_INFO_SZ*sizeof(BeamInstr));
sys_memset(&code[finfo_ix], 0, pad*sizeof(BeamInstr));
ci += pad;
stp->labels[last_label].value += pad;
}
}
last_func_start = ci;
+
+ /*
+ * Save current offset of into the line instruction array.
+ */
+
+ if (stp->func_line) {
+ stp->func_line[function_number] = stp->current_li;
+ }
+
/*
* Save context for error messages.
*/
stp->function = code[ci-2];
stp->arity = code[ci-1];
- ASSERT(stp->labels[last_label].value == ci - FINFO_SZ);
+ ASSERT(stp->labels[last_label].value == ci - FUNC_INFO_SZ);
offset = MI_FUNCTIONS + function_number;
code[offset] = stp->labels[last_label].patches;
stp->labels[last_label].patches = offset;
@@ -2104,6 +2333,45 @@ load_code(LoaderState* stp)
stp->catches = ci-3;
break;
+ case op_line_I:
+ if (stp->line_item) {
+ BeamInstr item = code[ci-1];
+ BeamInstr loc;
+ int li;
+ if (item >= stp->num_line_items) {
+ LoadError2(stp, "line instruction index overflow (%d/%d)",
+ item, stp->num_line_items);
+ }
+ li = stp->current_li;
+ if (li >= stp->num_line_instrs) {
+ LoadError2(stp, "line instruction table overflow (%d/%d)",
+ li, stp->num_line_instrs);
+ }
+ loc = stp->line_item[item];
+
+ if (ci - 2 == last_func_start) {
+ /*
+ * This line instruction directly follows the func_info
+ * instruction. Its address must be adjusted to point to
+ * func_info instruction.
+ */
+ stp->line_instr[li].pos = last_func_start - FUNC_INFO_SZ;
+ stp->line_instr[li].loc = stp->line_item[item];
+ stp->current_li++;
+ } else if (li <= stp->func_line[function_number-1] ||
+ stp->line_instr[li-1].loc != loc) {
+ /*
+ * Only store the location if it is different
+ * from the previous location in the same function.
+ */
+ stp->line_instr[li].pos = ci - 2;
+ stp->line_instr[li].loc = stp->line_item[item];
+ stp->current_li++;
+ }
+ }
+ ci -= 2; /* Get rid of the instruction */
+ break;
+
/*
* End of code found.
*/
@@ -3569,6 +3837,7 @@ freeze_code(LoaderState* stp)
Uint size;
unsigned catches;
Sint decoded_size;
+ Uint line_size;
/*
* Verify that there was a correct 'FunT' chunk if there were
@@ -3579,13 +3848,19 @@ freeze_code(LoaderState* stp)
LoadError0(stp, stp->lambda_error);
}
-
/*
* Calculate the final size of the code.
*/
-
- size = (stp->ci * sizeof(BeamInstr)) + (stp->total_literal_size * sizeof(Eterm)) +
- strtab_size + attr_size + compile_size;
+ if (stp->line_instr == 0) {
+ line_size = 0;
+ } else {
+ line_size = (MI_LINE_FUNC_TAB + (stp->num_functions + 1) +
+ (stp->current_li+1) + stp->num_fnames) *
+ sizeof(Eterm) + (stp->current_li+1) * stp->loc_size;
+ }
+ size = (stp->ci * sizeof(BeamInstr)) +
+ (stp->total_literal_size * sizeof(Eterm)) +
+ strtab_size + attr_size + compile_size + line_size;
/*
* Move the code to its final location.
@@ -3673,15 +3948,66 @@ freeze_code(LoaderState* stp)
}
literal_end += stp->total_literal_size;
}
-
+ CHKBLK(ERTS_ALC_T_CODE,code);
+
/*
- * Place the string table and, optionally, attributes, after the literal heap.
+ * If there is line information, place it here.
*/
- CHKBLK(ERTS_ALC_T_CODE,code);
+ if (stp->line_instr == 0) {
+ code[MI_LINE_TABLE] = (BeamInstr) 0;
+ str_table = (byte *) literal_end;
+ } else {
+ Eterm* line_tab = (Eterm *) literal_end;
+ Eterm* p;
+ int ftab_size = stp->num_functions;
+ int num_instrs = stp->current_li;
+ Eterm* first_line_item;
+
+ code[MI_LINE_TABLE] = (BeamInstr) line_tab;
+ p = line_tab + MI_LINE_FUNC_TAB;
+
+ first_line_item = (p + ftab_size + 1);
+ for (i = 0; i < ftab_size; i++) {
+ *p++ = (Eterm) (BeamInstr) (first_line_item + stp->func_line[i]);
+ }
+ *p++ = (Eterm) (BeamInstr) (first_line_item + num_instrs);
+ ASSERT(p == first_line_item);
+ for (i = 0; i < num_instrs; i++) {
+ *p++ = (Eterm) (BeamInstr) (code + stp->line_instr[i].pos);
+ }
+ *p++ = (Eterm) (BeamInstr) (code + stp->ci - 1);
+
+ line_tab[MI_LINE_FNAME_PTR] = (Eterm) (BeamInstr) p;
+ memcpy(p, stp->fname, stp->num_fnames*sizeof(Eterm));
+ p += stp->num_fnames;
+
+ line_tab[MI_LINE_LOC_TAB] = (Eterm) (BeamInstr) p;
+ line_tab[MI_LINE_LOC_SIZE] = stp->loc_size;
+ if (stp->loc_size == 2) {
+ Uint16* locp = (Uint16 *) p;
+ for (i = 0; i < num_instrs; i++) {
+ *locp++ = (Uint16) stp->line_instr[i].loc;
+ }
+ *locp++ = LINE_INVALID_LOCATION;
+ str_table = (byte *) locp;
+ } else {
+ Uint32* locp = (Uint32 *) p;
+ ASSERT(stp->loc_size == 4);
+ for (i = 0; i < num_instrs; i++) {
+ *locp++ = stp->line_instr[i].loc;
+ }
+ *locp++ = LINE_INVALID_LOCATION;
+ str_table = (byte *) locp;
+ }
+
+ CHKBLK(ERTS_ALC_T_CODE,code);
+ }
- sys_memcpy(literal_end, stp->chunks[STR_CHUNK].start, strtab_size);
+ /*
+ * Place the string table and, optionally, attributes here.
+ */
+ sys_memcpy(str_table, stp->chunks[STR_CHUNK].start, strtab_size);
CHKBLK(ERTS_ALC_T_CODE,code);
- str_table = (byte *) literal_end;
if (attr_size) {
byte* attr = str_table + strtab_size;
sys_memcpy(attr, stp->chunks[ATTR_CHUNK].start, stp->chunks[ATTR_CHUNK].size);
@@ -4809,17 +5135,24 @@ compilation_info_for_module(Process* p, /* Process whose heap to use. */
return result;
}
-
/*
- * Returns a pointer to {module, function, arity}, or NULL if not found.
+ * Find a function from the given pc and fill information in
+ * the FunctionInfo struct. If the full_info is non-zero, fill
+ * in all available information (including location in the
+ * source code). If no function is found, the 'current' field
+ * will be set to NULL.
*/
-BeamInstr *
-find_function_from_pc(BeamInstr* pc)
+
+void
+erts_lookup_function_info(FunctionInfo* fi, BeamInstr* pc, int full_info)
{
Range* low = modules;
Range* high = low + num_loaded_modules;
Range* mid = mid_module;
+ fi->current = NULL;
+ fi->needed = 5;
+ fi->loc = LINE_INVALID_LOCATION;
while (low < high) {
if (pc < mid->start) {
high = mid;
@@ -4836,16 +5169,147 @@ find_function_from_pc(BeamInstr* pc)
high1 = mid1;
} else if (pc < mid1[1]) {
mid_module = mid;
- return mid1[0]+2;
+ fi->current = mid1[0]+2;
+ if (full_info) {
+ BeamInstr** fp = (BeamInstr **) (mid->start +
+ MI_FUNCTIONS);
+ int idx = mid1 - fp;
+ lookup_loc(fi, pc, mid->start, idx);
+ }
+ return;
} else {
low1 = mid1 + 1;
}
}
- return NULL;
+ return;
}
mid = low + (high-low) / 2;
}
- return NULL;
+}
+
+static void
+lookup_loc(FunctionInfo* fi, BeamInstr* orig_pc, BeamInstr* modp, int idx)
+{
+ Eterm* line = (Eterm *) modp[MI_LINE_TABLE];
+ Eterm* low;
+ Eterm* high;
+ Eterm* mid;
+ Eterm pc;
+
+ if (line == 0) {
+ return;
+ }
+
+ pc = (Eterm) (BeamInstr) orig_pc;
+ fi->fname_ptr = (Eterm *) (BeamInstr) line[MI_LINE_FNAME_PTR];
+ low = (Eterm *) (BeamInstr) line[MI_LINE_FUNC_TAB+idx];
+ high = (Eterm *) (BeamInstr) line[MI_LINE_FUNC_TAB+idx+1];
+ while (high > low) {
+ mid = low + (high-low) / 2;
+ if (pc < mid[0]) {
+ high = mid;
+ } else if (pc < mid[1]) {
+ int file;
+ int index = mid - (Eterm *) (BeamInstr) line[MI_LINE_FUNC_TAB];
+
+ if (line[MI_LINE_LOC_SIZE] == 2) {
+ Uint16* loc_table =
+ (Uint16 *) (BeamInstr) line[MI_LINE_LOC_TAB];
+ fi->loc = loc_table[index];
+ } else {
+ Uint32* loc_table =
+ (Uint32 *) (BeamInstr) line[MI_LINE_LOC_TAB];
+ ASSERT(line[MI_LINE_LOC_SIZE] == 4);
+ fi->loc = loc_table[index];
+ }
+ if (fi->loc == LINE_INVALID_LOCATION) {
+ return;
+ }
+ fi->needed += 3+2+3+2;
+ file = LOC_FILE(fi->loc);
+ if (file == 0) {
+ /* Special case: Module name with ".erl" appended */
+ Atom* mod_atom = atom_tab(atom_val(fi->current[0]));
+ fi->needed += 2*(mod_atom->len+4);
+ } else {
+ Atom* ap = atom_tab(atom_val((fi->fname_ptr)[file-1]));
+ fi->needed += 2*ap->len;
+ }
+ return;
+ } else {
+ low = mid + 1;
+ }
+ }
+}
+
+/*
+ * Build a single {M,F,A,Loction} item to be part of
+ * a stack trace.
+ */
+Eterm*
+erts_build_mfa_item(FunctionInfo* fi, Eterm* hp, Eterm args, Eterm* mfa_p)
+{
+ BeamInstr* current = fi->current;
+ Eterm loc = NIL;
+
+ if (fi->loc != LINE_INVALID_LOCATION) {
+ Eterm tuple;
+ int line = LOC_LINE(fi->loc);
+ int file = LOC_FILE(fi->loc);
+ Eterm file_term = NIL;
+
+ if (file == 0) {
+ Atom* ap = atom_tab(atom_val(fi->current[0]));
+ file_term = buf_to_intlist(&hp, ".erl", 4, NIL);
+ file_term = buf_to_intlist(&hp, (char*)ap->name, ap->len, file_term);
+ } else {
+ Atom* ap = atom_tab(atom_val((fi->fname_ptr)[file-1]));
+ file_term = buf_to_intlist(&hp, (char*)ap->name, ap->len, NIL);
+ }
+
+ tuple = TUPLE2(hp, am_line, make_small(line));
+ hp += 3;
+ loc = CONS(hp, tuple, loc);
+ hp += 2;
+ tuple = TUPLE2(hp, am_file, file_term);
+ hp += 3;
+ loc = CONS(hp, tuple, loc);
+ hp += 2;
+ }
+
+ if (is_list(args) || is_nil(args)) {
+ *mfa_p = TUPLE4(hp, current[0], current[1], args, loc);
+ } else {
+ Eterm arity = make_small(current[2]);
+ *mfa_p = TUPLE4(hp, current[0], current[1], arity, loc);
+ }
+ return hp + 5;
+}
+
+/*
+ * Force setting of the current function in a FunctionInfo
+ * structure. No source code location will be associated with
+ * the function.
+ */
+void
+erts_set_current_function(FunctionInfo* fi, BeamInstr* current)
+{
+ fi->current = current;
+ fi->needed = 5;
+ fi->loc = LINE_INVALID_LOCATION;
+}
+
+
+/*
+ * Returns a pointer to {module, function, arity}, or NULL if not found.
+ */
+BeamInstr*
+find_function_from_pc(BeamInstr* pc)
+{
+ FunctionInfo fi;
+
+ erts_lookup_function_info(&fi, pc, 0);
+ return fi.current;
}
/*
diff --git a/erts/emulator/beam/beam_load.h b/erts/emulator/beam/beam_load.h
index 26e3054c4b..9d4a60fed1 100644
--- a/erts/emulator/beam/beam_load.h
+++ b/erts/emulator/beam/beam_load.h
@@ -108,6 +108,11 @@ extern Uint erts_total_code_size;
#define MI_ON_LOAD_FUNCTION_PTR 10
/*
+ * Pointer to the line table (or NULL if none).
+ */
+#define MI_LINE_TABLE 11
+
+/*
* Start of function pointer table. This table contains pointers to
* all functions in the module plus an additional pointer just beyond
* the end of the last function.
@@ -116,5 +121,5 @@ extern Uint erts_total_code_size;
* this table.
*/
-#define MI_FUNCTIONS 11
+#define MI_FUNCTIONS 12
#endif /* _BEAM_LOAD_H */
diff --git a/erts/emulator/beam/bif.c b/erts/emulator/beam/bif.c
index 98dde066fc..5b3261077b 100644
--- a/erts/emulator/beam/bif.c
+++ b/erts/emulator/beam/bif.c
@@ -1189,8 +1189,9 @@ raise_3(Process *c_p, Eterm class, Eterm value, Eterm stacktrace) {
Eterm l, *hp, *hp_end, *tp;
int depth, cnt;
size_t sz;
+ int must_copy = 0;
struct StackTrace *s;
-
+
if (class == am_error) {
c_p->fvalue = value;
reason = EXC_ERROR;
@@ -1206,35 +1207,74 @@ raise_3(Process *c_p, Eterm class, Eterm value, Eterm stacktrace) {
/* Check syntax of stacktrace, and count depth.
* Accept anything that can be returned from erlang:get_stacktrace/0,
* as well as a 2-tuple with a fun as first element that the
- * error_handler may need to give us.
+ * error_handler may need to give us. Also allow old-style
+ * MFA three-tuples.
*/
for (l = stacktrace, depth = 0;
is_list(l);
l = CDR(list_val(l)), depth++) {
Eterm t = CAR(list_val(l));
- int arity;
+ Eterm location = NIL;
+
if (is_not_tuple(t)) goto error;
tp = tuple_val(t);
- arity = arityval(tp[0]);
- if ((arity == 3) && is_atom(tp[1]) && is_atom(tp[2])) continue;
- if ((arity == 2) && is_fun(tp[1])) continue;
- goto error;
+ switch (arityval(tp[0])) {
+ case 2:
+ /* {Fun,Args} */
+ if (is_fun(tp[1])) {
+ must_copy = 1;
+ } else {
+ goto error;
+ }
+ break;
+ case 3:
+ /*
+ * One of:
+ * {Fun,Args,Location}
+ * {M,F,A}
+ */
+ if (is_fun(tp[1])) {
+ location = tp[3];
+ } else if (is_atom(tp[1]) && is_atom(tp[2])) {
+ must_copy = 1;
+ } else {
+ goto error;
+ }
+ break;
+ case 4:
+ if (!(is_atom(tp[1]) && is_atom(tp[2]))) {
+ goto error;
+ }
+ location = tp[4];
+ break;
+ default:
+ goto error;
+ }
+ if (is_not_list(location) && is_not_nil(location)) {
+ goto error;
+ }
}
if (is_not_nil(l)) goto error;
/* Create stacktrace and store */
- if (depth <= erts_backtrace_depth) {
+ if (erts_backtrace_depth < depth) {
+ depth = erts_backtrace_depth;
+ must_copy = 1;
+ }
+ if (must_copy) {
+ cnt = depth;
+ c_p->ftrace = NIL;
+ } else {
+ /* No need to copy the stacktrace */
cnt = 0;
c_p->ftrace = stacktrace;
- } else {
- cnt = depth = erts_backtrace_depth;
- c_p->ftrace = NIL;
}
+
tp = &c_p->ftrace;
sz = (offsetof(struct StackTrace, trace) + sizeof(Eterm) - 1)
/ sizeof(Eterm);
- hp = HAlloc(c_p, sz + 2*(cnt + 1));
- hp_end = hp + sz + 2*(cnt + 1);
+ hp = HAlloc(c_p, sz + (2+6)*(cnt + 1));
+ hp_end = hp + sz + (2+6)*(cnt + 1);
s = (struct StackTrace *) hp;
s->header = make_neg_bignum_header(sz - 1);
s->freason = reason;
@@ -1242,13 +1282,29 @@ raise_3(Process *c_p, Eterm class, Eterm value, Eterm stacktrace) {
s->current = NULL;
s->depth = 0;
hp += sz;
- if (cnt > 0) {
+ if (must_copy) {
+ int cnt;
+
/* Copy list up to depth */
for (cnt = 0, l = stacktrace;
cnt < depth;
cnt++, l = CDR(list_val(l))) {
+ Eterm t;
+ Eterm *tpp;
+ int arity;
+
ASSERT(*tp == NIL);
- *tp = CONS(hp, CAR(list_val(l)), *tp);
+ t = CAR(list_val(l));
+ tpp = tuple_val(t);
+ arity = arityval(tpp[0]);
+ if (arity == 2) {
+ t = TUPLE3(hp, tpp[1], tpp[2], NIL);
+ hp += 4;
+ } else if (arity == 3 && is_atom(tpp[1])) {
+ t = TUPLE4(hp, tpp[1], tpp[2], tpp[3], NIL);
+ hp += 5;
+ }
+ *tp = CONS(hp, t, *tp);
tp = &CDR(list_val(*tp));
hp += 2;
}
@@ -1256,7 +1312,7 @@ raise_3(Process *c_p, Eterm class, Eterm value, Eterm stacktrace) {
c_p->ftrace = CONS(hp, c_p->ftrace, make_big((Eterm *) s));
hp += 2;
ASSERT(hp <= hp_end);
-
+ HRelease(c_p, hp_end, hp);
BIF_ERROR(c_p, reason);
error:
diff --git a/erts/emulator/beam/bif.tab b/erts/emulator/beam/bif.tab
index d9dd80fa8b..b171e99e03 100644
--- a/erts/emulator/beam/bif.tab
+++ b/erts/emulator/beam/bif.tab
@@ -802,6 +802,12 @@ bif prim_file:internal_name2native/1
bif prim_file:internal_native2name/1
bif prim_file:internal_normalize_utf8/1
bif file:native_name_encoding/0
+
+#
+# New in R14B04.
+#
+bif erlang:check_old_code/1
+
#
# Obsolete
#
diff --git a/erts/emulator/beam/erl_bif_info.c b/erts/emulator/beam/erl_bif_info.c
index 6a74596f76..e17325b64f 100644
--- a/erts/emulator/beam/erl_bif_info.c
+++ b/erts/emulator/beam/erl_bif_info.c
@@ -120,6 +120,10 @@ static char erts_system_version[] = ("Erlang " ERLANG_OTP_RELEASE
#endif
static Eterm
+current_function(Process* p, Process* rp, Eterm** hpp, int full_info);
+static Eterm current_stacktrace(Process* p, Process* rp, Eterm** hpp);
+
+static Eterm
bld_bin_list(Uint **hpp, Uint *szp, ErlOffHeap* oh)
{
struct erl_off_heap_header* ohh;
@@ -554,6 +558,8 @@ static Eterm pi_args[] = {
am_suspending,
am_min_heap_size,
am_min_bin_vheap_size,
+ am_current_location,
+ am_current_stacktrace,
#ifdef HYBRID
am_message_binary
#endif
@@ -602,8 +608,10 @@ pi_arg2ix(Eterm arg)
case am_suspending: return 26;
case am_min_heap_size: return 27;
case am_min_bin_vheap_size: return 28;
+ case am_current_location: return 29;
+ case am_current_stacktrace: return 30;
#ifdef HYBRID
- case am_message_binary: return 29;
+ case am_message_binary: return 31;
#endif
default: return -1;
}
@@ -1006,35 +1014,15 @@ process_info_aux(Process *BIF_P,
break;
case am_current_function:
- if (rp->current == NULL) {
- rp->current = find_function_from_pc(rp->i);
- }
- if (rp->current == NULL) {
- hp = HAlloc(BIF_P, 3);
- res = am_undefined;
- } else {
- BeamInstr* current;
-
- if (rp->current[0] == am_erlang &&
- rp->current[1] == am_process_info &&
- (rp->current[2] == 1 || rp->current[2] == 2) &&
- (current = find_function_from_pc(rp->cp)) != NULL) {
-
- /*
- * The current function is erlang:process_info/2,
- * which is not the answer that the application want.
- * We will use the function pointed into by rp->cp
- * instead.
- */
+ res = current_function(BIF_P, rp, &hp, 0);
+ break;
- rp->current = current;
- }
+ case am_current_location:
+ res = current_function(BIF_P, rp, &hp, 1);
+ break;
- hp = HAlloc(BIF_P, 3+4);
- res = TUPLE3(hp, rp->current[0],
- rp->current[1], make_small(rp->current[2]));
- hp += 4;
- }
+ case am_current_stacktrace:
+ res = current_stacktrace(BIF_P, rp, &hp);
break;
case am_initial_call:
@@ -1608,6 +1596,113 @@ process_info_aux(Process *BIF_P,
}
#undef MI_INC
+static Eterm
+current_function(Process* BIF_P, Process* rp, Eterm** hpp, int full_info)
+{
+ Eterm* hp;
+ Eterm res;
+ FunctionInfo fi;
+
+ if (rp->current == NULL) {
+ erts_lookup_function_info(&fi, rp->i, full_info);
+ rp->current = fi.current;
+ } else if (full_info) {
+ erts_lookup_function_info(&fi, rp->i, full_info);
+ if (fi.current == NULL) {
+ /* Use the current function without location info */
+ erts_set_current_function(&fi, rp->current);
+ }
+ }
+
+ if (BIF_P->id == rp->id) {
+ FunctionInfo fi2;
+
+ /*
+ * The current function is erlang:process_info/{1,2},
+ * which is not the answer that the application want.
+ * We will use the function pointed into by rp->cp
+ * instead if it can be looked up.
+ */
+ erts_lookup_function_info(&fi2, rp->cp, full_info);
+ if (fi2.current) {
+ fi = fi2;
+ rp->current = fi2.current;
+ }
+ }
+
+ /*
+ * Return the result.
+ */
+ if (rp->current == NULL) {
+ hp = HAlloc(BIF_P, 3);
+ res = am_undefined;
+ } else if (full_info) {
+ hp = HAlloc(BIF_P, 3+fi.needed);
+ hp = erts_build_mfa_item(&fi, hp, am_true, &res);
+ } else {
+ hp = HAlloc(BIF_P, 3+4);
+ res = TUPLE3(hp, rp->current[0],
+ rp->current[1], make_small(rp->current[2]));
+ hp += 4;
+ }
+ *hpp = hp;
+ return res;
+}
+
+static Eterm
+current_stacktrace(Process* p, Process* rp, Eterm** hpp)
+{
+ Uint sz;
+ struct StackTrace* s;
+ int depth;
+ FunctionInfo* stk;
+ FunctionInfo* stkp;
+ Uint heap_size;
+ int i;
+ Eterm* hp = *hpp;
+ Eterm mfa;
+ Eterm res = NIL;
+
+ depth = 8;
+ sz = offsetof(struct StackTrace, trace) + sizeof(BeamInstr *)*depth;
+ s = (struct StackTrace *) erts_alloc(ERTS_ALC_T_TMP, sz);
+ s->depth = 0;
+ if (rp->i) {
+ s->trace[s->depth++] = rp->i;
+ depth--;
+ }
+ if (depth > 0 && rp->cp != 0) {
+ s->trace[s->depth++] = rp->cp - 1;
+ depth--;
+ }
+ erts_save_stacktrace(rp, s, depth);
+
+ depth = s->depth;
+ stk = stkp = (FunctionInfo *) erts_alloc(ERTS_ALC_T_TMP,
+ depth*sizeof(FunctionInfo));
+ heap_size = 3;
+ for (i = 0; i < depth; i++) {
+ erts_lookup_function_info(stkp, s->trace[i], 1);
+ if (stkp->current) {
+ heap_size += stkp->needed + 2;
+ stkp++;
+ }
+ }
+
+ hp = HAlloc(p, heap_size);
+ while (stkp > stk) {
+ stkp--;
+ hp = erts_build_mfa_item(stkp, hp, am_true, &mfa);
+ res = CONS(hp, mfa, res);
+ hp += 2;
+ }
+
+ erts_free(ERTS_ALC_T_TMP, stk);
+ erts_free(ERTS_ALC_T_TMP, s);
+ *hpp = hp;
+ return res;
+}
+
#if defined(VALGRIND)
static int check_if_xml(void)
{
diff --git a/erts/emulator/beam/erl_gc.c b/erts/emulator/beam/erl_gc.c
index 5edcd667e7..e3445bcdc5 100644
--- a/erts/emulator/beam/erl_gc.c
+++ b/erts/emulator/beam/erl_gc.c
@@ -100,14 +100,14 @@ static Uint combined_message_size(Process* p);
static void remove_message_buffers(Process* p);
static int major_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl);
static int minor_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl);
-static void do_minor(Process *p, int new_sz, Eterm* objv, int nobj);
+static void do_minor(Process *p, Uint new_sz, Eterm* objv, int nobj);
static Eterm* sweep_rootset(Rootset *rootset, Eterm* htop, char* src, Uint src_size);
static Eterm* sweep_one_area(Eterm* n_hp, Eterm* n_htop, char* src, Uint src_size);
static Eterm* sweep_one_heap(Eterm* heap_ptr, Eterm* heap_end, Eterm* htop,
char* src, Uint src_size);
static Eterm* collect_heap_frags(Process* p, Eterm* heap,
Eterm* htop, Eterm* objv, int nobj);
-static Uint adjust_after_fullsweep(Process *p, int size_before,
+static Uint adjust_after_fullsweep(Process *p, Uint size_before,
int need, Eterm *objv, int nobj);
static void shrink_new_heap(Process *p, Uint new_sz, Eterm *objv, int nobj);
static void grow_new_heap(Process *p, Uint new_sz, Eterm* objv, int nobj);
@@ -441,7 +441,15 @@ erts_garbage_collect(Process* p, int need, Eterm* objv, int nobj)
p->last_old_htop = p->old_htop;
#endif
- return ((int) (HEAP_TOP(p) - HEAP_START(p)) / 10);
+ /* FIXME: This function should really return an Sint, i.e., a possibly
+ 64 bit wide signed integer, but that requires updating all the code
+ that calls it. For now, we just return INT_MAX if the result is too
+ large for an int. */
+ {
+ Sint result = (HEAP_TOP(p) - HEAP_START(p)) / 10;
+ if (result >= INT_MAX) return INT_MAX;
+ else return (int) result;
+ }
}
/*
@@ -599,7 +607,7 @@ erts_garbage_collect_literals(Process* p, Eterm* literals, Uint lit_size)
char* area;
Uint area_size;
Eterm* old_htop;
- int n;
+ Uint n;
/*
* Set GC state.
@@ -731,7 +739,7 @@ minor_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
* This improved Estone by more than 1200 estones on my computer
* (Ultra Sparc 10).
*/
- size_t new_sz = erts_next_heap_size(HEAP_TOP(p) - HEAP_START(p), 1);
+ Uint new_sz = erts_next_heap_size(HEAP_TOP(p) - HEAP_START(p), 1);
/* Create new, empty old_heap */
n_old = (Eterm *) ERTS_HEAP_ALLOC(ERTS_ALC_T_OLD_HEAP,
@@ -871,12 +879,12 @@ minor_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
#endif /* HIPE */
static void
-do_minor(Process *p, int new_sz, Eterm* objv, int nobj)
+do_minor(Process *p, Uint new_sz, Eterm* objv, int nobj)
{
Rootset rootset; /* Rootset for GC (stack, dictionary, etc). */
Roots* roots;
Eterm* n_htop;
- int n;
+ Uint n;
Eterm* ptr;
Eterm val;
Eterm gval;
@@ -1079,14 +1087,14 @@ major_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
{
Rootset rootset;
Roots* roots;
- int size_before;
+ Uint size_before;
Eterm* n_heap;
Eterm* n_htop;
char* src = (char *) HEAP_START(p);
Uint src_size = (char *) HEAP_TOP(p) - src;
char* oh = (char *) OLD_HEAP(p);
Uint oh_size = (char *) OLD_HTOP(p) - oh;
- int n;
+ Uint n;
Uint new_sz;
Uint fragments = MBUF_SIZE(p) + combined_message_size(p);
ErlMessage *msgp;
@@ -1312,10 +1320,10 @@ major_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
}
static Uint
-adjust_after_fullsweep(Process *p, int size_before, int need, Eterm *objv, int nobj)
+adjust_after_fullsweep(Process *p, Uint size_before, int need, Eterm *objv, int nobj)
{
- int wanted, sz, size_after, need_after;
- int stack_size = STACK_SZ_ON_HEAP(p);
+ Uint wanted, sz, size_after, need_after;
+ Uint stack_size = STACK_SZ_ON_HEAP(p);
Uint reclaimed_now;
size_after = (HEAP_TOP(p) - HEAP_START(p));
@@ -1915,8 +1923,8 @@ static void
grow_new_heap(Process *p, Uint new_sz, Eterm* objv, int nobj)
{
Eterm* new_heap;
- int heap_size = HEAP_TOP(p) - HEAP_START(p);
- int stack_size = p->hend - p->stop;
+ Uint heap_size = HEAP_TOP(p) - HEAP_START(p);
+ Uint stack_size = p->hend - p->stop;
Sint offs;
ASSERT(HEAP_SIZE(p) < new_sz);
@@ -1954,10 +1962,10 @@ static void
shrink_new_heap(Process *p, Uint new_sz, Eterm *objv, int nobj)
{
Eterm* new_heap;
- int heap_size = HEAP_TOP(p) - HEAP_START(p);
+ Uint heap_size = HEAP_TOP(p) - HEAP_START(p);
Sint offs;
- int stack_size = p->hend - p->stop;
+ Uint stack_size = p->hend - p->stop;
ASSERT(new_sz < p->heap_sz);
sys_memmove(p->heap + new_sz - stack_size, p->stop, stack_size *
diff --git a/erts/emulator/beam/erl_init.c b/erts/emulator/beam/erl_init.c
index 5f3f653e99..286fe9ff1e 100644
--- a/erts/emulator/beam/erl_init.c
+++ b/erts/emulator/beam/erl_init.c
@@ -127,6 +127,8 @@ int erts_modified_timing_level;
int erts_no_crash_dump = 0; /* Use -d to suppress crash dump. */
+int erts_no_line_info = 0; /* -L: Don't load line information */
+
/*
* Other global variables.
*/
@@ -936,7 +938,9 @@ erl_start(int argc, char **argv)
case 'l':
display_loads++;
break;
-
+ case 'L':
+ erts_no_line_info = 1;
+ break;
case 'v':
#ifdef DEBUG
if (argv[i][2] == '\0') {
diff --git a/erts/emulator/beam/global.h b/erts/emulator/beam/global.h
index 249df54015..a967aa0e3e 100644
--- a/erts/emulator/beam/global.h
+++ b/erts/emulator/beam/global.h
@@ -37,6 +37,7 @@
#include "erl_process.h"
#include "erl_sys_driver.h"
#include "erl_debug.h"
+#include "error.h"
typedef struct port Port;
#include "erl_port_task.h"
@@ -859,10 +860,21 @@ void erts_system_monitor_clear(Process *c_p);
void erts_system_profile_clear(Process *c_p);
/* beam_load.c */
+typedef struct {
+ BeamInstr* current; /* Pointer to: Mod, Name, Arity */
+ Uint needed; /* Heap space needed for entire tuple */
+ Uint32 loc; /* Location in source code */
+ Eterm* fname_ptr; /* Pointer to fname table */
+} FunctionInfo;
+
int erts_load_module(Process *c_p, ErtsProcLocks c_p_locks,
Eterm group_leader, Eterm* mod, byte* code, int size);
void init_load(void);
BeamInstr* find_function_from_pc(BeamInstr* pc);
+Eterm* erts_build_mfa_item(FunctionInfo* fi, Eterm* hp,
+ Eterm args, Eterm* mfa_p);
+void erts_lookup_function_info(FunctionInfo* fi, BeamInstr* pc, int full_info);
+void erts_set_current_function(FunctionInfo* fi, BeamInstr* current);
Eterm erts_module_info_0(Process* p, Eterm module);
Eterm erts_module_info_1(Process* p, Eterm module, Eterm what);
Eterm erts_make_stub_module(Process* p, Eterm Mod, Eterm Beam, Eterm Info);
@@ -1053,6 +1065,7 @@ void init_emulator(void);
void process_main(void);
Eterm build_stacktrace(Process* c_p, Eterm exc);
Eterm expand_error_value(Process* c_p, Uint freason, Eterm Value);
+void erts_save_stacktrace(Process* p, struct StackTrace* s, int depth);
/* erl_init.c */
@@ -1074,6 +1087,7 @@ extern ErtsModifiedTimings erts_modified_timings[];
#define ERTS_MODIFIED_TIMING_INPUT_REDS \
(erts_modified_timings[erts_modified_timing_level].input_reds)
+extern int erts_no_line_info;
extern Eterm erts_error_logger_warnings;
extern int erts_initialized;
extern int erts_compat_rel;
diff --git a/erts/emulator/beam/ops.tab b/erts/emulator/beam/ops.tab
index 304ce22ef2..538f0b94af 100644
--- a/erts/emulator/beam/ops.tab
+++ b/erts/emulator/beam/ops.tab
@@ -94,6 +94,39 @@ i_global_copy
return
+#
+# To ensure that a "move Src x(0)" instruction can be combined
+# with the following call instruction, we need to make sure that
+# there is no line/1 instruction between the move and the call.
+#
+
+move S r | line Loc | call_ext Ar Func => \
+ line Loc | move S r | call_ext Ar Func
+move S r | line Loc | call_ext_last Ar Func=u$is_bif D => \
+ line Loc | move S r | call_ext_last Ar Func D
+move S r | line Loc | call_ext_only Ar Func=u$is_bif => \
+ line Loc | move S r | call_ext_only Ar Func
+move S r | line Loc | call Ar Func => \
+ line Loc | move S r | call Ar Func
+
+#
+# A tail-recursive call to an external function (non-BIF) will
+# never be saved on the stack, so there is no reason to keep
+# the line instruction. (The compiler did not remove the line
+# instruction because it cannot tell the difference between
+# BIFs and ordinary Erlang functions.)
+#
+
+line Loc | call_ext_last Ar Func=u$is_not_bif D => \
+ call_ext_last Ar Func D
+line Loc | call_ext_only Ar Func=u$is_not_bif => \
+ call_ext_only Ar Func
+
+line Loc | func_info M F A => func_info M F A | line Loc
+
+line I
+
+
%macro: allocate Allocate -pack
%macro: allocate_zero AllocateZero -pack
%macro: allocate_heap AllocateHeap -pack
diff --git a/erts/emulator/drivers/common/inet_drv.c b/erts/emulator/drivers/common/inet_drv.c
index 40c4a0df08..ebc4469a23 100644
--- a/erts/emulator/drivers/common/inet_drv.c
+++ b/erts/emulator/drivers/common/inet_drv.c
@@ -3709,6 +3709,8 @@ static int inet_ctl_fdopen(inet_descriptor* desc, int domain, int type,
/* check that it is a socket and that the socket is bound */
if (IS_SOCKET_ERROR(sock_name(s, (struct sockaddr*) &name, &sz)))
return ctl_error(sock_errno(), rbuf, rsize);
+ if (name.sa.sa_family != domain)
+ return ctl_error(EINVAL, rbuf, rsize);
desc->s = s;
if ((desc->event = sock_create_event(desc)) == INVALID_EVENT)
return ctl_error(sock_errno(), rbuf, rsize);
@@ -9739,7 +9741,7 @@ static int packet_inet_ctl(ErlDrvData e, unsigned int cmd, char* buf, int len,
if (desc->active || (len != 8))
return ctl_error(EINVAL, rbuf, rsize);
timeout = get_int32(buf);
- /* The 2nd arg, Length(4), is ignored for both UDP ans SCTP protocols,
+ /* The 2nd arg, Length(4), is ignored for both UDP and SCTP protocols,
since they are msg-oriented. */
if (enq_async(desc, tbuf, PACKET_REQ_RECV) < 0)
diff --git a/erts/emulator/hipe/hipe_mode_switch.c b/erts/emulator/hipe/hipe_mode_switch.c
index 16f8fb1347..0b35dbdf04 100644
--- a/erts/emulator/hipe/hipe_mode_switch.c
+++ b/erts/emulator/hipe/hipe_mode_switch.c
@@ -346,7 +346,12 @@ Process *hipe_mode_switch(Process *p, unsigned cmd, Eterm reg[])
p->arity = callee_arity;
}
- /* If process is in P_WAITING state, we schedule the next process */
+ /* Schedule next process if current process was hibernated or is waiting
+ for messages */
+ if (p->flags & F_HIBERNATE_SCHED) {
+ p->flags &= ~F_HIBERNATE_SCHED;
+ goto do_schedule;
+ }
if (p->status == P_WAITING) {
goto do_schedule;
}
@@ -643,7 +648,7 @@ Eterm hipe_build_stacktrace(Process *p, struct StackTrace *s)
if (depth < 1)
return NIL;
- heap_size = 6 * depth; /* each [{M,F,A}|_] is 2+4 == 6 words */
+ heap_size = 7 * depth; /* each [{M,F,A,[]}|_] is 2+5 == 7 words */
hp = HAlloc(p, heap_size);
hp_end = hp + heap_size;
@@ -654,8 +659,8 @@ Eterm hipe_build_stacktrace(Process *p, struct StackTrace *s)
ra = (const void*)s->trace[i];
if (!hipe_find_mfa_from_ra(ra, &m, &f, &a))
continue;
- mfa = TUPLE3(hp, m, f, make_small(a));
- hp += 4;
+ mfa = TUPLE4(hp, m, f, make_small(a), NIL);
+ hp += 5;
next = CONS(hp, mfa, NIL);
*next_p = next;
next_p = &CDR(list_val(next));
diff --git a/erts/emulator/pcre/Makefile b/erts/emulator/pcre/Makefile
deleted file mode 100644
index 72eea01130..0000000000
--- a/erts/emulator/pcre/Makefile
+++ /dev/null
@@ -1,26 +0,0 @@
-#
-# %CopyrightBegin%
-#
-# Copyright Ericsson AB 2008-2009. All Rights Reserved.
-#
-# The contents of this file are subject to the Erlang Public License,
-# Version 1.1, (the "License"); you may not use this file except in
-# compliance with the License. You should have received a copy of the
-# Erlang Public License along with this software. If not, it can be
-# retrieved online at http://www.erlang.org/.
-#
-# Software distributed under the License is distributed on an "AS IS"
-# basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-# the License for the specific language governing rights and limitations
-# under the License.
-#
-# %CopyrightEnd%
-#
-#
-# Invoke with GNU make or clearmake -C gnu.
-#
-
-include $(ERL_TOP)/make/run_make.mk
-
-table:
- $(MAKE) -f $(TARGET)/Makefile $@ \ No newline at end of file
diff --git a/erts/emulator/pcre/Makefile.in b/erts/emulator/pcre/Makefile.in
deleted file mode 100644
index f62700ec4e..0000000000
--- a/erts/emulator/pcre/Makefile.in
+++ /dev/null
@@ -1,165 +0,0 @@
-# Makefile for zlib
-# Copyright (C) 1995-1996 Jean-loup Gailly.
-# For conditions of distribution and use, see copyright notice in zlib.h
-
-# To compile and test, type:
-# ./configure; make test
-# The call of configure is optional if you don't have special requirements
-
-# To install /usr/local/lib/libz.* and /usr/local/include/zlib.h, type:
-# make install
-# To install in $HOME instead of /usr/local, use:
-# make install prefix=$HOME
-
-# %ExternalCopyright%
-
-ARFLAGS = rc
-
-O = \
-pcre_latin_1_table.o \
-pcre_compile.o \
-pcre_config.o \
-pcre_dfa_exec.o \
-pcre_exec.o \
-pcre_fullinfo.o \
-pcre_get.o \
-pcre_globals.o \
-pcre_info.o \
-pcre_maketables.o \
-pcre_newline.o \
-pcre_ord2utf8.o \
-pcre_refcount.o \
-pcre_study.o \
-pcre_tables.o \
-pcre_try_flipped.o \
-pcre_ucp_searchfuncs.o \
-pcre_valid_utf8.o \
-pcre_version.o \
-pcre_xclass.o
-
-OBJS = $(O:%=$(OBJDIR)/%)
-
-GENINC = pcre_exec_loop_break_cases.inc
-
-#### Begin OTP targets
-
-include $(ERL_TOP)/make/target.mk
-
-# On windows we need a separate zlib during debug build
-ifeq ($(TARGET),win32)
-
-ifeq ($(TYPE),debug)
-CFLAGS = $(subst -O2, -g, @CFLAGS@ @DEFS@ @DEBUG_FLAGS@ @EMU_THR_DEFS@ -DERLANG_INTEGRATION)
-else # debug
-CFLAGS = @CFLAGS@ @DEFS@ @EMU_THR_DEFS@ -DERLANG_INTEGRATION
-endif # debug
-
-else # win32
-
-ifeq ($(TYPE),debug)
-TYPE_FLAGS = @DEBUG_CFLAGS@
-else # debug
-ifeq ($(TYPE),gcov)
-TYPE_FLAGS = -O0 -fprofile-arcs -ftest-coverage
-else # gcov
-TYPE_FLAGS = -O3
-endif # gcov
-endif # debug
-
-CFLAGS = $(TYPE_FLAGS) $(subst -O2,, @CFLAGS@) @DEFS@ @EMU_THR_DEFS@ -DERLANG_INTEGRATION
-
-endif # win32
-
-OBJDIR = $(ERL_TOP)/erts/emulator/pcre/obj/$(TARGET)/$(TYPE)
-
-include $(ERL_TOP)/make/$(TARGET)/otp.mk
-
-ifeq ($(TARGET), win32)
-LIBRARY=$(OBJDIR)/epcre.lib
-else
-LIBRARY=$(OBJDIR)/libepcre.a
-endif
-
-all: $(LIBRARY)
-
-# ----------------------------------------------------
-# Release Target
-# ----------------------------------------------------
-include $(ERL_TOP)/make/otp_release_targets.mk
-
-release_spec: opt
-
-tests release_tests:
-
-docs release_docs release_docs_spec:
-
-clean:
- rm -f $(OBJS) $(OBJDIR)/libepcre.a
-
-#### end OTP targets
-
-ifeq ($(TARGET), win32)
-$(LIBRARY): $(OBJS)
- $(AR) -out:$@ $(OBJS)
-else
-$(LIBRARY): $(OBJS)
- $(AR) $(ARFLAGS) $@ $(OBJS)
- -@ ($(RANLIB) $@ || true) 2>/dev/null
-endif
-
-$(OBJDIR)/%.o: %.c
- $(CC) -c $(CFLAGS) -o $@ $<
-
-$(GENINC): pcre_exec.c
- for x in `grep -n COST_CHK pcre_exec.c | grep -v 'COST_CHK(N)' | awk -F: '{print $$1}'`; \
- do \
- N=`expr $$x + 100`; \
- echo "case $$N: goto L_LOOP_COUNT_$${x};"; \
- done > $(GENINC)
-
-table: ./gen_table
- ./gen_table pcre_latin_1_table.c
-
-./gen_table: pcre_make_latin1_default.c make_latin1_table.c
- $(CC) $(CFLAGS) -o gen_table pcre_make_latin1_default.c make_latin1_table.c
-
-# DO NOT DELETE THIS LINE -- make depend depends on it.
-
-$(OBJDIR)/pcre_chartables.o: pcre_chartables.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_compile.o: pcre_compile.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_config.o: pcre_config.c pcre_internal.h local_config.h pcre.h \
- ucp.h
-$(OBJDIR)/pcre_dfa_exec.o: pcre_dfa_exec.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_exec.o: pcre_exec.c pcre_internal.h local_config.h pcre.h ucp.h \
- $(GENINC)
-$(OBJDIR)/pcre_fullinfo.o: pcre_fullinfo.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_get.o: pcre_get.c pcre_internal.h local_config.h pcre.h ucp.h
-$(OBJDIR)/pcre_globals.o: pcre_globals.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_info.o: pcre_info.c pcre_internal.h local_config.h pcre.h ucp.h
-$(OBJDIR)/pcre_maketables.o: pcre_maketables.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_newline.o: pcre_newline.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_ord2utf8.o: pcre_ord2utf8.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_refcount.o: pcre_refcount.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-$(OBJDIR)/pcre_study.o: pcre_study.c pcre_internal.h local_config.h pcre.h \
- ucp.h
-$(OBJDIR)/pcre_tables.o: pcre_tables.c pcre_internal.h local_config.h pcre.h \
- ucp.h
-$(OBJDIR)/pcre_try_flipped.o: pcre_try_flipped.c pcre_internal.h \
- local_config.h pcre.h ucp.h
-$(OBJDIR)/pcre_ucp_searchfuncs.o: pcre_ucp_searchfuncs.c pcre_internal.h \
- local_config.h pcre.h ucp.h ucpinternal.h ucptable.h
-$(OBJDIR)/pcre_valid_utf8.o: pcre_valid_utf8.c pcre_internal.h local_config.h \
- pcre.h ucp.h
-pcre_version.o: pcre_version.c pcre_internal.h local_config.h pcre.h \
- ucp.h
-$(OBJDIR)/pcre_xclass.o: pcre_xclass.c pcre_internal.h local_config.h pcre.h \
- ucp.h
diff --git a/erts/emulator/pcre/pcre.mk b/erts/emulator/pcre/pcre.mk
new file mode 100644
index 0000000000..b752c11459
--- /dev/null
+++ b/erts/emulator/pcre/pcre.mk
@@ -0,0 +1,113 @@
+#
+# %CopyrightBegin%
+#
+# Copyright Ericsson AB 2011. All Rights Reserved.
+#
+# The contents of this file are subject to the Erlang Public License,
+# Version 1.1, (the "License"); you may not use this file except in
+# compliance with the License. You should have received a copy of the
+# Erlang Public License along with this software. If not, it can be
+# retrieved online at http://www.erlang.org/.
+#
+# Software distributed under the License is distributed on an "AS IS"
+# basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+# the License for the specific language governing rights and limitations
+# under the License.
+#
+# %CopyrightEnd%
+#
+
+ARFLAGS = rc
+
+PCRE_O = \
+pcre_latin_1_table.o \
+pcre_compile.o \
+pcre_config.o \
+pcre_dfa_exec.o \
+pcre_exec.o \
+pcre_fullinfo.o \
+pcre_get.o \
+pcre_globals.o \
+pcre_info.o \
+pcre_maketables.o \
+pcre_newline.o \
+pcre_ord2utf8.o \
+pcre_refcount.o \
+pcre_study.o \
+pcre_tables.o \
+pcre_try_flipped.o \
+pcre_ucp_searchfuncs.o \
+pcre_valid_utf8.o \
+pcre_version.o \
+pcre_xclass.o
+
+PCRE_OBJS = $(PCRE_O:%=$(PCRE_OBJDIR)/%)
+
+GENINC = pcre/pcre_exec_loop_break_cases.inc
+
+PCRE_OBJDIR = $(ERL_TOP)/erts/emulator/pcre/obj/$(TARGET)/$(TYPE)
+
+PCRE_CFLAGS = $(filter-out -DDEBUG,$(CFLAGS)) -DERLANG_INTEGRATION
+
+ifeq ($(TARGET), win32)
+$(EPCRE_LIB): $(PCRE_OBJS)
+ $(AR) -out:$@ $(PCRE_OBJS)
+else
+$(EPCRE_LIB): $(PCRE_OBJS)
+ $(AR) $(ARFLAGS) $@ $(PCRE_OBJS)
+ -@ ($(RANLIB) $@ || true) 2>/dev/null
+endif
+
+$(PCRE_OBJDIR)/%.o: pcre/%.c
+ $(CC) -c $(PCRE_CFLAGS) -o $@ $<
+
+$(GENINC): pcre/pcre_exec.c
+ for x in `grep -n COST_CHK pcre/pcre_exec.c | grep -v 'COST_CHK(N)' | awk -F: '{print $$1}'`; \
+ do \
+ N=`expr $$x + 100`; \
+ echo "case $$N: goto L_LOOP_COUNT_$${x};"; \
+ done > $(GENINC)
+
+# Dependencies.
+
+$(PCRE_OBJDIR)/pcre_chartables.o: pcre/pcre_chartables.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_compile.o: pcre/pcre_compile.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_config.o: pcre/pcre_config.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_dfa_exec.o: pcre/pcre_dfa_exec.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_exec.o: pcre/pcre_exec.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h $(GENINC)
+$(PCRE_OBJDIR)/pcre_fullinfo.o: pcre/pcre_fullinfo.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_get.o: pcre/pcre_get.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_globals.o: pcre/pcre_globals.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_info.o: pcre/pcre_info.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_maketables.o: pcre/pcre_maketables.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_newline.o: pcre/pcre_newline.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_ord2utf8.o: pcre/pcre_ord2utf8.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre/pcre_refcount.o: pcre/pcre_refcount.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_study.o: pcre/pcre_study.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_tables.o: pcre/pcre_tables.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_try_flipped.o: pcre/pcre_try_flipped.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre_ucp_searchfuncs.o: pcre/pcre_ucp_searchfuncs.c \
+ pcre/pcre_internal.h pcre/local_config.h pcre/pcre.h pcre/ucp.h \
+ pcre/ucpinternal.h pcre/ucptable.h
+$(PCRE_OBJDIR)/pcre_valid_utf8.o: pcre/pcre_valid_utf8.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
+pcre_version.o: pcre/pcre_version.c pcre/pcre_internal.h pcre/local_config.h \
+ pcre/pcre.h pcre/ucp.h
+$(PCRE_OBJDIR)/pcre/pcre_xclass.o: pcre/pcre_xclass.c pcre/pcre_internal.h \
+ pcre/local_config.h pcre/pcre.h pcre/ucp.h
diff --git a/erts/emulator/test/bs_match_misc_SUITE.erl b/erts/emulator/test/bs_match_misc_SUITE.erl
index b022f96740..15427661f3 100644
--- a/erts/emulator/test/bs_match_misc_SUITE.erl
+++ b/erts/emulator/test/bs_match_misc_SUITE.erl
@@ -23,7 +23,7 @@
bound_var/1,bound_tail/1,t_float/1,little_float/1,sean/1,
kenneth/1,encode_binary/1,native/1,happi/1,
size_var/1,wiger/1,x0_context/1,huge_float_field/1,
- writable_binary_matched/1,otp_7198/1]).
+ writable_binary_matched/1,otp_7198/1,unordered_bindings/1]).
-include_lib("test_server/include/test_server.hrl").
@@ -33,7 +33,7 @@ all() ->
[bound_var, bound_tail, t_float, little_float, sean,
kenneth, encode_binary, native, happi, size_var, wiger,
x0_context, huge_float_field, writable_binary_matched,
- otp_7198].
+ otp_7198, unordered_bindings].
groups() ->
[].
@@ -553,5 +553,15 @@ otp_7198_scan(<<C, Rest/binary>>, TokAcc) when
otp_7198_scan(Rest, [{'KEYWORD', C} | TokAcc])
end.
+unordered_bindings(Config) when is_list(Config) ->
+ {<<1,2,3,4>>,<<42,42>>,<<3,3,3>>} =
+ unordered_bindings(4, 2, 3, <<1,2,3,4, 42,42, 3,3,3, 3>>),
+ ok.
+
+unordered_bindings(CompressedLength, HashSize, PadLength, T) ->
+ <<Content:CompressedLength/binary,Mac:HashSize/binary,
+ Padding:PadLength/binary,PadLength>> = T,
+ {Content,Mac,Padding}.
+
id(I) -> I.
diff --git a/erts/emulator/test/call_trace_SUITE.erl b/erts/emulator/test/call_trace_SUITE.erl
index 93fdc157f7..3e2bee06d1 100644
--- a/erts/emulator/test/call_trace_SUITE.erl
+++ b/erts/emulator/test/call_trace_SUITE.erl
@@ -934,6 +934,10 @@ exception_nocatch(Config) when is_list(Config) ->
exception_nocatch().
exception_nocatch() ->
+ Deep4LocThrow = get_deep_4_loc({throw,[42]}),
+ Deep4LocError = get_deep_4_loc({error,[42]}),
+ Deep4LocBadmatch = get_deep_4_loc({'=',[a,b]}),
+
Prog = [{'_',[],[{exception_trace}]}],
?line 1 = erlang:trace_pattern({?MODULE,deep_1,'_'}, Prog),
?line 1 = erlang:trace_pattern({?MODULE,deep_2,'_'}, Prog),
@@ -959,8 +963,9 @@ exception_nocatch() ->
{trace,t2,exception_from,{erlang,throw,1},
{error,{nocatch,Q2}}}],
exception_from, {error,{nocatch,Q2}}),
- ?line expect({trace,T2,exit,{{nocatch,Q2},[{erlang,throw,[Q2]},
- {?MODULE,deep_4,1}]}}),
+ ?line expect({trace,T2,exit,{{nocatch,Q2},[{erlang,throw,[Q2],[]},
+ {?MODULE,deep_4,1,
+ Deep4LocThrow}]}}),
?line Q3 = {dump,[dump,{dump}]},
?line T3 =
exception_nocatch(?LINE, error, [Q3], 4,
@@ -968,18 +973,29 @@ exception_nocatch() ->
{trace,t3,exception_from,{erlang,error,1},
{error,Q3}}],
exception_from, {error,Q3}),
- ?line expect({trace,T3,exit,{Q3,[{erlang,error,[Q3]},
- {?MODULE,deep_4,1}]}}),
+ ?line expect({trace,T3,exit,{Q3,[{erlang,error,[Q3],[]},
+ {?MODULE,deep_4,1,Deep4LocError}]}}),
?line T4 =
exception_nocatch(?LINE, '=', [17,4711], 5, [],
exception_from, {error,{badmatch,4711}}),
- ?line expect({trace,T4,exit,{{badmatch,4711},[{?MODULE,deep_4,1}]}}),
+ ?line expect({trace,T4,exit,{{badmatch,4711},
+ [{?MODULE,deep_4,1,Deep4LocBadmatch}]}}),
%%
?line erlang:trace_pattern({?MODULE,'_','_'}, false),
?line erlang:trace_pattern({erlang,'_','_'}, false),
?line expect(),
?line ok.
+get_deep_4_loc(Arg) ->
+ try
+ deep_4(Arg),
+ ?t:fail(should_not_return_to_here)
+ catch
+ _:_ ->
+ [{?MODULE,deep_4,1,Loc0}|_] = erlang:get_stacktrace(),
+ Loc0
+ end.
+
exception_nocatch(Line, B, Q, N, Extra, Tag, R) ->
?line io:format("== Subtest: ~w", [Line]),
?line Go = make_ref(),
diff --git a/erts/emulator/test/code_SUITE.erl b/erts/emulator/test/code_SUITE.erl
index a062cea117..29cbdedd17 100644
--- a/erts/emulator/test/code_SUITE.erl
+++ b/erts/emulator/test/code_SUITE.erl
@@ -20,7 +20,9 @@
-module(code_SUITE).
-export([all/0, suite/0,groups/0,init_per_suite/1, end_per_suite/1,
init_per_group/2,end_per_group/2,
- new_binary_types/1,t_check_process_code/1,t_check_process_code_ets/1,
+ new_binary_types/1,
+ t_check_process_code/1,t_check_old_code/1,
+ t_check_process_code_ets/1,
external_fun/1,get_chunk/1,module_md5/1,make_stub/1,
make_stub_many_funs/1,constant_pools/1,
false_dependency/1,coverage/1]).
@@ -31,7 +33,7 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[new_binary_types, t_check_process_code,
- t_check_process_code_ets, external_fun, get_chunk,
+ t_check_process_code_ets, t_check_old_code, external_fun, get_chunk,
module_md5, make_stub, make_stub_many_funs,
constant_pools, false_dependency, coverage].
@@ -248,6 +250,32 @@ fun_refc(F) ->
Count.
+%% Test the erlang:check_old_code/1 BIF.
+t_check_old_code(Config) when is_list(Config) ->
+ ?line Data = ?config(data_dir, Config),
+ ?line File = filename:join(Data, "my_code_test"),
+
+ ?line erlang:purge_module(my_code_test),
+ ?line erlang:delete_module(my_code_test),
+ ?line catch erlang:purge_module(my_code_test),
+
+ ?line false = erlang:check_old_code(my_code_test),
+
+ ?line {ok,my_code_test,Code} = compile:file(File, [binary]),
+ ?line {module,my_code_test} = code:load_binary(my_code_test, File, Code),
+
+ ?line false = erlang:check_old_code(my_code_test),
+ ?line {module,my_code_test} = code:load_binary(my_code_test, File, Code),
+ ?line true = erlang:check_old_code(my_code_test),
+
+ ?line true = erlang:purge_module(my_code_test),
+ ?line true = erlang:delete_module(my_code_test),
+ ?line true = erlang:purge_module(my_code_test),
+
+ ?line {'EXIT',_} = (catch erlang:check_old_code([])),
+
+ ok.
+
external_fun(Config) when is_list(Config) ->
?line false = erlang:function_exported(another_code_test, x, 1),
?line ExtFun = erlang:make_fun(id(another_code_test), x, 1),
diff --git a/erts/emulator/test/exception_SUITE.erl b/erts/emulator/test/exception_SUITE.erl
index 9d6fc9521d..109cec25cb 100644
--- a/erts/emulator/test/exception_SUITE.erl
+++ b/erts/emulator/test/exception_SUITE.erl
@@ -23,9 +23,10 @@
init_per_group/2,end_per_group/2,
badmatch/1, pending_errors/1, nil_arith/1,
stacktrace/1, nested_stacktrace/1, raise/1, gunilla/1, per/1,
- exception_with_heap_frag/1]).
+ exception_with_heap_frag/1, line_numbers/1]).
-export([bad_guy/2]).
+-export([crash/1]).
-include_lib("test_server/include/test_server.hrl").
-import(lists, [foreach/2]).
@@ -35,7 +36,7 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[badmatch, pending_errors, nil_arith, stacktrace,
nested_stacktrace, raise, gunilla, per,
- exception_with_heap_frag].
+ exception_with_heap_frag, line_numbers].
groups() ->
[].
@@ -141,14 +142,20 @@ pending_exit_message(Args, Expected) ->
end,
process_flag(trap_exit, false).
-pending({badarg, [{erlang,Bif,BifArgs},{?MODULE,Func,Arity}|_]}, Func, Args, _Code)
- when is_atom(Bif), is_list(BifArgs), length(Args) == Arity ->
+pending({badarg,[{erlang,Bif,BifArgs,Loc1},
+ {?MODULE,Func,Arity,Loc2}|_]},
+ Func, Args, _Code)
+ when is_atom(Bif), is_list(BifArgs), length(Args) =:= Arity,
+ is_list(Loc1), is_list(Loc2) ->
ok;
-pending({undef,[{non_existing_module,foo,[]}|_]}, _, _, _) ->
+pending({undef,[{non_existing_module,foo,[],Loc}|_]}, _, _, _)
+ when is_list(Loc) ->
ok;
-pending({function_clause,[{?MODULE,Func,Args}|_]}, Func, Args, _Code) ->
+pending({function_clause,[{?MODULE,Func,Args,Loc}|_]}, Func, Args, _Code)
+ when is_list(Loc) ->
ok;
-pending({Code,[{?MODULE,Func,Arity}|_]}, Func, Args, Code) when length(Args) == Arity ->
+pending({Code,[{?MODULE,Func,Arity,Loc}|_]}, Func, Args, Code)
+ when length(Args) =:= Arity, is_list(Loc) ->
ok;
pending(Reason, _Function, _Args, _Code) ->
test_server:fail({bad_exit_reason,Reason}).
@@ -255,24 +262,24 @@ stacktrace(Conf) when is_list(Conf) ->
?line {_,Mref} = spawn_monitor(fun() -> exit({Tag,erlang:get_stacktrace()}) end),
?line {Tag,[]} = receive {'DOWN',Mref,_,_,Info} -> Info end,
V = [make_ref()|self()],
- ?line {value2,{caught1,badarg,[{erlang,abs,[V]}|_]=St1}} =
+ ?line {value2,{caught1,badarg,[{erlang,abs,[V],_}|_]=St1}} =
stacktrace_1({'abs',V}, error, {value,V}),
?line St1 = erase(stacktrace1),
?line St1 = erase(stacktrace2),
?line St1 = erlang:get_stacktrace(),
- ?line {caught2,{error,badarith},[{?MODULE,my_add,2}|_]=St2} =
+ ?line {caught2,{error,badarith},[{?MODULE,my_add,2,_}|_]=St2} =
stacktrace_1({'div',{1,0}}, error, {'add',{0,a}}),
- ?line [{?MODULE,my_div,2}|_] = erase(stacktrace1),
+ ?line [{?MODULE,my_div,2,_}|_] = erase(stacktrace1),
?line St2 = erase(stacktrace2),
?line St2 = erlang:get_stacktrace(),
- ?line {caught2,{error,{try_clause,V}},[{?MODULE,stacktrace_1,3}|_]=St3} =
+ ?line {caught2,{error,{try_clause,V}},[{?MODULE,stacktrace_1,3,_}|_]=St3} =
stacktrace_1({value,V}, error, {value,V}),
?line St3 = erase(stacktrace1),
?line St3 = erase(stacktrace2),
?line St3 = erlang:get_stacktrace(),
- ?line {caught2,{throw,V},[{?MODULE,foo,1}|_]=St4} =
+ ?line {caught2,{throw,V},[{?MODULE,foo,1,_}|_]=St4} =
stacktrace_1({value,V}, error, {throw,V}),
- ?line [{?MODULE,stacktrace_1,3}|_] = erase(stacktrace1),
+ ?line [{?MODULE,stacktrace_1,3,_}|_] = erase(stacktrace1),
?line St4 = erase(stacktrace2),
?line St4 = erlang:get_stacktrace(),
@@ -280,8 +287,8 @@ stacktrace(Conf) when is_list(Conf) ->
?line stacktrace_2()
catch
error:{badmatch,_} ->
- [{?MODULE,stacktrace_2,0},
- {?MODULE,stacktrace,1}|_] =
+ [{?MODULE,stacktrace_2,0,_},
+ {?MODULE,stacktrace,1,_}|_] =
erlang:get_stacktrace(),
ok
end.
@@ -315,15 +322,15 @@ nested_stacktrace(Conf) when is_list(Conf) ->
nested_stacktrace_1({{value,{V,x1}},void,{V,x1}},
{void,void,void}),
?line {caught1,
- [{?MODULE,my_add,2}|_],
+ [{?MODULE,my_add,2,_}|_],
value2,
- [{?MODULE,my_add,2}|_]} =
+ [{?MODULE,my_add,2,_}|_]} =
nested_stacktrace_1({{'add',{V,x1}},error,badarith},
{{value,{V,x2}},void,{V,x2}}),
?line {caught1,
- [{?MODULE,my_add,2}|_],
- {caught2,[{erlang,abs,[V]}|_]},
- [{erlang,abs,[V]}|_]} =
+ [{?MODULE,my_add,2,_}|_],
+ {caught2,[{erlang,abs,[V],_}|_]},
+ [{erlang,abs,[V],_}|_]} =
nested_stacktrace_1({{'add',{V,x1}},error,badarith},
{{'abs',V},error,badarg}),
ok.
@@ -362,14 +369,14 @@ raise(Conf) when is_list(Conf) ->
end,
?line A = erlang:get_stacktrace(),
?line A = get(raise),
- ?line [{?MODULE,my_div,2}|_] = A,
+ ?line [{?MODULE,my_div,2,_}|_] = A,
%%
N = 8, % Must be even
?line N = erlang:system_flag(backtrace_depth, N),
+ ?line B = odd_even(N, []),
?line try even(N)
catch error:function_clause -> ok
end,
- ?line B = odd_even(N, []),
?line B = erlang:get_stacktrace(),
%%
?line C0 = odd_even(N+1, []),
@@ -387,19 +394,12 @@ raise(Conf) when is_list(Conf) ->
odd_even(N, R) when is_integer(N), N > 1 ->
odd_even(N-1,
[if (N rem 2) == 0 ->
- {?MODULE,even,1};
+ {?MODULE,even,1,[{file,"odd_even.erl"},{line,3}]};
true ->
- {?MODULE,odd,1}
+ {?MODULE,odd,1,[{file,"odd_even.erl"},{line,6}]}
end|R]);
odd_even(1, R) ->
- [{?MODULE,odd,[1]}|R].
-
-even(N) when is_integer(N), N > 1, (N rem 2) == 0 ->
- odd(N-1)++[N].
-
-odd(N) when is_integer(N), N > 1, (N rem 2) == 1 ->
- even(N-1)++[N].
-
+ [{?MODULE,odd,[1],[{file,"odd_even.erl"},{line,5}]}|R].
foo({value,Value}) -> Value;
foo({'div',{A,B}}) ->
@@ -526,4 +526,186 @@ do_exception_with_heap_frag(Bin, [Sz|Sizes]) ->
do_exception_with_heap_frag(Bin, Sizes);
do_exception_with_heap_frag(_, []) -> ok.
+line_numbers(Config) when is_list(Config) ->
+ {'EXIT',{{case_clause,bad_tag},
+ [{?MODULE,line1,2,
+ [{file,"fake_file.erl"},{line,3}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(bad_tag, 0)),
+ {'EXIT',{badarith,
+ [{?MODULE,line1,2,
+ [{file,"fake_file.erl"},{line,5}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, not_an_integer)),
+ {'EXIT',{{badmatch,{ok,1}},
+ [{?MODULE,line1,2,
+ [{file,"fake_file.erl"},{line,7}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, 0)),
+ {'EXIT',{crash,
+ [{?MODULE,crash,1,
+ [{file,"fake_file.erl"},{line,14}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, 41)),
+
+ ModFile = ?MODULE_STRING++".erl",
+ [{?MODULE,maybe_crash,1,[{file,"call.erl"},{line,28}]},
+ {?MODULE,call1,0,[{file,"call.erl"},{line,14}]},
+ {?MODULE,close_calls,1,[{file,"call.erl"},{line,5}]},
+ {?MODULE,line_numbers,1,[{file,ModFile},{line,_}]}|_] =
+ close_calls(call1),
+ [{?MODULE,maybe_crash,1,[{file,"call.erl"},{line,28}]},
+ {?MODULE,call2,0,[{file,"call.erl"},{line,18}]},
+ {?MODULE,close_calls,1,[{file,"call.erl"},{line,6}]},
+ {?MODULE,line_numbers,1,[{file,ModFile},{line,_}]}|_] =
+ close_calls(call2),
+ [{?MODULE,maybe_crash,1,[{file,"call.erl"},{line,28}]},
+ {?MODULE,call3,0,[{file,"call.erl"},{line,22}]},
+ {?MODULE,close_calls,1,[{file,"call.erl"},{line,7}]},
+ {?MODULE,line_numbers,1,[{file,ModFile},{line,_}]}|_] =
+ close_calls(call3),
+ no_crash = close_calls(other),
+
+ <<0,0>> = build_binary1(16),
+ {'EXIT',{badarg,
+ [{?MODULE,build_binary1,1,
+ [{file,"bit_syntax.erl"},{line,72503}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary1(bad_size)),
+
+ <<7,1,2,3>> = build_binary2(8, <<1,2,3>>),
+ {'EXIT',{badarg,
+ [{?MODULE,build_binary2,2,
+ [{file,"bit_syntax.erl"},{line,72507}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary2(bad_size, <<>>)),
+ {'EXIT',{badarg,
+ [{erlang,bit_size,[bad_binary],[]},
+ {?MODULE,build_binary2,2,
+ [{file,"bit_syntax.erl"},{line,72507}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary2(8, bad_binary)),
+
+ {'EXIT',{function_clause,
+ [{?MODULE,do_call_abs,[y,y],
+ [{file,"gc_bif.erl"},{line,18}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_abs(y, y)),
+ {'EXIT',{badarg,
+ [{erlang,abs,[[]],[]},
+ {?MODULE,do_call_abs,2,
+ [{file,"gc_bif.erl"},{line,19}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_abs(x, [])),
+
+ {'EXIT',{{badmatch,"42"},
+ [{MODULE,applied_bif_1,1,[{file,"applied_bif.erl"},{line,5}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch applied_bif_1(42)),
+
+ {'EXIT',{{badmatch,{current_location,
+ {?MODULE,applied_bif_2,0,
+ [{file,"applied_bif.erl"},{line,9}]}}},
+ [{MODULE,applied_bif_2,0,[{file,"applied_bif.erl"},{line,10}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch applied_bif_2()),
+
+ ok.
+
id(I) -> I.
+
+-file("odd_even.erl", 1). %Line 1
+even(N) when is_integer(N), N > 1, (N rem 2) == 0 ->
+ odd(N-1)++[N]. %Line 3
+
+odd(N) when is_integer(N), N > 1, (N rem 2) == 1 ->
+ even(N-1)++[N]. %Line 6
+
+%%
+%% If the compiler removes redundant line instructions (any
+%% line instruction with the same location as the previous),
+%% and the loader also removes line instructions before
+%% tail-recursive calls to external functions, then the
+%% badmatch exception in line 7 below will be reported as
+%% occurring in line 6.
+%%
+%% That means that any removal of redundant line instructions
+%% must all be done in the compiler OR in the loader.
+%%
+-file("fake_file.erl", 1). %Line 1
+line1(Tag, X) -> %Line 2
+ case Tag of %Line 3
+ a ->
+ Y = X + 1, %Line 5
+ Res = id({ok,Y}), %Line 6
+ ?MODULE:crash({ok,42} = Res); %Line 7
+ b ->
+ x = id(x), %Line 9
+ ok %Line 10
+ end. %Line 11
+
+crash(_) -> %Line 13
+ erlang:error(crash). %Line 14
+
+-file("call.erl", 1). %Line 1
+close_calls(Where) -> %Line 2
+ put(where_to_crash, Where), %Line 3
+ try
+ call1(), %Line 5
+ call2(), %Line 6
+ call3(), %Line 7
+ no_crash %Line 8
+ catch error:crash ->
+ erlang:get_stacktrace() %Line 10
+ end. %Line 11
+
+call1() -> %Line 13
+ maybe_crash(call1), %Line 14
+ ok. %Line 15
+
+call2() -> %Line 17
+ maybe_crash(call2), %Line 18
+ ok. %Line 19
+
+call3() -> %Line 21
+ maybe_crash(call3), %Line 22
+ ok. %Line 23
+
+maybe_crash(Name) -> %Line 25
+ case get(where_to_crash) of %Line 26
+ Name ->
+ erlang:error(crash); %Line 28
+ _ ->
+ ok %Line 30
+ end.
+
+-file("bit_syntax.erl", 72500). %Line 72500
+build_binary1(Size) -> %Line 72501
+ id(42), %Line 72502
+ <<0:Size>>. %Line 72503
+
+build_binary2(Size, Bin) -> %Line 72505
+ id(0), %Line 72506
+ <<7:Size,Bin/binary>>. %Line 72507
+
+-file("gc_bif.erl", 17).
+do_call_abs(x, Arg) -> %Line 18
+ abs(Arg). %Line 19
+
+%% Make sure a BIF that is applied does not leave the p->cp
+%% set (and thus generating an extra entry on the stack).
+
+-file("applied_bif.erl", 1).
+%% Explicit apply.
+applied_bif_1(I) -> %Line 3
+ L = apply(erlang, integer_to_list, [I]), %Line 4
+ fail = L, %Line 5
+ ok. %Line 6
+%% Implicit apply.
+applied_bif_2() -> %Line 8
+ R = process_info(self(), current_location), %Line 9
+ fail = R, %Line 10
+ ok. %Line 11
diff --git a/erts/emulator/test/guard_SUITE.erl b/erts/emulator/test/guard_SUITE.erl
index f41324c2cc..a5df9b59a0 100644
--- a/erts/emulator/test/guard_SUITE.erl
+++ b/erts/emulator/test/guard_SUITE.erl
@@ -421,7 +421,7 @@ try_gbif(Id, X, Y) ->
try_fail_gbif(Id, X, Y) ->
case catch guard_bif(Id, X, Y) of
- {'EXIT', {function_clause,[{?MODULE,guard_bif,[Id,X,Y]}|_]}} ->
+ {'EXIT',{function_clause,[{?MODULE,guard_bif,[Id,X,Y],_}|_]}} ->
io:format("guard_bif(~p, ~p, ~p) -- ok", [Id,X,Y]);
Other ->
?line ok = io:format("guard_bif(~p, ~p, ~p) -- bad result: ~p\n",
@@ -493,9 +493,9 @@ type_tests(Test, [Type|T], Allowed) ->
end;
false ->
case catch type_test(Test, Value) of
- {'EXIT', {function_clause, {?MODULE,type_test,[Test,Value]}}} ->
- ok;
- {'EXIT', {function_clause,[{?MODULE,type_test,[Test,Value]}|_]}} ->
+ {'EXIT',{function_clause,
+ [{?MODULE,type_test,[Test,Value],Loc}|_]}}
+ when is_list(Loc) ->
ok;
{'EXIT',Other} ->
?line test_server:fail({unexpected_error_reason,Other});
diff --git a/erts/emulator/test/hibernate_SUITE.erl b/erts/emulator/test/hibernate_SUITE.erl
index 203fa6b48e..82a0aad189 100644
--- a/erts/emulator/test/hibernate_SUITE.erl
+++ b/erts/emulator/test/hibernate_SUITE.erl
@@ -25,16 +25,16 @@
init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
basic/1,dynamic_call/1,min_heap_size/1,bad_args/1,
- messages_in_queue/1,undefined_mfa/1, no_heap/1]).
+ messages_in_queue/1,undefined_mfa/1,no_heap/1,wake_up_and_bif_trap/1]).
%% Used by test cases.
--export([basic_hibernator/1,dynamic_call_hibernator/2,messages_in_queue_restart/2, no_heap_loop/0]).
+-export([basic_hibernator/1,dynamic_call_hibernator/2,messages_in_queue_restart/2, no_heap_loop/0,characters_to_list_trap/1]).
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[basic, dynamic_call, min_heap_size, bad_args, messages_in_queue,
- undefined_mfa, no_heap].
+ undefined_mfa, no_heap, wake_up_and_bif_trap].
groups() ->
[].
@@ -384,6 +384,31 @@ clean_dict() ->
lists:foreach(fun ({Key, _}) -> erase(Key) end, Dict).
%%
+%% Wake up and then immediatly bif trap with a lengthy computation.
+%%
+
+wake_up_and_bif_trap(doc) -> [];
+wake_up_and_bif_trap(suite) -> [];
+wake_up_and_bif_trap(Config) when is_list(Config) ->
+ ?line Self = self(),
+ ?line Pid = spawn_link(fun() -> erlang:hibernate(?MODULE, characters_to_list_trap, [Self]) end),
+ ?line Pid ! wakeup,
+ ?line receive
+ {ok, Pid0} when Pid0 =:= Pid -> ok
+ after 5000 ->
+ ?line ?t:fail(process_blocked)
+ end,
+ ?line unlink(Pid),
+ ?line exit(Pid, bye).
+
+%% Lengthy computation that traps (in characters_to_list_trap_3).
+characters_to_list_trap(Parent) ->
+ Bin0 = <<"abcdefghijklmnopqrstuvwxz0123456789">>,
+ Bin = binary:copy(Bin0, 1500),
+ unicode:characters_to_list(Bin),
+ Parent ! {ok, self()}.
+
+%%
%% Misc
%%
diff --git a/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c b/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c
index 818023211c..0e4065c26b 100644
--- a/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c
+++ b/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c
@@ -552,13 +552,19 @@ create_rwlock(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
static ERL_NIF_TERM
rwlock_op(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
{
- rwlock_resource_t *rwlr;
+ /*
+ * Use a union for pointer type conversion to avoid compiler warnings
+ * about strict-aliasing violations with gcc-4.1. gcc >= 4.2 does not
+ * emit the warning.
+ * TODO: Reconsider use of union once gcc-4.1 is obsolete?
+ */
+ union { void* vp; rwlock_resource_t *p; } rwlr;
int blocking, write, wait_locked, wait_unlocked;
if (argc != 5)
goto badarg;
- if (!enif_get_resource(env, argv[0], enif_priv_data(env), (void **) &rwlr))
+ if (!enif_get_resource(env, argv[0], enif_priv_data(env), &rwlr.vp))
goto badarg;
blocking = get_bool(env, argv[1]);
@@ -581,22 +587,22 @@ rwlock_op(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
if (write) {
if (blocking)
- RWMUTEX_WLOCK(rwlr->rwlock);
+ RWMUTEX_WLOCK(rwlr.p->rwlock);
else
- while (EBUSY == RWMUTEX_TRYWLOCK(rwlr->rwlock));
- if (rwlr->lock_check) {
- ASSERT(!ATOMIC_READ(&rwlr->is_locked));
- ATOMIC_SET(&rwlr->is_locked, -1);
+ while (EBUSY == RWMUTEX_TRYWLOCK(rwlr.p->rwlock));
+ if (rwlr.p->lock_check) {
+ ASSERT(!ATOMIC_READ(&rwlr.p->is_locked));
+ ATOMIC_SET(&rwlr.p->is_locked, -1);
}
}
else {
if (blocking)
- RWMUTEX_RLOCK(rwlr->rwlock);
+ RWMUTEX_RLOCK(rwlr.p->rwlock);
else
- while (EBUSY == RWMUTEX_TRYRLOCK(rwlr->rwlock));
- if (rwlr->lock_check) {
- ASSERT(ATOMIC_READ(&rwlr->is_locked) >= 0);
- ATOMIC_INC(&rwlr->is_locked);
+ while (EBUSY == RWMUTEX_TRYRLOCK(rwlr.p->rwlock));
+ if (rwlr.p->lock_check) {
+ ASSERT(ATOMIC_READ(&rwlr.p->is_locked) >= 0);
+ ATOMIC_INC(&rwlr.p->is_locked);
}
}
@@ -604,18 +610,18 @@ rwlock_op(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
milli_sleep(wait_locked);
if (write) {
- if (rwlr->lock_check) {
- ASSERT(ATOMIC_READ(&rwlr->is_locked) == -1);
- ATOMIC_SET(&rwlr->is_locked, 0);
+ if (rwlr.p->lock_check) {
+ ASSERT(ATOMIC_READ(&rwlr.p->is_locked) == -1);
+ ATOMIC_SET(&rwlr.p->is_locked, 0);
}
- RWMUTEX_WUNLOCK(rwlr->rwlock);
+ RWMUTEX_WUNLOCK(rwlr.p->rwlock);
}
else {
- if (rwlr->lock_check) {
- ASSERT(ATOMIC_READ(&rwlr->is_locked) > 0);
- ATOMIC_DEC(&rwlr->is_locked);
+ if (rwlr.p->lock_check) {
+ ASSERT(ATOMIC_READ(&rwlr.p->is_locked) > 0);
+ ATOMIC_DEC(&rwlr.p->is_locked);
}
- RWMUTEX_RUNLOCK(rwlr->rwlock);
+ RWMUTEX_RUNLOCK(rwlr.p->rwlock);
}
if (wait_unlocked)
diff --git a/erts/emulator/test/nif_SUITE_data/nif_SUITE.c b/erts/emulator/test/nif_SUITE_data/nif_SUITE.c
index bdf1549862..cf2ec4aaf0 100644
--- a/erts/emulator/test/nif_SUITE_data/nif_SUITE.c
+++ b/erts/emulator/test/nif_SUITE_data/nif_SUITE.c
@@ -41,7 +41,18 @@ typedef struct
CallInfo* call_history;
NifModPrivData* nif_mod;
union { ErlNifResourceType* t; long l; } rt_arr[2];
-}PrivData;
+} PrivData;
+
+/*
+ * Use a union for pointer type conversion to avoid compiler warnings
+ * about strict-aliasing violations with gcc-4.1. gcc >= 4.2 does not
+ * emit the warning.
+ * TODO: Reconsider use of union once gcc-4.1 is obsolete?
+ */
+typedef union {
+ void* vp;
+ struct make_term_info* p;
+} mti_t;
void add_call(ErlNifEnv* env, PrivData* data, const char* func_name)
{
@@ -707,7 +718,7 @@ static ERL_NIF_TERM get_resource_type(ErlNifEnv* env, int argc, const ERL_NIF_TE
static ERL_NIF_TERM alloc_resource(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
ErlNifBinary data_bin;
- union { ErlNifResourceType* t; long l;} type;
+ union { ErlNifResourceType* t; long l; } type;
union { void* p; long l;} data;
if (!enif_get_long(env, argv[0], &type.l)
|| !enif_inspect_binary(env, argv[1], &data_bin)
@@ -731,7 +742,7 @@ static ERL_NIF_TERM make_resource(ErlNifEnv* env, int argc, const ERL_NIF_TERM a
static ERL_NIF_TERM make_new_resource(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
ErlNifBinary data_bin;
- union { ErlNifResourceType* t; long l;} type;
+ union { ErlNifResourceType* t; long l; } type;
void* data;
ERL_NIF_TERM ret;
if (!enif_get_long(env, argv[0], &type.l)
@@ -749,7 +760,7 @@ static ERL_NIF_TERM make_new_resource(ErlNifEnv* env, int argc, const ERL_NIF_TE
static ERL_NIF_TERM make_new_resource_binary(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
ErlNifBinary data_bin;
- union { struct binary_resource* p; void* vp; long l;} br;
+ union { struct binary_resource* p; void* vp; long l; } br;
void* buf;
ERL_NIF_TERM ret;
if (!enif_inspect_binary(env, argv[0], &data_bin)
@@ -1269,10 +1280,7 @@ static void msgenv_dtor(ErlNifEnv* env, void* obj)
static ERL_NIF_TERM clear_msgenv(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union {
- void* vp;
- struct make_term_info* p;
- }mti;
+ mti_t mti;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)) {
return enif_make_badarg(env);
}
@@ -1285,7 +1293,7 @@ static ERL_NIF_TERM clear_msgenv(ErlNifEnv* env, int argc, const ERL_NIF_TERM ar
static ERL_NIF_TERM grow_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ERL_NIF_TERM term;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)
|| (argc>2 && !enif_get_uint(env,argv[2], &mti.p->n))) {
@@ -1301,7 +1309,7 @@ static ERL_NIF_TERM grow_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[
static ERL_NIF_TERM send_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ErlNifPid to;
ERL_NIF_TERM copy;
int res;
@@ -1316,7 +1324,7 @@ static ERL_NIF_TERM send_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[
static ERL_NIF_TERM send3_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ErlNifPid to;
ERL_NIF_TERM copy;
int res;
@@ -1334,7 +1342,7 @@ static ERL_NIF_TERM send3_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv
void* threaded_sender(void *arg)
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
mti.vp = arg;
enif_mutex_lock(mti.p->mtx);
@@ -1349,7 +1357,7 @@ void* threaded_sender(void *arg)
static ERL_NIF_TERM send_blob_thread(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ERL_NIF_TERM copy;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)
|| !enif_get_local_pid(env,argv[1], &mti.p->to_pid)) {
@@ -1375,7 +1383,7 @@ static ERL_NIF_TERM send_blob_thread(ErlNifEnv* env, int argc, const ERL_NIF_TER
static ERL_NIF_TERM join_send_thread(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
int err;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)) {
return enif_make_badarg(env);
@@ -1392,7 +1400,7 @@ static ERL_NIF_TERM join_send_thread(ErlNifEnv* env, int argc, const ERL_NIF_TER
static ERL_NIF_TERM copy_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)) {
return enif_make_badarg(env);
}
diff --git a/erts/emulator/test/process_SUITE.erl b/erts/emulator/test/process_SUITE.erl
index f68e712268..fdc55a4cc5 100644
--- a/erts/emulator/test/process_SUITE.erl
+++ b/erts/emulator/test/process_SUITE.erl
@@ -35,7 +35,7 @@
self_exit/1, normal_suicide_exit/1, abnormal_suicide_exit/1,
t_exit_2_catch/1, trap_exit_badarg/1, trap_exit_badarg_in_bif/1,
exit_and_timeout/1, exit_twice/1,
- t_process_info/1, process_info_other_msg/1,
+ t_process_info/1, process_info_other/1, process_info_other_msg/1,
process_info_other_dist_msg/1,
process_info_2_list/1, process_info_lock_reschedule/1,
process_info_lock_reschedule2/1,
@@ -64,7 +64,7 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[spawn_with_binaries, t_exit_1, {group, t_exit_2},
trap_exit_badarg, trap_exit_badarg_in_bif,
- t_process_info, process_info_other_msg,
+ t_process_info, process_info_other, process_info_other_msg,
process_info_other_dist_msg, process_info_2_list,
process_info_lock_reschedule,
process_info_lock_reschedule2,
@@ -258,7 +258,9 @@ trap_exit_badarg() ->
?line Pid = fun_spawn(fun() -> bad_guy(kb_128()) end),
?line Garbage = kb_128(),
?line receive
- {'EXIT', Pid, {badarg,[{erlang,abs,[Garbage]},{?MODULE,bad_guy,1}|_]}} ->
+ {'EXIT',Pid,{badarg,[{erlang,abs,[Garbage],Loc1},
+ {?MODULE,bad_guy,1,Loc2}|_]}}
+ when is_list(Loc1), is_list(Loc2) ->
ok;
Other ->
?line ok = io:format("Bad EXIT message: ~P", [Other, 30]),
@@ -410,7 +412,7 @@ etwice_high(Low) ->
exit(Low, first),
exit(Low, second).
-%% Tests the process_info/1 BIF.
+%% Tests the process_info/2 BIF.
t_process_info(Config) when is_list(Config) ->
?line [] = process_info(self(), registered_name),
?line register(my_name, self()),
@@ -418,13 +420,100 @@ t_process_info(Config) when is_list(Config) ->
?line {status, running} = process_info(self(), status),
?line {min_heap_size, 233} = process_info(self(), min_heap_size),
?line {min_bin_vheap_size, 46368} = process_info(self(), min_bin_vheap_size),
- ?line {current_function, {?MODULE, t_process_info, 1}} =
+ ?line {current_function,{?MODULE,t_process_info,1}} =
process_info(self(), current_function),
+ ?line {current_function,{?MODULE,t_process_info,1}} =
+ apply(erlang, process_info, [self(),current_function]),
+
+ %% current_location and current_stacktrace
+ {Line1,Res1} = {?LINE,process_info(self(), current_location)},
+ verify_loc(Line1, Res1),
+ {Line2,Res2} = {?LINE,apply(erlang, process_info,
+ [self(),current_location])},
+ verify_loc(Line2, Res2),
+ pi_stacktrace([{?MODULE,t_process_info,1,?LINE}]),
+
?line Gleader = group_leader(),
?line {group_leader, Gleader} = process_info(self(), group_leader),
?line {'EXIT',{badarg,_Info}} = (catch process_info('not_a_pid')),
ok.
+pi_stacktrace(Expected0) ->
+ {Line,Res} = {?LINE,erlang:process_info(self(), current_stacktrace)},
+ {current_stacktrace,Stack} = Res,
+ Expected = [{?MODULE,pi_stacktrace,1,Line}|Expected0],
+ pi_stacktrace_1(Stack, Expected).
+
+pi_stacktrace_1([{M,F,A,Loc}|Stk], [{M,F,A,Line}|Exp]) ->
+ case Loc of
+ [] ->
+ %% No location info for some reason (+L, native code).
+ io:format("Missing location information for ~w:~w/~w",
+ [M,F,A]),
+ ok;
+ [_|_] ->
+ Line = proplists:get_value(line, Loc),
+ File = proplists:get_value(file, Loc),
+ File = ?MODULE_STRING ++ ".erl"
+ end,
+ pi_stacktrace_1(Stk, Exp);
+pi_stacktrace_1([_|_], []) -> ok.
+
+verify_loc(Line, {current_location,{?MODULE,t_process_info=F,1=A,Loc}}) ->
+ case Loc of
+ [] ->
+ %% No location info for some reason (+L, native code).
+ io:format("Missing location information for ~w:~w/~w",
+ [?MODULE,F,A]),
+ ok;
+ [_|_] ->
+ Line = proplists:get_value(line, Loc),
+ File = proplists:get_value(file, Loc),
+ File = ?MODULE_STRING ++ ".erl"
+ end.
+
+process_info_other(Config) when is_list(Config) ->
+ Self = self(),
+ Pid = spawn_link(fun() -> process_info_looper(Self) end),
+ receive after 1 -> ok end,
+ pio_current_location(10000, Pid, 0, 0),
+ pio_current_stacktrace().
+
+pio_current_location(0, _, Pi, Looper) ->
+ io:format("~w call(s) to erlang:process_info/2", [Pi]),
+ io:format("~w call(s) to ~w:process_info_looper/1", [Looper,?MODULE]);
+pio_current_location(N, Pid, Pi, Looper) ->
+ erlang:yield(),
+ {current_location,Where} = process_info(Pid, current_location),
+ case Where of
+ {erlang,process_info,2,[]} ->
+ pio_current_location(N-1, Pid, Pi+1, Looper);
+ {?MODULE,process_info_looper,1,Loc} when is_list(Loc) ->
+ pio_current_location(N-1, Pid, Pi, Looper+1)
+ end.
+
+pio_current_stacktrace() ->
+ L = [begin
+ {current_stacktrace,Stk} = process_info(P, current_stacktrace),
+ {P,Stk}
+ end || P <- processes()],
+ [erlang:garbage_collect(P) || {P,_} <- L],
+ erlang:garbage_collect(),
+ [verify_stacktrace(Stk) || {_,Stk} <- L],
+ ok.
+
+verify_stacktrace([{M,F,A,Loc}|T])
+ when is_atom(M),
+ is_atom(F),
+ is_integer(A),
+ is_list(Loc) ->
+ verify_stacktrace(T);
+verify_stacktrace([]) -> ok.
+
+process_info_looper(Parent) ->
+ process_info(Parent, current_location),
+ process_info_looper(Parent).
+
%% Tests the process_info/1 BIF on another process with messages.
process_info_other_msg(Config) when is_list(Config) ->
Self = self(),
diff --git a/erts/emulator/test/trace_local_SUITE.erl b/erts/emulator/test/trace_local_SUITE.erl
index 091e960610..32e2a98e3c 100644
--- a/erts/emulator/test/trace_local_SUITE.erl
+++ b/erts/emulator/test/trace_local_SUITE.erl
@@ -767,8 +767,8 @@ exception_test(Opts, Func0, Args0) ->
end,
?line R1 = exc_slave(ExcOpts, Func, Args),
- ?line Stack2 = [{?MODULE,exc_top,3},{?MODULE,slave,2}],
- ?line Stack3 = [{?MODULE,exc,2}|Stack2],
+ ?line Stack2 = [{?MODULE,exc_top,3,[]},{?MODULE,slave,2,[]}],
+ ?line Stack3 = [{?MODULE,exc,2,[]}|Stack2],
?line Rs =
case x_exc_top(ExcOpts, Func, Args) of % Emulation
{crash,{Reason,Stack}}=R when is_list(Stack) ->
@@ -789,21 +789,29 @@ exception_test(Opts, Func0, Args0) ->
end,
?line expect({nm}).
-exception_validate(R1, [R2|Rs]) ->
+exception_validate(R0, Rs0) ->
+ R = clean_location(R0),
+ Rs = [clean_location(E) || E <- Rs0],
+ exception_validate_1(R, Rs).
+
+exception_validate_1(R1, [R2|Rs]) ->
case [R1|R2] of
[R|R] ->
ok;
- [{crash,{badarg,[{lists,reverse,[L1a,L1b]}|T]}}|
- {crash,{badarg,[{lists,reverse,[L2a,L2b]}|T]}}] ->
+ [{crash,{badarg,[{lists,reverse,[L1a,L1b],_}|T]}}|
+ {crash,{badarg,[{lists,reverse,[L2a,L2b],_}|T]}}] ->
same({crash,{badarg,[{lists,reverse,
- [lists:reverse(L1b, L1a),[]]}|T]}},
+ [lists:reverse(L1b, L1a),[]],[]}|T]}},
{crash,{badarg,[{lists,reverse,
- [lists:reverse(L2b, L2a),[]]}|T]}});
+ [lists:reverse(L2b, L2a),[]],[]}|T]}});
_ when is_list(Rs), Rs =/= [] ->
exception_validate(R1, Rs)
end.
-
+clean_location({crash,{Reason,Stk0}}) ->
+ Stk = [{M,F,A,[]} || {M,F,A,_} <- Stk0],
+ {crash,{Reason,Stk}};
+clean_location(Term) -> Term.
%%% Tracee target functions %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%%%
@@ -1057,10 +1065,10 @@ x_exc_exception(_Rtt, M, F, _, Arity, CR) ->
x_exc_stacktrace() ->
x_exc_stacktrace(erlang:get_stacktrace()).
%% Truncate stacktrace to below exc/2
-x_exc_stacktrace([{?MODULE,x_exc,4}|_]) -> [];
-x_exc_stacktrace([{?MODULE,x_exc_func,4}|_]) -> [];
-x_exc_stacktrace([{?MODULE,x_exc_body,4}|_]) -> [];
-x_exc_stacktrace([{?MODULE,exc,2}|_]) -> [];
+x_exc_stacktrace([{?MODULE,x_exc,4,_}|_]) -> [];
+x_exc_stacktrace([{?MODULE,x_exc_func,4,_}|_]) -> [];
+x_exc_stacktrace([{?MODULE,x_exc_body,4,_}|_]) -> [];
+x_exc_stacktrace([{?MODULE,exc,2,_}|_]) -> [];
x_exc_stacktrace([H|T]) ->
[H|x_exc_stacktrace(T)].
diff --git a/erts/epmd/src/epmd.c b/erts/epmd/src/epmd.c
index 08576d923f..2267f9b12b 100644
--- a/erts/epmd/src/epmd.c
+++ b/erts/epmd/src/epmd.c
@@ -324,7 +324,11 @@ static void run_daemon(EpmdVars *g)
}
/* move cwd to root to make sure we are not on a mounted filesystem */
- chdir("/");
+ if (chdir("/") < 0)
+ {
+ dbg_perror(g,"epmd: chdir() failed");
+ epmd_cleanup_exit(g,1);
+ }
umask(0);
diff --git a/erts/epmd/src/epmd_cli.c b/erts/epmd/src/epmd_cli.c
index ac55ba6bb6..2377c0dfe7 100644
--- a/erts/epmd/src/epmd_cli.c
+++ b/erts/epmd/src/epmd_cli.c
@@ -104,7 +104,10 @@ void epmd_call(EpmdVars *g,int what)
fd = conn_to_epmd(g);
put_int16(1,buf);
buf[2] = what;
- write(fd,buf,3);
+ if (write(fd, buf, 3) != 3) {
+ printf("epmd: Can't write to epmd\n");
+ epmd_cleanup_exit(g,1);
+ }
if (read(fd,(char *)&i,4) != 4) {
if (!g->silent)
printf("epmd: no response from local epmd\n");
diff --git a/erts/example/matrix_nif.c b/erts/example/matrix_nif.c
index c5e01dade5..43f9526ae3 100644
--- a/erts/example/matrix_nif.c
+++ b/erts/example/matrix_nif.c
@@ -31,7 +31,19 @@ typedef struct
unsigned nrows;
unsigned ncols;
double* data;
-}Matrix;
+} Matrix;
+
+/*
+ * Use a union for pointer type conversion to avoid compiler warnings
+ * about strict-aliasing violations with gcc-4.1. gcc >= 4.2 does not
+ * emit the warning.
+ * TODO: Reconsider use of union once gcc-4.1 is obsolete?
+ */
+typedef union
+{
+ void* vp;
+ Matrix* p;
+} mx_t;
#define POS(MX, ROW, COL) ((MX)->data[(ROW)* (MX)->ncols + (COL)])
@@ -44,8 +56,9 @@ static ErlNifResourceType* resource_type = NULL;
static int load(ErlNifEnv* env, void** priv_data, ERL_NIF_TERM load_info)
{
- ErlNifResourceType* rt = enif_open_resource_type(env, "matrix_nif_example",
- matrix_dtor,
+ ErlNifResourceType* rt = enif_open_resource_type(env, NULL,
+ "matrix_nif_example",
+ matrix_dtor,
ERL_NIF_RT_CREATE, NULL);
if (rt == NULL) {
return -1;
@@ -90,12 +103,12 @@ static ERL_NIF_TERM create(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
}
ret = enif_make_resource(env, mx);
- enif_release_resource(env, mx);
+ enif_release_resource(mx);
return ret;
badarg:
if (mx != NULL) {
- enif_release_resource(env,mx);
+ enif_release_resource(mx);
}
return enif_make_badarg(env);
}
@@ -104,14 +117,14 @@ badarg:
static ERL_NIF_TERM pos(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
/* pos(Matrix, Row, Column) -> float() */
- Matrix* mx;
+ mx_t mx;
unsigned i, j;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mx) ||
- !enif_get_uint(env, argv[1], &i) || (--i >= mx->nrows) ||
- !enif_get_uint(env, argv[2], &j) || (--j >= mx->ncols)) {
+ if (!enif_get_resource(env, argv[0], resource_type, &mx.vp) ||
+ !enif_get_uint(env, argv[1], &i) || (--i >= mx.p->nrows) ||
+ !enif_get_uint(env, argv[2], &j) || (--j >= mx.p->ncols)) {
return enif_make_badarg(env);
}
- return enif_make_double(env, POS(mx, i,j));
+ return enif_make_double(env, POS(mx.p, i,j));
}
static ERL_NIF_TERM add(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
@@ -119,37 +132,38 @@ static ERL_NIF_TERM add(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
/* add(Matrix_A, Matrix_B) -> Matrix_Sum */
unsigned i, j;
ERL_NIF_TERM ret;
- Matrix* mxA = NULL;
- Matrix* mxB = NULL;
- Matrix* mxS = NULL;
+ mx_t mxA, mxB, mxS;
+ mxA.p = NULL;
+ mxB.p = NULL;
+ mxS.p = NULL;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mxA) ||
- !enif_get_resource(env, argv[1], resource_type, (void**)&mxB) ||
- mxA->nrows != mxB->nrows ||
- mxB->ncols != mxB->ncols) {
+ if (!enif_get_resource(env, argv[0], resource_type, &mxA.vp) ||
+ !enif_get_resource(env, argv[1], resource_type, &mxB.vp) ||
+ mxA.p->nrows != mxB.p->nrows ||
+ mxB.p->ncols != mxB.p->ncols) {
return enif_make_badarg(env);
}
- mxS = alloc_matrix(env, mxA->nrows, mxA->ncols);
- for (i = 0; i < mxA->nrows; i++) {
- for (j = 0; j < mxA->ncols; j++) {
- POS(mxS, i, j) = POS(mxA, i, j) + POS(mxB, i, j);
+ mxS.p = alloc_matrix(env, mxA.p->nrows, mxA.p->ncols);
+ for (i = 0; i < mxA.p->nrows; i++) {
+ for (j = 0; j < mxA.p->ncols; j++) {
+ POS(mxS.p, i, j) = POS(mxA.p, i, j) + POS(mxB.p, i, j);
}
}
- ret = enif_make_resource(env, mxS);
- enif_release_resource(env, mxS);
+ ret = enif_make_resource(env, mxS.p);
+ enif_release_resource(mxS.p);
return ret;
}
static ERL_NIF_TERM size_of(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
/* size(Matrix) -> {Nrows, Ncols} */
- Matrix* mx;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mx)) {
+ mx_t mx;
+ if (!enif_get_resource(env, argv[0], resource_type, &mx.vp)) {
return enif_make_badarg(env);
}
- return enif_make_tuple2(env, enif_make_uint(env, mx->nrows),
- enif_make_uint(env, mx->ncols));
+ return enif_make_tuple2(env, enif_make_uint(env, mx.p->nrows),
+ enif_make_uint(env, mx.p->ncols));
}
static ERL_NIF_TERM to_term(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
@@ -157,16 +171,17 @@ static ERL_NIF_TERM to_term(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
/* to_term(Matrix) -> [[first row], [second row], ...,[last row]] */
unsigned i, j;
ERL_NIF_TERM res;
- Matrix* mx = NULL;
+ mx_t mx;
+ mx.p = NULL;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mx)) {
+ if (!enif_get_resource(env, argv[0], resource_type, &mx.vp)) {
return enif_make_badarg(env);
}
res = enif_make_list(env, 0);
- for (i = mx->nrows; i-- > 0; ) {
+ for (i = mx.p->nrows; i-- > 0; ) {
ERL_NIF_TERM row = enif_make_list(env, 0);
- for (j = mx->ncols; j-- > 0; ) {
- row = enif_make_list_cell(env, enif_make_double(env, POS(mx,i,j)),
+ for (j = mx.p->ncols; j-- > 0; ) {
+ row = enif_make_list_cell(env, enif_make_double(env, POS(mx.p,i,j)),
row);
}
res = enif_make_list_cell(env, row, res);
@@ -183,17 +198,17 @@ static int get_number(ErlNifEnv* env, ERL_NIF_TERM term, double* dp)
static Matrix* alloc_matrix(ErlNifEnv* env, unsigned nrows, unsigned ncols)
{
- Matrix* mx = enif_alloc_resource(env, resource_type, sizeof(Matrix));
+ Matrix* mx = enif_alloc_resource(resource_type, sizeof(Matrix));
mx->nrows = nrows;
mx->ncols = ncols;
- mx->data = enif_alloc(env, nrows*ncols*sizeof(double));
+ mx->data = enif_alloc(nrows*ncols*sizeof(double));
return mx;
}
static void matrix_dtor(ErlNifEnv* env, void* obj)
{
Matrix* mx = (Matrix*) obj;
- enif_free(env, mx->data);
+ enif_free(mx->data);
mx->data = NULL;
}
diff --git a/erts/lib_src/common/erl_misc_utils.c b/erts/lib_src/common/erl_misc_utils.c
index 5dbf98c7d1..35b148990a 100644
--- a/erts/lib_src/common/erl_misc_utils.c
+++ b/erts/lib_src/common/erl_misc_utils.c
@@ -1511,7 +1511,7 @@ const char* parse_topology_spec_group(erts_cpu_info_t *cpuinfo, const char* xml,
}
}
- if (cacheLevel == 0) {
+ if (parentCacheLevel == 0) {
*core_p = 0;
*processor_p = (*processor_p)++;
} else {
diff --git a/erts/lib_src/common/erl_printf_format.c b/erts/lib_src/common/erl_printf_format.c
index fba3fd723c..473791dce4 100644
--- a/erts/lib_src/common/erl_printf_format.c
+++ b/erts/lib_src/common/erl_printf_format.c
@@ -388,7 +388,7 @@ static int fmt_double(fmtfn_t fn,void*arg,double val,
max_size++;
if (precision)
max_size += precision;
- else if (fmt && FMTF_alt)
+ else if (fmt & FMTF_alt)
max_size++;
break;
case FMTC_E:
@@ -402,7 +402,7 @@ static int fmt_double(fmtfn_t fn,void*arg,double val,
max_size += 4;
if (precision)
max_size += precision;
- else if (fmt && FMTF_alt)
+ else if (fmt & FMTF_alt)
max_size++;
aexp = exp >= 0 ? exp : -exp;
if (aexp < 100)
diff --git a/erts/preloaded/ebin/zlib.beam b/erts/preloaded/ebin/zlib.beam
index 9b62607c04..44dd264346 100644
--- a/erts/preloaded/ebin/zlib.beam
+++ b/erts/preloaded/ebin/zlib.beam
Binary files differ
diff --git a/erts/preloaded/src/zlib.erl b/erts/preloaded/src/zlib.erl
index 6cc7b27114..210532edac 100644
--- a/erts/preloaded/src/zlib.erl
+++ b/erts/preloaded/src/zlib.erl
@@ -173,7 +173,7 @@ deflateInit(Z, Level, Method, WindowBits, MemLevel, Strategy) ->
-spec deflateSetDictionary(Z, Dictionary) -> Adler32 when
Z :: zstream(),
- Dictionary :: binary(),
+ Dictionary :: iodata(),
Adler32 :: integer().
deflateSetDictionary(Z, Dictionary) ->
call(Z, ?DEFLATE_SETDICT, Dictionary).
@@ -232,7 +232,7 @@ inflateInit(Z, WindowBits) ->
-spec inflateSetDictionary(Z, Dictionary) -> 'ok' when
Z :: zstream(),
- Dictionary :: binary().
+ Dictionary :: iodata().
inflateSetDictionary(Z, Dictionary) ->
call(Z, ?INFLATE_SETDICT, Dictionary).
@@ -283,38 +283,36 @@ getBufSize(Z) ->
crc32(Z) ->
call(Z, ?CRC32_0, []).
--spec crc32(Z, Binary) -> CRC when
+-spec crc32(Z, Data) -> CRC when
Z :: zstream(),
- Binary :: binary(),
+ Data :: iodata(),
CRC :: integer().
-crc32(Z, Binary) ->
- call(Z, ?CRC32_1, Binary).
+crc32(Z, Data) ->
+ call(Z, ?CRC32_1, Data).
--spec crc32(Z, PrevCRC, Binary) -> CRC when
+-spec crc32(Z, PrevCRC, Data) -> CRC when
Z :: zstream(),
PrevCRC :: integer(),
- Binary :: binary(),
+ Data :: iodata(),
CRC :: integer().
-crc32(Z, CRC, Binary) when is_binary(Binary), is_integer(CRC) ->
- call(Z, ?CRC32_2, <<CRC:32, Binary/binary>>);
-crc32(_Z, _CRC, _Binary) ->
- erlang:error(badarg).
+crc32(Z, CRC, Data) ->
+ call(Z, ?CRC32_2, [<<CRC:32>>, Data]).
--spec adler32(Z, Binary) -> CheckSum when
+-spec adler32(Z, Data) -> CheckSum when
Z :: zstream(),
- Binary :: binary(),
+ Data :: iodata(),
CheckSum :: integer().
-adler32(Z, Binary) ->
- call(Z, ?ADLER32_1, Binary).
+adler32(Z, Data) ->
+ call(Z, ?ADLER32_1, Data).
--spec adler32(Z, PrevAdler, Binary) -> CheckSum when
+-spec adler32(Z, PrevAdler, Data) -> CheckSum when
Z :: zstream(),
PrevAdler :: integer(),
- Binary :: binary(),
+ Data :: iodata(),
CheckSum :: integer().
-adler32(Z, Adler, Binary) when is_binary(Binary), is_integer(Adler) ->
- call(Z, ?ADLER32_2, <<Adler:32, Binary/binary>>);
-adler32(_Z, _Adler, _Binary) ->
+adler32(Z, Adler, Data) when is_integer(Adler) ->
+ call(Z, ?ADLER32_2, [<<Adler:32>>, Data]);
+adler32(_Z, _Adler, _Data) ->
erlang:error(badarg).
-spec crc32_combine(Z, CRC1, CRC2, Size2) -> CRC when
@@ -346,76 +344,83 @@ getQSize(Z) ->
call(Z, ?GET_QSIZE, []).
%% compress/uncompress zlib with header
--spec compress(Binary) -> Compressed when
- Binary :: binary(),
+-spec compress(Data) -> Compressed when
+ Data :: iodata(),
Compressed :: binary().
-compress(Binary) ->
+compress(Data) ->
Z = open(),
deflateInit(Z, default),
- Bs = deflate(Z, Binary,finish),
+ Bs = deflate(Z, Data, finish),
deflateEnd(Z),
close(Z),
- list_to_binary(Bs).
+ iolist_to_binary(Bs).
--spec uncompress(Binary) -> Decompressed when
- Binary :: binary(),
+-spec uncompress(Data) -> Decompressed when
+ Data :: iodata(),
Decompressed :: binary().
-uncompress(Binary) when byte_size(Binary) >= 8 ->
- Z = open(),
- inflateInit(Z),
- Bs = inflate(Z, Binary),
- inflateEnd(Z),
- close(Z),
- list_to_binary(Bs);
-uncompress(Binary) when is_binary(Binary) -> erlang:error(data_error);
-uncompress(_) -> erlang:error(badarg).
+uncompress(Data) ->
+ try iolist_size(Data) of
+ Size ->
+ if
+ Size >= 8 ->
+ Z = open(),
+ inflateInit(Z),
+ Bs = inflate(Z, Data),
+ inflateEnd(Z),
+ close(Z),
+ iolist_to_binary(Bs);
+ true ->
+ erlang:error(data_error)
+ end
+ catch
+ _:_ ->
+ erlang:error(badarg)
+ end.
%% unzip/zip zlib without header (zip members)
--spec zip(Binary) -> Compressed when
- Binary :: binary(),
+-spec zip(Data) -> Compressed when
+ Data :: iodata(),
Compressed :: binary().
-zip(Binary) ->
+zip(Data) ->
Z = open(),
deflateInit(Z, default, deflated, -?MAX_WBITS, 8, default),
- Bs = deflate(Z, Binary, finish),
+ Bs = deflate(Z, Data, finish),
deflateEnd(Z),
close(Z),
- list_to_binary(Bs).
+ iolist_to_binary(Bs).
--spec unzip(Binary) -> Decompressed when
- Binary :: binary(),
+-spec unzip(Data) -> Decompressed when
+ Data :: iodata(),
Decompressed :: binary().
-unzip(Binary) ->
+unzip(Data) ->
Z = open(),
inflateInit(Z, -?MAX_WBITS),
- Bs = inflate(Z, Binary),
+ Bs = inflate(Z, Data),
inflateEnd(Z),
close(Z),
- list_to_binary(Bs).
+ iolist_to_binary(Bs).
-spec gzip(Data) -> Compressed when
Data :: iodata(),
Compressed :: binary().
-gzip(Data) when is_binary(Data); is_list(Data) ->
+gzip(Data) ->
Z = open(),
deflateInit(Z, default, deflated, 16+?MAX_WBITS, 8, default),
Bs = deflate(Z, Data, finish),
deflateEnd(Z),
close(Z),
- iolist_to_binary(Bs);
-gzip(_) -> erlang:error(badarg).
+ iolist_to_binary(Bs).
--spec gunzip(Binary) -> Decompressed when
- Binary :: binary(),
+-spec gunzip(Data) -> Decompressed when
+ Data :: iodata(),
Decompressed :: binary().
-gunzip(Data) when is_binary(Data); is_list(Data) ->
+gunzip(Data) ->
Z = open(),
inflateInit(Z, 16+?MAX_WBITS),
Bs = inflate(Z, Data),
inflateEnd(Z),
close(Z),
- iolist_to_binary(Bs);
-gunzip(_) -> erlang:error(badarg).
+ iolist_to_binary(Bs).
-spec collect(zstream()) -> iolist().
collect(Z) ->
diff --git a/lib/Makefile b/lib/Makefile
index 7f4c309da9..c443425f8b 100644
--- a/lib/Makefile
+++ b/lib/Makefile
@@ -33,20 +33,6 @@ ifeq ($(findstring vxworks,$(TARGET)),vxworks)
cosFileTransfer cosEventDomain
endif
else
- ifeq ($(findstring ose,$(TARGET)),ose)
- ERTS_SUB_DIRECTORIES = stdlib sasl kernel compiler erl_interface
- OTHER_SUB_DIRECTORIES = \
- snmp otp_mibs appmon tools
-# OTHER_SUB_DIRECTORIES = \
-# appmon os_mon tools runtime_tools
- ifdef BUILD_ALL
- OTHER_SUB_DIRECTORIES += mnesia \
- inets pman tv observer
-# OTHER_SUB_DIRECTORIES += mnesia ic asn1 debugger \
-# inets orber pman tv observer cosTransactions cosEvent \
-# cosTime cosNotification cosProperty cosFileTransfer cosEventDomain
- endif
- else
#
# unix and win32
# --------------
@@ -59,10 +45,11 @@ else
snmp otp_mibs appmon erl_interface asn1 jinterface gs wx inets ic \
mnesia crypto orber os_mon parsetools syntax_tools pman \
public_key ssl toolbar tv observer debugger reltool odbc \
- runtime_tools diameter \
+ diameter \
cosTransactions cosEvent cosTime cosNotification cosProperty \
cosFileTransfer cosEventDomain et megaco webtool \
- xmerl edoc eunit ssh inviso typer docbuilder erl_docgen common_test percept
+ xmerl edoc eunit ssh inviso typer docbuilder erl_docgen \
+ common_test percept dialyzer
# dialyzer
OTHER_SUB_DIRECTORIES += hipe
else # BUILD_ALL on unix
@@ -70,15 +57,15 @@ else
snmp otp_mibs appmon erl_interface asn1 jinterface wx debugger reltool gs inets \
ic mnesia crypto orber os_mon parsetools syntax_tools \
pman public_key ssl toolbar tv observer odbc \
- runtime_tools diameter \
+ diameter \
cosTransactions cosEvent cosTime cosNotification \
cosProperty cosFileTransfer cosEventDomain et megaco webtool \
- xmerl edoc eunit ssh inviso typer docbuilder erl_docgen common_test percept
+ xmerl edoc eunit ssh inviso typer docbuilder erl_docgen \
+ common_test percept dialyzer
# dialyzer
OTHER_SUB_DIRECTORIES += hipe $(TSP_APP)
endif
endif
- endif
endif
ifdef BOOTSTRAP
diff --git a/lib/asn1/c_src/Makefile b/lib/asn1/c_src/Makefile
index 60543df355..f7213b9651 100644
--- a/lib/asn1/c_src/Makefile
+++ b/lib/asn1/c_src/Makefile
@@ -80,7 +80,9 @@ endif
# Targets
# ----------------------------------------------------
-opt: $(OBJDIR) $(LIBDIR) $(NIF_SHARED_OBJ_FILE)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
+
+opt: $(NIF_SHARED_OBJ_FILE)
debug: opt
@@ -102,14 +104,6 @@ $(OBJDIR)/%.o: %.c
$(NIF_SHARED_OBJ_FILE): $(NIF_OBJ_FILES)
$(LD) $(LDFLAGS) -o $(NIF_SHARED_OBJ_FILE) $(NIF_OBJ_FILES) $(CLIB_FLAGS) $(LIBS)
-$(LIBDIR):
- -mkdir -p $(LIBDIR)
-
-$(OBJDIR):
- -mkdir -p $(OBJDIR)
-
-
-
# ----------------------------------------------------
# Release Target
# ----------------------------------------------------
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml
index c92566de37..57b032b3fd 100644
--- a/lib/common_test/doc/src/common_test_app.xml
+++ b/lib/common_test/doc/src/common_test_app.xml
@@ -144,7 +144,7 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs}]</v>
+ <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
diff --git a/lib/common_test/doc/src/ct_hooks.xml b/lib/common_test/doc/src/ct_hooks.xml
index 7d5c9f4750..0ece3199bb 100644
--- a/lib/common_test/doc/src/ct_hooks.xml
+++ b/lib/common_test/doc/src/ct_hooks.xml
@@ -81,12 +81,14 @@
<funcs>
<func>
- <name>Module:init(Id, Opts) -&gt; State</name>
+ <name>Module:init(Id, Opts) -&gt; {ok, State} |
+ {ok, State, Priority}</name>
<fsummary>Initiates the Common Test Hook</fsummary>
<type>
<v>Id = reference() | term()</v>
<v>Opts = term()</v>
<v>State = term()</v>
+ <v>Priority = integer()</v>
</type>
<desc>
@@ -103,6 +105,10 @@
if <seealso marker="#Module:id-1">id/1</seealso> is not implemented.
</p>
+ <p><c>Priority</c> is the relative priority of this hook. Hooks with a
+ lower priority will be executed first. If no priority is given,
+ it will be set to 0. </p>
+
<p>For details about when init is called see
<seealso marker="ct_hooks_chapter#scope">scope</seealso>
in the User's Guide.</p>
diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml
index fc5ab48e1b..dbb4310040 100644
--- a/lib/common_test/doc/src/ct_hooks_chapter.xml
+++ b/lib/common_test/doc/src/ct_hooks_chapter.xml
@@ -94,9 +94,11 @@
<seealso marker="common_test#Module:init_per_group-2">
init_per_group/2</seealso>. <c>CTH</c> in this case can be either
only the module name of the CTH or a tuple with the module name and the
- initial arguments to the CTH. Eg:
+ initial arguments and optionally the hook priority of the CTH. Eg:
<c>{ct_hooks,[my_cth_module]}</c> or
- <c>{ct_hooks,[{my_cth_module,[{debug,true}]}]}</c></p>
+ <c>{ct_hooks,[{my_cth_module,[{debug,true}]}]}</c> or
+ <c>{ct_hooks,[{my_cth_module,[{debug,true}],500}]}</c>
+ </p>
<section>
<title>Overriding CTHs</title>
@@ -109,7 +111,16 @@
<c>id</c> in both places, Common Test knows that this CTH
has already been installed and will not try to install it again.</p>
</section>
-
+
+ <section>
+ <title>CTH Priority</title>
+ <p>By default each CTH installed will be executed in the order which
+ they are installed. This is not always wanted so common_test allows
+ the user to specify a priority for each hook. The priority can either
+ be specified in the CTH <seealso marker="ct_hooks#Module:init-2">init/2
+ </seealso> function or when installing the hook. The priority given at
+ installation will override the priority returned by the CTH. </p>
+ </section>
</section>
<marker id="scope"/>
@@ -331,7 +342,7 @@ id(Opts) ->
%% any common state.
init(Id, Opts) ->
{ok,D} = file:open(Id,[write]),
- #state{ file_handle = D, total = 0, data = [] }.
+ {ok, #state{ file_handle = D, total = 0, data = [] }}.
%% @doc Called before init_per_suite is called.
pre_init_per_suite(Suite,Config,State) ->
diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml
index e6fb85634f..e668568795 100644
--- a/lib/common_test/doc/src/run_test_chapter.xml
+++ b/lib/common_test/doc/src/run_test_chapter.xml
@@ -488,7 +488,7 @@
LogDir = string()
EventHandlers = atom() | [atom()]
InitArgs = [term()]
- CTHModules = [CTHModule | {CTHModule, CTHInitArgs}]
+ CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]
CTHModule = atom()
CTHInitArgs = term()
DirRef = DirAlias | Dir
diff --git a/lib/common_test/include/ct.hrl b/lib/common_test/include/ct.hrl
index aa1cc832cf..5a77108e1a 100644
--- a/lib/common_test/include/ct.hrl
+++ b/lib/common_test/include/ct.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -18,5 +18,4 @@
%%
-include_lib("test_server/include/test_server.hrl").
--compile({parse_transform,ct_line}).
diff --git a/lib/common_test/src/Makefile b/lib/common_test/src/Makefile
index 84b122b5e4..5b23558a96 100644
--- a/lib/common_test/src/Makefile
+++ b/lib/common_test/src/Makefile
@@ -40,7 +40,6 @@ RELSYSDIR = $(RELEASE_PATH)/lib/common_test-$(VSN)
# ----------------------------------------------------
MODULES= \
- ct_line \
ct \
ct_logs \
ct_framework \
@@ -72,6 +71,7 @@ MODULES= \
ct_hooks_lock
TARGET_MODULES= $(MODULES:%=$(EBIN)/%)
+BEAM_FILES= $(MODULES:%=$(EBIN)/%.$(EMULATOR))
ERL_FILES= $(MODULES:=.erl)
HRL_FILES = \
@@ -97,7 +97,7 @@ ERL_COMPILE_FLAGS += -pa ../ebin -I../include -I $(ERL_TOP)/lib/snmp/include/ \
# ----------------------------------------------------
TARGET_FILES = \
$(GEN_ERL_FILES:%.erl=$(EBIN)/%.$(EMULATOR)) \
- $(MODULES:%=$(EBIN)/%.$(EMULATOR)) \
+ $(BEAM_FILES) \
$(APP_TARGET) $(APPUP_TARGET)
APP_FILE= common_test.app
diff --git a/lib/common_test/src/common_test.app.src b/lib/common_test/src/common_test.app.src
index b42173f412..57606c01db 100644
--- a/lib/common_test/src/common_test.app.src
+++ b/lib/common_test/src/common_test.app.src
@@ -25,7 +25,6 @@
ct_framework,
ct_ftp,
ct_gen_conn,
- ct_line,
ct_logs,
ct_make,
ct_master,
diff --git a/lib/common_test/src/ct_framework.erl b/lib/common_test/src/ct_framework.erl
index 809616d8e3..9e597edf38 100644
--- a/lib/common_test/src/ct_framework.erl
+++ b/lib/common_test/src/ct_framework.erl
@@ -240,7 +240,8 @@ add_defaults(Mod,Func,FuncInfo,DoInit) ->
case (catch Mod:suite()) of
{'EXIT',{undef,_}} ->
SuiteInfo = merge_with_suite_defaults(Mod,[]),
- case add_defaults1(Mod,Func,FuncInfo,SuiteInfo,DoInit) of
+ SuiteInfoNoCTH = [I || I <- SuiteInfo, element(1,I) =/= ct_hooks],
+ case add_defaults1(Mod,Func,FuncInfo,SuiteInfoNoCTH,DoInit) of
Error = {error,_} -> {SuiteInfo,Error};
MergedInfo -> {SuiteInfo,MergedInfo}
end;
@@ -251,10 +252,11 @@ add_defaults(Mod,Func,FuncInfo,DoInit) ->
(_) -> false
end, SuiteInfo) of
true ->
- SuiteInfoNoCTH =
- lists:keydelete(ct_hooks,1,SuiteInfo),
- SuiteInfo1 = merge_with_suite_defaults(Mod,SuiteInfoNoCTH),
- case add_defaults1(Mod,Func,FuncInfo,SuiteInfo1,DoInit) of
+ SuiteInfo1 = merge_with_suite_defaults(Mod,SuiteInfo),
+ SuiteInfoNoCTH = [I || I <- SuiteInfo1,
+ element(1,I) =/= ct_hooks],
+ case add_defaults1(Mod,Func,FuncInfo,
+ SuiteInfoNoCTH,DoInit) of
Error = {error,_} -> {SuiteInfo1,Error};
MergedInfo -> {SuiteInfo1,MergedInfo}
end;
diff --git a/lib/common_test/src/ct_hooks.erl b/lib/common_test/src/ct_hooks.erl
index 984e04b90f..d5b585a831 100644
--- a/lib/common_test/src/ct_hooks.erl
+++ b/lib/common_test/src/ct_hooks.erl
@@ -31,11 +31,11 @@
-export([on_tc_skip/2]).
-export([on_tc_fail/2]).
--type proplist() :: [{atom(),term()}].
-
%% If you change this, remember to update ct_util:look -> stop clause as well.
-define(config_name, ct_hooks).
+-record(ct_hook_config, {id, module, prio, scope, opts = [], state = []}).
+
%% -------------------------------------------------------------------------
%% API Functions
%% -------------------------------------------------------------------------
@@ -44,22 +44,22 @@
-spec init(State :: term()) -> ok |
{error, Reason :: term()}.
init(Opts) ->
- call([{Hook, call_id, undefined} || Hook <- get_new_hooks(Opts)],
- ok, init, []).
+ call(get_new_hooks(Opts, undefined), ok, init, []).
%% @doc Called after all suites are done.
-spec terminate(Hooks :: term()) ->
ok.
terminate(Hooks) ->
- call([{HookId, fun call_terminate/3} || {HookId,_,_} <- Hooks],
+ call([{HookId, fun call_terminate/3}
+ || #ct_hook_config{id = HookId} <- Hooks],
ct_hooks_terminate_dummy, terminate, Hooks),
ok.
%% @doc Called as each test case is started. This includes all configuration
%% tests.
-spec init_tc(Mod :: atom(), Func :: atom(), Args :: list()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()}.
@@ -68,11 +68,11 @@ init_tc(ct_framework, _Func, Args) ->
init_tc(Mod, init_per_suite, Config) ->
Info = try proplists:get_value(ct_hooks, Mod:suite(),[]) of
List when is_list(List) ->
- [{ct_hooks,List}];
+ [{?config_name,List}];
CTHook when is_atom(CTHook) ->
- [{ct_hooks,[CTHook]}]
+ [{?config_name,[CTHook]}]
catch error:undef ->
- [{ct_hooks,[]}]
+ [{?config_name,[]}]
end,
call(fun call_generic/3, Config ++ Info, [pre_init_per_suite, Mod]);
init_tc(Mod, end_per_suite, Config) ->
@@ -92,7 +92,7 @@ init_tc(_Mod, TC, Config) ->
Args :: list(),
Result :: term(),
Resturn :: term()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()} |
@@ -131,36 +131,48 @@ on_tc_fail(_How, {Suite, Case, Reason}) ->
%% -------------------------------------------------------------------------
%% Internal Functions
%% -------------------------------------------------------------------------
-call_id(Mod, Config, Meta) when is_atom(Mod) ->
- call_id({Mod, []}, Config, Meta);
-call_id({Mod, Opts}, Config, Scope) ->
+call_id(#ct_hook_config{ module = Mod, opts = Opts} = Hook, Config, Scope) ->
Id = catch_apply(Mod,id,[Opts], make_ref()),
- {Config, {Id, scope(Scope), {Mod, {Id,Opts}}}}.
+ {Config, Hook#ct_hook_config{ id = Id, scope = scope(Scope)}}.
-call_init({Mod,{Id,Opts}},Config,_Meta) ->
- NewState = Mod:init(Id, Opts),
- {Config, {Mod, NewState}}.
-
-call_terminate({Mod, State}, _, _) ->
+call_init(#ct_hook_config{ module = Mod, opts = Opts, id = Id, prio = P} = Hook,
+ Config,_Meta) ->
+ case Mod:init(Id, Opts) of
+ {ok, NewState} when P =:= undefined ->
+ {Config, Hook#ct_hook_config{ state = NewState, prio = 0 } };
+ {ok, NewState} ->
+ {Config, Hook#ct_hook_config{ state = NewState } };
+ {ok, NewState, Prio} when P =:= undefined ->
+ %% Only set prio if not already set when installing hook
+ {Config, Hook#ct_hook_config{ state = NewState, prio = Prio } };
+ {ok, NewState, _} ->
+ {Config, Hook#ct_hook_config{ state = NewState } };
+ NewState -> %% Keep for backward compatability reasons
+ {Config, Hook#ct_hook_config{ state = NewState } }
+ end.
+
+call_terminate(#ct_hook_config{ module = Mod, state = State} = Hook, _, _) ->
catch_apply(Mod,terminate,[State], ok),
- {[],{Mod,State}}.
+ {[],Hook}.
-call_cleanup({Mod, State}, Reason, [Function, _Suite | Args]) ->
+call_cleanup(#ct_hook_config{ module = Mod, state = State} = Hook,
+ Reason, [Function, _Suite | Args]) ->
NewState = catch_apply(Mod,Function, Args ++ [Reason, State],
State),
- {Reason, {Mod, NewState}}.
+ {Reason, Hook#ct_hook_config{ state = NewState } }.
-call_generic({Mod, State}, Value, [Function | Args]) ->
+call_generic(#ct_hook_config{ module = Mod, state = State} = Hook,
+ Value, [Function | Args]) ->
{NewValue, NewState} = catch_apply(Mod, Function, Args ++ [Value, State],
{Value,State}),
- {NewValue, {Mod, NewState}}.
+ {NewValue, Hook#ct_hook_config{ state = NewState } }.
%% Generic call function
call(Fun, Config, Meta) ->
maybe_lock(),
Hooks = get_hooks(),
- Res = call([{HookId,Fun} || {HookId,_, _} <- Hooks] ++
- get_new_hooks(Config, Fun),
+ Res = call(get_new_hooks(Config, Fun) ++
+ [{HookId,Fun} || #ct_hook_config{id = HookId} <- Hooks],
remove(?config_name,Config), Meta, Hooks),
maybe_unlock(),
Res.
@@ -173,19 +185,20 @@ call(Fun, Config, Meta, NoChangeRet) when is_function(Fun) ->
call([{Hook, call_id, NextFun} | Rest], Config, Meta, Hooks) ->
try
- {Config, {NewId, _, _} = NewHook} = call_id(Hook, Config, Meta),
+ {Config, #ct_hook_config{ id = NewId } = NewHook} =
+ call_id(Hook, Config, Meta),
{NewHooks, NewRest} =
- case lists:keyfind(NewId, 1, Hooks) of
+ case lists:keyfind(NewId, #ct_hook_config.id, Hooks) of
false when NextFun =:= undefined ->
{Hooks ++ [NewHook],
- [{NewId, fun call_init/3} | Rest]};
+ [{NewId, call_init} | Rest]};
ExistingHook when is_tuple(ExistingHook) ->
{Hooks, Rest};
_ ->
{Hooks ++ [NewHook],
- [{NewId, fun call_init/3},{NewId,NextFun} | Rest]}
+ [{NewId, call_init}, {NewId,NextFun} | Rest]}
end,
- call(NewRest, Config, Meta, NewHooks)
+ call(resort(NewRest,NewHooks), Config, Meta, NewHooks)
catch Error:Reason ->
Trace = erlang:get_stacktrace(),
ct_logs:log("Suite Hook","Failed to start a CTH: ~p:~p",
@@ -193,13 +206,16 @@ call([{Hook, call_id, NextFun} | Rest], Config, Meta, Hooks) ->
call([], {fail,"Failed to start CTH"
", see the CT Log for details"}, Meta, Hooks)
end;
+call([{HookId, call_init} | Rest], Config, Meta, Hooks) ->
+ call([{HookId, fun call_init/3} | Rest], Config, Meta, Hooks);
call([{HookId, Fun} | Rest], Config, Meta, Hooks) ->
try
- {_,Scope,ModState} = lists:keyfind(HookId, 1, Hooks),
- {NewConf, NewHookInfo} = Fun(ModState, Config, Meta),
+ Hook = lists:keyfind(HookId, #ct_hook_config.id, Hooks),
+ {NewConf, NewHook} = Fun(Hook, Config, Meta),
NewCalls = get_new_hooks(NewConf, Fun),
- NewHooks = lists:keyreplace(HookId, 1, Hooks, {HookId, Scope, NewHookInfo}),
- call(NewCalls ++ Rest, remove(?config_name, NewConf), Meta,
+ NewHooks = lists:keyreplace(HookId, #ct_hook_config.id, Hooks, NewHook),
+ call(resort(NewCalls ++ Rest,NewHooks), %% Resort if call_init changed prio
+ remove(?config_name, NewConf), Meta,
terminate_if_scope_ends(HookId, Meta, NewHooks))
catch throw:{error_in_cth_call,Reason} ->
call(Rest, {fail, Reason}, Meta,
@@ -237,19 +253,26 @@ terminate_if_scope_ends(HookId, [on_tc_skip,Suite,end_per_suite], Hooks) ->
terminate_if_scope_ends(HookId, [Function,Tag|T], Hooks) when T =/= [] ->
terminate_if_scope_ends(HookId,[Function,Tag],Hooks);
terminate_if_scope_ends(HookId, Function, Hooks) ->
- case lists:keyfind(HookId, 1, Hooks) of
- {HookId, Function, _ModState} = Hook ->
+ case lists:keyfind(HookId, #ct_hook_config.id, Hooks) of
+ #ct_hook_config{ id = HookId, scope = Function} = Hook ->
terminate([Hook]),
- lists:keydelete(HookId, 1, Hooks);
+ lists:keydelete(HookId, #ct_hook_config.id, Hooks);
_ ->
Hooks
end.
%% Fetch hook functions
get_new_hooks(Config, Fun) ->
- lists:foldl(fun(NewHook, Acc) ->
- [{NewHook, call_id, Fun} | Acc]
- end, [], get_new_hooks(Config)).
+ lists:map(fun(NewHook) when is_atom(NewHook) ->
+ {#ct_hook_config{ module = NewHook }, call_id, Fun};
+ ({NewHook,Opts}) ->
+ {#ct_hook_config{ module = NewHook,
+ opts = Opts}, call_id, Fun};
+ ({NewHook,Opts,Prio}) ->
+ {#ct_hook_config{ module = NewHook,
+ opts = Opts,
+ prio = Prio }, call_id, Fun}
+ end, get_new_hooks(Config)).
get_new_hooks(Config) when is_list(Config) ->
lists:flatmap(fun({?config_name, HookConfigs}) ->
@@ -264,7 +287,43 @@ save_suite_data_async(Hooks) ->
ct_util:save_suite_data_async(?config_name, Hooks).
get_hooks() ->
- ct_util:read_suite_data(?config_name).
+ lists:keysort(#ct_hook_config.prio,ct_util:read_suite_data(?config_name)).
+
+%% Sort all calls in this order:
+%% call_id < call_init < Hook Priority 1 < .. < Hook Priority N
+%% If Hook Priority is equal, check when it has been installed and
+%% sort on that instead.
+resort(Calls, Hooks) ->
+ lists:sort(
+ fun({_,_,_},_) ->
+ true;
+ (_,{_,_,_}) ->
+ false;
+ ({_,call_init},_) ->
+ true;
+ (_,{_,call_init}) ->
+ false;
+ ({Id1,_},{Id2,_}) ->
+ P1 = (lists:keyfind(Id1, #ct_hook_config.id, Hooks))#ct_hook_config.prio,
+ P2 = (lists:keyfind(Id2, #ct_hook_config.id, Hooks))#ct_hook_config.prio,
+ if
+ P1 == P2 ->
+ %% If priorities are equal, we check the position in the
+ %% hooks list
+ pos(Id1,Hooks) < pos(Id2,Hooks);
+ true ->
+ P1 < P2
+ end
+ end,Calls).
+
+pos(Id,Hooks) ->
+ pos(Id,Hooks,0).
+pos(Id,[#ct_hook_config{ id = Id}|_],Num) ->
+ Num;
+pos(Id,[_|Rest],Num) ->
+ pos(Id,Rest,Num+1).
+
+
catch_apply(M,F,A, Default) ->
try
@@ -272,7 +331,7 @@ catch_apply(M,F,A, Default) ->
catch error:Reason ->
case erlang:get_stacktrace() of
%% Return the default if it was the CTH module which did not have the function.
- [{M,F,A}|_] when Reason == undef ->
+ [{M,F,A,_}|_] when Reason == undef ->
Default;
Trace ->
ct_logs:log("Suite Hook","Call to CTH failed: ~p:~p",
diff --git a/lib/common_test/src/ct_line.erl b/lib/common_test/src/ct_line.erl
deleted file mode 100644
index 4af9da5463..0000000000
--- a/lib/common_test/src/ct_line.erl
+++ /dev/null
@@ -1,266 +0,0 @@
-%%
-%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2003-2009. All Rights Reserved.
-%%
-%% The contents of this file are subject to the Erlang Public License,
-%% Version 1.1, (the "License"); you may not use this file except in
-%% compliance with the License. You should have received a copy of the
-%% Erlang Public License along with this software. If not, it can be
-%% retrieved online at http://www.erlang.org/.
-%%
-%% Software distributed under the License is distributed on an "AS IS"
-%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-%% the License for the specific language governing rights and limitations
-%% under the License.
-%%
-%% %CopyrightEnd%
-%%
-
-%%% @doc Parse transform for inserting line numbers
-
--module(ct_line).
-
--record(vars, {module, % atom() Module name
- vsn, % atom()
-
- init_info=[], % [{M,F,A,C,L}]
-
- function, % atom()
- arity, % int()
- clause, % int()
- lines, % [int()]
- depth, % int()
- is_guard=false % boolean
- }).
-
--export([parse_transform/2,
- line/1]).
-
-line(LOC={{Mod,Func},_Line}) ->
- Lines = case get(test_server_loc) of
- [{{Mod,Func},_}|Ls] ->
- Ls;
- Ls when is_list(Ls) ->
- case length(Ls) of
- 10 ->
- [_|T]=lists:reverse(Ls),
- lists:reverse(T);
- _ ->
- Ls
- end;
- _ ->
- []
- end,
- put(test_server_loc,[LOC|Lines]).
-
-parse_transform(Forms, _Options) ->
- transform(Forms, _Options).
-
-%% forms(Fs) -> lists:map(fun (F) -> form(F) end, Fs).
-
-transform(Forms, _Options)->
- Vars0 = #vars{},
- {ok, MungedForms, _Vars} = transform(Forms, [], Vars0),
- MungedForms.
-
-
-transform([Form|Forms], MungedForms, Vars) ->
- case munge(Form, Vars) of
- ignore ->
- transform(Forms, MungedForms, Vars);
- {MungedForm, Vars2} ->
- transform(Forms, [MungedForm|MungedForms], Vars2)
- end;
-transform([], MungedForms, Vars) ->
- {ok, lists:reverse(MungedForms), Vars}.
-
-%% This code traverses the abstract code, stored as the abstract_code
-%% chunk in the BEAM file, as described in absform(3) for Erlang/OTP R8B
-%% (Vsn=abstract_v2).
-%% The abstract format after preprocessing differs slightly from the abstract
-%% format given eg using epp:parse_form, this has been noted in comments.
-munge(Form={attribute,_,module,Module}, Vars) ->
- Vars2 = Vars#vars{module=Module},
- {Form, Vars2};
-
-munge({function,0,module_info,_Arity,_Clauses}, _Vars) ->
- ignore; % module_info will be added again when the forms are recompiled
-munge({function,Line,Function,Arity,Clauses}, Vars) ->
- Vars2 = Vars#vars{function=Function,
- arity=Arity,
- clause=1,
- lines=[],
- depth=1},
- {MungedClauses, Vars3} = munge_clauses(Clauses, Vars2, []),
- {{function,Line,Function,Arity,MungedClauses}, Vars3};
-munge(Form, Vars) -> % attributes
- {Form, Vars}.
-
-munge_clauses([{clause,Line,Pattern,Guards,Body}|Clauses], Vars, MClauses) ->
- {MungedGuards, _Vars} = munge_exprs(Guards, Vars#vars{is_guard=true},[]),
-
- case Vars#vars.depth of
- 1 -> % function clause
- {MungedBody, Vars2} = munge_body(Body, Vars#vars{depth=2}, []),
- ClauseInfo = {Vars2#vars.module,
- Vars2#vars.function,
- Vars2#vars.arity,
- Vars2#vars.clause,
- length(Vars2#vars.lines)},
- InitInfo = [ClauseInfo | Vars2#vars.init_info],
- Vars3 = Vars2#vars{init_info=InitInfo,
- clause=(Vars2#vars.clause)+1,
- lines=[],
- depth=1},
- munge_clauses(Clauses, Vars3,
- [{clause,Line,Pattern,MungedGuards,MungedBody}|
- MClauses]);
-
- 2 -> % receive-, case- or if clause
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- munge_clauses(Clauses, Vars2,
- [{clause,Line,Pattern,MungedGuards,MungedBody}|
- MClauses])
- end;
-munge_clauses([], Vars, MungedClauses) ->
- {lists:reverse(MungedClauses), Vars}.
-
-munge_body([Expr|Body], Vars, MungedBody) ->
- %% Here is the place to add a call to cover:bump/6!
- Line = element(2, Expr),
- Lines = Vars#vars.lines,
- case lists:member(Line,Lines) of
- true -> % already a bump at this line!
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_body(Body, Vars2, [MungedExpr|MungedBody]);
- false ->
- Bump = {call, 0, {remote,0,{atom,0,?MODULE},{atom,0,line}},
- [{tuple,0,[{tuple,0,[{atom,0,Vars#vars.module},
- {atom, 0, Vars#vars.function}]},
- {integer, 0, Line}]}]},
- Lines2 = [Line|Lines],
-
- {MungedExpr, Vars2} = munge_expr(Expr, Vars#vars{lines=Lines2}),
- munge_body(Body, Vars2, [MungedExpr,Bump|MungedBody])
- end;
-munge_body([], Vars, MungedBody) ->
- {lists:reverse(MungedBody), Vars}.
-
-munge_expr({match,Line,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{match,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({tuple,Line,Exprs}, Vars) ->
- {MungedExprs, Vars2} = munge_exprs(Exprs, Vars, []),
- {{tuple,Line,MungedExprs}, Vars2};
-munge_expr({record,Line,Expr,Exprs}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprName, Vars2} = munge_expr(Expr, Vars),
- {MungedExprFields, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{record,Line,MungedExprName,MungedExprFields}, Vars3};
-munge_expr({record_field,Line,ExprL,ExprR}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{record_field,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({cons,Line,ExprH,ExprT}, Vars) ->
- {MungedExprH, Vars2} = munge_expr(ExprH, Vars),
- {MungedExprT, Vars3} = munge_expr(ExprT, Vars2),
- {{cons,Line,MungedExprH,MungedExprT}, Vars3};
-munge_expr({op,Line,Op,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{op,Line,Op,MungedExprL,MungedExprR}, Vars3};
-munge_expr({op,Line,Op,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{op,Line,Op,MungedExpr}, Vars2};
-munge_expr({'catch',Line,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{'catch',Line,MungedExpr}, Vars2};
-munge_expr({call,Line1,{remote,Line2,ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==false->
- {MungedExprM, Vars2} = munge_expr(ExprM, Vars),
- {MungedExprF, Vars3} = munge_expr(ExprF, Vars2),
- {MungedExprs, Vars4} = munge_exprs(Exprs, Vars3, []),
- {{call,Line1,{remote,Line2,MungedExprM,MungedExprF},MungedExprs}, Vars4};
-munge_expr({call,Line1,{remote,_Line2,_ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==true ->
- %% Difference in abstract format after preprocessing: BIF calls in guards
- %% are translated to {remote,...} (which is not allowed as source form)
- %% NOT NECESSARY FOR Vsn=raw_abstract_v1
- munge_expr({call,Line1,ExprF,Exprs}, Vars);
-munge_expr({call,Line,Expr,Exprs}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedExprs, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{call,Line,MungedExpr,MungedExprs}, Vars3};
-munge_expr({lc,Line,Expr,LC}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedLC, Vars3} = munge_lc(LC, Vars2, []),
- {{lc,Line,MungedExpr,MungedLC}, Vars3};
-munge_expr({block,Line,Body}, Vars) ->
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- {{block,Line,MungedBody}, Vars2};
-munge_expr({'if',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'if',Line,MungedClauses}, Vars2};
-munge_expr({'case',Line,Expr,Clauses}, Vars) ->
- {MungedExpr,Vars2} = munge_expr(Expr,Vars),
- {MungedClauses,Vars3} = munge_clauses(Clauses, Vars2, []),
- {{'case',Line,MungedExpr,MungedClauses}, Vars3};
-munge_expr({'receive',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'receive',Line,MungedClauses}, Vars2};
-munge_expr({'receive',Line,Clauses,Expr,Body}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {MungedExpr, Vars3} = munge_expr(Expr, Vars2),
- {MungedBody, Vars4} = munge_body(Body, Vars3, []),
- {{'receive',Line,MungedClauses,MungedExpr,MungedBody}, Vars4};
-munge_expr({'try',Line,Exprs,Clauses,CatchClauses}, Vars) ->
- {MungedExprs, Vars1} = munge_exprs(Exprs, Vars, []),
- {MungedClauses, Vars2} = munge_clauses(Clauses, Vars1, []),
- {MungedCatchClauses, Vars3} = munge_clauses(CatchClauses, Vars2, []),
- {{'try',Line,MungedExprs,MungedClauses,MungedCatchClauses}, Vars3};
-%% Difference in abstract format after preprocessing: Funs get an extra
-%% element Extra.
-%% NOT NECESSARY FOR Vsn=raw_abstract_v1
-munge_expr({'fun',Line,{function,Name,Arity},_Extra}, Vars) ->
- {{'fun',Line,{function,Name,Arity}}, Vars};
-munge_expr({'fun',Line,{clauses,Clauses},_Extra}, Vars) ->
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr({'fun',Line,{clauses,Clauses}}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr(Form, Vars) -> % var|char|integer|float|string|atom|nil|bin|eof
- {Form, Vars}.
-
-munge_exprs([Expr|Exprs], Vars, MungedExprs) when Vars#vars.is_guard==true,
- is_list(Expr) ->
- {MungedExpr, _Vars} = munge_exprs(Expr, Vars, []),
- munge_exprs(Exprs, Vars, [MungedExpr|MungedExprs]);
-munge_exprs([Expr|Exprs], Vars, MungedExprs) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_exprs(Exprs, Vars2, [MungedExpr|MungedExprs]);
-munge_exprs([], Vars, MungedExprs) ->
- {lists:reverse(MungedExprs), Vars}.
-
-munge_lc([{generate,Line,Pattern,Expr}|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [{generate,Line,Pattern,MungedExpr}|MungedLC]);
-munge_lc([Expr|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [MungedExpr|MungedLC]);
-munge_lc([], Vars, MungedLC) ->
- {lists:reverse(MungedLC), Vars}.
-
-
-
-
-
-
-
-
-
-
diff --git a/lib/common_test/src/ct_run.erl b/lib/common_test/src/ct_run.erl
index c01e97b358..877ec9c7dd 100644
--- a/lib/common_test/src/ct_run.erl
+++ b/lib/common_test/src/ct_run.erl
@@ -521,8 +521,8 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
- "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
- "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
+ "\n\t[-event_handler EvHandler1 and EvHandler2 .. EvHandlerN]"
+ "\n\t[-ct_hooks CTHook1 and CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
"\n\t[-no_auto_compile]"
"\n\t[-multiply_timetraps N]"
@@ -540,8 +540,8 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
- "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
- "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
+ "\n\t[-event_handler EvHandler1 and EvHandler2 .. EvHandlerN]"
+ "\n\t[-ct_hooks CTHook1 and CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
"\n\t[-no_auto_compile]"
"\n\t[-multiply_timetraps N]"
@@ -2070,15 +2070,21 @@ ct_hooks_args2opts(Args) ->
ct_hooks_args2opts(
proplists:get_value(ct_hooks, Args, []),[]).
+ct_hooks_args2opts([CTH,Arg,Prio,"and"| Rest],Acc) ->
+ ct_hooks_args2opts(Rest,[{list_to_atom(CTH),
+ parse_cth_args(Arg),
+ parse_cth_args(Prio)}|Acc]);
ct_hooks_args2opts([CTH,Arg,"and"| Rest],Acc) ->
ct_hooks_args2opts(Rest,[{list_to_atom(CTH),
- parse_cth_args(Arg)}|Acc]);
+ parse_cth_args(Arg)}|Acc]);
ct_hooks_args2opts([CTH], Acc) ->
ct_hooks_args2opts([CTH,"and"],Acc);
ct_hooks_args2opts([CTH, "and" | Rest], Acc) ->
ct_hooks_args2opts(Rest,[list_to_atom(CTH)|Acc]);
ct_hooks_args2opts([CTH, Args], Acc) ->
ct_hooks_args2opts([CTH, Args, "and"],Acc);
+ct_hooks_args2opts([CTH, Args, Prio], Acc) ->
+ ct_hooks_args2opts([CTH, Args, Prio, "and"],Acc);
ct_hooks_args2opts([],Acc) ->
lists:reverse(Acc).
@@ -2225,7 +2231,14 @@ opts2args(EnvStartOpts) ->
({ct_hooks,CTHs}) when is_list(CTHs) ->
io:format(user,"ct_hooks: ~p",[CTHs]),
Strs = lists:flatmap(
- fun({CTH,Arg}) ->
+ fun({CTH,Arg,Prio}) ->
+ [atom_to_list(CTH),
+ lists:flatten(
+ io_lib:format("~p",[Arg])),
+ lists:flatten(
+ io_lib:format("~p",[Prio])),
+ "and"];
+ ({CTH,Arg}) ->
[atom_to_list(CTH),
lists:flatten(
io_lib:format("~p",[Arg])),
diff --git a/lib/common_test/test/ct_error_SUITE.erl b/lib/common_test/test/ct_error_SUITE.erl
index 6867e59b60..836443009f 100644
--- a/lib/common_test/test/ct_error_SUITE.erl
+++ b/lib/common_test/test/ct_error_SUITE.erl
@@ -280,41 +280,21 @@ test_events(cfg_error) ->
{?eh,tc_start,{cfg_error_2_SUITE,init_per_suite}},
{?eh,tc_done,
{cfg_error_2_SUITE,init_per_suite,
- {failed,{error,{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {failed,{error,{{badmatch,[1,2]},'_'}}}}},
{?eh,tc_auto_skip,
{cfg_error_2_SUITE,tc1,
{failed,{cfg_error_2_SUITE,init_per_suite,
- {'EXIT',{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,[1,2]},'_'}}}}}},
{?eh,test_stats,{0,0,{0,3}}},
{?eh,tc_auto_skip,
{cfg_error_2_SUITE,tc2,
{failed,{cfg_error_2_SUITE,init_per_suite,
- {'EXIT',{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,[1,2]},'_'}}}}}},
{?eh,test_stats,{0,0,{0,4}}},
{?eh,tc_auto_skip,
{cfg_error_2_SUITE,end_per_suite,
{failed,{cfg_error_2_SUITE,init_per_suite,
- {'EXIT',{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,[1,2]},'_'}}}}}},
{?eh,tc_start,{cfg_error_3_SUITE,init_per_suite}},
{?eh,tc_done,
@@ -373,12 +353,7 @@ test_events(cfg_error) ->
{?eh,tc_done,{cfg_error_6_SUITE,{end_per_group,g1,[]},ok}}],
{?eh,tc_start,{cfg_error_6_SUITE,end_per_suite}},
{?eh,tc_done,{cfg_error_6_SUITE,end_per_suite,
- {failed,{error,{{badmatch,[1,2]},
- [{cfg_error_6_SUITE,end_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {failed,{error,{{badmatch,[1,2]},'_'}}}}},
{?eh,tc_start,{cfg_error_7_SUITE,init_per_suite}},
{?eh,tc_done,{cfg_error_7_SUITE,init_per_suite,ok}},
@@ -427,31 +402,16 @@ test_events(cfg_error) ->
[{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g3,[]}}},
{?eh,tc_done,
{cfg_error_8_SUITE,{init_per_group,g3,[]},
- {failed,{error,{{badmatch,42},
- [{cfg_error_8_SUITE,init_per_group,2},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {failed,{error,{{badmatch,42},'_'}}}}},
{?eh,tc_auto_skip,
{cfg_error_8_SUITE,tc1,
{failed,{cfg_error_8_SUITE,init_per_group,
- {'EXIT',{{badmatch,42},
- [{cfg_error_8_SUITE,init_per_group,2},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,42},'_'}}}}}},
{?eh,test_stats,{4,0,{0,13}}},
{?eh,tc_auto_skip,
{cfg_error_8_SUITE,end_per_group,
{failed,{cfg_error_8_SUITE,init_per_group,
- {'EXIT',{{badmatch,42},
- [{cfg_error_8_SUITE,init_per_group,2},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}}],
+ {'EXIT',{{badmatch,42},'_'}}}}}}],
[{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g4,[]}}},
{?eh,tc_done,{cfg_error_8_SUITE,{init_per_group,g4,[]},ok}},
@@ -520,12 +480,7 @@ test_events(cfg_error) ->
{?eh,tc_start,{cfg_error_9_SUITE,tc3}},
{?eh,tc_done,{cfg_error_9_SUITE,tc3,
{skipped,{failed,{cfg_error_9_SUITE,init_per_testcase,
- {{badmatch,undefined},
- [{cfg_error_9_SUITE,init_per_testcase,2},
- {test_server,my_apply,3},
- {test_server,init_per_testcase,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {{badmatch,undefined},'_'}}}}}},
{?eh,test_stats,{9,0,{0,17}}},
{?eh,tc_start,{cfg_error_9_SUITE,tc4}},
{?eh,tc_done,
@@ -640,13 +595,7 @@ test_events(lib_error) ->
{?eh,tc_done,
{lib_error_1_SUITE,lines_error,{failed,
{error,
- {{badmatch,[1,2]},
- [{lib_lines,do_error,0},
- {lib_error_1_SUITE,lines_error,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {{badmatch,[1,2]},'_'}}}}},
{?eh,test_stats,{0,1,{0,0}}},
{?eh,tc_start,{lib_error_1_SUITE,lines_exit}},
{?eh,tc_done,
@@ -665,13 +614,7 @@ test_events(lib_error) ->
{?eh,tc_done,
{lib_error_1_SUITE,no_lines_error,{failed,
{error,
- {{badmatch,[1,2]},
- [{lib_no_lines,do_error,0},
- {lib_error_1_SUITE,no_lines_error,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {{badmatch,[1,2]},'_'}}}}},
{?eh,test_stats,{0,5,{0,0}}},
{?eh,tc_start,{lib_error_1_SUITE,no_lines_exit}},
{?eh,tc_done,
diff --git a/lib/common_test/test/ct_hooks_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE.erl
index 8574d7aabc..5c99f0f9f7 100644
--- a/lib/common_test/test/ct_hooks_SUITE.erl
+++ b/lib/common_test/test/ct_hooks_SUITE.erl
@@ -83,7 +83,7 @@ all(suite) ->
fail_post_suite_cth, skip_pre_suite_cth,
skip_post_suite_cth, recover_post_suite_cth, update_config_cth,
state_update_cth, options_cth, same_id_cth,
- fail_n_skip_with_minimal_cth
+ fail_n_skip_with_minimal_cth, prio_cth
]
)
.
@@ -209,6 +209,11 @@ fail_n_skip_with_minimal_cth(Config) when is_list(Config) ->
do_test(fail_n_skip_with_minimal_cth, "ct_cth_fail_one_skip_one_SUITE.erl",
[minimal_terminate_cth],Config).
+prio_cth(Config) when is_list(Config) ->
+ do_test(prio_cth, "ct_cth_prio_SUITE.erl",
+ [{empty_cth,[1000],1000},{empty_cth,[900],900},
+ {prio_cth,[1100,100],100},{prio_cth,[1100]}],Config).
+
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
%%%-----------------------------------------------------------------
@@ -296,9 +301,9 @@ test_events(two_empty_cth) ->
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
{?eh,cth,{'_',id,[[]]}},
- {?eh,cth,{'_',init,['_',[]]}},
{?eh,cth,{'_',id,[[]]}},
{?eh,cth,{'_',init,['_',[]]}},
+ {?eh,cth,{'_',init,['_',[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
@@ -365,9 +370,9 @@ test_events(minimal_and_maximal_cth) ->
[
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,cth,{'_',id,[[]]}},
{negative,{?eh,cth,{'_',id,['_',[]]}},
{?eh,cth,{'_',init,['_',[]]}}},
- {?eh,cth,{'_',id,[[]]}},
{?eh,cth,{'_',init,['_',[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
@@ -954,8 +959,8 @@ test_events(same_id_cth) ->
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
{?eh,cth,{'_',id,[[]]}},
- {?eh,cth,{'_',init,[same_id_cth,[]]}},
{?eh,cth,{'_',id,[[]]}},
+ {?eh,cth,{'_',init,[same_id_cth,[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
{negative,
@@ -1001,6 +1006,73 @@ test_events(fail_n_skip_with_minimal_cth) ->
{?eh,stop_logging,[]}
];
+test_events(prio_cth) ->
+
+ GenPre = fun(Func,States) ->
+ [{?eh,cth,{'_',Func,['_','_',State]}} ||
+ State <- States]
+ end,
+
+ GenPost = fun(Func,States) ->
+ [{?eh,cth,{'_',Func,['_','_','_',State]}} ||
+ State <- States]
+ end,
+
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}] ++
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,init_per_suite}}] ++
+ GenPre(pre_init_per_suite,
+ [[1100,100],[800],[900],[1000],[1200,1050],[1100],[1200]]) ++
+ GenPost(post_init_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,init_per_suite,ok}},
+
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,{init_per_group,'_',[]}}}] ++
+ GenPre(pre_init_per_group,
+ [[1100,100],[600,200],[600,600],[700],[800],
+ [900],[1000],[1200,1050],[1100],[1200]]) ++
+ GenPost(post_init_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,{init_per_group,'_',[]},ok}}] ++
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,test_case}}] ++
+ GenPre(pre_init_per_testcase,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ GenPost(post_end_per_testcase,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,test_case,ok}},
+
+ {?eh,tc_start,{ct_cth_prio_SUITE,{end_per_group,'_',[]}}}] ++
+ GenPre(pre_end_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ GenPost(post_end_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,{end_per_group,'_',[]},ok}}],
+
+ {?eh,tc_start,{ct_cth_prio_SUITE,end_per_suite}}] ++
+ GenPre(pre_end_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ GenPost(post_end_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
test_events(ok) ->
ok.
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl
new file mode 100644
index 0000000000..d564398cd0
--- /dev/null
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl
@@ -0,0 +1,62 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(ct_cth_prio_SUITE).
+
+%% Note: This directive should only be used in test suites.
+-compile(export_all).
+
+-include("ct.hrl").
+
+suite() ->
+ ([{timetrap, {minutes, 10}},
+ {ct_hooks, [{empty_cth,[800],800},
+ {prio_cth,[1200]},{prio_cth,[1200,1050],1050}]}]).
+
+%% Test server callback functions
+init_per_suite(Config) ->
+ [{ct_hooks, [{empty_cth,[700],700},
+ {prio_cth,[600,600]},
+ {prio_cth,[600,200],200}]}|Config].
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_group(_G, Config) ->
+ [{ct_hooks, [{empty_cth,[600],600},
+ {prio_cth,[900,900]},{prio_cth,[500,900],900}]}|Config].
+
+end_per_group(_G, _Config) ->
+ ok.
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+all() ->
+ [{group,test_group}].
+
+groups() ->
+ [{test_group,[],[test_case]}].
+
+%% Test cases starts here.
+test_case(Config) when is_list(Config) ->
+ ok.
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
index ebebfd18a9..7befcfa57c 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
@@ -59,8 +59,7 @@
-include_lib("common_test/src/ct_util.hrl").
-include_lib("common_test/include/ct_event.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -71,17 +70,17 @@
%% @doc Always called before any other callback function. Use this to initiate
%% any common state. It should return an state for this CTH.
--spec init(Id :: term(), Opts :: proplist()) ->
- State :: #state{}.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
init(Id, Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
data = {?MODULE, init, [Id, Opts]}}),
- Opts.
+ {ok,Opts}.
%% @doc The ID is used to uniquly identify an CTH instance, if two CTH's
%% return the same ID the seconds CTH is ignored. This function should NOT
%% have any side effects as it might be called multiple times by common test.
--spec id(Opts :: proplist()) ->
+-spec id(Opts :: proplists:proplist()) ->
Id :: term().
id(Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl
new file mode 100644
index 0000000000..82511ab0d3
--- /dev/null
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl
@@ -0,0 +1,74 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+
+-module(prio_cth).
+
+
+-include_lib("common_test/src/ct_util.hrl").
+
+
+%% CT Hooks
+-compile(export_all).
+
+id(Opts) ->
+ empty_cth:id(Opts).
+
+init(Id, Opts) ->
+ {ok, [Prio|_] = State} = empty_cth:init(Id, Opts),
+ {ok, State, Prio}.
+
+pre_init_per_suite(Suite, Config, State) ->
+ empty_cth:pre_init_per_suite(Suite,Config,State).
+
+post_init_per_suite(Suite,Config,Return,State) ->
+ empty_cth:post_init_per_suite(Suite,Config,Return,State).
+
+pre_end_per_suite(Suite,Config,State) ->
+ empty_cth:pre_end_per_suite(Suite,Config,State).
+
+post_end_per_suite(Suite,Config,Return,State) ->
+ empty_cth:post_end_per_suite(Suite,Config,Return,State).
+
+pre_init_per_group(Group,Config,State) ->
+ empty_cth:pre_init_per_group(Group,Config,State).
+
+post_init_per_group(Group,Config,Return,State) ->
+ empty_cth:post_init_per_group(Group,Config,Return,State).
+
+pre_end_per_group(Group,Config,State) ->
+ empty_cth:pre_end_per_group(Group,Config,State).
+
+post_end_per_group(Group,Config,Return,State) ->
+ empty_cth:post_end_per_group(Group,Config,Return,State).
+
+pre_init_per_testcase(TC,Config,State) ->
+ empty_cth:pre_init_per_testcase(TC,Config,State).
+
+post_end_per_testcase(TC,Config,Return,State) ->
+ empty_cth:post_end_per_testcase(TC,Config,Return,State).
+
+on_tc_fail(TC, Reason, State) ->
+ empty_cth:on_tc_fail(TC,Reason,State).
+
+on_tc_skip(TC, Reason, State) ->
+ empty_cth:on_tc_skip(TC,Reason,State).
+
+terminate(State) ->
+ empty_cth:terminate(State).
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
index 35c990c0be..9da48d3a4c 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
@@ -29,7 +29,7 @@
init(Id, Opts) ->
State = empty_cth:init(Id, Opts),
- [init|State].
+ {ok, [init|State]}.
pre_init_per_suite(Suite, Config, State) ->
empty_cth:pre_init_per_suite(Suite,Config,State),
diff --git a/lib/common_test/test/ct_repeat_1_SUITE.erl b/lib/common_test/test/ct_repeat_1_SUITE.erl
index 4e842bd6d6..090002d0c2 100644
--- a/lib/common_test/test/ct_repeat_1_SUITE.erl
+++ b/lib/common_test/test/ct_repeat_1_SUITE.erl
@@ -560,12 +560,7 @@ test_events(repeat_cs_until_any_fail) ->
{repeat_1_SUITE,tc_fail_1,
{failed,
{error,
- {{badmatch,2},
- [{repeat_1_SUITE,tc_fail_1,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {{badmatch,2},'_'}}}}},
{?eh,test_stats,{5,2,{0,0}}},
{?eh,tc_start,{repeat_1_SUITE,tc_fail_2}},
{?eh,tc_done,
diff --git a/lib/common_test/test/ct_skip_SUITE.erl b/lib/common_test/test/ct_skip_SUITE.erl
index 4ba4479208..b8be55f43a 100644
--- a/lib/common_test/test/ct_skip_SUITE.erl
+++ b/lib/common_test/test/ct_skip_SUITE.erl
@@ -197,7 +197,7 @@ test_events(auto_skip) ->
{?eh,tc_done,
{auto_skip_3_SUITE,tc1,
{skipped,{failed,{auto_skip_3_SUITE,init_per_testcase,
- {init_per_testcase,tc1,failed}}}}}},
+ {{init_per_testcase,tc1,failed},'_'}}}}}},
{?eh,test_stats,{0,0,{0,4}}},
{?eh,tc_start,{auto_skip_3_SUITE,tc2}},
{?eh,tc_done,{auto_skip_3_SUITE,tc2,ok}},
@@ -364,12 +364,7 @@ test_events(auto_skip) ->
{?eh,tc_done,
{auto_skip_9_SUITE,tc8,
{skipped,{failed,{auto_skip_9_SUITE,init_per_testcase,
- {{badmatch,undefined},
- [{auto_skip_9_SUITE,init_per_testcase,2},
- {test_server,my_apply,3},
- {test_server,init_per_testcase,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {{badmatch,undefined},'_'}}}}}},
{?eh,tc_start,
{auto_skip_9_SUITE,{end_per_group,g5,[parallel]}}},
{?eh,tc_done,
diff --git a/lib/compiler/doc/src/compile.xml b/lib/compiler/doc/src/compile.xml
index 830c89ae84..522c1dc411 100644
--- a/lib/compiler/doc/src/compile.xml
+++ b/lib/compiler/doc/src/compile.xml
@@ -395,6 +395,14 @@ module.beam: module.erl \
<code>-compile({no_auto_import,[error/1]}).</code>
</item>
+ <tag><c>no_line_info</c></tag>
+
+ <item>
+ <p>Omit line number information in order to produce a slightly
+ smaller output file.
+ </p>
+ </item>
+
</taglist>
<p>If warnings are turned on (the <c>report_warnings</c> option
diff --git a/lib/compiler/src/beam_asm.erl b/lib/compiler/src/beam_asm.erl
index 89d64834cf..6e63c4d0f2 100644
--- a/lib/compiler/src/beam_asm.erl
+++ b/lib/compiler/src/beam_asm.erl
@@ -23,7 +23,7 @@
-export([module/4]).
-export([encode/2]).
--import(lists, [map/2,member/2,keymember/3,duplicate/2]).
+-import(lists, [map/2,member/2,keymember/3,duplicate/2,splitwith/2]).
-include("beam_opcodes.hrl").
module(Code, Abst, SourceFile, Opts) ->
@@ -31,22 +31,20 @@ module(Code, Abst, SourceFile, Opts) ->
assemble({Mod,Exp,Attr0,Asm0,NumLabels}, Abst, SourceFile, Opts) ->
{1,Dict0} = beam_dict:atom(Mod, beam_dict:new()),
+ {0,Dict1} = beam_dict:fname(atom_to_list(Mod) ++ ".erl", Dict0),
NumFuncs = length(Asm0),
{Asm,Attr} = on_load(Asm0, Attr0),
- {Code,Dict1} = assemble_1(Asm, Exp, Dict0, []),
- build_file(Code, Attr, Dict1, NumLabels, NumFuncs, Abst, SourceFile, Opts).
+ {Code,Dict2} = assemble_1(Asm, Exp, Dict1, []),
+ build_file(Code, Attr, Dict2, NumLabels, NumFuncs, Abst, SourceFile, Opts).
on_load(Fs0, Attr0) ->
case proplists:get_value(on_load, Attr0) of
undefined ->
{Fs0,Attr0};
[{Name,0}] ->
- Fs = map(fun({function,N,0,Entry,Asm0}) when N =:= Name ->
- [{label,_}=L,
- {func_info,_,_,_}=Fi,
- {label,_}=E|Asm1] = Asm0,
- Asm = [L,Fi,E,on_load|Asm1],
- {function,N,0,Entry,Asm};
+ Fs = map(fun({function,N,0,Entry,Is0}) when N =:= Name ->
+ Is = insert_on_load_instruction(Is0, Entry),
+ {function,N,0,Entry,Is};
(F) ->
F
end, Fs0),
@@ -54,6 +52,13 @@ on_load(Fs0, Attr0) ->
{Fs,Attr}
end.
+insert_on_load_instruction(Is0, Entry) ->
+ {Bef,[{label,Entry}=El|Is]} =
+ splitwith(fun({label,L}) when L =:= Entry -> false;
+ (_) -> true
+ end, Is0),
+ Bef ++ [El,on_load|Is].
+
assemble_1([{function,Name,Arity,Entry,Asm}|T], Exp, Dict0, Acc) ->
Dict1 = case member({Name,Arity}, Exp) of
true ->
@@ -132,7 +137,10 @@ build_file(Code, Attr, Dict, NumLabels, NumFuncs, Abst, SourceFile, Opts) ->
LitTab = iolist_to_binary(zlib:compress(LitTab2)),
chunk(<<"LitT">>, <<(byte_size(LitTab2)):32>>, LitTab)
end,
+
+ %% Create the line chunk.
+ LineChunk = chunk(<<"Line">>, build_line_table(Dict)),
%% Create the attributes and compile info chunks.
@@ -150,8 +158,11 @@ build_file(Code, Attr, Dict, NumLabels, NumFuncs, Abst, SourceFile, Opts) ->
%% Create IFF chunk.
Chunks = case member(slim, Opts) of
- true -> [Essentials,AttrChunk,AbstChunk];
- false -> [Essentials,LocChunk,AttrChunk,CompileChunk,AbstChunk]
+ true ->
+ [Essentials,AttrChunk,AbstChunk];
+ false ->
+ [Essentials,LocChunk,AttrChunk,
+ CompileChunk,AbstChunk,LineChunk]
end,
build_form(<<"BEAM">>, Chunks).
@@ -201,6 +212,31 @@ build_attributes(Opts, SourceFile, Attr, Essentials) ->
Compile = [{options,Opts},{version,?COMPILER_VSN}|Misc],
{term_to_binary(calc_vsn(Attr, Essentials)),term_to_binary(Compile)}.
+build_line_table(Dict) ->
+ {NumLineInstrs,NumFnames0,Fnames0,NumLines,Lines0} =
+ beam_dict:line_table(Dict),
+ NumFnames = NumFnames0 - 1,
+ [_|Fnames1] = Fnames0,
+ Fnames2 = [unicode:characters_to_binary(F) || F <- Fnames1],
+ Fnames = << <<(byte_size(F)):16,F/binary>> || F <- Fnames2 >>,
+ Lines1 = encode_line_items(Lines0, 0),
+ Lines = iolist_to_binary(Lines1),
+ Ver = 0,
+ Bits = 0,
+ <<Ver:32,Bits:32,NumLineInstrs:32,NumLines:32,NumFnames:32,
+ Lines/binary,Fnames/binary>>.
+
+%% encode_line_items([{FnameIndex,Line}], PrevFnameIndex)
+%% Encode the line items compactly. Tag the FnameIndex with
+%% an 'a' tag (atom) and only include it when it has changed.
+%% Tag the line numbers with an 'i' (integer) tag.
+
+encode_line_items([{F,L}|T], F) ->
+ [encode(?tag_i, L)|encode_line_items(T, F)];
+encode_line_items([{F,L}|T], _) ->
+ [encode(?tag_a, F),encode(?tag_i, L)|encode_line_items(T, F)];
+encode_line_items([], _) -> [].
+
%%
%% If the attributes contains no 'vsn' attribute, we'll insert one
%% with an MD5 "checksum" calculated on the code as its value.
@@ -243,6 +279,9 @@ bif_type(_, 2) -> bif2.
make_op({'%',_}, Dict) ->
{[],Dict};
+make_op({line,Location}, Dict0) ->
+ {Index,Dict} = beam_dict:line(Location, Dict0),
+ encode_op(line, [Index], Dict);
make_op({bif, Bif, {f,_}, [], Dest}, Dict) ->
%% BIFs without arguments cannot fail.
encode_op(bif0, [{extfunc, erlang, Bif, 0}, Dest], Dict);
diff --git a/lib/compiler/src/beam_block.erl b/lib/compiler/src/beam_block.erl
index c45874597a..432d1e7eea 100644
--- a/lib/compiler/src/beam_block.erl
+++ b/lib/compiler/src/beam_block.erl
@@ -36,13 +36,14 @@ function({function,Name,Arity,CLabel,Is0}, Lc0) ->
%% Collect basic blocks and optimize them.
Is2 = blockify(Is1),
- Is3 = move_allocates(Is2),
- Is4 = beam_utils:live_opt(Is3),
- Is5 = opt_blocks(Is4),
- Is6 = beam_utils:delete_live_annos(Is5),
+ Is3 = embed_lines(Is2),
+ Is4 = move_allocates(Is3),
+ Is5 = beam_utils:live_opt(Is4),
+ Is6 = opt_blocks(Is5),
+ Is7 = beam_utils:delete_live_annos(Is6),
%% Optimize bit syntax.
- {Is,Lc} = bsm_opt(Is6, Lc0),
+ {Is,Lc} = bsm_opt(Is7, Lc0),
%% Done.
{{function,Name,Arity,CLabel,Is},Lc}
@@ -148,6 +149,24 @@ collect(remove_message) -> {set,[],[],remove_message};
collect({'catch',R,L}) -> {set,[R],[],{'catch',L}};
collect(_) -> error.
+%% embed_lines([Instruction]) -> [Instruction]
+%% Combine blocks that would be split by line/1 instructions.
+%% Also move a line instruction before a block into the block,
+%% but leave the line/1 instruction after a block outside.
+
+embed_lines(Is) ->
+ embed_lines(reverse(Is), []).
+
+embed_lines([{block,B2},{line,_}=Line,{block,B1}|T], Acc) ->
+ B = {block,B1++[{set,[],[],Line}]++B2},
+ embed_lines([B|T], Acc);
+embed_lines([{block,B1},{line,_}=Line|T], Acc) ->
+ B = {block,[{set,[],[],Line}|B1]},
+ embed_lines([B|T], Acc);
+embed_lines([I|Is], Acc) ->
+ embed_lines(Is, [I|Acc]);
+embed_lines([], Acc) -> Acc.
+
opt_blocks([{block,Bl0}|Is]) ->
%% The live annotation at the beginning is not useful.
[{'%live',_}|Bl] = Bl0,
@@ -225,10 +244,12 @@ opt([{set,[Dst],As,{bif,Bif,Fail}}=I1,
RevBif -> [{set,[Dst],As,{bif,RevBif,Fail}}|opt(Is)]
end;
opt([{set,[X],[X],move}|Is]) -> opt(Is);
-opt([{set,[D1],[{integer,Idx1},Reg],{bif,element,{f,0}}}=I1,
+opt([{set,_,_,{line,_}}=Line1,
+ {set,[D1],[{integer,Idx1},Reg],{bif,element,{f,0}}}=I1,
+ {set,_,_,{line,_}}=Line2,
{set,[D2],[{integer,Idx2},Reg],{bif,element,{f,0}}}=I2|Is])
when Idx1 < Idx2, D1 =/= D2, D1 =/= Reg, D2 =/= Reg ->
- opt([I2,I1|Is]);
+ opt([Line2,I2,Line1,I1|Is]);
opt([{set,Ds0,Ss,Op}|Is0]) ->
{Ds,Is} = opt_moves(Ds0, Is0),
[{set,Ds,Ss,Op}|opt(Is)];
diff --git a/lib/compiler/src/beam_bsm.erl b/lib/compiler/src/beam_bsm.erl
index 415864b8e9..1217f7f777 100644
--- a/lib/compiler/src/beam_bsm.erl
+++ b/lib/compiler/src/beam_bsm.erl
@@ -20,7 +20,7 @@
-module(beam_bsm).
-export([module/2,format_error/1]).
--import(lists, [member/2,foldl/3,reverse/1,sort/1,all/2]).
+-import(lists, [member/2,foldl/3,reverse/1,sort/1,all/2,dropwhile/2]).
%%%
%%% We optimize bit syntax matching where the tail end of a binary is
@@ -376,6 +376,8 @@ btb_reaches_match_2([{func_info,_,_,Arity}=I|_], Regs0, D) ->
[] -> D;
_ -> {binary_used_in,I}
end;
+btb_reaches_match_2([{line,_}|Is], Regs, D) ->
+ btb_reaches_match_1(Is, Regs, D);
btb_reaches_match_2([I|_], Regs, _) ->
btb_error({btb_context_regs(Regs),I,not_handled}).
@@ -580,7 +582,10 @@ btb_index(Fs) ->
btb_index_1(Fs, []).
btb_index_1([{function,_,_,Entry,Is0}|Fs], Acc0) ->
- [{label,_},{func_info,_,_,_},{label,Entry}|Is] = Is0,
+ [{label,Entry}|Is] =
+ dropwhile(fun({label,L}) when L =:= Entry -> false;
+ (_) -> true
+ end, Is0),
Acc = btb_index_2(Is, Entry, false, Acc0),
btb_index_1(Fs, Acc);
btb_index_1([], Acc) -> gb_trees:from_orddict(sort(Acc)).
diff --git a/lib/compiler/src/beam_clean.erl b/lib/compiler/src/beam_clean.erl
index 64c93e11f7..a7994ab3b3 100644
--- a/lib/compiler/src/beam_clean.erl
+++ b/lib/compiler/src/beam_clean.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2000-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2000-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -23,9 +23,9 @@
-export([module/2]).
-export([bs_clean_saves/1]).
-export([clean_labels/1]).
--import(lists, [map/2,foldl/3,reverse/1]).
+-import(lists, [map/2,foldl/3,reverse/1,filter/2]).
-module({Mod,Exp,Attr,Fs0,_}, _Opt) ->
+module({Mod,Exp,Attr,Fs0,_}, Opts) ->
Order = [Lbl || {function,_,_,Lbl,_} <- Fs0],
All = foldl(fun({function,_,_,Lbl,_}=Func,D) -> dict:store(Lbl, Func, D) end,
dict:new(), Fs0),
@@ -33,7 +33,8 @@ module({Mod,Exp,Attr,Fs0,_}, _Opt) ->
Used = find_all_used(WorkList, All, sets:from_list(WorkList)),
Fs1 = remove_unused(Order, Used, All),
{Fs2,Lc} = clean_labels(Fs1),
- Fs = bs_fix(Fs2),
+ Fs3 = bs_fix(Fs2),
+ Fs = maybe_remove_lines(Fs3, Opts),
{ok,{Mod,Exp,Attr,Fs,Lc}}.
%% Remove all bs_save2/2 instructions not referenced by a bs_restore2/2.
@@ -375,3 +376,20 @@ bs_clean_saves_1([{bs_save2,_,{_,_}=SavePoint}=I|Is], Needed, Acc) ->
bs_clean_saves_1([I|Is], Needed, Acc) ->
bs_clean_saves_1(Is, Needed, [I|Acc]);
bs_clean_saves_1([], _, Acc) -> reverse(Acc).
+
+%%%
+%%% Remove line instructions if requested.
+%%%
+
+maybe_remove_lines(Fs, Opts) ->
+ case proplists:get_bool(no_line_info, Opts) of
+ false -> Fs;
+ true -> remove_lines(Fs)
+ end.
+
+remove_lines([{function,N,A,Lbl,Is0}|T]) ->
+ Is = filter(fun({line,_}) -> false;
+ (_) -> true
+ end, Is0),
+ [{function,N,A,Lbl,Is}|remove_lines(T)];
+remove_lines([]) -> [].
diff --git a/lib/compiler/src/beam_dead.erl b/lib/compiler/src/beam_dead.erl
index 1365f3d20a..9f81a6ab43 100644
--- a/lib/compiler/src/beam_dead.erl
+++ b/lib/compiler/src/beam_dead.erl
@@ -144,9 +144,9 @@ function({function,Name,Arity,CLabel,Is0}, Lc0) ->
%% Initialize label information with the code
%% for the func_info label. Without it, a register
%% may seem to be live when it is not.
- [{label,L},{func_info,_,_,_}=FI|_] = Is1,
+ [{label,L}|FiIs] = Is1,
D0 = beam_utils:empty_label_index(),
- D = beam_utils:index_label(L, [FI], D0),
+ D = beam_utils:index_label(L, FiIs, D0),
%% Optimize away dead code.
{Is2,Lc} = forward(Is1, Lc0),
@@ -185,6 +185,8 @@ split_block([{set,[R],As,{alloc,Live,{gc_bif,N,{f,Lbl}=Fail}}}|Is], Bl, Acc)
split_block(Is, [], [{gc_bif,N,Fail,Live,As,R}|make_block(Bl, Acc)]);
split_block([{set,[R],[],{'catch',L}}|Is], Bl, Acc) ->
split_block(Is, [], [{'catch',R,L}|make_block(Bl, Acc)]);
+split_block([{set,[],[],{line,_}=Line}|Is], Bl, Acc) ->
+ split_block(Is, [], [Line|make_block(Bl, Acc)]);
split_block([I|Is], Bl, Acc) ->
split_block(Is, [I|Bl], Acc);
split_block([], Bl, Acc) -> make_block(Bl, Acc).
@@ -406,7 +408,7 @@ backward([{test,Op,{f,To0},Live,Ops0,Dst}|Is], D, Acc) ->
end,
I = {test,Op,{f,To},Live,Ops0,Dst},
backward(Is, D, [I|Acc]);
-backward([{kill,_}=I|Is], D, [Exit|_]=Acc) ->
+backward([{kill,_}=I|Is], D, [{line,_},Exit|_]=Acc) ->
case beam_jump:is_exit_instruction(Exit) of
false -> backward(Is, D, [I|Acc]);
true -> backward(Is, D, Acc)
@@ -471,7 +473,7 @@ shortcut_fail_label(To0, Reg, Val, D) ->
shortcut_boolean_label(To0, Reg, Bool0, D) when is_boolean(Bool0) ->
case beam_utils:code_at(To0, D) of
- [{bif,'not',_,[Reg],Reg},{jump,{f,To}}|_] ->
+ [{line,_},{bif,'not',_,[Reg],Reg},{jump,{f,To}}|_] ->
Bool = not Bool0,
{shortcut_select_label(To, Reg, Bool, D),Bool};
_ ->
diff --git a/lib/compiler/src/beam_dict.erl b/lib/compiler/src/beam_dict.erl
index c50ed28aa9..ee76623976 100644
--- a/lib/compiler/src/beam_dict.erl
+++ b/lib/compiler/src/beam_dict.erl
@@ -22,9 +22,10 @@
-export([new/0,opcode/2,highest_opcode/1,
atom/2,local/4,export/4,import/4,
- string/2,lambda/5,literal/2,
+ string/2,lambda/5,literal/2,line/2,fname/2,
atom_table/1,local_table/1,export_table/1,import_table/1,
- string_table/1,lambda_table/1,literal_table/1]).
+ string_table/1,lambda_table/1,literal_table/1,
+ line_table/1]).
-type label() :: non_neg_integer().
@@ -36,6 +37,9 @@
strings = <<>> :: binary(), %String pool
lambdas = [], %[{...}]
literals = dict:new() :: dict(), %Format: {Literal,Number}
+ fnames = gb_trees:empty() :: gb_tree(), %{Name,Index}
+ lines = gb_trees:empty() :: gb_tree(), %{{Fname,Line},Index}
+ num_lines = 0 :: non_neg_integer(), %Number of line instructions
next_import = 0 :: non_neg_integer(),
string_offset = 0 :: non_neg_integer(),
next_literal = 0 :: non_neg_integer(),
@@ -152,6 +156,36 @@ literal(Lit, #asm{literals=Tab0,next_literal=NextIndex}=Dict) ->
{NextIndex,Dict#asm{literals=Tab,next_literal=NextIndex+1}}
end.
+%% Returns the index for a line instruction (adding information
+%% to the location information table).
+-spec line(list(), bdict()) -> {non_neg_integer(), bdict()}.
+
+line([], #asm{num_lines=N}=Dict) ->
+ %% No location available. Return the special pre-defined
+ %% index 0.
+ {0,Dict#asm{num_lines=N+1}};
+line([{location,Name,Line}], #asm{lines=Lines0,num_lines=N}=Dict0) ->
+ {FnameIndex,Dict1} = fname(Name, Dict0),
+ case gb_trees:lookup({FnameIndex,Line}, Lines0) of
+ {value,Index} ->
+ {Index,Dict1#asm{num_lines=N+1}};
+ none ->
+ Index = gb_trees:size(Lines0) + 1,
+ Lines = gb_trees:insert({FnameIndex,Line}, Index, Lines0),
+ Dict = Dict1#asm{lines=Lines,num_lines=N+1},
+ {Index,Dict}
+ end.
+
+fname(Name, #asm{fnames=Fnames0}=Dict) ->
+ case gb_trees:lookup(Name, Fnames0) of
+ {value,Index} ->
+ {Index,Dict};
+ none ->
+ Index = gb_trees:size(Fnames0),
+ Fnames = gb_trees:insert(Name, Index, Fnames0),
+ {Index,Dict#asm{fnames=Fnames}}
+ end.
+
%% Returns the atom table.
%% atom_table(Dict) -> {LastIndex,[Length,AtomString...]}
-spec atom_table(bdict()) -> {non_neg_integer(), [[non_neg_integer(),...]]}.
@@ -219,6 +253,21 @@ literal_table(#asm{literals=Tab,next_literal=NumLiterals}) ->
my_term_to_binary(Term) ->
term_to_binary(Term, [{minor_version,1}]).
+%% Return the line table.
+-spec line_table(bdict()) ->
+ {non_neg_integer(), %Number of line instructions.
+ non_neg_integer(),[string()],
+ non_neg_integer(),[{non_neg_integer(),non_neg_integer()}]}.
+
+line_table(#asm{fnames=Fnames0,lines=Lines0,num_lines=NumLineInstrs}) ->
+ NumFnames = gb_trees:size(Fnames0),
+ Fnames1 = lists:keysort(2, gb_trees:to_list(Fnames0)),
+ Fnames = [Name || {Name,_} <- Fnames1],
+ NumLines = gb_trees:size(Lines0),
+ Lines1 = lists:keysort(2, gb_trees:to_list(Lines0)),
+ Lines = [L || {L,_} <- Lines1],
+ {NumLineInstrs,NumFnames,Fnames,NumLines,Lines}.
+
%% Search for binary string Str in the binary string pool Pool.
%% old_string(Str, Pool) -> none | Index
-spec old_string(binary(), binary()) -> 'none' | pos_integer().
diff --git a/lib/compiler/src/beam_disasm.erl b/lib/compiler/src/beam_disasm.erl
index 017ca129b0..410233a0f7 100644
--- a/lib/compiler/src/beam_disasm.erl
+++ b/lib/compiler/src/beam_disasm.erl
@@ -296,6 +296,8 @@ get_function_chunks(Code) ->
labels_r([], R) -> {R, []};
labels_r([{label,_}=I|Is], R) ->
labels_r(Is, [I|R]);
+labels_r([{line,_}=I|Is], R) ->
+ labels_r(Is, [I|R]);
labels_r(Is, R) -> {R, Is}.
get_funs({[],[]}) -> [];
@@ -335,20 +337,17 @@ local_labels(Funs) ->
local_labels_1(function__code(F), R)
end, [], Funs)).
-%% The first clause below attempts to provide some (limited form of)
-%% backwards compatibility; it is not needed for .beam files generated
-%% by the R8 compiler. The clause should one fine day be taken out.
-local_labels_1([{label,_}|[{label,_}|_]=Code], R) ->
- local_labels_1(Code, R);
-local_labels_1([{label,_},{func_info,{atom,M},{atom,F},A}|Code], R)
- when is_atom(M), is_atom(F) ->
- local_labels_2(Code, R, M, F, A);
-local_labels_1(Code, _) ->
- ?exit({'local_labels: no label in code',Code}).
+local_labels_1(Code0, R) ->
+ Code1 = lists:dropwhile(fun({label,_}) -> true;
+ ({line,_}) -> true;
+ ({func_info,_,_,_}) -> false
+ end, Code0),
+ [{func_info,{atom,M},{atom,F},A}|Code] = Code1,
+ local_labels_2(Code, R, {M,F,A}).
-local_labels_2([{label,[{u,L}]}|Code], R, M, F, A) ->
- local_labels_2(Code, [{L,{M,F,A}}|R], M, F, A);
-local_labels_2(_, R, _, _, _) -> R.
+local_labels_2([{label,[{u,L}]}|Code], R, MFA) ->
+ local_labels_2(Code, [{L,MFA}|R], MFA);
+local_labels_2(_, R, _) -> R.
%%-----------------------------------------------------------------------
%% Disassembles a single BEAM instruction; most instructions are handled
@@ -1105,6 +1104,12 @@ resolve_inst({recv_set,[Lbl]},_,_,_) ->
{recv_set,Lbl};
%%
+%% R15A.
+%%
+resolve_inst({line,[Index]},_,_,_) ->
+ {line,resolve_arg(Index)};
+
+%%
%% Catches instructions that are not yet handled.
%%
resolve_inst(X,_,_,_) -> ?exit({resolve_inst,X}).
diff --git a/lib/compiler/src/beam_jump.erl b/lib/compiler/src/beam_jump.erl
index 3cab55c4cb..537f8ca81b 100644
--- a/lib/compiler/src/beam_jump.erl
+++ b/lib/compiler/src/beam_jump.erl
@@ -169,7 +169,7 @@ share_1([{label,L}=Lbl|Is], Dict0, Seq, Acc) ->
share_1(Is, Dict0, [], [Lbl,{jump,{f,Label}}|Acc])
end;
share_1([{func_info,_,_,_}=I|Is], _, [], Acc) ->
- Is++[I|Acc];
+ reverse(Is, [I|Acc]);
share_1([I|Is], Dict, Seq, Acc) ->
case is_unreachable_after(I) of
false ->
@@ -206,25 +206,35 @@ is_label(_) -> false.
move(Is) ->
move_1(Is, [], []).
-move_1([I|Is], End, Acc) ->
+move_1([I|Is], End0, Acc0) ->
case is_exit_instruction(I) of
- false -> move_1(Is, End, [I|Acc]);
- true -> move_2(I, Is, End, Acc)
+ false ->
+ move_1(Is, End0, [I|Acc0]);
+ true ->
+ case extract_seq(Acc0, [I|End0]) of
+ no ->
+ move_1(Is, End0, [I|Acc0]);
+ {yes,End,Acc} ->
+ move_1(Is, End, Acc)
+ end
end;
-move_1([], End, Acc) ->
- reverse(Acc, reverse(End)).
-
-move_2(Exit, Is, End, [{block,_},{label,_},{func_info,_,_,_}|_]=Acc) ->
- move_1(Is, End, [Exit|Acc]);
-move_2(Exit, Is, End, [{block,_}=Blk,{label,_}=Lbl,Unreachable|More]) ->
- move_1([Unreachable|Is], [Exit,Blk,Lbl|End], More);
-move_2(Exit, Is, End, [{bs_context_to_binary,_}=Bs,{label,_}=Lbl,
- Unreachable|More]) ->
- move_1([Unreachable|Is], [Exit,Bs,Lbl|End], More);
-move_2(Exit, Is, End, [{label,_}=Lbl,Unreachable|More]) ->
- move_1([Unreachable|Is], [Exit,Lbl|End], More);
-move_2(Exit, Is, End, Acc) ->
- move_1(Is, End, [Exit|Acc]).
+move_1([], End, Acc) -> reverse(Acc, End).
+
+extract_seq([{line,_}=Line|Is], Acc) ->
+ extract_seq(Is, [Line|Acc]);
+extract_seq([{block,_}=Bl|Is], Acc) ->
+ extract_seq_1(Is, [Bl|Acc]);
+extract_seq([{label,_}|_]=Is, Acc) ->
+ extract_seq_1(Is, Acc);
+extract_seq(_, _) -> no.
+
+extract_seq_1([{line,_}=Line|Is], Acc) ->
+ extract_seq_1(Is, [Line|Acc]);
+extract_seq_1([{label,_},{func_info,_,_,_}|_], _) ->
+ no;
+extract_seq_1([{label,_}=Lbl|Is], Acc) ->
+ {yes,[Lbl|Acc],Is};
+extract_seq_1(_, _) -> no.
%%%
%%% (3) (4) (5) (6) Jump and unreachable code optimizations.
@@ -454,6 +464,7 @@ is_label_used_in_2({set,_,_,Info}, Lbl) ->
{put_tuple,_} -> false;
{get_tuple_element,_} -> false;
{set_tuple_element,_} -> false;
+ {line,_} -> false;
_ when is_atom(Info) -> false
end.
@@ -487,6 +498,8 @@ rem_unused([], _, Acc) -> reverse(Acc).
initial_labels(Is) ->
initial_labels(Is, []).
+initial_labels([{line,_}|Is], Acc) ->
+ initial_labels(Is, Acc);
initial_labels([{label,Lbl}|Is], Acc) ->
initial_labels(Is, [Lbl|Acc]);
initial_labels([{func_info,_,_,_},{label,Lbl}|_], Acc) ->
diff --git a/lib/compiler/src/beam_listing.erl b/lib/compiler/src/beam_listing.erl
index be7b14c3dd..2941f6135c 100644
--- a/lib/compiler/src/beam_listing.erl
+++ b/lib/compiler/src/beam_listing.erl
@@ -61,7 +61,7 @@ print_op(Stream, Label) when element(1, Label) == label ->
print_op(Stream, Op) ->
io:format(Stream, " ~p.\n", [Op]).
-function(File, {function,Name,Arity,Args,Body,Vdb}) ->
+function(File, {function,Name,Arity,Args,Body,Vdb,_Anno}) ->
io:nl(File),
io:format(File, "function ~p/~p.\n", [Name,Arity]),
io:format(File, " ~p.\n", [Args]),
diff --git a/lib/compiler/src/beam_receive.erl b/lib/compiler/src/beam_receive.erl
index 9ed44ad5d7..c483d85a97 100644
--- a/lib/compiler/src/beam_receive.erl
+++ b/lib/compiler/src/beam_receive.erl
@@ -175,6 +175,8 @@ opt_update_regs({label,Lbl}, R, L) ->
end;
opt_update_regs({try_end,_}, R, L) ->
{R,L};
+opt_update_regs({line,_}, R, L) ->
+ {R,L};
opt_update_regs(_I, _R, L) ->
%% Unrecognized instruction. Abort the search.
{regs_init(),L}.
diff --git a/lib/compiler/src/beam_trim.erl b/lib/compiler/src/beam_trim.erl
index 790aba0a9a..25e6ffbb73 100644
--- a/lib/compiler/src/beam_trim.erl
+++ b/lib/compiler/src/beam_trim.erl
@@ -222,7 +222,9 @@ remap([{call_last,Ar,Name,N}|Is], Map, Acc) ->
reverse(Acc, [I|Is]);
remap([{call_ext_last,Ar,Name,N}|Is], Map, Acc) ->
I = {call_ext_last,Ar,Name,Map({frame_size,N})},
- reverse(Acc, [I|Is]).
+ reverse(Acc, [I|Is]);
+remap([{line,_}=I|Is], Map, Acc) ->
+ remap(Is, Map, [I|Acc]).
remap_block([{set,Ds0,Ss0,Info}|Is], Map, Acc) ->
Ds = [Map(D) || D <- Ds0],
@@ -230,14 +232,15 @@ remap_block([{set,Ds0,Ss0,Info}|Is], Map, Acc) ->
remap_block(Is, Map, [{set,Ds,Ss,Info}|Acc]);
remap_block([], _, Acc) -> reverse(Acc).
-safe_labels([{label,L},{badmatch,{Tag,_}}|Is], Acc) when Tag =/= y ->
+safe_labels([{label,L},{line,_},{badmatch,{Tag,_}}|Is], Acc) when Tag =/= y ->
safe_labels(Is, [L|Acc]);
-safe_labels([{label,L},{case_end,{Tag,_}}|Is], Acc) when Tag =/= y ->
+safe_labels([{label,L},{line,_},{case_end,{Tag,_}}|Is], Acc) when Tag =/= y ->
safe_labels(Is, [L|Acc]);
-safe_labels([{label,L},if_end|Is], Acc) ->
+safe_labels([{label,L},{line,_},if_end|Is], Acc) ->
safe_labels(Is, [L|Acc]);
safe_labels([{label,L},
{block,[{set,[{x,0}],[{Tag,_}],move}]},
+ {line,_},
{call_ext,1,{extfunc,erlang,error,1}}|Is], Acc) when Tag =/= y ->
safe_labels(Is, [L|Acc]);
safe_labels([_|Is], Acc) ->
@@ -321,6 +324,8 @@ frame_size([{make_fun2,_,_,_,_}|Is], Safe) ->
frame_size([{deallocate,N}|_], _) -> N;
frame_size([{call_last,_,_,N}|_], _) -> N;
frame_size([{call_ext_last,_,_,N}|_], _) -> N;
+frame_size([{line,_}|Is], Safe) ->
+ frame_size(Is, Safe);
frame_size([_|_], _) -> throw(not_possible).
frame_size_branch(0, Is, Safe) ->
diff --git a/lib/compiler/src/beam_type.erl b/lib/compiler/src/beam_type.erl
index f83f73b224..7fdb8d072a 100644
--- a/lib/compiler/src/beam_type.erl
+++ b/lib/compiler/src/beam_type.erl
@@ -400,6 +400,7 @@ update({call_ext,3,{extfunc,erlang,setelement,3}}, Ts0) ->
update({call,_Arity,_Func}, Ts) -> tdb_kill_xregs(Ts);
update({call_ext,_Arity,_Func}, Ts) -> tdb_kill_xregs(Ts);
update({make_fun2,_,_,_,_}, Ts) -> tdb_kill_xregs(Ts);
+update({line,_}, Ts) -> Ts;
%% The instruction is unknown. Kill all information.
update(_I, _Ts) -> tdb_new().
diff --git a/lib/compiler/src/beam_utils.erl b/lib/compiler/src/beam_utils.erl
index 45cdf8a659..f281ad5eac 100644
--- a/lib/compiler/src/beam_utils.erl
+++ b/lib/compiler/src/beam_utils.erl
@@ -26,7 +26,7 @@
code_at/2,bif_to_test/3,is_pure_test/1,
live_opt/1,delete_live_annos/1,combine_heap_needs/2]).
--import(lists, [member/2,sort/1,reverse/1]).
+-import(lists, [member/2,sort/1,reverse/1,splitwith/2]).
-record(live,
{bl, %Block check fun.
@@ -195,10 +195,14 @@ is_pure_test({test,Op,_,Ops}) ->
%% Also insert {'%live',Live} annotations at the beginning
%% and end of each block.
%%
-live_opt([{label,Fail}=I1,
- {func_info,_,_,Live}=I2|Is]) ->
+live_opt(Is0) ->
+ {[{label,Fail}|_]=Bef,[Fi|Is]} =
+ splitwith(fun({func_info,_,_,_}) -> false;
+ (_) -> true
+ end, Is0),
+ {func_info,_,_,Live} = Fi,
D = gb_trees:insert(Fail, live_call(Live), gb_trees:empty()),
- [I1,I2|live_opt(reverse(Is), 0, D, [])].
+ Bef ++ [Fi|live_opt(reverse(Is), 0, D, [])].
%% delete_live_annos([Instruction]) -> [Instruction].
@@ -499,6 +503,8 @@ check_liveness(R, [{loop_rec,{f,_},{x,0}}|_], St) ->
end;
check_liveness(R, [{loop_rec_end,{f,Fail}}|_], St) ->
check_liveness_at(R, Fail, St);
+check_liveness(R, [{line,_}|Is], St) ->
+ check_liveness(R, Is, St);
check_liveness(_R, Is, St) when is_list(Is) ->
%% case Is of
%% [I|_] ->
@@ -799,6 +805,8 @@ live_opt([{wait,_}=I|Is], Regs, D, Acc) ->
live_opt(Is, Regs, D, [I|Acc]);
live_opt([{wait_timeout,_,{Tag,_}}=I|Is], Regs, D, Acc) when Tag =/= x ->
live_opt(Is, Regs, D, [I|Acc]);
+live_opt([{line,_}=I|Is], Regs, D, Acc) ->
+ live_opt(Is, Regs, D, [I|Acc]);
%% The following instructions can occur if the "compilation" has been
%% started from a .S file using the 'asm' option.
diff --git a/lib/compiler/src/beam_validator.erl b/lib/compiler/src/beam_validator.erl
index fb267b35b6..fe3b1680d9 100644
--- a/lib/compiler/src/beam_validator.erl
+++ b/lib/compiler/src/beam_validator.erl
@@ -166,12 +166,17 @@ validate(Module, Fs) ->
Ft = index_bs_start_match(Fs, []),
validate_0(Module, Fs, Ft).
-index_bs_start_match([{function,_,_,Entry,Code}|Fs], Acc0) ->
+index_bs_start_match([{function,_,_,Entry,Code0}|Fs], Acc0) ->
+ Code = dropwhile(fun({label,L}) when L =:= Entry -> false;
+ (_) -> true
+ end, Code0),
case Code of
- [_,_,{label,Entry}|Is] ->
+ [{label,Entry}|Is] ->
Acc = index_bs_start_match_1(Is, Entry, Acc0),
index_bs_start_match(Fs, Acc);
_ ->
+ %% Something serious is wrong. Ignore it for now.
+ %% It will be detected and diagnosed later.
index_bs_start_match(Fs, Acc0)
end;
index_bs_start_match([], Acc) ->
@@ -292,6 +297,8 @@ labels(Is) ->
labels_1([{label,L}|Is], R) ->
labels_1(Is, [L|R]);
+labels_1([{line,_}|Is], R) ->
+ labels_1(Is, R);
labels_1(Is, R) ->
{lists:reverse(R),Is}.
@@ -433,6 +440,8 @@ valfun_1(remove_message, Vst) ->
Vst;
valfun_1({'%',_}, Vst) ->
Vst;
+valfun_1({line,_}, Vst) ->
+ Vst;
%% Exception generating calls
valfun_1({call_ext,Live,Func}=I, Vst) ->
case return_type(Func, Vst) of
@@ -870,6 +879,8 @@ val_dsetel({set_tuple_element,_,_,_}, #vst{current=#st{setelem=false}}) ->
error(illegal_context_for_set_tuple_element);
val_dsetel({set_tuple_element,_,_,_}, #vst{current=#st{setelem=true}}=Vst) ->
Vst;
+val_dsetel({line,_}, Vst) ->
+ Vst;
val_dsetel(_, #vst{current=#st{setelem=true}=St}=Vst) ->
Vst#vst{current=St#st{setelem=false}};
val_dsetel(_, Vst) -> Vst.
diff --git a/lib/compiler/src/compile.erl b/lib/compiler/src/compile.erl
index ce8a5bf864..29c7ec0dcd 100644
--- a/lib/compiler/src/compile.erl
+++ b/lib/compiler/src/compile.erl
@@ -171,9 +171,9 @@ expand_opt(report, Os) ->
expand_opt(return, Os) ->
[return_errors,return_warnings|Os];
expand_opt(r12, Os) ->
- [no_recv_opt|Os];
+ [no_recv_opt,no_line_info|Os];
expand_opt(r13, Os) ->
- [no_recv_opt|Os];
+ [no_recv_opt,no_line_info|Os];
expand_opt({debug_info_key,_}=O, Os) ->
[encrypt_debug_info,O|Os];
expand_opt(no_float_opt, Os) ->
@@ -1426,6 +1426,8 @@ iofile(File) when is_atom(File) ->
iofile(File) ->
{filename:dirname(File), filename:basename(File, ".erl")}.
+erlfile(".", Base, Suffix) ->
+ Base ++ Suffix;
erlfile(Dir, Base, Suffix) ->
filename:join(Dir, Base ++ Suffix).
diff --git a/lib/compiler/src/genop.tab b/lib/compiler/src/genop.tab
index 63527bda8f..39c1e8297f 100644
--- a/lib/compiler/src/genop.tab
+++ b/lib/compiler/src/genop.tab
@@ -280,3 +280,7 @@ BEAM_FORMAT_NUMBER=0
150: recv_mark/1
151: recv_set/1
152: gc_bif3/7
+
+# R15A
+
+153: line/1
diff --git a/lib/compiler/src/v3_codegen.erl b/lib/compiler/src/v3_codegen.erl
index 55e3c58d2a..e7dae67085 100644
--- a/lib/compiler/src/v3_codegen.erl
+++ b/lib/compiler/src/v3_codegen.erl
@@ -79,9 +79,10 @@ module({Mod,Exp,Attr,Forms}, Options) ->
functions(Forms, AtomMod) ->
mapfoldl(fun (F, St) -> function(F, AtomMod, St) end, #cg{lcount=1}, Forms).
-function({function,Name,Arity,Asm0,Vb,Vdb}, AtomMod, St0) ->
+function({function,Name,Arity,Asm0,Vb,Vdb,Anno}, AtomMod, St0) ->
try
- {Asm,EntryLabel,St} = cg_fun(Vb, Asm0, Vdb, AtomMod, {Name,Arity}, St0),
+ {Asm,EntryLabel,St} = cg_fun(Vb, Asm0, Vdb, AtomMod,
+ {Name,Arity}, Anno, St0),
Func = {function,Name,Arity,EntryLabel,Asm},
{Func,St}
catch
@@ -93,7 +94,7 @@ function({function,Name,Arity,Asm0,Vb,Vdb}, AtomMod, St0) ->
%% cg_fun([Lkexpr], [HeadVar], Vdb, State) -> {[Ainstr],State}
-cg_fun(Les, Hvs, Vdb, AtomMod, NameArity, St0) ->
+cg_fun(Les, Hvs, Vdb, AtomMod, NameArity, Anno, St0) ->
{Fi,St1} = new_label(St0), %FuncInfo label
{Fl,St2} = local_func_label(NameArity, St1),
@@ -129,7 +130,7 @@ cg_fun(Les, Hvs, Vdb, AtomMod, NameArity, St0) ->
ultimate_failure=UltimateMatchFail,
is_top_block=true}),
{Name,Arity} = NameArity,
- Asm = [{label,Fi},{func_info,AtomMod,{atom,Name},Arity},
+ Asm = [{label,Fi},line(Anno),{func_info,AtomMod,{atom,Name},Arity},
{label,Fl}|B++[{label,UltimateMatchFail},if_end]],
{Asm,Fl,St}.
@@ -307,23 +308,23 @@ match_fail_cg({badmatch,Term}, Le, Vdb, Bef, St) ->
R = cg_reg_arg(Term, Bef),
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis ++ [{badmatch,R}],
+ {Sis ++ [line(Le),{badmatch,R}],
Int#sr{reg=clear_regs(Int0#sr.reg)},St};
match_fail_cg({case_clause,Reason}, Le, Vdb, Bef, St) ->
R = cg_reg_arg(Reason, Bef),
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis++[{case_end,R}],
+ {Sis++[line(Le),{case_end,R}],
Int#sr{reg=clear_regs(Bef#sr.reg)},St};
match_fail_cg(if_clause, Le, Vdb, Bef, St) ->
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int1} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis++[if_end],Int1#sr{reg=clear_regs(Int1#sr.reg)},St};
+ {Sis++[line(Le),if_end],Int1#sr{reg=clear_regs(Int1#sr.reg)},St};
match_fail_cg({try_clause,Reason}, Le, Vdb, Bef, St) ->
R = cg_reg_arg(Reason, Bef),
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis ++ [{try_case_end,R}],
+ {Sis ++ [line(Le),{try_case_end,R}],
Int#sr{reg=clear_regs(Int0#sr.reg)},St}.
%% bsm_rename_ctx([Clause], Var) -> [Clause]
@@ -1047,7 +1048,7 @@ call_cg({var,_V} = Var, As, Rs, Le, Vdb, Bef, St0) ->
%% Build complete code and final stack/register state.
Arity = length(As),
{Frees,Aft} = free_dead(clear_dead(Int#sr{reg=Reg}, Le#l.i, Vdb)),
- {Sis ++ Frees ++ [{call_fun,Arity}],Aft,
+ {Sis ++ Frees ++ [line(Le),{call_fun,Arity}],Aft,
need_stack_frame(St0)};
call_cg({remote,Mod,Name}, As, Rs, Le, Vdb, Bef, St0)
when element(1, Mod) =:= var;
@@ -1057,11 +1058,10 @@ call_cg({remote,Mod,Name}, As, Rs, Le, Vdb, Bef, St0)
Reg = load_vars(Rs, clear_regs(Int#sr.reg)),
%% Build complete code and final stack/register state.
Arity = length(As),
- Call = {apply,Arity},
St = need_stack_frame(St0),
%%{Call,St1} = build_call(Func, Arity, St0),
{Frees,Aft} = free_dead(clear_dead(Int#sr{reg=Reg}, Le#l.i, Vdb)),
- {Sis ++ Frees ++ [Call],Aft,St};
+ {Sis ++ Frees ++ [line(Le),{apply,Arity}],Aft,St};
call_cg(Func, As, Rs, Le, Vdb, Bef, St0) ->
case St0 of
#cg{bfail=Fail} when Fail =/= 0 ->
@@ -1091,7 +1091,7 @@ call_cg(Func, As, Rs, Le, Vdb, Bef, St0) ->
Arity = length(As),
{Call,St1} = build_call(Func, Arity, St0),
{Frees,Aft} = free_dead(clear_dead(Int#sr{reg=Reg}, Le#l.i, Vdb)),
- {Sis ++ Frees ++ Call,Aft,St1}
+ {Sis ++ Frees ++ [line(Le)|Call],Aft,St1}
end.
build_call({remote,{atom,erlang},{atom,'!'}}, 2, St0) ->
@@ -1118,7 +1118,7 @@ enter_cg({var,_V} = Var, As, Le, Vdb, Bef, St0) ->
{Sis,Int} = cg_setup_call(As++[Var], Bef, Le#l.i, Vdb),
%% Build complete code and final stack/register state.
Arity = length(As),
- {Sis ++ [{call_fun,Arity},return],
+ {Sis ++ [line(Le),{call_fun,Arity},return],
clear_dead(Int#sr{reg=clear_regs(Int#sr.reg)}, Le#l.i, Vdb),
need_stack_frame(St0)};
enter_cg({remote,Mod,Name}, As, Le, Vdb, Bef, St0)
@@ -1127,9 +1127,8 @@ enter_cg({remote,Mod,Name}, As, Le, Vdb, Bef, St0)
{Sis,Int} = cg_setup_call(As++[Mod,Name], Bef, Le#l.i, Vdb),
%% Build complete code and final stack/register state.
Arity = length(As),
- Call = {apply_only,Arity},
St = need_stack_frame(St0),
- {Sis ++ [Call],
+ {Sis ++ [line(Le),{apply_only,Arity}],
clear_dead(Int#sr{reg=clear_regs(Int#sr.reg)}, Le#l.i, Vdb),
St};
enter_cg(Func, As, Le, Vdb, Bef, St0) ->
@@ -1137,7 +1136,8 @@ enter_cg(Func, As, Le, Vdb, Bef, St0) ->
%% Build complete code and final stack/register state.
Arity = length(As),
{Call,St1} = build_enter(Func, Arity, St0),
- {Sis ++ Call,
+ Line = enter_line(Func, Arity, Le),
+ {Sis ++ Line ++ Call,
clear_dead(Int#sr{reg=clear_regs(Int#sr.reg)}, Le#l.i, Vdb),
St1}.
@@ -1153,6 +1153,23 @@ build_enter(Name, Arity, St0) when is_atom(Name) ->
{Lbl,St1} = local_func_label(Name, Arity, St0),
{[{call_only,Arity,{f,Lbl}}],St1}.
+enter_line({remote,{atom,Mod},{atom,Name}}, Arity, Le) ->
+ case erl_bifs:is_safe(Mod, Name, Arity) of
+ false ->
+ %% Tail-recursive call, possibly to a BIF.
+ %% We'll need a line instruction in case the
+ %% BIF call fails.
+ [line(Le)];
+ true ->
+ %% Call to a safe BIF. Since it cannot fail,
+ %% we don't need any line instruction here.
+ []
+ end;
+enter_line(_, _, _) ->
+ %% Tail-recursive call to a local function. A line
+ %% instruction will not be useful.
+ [].
+
%% local_func_label(Name, Arity, State) -> {Label,State'}
%% local_func_label({Name,Arity}, State) -> {Label,State'}
%% Get the function entry label for a local function.
@@ -1226,9 +1243,10 @@ bif_cg(Bif, As, [{var,V}], Le, Vdb, Bef, St0) ->
%% Currently, we are somewhat pessimistic in
%% that we save any variable that will be live after this BIF call.
+ MayFail = not erl_bifs:is_safe(erlang, Bif, length(As)),
{Sis,Int0} = case St0#cg.in_catch andalso
St0#cg.bfail =:= 0 andalso
- not erl_bifs:is_safe(erlang, Bif, length(As)) of
+ MayFail of
true -> adjust_stack(Bef, Le#l.i, Le#l.i+1, Vdb);
false -> {[],Bef}
end,
@@ -1237,7 +1255,14 @@ bif_cg(Bif, As, [{var,V}], Le, Vdb, Bef, St0) ->
Int = Int1#sr{reg=Reg},
Dst = fetch_reg(V, Reg),
BifFail = {f,St0#cg.bfail},
- {Sis++[{bif,Bif,BifFail,Ars,Dst}],
+ %% We need a line instructions for BIFs that may fail in a body.
+ Line = case BifFail of
+ {f,0} when MayFail ->
+ [line(Le)];
+ _ ->
+ []
+ end,
+ {Sis++Line++[{bif,Bif,BifFail,Ars,Dst}],
clear_dead(Int, Le#l.i, Vdb), St0}.
@@ -1266,7 +1291,11 @@ gc_bif_cg(Bif, As, [{var,V}], Le, Vdb, Bef, St0) ->
Int = Int1#sr{reg=Reg},
Dst = fetch_reg(V, Reg),
BifFail = {f,St0#cg.bfail},
- {Sis++[{gc_bif,Bif,BifFail,max_reg(Bef#sr.reg),Ars,Dst}],
+ Line = case BifFail of
+ {f,0} -> [line(Le)];
+ {f,_} -> []
+ end,
+ {Sis++Line++[{gc_bif,Bif,BifFail,max_reg(Bef#sr.reg),Ars,Dst}],
clear_dead(Int, Le#l.i, Vdb), St0}.
%% recv_loop_cg(TimeOut, ReceiveVar, ReceiveMatch, TimeOutExprs,
@@ -1284,7 +1313,7 @@ recv_loop_cg(Te, Rvar, Rm, Tes, Rs, Le, Vdb, Bef, St0) ->
{Wis,Taft,St6} = cg_recv_wait(Te, Tes, Le#l.i, Int1, St5),
Int2 = sr_merge(Raft, Taft), %Merge stack/registers
Reg = load_vars(Rs, Int2#sr.reg),
- {Sis ++ Ris ++ [{label,Tl}] ++ Wis ++ [{label,Bl}],
+ {Sis ++ [line(Le)] ++ Ris ++ [{label,Tl}] ++ Wis ++ [{label,Bl}],
clear_dead(Int2#sr{reg=Reg}, Le#l.i, Vdb),
St6#cg{break=St0#cg.break,recv=St0#cg.recv}}.
@@ -1463,12 +1492,13 @@ cg_binary([{bs_put_binary,Fail,{atom,all},U,_Flags,Src}|PutCode],
{bs_append,Fail,Target,0,MaxRegs,U,Src,BinFlags,Target}
end] ++ PutCode,
cg_bin_opt(Code);
-cg_binary(PutCode, Target, Temp, Fail, MaxRegs, _Anno) ->
+cg_binary(PutCode, Target, Temp, Fail, MaxRegs, Anno) ->
+ Line = line(Anno),
Live = cg_live(Target, MaxRegs),
{InitOp,SzCode} = cg_binary_size(PutCode, Target, Temp, Fail, Live),
- Code = SzCode ++ [{InitOp,Fail,Target,0,MaxRegs,
- {field_flags,[]},Target}|PutCode],
+ Code = [Line|SzCode] ++ [{InitOp,Fail,Target,0,MaxRegs,
+ {field_flags,[]},Target}|PutCode],
cg_bin_opt(Code).
cg_live({x,X}, MaxRegs) when X =:= MaxRegs -> MaxRegs+1;
@@ -2052,6 +2082,38 @@ drop_catch(Tag, [Other|Stk]) -> [Other|drop_catch(Tag, Stk)].
new_label(#cg{lcount=Next}=St) ->
{Next,St#cg{lcount=Next+1}}.
+%% line(Le) -> {line,[] | {location,File,Line}}
+%% Create a line instruction, containing information about
+%% the current filename and line number. A line information
+%% instruction should be placed before any operation that could
+%% cause an exception.
+
+line(#l{a=Anno}) ->
+ line(Anno);
+line([Line,{file,Name}]) when is_integer(Line) ->
+ line_1(Name, Line);
+line([_|_]=A) ->
+ {Name,Line} = find_loc(A, no_file, 0),
+ line_1(Name, Line);
+line([]) ->
+ {line,[]}.
+
+line_1(no_file, _) ->
+ {line,[]};
+line_1(_, 0) ->
+ %% Missing line number or line number 0.
+ {line,[]};
+line_1(Name, Line) ->
+ {line,[{location,Name,abs(Line)}]}.
+
+find_loc([Line|T], File, _) when is_integer(Line) ->
+ find_loc(T, File, Line);
+find_loc([{file,File}|T], _, Line) ->
+ find_loc(T, File, Line);
+find_loc([_|T], File, Line) ->
+ find_loc(T, File, Line);
+find_loc([], File, Line) -> {File,Line}.
+
flatmapfoldl(F, Accu0, [Hd|Tail]) ->
{R,Accu1} = F(Hd, Accu0),
{Rs,Accu2} = flatmapfoldl(F, Accu1, Tail),
diff --git a/lib/compiler/src/v3_core.erl b/lib/compiler/src/v3_core.erl
index 87bb5bec25..6f3590b156 100644
--- a/lib/compiler/src/v3_core.erl
+++ b/lib/compiler/src/v3_core.erl
@@ -180,7 +180,7 @@ body(Cs0, Name, Arity, St0) ->
{Args,St1} = new_vars(Anno, Arity, St0),
{Cs1,St2} = clauses(Cs0, St1),
{Ps,St3} = new_vars(Arity, St2), %Need new variables here
- Fc = function_clause(Ps, {Name,Arity}),
+ Fc = function_clause(Ps, Anno, {Name,Arity}),
{#ifun{anno=#a{anno=Anno},id=[],vars=Args,clauses=Cs1,fc=Fc},St3}.
%% clause(Clause, State) -> {Cclause,State} | noclause.
@@ -507,15 +507,15 @@ expr({block,_,Es0}, St0) ->
{E1,Es1 ++ Eps,St2};
expr({'if',L,Cs0}, St0) ->
{Cs1,St1} = clauses(Cs0, St0),
- Fc = fail_clause([], #c_literal{val=if_clause}),
Lanno = lineno_anno(L, St1),
+ Fc = fail_clause([], Lanno, #c_literal{val=if_clause}),
{#icase{anno=#a{anno=Lanno},args=[],clauses=Cs1,fc=Fc},[],St1};
expr({'case',L,E0,Cs0}, St0) ->
{E1,Eps,St1} = novars(E0, St0),
{Cs1,St2} = clauses(Cs0, St1),
{Fpat,St3} = new_var(St2),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=case_clause},Fpat])),
- Lanno = lineno_anno(L, St3),
+ Lanno = lineno_anno(L, St2),
+ Fc = fail_clause([Fpat], Lanno, c_tuple([#c_literal{val=case_clause},Fpat])),
{#icase{anno=#a{anno=Lanno},args=[E1],clauses=Cs1,fc=Fc},Eps,St3};
expr({'receive',L,Cs0}, St0) ->
{Cs1,St1} = clauses(Cs0, St0),
@@ -541,9 +541,10 @@ expr({'try',L,Es0,Cs0,Ecs,[]}, St0) ->
{V,St2} = new_var(St1), %This name should be arbitrary
{Cs1,St3} = clauses(Cs0, St2),
{Fpat,St4} = new_var(St3),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=try_clause},Fpat])),
+ Lanno = lineno_anno(L, St4),
+ Fc = fail_clause([Fpat], Lanno,
+ c_tuple([#c_literal{val=try_clause},Fpat])),
{Evs,Hs,St5} = try_exception(Ecs, St4),
- Lanno = lineno_anno(L, St1),
{#itry{anno=#a{anno=lineno_anno(L, St5)},args=Es1,
vars=[V],body=[#icase{anno=#a{anno=Lanno},args=[V],clauses=Cs1,fc=Fc}],
evars=Evs,handler=Hs},
@@ -607,8 +608,8 @@ expr({match,L,P0,E0}, St0) ->
Thrown
end,
{Fpat,St4} = new_var(St3),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=badmatch},Fpat])),
Lanno = lineno_anno(L, St4),
+ Fc = fail_clause([Fpat], Lanno, c_tuple([#c_literal{val=badmatch},Fpat])),
case P2 of
nomatch ->
St = add_warning(L, nomatch, St4),
@@ -828,8 +829,9 @@ fun_tq({_,_,Name}=Id, Cs0, L, St0) ->
{Cs1,St1} = clauses(Cs0, St0),
{Args,St2} = new_vars(Arity, St1),
{Ps,St3} = new_vars(Arity, St2), %Need new variables here
- Fc = function_clause(Ps, {Name,Arity}),
- Fun = #ifun{anno=#a{anno=lineno_anno(L, St3)},
+ Anno = lineno_anno(L, St3),
+ Fc = function_clause(Ps, Anno, {Name,Arity}),
+ Fun = #ifun{anno=#a{anno=Anno},
id=[{id,Id}], %We KNOW!
vars=Args,clauses=Cs1,fc=Fc},
{Fun,[],St3}.
@@ -929,7 +931,7 @@ lc_tq(Line, E, [{b_generate,Lg,P,G}|Qs0], Mc, St0) ->
[],St};
lc_tq(Line, E, [Fil0|Qs0], Mc, St0) ->
%% Special case sequences guard tests.
- LA = lineno_anno(Line, St0),
+ LA = lineno_anno(element(2, Fil0), St0),
LAnno = #a{anno=LA},
case is_guard_test(Fil0) of
true ->
@@ -945,7 +947,8 @@ lc_tq(Line, E, [Fil0|Qs0], Mc, St0) ->
false ->
{Lc,Lps,St1} = lc_tq(Line, E, Qs0, Mc, St0),
{Fpat,St2} = new_var(St1),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=case_clause},Fpat])),
+ Fc = fail_clause([Fpat], LA,
+ c_tuple([#c_literal{val=case_clause},Fpat])),
%% Do a novars little optimisation here.
{Filc,Fps,St3} = novars(Fil0, St2),
{#icase{anno=LAnno,
@@ -1072,7 +1075,7 @@ bc_tq1(Line, E, [{b_generate,Lg,P,G}|Qs0], AccExpr, St0) ->
[],St};
bc_tq1(Line, E, [Fil0|Qs0], AccVar, St0) ->
%% Special case sequences guard tests.
- LA = lineno_anno(Line, St0),
+ LA = lineno_anno(element(2, Fil0), St0),
LAnno = #a{anno=LA},
case is_guard_test(Fil0) of
true ->
@@ -1089,7 +1092,8 @@ bc_tq1(Line, E, [Fil0|Qs0], AccVar, St0) ->
false ->
{Bc,Bps,St1} = bc_tq1(Line, E, Qs0, AccVar, St0),
{Fpat,St2} = new_var(St1),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=case_clause},Fpat])),
+ Fc = fail_clause([Fpat], LA,
+ c_tuple([#c_literal{val=case_clause},Fpat])),
%% Do a novars little optimisation here.
{Filc,Fps,St} = novars(Fil0, St2),
{#icase{anno=LAnno,
@@ -1562,17 +1566,11 @@ new_vars_1(N, Anno, St0, Vs) when N > 0 ->
new_vars_1(N-1, Anno, St1, [V|Vs]);
new_vars_1(0, _, St, Vs) -> {Vs,St}.
-function_clause(Ps, Name) ->
- function_clause(Ps, [], Name).
-
function_clause(Ps, LineAnno, Name) ->
- FcAnno = [{function_name,Name}],
+ FcAnno = [{function_name,Name}|LineAnno],
fail_clause(Ps, FcAnno,
ann_c_tuple(LineAnno, [#c_literal{val=function_clause}|Ps])).
-fail_clause(Pats, Arg) ->
- fail_clause(Pats, [], Arg).
-
fail_clause(Pats, Anno, Arg) ->
#iclause{anno=#a{anno=[compiler_generated]},
pats=Pats,guard=[],
diff --git a/lib/compiler/src/v3_kernel.erl b/lib/compiler/src/v3_kernel.erl
index 3b33a08cf7..4e06b464a4 100644
--- a/lib/compiler/src/v3_kernel.erl
+++ b/lib/compiler/src/v3_kernel.erl
@@ -247,7 +247,7 @@ expr(#c_var{anno=A,name={_Name,Arity}}=Fname, Sub, St) ->
%% instead of one for each occurrence as done now.
Vs = [#c_var{name=list_to_atom("V" ++ integer_to_list(V))} ||
V <- integers(1, Arity)],
- Fun = #c_fun{anno=A,vars=Vs,body=#c_apply{op=Fname,args=Vs}},
+ Fun = #c_fun{anno=A,vars=Vs,body=#c_apply{anno=A,op=Fname,args=Vs}},
expr(Fun, Sub, St);
expr(#c_var{anno=A,name=V}, Sub, St) ->
{#k_var{anno=A,name=get_vsub(V, Sub)},[],St};
@@ -291,7 +291,7 @@ expr(#c_binary{anno=A,segments=Cv}, Sub, St0) ->
Erl = #c_literal{val=erlang},
Name = #c_literal{val=error},
Args = [#c_literal{val=badarg}],
- Error = #c_call{module=Erl,name=Name,args=Args},
+ Error = #c_call{anno=A,module=Erl,name=Name,args=Args},
expr(Error, Sub, St0)
end;
expr(#c_fun{anno=A,vars=Cvs,body=Cb}, Sub0, #kern{ff=OldFF,func=Func}=St0) ->
@@ -1167,9 +1167,7 @@ select_bin_int_1(_, _, _, _) -> throw(not_possible).
select_assert_match_possible(Sz, Val, Fs) ->
EmptyBindings = erl_eval:new_bindings(),
- MatchFun = fun({integer,_,_}, NewV, Bs) when NewV =:= Val ->
- {match,Bs}
- end,
+ MatchFun = match_fun(Val),
EvalFun = fun({integer,_,S}, B) -> {value,S,B} end,
Expr = [{bin_element,0,{integer,0,Val},{integer,0,Sz},[{unit,1}|Fs]}],
{value,Bin,EmptyBindings} = eval_bits:expr_grp(Expr, EmptyBindings, EvalFun),
@@ -1184,6 +1182,11 @@ select_assert_match_possible(Sz, Val, Fs) ->
throw(not_possible)
end.
+match_fun(Val) ->
+ fun(match, {{integer,_,_},NewV,Bs}) when NewV =:= Val ->
+ {match,Bs}
+ end.
+
select_utf8(Val0) ->
try
Bin = <<Val0/utf8>>,
diff --git a/lib/compiler/src/v3_life.erl b/lib/compiler/src/v3_life.erl
index a7a4d4dc91..a1d92af9f8 100644
--- a/lib/compiler/src/v3_life.erl
+++ b/lib/compiler/src/v3_life.erl
@@ -65,7 +65,7 @@ functions([], Acc) -> reverse(Acc).
%% function(Kfunc) -> Func.
-function(#k_fdef{func=F,arity=Ar,vars=Vs,body=Kb}) ->
+function(#k_fdef{anno=#k{a=Anno},func=F,arity=Ar,vars=Vs,body=Kb}) ->
try
As = var_list(Vs),
Vdb0 = foldl(fun ({var,N}, Vdb) -> new_var(N, 0, Vdb) end, [], As),
@@ -80,7 +80,7 @@ function(#k_fdef{func=F,arity=Ar,vars=Vs,body=Kb}) ->
put(guard_refc, 0),
{B1,_,Vdb1} = body(B0, 1, Vdb0),
erase(guard_refc),
- {function,F,Ar,As,B1,Vdb1}
+ {function,F,Ar,As,B1,Vdb1,Anno}
catch
Class:Error ->
Stack = erlang:get_stacktrace(),
diff --git a/lib/compiler/test/bs_match_SUITE.erl b/lib/compiler/test/bs_match_SUITE.erl
index 6a795f6634..f8c71a0257 100644
--- a/lib/compiler/test/bs_match_SUITE.erl
+++ b/lib/compiler/test/bs_match_SUITE.erl
@@ -1028,8 +1028,8 @@ haystack_2(Haystack) ->
fc({'EXIT',{function_clause,_}}) -> ok;
fc({'EXIT',{{case_clause,_},_}}) when ?MODULE =:= bs_match_inline_SUITE -> ok.
-fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Args}|_]}}) -> ok;
-fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Arity}|_]}})
+fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Args,_}|_]}}) -> ok;
+fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Arity,_}|_]}})
when length(Args) =:= Arity ->
true = test_server:is_native(?MODULE);
fc(_, Args, {'EXIT',{{case_clause,ActualArgs},_}})
diff --git a/lib/compiler/test/compile_SUITE.erl b/lib/compiler/test/compile_SUITE.erl
index b3e5376ffd..8c6a623dfb 100644
--- a/lib/compiler/test/compile_SUITE.erl
+++ b/lib/compiler/test/compile_SUITE.erl
@@ -82,6 +82,7 @@ file_1(Config) when is_list(Config) ->
?line {ok,simple} = compile:file(Simple, [native,report]), %Smoke test.
?line {ok,simple} = compile:file(Target, [native,from_beam]), %Smoke test.
?line {ok,simple} = compile:file(Simple, [debug_info]),
+ ?line {ok,simple} = compile:file(Simple, [no_line_info]), %Coverage
?line ok = file:set_cwd(Cwd),
?line true = exists(Target),
?line passed = run(Target, test, []),
diff --git a/lib/compiler/test/guard_SUITE.erl b/lib/compiler/test/guard_SUITE.erl
index 0e69efba6b..40711783ed 100644
--- a/lib/compiler/test/guard_SUITE.erl
+++ b/lib/compiler/test/guard_SUITE.erl
@@ -32,7 +32,8 @@
t_is_boolean/1,is_function_2/1,
tricky/1,rel_ops/1,literal_type_tests/1,
basic_andalso_orelse/1,traverse_dcd/1,
- check_qlc_hrl/1,andalso_semi/1,t_tuple_size/1,binary_part/1]).
+ check_qlc_hrl/1,andalso_semi/1,t_tuple_size/1,binary_part/1,
+ bad_constants/1]).
suite() -> [{ct_hooks,[ts_install_cth]}].
@@ -44,7 +45,8 @@ all() ->
more_xor_guards, build_in_guard, old_guard_tests, gbif,
t_is_boolean, is_function_2, tricky, rel_ops,
literal_type_tests, basic_andalso_orelse, traverse_dcd,
- check_qlc_hrl, andalso_semi, t_tuple_size, binary_part].
+ check_qlc_hrl, andalso_semi, t_tuple_size, binary_part,
+ bad_constants].
groups() ->
[].
@@ -1517,8 +1519,27 @@ bptest(B,A,C) when erlang:binary_part(B,{A,C}) =:= <<3,3>> ->
bptest(_,_,_) ->
error.
-
-
+-define(FAILING(C),
+ if
+ C -> ?t:fail(should_fail);
+ true -> ok
+ end,
+ if
+ true, C -> ?t:fail(should_fail);
+ true -> ok
+ end).
+
+bad_constants(Config) when is_list(Config) ->
+ ?line ?FAILING(false),
+ ?line ?FAILING([]),
+ ?line ?FAILING([a]),
+ ?line ?FAILING([Config]),
+ ?line ?FAILING({a,b}),
+ ?line ?FAILING({a,Config}),
+ ?line ?FAILING(<<1>>),
+ ?line ?FAILING(42),
+ ?line ?FAILING(3.14),
+ ok.
%% Call this function to turn off constant propagation.
id(I) -> I.
diff --git a/lib/compiler/test/inline_SUITE.erl b/lib/compiler/test/inline_SUITE.erl
index af2b8ec92a..086fba2649 100644
--- a/lib/compiler/test/inline_SUITE.erl
+++ b/lib/compiler/test/inline_SUITE.erl
@@ -263,7 +263,8 @@ my_apply(M, F, A, Init) ->
really_inlined(Config) when is_list(Config) ->
%% Make sure that badarg/2 really gets inlined.
- {'EXIT',{badarg,[{?MODULE,fail_me_now,[]}|_]}} = (catch fail_me_now()),
+ {'EXIT',{badarg,[{?MODULE,fail_me_now,[],_}|_]}} =
+ (catch fail_me_now()),
ok.
fail_me_now() ->
diff --git a/lib/compiler/test/lc_SUITE.erl b/lib/compiler/test/lc_SUITE.erl
index c8908858ba..f5948504b3 100644
--- a/lib/compiler/test/lc_SUITE.erl
+++ b/lib/compiler/test/lc_SUITE.erl
@@ -179,8 +179,8 @@ empty_generator(Config) when is_list(Config) ->
id(I) -> I.
-fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Args}|_]}}) -> ok;
-fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Arity}|_]}})
+fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Args,_}|_]}}) -> ok;
+fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Arity,_}|_]}})
when length(Args) =:= Arity ->
true = test_server:is_native(?MODULE);
fc(Args, {'EXIT',{{case_clause,ActualArgs},_}})
diff --git a/lib/compiler/test/misc_SUITE.erl b/lib/compiler/test/misc_SUITE.erl
index c941a80e61..9b414cade6 100644
--- a/lib/compiler/test/misc_SUITE.erl
+++ b/lib/compiler/test/misc_SUITE.erl
@@ -179,7 +179,7 @@ silly_coverage(Config) when is_list(Config) ->
?line expect_error(fun() -> v3_life:module(BadKernel, []) end),
%% v3_codegen
- CodegenInput = {?MODULE,[{foo,0}],[],[{function,foo,0,[a|b],a,b}]},
+ CodegenInput = {?MODULE,[{foo,0}],[],[{function,foo,0,[a|b],a,b,[]}]},
?line expect_error(fun() -> v3_codegen:module(CodegenInput, []) end),
%% beam_block
@@ -187,7 +187,7 @@ silly_coverage(Config) when is_list(Config) ->
[{function,foo,0,2,
[{label,1},
{func_info,{atom,?MODULE},{atom,foo},0},
- {label,2}|non_proper_list],99}]},
+ {label,2}|non_proper_list]}],99},
?line expect_error(fun() -> beam_block:module(BlockInput, []) end),
%% beam_bool
diff --git a/lib/compiler/test/trycatch_SUITE.erl b/lib/compiler/test/trycatch_SUITE.erl
index c6e0f8d85d..760cf17225 100644
--- a/lib/compiler/test/trycatch_SUITE.erl
+++ b/lib/compiler/test/trycatch_SUITE.erl
@@ -314,19 +314,19 @@ eclectic(Conf) when is_list(Conf) ->
V = {make_ref(),3.1415926535,[[]|{}]},
?line {{value,{value,V},V},V} =
eclectic_1({foo,{value,{value,V}}}, undefined, {value,V}),
- ?line {{'EXIT',{V,[{?MODULE,foo,1}|_]}},V} =
+ ?line {{'EXIT',{V,[{?MODULE,foo,1,_}|_]}},V} =
eclectic_1({catch_foo,{error,V}}, undefined, {value,V}),
?line {{error,{exit,V},{'EXIT',V}},V} =
eclectic_1({foo,{error,{exit,V}}}, error, {value,V}),
?line {{value,{value,V},V},
- {'EXIT',{badarith,[{?MODULE,my_add,2}|_]}}} =
+ {'EXIT',{badarith,[{?MODULE,my_add,2,_}|_]}}} =
eclectic_1({foo,{value,{value,V}}}, undefined, {'add',{0,a}}),
?line {{'EXIT',V},V} =
eclectic_1({catch_foo,{exit,V}}, undefined, {throw,V}),
- ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,2}|_]}}},
+ ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,2,_}|_]}}},
{'EXIT',V}} =
eclectic_1({foo,{error,{'div',{1,0}}}}, error, {exit,V}),
- ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,1}|_]}}},
+ ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,1,_}|_]}}},
{'EXIT',V}} =
eclectic_1({catch_foo,{throw,{error,V}}}, undefined, {exit,V}),
%%
@@ -336,15 +336,15 @@ eclectic(Conf) when is_list(Conf) ->
eclectic_2({throw,{value,V}}, throw, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{value,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1,_}|_]}}},undefined} =
eclectic_2({error,{value,V}}, throw, {error,V}),
- ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V]}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V],_}|_]}}},V} =
eclectic_2({value,{'abs',V}}, undefined, {value,V}),
- ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,2}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,2,_}|_]}}},V} =
eclectic_2({exit,{'add',{0,a}}}, exit, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{error,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1,_}|_]}}},undefined} =
eclectic_2({throw,{'div',{1,0}}}, throw, {error,V}),
ok.
diff --git a/lib/cosEvent/src/Makefile b/lib/cosEvent/src/Makefile
index a62d47ce74..c774d18380 100644
--- a/lib/cosEvent/src/Makefile
+++ b/lib/cosEvent/src/Makefile
@@ -177,16 +177,18 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES1) $(EXTERNAL_GEN_HRL_FILES1): CosEventChannelAdmin.idl
+
+IDL-GENERATED: CosEventChannelAdmin.idl cosEventApp.idl CosEventComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosEventChannelAdmin.cfg"}' CosEventChannelAdmin.idl
mv $(GEN_HRL_FILES1) $(EXTERNAL_INC_PATH)
-
-$(GEN_ERL_FILES2) $(GEN_HRL_FILES2): cosEventApp.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"cosEventApp.cfg"}' cosEventApp.idl
-
-$(GEN_ERL_FILES3) $(EXTERNAL_GEN_HRL_FILES3): CosEventComm.idl
erlc $(ERL_IDL_FLAGS) CosEventComm.idl
mv $(GEN_HRL_FILES3) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosEvent/test/Makefile b/lib/cosEvent/test/Makefile
index c59c7ee315..c3f07c156f 100644
--- a/lib/cosEvent/test/Makefile
+++ b/lib/cosEvent/test/Makefile
@@ -121,17 +121,13 @@ docs:
# Special Targets
# ----------------------------------------------------
-#
-# Each IDL file produces many target files so no pattern
-# rule can be used.
-#
-TGT_COS = \
- $(GEN_HRL_COS:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_COS:%=$(IDLOUTDIR)/%.erl)
+IDL-GENERATED: event_test_server.idl
+ erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) event_test_server.idl
+ >IDL-GENERATED
+$(GEN_FILES): IDL-GENERATED
-$(TGT_COS): event_test_server.idl
- erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) event_test_server.idl
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/cosEventDomain/src/Makefile b/lib/cosEventDomain/src/Makefile
index 56a67cd225..91bef4e7e6 100644
--- a/lib/cosEventDomain/src/Makefile
+++ b/lib/cosEventDomain/src/Makefile
@@ -150,9 +150,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(EXTERNAL_GEN_HRL_FILES): CosEventDomainAdmin.idl
+IDL-GENERATED: CosEventDomainAdmin.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosEventDomainAdmin.cfg"}' CosEventDomainAdmin.idl
mv $(GEN_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosFileTransfer/src/Makefile b/lib/cosFileTransfer/src/Makefile
index 773ed7f6b7..17e82f9bc2 100644
--- a/lib/cosFileTransfer/src/Makefile
+++ b/lib/cosFileTransfer/src/Makefile
@@ -161,9 +161,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(GEN_HRL_FILES): CosFileTransfer.idl
+IDL-GENERATED: CosFileTransfer.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosFileTransfer.cfg"}' CosFileTransfer.idl
mv $(LOCAL_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosNotification/src/Makefile b/lib/cosNotification/src/Makefile
index 637c633e52..b976ab94f3 100644
--- a/lib/cosNotification/src/Makefile
+++ b/lib/cosNotification/src/Makefile
@@ -242,20 +242,26 @@ GEN_OE_EVENTCOMM_HRL_FILES = \
oe_CosNotificationComm.hrl \
oe_CosNotificationComm_Event.hrl
-GEN_ERL_FILES = \
+IDL_GEN_ERL_FILES = \
$(GEN_NOTIFICATION_ERL_FILES) \
$(GEN_OE_EVENTCOMM_ERL_FILES) \
$(GEN_NOTIFYCOMM_ERL_FILES) \
$(GEN_NOTIFYFILTER_ERL_FILES) \
- $(GEN_CHANNELADMIN_ERL_FILES) \
- $(GEN_YECC_ERL_FILES)
+ $(GEN_CHANNELADMIN_ERL_FILES)
-GEN_HRL_FILES = \
+IDL_GEN_HRL_FILES = \
$(EXTERNAL_GEN_NOTIFICATION_HRL_FILES) \
$(GEN_OE_EVENTCOMM_HRL_FILES) \
$(EXTERNAL_GEN_NOTIFYCOMM_HRL_FILES) \
$(EXTERNAL_GEN_NOTIFYFILTER_HRL_FILES) \
- $(EXTERNAL_GEN_CHANNELADMIN_HRL_FILES) \
+ $(EXTERNAL_GEN_CHANNELADMIN_HRL_FILES)
+
+GEN_ERL_FILES = \
+ $(IDL_GEN_ERL_FILES) \
+ $(GEN_YECC_ERL_FILES)
+
+GEN_HRL_FILES = \
+ $(IDL_GEN_HRL_FILES) \
$(GEN_YECC_HRL_FILES)
@@ -336,20 +342,23 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_NOTIFICATION_ERL_FILES) $(EXTERNAL_GEN_NOTIFICATION_HRL_FILES): CosNotification.idl
+IDL-GENERATED: CosNotification.idl CosNotifyChannelAdmin.idl \
+ CosNotifyFilter.idl cosNotificationAppComm.idl CosNotifyComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotification.cfg"}' CosNotification.idl
mv $(GEN_NOTIFICATION_HRL_FILES) $(EXTERNAL_INC_PATH)
-$(GEN_CHANNELADMIN_ERL_FILES) $(EXTERNAL_GEN_CHANNELADMIN_HRL_FILES): CosNotifyChannelAdmin.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotifyChannelAdmin.cfg"}' CosNotifyChannelAdmin.idl
mv $(GEN_CHANNELADMIN_HRL_FILES) $(EXTERNAL_INC_PATH)
-$(GEN_NOTIFYFILTER_ERL_FILES) $(EXTERNAL_GEN_NOTIFYFILTER_HRL_FILES): CosNotifyFilter.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotifyFilter.cfg"}' CosNotifyFilter.idl
mv $(GEN_NOTIFYFILTER_HRL_FILES) $(EXTERNAL_INC_PATH)
-$(GEN_OE_EVENTCOMM_ERL_FILES) $(GEN_OE_EVENTCOMM_HRL_FILES): cosNotificationAppComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"cosNotificationComm.cfg"}' cosNotificationAppComm.idl
-$(GEN_NOTIFYCOMM_ERL_FILES) $(EXTERNAL_GEN_NOTIFYCOMM_HRL_FILES): CosNotifyComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotifyComm.cfg"}' CosNotifyComm.idl
mv $(GEN_NOTIFYCOMM_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(IDL_GEN_ERL_FILES) $(IDL_GEN_HRL_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
+
$(GEN_YECC_ERL_FILES) $(GEN_YECC_HRL_FILES): cosNotification_Grammar.yrl
# ----------------------------------------------------
diff --git a/lib/cosNotification/test/Makefile b/lib/cosNotification/test/Makefile
index 43f73addae..f509370430 100644
--- a/lib/cosNotification/test/Makefile
+++ b/lib/cosNotification/test/Makefile
@@ -161,13 +161,14 @@ docs:
# Special Targets
# ----------------------------------------------------
-TGT_TEST = \
- $(GEN_HRL_FILES:%=$(IDLOUTDIR)/%) \
- $(GEN_MODULES:%=$(IDLOUTDIR)/%.erl)
-
-$(TGT_TEST): notify_test_server.idl
+IDL-GENERATED: notify_test_server.idl
erlc $(ERL_COMPILE_FLAGS) -o$(IDLOUTDIR) \
+'{cfgfile,"notify_test_server.cfg"}' notify_test_server.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/cosProperty/src/Makefile b/lib/cosProperty/src/Makefile
index 1d2119dfb3..d12554b18d 100644
--- a/lib/cosProperty/src/Makefile
+++ b/lib/cosProperty/src/Makefile
@@ -161,10 +161,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(GEN_HRL_FILES): CosProperty.idl
+IDL-GENERATED: CosProperty.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosProperty.cfg"}' CosProperty.idl
mv $(LOCAL_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosTime/src/Makefile b/lib/cosTime/src/Makefile
index 3b6f7bae2e..1793822fb6 100644
--- a/lib/cosTime/src/Makefile
+++ b/lib/cosTime/src/Makefile
@@ -176,17 +176,18 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_TIMEBASE_ERL_FILES) $(EXTERNAL_TIMEBASE_HRL_FILES): TimeBase.idl
+IDL-GENERATED: TimeBase.idl CosTime.idl CosTimerEvent.idl
erlc $(ERL_IDL_FLAGS) TimeBase.idl
mv $(GEN_TIMEBASE_HRL_FILES) $(EXTERNAL_INC_PATH)
-
-$(GEN_COSTIME_ERL_FILES) $(EXTERNAL_COSTIME_HRL_FILES): CosTime.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosTime.cfg"}' CosTime.idl
mv $(GEN_COSTIME_HRL_FILES) $(EXTERNAL_INC_PATH)
-
-$(GEN_COSTIMEREVENT_ERL_FILES) $(EXTERNAL_COSTIMEREVENT_HRL_FILES): CosTimerEvent.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosTimerEvent.cfg"}' CosTimerEvent.idl
mv $(GEN_COSTIMEREVENT_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosTransactions/src/Makefile b/lib/cosTransactions/src/Makefile
index 7e10ec175b..4b77251c3c 100644
--- a/lib/cosTransactions/src/Makefile
+++ b/lib/cosTransactions/src/Makefile
@@ -155,9 +155,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(EXTERNAL_GEN_HRL_FILES): CosTransactions.idl
+IDL-GENERATED: CosTransactions.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosTransactions.cfg"}' CosTransactions.idl
mv $(GEN_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosTransactions/test/Makefile b/lib/cosTransactions/test/Makefile
index 44c90e8f84..0bc8c007da 100644
--- a/lib/cosTransactions/test/Makefile
+++ b/lib/cosTransactions/test/Makefile
@@ -121,13 +121,14 @@ docs:
# Special Targets
# ----------------------------------------------------
-TGT_TEST = \
- $(GEN_HRL_FILES:%=$(IDLOUTDIR)/%) \
- $(GEN_MODULES:%=$(IDLOUTDIR)/%.erl)
-
-$(TGT_TEST): etrap_test.idl
+IDL-GENERATED: etrap_test.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) \
+'{cfgfile,"etrap_test.cfg"}' etrap_test.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/crypto/c_src/Makefile.in b/lib/crypto/c_src/Makefile.in
index 276c84d601..775e5a9b89 100644
--- a/lib/crypto/c_src/Makefile.in
+++ b/lib/crypto/c_src/Makefile.in
@@ -94,13 +94,9 @@ endif
# Targets
# ----------------------------------------------------
-debug opt valgrind: $(OBJDIR) $(LIBDIR) $(NIF_LIB)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(LIBDIR):
- -@mkdir -p $(LIBDIR)
+debug opt valgrind: $(NIF_LIB)
$(OBJDIR)/%$(TYPEMARKER).o: %.c
$(INSTALL_DIR) $(OBJDIR)
diff --git a/lib/debugger/doc/src/debugger_chapter.xml b/lib/debugger/doc/src/debugger_chapter.xml
index 1f5d4dd5ff..2d812b0236 100644
--- a/lib/debugger/doc/src/debugger_chapter.xml
+++ b/lib/debugger/doc/src/debugger_chapter.xml
@@ -254,19 +254,17 @@ c_break(Bindings) ->
used, for example, if an error occurs:</p>
<pre>
1> <input>catch a+1.</input>
-{'EXIT',{badarith,[{erlang,'+',[a,1]},
- {erl_eval,do_apply,5},
- {erl_eval,expr,5},
- {shell,exprs,6},
- {shell,eval_exprs,6},
- {shell,eval_loop,3}]}}</pre>
-
- <p>In the case above, the stack trace shows that the function called
- last was <c>erl_eval:eval_op/3</c>. See <em>Erlang Reference
- Manual, Errors and Error handling</em>, for more information
- about stack trace.</p>
-
- <p>Debugger emulates the stack trace by keeping track of recently
+{'EXIT',{badarith,[{erlang,'+',[a,1],[]},
+ {erl_eval,do_apply,5,[{file,"erl_eval.erl"},{line,562}]},
+ {erl_eval,expr,5,[{file,"erl_eval.erl"},{line,359}]},
+ {shell,exprs,7,[{file,"shell.erl"},{line,668}]},
+ {shell,eval_exprs,7,[{file,"shell.erl"},{line,623}]},
+ {shell,eval_loop,3,[{file,"shell.erl"},{line,608}]}]}}</pre>
+
+ <p>See the <em>Erlang Reference Manual, Errors and Error handling</em>,
+ for more information about the stack trace.</p>
+
+ <p>The Debugger emulates the stack trace by keeping track of recently
called interpreted functions. (The real stack trace cannot be
used, as it shows which functions of the Debugger have been
called, rather than which interpreted functions).</p>
@@ -276,17 +274,15 @@ c_break(Bindings) ->
<seealso marker="#attach">the Attach Process window</seealso>.
</p>
- <p>By default, the Debugger saves information about all current
+ <p>By default, the Debugger only saves information about recursive
function calls, that is, function calls that have not yet returned
- a value (option 'Stack On, Tail').</p>
-
- <p>This means, however, that information is saved also for tail
- recursive calls. For example, repeated calls to the <c>loop</c>
- function of an Erlang process. This may consume unnecessary
- amounts of memory for debugged processes with long lifetimes and
- many tail recursive calls. It is therefore possible to set
- the option 'Stack On, no tail', in which case information about
- previous calls are discarded when a tail recursive call is made.
+ a value (option 'Stack On, No Tail').</p>
+
+ <p>Sometimes, however, it can be useful to save all calls, even
+ tail-recursive calls. That can be done with the 'Stack On, Tail'
+ option. Note that this option will consume more memory and slow
+ down execution of interpreted functions when there are many
+ tail-recursive calls.
</p>
<p>It is also possible to turn off the Debugger stack trace
diff --git a/lib/debugger/doc/src/int.xml b/lib/debugger/doc/src/int.xml
index 8b55461a44..c9d815755d 100644
--- a/lib/debugger/doc/src/int.xml
+++ b/lib/debugger/doc/src/int.xml
@@ -284,12 +284,12 @@ spawn(Module, Name, [Pid | Args])
<list>
<item><c>all</c> - save information about all current calls,
that is, function calls that have not yet returned a value.
- This is the default.</item>
+ </item>
<item><c>no_tail</c> - save information about current calls,
but discard previous information when a tail recursive call
is made. This option consumes less memory and may be
necessary to use for processes with long lifetimes and many
- tail recursive calls.</item>
+ tail recursive calls. This is the default.</item>
<item><c>false</c> - do not save any information about current
calls.</item>
</list>
diff --git a/lib/debugger/src/Makefile b/lib/debugger/src/Makefile
index 8551fe887d..6dc7d0d783 100644
--- a/lib/debugger/src/Makefile
+++ b/lib/debugger/src/Makefile
@@ -44,6 +44,7 @@ MODULES= \
dbg_ieval \
dbg_iload \
dbg_iserver \
+ dbg_istk \
dbg_ui_break \
dbg_ui_break_win \
dbg_ui_edit \
diff --git a/lib/debugger/src/dbg_debugged.erl b/lib/debugger/src/dbg_debugged.erl
index 3732c40c73..18dcd92ff3 100644
--- a/lib/debugger/src/dbg_debugged.erl
+++ b/lib/debugger/src/dbg_debugged.erl
@@ -76,8 +76,8 @@ msg_loop(Meta, Mref, SaveStacktrace) ->
msg_loop(Meta, Mref, SaveStacktrace);
%% Meta needs something evaluated within context of real process
- {sys, Meta, {command, Command, Stacktrace}} ->
- Reply = handle_command(Command, Stacktrace),
+ {sys, Meta, {command,Command}} ->
+ Reply = handle_command(Command),
Meta ! {sys, self(), Reply},
msg_loop(Meta, Mref, SaveStacktrace);
@@ -93,11 +93,12 @@ msg_loop(Meta, Mref, SaveStacktrace) ->
end
end.
-handle_command(Command, Stacktrace) ->
- try reply(Command)
+handle_command(Command) ->
+ try
+ reply(Command)
catch Class:Reason ->
- Stacktrace2 = stacktrace_f(erlang:get_stacktrace()),
- {exception, {Class,Reason,Stacktrace2++Stacktrace}}
+ Stacktrace = stacktrace_f(erlang:get_stacktrace()),
+ {exception,{Class,Reason,Stacktrace}}
end.
reply({apply,M,F,As}) ->
@@ -116,5 +117,5 @@ demonitor(Mref) ->
%% Fix stacktrace - keep all above call to this module.
%%
stacktrace_f([]) -> [];
-stacktrace_f([{?MODULE,_,_}|_]) -> [];
+stacktrace_f([{?MODULE,_,_,_}|_]) -> [];
stacktrace_f([F|S]) -> [F|stacktrace_f(S)].
diff --git a/lib/debugger/src/dbg_icmd.erl b/lib/debugger/src/dbg_icmd.erl
index e9502eaa2b..b230efaa7a 100644
--- a/lib/debugger/src/dbg_icmd.erl
+++ b/lib/debugger/src/dbg_icmd.erl
@@ -273,7 +273,7 @@ handle_int_msg({old_code,Mod}, Status, Bs,
erase([Mod|db]),
put(cache, []);
true ->
- case dbg_ieval:in_use_p(Mod, M) of
+ case dbg_istk:in_use_p(Mod, M) of
true ->
%% A call to Mod is on the stack (or might be),
%% so we must terminate.
@@ -342,11 +342,11 @@ handle_user_msg({set,stack_trace,Flag}, _Status, _Bs, _Ieval) ->
handle_user_msg({get,bindings,From,SP}, _Status, Bs, _Ieval) ->
reply(From, bindings, bindings(Bs, SP));
handle_user_msg({get,stack_frame,From,{Dir,SP}}, _Status, _Bs,_Ieval) ->
- reply(From, stack_frame, dbg_ieval:stack_frame(Dir, SP));
+ reply(From, stack_frame, dbg_istk:stack_frame(Dir, SP));
handle_user_msg({get,messages,From,_}, _Status, _Bs, _Ieval) ->
reply(From, messages, messages());
-handle_user_msg({get,backtrace,From,N}, _Status, _Bs, _Ieval) ->
- reply(From, backtrace, dbg_ieval:backtrace(N)).
+handle_user_msg({get,backtrace,From,N}, _Status, _Bs, Ieval) ->
+ reply(From, backtrace, dbg_istk:backtrace(N, Ieval)).
set_stack_trace(true) ->
set_stack_trace(all);
@@ -366,11 +366,11 @@ reply(From, Tag, Reply) ->
bindings(Bs, nostack) ->
Bs;
bindings(Bs, SP) ->
- case dbg_ieval:stack_level() of
+ case dbg_istk:stack_level() of
Le when SP > Le ->
Bs;
_ ->
- dbg_ieval:bindings(SP)
+ dbg_istk:bindings(SP)
end.
messages() ->
@@ -422,7 +422,7 @@ eval_nonrestricted({From, _Mod, Cmd, _SP}, Bs,
eval_nonrestricted_1({match,_,{var,_,Var},Expr}, Bs, Ieval) ->
{value,Res,Bs2} =
- dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{last_call=false}),
+ dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{top=false}),
Bs3 = case lists:keyfind(Var, 1, Bs) of
{Var,_Value} ->
lists:keyreplace(Var, 1, Bs2, {Var,Res});
@@ -437,7 +437,7 @@ eval_nonrestricted_1({var,_,Var}, Bs, _Ieval) ->
{Res,Bs};
eval_nonrestricted_1(Expr, Bs, Ieval) ->
{value,Res,Bs2} =
- dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{last_call=false}),
+ dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{top=false}),
{Res,Bs2}.
mark_running(LineNo, Le) ->
diff --git a/lib/debugger/src/dbg_ieval.erl b/lib/debugger/src/dbg_ieval.erl
index 306323f8ea..df725ed9e5 100644
--- a/lib/debugger/src/dbg_ieval.erl
+++ b/lib/debugger/src/dbg_ieval.erl
@@ -20,8 +20,7 @@
-export([eval/3,exit_info/5]).
-export([eval_expr/3]).
--export([check_exit_msg/3,exception/4,in_use_p/2]).
--export([stack_level/0, bindings/1, stack_frame/2, backtrace/1]).
+-export([check_exit_msg/3,exception/4]).
-include("dbg_ieval.hrl").
@@ -71,13 +70,12 @@ exit_info(Int, AttPid, OrigPid, Reason, ExitInfo) ->
case ExitInfo of
{{Mod,Line},Bs,S} ->
- Stack = binary_to_term(S),
- put(stack, Stack),
- Le = stack_level(Stack),
+ dbg_istk:from_external(S),
+ Le = dbg_istk:stack_level(),
dbg_icmd:tell_attached({exit_at, {Mod, Line}, Reason, Le}),
exit_loop(OrigPid, Reason, Bs,#ieval{module=Mod,line=Line});
{} ->
- put(stack, []),
+ dbg_istk:init(),
dbg_icmd:tell_attached({exit_at, null, Reason, 1}),
exit_loop(OrigPid, Reason, erl_eval:new_bindings(),#ieval{})
end.
@@ -142,12 +140,12 @@ check_exit_msg({'DOWN',_,_,_,Reason}, Bs,
undefined when Le =:= 1 -> % died outside interpreted code
{};
undefined when Le > 1 ->
- StackBin = term_to_binary(get(stack)),
- {{Mod, Li}, Bs, StackBin};
+ StackExternal = (dbg_istk:delayed_to_external())(),
+ {{Mod, Li}, Bs, StackExternal};
%% Debugged has terminated due to an exception
- ExitInfo0 ->
- ExitInfo0
+ ExitInfo0 when is_function(ExitInfo0, 0) ->
+ ExitInfo0()
end,
dbg_iserver:cast(get(int), {set_exit_info,self(),ExitInfo}),
@@ -170,30 +168,26 @@ check_exit_msg(_Msg, _Bs, _Ieval) ->
%% and then raise the exception.
%%--------------------------------------------------------------------
exception(Class, Reason, Bs, Ieval) ->
- exception(Class, Reason, fix_stacktrace(1), Bs, Ieval).
-
-exception(Class, Reason, Stacktrace, Bs, #ieval{module=M, line=Line}) ->
- ExitInfo = {{M,Line}, Bs, term_to_binary(get(stack))},
+ exception(Class, Reason, Bs, Ieval, false).
+
+exception(Class, Reason, Bs, Ieval, false) ->
+ do_exception(Class, Reason,
+ dbg_istk:delayed_stacktrace(no_args, Ieval),
+ Bs, Ieval);
+exception(Class, Reason, Bs, Ieval, true) ->
+ do_exception(Class, Reason,
+ dbg_istk:delayed_stacktrace(include_args, Ieval),
+ Bs, Ieval).
+
+do_exception(Class, Reason, Stacktrace, Bs, #ieval{module=M, line=Line}) ->
+ StackFun = dbg_istk:delayed_to_external(),
+ ExitInfo = fun() ->
+ {{M,Line},Bs,StackFun()}
+ end,
put(exit_info, ExitInfo),
put(stacktrace, Stacktrace),
erlang:Class(Reason).
-%%--------------------------------------------------------------------
-%% in_use_p(Mod, Cm) -> boolean()
-%% Mod = Cm = atom()
-%% Returns true if Mod is found on the stack, otherwise false.
-%%--------------------------------------------------------------------
-in_use_p(Mod, Mod) -> true;
-in_use_p(Mod, _Cm) ->
- case get(trace_stack) of
- false -> true;
- _ -> % all | no_tail
- lists:any(fun({_,{M,_,_,_}}) when M =:= Mod -> true;
- (_) -> false
- end,
- get(stack))
- end.
-
%%====================================================================
%% Internal functions
%%====================================================================
@@ -225,7 +219,7 @@ meta(Int, Debugged, M, F, As) ->
put(cache, []),
put(next_break, Status), % break | running (other values later)
put(self, Debugged), % pid() interpreted process
- put(stack, []),
+ dbg_istk:init(),
put(stacktrace, []),
put(trace_stack, dbg_iserver:call(Int, get_stack_trace)),
put(trace, false), % bool() Trace on/off
@@ -243,8 +237,7 @@ meta(Int, Debugged, M, F, As) ->
debugged_cmd(Cmd, Bs, Ieval) ->
Debugged = get(self),
- Stacktrace = fix_stacktrace(2),
- Debugged ! {sys, self(), {command,Cmd,Stacktrace}},
+ Debugged ! {sys, self(), {command,Cmd}},
meta_loop(Debugged, Bs, Ieval).
meta_loop(Debugged, Bs, #ieval{level=Le} = Ieval) ->
@@ -257,12 +250,17 @@ meta_loop(Debugged, Bs, #ieval{level=Le} = Ieval) ->
{value, Val, Bs};
{sys, Debugged, {value,Val,Bs2}} ->
{value, Val, Bs2};
- {sys, Debugged, {exception,{Class,Reason,Stacktrace}}} ->
+ {sys, Debugged, {exception,{Class,Reason,Stk}}} ->
case get(exit_info) of
- %% Error occured outside interpreted code
+ %% Error occurred outside of interpreted code.
undefined ->
- exception(Class,Reason,Stacktrace,Bs,Ieval);
+ MakeStk0 = dbg_istk:delayed_stacktrace(),
+ MakeStk = fun(Depth0) ->
+ Depth = max(0, Depth0 - length(Stk)),
+ Stk ++ MakeStk0(Depth)
+ end,
+ do_exception(Class, Reason, MakeStk, Bs, Ieval);
%% Error must have occured within a re-entry to
%% interpreted code, simply raise the exception
@@ -275,7 +273,7 @@ meta_loop(Debugged, Bs, #ieval{level=Le} = Ieval) ->
%% Reset process dictionary
%% This is really only necessary if the process left
%% interpreted code at a call level > 1
- put(stack, []),
+ dbg_istk:init(),
put(stacktrace, []),
put(exit_info, undefined),
@@ -313,177 +311,6 @@ exit_loop(OrigPid, Reason, Bs, Ieval) ->
exit_loop(OrigPid, Reason, Bs, Ieval)
end.
-%%--Stack emulation---------------------------------------------------
-
-%% We keep track of a call stack that is used for
-%% 1) saving stack frames that can be inspected from an Attached
-%% Process GUI (using dbg_icmd:get(Meta, stack_frame, {Dir, SP})
-%% 2) generate an approximation of regular stacktrace -- sent to
-%% Debugged when it should raise an exception or evaluate a
-%% function (since it might possible raise an exception)
-%%
-%% Stack = [Entry]
-%% Entry = {Le, {MFA, Where, Bs}}
-%% Le = int() % current call level
-%% MFA = {M,F,Args} % called function (or fun)
-%% | {Fun,Args} %
-%% Where = {M,Li} % from where (module+line) function is called
-%% Bs = bindings() % current variable bindings
-%%
-%% How to push depends on the "Stack Trace" option (value saved in
-%% process dictionary item 'trace_stack').
-%% all - everything is pushed
-%% no_tail - tail recursive push
-%% false - nothing is pushed
-%% Whenever a function returns, the corresponding call frame is popped.
-
-push(MFA, Bs, #ieval{level=Le,module=Cm,line=Li,last_call=Lc}) ->
- Entry = {Le, {MFA, {Cm,Li}, Bs}},
- case get(trace_stack) of
- false -> ignore;
- no_tail when Lc ->
- case get(stack) of
- [] -> put(stack, [Entry]);
- [_Entry|Entries] -> put(stack, [Entry|Entries])
- end;
- _ -> % all | no_tail when Lc =:= false
- put(stack, [Entry|get(stack)])
- end.
-
-pop() ->
- case get(trace_stack) of
- false -> ignore;
- _ -> % all � no_tail
- case get(stack) of
- [_Entry|Entries] ->
- put(stack, Entries);
- [] ->
- ignore
- end
- end.
-
-pop(Le) ->
- case get(trace_stack) of
- false -> ignore;
- _ -> % all | no_tail
- put(stack, pop(Le, get(stack)))
- end.
-
-pop(Level, [{Le, _}|Stack]) when Level=<Le ->
- pop(Level, Stack);
-pop(_Level, Stack) ->
- Stack.
-
-
-%% stack_level() -> Le
-%% stack_level(Stack) -> Le
-%% Top call level
-stack_level() ->
- stack_level(get(stack)).
-
-stack_level([]) -> 1;
-stack_level([{Le,_}|_]) -> Le.
-
-%% fix_stacktrace(Start) -> Stacktrace
-%% Start = 1|2
-%% Stacktrace = [{M,F,Args|Arity} | {Fun,Args}]
-%% Convert internal stack format to imitation of regular stacktrace.
-%% Max three elements, no repeated (recursive) calls to the same
-%% function and convert argument lists to arity for all but topmost
-%% entry (and funs).
-%% 'Start' indicates where at get(stack) to start. This somewhat ugly
-%% solution is because fix_stacktrace has two uses: 1) to imitate
-%% the stacktrace in the case of an exception in the interpreted code,
-%% in which case the current call (top of the stack = first of the list)
-%% should be included, and 2) to send a current stacktrace to Debugged
-%% when evaluation passes into non-interpreted code, in which case
-%% the current call should NOT be included (as it is Debugged which
-%% will make the actual function call).
-fix_stacktrace(Start) ->
- case fix_stacktrace2(sublist(get(stack), Start, 3)) of
- [] ->
- [];
- [H|T] ->
- [H|args2arity(T)]
- end.
-
-sublist([], _Start, _Length) ->
- []; % workaround, lists:sublist([],2,3) fails
-sublist(L, Start, Length) ->
- lists:sublist(L, Start, Length).
-
-fix_stacktrace2([{_,{{M,F,As1},_,_}}, {_,{{M,F,As2},_,_}}|_])
- when length(As1) =:= length(As2) ->
- [{M,F,As1}];
-fix_stacktrace2([{_,{{Fun,As1},_,_}}, {_,{{Fun,As2},_,_}}|_])
- when length(As1) =:= length(As2) ->
- [{Fun,As1}];
-fix_stacktrace2([{_,{MFA,_,_}}|Entries]) ->
- [MFA|fix_stacktrace2(Entries)];
-fix_stacktrace2([]) ->
- [].
-
-args2arity([{M,F,As}|Entries]) when is_list(As) ->
- [{M,F,length(As)}|args2arity(Entries)];
-args2arity([Entry|Entries]) ->
- [Entry|args2arity(Entries)];
-args2arity([]) ->
- [].
-
-%% bindings(SP) -> Bs
-%% SP = Le % stack pointer
-%% Return the bindings for the specified call level
-bindings(SP) ->
- bindings(SP, get(stack)).
-
-bindings(SP, [{SP,{_MFA,_Wh,Bs}}|_]) ->
- Bs;
-bindings(SP, [_Entry|Entries]) ->
- bindings(SP, Entries);
-bindings(_SP, []) ->
- erl_eval:new_bindings().
-
-%% stack_frame(Dir, SP) -> {Le, Where, Bs} | top | bottom
-%% Dir = up | down
-%% Where = {Cm, Li}
-%% Cm = Module | undefined % module
-%% Li = int() | -1 % line number
-%% Bs = bindings()
-%% Return stack frame info one step up/down from given stack pointer
-%% up = to lower call levels
-%% down = to higher call levels
-stack_frame(up, SP) ->
- stack_frame(SP, up, get(stack));
-stack_frame(down, SP) ->
- stack_frame(SP, down, lists:reverse(get(stack))).
-
-stack_frame(SP, up, [{Le, {_MFA,Where,Bs}}|_]) when Le<SP ->
- {Le, Where, Bs};
-stack_frame(SP, down, [{Le, {_MFA,Where,Bs}}|_]) when Le>SP ->
- {Le, Where, Bs};
-stack_frame(SP, Dir, [{SP, _}|Stack]) ->
- case Stack of
- [{Le, {_MFA,Where,Bs}}|_] ->
- {Le, Where, Bs};
- [] when Dir =:= up ->
- top;
- [] when Dir =:= down ->
- bottom
- end;
-stack_frame(SP, Dir, [_Entry|Stack]) ->
- stack_frame(SP, Dir, Stack).
-
-%% backtrace(HowMany) -> Backtrace
-%% HowMany = all | int()
-%% Backtrace = {Le, MFA}
-%% Return all/the last N called functions, in reversed call order
-backtrace(HowMany) ->
- Stack = case HowMany of
- all -> get(stack);
- N -> lists:sublist(get(stack), N)
- end,
- [{Le, MFA} || {Le,{MFA,_Wh,_Bs}} <- Stack].
-
%%--Trace function----------------------------------------------------
%%--------------------------------------------------------------------
@@ -558,7 +385,7 @@ format_args1([]) ->
%% Mimic catch behaviour
catch_value(error, Reason) ->
- {'EXIT',{Reason,get(stacktrace)}};
+ {'EXIT',{Reason,get_stacktrace()}};
catch_value(exit, Reason) ->
{'EXIT',Reason};
catch_value(throw, Reason) ->
@@ -570,11 +397,13 @@ catch_value(throw, Reason) ->
%% Top level function of meta evaluator.
%% Return message to be replied to the target process.
%%--------------------------------------------------------------------
-eval_mfa(Debugged, M, F, As, Ieval) ->
+eval_mfa(Debugged, M, F, As, #ieval{level=Le}=Ieval0) ->
Int = get(int),
Bs = erl_eval:new_bindings(),
- try eval_function(M,F,As,Bs,extern,Ieval#ieval{last_call=true}) of
+ Ieval = Ieval0#ieval{level=Le+1,top=true},
+ try do_eval_function(M, F, As, Bs, extern, Ieval) of
{value, Val, _Bs} ->
+ trace(return, {Le,Val}),
{ready, Val}
catch
exit:{Debugged, Reason} ->
@@ -582,76 +411,68 @@ eval_mfa(Debugged, M, F, As, Ieval) ->
exit:{Int, Reason} ->
exit(Reason);
Class:Reason ->
- {exception, {Class, Reason, get(stacktrace)}}
+ {exception, {Class, Reason, get_stacktrace()}}
+ end.
+
+eval_function(Mod, Name, As, Bs, Called, Ieval0, Lc) ->
+ Tail = Lc andalso get(trace_stack) =:= no_tail,
+ case Tail of
+ false ->
+ Ieval = dbg_istk:push(Bs, Ieval0, Lc),
+ {value,Val,_} = do_eval_function(Mod, Name, As, Bs, Called, Ieval),
+ dbg_istk:pop(),
+ trace(return, {Ieval#ieval.level,Val}),
+ {value,Val,Bs};
+ true ->
+ do_eval_function(Mod, Name, As, Bs, Called, Ieval0)
end.
-eval_function(Mod, Fun, As0, Bs0, _Called, Ieval) when is_function(Fun);
- Mod =:= ?MODULE,
- Fun =:= eval_fun ->
- #ieval{level=Le, line=Li, last_call=Lc} = Ieval,
+do_eval_function(Mod, Fun, As0, Bs0, _, Ieval0) when is_function(Fun);
+ Mod =:= ?MODULE,
+ Fun =:= eval_fun ->
+ #ieval{level=Le,line=Li,top=Top} = Ieval0,
case lambda(Fun, As0) of
- {Cs,Module,Name,As,Bs} ->
- push({Module,Name,As}, Bs0, Ieval),
+ {[{clause,Fc,_,_,_}|_]=Cs,Module,Name,As,Bs} ->
+ Ieval = Ieval0#ieval{module=Module,function=Name,
+ arguments=As0,line=Fc},
trace(call_fun, {Le,Li,Name,As}),
- {value, Val, _Bs} =
- fnk_clauses(Cs, Module, Name, As, Bs,
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ fnk_clauses(Cs, As, Bs, Ieval);
- not_interpreted when Lc -> % We are leaving interpreted code
+ not_interpreted when Top -> % We are leaving interpreted code
trace(call_fun, {Le,Li,Fun,As0}),
{value, {dbg_apply,erlang,apply,[Fun,As0]}, Bs0};
not_interpreted ->
- push({Fun,As0}, Bs0, Ieval),
trace(call_fun, {Le,Li,Fun,As0}),
- {value, Val, _Bs} =
- debugged_cmd({apply,erlang,apply,[Fun,As0]},Bs0,
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ debugged_cmd({apply,erlang,apply,[Fun,As0]}, Bs0, Ieval0);
{error,Reason} ->
%% It's ok not to push anything in this case, the error
%% reason contains information about the culprit
%% ({badarity,{{Mod,Name},As}})
- exception(error, Reason, Bs0, Ieval)
+ exception(error, Reason, Bs0, Ieval0)
end;
%% Common Test adaptation
-eval_function(ct_line, line, As, Bs, extern, #ieval{level=Le}=Ieval) ->
+do_eval_function(ct_line, line, As, Bs, extern, #ieval{level=Le}=Ieval) ->
debugged_cmd({apply,ct_line,line,As}, Bs, Ieval#ieval{level=Le+1}),
{value, ignore, Bs};
-eval_function(Mod, Name, As0, Bs0, Called, Ieval) ->
- #ieval{level=Le, line=Li, last_call=Lc} = Ieval,
-
- push({Mod,Name,As0}, Bs0, Ieval),
+do_eval_function(Mod, Name, As0, Bs0, Called, Ieval0) ->
+ #ieval{level=Le,line=Li,top=Top} = Ieval0,
trace(call, {Called, {Le,Li,Mod,Name,As0}}),
-
+ Ieval = Ieval0#ieval{module=Mod,function=Name,arguments=As0},
case get_function(Mod, Name, As0, Called) of
- Cs when is_list(Cs) ->
- {value, Val, _Bs} =
- fnk_clauses(Cs, Mod, Name, As0, erl_eval:new_bindings(),
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ [{clause,FcLine,_,_,_}|_]=Cs ->
+ fnk_clauses(Cs, As0, erl_eval:new_bindings(),
+ Ieval#ieval{line=FcLine});
- not_interpreted when Lc -> % We are leaving interpreted code
+ not_interpreted when Top -> % We are leaving interpreted code
{value, {dbg_apply,Mod,Name,As0}, Bs0};
not_interpreted ->
- {value, Val, _Bs} =
- debugged_cmd({apply,Mod,Name,As0}, Bs0,
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ debugged_cmd({apply,Mod,Name,As0}, Bs0, Ieval);
undef ->
- exception(error, undef, Bs0, Ieval)
+ exception(error, undef, Bs0, Ieval, true)
end.
lambda(eval_fun, [Cs,As,Bs,{Mod,Name}=F]) ->
@@ -752,23 +573,21 @@ cached(Key) ->
%% Try to find a matching function clause
%% #ieval.level is set, the other fields must be set in this function
-fnk_clauses([{clause,Line,Pars,Gs,Body}|Cs], M, F, As, Bs0, Ieval) ->
+fnk_clauses([{clause,Line,Pars,Gs,Body}|Cs], As, Bs0, Ieval) ->
case head_match(Pars, As, [], Bs0) of
{match,Bs1} ->
Bs = add_bindings(Bs1, Bs0),
case guard(Gs, Bs) of
true ->
- seq(Body, Bs,
- Ieval#ieval{line=Line,
- module=M,function=F,arguments=As});
+ seq(Body, Bs, Ieval#ieval{line=Line});
false ->
- fnk_clauses(Cs, M, F, As, Bs0, Ieval)
+ fnk_clauses(Cs, As, Bs0, Ieval)
end;
nomatch ->
- fnk_clauses(Cs, M, F, As, Bs0, Ieval)
+ fnk_clauses(Cs, As, Bs0, Ieval)
end;
-fnk_clauses([], _M, _F, _As, Bs, Ieval) ->
- exception(error, function_clause, Bs, Ieval).
+fnk_clauses([], _As, Bs, Ieval) ->
+ exception(error, function_clause, Bs, Ieval, true).
seq([E], Bs0, Ieval) ->
case dbg_icmd:cmd(E, Bs0, Ieval) of
@@ -782,7 +601,7 @@ seq([E|Es], Bs0, Ieval) ->
{skip,Bs} ->
seq(Es, Bs, Ieval);
Bs1 ->
- {value,_,Bs} = expr(E, Bs1, Ieval#ieval{last_call=false}),
+ {value,_,Bs} = expr(E, Bs1, Ieval#ieval{top=false}),
seq(Es, Bs, Ieval)
end;
seq([], Bs, _) ->
@@ -804,10 +623,9 @@ expr({value,Val}, Bs, _Ieval) -> % Special case straight values
%% List
expr({cons,Line,H0,T0}, Bs0, Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- Ieval1 = Ieval#ieval{last_call=false},
- {value,H,Bs1} = expr(H0,Bs0,Ieval1),
- {value,T,Bs2} = expr(T0,Bs0,Ieval1),
+ Ieval = Ieval0#ieval{line=Line,top=false},
+ {value,H,Bs1} = expr(H0, Bs0, Ieval),
+ {value,T,Bs2} = expr(T0, Bs0, Ieval),
{value,[H|T],merge_bindings(Bs2, Bs1, Ieval)};
%% Tuple
@@ -821,12 +639,12 @@ expr({block,Line,Es},Bs,Ieval) ->
%% Catch statement
expr({'catch',Line,Expr}, Bs0, Ieval) ->
- try expr(Expr, Bs0, Ieval#ieval{line=Line, last_call=false})
+ try expr(Expr, Bs0, Ieval#ieval{line=Line, top=false})
catch
Class:Reason ->
%% Exception caught, reset exit info
put(exit_info, undefined),
- pop(Ieval#ieval.level),
+ dbg_istk:pop(Ieval#ieval.level),
Value = catch_value(Class, Reason),
trace(return, {Ieval#ieval.level,Value}),
{value, Value, Bs0}
@@ -835,7 +653,7 @@ expr({'catch',Line,Expr}, Bs0, Ieval) ->
%% Try-catch statement
expr({'try',Line,Es,CaseCs,CatchCs,[]}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- try seq(Es, Bs0, Ieval#ieval{last_call=false}) of
+ try seq(Es, Bs0, Ieval#ieval{top=false}) of
{value,Val,Bs} = Value ->
case CaseCs of
[] -> Value;
@@ -848,7 +666,7 @@ expr({'try',Line,Es,CaseCs,CatchCs,[]}, Bs0, Ieval0) ->
end;
expr({'try',Line,Es,CaseCs,CatchCs,As}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- try seq(Es, Bs0, Ieval#ieval{last_call=false}) of
+ try seq(Es, Bs0, Ieval#ieval{top=false}) of
{value,Val,Bs} = Value ->
case CaseCs of
[] -> Value;
@@ -859,13 +677,13 @@ expr({'try',Line,Es,CaseCs,CatchCs,As}, Bs0, Ieval0) ->
Class:Reason when CatchCs =/= [] ->
catch_clauses({Class,Reason,[]}, CatchCs, Bs0, Ieval)
after
- seq(As, Bs0, Ieval#ieval{last_call=false})
+ seq(As, Bs0, Ieval#ieval{top=false})
end;
%% Case statement
expr({'case',Line,E,Cs}, Bs0, Ieval) ->
{value,Val,Bs} =
- expr(E, Bs0, Ieval#ieval{line=Line, last_call=false}),
+ expr(E, Bs0, Ieval#ieval{line=Line, top=false}),
case_clauses(Val, Cs, Bs, case_clause, Ieval#ieval{line=Line});
%% If statement
@@ -874,20 +692,20 @@ expr({'if',Line,Cs}, Bs, Ieval) ->
%% Andalso/orelse
expr({'andalso',Line,E1,E2}, Bs, Ieval) ->
- case expr(E1, Bs, Ieval#ieval{line=Line, last_call=false}) of
+ case expr(E1, Bs, Ieval#ieval{line=Line, top=false}) of
{value,false,_}=Res ->
Res;
{value,true,_} ->
- expr(E2, Bs, Ieval#ieval{line=Line, last_call=false});
+ expr(E2, Bs, Ieval#ieval{line=Line, top=false});
{value,Val,Bs} ->
exception(error, {badarg,Val}, Bs, Ieval)
end;
expr({'orelse',Line,E1,E2}, Bs, Ieval) ->
- case expr(E1, Bs, Ieval#ieval{line=Line, last_call=false}) of
+ case expr(E1, Bs, Ieval#ieval{line=Line, top=false}) of
{value,true,_}=Res ->
Res;
{value,false,_} ->
- expr(E2, Bs, Ieval#ieval{line=Line, last_call=false});
+ expr(E2, Bs, Ieval#ieval{line=Line, top=false});
{value,Val,_} ->
exception(error, {badarg,Val}, Bs, Ieval)
end;
@@ -895,7 +713,7 @@ expr({'orelse',Line,E1,E2}, Bs, Ieval) ->
%% Matching expression
expr({match,Line,Lhs,Rhs0}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,Rhs,Bs1} = expr(Rhs0, Bs0, Ieval#ieval{last_call=false}),
+ {value,Rhs,Bs1} = expr(Rhs0, Bs0, Ieval#ieval{top=false}),
case match(Lhs, Rhs, Bs1) of
{match,Bs} ->
{value,Rhs,Bs};
@@ -951,21 +769,21 @@ expr({make_fun,Line,Name,Cs}, Bs, #ieval{module=Module}=Ieval) ->
{value,Fun,Bs};
%% Common test adaptation
-expr({call_remote,0,ct_line,line,As0}, Bs0, Ieval0) ->
+expr({call_remote,0,ct_line,line,As0,Lc}, Bs0, Ieval0) ->
{As,_Bs} = eval_list(As0, Bs0, Ieval0),
- eval_function(ct_line, line, As, Bs0, extern, Ieval0);
+ eval_function(ct_line, line, As, Bs0, extern, Ieval0, Lc);
%% Local function call
-expr({local_call,Line,F,As0}, Bs0, #ieval{module=M} = Ieval0) ->
+expr({local_call,Line,F,As0,Lc}, Bs0, #ieval{module=M} = Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{As,Bs} = eval_list(As0, Bs0, Ieval),
- eval_function(M, F, As, Bs, local, Ieval);
+ eval_function(M, F, As, Bs, local, Ieval, Lc);
%% Remote function call
-expr({call_remote,Line,M,F,As0}, Bs0, Ieval0) ->
+expr({call_remote,Line,M,F,As0,Lc}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{As,Bs} = eval_list(As0, Bs0, Ieval),
- eval_function(M, F, As, Bs, extern, Ieval);
+ eval_function(M, F, As, Bs, extern, Ieval, Lc);
%% Emulated semantics of some BIFs
expr({dbg,Line,self,[]}, Bs, #ieval{level=Le}) ->
@@ -975,9 +793,28 @@ expr({dbg,Line,self,[]}, Bs, #ieval{level=Le}) ->
{value,Self,Bs};
expr({dbg,Line,get_stacktrace,[]}, Bs, #ieval{level=Le}) ->
trace(bif, {Le,Line,erlang,get_stacktrace,[]}),
- Stacktrace = get(stacktrace),
+ Stacktrace = get_stacktrace(),
trace(return, {Le,Stacktrace}),
{value,Stacktrace,Bs};
+expr({dbg,Line,raise,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
+ %% Since erlang:get_stacktrace/0 is emulated, we will
+ %% need to emulate erlang:raise/3 too so that we can
+ %% capture the stacktrace.
+ Ieval = Ieval0#ieval{line=Line},
+ {[Class,Reason,Stk0]=As,Bs} = eval_list(As0, Bs0, Ieval),
+ trace(bif, {Le,Line,erlang,raise,As}),
+ try
+ %% Evaluate raise/3 for error checking and
+ %% truncating of the stacktrace to the correct depth.
+ Error = erlang:raise(Class, Reason, Stk0),
+ trace(return, {Le,Error}),
+ {value,Error,Bs}
+ catch
+ _:_ ->
+ Stk = erlang:get_stacktrace(), %Possibly truncated.
+ StkFun = fun(_) -> Stk end,
+ do_exception(Class, Reason, StkFun, Bs, Ieval)
+ end;
expr({dbg,Line,throw,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{[Term],Bs} = eval_list(As0, Bs0, Ieval),
@@ -988,11 +825,6 @@ expr({dbg,Line,error,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
{[Term],Bs} = eval_list(As0, Bs0, Ieval),
trace(bif, {Le,Line,erlang,error,[Term]}),
exception(error, Term, Bs, Ieval);
-expr({dbg,Line,fault,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {[Term],Bs} = eval_list(As0, Bs0, Ieval),
- trace(bif, {Le,Line,erlang,fault,[Term]}),
- exception(fault, Term, Bs, Ieval);
expr({dbg,Line,exit,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{[Term],Bs} = eval_list(As0, Bs0, Ieval),
@@ -1001,36 +833,26 @@ expr({dbg,Line,exit,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
%% Call to "safe" BIF, ie a BIF that can be executed in Meta process
expr({safe_bif,Line,M,F,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {As,Bs} = eval_list(As0, Bs0, Ieval),
+ Ieval1 = Ieval0#ieval{line=Line},
+ {As,Bs} = eval_list(As0, Bs0, Ieval1),
trace(bif, {Le,Line,M,F,As}),
- push({M,F,As}, Bs0, Ieval),
+ Ieval2 = dbg_istk:push(Bs0, Ieval1, false),
+ Ieval = Ieval2#ieval{module=M,function=F,arguments=As,line=-1},
{_,Value,_} = Res = safe_bif(M, F, As, Bs, Ieval),
trace(return, {Le,Value}),
- pop(),
+ dbg_istk:pop(),
Res;
%% Call to a BIF that must be evaluated in the correct process
expr({bif,Line,M,F,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {As,Bs} = eval_list(As0, Bs0, Ieval),
+ Ieval1 = Ieval0#ieval{line=Line},
+ {As,Bs} = eval_list(As0, Bs0, Ieval1),
trace(bif, {Le,Line,M,F,As}),
- push({M,F,As}, Bs0, Ieval),
- {_,Value,_} =
- Res = debugged_cmd({apply,M,F,As}, Bs, Ieval#ieval{level=Le+1}),
+ Ieval2 = dbg_istk:push(Bs0, Ieval1, false),
+ Ieval = Ieval2#ieval{module=M,function=F,arguments=As,line=-1},
+ {_,Value,_} = Res = debugged_cmd({apply,M,F,As}, Bs, Ieval),
trace(return, {Le,Value}),
- pop(),
- Res;
-
-%% Call to a BIF that spawns a new process
-expr({spawn_bif,Line,M,F,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {As,Bs} = eval_list(As0, Bs0, Ieval),
- trace(bif, {Le,Line,M,F,As}),
- push({M,F,As}, Bs0, Ieval),
- Res = debugged_cmd({apply,M,F,As}, Bs,Ieval#ieval{level=Le+1}),
- trace(return, {Le,Res}),
- pop(),
+ dbg_istk:pop(),
Res;
%% Call to an operation
@@ -1046,7 +868,7 @@ expr({op,Line,Op,As0}, Bs0, Ieval0) ->
end;
%% apply/2 (fun)
-expr({apply_fun,Line,Fun0,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
+expr({apply_fun,Line,Fun0,As0,Lc}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
FunValue = case expr(Fun0, Bs0, Ieval) of
{value,{dbg_apply,Mx,Fx,Asx},Bsx} ->
@@ -1058,31 +880,20 @@ expr({apply_fun,Line,Fun0,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
case FunValue of
{value,Fun,Bs1} when is_function(Fun) ->
{As,Bs} = eval_list(As0, Bs1, Ieval),
- eval_function(undefined, Fun, As, Bs, extern, Ieval);
+ eval_function(undefined, Fun, As, Bs, extern, Ieval, Lc);
{value,{M,F},Bs1} when is_atom(M), is_atom(F) ->
{As,Bs} = eval_list(As0, Bs1, Ieval),
- eval_function(M, F, As, Bs, extern, Ieval);
+ eval_function(M, F, As, Bs, extern, Ieval, Lc);
{value,BadFun,Bs1} ->
exception(error, {badfun,BadFun}, Bs1, Ieval)
end;
%% apply/3
-expr({apply,Line,As0}, Bs0, Ieval0) ->
+expr({apply,Line,As0,Lc}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{[M,F,As],Bs} = eval_list(As0, Bs0, Ieval),
- eval_function(M, F, As, Bs, extern, Ieval);
+ eval_function(M, F, As, Bs, extern, Ieval, Lc);
-%% Mod:module_info/0,1
-expr({module_info_0,_,Mod}, Bs, _Ieval) ->
- {value,[{compile,module_info(Mod,compile)},
- {attributes,module_info(Mod,attributes)},
- {imports,module_info(Mod,imports)},
- {exports,module_info(Mod,exports)}],Bs};
-expr({module_info_1,Line,Mod,[As0]}, Bs0, Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {value,What,Bs} = expr(As0, Bs0, Ieval),
- {value,module_info(Mod, What),Bs};
-
%% Receive statement
expr({'receive',Line,Cs}, Bs0, #ieval{level=Le}=Ieval) ->
trace(receivex, {Le,false}),
@@ -1091,7 +902,7 @@ expr({'receive',Line,Cs}, Bs0, #ieval{level=Le}=Ieval) ->
%% Receive..after statement
expr({'receive',Line,Cs,To,ToExprs}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,ToVal,ToBs} = expr(To, Bs0, Ieval#ieval{last_call=false}),
+ {value,ToVal,ToBs} = expr(To, Bs0, Ieval#ieval{top=false}),
trace(receivex, {Le,true}),
check_timeoutvalue(ToVal, ToBs, To, Ieval),
{Stamp,_} = statistics(wall_clock),
@@ -1101,7 +912,7 @@ expr({'receive',Line,Cs,To,ToExprs}, Bs0, #ieval{level=Le}=Ieval0) ->
%% Send (!)
expr({send,Line,To0,Msg0}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- Ieval1 = Ieval#ieval{last_call=false},
+ Ieval1 = Ieval#ieval{top=false},
{value,To,Bs1} = expr(To0, Bs0, Ieval1),
{value,Msg,Bs2} = expr(Msg0, Bs0, Ieval1),
Bs = merge_bindings(Bs2, Bs1, Ieval),
@@ -1110,10 +921,15 @@ expr({send,Line,To0,Msg0}, Bs0, Ieval0) ->
%% Binary
expr({bin,Line,Fs}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- eval_bits:expr_grp(Fs, Bs0,
- fun (E, B) -> expr(E, B, Ieval) end,
- [],
- false);
+ try
+ eval_bits:expr_grp(Fs, Bs0,
+ fun (E, B) -> expr(E, B, Ieval) end,
+ [],
+ false)
+ catch
+ Class:Reason ->
+ exception(Class, Reason, Bs0, Ieval)
+ end;
%% List comprehension
expr({lc,_Line,E,Qs}, Bs, Ieval) ->
@@ -1138,12 +954,12 @@ eval_lc(E, Qs, Bs, Ieval) ->
eval_lc1(E, [{generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_lc1(E, Qs, NewBs, Ieval) end,
eval_generate(L1, P, Bs1, CompFun, Ieval);
eval_lc1(E, [{b_generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_lc1(E, Qs, NewBs, Ieval) end,
eval_b_generate(Bin, P, Bs0, CompFun, Ieval);
eval_lc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
@@ -1152,13 +968,13 @@ eval_lc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
false -> []
end;
eval_lc1(E, [Q|Qs], Bs0, Ieval) ->
- case expr(Q, Bs0, Ieval#ieval{last_call=false}) of
+ case expr(Q, Bs0, Ieval#ieval{top=false}) of
{value,true,Bs} -> eval_lc1(E, Qs, Bs, Ieval);
{value,false,_Bs} -> [];
{value,V,Bs} -> exception(error, {bad_filter,V}, Bs, Ieval)
end;
eval_lc1(E, [], Bs, Ieval) ->
- {value,V,_} = expr(E, Bs, Ieval#ieval{last_call=false}),
+ {value,V,_} = expr(E, Bs, Ieval#ieval{top=false}),
[V].
%% eval_bc(Expr,[Qualifier],Bindings,IevalState) ->
@@ -1171,12 +987,12 @@ eval_bc(E, Qs, Bs, Ieval) ->
eval_bc1(E, [{generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_bc1(E, Qs, NewBs, Ieval) end,
eval_generate(L1, P, Bs1, CompFun, Ieval);
eval_bc1(E, [{b_generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_bc1(E, Qs, NewBs, Ieval) end,
eval_b_generate(Bin, P, Bs0, CompFun, Ieval);
eval_bc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
@@ -1185,13 +1001,13 @@ eval_bc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
false -> []
end;
eval_bc1(E, [Q|Qs], Bs0, Ieval) ->
- case expr(Q, Bs0, Ieval#ieval{last_call=false}) of
+ case expr(Q, Bs0, Ieval#ieval{top=false}) of
{value,true,Bs} -> eval_bc1(E, Qs, Bs, Ieval);
{value,false,_Bs} -> [];
{value,V,Bs} -> exception(error, {bad_filter,V}, Bs, Ieval)
end;
eval_bc1(E, [], Bs, Ieval) ->
- {value,V,_} = expr(E, Bs, Ieval#ieval{last_call=false}),
+ {value,V,_} = expr(E, Bs, Ieval#ieval{top=false}),
[V].
eval_generate([V|Rest], P, Bs0, CompFun, Ieval) ->
@@ -1208,7 +1024,7 @@ eval_generate(Term, _P, Bs, _CompFun, Ieval) ->
exception(error, {bad_generator,Term}, Bs, Ieval).
eval_b_generate(<<_/bitstring>>=Bin, P, Bs0, CompFun, Ieval) ->
- Mfun = fun(L, R, Bs) -> match1(L, R, Bs, Bs0) end,
+ Mfun = match_fun(Bs0),
Efun = fun(Exp, Bs) -> expr(Exp, Bs, #ieval{}) end,
case eval_bits:bin_gen(P, Bin, erl_eval:new_bindings(), Bs0, Mfun, Efun) of
{match,Rest,Bs1} ->
@@ -1222,24 +1038,13 @@ eval_b_generate(<<_/bitstring>>=Bin, P, Bs0, CompFun, Ieval) ->
eval_b_generate(Term, _P, Bs, _CompFun, Ieval) ->
exception(error, {bad_generator,Term}, Bs, Ieval).
-module_info(Mod, module) -> Mod;
-module_info(_Mod, compile) -> [];
-module_info(Mod, attributes) ->
- {ok, Attr} = dbg_iserver:call(get(int), {lookup, Mod, attributes}),
- Attr;
-module_info(_Mod, imports) -> [];
-module_info(Mod, exports) ->
- {ok, Exp} = dbg_iserver:call(get(int), {lookup, Mod, exports}),
- Exp;
-module_info(_Mod, functions) -> [].
-
safe_bif(M, F, As, Bs, Ieval) ->
try apply(M, F, As) of
Value ->
{value,Value,Bs}
catch
Class:Reason ->
- exception(Class, Reason, Bs, Ieval)
+ exception(Class, Reason, Bs, Ieval, true)
end.
eval_send(To, Msg, Bs, Ieval) ->
@@ -1408,12 +1213,12 @@ flush_traces(Debugged) ->
%% eval_list(ExpressionList, Bindings, Ieval)
%% Evaluate a list of expressions "in parallel" at the same level.
eval_list(Es, Bs, Ieval) ->
- eval_list(Es, [], Bs, Bs, Ieval).
+ eval_list_1(Es, [], Bs, Bs, Ieval#ieval{top=false}).
-eval_list([E|Es], Vs, BsOrig, Bs0, Ieval) ->
- {value,V,Bs1} = expr(E, BsOrig, Ieval#ieval{last_call=false}),
- eval_list(Es, [V|Vs], BsOrig, merge_bindings(Bs1,Bs0,Ieval), Ieval);
-eval_list([], Vs, _, Bs, _Ieval) ->
+eval_list_1([E|Es], Vs, BsOrig, Bs0, Ieval) ->
+ {value,V,Bs1} = expr(E, BsOrig, Ieval),
+ eval_list_1(Es, [V|Vs], BsOrig, merge_bindings(Bs1, Bs0, Ieval), Ieval);
+eval_list_1([], Vs, _, Bs, _Ieval) ->
{lists:reverse(Vs,[]),Bs}.
%% if_clauses(Clauses, Bindings, Ieval)
@@ -1453,7 +1258,7 @@ catch_clauses(Exception, [{clause,_,[P],G,B}|CatchCs], Bs0, Ieval) ->
true ->
%% Exception caught, reset exit info
put(exit_info, undefined),
- pop(Ieval#ieval.level),
+ dbg_istk:pop(Ieval#ieval.level),
seq(B, Bs, Ieval);
false ->
catch_clauses(Exception, CatchCs, Bs0, Ieval)
@@ -1588,11 +1393,9 @@ match1({cons,_,H,T}, [H1|T1], Bs0, BBs) ->
match1({tuple,_,Elts}, Tuple, Bs, BBs)
when length(Elts) =:= tuple_size(Tuple) ->
match_tuple(Elts, Tuple, 1, Bs, BBs);
-match1({bin,_,Fs}, B, Bs0, BBs0) when is_bitstring(B) ->
- Bs1 = lists:sort(Bs0), %Kludge.
- BBs = lists:sort(BBs0),
- try eval_bits:match_bits(Fs, B, Bs1, BBs,
- fun(L, R, Bs) -> match1(L, R, Bs, BBs) end,
+match1({bin,_,Fs}, B, Bs0, BBs) when is_bitstring(B) ->
+ try eval_bits:match_bits(Fs, B, Bs0, BBs,
+ match_fun(BBs),
fun(E, Bs) -> expr(E, Bs, #ieval{}) end,
false)
catch
@@ -1601,6 +1404,12 @@ match1({bin,_,Fs}, B, Bs0, BBs0) when is_bitstring(B) ->
match1(_,_,_,_) ->
throw(nomatch).
+match_fun(BBs) ->
+ fun(match, {L,R,Bs}) -> match1(L, R, Bs, BBs);
+ (binding, {Name,Bs}) -> binding(Name, Bs);
+ (add_binding, {Name,Val,Bs}) -> add_binding(Name, Val, Bs)
+ end.
+
match_tuple([E|Es], Tuple, I, Bs0, BBs) ->
{match,Bs} = match1(E, element(I, Tuple), Bs0, BBs),
match_tuple(Es, Tuple, I+1, Bs, BBs);
@@ -1731,3 +1540,19 @@ add_binding(N,Val,[B1|Bs]) ->
[B1|add_binding(N,Val,Bs)];
add_binding(N,Val,[]) ->
[{N,Val}].
+
+%% get_stacktrace() -> Stacktrace
+%% Return the latest stacktrace for the process.
+get_stacktrace() ->
+ case get(stacktrace) of
+ MakeStk when is_function(MakeStk, 1) ->
+ %% The stacktrace has not been constructed before.
+ %% Construct it and remember the result.
+ Depth = erlang:system_flag(backtrace_depth, 8),
+ erlang:system_flag(backtrace_depth, Depth),
+ Stk = MakeStk(Depth),
+ put(stacktrace, Stk),
+ Stk;
+ Stk when is_list(Stk) ->
+ Stk
+ end.
diff --git a/lib/debugger/src/dbg_ieval.hrl b/lib/debugger/src/dbg_ieval.hrl
index a344748f48..ea6189ad02 100644
--- a/lib/debugger/src/dbg_ieval.hrl
+++ b/lib/debugger/src/dbg_ieval.hrl
@@ -21,6 +21,8 @@
module, % MFA which called the currently
function, % interpreted function
arguments, %
- last_call = false % True if current expression is
- }). % the VERY last to be evaluated
- % (ie at all, not only in a clause)
+
+ %% True if the current expression is at the top level
+ %% (i.e. the next call will leave interpreted code).
+ top = false
+ }).
diff --git a/lib/debugger/src/dbg_iload.erl b/lib/debugger/src/dbg_iload.erl
index db5a17ad2e..ce5631e45f 100644
--- a/lib/debugger/src/dbg_iload.erl
+++ b/lib/debugger/src/dbg_iload.erl
@@ -62,22 +62,23 @@ load_mod1(Mod, File, Binary, Db) ->
store_module(Mod, File, Binary, Db) ->
{interpreter_module, Exp, Abst, Src, MD5} = binary_to_term(Binary),
Forms = case abstr(Abst) of
- {abstract_v1,Forms0} -> Forms0;
- {abstract_v2,Forms0} -> Forms0;
+ {abstract_v1,_} ->
+ exit({Mod,too_old_beam_file});
+ {abstract_v2,_} ->
+ exit({Mod,too_old_beam_file});
{raw_abstract_v1,Code0} ->
Code = interpret_file_attribute(Code0),
{_,_,Forms0,_} = sys_pre_expand:module(Code, []),
Forms0
end,
dbg_idb:insert(Db, mod_file, File),
- dbg_idb:insert(Db, exports, Exp),
dbg_idb:insert(Db, defs, []),
put(vcount, 0),
put(fun_count, 0),
put(funs, []),
put(mod_md5, MD5),
- Attr = store_forms(Forms, Mod, Db, Exp, []),
+ store_forms(Forms, Mod, Db, Exp),
erase(mod_md5),
erase(current_function),
%% store_funs(Db, Mod),
@@ -85,11 +86,10 @@ store_module(Mod, File, Binary, Db) ->
erase(funs),
erase(fun_count),
- dbg_idb:insert(Db, attributes, Attr),
NewBinary = store_mod_line_no(Mod, Db, binary_to_list(Src)),
dbg_idb:insert(Db, mod_bin, NewBinary),
- dbg_idb:insert(Db, mod_raw, <<Src/binary,0:8>>), %% Add eos
- dbg_idb:insert(Db, module, Mod).
+ dbg_idb:insert(Db, mod_raw, <<Src/binary,0:8>>). %% Add eos
+
%% Adjust line numbers using the file/2 attribute.
%% Also take the absolute value of line numbers.
%% This simple fix will make the marker point at the correct line
@@ -111,27 +111,19 @@ abstr(Term) -> Term.
% store_funs_1(Fs, Db, Mod);
% store_funs_1([], _, _) -> ok.
-store_forms([{function,_,module_info,0,_}|Fs], Mod, Db, Exp, Attr) ->
- Cs = [{clause,0,[],[], [{module_info_0,0,Mod}]}],
- dbg_idb:insert(Db, {Mod,module_info,0,true}, Cs),
- store_forms(Fs, Mod, Db, Exp, Attr);
-store_forms([{function,_,module_info,1,_}|Fs], Mod, Db, Exp, Attr) ->
- Cs = [{clause,0,[{var,0,'What'}],[], [{module_info_1,0,Mod,[{var,0,'What'}]}]}],
- dbg_idb:insert(Db, {Mod,module_info,1,true}, Cs),
- store_forms(Fs, Mod, Db, Exp, Attr);
-store_forms([{function,_,Name,Arity,Cs0}|Fs], Mod, Db, Exp, Attr) ->
+store_forms([{function,_,Name,Arity,Cs0}|Fs], Mod, Db, Exp) ->
FA = {Name,Arity},
put(current_function, FA),
Cs = clauses(Cs0),
Exported = lists:member(FA, Exp),
dbg_idb:insert(Db, {Mod,Name,Arity,Exported}, Cs),
- store_forms(Fs, Mod, Db, Exp, Attr);
-store_forms([{attribute,_,Name,Val}|Fs], Mod, Db, Exp, Attr) ->
- store_forms(Fs, Mod, Db, Exp, [{Name,Val}|Attr]);
-store_forms([F|_], _Mod, _Db, _Exp, _Attr) ->
+ store_forms(Fs, Mod, Db, Exp);
+store_forms([{attribute,_,_Name,_Val}|Fs], Mod, Db, Exp) ->
+ store_forms(Fs, Mod, Db, Exp);
+store_forms([F|_], _Mod, _Db, _Exp) ->
exit({unknown_form,F});
-store_forms([], _, _, _, Attr) ->
- lists:reverse(Attr).
+store_forms([], _, _, _) ->
+ ok.
store_mod_line_no(Mod, Db, Contents) ->
store_mod_line_no(Mod, Db, Contents, 1, 0, []).
@@ -164,14 +156,14 @@ get_nl([],Pos,Head) -> {lists:reverse(Head),[],Pos}.
%%% to interpret.
clauses([C0|Cs]) ->
- C1 = clause(C0),
+ C1 = clause(C0, true),
[C1|clauses(Cs)];
clauses([]) -> [].
-clause({clause,Line,H0,G0,B0}) ->
+clause({clause,Line,H0,G0,B0}, Lc) ->
H1 = head(H0),
G1 = guard(G0),
- B1 = exprs(B0),
+ B1 = exprs(B0, Lc),
{clause,Line,H1,G1,B1}.
head(Ps) -> patterns(Ps).
@@ -219,7 +211,7 @@ pattern({bin,Line,Grp}) ->
{bin,Line,Grp1};
pattern({bin_element,Line,Expr,Size,Type}) ->
Expr1 = pattern(Expr),
- Size1 = expr(Size),
+ Size1 = expr(Size, false),
{bin_element,Line,Expr1,Size1,Type}.
%% These patterns are processed "in parallel" for purposes of variable
@@ -235,8 +227,6 @@ guard([G0|Gs]) ->
[G1|guard(Gs)];
guard([]) -> [].
-and_guard([{atom,_,true}|Gs]) ->
- and_guard(Gs);
and_guard([G0|Gs]) ->
G1 = guard_test(G0),
[G1|and_guard(Gs)];
@@ -244,12 +234,7 @@ and_guard([]) -> [].
guard_test({call,Line,{remote,_,{atom,_,erlang},{atom,_,F}},As0}) ->
As = gexpr_list(As0),
- case map_guard_bif(F, length(As0)) of
- {ok,Name} ->
- {safe_bif,Line,erlang,Name,As};
- error ->
- {safe_bif,Line,erlang,F,As}
- end;
+ {safe_bif,Line,erlang,F,As};
guard_test({op,Line,Op,L0}) ->
true = erl_internal:arith_op(Op, 1) orelse %Assertion.
erl_internal:bool_op(Op, 1),
@@ -266,25 +251,18 @@ guard_test({op,Line,Op,L0,R0}) ->
L1 = gexpr(L0),
R1 = gexpr(R0), %They see the same variables
{safe_bif,Line,erlang,Op,[L1,R1]};
-guard_test({integer,_,_}=I) -> I;
-guard_test({char,_,_}=C) -> C;
-guard_test({float,_,_}=F) -> F;
-guard_test({atom,_,_}=A) -> A;
-guard_test({nil,_}=N) -> N;
-guard_test({var,_,_}=V) ->V. % Boolean var
-
-map_guard_bif(integer, 1) -> {ok,is_integer};
-map_guard_bif(float, 1) -> {ok,is_float};
-map_guard_bif(number, 1) -> {ok,is_number};
-map_guard_bif(atom, 1) -> {ok,is_atom};
-map_guard_bif(list, 1) -> {ok,is_list};
-map_guard_bif(tuple, 1) -> {ok,is_tuple};
-map_guard_bif(pid, 1) -> {ok,is_pid};
-map_guard_bif(reference, 1) -> {ok,is_reference};
-map_guard_bif(port, 1) -> {ok,is_port};
-map_guard_bif(binary, 1) -> {ok,is_binary};
-map_guard_bif(function, 1) -> {ok,is_function};
-map_guard_bif(_, _) -> error.
+guard_test({var,_,_}=V) ->V; % Boolean var
+guard_test({atom,Line,true}) -> {value,Line,true};
+%% All other constants at this level means false.
+guard_test({atom,Line,_}) -> {value,Line,false};
+guard_test({integer,Line,_}) -> {value,Line,false};
+guard_test({char,Line,_}) -> {value,Line,false};
+guard_test({float,Line,_}) -> {value,Line,false};
+guard_test({string,Line,_}) -> {value,Line,false};
+guard_test({nil,Line}) -> {value,Line,false};
+guard_test({cons,Line,_,_}) -> {value,Line,false};
+guard_test({tuple,Line,_}) -> {value,Line,false};
+guard_test({bin,Line,_}) -> {value,Line,false}.
gexpr({var,Line,V}) -> {var,Line,V};
gexpr({integer,Line,I}) -> {value,Line,I};
@@ -341,186 +319,179 @@ gexpr_list([]) -> [].
%% These expressions are processed "sequentially" for purposes of variable
%% definition etc.
-exprs([E0|Es]) ->
- E1 = expr(E0),
- [E1|exprs(Es)];
-exprs([]) -> [].
-
-expr({var,Line,V}) -> {var,Line,V};
-expr({integer,Line,I}) -> {value,Line,I};
-expr({char,Line,I}) -> {value,Line,I};
-expr({float,Line,F}) -> {value,Line,F};
-expr({atom,Line,A}) -> {value,Line,A};
-expr({string,Line,S}) -> {value,Line,S};
-expr({nil,Line}) -> {value,Line,[]};
-expr({cons,Line,H0,T0}) ->
- case {expr(H0),expr(T0)} of
+exprs([E], Lc) ->
+ [expr(E, Lc)];
+exprs([E0|Es], Lc) ->
+ E1 = expr(E0, false),
+ [E1|exprs(Es, Lc)];
+exprs([], _Lc) -> [].
+
+expr({var,Line,V}, _Lc) -> {var,Line,V};
+expr({integer,Line,I}, _Lc) -> {value,Line,I};
+expr({char,Line,I}, _Lc) -> {value,Line,I};
+expr({float,Line,F}, _Lc) -> {value,Line,F};
+expr({atom,Line,A}, _Lc) -> {value,Line,A};
+expr({string,Line,S}, _Lc) -> {value,Line,S};
+expr({nil,Line}, _Lc) -> {value,Line,[]};
+expr({cons,Line,H0,T0}, _Lc) ->
+ case {expr(H0, false),expr(T0, false)} of
{{value,Line,H1},{value,Line,T1}} -> {value,Line,[H1|T1]};
{H1,T1} -> {cons,Line,H1,T1}
end;
-expr({tuple,Line,Es0}) ->
+expr({tuple,Line,Es0}, _Lc) ->
Es1 = expr_list(Es0),
{tuple,Line,Es1};
-expr({block,Line,Es0}) ->
+expr({block,Line,Es0}, Lc) ->
%% Unfold block into a sequence.
- Es1 = exprs(Es0),
+ Es1 = exprs(Es0, Lc),
{block,Line,Es1};
-expr({'if',Line,Cs0}) ->
- Cs1 = icr_clauses(Cs0),
+expr({'if',Line,Cs0}, Lc) ->
+ Cs1 = icr_clauses(Cs0, Lc),
{'if',Line,Cs1};
-expr({'case',Line,E0,Cs0}) ->
- E1 = expr(E0),
- Cs1 = icr_clauses(Cs0),
+expr({'case',Line,E0,Cs0}, Lc) ->
+ E1 = expr(E0, false),
+ Cs1 = icr_clauses(Cs0, Lc),
{'case',Line,E1,Cs1};
-expr({'receive',Line,Cs0}) ->
- Cs1 = icr_clauses(Cs0),
+expr({'receive',Line,Cs0}, Lc) ->
+ Cs1 = icr_clauses(Cs0, Lc),
{'receive',Line,Cs1};
-expr({'receive',Line,Cs0,To0,ToEs0}) ->
- To1 = expr(To0),
- ToEs1 = exprs(ToEs0),
- Cs1 = icr_clauses(Cs0),
+expr({'receive',Line,Cs0,To0,ToEs0}, Lc) ->
+ To1 = expr(To0, false),
+ ToEs1 = exprs(ToEs0, Lc),
+ Cs1 = icr_clauses(Cs0, Lc),
{'receive',Line,Cs1,To1,ToEs1};
-expr({'fun',Line,{clauses,Cs0},{_,_,Name}}) when is_atom(Name) ->
+expr({'fun',Line,{clauses,Cs0},{_,_,Name}}, _Lc) when is_atom(Name) ->
%% New R10B-2 format (abstract_v2).
Cs = fun_clauses(Cs0),
{make_fun,Line,Name,Cs};
-expr({'fun',Line,{clauses,Cs0},{_,_,_,_,Name}}) when is_atom(Name) ->
- %% New R8 format (abstract_v2).
- Cs = fun_clauses(Cs0),
- {make_fun,Line,Name,Cs};
-expr({'fun',Line,{function,F,A},{_Index,_OldUniq,Name}}) ->
+expr({'fun',Line,{function,F,A},{_Index,_OldUniq,Name}}, _Lc) ->
%% New R8 format (abstract_v2).
As = new_vars(A, Line),
- Cs = [{clause,Line,As,[],[{local_call,Line,F,As}]}],
+ Cs = [{clause,Line,As,[],[{local_call,Line,F,As,true}]}],
{make_fun,Line,Name,Cs};
-expr({'fun',_,{clauses,_},{_OldUniq,_Hvss,_Free}}) ->
- %% Old format (abstract_v1).
- exit({?MODULE,old_funs});
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,self}},[]}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,self}},[]}, _Lc) ->
{dbg,Line,self,[]};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,get_stacktrace}},[]}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,get_stacktrace}},[]}, _Lc) ->
{dbg,Line,get_stacktrace,[]};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,throw}},[_]=As}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,throw}},[_]=As}, _Lc) ->
{dbg,Line,throw,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,error}},[_]=As}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,error}},[_]=As}, _Lc) ->
{dbg,Line,error,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,fault}},[_]=As}) ->
- {dbg,Line,fault,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,exit}},[_]=As}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,exit}},[_]=As}, _Lc) ->
{dbg,Line,exit,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,apply}},[_,_,_]=As0}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,raise}},[_,_,_]=As}, _Lc) ->
+ {dbg,Line,raise,expr_list(As)};
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,apply}},[_,_,_]=As0}, Lc) ->
As = expr_list(As0),
- {apply,Line,As};
-expr({call,Line,{remote,_,{atom,_,Mod},{atom,_,Func}},As0}) ->
+ {apply,Line,As,Lc};
+expr({call,Line,{remote,_,{atom,_,Mod},{atom,_,Func}},As0}, Lc) ->
As = expr_list(As0),
case erlang:is_builtin(Mod, Func, length(As)) of
false ->
- {call_remote,Line,Mod,Func,As};
+ {call_remote,Line,Mod,Func,As,Lc};
true ->
- case bif_type(Mod, Func) of
+ case bif_type(Mod, Func, length(As0)) of
safe -> {safe_bif,Line,Mod,Func,As};
- spawn -> {spawn_bif,Line,Mod,Func,As};
unsafe ->{bif,Line,Mod,Func,As}
end
end;
-expr({call,Line,{remote,_,Mod0,Func0},As0}) ->
+expr({call,Line,{remote,_,Mod0,Func0},As0}, Lc) ->
%% New R8 format (abstract_v2).
- Mod = expr(Mod0),
- Func = expr(Func0),
+ Mod = expr(Mod0, false),
+ Func = expr(Func0, false),
As = consify(expr_list(As0)),
- {apply,Line,[Mod,Func,As]};
-expr({call,Line,{atom,_,Func},As0}) ->
+ {apply,Line,[Mod,Func,As],Lc};
+expr({call,Line,{atom,_,Func},As0}, Lc) ->
As = expr_list(As0),
- {local_call,Line,Func,As};
-expr({call,Line,Fun0,As0}) ->
- Fun = expr(Fun0),
+ {local_call,Line,Func,As,Lc};
+expr({call,Line,Fun0,As0}, Lc) ->
+ Fun = expr(Fun0, false),
As = expr_list(As0),
- {apply_fun,Line,Fun,As};
-expr({'catch',Line,E0}) ->
+ {apply_fun,Line,Fun,As,Lc};
+expr({'catch',Line,E0}, _Lc) ->
%% No new variables added.
- E1 = expr(E0),
+ E1 = expr(E0, false),
{'catch',Line,E1};
-expr({'try',Line,Es0,CaseCs0,CatchCs0,As0}) ->
+expr({'try',Line,Es0,CaseCs0,CatchCs0,As0}, Lc) ->
%% No new variables added.
Es = expr_list(Es0),
- CaseCs = icr_clauses(CaseCs0),
- CatchCs = icr_clauses(CatchCs0),
+ CaseCs = icr_clauses(CaseCs0, Lc),
+ CatchCs = icr_clauses(CatchCs0, Lc),
As = expr_list(As0),
{'try',Line,Es,CaseCs,CatchCs,As};
-expr({'query', Line, E0}) ->
- E = expr(E0),
- {'query', Line, E};
-expr({lc,Line,E0,Gs0}) -> %R8.
+expr({lc,Line,E0,Gs0}, _Lc) -> %R8.
Gs = lists:map(fun ({generate,L,P0,Qs}) ->
- {generate,L,expr(P0),expr(Qs)};
+ {generate,L,expr(P0, false),expr(Qs, false)};
({b_generate,L,P0,Qs}) -> %R12.
- {b_generate,L,expr(P0),expr(Qs)};
+ {b_generate,L,expr(P0, false),expr(Qs, false)};
(Expr) ->
- case is_guard_test(Expr) of
- true -> {guard,[[guard_test(Expr)]]};
- false -> expr(Expr)
+ case is_guard(Expr) of
+ true -> {guard,guard([[Expr]])};
+ false -> expr(Expr, false)
end
end, Gs0),
- {lc,Line,expr(E0),Gs};
-expr({bc,Line,E0,Gs0}) -> %R12.
+ {lc,Line,expr(E0, false),Gs};
+expr({bc,Line,E0,Gs0}, _Lc) -> %R12.
Gs = lists:map(fun ({generate,L,P0,Qs}) ->
- {generate,L,expr(P0),expr(Qs)};
+ {generate,L,expr(P0, false),expr(Qs, false)};
({b_generate,L,P0,Qs}) -> %R12.
- {b_generate,L,expr(P0),expr(Qs)};
+ {b_generate,L,expr(P0, false),expr(Qs, false)};
(Expr) ->
- case is_guard_test(Expr) of
- true -> {guard,[[guard_test(Expr)]]};
- false -> expr(Expr)
+ case is_guard(Expr) of
+ true -> {guard,guard([[Expr]])};
+ false -> expr(Expr, false)
end
end, Gs0),
- {bc,Line,expr(E0),Gs};
-expr({match,Line,P0,E0}) ->
- E1 = expr(E0),
+ {bc,Line,expr(E0, false),Gs};
+expr({match,Line,P0,E0}, _Lc) ->
+ E1 = expr(E0, false),
P1 = pattern(P0),
{match,Line,P1,E1};
-expr({op,Line,Op,A0}) ->
- A1 = expr(A0),
+expr({op,Line,Op,A0}, _Lc) ->
+ A1 = expr(A0, false),
{op,Line,Op,[A1]};
-expr({op,Line,'++',L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,'++',L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{op,Line,append,[L1,R1]};
-expr({op,Line,'--',L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,'--',L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{op,Line,subtract,[L1,R1]};
-expr({op,Line,'!',L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,'!',L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{send,Line,L1,R1};
-expr({op,Line,Op,L0,R0}) when Op =:= 'andalso'; Op =:= 'orelse' ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,Op,L0,R0}, _Lc) when Op =:= 'andalso'; Op =:= 'orelse' ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{Op,Line,L1,R1};
-expr({op,Line,Op,L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,Op,L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{op,Line,Op,[L1,R1]};
-expr({bin,Line,Grp}) ->
+expr({bin,Line,Grp}, _Lc) ->
Grp1 = expr_list(Grp),
{bin,Line,Grp1};
-expr({bin_element,Line,Expr,Size,Type}) ->
- Expr1 = expr(Expr),
- Size1 = expr(Size),
+expr({bin_element,Line,Expr,Size,Type}, _Lc) ->
+ Expr1 = expr(Expr, false),
+ Size1 = expr(Size, false),
{bin_element,Line,Expr1,Size1,Type};
-expr(Other) ->
+expr(Other, _Lc) ->
exit({?MODULE,{unknown_expr,Other}}).
-%% is_guard_test(Expression) -> true | false.
-%% Test if a general expression is a guard test. Cannot use erl_lint
-%% here as sys_pre_expand has transformed source.
+%% is_guard(Expression) -> true | false.
+%% Test if a general expression is a guard test or guard BIF.
+%% Cannot use erl_lint here as sys_pre_expand has transformed source.
-is_guard_test({op,_,Op,L,R}) ->
+is_guard({op,_,Op,L,R}) ->
erl_internal:comp_op(Op, 2) andalso is_gexpr_list([L,R]);
-is_guard_test({call,_,{remote,_,{atom,_,erlang},{atom,_,Test}},As}) ->
- erl_internal:type_test(Test, length(As)) andalso is_gexpr_list(As);
-is_guard_test({atom,_,true}) -> true;
-is_guard_test(_) -> false.
+is_guard({call,_,{remote,_,{atom,_,erlang},{atom,_,Test}},As}) ->
+ Arity = length(As),
+ (erl_internal:guard_bif(Test, Arity) orelse
+ erl_internal:old_type_test(Test, Arity)) andalso is_gexpr_list(As);
+is_guard({atom,_,true}) -> true;
+is_guard(_) -> false.
is_gexpr({var,_,_}) -> true;
is_gexpr({atom,_,_}) -> true;
@@ -555,17 +526,17 @@ consify([]) -> {value,0,[]}.
%% definition etc.
expr_list([E0|Es]) ->
- E1 = expr(E0),
+ E1 = expr(E0, false),
[E1|expr_list(Es)];
expr_list([]) -> [].
-icr_clauses([C0|Cs]) ->
- C1 = clause(C0),
- [C1|icr_clauses(Cs)];
-icr_clauses([]) -> [].
+icr_clauses([C0|Cs], Lc) ->
+ C1 = clause(C0, Lc),
+ [C1|icr_clauses(Cs, Lc)];
+icr_clauses([], _) -> [].
fun_clauses([{clause,L,H,G,B}|Cs]) ->
- [{clause,L,head(H),guard(G),exprs(B)}|fun_clauses(Cs)];
+ [{clause,L,head(H),guard(G),exprs(B, true)}|fun_clauses(Cs)];
fun_clauses([]) -> [].
%% new_var_name() -> VarName.
@@ -585,24 +556,21 @@ new_vars(N, L, Vs) when N > 0 ->
new_vars(N-1, L, [V|Vs]);
new_vars(0, _, Vs) -> Vs.
-bif_type(erlang, Name) -> bif_type(Name);
-bif_type(_, _) -> unsafe.
+bif_type(erlang, Name, Arity) ->
+ case erl_internal:guard_bif(Name, Arity) of
+ true ->
+ %% Guard BIFs are safe (except for self/0, but it is
+ %% handled with a special instruction anyway).
+ safe;
+ false ->
+ bif_type(Name)
+ end;
+bif_type(_, _, _) -> unsafe.
bif_type(register) -> safe;
bif_type(unregister) -> safe;
bif_type(whereis) -> safe;
bif_type(registered) -> safe;
-bif_type(abs) -> safe;
-bif_type(float) -> safe;
-bif_type(trunc) -> safe;
-bif_type(round) -> safe;
-bif_type(math) -> safe;
-bif_type(node) -> safe;
-bif_type(length) -> safe;
-bif_type(hd) -> safe;
-bif_type(tl) -> safe;
-bif_type(size) -> safe;
-bif_type(element) -> safe;
bif_type(setelement) -> safe;
bif_type(atom_to_list) -> safe;
bif_type(list_to_atom) -> safe;
@@ -627,21 +595,14 @@ bif_type(list_to_pid) -> safe;
bif_type(module_loaded) -> safe;
bif_type(binary_to_term) -> safe;
bif_type(term_to_binary) -> safe;
-bif_type(alive) -> safe;
-bif_type(notalive) -> safe;
bif_type(nodes) -> safe;
bif_type(is_alive) -> safe;
bif_type(disconnect_node) -> safe;
bif_type(binary_to_list) -> safe;
bif_type(list_to_binary) -> safe;
bif_type(split_binary) -> safe;
-bif_type(term_to_atom) -> safe;
bif_type(hash) -> safe;
bif_type(pre_loaded) -> safe;
-bif_type(info) -> safe;
bif_type(set_cookie) -> safe;
bif_type(get_cookie) -> safe;
-bif_type(spawn) -> spawn;
-bif_type(spawn_link) -> spawn;
-bif_type(spawn_opt) -> spawn;
bif_type(_) -> unsafe.
diff --git a/lib/debugger/src/dbg_iserver.erl b/lib/debugger/src/dbg_iserver.erl
index 212bc2b8ab..1bb73a43b9 100644
--- a/lib/debugger/src/dbg_iserver.erl
+++ b/lib/debugger/src/dbg_iserver.erl
@@ -97,13 +97,10 @@ ensure_started() ->
%%
%% Key Value
%% --- -----
-%% attributes Attr
-%% exports Exp
%% defs []
%% mod_bin Binary
%% mod_raw Raw Binary
%% mod_file File
-%% module Mod
%% {Mod,Name,Arity,Exported} Cs
%% {'fun',Mod,Index,Uniq} {Name,Arity,Cs}
%% Line {Pos,PosNL}
@@ -117,7 +114,7 @@ init([]) ->
process_flag(trap_exit, true),
global:register_name(?MODULE, self()),
Db = ets:new(?MODULE, [ordered_set, protected]),
- {ok, #state{db=Db, auto=false, stack=all}}.
+ {ok, #state{db=Db, auto=false, stack=no_tail}}.
%% Attaching to a process
handle_call({attached, AttPid, Pid}, _From, State) ->
diff --git a/lib/debugger/src/dbg_istk.erl b/lib/debugger/src/dbg_istk.erl
new file mode 100644
index 0000000000..c6922a80e4
--- /dev/null
+++ b/lib/debugger/src/dbg_istk.erl
@@ -0,0 +1,245 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(dbg_istk).
+-export([init/0,delayed_to_external/0,from_external/1,
+ push/3,pop/0,pop/1,stack_level/0,
+ delayed_stacktrace/0,delayed_stacktrace/2,
+ bindings/1,stack_frame/2,backtrace/2,
+ in_use_p/2]).
+
+-include("dbg_ieval.hrl").
+
+-define(STACK, ?MODULE).
+
+-record(e,
+ {level, %Level
+ mfa, %{Mod,Func,Args|Arity}|{Fun,Args}
+ line, %Line called from
+ bindings,
+ lc %Last call (true|false)
+ }).
+
+init() ->
+ init([]).
+
+delayed_to_external() ->
+ Stack = get(?STACK),
+ fun() -> {stack,term_to_binary(Stack)} end.
+
+from_external({stack,Stk}) ->
+ put(?STACK, binary_to_term(Stk)).
+
+init(Stack) ->
+ put(?STACK, Stack).
+
+%% We keep track of a call stack that is used for
+%% 1) saving stack frames that can be inspected from an Attached
+%% Process GUI (using dbg_icmd:get(Meta, stack_frame, {Dir, SP})
+%% 2) generate an approximation of regular stacktrace -- sent to
+%% Debugged when it should raise an exception or evaluate a
+%% function (since it might possible raise an exception)
+%%
+%% How to push depends on the "Stack Trace" option (value saved in
+%% process dictionary item 'trace_stack').
+%% all - everything is pushed
+%% no_tail - tail recursive push
+%% false - nothing is pushed
+%% Whenever a function returns, the corresponding call frame is popped.
+
+push(Bs, #ieval{level=Le,module=Mod,function=Name,
+ arguments=As,line=Li}=Ieval, Lc) ->
+ Entry = #e{level=Le,mfa={Mod,Name,As},line=Li,bindings=Bs,lc=Lc},
+ case get(trace_stack) of
+ false ->
+ Ieval#ieval{level=Le+1};
+ no_tail when Lc ->
+ Ieval;
+ _ -> % all | no_tail when Lc =:= false
+ put(?STACK, [Entry|get(?STACK)]),
+ Ieval#ieval{level=Le+1}
+ end.
+
+pop() ->
+ case get(trace_stack) of
+ false -> ignore;
+ _ -> % all ¦ no_tail
+ case get(?STACK) of
+ [_Entry|Entries] ->
+ put(?STACK, Entries);
+ [] ->
+ ignore
+ end
+ end.
+
+pop(Le) ->
+ case get(trace_stack) of
+ false -> ignore;
+ _ -> % all | no_tail
+ put(?STACK, pop(Le, get(?STACK)))
+ end.
+
+pop(Level, [#e{level=Le}|Stack]) when Level =< Le ->
+ pop(Level, Stack);
+pop(_Level, Stack) ->
+ Stack.
+
+%% stack_level() -> Le
+%% stack_level(Stack) -> Le
+%% Top call level
+stack_level() ->
+ stack_level(get(?STACK)).
+
+stack_level([]) -> 1;
+stack_level([#e{level=Le}|_]) -> Le.
+
+%% delayed_stacktrace() -> CreateStacktraceFun
+%% delayed_stacktrace(ArgFlag, #ieval{}) -> CreateStacktraceFun
+%% ArgFlag = no_args | include_args
+%% CreateStacktraceFun = fun(NumberOfEntries)
+%%
+%% Return a fun that can convert the internal stack format to
+%% an imitation of the regular stacktrace.
+
+delayed_stacktrace() ->
+ Stack0 = get(?STACK),
+ fun(NumEntries) ->
+ Stack = stacktrace(NumEntries, Stack0, []),
+ [finalize(ArityOnly) || {ArityOnly,_} <- Stack]
+ end.
+
+delayed_stacktrace(include_args, Ieval) ->
+ #ieval{module=Mod,function=Name,arguments=As,line=Li} = Ieval,
+ Stack0 = [#e{mfa={Mod,Name,As},line=Li}|get(?STACK)],
+ fun(NumEntries) ->
+ case stacktrace(NumEntries, Stack0, []) of
+ [] ->
+ [];
+ [{_,WithArgs}|Stack] ->
+ [finalize(WithArgs) |
+ [finalize(ArityOnly) || {ArityOnly,_} <- Stack]]
+ end
+ end;
+delayed_stacktrace(no_args, Ieval) ->
+ #ieval{module=Mod,function=Name,arguments=As,line=Li} = Ieval,
+ Stack0 = [#e{mfa={Mod,Name,As},line=Li}|get(?STACK)],
+ fun(NumEntries) ->
+ Stack = stacktrace(NumEntries, Stack0, []),
+ [finalize(ArityOnly) || {ArityOnly,_} <- Stack]
+ end.
+
+stacktrace(N, [#e{lc=true}|T], Acc) ->
+ stacktrace(N, T, Acc);
+stacktrace(N, [E|T], []) ->
+ stacktrace(N-1, T, [normalize(E)]);
+stacktrace(N, [E|T], [{P,_}|_]=Acc) when N > 0 ->
+ case normalize(E) of
+ {P,_} ->
+ stacktrace(N, T, Acc);
+ New ->
+ stacktrace(N-1, T, [New|Acc])
+ end;
+stacktrace(_, _, Acc) ->
+ lists:reverse(Acc).
+
+normalize(#e{mfa={M,Fun,As},line=Li}) when is_function(Fun) ->
+ Loc = {M,Li},
+ {{Fun,length(As),Loc},{Fun,As,Loc}};
+normalize(#e{mfa={M,F,As},line=Li}) ->
+ Loc = {M,Li},
+ {{M,F,length(As),Loc},{M,F,As,Loc}}.
+
+finalize({M,F,A,Loc}) -> {M,F,A,line(Loc)};
+finalize({Fun,A,Loc}) -> {Fun,A,line(Loc)}.
+
+line({Mod,Line}) when Line > 0 ->
+ [{file,atom_to_list(Mod)++".erl"},{line,Line}];
+line(_) -> [].
+
+%% bindings(SP) -> Bs
+%% SP = Le % stack pointer
+%% Return the bindings for the specified call level
+bindings(SP) ->
+ bindings(SP, get(?STACK)).
+
+bindings(SP, [#e{level=SP,bindings=Bs}|_]) ->
+ Bs;
+bindings(SP, [_Entry|Entries]) ->
+ bindings(SP, Entries);
+bindings(_SP, []) ->
+ erl_eval:new_bindings().
+
+%% stack_frame(Dir, SP) -> {Le, Where, Bs} | top | bottom
+%% Dir = up | down
+%% Where = {Cm, Li}
+%% Cm = Module | undefined % module
+%% Li = int() | -1 % line number
+%% Bs = bindings()
+%% Return stack frame info one step up/down from given stack pointer
+%% up = to lower call levels
+%% down = to higher call levels
+stack_frame(up, SP) ->
+ stack_frame(SP, up, get(?STACK));
+stack_frame(down, SP) ->
+ stack_frame(SP, down, lists:reverse(get(?STACK))).
+
+stack_frame(SP, up, [#e{level=Le,mfa={Cm,_,_},line=Li,bindings=Bs}|_])
+ when Le < SP ->
+ {Le,{Cm,Li},Bs};
+stack_frame(SP, down, [#e{level=Le,mfa={Cm,_,_},line=Li,bindings=Bs}|_])
+ when Le > SP ->
+ {Le,{Cm,Li},Bs};
+stack_frame(SP, Dir, [#e{level=SP}|Stack]) ->
+ case Stack of
+ [#e{level=Le,mfa={Cm,_,_},line=Li,bindings=Bs}|_] ->
+ {Le,{Cm,Li},Bs};
+ [] when Dir =:= up ->
+ top;
+ [] when Dir =:= down ->
+ bottom
+ end;
+stack_frame(SP, Dir, [_Entry|Stack]) ->
+ stack_frame(SP, Dir, Stack).
+
+%% backtrace(HowMany) -> Backtrace
+%% HowMany = all | int()
+%% Backtrace = {Le, MFA}
+%% Return all/the last N called functions, in reversed call order
+backtrace(HowMany, Ieval) ->
+ #ieval{level=Level,module=Mod,function=Name,arguments=As} = Ieval,
+ Stack0 = [#e{level=Level,mfa={Mod,Name,As}}|get(?STACK)],
+ Stack = case HowMany of
+ all -> Stack0;
+ N -> lists:sublist(Stack0, N)
+ end,
+ [{Le,MFA} || #e{level=Le,mfa=MFA} <- Stack].
+
+%%--------------------------------------------------------------------
+%% in_use_p(Mod, Cm) -> boolean()
+%% Mod = Cm = atom()
+%% Returns true if Mod is found on the stack, otherwise false.
+%%--------------------------------------------------------------------
+in_use_p(Mod, Mod) -> true;
+in_use_p(Mod, _Cm) ->
+ case get(trace_stack) of
+ false -> true;
+ _ -> % all | no_tail
+ lists:any(fun(#e{mfa={M,_,_}}) when M =:= Mod -> true;
+ (_) -> false
+ end, get(?STACK))
+ end.
diff --git a/lib/debugger/src/debugger.app.src b/lib/debugger/src/debugger.app.src
index 21cf59a2e1..5538f66260 100644
--- a/lib/debugger/src/debugger.app.src
+++ b/lib/debugger/src/debugger.app.src
@@ -26,6 +26,7 @@
dbg_ieval,
dbg_iload,
dbg_iserver,
+ dbg_istk,
dbg_ui_break,
dbg_ui_break_win,
dbg_ui_edit,
diff --git a/lib/debugger/test/Makefile b/lib/debugger/test/Makefile
index 2296bd0ae6..3dfbed31ff 100644
--- a/lib/debugger/test/Makefile
+++ b/lib/debugger/test/Makefile
@@ -43,6 +43,7 @@ MODULES= \
exception_SUITE \
fun_SUITE \
lc_SUITE \
+ line_number_SUITE \
record_SUITE \
trycatch_SUITE \
test_lib \
diff --git a/lib/debugger/test/bs_construct_SUITE.erl b/lib/debugger/test/bs_construct_SUITE.erl
index 5c7d49e951..187c9f53b0 100644
--- a/lib/debugger/test/bs_construct_SUITE.erl
+++ b/lib/debugger/test/bs_construct_SUITE.erl
@@ -19,18 +19,31 @@
-module(bs_construct_SUITE).
+%% Copied from bs_construct_SUITE in the emulator test suite.
+%% The following test cases have been omitted since they don't
+%% make much sense for the debugger:
+%% bs_add
+%% kostis
+
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- test1/1, test2/1, test3/1, test4/1, test5/1, testf/1, not_used/1, in_guard/1,
- coerce_to_float/1]).
+ test1/1, test2/1, test3/1, test4/1, test5/1, testf/1,
+ not_used/1, in_guard/1,
+ mem_leak/1, coerce_to_float/1, bjorn/1,
+ huge_float_field/1, huge_binary/1, system_limit/1, badarg/1,
+ copy_writable_binary/1, dynamic/1,
+ otp_7422/1, zero_width/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [test1, test2, test3, test4, test5, testf, not_used,
+ in_guard, mem_leak, coerce_to_float, bjorn,
+ huge_float_field, huge_binary, system_limit, badarg,
+ copy_writable_binary, dynamic, otp_7422, zero_width].
groups() ->
[].
@@ -41,11 +54,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [test1, test2, test3, test4, test5, testf, not_used,
- in_guard, coerce_to_float].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(1)),
@@ -75,7 +83,9 @@ r(L) ->
-define(T(B, L), {B, ??B, L}).
-define(N(B), {B, ??B, unknown}).
--define(FAIL(Expr), ?line {'EXIT',{badarg,_}} = (catch Expr)).
+-define(FAIL(Expr), ?line fail_check(catch Expr, ??Expr, [])).
+
+-define(FAIL_VARS(Expr, Vars), ?line fail_check(catch Expr, ??Expr, Vars)).
l(I_13, I_big1) ->
[
@@ -143,7 +153,13 @@ l(I_13, I_big1) ->
native_3798()),
?T(<<32978297842987249827298387697777669766334937:128/native-integer>>,
- native_bignum())
+ native_bignum()),
+
+ %% Unit tests.
+ ?T(<<<<5:3>>/bitstring>>, <<5:3>>),
+ ?T(<<42,<<7:4>>/binary-unit:4>>, <<42,7:4>>),
+ ?T(<<<<344:17>>/binary-unit:17>>, <<344:17>>),
+ ?T(<<<<42,3,7656:16>>/binary-unit:16>>, <<42,3,7656:16>>)
].
@@ -179,7 +195,7 @@ eval_list([{C_bin, Str, Bytes} | Rest], Vars) ->
[{C_bin, E_bin, Str, Bytes} | eval_list(Rest, Vars)]
end.
-one_test({C_bin, E_bin, Str, Bytes}) when list(Bytes) ->
+one_test({C_bin, E_bin, Str, Bytes}) when is_list(Bytes) ->
io:format(" ~s, ~p~n", [Str, Bytes]),
Bin = list_to_binary(Bytes),
if
@@ -222,7 +238,7 @@ one_test({C_bin, E_bin, Str, Result}) ->
ok;
%% For situations where the final bits may not matter, like
%% for floats:
- N when integer(N) ->
+ N when is_integer(N) ->
io:format("Info: compiled and interpreted differ in the"
" last bytes:~n ~p, ~p.~n",
[binary_to_list(C_bin), binary_to_list(E_bin)]),
@@ -248,9 +264,22 @@ equal_lists(A, B, R) ->
false
end.
+fail_check({'EXIT',{badarg,_}}, Str, Vars) ->
+ try evaluate(Str, Vars) of
+ Res ->
+ io:format("Interpreted result: ~p", [Res]),
+ ?t:fail(did_not_fail_in_intepreted_code)
+ catch
+ error:badarg ->
+ ok
+ end;
+fail_check(Res, _, _) ->
+ io:format("Compiled result: ~p", [Res]),
+ ?t:fail(did_not_fail_in_compiled_code).
+
%%% Simple working cases
test1(suite) -> [];
-test1(Config) when list(Config) ->
+test1(Config) when is_list(Config) ->
?line I_13 = i(13),
?line I_big1 = big(1),
?line Vars = [{'I_13', I_13},
@@ -272,7 +301,7 @@ gen_l(N, S, A) ->
[?T(<<A:S/little, A:(N-S)/little>>, comp(N, A, S))].
test2(suite) -> [];
-test2(Config) when list(Config) ->
+test2(Config) when is_list(Config) ->
?line test2(0, 8, 2#10101010101010101),
?line test2(0, 8, 2#1111111111).
@@ -300,7 +329,7 @@ t3() ->
].
test3(suite) -> [];
-test3(Config) when list(Config) ->
+test3(Config) when is_list(Config) ->
?line Vars = [],
?line lists:foreach(fun one_test/1, eval_list(t3(), Vars)).
@@ -311,7 +340,7 @@ gen_u_l(N, S, A) ->
[?N(<<A:S/little, A:(N-S)/little>>)].
test4(suite) -> [];
-test4(Config) when list(Config) ->
+test4(Config) when is_list(Config) ->
?line test4(0, 16, 2#10101010101010101),
?line test4(0, 16, 2#1111111111).
@@ -333,7 +362,7 @@ gen_b(N, S, A) ->
test5(suite) -> [];
test5(doc) -> ["OTP-3995"];
-test5(Config) when list(Config) ->
+test5(Config) when is_list(Config) ->
?line test5(0, 8, <<73>>),
?line test5(0, 8, <<68>>).
@@ -350,40 +379,63 @@ test5(S, A) ->
%%% Failure cases
testf(suite) -> [];
-testf(Config) when list(Config) ->
- ?FAIL(<<3.14>>),
- ?FAIL(<<<<1,2>>>>),
-
- ?FAIL(<<2.71/binary>>),
- ?FAIL(<<24334/binary>>),
- ?FAIL(<<24334344294788947129487129487219847/binary>>),
-
- ?FAIL(<<<<1,2,3>>/float>>),
+testf(Config) when is_list(Config) ->
+ ?line ?FAIL(<<3.14>>),
+ ?line ?FAIL(<<<<1,2>>>>),
+
+ ?line ?FAIL(<<2.71/binary>>),
+ ?line ?FAIL(<<24334/binary>>),
+ ?line ?FAIL(<<24334344294788947129487129487219847/binary>>),
+ BigInt = id(24334344294788947129487129487219847),
+ ?line ?FAIL_VARS(<<BigInt/binary>>, [{'BigInt',BigInt}]),
+ ?line ?FAIL_VARS(<<42,BigInt/binary>>, [{'BigInt',BigInt}]),
+ ?line ?FAIL_VARS(<<BigInt:2/binary>>, [{'BigInt',BigInt}]),
+
+ %% One negative field size, but the sum of field sizes will be 1 byte.
+ %% Make sure that we reject that properly.
+ I_minus_777 = id(-777),
+ I_minus_2047 = id(-2047),
+ ?line ?FAIL_VARS(<<I_minus_777:2048/unit:8,57:I_minus_2047/unit:8>>,
+ ordsets:from_list([{'I_minus_777',I_minus_777},
+ {'I_minus_2047',I_minus_2047}])),
+ ?line ?FAIL(<<<<1,2,3>>/float>>),
%% Negative field widths.
- testf_1(-8, <<1,2,3,4,5>>),
-
- ?FAIL(<<42:(-16)>>),
- ?FAIL(<<3.14:(-8)/float>>),
- ?FAIL(<<<<23,56,0,2>>:(-16)/binary>>),
- ?FAIL(<<<<23,56,0,2>>:(2.5)/binary>>),
- ?FAIL(<<<<23,56,0,2>>:(anka)>>),
+ ?line testf_1(-8, <<1,2,3,4,5>>),
+ ?line ?FAIL(<<0:(-(1 bsl 100))>>),
+
+ ?line ?FAIL(<<42:(-16)>>),
+ ?line ?FAIL(<<3.14:(-8)/float>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(-16)/binary>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(2.5)/binary>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(anka)>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(anka)>>),
+
+ %% Unit failures.
+ ?line ?FAIL(<<<<1:1>>/binary>>),
+ Sz = id(1),
+ ?line ?FAIL_VARS(<<<<1:Sz>>/binary>>, [{'Sz',Sz}]),
+ ?line {'EXIT',{badarg,_}} = (catch <<<<1:(id(1))>>/binary>>),
+ ?line ?FAIL(<<<<7,8,9>>/binary-unit:16>>),
+ ?line ?FAIL(<<<<7,8,9,3:7>>/binary-unit:16>>),
+ ?line ?FAIL(<<<<7,8,9,3:7>>/binary-unit:17>>),
ok.
testf_1(W, B) ->
- ?FAIL(<<42:W>>),
- ?FAIL(<<3.14:W/float>>),
- ?FAIL(<<B:W/binary>>).
+ Vars = [{'W',W}],
+ ?FAIL_VARS(<<42:W>>, Vars),
+ ?FAIL_VARS(<<3.14:W/float>>, Vars),
+ ?FAIL_VARS(<<B:W/binary>>, [{'B',B}|Vars]).
not_used(doc) ->
"Test that constructed binaries that are not used will still give an exception.";
not_used(Config) when is_list(Config) ->
?line ok = not_used1(3, <<"dum">>),
- ?line ?FAIL(not_used1(3, "dum")),
- ?line ?FAIL(not_used2(444, -2)),
- ?line ?FAIL(not_used2(444, anka)),
- ?line ?FAIL(not_used3(444)),
+ ?line {'EXIT',{badarg,_}} = (catch not_used1(3, "dum")),
+ ?line {'EXIT',{badarg,_}} = (catch not_used2(444, -2)),
+ ?line {'EXIT',{badarg,_}} = (catch not_used2(444, anka)),
+ ?line {'EXIT',{badarg,_}} = (catch not_used3(444)),
ok.
not_used1(I, BinString) ->
@@ -398,7 +450,7 @@ not_used3(I) ->
<<I:(-8)>>,
ok.
-in_guard(Config) when list(Config) ->
+in_guard(Config) when is_list(Config) ->
?line 1 = in_guard(<<16#74ad:16>>, 16#e95, 5),
?line 2 = in_guard(<<16#3A,16#F7,"hello">>, 16#3AF7, <<"hello">>),
?line 3 = in_guard(<<16#FBCD:14,3.1415/float,3:2>>, 16#FBCD, 3.1415),
@@ -415,6 +467,36 @@ in_guard(Bin, A, B) when <<A:14,B/float,3:2>> == Bin -> 3;
in_guard(Bin, A, B) when {a,b,<<A:14,B/float,3:2>>} == Bin -> cant_happen;
in_guard(_, _, _) -> nope.
+mem_leak(doc) -> "Make sure that construction has no memory leak";
+mem_leak(Config) when is_list(Config) ->
+ ?line B = make_bin(16, <<0>>),
+ ?line mem_leak(1024, B),
+ ok.
+
+mem_leak(0, _) -> ok;
+mem_leak(N, B) ->
+ ?line big_bin(B, <<23>>),
+ ?line {'EXIT',{badarg,_}} = (catch big_bin(B, bad)),
+ maybe_gc(),
+ mem_leak(N-1, B).
+
+big_bin(B1, B2) ->
+ <<B1/binary,B1/binary,B1/binary,B1/binary,
+ B1/binary,B1/binary,B1/binary,B1/binary,
+ B1/binary,B1/binary,B1/binary,B1/binary,
+ B1/binary,B1/binary,B1/binary,B1/binary,
+ B2/binary>>.
+
+make_bin(0, Acc) -> Acc;
+make_bin(N, Acc) -> make_bin(N-1, <<Acc/binary,Acc/binary>>).
+
+maybe_gc() ->
+ case erlang:system_info(heap_type) of
+ shared -> erlang:garbage_collect();
+ hybrid -> erlang:garbage_collect();
+ private -> ok
+ end.
+
-define(COF(Int0),
?line (fun(Int) ->
true = <<Int:32/float>> =:= <<(float(Int)):32/float>>,
@@ -431,7 +513,7 @@ in_guard(_, _, _) -> nope.
nonliteral(X) -> X.
-coerce_to_float(Config) when list(Config) ->
+coerce_to_float(Config) when is_list(Config) ->
?COF(0),
?COF(-1),
?COF(1),
@@ -444,3 +526,232 @@ coerce_to_float(Config) when list(Config) ->
?COF64(298748888888888888888888888883478264866528467367364766666666666666663),
?COF64(-367546729879999999999947826486652846736736476555566666663),
ok.
+
+bjorn(Config) when is_list(Config) ->
+ ?line error = bjorn_1(),
+ ok.
+
+bjorn_1() ->
+ Bitstr = <<7:13>>,
+ try
+ do_something()
+ catch
+ throw:blurf ->
+ ignore
+ end,
+ do_more(Bitstr, 13).
+
+do_more(Bin, Sz) ->
+ %% Previous bug in the bs_bits_to_bytes instruction: The exeption code
+ %% was not set - the previous exception (throw:blurf) would be used,
+ %% causing the catch to slip.
+ try <<Bin:Sz/binary>> of
+ _V -> ok
+ catch
+ error:_ ->
+ error
+ end.
+
+do_something() ->
+ throw(blurf).
+
+huge_float_field(Config) when is_list(Config) ->
+ ?line {'EXIT',{badarg,_}} = (catch <<0.0:9/float-unit:8>>),
+ ?line huge_float_check(catch <<0.0:67108865/float-unit:64>>),
+ ?line huge_float_check(catch <<0.0:((1 bsl 26)+1)/float-unit:64>>),
+ ?line huge_float_check(catch <<0.0:(id(67108865))/float-unit:64>>),
+%% ?line huge_float_check(catch <<0.0:((1 bsl 60)+1)/float-unit:64>>),
+ ?line huge_float_check(catch <<3839739387439387383739387987347983:((1 bsl 26)+1)/float-unit:64>>),
+%% ?line huge_float_check(catch <<3839739387439387383739387987347983:((1 bsl 60)+1)/float-unit:64>>),
+ ok.
+
+huge_float_check({'EXIT',{system_limit,_}}) -> ok;
+huge_float_check({'EXIT',{badarg,_}}) -> ok.
+
+huge_binary(Config) when is_list(Config) ->
+ ?line 16777216 = size(<<0:(id(1 bsl 26)),(-1):(id(1 bsl 26))>>),
+ ok.
+
+system_limit(Config) when is_list(Config) ->
+ WordSize = erlang:system_info(wordsize),
+ BitsPerWord = WordSize * 8,
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<0:(id(0)),42:(id(1 bsl BitsPerWord))>>),
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<42:(id(1 bsl BitsPerWord)),0:(id(0))>>),
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<(id(<<>>))/binary,0:(id(1 bsl 100))>>),
+
+ case WordSize of
+ 4 ->
+ system_limit_32();
+ 8 ->
+ ok
+ end.
+
+system_limit_32() ->
+ ?line {'EXIT',{badarg,_}} = (catch <<42:(-1)>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<42:(id(-1))>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<42:(id(-389739873536870912))/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<42:536870912/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<42:(id(536870912))/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:(id(8)),42:536870912/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<0:(id(8)),42:(id(536870912))/unit:8>>),
+ ok.
+
+badarg(Config) when is_list(Config) ->
+ %% BEAM will generate a badarg exception for:
+ %% <<0:(id(1 bsl 100)),0:(id(-1))>>
+ %% but the debugger will generate a system_limit exception.
+ %% It does not seems worthwhile to fix the debugger.
+
+ ?line {'EXIT',{badarg,_}} =
+ (catch <<(id(<<>>))/binary,0:(id(-(1 bsl 100)))>>),
+
+ ok.
+
+copy_writable_binary(Config) when is_list(Config) ->
+ ?line [copy_writable_binary_1(I) || I <- lists:seq(0, 256)],
+ ok.
+
+copy_writable_binary_1(_) ->
+ ?line Bin0 = <<(id(<<>>))/binary,0,1,2,3,4,5,6,7>>,
+ ?line SubBin = make_sub_bin(Bin0),
+ ?line id(<<42,34,55,Bin0/binary>>), %Make reallocation likelier.
+ ?line Pid = spawn(fun() ->
+ copy_writable_binary_holder(Bin0, SubBin)
+ end),
+ ?line Tab = ets:new(holder, []),
+ ?line ets:insert(Tab, {17,Bin0}),
+ ?line ets:insert(Tab, {42,SubBin}),
+ ?line id(<<Bin0/binary,0:(64*1024*8)>>),
+ ?line Pid ! self(),
+ ?line [{17,Bin0}] = ets:lookup(Tab, 17),
+ ?line [{42,Bin0}] = ets:lookup(Tab, 42),
+ receive
+ {Pid,Bin0,Bin0} -> ok;
+ Other ->
+ io:format("Unexpected message: ~p", [Other]),
+ ?line ?t:fail()
+ end,
+ ok.
+
+copy_writable_binary_holder(Bin, SubBin) ->
+ receive
+ Pid ->
+ Pid ! {self(),Bin,SubBin}
+ end.
+
+make_sub_bin(Bin0) ->
+ N = bit_size(Bin0),
+ <<_:17,Bin:N/bitstring,_:5>> = <<(-1):17,Bin0/bitstring,(-1):5>>,
+ Bin = Bin0, %Assertion.
+ Bin.
+
+%% Test that different ways of using bit syntax instructions
+%% give the same result.
+
+dynamic(Config) when is_list(Config) ->
+ ?line dynamic_1(fun dynamic_big/5),
+ ?line dynamic_1(fun dynamic_little/5),
+ ok.
+
+dynamic_1(Dynamic) ->
+ <<Lpad:128>> = erlang:md5([0]),
+ <<Rpad:128>> = erlang:md5([1]),
+ <<Int:128>> = erlang:md5([2]),
+ 8385 = dynamic_2(0, {Int,Lpad,Rpad,Dynamic}, 0).
+
+dynamic_2(129, _, Count) -> Count;
+dynamic_2(Bef, Data, Count0) ->
+ Count = dynamic_3(Bef, 128-Bef, Data, Count0),
+ dynamic_2(Bef+1, Data, Count).
+
+dynamic_3(_, -1, _, Count) -> Count;
+dynamic_3(Bef, N, {Int0,Lpad,Rpad,Dynamic}=Data, Count) ->
+ Int1 = Int0 band ((1 bsl (N+3))-1),
+ Dynamic(Bef, N, Int1, Lpad, Rpad),
+ Dynamic(Bef, N, -Int1, Lpad, Rpad),
+
+ %% OTP-7085: Test a small number in a wide field.
+ Int2 = Int0 band 16#FFFFFF,
+ Dynamic(Bef, N, Int2, Lpad, Rpad),
+ Dynamic(Bef, N, -Int2, Lpad, Rpad),
+ dynamic_3(Bef, N-1, Data, Count+1).
+
+dynamic_big(Bef, N, Int, Lpad, Rpad) ->
+ NumBin = id(<<Int:N>>),
+ MaskedInt = Int band ((1 bsl N) - 1),
+ <<MaskedInt:N>> = NumBin,
+
+ %% Construct the binary in two different ways.
+ Bin = id(<<Lpad:Bef,NumBin/bitstring,Rpad:(128-Bef-N)>>),
+ Bin = <<Lpad:Bef,Int:N,Rpad:(128-Bef-N)>>,
+
+ %% Further verify the result by matching.
+ LpadMasked = Lpad band ((1 bsl Bef) - 1),
+ RpadMasked = Rpad band ((1 bsl (128-Bef-N)) - 1),
+ Rbits = (128-Bef-N),
+ <<LpadMasked:Bef,MaskedInt:N,RpadMasked:Rbits>> = id(Bin),
+ ok.
+
+dynamic_little(Bef, N, Int, Lpad, Rpad) ->
+ NumBin = id(<<Int:N/little>>),
+ MaskedInt = Int band ((1 bsl N) - 1),
+ <<MaskedInt:N/little>> = NumBin,
+
+ %% Construct the binary in two different ways.
+ Bin = id(<<Lpad:Bef/little,NumBin/bitstring,Rpad:(128-Bef-N)/little>>),
+ Bin = <<Lpad:Bef/little,Int:N/little,Rpad:(128-Bef-N)/little>>,
+
+ %% Further verify the result by matching.
+ LpadMasked = Lpad band ((1 bsl Bef) - 1),
+ RpadMasked = Rpad band ((1 bsl (128-Bef-N)) - 1),
+ Rbits = (128-Bef-N),
+ <<LpadMasked:Bef/little,MaskedInt:N/little,RpadMasked:Rbits/little>> = id(Bin),
+ ok.
+
+otp_7422(Config) when is_list(Config) ->
+ otp_7422_int(0),
+ otp_7422_bin(0).
+
+otp_7422_int(N) when N < 512 ->
+ T = erlang:make_tuple(N, []),
+ spawn_link(fun() ->
+ id(T),
+ %% A size of field 0 would write one byte beyond
+ %% the current position in the binary. It could
+ %% overwrite the continuation pointer stored on
+ %% the stack if HTOP was equal to E (the stack pointer).
+ id(<<0:(id(0))>>)
+ end),
+ otp_7422_int(N+1);
+otp_7422_int(_) -> ok.
+
+otp_7422_bin(N) when N < 512 ->
+ T = erlang:make_tuple(N, []),
+ Z = id(<<>>),
+ spawn_link(fun() ->
+ id(T),
+ id(<<Z:(id(0))/bits>>)
+ end),
+ otp_7422_bin(N+1);
+otp_7422_bin(_) -> ok.
+
+zero_width(Config) when is_list(Config) ->
+ ?line Z = id(0),
+ Small = id(42),
+ Big = id(1 bsl 128),
+ ?line <<>> = <<Small:Z>>,
+ ?line <<>> = <<Small:0>>,
+ ?line <<>> = <<Big:Z>>,
+ ?line <<>> = <<Big:0>>,
+
+ ?line {'EXIT',{badarg,_}} = (catch <<not_a_number:0>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<(id(not_a_number)):Z>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<(id(not_a_number)):0>>),
+
+ ok.
+
+id(I) -> I.
diff --git a/lib/debugger/test/bs_match_bin_SUITE.erl b/lib/debugger/test/bs_match_bin_SUITE.erl
index b42b84aef2..5a7c30f16b 100644
--- a/lib/debugger/test/bs_match_bin_SUITE.erl
+++ b/lib/debugger/test/bs_match_bin_SUITE.erl
@@ -24,14 +24,14 @@
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- byte_split_binary/1,bit_split_binary/1]).
+ byte_split_binary/1,bit_split_binary/1,match_huge_bin/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [byte_split_binary, bit_split_binary, match_huge_bin].
groups() ->
[].
@@ -42,10 +42,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [byte_split_binary, bit_split_binary].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(1)),
@@ -65,11 +61,12 @@ end_per_suite(Config) when is_list(Config) ->
ok.
byte_split_binary(doc) -> "Tries to split a binary at all byte-aligned positions.";
-byte_split_binary(suite) -> [];
-byte_split_binary(Config) when list(Config) ->
+byte_split_binary(Config) when is_list(Config) ->
?line L = lists:seq(0, 57),
?line B = mkbin(L),
- ?line byte_split(L, B, size(B)).
+ ?line byte_split(L, B, size(B)),
+ ?line Unaligned = make_unaligned_sub_binary(B),
+ ?line byte_split(L, Unaligned, size(Unaligned)).
byte_split(L, B, Pos) when Pos >= 0 ->
?line Sz1 = Pos,
@@ -78,18 +75,19 @@ byte_split(L, B, Pos) when Pos >= 0 ->
?line B1 = list_to_binary(lists:sublist(L, 1, Pos)),
?line B2 = list_to_binary(lists:nthtail(Pos, L)),
?line byte_split(L, B, Pos-1);
-byte_split(_L, _B, _) -> ok.
+byte_split(_, _, _) -> ok.
bit_split_binary(doc) -> "Tries to split a binary at all positions.";
-bit_split_binary(suite) -> [];
-bit_split_binary(Config) when list(Config) ->
+bit_split_binary(Config) when is_list(Config) ->
Fun = fun(Bin, List, SkipBef, N) ->
?line SkipAft = 8*size(Bin) - N - SkipBef,
- io:format("~p, ~p, ~p", [SkipBef,N,SkipAft]),
- ?line <<_I1:SkipBef,OutBin:N/binary-unit:1,_I2:SkipAft>> = Bin,
+ %%io:format("~p, ~p, ~p", [SkipBef,N,SkipAft]),
+ ?line <<_:SkipBef,OutBin:N/binary-unit:1,_:SkipAft>> = Bin,
?line OutBin = make_bin_from_list(List, N)
end,
?line bit_split_binary1(Fun, erlang:md5(<<1,2,3>>)),
+ ?line bit_split_binary1(Fun,
+ make_unaligned_sub_binary(erlang:md5(<<1,2,3>>))),
ok.
bit_split_binary1(Action, Bin) ->
@@ -99,24 +97,23 @@ bit_split_binary1(Action, Bin) ->
bit_split_binary2(Action, Bin, [_|T]=List, Bef) ->
bit_split_binary3(Action, Bin, List, Bef, size(Bin)*8),
bit_split_binary2(Action, Bin, T, Bef+1);
-bit_split_binary2(_Action, _Bin, [], _Bef) -> ok.
+bit_split_binary2(_, _, [], _) -> ok.
bit_split_binary3(Action, Bin, List, Bef, Aft) when Bef =< Aft ->
Action(Bin, List, Bef, (Aft-Bef) div 8 * 8),
bit_split_binary3(Action, Bin, List, Bef, Aft-8);
bit_split_binary3(_, _, _, _, _) -> ok.
-make_bin_from_list(_List, 0) ->
- mkbin([]);
+make_bin_from_list(_, 0) -> mkbin([]);
make_bin_from_list(List, N) ->
list_to_binary([make_int(List, 8, 0),
make_bin_from_list(lists:nthtail(8, List), N-8)]).
-make_int(_List, 0, Acc) -> Acc;
+make_int(_, 0, Acc) -> Acc;
make_int([H|T], N, Acc) -> make_int(T, N-1, Acc bsl 1 bor H).
-bits_to_list([_H|T], 0) -> bits_to_list(T, 16#80);
+bits_to_list([_|T], 0) -> bits_to_list(T, 16#80);
bits_to_list([H|_]=List, Mask) ->
[case H band Mask of
0 -> 0;
@@ -124,5 +121,109 @@ bits_to_list([H|_]=List, Mask) ->
end|bits_to_list(List, Mask bsr 1)];
bits_to_list([], _) -> [].
+mkbin(L) when is_list(L) -> list_to_binary(L).
+
+make_unaligned_sub_binary(Bin0) ->
+ Bin1 = <<0:3,Bin0/binary,31:5>>,
+ Sz = size(Bin0),
+ <<0:3,Bin:Sz/binary,31:5>> = id(Bin1),
+ Bin.
+
+id(I) -> I.
+
+match_huge_bin(Config) when is_list(Config) ->
+ ?line Bin = <<0:(1 bsl 27),13:8>>,
+ ?line skip_huge_bin_1(1 bsl 27, Bin),
+ ?line 16777216 = match_huge_bin_1(1 bsl 27, Bin),
+
+ %% Test overflowing the size of a binary field.
+ ?line nomatch = overflow_huge_bin_skip_32(Bin),
+ ?line nomatch = overflow_huge_bin_32(Bin),
+ ?line nomatch = overflow_huge_bin_skip_64(Bin),
+ ?line nomatch = overflow_huge_bin_64(Bin),
+
+ %% Size in variable
+ ?line ok = overflow_huge_bin(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+ ?line ok = overflow_huge_bin_unit128(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+
+ ok.
+
+overflow_huge_bin(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/binary-unit:8,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<NewBin:Sz/binary-unit:8,0,_/binary>> ->
+ {error,Sz,size(NewBin)};
+ _ ->
+ overflow_huge_bin(Bin, Sizes)
+ end
+ end;
+overflow_huge_bin(_, []) -> ok.
+
+overflow_huge_bin_unit128(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/binary-unit:128,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<NewBin:Sz/binary-unit:128,0,_/binary>> ->
+ {error,Sz,size(NewBin)};
+ _ ->
+ overflow_huge_bin_unit128(Bin, Sizes)
+ end
+ end;
+overflow_huge_bin_unit128(_, []) -> ok.
+
+skip_huge_bin_1(I, Bin) ->
+ <<_:I/binary-unit:1,13>> = Bin,
+ ok.
-mkbin(L) when list(L) -> list_to_binary(L).
+match_huge_bin_1(I, Bin) ->
+ case Bin of
+ <<Val:I/binary-unit:1,13>> -> size(Val);
+ _ -> nomatch
+ end.
+
+overflow_huge_bin_skip_32(<<_:4294967296/binary,0,_/binary>>) -> 1; % 1 bsl 32
+overflow_huge_bin_skip_32(<<_:33554432/binary-unit:128,0,_/binary>>) -> 2; % 1 bsl 25
+overflow_huge_bin_skip_32(<<_:67108864/binary-unit:64,0,_/binary>>) -> 3; % 1 bsl 26
+overflow_huge_bin_skip_32(<<_:134217728/binary-unit:32,0,_/binary>>) -> 4; % 1 bsl 27
+overflow_huge_bin_skip_32(<<_:268435456/binary-unit:16,0,_/binary>>) -> 5; % 1 bsl 28
+overflow_huge_bin_skip_32(<<_:536870912/binary-unit:8,0,_/binary>>) -> 6; % 1 bsl 29
+overflow_huge_bin_skip_32(<<_:1073741824/binary-unit:8,0,_/binary>>) -> 7; % 1 bsl 30
+overflow_huge_bin_skip_32(<<_:2147483648/binary-unit:8,0,_/binary>>) -> 8; % 1 bsl 31
+overflow_huge_bin_skip_32(_) -> nomatch.
+
+overflow_huge_bin_32(<<Bin:4294967296/binary,_/binary>>) -> {1,Bin}; % 1 bsl 32
+overflow_huge_bin_32(<<Bin:33554432/binary-unit:128,0,_/binary>>) -> {2,Bin}; % 1 bsl 25
+overflow_huge_bin_32(<<Bin:67108864/binary-unit:128,0,_/binary>>) -> {3,Bin}; % 1 bsl 26
+overflow_huge_bin_32(<<Bin:134217728/binary-unit:128,0,_/binary>>) -> {4,Bin}; % 1 bsl 27
+overflow_huge_bin_32(<<Bin:268435456/binary-unit:128,0,_/binary>>) -> {5,Bin}; % 1 bsl 28
+overflow_huge_bin_32(<<Bin:536870912/binary-unit:128,0,_/binary>>) -> {6,Bin}; % 1 bsl 29
+overflow_huge_bin_32(<<Bin:1073741824/binary-unit:128,0,_/binary>>) -> {7,Bin}; % 1 bsl 30
+overflow_huge_bin_32(<<Bin:2147483648/binary-unit:128,0,_/binary>>) -> {8,Bin}; % 1 bsl 31
+overflow_huge_bin_32(_) -> nomatch.
+
+overflow_huge_bin_skip_64(<<_:18446744073709551616/binary,0,_/binary>>) -> 1; % 1 bsl 64
+overflow_huge_bin_skip_64(<<_:144115188075855872/binary-unit:128,0,_/binary>>) -> 2; % 1 bsl 57
+overflow_huge_bin_skip_64(<<_:288230376151711744/binary-unit:64,0,_/binary>>) -> 3; % 1 bsl 58
+overflow_huge_bin_skip_64(<<_:576460752303423488/binary-unit:32,0,_/binary>>) -> 4; % 1 bsl 59
+overflow_huge_bin_skip_64(<<_:1152921504606846976/binary-unit:16,0,_/binary>>) -> 5; % 1 bsl 60
+overflow_huge_bin_skip_64(<<_:2305843009213693952/binary-unit:8,0,_/binary>>) -> 6; % 1 bsl 61
+overflow_huge_bin_skip_64(<<_:4611686018427387904/binary-unit:8,0,_/binary>>) -> 7; % 1 bsl 62
+overflow_huge_bin_skip_64(<<_:9223372036854775808/binary-unit:8,_/binary>>) -> 8; % 1 bsl 63
+overflow_huge_bin_skip_64(_) -> nomatch.
+
+overflow_huge_bin_64(<<Bin:18446744073709551616/binary,_/binary>>) -> {1,Bin}; % 1 bsl 64
+overflow_huge_bin_64(<<Bin:144115188075855872/binary-unit:128,0,_/binary>>) -> {2,Bin}; % 1 bsl 57
+overflow_huge_bin_64(<<Bin:288230376151711744/binary-unit:128,0,_/binary>>) -> {3,Bin}; % 1 bsl 58
+overflow_huge_bin_64(<<Bin:576460752303423488/binary-unit:128,0,_/binary>>) -> {4,Bin}; % 1 bsl 59
+overflow_huge_bin_64(<<Bin:1152921504606846976/binary-unit:128,0,_/binary>>) -> {5,Bin}; % 1 bsl 60
+overflow_huge_bin_64(<<Bin:2305843009213693952/binary-unit:128,0,_/binary>>) -> {6,Bin}; % 1 bsl 61
+overflow_huge_bin_64(<<Bin:4611686018427387904/binary-unit:128,0,_/binary>>) -> {7,Bin}; % 1 bsl 62
+overflow_huge_bin_64(<<Bin:9223372036854775808/binary-unit:128,0,_/binary>>) -> {8,Bin}; % 1 bsl 63
+overflow_huge_bin_64(_) -> nomatch.
diff --git a/lib/debugger/test/bs_match_int_SUITE.erl b/lib/debugger/test/bs_match_int_SUITE.erl
index 745368fdfc..bff5f8ff65 100644
--- a/lib/debugger/test/bs_match_int_SUITE.erl
+++ b/lib/debugger/test/bs_match_int_SUITE.erl
@@ -19,11 +19,11 @@
-module(bs_match_int_SUITE).
--author('[email protected]').
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- integer/1,signed_integer/1,dynamic/1,more_dynamic/1,mml/1]).
+ integer/1,signed_integer/1,dynamic/1,more_dynamic/1,mml/1,
+ match_huge_int/1,bignum/1,unaligned_32_bit/1]).
-include_lib("test_server/include/test_server.hrl").
@@ -32,7 +32,8 @@
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- [cases()].
+ [integer, signed_integer, dynamic, more_dynamic, mml,
+ match_huge_int, bignum, unaligned_32_bit].
groups() ->
[].
@@ -43,10 +44,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [integer, signed_integer, dynamic, more_dynamic, mml].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(4)),
@@ -65,8 +62,7 @@ init_per_suite(Config) when is_list(Config) ->
end_per_suite(Config) when is_list(Config) ->
ok.
-integer(suite) -> [];
-integer(Config) when list(Config) ->
+integer(Config) when is_list(Config) ->
?line 0 = get_int(mkbin([])),
?line 0 = get_int(mkbin([0])),
?line 42 = get_int(mkbin([42])),
@@ -78,22 +74,33 @@ integer(Config) when list(Config) ->
?line 65534 = get_int(mkbin([255,254])),
?line 16776455 = get_int(mkbin([255,253,7])),
?line 4245492555 = get_int(mkbin([253,13,19,75])),
+ ?line 4294967294 = get_int(mkbin([255,255,255,254])),
+ ?line 4294967295 = get_int(mkbin([255,255,255,255])),
?line Eight = [200,1,19,128,222,42,97,111],
?line cmp128(Eight, uint(Eight)),
?line fun_clause(catch get_int(mkbin(seq(1,5)))),
ok.
-get_int(<<I:0>>) -> I;
-get_int(<<I:8>>) -> I;
-get_int(<<I:16>>) -> I;
-get_int(<<I:24>>) -> I;
-get_int(<<I:32>>) -> I.
+get_int(Bin) ->
+ I = get_int1(Bin),
+ get_int(Bin, I).
+
+get_int(Bin0, I) when size(Bin0) < 4 ->
+ Bin = <<0,Bin0/binary>>,
+ I = get_int1(Bin),
+ get_int(Bin, I);
+get_int(_, I) -> I.
+
+get_int1(<<I:0>>) -> I;
+get_int1(<<I:8>>) -> I;
+get_int1(<<I:16>>) -> I;
+get_int1(<<I:24>>) -> I;
+get_int1(<<I:32>>) -> I.
cmp128(<<I:128>>, I) -> equal;
-cmp128(_B, _I) -> not_equal.
+cmp128(_, _) -> not_equal.
-signed_integer(suite) -> [];
-signed_integer(Config) when list(Config) ->
+signed_integer(Config) when is_list(Config) ->
?line {no_match,_} = sint(mkbin([])),
?line {no_match,_} = sint(mkbin([1,2,3])),
?line 127 = sint(mkbin([127])),
@@ -113,7 +120,7 @@ uint(L) -> uint(L, 0).
uint([H|T], Acc) -> uint(T, Acc bsl 8 bor H);
uint([], Acc) -> Acc.
-dynamic(Config) when list(Config) ->
+dynamic(Config) when is_list(Config) ->
dynamic(mkbin([255]), 8),
dynamic(mkbin([255,255]), 16),
dynamic(mkbin([255,255,255]), 24),
@@ -124,7 +131,7 @@ dynamic(Bin, S1) when S1 >= 0 ->
S2 = size(Bin) * 8 - S1,
dynamic(Bin, S1, S2, (1 bsl S1) - 1, (1 bsl S2) - 1),
dynamic(Bin, S1-1);
-dynamic(_Bin, _) -> ok.
+dynamic(_, _) -> ok.
dynamic(Bin, S1, S2, A, B) ->
% io:format("~p ~p ~p ~p\n", [S1,S2,A,B]),
@@ -132,25 +139,24 @@ dynamic(Bin, S1, S2, A, B) ->
<<A:S1,B:S2>> ->
io:format("~p ~p ~p ~p\n", [S1,S2,A,B]),
ok;
- _Other ->
- erlang:error(badmatch, [Bin,S1,S2,A,B])
+ _Other -> erlang:error(badmatch, [Bin,S1,S2,A,B])
end.
more_dynamic(doc) -> "Extract integers at different alignments and of different sizes.";
-more_dynamic(Config) when list(Config) ->
+more_dynamic(Config) when is_list(Config) ->
% Unsigned big-endian numbers.
Unsigned = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N,_:SkipAft>> = Bin,
Int = make_int(List, N, 0)
end,
?line more_dynamic1(Unsigned, funny_binary(42)),
- % Signed big-endian numbers.
+ %% Signed big-endian numbers.
Signed = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N/signed,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N/signed,_:SkipAft>> = Bin,
case make_signed_int(List, N) of
Int -> ok;
Other ->
@@ -162,18 +168,18 @@ more_dynamic(Config) when list(Config) ->
end,
?line more_dynamic1(Signed, funny_binary(43)),
- % Unsigned little-endian numbers.
+ %% Unsigned little-endian numbers.
UnsLittle = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N/little,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N/little,_:SkipAft>> = Bin,
Int = make_int(big_to_little(List, N), N, 0)
end,
?line more_dynamic1(UnsLittle, funny_binary(44)),
- % Signed little-endian numbers.
+ %% Signed little-endian numbers.
SignLittle = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N/signed-little,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N/signed-little,_:SkipAft>> = Bin,
Little = big_to_little(List, N),
Int = make_signed_int(Little, N)
end,
@@ -181,11 +187,6 @@ more_dynamic(Config) when list(Config) ->
ok.
-funny_binary(N) ->
- B0 = erlang:md5([N]),
- {B1,_B2} = split_binary(B0, size(B0) div 2),
- B1.
-
more_dynamic1(Action, Bin) ->
BitList = bits_to_list(binary_to_list(Bin), 16#80),
more_dynamic2(Action, Bin, BitList, 0).
@@ -193,7 +194,7 @@ more_dynamic1(Action, Bin) ->
more_dynamic2(Action, Bin, [_|T]=List, Bef) ->
more_dynamic3(Action, Bin, List, Bef, size(Bin)*8),
more_dynamic2(Action, Bin, T, Bef+1);
-more_dynamic2(_Action, _Bin, [], _Bef) -> ok.
+more_dynamic2(_, _, [], _) -> ok.
more_dynamic3(Action, Bin, List, Bef, Aft) when Bef =< Aft ->
%% io:format("~p, ~p", [Bef,Aft-Bef]),
@@ -208,8 +209,8 @@ big_to_little([B0,B1,B2,B3,B4,B5,B6,B7|T], N, Acc) when N >= 8 ->
big_to_little(List, N, Acc) -> lists:sublist(List, 1, N) ++ Acc.
make_signed_int(_List, 0) -> 0;
-make_signed_int([0|_T]=List, N) -> make_int(List, N, 0);
-make_signed_int([1|_T]=List0, N) ->
+make_signed_int([0|_]=List, N) -> make_int(List, N, 0);
+make_signed_int([1|_]=List0, N) ->
List1 = reversed_sublist(List0, N, []),
List2 = two_complement_and_reverse(List1, 1, []),
-make_int(List2, length(List2), 0).
@@ -225,7 +226,7 @@ two_complement_and_reverse([], Carry, Acc) -> [Carry|Acc].
make_int(_List, 0, Acc) -> Acc;
make_int([H|T], N, Acc) -> make_int(T, N-1, Acc bsl 1 bor H).
-bits_to_list([_H|T], 0) -> bits_to_list(T, 16#80);
+bits_to_list([_|T], 0) -> bits_to_list(T, 16#80);
bits_to_list([H|_]=List, Mask) ->
[case H band Mask of
0 -> 0;
@@ -234,11 +235,134 @@ bits_to_list([H|_]=List, Mask) ->
bits_to_list([], _) -> [].
fun_clause({'EXIT',{function_clause,_}}) -> ok.
-mkbin(L) when list(L) -> list_to_binary(L).
+mkbin(L) when is_list(L) -> list_to_binary(L).
+
+funny_binary(N) ->
+ B0 = erlang:md5([N]),
+ {B1,_B2} = split_binary(B0, byte_size(B0) div 3),
+ B1.
-mml(Config) when list(Config) ->
+mml(Config) when is_list(Config) ->
?line single_byte_binary = mml_choose(<<42>>),
?line multi_byte_binary = mml_choose(<<42,43>>).
mml_choose(<<_A:8>>) -> single_byte_binary;
-mml_choose(<<_A:8, _T/binary>>) -> multi_byte_binary.
+mml_choose(<<_A:8,_T/binary>>) -> multi_byte_binary.
+
+match_huge_int(Config) when is_list(Config) ->
+ Sz = 1 bsl 27,
+ ?line Bin = <<0:Sz,13:8>>,
+ ?line skip_huge_int_1(Sz, Bin),
+ ?line 0 = match_huge_int_1(Sz, Bin),
+
+ %% Test overflowing the size of an integer field.
+ ?line nomatch = overflow_huge_int_skip_32(Bin),
+ case erlang:system_info(wordsize) of
+ 4 ->
+ ?line nomatch = overflow_huge_int_32(Bin);
+ 8 ->
+ %% An attempt will be made to allocate heap space for
+ %% the bignum (which will probably fail); only if the
+ %% allocation succeds will the matching fail because
+ %% the binary is too small.
+ ok
+ end,
+ ?line nomatch = overflow_huge_int_skip_64(Bin),
+ ?line nomatch = overflow_huge_int_64(Bin),
+
+ %% Test overflowing the size of an integer field using variables as sizes.
+ ?line Sizes = case erlang:system_info(wordsize) of
+ 4 -> lists:seq(25, 32);
+ 8 -> []
+ end ++ lists:seq(50, 64),
+ ?line ok = overflow_huge_int_unit128(Bin, Sizes),
+
+ ok.
+
+overflow_huge_int_unit128(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/unit:128,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<Var:Sz/unit:128,0,_/binary>> ->
+ {error,Sz,Var};
+ _ ->
+ overflow_huge_int_unit128(Bin, Sizes)
+ end
+ end;
+overflow_huge_int_unit128(_, []) -> ok.
+
+match_huge_int_1(I, Bin) ->
+ <<Int:I,13>> = Bin,
+ Int.
+
+skip_huge_int_1(I, Bin) ->
+ <<_:I,13>> = Bin.
+
+overflow_huge_int_skip_32(<<_:4294967296,0,_/binary>>) -> 1; % 1 bsl 32
+overflow_huge_int_skip_32(<<_:33554432/unit:128,0,_/binary>>) -> 2; % 1 bsl 25
+overflow_huge_int_skip_32(<<_:67108864/unit:64,0,_/binary>>) -> 3; % 1 bsl 26
+overflow_huge_int_skip_32(<<_:134217728/unit:32,0,_/binary>>) -> 4; % 1 bsl 27
+overflow_huge_int_skip_32(<<_:268435456/unit:16,0,_/binary>>) -> 5; % 1 bsl 28
+overflow_huge_int_skip_32(<<_:536870912/unit:8,0,_/binary>>) -> 6; % 1 bsl 29
+overflow_huge_int_skip_32(<<_:1073741824/unit:8,0,_/binary>>) -> 7; % 1 bsl 30
+overflow_huge_int_skip_32(<<_:2147483648/unit:8,0,_/binary>>) -> 8; % 1 bsl 31
+overflow_huge_int_skip_32(_) -> nomatch.
+
+overflow_huge_int_32(<<Int:4294967296,_/binary>>) -> {1,Int}; % 1 bsl 32
+overflow_huge_int_32(<<Int:33554432/unit:128,0,_/binary>>) -> {2,Int}; % 1 bsl 25
+overflow_huge_int_32(<<Int:67108864/unit:128,0,_/binary>>) -> {3,Int}; % 1 bsl 26
+overflow_huge_int_32(<<Int:134217728/unit:128,0,_/binary>>) -> {4,Int}; % 1 bsl 27
+overflow_huge_int_32(<<Int:268435456/unit:128,0,_/binary>>) -> {5,Int}; % 1 bsl 28
+overflow_huge_int_32(<<Int:536870912/unit:128,0,_/binary>>) -> {6,Int}; % 1 bsl 29
+overflow_huge_int_32(<<Int:1073741824/unit:128,0,_/binary>>) -> {7,Int}; % 1 bsl 30
+overflow_huge_int_32(<<Int:2147483648/unit:128,0,_/binary>>) -> {8,Int}; % 1 bsl 31
+overflow_huge_int_32(_) -> nomatch.
+
+overflow_huge_int_skip_64(<<_:18446744073709551616,_/binary>>) -> 1; % 1 bsl 64
+overflow_huge_int_skip_64(<<_:144115188075855872/unit:128,0,_/binary>>) -> 2; % 1 bsl 57
+overflow_huge_int_skip_64(<<_:288230376151711744/unit:64,0,_/binary>>) -> 3; % 1 bsl 58
+overflow_huge_int_skip_64(<<_:576460752303423488/unit:32,0,_/binary>>) -> 4; % 1 bsl 59
+overflow_huge_int_skip_64(<<_:1152921504606846976/unit:16,0,_/binary>>) -> 5; % 1 bsl 60
+overflow_huge_int_skip_64(<<_:2305843009213693952/unit:8,0,_/binary>>) -> 6; % 1 bsl 61
+overflow_huge_int_skip_64(<<_:4611686018427387904/unit:8,0,_/binary>>) -> 7; % 1 bsl 62
+overflow_huge_int_skip_64(<<_:9223372036854775808/unit:8,0,_/binary>>) -> 8; % 1 bsl 63
+overflow_huge_int_skip_64(_) -> nomatch.
+
+overflow_huge_int_64(<<Int:18446744073709551616,_/binary>>) -> {1,Int}; % 1 bsl 64
+overflow_huge_int_64(<<Int:144115188075855872/unit:128,0,_/binary>>) -> {2,Int}; % 1 bsl 57
+overflow_huge_int_64(<<Int:288230376151711744/unit:128,0,_/binary>>) -> {3,Int}; % 1 bsl 58
+overflow_huge_int_64(<<Int:576460752303423488/unit:128,0,_/binary>>) -> {4,Int}; % 1 bsl 59
+overflow_huge_int_64(<<Int:1152921504606846976/unit:128,0,_/binary>>) -> {5,Int}; % 1 bsl 60
+overflow_huge_int_64(<<Int:2305843009213693952/unit:128,0,_/binary>>) -> {6,Int}; % 1 bsl 61
+overflow_huge_int_64(<<Int:4611686018427387904/unit:128,0,_/binary>>) -> {7,Int}; % 1 bsl 62
+overflow_huge_int_64(<<Int:9223372036854775808/unit:128,0,_/binary>>) -> {8,Int}; % 1 bsl 63
+overflow_huge_int_64(_) -> nomatch.
+
+bignum(Config) when is_list(Config) ->
+ ?line Bin = id(<<42,0:1024/unit:8,43>>),
+ ?line <<42:1025/little-integer-unit:8,_:8>> = Bin,
+ ?line <<_:8,43:1025/integer-unit:8>> = Bin,
+
+ ?line BignumBin = id(<<0:512/unit:8,258254417031933722623:9/unit:8>>),
+ ?line <<258254417031933722623:(512+9)/unit:8>> = BignumBin,
+ erlang:garbage_collect(), %Search for holes in debug-build.
+ ok.
+
+unaligned_32_bit(Config) when is_list(Config) ->
+ %% There used to be a risk for heap overflow (fixed in R11B-5).
+ ?line L = unaligned_32_bit_1(<<-1:(64*1024)>>),
+ ?line unaligned_32_bit_verify(L, 1638).
+
+unaligned_32_bit_1(<<1:1,U:32,_:7,T/binary>>) ->
+ [U|unaligned_32_bit_1(T)];
+unaligned_32_bit_1(_) ->
+ [].
+
+unaligned_32_bit_verify([], 0) -> ok;
+unaligned_32_bit_verify([4294967295|T], N) when N > 0 ->
+ unaligned_32_bit_verify(T, N-1).
+
+id(I) -> I.
diff --git a/lib/debugger/test/bs_match_misc_SUITE.erl b/lib/debugger/test/bs_match_misc_SUITE.erl
index 53d11ba179..89fce263f5 100644
--- a/lib/debugger/test/bs_match_misc_SUITE.erl
+++ b/lib/debugger/test/bs_match_misc_SUITE.erl
@@ -19,18 +19,24 @@
-module(bs_match_misc_SUITE).
--author('[email protected]').
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- bound_var/1,bound_tail/1,t_float/1,little_float/1,sean/1]).
+ bound_var/1,bound_tail/1,t_float/1,little_float/1,sean/1,
+ kenneth/1,encode_binary/1,native/1,happi/1,
+ size_var/1,wiger/1,x0_context/1,huge_float_field/1,
+ writable_binary_matched/1,otp_7198/1,
+ unordered_bindings/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [bound_var, bound_tail, t_float, little_float, sean,
+ kenneth, encode_binary, native, happi, size_var, wiger,
+ x0_context, huge_float_field, writable_binary_matched,
+ otp_7198, unordered_bindings].
groups() ->
[].
@@ -41,9 +47,13 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
+init_per_suite(Config) when is_list(Config) ->
+ ?line test_lib:interpret(?MODULE),
+ ?line true = lists:member(?MODULE, int:interpreted()),
+ Config.
-cases() ->
- [bound_var, bound_tail, t_float, little_float, sean].
+end_per_suite(Config) when is_list(Config) ->
+ ok.
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
@@ -55,16 +65,8 @@ end_per_testcase(_Case, Config) ->
?t:timetrap_cancel(Dog),
ok.
-init_per_suite(Config) when is_list(Config) ->
- ?line test_lib:interpret(?MODULE),
- ?line true = lists:member(?MODULE, int:interpreted()),
- Config.
-
-end_per_suite(Config) when is_list(Config) ->
- ok.
-
bound_var(doc) -> "Test matching of bound variables.";
-bound_var(Config) when list(Config) ->
+bound_var(Config) when is_list(Config) ->
?line ok = bound_var(42, 13, <<42,13>>),
?line nope = bound_var(42, 13, <<42,255>>),
?line nope = bound_var(42, 13, <<154,255>>),
@@ -74,7 +76,7 @@ bound_var(A, B, <<A:8,B:8>>) -> ok;
bound_var(_, _, _) -> nope.
bound_tail(doc) -> "Test matching of a bound tail.";
-bound_tail(Config) when list(Config) ->
+bound_tail(Config) when is_list(Config) ->
?line ok = bound_tail(<<>>, <<13,14>>),
?line ok = bound_tail(<<2,3>>, <<1,1,2,3>>),
?line nope = bound_tail(<<2,3>>, <<1,1,2,7>>),
@@ -85,7 +87,7 @@ bound_tail(Config) when list(Config) ->
bound_tail(T, <<_:16,T/binary>>) -> ok;
bound_tail(_, _) -> nope.
-t_float(Config) when list(Config) ->
+t_float(Config) when is_list(Config) ->
F = f1(),
G = f_one(),
@@ -98,6 +100,10 @@ t_float(Config) when list(Config) ->
?line fcmp(F, match_float(<<1:1,F:64/float,127:7>>, 64, 1)),
?line fcmp(F, match_float(<<1:13,F:32/float,127:3>>, 32, 13)),
?line fcmp(F, match_float(<<1:13,F:64/float,127:3>>, 64, 13)),
+
+ ?line {'EXIT',{{badmatch,_},_}} = (catch match_float(<<0,0>>, 16, 0)),
+ ?line {'EXIT',{{badmatch,_},_}} = (catch match_float(<<0,0>>, 16#7fffffff, 0)),
+
ok.
@@ -110,7 +116,7 @@ match_float(Bin0, Fsz, I) ->
<<_:I,F:Fsz/float,_:Tsz>> = Bin,
F.
-little_float(Config) when list(Config) ->
+little_float(Config) when is_list(Config) ->
F = f2(),
G = f_one(),
@@ -149,7 +155,7 @@ f2() ->
f_one() ->
1.0.
-sean(Config) when list(Config) ->
+sean(Config) when is_list(Config) ->
?line small = sean1(<<>>),
?line small = sean1(<<1>>),
?line small = sean1(<<1,2>>),
@@ -162,5 +168,414 @@ sean(Config) when list(Config) ->
?line {'EXIT',{function_clause,_}} = (catch sean1(<<4,5,6,7>>)),
ok.
-sean1(<<B/binary>>) when size(B) < 4 -> small;
+sean1(<<B/binary>>) when byte_size(B) < 4 -> small;
sean1(<<1, _B/binary>>) -> large.
+
+kenneth(Config) when is_list(Config) ->
+ {ok,[145,148,113,129,0,0,0,0]} =
+ msisdn_internal_storage(<<145,148,113,129,0,0,0,0>>, []).
+
+msisdn_internal_storage(<<>>,MSISDN) ->
+ {ok,lists:reverse(MSISDN)};
+msisdn_internal_storage(<<2#11111111:8,_Rest/binary>>,MSISDN) ->
+ {ok,lists:reverse(MSISDN)};
+msisdn_internal_storage(<<2#1111:4,DigitN:4,_Rest/binary>>,MSISDN) when
+ DigitN < 10 ->
+ {ok,lists:reverse([(DigitN bor 2#11110000)|MSISDN])};
+msisdn_internal_storage(<<DigitNplus1:4,DigitN:4,Rest/binary>>,MSISDN) when
+ DigitNplus1 < 10,
+ DigitN < 10 ->
+ NewMSISDN=[((DigitNplus1 bsl 4) bor DigitN)|MSISDN],
+ msisdn_internal_storage(Rest,NewMSISDN);
+msisdn_internal_storage(_Rest,_MSISDN) ->
+ {fault}. %% Mandatory IE incorrect
+
+encode_binary(Config) when is_list(Config) ->
+ "C2J2QiSc" = encodeBinary(<<11,98,118,66,36,156>>, []),
+ ok.
+
+encodeBinary(<<>>, Output) ->
+ lists:reverse(Output);
+encodeBinary(<<Data:1/binary>>, Output) ->
+ <<DChar1:6, DChar2:2>> = Data,
+ Char1 = getBase64Char(DChar1),
+ Char2 = getBase64Char(DChar2),
+ Char3 = "=",
+ Char4 = "=",
+ NewOutput = Char4 ++ Char3 ++ Char2 ++ Char1 ++ Output,
+ encodeBinary(<<>>, NewOutput);
+encodeBinary(<<Data:2/binary>>, Output) ->
+ <<DChar1:6, DChar2:6, DChar3:4>> = Data,
+ Char1 = getBase64Char(DChar1),
+ Char2 = getBase64Char(DChar2),
+ Char3 = getBase64Char(DChar3),
+ Char4 = "=",
+ NewOutput = Char4 ++ Char3 ++ Char2 ++ Char1 ++ Output,
+ encodeBinary(<<>>, NewOutput);
+encodeBinary(<<Data:3/binary, Rest/binary>>, Output) ->
+ <<DChar1:6, DChar2:6, DChar3:6, DChar4:6>> = Data,
+ Char1 = getBase64Char(DChar1),
+ Char2 = getBase64Char(DChar2),
+ Char3 = getBase64Char(DChar3),
+ Char4 = getBase64Char(DChar4),
+ NewOutput = Char4 ++ Char3 ++ Char2 ++ Char1 ++ Output,
+ encodeBinary(Rest, NewOutput);
+encodeBinary(_Data, _) ->
+ error.
+
+getBase64Char(0) -> "A";
+getBase64Char(1) -> "B";
+getBase64Char(2) -> "C";
+getBase64Char(3) -> "D";
+getBase64Char(4) -> "E";
+getBase64Char(5) -> "F";
+getBase64Char(6) -> "G";
+getBase64Char(7) -> "H";
+getBase64Char(8) -> "I";
+getBase64Char(9) -> "J";
+getBase64Char(10) -> "K";
+getBase64Char(11) -> "L";
+getBase64Char(12) -> "M";
+getBase64Char(13) -> "N";
+getBase64Char(14) -> "O";
+getBase64Char(15) -> "P";
+getBase64Char(16) -> "Q";
+getBase64Char(17) -> "R";
+getBase64Char(18) -> "S";
+getBase64Char(19) -> "T";
+getBase64Char(20) -> "U";
+getBase64Char(21) -> "V";
+getBase64Char(22) -> "W";
+getBase64Char(23) -> "X";
+getBase64Char(24) -> "Y";
+getBase64Char(25) -> "Z";
+getBase64Char(26) -> "a";
+getBase64Char(27) -> "b";
+getBase64Char(28) -> "c";
+getBase64Char(29) -> "d";
+getBase64Char(30) -> "e";
+getBase64Char(31) -> "f";
+getBase64Char(32) -> "g";
+getBase64Char(33) -> "h";
+getBase64Char(34) -> "i";
+getBase64Char(35) -> "j";
+getBase64Char(36) -> "k";
+getBase64Char(37) -> "l";
+getBase64Char(38) -> "m";
+getBase64Char(39) -> "n";
+getBase64Char(40) -> "o";
+getBase64Char(41) -> "p";
+getBase64Char(42) -> "q";
+getBase64Char(43) -> "r";
+getBase64Char(44) -> "s";
+getBase64Char(45) -> "t";
+getBase64Char(46) -> "u";
+getBase64Char(47) -> "v";
+getBase64Char(48) -> "w";
+getBase64Char(49) -> "x";
+getBase64Char(50) -> "y";
+getBase64Char(51) -> "z";
+getBase64Char(52) -> "0";
+getBase64Char(53) -> "1";
+getBase64Char(54) -> "2";
+getBase64Char(55) -> "3";
+getBase64Char(56) -> "4";
+getBase64Char(57) -> "5";
+getBase64Char(58) -> "6";
+getBase64Char(59) -> "7";
+getBase64Char(60) -> "8";
+getBase64Char(61) -> "9";
+getBase64Char(62) -> "+";
+getBase64Char(63) -> "/";
+getBase64Char(_Else) ->
+ %% This is an illegal input.
+% cgLogEM:log(error, ?MODULE, getBase64Char, [Else],
+% "illegal input",
+% ?LINE, version()),
+ "**".
+
+-define(M(F), <<F>> = <<F>>).
+
+native(Config) when is_list(Config) ->
+ ?line ?M(3.14:64/native-float),
+ ?line ?M(333:16/native),
+ ?line ?M(38658345:32/native),
+ case <<1:16/native>> of
+ <<0,1>> -> native_big();
+ <<1,0>> -> native_little()
+ end.
+
+native_big() ->
+ ?line <<37.33:64/native-float>> = <<37.33:64/big-float>>,
+ ?line <<3974:16/native-integer>> = <<3974:16/big-integer>>,
+ {comment,"Big endian"}.
+
+native_little() ->
+ ?line <<37869.32343:64/native-float>> = <<37869.32343:64/little-float>>,
+ ?line <<7974:16/native-integer>> = <<7974:16/little-integer>>,
+ {comment,"Little endian"}.
+
+happi(Config) when is_list(Config) ->
+ Bin = <<".123">>,
+ ?line <<"123">> = lex_digits1(Bin, 1, []),
+ ?line <<"123">> = lex_digits2(Bin, 1, []),
+ ok.
+
+lex_digits1(<<$., Rest/binary>>,_Val,_Acc) ->
+ Rest;
+lex_digits1(<<N, Rest/binary>>,Val, Acc) when N >= $0 , N =< $9 ->
+ lex_digits1(Rest,Val*10+dec(N),Acc);
+lex_digits1(_Other,_Val,_Acc) ->
+ not_ok.
+
+lex_digits2(<<N, Rest/binary>>,Val, Acc) when N >= $0 , N =< $9 ->
+ lex_digits2(Rest,Val*10+dec(N),Acc);
+lex_digits2(<<$., Rest/binary>>,_Val,_Acc) ->
+ Rest;
+lex_digits2(_Other,_Val,_Acc) ->
+ not_ok.
+
+dec(A) ->
+ A-$0.
+
+size_var(Config) when is_list(Config) ->
+ ?line {<<45>>,<<>>} = split(<<1:16,45>>),
+ ?line {<<45>>,<<46,47>>} = split(<<1:16,45,46,47>>),
+ ?line {<<45,46>>,<<47>>} = split(<<2:16,45,46,47>>),
+
+ ?line {<<45,46,47>>,<<48>>} = split_2(<<16:8,3:16,45,46,47,48>>),
+
+ ?line {<<45,46>>,<<47>>} = split(2, <<2:16,45,46,47>>),
+ ?line {'EXIT',{function_clause,_}} = (catch split(42, <<2:16,45,46,47>>)),
+
+ ?line <<"cdef">> = skip(<<2:8,"abcdef">>),
+
+ ok.
+
+split(<<N:16,B:N/binary,T/binary>>) ->
+ {B,T}.
+
+split(N, <<N:16,B:N/binary,T/binary>>) ->
+ {B,T}.
+
+split_2(<<N0:8,N:N0,B:N/binary,T/binary>>) ->
+ {B,T}.
+
+skip(<<N:8,_:N/binary,T/binary>>) -> T.
+
+wiger(Config) when is_list(Config) ->
+ ?line ok1 = wcheck(<<3>>),
+ ?line ok2 = wcheck(<<1,2,3>>),
+ ?line ok3 = wcheck(<<4>>),
+ ?line {error,<<1,2,3,4>>} = wcheck(<<1,2,3,4>>),
+ ?line {error,<<>>} = wcheck(<<>>),
+ ok.
+
+wcheck(<<A>>) when A==3->
+ ok1;
+wcheck(<<_,_:2/binary>>) ->
+ ok2;
+wcheck(<<_>>) ->
+ ok3;
+wcheck(Other) ->
+ {error,Other}.
+
+%% Test that having the match context in x(0) works.
+
+x0_context(Config) when is_list(Config) ->
+ x0_0([], <<3.0:64/float,42:16,123456:32>>).
+
+x0_0(_, Bin) ->
+ <<3.0:64/float,42:16,_/binary>> = Bin,
+ x0_1([], Bin, 64, 16, 2).
+
+x0_1(_, Bin, FloatSz, IntSz, BinSz) ->
+ <<_:FloatSz/float,42:IntSz,B:BinSz/binary,C:1/binary,D/binary>> = Bin,
+ id({B,C,D}),
+ <<_:FloatSz/float,42:IntSz,B:BinSz/binary,_/binary>> = Bin,
+ x0_2([], Bin).
+
+x0_2(_, Bin) ->
+ <<_:64,0:7,42:9,_/binary>> = Bin,
+ x0_3([], Bin).
+
+x0_3(_, Bin) ->
+ case Bin of
+ <<_:72,7:8,_/binary>> ->
+ ?line ?t:fail();
+ <<_:64,0:16,_/binary>> ->
+ ?line ?t:fail();
+ <<_:64,42:16,123456:32,_/binary>> ->
+ ok
+ end.
+
+
+huge_float_field(Config) when is_list(Config) ->
+ Sz = 1 bsl 27,
+ ?line Bin = <<0:Sz>>,
+
+ ?line nomatch = overflow_huge_float_skip_32(Bin),
+ ?line nomatch = overflow_huge_float_32(Bin),
+
+ ?line ok = overflow_huge_float(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+ ?line ok = overflow_huge_float_unit128(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+ ok.
+
+overflow_huge_float_skip_32(<<_:4294967296/float,0,_/binary>>) -> 1; % 1 bsl 32
+overflow_huge_float_skip_32(<<_:33554432/float-unit:128,0,_/binary>>) -> 2; % 1 bsl 25
+overflow_huge_float_skip_32(<<_:67108864/float-unit:64,0,_/binary>>) -> 3; % 1 bsl 26
+overflow_huge_float_skip_32(<<_:134217728/float-unit:32,0,_/binary>>) -> 4; % 1 bsl 27
+overflow_huge_float_skip_32(<<_:268435456/float-unit:16,0,_/binary>>) -> 5; % 1 bsl 28
+overflow_huge_float_skip_32(<<_:536870912/float-unit:8,0,_/binary>>) -> 6; % 1 bsl 29
+overflow_huge_float_skip_32(<<_:1073741824/float-unit:8,0,_/binary>>) -> 7; % 1 bsl 30
+overflow_huge_float_skip_32(<<_:2147483648/float-unit:8,0,_/binary>>) -> 8; % 1 bsl 31
+overflow_huge_float_skip_32(_) -> nomatch.
+
+overflow_huge_float_32(<<F:4294967296/float,_/binary>>) -> {1,F}; % 1 bsl 32
+overflow_huge_float_32(<<F:33554432/float-unit:128,0,_/binary>>) -> {2,F}; % 1 bsl 25
+overflow_huge_float_32(<<F:67108864/float-unit:128,0,_/binary>>) -> {3,F}; % 1 bsl 26
+overflow_huge_float_32(<<F:134217728/float-unit:128,0,_/binary>>) -> {4,F}; % 1 bsl 27
+overflow_huge_float_32(<<F:268435456/float-unit:128,0,_/binary>>) -> {5,F}; % 1 bsl 28
+overflow_huge_float_32(<<F:536870912/float-unit:128,0,_/binary>>) -> {6,F}; % 1 bsl 29
+overflow_huge_float_32(<<F:1073741824/float-unit:128,0,_/binary>>) -> {7,F}; % 1 bsl 30
+overflow_huge_float_32(<<F:2147483648/float-unit:128,0,_/binary>>) -> {8,F}; % 1 bsl 31
+overflow_huge_float_32(_) -> nomatch.
+
+
+overflow_huge_float(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/float-unit:8,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<Var:Sz/float-unit:8,0,_/binary>> ->
+ {error,Sz,Var};
+ _ ->
+ overflow_huge_float(Bin, Sizes)
+ end
+ end;
+overflow_huge_float(_, []) -> ok.
+
+overflow_huge_float_unit128(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/float-unit:128,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<Var:Sz/float-unit:128,0,_/binary>> ->
+ {error,Sz,Var};
+ _ ->
+ overflow_huge_float_unit128(Bin, Sizes)
+ end
+ end;
+overflow_huge_float_unit128(_, []) -> ok.
+
+
+%%
+%% Test that a writable binary can be safely matched.
+%%
+
+writable_binary_matched(Config) when is_list(Config) ->
+ ?line WritableBin = create_writeable_binary(),
+ ?line writable_binary_matched(WritableBin, WritableBin, 500).
+
+writable_binary_matched(<<0>>, _, N) ->
+ if
+ N =:= 0 -> ok;
+ true ->
+ put(grow_heap, [N|get(grow_heap)]),
+ ?line WritableBin = create_writeable_binary(),
+ ?line writable_binary_matched(WritableBin, WritableBin, N-1)
+ end;
+writable_binary_matched(<<B:8,T/binary>>, WritableBin0, N) ->
+ ?line WritableBin = writable_binary(WritableBin0, B),
+ writable_binary_matched(T, WritableBin, N).
+
+writable_binary(WritableBin0, B) when is_binary(WritableBin0) ->
+ %% Heavy append to force the binary to move.
+ ?line WritableBin = <<WritableBin0/binary,0:(size(WritableBin0))/unit:8,B>>,
+ ?line id(<<(id(0)):128/unit:8>>),
+ WritableBin.
+
+create_writeable_binary() ->
+ <<(id(<<>>))/binary,1,2,3,4,5,6,0>>.
+
+otp_7198(Config) when is_list(Config) ->
+ %% When a match context was reused, and grown at the same time to
+ %% increase the number of saved positions, the thing word was not updated
+ %% to account for the new size. Therefore, if there was a garbage collection,
+ %% the new slots would be included in the garbage collection.
+ ?line [do_otp_7198(FillerSize) || FillerSize <- lists:seq(0, 256)],
+ ok.
+
+do_otp_7198(FillerSize) ->
+ Filler = erlang:make_tuple(FillerSize, 42),
+ {Pid,Ref} = spawn_monitor(fun() -> do_otp_7198_test(Filler) end),
+ receive
+ {'DOWN',Ref,process,Pid,normal} ->
+ ok;
+ {'DOWN',Ref,process,Pid,Reason} ->
+ io:format("unexpected: ~p", [Reason]),
+ ?line ?t:fail()
+ end.
+
+do_otp_7198_test(_) ->
+ [{'KEYWORD',114},
+ {'KEYWORD',101},
+ {'KEYWORD',103},
+ {'KEYWORD',105},
+ {'KEYWORD',111},
+ {'FIELD',110},
+ {'KEYWORD',119},
+ {'KEYWORD',104},
+ {'KEYWORD',97},
+ {'KEYWORD',116},
+ {'KEYWORD',101},
+ {'KEYWORD',118},
+ {'KEYWORD',101},
+ {'KEYWORD',114},
+ '$thats_all_folks$'] = otp_7198_scan(<<"region:whatever">>, []).
+
+
+otp_7198_scan(<<>>, TokAcc) ->
+ lists:reverse(['$thats_all_folks$' | TokAcc]);
+
+otp_7198_scan(<<D, Z, Rest/binary>>, TokAcc) when
+ (D =:= $D orelse D =:= $d) and
+ ((Z =:= $\s) or (Z =:= $() or (Z =:= $))) ->
+ otp_7198_scan(<<Z, Rest/binary>>, ['AND' | TokAcc]);
+
+otp_7198_scan(<<D>>, TokAcc) when
+ (D =:= $D) or (D =:= $d) ->
+ otp_7198_scan(<<>>, ['AND' | TokAcc]);
+
+otp_7198_scan(<<N, Z, Rest/binary>>, TokAcc) when
+ (N =:= $N orelse N =:= $n) and
+ ((Z =:= $\s) or (Z =:= $() or (Z =:= $))) ->
+ otp_7198_scan(<<Z, Rest/binary>>, ['NOT' | TokAcc]);
+
+otp_7198_scan(<<C, Rest/binary>>, TokAcc) when
+ (C >= $A) and (C =< $Z);
+ (C >= $a) and (C =< $z);
+ (C >= $0) and (C =< $9) ->
+ case Rest of
+ <<$:, R/binary>> ->
+ otp_7198_scan(R, [{'FIELD', C} | TokAcc]);
+ _ ->
+ otp_7198_scan(Rest, [{'KEYWORD', C} | TokAcc])
+ end.
+
+unordered_bindings(Config) when is_list(Config) ->
+ {<<1,2,3,4>>,<<42,42>>,<<3,3,3>>} =
+ unordered_bindings(4, 2, 3, <<1,2,3,4, 42,42, 3,3,3, 3>>),
+ ok.
+
+unordered_bindings(CompressedLength, HashSize, PadLength, T) ->
+ <<Content:CompressedLength/binary,Mac:HashSize/binary,
+ Padding:PadLength/binary,PadLength>> = T,
+ {Content,Mac,Padding}.
+
+
+id(I) -> I.
diff --git a/lib/debugger/test/bs_match_tail_SUITE.erl b/lib/debugger/test/bs_match_tail_SUITE.erl
index 961ccbb599..9f7519cf3a 100644
--- a/lib/debugger/test/bs_match_tail_SUITE.erl
+++ b/lib/debugger/test/bs_match_tail_SUITE.erl
@@ -64,7 +64,7 @@ end_per_suite(Config) when is_list(Config) ->
ok.
aligned(doc) -> "Test aligned tails.";
-aligned(Config) when list(Config) ->
+aligned(Config) when is_list(Config) ->
?line Tail1 = mkbin([]),
?line {258,Tail1} = al_get_tail_used(mkbin([1,2])),
?line Tail2 = mkbin(lists:seq(1, 127)),
@@ -84,10 +84,10 @@ aligned(Config) when list(Config) ->
ok.
al_get_tail_used(<<A:16,T/binary>>) -> {A,T}.
-al_get_tail_unused(<<A:16,_T/binary>>) -> A.
+al_get_tail_unused(<<A:16,_/binary>>) -> A.
unaligned(doc) -> "Test that an non-aligned tail cannot be matched out.";
-unaligned(Config) when list(Config) ->
+unaligned(Config) when is_list(Config) ->
?line {'EXIT',{function_clause,_}} = (catch get_tail_used(mkbin([42]))),
?line {'EXIT',{{badmatch,_},_}} = (catch get_dyn_tail_used(mkbin([137]), 3)),
?line {'EXIT',{function_clause,_}} = (catch get_tail_unused(mkbin([42,33]))),
@@ -103,11 +103,11 @@ get_dyn_tail_used(Bin, Sz) ->
{A,T}.
get_dyn_tail_unused(Bin, Sz) ->
- <<A:Sz,_T/binary>> = Bin,
+ <<A:Sz,_/binary>> = Bin,
A.
zero_tail(doc) -> "Test that zero tails are tested correctly.";
-zero_tail(Config) when list(Config) ->
+zero_tail(Config) when is_list(Config) ->
?line 7 = (catch test_zero_tail(mkbin([7]))),
?line {'EXIT',{function_clause,_}} = (catch test_zero_tail(mkbin([1,2]))),
?line {'EXIT',{function_clause,_}} = (catch test_zero_tail2(mkbin([1,2,3]))),
@@ -117,4 +117,4 @@ test_zero_tail(<<A:8>>) -> A.
test_zero_tail2(<<_A:4,_B:4>>) -> ok.
-mkbin(L) when list(L) -> list_to_binary(L).
+mkbin(L) when is_list(L) -> list_to_binary(L).
diff --git a/lib/debugger/test/bug_SUITE.erl b/lib/debugger/test/bug_SUITE.erl
index a831897dfb..1a7e876329 100644
--- a/lib/debugger/test/bug_SUITE.erl
+++ b/lib/debugger/test/bug_SUITE.erl
@@ -51,7 +51,7 @@ end_per_group(_GroupName, Config) ->
otp2163(doc) -> ["BIF exit reason"];
otp2163(suite) -> [];
-otp2163(Config) when list(Config) ->
+otp2163(Config) when is_list(Config) ->
?line DataDir = ?config(data_dir, Config),
%% First compile and get the expected results:
@@ -74,7 +74,7 @@ otp2163(Config) when list(Config) ->
otp4845(doc) -> ["BIF not loading and not bug compatible, OTP-4845 OTP-4859"];
otp4845(suite) -> [];
-otp4845(Config) when list(Config) ->
+otp4845(Config) when is_list(Config) ->
?line DataDir = ?config(data_dir, Config),
%% First compile and get the expected results:
diff --git a/lib/debugger/test/exception_SUITE.erl b/lib/debugger/test/exception_SUITE.erl
index 8c864e4b5f..86554ab2d4 100644
--- a/lib/debugger/test/exception_SUITE.erl
+++ b/lib/debugger/test/exception_SUITE.erl
@@ -23,7 +23,8 @@
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- badmatch/1,pending_errors/1,nil_arith/1]).
+ badmatch/1,pending_errors/1,nil_arith/1,
+ stacktrace/1,nested_stacktrace/1,raise/1,gunilla/1,per/1]).
-export([bad_guy/2]).
@@ -31,6 +32,19 @@
suite() -> [{ct_hooks,[ts_install_cth]}].
+%% Filler.
+%%
+%%
+%%
+%%
+%% This is line 40.
+even(N) when is_integer(N), N > 1, (N rem 2) == 0 ->
+ odd(N-1)++[N].
+
+odd(N) when is_integer(N), N > 1, (N rem 2) == 1 ->
+ even(N-1)++[N].
+
+
all() ->
cases().
@@ -45,7 +59,8 @@ end_per_group(_GroupName, Config) ->
cases() ->
- [badmatch, pending_errors, nil_arith].
+ [badmatch, pending_errors, nil_arith, stacktrace,
+ nested_stacktrace, raise, gunilla, per].
-define(try_match(E),
catch ?MODULE:bar(),
@@ -69,9 +84,9 @@ init_per_suite(Config) when is_list(Config) ->
end_per_suite(Config) when is_list(Config) ->
ok.
-badmatch(doc) -> "Test that deliberately bad matches are reported correctly.";
-badmatch(suite) -> [];
-badmatch(Config) when list(Config) ->
+%% Test that deliberately bad matches are reported correctly.
+
+badmatch(Config) when is_list(Config) ->
?line ?try_match(a),
?line ?try_match(42),
?line ?try_match({a, b, c}),
@@ -79,11 +94,9 @@ badmatch(Config) when list(Config) ->
?line ?try_match(1.0),
ok.
-pending_errors(doc) ->
- ["Test various exceptions, in the presence of a previous error suppressed ",
- "in a guard."];
-pending_errors(suite) -> [];
-pending_errors(Config) when list(Config) ->
+%% Test various exceptions, in the presence of a previous error suppressed
+%% in a guard.
+pending_errors(Config) when is_list(Config) ->
?line pending(e_badmatch, {badmatch, b}),
?line pending(x, function_clause),
?line pending(e_case, {case_clause, xxx}),
@@ -100,7 +113,7 @@ bad_guy(pe_badarith, Other) when Other+1 == 0 -> % badarith (suppressed)
bad_guy(pe_badarg, Other) when length(Other) > 0 -> % badarg (suppressed)
ok;
bad_guy(_, e_case) ->
- case xxx of
+ case id(xxx) of
ok -> ok
end; % case_clause
bad_guy(_, e_if) ->
@@ -121,7 +134,7 @@ bad_guy(_, e_badarg) ->
bad_guy(_, e_badarg_spawn) ->
spawn({}, {}, {}); % badarg
bad_guy(_, e_badmatch) ->
- a = b. % badmatch
+ a = id(b). % badmatch
pending(Arg, Expected) ->
pending(pe_badarith, Arg, Expected),
@@ -155,28 +168,23 @@ pending_exit_message(Args, Expected) ->
end,
process_flag(trap_exit, false).
-pending({badarg,[{erlang,Bif,BifArgs},{?MODULE,Func,Arity}|_]}, Func, Args, _Code)
- when atom(Bif), list(BifArgs), length(Args) == Arity -> %Threaded code.
- ok;
-pending({badarg,[{erlang,Bif,BifArgs},{?MODULE,Func,Args}|_]}, Func, Args, _Code)
- when atom(Bif), list(BifArgs) -> %From interpreted code.
+pending({badarg, [{erlang,Bif,BifArgs,_},{?MODULE,Func,Arity,_}|_]},
+ Func, Args, _Code)
+ when is_atom(Bif), is_list(BifArgs), length(Args) == Arity ->
ok;
-pending({undef,[{non_existing_module,foo,[]}|_]}, _, _, _) ->
+pending({undef,[{non_existing_module,foo,[],_}|_]}, _, _, _) ->
ok;
-pending({function_clause,[{?MODULE,Func,Args}|_]}, Func, Args, _Code) ->
+pending({function_clause,[{?MODULE,Func,Args,_}|_]}, Func, Args, _Code) ->
ok;
-pending({Code,[{?MODULE,Func,Arity}|_]}, Func, Args, Code) when length(Args) == Arity -> %Threaded code
+pending({Code,[{?MODULE,Func,Arity,_}|_]}, Func, Args, Code)
+ when length(Args) == Arity ->
ok;
-pending({Code,[{?MODULE,Func,Args}|_]}, Func, Args, Code) -> %From interpreted code.
- ok;
-pending(Reason, Func, Args, Code) ->
- test_server:fail({bad_exit_reason,Reason,{Func,Args,Code}}).
-
-nil_arith(doc) ->
- "Test that doing arithmetics on [] gives a badarith EXIT and not a crash.";
-nil_arith(suite) ->
- [];
-nil_arith(Config) when list(Config) ->
+pending(Reason, _Function, _Args, _Code) ->
+ test_server:fail({bad_exit_reason,Reason}).
+
+%% Test that doing arithmetics on [] gives a badarith EXIT and not a crash.
+
+nil_arith(Config) when is_list(Config) ->
?line ba_plus_minus_times([], []),
?line ba_plus_minus_times([], 0),
@@ -268,3 +276,199 @@ ba_shift(A, B) ->
ba_bnot(A) ->
io:format("bnot ~p", [A]),
{'EXIT', {badarith, _}} = (catch bnot A).
+
+stacktrace(Conf) when is_list(Conf) ->
+ Tag = make_ref(),
+ ?line {_,Mref} = spawn_monitor(fun() -> exit({Tag,erlang:get_stacktrace()}) end),
+ ?line {Tag,[]} = receive {'DOWN',Mref,_,_,Info} -> Info end,
+ V = [make_ref()|self()],
+ ?line {value2,{caught1,badarg,[{erlang,abs,[V],_}|_]=St1}} =
+ stacktrace_1({'abs',V}, error, {value,V}),
+ ?line St1 = erase(stacktrace1),
+ ?line St1 = erase(stacktrace2),
+ ?line St1 = erlang:get_stacktrace(),
+ ?line {caught2,{error,badarith},[{?MODULE,my_add,2,_}|_]=St2} =
+ stacktrace_1({'div',{1,0}}, error, {'add',{0,a}}),
+ ?line [{?MODULE,my_div,2,_}|_] = erase(stacktrace1),
+ ?line St2 = erase(stacktrace2),
+ ?line St2 = erlang:get_stacktrace(),
+ ?line {caught2,{error,{try_clause,V}},[{?MODULE,stacktrace_1,3,_}|_]=St3} =
+ stacktrace_1({value,V}, error, {value,V}),
+ ?line St3 = erase(stacktrace1),
+ ?line St3 = erase(stacktrace2),
+ ?line St3 = erlang:get_stacktrace(),
+ ?line {caught2,{throw,V},[{?MODULE,foo,1,_}|_]=St4} =
+ stacktrace_1({value,V}, error, {throw,V}),
+ ?line [{?MODULE,stacktrace_1,3,_}|_] = erase(stacktrace1),
+ ?line St4 = erase(stacktrace2),
+ ?line St4 = erlang:get_stacktrace(),
+ ok.
+
+stacktrace_1(X, C1, Y) ->
+ erase(stacktrace1),
+ erase(stacktrace2),
+ try try foo(X) of
+ C1 -> value1
+ catch
+ C1:D1 -> {caught1,D1,erlang:get_stacktrace()}
+ after
+ put(stacktrace1, erlang:get_stacktrace()),
+ foo(Y)
+ end of
+ V2 -> {value2,V2}
+ catch
+ C2:D2 -> {caught2,{C2,D2},erlang:get_stacktrace()}
+ after
+ put(stacktrace2, erlang:get_stacktrace())
+ end.
+
+
+
+nested_stacktrace(Conf) when is_list(Conf) ->
+ V = [{make_ref()}|[self()]],
+ ?line value1 =
+ nested_stacktrace_1({{value,{V,x1}},void,{V,x1}},
+ {void,void,void}),
+ ?line {caught1,
+ [{?MODULE,my_add,2,_}|_],
+ value2,
+ [{?MODULE,my_add,2,_}|_]} =
+ nested_stacktrace_1({{'add',{V,x1}},error,badarith},
+ {{value,{V,x2}},void,{V,x2}}),
+ ?line {caught1,
+ [{?MODULE,my_add,2,_}|_],
+ {caught2,[{erlang,abs,[V],_}|_]},
+ [{erlang,abs,[V],_}|_]} =
+ nested_stacktrace_1({{'add',{V,x1}},error,badarith},
+ {{'abs',V},error,badarg}),
+ ok.
+
+nested_stacktrace_1({X1,C1,V1}, {X2,C2,V2}) ->
+ try foo(X1) of
+ V1 -> value1
+ catch
+ C1:V1 ->
+ S1 = erlang:get_stacktrace(),
+ T2 =
+ try foo(X2) of
+ V2 -> value2
+ catch
+ C2:V2 -> {caught2,erlang:get_stacktrace()}
+ end,
+ {caught1,S1,T2,erlang:get_stacktrace()}
+ end.
+
+
+
+raise(Conf) when is_list(Conf) ->
+ ?line erase(raise),
+ ?line A =
+ try
+ ?line try foo({'div',{1,0}})
+ catch
+ error:badarith ->
+ put(raise, A0 = erlang:get_stacktrace()),
+ ?line erlang:raise(error, badarith, A0)
+ end
+ catch
+ error:badarith ->
+ ?line A1 = erlang:get_stacktrace(),
+ ?line A1 = get(raise)
+ end,
+ ?line A = erlang:get_stacktrace(),
+ ?line A = get(raise),
+ ?line [{?MODULE,my_div,2,_}|_] = A,
+ %%
+ N = 8, % Must be even
+ ?line N = erlang:system_flag(backtrace_depth, N),
+ ?line try even(N)
+ catch error:function_clause -> ok
+ end,
+ ?line B = odd_even(N, []),
+ ?line B = erlang:get_stacktrace(),
+ %%
+ ?line C0 = odd_even(N+1, []),
+ ?line C = lists:sublist(C0, N),
+ ?line try odd(N+1)
+ catch error:function_clause -> ok
+ end,
+ ?line C = erlang:get_stacktrace(),
+ ?line try erlang:raise(error, function_clause, C0)
+ catch error:function_clause -> ok
+ end,
+ ?line C = erlang:get_stacktrace(),
+ ok.
+
+odd_even(N, R) when is_integer(N), N > 1 ->
+ odd_even(N-1,
+ [if (N rem 2) == 0 ->
+ {?MODULE,even,1,[{file,?MODULE_STRING++".erl"},
+ {line,42}]};
+ true ->
+ {?MODULE,odd,1,[{file,?MODULE_STRING++".erl"},
+ {line,45}]}
+ end|R]);
+odd_even(1, R) ->
+ [{?MODULE,odd,[1],[{file,?MODULE_STRING++".erl"},
+ {line,44}]}|R].
+
+foo({value,Value}) -> Value;
+foo({'div',{A,B}}) ->
+ my_div(A, B);
+foo({'add',{A,B}}) ->
+ my_add(A, B);
+foo({'abs',X}) ->
+ my_abs(X);
+foo({error,Error}) ->
+ erlang:error(Error);
+foo({throw,Throw}) ->
+ erlang:throw(Throw);
+foo({exit,Exit}) ->
+ erlang:exit(Exit);
+foo({raise,{Class,Reason,Stacktrace}}) ->
+ erlang:raise(Class, Reason, Stacktrace).
+%%foo(function_clause) -> % must not be defined!
+
+my_div(A, B) ->
+ A div B.
+
+my_add(A, B) ->
+ A + B.
+
+my_abs(X) -> abs(X).
+
+gunilla(Config) when is_list(Config) ->
+ ?line {throw,kalle} = gunilla_1(),
+ ?line [] = erlang:get_stacktrace(),
+ ok.
+
+gunilla_1() ->
+ try try arne()
+ after
+ pelle
+ end
+ catch
+ C:R ->
+ {C,R}
+ end.
+
+arne() ->
+ %% Empty stack trace used to cause change the error class to 'error'.
+ erlang:raise(throw, kalle, []).
+
+per(Config) when is_list(Config) ->
+ try
+ t1(0,pad,0),
+ t2(0,pad,0)
+ catch
+ error:badarith ->
+ ok
+ end.
+
+t1(_,X,_) ->
+ (1 bsl X) + 1.
+
+t2(_,X,_) ->
+ (X bsl 1) + 1.
+
+id(I) -> I.
diff --git a/lib/debugger/test/guard_SUITE.erl b/lib/debugger/test/guard_SUITE.erl
index 611dcb4dff..bf5fa82749 100644
--- a/lib/debugger/test/guard_SUITE.erl
+++ b/lib/debugger/test/guard_SUITE.erl
@@ -35,7 +35,8 @@
t_is_boolean/1,is_function_2/1,
tricky/1,rel_ops/1,
basic_andalso_orelse/1,traverse_dcd/1,
- check_qlc_hrl/1]).
+ check_qlc_hrl/1,andalso_semi/1,t_tuple_size/1,binary_part/1,
+ bad_constants/1]).
-include_lib("test_server/include/test_server.hrl").
@@ -65,7 +66,8 @@ cases() ->
xor_guard, more_xor_guards, build_in_guard,
old_guard_tests, gbif, t_is_boolean, is_function_2,
tricky, rel_ops, basic_andalso_orelse, traverse_dcd,
- check_qlc_hrl].
+ check_qlc_hrl, andalso_semi, t_tuple_size, binary_part,
+ bad_constants].
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
@@ -294,9 +296,7 @@ try_gbif(Id, X, Y) ->
try_fail_gbif(Id, X, Y) ->
case catch guard_bif(Id, X, Y) of
- {'EXIT', {function_clause,{?MODULE,guard_bif,[Id,X,Y]}}} -> %Jam
- io:format("guard_bif(~p, ~p, ~p) -- ok", [Id,X,Y]);
- {'EXIT', {function_clause,[{?MODULE,guard_bif,[Id,X,Y]}|_]}} -> %Beam
+ {'EXIT', {function_clause,[{?MODULE,guard_bif,[Id,X,Y],_}|_]}} ->
io:format("guard_bif(~p, ~p, ~p) -- ok", [Id,X,Y]);
Other ->
?line ok = io:format("guard_bif(~p, ~p, ~p) -- bad result: ~p\n",
@@ -367,9 +367,8 @@ type_tests(Test, [Type|T], Allowed) ->
end;
false ->
case catch type_test(Test, Value) of
- {'EXIT', {function_clause, {?MODULE, type_test, [Test, Value]}}} ->
- ok;
- {'EXIT', {function_clause,[{?MODULE,type_test,[Test,Value]}|_]}} ->
+ {'EXIT',{function_clause,
+ [{?MODULE,type_test,[Test,Value],_}|_]}} ->
ok;
{'EXIT',Other} ->
?line test_server:fail({unexpected_error_reason,Other});
@@ -1477,7 +1476,207 @@ cqlc(M, F, As, St) ->
St
end.
+%% OTP-7679: Thanks to Hunter Morris.
+andalso_semi(Config) when is_list(Config) ->
+ ?line ok = andalso_semi_foo(0),
+ ?line ok = andalso_semi_foo(1),
+ ?line fc(catch andalso_semi_foo(2)),
+
+ ?line ok = andalso_semi_bar([a,b,c]),
+ ?line ok = andalso_semi_bar(1),
+ ?line fc(catch andalso_semi_bar([a,b])),
+ ok.
+
+andalso_semi_foo(Bar) when is_integer(Bar) andalso Bar =:= 0; Bar =:= 1 ->
+ ok.
+
+andalso_semi_bar(Bar) when is_list(Bar) andalso length(Bar) =:= 3; Bar =:= 1 ->
+ ok.
+
+
+t_tuple_size(Config) when is_list(Config) ->
+ ?line 10 = do_tuple_size({1,2,3,4}),
+ ?line fc(catch do_tuple_size({1,2,3})),
+ ?line fc(catch do_tuple_size(42)),
+ ?line error = ludicrous_tuple_size({a,b,c}),
+ ?line error = ludicrous_tuple_size([a,b,c]),
+
+ ok.
+
+do_tuple_size(T) when tuple_size(T) =:= 4 ->
+ {A,B,C,D} = T,
+ A+B+C+D.
+
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= 16#7777777777777777777777777777777777 -> ok;
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= 16#10000000000000000 -> ok;
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= (1 bsl 64) - 1 -> ok;
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= 16#FFFFFFFFFFFFFFFF -> ok;
+ludicrous_tuple_size(_) -> error.
+
+%%
+%% The binary_part/2,3 guard BIFs
+%%
+-define(MASK_ERROR(EXPR),mask_error((catch (EXPR)))).
+mask_error({'EXIT',{Err,_}}) ->
+ Err;
+mask_error(Else) ->
+ Else.
+
+binary_part(doc) ->
+ ["Tests the binary_part/2,3 guard (GC) bif's"];
+binary_part(Config) when is_list(Config) ->
+ %% This is more or less a copy of what the guard_SUITE in emulator
+ %% does to cover the guard bif's
+ ?line 1 = bptest(<<1,2,3>>),
+ ?line 2 = bptest(<<2,1,3>>),
+ ?line error = bptest(<<1>>),
+ ?line error = bptest(<<>>),
+ ?line error = bptest(apa),
+ ?line 3 = bptest(<<2,3,3>>),
+ % With one variable (pos)
+ ?line 1 = bptest(<<1,2,3>>,1),
+ ?line 2 = bptest(<<2,1,3>>,1),
+ ?line error = bptest(<<1>>,1),
+ ?line error = bptest(<<>>,1),
+ ?line error = bptest(apa,1),
+ ?line 3 = bptest(<<2,3,3>>,1),
+ % With one variable (length)
+ ?line 1 = bptesty(<<1,2,3>>,1),
+ ?line 2 = bptesty(<<2,1,3>>,1),
+ ?line error = bptesty(<<1>>,1),
+ ?line error = bptesty(<<>>,1),
+ ?line error = bptesty(apa,1),
+ ?line 3 = bptesty(<<2,3,3>>,2),
+ % With one variable (whole tuple)
+ ?line 1 = bptestx(<<1,2,3>>,{1,1}),
+ ?line 2 = bptestx(<<2,1,3>>,{1,1}),
+ ?line error = bptestx(<<1>>,{1,1}),
+ ?line error = bptestx(<<>>,{1,1}),
+ ?line error = bptestx(apa,{1,1}),
+ ?line 3 = bptestx(<<2,3,3>>,{1,2}),
+ % With two variables
+ ?line 1 = bptest(<<1,2,3>>,1,1),
+ ?line 2 = bptest(<<2,1,3>>,1,1),
+ ?line error = bptest(<<1>>,1,1),
+ ?line error = bptest(<<>>,1,1),
+ ?line error = bptest(apa,1,1),
+ ?line 3 = bptest(<<2,3,3>>,1,2),
+ % Direct (autoimported) call, these will be evaluated by the compiler...
+ ?line <<2>> = binary_part(<<1,2,3>>,1,1),
+ ?line <<1>> = binary_part(<<2,1,3>>,1,1),
+ % Compiler warnings due to constant evaluation expected (3)
+ ?line badarg = ?MASK_ERROR(binary_part(<<1>>,1,1)),
+ ?line badarg = ?MASK_ERROR(binary_part(<<>>,1,1)),
+ ?line badarg = ?MASK_ERROR(binary_part(apa,1,1)),
+ ?line <<3,3>> = binary_part(<<2,3,3>>,1,2),
+ % Direct call through apply
+ ?line <<2>> = apply(erlang,binary_part,[<<1,2,3>>,1,1]),
+ ?line <<1>> = apply(erlang,binary_part,[<<2,1,3>>,1,1]),
+ % Compiler warnings due to constant evaluation expected (3)
+ ?line badarg = ?MASK_ERROR(apply(erlang,binary_part,[<<1>>,1,1])),
+ ?line badarg = ?MASK_ERROR(apply(erlang,binary_part,[<<>>,1,1])),
+ ?line badarg = ?MASK_ERROR(apply(erlang,binary_part,[apa,1,1])),
+ ?line <<3,3>> = apply(erlang,binary_part,[<<2,3,3>>,1,2]),
+ % Constant propagation
+ ?line Bin = <<1,2,3>>,
+ ?line ok = if
+ binary_part(Bin,1,1) =:= <<2>> ->
+ ok;
+ %% Compiler warning, clause cannot match (expected)
+ true ->
+ error
+ end,
+ ?line ok = if
+ binary_part(Bin,{1,1}) =:= <<2>> ->
+ ok;
+ %% Compiler warning, clause cannot match (expected)
+ true ->
+ error
+ end,
+ ok.
+
+
+bptest(B) when length(B) =:= 1337 ->
+ 1;
+bptest(B) when binary_part(B,{1,1}) =:= <<2>> ->
+ 1;
+bptest(B) when erlang:binary_part(B,1,1) =:= <<1>> ->
+ 2;
+bptest(B) when erlang:binary_part(B,{1,2}) =:= <<3,3>> ->
+ 3;
+bptest(_) ->
+ error.
+
+bptest(B,A) when length(B) =:= A ->
+ 1;
+bptest(B,A) when binary_part(B,{A,1}) =:= <<2>> ->
+ 1;
+bptest(B,A) when erlang:binary_part(B,A,1) =:= <<1>> ->
+ 2;
+bptest(B,A) when erlang:binary_part(B,{A,2}) =:= <<3,3>> ->
+ 3;
+bptest(_,_) ->
+ error.
+
+bptestx(B,A) when length(B) =:= A ->
+ 1;
+bptestx(B,A) when binary_part(B,A) =:= <<2>> ->
+ 1;
+bptestx(B,A) when erlang:binary_part(B,A) =:= <<1>> ->
+ 2;
+bptestx(B,A) when erlang:binary_part(B,A) =:= <<3,3>> ->
+ 3;
+bptestx(_,_) ->
+ error.
+
+bptesty(B,A) when length(B) =:= A ->
+ 1;
+bptesty(B,A) when binary_part(B,{1,A}) =:= <<2>> ->
+ 1;
+bptesty(B,A) when erlang:binary_part(B,1,A) =:= <<1>> ->
+ 2;
+bptesty(B,A) when erlang:binary_part(B,{1,A}) =:= <<3,3>> ->
+ 3;
+bptesty(_,_) ->
+ error.
+
+bptest(B,A,_C) when length(B) =:= A ->
+ 1;
+bptest(B,A,C) when binary_part(B,{A,C}) =:= <<2>> ->
+ 1;
+bptest(B,A,C) when erlang:binary_part(B,A,C) =:= <<1>> ->
+ 2;
+bptest(B,A,C) when erlang:binary_part(B,{A,C}) =:= <<3,3>> ->
+ 3;
+bptest(_,_,_) ->
+ error.
+
+-define(FAILING(C),
+ if
+ C -> ?t:fail(should_fail);
+ true -> ok
+ end,
+ if
+ true, C -> ?t:fail(should_fail);
+ true -> ok
+ end).
+
+bad_constants(Config) when is_list(Config) ->
+ ?line ?FAILING(false),
+ ?line ?FAILING([]),
+ ?line ?FAILING([a]),
+ ?line ?FAILING([Config]),
+ ?line ?FAILING({a,b}),
+ ?line ?FAILING({a,Config}),
+ ?line ?FAILING(<<1>>),
+ ?line ?FAILING(42),
+ ?line ?FAILING(3.14),
+ ok.
%% Call this function to turn off constant propagation.
id(I) -> I.
@@ -1490,3 +1689,5 @@ check(F, Result) ->
io:format(" Got: ~p\n", [Other]),
test_server:fail()
end.
+
+fc({'EXIT',{function_clause,_}}) -> ok.
diff --git a/lib/debugger/test/int_eval_SUITE.erl b/lib/debugger/test/int_eval_SUITE.erl
index f36ed213d1..4ffcf7888e 100644
--- a/lib/debugger/test/int_eval_SUITE.erl
+++ b/lib/debugger/test/int_eval_SUITE.erl
@@ -28,7 +28,7 @@
bifs_outside_erlang/1, spawning/1, applying/1,
catch_and_throw/1, external_call/1, test_module_info/1,
apply_interpreted_fun/1, apply_uninterpreted_fun/1,
- interpreted_exit/1, otp_8310/1]).
+ interpreted_exit/1, otp_8310/1, stacktrace/1]).
%% Helpers.
-export([applier/3]).
@@ -44,7 +44,7 @@ all() ->
[bifs_outside_erlang, spawning, applying,
catch_and_throw, external_call, test_module_info,
apply_interpreted_fun, apply_uninterpreted_fun,
- interpreted_exit, otp_8310].
+ interpreted_exit, otp_8310, stacktrace].
groups() ->
[].
@@ -191,23 +191,23 @@ apply_interpreted_fun(Config) when is_list(Config) ->
?line {ok,ATerm} = spawn_eval(fun() -> F2() end),
%% Called from uninterpreted code, badarity
- ?line {'EXIT',{{badarity,{F1,[snape]}},[{?MODULE,_,_}|_]}} =
+ ?line {'EXIT',{{badarity,{F1,[snape]}},[{?MODULE,_,_,_}|_]}} =
spawn_eval(fun() -> F1(snape) end),
%% Called from uninterpreted code, error in fun
?line F3 = spawn_eval(fun() -> ?IM:give_me_a_bad_fun() end),
- ?line {'EXIT',{snape,[{?IM,_FunName,_}|_]}} =
+ ?line {'EXIT',{snape,[{?IM,_FunName,_,_}|_]}} =
spawn_eval(fun() -> F3(snape) end),
%% Called from within interpreted code
?line perfectly_alright = spawn_eval(fun() -> ?IM:do_apply(F1) end),
%% Called from within interpreted code, badarity
- ?line {'EXIT',{{badarity,{F1,[snape]}},[{?IM,do_apply,_}|_]}} =
+ ?line {'EXIT',{{badarity,{F1,[snape]}},[{?IM,do_apply,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F1, snape) end),
%% Called from within interpreted code, error in fun
- ?line {'EXIT',{snape,[{?IM,_FunName,_}|_]}} =
+ ?line {'EXIT',{snape,[{?IM,_FunName,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F3, snape) end),
%% Try some more complex funs.
@@ -239,11 +239,11 @@ apply_uninterpreted_fun(Config) when is_list(Config) ->
spawn_eval(fun() -> ?IM:do_apply(F1, any_arg) end),
%% Badarity (evaluated in dbg_debugged, which calls erlang:apply/2)
- ?line {'EXIT',{{badarity,{F1,[]}},[{erlang,apply,_}|_]}} =
+ ?line {'EXIT',{{badarity,{F1,[]}},[{erlang,apply,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F1) end),
%% Error in fun
- ?line {'EXIT',{snape,[{?MODULE,_FunName,_}|_]}} =
+ ?line {'EXIT',{snape,[{?MODULE,_FunName,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F1, snape) end),
ok.
@@ -277,6 +277,37 @@ applier(M, F, A) ->
io:format("~p:~p(~p) => ~p\n", [M,F,A,Res]),
Res.
+stacktrace(Config) when is_list(Config) ->
+ ?line {done,Stk} = do_eval(Config, stacktrace),
+ ?line 13 = length(Stk),
+ ?line OldStackTraceFlag = int:stack_trace(),
+ ?line int:stack_trace(no_tail),
+ try
+ ?line Res = spawn_eval(fun() -> stacktrace:stacktrace() end),
+ ?line io:format("\nInterpreted (no_tail):\n~p", [Res]),
+ ?line {done,Stk} = Res
+ after
+ ?line int:stack_trace(OldStackTraceFlag)
+ end,
+ ok.
+
+
+do_eval(Config, Mod) ->
+ ?line DataDir = ?config(data_dir, Config),
+ ?line ok = file:set_cwd(DataDir),
+
+ ?line {ok,Mod} = compile:file(Mod, [report,debug_info]),
+ ?line {module,Mod} = code:load_file(Mod),
+ ?line CompiledRes = Mod:Mod(),
+ ?line ok = io:format("Compiled:\n~p", [CompiledRes]),
+ io:nl(),
+
+ ?line {module,Mod} = int:i(Mod),
+ ?line IntRes = Mod:Mod(),
+ ?line ok = io:format("Interpreted:\n~p", [IntRes]),
+
+ ?line CompiledRes = IntRes.
+
%%
%% Evaluate in another process, to prevent the test_case process to become
%% interpreted.
diff --git a/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl b/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl
index 997ee6e17d..90f83e80e8 100644
--- a/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl
+++ b/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl
@@ -117,7 +117,7 @@ more_nocatch(Fun) ->
%% External calls.
external_call_test(Data) ->
- {'EXIT',{undef,[{?MODULE,not_exported,[42,Data]}|_]}} =
+ {'EXIT',{undef,[{?MODULE,not_exported,[42,Data],_}|_]}} =
(catch ?MODULE:not_exported(42, Data)),
{yes,Data} = i_am_exported(Data),
{yes,Data} = ?MODULE:i_am_exported(Data),
@@ -127,7 +127,7 @@ external_call_test(Data) ->
{ok,Data,[a,b]} = not_exported(Data, [a,b]),
{yes,Data} = i_am_exported(Data),
{ok,Data,[a,b]} = not_exported(Data, [a,b]),
- {'EXIT',{undef,[{?MODULE,not_exported,[7,Data]}|_]}} =
+ {'EXIT',{undef,[{?MODULE,not_exported,[7,Data],_}|_]}} =
(catch ?MODULE:not_exported(7, Data)),
{yes,Data} = ?MODULE:i_am_exported(Data),
ok.
diff --git a/lib/debugger/test/int_eval_SUITE_data/stacktrace.erl b/lib/debugger/test/int_eval_SUITE_data/stacktrace.erl
new file mode 100644
index 0000000000..3380178fdc
--- /dev/null
+++ b/lib/debugger/test/int_eval_SUITE_data/stacktrace.erl
@@ -0,0 +1,130 @@
+-module(stacktrace).
+-export([?MODULE/0]).
+
+?MODULE() ->
+ OldDepth = erlang:system_flag(backtrace_depth, 32),
+ done = (catch do_try()),
+ Stk = trim(erlang:get_stacktrace()),
+ erlang:system_flag(backtrace_depth, OldDepth),
+ {done,Stk}.
+
+trim([{int_eval_SUITE,_,_,_}|_]) ->
+ [];
+trim([H|T]) ->
+ [H|trim(T)];
+trim([]) -> [].
+
+do_try() ->
+ try
+ 0 = id(42)
+ catch
+ error:{badmatch,42} ->
+ do_try2() %Tail-recursive
+ end.
+
+do_try2() ->
+ try
+ 0 = id(42)
+ catch
+ error:{badmatch,42} ->
+ do_try3() %Not tail-recursive
+ end,
+ ?LINE.
+
+do_try3() ->
+ try id(42) of
+ 42 -> do_try4() %Tail-recursive
+ catch
+ error:ignore -> %Should never catch
+ ?LINE
+ end.
+
+do_try4() ->
+ try
+ do_recv() %Not tail-recursive
+ catch
+ error:ignore -> %Should never catch
+ ?LINE
+ end.
+
+do_recv() ->
+ self() ! x,
+ receive
+ x -> do_recv2() %Not tail-recursive
+ end,
+ ?LINE.
+
+do_recv2() ->
+ self() ! y,
+ receive
+ y -> do_recv3() %Tail-recursive
+ end.
+
+do_recv3() ->
+ receive
+ after 0 -> do_recv4() %Tail-recursive
+ end.
+
+do_recv4() ->
+ receive
+ after 0 -> do_if(true) %Not tail-recursive
+ end,
+ ?LINE.
+
+do_if(Bool) ->
+ if
+ Bool -> do_if2(Bool) %Tail-recursive
+ end.
+
+do_if2(Bool) ->
+ if
+ Bool -> do_case(Bool) %Not tail-recursive
+ end,
+ ?LINE.
+
+
+do_case(Bool) ->
+ case Bool of
+ true -> do_case2(Bool) %Tail-recursive
+ end.
+
+do_case2(Bool) ->
+ case Bool of
+ true -> do_fun(Bool) %Not tail-recursive
+ end,
+ ?LINE.
+
+do_fun(Bool) ->
+ F = fun(true) ->
+ do_fun2(Bool) %Tail-recursive
+ end,
+ F(Bool). %Tail-recursive
+
+do_fun2(Bool) ->
+ F = fun(true) ->
+ cons(Bool) %Tail-recursive
+ end,
+ F(Bool), %Not tail-recursive
+ ?LINE.
+
+cons(Bool) ->
+ [Bool|tuple()].
+
+tuple() ->
+ {ok,op()}.
+
+op() ->
+ 1 + lc().
+
+lc() ->
+ [done() || true].
+
+done() ->
+ tail(100),
+ throw(done).
+
+tail(0) -> ok;
+tail(N) -> tail(N-1).
+
+id(I) ->
+ I.
diff --git a/lib/debugger/test/lc_SUITE.erl b/lib/debugger/test/lc_SUITE.erl
index 92a03ef58e..2f05eb7fca 100644
--- a/lib/debugger/test/lc_SUITE.erl
+++ b/lib/debugger/test/lc_SUITE.erl
@@ -17,21 +17,22 @@
%% %CopyrightEnd%
%%
-%%
-module(lc_SUITE).
--author('[email protected]').
+%% Copied from lc_SUITE in the compiler application.
+
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- basic/1]).
+ basic/1,deeply_nested/1,no_generator/1,
+ empty_generator/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [basic, deeply_nested, no_generator, empty_generator].
groups() ->
[].
@@ -42,10 +43,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [basic].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(1)),
@@ -64,7 +61,7 @@ init_per_suite(Config) when is_list(Config) ->
end_per_suite(Config) when is_list(Config) ->
ok.
-basic(Config) when list(Config) ->
+basic(Config) when is_list(Config) ->
?line L0 = lists:seq(1, 10),
?line L1 = my_map(fun(X) -> {x,X} end, L0),
?line L1 = [{x,X} || X <- L0],
@@ -73,16 +70,116 @@ basic(Config) when list(Config) ->
?line [4,5,6] = [X || X <- L0, X > 3, X < 7],
?line [] = [X || X <- L0, X > 32, X < 7],
?line [1,3,5,7,9] = [X || X <- L0, odd(X)],
+ ?line [2,4,6,8,10] = [X || X <- L0, not odd(X)],
+ ?line [1,3,5,9] = [X || X <- L0, odd(X), X =/= 7],
+ ?line [2,4,8,10] = [X || X <- L0, not odd(X), X =/= 6],
+
+ %% Append is specially handled.
+ ?line [1,3,5,9,2,4,8,10] = [X || X <- L0, odd(X), X =/= 7] ++
+ [X || X <- L0, not odd(X), X =/= 6],
+
+ %% Guards BIFs are evaluated in guard context. Weird, but true.
+ ?line [{a,b,true},{x,y,true,true}] = [X || X <- tuple_list(), element(3, X)],
+
+ %% Filter expressions with andalso/orelse.
+ ?line "abc123" = alphanum("?abc123.;"),
%% Error cases.
- ?line [] = [X || X <- L1, X+1 < 2],
?line [] = [{xx,X} || X <- L0, element(2, X) == no_no_no],
- ?line {'EXIT',_} = (catch [X || X <- L1, odd(X)]),
+ ?line {'EXIT',_} = (catch [X || X <- L1, list_to_atom(X) == dum]),
+ ?line [] = [X || X <- L1, X+1 < 2],
+ ?line {'EXIT',_} = (catch [X || X <- L1, odd(X)]),
+ %% A bad generator has a different exception compared to BEAM.
+ ?line {'EXIT',{{bad_generator,x},_}} = (catch [E || E <- id(x)]),
ok.
+tuple_list() ->
+ [{a,b,true},[a,b,c],glurf,{a,b,false,xx},{a,b},{x,y,true,true},{a,b,d,ddd}].
+
my_map(F, L) ->
[F(X) || X <- L].
odd(X) ->
X rem 2 == 1.
+
+alphanum(Str) ->
+ [C || C <- Str, ((C >= $0) andalso (C =< $9))
+ orelse ((C >= $a) andalso (C =< $z))
+ orelse ((C >= $A) andalso (C =< $Z))].
+
+deeply_nested(Config) when is_list(Config) ->
+ [[99,98,97,96,42,17,1764,12,11,10,9,8,7,6,5,4,3,7,2,1]] = deeply_nested_1(),
+ ok.
+
+deeply_nested_1() ->
+ %% This used to compile really, really SLOW before R11B-1...
+ [[X1,X2,X3,X4,X5,X6,X7(),X8,X9,X10,X11,X12,X13,X14,X15,X16,X17,X18(),X19,X20] ||
+ X1 <- [99],X2 <- [98],X3 <- [97],X4 <- [96],X5 <- [42],X6 <- [17],
+ X7 <- [fun() -> X5*X5 end],X8 <- [12],X9 <- [11],X10 <- [10],
+ X11 <- [9],X12 <- [8],X13 <- [7],X14 <- [6],X15 <- [5],
+ X16 <- [4],X17 <- [3],X18 <- [fun() -> X16+X17 end],X19 <- [2],X20 <- [1]].
+
+no_generator(Config) when is_list(Config) ->
+ ?line Seq = lists:seq(-10, 17),
+ ?line [no_gen_verify(no_gen(A, B), A, B) || A <- Seq, B <- Seq],
+
+ %% Literal expression, for coverage.
+ ?line [a] = [a || true],
+ ?line [a,b,c] = [a || true] ++ [b,c],
+ ok.
+
+no_gen(A, B) ->
+ [{A,B} || A+B =:= 0] ++
+ [{A,B} || A*B =:= 0] ++
+ [{A,B} || A rem B =:= 3] ++
+ [{A,B} || A =:= B] ++
+ [{one_more,A,B} || no_gen_one_more(A, B)] ++
+ [A || A =:= 1] ++
+ [A || A =:= 2] ++
+ [A || A =:= 3] ++
+ [A || A =:= 4] ++
+ [A || A =:= 5] ++
+ [A || A =:= 6] ++
+ [A || A =:= 7] ++
+ [A || A =:= 8] ++
+ [A || A =:= 9] ++
+ [B || B =:= 1] ++
+ [B || B =:= 2] ++
+ [B || B =:= 3] ++
+ [B || B =:= 4] ++
+ [B || B =:= 5] ++
+ [B || B =:= 6] ++
+ [B || B =:= 7] ++
+ [B || B =:= 8] ++
+ [B || B =:= 9].
+
+no_gen_verify(Res, A, B) ->
+ Pair = {A,B},
+ ShouldBe = no_gen_eval(fun() -> A+B =:= 0 end, Pair) ++
+ no_gen_eval(fun() -> A*B =:= 0 end, Pair) ++
+ no_gen_eval(fun() -> B =/= 0 andalso A rem B =:= 3 end, Pair) ++
+ no_gen_eval(fun() -> A =:= B end, Pair) ++
+ no_gen_eval(fun() -> A + 1 =:= B end, {one_more,A,B}) ++
+ no_gen_eval(fun() -> 1 =< A andalso A =< 9 end, A) ++
+ no_gen_eval(fun() -> 1 =< B andalso B =< 9 end, B),
+ case Res of
+ ShouldBe -> ok;
+ _ ->
+ io:format("A = ~p; B = ~p; Expected = ~p, actual = ~p", [A,B,ShouldBe,Res]),
+ ?t:fail()
+ end.
+
+no_gen_eval(Fun, Res) ->
+ case Fun() of
+ true -> [Res];
+ false -> []
+ end.
+
+no_gen_one_more(A, B) -> A + 1 =:= B.
+
+empty_generator(Config) when is_list(Config) ->
+ ?line [] = [X || {X} <- [], (false or (X/0 > 3))],
+ ok.
+
+id(I) -> I.
diff --git a/lib/debugger/test/line_number_SUITE.erl b/lib/debugger/test/line_number_SUITE.erl
new file mode 100644
index 0000000000..d1f56d3493
--- /dev/null
+++ b/lib/debugger/test/line_number_SUITE.erl
@@ -0,0 +1,220 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 1999-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(line_number_SUITE).
+
+-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
+ init_per_testcase/2,end_per_testcase/2,
+ init_per_suite/1,end_per_suite/1,
+ line_numbers/1]).
+-export([crash/1]).
+
+-include_lib("test_server/include/test_server.hrl").
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ cases().
+
+groups() ->
+ [].
+
+init_per_group(_GroupName, Config) ->
+ Config.
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
+cases() ->
+ [line_numbers].
+
+init_per_testcase(_Case, Config) ->
+ test_lib:interpret(?MODULE),
+ Dog = test_server:timetrap(?t:minutes(1)),
+ [{watchdog,Dog}|Config].
+
+end_per_testcase(_Case, Config) ->
+ Dog = ?config(watchdog, Config),
+ ?t:timetrap_cancel(Dog),
+ ok.
+
+init_per_suite(Config) when is_list(Config) ->
+ ?line test_lib:interpret(?MODULE),
+ ?line true = lists:member(?MODULE, int:interpreted()),
+ Config.
+
+end_per_suite(Config) when is_list(Config) ->
+ ok.
+
+
+
+
+
+%%
+%% === Make sure that this is always line 70 ===
+%%
+line1(Tag, X) -> %Line 72
+ case Tag of %Line 73
+ a ->
+ Y = X + 1, %Line 75
+ Res = id({ok,Y}), %Line 76
+ ?MODULE:crash({ok,42} = Res); %Line 77
+ b ->
+ x = id(x), %Line 79
+ ok %Line 80
+ end. %Line 81
+
+crash(_) -> %Line 83
+ erlang:error(crash). %Line 84
+
+close_calls(Where) -> %Line 86
+ put(where_to_crash, Where), %Line 87
+ try
+ call1(), %Line 89
+ call2(), %Line 90
+ call3(), %Line 91
+ no_crash %Line 92
+ catch error:crash ->
+ erlang:get_stacktrace() %Line 94
+ end. %Line 95
+
+call1() -> %Line 97
+ maybe_crash(call1), %Line 98
+ ok. %Line 99
+
+call2() -> %Line 101
+ maybe_crash(call2), %Line 102
+ ok. %Line 103
+
+call3() -> %Line 105
+ maybe_crash(call3), %Line 106
+ ok. %Line 107
+
+maybe_crash(Name) -> %Line 109
+ case get(where_to_crash) of %Line 110
+ Name ->
+ erlang:error(crash); %Line 112
+ _ ->
+ ok %Line 114
+ end. %Line 115
+
+build_binary1(Size) -> %Line 117
+ id(42), %Line 118
+ <<0:Size>>. %Line 119
+
+build_binary2(Size, Bin) -> %Line 121
+ id(0), %Line 122
+ <<7:Size,Bin/binary>>. %Line 123
+
+do_call_abs(x, Arg) -> %Line 125
+ abs(Arg). %Line 126
+
+do_call_unsafe_bif(x, Arg) -> %Line 128
+ link(Arg). %Line 129
+
+
+line_numbers(Config) when is_list(Config) ->
+ File = ?MODULE_STRING ++ ".erl",
+ {'EXIT',{{case_clause,bad_tag},
+ [{?MODULE,line1,2,
+ [{file,File},{line,73}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(bad_tag, 0)),
+ {'EXIT',{badarith,
+ [{?MODULE,line1,2,
+ [{file,File},{line,75}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, not_an_integer)),
+ {'EXIT',{{badmatch,{ok,1}},
+ [{?MODULE,line1,2,
+ [{file,File},{line,77}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, 0)),
+ {'EXIT',{crash,
+ [{?MODULE,crash,1,
+ [{file,File},{line,84}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, 41)),
+
+ [{?MODULE,maybe_crash,1,[{file,File},{line,112}]},
+ {?MODULE,call1,0,[{file,File},{line,98}]},
+ {?MODULE,close_calls,1,[{file,File},{line,89}]},
+ {?MODULE,line_numbers,1,[{file,File},{line,_}]}|_] =
+ close_calls(call1),
+ [{?MODULE,maybe_crash,1,[{file,File},{line,112}]},
+ {?MODULE,call2,0,[{file,File},{line,102}]},
+ {?MODULE,close_calls,1,[{file,File},{line,90}]},
+ {?MODULE,line_numbers,1,[{file,File},{line,_}]}|_] =
+ close_calls(call2),
+ [{?MODULE,maybe_crash,1,[{file,File},{line,112}]},
+ {?MODULE,call3,0,[{file,File},{line,106}]},
+ {?MODULE,close_calls,1,[{file,File},{line,91}]},
+ {?MODULE,line_numbers,1,[{file,File},{line,_}]}|_] =
+ close_calls(call3),
+ no_crash = close_calls(other),
+
+ <<0,0>> = build_binary1(16),
+ {'EXIT',{badarg,
+ [{?MODULE,build_binary1,1,
+ [{file,File},{line,119}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary1(bad_size)),
+
+ <<7,1,2,3>> = build_binary2(8, <<1,2,3>>),
+ {'EXIT',{badarg,
+ [{?MODULE,build_binary2,2,
+ [{file,File},{line,123}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary2(bad_size, <<>>)),
+ {'EXIT',{badarg,
+ [%% Beam has an extra here:
+ %% {erlang,bit_size,[bad_binary],[]}
+ %% Since this is an artifact of the implementation,
+ %% we don't attempt to mimic it in the debugger.
+ {?MODULE,build_binary2,2,
+ [{file,File},{line,123}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary2(8, bad_binary)),
+
+ {'EXIT',{function_clause,
+ [{?MODULE,do_call_abs,[y,y],
+ [{file,File},{line,125}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_abs(y, y)),
+ {'EXIT',{badarg,
+ [{erlang,abs,[[]],[]},
+ {?MODULE,do_call_abs,2,
+ [{file,File},{line,126}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_abs(x, [])),
+
+ {'EXIT',{badarg,
+ [{erlang,link,[[]],[]},
+ {?MODULE,do_call_unsafe_bif,2,
+ [{file,File},{line,129}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_unsafe_bif(x, [])),
+
+ ok.
+
+id(I) ->
+ I.
diff --git a/lib/debugger/test/test_lib.erl b/lib/debugger/test/test_lib.erl
index 541375e64a..5e4ac7f164 100644
--- a/lib/debugger/test/test_lib.erl
+++ b/lib/debugger/test/test_lib.erl
@@ -22,7 +22,7 @@
-export([interpret/1]).
-interpret(Mod) when atom(Mod) ->
+interpret(Mod) when is_atom(Mod) ->
case lists:member(Mod, int:interpreted()) of
true -> ok;
false -> {module,Mod} = i:ii(Mod)
diff --git a/lib/debugger/test/trycatch_SUITE.erl b/lib/debugger/test/trycatch_SUITE.erl
index a87c5db138..470d46d915 100644
--- a/lib/debugger/test/trycatch_SUITE.erl
+++ b/lib/debugger/test/trycatch_SUITE.erl
@@ -318,17 +318,18 @@ eclectic(Conf) when is_list(Conf) ->
V = {make_ref(),3.1415926535,[[]|{}]},
?line {{value,{value,V},V},V} =
eclectic_1({foo,{value,{value,V}}}, undefined, {value,V}),
- ?line {{'EXIT',{V,[{?MODULE,foo,_}|_]}},V} =
+ ?line {{'EXIT',{V,[{?MODULE,foo,_,_}|_]}},V} =
eclectic_1({catch_foo,{error,V}}, undefined, {value,V}),
?line {{error,{exit,V},{'EXIT',V}},V} =
eclectic_1({foo,{error,{exit,V}}}, error, {value,V}),
- ?line {{value,{value,V},V},{'EXIT',{badarith,[{?MODULE,my_add,_}|_]}}} =
+ ?line {{value,{value,V},V},{'EXIT',{badarith,[{?MODULE,my_add,_,_}|_]}}} =
eclectic_1({foo,{value,{value,V}}}, undefined, {'add',{0,a}}),
?line {{'EXIT',V},V} =
eclectic_1({catch_foo,{exit,V}}, undefined, {throw,V}),
- ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,_}|_]}}}, {'EXIT',V}} =
+ ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,_,_}|_]}}},
+ {'EXIT',V}} =
eclectic_1({foo,{error,{'div',{1,0}}}}, error, {exit,V}),
- ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,_}|_]}}},{'EXIT',V}} =
+ ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,_,_}|_]}}},{'EXIT',V}} =
eclectic_1({catch_foo,{throw,{error,V}}}, undefined, {exit,V}),
%%
?line {{value,{value,{value,V},V}},V} =
@@ -337,15 +338,15 @@ eclectic(Conf) when is_list(Conf) ->
eclectic_2({throw,{value,V}}, throw, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{value,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_,_}|_]}}},undefined} =
eclectic_2({error,{value,V}}, throw, {error,V}),
- ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V]}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V],_}|_]}}},V} =
eclectic_2({value,{'abs',V}}, undefined, {value,V}),
- ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,_}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,_,_}|_]}}},V} =
eclectic_2({exit,{'add',{0,a}}}, exit, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{error,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_,_}|_]}}},undefined} =
eclectic_2({throw,{'div',{1,0}}}, throw, {error,V}),
ok.
diff --git a/lib/dialyzer/src/dialyzer_dataflow.erl b/lib/dialyzer/src/dialyzer_dataflow.erl
index 7137dbc036..8cb16d8f09 100644
--- a/lib/dialyzer/src/dialyzer_dataflow.erl
+++ b/lib/dialyzer/src/dialyzer_dataflow.erl
@@ -1414,6 +1414,17 @@ do_clause(C, Arg, ArgType0, OrigArgType, Map,
false ->
true
end;
+ [Pat0, Pat1] -> % binary comprehension
+ case cerl:is_c_cons(Pat0) of
+ true ->
+ not (cerl:is_c_var(cerl:cons_hd(Pat0)) andalso
+ cerl:is_c_var(cerl:cons_tl(Pat0)) andalso
+ cerl:is_c_var(Pat1) andalso
+ cerl:is_literal(Guard) andalso
+ (cerl:concrete(Guard) =:= true));
+ false ->
+ true
+ end;
_ -> true
end;
false ->
@@ -2915,7 +2926,7 @@ state__get_warnings(#state{tree_map = TreeMap, fun_tab = FunTab,
{Warn, Msg} =
case dialyzer_callgraph:lookup_name(FunLbl, Callgraph) of
error -> {true, {unused_fun, []}};
- {ok, {_M, F, A}} = MFA ->
+ {ok, {_M, F, A} = MFA} ->
{not sets:is_element(MFA, NoWarnUnused),
{unused_fun, [F, A]}}
end,
diff --git a/lib/dialyzer/src/dialyzer_typesig.erl b/lib/dialyzer/src/dialyzer_typesig.erl
index c45615d670..65c2ff76bb 100644
--- a/lib/dialyzer/src/dialyzer_typesig.erl
+++ b/lib/dialyzer/src/dialyzer_typesig.erl
@@ -1684,11 +1684,14 @@ solve_scc(SCC, Map, State, TryingUnit) ->
true ->
?debug("SCC ~w reached fixpoint\n", [SCC]),
NewTypes = unsafe_lookup_type_list(Funs, Map2),
- case lists:all(fun(T) -> t_is_none(t_fun_range(T)) end, NewTypes)
+ case erl_types:any_none([t_fun_range(T) || T <- NewTypes])
andalso TryingUnit =:= false of
true ->
- UnitTypes = [t_fun(state__fun_arity(F, State), t_unit())
- || F <- Funs],
+ UnitTypes =
+ [case t_is_none(t_fun_range(T)) of
+ false -> T;
+ true -> t_fun(t_fun_args(T), t_unit())
+ end || T <- NewTypes],
Map3 = enter_type_lists(Funs, UnitTypes, Map2),
solve_scc(SCC, Map3, State, true);
false ->
diff --git a/lib/dialyzer/test/Makefile b/lib/dialyzer/test/Makefile
index 69a8fd742e..47deb17f1d 100644
--- a/lib/dialyzer/test/Makefile
+++ b/lib/dialyzer/test/Makefile
@@ -26,7 +26,7 @@ include $(ERL_TOP)/make/otp_release_targets.mk
release_tests_spec:
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DATA) $(AUXILIARY_FILES) $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
cd $(RELSYSDIR);\
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/asn1 b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
index ac83366bc8..571e562d0d 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/asn1
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
@@ -2,7 +2,7 @@
asn1ct.erl:1500: The variable Err can never match since previous clauses completely covered the type #type{}
asn1ct.erl:1596: The variable _ can never match since previous clauses completely covered the type 'ber_bin_v2'
asn1ct.erl:1673: The pattern 'all' can never match the type 'asn1_module' | 'exclusive_decode' | 'partial_decode'
-asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()],[any()]>
+asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | [any()] | char()],[any()]>
asn1ct.erl:909: Guard test is_atom(Ext::[49 | 97 | 98 | 100 | 110 | 115]) can never succeed
asn1ct_check.erl:1698: The pattern {'error', _} can never match the type [any()]
asn1ct_check.erl:2733: The pattern {'type', Tag, _, _, _, _} can never match the type 'ASN1_OPEN_TYPE' | {_,_} | {'fixedtypevaluefield',_,_}
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/inets b/lib/dialyzer/test/r9c_SUITE_data/results/inets
index fd5e36a3cd..6b16dba2ff 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/inets
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/inets
@@ -7,9 +7,6 @@ http_lib.erl:286: The call http_lib:close('ip_comm' | {'ssl',_},any()) will neve
http_lib.erl:424: The variable _ can never match since previous clauses completely covered the type any()
http_lib.erl:438: The variable _ can never match since previous clauses completely covered the type any()
http_lib.erl:99: Function getHeaderValue/2 will never be called
-httpc_handler.erl:322: Function status_continue/2 has no local return
-httpc_handler.erl:37: Function init_connection/2 has no local return
-httpc_handler.erl:65: Function next_response_with_request/2 has no local return
httpc_handler.erl:660: Function exit_session_ok/2 has no local return
httpc_manager.erl:145: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
httpc_manager.erl:160: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
@@ -27,7 +24,7 @@ httpd_manager.erl:933: Function acceptor_status/1 will never be called
httpd_request_handler.erl:374: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 66 | 98 | 100 | 103 | 105 | 111 | 116 | 121,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
httpd_request_handler.erl:378: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
httpd_request_handler.erl:401: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',[[any()]]}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',_}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
httpd_request_handler.erl:645: Function will never be called
httpd_sup.erl:63: The variable Else can never match since previous clauses completely covered the type {'error',_} | {'ok',[any()],_,_}
httpd_sup.erl:88: The pattern {'error', Reason} can never match the type {'ok',_,_}
@@ -38,17 +35,17 @@ mod_auth_plain.erl:100: The variable _ can never match since previous clauses co
mod_auth_plain.erl:159: The variable _ can never match since previous clauses completely covered the type [any()]
mod_auth_plain.erl:83: The variable O can never match since previous clauses completely covered the type [any()]
mod_cgi.erl:372: The pattern {'http_response', NewAccResponse} can never match the type 'ok'
-mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
mod_dir.erl:72: The pattern {'error', Reason} can never match the type {'ok',[[[any()] | char()],...]}
-mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [any()] | char()]>
-mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_htaccess.erl:460: The pattern {'error', BadData} can never match the type {'ok',_}
-mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
-mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],string()}
+mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],string()}
+mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_include.erl:716: Function read_error/3 will never be called
mod_include.erl:719: Function read_error/4 will never be called
mod_security_server.erl:386: The variable O can never match since previous clauses completely covered the type [any()]
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
index e199581a0e..b0f4d12ae5 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
@@ -6,6 +6,9 @@ mnesia_bup.erl:111: The created fun has no local return
mnesia_bup.erl:574: Function fallback_receiver/2 has no local return
mnesia_bup.erl:967: Function uninstall_fallback_master/2 has no local return
mnesia_checkpoint.erl:1014: The variable Error can never match since previous clauses completely covered the type {'ok',#checkpoint_args{nodes::[any()],retainers::[any(),...]}}
+mnesia_checkpoint.erl:1209: Function system_continue/3 has no local return
+mnesia_checkpoint.erl:792: Function retainer_loop/1 has no local return
+mnesia_checkpoint.erl:894: The call sys:handle_system_msg(Msg::any(),From::any(),'no_parent','mnesia_checkpoint',[],Cp::#checkpoint_args{}) breaks the contract (Msg,From,Parent,Module,Debug,Misc) -> Void when is_subtype(Msg,term()), is_subtype(From,{pid(),Tag::_}), is_subtype(Parent,pid()), is_subtype(Module,module()), is_subtype(Debug,[dbg_opt()]), is_subtype(Misc,term()), is_subtype(Void,term())
mnesia_controller.erl:1666: The variable Tab can never match since previous clauses completely covered the type [any()]
mnesia_controller.erl:1679: The pattern {'stop', Reason, Reply, State2} can never match the type {'noreply',_} | {'reply',_,_} | {'stop','shutdown',#state{}}
mnesia_controller.erl:1685: The pattern {'noreply', State2, _Timeout} can never match the type {'reply',_,_}
@@ -15,6 +18,7 @@ mnesia_frag.erl:294: The call mnesia_frag:remote_collect(Ref::reference(),{'erro
mnesia_frag.erl:304: The call mnesia_frag:remote_collect(Ref::reference(),{'error',{'node_not_running',_}},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_frag.erl:312: The call mnesia_frag:remote_collect(Ref::reference(),LocalRes::{'error',_},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_index.erl:52: The call mnesia_lib:other_val(Var::{_,'commit_work' | 'index' | 'setorbag' | 'storage_type' | {'index',_}},_ReASoN_::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
+mnesia_lib.erl:1028: The pattern {'EXIT', Reason} can never match the type [any()] | {'error',_}
mnesia_lib.erl:957: The pattern {'ok', {0, _}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_lib.erl:959: The pattern {'ok', {_, Bin}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_loader.erl:36: The call mnesia_lib:other_val(Var::{_,'access_mode' | 'cstruct' | 'db_nodes' | 'setorbag' | 'snmp' | 'storage_type'},Reason::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
@@ -30,5 +34,6 @@ mnesia_schema.erl:1258: Guard test FromS::'disc_copies' | 'disc_only_copies' | '
mnesia_schema.erl:1639: The pattern {'false', 'mandatory'} can never match the type {'false','optional'}
mnesia_schema.erl:2434: The variable Reason can never match since previous clauses completely covered the type {'error',_} | {'ok',_}
mnesia_schema.erl:451: Guard test UseDirAnyway::'false' == 'true' can never succeed
+mnesia_text.erl:180: The variable T can never match since previous clauses completely covered the type {'error',{integer(),atom() | tuple(),_}} | {'ok',_}
mnesia_tm.erl:1522: Function commit_participant/5 has no local return
mnesia_tm.erl:2169: Function system_terminate/4 has no local return
diff --git a/lib/dialyzer/test/race_SUITE_data/results/extract_translations b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
index f7d5abc6f5..62aa1aa511 100644
--- a/lib/dialyzer/test/race_SUITE_data/results/extract_translations
+++ b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
@@ -1,5 +1,5 @@
-extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 135
+extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 135
extract_translations.erl:146: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
-extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 148
+extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 148
extract_translations.erl:154: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
diff --git a/lib/dialyzer/test/small_SUITE_data/results/flatten b/lib/dialyzer/test/small_SUITE_data/results/flatten
index 4571214e49..8aa44dd002 100644
--- a/lib/dialyzer/test/small_SUITE_data/results/flatten
+++ b/lib/dialyzer/test/small_SUITE_data/results/flatten
@@ -1,2 +1,2 @@
-flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
diff --git a/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
new file mode 100644
index 0000000000..c1e82bfa59
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
@@ -0,0 +1,8 @@
+-module(test).
+
+-export([bin_compr/0]).
+
+bin_compr() ->
+% [ 0 || {N, V} <- [{a, b}] ]. % Works ok
+ << <<>> || {A, B} <- [{a, b}] >>. % Complains
+% << <<>> || X <- [{a, b}] >>. % Works ok
diff --git a/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
new file mode 100644
index 0000000000..8abf872b37
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
@@ -0,0 +1,35 @@
+%%---------------------------------------------------------------------
+%% From: Peer Stritzinger
+%% Date: 1 May 2011
+%% Subject: Dialyzer v2.2.0 crash
+%%
+%% Binaries of the form <<_:N,_:_*M>> in specs resulted in a crash:
+%% dialyzer: Analysis failed with error: {{case_clause,8},
+%% [{erl_types,t_form_to_string,1},
+%% {erl_types,t_form_to_string,1},
+%% {dialyzer_contracts,contract_to_string_1,1},
+%% {dialyzer_contracts,extra_contract_warning,6},
+%% {dialyzer_contracts,picky_contract_check,7},
+%% because function erl_types:t_form_to_string/1 was not the inverse
+%% of erl_types:t_to_string/2.
+%%
+%% Fixed on the same date and send to OTP for inclusion.
+%%---------------------------------------------------------------------
+-module(codec_can).
+
+-export([recv/3, decode/1]).
+
+-record(can_pkt, {id, data :: binary(), timestamp}).
+
+-type can_pkt() :: #can_pkt{}.
+-type channel() :: atom() | pid() | {atom(),_}.
+
+-spec recv(<<_:64,_:_*8>>, fun((can_pkt()) -> R), channel()) -> R.
+recv(Packet, Fun, Chan) ->
+ #can_pkt{id = Can_id, data = Can_data} = P = decode(Packet),
+ Fun(P).
+
+-spec decode(<<_:64,_:_*8>>) -> #can_pkt{id::<<_:11>>,timestamp::char()}.
+decode(<<_:12, Len:4, Timestamp:16, 0:3, Id:11/bitstring, 0:18,
+ Data:Len/binary, _/binary>>) ->
+ #can_pkt{id = Id, data = Data, timestamp = Timestamp}.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
index 4f1268eba8..086df3464b 100644
--- a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
+++ b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
@@ -6,9 +6,7 @@
-export([parse/1]).
--type proplist() :: [{atom(), any()}].
-
--spec parse(string()) -> proplist().
+-spec parse(string()) -> proplists:proplist().
parse(FileName) ->
{ok, IoDevice} = file:open(FileName, [read, binary, {encoding, utf8}]),
do_parse(IoDevice, []).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
new file mode 100644
index 0000000000..2da708cb15
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
@@ -0,0 +1,21 @@
+%%=====================================================================
+%% From: Ken Robinson
+%% Date: 28/04/2011, 17:26
+%%
+%% Program that produced borus "Function has no local return" warnings
+%% due to erlang:list_to_bitstring/1 having erroneous hard coded type
+%% information, namely accepting iolist() instead of bitstrlist().
+%% Fixed 29/04/2011.
+%%=====================================================================
+
+-module(list_to_bitstring).
+
+-export([l2bs/0, l2bs_ok/0]).
+
+%% This function was producing a warning
+l2bs() ->
+ erlang:list_to_bitstring([<<42>>, <<42:13>>]).
+
+%% while this one was ok.
+l2bs_ok() ->
+ erlang:list_to_bitstring([<<42>>, <<42,42>>]).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
new file mode 100644
index 0000000000..5c24902590
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
@@ -0,0 +1,42 @@
+%% Dialyzer couldn't infer that monitor_diskspace would go in an infinite loop
+%% instead of crashing due to the existence of list comprehensions that have a
+%% normal success typing. These were added to the monitor_diskspace's SCC and
+%% dialyzer_typesig didn't try to assign unit() to monitor_diskspace, as it
+%% required all the members of the SCC to return none().
+%%
+%% Testcase was submitted in erlang-questions mailing list by Prashanth Mundkur
+%% (http://erlang.org/pipermail/erlang-questions/2011-May/058063.html)
+
+-module(no_return_bug).
+-export([diskspace/1, monitor_diskspace/2, refresh_tags/1, monitor_launch/0]).
+
+-type diskinfo() :: {non_neg_integer(), non_neg_integer()}.
+
+-spec diskspace(nonempty_string()) -> {'ok', diskinfo()} | {'error', term()}.
+diskspace(Path) ->
+ case Path of
+ "a" -> {ok, {0,0}};
+ _ -> {error, error}
+ end.
+
+-spec monitor_diskspace(nonempty_string(),
+ [{diskinfo(), nonempty_string()}]) ->
+ no_return().
+monitor_diskspace(Root, Vols) ->
+ Df = fun(VolName) ->
+ diskspace(filename:join([Root, VolName]))
+ end,
+ NewVols = [{Space, VolName}
+ || {VolName, {ok, Space}}
+ <- [{VolName, Df(VolName)}
+ || {_OldSpace, VolName} <- Vols]],
+ monitor_diskspace(Root, NewVols).
+
+-spec refresh_tags(nonempty_string()) -> no_return().
+refresh_tags(Root) ->
+ {ok, _} = diskspace(Root),
+ refresh_tags(Root).
+
+monitor_launch() ->
+ spawn_link(fun() -> refresh_tags("abc") end),
+ spawn_link(fun() -> monitor_diskspace("root", [{{0,0}, "a"}]) end).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
new file mode 100644
index 0000000000..63daeee9e3
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
@@ -0,0 +1,7 @@
+-module(nowarnunused).
+
+-compile({nowarn_unused_function, return_error/2}).
+
+-spec return_error(integer(), any()) -> no_return().
+return_error(Line, Message) ->
+ throw({error, {Line, ?MODULE, Message}}).
diff --git a/lib/diameter/doc/src/diameter_dict.xml b/lib/diameter/doc/src/diameter_dict.xml
index a87f59bad5..e7c530f1b8 100644
--- a/lib/diameter/doc/src/diameter_dict.xml
+++ b/lib/diameter/doc/src/diameter_dict.xml
@@ -105,7 +105,7 @@ quantity is insignificant.</p>
<p>
The tags, their arguments and the contents of each corresponding
section are as follows.
-Each section can occur only once unless otherwise specified.
+Each section can occur at most once unless otherwise specified.
The order in which sections are specified is unimportant.</p>
<taglist>
@@ -115,6 +115,7 @@ The order in which sections are specified is unimportant.</p>
<p>
Defines the integer Number as the Diameter Application Id of the
application in question.
+Required if the dictionary defines <c>@messages</c>.
The section has empty content.</p>
<p>
@@ -370,7 +371,11 @@ Integer values can be prefixed with 0x to be interpreted as
hexidecimal.</p>
<p>
-Can occur 0 or more times (with different values of Name).</p>
+Can occur 0 or more times (with different values of Name).
+The AVP in question can be defined in an inherited dictionary in order
+to introduce additional values.
+An AVP so extended must be referenced by in a <c>@messages</c> or
+<c>@grouped</c> section.</p>
<p>
Example:</p>
diff --git a/lib/diameter/src/app/Makefile b/lib/diameter/src/app/Makefile
index 6de220d282..31344fa80b 100644
--- a/lib/diameter/src/app/Makefile
+++ b/lib/diameter/src/app/Makefile
@@ -52,6 +52,14 @@ INCDIR = ../../include
include modules.mk
+diameter_gen_base_accounting.erl: \
+ $(EBIN)/diameter_gen_base_rfc3588.beam
+diameter_gen_relay.erl: \
+ $(EBIN)/diameter_gen_base_rfc3588.beam
+
+SPEC_MODULES = \
+ $(SPEC_FILES:%.dia=%)
+
SPEC_ERL_FILES = \
$(SPEC_FILES:%.dia=%.erl)
@@ -60,7 +68,7 @@ SPEC_HRL_FILES = \
APP_MODULES = \
$(MODULES) \
- $(SPEC_FILES:%.dia=%)
+ $(SPEC_MODULES)
TARGET_FILES = \
$(APP_MODULES:%=$(EBIN)/%.$(EMULATOR)) \
@@ -150,6 +158,7 @@ app: $(APP_TARGET) $(APPUP_TARGET)
diameter_gen_%.erl diameter_gen_%.hrl: diameter_gen_%.dia
../../bin/diameterc -i $(EBIN) -o $(@D) $<
+$(SPEC_MODULES:%=$(EBIN)/%.$(EMULATOR)): $(EBIN)/diameter_exprecs.$(EMULATOR)
# ----------------------------------------------------
# Release Target
diff --git a/lib/diameter/src/compiler/diameter_codegen.erl b/lib/diameter/src/compiler/diameter_codegen.erl
index 213ba0d22c..30caebc544 100644
--- a/lib/diameter/src/compiler/diameter_codegen.erl
+++ b/lib/diameter/src/compiler/diameter_codegen.erl
@@ -250,9 +250,14 @@ f_name(Name) ->
%%% ------------------------------------------------------------------------
f_id(Spec) ->
- Id = orddict:fetch(id, Spec),
{?function, id, 0,
- [{?clause, [], [], [?INTEGER(Id)]}]}.
+ [c_id(orddict:find(id, Spec))]}.
+
+c_id({ok, Id}) ->
+ {?clause, [], [], [?INTEGER(Id)]};
+
+c_id(error) ->
+ ?UNEXPECTED(0).
%%% ------------------------------------------------------------------------
%%% # vendor_id/0
@@ -454,9 +459,10 @@ avp(Spec) ->
Native = get_value(avp_types, Spec),
Custom = get_value(custom_types, Spec),
Imported = get_value(import_avps, Spec),
- avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom).
+ Enums = get_value(enums, Spec),
+ avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom, Enums).
-avp(Native, Imported, Custom) ->
+avp(Native, Imported, Custom, Enums) ->
Dict = orddict:from_list(Native),
report(native, Dict),
@@ -470,8 +476,8 @@ avp(Native, Imported, Custom) ->
false == lists:member(N, CustomNames)
end,
Native))
- ++ lists:flatmap(fun c_imported_avp/1, Imported)
- ++ lists:flatmap(fun(C) -> c_custom_avp(C, Dict) end, Custom).
+ ++ lists:flatmap(fun(I) -> cs_imported_avp(I, Enums) end, Imported)
+ ++ lists:flatmap(fun(C) -> cs_custom_avp(C, Dict) end, Custom).
c_base_avp({AvpName, T}) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
@@ -487,23 +493,35 @@ base_avp(AvpName, 'Grouped') ->
base_avp(_, Type) ->
?APPLY(diameter_types, Type, [?VAR('T'), ?VAR('Data')]).
-c_imported_avp({Mod, Avps}) ->
- lists:map(fun(A) -> imported_avp(Mod, A) end, Avps).
+cs_imported_avp({Mod, Avps}, Enums) ->
+ lists:map(fun(A) -> imported_avp(Mod, A, Enums) end, Avps).
-imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}) ->
+imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}, _) ->
c_base_avp({AvpName, T});
-imported_avp(Mod, {AvpName, _, _, _, _}) ->
+imported_avp(Mod, {AvpName, _, 'Enumerated' = T, _, _}, Enums) ->
+ case lists:keymember(AvpName, 1, Enums) of
+ true ->
+ c_base_avp({AvpName, T});
+ false ->
+ c_imported_avp(Mod, AvpName)
+ end;
+
+imported_avp(Mod, {AvpName, _, _, _, _}, _) ->
+ c_imported_avp(Mod, AvpName).
+
+c_imported_avp(Mod, AvpName) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, avp, [?VAR('T'),
?VAR('Data'),
?ATOM(AvpName)])]}.
-c_custom_avp({Mod, Avps}, Dict) ->
- lists:map(fun(N) -> custom_avp(Mod, N, orddict:fetch(N, Dict)) end, Avps).
+cs_custom_avp({Mod, Avps}, Dict) ->
+ lists:map(fun(N) -> c_custom_avp(Mod, N, orddict:fetch(N, Dict)) end,
+ Avps).
-custom_avp(Mod, AvpName, Type) ->
+c_custom_avp(Mod, AvpName, Type) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, AvpName, [?VAR('T'), ?ATOM(Type), ?VAR('Data')])]}.
@@ -516,9 +534,25 @@ f_enumerated_avp(Spec) ->
{?function, enumerated_avp, 3, enumerated_avp(Spec) ++ [?UNEXPECTED(3)]}.
enumerated_avp(Spec) ->
- lists:flatmap(fun c_enumerated_avp/1, get_value(enums, Spec)).
+ Enums = get_value(enums, Spec),
+ lists:flatmap(fun cs_enumerated_avp/1, Enums)
+ ++ lists:flatmap(fun({M,Es}) -> enumerated_avp(M, Es, Enums) end,
+ get_value(import_enums, Spec)).
+
+enumerated_avp(Mod, Es, Enums) ->
+ lists:flatmap(fun({N,_}) ->
+ cs_enumerated_avp(lists:keymember(N, 1, Enums),
+ Mod,
+ N)
+ end,
+ Es).
-c_enumerated_avp({AvpName, Values}) ->
+cs_enumerated_avp(true, Mod, Name) ->
+ [c_imported_avp(Mod, Name)];
+cs_enumerated_avp(false, _, _) ->
+ [].
+
+cs_enumerated_avp({AvpName, Values}) ->
lists:flatmap(fun(V) -> c_enumerated_avp(AvpName, V) end, Values).
c_enumerated_avp(AvpName, {I,_}) ->
@@ -537,10 +571,14 @@ f_msg_header(Spec) ->
{?function, msg_header, 1, msg_header(Spec) ++ [?UNEXPECTED(1)]}.
msg_header(Spec) ->
+ msg_header(get_value(messages, Spec), Spec).
+
+msg_header([], _) ->
+ [];
+msg_header(Msgs, Spec) ->
ApplId = orddict:fetch(id, Spec),
- lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end,
- get_value(messages, Spec)).
+ lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end, Msgs).
%% Note that any application id in the message header spec is ignored.
@@ -616,10 +654,12 @@ f_empty_value(Spec) ->
{?function, empty_value, 1, empty_value(Spec)}.
empty_value(Spec) ->
+ Imported = lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
Groups = get_value(grouped, Spec)
++ lists:flatmap(fun avps/1, get_value(import_groups, Spec)),
- Enums = get_value(enums, Spec)
- ++ lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
+ Enums = [T || {N,_} = T <- get_value(enums, Spec),
+ not lists:keymember(N, 1, Imported)]
+ ++ Imported,
lists:map(fun c_empty_value/1, Groups ++ Enums)
++ [{?clause, [?VAR('Name')], [], [?CALL(empty, [?VAR('Name')])]}].
diff --git a/lib/diameter/src/compiler/diameter_spec_util.erl b/lib/diameter/src/compiler/diameter_spec_util.erl
index 322d53a199..b60886b678 100644
--- a/lib/diameter/src/compiler/diameter_spec_util.erl
+++ b/lib/diameter/src/compiler/diameter_spec_util.erl
@@ -39,11 +39,11 @@ parse(Path, Options) ->
{ok, B} = file:read_file(Path),
Chunks = chunk(B),
Spec = make_spec(Chunks),
- true = enums_defined(Spec), %% sanity checks
- true = groups_defined(Spec), %%
+ true = groups_defined(Spec), %% sanity checks
true = customs_defined(Spec), %%
Full = import_enums(import_groups(import_avps(insert_codes(Spec),
Options))),
+ true = enums_defined(Full), %% sanity checks
true = v_flags_set(Spec),
Full.
@@ -243,35 +243,48 @@ get_value(Key, Spec) ->
%% with an appropriate type.
enums_defined(Spec) ->
- is_defined(Spec, 'Enumerated', enums).
+ Avps = get_value(avp_types, Spec),
+ Import = get_value(import_enums, Spec),
+ lists:all(fun({N,_}) ->
+ true = enum_defined(N, Avps, Import)
+ end,
+ get_value(enums, Spec)).
-groups_defined(Spec) ->
- is_defined(Spec, 'Grouped', grouped).
+enum_defined(Name, Avps, Import) ->
+ case lists:keyfind(Name, 1, Avps) of
+ {Name, _, 'Enumerated', _, _} ->
+ true;
+ {Name, _, T, _, _} ->
+ ?ERROR({avp_has_wrong_type, Name, 'Enumerated', T});
+ false ->
+ lists:any(fun({_,Is}) -> lists:keymember(Name, 1, Is) end, Import)
+ orelse ?ERROR({avp_not_defined, Name, 'Enumerated'})
+ end.
+%% Note that an AVP is imported only if referenced by a message or
+%% grouped AVP, so the final branch will fail if an enum definition is
+%% extended without this being the case.
-is_defined(Spec, Type, Key) ->
+groups_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(T) -> true = is_local(name(Key, T), Type, Avps) end,
- get_value(Key, Spec)).
+ lists:all(fun({N,_,_,_}) -> true = group_defined(N, Avps) end,
+ get_value(grouped, Spec)).
-name(enums, {N,_}) -> N;
-name(grouped, {N,_,_,_}) -> N.
-
-is_local(Name, Type, Avps) ->
+group_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
- {Name, _, Type, _, _} ->
+ {Name, _, 'Grouped', _, _} ->
true;
{Name, _, T, _, _} ->
- ?ERROR({avp_has_wrong_type, Name, Type, T});
+ ?ERROR({avp_has_wrong_type, Name, 'Grouped', T});
false ->
- ?ERROR({avp_not_defined, Name, Type})
+ ?ERROR({avp_not_defined, Name, 'Grouped'})
end.
customs_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(A) -> true = is_local(A, Avps) end,
+ lists:all(fun(A) -> true = custom_defined(A, Avps) end,
lists:flatmap(fun last/1, get_value(custom_types, Spec))).
-is_local(Name, Avps) ->
+custom_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
{Name, _, T, _, _} when T == 'Grouped';
T == 'Enumerated' ->
@@ -510,6 +523,9 @@ choose(false, _, X) -> X.
%% ------------------------------------------------------------------------
%% import_groups/1
%% import_enums/1
+%%
+%% For each inherited module, store the content of imported AVP's of
+%% type grouped/enumerated in a new key.
import_groups(Spec) ->
orddict:store(import_groups, import(grouped, Spec), Spec).
diff --git a/lib/diameter/test/Makefile b/lib/diameter/test/Makefile
index 823e2f0311..b3648c7bb1 100644
--- a/lib/diameter/test/Makefile
+++ b/lib/diameter/test/Makefile
@@ -404,5 +404,5 @@ release_tests_spec: tests
# $(HRL_FILES) $(ERL_FILES) \
# $(RELSYSDIR)
#
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/docbuilder/src/docb_gen.erl b/lib/docbuilder/src/docb_gen.erl
index 0d8d640324..75494314f1 100644
--- a/lib/docbuilder/src/docb_gen.erl
+++ b/lib/docbuilder/src/docb_gen.erl
@@ -18,6 +18,10 @@
-module(docb_gen).
-export([module/1, module/2, users_guide/1, users_guide/2]).
+-deprecated([{module,1,next_major_release},
+ {module,2,next_major_release},
+ {users_guide,1,next_major_release},
+ {users_guide,2,next_major_release}]).
-record(args, {suffix=".xml",
layout=docb_edoc_xml_cb,
diff --git a/lib/docbuilder/src/docb_main.erl b/lib/docbuilder/src/docb_main.erl
index 4f5f035a65..c20cfc8e67 100644
--- a/lib/docbuilder/src/docb_main.erl
+++ b/lib/docbuilder/src/docb_main.erl
@@ -436,11 +436,11 @@ transform(From, To, Opts, File, Tree) ->
case catch Filter:transform(File, Tree, Opts) of
%% R5C
- {'EXIT', {undef, [{Filter, transform, [File, Tree, Opts]}|_]}}->
+ {'EXIT', {undef, [{Filter, transform, [File, Tree, Opts],_}|_]}}->
%% No transformation defined
finish_transform(Tree, File, Opts, Filter);
- {'EXIT', {undef, {Filter, transform, [File, Tree, Opts]}}} ->
+ {'EXIT', {undef, {Filter, transform, [File, Tree, Opts],_}}} ->
%% No transformation defined
finish_transform(Tree, File, Opts, Filter);
@@ -507,16 +507,16 @@ pp({Tag, Optional, Args}, TagPath, Level, Filter, Opts) ->
Rule_3_result =
case catch Filter:rule(TagPath1, {Level,Optional1,Args},Opts) of
%% R5C
- {'EXIT', {undef, [{_, rule, _}|_]}} -> % No rule/3 defined
+ {'EXIT', {undef, [{_, rule, _, _}|_]}} -> % No rule/3 defined
failed;
- {'EXIT', {undef, {_, rule, _}}} -> % No rule/3 defined
+ {'EXIT', {undef, {_, rule, _, _}}} -> % No rule/3 defined
failed;
%% R5C
- {'EXIT', {function_clause, [{_, rule, _}|_]}} -> % No MATCHING rule/3
+ {'EXIT', {function_clause, [{_, rule, _, _}|_]}} -> % No MATCHING rule/3
failed;
- {'EXIT', {function_clause, {_, rule, _}}} -> % No MATCHING rule/3
+ {'EXIT', {function_clause, {_, rule, _, _}}} -> % No MATCHING rule/3
failed;
{'EXIT', What} ->
diff --git a/lib/docbuilder/src/docb_transform.erl b/lib/docbuilder/src/docb_transform.erl
index 9c7561b07b..736ac92274 100644
--- a/lib/docbuilder/src/docb_transform.erl
+++ b/lib/docbuilder/src/docb_transform.erl
@@ -18,6 +18,8 @@
-module(docb_transform).
-export([file/1, file/2]).
+-deprecated([{file,1,next_major_release},
+ {file,2,next_major_release}]).
%% file(File) -> ok | {error, Reason}
%% file(File, Opts) -> ok | {error, Reason}
diff --git a/lib/docbuilder/src/docb_xml_check.erl b/lib/docbuilder/src/docb_xml_check.erl
index 8ae5cd2eac..5912e22e7b 100644
--- a/lib/docbuilder/src/docb_xml_check.erl
+++ b/lib/docbuilder/src/docb_xml_check.erl
@@ -18,6 +18,7 @@
-module(docb_xml_check).
-export([validate/1]).
+-deprecated([{validate,1,next_major_release}]).
%% validate(File) -> ok | error | {error, badfile}
%% File = string(), file name with or without ".xml" extension
diff --git a/lib/docbuilder/vsn.mk b/lib/docbuilder/vsn.mk
index 2475966ec2..6df438a537 100644
--- a/lib/docbuilder/vsn.mk
+++ b/lib/docbuilder/vsn.mk
@@ -1 +1 @@
-DOCB_VSN = 0.9.8.10
+DOCB_VSN = 0.9.8.11
diff --git a/lib/edoc/Makefile b/lib/edoc/Makefile
index e512e390e3..1add669398 100644
--- a/lib/edoc/Makefile
+++ b/lib/edoc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/Makefile b/lib/edoc/doc/Makefile
index a0f6484382..c5f68b25d0 100644
--- a/lib/edoc/doc/Makefile
+++ b/lib/edoc/doc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id: Makefile,v 1.1.1.1 2004/10/04 13:53:33 richardc Exp $
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/overview.edoc b/lib/edoc/doc/overview.edoc
index bd603b7a13..fa699c6f08 100644
--- a/lib/edoc/doc/overview.edoc
+++ b/lib/edoc/doc/overview.edoc
@@ -1084,10 +1084,11 @@ Details:
the Erlang programming language.</li>
<li>`boolean()' is the subset of `atom()' consisting
of the atoms `true' and `false'.</li>
- <li>`char()' is a subset of
- `integer()' representing character codes.</li>
+ <li>`char()' is the subset of `integer()' representing
+ Unicode character codes: hex 000000-10FFFF.</li>
<li>`tuple()' is the set of all tuples `{...}'.</li>
- <li>`list(T)' is just an alias for `[T]'.</li>
+ <li>`list(T)' is just an alias for `[T]'; list() is an alias
+ for `list(any())', i.e., `[any()]'.</li>
<li>`nil()' is an alias for the empty list `[]'.</li>
<li>`cons(H,T)' is the list constructor. This is usually not
used directly. It is possible to recursively define `list(T)
diff --git a/lib/edoc/doc/src/Makefile b/lib/edoc/doc/src/Makefile
index 5ee0096f0f..b933094464 100644
--- a/lib/edoc/doc/src/Makefile
+++ b/lib/edoc/doc/src/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/include/Makefile b/lib/edoc/include/Makefile
index 0533c27567..5b2ad38c9d 100644
--- a/lib/edoc/include/Makefile
+++ b/lib/edoc/include/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/priv/edoc_generate.src b/lib/edoc/priv/edoc_generate.src
index e87fdbc902..7ec89207b0 100644
--- a/lib/edoc/priv/edoc_generate.src
+++ b/lib/edoc/priv/edoc_generate.src
@@ -14,9 +14,6 @@
# Portions created by Ericsson are Copyright 1999-2000, Ericsson
# Utvecklings AB. All Rights Reserved.''
#
-# $Id$
-#
-#
#EDOC_DIR=/clearcase/otp/internal_tools/edoc
EDOC_DIR=/home/otp/sgml/edoc-%EDOC_VSN%
diff --git a/lib/edoc/src/Makefile b/lib/edoc/src/Makefile
index 9c5a9d30d1..fcb0b61292 100644
--- a/lib/edoc/src/Makefile
+++ b/lib/edoc/src/Makefile
@@ -23,7 +23,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/edoc-$(VSN)
EBIN = ../ebin
XMERL = ../../xmerl
-ERL_COMPILE_FLAGS += -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
+ERL_COMPILE_FLAGS += -pa $(XMERL) -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
SOURCES= \
edoc.erl edoc_data.erl edoc_doclet.erl edoc_extract.erl \
diff --git a/lib/edoc/src/edoc.erl b/lib/edoc/src/edoc.erl
index 360f2dbc9e..a279f7dcb3 100644
--- a/lib/edoc/src/edoc.erl
+++ b/lib/edoc/src/edoc.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2007 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @version {@version}
@@ -60,8 +58,6 @@
-compile({no_auto_import,[error/1]}).
--import(edoc_report, [report/2, report/3, error/1, error/3]).
-
-include("edoc.hrl").
@@ -179,8 +175,8 @@ application(App, Options) when is_atom(App) ->
Dir when is_list(Dir) ->
application(App, Dir, Options);
_ ->
- report("cannot find application directory for '~s'.",
- [App]),
+ edoc_report:report("cannot find application directory for '~s'.",
+ [App]),
exit(error)
end.
@@ -663,8 +659,8 @@ read_source(Name, Opts0) ->
check_forms(Forms, Name),
Forms;
{error, R} ->
- error({"error reading file '~s'.",
- [edoc_lib:filename(Name)]}),
+ edoc_report:error({"error reading file '~s'.",
+ [edoc_lib:filename(Name)]}),
exit({error, R})
end.
@@ -688,11 +684,10 @@ check_forms(Fs, Name) ->
error_marker ->
case erl_syntax:error_marker_info(F) of
{L, M, D} ->
- error(L, Name, {format_error, M, D});
-
+ edoc_report:error(L, Name, {format_error, M, D});
Other ->
- report(Name, "unknown error in "
- "source code: ~w.", [Other])
+ edoc_report:report(Name, "unknown error in "
+ "source code: ~w.", [Other])
end,
exit(error);
_ ->
diff --git a/lib/edoc/src/edoc_data.erl b/lib/edoc/src/edoc_data.erl
index 27f43dca5a..e3b5a0d51b 100644
--- a/lib/edoc/src/edoc_data.erl
+++ b/lib/edoc/src/edoc_data.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_doclet.erl b/lib/edoc/src/edoc_doclet.erl
index 30eef3e63a..c66be9d7c7 100644
--- a/lib/edoc/src/edoc_doclet.erl
+++ b/lib/edoc/src/edoc_doclet.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003-2006 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -52,7 +50,7 @@
-define(IMAGE, "erlang.png").
-define(NL, "\n").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
%% Sources is the list of inputs in the order they were found. Packages
%% and Modules are sorted lists of atoms without duplicates. (They
diff --git a/lib/edoc/src/edoc_extract.erl b/lib/edoc/src/edoc_extract.erl
index 5e28762c53..1209d86fe5 100644
--- a/lib/edoc/src/edoc_extract.erl
+++ b/lib/edoc/src/edoc_extract.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -238,8 +236,8 @@ file(File, Context, Env, Opts) ->
case file:read_file(File) of
{ok, Bin} ->
{ok, text(binary_to_list(Bin), Context, Env, Opts, File)};
- {error, _R} = Error ->
- Error
+ {error, _} = Error ->
+ Error
end.
@@ -298,8 +296,8 @@ get_module_info(Forms, File) ->
{Name, Vars} = case lists:keyfind(module, 1, L) of
{module, N} when is_atom(N) ->
{N, none};
- {module, {N, _Vs} = NVs} when is_atom(N) ->
- NVs;
+ {module, {N, _}=Mod} when is_atom(N) ->
+ Mod;
_ ->
report(File, "module name missing.", []),
exit(error)
diff --git a/lib/edoc/src/edoc_layout.erl b/lib/edoc/src/edoc_layout.erl
index 3ec87b7060..1c0841815f 100644
--- a/lib/edoc/src/edoc_layout.erl
+++ b/lib/edoc/src/edoc_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @author Richard Carlsson <[email protected]>
%% @copyright 2001-2006 Richard Carlsson
%% @see edoc
@@ -33,7 +31,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(HTML_EXPORT, xmerl_html).
-define(DEFAULT_XML_EXPORT, ?HTML_EXPORT).
@@ -959,12 +957,16 @@ local_label(R) ->
xhtml(Title, CSS, Body) ->
[{html, [?NL,
- {head, [?NL,
- {title, Title},
- ?NL] ++ CSS},
- ?NL,
- {body, [{bgcolor, "white"}], Body},
- ?NL]
+ {head, [?NL,
+ {meta, [{'http-equiv',"Content-Type"},
+ {content, "text/html; charset=ISO-8859-1"}],
+ []},
+ ?NL,
+ {title, Title},
+ ?NL] ++ CSS},
+ ?NL,
+ {body, [{bgcolor, "white"}], Body},
+ ?NL]
},
?NL].
diff --git a/lib/edoc/src/edoc_lib.erl b/lib/edoc/src/edoc_lib.erl
index 585e30a2d2..6c698e83ef 100644
--- a/lib/edoc/src/edoc_lib.erl
+++ b/lib/edoc/src/edoc_lib.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -40,7 +38,7 @@
-import(edoc_report, [report/2, warning/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(FILE_BASE, "/").
@@ -494,7 +492,7 @@ uri_get_file(File0) ->
uri_get_http(URI) ->
%% Try using option full_result=false
case catch {ok, httpc:request(get, {URI,[]}, [],
- [{full_result, false}])} of
+ [{full_result, false}])} of
{'EXIT', _} ->
uri_get_http_r10(URI);
Result ->
diff --git a/lib/edoc/src/edoc_parser.yrl b/lib/edoc/src/edoc_parser.yrl
index 6943f1bdb8..3ce4cde4fb 100644
--- a/lib/edoc/src/edoc_parser.yrl
+++ b/lib/edoc/src/edoc_parser.yrl
@@ -23,9 +23,6 @@
%% USA
%%
%% Author contact: [email protected]
-%%
-%% $Id $
-%%
%% =====================================================================
Nonterminals
@@ -362,10 +359,10 @@ parse_spec(S, L) ->
{ok, Spec} ->
Spec;
{error, E} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end;
{error, E, _} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end.
%% ---------------------------------------------------------------------
diff --git a/lib/edoc/src/edoc_report.erl b/lib/edoc/src/edoc_report.erl
index ee54c60c90..f082513bee 100644
--- a/lib/edoc/src/edoc_report.erl
+++ b/lib/edoc/src/edoc_report.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_run.erl b/lib/edoc/src/edoc_run.erl
index 96e5ea4631..1355db840f 100644
--- a/lib/edoc/src/edoc_run.erl
+++ b/lib/edoc/src/edoc_run.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
diff --git a/lib/edoc/src/edoc_scanner.erl b/lib/edoc/src/edoc_scanner.erl
index 9d2e6f3aed..8e895ad1ad 100644
--- a/lib/edoc/src/edoc_scanner.erl
+++ b/lib/edoc/src/edoc_scanner.erl
@@ -13,8 +13,6 @@
%% AB. Portions created by Ericsson are Copyright 1999, Ericsson
%% Utvecklings AB. All Rights Reserved.''
%%
-%% $Id: $
-%%
%% @private
%% @copyright Richard Carlsson 2001-2003. Portions created by Ericsson
%% are Copyright 1999, Ericsson Utvecklings AB. All Rights Reserved.
diff --git a/lib/edoc/src/edoc_specs.erl b/lib/edoc/src/edoc_specs.erl
index 79a5d142bc..5acf8ac0d5 100644
--- a/lib/edoc/src/edoc_specs.erl
+++ b/lib/edoc/src/edoc_specs.erl
@@ -27,7 +27,6 @@
-include("edoc.hrl").
-include("edoc_types.hrl").
--type proplist() :: [proplists:property()].
-type syntaxTree() :: erl_syntax:syntaxTree().
-define(TOP_TYPE, term).
@@ -87,8 +86,9 @@ dummy_spec(Form) ->
#tag{name = spec, line = element(2, hd(TypeSpecs)),
origin = code, data = S}.
--spec docs(Forms::[syntaxTree()], CommentFun) -> dict() when
- CommentFun :: fun(([syntaxTree()], Line :: term()) -> #tag{}).
+-spec docs(Forms::[syntaxTree()],
+ CommentFun :: fun( ([syntaxTree()], Line :: term()) -> #tag{} ))
+ -> dict().
%% @doc Find comments after -type/-opaque declarations.
%% Postcomments "inside" the type are skipped.
@@ -98,7 +98,7 @@ docs(Forms, CommentFun) ->
-type entry() :: #entry{}.
-type module_info() :: #module{}.
-type entries() :: [entry()].
--spec add_data(Entries::entries(), Options::proplist(),
+-spec add_data(Entries::entries(), Options::proplists:proplist(),
File::file:filename(), Module::module_info()) -> entries().
%% @doc Create tags a la EDoc for Erlang specifications and types.
diff --git a/lib/edoc/src/edoc_tags.erl b/lib/edoc/src/edoc_tags.erl
index 8ee8f87b5f..80989428ce 100644
--- a/lib/edoc/src/edoc_tags.erl
+++ b/lib/edoc/src/edoc_tags.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_types.erl b/lib/edoc/src/edoc_types.erl
index e784b3359a..a54544868c 100644
--- a/lib/edoc/src/edoc_types.erl
+++ b/lib/edoc/src/edoc_types.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -34,13 +32,13 @@
%% @headerfile "edoc_types.hrl"
-include("edoc_types.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
is_predefined(any, 0) -> true;
is_predefined(atom, 0) -> true;
is_predefined(binary, 0) -> true;
-is_predefined(bool, 0) -> true;
+is_predefined(bool, 0) -> true; % kept for backwards compatibility
is_predefined(char, 0) -> true;
is_predefined(cons, 2) -> true;
is_predefined(deep_string, 0) -> true;
diff --git a/lib/edoc/src/edoc_wiki.erl b/lib/edoc/src/edoc_wiki.erl
index ba33198787..2f2d14853c 100644
--- a/lib/edoc/src/edoc_wiki.erl
+++ b/lib/edoc/src/edoc_wiki.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -70,7 +68,7 @@
-export([parse_xml/2, expand_text/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(BASE_HEADING, 3).
@@ -82,8 +80,8 @@ parse_xml(Data, Line) ->
parse_xml_1(Text, Line) ->
Text1 = "<doc>" ++ Text ++ "</doc>",
- Options = [{line, Line}, {encoding, "iso-8859-1"}],
- case catch {ok, xmerl_scan:string(Text1, Options)} of
+ Opts = [{line, Line}, {encoding, 'iso-8859-1'}],
+ case catch {ok, xmerl_scan:string(Text1, Opts)} of
{ok, {E, _}} ->
E#xmlElement.content;
{'EXIT', {fatal, {Reason, L, _C}}} ->
diff --git a/lib/edoc/src/otpsgml_layout.erl b/lib/edoc/src/otpsgml_layout.erl
index 45f74b299e..d425dc0ed8 100644
--- a/lib/edoc/src/otpsgml_layout.erl
+++ b/lib/edoc/src/otpsgml_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @author Richard Carlsson <[email protected]>
%% @author Kenneth Lundin <[email protected]>
%% @copyright 2001-2004 Richard Carlsson
@@ -34,7 +32,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(SGML_EXPORT, xmerl_otpsgml).
-define(DEFAULT_XML_EXPORT, ?SGML_EXPORT).
diff --git a/lib/edoc/test/edoc_SUITE.erl b/lib/edoc/test/edoc_SUITE.erl
index 0d57591e3e..5b95c35756 100644
--- a/lib/edoc/test/edoc_SUITE.erl
+++ b/lib/edoc/test/edoc_SUITE.erl
@@ -13,8 +13,6 @@
%% Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
%% AB. All Rights Reserved.''
%%
-%% $Id$
-%%
-module(edoc_SUITE).
-include_lib("test_server/include/test_server.hrl").
diff --git a/lib/erl_interface/src/Makefile.in b/lib/erl_interface/src/Makefile.in
index 8ff142a366..0d841cfa48 100644
--- a/lib/erl_interface/src/Makefile.in
+++ b/lib/erl_interface/src/Makefile.in
@@ -143,7 +143,6 @@ BINDIR = $(ERL_TOP)/lib/erl_interface/bin/$(TARGET)
vpath %.c connect:encode:decode:misc:epmd:legacy:registry
-
###########################################################################
# List targets
###########################################################################
@@ -202,11 +201,6 @@ ifeq ($(USING_VC),yes)
# Windows targets
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(MT_OBJDIR) \
- $(MD_OBJDIR) \
- $(MDD_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -236,9 +230,6 @@ else
ifeq ($USING_MINGW,yes)
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(MD_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -257,10 +248,6 @@ else
ifdef THR_DEFS
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(ST_OBJDIR) \
- $(MT_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -283,9 +270,6 @@ FAKE_TARGETS = \
else
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(ST_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -601,23 +585,7 @@ $(MDD_OBJDIR)/%.o: %.c
# Create directories
###########################################################################
-$(BINDIR):
- mkdir -p $(BINDIR)
-
-$(OBJDIR):
- mkdir -p $(OBJDIR)
-
-$(ST_OBJDIR):
- mkdir -p $(ST_OBJDIR)
-
-$(MT_OBJDIR):
- mkdir -p $(MT_OBJDIR)
-
-$(MD_OBJDIR):
- mkdir -p $(MD_OBJDIR)
-
-$(MDD_OBJDIR):
- mkdir -p $(MDD_OBJDIR)
+_create_dirs := $(shell mkdir -p $(BINDIR) $(OBJDIR) $(ST_OBJDIR) $(MT_OBJDIR) $(MD_OBJDIR) $(MDD_OBJDIR))
###########################################################################
# Special rules
diff --git a/lib/et/src/et_wx_viewer.erl b/lib/et/src/et_wx_viewer.erl
index 7d4286ed9d..386f8fc86b 100644
--- a/lib/et/src/et_wx_viewer.erl
+++ b/lib/et/src/et_wx_viewer.erl
@@ -257,10 +257,10 @@ parse_opt([H | T], S, CollectorOpt) ->
Actors = [create_actor(Name) || Name <- ActorNames2],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{include, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, include, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, include, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{exclude, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, exclude, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, exclude, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{first_event, _FirstKey} ->
%% NYI
diff --git a/lib/eunit/doc/overview.edoc b/lib/eunit/doc/overview.edoc
index be05a13fba..2583f0be25 100644
--- a/lib/eunit/doc/overview.edoc
+++ b/lib/eunit/doc/overview.edoc
@@ -913,7 +913,7 @@ To make the descriptions simpler, we first list some definitions:
<td>`CleanupX'</td><td>`(X::any(), R::any()) -> any()'</td>
</tr>
<tr>
-<td>`Instantiator'</td><td>`((R::any()) -> Tests | {with, [AbstractTestFun::((any()) -> any())]}'</td>
+<td>`Instantiator'</td><td>`((R::any()) -> Tests) | {with, [AbstractTestFun::((any()) -> any())]}'</td>
</tr>
<tr>
<td>`Where'</td><td>`local | spawn | {spawn, Node::atom()}'</td>
diff --git a/lib/eunit/include/eunit.hrl b/lib/eunit/include/eunit.hrl
index 82ba982f03..493ba60a2d 100644
--- a/lib/eunit/include/eunit.hrl
+++ b/lib/eunit/include/eunit.hrl
@@ -39,6 +39,7 @@
-ifndef(EUNIT_HRL).
-define(EUNIT_HRL, true).
+
%% allow defining TEST to override NOTEST
-ifdef(TEST).
-undef(NOTEST).
@@ -164,7 +165,7 @@
%% This is mostly a convenience which gives more detailed reports.
%% Note: Guard is a guarded pattern, and can not be used for value.
-ifdef(NOASSERT).
--define(assertMatch(Guard,Expr),ok).
+-define(assertMatch(Guard, Expr), ok).
-else.
-define(assertMatch(Guard, Expr),
((fun () ->
@@ -174,17 +175,37 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected, (??Guard)},
+ {pattern, (??Guard)},
{value, __V}]})
end
end)())).
-endif.
-define(_assertMatch(Guard, Expr), ?_test(?assertMatch(Guard, Expr))).
+%% This is the inverse case of assertMatch, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotMatch(Guard, Expr), ok).
+-else.
+-define(assertNotMatch(Guard, Expr),
+ ((fun () ->
+ __V = (Expr),
+ case __V of
+ Guard -> .erlang:error({assertNotMatch_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern, (??Guard)},
+ {value, __V}]});
+ _ -> ok
+ end
+ end)())).
+-endif.
+-define(_assertNotMatch(Guard, Expr), ?_test(?assertNotMatch(Guard, Expr))).
+
%% This is a convenience macro which gives more detailed reports when
%% the expected LHS value is not a pattern, but a computed value
-ifdef(NOASSERT).
--define(assertEqual(Expect,Expr),ok).
+-define(assertEqual(Expect, Expr), ok).
-else.
-define(assertEqual(Expect, Expr),
((fun (__X) ->
@@ -201,9 +222,29 @@
-endif.
-define(_assertEqual(Expect, Expr), ?_test(?assertEqual(Expect, Expr))).
+%% This is the inverse case of assertEqual, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotEqual(Unexpected, Expr), ok).
+-else.
+-define(assertNotEqual(Unexpected, Expr),
+ ((fun (__X) ->
+ case (Expr) of
+ __X -> .erlang:error({assertNotEqual_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {value, __X}]});
+ _ -> ok
+ end
+ end)(Unexpected))).
+-endif.
+-define(_assertNotEqual(Unexpected, Expr),
+ ?_test(?assertNotEqual(Unexpected, Expr))).
+
%% Note: Class and Term are patterns, and can not be used for value.
+%% Term can be a guarded pattern, but Class cannot.
-ifdef(NOASSERT).
--define(assertException(Class, Term, Expr),ok).
+-define(assertException(Class, Term, Expr), ok).
-else.
-define(assertException(Class, Term, Expr),
((fun () ->
@@ -212,7 +253,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_success, __V}]})
@@ -223,7 +264,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_exception,
@@ -243,6 +284,43 @@
-define(_assertExit(Term, Expr), ?_assertException(exit, Term, Expr)).
-define(_assertThrow(Term, Expr), ?_assertException(throw, Term, Expr)).
+%% This is the inverse case of assertException, for convenience.
+%% Note: Class and Term are patterns, and can not be used for value.
+%% Both Class and Term can be guarded patterns.
+-ifdef(NOASSERT).
+-define(assertNotException(Class, Term, Expr), ok).
+-else.
+-define(assertNotException(Class, Term, Expr),
+ ((fun () ->
+ try (Expr) of
+ _ -> ok
+ catch
+ __C:__T ->
+ case __C of
+ Class ->
+ case __T of
+ Term ->
+ .erlang:error({assertNotException_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern,
+ "{ "++(??Class)++" , "
+ ++(??Term)++" , [...] }"},
+ {unexpected_exception,
+ {__C, __T,
+ .erlang:get_stacktrace()
+ }}]});
+ _ -> ok
+ end;
+ _ -> ok
+ end
+ end
+ end)())).
+-endif.
+-define(_assertNotException(Class, Term, Expr),
+ ?_test(?assertNotException(Class, Term, Expr))).
+
%% Macros for running operating system commands. (Note that these
%% require EUnit to be present at runtime, or at least eunit_lib.)
@@ -267,7 +345,7 @@
%% these are only used for testing; they always return 'ok' on success,
%% and have no effect if debugging/testing is turned off
-ifdef(NOASSERT).
--define(assertCmdStatus(N, Cmd),ok).
+-define(assertCmdStatus(N, Cmd), ok).
-else.
-define(assertCmdStatus(N, Cmd),
((fun () ->
@@ -285,7 +363,7 @@
-define(assertCmd(Cmd), ?assertCmdStatus(0, Cmd)).
-ifdef(NOASSERT).
--define(assertCmdOutput(T, Cmd),ok).
+-define(assertCmdOutput(T, Cmd), ok).
-else.
-define(assertCmdOutput(T, Cmd),
((fun () ->
@@ -313,11 +391,12 @@
-define(debugHere, ok).
-define(debugFmt(S, As), ok).
-define(debugVal(E), (E)).
--define(debugTime(S,E), (E)).
+-define(debugTime(S, E), (E)).
-else.
-define(debugMsg(S),
(begin
- .io:fwrite(user, <<"~s:~w: ~s\n">>, [?FILE, ?LINE, S]),
+ .io:fwrite(user, <<"~s:~w:~w: ~s\n">>,
+ [?FILE, ?LINE, self(), S]),
ok
end)).
-define(debugHere, (?debugMsg("<-"))).
@@ -327,7 +406,7 @@
?debugFmt(<<"~s = ~P">>, [(??E), __V, 15]),
__V
end)(E))).
--define(debugTime(S,E),
+-define(debugTime(S, E),
((fun () ->
{__T0, _} = statistics(wall_clock),
__V = (E),
@@ -337,4 +416,5 @@
end)())).
-endif.
+
-endif. % EUNIT_HRL
diff --git a/lib/eunit/src/Makefile b/lib/eunit/src/Makefile
index 4897c20ec1..bec2fdbe0b 100644
--- a/lib/eunit/src/Makefile
+++ b/lib/eunit/src/Makefile
@@ -26,8 +26,9 @@ INCLUDE=../include
ERL_COMPILE_FLAGS += -pa $(EBIN) -I$(INCLUDE) +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_obsolete_guard
+PARSE_TRANSFORM = eunit_autoexport.erl
+
SOURCES= \
- eunit_autoexport.erl \
eunit_striptests.erl \
eunit.erl \
eunit_tests.erl \
@@ -43,6 +44,8 @@ SOURCES= \
INCLUDE_FILES = eunit.hrl
+PARSE_TRANSFORM_BIN = $(PARSE_TRANSFORM:%.erl=$(EBIN)/%.$(EMULATOR))
+
OBJECTS=$(SOURCES:%.erl=$(EBIN)/%.$(EMULATOR)) $(APP_TARGET) $(APPUP_TARGET)
INCLUDE_DELIVERABLES = $(INCLUDE_FILES:%=$(INCLUDE)/%)
@@ -59,7 +62,7 @@ APPUP_TARGET= $(EBIN)/$(APPUP_FILE)
# Targets
# ----------------------------------------------------
-debug opt: $(OBJECTS)
+debug opt: $(PARSE_TRANSFORM_BIN) $(OBJECTS)
docs:
@@ -86,6 +89,8 @@ realclean: clean
$(EBIN)/%.$(EMULATOR):%.erl
erlc -W $(ERL_COMPILE_FLAGS) -o$(EBIN) $<
+$(OBJECTS): $(PARSE_TRANSFORM_BIN)
+
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
@@ -103,9 +108,9 @@ include $(ERL_TOP)/make/otp_release_targets.mk
release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/ebin
- $(INSTALL_DATA) $(OBJECTS) $(RELSYSDIR)/ebin
+ $(INSTALL_DATA) $(PARSE_TRANSFORM_BIN) $(OBJECTS) $(RELSYSDIR)/ebin
$(INSTALL_DIR) $(RELSYSDIR)/src
- $(INSTALL_DATA) $(SOURCES) $(RELSYSDIR)/src
+ $(INSTALL_DATA) $(PARSE_TRANSFORM) $(SOURCES) $(RELSYSDIR)/src
$(INSTALL_DIR) $(RELSYSDIR)/include
$(INSTALL_DATA) $(INCLUDE_DELIVERABLES) $(RELSYSDIR)/include
diff --git a/lib/eunit/src/eunit.app.src b/lib/eunit/src/eunit.app.src
index 4fd76588c3..5e16dfa2ce 100644
--- a/lib/eunit/src/eunit.app.src
+++ b/lib/eunit/src/eunit.app.src
@@ -5,17 +5,17 @@
{vsn, "%VSN%"},
{modules, [eunit,
eunit_autoexport,
- eunit_striptests,
- eunit_server,
+ eunit_data,
+ eunit_lib,
+ eunit_listener,
eunit_proc,
eunit_serial,
+ eunit_server,
+ eunit_striptests,
+ eunit_surefire,
eunit_test,
eunit_tests,
- eunit_lib,
- eunit_listener,
- eunit_data,
- eunit_tty,
- eunit_surefire]},
+ eunit_tty]},
{registered,[]},
- {applications, [stdlib]},
+ {applications, [kernel,stdlib]},
{env, []}]}.
diff --git a/lib/eunit/src/eunit.erl b/lib/eunit/src/eunit.erl
index da35c5c2ec..15fc3bdf32 100644
--- a/lib/eunit/src/eunit.erl
+++ b/lib/eunit/src/eunit.erl
@@ -16,7 +16,7 @@
%% $Id: eunit.erl 339 2009-04-05 14:10:47Z rcarlsson $
%%
%% @copyright 2004-2009 Micka�l R�mond, Richard Carlsson
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% [http://www.process-one.net/]
%% @author Richard Carlsson <[email protected]>
%% [http://user.it.uu.se/~richardc/]
diff --git a/lib/eunit/src/eunit_data.erl b/lib/eunit/src/eunit_data.erl
index 0543b6c543..288dd74ddf 100644
--- a/lib/eunit/src/eunit_data.erl
+++ b/lib/eunit/src/eunit_data.erl
@@ -146,8 +146,10 @@ iter_next(I = #iter{next = [T | Ts]}) ->
iter_prev(#iter{prev = []}) ->
none;
-iter_prev(#iter{prev = [T | Ts], next = Next, pos = Pos} = I) ->
- {T, I#iter{prev = Ts, next = [T | Next], pos = Pos - 1}}.
+iter_prev(#iter{prev = [T | Ts]} = I) ->
+ {T, I#iter{prev = Ts,
+ next = [T | I#iter.next],
+ pos = I#iter.pos - 1}}.
%% ---------------------------------------------------------------------
@@ -363,7 +365,8 @@ parse({file, F} = T) when is_list(F) ->
parse({dir, D}=T) when is_list(D) ->
case eunit_lib:is_string(D) of
true ->
- {data, {"directory \"" ++ D ++ "\"", get_directory_modules(D)}};
+ {data, {"directory \"" ++ D ++ "\"",
+ get_directory_module_tests(D)}};
false ->
bad_test(T)
end;
@@ -385,10 +388,10 @@ parse({S, T1} = T) when is_list(S) ->
end;
parse({S, T1}) when is_binary(S) ->
group(#group{tests = T1, desc = S});
-parse(T) when tuple_size(T) > 2, is_list(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_list(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
-parse(T) when tuple_size(T) > 2, is_binary(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_binary(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
parse(M) when is_atom(M) ->
@@ -596,7 +599,7 @@ testfuns(Es, M, TestSuffix, GeneratorSuffix) ->
%% ---------------------------------------------------------------------
-%% Getting a test set from a file
+%% Getting a test set from a file (text file or object file)
%% @throws {file_read_error, {Reason::atom(), Message::string(),
%% fileName()}}
@@ -625,17 +628,23 @@ get_file_tests(F) ->
is_module_filename(F) ->
filename:extension(F) =:= code:objfile_extension().
+objfile_test({M, File}) ->
+ {setup,
+ fun () ->
+ %% TODO: better error/stacktrace for this internal fun
+ code:purge(M),
+ {module,M} = code:load_abs(filename:rootname(File)),
+ ok
+ end,
+ {module, M}};
objfile_test(File) ->
+ objfile_test({objfile_module(File), File}).
+
+objfile_module(File) ->
try
- {module, M} = lists:keyfind(module, 1, beam_lib:info(File)),
- {setup,
- fun () ->
- %% TODO: better error/stacktrace for this internal fun
- code:purge(M),
- {module,M} = code:load_abs(filename:rootname(File)),
- ok
- end,
- {module, M}}
+ {value, {module, M}} = lists:keysearch(module, 1,
+ beam_lib:info(File)),
+ M
catch
_:_ ->
throw({file_read_error,
@@ -644,15 +653,34 @@ objfile_test(File) ->
%% ---------------------------------------------------------------------
-%% Getting a list of module names from object files in a directory
-
-%% @throws {file_read_error, {Reason::atom(), Message::string(),
-%% fileName()}}
+%% Getting a set of module tests from the object files in a directory
+
+%% @throws {file_read_error,
+%% {Reason::atom(), Message::string(), fileName()}}
+
+get_directory_module_tests(D) ->
+ Ms = get_directory_modules(D),
+ %% for all 'm' in the set, remove 'm_tests' if present
+ F = fun ({M,_}, S) ->
+ Name = atom_to_list(M),
+ case lists:suffix(?DEFAULT_TESTMODULE_SUFFIX, Name) of
+ false ->
+ Name1 = Name ++ ?DEFAULT_TESTMODULE_SUFFIX,
+ M1 = list_to_atom(Name1),
+ dict:erase(M1, S);
+ true ->
+ S
+ end
+ end,
+ [objfile_test(Obj)
+ || Obj <- dict:to_list(lists:foldl(F, dict:from_list(Ms), Ms))].
%% TODO: handle packages (recursive search for files)
-
get_directory_modules(D) ->
- [objfile_test(filename:join(D, F))
+ [begin
+ F1 = filename:join(D, F),
+ {objfile_module(F1), F1}
+ end
|| F <- eunit_lib:list_dir(D), is_module_filename(F)].
diff --git a/lib/eunit/src/eunit_server.erl b/lib/eunit/src/eunit_server.erl
index bf1bb9bcef..2cdfef2668 100644
--- a/lib/eunit/src/eunit_server.erl
+++ b/lib/eunit/src/eunit_server.erl
@@ -59,8 +59,9 @@ watch(Server, Module, Opts) when is_atom(Module) ->
watch_path(Server, Path, Opts) ->
command(Server, {watch, {path, filename:flatten(Path)}, Opts}).
+%% note that the user must use $ at the end to match whole paths only
watch_regexp(Server, Regex, Opts) ->
- case regexp:parse(Regex) of
+ case re:compile(Regex,[anchored]) of
{ok, R} ->
command(Server, {watch, {regexp, R}, Opts});
{error, _}=Error ->
@@ -278,8 +279,8 @@ is_watched(Path, St) ->
match_any(sets:to_list(St#state.regexps), Path).
match_any([R | Rs], Str) ->
- case regexp:first_match(Str, R) of
- {match, _, _} -> true;
+ case re:run(Str, R, [{capture,none}]) of
+ match -> true;
_ -> match_any(Rs, Str)
end;
match_any([], _Str) -> false.
diff --git a/lib/eunit/src/eunit_surefire.erl b/lib/eunit/src/eunit_surefire.erl
index dfb08c90b2..6e0a447105 100644
--- a/lib/eunit/src/eunit_surefire.erl
+++ b/lib/eunit/src/eunit_surefire.erl
@@ -15,7 +15,7 @@
%%
%% $Id: $
%%
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% @copyright 2009 Micka�l R�mond, Paul Guyot
%% @see eunit
%% @doc Surefire reports for EUnit (Format used by Maven and Atlassian
@@ -64,6 +64,7 @@
}).
-record(testsuite,
{
+ id = 0 :: integer(),
name = <<>> :: binary(),
time = 0 :: integer(),
output = <<>> :: binary(),
@@ -76,7 +77,7 @@
-record(state, {verbose = false,
indent = 0,
xmldir = ".",
- testsuite = #testsuite{}
+ testsuites = [] :: [#testsuite{}]
}).
start() ->
@@ -89,55 +90,60 @@ init(Options) ->
XMLDir = proplists:get_value(dir, Options, ?XMLDIR),
St = #state{verbose = proplists:get_bool(verbose, Options),
xmldir = XMLDir,
- testsuite = #testsuite{}},
+ testsuites = []},
receive
{start, _Reference} ->
St
end.
terminate({ok, _Data}, St) ->
- TestSuite = St#state.testsuite,
+ TestSuites = St#state.testsuites,
XmlDir = St#state.xmldir,
- write_report(TestSuite, XmlDir),
+ write_reports(TestSuites, XmlDir),
ok;
terminate({error, _Reason}, _St) ->
%% Don't report any errors here, since eunit_tty takes care of that.
%% Just terminate.
ok.
-handle_begin(group, Data, St) ->
+handle_begin(Kind, Data, St) when Kind == group; Kind == test ->
+ %% Run this code both for groups and tests; test is a bit
+ %% surprising: This is a workaround for the fact that we don't get
+ %% a group (handle_begin(group, ...) for testsuites (modules)
+ %% which only have one test case. In that case we get a test case
+ %% with an id comprised of just one integer - the group id.
NewId = proplists:get_value(id, Data),
case NewId of
[] ->
St;
- [_GroupId] ->
+ [GroupId] ->
Desc = proplists:get_value(desc, Data),
- TestSuite = St#state.testsuite,
- NewTestSuite = TestSuite#testsuite{name = Desc},
- St#state{testsuite=NewTestSuite};
+ TestSuite = #testsuite{id = GroupId, name = Desc},
+ St#state{testsuites=store_suite(TestSuite, St#state.testsuites)};
%% Surefire format is not hierarchic: Ignore subgroups:
_ ->
St
- end;
-handle_begin(test, _Data, St) ->
- St.
+ end.
handle_end(group, Data, St) ->
%% Retrieve existing test suite:
case proplists:get_value(id, Data) of
[] ->
St;
- [_GroupId|_] ->
- TestSuite = St#state.testsuite,
+ [GroupId|_] ->
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Update TestSuite data:
Time = proplists:get_value(time, Data),
Output = proplists:get_value(output, Data),
NewTestSuite = TestSuite#testsuite{ time = Time, output = Output },
- St#state{testsuite=NewTestSuite}
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}
end;
handle_end(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -149,7 +155,7 @@ handle_end(test, Data, St) ->
TestCase = #testcase{name = Name, description = Desc,
time = Time,output = Output},
NewTestSuite = add_testcase_to_testsuite(Result, TestCase, TestSuite),
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
%% Cancel group does not give information on the individual cancelled test case
%% We ignore this event
@@ -157,7 +163,9 @@ handle_cancel(group, _Data, St) ->
St;
handle_cancel(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -171,7 +179,7 @@ handle_cancel(test, Data, St) ->
NewTestSuite = TestSuite#testsuite{
skipped = TestSuite#testsuite.skipped+1,
testcases=[TestCase|TestSuite#testsuite.testcases] },
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
format_name({Module, Function, Arity}, Line) ->
lists:flatten([atom_to_list(Module), ":", atom_to_list(Function), "/",
@@ -183,6 +191,12 @@ format_desc(Desc) when is_binary(Desc) ->
format_desc(Desc) when is_list(Desc) ->
Desc.
+lookup_suite_by_group_id(GroupId, TestSuites) ->
+ #testsuite{} = lists:keyfind(GroupId, #testsuite.id, TestSuites).
+
+store_suite(#testsuite{id=GroupId} = TestSuite, TestSuites) ->
+ lists:keystore(GroupId, #testsuite.id, TestSuites, TestSuite).
+
%% Add testcase to testsuite depending on the result of the test.
add_testcase_to_testsuite(ok, TestCaseTmp, TestSuite) ->
TestCase = TestCaseTmp#testcase{ result = ok },
@@ -214,6 +228,10 @@ add_testcase_to_testsuite({error, Exception}, TestCaseTmp, TestSuite) ->
%% Write a report to the XML directory.
%% This function opens the report file, calls write_report_to/2 and closes the file.
%% ----------------------------------------------------------------------------
+write_reports(TestSuites, XmlDir) ->
+ lists:foreach(fun(TestSuite) -> write_report(TestSuite, XmlDir) end,
+ TestSuites).
+
write_report(#testsuite{name = Name} = TestSuite, XmlDir) ->
Filename = filename:join(XmlDir, lists:flatten(["TEST-", escape_suitename(Name)], ".xml")),
case file:open(Filename, [write, raw]) of
diff --git a/lib/eunit/src/eunit_test.erl b/lib/eunit/src/eunit_test.erl
index d322c4b420..9ac1d1e7d9 100644
--- a/lib/eunit/src/eunit_test.erl
+++ b/lib/eunit/src/eunit_test.erl
@@ -131,12 +131,27 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,"[ _ ]"},
+ {pattern,"[ _ ]"},
{value,[]}]},
_}}
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotMatch(ok, error),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotMatch([_], [42]),
+ {error,{error,{assertNotMatch_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,"[ _ ]"},
+ {value,[42]}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertEqual(ok, ok),
{ok, ok} = run_testfun(F)
end),
@@ -152,6 +167,20 @@ macro_test_() ->
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotEqual(1, 0),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotEqual(2, 1+1),
+ {error,{error,{assertNotEqual_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {value,2}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertException(error, badarith,
erlang:error(badarith)),
{ok, ok} = run_testfun(F)
@@ -162,7 +191,7 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
{unexpected_success,ok}]},
_}}
= run_testfun(F)
@@ -174,15 +203,48 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
+ {unexpected_exception,
+ {error,badarith,_}}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertError(badarith,
+ erlang:error(badarith)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertExit(normal, exit(normal)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertThrow(foo, throw(foo)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith, 42),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarg)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarith)),
+ {error,{error,{assertNotException_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,_},
{unexpected_exception,
{error,badarith,_}}]},
_}}
= run_testfun(F)
end)
]}.
-
-under_eunit_test() -> ?assert(?UNDER_EUNIT).
-endif.
diff --git a/lib/eunit/src/eunit_tests.erl b/lib/eunit/src/eunit_tests.erl
index 37c0b4d6ae..a63d102d98 100644
--- a/lib/eunit/src/eunit_tests.erl
+++ b/lib/eunit/src/eunit_tests.erl
@@ -26,17 +26,17 @@
-include("eunit.hrl").
-ifdef(TEST).
-%% Cause all the other modules to be tested as well as this one.
-full_test_() ->
- %%{application, eunit}. % this currently causes a loop
- %% We use the below until loop detection is implemented
- [eunit_autoexport,
- eunit_striptests,
- eunit_server,
- eunit_proc,
- eunit_serial,
- eunit_test,
- eunit_lib,
- eunit_data,
- eunit_tty].
+id(X) -> X. % for suppressing compiler warnings
-endif.
+
+under_eunit_test() -> ?assert(?UNDER_EUNIT).
+
+let_test() -> ?assertEqual(42, ?LET(X, 17, X+25)).
+
+if_test_() ->
+ [?_assertEqual(17, ?IF(id(1) > 0, 17, 42)),
+ ?_assertEqual(42, ?IF(id(1) < 0, 17, 42))].
+
+matches_test_() ->
+ [?_assert(?MATCHES("hel"++_, "hello")),
+ ?_assertNot(?MATCHES("hal"++_, "hello"))].
diff --git a/lib/eunit/vsn.mk b/lib/eunit/vsn.mk
index d7edd7977b..d933085bbc 100644
--- a/lib/eunit/vsn.mk
+++ b/lib/eunit/vsn.mk
@@ -1 +1 @@
-EUNIT_VSN = 2.1.7
+EUNIT_VSN = 2.2.0
diff --git a/lib/gs/src/Makefile b/lib/gs/src/Makefile
index a648d3cf13..b3f11fb71b 100644
--- a/lib/gs/src/Makefile
+++ b/lib/gs/src/Makefile
@@ -90,7 +90,7 @@ clean:
# Special Build Targets
# ----------------------------------------------------
-gstk_generic.hrl: gs_make.erl
+gstk_generic.hrl: gs_make.erl ../ebin/gs.$(EMULATOR)
$(ERL) -pa $(EBIN) -s gs_make -s erlang halt -noshell
$(APP_TARGET): $(APP_SRC) ../vsn.mk
@@ -99,6 +99,8 @@ $(APP_TARGET): $(APP_SRC) ../vsn.mk
$(APPUP_TARGET): $(APPUP_SRC) ../vsn.mk
sed -e 's;%VSN%;$(VSN);' $< > $@
+$(GSTK_GENERIC_TARGET): gstk_generic.hrl
+
# ----------------------------------------------------
# Release Target
# ----------------------------------------------------
diff --git a/lib/hipe/cerl/erl_bif_types.erl b/lib/hipe/cerl/erl_bif_types.erl
index 64a695129b..43c2ac2615 100644
--- a/lib/hipe/cerl/erl_bif_types.erl
+++ b/lib/hipe/cerl/erl_bif_types.erl
@@ -672,6 +672,9 @@ type(erlang, call_on_load_function, 1, Xs) ->
type(erlang, cancel_timer, 1, Xs) ->
strict(arg_types(erlang, cancel_timer, 1), Xs,
fun (_) -> t_sup(t_integer(), t_atom('false')) end);
+type(erlang, check_old_code, 1, Xs) ->
+ strict(arg_types(erlang, check_old_code, 1), Xs,
+ fun (_) -> t_boolean() end);
type(erlang, check_process_code, 2, Xs) ->
strict(arg_types(erlang, check_process_code, 2), Xs,
fun (_) -> t_boolean() end);
@@ -795,7 +798,8 @@ type(erlang, get_module_info, 2, Xs) ->
end
end);
type(erlang, get_stacktrace, 0, _) ->
- t_list(t_tuple([t_atom(), t_atom(), t_sup([t_arity(), t_list()])]));
+ t_list(t_tuple([t_atom(), t_atom(), t_sup([t_arity(), t_list()]),
+ t_list()]));
type(erlang, group_leader, 0, _) -> t_pid();
type(erlang, group_leader, 2, Xs) ->
strict(arg_types(erlang, group_leader, 2), Xs,
@@ -3393,6 +3397,8 @@ arg_types(erlang, call_on_load_function, 1) ->
[t_atom()];
arg_types(erlang, cancel_timer, 1) ->
[t_reference()];
+arg_types(erlang, check_old_code, 1) ->
+ [t_atom()];
arg_types(erlang, check_process_code, 2) ->
[t_pid(), t_atom()];
arg_types(erlang, crc32, 1) ->
@@ -3707,7 +3713,10 @@ arg_types(erlang, purge_module, 1) ->
arg_types(erlang, put, 2) ->
[t_any(), t_any()];
arg_types(erlang, raise, 3) ->
- [t_raise_errorclass(), t_any(), type(erlang, get_stacktrace, 0, [])];
+ OldStyleType = t_list(t_tuple([t_atom(), t_atom(),
+ t_sup([t_arity(), t_list()])])),
+ NewStyleType = type(erlang, get_stacktrace, 0, []),
+ [t_raise_errorclass(), t_any(), t_sup(OldStyleType, NewStyleType)];
arg_types(erlang, read_timer, 1) ->
[t_reference()];
arg_types(erlang, ref_to_list, 1) ->
diff --git a/lib/hipe/icode/hipe_beam_to_icode.erl b/lib/hipe/icode/hipe_beam_to_icode.erl
index d7eb035551..f557d3419e 100644
--- a/lib/hipe/icode/hipe_beam_to_icode.erl
+++ b/lib/hipe/icode/hipe_beam_to_icode.erl
@@ -281,10 +281,14 @@ needs_redtest(Leafness) ->
%%-----------------------------------------------------------------------
%%--- label & func_info combo ---
+trans_fun([{label,_}=F,{func_info,_,_,_}=FI|Instructions], Env) ->
+ %% Handle old code without a line instruction.
+ trans_fun([F,{line,[]},FI|Instructions], Env);
trans_fun([{label,B},{label,_},
{func_info,M,F,A},{label,L}|Instructions], Env) ->
trans_fun([{label,B},{func_info,M,F,A},{label,L}|Instructions], Env);
trans_fun([{label,B},
+ {line,_},
{func_info,{atom,_M},{atom,_F},_A},
{label,L}|Instructions], Env) ->
%% Emit code to handle function_clause errors. The BEAM test instructions
@@ -1142,6 +1146,11 @@ trans_fun([{trim,N,NY}|Instructions], Env) ->
Moves = trans_trim(N, NY),
Moves ++ trans_fun(Instructions, Env);
%%--------------------------------------------------------------------
+%% New line/1 instruction in R15.
+%%--------------------------------------------------------------------
+trans_fun([{line,_}|Instructions], Env) ->
+ trans_fun(Instructions,Env);
+%%--------------------------------------------------------------------
%%--- ERROR HANDLING ---
%%--------------------------------------------------------------------
trans_fun([X|_], _) ->
@@ -1869,6 +1878,8 @@ patch_make_funs([], FunIndex, Acc) ->
find_mfa([{label,_}|Code]) ->
find_mfa(Code);
+find_mfa([{line,_}|Code]) ->
+ find_mfa(Code);
find_mfa([{func_info,{atom,M},{atom,F},A}|_])
when is_atom(M), is_atom(F), is_integer(A), 0 =< A, A =< 255 ->
{M, F, A}.
diff --git a/lib/hipe/main/hipe.hrl.src b/lib/hipe/main/hipe.hrl.src
index a1fbeda9cf..ec55c707ef 100644
--- a/lib/hipe/main/hipe.hrl.src
+++ b/lib/hipe/main/hipe.hrl.src
@@ -50,9 +50,8 @@
%% Flags:
%% DEBUG - Turns on debugging. (Can be defined to a integer
%% value to determine the level of debugging)
-%% VERBOSE - More info is printed...
%% HIPE_LOGGING - Turn on logging of messages with erl_logger.
-%% DO_ASSERT - Turn on Assertions.
+%% DO_ASSERT - Turn on assertions.
%% TIMING - Turn on timing.
%% HIPE_INSTRUMENT_COMPILER - Turn on instrumentation of the compiler.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
@@ -107,13 +106,9 @@
%%
%% Define the exit macro
%%
--ifdef(VERBOSE).
--define(EXIT(Reason), erlang:error({?MODULE,?LINE,Reason})).
--else.
-define(EXIT(Reason),
?msg("EXITED with reason ~w @~w:~w\n", [Reason,?MODULE,?LINE]),
erlang:error({?MODULE,?LINE,Reason})).
--endif.
%%
%% Assertions.
diff --git a/lib/ic/c_src/Makefile.in b/lib/ic/c_src/Makefile.in
index 6eef7827b9..28040ca42d 100644
--- a/lib/ic/c_src/Makefile.in
+++ b/lib/ic/c_src/Makefile.in
@@ -125,13 +125,9 @@ docs:
# Special Build Targets
# ----------------------------------------------------
-$(OBJDIR):
- -mkdir -p $(OBJDIR)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
-$(LIBDIR):
- -mkdir -p $(LIBDIR)
-
-$(LIBRARY): $(OBJDIR) $(LIBDIR) $(OBJ_FILES)
+$(LIBRARY): $(OBJ_FILES)
-$(AR) $(AR_OUT) $@ $(OBJ_FILES)
-$(RANLIB) $@
diff --git a/lib/ic/doc/src/notes.xml b/lib/ic/doc/src/notes.xml
index 5f6c31069c..de519d5f84 100644
--- a/lib/ic/doc/src/notes.xml
+++ b/lib/ic/doc/src/notes.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>1998</year><year>2010</year>
+ <year>1998</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -31,6 +31,22 @@
</header>
<section>
+ <title>IC 4.2.27</title>
+
+ <section>
+ <title>Improvements and New Features</title>
+ <list type="bulleted">
+ <item>
+ <p>
+ Reduced compile overhead (Thanks to Haitao Li).</p>
+ <p>
+ Own Id: OTP-9460 </p>
+ </item>
+ </list>
+ </section>
+ </section>
+
+ <section>
<title>IC 4.2.26</title>
<section>
diff --git a/lib/ic/examples/pre_post_condition/Makefile b/lib/ic/examples/pre_post_condition/Makefile
index 68e2168e1e..85cbbdb9ff 100644
--- a/lib/ic/examples/pre_post_condition/Makefile
+++ b/lib/ic/examples/pre_post_condition/Makefile
@@ -108,9 +108,14 @@ docs:
test: $(TEST_TARGET_FILES)
-$(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES): ex.idl
+IDL-GENERATED: ex.idl
erlc $(ERL_LOCAL_FLAGS) +'{precond,{tracer,pre}}' \
+'{{postcond,"m::i::f"},{tracer,post}}' ex.idl
+ >IDL-GENERATED
+
+$(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf b/lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf
deleted file mode 100644
index 34e5586175..0000000000
--- a/lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf
+++ /dev/null
@@ -1 +0,0 @@
-Dummy to speed up compilatio
diff --git a/lib/ic/src/ic_pp.erl b/lib/ic/src/ic_pp.erl
index db06118d32..8b53473caa 100644
--- a/lib/ic/src/ic_pp.erl
+++ b/lib/ic/src/ic_pp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -92,6 +92,14 @@
%%
%%======================================================================================
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+-record(mio, {valid = true, %% multiple include valid
+ cmacro, %% controlling macro of the current conditional directive
+ depth = 0, %% conditional directive depth
+ included = []}).
@@ -130,7 +138,7 @@ run(FileList, FileName, IncDir, Flags) ->
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
- {Out, Err, War, _Defs, IfCou} = expand(File, FileName, IncDir, Flags),
+ {Out, Err, War, _Defs, _Mio, IfCou} = expand(File, FileName, IncDir, Flags),
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -155,9 +163,9 @@ run(FileList, FileName, IncDir, Flags) ->
%% The entry for all included files
%%
%%
-%% Output {Out, Defs, Err, War}
+%% Output {Out, Err, War, Defs, MultipleIncludeValid}
%%======================================================================================
-run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir) ->
+run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir, Mio) ->
%%----------------------------------------------------------
%% Run the first phase, i.e tokenise the file
@@ -169,18 +177,21 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
-
- %% Try first pass without file info start/end
- {OutT, ErrT, WarT, DefsT, IfCouT} =
- expand(File, Defs, Err, War, [FileName|IncFile], IncDir),
-
- {Out2, Err2, War2, Defs2, IfCou2} =
- case only_nls(OutT) of
- true -> %% The file is defined before
- {["\n"], ErrT, WarT, DefsT, IfCouT};
- false -> %% The file is not defined before, try second pass
- expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War, [FileName|IncFile], IncDir)
- end,
+ {Out2, Err2, War2, Defs2, Mio2, IfCou2} =
+ expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War,
+ [FileName|IncFile], IncDir,
+ #mio{included=Mio#mio.included}),
+
+ MergeIncluded = sets:to_list(sets:from_list(Mio#mio.included ++ Mio2#mio.included)),
+
+ Mio3 =
+ case {Mio2#mio.valid, Mio2#mio.cmacro} of
+ {V, Macro} when V == false;
+ Macro == undefined ->
+ update_mio(Mio#mio{included=MergeIncluded});
+ {true, _} ->
+ update_mio({include, FileName}, Mio#mio{included=MergeIncluded})
+ end,
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -192,26 +203,7 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
[]
end,
- {Out2, Defs2, Err2++IfError, War2}.
-
-
-
-%% Return true if there is no data
-%% other than new lines
-only_nls([]) ->
- true;
-only_nls(["\n"|Rem]) ->
- only_nls(Rem);
-only_nls(["\r","\n"|Rem]) ->
- only_nls(Rem);
-only_nls([_|_Rem]) ->
- false.
-
-
-
-
-
-
+ {Out2, Defs2, Err2++IfError, War2, Mio3}.
@@ -647,87 +639,86 @@ expand(List, FileName, IncDir, Flags) ->
%% Get all definitions from preprocessor commnads
%% and merge them on top of the file collected.
CLDefs = get_cmd_line_defs(Flags),
- expand(List, [], [], CLDefs, [FileName], IncDir, check_all, [], [], 1, FileName).
-
-expand(List, Defs, Err, War, [FileName|IncFile], IncDir) ->
- expand(List, [], [], Defs, [FileName|IncFile], IncDir, check_all, Err, War, 1, FileName).
+ expand(List, [], [], CLDefs, [FileName], IncDir, #mio{}, check_all, [], [], 1, FileName).
+expand(List, Defs, Err, War, [FileName|IncFile], IncDir, Mio) ->
+ expand(List, [], [], Defs, [FileName|IncFile], IncDir, Mio, check_all, Err, War, 1, FileName).
%%=======================================================
%% Main loop for the expansion
%%=======================================================
-expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, IfCou, Err, War, _L, _FN) ->
+expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, Mio, IfCou, Err, War, _L, _FN) ->
% io:format("~n ===============~n"),
% io:format(" definitions ~p~n",[lists:reverse(Defs)]),
% io:format(" found warnings ~p~n",[lists:reverse(War)]),
% io:format(" found errors ~p~n",[lists:reverse(Err)]),
% io:format(" ===============~n~n~n"),
- {Out, Err, War, Defs, IfCou};
+ {Out, Err, War, Defs, Mio, IfCou};
-expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
%%---------------------------------------
%% Searching for endif,
%% i.e skip all source lines until matching
%% end if is encountered
%%---------------------------------------
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifdef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifndef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "if" ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{{'if', true}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Rem2, Err2, War2, Nl} -> Not implemented yet
{{'if', error}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN)
end;
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "endif" ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
case Endif of
1 ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L+Nl, FN);
_ ->
IfCou2 = {endif, Endif-1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L+Nl, FN)
end;
-expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
%% Solves a bug when spaces in front of hashmark !
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
@@ -736,121 +727,132 @@ expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine},
%%---------------------------------------
%% Check all tokens
%%---------------------------------------
-expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+1, FN);
+expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L+1, FN);
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN) ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN) ->
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{define, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{undef, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{{include, ok}, FileName, FileCont, Rem2, Nl, Err2, War2} ->
- {Out3, Defs3, Err3, War3} =
- run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir),
+ {Out3, Defs3, Err3, War3, Mio2} =
+ run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir, Mio),
Nls = [],
Out4 = Out3++Nls++Out,
- expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, check_all, Err3, War3, L+Nl, FN);
+ expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, Mio2, check_all, Err3, War3, L+Nl, FN);
{{include, error}, Rem2, Nl, Err2, War2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
+
+ {{include, skip}, Rem2} ->
+ Out2 = [$\n|Out],
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+1, FN);
{{ifdef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
{{ifdef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(ifdef, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{ifndef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
- {{ifndef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
+ {{ifndef, false}, Macro, Rem2, Err2, War2, Nl} ->
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio({ifndef, Macro}, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{endif, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(endif, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{'if', true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Removed, Rem2, Nl} -> Not implemented at present
{{'if', error}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio('if', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{'else', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`else' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('else', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{'elif', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`elif' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('elif', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{warning, {WarningText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
War2 = {FileName, L, "warning: #warning "++detokenise(WarningText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, [War2|War], L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, [War2|War], L+Nl, FN);
{error, {ErrorText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
Err2 = {FileName, L, detokenise(ErrorText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
{{line, ok}, {_Removed, Rem2, Nl}, L2, FN2, LineText} ->
Out2 = lists:duplicate(Nl,$\n)++LineText++Out,
[_X|IF] = IncFile,
IncFile2 = [FN2|IF],
- expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, check_all, Err, War, L2, FN2);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, update_mio(Mio), check_all, Err, War, L2, FN2);
{{line, error}, {_Removed, Rem2, Nl}, Err2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
hash_mark ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN);
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN);
{pragma, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{ident, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{not_recognised, {Removed, Rem2, Nl}} ->
Text = lists:reverse([$#|Command]),
RemovedS = lists:reverse([?space|detokenise(Removed)]),
Out2 = [$\n|RemovedS]++Text++Out,
+ Mio2 = update_mio(Mio),
case Command of
[X|_T] when ?is_upper(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_lower(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_underline(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
_ ->
Err2 = {FN, L, "invalid preprocessing directive name"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN)
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN)
end;
Else ->
@@ -859,19 +861,19 @@ expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all
end;
-expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
LL = io_lib:format("~p",[L]),
- expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, Mio, IncDir, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{Y,M,D},{_H,_Mi,_S}} = calendar:universal_time(),
Date = io_lib:format("\"~s ~p ~p\"",[month(M),D,Y]),
- expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{_Y,_M,_D},{H,Mi,S}} = calendar:universal_time(),
HS = if H < 10 -> "0"++integer_to_list(H);
true -> integer_to_list(H)
@@ -883,40 +885,40 @@ expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err,
true -> integer_to_list(S)
end,
Time = io_lib:format("\"~s:~s:~s\"",[HS,MiS,SS]),
- expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
IL = io_lib:format("~p",[length(IncFile)-1]),
- expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
[BF|_T] = lists:reverse(IncFile),
- expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Out2, Err2, War2, Rem2, SelfRef2} =
source_line(Var, Rem, SelfRef, Defs, Err, War, L, FN),
- expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, IfCou, Err2, War2, L, FN);
+ expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err2, War2, L, FN);
-expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
SelfRef2 = lists:delete(Str,SelfRef),
- expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Str2, Rem2, Nl} = expand_string_part([$"|Str], Rem),
- expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+Nl, FN).
+ expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L+Nl, FN).
@@ -954,13 +956,14 @@ expand_string_part([{string_part, Str_part} | Rem], Str, Nl) ->
get_cmd_line_defs(Flags) ->
Adjusted = parse_cmd_line(Flags,[]),
- {_Out, _Err, _War, Defs, _IfCou} =
+ {_Out, _Err, _War, Defs, _IfCou, _Mio} =
expand(tokenise(Adjusted,""),
[],
[],
[],
[],
[],
+ #mio{},
check_all,
[],
[],
@@ -1030,10 +1033,10 @@ collect_undefine([C|Rest],Found) ->
%%======================================================================================
%%======================================================================================
-pp_command(Command, [space|File], Defs, IncDir, Err, War, L, FN) ->
- pp_command(Command, File, Defs, IncDir, Err, War, L, FN);
+pp_command(Command, [space|File], Defs, IncDir, Mio, Err, War, L, FN) ->
+ pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN);
-pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
+pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN) ->
case Command of
%%----------------------------------------
@@ -1081,14 +1084,16 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
%% #include
%%----------------------------------------
"include" ->
- case include(File, IncDir) of
- {error, Rem, Nl, Err2} ->
- {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
- {error, Rem, Nl, Err2, NameNl} ->
- {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
- {ok, FileName, FileCont, Rem, Nl} ->
- {{include, ok}, FileName, FileCont, Rem, Nl, Err, War}
- end;
+ case include(File, IncDir, Mio) of
+ {error, Rem, Nl, Err2} ->
+ {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
+ {error, Rem, Nl, Err2, NameNl} ->
+ {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
+ {ok, FileNamePath, FileCont, Rem, Nl} ->
+ {{include, ok}, FileNamePath, FileCont, Rem, Nl, Err, War};
+ {skip, Rem} ->
+ {{include, skip}, Rem}
+ end;
%%----------------------------------------
%% #ifdef
@@ -1127,14 +1132,14 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end;
{ok, Rem, Name, No_of_para, _Parameters, _Macro, Err2, War2, Nl} ->
case is_defined_before(Name, No_of_para, Defs) of
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end
end;
@@ -1408,29 +1413,32 @@ undef(_Rem) ->
%%===============================================================
%%===============================================================
-include(File, IncDir) ->
+include(File, IncDir, Mio) ->
case include2(File) of
- {ok, FileName, Rem, Nl, FileType} ->
- %% The error handling is lite strange just to make it compatible to gcc
- case {read_inc_file(FileName, IncDir), Nl, FileType} of
- {{ok, FileList, FileNamePath}, _, _} ->
- {ok, FileNamePath, FileList, Rem, Nl};
- {{error, Text}, _, own_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, Text}, 1, sys_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, _Text}, _, sys_file} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
- end;
-
- {error, {_Removed, Rem, Nl}} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ {ok, FileName, Rem, Nl, FileType} ->
+ Result = read_inc_file(FileName, IncDir, Mio),
+ case {Result, Nl, FileType} of
+ {{ok, FileNamePath, FileCont}, _, _} ->
+ {ok, FileNamePath, FileCont, Rem, Nl};
+ {skip, _, _} ->
+ {skip, Rem};
+ {{error, Text}, _, own_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, Text}, 1, sys_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, _Text}, _, sys_file} ->
+ {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ end;
+ {error, {_Removed, Rem, Nl}} ->
+ {error, Rem, Nl, "`#include' expects \#FILENAME\" or <FILENAME>"}
end.
+
+
count_nl([],Nl) ->
Nl;
count_nl([$\n|T],Nl) ->
@@ -1909,18 +1917,37 @@ include_dir(Flags,IncDir) ->
%% Read a included file. Try current dir first then the IncDir list
%%===============================================================
-read_inc_file(FileName, IncDir) ->
- case catch file:read_file(FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, FileName};
+read_inc_file(FileName, IncDir, Mio) ->
+ case find_inc_file(FileName, IncDir) of
+ {ok, AbsFile} ->
+ %% is included before?
+ case lists:member(FileName, Mio#mio.included) of
+ false ->
+ case catch file:read_file(AbsFile) of
+ {ok, Bin} ->
+ FileList = binary_to_list(Bin),
+ {ok, AbsFile, FileList};
+ {error, Text} ->
+ {error, Text}
+ end;
+ true ->
+ skip
+ end;
+ {error, Text} ->
+ {error, Text}
+ end.
+
+find_inc_file(FileName, IncDir) ->
+ case catch file:read_file_info(FileName) of
+ {ok, _} ->
+ {ok, FileName};
{error, _} ->
- read_inc_file2(FileName, IncDir)
+ find_inc_file2(FileName, IncDir)
end.
-read_inc_file2(_FileName, []) ->
+find_inc_file2(_FileName, []) ->
{error, "No such file or directory"};
-read_inc_file2(FileName, [D|Rem]) ->
+find_inc_file2(FileName, [D|Rem]) ->
Dir = case lists:last(D) of
$/ ->
D;
@@ -1928,17 +1955,14 @@ read_inc_file2(FileName, [D|Rem]) ->
D++"/"
end,
- case catch file:read_file(Dir++FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, Dir++FileName};
+ case catch file:read_file_info(Dir++FileName) of
+ {ok, _} ->
+ {ok, Dir++FileName};
{error, _} ->
- read_inc_file2(FileName, Rem)
+ find_inc_file2(FileName, Rem)
end.
-
-
%%===============================================================
%% Read parameters of a macro or a variable in a source line
%%===============================================================
@@ -2135,5 +2159,73 @@ month(11) -> "Nov";
month(12) -> "Dec".
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+update_mio({include, FileName}, #mio{included=Inc}=Mio) ->
+ Mio#mio{valid=false, included=[FileName|Inc]};
+
+%% valid=false & cmacro=undefined indicates it is already decided this file is
+%% not subject to MIO
+update_mio(_, #mio{valid=false, depth=0, cmacro=undefined}=Mio) ->
+ Mio;
+
+%% if valid=true, there is no non-whitespace tokens before this ifndef
+update_mio({'ifndef', Macro}, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, cmacro=Macro, depth=1};
+
+%% detect any tokens before top level #ifndef
+update_mio(_, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false};
+
+%% If cmacro is alreay set, this is after the top level #endif
+update_mio({'ifndef', _}, #mio{valid=true, depth=0}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+
+%% non-top level conditional, just update depth
+update_mio({'ifndef', _}, #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{depth=D+1};
+update_mio('ifdef', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+update_mio('if', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+
+%% top level #else #elif invalidates multiple include optimization
+update_mio('else', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('else', Mio) ->
+ Mio;
+update_mio('elif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('elif', Mio) ->
+ Mio;
+
+%% AT exit to top level, if the controlling macro is not set, this could be the
+%% end of a non-ifndef conditional block, or there were tokens before entering
+%% the #ifndef block. In either way, this invalidates the MIO
+%%
+%% It doesn't matter if `valid` is true at the time of exiting, it is set to
+%% true. This will be used to detect if more tokens are following the top
+%% level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=true, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 1 ->
+ Mio#mio{valid=true, depth=D-1};
+
+%%if more tokens are following the top level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{valid=true, depth=D-1};
+update_mio(_, Mio) ->
+ Mio#mio{valid=false}.
+
+%% clear `valid`, this doesn't matter since #endif will restore it if
+%% appropriate
+update_mio(Mio) ->
+ Mio#mio{valid=false}.
diff --git a/lib/ic/src/ic_pragma.erl b/lib/ic/src/ic_pragma.erl
index 45cb64c9c8..7f2216b9dc 100644
--- a/lib/ic/src/ic_pragma.erl
+++ b/lib/ic/src/ic_pragma.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1998-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1998-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -1600,9 +1600,8 @@ remove_inheriters(S,RS,InheriterList) ->
[_OneOnly] ->
ReducedInhList;
_Other ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits,'_','_'}),
% CodeOptList =
% [X || X <- EtsList, element(1,X) == codeopt],
NoInheriters =remove_inheriters2(S,ReducedInhList,CleanList),
@@ -1648,9 +1647,8 @@ remove_inh([X],[Y],List,EtsList) ->
%%% from others in the list
%%%----------------------------------------------
remove_inherited(S,InheriterList) ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits, '_', '_'}),
remove_inherited(S,InheriterList,CleanList).
@@ -1694,11 +1692,8 @@ remove_inhed([X],[Y],List,EtsList) ->
%% are inherited from scope in the list
%%%----------------------------------------------
get_inherited(S,Scope,OpScopeList) ->
- EtsList = ets:tab2list(S),
- [[element(3,X)] || X <- EtsList,
- element(1,X) == inherits,
- element(2,X) == Scope,
- member([element(3,X)],OpScopeList)].
+ EtsList1 = ets:match(S, {inherits, Scope, '$1'}),
+ [X || X <- EtsList1, member(X, OpScopeList)].
@@ -1771,9 +1766,7 @@ inherits2(_X,Y,Z,EtsList) ->
%% false otherwise
%%
is_inherited_by(Interface1,Interface2,PragmaTab) ->
- FullList = ets:tab2list(PragmaTab),
- InheritsList =
- [X || X <- FullList, element(1,X) == inherits],
+ InheritsList = ets:match(PragmaTab, {inherits, '_', '_'}),
inherits(Interface2,Interface1,InheritsList).
diff --git a/lib/ic/vsn.mk b/lib/ic/vsn.mk
index 6d6c7fa625..6561ccd2a7 100644
--- a/lib/ic/vsn.mk
+++ b/lib/ic/vsn.mk
@@ -1 +1 @@
-IC_VSN = 4.2.26
+IC_VSN = 4.2.27
diff --git a/lib/jinterface/java_src/Makefile b/lib/jinterface/java_src/Makefile
index 755ef46a8b..19f99831eb 100644
--- a/lib/jinterface/java_src/Makefile
+++ b/lib/jinterface/java_src/Makefile
@@ -29,9 +29,7 @@ VSN=$(JINTERFACE_VSN)
# Common Macros
# ----------------------------------------------------
-# call recursive make explicitly below
-# due to separate makefiles for Ronja & OTP
-# SUB_DIRECTORIES = com/ericsson/otp/erlang
+SUB_DIRECTORIES = com/ericsson/otp/erlang
SPECIAL_TARGETS =
@@ -51,15 +49,5 @@ POM_SRC= $(POM_FILE).src
$(POM_TARGET): $(POM_SRC) ../vsn.mk
sed -e 's;%VSN%;$(VSN);' $< > $@
-# ----------------------------------------------------
-# Default Subdir Targets
-# ----------------------------------------------------
-
-.PHONY: debug opt instr release docs release_docs tests release_tests clean depend
-
-debug opt instr release docs release_docs tests release_tests clean depend: $(TARGET_FILES)
- set -e; set -x; \
- case "$(MAKE)" in *clearmake*) tflag="-T";; *) tflag="";; esac; \
- if test -f com/ericsson/otp/erlang/ignore_config_record.inf; then xflag=$$tflag; fi; \
- (cd com/ericsson/otp/erlang && $(MAKE) -f Makefile.otp $$xflag $@)
+include $(ERL_TOP)/make/otp_subdir.mk
diff --git a/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile.otp b/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile
index d0ff9cda34..e772a2b0a5 100644
--- a/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile.otp
+++ b/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile
@@ -96,7 +96,7 @@ docs:
# include $(ERL_TOP)/make/otp_release_targets.mk
release release_docs release_tests release_html:
- $(MAKE) -f Makefile.otp $(MFLAGS) RELEASE_PATH=$(RELEASE_PATH) $(TARGET_MAKEFILE) $@_spec
+ $(MAKE) $(MFLAGS) RELEASE_PATH=$(RELEASE_PATH) $(TARGET_MAKEFILE) $@_spec
release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/java_src/com/ericsson/otp/erlang
diff --git a/lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf b/lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf
deleted file mode 100644
index 0a5053eba3..0000000000
--- a/lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf
+++ /dev/null
@@ -1 +0,0 @@
-This file makes clearmake use the -T switch for this subdirectory
diff --git a/lib/kernel/doc/src/gen_sctp.xml b/lib/kernel/doc/src/gen_sctp.xml
index b761b6bd83..cc49090386 100644
--- a/lib/kernel/doc/src/gen_sctp.xml
+++ b/lib/kernel/doc/src/gen_sctp.xml
@@ -63,14 +63,13 @@
<item><seealso marker="#options">SCTP SOCKET OPTIONS</seealso></item>
<item><seealso marker="#examples">SCTP EXAMPLES</seealso></item>
<item><seealso marker="#seealso">SEE ALSO</seealso></item>
- <item><seealso marker="#authors">AUTHORS</seealso></item>
</list>
<marker id="types"></marker>
</section>
<datatypes>
<datatype>
- <name name="assoc_id"/>
+ <name><marker id="type-assoc_id">assoc_id()</marker></name>
<desc>
<p>An opaque term returned in for example #sctp_paddr_change{}
that identifies an association for an SCTP socket. The term
@@ -80,36 +79,18 @@
</desc>
</datatype>
<datatype>
- <name name="hostname"/>
- </datatype>
- <datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of an SCTP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="sctp_option"/>
+ <name name="option"/>
<desc>
<p>One of the
<seealso marker="#options">SCTP Socket Options.</seealso></p>
- <marker id="type-sctp_socket"></marker>
</desc>
</datatype>
<datatype>
- <name name="sctp_socket"/>
+ <name name="option_name"/>
+ <desc><marker id="type-sctp_socket"></marker></desc>
+ </datatype>
+ <datatype>
+ <name><marker id="type-sctp_socket">sctp_socket()</marker></name>
<desc>
<p>Socket identifier returned from <c>open/*</c>.</p>
<marker id="exports"></marker>
@@ -175,8 +156,8 @@
#sctp_assoc_change{
state = atom(),
error = atom(),
- outbound_streams = int(),
- inbound_streams = int(),
+ outbound_streams = integer(),
+ inbound_streams = integer(),
assoc_id = assoc_id()
} </pre>
<p>The number of outbound and inbound streams can be set by
@@ -300,6 +281,19 @@
The default <c><anno>IP</anno></c> and <c><anno>Port</anno></c> are <c>any</c>
and <c>0</c>, meaning bind to all local addresses on any
one free port.</p>
+
+ <p>Other options are:</p>
+ <taglist>
+ <tag><c>inet6</c></tag>
+ <item>
+ <p>Set up the socket for IPv6.</p>
+ </item>
+ <tag><c>inet</c></tag>
+ <item>
+ <p>Set up the socket for IPv4. This is the default.</p>
+ </item>
+ </taglist>
+
<p>A default set of socket <seealso marker="#options">options</seealso>
is used. In particular, the socket is opened in
<seealso marker="#option-binary">binary</seealso> and
@@ -350,7 +344,7 @@
#sctp_paddr_change{
addr = {ip_address(),port()},
state = atom(),
- error = int(),
+ error = integer(),
assoc_id = assoc_id()
} </pre>
<p>Indicates change of the status of the peer's IP address given by
@@ -387,7 +381,7 @@
<pre>
#sctp_send_failed{
flags = true | false,
- error = int(),
+ error = integer(),
info = #sctp_sndrcvinfo{},
assoc_id = assoc_id()
data = binary()
@@ -407,7 +401,7 @@
<item>
<pre>
#sctp_adaptation_event{
- adaptation_ind = int(),
+ adaptation_ind = integer(),
assoc_id = assoc_id()
} </pre>
<p>Delivered when a peer sends an Adaptation Layer Indication
@@ -505,7 +499,7 @@
</list>
<marker id="option-buffer"></marker>
</item>
- <tag><c>{buffer, int()}</c></tag>
+ <tag><c>{buffer, integer()}</c></tag>
<item>
<p>Determines the size of the user-level software buffer used by
the SCTP driver. Not to be confused with <c>sndbuf</c>
@@ -515,7 +509,7 @@
In fact, the <c>val(buffer)</c> is automatically set to
the above maximum when <c>sndbuf</c> or <c>recbuf</c> values are set.</p>
</item>
- <tag><c>{tos, int()}</c></tag>
+ <tag><c>{tos, integer()}</c></tag>
<item>
<p>Sets the Type-Of-Service field on the IP datagrams being sent,
to the given value, which effectively determines a prioritization
@@ -523,7 +517,7 @@
are system-dependent. TODO: we do not provide
symbolic names for these values yet.</p>
</item>
- <tag><c>{priority, int()}</c></tag>
+ <tag><c>{priority, integer()}</c></tag>
<item>
<p>A protocol-independent equivalent of <c>tos</c> above. Setting
priority implies setting tos as well.</p>
@@ -542,7 +536,7 @@
required for high-throughput servers).</p>
<marker id="option-linger"></marker>
</item>
- <tag><c>{linger, {true|false, int()}</c></tag>
+ <tag><c>{linger, {true|false, integer()}</c></tag>
<item>
<p>Determines the timeout in seconds for flushing unsent data in the
<c>gen_sctp:close/1</c> socket call. If the 1st component of the value
@@ -552,14 +546,14 @@
the flushing time-out in seconds.</p>
<marker id="option-sndbuf"></marker>
</item>
- <tag><c>{sndbuf, int()}</c></tag>
+ <tag><c>{sndbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* send buffer for this socket.
Sending errors would occur for datagrams larger than
<c>val(sndbuf)</c>. Setting this option also adjusts
the size of the driver buffer (see <c>buffer</c> above).</p>
</item>
- <tag><c>{recbuf, int()}</c></tag>
+ <tag><c>{recbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* recv buffer for this socket.
Sending errors would occur for datagrams larger than
@@ -571,9 +565,9 @@
<pre>
#sctp_rtoinfo{
assoc_id = assoc_id(),
- initial = int(),
- max = int(),
- min = int()
+ initial = integer(),
+ max = integer(),
+ min = integer()
} </pre>
<p>Determines re-transmission time-out parameters, in milliseconds,
for the association(s) given by <c>assoc_id</c>.
@@ -586,11 +580,11 @@
<pre>
#sctp_assocparams{
assoc_id = assoc_id(),
- asocmaxrxt = int(),
- number_peer_destinations = int(),
- peer_rwnd = int(),
- local_rwnd = int(),
- cookie_life = int()
+ asocmaxrxt = integer(),
+ number_peer_destinations = integer(),
+ peer_rwnd = integer(),
+ local_rwnd = integer(),
+ cookie_life = integer()
} </pre>
<p>Determines association parameters for the association(s) given by
<c>assoc_id</c>. <c>assoc_id = 0</c> (default) indicates
@@ -601,10 +595,10 @@
<item>
<pre>
#sctp_initmsg{
- num_ostreams = int(),
- max_instreams = int(),
- max_attempts = int(),
- max_init_timeo = int()
+ num_ostreams = integer(),
+ max_instreams = integer(),
+ max_attempts = integer(),
+ max_init_timeo = integer()
} </pre>
<p>Determines the default parameters which this socket attempts
to negotiate with its peer while establishing an association with it.
@@ -630,10 +624,11 @@
</list>
<p></p>
</item>
- <tag><c>{sctp_autoclose, int()|infinity}</c></tag>
+ <tag><c>{sctp_autoclose, integer() >= 0}</c></tag>
<item>
<p>Determines the time (in seconds) after which an idle association is
- automatically closed.</p>
+ automatically closed. <c>0</c> means that the association is
+ never automatically closed.</p>
</item>
<tag><c>{sctp_nodelay, true|false}</c></tag>
<item>
@@ -655,7 +650,7 @@
<p>Turns on|off automatic mapping of IPv4 addresses into IPv6 ones
(if the socket address family is AF_INET6).</p>
</item>
- <tag><c>{sctp_maxseg, int()}</c></tag>
+ <tag><c>{sctp_maxseg, integer()}</c></tag>
<item>
<p>Determines the maximum chunk size if message fragmentation is used.
If <c>0</c>, the chunk size is limited by the Path MTU only.</p>
@@ -693,7 +688,7 @@
<marker id="record-sctp_setadaptation"></marker>
<pre>
#sctp_setadaptation{
- adaptation_ind = int()
+ adaptation_ind = integer()
} </pre>
<p>When set, requests that the local endpoint uses the value given by
<c>adaptation_ind</c> as the Adaptation Indication parameter for
@@ -707,10 +702,10 @@
#sctp_paddrparams{
assoc_id = assoc_id(),
address = {IP, Port},
- hbinterval = int(),
- pathmaxrxt = int(),
- pathmtu = int(),
- sackdelay = int(),
+ hbinterval = integer(),
+ pathmaxrxt = integer(),
+ pathmtu = integer(),
+ sackdelay = integer(),
flags = list()
}
IP = ip_address()
@@ -771,14 +766,14 @@
<marker id="record-sctp_sndrcvinfo"></marker>
<pre>
#sctp_sndrcvinfo{
- stream = int(),
- ssn = int(),
+ stream = integer(),
+ ssn = integer(),
flags = list(),
- ppid = int(),
- context = int(),
- timetolive = int(),
- tsn = int(),
- cumtsn = int(),
+ ppid = integer(),
+ context = integer(),
+ timetolive = integer(),
+ tsn = integer(),
+ cumtsn = integer(),
assoc_id = assoc_id()
} </pre>
<p><c>#sctp_sndrcvinfo{}</c> is used both in this socket option, and as
@@ -853,7 +848,7 @@
<pre>
#sctp_assoc_value{
assoc_id = assoc_id(),
- assoc_value = int()
+ assoc_value = integer()
} </pre>
<p>Rarely used. Determines the ACK time
(given by <c>assoc_value</c> in milliseconds) for
@@ -866,12 +861,12 @@
#sctp_status{
assoc_id = assoc_id(),
state = atom(),
- rwnd = int(),
- unackdata = int(),
- penddata = int(),
- instrms = int(),
- outstrms = int(),
- fragmentation_point = int(),
+ rwnd = integer(),
+ unackdata = integer(),
+ penddata = integer(),
+ instrms = integer(),
+ outstrms = integer(),
+ fragmentation_point = integer(),
primary = #sctp_paddrinfo{}
} </pre>
<p>This option is read-only. It determines the status of
@@ -946,10 +941,10 @@
assoc_id = assoc_id(),
address = {IP, Port},
state = inactive | active,
- cwnd = int(),
- srtt = int(),
- rto = int(),
- mtu = int()
+ cwnd = integer(),
+ srtt = integer(),
+ rto = integer(),
+ mtu = integer()
}
IP = ip_address()
Port = port_number() </pre>
@@ -1119,7 +1114,6 @@ client_loop(S, Peer1, Port1, AssocId1, Peer2, Port2, AssocId2) -&gt;
<seealso marker="gen_udp">gen_udp(3)</seealso>,
<url href="http://www.rfc-archive.org/getrfc.php?rfc=2960">RFC2960</url> (Stream Control Transmission Protocol),
<url href="http://tools.ietf.org/html/draft-ietf-tsvwg-sctpsocket-13">Sockets API Extensions for SCTP.</url></p>
- <marker id="authors"></marker>
</section>
</erlref>
diff --git a/lib/kernel/doc/src/gen_tcp.xml b/lib/kernel/doc/src/gen_tcp.xml
index f1d42d9faa..8a5d40bb16 100644
--- a/lib/kernel/doc/src/gen_tcp.xml
+++ b/lib/kernel/doc/src/gen_tcp.xml
@@ -37,7 +37,7 @@
binary and closing the connection:</p>
<code type="none">
client() ->
- SomeHostInNet = "localhost" % to make it runnable on one machine
+ SomeHostInNet = "localhost", % to make it runnable on one machine
{ok, Sock} = gen_tcp:connect(SomeHostInNet, 5678,
[binary, {packet, 0}]),
ok = gen_tcp:send(Sock, "Some Data"),
@@ -65,25 +65,16 @@ do_recv(Sock, Bs) ->
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
- <name name="port_number"/>
+ <name name="connect_option"/>
</datatype>
<datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="listen_option"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -122,7 +113,7 @@ do_recv(Sock, Bs) ->
<item>
<p>Specify which local port number to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been connected without using
<c>gen_tcp</c>, use this option to pass the file
@@ -196,6 +187,10 @@ do_recv(Sock, Bs) ->
<p>If the host has several network interfaces, this option
specifies which one to listen on.</p>
</item>
+ <tag><c>{port, Port}</c></tag>
+ <item>
+ <p>Specify which local port number to use.</p>
+ </item>
<tag><c>{fd, Fd}</c></tag>
<item>
<p>If a socket has somehow been connected without using
diff --git a/lib/kernel/doc/src/gen_udp.xml b/lib/kernel/doc/src/gen_udp.xml
index c0e783f508..daa9b7d887 100644
--- a/lib/kernel/doc/src/gen_udp.xml
+++ b/lib/kernel/doc/src/gen_udp.xml
@@ -36,25 +36,10 @@
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -87,7 +72,7 @@
<p>If the host has several network interfaces, this option
specifies which one to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been opened without using
<c>gen_udp</c>, use this option to pass the file
diff --git a/lib/kernel/doc/src/inet.xml b/lib/kernel/doc/src/inet.xml
index fd843b00d9..b36c28e027 100644
--- a/lib/kernel/doc/src/inet.xml
+++ b/lib/kernel/doc/src/inet.xml
@@ -105,6 +105,9 @@ fe80::204:acff:fe17:bf38
<name name="ip6_address"/>
</datatype>
<datatype>
+ <name name="port_number"/>
+ </datatype>
+ <datatype>
<name name="posix"/>
<desc><p>An atom which is named from the Posix error codes
used in Unix, and in the runtime libraries of most
@@ -119,7 +122,7 @@ fe80::204:acff:fe17:bf38
</desc>
</datatype>
<datatype>
- <name name="family_option"/>
+ <name name="address_family"/>
</datatype>
</datatypes>
@@ -250,26 +253,15 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getopts(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getopts" arity="2"/>
<fsummary>Get one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt | RawOptReq]</v>
- <v>Opt = atom()</v>
- <v>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueSpec = ValueSize | ValueBin</v>
- <v>ValueSize = integer()</v>
- <v>ValueBin = binary()</v>
- <v>OptionValues = [{Opt, Val} | {raw, Protocol, OptionNum, ValueBin}]</v>
- </type>
<type name="socket_getopt"/>
+ <type name="socket_setopt"/>
<desc>
<p>Gets one or more options for a socket.
See <seealso marker="#setopts/2">setopts/2</seealso>
for a list of available options.</p>
- <p>The number of elements in the returned <c>OptionValues</c>
+ <p>The number of elements in the returned <c><anno>OptionValues</anno></c>
list does not necessarily correspond to the number of options
asked for. If the operating system fails to support an option,
it is simply left out in the returned list. An error tuple is only
@@ -277,12 +269,12 @@ fe80::204:acff:fe17:bf38
(i.e. the socket is closed or the buffer size in a raw request
is too large). This behavior is kept for backward
compatibility reasons.</p>
- <p>A <c>RawOptReq</c> can be used to get information about
+ <p>A raw option request <c>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</c> can be used to get information about
socket options not (explicitly) supported by the emulator. The
use of raw socket options makes the code non portable, but
allows the Erlang programmer to take advantage of unusual features
present on the current platform.</p>
- <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
+ <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
by the protocol level, the option number and either a binary
or the size, in bytes, of the
buffer in which the option value is to be stored. A binary
@@ -325,19 +317,14 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getstat(Socket)</name>
- <name>getstat(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getstat" arity="1"/>
+ <name name="getstat" arity="2"/>
<fsummary>Get one or more statistic options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt]</v>
- <v>OptionValues = [{Opt, Val}]</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="stat_option"/>
<desc>
<p>Gets one or more statistic options for a socket.</p>
- <p><c>getstat(Socket)</c> is equivalent to
- <c>getstat(Socket,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
+ <p><c>getstat(<anno>Socket</anno>)</c> is equivalent to
+ <c>getstat(<anno>Socket</anno>,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
<p>The following options are available:</p>
<taglist>
<tag><c>recv_avg</c></tag>
@@ -394,12 +381,8 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>port(Socket) -> {ok, Port} | {error, any()}</name>
+ <name name="port" arity="1"/>
<fsummary>Return the local port number for a socket</fsummary>
- <type>
- <v>Socket = socket()</v>
- <v>Port = integer()</v>
- </type>
<desc>
<p>Returns the local port number for a socket.</p>
</desc>
@@ -412,16 +395,9 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>setopts(Socket, Options) -> ok | {error, posix()}</name>
+ <name name="setopts" arity="2"/>
<fsummary>Set one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [{Opt, Val} | {raw, Protocol, Option, ValueBin}]</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueBin = binary()</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="socket_setopt"/>
<desc>
<p>Sets one or more options for a socket. The following options
are available:</p>
diff --git a/lib/kernel/src/code_server.erl b/lib/kernel/src/code_server.erl
index 4a1fc7df34..85bbff9cc3 100644
--- a/lib/kernel/src/code_server.erl
+++ b/lib/kernel/src/code_server.erl
@@ -1379,8 +1379,12 @@ absname_vr([[X, $:]|Name], _, _AbsBase) ->
%% Kill all processes running code from *old* Module, and then purge the
%% module. Return true if any processes killed, else false.
-do_purge(Mod) ->
- do_purge(processes(), to_atom(Mod), false).
+do_purge(Mod0) ->
+ Mod = to_atom(Mod0),
+ case erlang:check_old_code(Mod) of
+ false -> false;
+ true -> do_purge(processes(), Mod, false)
+ end.
do_purge([P|Ps], Mod, Purged) ->
case erlang:check_process_code(P, Mod) of
@@ -1399,16 +1403,19 @@ do_purge([], Mod, Purged) ->
Purged.
%% do_soft_purge(Module)
-%% Purge old code only if no procs remain that run old code
+%% Purge old code only if no procs remain that run old code.
%% Return true in that case, false if procs remain (in this
%% case old code is not purged)
do_soft_purge(Mod) ->
- catch do_soft_purge(processes(), Mod).
+ case erlang:check_old_code(Mod) of
+ false -> true;
+ true -> do_soft_purge(processes(), Mod)
+ end.
do_soft_purge([P|Ps], Mod) ->
case erlang:check_process_code(P, Mod) of
- true -> throw(false);
+ true -> false;
false -> do_soft_purge(Ps, Mod)
end;
do_soft_purge([], Mod) ->
diff --git a/lib/kernel/src/error_handler.erl b/lib/kernel/src/error_handler.erl
index e1f99bf417..a67b11a888 100644
--- a/lib/kernel/src/error_handler.erl
+++ b/lib/kernel/src/error_handler.erl
@@ -88,12 +88,12 @@ int() -> int.
-spec crash(atom(), [term()]) -> no_return().
crash(Fun, Args) ->
- crash({Fun,Args}).
+ crash({Fun,Args,[]}).
-spec crash(atom(), atom(), arity()) -> no_return().
crash(M, F, A) ->
- crash({M,F,A}).
+ crash({M,F,A,[]}).
-spec crash(tuple()) -> no_return().
@@ -101,7 +101,8 @@ crash(Tuple) ->
try erlang:error(undef)
catch
error:undef ->
- erlang:raise(error, undef, [Tuple|tl(erlang:get_stacktrace())])
+ Stk = [Tuple|tl(erlang:get_stacktrace())],
+ erlang:raise(error, undef, Stk)
end.
%% If the code_server has not been started yet dynamic code loading
@@ -127,7 +128,7 @@ ensure_loaded(Module) ->
-spec stub_function(atom(), atom(), [_]) -> no_return().
stub_function(Mod, Func, Args) ->
- exit({undef,[{Mod,Func,Args}]}).
+ exit({undef,[{Mod,Func,Args,[]}]}).
check_inheritance(Module, Args) ->
Attrs = erlang:get_module_info(Module, attributes),
diff --git a/lib/kernel/src/file.erl b/lib/kernel/src/file.erl
index 5e4e1b0ba8..706c60caaf 100644
--- a/lib/kernel/src/file.erl
+++ b/lib/kernel/src/file.erl
@@ -1163,7 +1163,7 @@ path_open_first([Path|Rest], Name, Mode, LastError) ->
{error, _} = Error ->
Error;
FilePath ->
- FileName = filename:join(FilePath, Name),
+ FileName = fname_join(FilePath, Name),
case open(FileName, Mode) of
{ok, Fd} ->
{ok, Fd, FileName};
@@ -1176,6 +1176,11 @@ path_open_first([Path|Rest], Name, Mode, LastError) ->
path_open_first([], _Name, _Mode, LastError) ->
{error, LastError}.
+fname_join(".", Name) ->
+ Name;
+fname_join(Dir, Name) ->
+ filename:join(Dir, Name).
+
%%%-----------------------------------------------------------------
%%% Utility functions.
diff --git a/lib/kernel/src/gen_sctp.erl b/lib/kernel/src/gen_sctp.erl
index 004f03f231..6cebb7ab97 100644
--- a/lib/kernel/src/gen_sctp.erl
+++ b/lib/kernel/src/gen_sctp.erl
@@ -33,55 +33,85 @@
-export([error_string/1]).
-export([controlling_process/2]).
--opaque assoc_id() :: term().
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
--type sctp_option() ::
- {mode, list | binary} | list | binary
- | {active, true | false | once}
- | {buffer, non_neg_integer()}
- | {tos, integer()}
- | {priority, integer()}
- | {dontroute, boolean()}
- | {reuseaddr, boolean()}
- | {linger, {boolean(), non_neg_integer()}}
- | {sndbuf, non_neg_integer()}
- | {recbuf, non_neg_integer()}
- | {sctp_rtoinfo, #sctp_rtoinfo{}}
- | {sctp_associnfo, #sctp_assocparams{}}
- | {sctp_initmsg, #sctp_initmsg{}}
- | {sctp_autoclose, timeout()}
- | {sctp_nodelay, boolean()}
- | {sctp_disable_fragments, boolean()}
- | {sctp_i_want_mapped_v4_addr, boolean()}
- | {sctp_maxseg, non_neg_integer()}
- | {sctp_primary_addr, #sctp_prim{}}
- | {sctp_set_peer_primary_addr, #sctp_setpeerprim{}}
- | {sctp_adaptation_layer, #sctp_setadaptation{}}
- | {sctp_peer_addr_params, #sctp_paddrparams{}}
- | {sctp_default_send_param, #sctp_sndrcvinfo{}}
- | {sctp_events, #sctp_event_subscribe{}}
- | {sctp_delayed_ack_time, #sctp_assoc_value{}}
- | {sctp_status, #sctp_status{}}
- | {sctp_get_peer_addr_info, #sctp_paddrinfo{}}.
--opaque sctp_socket() :: port().
-
--spec open() -> {ok, Socket} | {error, posix()} when
+-type assoc_id() :: term().
+-type option() ::
+ {active, true | false | once} |
+ {buffer, non_neg_integer()} |
+ {dontroute, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {mode, list | binary} | list | binary |
+ {priority, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sctp_adaptation_layer, #sctp_setadaptation{}} |
+ {sctp_associnfo, #sctp_assocparams{}} |
+ {sctp_autoclose, non_neg_integer()} |
+ {sctp_default_send_param, #sctp_sndrcvinfo{}} |
+ {sctp_delayed_ack_time, #sctp_assoc_value{}} |
+ {sctp_disable_fragments, boolean()} |
+ {sctp_events, #sctp_event_subscribe{}} |
+ {sctp_get_peer_addr_info, #sctp_paddrinfo{}} |
+ {sctp_i_want_mapped_v4_addr, boolean()} |
+ {sctp_initmsg, #sctp_initmsg{}} |
+ {sctp_maxseg, non_neg_integer()} |
+ {sctp_nodelay, boolean()} |
+ {sctp_peer_addr_params, #sctp_paddrparams{}} |
+ {sctp_primary_addr, #sctp_prim{}} |
+ {sctp_rtoinfo, #sctp_rtoinfo{}} |
+ {sctp_set_peer_primary_addr, #sctp_setpeerprim{}} |
+ {sctp_status, #sctp_status{}} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ buffer |
+ dontroute |
+ linger |
+ mode |
+ priority |
+ recbuf |
+ reuseaddr |
+ sctp_adaptation_layer |
+ sctp_associnfo |
+ sctp_autoclose |
+ sctp_default_send_param |
+ sctp_delayed_ack_time |
+ sctp_disable_fragments |
+ sctp_events |
+ sctp_get_peer_addr_info |
+ sctp_i_want_mapped_v4_addr |
+ sctp_initmsg |
+ sctp_maxseg |
+ sctp_nodelay |
+ sctp_peer_addr_params |
+ sctp_primary_addr |
+ sctp_rtoinfo |
+ sctp_set_peer_primary_addr |
+ sctp_status |
+ sndbuf |
+ tos.
+-type sctp_socket() :: port().
+
+-export_type([assoc_id/0, option/0, option_name/0, sctp_socket/0]).
+
+-spec open() -> {ok, Socket} | {error, inet:posix()} when
Socket :: sctp_socket().
open() ->
open([]).
--spec open(Port) -> {ok, Socket} | {error, posix()} when
- Port :: port_number(),
+-spec open(Port) -> {ok, Socket} | {error, inet:posix()} when
+ Port :: inet:port_number(),
Socket :: sctp_socket();
- (Opts) -> {ok, Socket} | {error, posix()} when
+ (Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Opts) when is_list(Opts) ->
@@ -98,11 +128,15 @@ open(Port) when is_integer(Port) ->
open(X) ->
erlang:error(badarg, [X]).
--spec open(Port, Opts) -> {ok, Socket} | {error, posix()} when
+-spec open(Port, Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Port, Opts) when is_integer(Port), is_list(Opts) ->
@@ -110,7 +144,7 @@ open(Port, Opts) when is_integer(Port), is_list(Opts) ->
open(Port, Opts) ->
erlang:error(badarg, [Port,Opts]).
--spec close(Socket) -> ok | {error, posix()} when
+-spec close(Socket) -> ok | {error, inet:posix()} when
Socket :: sctp_socket().
close(S) when is_port(S) ->
@@ -138,22 +172,22 @@ listen(S, Flag) when is_port(S), is_boolean(Flag) ->
listen(S, Flag) ->
erlang:error(badarg, [S,Flag]).
--spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, posix()} when
+-spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Assoc :: #sctp_assoc_change{}.
connect(S, Addr, Port, Opts) ->
connect(S, Addr, Port, Opts, infinity).
-spec connect(Socket, Addr, Port, Opts, Timeout) ->
- {ok, Assoc} | {error, posix()} when
+ {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Timeout :: timeout(),
Assoc :: #sctp_assoc_change{}.
@@ -166,21 +200,21 @@ connect(S, Addr, Port, Opts, Timeout) ->
end.
-spec connect_init(Socket, Addr, Port, Opts) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()].
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()].
connect_init(S, Addr, Port, Opts) ->
connect_init(S, Addr, Port, Opts, infinity).
-spec connect_init(Socket, Addr, Port, Opts, Timeout) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()],
Timeout :: timeout().
connect_init(S, Addr, Port, Opts, Timeout) ->
@@ -232,7 +266,7 @@ eof(S, #sctp_assoc_change{assoc_id=AssocId}) when is_port(S) ->
eof(S, Assoc) ->
erlang:error(badarg, [S,Assoc]).
--spec abort(Socket, Assoc) -> ok | {error, posix()} when
+-spec abort(Socket, Assoc) -> ok | {error, inet:posix()} when
Socket :: sctp_socket(),
Assoc :: #sctp_assoc_change{}.
@@ -294,13 +328,13 @@ send(S, AssocChange, Stream, Data) ->
-spec recv(Socket) -> {ok, {FromIP, FromPort, AncData, Data}}
| {error, Reason} when
Socket :: sctp_socket(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
@@ -311,13 +345,13 @@ recv(S) ->
| {error, Reason} when
Socket :: sctp_socket(),
Timeout :: timeout(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
diff --git a/lib/kernel/src/gen_tcp.erl b/lib/kernel/src/gen_tcp.erl
index bee61ca84a..8ab18c01b4 100644
--- a/lib/kernel/src/gen_tcp.erl
+++ b/lib/kernel/src/gen_tcp.erl
@@ -28,34 +28,108 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {bit8, clear | set | on | off} |
+ {buffer, non_neg_integer()} |
+ {delay_send, boolean()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {exit_on_close, boolean()} |
+ {header, non_neg_integer()} |
+ {high_watermark, non_neg_integer()} |
+ {keepalive, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {low_watermark, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {nodelay, boolean()} |
+ {packet,
+ 0 | 1 | 2 | 4 | raw | sunrm | asn1 |
+ cdr | fcgi | line | tpkt | http | httph | http_bin | httph_bin } |
+ {packet_size, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {send_timeout, non_neg_integer() | infinity} |
+ {send_timeout_close, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ bit8 |
+ buffer |
+ delay_send |
+ deliver |
+ dontroute |
+ exit_on_close |
+ header |
+ high_watermark |
+ keepalive |
+ linger |
+ low_watermark |
+ mode |
+ nodelay |
+ packet |
+ packet_size |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ recbuf |
+ reuseaddr |
+ send_timeout |
+ send_timeout_close |
+ sndbuf |
+ tos.
+-type connect_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {tcp_module, module()} |
+ option().
+-type listen_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {backlog, B :: non_neg_integer()} |
+ {tcp_module, module()} |
+ option().
-type socket() :: port().
+-export_type([option/0, option_name/0, connect_option/0, listen_option/0]).
+
%%
%% Connect a socket
%%
-spec connect(Address, Port, Options) -> {ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts) ->
connect(Address,Port,Opts,infinity).
-spec connect(Address, Port, Options, Timeout) ->
{ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Timeout :: timeout(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts, Time) ->
Timer = inet:start_timer(Time),
@@ -97,10 +171,10 @@ try_connect([], _Port, _Opts, _Timer, _Mod, Err) ->
%%
-spec listen(Port, Options) -> {ok, ListenSocket} | {error, Reason} when
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Options :: [listen_option()],
ListenSocket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
listen(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -119,7 +193,7 @@ listen(Port, Opts) ->
-spec accept(ListenSocket) -> {ok, Socket} | {error, Reason} when
ListenSocket :: socket(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S) ->
case inet_db:lookup_socket(S) of
@@ -133,7 +207,7 @@ accept(S) ->
ListenSocket :: socket(),
Timeout :: timeout(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S, Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -150,7 +224,7 @@ accept(S, Time) when is_port(S) ->
-spec shutdown(Socket, How) -> ok | {error, Reason} when
Socket :: socket(),
How :: read | write | read_write,
- Reason :: posix().
+ Reason :: inet:posix().
shutdown(S, How) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -176,8 +250,8 @@ close(S) ->
-spec send(Socket, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Packet :: string() | binary(),
- Reason :: posix().
+ Packet :: iodata(),
+ Reason :: inet:posix().
send(S, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -195,7 +269,7 @@ send(S, Packet) when is_port(S) ->
Socket :: socket(),
Length :: non_neg_integer(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length) when is_port(S) ->
@@ -211,7 +285,7 @@ recv(S, Length) when is_port(S) ->
Length :: non_neg_integer(),
Timeout :: timeout(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length, Time) when is_port(S) ->
@@ -237,7 +311,7 @@ unrecv(S, Data) when is_port(S) ->
-spec controlling_process(Socket, Pid) -> ok | {error, Reason} when
Socket :: socket(),
Pid :: pid(),
- Reason :: closed | not_owner | posix().
+ Reason :: closed | not_owner | inet:posix().
controlling_process(S, NewOwner) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/gen_udp.erl b/lib/kernel/src/gen_udp.erl
index 7d14615c04..8688799ae9 100644
--- a/lib/kernel/src/gen_udp.erl
+++ b/lib/kernel/src/gen_udp.erl
@@ -25,25 +25,74 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {add_membership, {inet:ip_address(), inet:ip_address()}} |
+ {broadcast, boolean()} |
+ {buffer, non_neg_integer()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {drop_membership, {inet:ip_address(), inet:ip_address()}} |
+ {header, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {multicast_if, inet:ip_address()} |
+ {multicast_loop, boolean()} |
+ {multicast_ttl, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {read_packets, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ broadcast |
+ buffer |
+ deliver |
+ dontroute |
+ header |
+ mode |
+ multicast_if |
+ multicast_loop |
+ multicast_ttl |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ read_packets |
+ recbuf |
+ reuseaddr |
+ sndbuf |
+ tos.
-type socket() :: port().
+-export_type([option/0, option_name/0]).
+
-spec open(Port) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
+ Port :: inet:port_number(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port) ->
open(Port, []).
-spec open(Port, Opts) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
- Opts :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Opts :: [Option],
+ Option :: {ip, inet:ip_address()}
+ | {fd, non_neg_integer()}
+ | {ifaddr, inet:ip_address()}
+ | inet:address_family()
+ | {port, inet:port_number()}
+ | option(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -58,10 +107,10 @@ close(S) ->
-spec send(Socket, Address, Port, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Packet :: iodata(),
+ Reason :: not_owner | inet:posix().
send(S, Address, Port, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -92,10 +141,10 @@ send(S, Packet) when is_port(S) ->
{ok, {Address, Port, Packet}} | {error, Reason} when
Socket :: socket(),
Length :: non_neg_integer(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len) when is_port(S), is_integer(Len) ->
case inet_db:lookup_socket(S) of
@@ -110,10 +159,10 @@ recv(S,Len) when is_port(S), is_integer(Len) ->
Socket :: socket(),
Length :: non_neg_integer(),
Timeout :: timeout(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len,Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/inet.erl b/lib/kernel/src/inet.erl
index 5649188c38..48a6f3db65 100644
--- a/lib/kernel/src/inet.erl
+++ b/lib/kernel/src/inet.erl
@@ -63,8 +63,9 @@
%% timer interface
-export([start_timer/1, timeout/1, timeout/2, stop_timer/1]).
--export_type([family_option/0, hostent/0, hostname/0, ip4_address/0,
- ip6_address/0, ip_address/0, posix/0, socket/0]).
+-export_type([address_family/0, hostent/0, hostname/0, ip4_address/0,
+ ip6_address/0, ip_address/0, posix/0, socket/0,
+ port_number/0]).
%% imports
-import(lists, [append/1, duplicate/2, filter/2, foldl/3]).
@@ -87,98 +88,15 @@
-type ip6_address() :: {0..65535,0..65535,0..65535,0..65535,
0..65535,0..65535,0..65535,0..65535}.
-type ip_address() :: ip4_address() | ip6_address().
--type ip_port() :: 0..65535.
+-type port_number() :: 0..65535.
-type posix() :: exbadport | exbadseq | file:posix().
-type socket() :: port().
-type socket_setopt() ::
- {'raw', non_neg_integer(), non_neg_integer(), binary()} |
- %% TCP/UDP options
- {'reuseaddr', boolean()} |
- {'keepalive', boolean()} |
- {'dontroute', boolean()} |
- {'linger', {boolean(), non_neg_integer()}} |
- {'broadcast', boolean()} |
- {'sndbuf', non_neg_integer()} |
- {'recbuf', non_neg_integer()} |
- {'priority', non_neg_integer()} |
- {'tos', non_neg_integer()} |
- {'nodelay', boolean()} |
- {'multicast_ttl', non_neg_integer()} |
- {'multicast_loop', boolean()} |
- {'multicast_if', ip_address()} |
- {'add_membership', {ip_address(), ip_address()}} |
- {'drop_membership', {ip_address(), ip_address()}} |
- {'header', non_neg_integer()} |
- {'buffer', non_neg_integer()} |
- {'active', boolean() | 'once'} |
- {'packet',
- 0 | 1 | 2 | 4 | 'raw' | 'sunrm' | 'asn1' |
- 'cdr' | 'fcgi' | 'line' | 'tpkt' | 'http' | 'httph' | 'http_bin' | 'httph_bin' } |
- {'mode', 'list' | 'binary'} |
- {'port', 'port', 'term'} |
- {'exit_on_close', boolean()} |
- {'low_watermark', non_neg_integer()} |
- {'high_watermark', non_neg_integer()} |
- {'bit8', 'clear' | 'set' | 'on' | 'off'} |
- {'send_timeout', non_neg_integer() | 'infinity'} |
- {'send_timeout_close', boolean()} |
- {'delay_send', boolean()} |
- {'packet_size', non_neg_integer()} |
- {'read_packets', non_neg_integer()} |
- %% SCTP options
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- {'sctp_associnfo', #sctp_assocparams{}} |
- {'sctp_initmsg', #sctp_initmsg{}} |
- {'sctp_nodelay', boolean()} |
- {'sctp_autoclose', non_neg_integer()} |
- {'sctp_disable_fragments', boolean()} |
- {'sctp_i_want_mapped_v4_addr', boolean()} |
- {'sctp_maxseg', non_neg_integer()} |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- {'sctp_events', #sctp_event_subscribe{}} |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
+ gen_sctp:option() | gen_tcp:option() | gen_udp:option().
-type socket_getopt() ::
- {'raw',
- non_neg_integer(), non_neg_integer(), binary()|non_neg_integer()} |
- %% TCP/UDP options
- 'reuseaddr' | 'keepalive' | 'dontroute' | 'linger' |
- 'broadcast' | 'sndbuf' | 'recbuf' | 'priority' | 'tos' | 'nodelay' |
- 'multicast_ttl' | 'multicast_loop' | 'multicast_if' |
- 'add_membership' | 'drop_membership' |
- 'header' | 'buffer' | 'active' | 'packet' | 'mode' | 'port' |
- 'exit_on_close' | 'low_watermark' | 'high_watermark' | 'bit8' |
- 'send_timeout' | 'send_timeout_close' |
- 'delay_send' | 'packet_size' | 'read_packets' |
- %% SCTP options
- {'sctp_status', #sctp_status{}} |
- 'sctp_get_peer_addr_info' |
- {'sctp_get_peer_addr_info', #sctp_status{}} |
- 'sctp_rtoinfo' |
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- 'sctp_associnfo' |
- {'sctp_associnfo', #sctp_assocparams{}} |
- 'sctp_initmsg' |
- {'sctp_initmsg', #sctp_initmsg{}} |
- 'sctp_nodelay' | 'sctp_autoclose' | 'sctp_disable_fragments' |
- 'sctp_i_want_mapped_v4_addr' | 'sctp_maxseg' |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- 'sctp_adaptation_layer' |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- 'sctp_default_send_param' |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- 'sctp_events' |
- {'sctp_events', #sctp_event_subscribe{}} |
- 'sctp_delayed_ack_time' |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
-
+ gen_sctp:option_name() | gen_tcp:option_name() | gen_udp:option_name().
-type ether_address() :: [0..255].
-type if_setopt() ::
@@ -196,7 +114,7 @@
'addr' | 'broadaddr' | 'dstaddr' |
'mtu' | 'netmask' | 'flags' |'hwaddr'.
--type family_option() :: 'inet' | 'inet6'.
+-type address_family() :: 'inet' | 'inet6'.
-type protocol_option() :: 'tcp' | 'udp' | 'sctp'.
-type stat_option() ::
'recv_cnt' | 'recv_max' | 'recv_avg' | 'recv_oct' | 'recv_dvi' |
@@ -229,7 +147,7 @@ close(Socket) ->
peername(Socket) ->
prim_inet:peername(Socket).
--spec setpeername(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setpeername(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setpeername(Socket, {IP,Port}) ->
@@ -246,7 +164,7 @@ setpeername(Socket, undefined) ->
sockname(Socket) ->
prim_inet:sockname(Socket).
--spec setsockname(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setsockname(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setsockname(Socket, {IP,Port}) ->
@@ -254,7 +172,9 @@ setsockname(Socket, {IP,Port}) ->
setsockname(Socket, undefined) ->
prim_inet:setsockname(Socket, undefined).
--spec port(Socket :: socket()) -> {'ok', ip_port()} | {'error', any()}.
+-spec port(Socket) -> {'ok', Port} | {'error', any()} when
+ Socket :: socket(),
+ Port :: port_number().
port(Socket) ->
case prim_inet:sockname(Socket) of
@@ -268,16 +188,18 @@ port(Socket) ->
send(Socket, Packet) ->
prim_inet:send(Socket, Packet).
--spec setopts(Socket :: socket(), Opts :: [socket_setopt()]) ->
- 'ok' | {'error', posix()}.
+-spec setopts(Socket, Options) -> ok | {error, posix()} when
+ Socket :: socket(),
+ Options :: [socket_setopt()].
setopts(Socket, Opts) ->
prim_inet:setopts(Socket, Opts).
-spec getopts(Socket, Options) ->
- {'ok', [socket_setopt()]} | {'error', posix()} when
+ {'ok', OptionValues} | {'error', posix()} when
Socket :: socket(),
- Options :: [socket_getopt()].
+ Options :: [socket_getopt()],
+ OptionValues :: [socket_setopt()].
getopts(Socket, Opts) ->
prim_inet:getopts(Socket, Opts).
@@ -419,14 +341,19 @@ gethostname() ->
gethostname(Socket) ->
prim_inet:gethostname(Socket).
--spec getstat(Socket :: socket()) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket) ->
prim_inet:getstat(Socket, stats()).
--spec getstat(Socket :: socket(), Statoptions :: [stat_option()]) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket, Options) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ Options :: [stat_option()],
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket,What) ->
prim_inet:getstat(Socket, What).
@@ -441,14 +368,14 @@ gethostbyname(Name) ->
-spec gethostbyname(Hostname, Family) ->
{ok, Hostent} | {error, posix()} when
Hostname :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Hostent :: hostent().
gethostbyname(Name,Family) ->
gethostbyname_tm(Name, Family, false).
-spec gethostbyname(Name :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', #hostent{}} | {'error', posix()}.
@@ -527,14 +454,14 @@ getfd(Socket) ->
-spec getaddr(Host, Family) -> {ok, Address} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Address :: ip_address().
getaddr(Address, Family) ->
getaddr(Address, Family, infinity).
-spec getaddr(Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', ip_address()} | {'error', posix()}.
@@ -553,14 +480,14 @@ getaddr_tm(Address, Family, Timer) ->
-spec getaddrs(Host, Family) ->
{ok, Addresses} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Addresses :: [ip_address()].
getaddrs(Address, Family) ->
getaddrs(Address, Family, infinity).
-spec getaddrs(Host :: ip_address() | string() | atom(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', [ip_address()]} | {'error', posix()}.
@@ -570,7 +497,7 @@ getaddrs(Address, Family, Timeout) ->
stop_timer(Timer),
Res.
--spec getservbyport(Port :: ip_port(), Protocol :: atom() | string()) ->
+-spec getservbyport(Port :: port_number(), Protocol :: atom() | string()) ->
{'ok', string()} | {'error', posix()}.
getservbyport(Port, Proto) ->
@@ -584,7 +511,7 @@ getservbyport(Port, Proto) ->
-spec getservbyname(Name :: atom() | string(),
Protocol :: atom() | string()) ->
- {'ok', ip_port()} | {'error', posix()}.
+ {'ok', port_number()} | {'error', posix()}.
getservbyname(Name, Protocol) when is_atom(Name) ->
case inet_udp:open(0, []) of
@@ -1067,7 +994,7 @@ gethostbyaddr_tm_native(Addr, Timer, Opts) ->
-spec open(Fd :: integer(),
Addr :: ip_address(),
- Port :: ip_port(),
+ Port :: port_number(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
Family :: 'inet' | 'inet6',
@@ -1108,7 +1035,7 @@ open(Fd, _Addr, _Port, Opts, Protocol, Family, Module) ->
-spec fdopen(Fd :: non_neg_integer(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
- Family :: family_option(),
+ Family :: address_family(),
Module :: atom()) ->
{'ok', socket()} | {'error', posix()}.
diff --git a/lib/kernel/src/inet_res.erl b/lib/kernel/src/inet_res.erl
index d1f5644ff7..59ba408d7a 100644
--- a/lib/kernel/src/inet_res.erl
+++ b/lib/kernel/src/inet_res.erl
@@ -407,7 +407,7 @@ gethostbyname(Name) ->
-spec gethostbyname(Name, Family) -> {ok, Hostent} | {error, Reason} when
Name :: dns_name(),
Hostent :: inet:hostent(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family) ->
@@ -418,7 +418,7 @@ gethostbyname(Name,Family) ->
Name :: dns_name(),
Hostent :: inet:hostent(),
Timeout :: timeout(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family,Timeout) ->
diff --git a/lib/kernel/test/application_SUITE.erl b/lib/kernel/test/application_SUITE.erl
index 4ae4151004..2c5b8ccb66 100644
--- a/lib/kernel/test/application_SUITE.erl
+++ b/lib/kernel/test/application_SUITE.erl
@@ -967,7 +967,7 @@ otp_1586(doc) ->
["Test recursive load of applications."];
otp_1586(Conf) when is_list(Conf) ->
Dir = ?config(priv_dir,Conf),
- {ok, Fd} = file:open(filename:join(Dir, "app5.app"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "app5.app"), [write]),
w_app5(Fd),
file:close(Fd),
?line code:add_patha(Dir),
@@ -1021,10 +1021,10 @@ otp_2012(Conf) when is_list(Conf) ->
?line yes = global:register_name(conf_change, CcPid),
% Write a .app file
- {ok, Fd} = file:open("app1.app", write),
+ {ok, Fd} = file:open("app1.app", [write]),
w_app1(Fd),
file:close(Fd),
- {ok, Fd2} = file:open("app2.app", write),
+ {ok, Fd2} = file:open("app2.app", [write]),
w_app1(Fd2),
file:close(Fd2),
@@ -1096,7 +1096,7 @@ otp_2973(doc) ->
["Test of two processes simultanously starting the same application."];
otp_2973(Conf) when is_list(Conf) ->
% Write a .app file
- {ok, Fd} = file:open("app0.app", write),
+ {ok, Fd} = file:open("app0.app", [write]),
w_app(Fd, app0()),
file:close(Fd),
@@ -1138,7 +1138,7 @@ otp_2973(Conf) when is_list(Conf) ->
% Write a .app file
- ?line {ok, Fda} = file:open("app_start_error.app", write),
+ ?line {ok, Fda} = file:open("app_start_error.app", [write]),
?line w_app_start_error(Fda),
?line file:close(Fda),
@@ -1273,12 +1273,12 @@ otp_4066(Conf) when is_list(Conf) ->
App1Nodes = {app1, AllNodes},
Dir = ?config(priv_dir,Conf),
- ?line {ok, FdC} = file:open(filename:join(Dir, "otp_4066.config"), write),
+ ?line {ok, FdC} = file:open(filename:join(Dir, "otp_4066.config"), [write]),
?line write_config(FdC, config_4066(AllNodes, 5000, [App1Nodes])),
?line file:close(FdC),
% Write the app1.app file
- ?line {ok, FdA12} = file:open(filename:join(Dir, "app1.app"), write),
+ ?line {ok, FdA12} = file:open(filename:join(Dir, "app1.app"), [write]),
?line w_app1(FdA12),
?line file:close(FdA12),
@@ -1441,7 +1441,7 @@ otp_5606(Conf) when is_list(Conf) ->
%% Write a config file
Dir = ?config(priv_dir, Conf),
- {ok, Fd} = file:open(filename:join(Dir, "sys.config"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "sys.config"), [write]),
NodeNames = [Ncp1, Ncp2] = node_names([cp1, cp2], Conf),
(config4(NodeNames))(Fd, 10000),
file:close(Fd),
@@ -2436,7 +2436,7 @@ start_node_config_sf(Name, SysConfigFun, Conf) ->
write_config_file(SysConfigFun, Conf) ->
Dir = ?config(priv_dir, Conf),
- {ok, Fd} = file:open(filename:join(Dir, "sys.config"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "sys.config"), [write]),
SysConfigFun(Fd),
file:close(Fd),
filename:join(Dir,"sys").
@@ -2571,15 +2571,15 @@ cc(List) ->
create_app() ->
?line Dir = "./",
?line App1 = Dir ++ "app1",
- ?line {ok, Fd1} = file:open(App1++".app",write),
+ ?line {ok, Fd1} = file:open(App1++".app",[write]),
?line io:format(Fd1, "~p. \n", [app1()]),
?line file:close(Fd1),
?line App2 = Dir ++ "app2",
- ?line {ok, Fd2} = file:open(App2++".app",write),
+ ?line {ok, Fd2} = file:open(App2++".app",[write]),
?line io:format(Fd2, "~p. \n", [app2()]),
?line file:close(Fd2),
?line App3 = Dir ++ "app_sp",
- ?line {ok, Fd3} = file:open(App3++".app",write),
+ ?line {ok, Fd3} = file:open(App3++".app",[write]),
?line io:format(Fd3, "~p. \n", [app_sp()]),
?line file:close(Fd3),
ok.
@@ -2591,7 +2591,7 @@ create_script(ScriptName) ->
?line Apps = which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2610,7 +2610,7 @@ create_script_dc(ScriptName) ->
?line Apps = which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2630,7 +2630,7 @@ create_script_3002(ScriptName) ->
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
?line {value,{_,_,SaslVer}} = lists:keysearch(sasl,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2646,22 +2646,22 @@ create_script_3002(ScriptName) ->
distr_changed_prep(Conf) when is_list(Conf) ->
% Write .app files
- ?line {ok, Fd1} = file:open("app1.app", write),
+ ?line {ok, Fd1} = file:open("app1.app", [write]),
?line w_app1(Fd1),
?line file:close(Fd1),
- ?line {ok, Fd2} = file:open("app2.app", write),
+ ?line {ok, Fd2} = file:open("app2.app", [write]),
?line w_app2(Fd2),
?line file:close(Fd2),
- ?line {ok, Fd3} = file:open("app3.app", write),
+ ?line {ok, Fd3} = file:open("app3.app", [write]),
?line w_app3(Fd3),
?line file:close(Fd3),
- ?line {ok, Fd4} = file:open("app6.app", write),
+ ?line {ok, Fd4} = file:open("app6.app", [write]),
?line w_app6(Fd4),
?line file:close(Fd4),
- ?line {ok, Fd5} = file:open("app7.app", write),
+ ?line {ok, Fd5} = file:open("app7.app", [write]),
?line w_app7(Fd5),
?line file:close(Fd5),
- ?line {ok, Fd6} = file:open("app8.app", write),
+ ?line {ok, Fd6} = file:open("app8.app", [write]),
?line w_app8(Fd6),
?line file:close(Fd6),
@@ -2683,7 +2683,7 @@ distr_changed_prep(Conf) when is_list(Conf) ->
WithSyncTime = config_fun(config_dc(NodeNames)),
?line Dir = ?config(priv_dir,Conf),
- ?line {ok, Fd_dc2} = file:open(filename:join(Dir, "sys2.config"), write),
+ ?line {ok, Fd_dc2} = file:open(filename:join(Dir, "sys2.config"), [write]),
?line (config_dc2(NodeNames))(Fd_dc2),
?line file:close(Fd_dc2),
?line Config2 = filename:join(Dir, "sys2"),
diff --git a/lib/kernel/test/code_SUITE.erl b/lib/kernel/test/code_SUITE.erl
index 3ad49254f1..c7d39dfd5d 100644
--- a/lib/kernel/test/code_SUITE.erl
+++ b/lib/kernel/test/code_SUITE.erl
@@ -258,8 +258,8 @@ replace_path(Config) when is_list(Config) ->
%% Add a completly new application.
- NewAppName = "blurf_blarfer",
- ?line NewAppDir = filename:join(Cwd, NewAppName ++ "-6.33.1"),
+ NewAppName = 'blurf_blarfer',
+ ?line NewAppDir = filename:join(Cwd, atom_to_list(NewAppName) ++ "-6.33.1"),
?line ok = file:make_dir(NewAppDir),
?line true = code:replace_path(NewAppName, NewAppDir),
?line NewAppDir = code:lib_dir(NewAppName),
@@ -410,8 +410,10 @@ all_loaded_1() ->
?line Loaded2 = match_and_remove(Preloaded, Loaded1),
ObjExt = code:objfile_extension(),
- ?line [] = lists:filter(fun({Mod,AbsName}) when is_atom(Mod), is_list(AbsName) ->
- Mod =:= filename:basename(AbsName, ObjExt);
+ ?line [] = lists:filter(fun({Mod,AbsName}) when is_atom(Mod),
+ is_list(AbsName) ->
+ Mod =/= list_to_atom(filename:basename(AbsName,
+ ObjExt));
(_) -> true
end,
Loaded2),
@@ -984,9 +986,9 @@ purge_stacktrace(Config) when is_list(Config) ->
error:function_clause ->
?line code:load_file(code_b_test),
?line case erlang:get_stacktrace() of
- [{?MODULE,_,[a]},
- {code_b_test,call,2},
- {?MODULE,purge_stacktrace,1}|_] ->
+ [{?MODULE,_,[a],_},
+ {code_b_test,call,2,_},
+ {?MODULE,purge_stacktrace,1,_}|_] ->
?line false = code:purge(code_b_test),
?line [] = erlang:get_stacktrace()
end
@@ -996,8 +998,8 @@ purge_stacktrace(Config) when is_list(Config) ->
error:function_clause ->
?line code:load_file(code_b_test),
?line case erlang:get_stacktrace() of
- [{code_b_test,call,[nofun,2]},
- {?MODULE,purge_stacktrace,1}|_] ->
+ [{code_b_test,call,[nofun,2],_},
+ {?MODULE,purge_stacktrace,1,_}|_] ->
?line false = code:purge(code_b_test),
?line [] = erlang:get_stacktrace()
end
@@ -1008,8 +1010,8 @@ purge_stacktrace(Config) when is_list(Config) ->
error:badarg ->
?line code:load_file(code_b_test),
?line case erlang:get_stacktrace() of
- [{code_b_test,call,Args},
- {?MODULE,purge_stacktrace,1}|_] ->
+ [{code_b_test,call,Args,_},
+ {?MODULE,purge_stacktrace,1,_}|_] ->
?line false = code:purge(code_b_test),
?line [] = erlang:get_stacktrace()
end
@@ -1023,8 +1025,8 @@ mult_lib_roots(Config) when is_list(Config) ->
"my_dummy_app-c/ebin/code_SUITE_mult_root_module"),
%% Set up ERL_LIBS and start a slave node.
- ErlLibs = filename:join(DataDir, first_root) ++ mult_lib_sep() ++
- filename:join(DataDir, second_root),
+ ErlLibs = filename:join(DataDir, "first_root") ++ mult_lib_sep() ++
+ filename:join(DataDir, "second_root"),
?line {ok,Node} =
?t:start_node(mult_lib_roots, slave,
@@ -1344,7 +1346,7 @@ create_script(Config) ->
?line Apps = application_controller:which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel, 1, Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib, 1, Apps),
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"9.42\"}, \n"
@@ -1409,7 +1411,7 @@ create_big_script(Config,Local) ->
%% Now we should have only "real" applications...
?line [application:load(list_to_atom(Y)) || {match,[Y]} <- [ re:run(X,code:lib_dir()++"/"++"([^/-]*).*/ebin",[{capture,[1],list}]) || X <- code:get_path()],filter_app(Y,Local)],
?line Apps = [ {N,V} || {N,_,V} <- application:loaded_applications()],
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"9.42\"}, \n"
@@ -1470,7 +1472,7 @@ do_on_load_error(ReturnValue) ->
?line ErrorPid ! ReturnValue,
receive
{'DOWN',Ref,process,_,Exit} ->
- ?line {undef,[{on_load_error,main,[]}|_]} = Exit
+ ?line {undef,[{on_load_error,main,[],_}|_]} = Exit
end.
native_early_modules(suite) -> [];
diff --git a/lib/kernel/test/disk_log_SUITE.erl b/lib/kernel/test/disk_log_SUITE.erl
index 4ae47b4762..ee1e2319b5 100644
--- a/lib/kernel/test/disk_log_SUITE.erl
+++ b/lib/kernel/test/disk_log_SUITE.erl
@@ -4917,7 +4917,7 @@ mark(FileName, What) ->
ok = file:close(Fd).
crash(File, Where) ->
- {ok, Fd} = file:open(File, read_write),
+ {ok, Fd} = file:open(File, [read,write]),
file:position(Fd, Where),
ok = file:write(Fd, [10]),
ok = file:close(Fd).
@@ -4933,7 +4933,7 @@ writable(Fname) ->
file:write_file_info(Fname, Info#file_info{mode = Mode}).
truncate(File, Where) ->
- {ok, Fd} = file:open(File, read_write),
+ {ok, Fd} = file:open(File, [read,write]),
file:position(Fd, Where),
ok = file:truncate(Fd),
ok = file:close(Fd).
diff --git a/lib/kernel/test/erl_prim_loader_SUITE.erl b/lib/kernel/test/erl_prim_loader_SUITE.erl
index f47c4603cf..7599a89779 100644
--- a/lib/kernel/test/erl_prim_loader_SUITE.erl
+++ b/lib/kernel/test/erl_prim_loader_SUITE.erl
@@ -547,8 +547,6 @@ host() ->
stop_node(Node) ->
test_server:stop_node(Node).
-get_loader_flag({ose,_}) ->
- " -loader ose_inet ";
get_loader_flag(_) ->
" -loader inet ".
diff --git a/lib/kernel/test/gen_tcp_api_SUITE.erl b/lib/kernel/test/gen_tcp_api_SUITE.erl
index fd4685cdad..cbaec2d6dd 100644
--- a/lib/kernel/test/gen_tcp_api_SUITE.erl
+++ b/lib/kernel/test/gen_tcp_api_SUITE.erl
@@ -158,6 +158,10 @@ t_shutdown_error(Config) when is_list(Config) ->
t_fdopen(Config) when is_list(Config) ->
?line Question = "Aaaa... Long time ago in a small town in Germany,",
+ ?line Question1 = list_to_binary(Question),
+ ?line Question2 = [<<"Aaaa">>, "... ", $L, <<>>, $o, "ng time ago ",
+ ["in ", [], <<"a small town">>, [" in Germany,", <<>>]]],
+ ?line Question1 = iolist_to_binary(Question2),
?line Answer = "there was a shoemaker, Schumacher was his name.",
?line {ok, L} = gen_tcp:listen(0, [{active, false}]),
?line {ok, Port} = inet:port(L),
@@ -167,6 +171,10 @@ t_fdopen(Config) when is_list(Config) ->
?line {ok, Server} = gen_tcp:fdopen(FD, []),
?line ok = gen_tcp:send(Client, Question),
?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
+ ?line ok = gen_tcp:send(Client, Question1),
+ ?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
+ ?line ok = gen_tcp:send(Client, Question2),
+ ?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
?line ok = gen_tcp:send(Server, Answer),
?line {ok, Answer} = gen_tcp:recv(Client, length(Answer), 2000),
?line ok = gen_tcp:close(Client),
diff --git a/lib/kernel/test/gen_udp_SUITE.erl b/lib/kernel/test/gen_udp_SUITE.erl
index d8a5519195..514deaf065 100644
--- a/lib/kernel/test/gen_udp_SUITE.erl
+++ b/lib/kernel/test/gen_udp_SUITE.erl
@@ -201,13 +201,21 @@ binary_passive_recv(suite) ->
binary_passive_recv(doc) ->
["OTP-3823 gen_udp:recv does not return address in binary mode"];
binary_passive_recv(Config) when is_list(Config) ->
- ?line D = "The quick brown fox jumps over a lazy dog",
- ?line B = list_to_binary(D),
+ ?line D1 = "The quick brown fox jumps over a lazy dog",
+ ?line D2 = list_to_binary(D1),
+ ?line D3 = ["The quick", <<" brown ">>, "fox jumps ", <<"over ">>,
+ <<>>, $a, [[], " lazy ", <<"dog">>]],
+ ?line D2 = iolist_to_binary(D3),
+ ?line B = D2,
?line {ok, R} = gen_udp:open(0, [binary, {active, false}]),
?line {ok, RP} = inet:port(R),
?line {ok, S} = gen_udp:open(0),
?line {ok, SP} = inet:port(S),
- ?line ok = gen_udp:send(S, localhost, RP, D),
+ ?line ok = gen_udp:send(S, localhost, RP, D1),
+ ?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
+ ?line ok = gen_udp:send(S, localhost, RP, D2),
+ ?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
+ ?line ok = gen_udp:send(S, localhost, RP, D3),
?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
?line ok = gen_udp:close(S),
?line ok = gen_udp:close(R),
@@ -400,6 +408,7 @@ open_fd(Config) when is_list(Config) ->
{ok,S1} = gen_udp:open(0),
{ok,P2} = inet:port(S1),
{ok,FD} = prim_inet:getfd(S1),
+ {error,einval} = gen_udp:open(P2, [inet6, {fd,FD}]),
{ok,S2} = gen_udp:open(P2, [{fd,FD}]),
{ok,S3} = gen_udp:open(0),
{ok,P3} = inet:port(S3),
diff --git a/lib/kernel/test/global_group_SUITE.erl b/lib/kernel/test/global_group_SUITE.erl
index 13b2fd07b5..799b0d9d05 100644
--- a/lib/kernel/test/global_group_SUITE.erl
+++ b/lib/kernel/test/global_group_SUITE.erl
@@ -100,7 +100,7 @@ start_gg_proc(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd}=file:open(File, write),
+ ?line {ok, Fd}=file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -135,7 +135,7 @@ no_gg_proc(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "no_global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
?line config_no(Fd),
?line NN = node_name(atom_to_list(node())),
@@ -308,7 +308,7 @@ no_gg_proc_sync(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "no_global_group_sync.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz], Config),
@@ -482,7 +482,7 @@ compatible(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group_comp.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz], Config),
@@ -655,7 +655,7 @@ one_grp(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -742,7 +742,7 @@ one_grp_x(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -804,7 +804,7 @@ two_grp(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz,Ncpq] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz,cpq], Config),
@@ -1104,7 +1104,7 @@ hidden_groups(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz,Ncpq] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz,cpq], Config),
diff --git a/lib/kernel/test/init_SUITE.erl b/lib/kernel/test/init_SUITE.erl
index 2db0f7dcb8..b39fadd65f 100644
--- a/lib/kernel/test/init_SUITE.erl
+++ b/lib/kernel/test/init_SUITE.erl
@@ -656,7 +656,7 @@ create_script(Config) ->
?line Apps = application_controller:which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"4.4\"}, \n"
diff --git a/lib/kernel/test/ram_file_SUITE.erl b/lib/kernel/test/ram_file_SUITE.erl
index 9b3fbb91fc..ab95a3ff5f 100644
--- a/lib/kernel/test/ram_file_SUITE.erl
+++ b/lib/kernel/test/ram_file_SUITE.erl
@@ -552,7 +552,7 @@ large_file_light(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
%% Marker for next test case that is to heavy to run in a suite.
?line ok = ?FILE_MODULE:write_file(
- filename:join(PrivDir, large_file_light),
+ filename:join(PrivDir, "large_file_light"),
<<"TAG">>),
%%
?line Data = "abcdefghijklmnopqrstuvwzyz",
@@ -582,7 +582,7 @@ large_file_heavy(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
%% Check previous test case marker.
case ?FILE_MODULE:read_file_info(
- filename:join(PrivDir, large_file_light)) of
+ filename:join(PrivDir, "large_file_light")) of
{ok,_} ->
{skipped,"Too heavy for casual testing!"};
_ ->
diff --git a/lib/kernel/test/zlib_SUITE.erl b/lib/kernel/test/zlib_SUITE.erl
index 9eb84c9167..74bafe8935 100644
--- a/lib/kernel/test/zlib_SUITE.erl
+++ b/lib/kernel/test/zlib_SUITE.erl
@@ -42,8 +42,8 @@
end
end()).
--define(BARG, {'EXIT',{badarg,[{zlib,_,_}|_]}}).
--define(DATA_ERROR, {'EXIT',{data_error,[{zlib,_,_}|_]}}).
+-define(BARG, {'EXIT',{badarg,[{zlib,_,_,_}|_]}}).
+-define(DATA_ERROR, {'EXIT',{data_error,[{zlib,_,_,_}|_]}}).
init_per_testcase(_Func, Config) ->
Dog = test_server:timetrap(test_server:seconds(60)),
@@ -412,6 +412,7 @@ api_crc32(Config) when is_list(Config) ->
Compressed = list_to_binary(Compressed1 ++ Compressed2),
CRC1 = ?m( CRC1 when is_integer(CRC1), zlib:crc32(Z1)),
?m(CRC1 when is_integer(CRC1), zlib:crc32(Z1,Bin)),
+ ?m(CRC1 when is_integer(CRC1), zlib:crc32(Z1,binary_to_list(Bin))),
?m(CRC2 when is_integer(CRC2), zlib:crc32(Z1,Compressed)),
CRC2 = ?m(CRC2 when is_integer(CRC2), zlib:crc32(Z1,0,Compressed)),
?m(CRC3 when CRC2 /= CRC3, zlib:crc32(Z1,234,Compressed)),
@@ -437,6 +438,7 @@ api_adler32(Config) when is_list(Config) ->
Compressed2 = ?m(_, zlib:deflate(Z1, <<>>, finish)),
Compressed = list_to_binary(Compressed1 ++ Compressed2),
?m(ADLER1 when is_integer(ADLER1), zlib:adler32(Z1,Bin)),
+ ?m(ADLER1 when is_integer(ADLER1), zlib:adler32(Z1,binary_to_list(Bin))),
ADLER2 = ?m(ADLER2 when is_integer(ADLER2), zlib:adler32(Z1,Compressed)),
?m(ADLER2 when is_integer(ADLER2), zlib:adler32(Z1,1,Compressed)),
?m(ADLER3 when ADLER2 /= ADLER3, zlib:adler32(Z1,234,Compressed)),
@@ -464,6 +466,7 @@ api_un_compress(Config) when is_list(Config) ->
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<120,156,3>>)),
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<120,156,3,0>>)),
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<0,156,3,0,0,0,0,1>>)),
+ ?m(Bin, zlib:uncompress(binary_to_list(Comp))),
?m(Bin, zlib:uncompress(Comp)).
api_un_zip(doc) -> "Test zip";
@@ -472,10 +475,12 @@ api_un_zip(Config) when is_list(Config) ->
?m(?BARG,zlib:zip(not_a_binary)),
Bin = <<1,11,1,23,45>>,
?line Comp = zlib:zip(Bin),
+ ?m(Comp, zlib:zip(binary_to_list(Bin))),
?m(?BARG,zlib:unzip(not_a_binary)),
?m({'EXIT',{data_error,_}}, zlib:unzip(<<171,171,171,171,171>>)),
?m({'EXIT',{data_error,_}}, zlib:unzip(<<>>)),
?m(Bin, zlib:unzip(Comp)),
+ ?m(Bin, zlib:unzip(binary_to_list(Comp))),
%% OTP-6396
B = <<131,104,19,100,0,13,99,95,99,105,100,95,99,115,103,115,110,95,50,97,1,107,0,4,208,161,246,29,107,0,3,237,166,224,107,0,6,66,240,153,0,2,10,1,0,8,97,116,116,97,99,104,101,100,104,2,100,0,22,117,112,100,97,116,101,95,112,100,112,95,99,111,110,116,101,120,116,95,114,101,113,107,0,114,69,3,12,1,11,97,31,113,150,64,104,132,61,64,104,12,3,197,31,113,150,64,104,132,61,64,104,12,1,11,97,31,115,150,64,104,116,73,64,104,0,0,0,0,0,0,65,149,16,61,65,149,16,61,1,241,33,4,5,0,33,4,4,10,6,10,181,4,10,6,10,181,38,15,99,111,109,109,97,110,100,1,114,45,97,112,110,45,49,3,99,111,109,5,109,110,99,57,57,6,109,99,99,50,52,48,4,103,112,114,115,8,0,104,2,104,2,100,0,8,97,99,116,105,118,97,116,101,104,23,100,0,11,112,100,112,95,99,111,110,116,1,120,116,100,0,7,112,114,105,109,97,114,121,97,1,100,0,9,117,110,100,101,102,105,110,101,100,97,1,97,4,97,4,97,7,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,10100,100,0,9,117,110,100,101,102,105,110,101,100,100,0,5,102,97,108,115,101,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,1,101,100,97,0,100,0,9,117,110,100,101,102,105,110,101,100,107,0,4,16,0,1,144,107,0,4,61,139,186,181,107,0,4,10,8,201,49,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,0,101,100,100,0,9,117,110,100,101,102,105,110,101,100,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,21,106,108,0,0,0,3,104,2,97,1,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,167,20,104,2,97,4,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,21,104,2,97,10,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,26,106,100,0,5,118,101,114,57,57,100,0,9,117,110,0,101,102,105,110,101,100,107,0,2,0,244,107,0,4,10,6,102,195,107,0,4,10,6,102,195,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,101,100,107,0,125,248,143,0,203,25115,157,116,65,185,65,172,55,87,164,88,225,50,203,251,115,157,116,65,185,65,172,55,87,164,88,225,50,0,0,82,153,50,0,200,98,87,148,237,193,185,65,149,167,69,144,14,16,153,50,3,81,70,94,13,109,193,1,120,5,181,113,198,118,50,3,81,70,94,13,109,193,185,120,5,181,113,198,118,153,3,81,70,94,13,109,193,185,120,5,181,113,198,118,153,50,16,1,2,3,4,5,6,7,8,9,0,1,2,3,4,5,6,113,92,2,119,128,0,0,108,0,0,1,107,0,114,69,3,12,1,11,97,31,113,150,64,104,132,61,64,104,12,3,11,97,31,113,150,64,104,132,61,64,104,12,1,11,97,31,115,150,64,104,116,73,64,104,0,0,0,0,0,0,65,149,16,61,65,149,16,61,1,241,33,4,0,33,4,4,10,6,10,181,4,10,6,10,181,38,15,99,111,109,109,97,110,100,101,114,45,97,112,110,45,49,3,99,111,109,5,109,110,99,57,57,6,109,99,99,50,52,48,4,103,112,114,115,8,0,106>>,
@@ -504,10 +509,12 @@ api_g_un_zip(Config) when is_list(Config) ->
?m(?BARG,zlib:gzip(not_a_binary)),
Bin = <<1,11,1,23,45>>,
?line Comp = zlib:gzip(Bin),
+ ?m(Comp, zlib:gzip(binary_to_list(Bin))),
?m(?BARG, zlib:gunzip(not_a_binary)),
?m(?DATA_ERROR, zlib:gunzip(<<171,171,171,171,171>>)),
?m(?DATA_ERROR, zlib:gunzip(<<>>)),
?m(Bin, zlib:gunzip(Comp)),
+ ?m(Bin, zlib:gunzip(binary_to_list(Comp))),
%% Bad CRC; bad length.
BadCrc = bad_crc_data(),
@@ -844,6 +851,7 @@ dictionary_usage({run}) ->
?m(ok, zlib:inflateInit(Z2)),
?line {'EXIT',{{need_dictionary,DictID},_}} = (catch zlib:inflate(Z2, Compressed)),
?m(ok, zlib:inflateSetDictionary(Z2, Dict)),
+ ?m(ok, zlib:inflateSetDictionary(Z2, binary_to_list(Dict))),
?line Uncompressed = ?m(B when is_list(B), zlib:inflate(Z2, [])),
?m(ok, zlib:inflateEnd(Z2)),
?m(ok, zlib:close(Z2)),
diff --git a/lib/megaco/src/binary/depend.mk b/lib/megaco/src/binary/depend.mk
index 5ec4977175..d12bd8bad0 100644
--- a/lib/megaco/src/binary/depend.mk
+++ b/lib/megaco/src/binary/depend.mk
@@ -83,17 +83,16 @@ PER_BIN_DRV_V3_FLAGS = $(ASN1_CT_OPTS) +optimize
# --- Version 1 ---
-$(BER_ASN1_V1_SPEC).erl $(BER_ASN1_V1_SPEC).hrl: \
+$(BER_ASN1_V1_SPEC).erl: \
$(BER_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(BER_ASN1_V1_SPEC):"
$(ERLC) -bber $(BER_V1_FLAGS) $(BER_ASN1_V1_SPEC).set.asn
$(EBIN)/$(BER_ASN1_V1_SPEC).$(EMULATOR): \
- $(BER_ASN1_V1_SPEC).erl \
- $(BER_ASN1_V1_SPEC).hrl
+ $(BER_ASN1_V1_SPEC).erl
-$(BER_BIN_ASN1_V1_SPEC).erl $(BER_BIN_ASN1_V1_SPEC).hrl: \
+$(BER_BIN_ASN1_V1_SPEC).erl: \
$(BER_BIN_ASN1_V1_SPEC).set.asn \
$(BER_BIN_ASN1_V1_SPEC).asn1config \
$(ASN1_V1_SPEC).asn
@@ -101,10 +100,9 @@ $(BER_BIN_ASN1_V1_SPEC).erl $(BER_BIN_ASN1_V1_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_V1_FLAGS) $(BER_BIN_ASN1_V1_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_V1_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_V1_SPEC).erl \
- $(BER_BIN_ASN1_V1_SPEC).hrl
+ $(BER_BIN_ASN1_V1_SPEC).erl
-$(BER_BIN_DRV_ASN1_V1_SPEC).erl $(BER_BIN_DRV_ASN1_V1_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_V1_SPEC).erl: \
$(BER_BIN_DRV_ASN1_V1_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_V1_SPEC).asn1config \
$(ASN1_V1_SPEC).asn
@@ -112,53 +110,48 @@ $(BER_BIN_DRV_ASN1_V1_SPEC).erl $(BER_BIN_DRV_ASN1_V1_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_V1_FLAGS) $(BER_BIN_DRV_ASN1_V1_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_V1_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_V1_SPEC).erl \
- $(BER_BIN_DRV_ASN1_V1_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_V1_SPEC).erl
-$(PER_ASN1_V1_SPEC).erl $(PER_ASN1_V1_SPEC).hrl: \
+$(PER_ASN1_V1_SPEC).erl: \
$(PER_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(PER_ASN1_V1_SPEC):"
$(ERLC) -bper $(PER_V1_FLAGS) $(PER_ASN1_V1_SPEC).set.asn
$(EBIN)/$(PER_ASN1_V1_SPEC).$(EMULATOR): \
- $(PER_ASN1_V1_SPEC).erl \
- $(PER_ASN1_V1_SPEC).hrl
+ $(PER_ASN1_V1_SPEC).erl
-$(PER_BIN_ASN1_V1_SPEC).erl $(PER_BIN_ASN1_V1_SPEC).hrl: \
+$(PER_BIN_ASN1_V1_SPEC).erl: \
$(PER_BIN_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(PER_BIN_ASN1_V1_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_V1_FLAGS) $(PER_BIN_ASN1_V1_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_V1_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_V1_SPEC).erl \
- $(PER_BIN_ASN1_V1_SPEC).hrl
+ $(PER_BIN_ASN1_V1_SPEC).erl
-$(PER_BIN_DRV_ASN1_V1_SPEC).erl $(PER_BIN_DRV_ASN1_V1_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_V1_SPEC).erl: \
$(PER_BIN_DRV_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_V1_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_V1_FLAGS) $(PER_BIN_DRV_ASN1_V1_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_V1_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_V1_SPEC).erl \
- $(PER_BIN_DRV_ASN1_V1_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_V1_SPEC).erl
# --- Version 2 ---
-$(BER_ASN1_V2_SPEC).erl $(BER_ASN1_V2_SPEC).hrl: \
+$(BER_ASN1_V2_SPEC).erl: \
$(BER_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(BER_ASN1_V2_SPEC):"
$(ERLC) -bber $(BER_V2_FLAGS) $(BER_ASN1_V2_SPEC).set.asn
$(EBIN)/$(BER_ASN1_V2_SPEC).$(EMULATOR): \
- $(BER_ASN1_V2_SPEC).erl \
- $(BER_ASN1_V2_SPEC).hrl
+ $(BER_ASN1_V2_SPEC).erl
-$(BER_BIN_ASN1_V2_SPEC).erl $(BER_BIN_ASN1_V2_SPEC).hrl: \
+$(BER_BIN_ASN1_V2_SPEC).erl: \
$(BER_BIN_ASN1_V2_SPEC).set.asn \
$(BER_BIN_ASN1_V2_SPEC).asn1config \
$(ASN1_V2_SPEC).asn
@@ -166,10 +159,9 @@ $(BER_BIN_ASN1_V2_SPEC).erl $(BER_BIN_ASN1_V2_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_V2_FLAGS) $(BER_BIN_ASN1_V2_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_V2_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_V2_SPEC).erl \
- $(BER_BIN_ASN1_V2_SPEC).hrl
+ $(BER_BIN_ASN1_V2_SPEC).erl
-$(BER_BIN_DRV_ASN1_V2_SPEC).erl $(BER_BIN_DRV_ASN1_V2_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_V2_SPEC).erl: \
$(BER_BIN_DRV_ASN1_V2_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_V2_SPEC).asn1config \
$(ASN1_V2_SPEC).asn
@@ -177,55 +169,50 @@ $(BER_BIN_DRV_ASN1_V2_SPEC).erl $(BER_BIN_DRV_ASN1_V2_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_V2_FLAGS) $(BER_BIN_DRV_ASN1_V2_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_V2_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_V2_SPEC).erl \
- $(BER_BIN_DRV_ASN1_V2_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_V2_SPEC).erl
-$(PER_ASN1_V2_SPEC).erl $(PER_ASN1_V2_SPEC).hrl: \
+$(PER_ASN1_V2_SPEC).erl: \
$(PER_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(PER_ASN1_V2_SPEC):"
$(ERLC) -bper $(PER_V2_FLAGS) $(PER_ASN1_V2_SPEC).set.asn
$(EBIN)/$(PER_ASN1_V2_SPEC).$(EMULATOR): \
- $(PER_ASN1_V2_SPEC).erl \
- $(PER_ASN1_V2_SPEC).hrl
+ $(PER_ASN1_V2_SPEC).erl
-$(PER_BIN_ASN1_V2_SPEC).erl $(PER_BIN_ASN1_V2_SPEC).hrl: \
+$(PER_BIN_ASN1_V2_SPEC).erl: \
$(PER_BIN_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(PER_BIN_ASN1_V2_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_V2_FLAGS) $(PER_BIN_ASN1_V2_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_V2_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_V2_SPEC).erl \
- $(PER_BIN_ASN1_V2_SPEC).hrl
+ $(PER_BIN_ASN1_V2_SPEC).erl
-$(PER_BIN_DRV_ASN1_V2_SPEC).erl $(PER_BIN_DRV_ASN1_V2_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_V2_SPEC).erl: \
$(PER_BIN_DRV_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_V2_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_V2_FLAGS) $(PER_BIN_DRV_ASN1_V2_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_V2_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_V2_SPEC).erl \
- $(PER_BIN_DRV_ASN1_V2_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_V2_SPEC).erl
# --- Version 3 ---
# -- (prev3a) --
-$(BER_ASN1_PREV3A_SPEC).erl $(BER_ASN1_PREV3A_SPEC).hrl: \
+$(BER_ASN1_PREV3A_SPEC).erl: \
$(BER_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(BER_ASN1_PREV3A_SPEC):"
$(ERLC) -bber $(BER_PREV3A_FLAGS) $(BER_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(BER_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(BER_ASN1_PREV3A_SPEC).erl \
- $(BER_ASN1_PREV3A_SPEC).hrl
+ $(BER_ASN1_PREV3A_SPEC).erl
-$(BER_BIN_ASN1_PREV3A_SPEC).erl $(BER_BIN_ASN1_PREV3A_SPEC).hrl: \
+$(BER_BIN_ASN1_PREV3A_SPEC).erl: \
$(BER_BIN_ASN1_PREV3A_SPEC).set.asn \
$(BER_BIN_ASN1_PREV3A_SPEC).asn1config \
$(ASN1_PREV3A_SPEC).asn
@@ -233,10 +220,9 @@ $(BER_BIN_ASN1_PREV3A_SPEC).erl $(BER_BIN_ASN1_PREV3A_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_PREV3A_FLAGS) $(BER_BIN_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_PREV3A_SPEC).erl \
- $(BER_BIN_ASN1_PREV3A_SPEC).hrl
+ $(BER_BIN_ASN1_PREV3A_SPEC).erl
-$(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3A_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl: \
$(BER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_PREV3A_SPEC).asn1config \
$(ASN1_PREV3A_SPEC).asn
@@ -244,52 +230,47 @@ $(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3A_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_PREV3A_FLAGS) $(BER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl \
- $(BER_BIN_DRV_ASN1_PREV3A_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl
-$(PER_ASN1_PREV3A_SPEC).erl $(PER_ASN1_PREV3A_SPEC).hrl: \
+$(PER_ASN1_PREV3A_SPEC).erl: \
$(PER_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(PER_ASN1_PREV3A_SPEC):"
$(ERLC) -bper $(PER_PREV3A_FLAGS) $(PER_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(PER_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(PER_ASN1_PREV3A_SPEC).erl \
- $(PER_ASN1_PREV3A_SPEC).hrl
+ $(PER_ASN1_PREV3A_SPEC).erl
-$(PER_BIN_ASN1_PREV3A_SPEC).erl $(PER_BIN_ASN1_PREV3A_SPEC).hrl: \
+$(PER_BIN_ASN1_PREV3A_SPEC).erl: \
$(PER_BIN_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(PER_BIN_ASN1_PREV3A_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_PREV3A_FLAGS) $(PER_BIN_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_PREV3A_SPEC).erl \
- $(PER_BIN_ASN1_PREV3A_SPEC).hrl
+ $(PER_BIN_ASN1_PREV3A_SPEC).erl
-$(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl $(PER_BIN_DRV_ASN1_PREV3A_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl: \
$(PER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_PREV3A_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_PREV3A_FLAGS) $(PER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl \
- $(PER_BIN_DRV_ASN1_PREV3A_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl
# -- (prev3b) --
-$(BER_ASN1_PREV3B_SPEC).erl $(BER_ASN1_PREV3B_SPEC).hrl: \
+$(BER_ASN1_PREV3B_SPEC).erl: \
$(BER_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(BER_ASN1_PREV3B_SPEC):"
$(ERLC) -bber $(BER_PREV3B_FLAGS) $(BER_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(BER_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(BER_ASN1_PREV3B_SPEC).erl \
- $(BER_ASN1_PREV3B_SPEC).hrl
+ $(BER_ASN1_PREV3B_SPEC).erl
-$(BER_BIN_ASN1_PREV3B_SPEC).erl $(BER_BIN_ASN1_PREV3B_SPEC).hrl: \
+$(BER_BIN_ASN1_PREV3B_SPEC).erl: \
$(BER_BIN_ASN1_PREV3B_SPEC).set.asn \
$(BER_BIN_ASN1_PREV3B_SPEC).asn1config \
$(ASN1_PREV3B_SPEC).asn
@@ -297,10 +278,9 @@ $(BER_BIN_ASN1_PREV3B_SPEC).erl $(BER_BIN_ASN1_PREV3B_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_PREV3B_FLAGS) $(BER_BIN_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_PREV3B_SPEC).erl \
- $(BER_BIN_ASN1_PREV3B_SPEC).hrl
+ $(BER_BIN_ASN1_PREV3B_SPEC).erl
-$(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3B_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl: \
$(BER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_PREV3B_SPEC).asn1config \
$(ASN1_PREV3B_SPEC).asn
@@ -308,53 +288,48 @@ $(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3B_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_PREV3B_FLAGS) $(BER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl \
- $(BER_BIN_DRV_ASN1_PREV3B_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl
-$(PER_ASN1_PREV3B_SPEC).erl $(PER_ASN1_PREV3B_SPEC).hrl: \
+$(PER_ASN1_PREV3B_SPEC).erl: \
$(PER_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(PER_ASN1_PREV3B_SPEC):"
$(ERLC) -bper $(PER_PREV3B_FLAGS) $(PER_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(PER_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(PER_ASN1_PREV3B_SPEC).erl \
- $(PER_ASN1_PREV3B_SPEC).hrl
+ $(PER_ASN1_PREV3B_SPEC).erl
-$(PER_BIN_ASN1_PREV3B_SPEC).erl $(PER_BIN_ASN1_PREV3B_SPEC).hrl: \
+$(PER_BIN_ASN1_PREV3B_SPEC).erl: \
$(PER_BIN_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(PER_BIN_ASN1_PREV3B_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_PREV3B_FLAGS) $(PER_BIN_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_PREV3B_SPEC).erl \
- $(PER_BIN_ASN1_PREV3B_SPEC).hrl
+ $(PER_BIN_ASN1_PREV3B_SPEC).erl
-$(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl $(PER_BIN_DRV_ASN1_PREV3B_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl: \
$(PER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_PREV3B_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_PREV3B_FLAGS) $(PER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl \
- $(PER_BIN_DRV_ASN1_PREV3B_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl
# -- (prev3c) --
-$(BER_ASN1_PREV3C_SPEC).erl $(BER_ASN1_PREV3C_SPEC).hrl: \
+$(BER_ASN1_PREV3C_SPEC).erl: \
$(BER_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(BER_ASN1_PREV3C_SPEC):"
$(ERLC) -bber $(BER_PREV3C_FLAGS) $(BER_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(BER_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(BER_ASN1_PREV3C_SPEC).erl \
- $(BER_ASN1_PREV3C_SPEC).hrl
+ $(BER_ASN1_PREV3C_SPEC).erl
-$(BER_BIN_ASN1_PREV3C_SPEC).erl $(BER_BIN_ASN1_PREV3C_SPEC).hrl: \
+$(BER_BIN_ASN1_PREV3C_SPEC).erl: \
$(BER_BIN_ASN1_PREV3C_SPEC).set.asn \
$(BER_BIN_ASN1_PREV3C_SPEC).asn1config \
$(ASN1_PREV3C_SPEC).asn
@@ -362,10 +337,9 @@ $(BER_BIN_ASN1_PREV3C_SPEC).erl $(BER_BIN_ASN1_PREV3C_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_PREV3C_FLAGS) $(BER_BIN_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_PREV3C_SPEC).erl \
- $(BER_BIN_ASN1_PREV3C_SPEC).hrl
+ $(BER_BIN_ASN1_PREV3C_SPEC).erl
-$(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3C_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl: \
$(BER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_PREV3C_SPEC).asn1config \
$(ASN1_PREV3C_SPEC).asn
@@ -373,53 +347,48 @@ $(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3C_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_PREV3C_FLAGS) $(BER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl \
- $(BER_BIN_DRV_ASN1_PREV3C_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl
-$(PER_ASN1_PREV3C_SPEC).erl $(PER_ASN1_PREV3C_SPEC).hrl: \
+$(PER_ASN1_PREV3C_SPEC).erl: \
$(PER_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(PER_ASN1_PREV3C_SPEC):"
$(ERLC) -bper $(PER_PREV3C_FLAGS) $(PER_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(PER_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(PER_ASN1_PREV3C_SPEC).erl \
- $(PER_ASN1_PREV3C_SPEC).hrl
+ $(PER_ASN1_PREV3C_SPEC).erl
-$(PER_BIN_ASN1_PREV3C_SPEC).erl $(PER_BIN_ASN1_PREV3C_SPEC).hrl: \
+$(PER_BIN_ASN1_PREV3C_SPEC).erl: \
$(PER_BIN_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(PER_BIN_ASN1_PREV3C_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_PREV3C_FLAGS) $(PER_BIN_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_PREV3C_SPEC).erl \
- $(PER_BIN_ASN1_PREV3C_SPEC).hrl
+ $(PER_BIN_ASN1_PREV3C_SPEC).erl
-$(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl $(PER_BIN_DRV_ASN1_PREV3C_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl: \
$(PER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_PREV3C_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_PREV3C_FLAGS) $(PER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl \
- $(PER_BIN_DRV_ASN1_PREV3C_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl
# -- (v3) --
-$(BER_ASN1_V3_SPEC).erl $(BER_ASN1_V3_SPEC).hrl: \
+$(BER_ASN1_V3_SPEC).erl: \
$(BER_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(BER_ASN1_V3_SPEC):"
$(ERLC) -bber $(BER_V3_FLAGS) $(BER_ASN1_V3_SPEC).set.asn
$(EBIN)/$(BER_ASN1_V3_SPEC).$(EMULATOR): \
- $(BER_ASN1_V3_SPEC).erl \
- $(BER_ASN1_V3_SPEC).hrl
+ $(BER_ASN1_V3_SPEC).erl
-$(BER_BIN_ASN1_V3_SPEC).erl $(BER_BIN_ASN1_V3_SPEC).hrl: \
+$(BER_BIN_ASN1_V3_SPEC).erl: \
$(BER_BIN_ASN1_V3_SPEC).set.asn \
$(BER_BIN_ASN1_V3_SPEC).asn1config \
$(ASN1_V3_SPEC).asn
@@ -427,10 +396,9 @@ $(BER_BIN_ASN1_V3_SPEC).erl $(BER_BIN_ASN1_V3_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_V3_FLAGS) $(BER_BIN_ASN1_V3_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_V3_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_V3_SPEC).erl \
- $(BER_BIN_ASN1_V3_SPEC).hrl
+ $(BER_BIN_ASN1_V3_SPEC).erl
-$(BER_BIN_DRV_ASN1_V3_SPEC).erl $(BER_BIN_DRV_ASN1_V3_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_V3_SPEC).erl: \
$(BER_BIN_DRV_ASN1_V3_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_V3_SPEC).asn1config \
$(ASN1_V3_SPEC).asn
@@ -438,38 +406,34 @@ $(BER_BIN_DRV_ASN1_V3_SPEC).erl $(BER_BIN_DRV_ASN1_V3_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_V3_FLAGS) $(BER_BIN_DRV_ASN1_V3_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_V3_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_V3_SPEC).erl \
- $(BER_BIN_DRV_ASN1_V3_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_V3_SPEC).erl
-$(PER_ASN1_V3_SPEC).erl $(PER_ASN1_V3_SPEC).hrl: \
+$(PER_ASN1_V3_SPEC).erl: \
$(PER_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(PER_ASN1_V3_SPEC):"
$(ERLC) -bper $(PER_V3_FLAGS) $(PER_ASN1_V3_SPEC).set.asn
$(EBIN)/$(PER_ASN1_V3_SPEC).$(EMULATOR): \
- $(PER_ASN1_V3_SPEC).erl \
- $(PER_ASN1_V3_SPEC).hrl
+ $(PER_ASN1_V3_SPEC).erl
-$(PER_BIN_ASN1_V3_SPEC).erl $(PER_BIN_ASN1_V3_SPEC).hrl: \
+$(PER_BIN_ASN1_V3_SPEC).erl: \
$(PER_BIN_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(PER_BIN_ASN1_V3_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_V3_FLAGS) $(PER_BIN_ASN1_V3_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_V3_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_V3_SPEC).erl \
- $(PER_BIN_ASN1_V3_SPEC).hrl
+ $(PER_BIN_ASN1_V3_SPEC).erl
-$(PER_BIN_DRV_ASN1_V3_SPEC).erl $(PER_BIN_DRV_ASN1_V3_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_V3_SPEC).erl: \
$(PER_BIN_DRV_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_V3_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_V3_FLAGS) $(PER_BIN_DRV_ASN1_V3_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_V3_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_V3_SPEC).erl \
- $(PER_BIN_DRV_ASN1_V3_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_V3_SPEC).erl
# -------------
diff --git a/lib/megaco/src/flex/Makefile.in b/lib/megaco/src/flex/Makefile.in
index 5af651d89b..2c46a673e4 100644
--- a/lib/megaco/src/flex/Makefile.in
+++ b/lib/megaco/src/flex/Makefile.in
@@ -391,7 +391,9 @@ $(STD_DRV).c: $(STD_DRV).flex
$(MT_DRV).c: $(MT_DRV).flex
$(LEX) $(MT_LEX_FLAGS) -P$* -o$@ $<
-solibs: $(LIBDIR) $(OBJDIR) $(SOLIBS)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
+
+solibs: $(SOLIBS)
$(OBJDIR)/$(STD_DRV).o: $(STD_DRV).c
@echo "compiling std driver:"
@@ -411,10 +413,3 @@ $(LIBDIR)/$(STD_DRV).$(DED_EXT): $(OBJDIR)/$(STD_DRV).o
$(LIBDIR)/$(MT_DRV).$(DED_EXT): $(OBJDIR)/$(MT_DRV).o
@echo "linking multi-threaded driver:"
$(LD) $(LDFLAGS) -o $@ $<
-
-$(LIBDIR):
- -mkdir -p $(LIBDIR)
-
-$(OBJDIR):
- -mkdir -p $(OBJDIR)
-
diff --git a/lib/mnesia/src/mnesia_lib.erl b/lib/mnesia/src/mnesia_lib.erl
index 7e926a6258..775d370d0f 100644
--- a/lib/mnesia/src/mnesia_lib.erl
+++ b/lib/mnesia/src/mnesia_lib.erl
@@ -413,7 +413,7 @@ pr_other(Var, Other) ->
[self(), process_info(self(), registered_name),
Var, Other, Why]),
case Other of
- {badarg, [{ets, lookup_element, _}|_]} ->
+ {badarg, [{ets, lookup_element, _, _}|_]} ->
exit(Why);
_ ->
erlang:error(Why)
diff --git a/lib/mnesia/src/mnesia_loader.erl b/lib/mnesia/src/mnesia_loader.erl
index e785b795d1..607e205fef 100644
--- a/lib/mnesia/src/mnesia_loader.erl
+++ b/lib/mnesia/src/mnesia_loader.erl
@@ -464,7 +464,7 @@ init_table(Tab, disc_only_copies, Fun, false, DetsInfo,Sender) ->
{ErtsVer, DetsData} ->
Res = (catch dets:is_compatible_bchunk_format(Tab, DetsData)),
case Res of
- {'EXIT',{undef,[{dets,_,_}|_]}} ->
+ {'EXIT',{undef,[{dets,_,_,_}|_]}} ->
Sender ! {self(), {old_protocol, Tab}},
dets:init_table(Tab, Fun); %% Old dets version
{'EXIT', What} ->
diff --git a/lib/observer/src/Makefile b/lib/observer/src/Makefile
index 2d06cb6bc4..3875b62101 100644
--- a/lib/observer/src/Makefile
+++ b/lib/observer/src/Makefile
@@ -56,13 +56,16 @@ TARGET_FILES= $(MODULES:%=$(EBIN)/%.$(EMULATOR)) $(APP_TARGET) $(APPUP_TARGET)
PRIVDIR= ../priv
WEBTOOLFILES= $(PRIVDIR)/crashdump_viewer.tool
BINDIR= $(PRIVDIR)/bin
+ifeq ($(findstring win32,$(TARGET)),win32)
+WIN32_EXECUTABLES= $(BINDIR)/etop.bat $(BINDIR)/getop.bat $(BINDIR)/cdv.bat
+else
+WIN32_EXECUTABLES=
+endif
EXECUTABLES= \
$(BINDIR)/etop \
$(BINDIR)/getop \
$(BINDIR)/cdv \
- $(BINDIR)/etop.bat \
- $(BINDIR)/getop.bat \
- $(BINDIR)/cdv.bat
+ $(WIN32_EXECUTABLES)
CDVDIR= $(PRIVDIR)/crashdump_viewer
GIF_FILES= \
$(CDVDIR)/collapsd.gif \
diff --git a/lib/odbc/c_src/odbcserver.c b/lib/odbc/c_src/odbcserver.c
index 11e311d72d..ab2d7fe210 100644
--- a/lib/odbc/c_src/odbcserver.c
+++ b/lib/odbc/c_src/odbcserver.c
@@ -772,6 +772,7 @@ static db_result_msg db_param_query(byte *buffer, db_state *state)
}
associated_result_set(state) = FALSE;
param_query(state) = TRUE;
+ out_params(state) = FALSE;
msg = encode_empty_message();
diff --git a/lib/odbc/test/mysql.erl b/lib/odbc/test/mysql.erl
index 49068c4356..c990793213 100644
--- a/lib/odbc/test/mysql.erl
+++ b/lib/odbc/test/mysql.erl
@@ -26,7 +26,22 @@
%-------------------------------------------------------------------------
connection_string() ->
- "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';".
+ case test_server:os_type() of
+ {unix, linux} ->
+ "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ {unix, sunos} ->
+ solaris_str();
+ {unix, darwin} ->
+ "DSN=MySQLMac;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
+
+solaris_str() ->
+ case erlang:system_info(system_architecture) of
+ "sparc" ++ _ ->
+ "DSN=MySQLSolaris10;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ "i386" ++ _ ->
+ "DSN=MySQLSolaris10i386;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
%-------------------------------------------------------------------------
insert_result() ->
diff --git a/lib/odbc/test/odbc_connect_SUITE.erl b/lib/odbc/test/odbc_connect_SUITE.erl
index e59be772e3..a076c4dfff 100644
--- a/lib/odbc/test/odbc_connect_SUITE.erl
+++ b/lib/odbc/test/odbc_connect_SUITE.erl
@@ -76,20 +76,26 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- case (catch odbc:start()) of
- ok ->
- case catch odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
- {ok, Ref} ->
- odbc:disconnect(Ref),
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC is not properly setup"}
- end;
- _ ->
- {skip,"ODBC not startable"}
- end.
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ case catch odbc:connect(?RDBMS:connection_string(),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
+ {ok, Ref} ->
+ odbc:disconnect(Ref),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config];
+ _ ->
+ {skip, "ODBC is not properly setup"}
+ end;
+ _ ->
+ {skip,"ODBC not startable"}
+ end
+ end.
+
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
diff --git a/lib/odbc/test/odbc_data_type_SUITE.erl b/lib/odbc/test/odbc_data_type_SUITE.erl
index 099ae0aa7d..d61a91f973 100644
--- a/lib/odbc/test/odbc_data_type_SUITE.erl
+++ b/lib/odbc/test/odbc_data_type_SUITE.erl
@@ -89,17 +89,15 @@ init_per_group(GroupName, Config) when GroupName == fixed_char;
end;
init_per_group(unicode, Config) ->
- %% Uses parameterized queries
- case {os:type(), erlang:system_info(wordsize)} of
+ case {os:type(), erlang:system_info({wordsize, external})} of
{{unix, _}, 4} ->
Config;
{{unix, _}, _} ->
- {skip, "Not supported by driver"};
+ {skip, "Postgres drivers pre version psqlODBC 08.04.0200 have utf8-problems"};
_ ->
Config
end;
-
init_per_group(_GroupName, Config) ->
Config.
@@ -115,14 +113,18 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- case (catch odbc:start()) of
- ok ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC not startable"}
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
end.
-
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
diff --git a/lib/odbc/test/odbc_query_SUITE.erl b/lib/odbc/test/odbc_query_SUITE.erl
index 76a214d553..1852678b4b 100644
--- a/lib/odbc/test/odbc_query_SUITE.erl
+++ b/lib/odbc/test/odbc_query_SUITE.erl
@@ -89,6 +89,7 @@ init_per_group(scrollable_cursors, Config) ->
_ ->
Config
end;
+
init_per_group(_,Config) ->
Config.
@@ -105,11 +106,16 @@ end_per_group(_GroupName, Config) ->
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) when is_list(Config) ->
- case (catch odbc:start()) of
- ok ->
- [{tableName, odbc_test_lib:unique_table_name()}| Config];
- _ ->
- {skip, "ODBC not startable"}
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
end.
%%--------------------------------------------------------------------
diff --git a/lib/odbc/test/odbc_start_SUITE.erl b/lib/odbc/test/odbc_start_SUITE.erl
index 440c0ca921..e3a3440559 100644
--- a/lib/odbc/test/odbc_start_SUITE.erl
+++ b/lib/odbc/test/odbc_start_SUITE.erl
@@ -39,11 +39,18 @@
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) ->
- case code:which(odbc) of
- non_existing ->
- {skip, "No ODBC built"};
- _ ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case code:which(odbc) of
+ non_existing ->
+ {skip, "No ODBC built"};
+ _ ->
+ %% Make sure odbc is not already started
+ odbc:stop(),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ end
end.
%%--------------------------------------------------------------------
diff --git a/lib/odbc/test/odbc_test.hrl b/lib/odbc/test/odbc_test.hrl
index 397d04756b..f7bb338a7f 100644
--- a/lib/odbc/test/odbc_test.hrl
+++ b/lib/odbc/test/odbc_test.hrl
@@ -25,14 +25,16 @@
-define(RDBMS, case os:type() of
{unix, sunos} ->
- postgres;
+ mysql;
{unix,linux} ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
mysql;
_ ->
postgres
end;
+ {unix, darwin} ->
+ mysql;
{win32, _} ->
sqlserver
end).
diff --git a/lib/odbc/test/odbc_test_lib.erl b/lib/odbc/test/odbc_test_lib.erl
index 3e78105cf3..4d7d1ae2fa 100644
--- a/lib/odbc/test/odbc_test_lib.erl
+++ b/lib/odbc/test/odbc_test_lib.erl
@@ -36,7 +36,7 @@ match_float(Float, Match, Delta) ->
(Float < Match + Delta) and (Float > Match - Delta).
odbc_check() ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
ok;
Other ->
@@ -71,9 +71,39 @@ strict(_,_) ->
ok.
platform_options() ->
+ [].
+
+skip() ->
case os:type() of
+ {unix, linux} ->
+ Issue = linux_issue(),
+ is_sles9(Issue);
{unix, sunos} ->
- [{scrollable_cursors, off}];
+ not supported_solaris();
_ ->
- []
+ false
end.
+
+supported_solaris() ->
+ case os:version() of
+ {_,10,_} ->
+ true;
+ _ ->
+ false
+ end.
+
+linux_issue() ->
+ {ok, Binary} = file:read_file("/etc/issue"),
+ string:tokens(binary_to_list(Binary), " ").
+
+is_sles11(IssueTokens) ->
+ lists:member("11", IssueTokens).
+
+is_sles10(IssueTokens) ->
+ lists:member("10", IssueTokens).
+
+is_sles9(IssueTokens) ->
+ lists:member("9", IssueTokens).
+
+is_ubuntu(IssueTokens) ->
+ lists:member("Ubuntu", IssueTokens).
diff --git a/lib/odbc/test/postgres.erl b/lib/odbc/test/postgres.erl
index 26a2913d46..d564dbd5ff 100644
--- a/lib/odbc/test/postgres.erl
+++ b/lib/odbc/test/postgres.erl
@@ -30,7 +30,7 @@ connection_string() ->
{unix, sunos} ->
"DSN=Postgres;UID=odbctest";
{unix, linux} ->
- Size = erlang:system_info(wordsize),
+ Size = erlang:system_info({wordsize, external}),
linux_dist_connection_string(Size)
end.
@@ -43,7 +43,12 @@ linux_dist_connection_string(4) ->
end;
linux_dist_connection_string(_) ->
- "DSN=PostgresLinux64;UID=odbctest".
+ case linux_dist() of
+ "ubuntu" ->
+ "DSN=PostgresLinux64Ubuntu;UID=odbctest";
+ _ ->
+ "DSN=PostgresLinux64;UID=odbctest"
+ end.
linux_dist() ->
case file:read_file("/etc/issue") of
diff --git a/lib/orber/COSS/CosNaming/Makefile b/lib/orber/COSS/CosNaming/Makefile
index d3deec7600..28b4d9cacc 100644
--- a/lib/orber/COSS/CosNaming/Makefile
+++ b/lib/orber/COSS/CosNaming/Makefile
@@ -124,13 +124,15 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_FILES): cos_naming_ext.idl cos_naming.idl
+IDL-GENERATED: cos_naming_ext.idl cos_naming.idl
erlc $(ERL_IDL_FLAGS) +'{this,"CosNaming::NamingContext"}' \
+'{this,"CosNaming::NamingContextExt"}' cos_naming_ext.idl
erlc $(ERL_IDL_FLAGS) +'{this,"CosNaming::NamingContext"}' cos_naming.idl
+ >IDL-GENERATED
-# echo "ic:gen(cos_naming, [{this, \"CosNaming::NamingContext\"}]), halt()."| $(ERL) $(ERL_IDL_FLAGS)
+$(GEN_FILES): IDL-GENERATED
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/orber/doc/src/Orber/ignore_config_record.inf b/lib/orber/doc/src/Orber/ignore_config_record.inf
deleted file mode 100644
index 0a5053eba3..0000000000
--- a/lib/orber/doc/src/Orber/ignore_config_record.inf
+++ /dev/null
@@ -1 +0,0 @@
-This file makes clearmake use the -T switch for this subdirectory
diff --git a/lib/orber/examples/Stack/Makefile b/lib/orber/examples/Stack/Makefile
index 6e7f292a04..ccb65038a3 100644
--- a/lib/orber/examples/Stack/Makefile
+++ b/lib/orber/examples/Stack/Makefile
@@ -64,6 +64,8 @@ HRL_FILES=
ERL_FILES= $(MODULES:%=%.erl)
+GEN_FILES = $(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES)
+
JAVA_CLASSES = \
StackClient
@@ -101,9 +103,13 @@ docs:
test: $(TEST_TARGET_FILES)
-
-$(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES): stack.idl
+IDL-GENERATED: stack.idl
erlc $(ERL_IDL_FLAGS) stack.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/orber/src/Makefile b/lib/orber/src/Makefile
index ccc449333c..ed62c94b98 100644
--- a/lib/orber/src/Makefile
+++ b/lib/orber/src/Makefile
@@ -227,15 +227,14 @@ docs:
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES1) $(GEN_HRL_FILES1): $(ERL_TOP)/lib/ic/include/erlang.idl
+IDL-GENERATED: $(ERL_TOP)/lib/ic/include/erlang.idl CORBA.idl OrberIFR.idl
erlc $(ERL_IDL_FLAGS) $(ERL_TOP)/lib/ic/include/erlang.idl
-
-$(GEN_ERL_FILES2) $(GEN_HRL_FILES2): CORBA.idl
erlc $(ERL_IDL_FLAGS) CORBA.idl
+ erlc $(ERL_IDL_FLAGS) +'{this,"Orber::IFR"}' OrberIFR.idl
+ >IDL-GENERATED
-$(GEN_ERL_FILES3) $(GEN_HRL_FILES3): OrberIFR.idl
- erlc $(ERL_IDL_FLAGS) +'{this,"Orber::IFR"}' \
- OrberIFR.idl
+$(GEN_ERL_FILES): IDL-GENERATED
+$(TARGET_FILES): IDL-GENERATED
$(GEN_ASN_ERL) $(GEN_ASN_HRL): OrberCSIv2.asn1 OrberCSIv2.set.asn
erlc $(ERL_COMPILE_FLAGS) $(ASN_FLAGS) +'{inline,"OrberCSIv2"}' OrberCSIv2.set.asn
diff --git a/lib/orber/src/corba.erl b/lib/orber/src/corba.erl
index ecec768544..989e84f581 100644
--- a/lib/orber/src/corba.erl
+++ b/lib/orber/src/corba.erl
@@ -947,7 +947,7 @@ handle_cast2(M, F, A, InternalState, State, Ctx) ->
{noreply, {InternalState, NewState}}
end.
-handle_exit(InternalState, State, {undef, [{M, F, _}|_]} = Reason,
+handle_exit(InternalState, State, {undef, [{M, F, _, _}|_]} = Reason,
OnewayOp, {M, F}, A) ->
case catch check_exports(M:module_info(exports), F) of
{'EXIT',{undef,_}} ->
@@ -979,7 +979,7 @@ handle_exit(InternalState, State, {undef, [{M, F, _}|_]} = Reason,
#'OBJ_ADAPTER'{minor=(?ORBER_VMCID bor 4),
completion_status=?COMPLETED_MAYBE})
end;
-handle_exit(InternalState, State, {undef, [{M2, F2, A2}|_]} = Reason,
+handle_exit(InternalState, State, {undef, [{M2, F2, A2, _}|_]} = Reason,
OnewayOp, {M, F}, A) ->
case catch check_exports(M2:module_info(exports), F2) of
{'EXIT',{undef,_}} ->
diff --git a/lib/orber/src/orber_diagnostics.erl b/lib/orber/src/orber_diagnostics.erl
index c12dbfa896..c115d79524 100644
--- a/lib/orber/src/orber_diagnostics.erl
+++ b/lib/orber/src/orber_diagnostics.erl
@@ -130,10 +130,10 @@ missing_modules_helper([[Mod, Type]|T], ErrorsFound) when Type == ?IFR_StructDef
end;
missing_modules_helper([[Mod, Type]|T], ErrorsFound) when Type == ?IFR_InterfaceDef ->
case catch Mod:oe_get_interface() of
- {'EXIT', {undef,[{Mod, _, _}|_]}} ->
+ {'EXIT', {undef,[{Mod, _, _, _}|_]}} ->
io:format("Missing (Interface): ~p~n", [Mod]),
missing_modules_helper(T, ErrorsFound + 1);
- {'EXIT', {undef,[{OtherMod, _, _}|_]}} ->
+ {'EXIT', {undef,[{OtherMod, _, _, _}|_]}} ->
io:format("Missing (Inherited by the ~p Interface): ~p~n",
[Mod, OtherMod]),
missing_modules_helper(T, ErrorsFound + 1);
diff --git a/lib/orber/src/orber_ifr.erl b/lib/orber/src/orber_ifr.erl
index e56672be93..9631a268e4 100644
--- a/lib/orber/src/orber_ifr.erl
+++ b/lib/orber/src/orber_ifr.erl
@@ -500,7 +500,7 @@ get_tc(Id, Type) ->
case catch Module:tc() of
{'EXIT', Reason} ->
case Reason of
- {undef,[{Module, tc,[]}|_]} ->
+ {undef,[{Module, tc,[],_}|_]} ->
orber:dbg("[~p] ~p:get_tc(~p);~nMissing ~p:tc()~n",
[?LINE, ?MODULE, Id, Module], ?DEBUG_LEVEL),
corba:raise(#'UNKNOWN'{minor=(?ORBER_VMCID bor 1),
diff --git a/lib/orber/test/Makefile b/lib/orber/test/Makefile
index b682bcf24b..996d0d1874 100644
--- a/lib/orber/test/Makefile
+++ b/lib/orber/test/Makefile
@@ -184,31 +184,17 @@ docs:
# Special Targets
# ----------------------------------------------------
-#
-# Each IDL file produces many target files so no pattern
-# rule can be used.
-#
-TGT_ORBER = \
- $(GEN_HRL_ORBER:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_ORBER:%=$(IDLOUTDIR)/%.erl)
-TGT_IIOP = \
- $(GEN_HRL_IIOP:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_IIOP:%=$(IDLOUTDIR)/%.erl)
-
-TGT_TEST_SERVER = \
- $(GEN_HRL_TEST_SERVER:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_TEST_SERVER:%=$(IDLOUTDIR)/%.erl)
-
-$(TGT_ORBER): orber_test.idl
+IDL-GENERATED: orber_test.idl iiop_test.idl orber_test_server.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) orber_test.idl
-
-$(TGT_IIOP): iiop_test.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) \
+'{preproc_flags,"-I../COSS/CosNaming"}' iiop_test.idl
-
-$(TGT_TEST_SERVER): orber_test_server.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) \
+'{cfgfile,"orber_test_server.cfg"}' orber_test_server.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/os_mon/c_src/Makefile.in b/lib/os_mon/c_src/Makefile.in
index 1a371eb380..b81d3f564b 100644
--- a/lib/os_mon/c_src/Makefile.in
+++ b/lib/os_mon/c_src/Makefile.in
@@ -82,13 +82,9 @@ ALL_CFLAGS = @CFLAGS@ @DEFS@ $(CFLAGS)
# Targets
# ----------------------------------------------------
-debug opt: $(OBJDIR) $(BINDIR) $(TARGET_FILES)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(BINDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(BINDIR):
- -@mkdir -p $(BINDIR)
+debug opt: $(TARGET_FILES)
clean:
rm -f $(TARGET_FILES)
diff --git a/lib/os_mon/mibs/Makefile b/lib/os_mon/mibs/Makefile
index cbbc337491..a361fef378 100644
--- a/lib/os_mon/mibs/Makefile
+++ b/lib/os_mon/mibs/Makefile
@@ -78,6 +78,9 @@ $(SNMP_BIN_TARGET_DIR)/OTP-MIB.bin: $(ERL_TOP)/lib/$(OTP_MIBDIR)/mibs/OTP-MI
v1/%.mib.v1: %.mib
$(ERL_TOP)/lib/snmp/bin/snmp-v2tov1 -o $@ $<
+$(SNMP_BIN_TARGET_DIR)/OTP-OS-MON-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/OTP-REG.bin \
+ $(SNMP_BIN_TARGET_DIR)/OTP-MIB.bin \
# ----------------------------------------------------
# Release Target
diff --git a/lib/parsetools/doc/src/yecc.xml b/lib/parsetools/doc/src/yecc.xml
index c712609cf4..1d2a985d7d 100644
--- a/lib/parsetools/doc/src/yecc.xml
+++ b/lib/parsetools/doc/src/yecc.xml
@@ -425,9 +425,9 @@ myparser:parse_and_scan({Mod, Tokenizer, Args}) </code>
Nonterminals E T F.
Terminals '+' '*' '(' ')' number.
Rootsymbol E.
-E -> E '+' T: ['$1', '$2', '$3'].
+E -> E '+' T: ['$2', '$1', '$3'].
E -> T : '$1'.
-T -> T '*' F: ['$1', '$2', '$3'].
+T -> T '*' F: ['$2', '$1', '$3'].
T -> F : '$1'.
F -> '(' E ')' : '$2'.
F -> number : '$1'. </code>
@@ -438,8 +438,8 @@ Terminals '+' '*' '(' ')' number.
Rootsymbol E.
Left 100 '+'.
Left 200 '*'.
-E -> E '+' E : ['$1', '$2', '$3'].
-E -> E '*' E : ['$1', '$2', '$3'].
+E -> E '+' E : ['$2', '$1', '$3'].
+E -> E '*' E : ['$2', '$1', '$3'].
E -> '(' E ')' : '$2'.
E -> number : '$1'. </code>
<p>3. An overloaded minus operator:</p>
diff --git a/lib/parsetools/include/yeccpre.hrl b/lib/parsetools/include/yeccpre.hrl
index 80a3afbdb6..f638529aa4 100644
--- a/lib/parsetools/include/yeccpre.hrl
+++ b/lib/parsetools/include/yeccpre.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -67,7 +67,7 @@ yeccpars0(Tokens, Tzr, State, States, Vstack) ->
Error
end.
-yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs} | _]) ->
+yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs,_} | _]) ->
case atom_to_list(F) of
"yeccgoto_" ++ SymbolL ->
{ok,[{atom,_,Symbol}],_} = erl_scan:string(SymbolL),
diff --git a/lib/parsetools/src/yeccparser.erl b/lib/parsetools/src/yeccparser.erl
index 63127802ee..e4b8b06db5 100644
--- a/lib/parsetools/src/yeccparser.erl
+++ b/lib/parsetools/src/yeccparser.erl
@@ -17,7 +17,7 @@ line_of(Token) ->
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -83,7 +83,7 @@ yeccpars0(Tokens, Tzr, State, States, Vstack) ->
Error
end.
-yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs} | _]) ->
+yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs,_} | _]) ->
case atom_to_list(F) of
"yeccgoto_" ++ SymbolL ->
{ok,[{atom,_,Symbol}],_} = erl_scan:string(SymbolL),
diff --git a/lib/percept/src/percept_db.erl b/lib/percept/src/percept_db.erl
index 52e9afb78f..61b68ce44f 100644
--- a/lib/percept/src/percept_db.erl
+++ b/lib/percept/src/percept_db.erl
@@ -92,7 +92,7 @@ restart(PerceptDB)->
stop_sync(PerceptDB),
do_start().
-%% @spec do_start(pid()) -> pid()
+%% @spec do_start() -> pid()
%% @private
%% @doc starts the percept database.
@@ -131,6 +131,7 @@ stop_sync(Pid)->
{'DOWN', MonitorRef, _Type, Pid, _Info}->
true
after ?STOP_TIMEOUT->
+ erlang:demonitor(MonitorRef, [flush]),
exit(Pid, kill)
end.
@@ -166,14 +167,14 @@ insert(Trace) ->
select(Query) ->
percept_db ! {select, self(), Query},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec select(atom(), list()) -> Result
%% @equiv select({Table,Options})
select(Table, Options) ->
percept_db ! {select, self(), {Table, Options}},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec consolidate() -> Result
%% @doc Checks timestamp and state-flow inconsistencies in the
@@ -213,7 +214,7 @@ loop_percept_db() ->
insert_trace(clean_trace(Trace)),
loop_percept_db();
{select, Pid, Query} ->
- Pid ! select_query(Query),
+ Pid ! {result, select_query(Query)},
loop_percept_db();
{action, stop} ->
stopped;
@@ -222,7 +223,7 @@ loop_percept_db() ->
loop_percept_db();
{operate, Pid, {Table, {Fun, Start}}} ->
Result = ets:foldl(Fun, Start, Table),
- Pid ! Result,
+ Pid ! {result, Result},
loop_percept_db();
Unhandled ->
io:format("loop_percept_db, unhandled query: ~p~n", [Unhandled]),
diff --git a/lib/public_key/asn1/Makefile b/lib/public_key/asn1/Makefile
index 6b2a2bc3d9..c4f8d65aa7 100644
--- a/lib/public_key/asn1/Makefile
+++ b/lib/public_key/asn1/Makefile
@@ -79,7 +79,7 @@ clean:
docs:
-%.erl: %.set.asn
+%.erl %.hrl: %.set.asn
erlc $(ASN_FLAGS) $<
$(HRL_FILES): $(ASN_HRLS)
diff --git a/lib/public_key/asn1/README b/lib/public_key/asn1/README
index 5fb8cf9725..2a880e2d51 100644
--- a/lib/public_key/asn1/README
+++ b/lib/public_key/asn1/README
@@ -46,6 +46,6 @@ diff -r1.1 PKIXAttributeCertificate.asn1
---
> version AttCertVersion, -- version is v2
-4. Defenitions of publuic keys from PKCS-1.asn1 present in
+4. Definitions of public keys from PKCS-1.asn1 present in
PKIX1Algorithms88.asn1 where removed as we take them directly from
PKCS-1.asn1 \ No newline at end of file
diff --git a/lib/public_key/doc/src/public_key.xml b/lib/public_key/doc/src/public_key.xml
index d60d91cd83..9a3832c68b 100644
--- a/lib/public_key/doc/src/public_key.xml
+++ b/lib/public_key/doc/src/public_key.xml
@@ -63,7 +63,7 @@
<p><code>pki_asn1_type() = 'Certificate' | 'RSAPrivateKey'| 'RSAPublicKey'
'DSAPrivateKey' | 'DSAPublicKey' | 'DHParameter' | 'SubjectPublicKeyInfo'</code></p>
- <p><code>pem_entry () = {pki_asn1_type(), binary() %% DER or encrypted DER
+ <p><code>pem_entry () = {pki_asn1_type(), binary(), %% DER or encrypted DER
not_encrypted | {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}}.</code></p>
<p><code>rsa_public_key() = #'RSAPublicKey'{}</code></p>
@@ -72,8 +72,6 @@
<p><code>dsa_public_key() = {integer(), #'Dss-Parms'{}} </code></p>
- <p><code>rsa_private_key() = #'RSAPrivateKey'{} </code></p>
-
<p><code>dsa_private_key() = #'DSAPrivateKey'{}</code></p>
<p><code> public_crypt_options() = [{rsa_pad, rsa_padding()}]. </code></p>
@@ -149,7 +147,7 @@
<name>der_decode(Asn1type, Der) -> term()</name>
<fsummary> Decodes a public key asn1 der encoded entity.</fsummary>
<type>
- <v>Asn1Type = atom() -</v>
+ <v>Asn1Type = atom()</v>
<d> ASN.1 type present in the public_key applications
asn1 specifications.</d>
<v>Der = der_encoded()</v>
@@ -166,7 +164,8 @@
<v>Asn1Type = atom()</v>
<d> Asn1 type present in the public_key applications
ASN.1 specifications.</d>
- <v>Entity = term() - The erlang representation of <c> Asn1Type</c></v>
+ <v>Entity = term()</v>
+ <d>The erlang representation of <c>Asn1Type</c></d>
</type>
<desc>
<p> Encodes a public key entity with ASN.1 DER encoding.</p>
@@ -218,12 +217,13 @@
<fsummary> Creates a pem entry that can be fed to pem_encode/1.</fsummary>
<type>
<v>Asn1Type = pki_asn1_type()</v>
- <v>Entity = term() - The Erlang representation of
+ <v>Entity = term()</v>
+ <d>The Erlang representation of
<c>Asn1Type</c>. If <c>Asn1Type</c> is 'SubjectPublicKeyInfo'
then <c>Entity</c> must be either an rsa_public_key() or a
dsa_public_key() and this function will create the appropriate
'SubjectPublicKeyInfo' entry.
- </v>
+ </d>
<v>CipherInfo = {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}</v>
<v>Password = string()</v>
</type>
@@ -281,7 +281,7 @@
<desc>
<p>Der encodes a pkix x509 certificate or part of such a
certificate. This function must be used for encoding certificates or parts of certificates
- that are decoded/created on the otp format, whereas for the plain format this
+ that are decoded/created in the otp format, whereas for the plain format this
function will directly call der_encode/2. </p>
</desc>
</func>
diff --git a/lib/public_key/src/public_key.erl b/lib/public_key/src/public_key.erl
index 2901020e83..33fcce2c44 100644
--- a/lib/public_key/src/public_key.erl
+++ b/lib/public_key/src/public_key.erl
@@ -488,9 +488,10 @@ pkix_path_validation(PathErr, [Cert | Chain], Options0) when is_atom(PathErr)->
_:_ ->
{error, Reason}
end;
-pkix_path_validation(TrustedCert, CertChain, Options) when
- is_binary(TrustedCert) -> OtpCert = pkix_decode_cert(TrustedCert,
- otp), pkix_path_validation(OtpCert, CertChain, Options);
+pkix_path_validation(TrustedCert, CertChain, Options)
+ when is_binary(TrustedCert) ->
+ OtpCert = pkix_decode_cert(TrustedCert, otp),
+ pkix_path_validation(OtpCert, CertChain, Options);
pkix_path_validation(#'OTPCertificate'{} = TrustedCert, CertChain, Options)
when is_list(CertChain), is_list(Options) ->
diff --git a/lib/runtime_tools/c_src/Makefile.in b/lib/runtime_tools/c_src/Makefile.in
index 840de39f07..73ab6cdc11 100644
--- a/lib/runtime_tools/c_src/Makefile.in
+++ b/lib/runtime_tools/c_src/Makefile.in
@@ -89,42 +89,31 @@ endif
# Targets
# ----------------------------------------------------
-debug opt: $(OBJDIR) $(BINDIR) $(SOLIBS)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(BINDIR):
- -@mkdir -p $(BINDIR)
+debug opt: $(SOLIBS)
$(OBJDIR)/%.o: %.c
- $(INSTALL_DIR) $(OBJDIR)
$(CC) -c -o $@ $(ALL_CFLAGS) $<
$(LIBDIR)/trace_ip_drv.so: $(TRACE_IP_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ -lc $(LIBS)
$(LIBDIR)/trace_file_drv.so: $(TRACE_FILE_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ -lc $(LIBS)
$(LIBDIR)/trace_ip_drv.dll: $(TRACE_IP_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ $(LIBS)
$(LIBDIR)/trace_file_drv.dll: $(TRACE_FILE_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ $(LIBS)
#
# VxWorks is simply to different from Unix in this sense.
# Here are the inference rules for VxWorks
#
$(LIBDIR)/trace_ip_drv.eld: $(TRACE_IP_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^
$(LIBDIR)/trace_file_drv.eld: $(TRACE_FILE_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^
clean:
diff --git a/lib/runtime_tools/doc/src/dbg.xml b/lib/runtime_tools/doc/src/dbg.xml
index 0e63649c09..a17896e4ff 100644
--- a/lib/runtime_tools/doc/src/dbg.xml
+++ b/lib/runtime_tools/doc/src/dbg.xml
@@ -4,7 +4,7 @@
<erlref>
<header>
<copyright>
- <year>1996</year><year>2009</year>
+ <year>1996</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -316,7 +316,8 @@ Error: fun containing local erlang function calls ('is_atomm' called in guard) c
<v>Module = atom() | '_'</v>
<v>Function = atom() | '_'</v>
<v>Arity = integer() |'_'</v>
- <v>MatchSpec = integer() | atom() | [] | match_spec()</v>
+ <v>MatchSpec = integer() | Built-inAlias | [] | match_spec()</v>
+ <v>Built-inAlias = x | c | cx</v>
<v>MatchDesc = [MatchInfo]</v>
<v>MatchInfo = {saved, integer()} | MatchNum</v>
<v>MatchNum = {matched, node(), integer()} | {matched, node(), 0, RPCError}</v>
@@ -349,8 +350,9 @@ Error: fun containing local erlang function calls ('is_atomm' called in guard) c
if the MatchSpec is other
than []. The integer <c>N</c> may then be used in
subsequent calls to this function and will stand as an
- "alias" for the given expression. There are also built-in
- aliases named with atoms (see also <c>ltp/0</c> below).</p>
+ "alias" for the given expression. There are also a couple of
+ built-in aliases for common expressions, see <c>ltp/0</c> below
+ for details.</p>
<p>If an error is returned, it can be due to errors in
compilation of the match specification. Such errors are
presented as a list of tuples <c>{error, string()}</c> where
@@ -528,6 +530,21 @@ Error: fun containing local erlang function calls ('is_atomm' called in guard) c
<p>Match specifications used can be saved in a file (if a
read-write file system is present) for use in later
debugging sessions, see <c>wtp/1</c> and <c>rtp/1</c></p>
+ <p>There are three built-in trace patterns:
+ <c>exception_trace</c>, <c>caller_trace</c>
+ and <c>caller_exception_trace</c> (or <c>x</c>, <c>c</c> and
+ <c>cx</c> respectively).
+ Exception trace sets a trace which will show function names,
+ parameters, return values and exceptions thrown from functions.
+ Caller traces display function names, parameters and information
+ about which function called it. An example using a built-in alias:</p>
+ <pre>
+(x@y)4> <input>dbg:tp(lists,sort,cx).</input>
+{ok,[{matched,nonode@nohost,2},{saved,cx}]}
+(x@y)4> <input>lists:sort([2,1]).</input>
+(&lt;0.32.0&gt;) call lists:sort([2,1]) ({erl_eval,do_apply,5})
+(&lt;0.32.0&gt;) returned from lists:sort/1 -> [1,2]
+[1,2]</pre>
</desc>
</func>
<func>
diff --git a/lib/runtime_tools/src/dbg.erl b/lib/runtime_tools/src/dbg.erl
index 56283f4d3d..446de63064 100644
--- a/lib/runtime_tools/src/dbg.erl
+++ b/lib/runtime_tools/src/dbg.erl
@@ -1449,6 +1449,19 @@ new_pattern_table() ->
ets:insert(PT,
{exception_trace,
term_to_binary(x)}),
+ ets:insert(PT,
+ {c,
+ term_to_binary([{'_',[],[{message,{caller}}]}])}),
+ ets:insert(PT,
+ {caller_trace,
+ term_to_binary(c)}),
+ ets:insert(PT,
+ {cx,
+ term_to_binary([{'_',[],[{exception_trace},
+ {message,{caller}}]}])}),
+ ets:insert(PT,
+ {caller_exception_trace,
+ term_to_binary(cx)}),
PT.
diff --git a/lib/sasl/examples/src/Makefile b/lib/sasl/examples/src/Makefile
index 4a4e04a536..c58f651696 100644
--- a/lib/sasl/examples/src/Makefile
+++ b/lib/sasl/examples/src/Makefile
@@ -66,7 +66,7 @@ release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/examples/src
$(INSTALL_DIR) $(RELSYSDIR)/examples/ebin
(cd ..; tar cf - src ebin | (cd $(RELSYSDIR)/examples; tar xf -))
- chmod -f -R ug+w $(RELSYSDIR)/examples
+ chmod -R ug+w $(RELSYSDIR)/examples
release_docs_spec:
diff --git a/lib/sasl/test/Makefile b/lib/sasl/test/Makefile
index 0bdb79a06a..65be134462 100644
--- a/lib/sasl/test/Makefile
+++ b/lib/sasl/test/Makefile
@@ -86,7 +86,7 @@ release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) sasl.spec sasl.cover $(EMAKEFILE) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cfh - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/snmp/mibs/Makefile.in b/lib/snmp/mibs/Makefile.in
index 3af74eca75..993a67c6f2 100644
--- a/lib/snmp/mibs/Makefile.in
+++ b/lib/snmp/mibs/Makefile.in
@@ -41,8 +41,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/snmp-$(VSN)
# ----------------------------------------------------
# NOTE:
-# 1) Order is important; some MIBs include others
-# 2) The OTP-REG mib actually belongs to another
+# The OTP-REG mib actually belongs to another
# application (otp_mibs), and is exported by this
# app. But since that app is built later, we have
# to built it here in order to be able to build
@@ -148,6 +147,35 @@ $(ERL_TOP)/lib/snmp/bin/snmp-v2tov1: $(ERL_TOP)/lib/snmp/bin/snmp-v2tov1.src
$(SNMP_BIN_TARGET_DIR)/OTP-REG.bin: $(ERL_TOP)/lib/$(OTP_MIBDIR)/mibs/OTP-REG.mib
$(ERLC) -pa $(SNMP_TOOLKIT)/ebin -I $(SNMP_TOOLKIT)/priv/mibs $(SNMP_FLAGS) -o $(SNMP_BIN_TARGET_DIR) $<
+# To support parallel make, we'll need explicit dependencies
+# to ensure that an imported MIB has been compiled when it's needed.
+
+$(SNMP_BIN_TARGET_DIR)/STANDARD-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/RFC1213-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-TARGET-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-NOTIFICATION-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-TARGET-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-COMMUNITY-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-TARGET-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-USER-BASED-SM-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-VIEW-BASED-ACM-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-USM-AES-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/OTP-SNMPEA-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/OTP-REG.bin
+
clean:
rm -f $(TARGET_FILES)
@@ -185,7 +213,7 @@ info:
@echo "VSN = $(VSN)"
@echo "RELSYSDIR = $(RELSYSDIR)"
-v1/%.mib.v1: %.mib
+v1/%.mib.v1: %.mib $(ERL_TOP)/lib/snmp/bin/snmp-v2tov1
$(ERL_TOP)/lib/snmp/bin/snmp-v2tov1 -o $@ $<
diff --git a/lib/snmp/src/agent/snmpa_set_lib.erl b/lib/snmp/src/agent/snmpa_set_lib.erl
index 191029f6db..00c77a0cdb 100644
--- a/lib/snmp/src/agent/snmpa_set_lib.erl
+++ b/lib/snmp/src/agent/snmpa_set_lib.erl
@@ -378,15 +378,15 @@ dbg_apply(M,F,A) ->
Res
end,
case Result of
- {'EXIT', {undef, [{M, F, A} | _]}} ->
+ {'EXIT', {undef, [{M, F, A, _} | _]}} ->
{'EXIT', {hook_undef, {M, F, A}}};
- {'EXIT', {function_clause, [{M, F, A} | _]}} ->
+ {'EXIT', {function_clause, [{M, F, A, _} | _]}} ->
{'EXIT', {hook_function_clause, {M, F, A}}};
% XXX: Old format for compatibility
- {'EXIT', {undef, {M, F, A}}} ->
+ {'EXIT', {undef, {M, F, A, _}}} ->
{'EXIT', {hook_undef, {M, F, A}}};
- {'EXIT', {function_clause, {M, F, A}}} ->
+ {'EXIT', {function_clause, {M, F, A, _}}} ->
{'EXIT', {hook_function_clause, {M, F, A}}};
Result ->
diff --git a/lib/snmp/test/Makefile b/lib/snmp/test/Makefile
index 5530805bc1..78ffb1c255 100644
--- a/lib/snmp/test/Makefile
+++ b/lib/snmp/test/Makefile
@@ -220,6 +220,10 @@ appup: make
$(MAYBE_ESTOP)
+$(SNMP_BIN_TARGET_DIR)/Klas4.bin: $(SNMP_BIN_TARGET_DIR)/Klas3.bin
+
+$(SNMP_BIN_TARGET_DIR)/SA-MIB.bin: $(SNMP_BIN_TARGET_DIR)/OLD-SNMPEA-MIB.bin
+
# ----------------------------------------------------
# Release Target
# ----------------------------------------------------
diff --git a/lib/snmp/test/test_config/Makefile b/lib/snmp/test/test_config/Makefile
index d7bebbc431..d65bb8abe2 100644
--- a/lib/snmp/test/test_config/Makefile
+++ b/lib/snmp/test/test_config/Makefile
@@ -155,23 +155,23 @@ release_spec:
release_tests_spec: clean opt
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DIR) $(RELSYSDIR)/agent
- chmod -f -R u+w $(RELSYSDIR)/agent
+ chmod -R u+w $(RELSYSDIR)/agent
$(INSTALL_DIR) $(RELSYSDIR)/agent/conf
- chmod -f -R u+w $(RELSYSDIR)/agent/conf
+ chmod -R u+w $(RELSYSDIR)/agent/conf
$(INSTALL_DIR) $(RELSYSDIR)/agent/db
- chmod -f -R u+w $(RELSYSDIR)/agent/db
+ chmod -R u+w $(RELSYSDIR)/agent/db
$(INSTALL_DIR) $(RELSYSDIR)/agent/log
- chmod -f -R u+w $(RELSYSDIR)/agent/log
+ chmod -R u+w $(RELSYSDIR)/agent/log
$(INSTALL_DIR) $(RELSYSDIR)/manager
- chmod -f -R u+w $(RELSYSDIR)/manager
+ chmod -R u+w $(RELSYSDIR)/manager
$(INSTALL_DIR) $(RELSYSDIR)/manager/conf
- chmod -f -R u+w $(RELSYSDIR)/manager/conf
+ chmod -R u+w $(RELSYSDIR)/manager/conf
$(INSTALL_DIR) $(RELSYSDIR)/manager/db
- chmod -f -R u+w $(RELSYSDIR)/manager/db
+ chmod -R u+w $(RELSYSDIR)/manager/db
$(INSTALL_DIR) $(RELSYSDIR)/manager/log
- chmod -f -R u+w $(RELSYSDIR)/manager/log
+ chmod -R u+w $(RELSYSDIR)/manager/log
$(INSTALL_DATA) $(SYS_CONFIG_FILES) $(RELSYSDIR)
$(INSTALL_DATA) $(AGENT_CONFIG_FILES) $(RELSYSDIR)/agent/conf
$(INSTALL_DATA) $(MANAGER_CONFIG_FILES) $(RELSYSDIR)/manager/conf
diff --git a/lib/ssh/doc/src/notes.xml b/lib/ssh/doc/src/notes.xml
index 71f3941577..6fc4fdc43d 100644
--- a/lib/ssh/doc/src/notes.xml
+++ b/lib/ssh/doc/src/notes.xml
@@ -29,6 +29,20 @@
<file>notes.xml</file>
</header>
+<section><title>Ssh 2.0.8</title>
+ <section><title>Fixed Bugs and Malfunctions</title>
+ <list>
+ <item>
+ <p>
+ Calling ssh_sftp:stop_channel/1 resulted in that the trap_exit flag was
+ set to true for the invoking process.</p>
+ <p>
+ Own Id: OTP-9386 Aux Id: seq11865</p>
+ </item>
+ </list>
+ </section>
+</section>
+
<section><title>Ssh 2.0.7</title>
<section><title>Fixed Bugs and Malfunctions</title>
<list>
diff --git a/lib/ssh/src/Makefile b/lib/ssh/src/Makefile
index 42880fa80b..e7cf2c6723 100644
--- a/lib/ssh/src/Makefile
+++ b/lib/ssh/src/Makefile
@@ -127,13 +127,10 @@ $(APP_TARGET): $(APP_SRC) ../vsn.mk
$(APPUP_TARGET): $(APPUP_SRC) ../vsn.mk
sed -e 's;%VSN%;$(VSN);' $< > $@
-%.hrl: %.asn1
- erlc $(ASN_FLAGS) $<
+%.erl %.hrl: %.asn1
+ $(ERLC) $(ASN_FLAGS) $<
-DSS.hrl DSS.erl: DSS.asn1
-PKCS-1.hrl PKCS-1.erl: PKCS-1.asn1
-
-$(EBIN)/ssh_file.$(EMULATOR): $(ASN_HRLS)
+$(EBIN)/ssh_file.$(EMULATOR) $(EBIN)/ssh_rsa.$(EMULATOR): $(ASN_HRLS)
docs:
diff --git a/lib/ssh/src/ssh.appup.src b/lib/ssh/src/ssh.appup.src
index 974145836c..150b7d86dd 100644
--- a/lib/ssh/src/ssh.appup.src
+++ b/lib/ssh/src/ssh.appup.src
@@ -19,13 +19,19 @@
{"%VSN%",
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
],
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
]
}.
diff --git a/lib/ssh/src/ssh_sftp.erl b/lib/ssh/src/ssh_sftp.erl
index 59e09fdd0f..f000558100 100755
--- a/lib/ssh/src/ssh_sftp.erl
+++ b/lib/ssh/src/ssh_sftp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2005-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2005-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -130,9 +130,9 @@ start_channel(Host, Port, Opts) ->
end.
stop_channel(Pid) ->
- case process_info(Pid, [trap_exit]) of
- [{trap_exit, Bool}] ->
- process_flag(trap_exit, true),
+ case is_process_alive(Pid) of
+ true ->
+ OldValue = process_flag(trap_exit, true),
link(Pid),
exit(Pid, ssh_sftp_stop_channel),
receive
@@ -145,9 +145,9 @@ stop_channel(Pid) ->
ok
end
end,
- process_flag(trap_exit, Bool),
+ process_flag(trap_exit, OldValue),
ok;
- undefined ->
+ false ->
ok
end.
diff --git a/lib/ssh/test/Makefile b/lib/ssh/test/Makefile
index 5a2a6de24a..1820924ed6 100644
--- a/lib/ssh/test/Makefile
+++ b/lib/ssh/test/Makefile
@@ -115,7 +115,7 @@ release_tests_spec: opt
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) ssh.spec ssh.cover $(RELSYSDIR)
$(INSTALL_DATA) $(HRL_FILES_NEEDED_IN_TEST) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/ssh/vsn.mk b/lib/ssh/vsn.mk
index d79038df29..fe2b915d17 100644
--- a/lib/ssh/vsn.mk
+++ b/lib/ssh/vsn.mk
@@ -1,5 +1,5 @@
#-*-makefile-*- ; force emacs to enter makefile-mode
-SSH_VSN = 2.0.7
+SSH_VSN = 2.0.8
APP_VSN = "ssh-$(SSH_VSN)"
diff --git a/lib/ssl/c_src/Makefile.in b/lib/ssl/c_src/Makefile.in
index 6e413e7e8e..a894e6dcd7 100644
--- a/lib/ssl/c_src/Makefile.in
+++ b/lib/ssl/c_src/Makefile.in
@@ -157,13 +157,9 @@ endif
# Targets
# ----------------------------------------------------
-debug opt: $(OBJDIR) $(BINDIR) $(OBJS) $(PORT_PROGRAM) $(SSL_MAKEFILE)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(BINDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(BINDIR):
- -@mkdir -p $(BINDIR)
+debug opt: $(OBJS) $(PORT_PROGRAM) $(SSL_MAKEFILE)
$(OBJDIR)/esock_openssl$(obj): esock_openssl.c
$(CC) -c -o $@ $(ALL_CFLAGS) $(SSL_INCLUDE) $<
diff --git a/lib/ssl/c_src/esock_openssl.c b/lib/ssl/c_src/esock_openssl.c
index 2621c9934e..0bc42958f0 100644
--- a/lib/ssl/c_src/esock_openssl.c
+++ b/lib/ssl/c_src/esock_openssl.c
@@ -1024,7 +1024,7 @@ static void info_callback(const SSL *ssl, int where, int ret)
}
}
-/* This function is called whenever a SSL_CTX *ctx structure is
+/* This function is called whenever an SSL_CTX *ctx structure is
* freed.
*/
static void callback_data_free(void *parent, void *ptr, CRYPTO_EX_DATA *ad,
diff --git a/lib/ssl/doc/src/notes.xml b/lib/ssl/doc/src/notes.xml
index b2d17925fd..e090b4e1ef 100644
--- a/lib/ssl/doc/src/notes.xml
+++ b/lib/ssl/doc/src/notes.xml
@@ -554,7 +554,7 @@
Own Id: OTP-8224</p>
</item>
<item>
- <p>A ssl:ssl_accept/3 could crash a connection if the
+ <p>An ssl:ssl_accept/3 could crash a connection if the
timing was wrong.</p> <p>Removed info message if the
socket closed without a proper disconnect from the ssl
layer. </p> <p>ssl:send/2 is now blocking until the
@@ -770,7 +770,7 @@
<item>
<p>
The new ssl implementation released as a alfa in this
- version supports upgrading of a tcp connection to a ssl
+ version supports upgrading of a tcp connection to an ssl
connection so that http client and servers may implement
RFC 2817.</p>
<p>
@@ -789,7 +789,7 @@
very crippled as the control of the ssl-socket was deep
down in openssl making it hard if not impossible to
support all inet options, ipv6 and upgrade of a tcp
- connection to a ssl connection. The alfa version has a
+ connection to an ssl connection. The alfa version has a
few limitations that will be removed before the ssl-4.0
release. Main differences and limitations in the alfa are
listed below.</p>
diff --git a/lib/ssl/doc/src/ssl.xml b/lib/ssl/doc/src/ssl.xml
index 566068beaf..0c4c8796be 100644
--- a/lib/ssl/doc/src/ssl.xml
+++ b/lib/ssl/doc/src/ssl.xml
@@ -35,7 +35,7 @@
<title>SSL</title>
<list type="bulleted">
- <item>ssl requires the crypto an public_key applications.</item>
+ <item>ssl requires the crypto and public_key applications.</item>
<item>Supported SSL/TLS-versions are SSL-3.0 and TLS-1.0 </item>
<item>For security reasons sslv2 is not supported.</item>
<item>Ephemeral Diffie-Hellman cipher suites are supported
@@ -216,7 +216,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
application is encountered. Additionally it will be called
when a certificate is considered valid by the path validation
to allow access to each certificate in the path to the user
- application. Note that the it will differentiate between the
+ application. Note that it will differentiate between the
peer certificate and CA certificates by using valid_peer or
valid as the second argument to the verify fun. See <seealso
marker="public_key:cert_records">the public_key User's
@@ -326,10 +326,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</item>
<tag>{fail_if_no_peer_cert, boolean()}</tag>
- <item>Used together with {verify, verify_peer} by a ssl server.
+ <item>Used together with {verify, verify_peer} by an ssl server.
If set to true, the server will fail if the client does not have
a certificate to send, i.e. sends a empty certificate, if set to
- false it will only fail if the client sends a invalid
+ false it will only fail if the client sends an invalid
certificate (an empty certificate is considered valid).
</item>
@@ -343,10 +343,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
PeerCert, Compression, CipherSuite) -> boolean()}</tag>
<item>Enables the ssl server to have a local policy
for deciding if a session should be reused or not,
- only meaning full if <c>reuse_sessions</c> is set to true.
+ only meaningful if <c>reuse_sessions</c> is set to true.
SuggestedSessionId is a binary(), PeerCert is a DER encoded
certificate, Compression is an enumeration integer
- and CipherSuite of type ciphersuite().
+ and CipherSuite is of type ciphersuite().
</item>
</taglist>
@@ -355,7 +355,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<section>
<title>General</title>
- <p>When a ssl socket is in active mode (the default), data from the
+ <p>When an ssl socket is in active mode (the default), data from the
socket is delivered to the owner of the socket in the form of
messages:
</p>
@@ -396,7 +396,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<name>connect(Socket, SslOptions, Timeout) -> {ok, SslSocket}
| {error, Reason}</name>
<fsummary> Upgrades a gen_tcp, or
- equivalent, connected socket to a ssl socket. </fsummary>
+ equivalent, connected socket to an ssl socket. </fsummary>
<type>
<v>Socket = socket()</v>
<v>SslOptions = [ssloption()]</v>
@@ -405,7 +405,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc> <p>Upgrades a gen_tcp, or equivalent,
- connected socket to a ssl socket i.e. performs the
+ connected socket to an ssl socket i.e. performs the
client-side ssl handshake.</p>
</desc>
</func>
@@ -428,12 +428,12 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>close(SslSocket) -> ok | {error, Reason}</name>
- <fsummary>Close a ssl connection</fsummary>
+ <fsummary>Close an ssl connection</fsummary>
<type>
<v>SslSocket = sslsocket()</v>
<v>Reason = term()</v>
</type>
- <desc><p>Close a ssl connection.</p>
+ <desc><p>Close an ssl connection.</p>
</desc>
</func>
@@ -450,7 +450,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc><p>Assigns a new controlling process to the ssl-socket. A
- controlling process is the owner of a ssl-socket, and receives
+ controlling process is the owner of an ssl-socket, and receives
all messages from the socket.</p>
</desc>
</func>
@@ -496,14 +496,14 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>listen(Port, Options) ->
{ok, ListenSocket} | {error, Reason}</name>
- <fsummary>Creates a ssl listen socket.</fsummary>
+ <fsummary>Creates an ssl listen socket.</fsummary>
<type>
<v>Port = integer()</v>
<v>Options = options()</v>
<v>ListenSocket = sslsocket()</v>
</type>
<desc>
- <p>Creates a ssl listen socket.</p>
+ <p>Creates an ssl listen socket.</p>
</desc>
</func>
@@ -587,6 +587,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
the socket is closed.</p>
</desc>
</func>
+
<func>
<name>setopts(Socket, Options) -> ok | {error, Reason}</name>
<fsummary>Set socket options.</fsummary>
@@ -646,7 +647,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</type>
<desc>
<p> Upgrades a gen_tcp, or
- equivalent, socket to a ssl socket i.e. performs the
+ equivalent, socket to an ssl socket i.e. performs the
ssl server-side handshake.</p>
<p><warning>Note that the listen socket should be in {active, false} mode
before telling the client that the server is ready to upgrade
diff --git a/lib/ssl/doc/src/ssl_protocol.xml b/lib/ssl/doc/src/ssl_protocol.xml
index 6936408881..ca5cc8bc7a 100644
--- a/lib/ssl/doc/src/ssl_protocol.xml
+++ b/lib/ssl/doc/src/ssl_protocol.xml
@@ -31,11 +31,11 @@
</p>
<p>By default erlang ssl is run over the TCP/IP protocol even
- though you could plug in an other reliable transport protocol
+ though you could plug in any other reliable transport protocol
with the same API as gen_tcp.</p>
<p>If a client and server wants to use an upgrade mechanism, such as
- defined by RFC2817, to upgrade a regular TCP/IP connection to a ssl
+ defined by RFC2817, to upgrade a regular TCP/IP connection to an ssl
connection the erlang ssl API supports this. This can be useful for
things such as supporting HTTP and HTTPS on the same port and
implementing virtual hosting.
diff --git a/lib/ssl/doc/src/using_ssl.xml b/lib/ssl/doc/src/using_ssl.xml
index 605290b6f9..ab837a156a 100644
--- a/lib/ssl/doc/src/using_ssl.xml
+++ b/lib/ssl/doc/src/using_ssl.xml
@@ -56,7 +56,7 @@
<code type="erl">1 server> ssl:start().
ok</code>
- <p>Create a ssl listen socket</p>
+ <p>Create an ssl listen socket</p>
<code type="erl">2 server> {ok, ListenSocket} =
ssl:listen(9999, [{certfile, "cert.pem"}, {keyfile, "key.pem"},{reuseaddr, true}]).
{ok,{sslsocket, [...]}}</code>
@@ -90,7 +90,7 @@ ok</code>
<section>
<title>Upgrade example</title>
- <note><p> To upgrade a TCP/IP connection to a ssl connection the
+ <note><p> To upgrade a TCP/IP connection to an ssl connection the
client and server have to aggre to do so. Agreement
may be accompliced by using a protocol such the one used by HTTP
specified in RFC 2817.</p> </note>
@@ -114,7 +114,7 @@ ok</code>
<code type="erl">2 client> {ok, Socket} = gen_tcp:connect("localhost", 9999, [], infinity).</code>
<p>Make sure active is set to false before trying
- to upgrade a connection to a ssl connection, otherwhise
+ to upgrade a connection to an ssl connection, otherwhise
ssl handshake messages may be deliverd to the wrong process.</p>
<code type="erl">4 server> inet:setopts(Socket, [{active, false}]).
ok</code>
@@ -124,7 +124,7 @@ ok</code>
{certfile, "cert.pem"}, {keyfile, "key.pem"}]).
{ok,{sslsocket,[...]}}</code>
- <p> Upgrade to a ssl connection. Note that the client and server
+ <p> Upgrade to an ssl connection. Note that the client and server
must agree upon the upgrade and the server must call
ssl:accept/2 before the client calls ssl:connect/3.</p>
<code type="erl">3 client>{ok, SSLSocket} = ssl:connect(Socket, [{cacertfile, "cacerts.pem"},
diff --git a/lib/ssl/src/ssl.erl b/lib/ssl/src/ssl.erl
index a0aedbbbee..6074dab3ca 100644
--- a/lib/ssl/src/ssl.erl
+++ b/lib/ssl/src/ssl.erl
@@ -49,9 +49,12 @@
inet_ssl, %% inet options for internal ssl socket
cb %% Callback info
}).
--type option() :: socketoption() | ssloption() | transportoption().
--type socketoption() :: term(). %% See gen_tcp and inet, import spec later when there is one to import
--type ssloption() :: {verify, verify_type()} |
+-type connect_option() :: socket_connect_option() | ssl_option() | transport_option().
+-type socket_connect_option() :: gen_tcp:connect_option().
+-type listen_option() :: socket_listen_option() | ssl_option() | transport_option().
+-type socket_listen_option() :: gen_tcp:listen_option().
+
+-type ssl_option() :: {verify, verify_type()} |
{verify_fun, {fun(), InitialUserState::term()}} |
{fail_if_no_peer_cert, boolean()} | {depth, integer()} |
{cert, Der::binary()} | {certfile, path()} | {key, Der::binary()} |
@@ -66,7 +69,7 @@
string(). % (according to old API)
-type ssl_imp() :: new | old.
--type transportoption() :: {CallbackModule::atom(), DataTag::atom(), ClosedTag::atom()}.
+-type transport_option() :: {cb_info, {CallbackModule::atom(), DataTag::atom(), ClosedTag::atom()}}.
%%--------------------------------------------------------------------
@@ -96,15 +99,15 @@ stop() ->
application:stop(ssl).
%%--------------------------------------------------------------------
--spec connect(host() | port(), [option()]) -> {ok, #sslsocket{}} |
+-spec connect(host() | inet:port_number(), [connect_option()]) -> {ok, #sslsocket{}} |
{error, reason()}.
--spec connect(host() | port(), [option()] | port_num(), timeout() | list()) ->
+-spec connect(host() | inet:port_number(), [connect_option()] | inet:port_number(), timeout() | list()) ->
{ok, #sslsocket{}} | {error, reason()}.
--spec connect(host() | port(), port_num(), list(), timeout()) ->
+-spec connect(host() | inet:port_number(), inet:port_number(), list(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Socket, SslOptions) when is_port(Socket) ->
connect(Socket, SslOptions, infinity).
@@ -148,10 +151,10 @@ connect(Host, Port, Options0, Timeout) ->
end.
%%--------------------------------------------------------------------
--spec listen(port_num(), [option()]) ->{ok, #sslsocket{}} | {error, reason()}.
+-spec listen(inet:port_number(), [listen_option()]) ->{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Creates a ssl listen socket.
+%% Description: Creates an ssl listen socket.
%%--------------------------------------------------------------------
listen(_Port, []) ->
{error, enooptions};
@@ -177,7 +180,7 @@ listen(Port, Options0) ->
-spec transport_accept(#sslsocket{}, timeout()) -> {ok, #sslsocket{}} |
{error, reason()}.
%%
-%% Description: Performs transport accept on a ssl listen socket
+%% Description: Performs transport accept on an ssl listen socket
%%--------------------------------------------------------------------
transport_accept(ListenSocket) ->
transport_accept(ListenSocket, infinity).
@@ -214,11 +217,11 @@ transport_accept(#sslsocket{} = ListenSocket, Timeout) ->
%%--------------------------------------------------------------------
-spec ssl_accept(#sslsocket{}) -> ok | {error, reason()}.
--spec ssl_accept(#sslsocket{} | port(), timeout()| [option()]) ->
+-spec ssl_accept(#sslsocket{} | port(), timeout()| [ssl_option() | transport_option()]) ->
ok | {ok, #sslsocket{}} | {error, reason()}.
--spec ssl_accept(port(), [option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
+-spec ssl_accept(port(), [ssl_option()| transport_option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(ListenSocket) ->
@@ -252,7 +255,7 @@ ssl_accept(Socket, SslOptions, Timeout) when is_port(Socket) ->
%%--------------------------------------------------------------------
-spec close(#sslsocket{}) -> term().
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(#sslsocket{pid = {ListenSocket, #config{cb={CbMod,_, _, _}}}, fd = new_ssl}) ->
CbMod:close(ListenSocket);
@@ -373,7 +376,7 @@ select_part(plain, Cert, Opts) ->
end.
%%--------------------------------------------------------------------
--spec peername(#sslsocket{}) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec peername(#sslsocket{}) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: same as inet:peername/1.
%%--------------------------------------------------------------------
@@ -402,7 +405,8 @@ cipher_suites(openssl) ->
[ssl_cipher:openssl_suite_name(S) || S <- ssl_cipher:suites(Version)].
%%--------------------------------------------------------------------
--spec getopts(#sslsocket{}, [atom()]) -> {ok, [{atom(), term()}]} | {error, reason()}.
+-spec getopts(#sslsocket{}, [gen_tcp:option_name()]) ->
+ {ok, [gen_tcp:option()]} | {error, reason()}.
%%
%% Description: Gets options
%%--------------------------------------------------------------------
@@ -425,7 +429,7 @@ getopts(#sslsocket{} = Socket, OptionTags) ->
ssl_broker:getopts(Socket, OptionTags).
%%--------------------------------------------------------------------
--spec setopts(#sslsocket{}, [proplists:property()]) -> ok | {error, reason()}.
+-spec setopts(#sslsocket{}, [gen_tcp:option()]) -> ok | {error, reason()}.
%%
%% Description: Sets options
%%--------------------------------------------------------------------
@@ -466,7 +470,7 @@ shutdown(#sslsocket{pid = Pid, fd = new_ssl}, How) ->
ssl_connection:shutdown(Pid, How).
%%--------------------------------------------------------------------
--spec sockname(#sslsocket{}) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec sockname(#sslsocket{}) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:sockname/1
%%--------------------------------------------------------------------
diff --git a/lib/ssl/src/ssl_connection.erl b/lib/ssl/src/ssl_connection.erl
index 21b021afb0..5187d0f78f 100644
--- a/lib/ssl/src/ssl_connection.erl
+++ b/lib/ssl/src/ssl_connection.erl
@@ -127,11 +127,11 @@ send(Pid, Data) ->
recv(Pid, Length, Timeout) ->
sync_send_all_state_event(Pid, {recv, Length}, Timeout).
%%--------------------------------------------------------------------
--spec connect(host(), port_num(), port(), {#ssl_options{}, #socket_options{}},
+-spec connect(host(), inet:port_number(), port(), {#ssl_options{}, #socket_options{}},
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
try start_fsm(client, Host, Port, Socket, Options, User, CbInfo,
@@ -141,11 +141,11 @@ connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
{error, ssl_not_started}
end.
%%--------------------------------------------------------------------
--spec ssl_accept(port_num(), port(), {#ssl_options{}, #socket_options{}},
+-spec ssl_accept(inet:port_number(), port(), {#ssl_options{}, #socket_options{}},
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(Port, Socket, Opts, User, CbInfo, Timeout) ->
@@ -185,7 +185,7 @@ socket_control(Socket, Pid, CbModule) ->
%%--------------------------------------------------------------------
-spec close(pid()) -> ok | {error, reason()}.
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(ConnectionPid) ->
case sync_send_all_state_event(ConnectionPid, close) of
@@ -212,14 +212,14 @@ shutdown(ConnectionPid, How) ->
new_user(ConnectionPid, User) ->
sync_send_all_state_event(ConnectionPid, {new_user, User}).
%%--------------------------------------------------------------------
--spec sockname(pid()) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec sockname(pid()) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:sockname/1
%%--------------------------------------------------------------------
sockname(ConnectionPid) ->
sync_send_all_state_event(ConnectionPid, sockname).
%%--------------------------------------------------------------------
--spec peername(pid()) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec peername(pid()) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:peername/1
%%--------------------------------------------------------------------
@@ -277,7 +277,7 @@ renegotiation(ConnectionPid) ->
%%====================================================================
%%--------------------------------------------------------------------
--spec start_link(atom(), host(), port_num(), port(), list(), pid(), tuple()) ->
+-spec start_link(atom(), host(), inet:port_number(), port(), list(), pid(), tuple()) ->
{ok, pid()} | ignore | {error, reason()}.
%%
%% Description: Creates a gen_fsm process which calls Module:init/1 to
diff --git a/lib/ssl/src/ssl_handshake.erl b/lib/ssl/src/ssl_handshake.erl
index 4e74aec4ac..453ea20f99 100644
--- a/lib/ssl/src/ssl_handshake.erl
+++ b/lib/ssl/src/ssl_handshake.erl
@@ -48,7 +48,7 @@
%% Internal application API
%%====================================================================
%%--------------------------------------------------------------------
--spec client_hello(host(), port_num(), #connection_states{},
+-spec client_hello(host(), inet:port_number(), #connection_states{},
#ssl_options{}, boolean(), der_cert()) -> #client_hello{}.
%%
%% Description: Creates a client hello message.
@@ -106,7 +106,7 @@ hello_request() ->
%%--------------------------------------------------------------------
-spec hello(#server_hello{} | #client_hello{}, #ssl_options{},
- #connection_states{} | {port_num(), #session{}, db_handle(),
+ #connection_states{} | {inet:port_number(), #session{}, db_handle(),
atom(), #connection_states{}, binary()},
boolean()) -> {tls_version(), session_id(), #connection_states{}}|
{tls_version(), {resumed | new, #session{}},
@@ -383,8 +383,9 @@ master_secret(Version, #session{master_secret = Mastersecret},
ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Key calculation failed due to ~p",
- [Reason]),
+ Report = io_lib:format("Key calculation failed due to ~p",
+ [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end;
@@ -400,8 +401,9 @@ master_secret(Version, PremasterSecret, ConnectionStates, Role) ->
SecParams, ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Master secret calculation failed"
- " due to ~p", [Reason]),
+ Report = io_lib:format("Master secret calculation failed"
+ " due to ~p", [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end.
diff --git a/lib/ssl/src/ssl_internal.hrl b/lib/ssl/src/ssl_internal.hrl
index cc66246068..6bf1edc452 100644
--- a/lib/ssl/src/ssl_internal.hrl
+++ b/lib/ssl/src/ssl_internal.hrl
@@ -28,8 +28,7 @@
-type reply() :: term().
-type msg() :: term().
-type from() :: term().
--type host() :: string() | tuple().
--type port_num() :: integer().
+-type host() :: inet:ip_address() | inet:hostname().
-type session_id() :: 0 | binary().
-type tls_version() :: {integer(), integer()}.
-type tls_atom_version() :: sslv3 | tlsv1.
diff --git a/lib/ssl/src/ssl_manager.erl b/lib/ssl/src/ssl_manager.erl
index b02815bfd8..725a085d1f 100644
--- a/lib/ssl/src/ssl_manager.erl
+++ b/lib/ssl/src/ssl_manager.erl
@@ -113,7 +113,7 @@ lookup_trusted_cert(DbHandle, Ref, SerialNumber, Issuer) ->
issuer_candidate(PrevCandidateKey, DbHandle) ->
ssl_certificate_db:issuer_candidate(PrevCandidateKey, DbHandle).
%%--------------------------------------------------------------------
--spec client_session_id(host(), port_num(), #ssl_options{},
+-spec client_session_id(host(), inet:port_number(), #ssl_options{},
der_cert() | undefined) -> session_id().
%%
%% Description: Select a session id for the client.
@@ -122,7 +122,7 @@ client_session_id(Host, Port, SslOpts, OwnCert) ->
call({client_session_id, Host, Port, SslOpts, OwnCert}).
%%--------------------------------------------------------------------
--spec server_session_id(host(), port_num(), #ssl_options{},
+-spec server_session_id(host(), inet:port_number(), #ssl_options{},
der_cert()) -> session_id().
%%
%% Description: Select a session id for the server.
@@ -131,8 +131,8 @@ server_session_id(Port, SuggestedSessionId, SslOpts, OwnCert) ->
call({server_session_id, Port, SuggestedSessionId, SslOpts, OwnCert}).
%%--------------------------------------------------------------------
--spec register_session(port_num(), #session{}) -> ok.
--spec register_session(host(), port_num(), #session{}) -> ok.
+-spec register_session(inet:port_number(), #session{}) -> ok.
+-spec register_session(host(), inet:port_number(), #session{}) -> ok.
%%
%% Description: Make the session available for reuse.
%%--------------------------------------------------------------------
@@ -142,8 +142,8 @@ register_session(Host, Port, Session) ->
register_session(Port, Session) ->
cast({register_session, Port, Session}).
%%--------------------------------------------------------------------
--spec invalidate_session(port_num(), #session{}) -> ok.
--spec invalidate_session(host(), port_num(), #session{}) -> ok.
+-spec invalidate_session(inet:port_number(), #session{}) -> ok.
+-spec invalidate_session(host(), inet:port_number(), #session{}) -> ok.
%%
%% Description: Make the session unavailable for reuse. After
%% a the session has been marked "is_resumable = false" for some while
diff --git a/lib/ssl/src/ssl_record.erl b/lib/ssl/src/ssl_record.erl
index 4c3c0b9c58..72091fdd5f 100644
--- a/lib/ssl/src/ssl_record.erl
+++ b/lib/ssl/src/ssl_record.erl
@@ -342,7 +342,7 @@ get_tls_records_aux(<<?BYTE(?CHANGE_CIPHER_SPEC),?BYTE(MajVer),?BYTE(MinVer),
get_tls_records_aux(Rest, [#ssl_tls{type = ?CHANGE_CIPHER_SPEC,
version = {MajVer, MinVer},
fragment = Data} | Acc]);
-%% Matches a ssl v2 client hello message.
+%% Matches an ssl v2 client hello message.
%% The server must be able to receive such messages, from clients that
%% are willing to use ssl v3 or higher, but have ssl v2 compatibility.
get_tls_records_aux(<<1:1, Length0:15, Data0:Length0/binary, Rest/binary>>,
diff --git a/lib/ssl/src/ssl_session.erl b/lib/ssl/src/ssl_session.erl
index 85c9fcb61c..bf738649f6 100644
--- a/lib/ssl/src/ssl_session.erl
+++ b/lib/ssl/src/ssl_session.erl
@@ -48,7 +48,7 @@ is_new(_ClientSuggestion, _ServerDecision) ->
true.
%%--------------------------------------------------------------------
--spec id({host(), port_num(), #ssl_options{}}, db_handle(), atom(),
+-spec id({host(), inet:port_number(), #ssl_options{}}, db_handle(), atom(),
undefined | binary()) -> binary().
%%
%% Description: Should be called by the client side to get an id
@@ -63,7 +63,7 @@ id(ClientInfo, Cache, CacheCb, OwnCert) ->
end.
%%--------------------------------------------------------------------
--spec id(port_num(), binary(), #ssl_options{}, db_handle(),
+-spec id(inet:port_number(), binary(), #ssl_options{}, db_handle(),
atom(), seconds(), binary()) -> binary().
%%
%% Description: Should be called by the server side to get an id
diff --git a/lib/ssl/src/ssl_session_cache.erl b/lib/ssl/src/ssl_session_cache.erl
index 66610817be..93969f628f 100644
--- a/lib/ssl/src/ssl_session_cache.erl
+++ b/lib/ssl/src/ssl_session_cache.erl
@@ -28,7 +28,7 @@
-export([init/1, terminate/1, lookup/2, update/3, delete/2, foldl/3,
select_session/2]).
--type key() :: {{host(), port_num()}, session_id()} | {port_num(), session_id()}.
+-type key() :: {{host(), inet:port_number()}, session_id()} | {inet:port_number(), session_id()}.
%%--------------------------------------------------------------------
-spec init(list()) -> db_handle(). %% Returns reference to the cache (opaque)
@@ -91,7 +91,7 @@ foldl(Fun, Acc0, Cache) ->
ets:foldl(Fun, Acc0, Cache).
%%--------------------------------------------------------------------
--spec select_session(db_handle(), {host(), port_num()} | port_num()) -> [#session{}].
+-spec select_session(db_handle(), {host(), inet:port_number()} | inet:port_number()) -> [#session{}].
%%
%% Description: Selects a session that could be reused. Should be callable
%% from any process.
diff --git a/lib/ssl/src/ssl_ssl2.erl b/lib/ssl/src/ssl_ssl2.erl
index b1005b1acb..30a3a5fc98 100644
--- a/lib/ssl/src/ssl_ssl2.erl
+++ b/lib/ssl/src/ssl_ssl2.erl
@@ -20,7 +20,7 @@
%%
%%----------------------------------------------------------------------
%% Purpose: Handles sslv2 hello as clients supporting sslv2 and higher
-%% will send a sslv2 hello.
+%% will send an sslv2 hello.
%%----------------------------------------------------------------------
-module(ssl_ssl2).
diff --git a/lib/stdlib/doc/src/dets.xml b/lib/stdlib/doc/src/dets.xml
index 2512c84e18..54fefbe2b8 100644
--- a/lib/stdlib/doc/src/dets.xml
+++ b/lib/stdlib/doc/src/dets.xml
@@ -1105,7 +1105,7 @@ fun(X) -> {continue, X} end. </pre>
<p>Terminate the traversal and return <c>[<anno>Value</anno> | Acc]</c>.</p>
</item>
</taglist>
- <p>Any other value returned by <c><anno>Fun</anno></c> terminates the
+ <p>Any other value <c><anno>OtherValue</anno></c> returned by <c><anno>Fun</anno></c> terminates the
traversal and is immediately returned.
</p>
</desc>
diff --git a/lib/stdlib/doc/src/gen_fsm.xml b/lib/stdlib/doc/src/gen_fsm.xml
index d15383c621..e35b5adace 100644
--- a/lib/stdlib/doc/src/gen_fsm.xml
+++ b/lib/stdlib/doc/src/gen_fsm.xml
@@ -438,7 +438,7 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<fsummary>Initialize process and internal state name and state data.</fsummary>
<type>
<v>Args = term()</v>
- <v>Return = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
+ <v>Result = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
<v>&nbsp;&nbsp;| {ok,StateName,StateData,hibernate}</v>
<v>&nbsp;&nbsp;| {stop,Reason} | ignore</v>
<v>&nbsp;StateName = atom()</v>
@@ -639,9 +639,9 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<v>StateName = atom()</v>
<v>StateData = term()</v>
<v>Result = {next_state,NextStateName,NewStateData}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
- <v>&nbsp;>&nbsp;| {stop,Reason,NewStateData}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
+ <v>&nbsp;&nbsp;| {stop,Reason,NewStateData}</v>
<v>&nbsp;NextStateName = atom()</v>
<v>&nbsp;NewStateData = term()</v>
<v>&nbsp;Timeout = int()>0 | infinity</v>
diff --git a/lib/stdlib/doc/src/supervisor.xml b/lib/stdlib/doc/src/supervisor.xml
index 009aa60faa..edd119d37a 100644
--- a/lib/stdlib/doc/src/supervisor.xml
+++ b/lib/stdlib/doc/src/supervisor.xml
@@ -150,9 +150,12 @@ child_spec() = {Id,StartFunc,Restart,Shutdown,Type,Modules}
<p><c>Restart</c> defines when a terminated child process
should be restarted. A <c>permanent</c> child process should
always be restarted, a <c>temporary</c> child process should
- never be restarted and a <c>transient</c> child process
- should be restarted only if it terminates abnormally, i.e.
- with another exit reason than <c>normal</c>.</p>
+ never be restarted (even when the supervisor's restart strategy
+ is <c>rest_for_one</c> or <c>one_for_all</c> and a sibling's
+ death causes the temporary process to be terminated) and a
+ <c>transient</c> child process should be restarted only if
+ it terminates abnormally, i.e. with another exit reason
+ than <c>normal</c>.</p>
</item>
<item>
<p><c>Shutdown</c> defines how a child process should be
diff --git a/lib/stdlib/doc/src/unicode_usage.xml b/lib/stdlib/doc/src/unicode_usage.xml
index 416df1f02c..b48ad8c1f3 100644
--- a/lib/stdlib/doc/src/unicode_usage.xml
+++ b/lib/stdlib/doc/src/unicode_usage.xml
@@ -52,7 +52,7 @@
<tag>UCS-4</tag>
<item>Basically the same as UTF-32, but without some Unicode semantics, defined by IEEE and has little use as a separate encoding standard. For all normal (and possibly abnormal) usages, UTF-32 and UCS-4 are interchangeable.</item>
</taglist>
-<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a whole in the Unicode range to cope with backward compatibility.</p>
+<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a hole in the Unicode range to cope with backward compatibility.</p>
<p>Additionally, the codepoint 16#FEFF is used for byte order marks (BOM's) and use of that character is not encouraged in other contexts than that. It actually is valid though, as the character "ZWNBS" (Zero Width Non Breaking Space). BOM's are used to identify encodings and byte order for programs where such parameters are not known in advance. Byte order marks are more seldom used than one could expect, put their use is becoming more widely spread as they provide the means for programs to make educated guesses about the Unicode format of a certain file.</p>
</section>
<section>
diff --git a/lib/stdlib/src/beam_lib.erl b/lib/stdlib/src/beam_lib.erl
index d9c645d787..9077e59fdc 100644
--- a/lib/stdlib/src/beam_lib.erl
+++ b/lib/stdlib/src/beam_lib.erl
@@ -224,7 +224,7 @@ version(File) ->
MD5 :: binary().
md5(File) ->
- case catch read_significant_chunks(File) of
+ case catch read_significant_chunks(File, md5_chunks()) of
{ok, {Module, Chunks0}} ->
Chunks = filter_funtab(Chunks0),
{ok, {Module, erlang:md5([C || {_Id, C} <- Chunks])}};
@@ -395,7 +395,7 @@ strip_fils(Files) ->
%% -> {ok, {Mod, FileName}} | {ok, {Mod, binary()}} | throw(Error)
strip_file(File) ->
- {ok, {Mod, Chunks}} = read_significant_chunks(File),
+ {ok, {Mod, Chunks}} = read_significant_chunks(File, significant_chunks()),
{ok, Stripped0} = build_module(Chunks),
Stripped = compress(Stripped0),
case File of
@@ -453,8 +453,8 @@ is_useless_chunk("CInf") -> true;
is_useless_chunk(_) -> false.
%% -> {ok, {Module, Chunks}} | throw(Error)
-read_significant_chunks(File) ->
- case read_chunk_data(File, significant_chunks(), [allow_missing_chunks]) of
+read_significant_chunks(File, ChunkList) ->
+ case read_chunk_data(File, ChunkList, [allow_missing_chunks]) of
{ok, {Module, Chunks0}} ->
Mandatory = mandatory_chunks(),
Chunks = filter_significant_chunks(Chunks0, Mandatory, File, Module),
@@ -835,12 +835,15 @@ file_error(FileName, {error, Reason}) ->
error(Reason) ->
throw({error, ?MODULE, Reason}).
-
-%% The following chunks are significant when calculating the MD5 for a module,
-%% and also the modules that must be retained when stripping a file.
-%% They are listed in the order that they should be MD5:ed.
+%% The following chunks must be kept when stripping a BEAM file.
significant_chunks() ->
+ ["Line" | md5_chunks()].
+
+%% The following chunks are significant when calculating the MD5
+%% for a module. They are listed in the order that they should be MD5:ed.
+
+md5_chunks() ->
["Atom", "Code", "StrT", "ImpT", "ExpT", "FunT", "LitT"].
%% The following chunks are mandatory in every Beam file.
diff --git a/lib/stdlib/src/c.erl b/lib/stdlib/src/c.erl
index febfdd6285..a920921a5e 100644
--- a/lib/stdlib/src/c.erl
+++ b/lib/stdlib/src/c.erl
@@ -797,7 +797,7 @@ appcall(App, M, F, Args) ->
catch
error:undef ->
case erlang:get_stacktrace() of
- [{M,F,Args}|_] ->
+ [{M,F,Args,_}|_] ->
Arity = length(Args),
io:format("Call to ~w:~w/~w in application ~w failed.\n",
[M,F,Arity,App]);
diff --git a/lib/stdlib/src/dets.erl b/lib/stdlib/src/dets.erl
index 671b5a9dd4..fa0641ffd9 100644
--- a/lib/stdlib/src/dets.erl
+++ b/lib/stdlib/src/dets.erl
@@ -411,7 +411,8 @@ init_table(Tab, InitFun) ->
InitFun :: fun((Arg) -> Res),
Arg :: read | close,
Res :: end_of_input | {[object()], InitFun} | {Data, InitFun} | term(),
- Options :: [{min_no_slots,no_slots()} | {format,term | bchunk}],
+ Options :: Option | [Option],
+ Option :: {min_no_slots,no_slots()} | {format,term | bchunk},
Reason :: term(),
Data :: binary() | tuple().
@@ -871,11 +872,15 @@ to_ets(DTab, ETab) ->
-spec traverse(Name, Fun) -> Return | {'error', Reason} when
Name :: tab_name(),
Fun :: fun((Object) -> FunReturn),
- FunReturn :: 'continue' | {'continue', Val} | {'done', Value},
+ Object :: object(),
+ FunReturn :: 'continue'
+ | {'continue', Val}
+ | {'done', Value}
+ | OtherValue,
+ Return :: [term()] | OtherValue,
Val :: term(),
Value :: term(),
- Object :: object(),
- Return :: [term()],
+ OtherValue :: term(),
Reason :: term().
traverse(Tab, Fun) ->
diff --git a/lib/stdlib/src/epp.erl b/lib/stdlib/src/epp.erl
index d804c1dee5..230a4a0612 100644
--- a/lib/stdlib/src/epp.erl
+++ b/lib/stdlib/src/epp.erl
@@ -684,7 +684,7 @@ scan_include_lib([{'(',_Llp},{string,_Lf,NewName0},{')',_Lrp},{dot,_Ld}],
{error,_E1} ->
case catch find_lib_dir(NewName) of
{LibDir, Rest} when is_list(LibDir) ->
- LibName = filename:join([LibDir | Rest]),
+ LibName = fname_join([LibDir | Rest]),
case file:open(LibName, [read]) of
{ok,NewF} ->
ExtraPath = [filename:dirname(LibName)],
@@ -1154,7 +1154,12 @@ expand_var1(NewName) ->
[[$$ | Var] | Rest] = filename:split(NewName),
Value = os:getenv(Var),
true = Value =/= false,
- {ok, filename:join([Value | Rest])}.
+ {ok, fname_join([Value | Rest])}.
+
+fname_join(["." | [_|_]=Rest]) ->
+ fname_join(Rest);
+fname_join(Components) ->
+ filename:join(Components).
%% The line only. (Other tokens may have the column and text as well...)
loc_attr(Line) when is_integer(Line) ->
diff --git a/lib/stdlib/src/erl_eval.erl b/lib/stdlib/src/erl_eval.erl
index 515ea2ebb7..4f4fa16040 100644
--- a/lib/stdlib/src/erl_eval.erl
+++ b/lib/stdlib/src/erl_eval.erl
@@ -621,7 +621,7 @@ eval_generate(Term, _P, _Bs0, _Lf, _Ef, _CompFun, _Acc) ->
erlang:raise(error, {bad_generator,Term}, stacktrace()).
eval_b_generate(<<_/bitstring>>=Bin, P, Bs0, Lf, Ef, CompFun, Acc) ->
- Mfun = fun(L, R, Bs) -> match1(L, R, Bs, Bs0) end,
+ Mfun = match_fun(Bs0),
Efun = fun(Exp, Bs) -> expr(Exp, Bs, Lf, Ef, none) end,
case eval_bits:bin_gen(P, Bin, new_bindings(), Bs0, Mfun, Efun) of
{match, Rest, Bs1} ->
@@ -1024,7 +1024,7 @@ match1({tuple,_,_}, _, _Bs, _BBs) ->
throw(nomatch);
match1({bin, _, Fs}, <<_/bitstring>>=B, Bs0, BBs) ->
eval_bits:match_bits(Fs, B, Bs0, BBs,
- fun(L, R, Bs) -> match1(L, R, Bs, BBs) end,
+ match_fun(BBs),
fun(E, Bs) -> expr(E, Bs, none, none, none) end);
match1({bin,_,_}, _, _Bs, _BBs) ->
throw(nomatch);
@@ -1053,6 +1053,12 @@ match1({op,Line,Op,L,R}, Term, Bs, BBs) ->
match1(_, _, _Bs, _BBs) ->
throw(invalid).
+match_fun(BBs) ->
+ fun(match, {L,R,Bs}) -> match1(L, R, Bs, BBs);
+ (binding, {Name,Bs}) -> binding(Name, Bs);
+ (add_binding, {Name,Val,Bs}) -> add_binding(Name, Val, Bs)
+ end.
+
match_tuple([E|Es], Tuple, I, Bs0, BBs) ->
{match,Bs} = match1(E, element(I, Tuple), Bs0, BBs),
match_tuple(Es, Tuple, I+1, Bs, BBs);
diff --git a/lib/stdlib/src/erl_internal.erl b/lib/stdlib/src/erl_internal.erl
index 0b9b8b8e17..cd3b531d10 100644
--- a/lib/stdlib/src/erl_internal.erl
+++ b/lib/stdlib/src/erl_internal.erl
@@ -262,6 +262,7 @@ bif(bitsize, 1) -> true;
bif(bit_size, 1) -> true;
bif(bitstring_to_list, 1) -> true;
bif(byte_size, 1) -> true;
+bif(check_old_code, 1) -> true;
bif(check_process_code, 2) -> true;
bif(date, 0) -> true;
bif(delete_module, 1) -> true;
diff --git a/lib/stdlib/src/escript.erl b/lib/stdlib/src/escript.erl
index d67617260e..ad49d89908 100644
--- a/lib/stdlib/src/escript.erl
+++ b/lib/stdlib/src/escript.erl
@@ -62,10 +62,10 @@
-type zip_create_option() :: term().
-type section() ::
shebang
- | {shebang, shebang()}
+ | {shebang, shebang() | default | undefined}
| comment
- | {comment, comment()}
- | {emu_args, emu_args()}
+ | {comment, comment() | default | undefined}
+ | {emu_args, emu_args() | undefined}
| {source, file:filename() | binary()}
| {beam, file:filename() | binary()}
| {archive, file:filename() | binary()}
@@ -866,7 +866,7 @@ hidden_apply(App, M, F, Args) ->
catch
error:undef ->
case erlang:get_stacktrace() of
- [{M,F,Args} | _] ->
+ [{M,F,Args,_} | _] ->
Arity = length(Args),
Text = io_lib:format("Call to ~w:~w/~w in application ~w failed.\n",
[M, F, Arity, App]),
diff --git a/lib/stdlib/src/eval_bits.erl b/lib/stdlib/src/eval_bits.erl
index 2cbd6cdae7..796c5b934d 100644
--- a/lib/stdlib/src/eval_bits.erl
+++ b/lib/stdlib/src/eval_bits.erl
@@ -31,15 +31,16 @@
%% @type evalfun(). A closure which evaluates an expression given an
%% environment
%%
-%% @type matchfun(). A closure which performs a match given a value, a
-%% pattern and an environment
+%% @type matchfun(). A closure which depending on its first argument
+%% can perform a match (given a value, a pattern and an environment),
+%% lookup a variable in the bindings, or add a new binding
%%
-%% @type field() represents a field in a "bin"
+%% @type field(). Represents a field in a "bin".
%%% Part 1: expression evaluation (binary construction)
%% @spec expr_grp(Fields::[field()], Bindings::bindings(),
-%% EvalFun::evalfun()) ->
+%% EvalFun::evalfun(), term(), term()) ->
%% {value, binary(), bindings()}
%%
%% @doc Returns a tuple with {value,Bin,Bs} where Bin is the binary
@@ -144,7 +145,8 @@ eval_exp_field(Val, Size, Unit, binary, _, _) ->
bin_gen({bin,_,Fs}, Bin, Bs0, BBs0, Mfun, Efun) ->
bin_gen(Fs, Bin, Bs0, BBs0, Mfun, Efun, true).
-bin_gen([F|Fs], Bin, Bs0, BBs0, Mfun, Efun, Flag) ->
+bin_gen([F|Fs], Bin, Bs0, BBs0, Mfun, Efun, Flag)
+ when is_function(Mfun, 2), is_function(Efun, 2) ->
case bin_gen_field(F, Bin, Bs0, BBs0, Mfun, Efun) of
{match,Bs,BBs,Rest} ->
bin_gen(Fs, Rest, Bs, BBs, Mfun, Efun, Flag);
@@ -175,14 +177,14 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
{Size1, [Type,{unit,Unit},Sign,Endian]} =
make_bit_type(Line, Size0, Options0),
V = erl_eval:partial_eval(VE),
- match_check_size(Size1, BBs0),
+ match_check_size(Mfun, Size1, BBs0),
{value, Size, _BBs} = Efun(Size1, BBs0),
case catch get_value(Bin, Type, Size, Unit, Sign, Endian) of
{Val,<<_/bitstring>>=Rest} ->
NewV = coerce_to_float(V, Type),
- case catch Mfun(NewV, Val, Bs0) of
+ case catch Mfun(match, {NewV,Val,Bs0}) of
{match,Bs} ->
- BBs = add_bin_binding(NewV, Bs, BBs0),
+ BBs = add_bin_binding(Mfun, NewV, Bs, BBs0),
{match,Bs,BBs,Rest};
_ ->
{nomatch,Rest}
@@ -192,9 +194,9 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
end.
%%% Part 3: binary pattern matching
-%% @spec match_bits(Fields::[field()], Bin::binary()
+%% @spec match_bits(Fields::[field()], Bin::binary(),
%% GlobalEnv::bindings(), LocalEnv::bindings(),
-%% MatchFun::matchfun(),EvalFun::evalfun()) ->
+%% MatchFun::matchfun(),EvalFun::evalfun(), term()) ->
%% {match, bindings()}
%% @doc Used to perform matching. If the match succeeds a new
%% environment is returned. If the match have some syntactic or
@@ -205,7 +207,8 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun, _) ->
match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun).
-match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun) ->
+match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun)
+ when is_function(Mfun, 2), is_function(Efun, 2) ->
case catch match_bits_1(Fs, Bin, Bs0, BBs, Mfun, Efun) of
{match,Bs} -> {match,Bs};
invalid -> throw(invalid);
@@ -230,12 +233,12 @@ match_field_1({bin_element,Line,VE,Size0,Options0},
make_bit_type(Line, Size0, Options0),
V = erl_eval:partial_eval(VE),
Size2 = erl_eval:partial_eval(Size1),
- match_check_size(Size2, BBs0),
+ match_check_size(Mfun, Size2, BBs0),
{value, Size, _BBs} = Efun(Size2, BBs0),
{Val,Rest} = get_value(Bin, Type, Size, Unit, Sign, Endian),
NewV = coerce_to_float(V, Type),
- {match,Bs} = Mfun(NewV, Val, Bs0),
- BBs = add_bin_binding(NewV, Bs, BBs0),
+ {match,Bs} = Mfun(match, {NewV,Val,Bs0}),
+ BBs = add_bin_binding(Mfun, NewV, Bs, BBs0),
{Bs,BBs,Rest}.
%% Almost identical to the one in sys_pre_expand.
@@ -249,12 +252,12 @@ coerce_to_float({integer,L,I}=E, float) ->
coerce_to_float(E, _Type) ->
E.
-add_bin_binding({var,_,'_'}, _Bs, BBs) ->
+add_bin_binding(_, {var,_,'_'}, _Bs, BBs) ->
BBs;
-add_bin_binding({var,_,Name}, Bs, BBs) ->
- {value,Value} = erl_eval:binding(Name, Bs),
- erl_eval:add_binding(Name, Value, BBs);
-add_bin_binding(_, _Bs, BBs) ->
+add_bin_binding(Mfun, {var,_,Name}, Bs, BBs) ->
+ {value,Value} = Mfun(binding, {Name,Bs}),
+ Mfun(add_binding, {Name,Value,BBs});
+add_bin_binding(_, _, _Bs, BBs) ->
BBs.
get_value(Bin, integer, Size, Unit, Sign, Endian) ->
@@ -327,20 +330,20 @@ make_bit_type(_Line, Size, Type0) -> %Size evaluates to an integer or 'all'
{error,Reason} -> error(Reason)
end.
-match_check_size({var,_,V}, Bs) ->
- case erl_eval:binding(V, Bs) of
+match_check_size(Mfun, {var,_,V}, Bs) ->
+ case Mfun(binding, {V,Bs}) of
{value,_} -> ok;
unbound -> throw(invalid) % or, rather, error({unbound,V})
end;
-match_check_size({atom,_,all}, _Bs) ->
+match_check_size(_, {atom,_,all}, _Bs) ->
ok;
-match_check_size({atom,_,undefined}, _Bs) ->
+match_check_size(_, {atom,_,undefined}, _Bs) ->
ok;
-match_check_size({integer,_,_}, _Bs) ->
+match_check_size(_, {integer,_,_}, _Bs) ->
ok;
-match_check_size({value,_,_}, _Bs) ->
+match_check_size(_, {value,_,_}, _Bs) ->
ok; %From the debugger.
-match_check_size(_, _Bs) ->
+match_check_size(_, _, _Bs) ->
throw(invalid).
%% error(Reason) -> exception thrown
diff --git a/lib/stdlib/src/gen_event.erl b/lib/stdlib/src/gen_event.erl
index 1c4a73680b..d1dd074fba 100644
--- a/lib/stdlib/src/gen_event.erl
+++ b/lib/stdlib/src/gen_event.erl
@@ -667,16 +667,16 @@ report_error(_Handler, {swapped,_,_}, _, _, _) -> ok;
report_error(Handler, Reason, State, LastIn, SName) ->
Reason1 =
case Reason of
- {'EXIT',{undef,[{M,F,A}|MFAs]}} ->
+ {'EXIT',{undef,[{M,F,A,L}|MFAs]}} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
- {undef,[{M,F,A}|MFAs]};
+ {undef,[{M,F,A,L}|MFAs]};
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
{'EXIT',Why} ->
diff --git a/lib/stdlib/src/gen_fsm.erl b/lib/stdlib/src/gen_fsm.erl
index f2f1365d3d..ea21136bdb 100644
--- a/lib/stdlib/src/gen_fsm.erl
+++ b/lib/stdlib/src/gen_fsm.erl
@@ -561,16 +561,16 @@ terminate(Reason, Name, Msg, Mod, StateName, StateData, Debug) ->
error_info(Reason, Name, Msg, StateName, StateData, Debug) ->
Reason1 =
case Reason of
- {undef,[{M,F,A}|MFAs]} ->
+ {undef,[{M,F,A,L}|MFAs]} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
Reason;
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
_ ->
diff --git a/lib/stdlib/src/gen_server.erl b/lib/stdlib/src/gen_server.erl
index 09d94a9c40..b8ea3a4de2 100644
--- a/lib/stdlib/src/gen_server.erl
+++ b/lib/stdlib/src/gen_server.erl
@@ -729,16 +729,16 @@ error_info(_Reason, application_controller, _Msg, _State, _Debug) ->
error_info(Reason, Name, Msg, State, Debug) ->
Reason1 =
case Reason of
- {undef,[{M,F,A}|MFAs]} ->
+ {undef,[{M,F,A,L}|MFAs]} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
Reason;
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
_ ->
diff --git a/lib/stdlib/src/io_lib.erl b/lib/stdlib/src/io_lib.erl
index 165e03e506..0252cdf742 100644
--- a/lib/stdlib/src/io_lib.erl
+++ b/lib/stdlib/src/io_lib.erl
@@ -109,9 +109,9 @@ fwrite(Format, Args) ->
fread(Chars, Format) ->
io_lib_fread:fread(Chars, Format).
--spec fread(Continuation, String, Format) -> Return when
+-spec fread(Continuation, CharSpec, Format) -> Return when
Continuation :: continuation() | [],
- String :: string(),
+ CharSpec :: string() | eof,
Format :: string(),
Return :: {'more', Continuation1 :: continuation()}
| {'done', Result, LeftOverChars :: string()},
diff --git a/lib/stdlib/src/lib.erl b/lib/stdlib/src/lib.erl
index c303ae60b5..314fd60903 100644
--- a/lib/stdlib/src/lib.erl
+++ b/lib/stdlib/src/lib.erl
@@ -173,12 +173,12 @@ format_fun(Fun) when is_function(Fun) ->
analyze_exception(error, Term, Stack) ->
case {is_stacktrace(Stack), Stack, Term} of
- {true, [{_M,_F,As}=MFA|MFAs], function_clause} when is_list(As) ->
- {Term,[MFA],MFAs};
- {true, [{shell,F,A}], function_clause} when is_integer(A) ->
+ {true, [{_,_,As,_}=MFAL|MFAs], function_clause} when is_list(As) ->
+ {Term,[MFAL],MFAs};
+ {true, [{shell,F,A,_}], function_clause} when is_integer(A) ->
{Term, [{F,A}], []};
- {true, [{_M,_F,_AorAs}=MFA|MFAs], undef} ->
- {Term,[MFA],MFAs};
+ {true, [{_,_,_,_}=MFAL|MFAs], undef} ->
+ {Term,[MFAL],MFAs};
{true, _, _} ->
{Term,[],Stack};
{false, _, _} ->
@@ -194,9 +194,11 @@ analyze_exception(_Class, Term, Stack) ->
is_stacktrace([]) ->
true;
-is_stacktrace([{M,F,A}|Fs]) when is_atom(M), is_atom(F), is_integer(A) ->
+is_stacktrace([{M,F,A,I}|Fs])
+ when is_atom(M), is_atom(F), is_integer(A), is_list(I) ->
is_stacktrace(Fs);
-is_stacktrace([{M,F,As}|Fs]) when is_atom(M), is_atom(F), length(As) >= 0 ->
+is_stacktrace([{M,F,As,I}|Fs])
+ when is_atom(M), is_atom(F), length(As) >= 0, is_list(I) ->
is_stacktrace(Fs);
is_stacktrace(_) ->
false.
@@ -225,9 +227,9 @@ explain_reason(function_clause, error, [{F,A}], _PF, _S) ->
%% Shell commands
FAs = io_lib:fwrite(<<"~w/~w">>, [F, A]),
[<<"no function clause matching call to ">> | FAs];
-explain_reason(function_clause, error=Cl, [{M,F,As}], PF, S) ->
+explain_reason(function_clause, error=Cl, [{M,F,As,Loc}], PF, S) ->
Str = <<"no function clause matching ">>,
- format_errstr_call(Str, Cl, {M,F}, As, PF, S);
+ [format_errstr_call(Str, Cl, {M,F}, As, PF, S),$\s|location(Loc)];
explain_reason(if_clause, error, [], _PF, _S) ->
<<"no true branch found when evaluating an if expression">>;
explain_reason(noproc, error, [], _PF, _S) ->
@@ -242,11 +244,11 @@ explain_reason({try_clause,V}, error=Cl, [], PF, S) ->
%% "there is no try clause with a true guard sequence and a
%% pattern matching..."
format_value(V, <<"no try clause matching ">>, Cl, PF, S);
-explain_reason(undef, error, [{M,F,A}], _PF, _S) ->
+explain_reason(undef, error, [{M,F,A,_}], _PF, _S) ->
%% Only the arity is displayed, not the arguments, if there are any.
io_lib:fwrite(<<"undefined function ~s">>,
[mfa_to_string(M, F, n_args(A))]);
-explain_reason({shell_undef,F,A}, error, [], _PF, _S) ->
+explain_reason({shell_undef,F,A,_}, error, [], _PF, _S) ->
%% Give nicer reports for undefined shell functions
%% (but not when the user actively calls shell_default:F(...)).
io_lib:fwrite(<<"undefined shell command ~s/~w">>, [F, n_args(A)]);
@@ -292,17 +294,19 @@ argss(I) ->
io_lib:fwrite(<<"~w arguments">>, [I]).
format_stacktrace1(S0, Stack0, PF, SF) ->
- Stack1 = lists:dropwhile(fun({M,F,A}) -> SF(M, F, A)
+ Stack1 = lists:dropwhile(fun({M,F,A,_}) -> SF(M, F, A)
end, lists:reverse(Stack0)),
S = [" " | S0],
Stack = lists:reverse(Stack1),
format_stacktrace2(S, Stack, 1, PF).
-format_stacktrace2(S, [{M,F,A}|Fs], N, PF) when is_integer(A) ->
- [io_lib:fwrite(<<"~s~s ~s">>,
- [sep(N, S), origin(N, M, F, A), mfa_to_string(M, F, A)])
+format_stacktrace2(S, [{M,F,A,L}|Fs], N, PF) when is_integer(A) ->
+ [io_lib:fwrite(<<"~s~s ~s ~s">>,
+ [sep(N, S), origin(N, M, F, A),
+ mfa_to_string(M, F, A),
+ location(L)])
| format_stacktrace2(S, Fs, N + 1, PF)];
-format_stacktrace2(S, [{M,F,As}|Fs], N, PF) when is_list(As) ->
+format_stacktrace2(S, [{M,F,As,_}|Fs], N, PF) when is_list(As) ->
A = length(As),
CalledAs = [S,<<" called as ">>],
C = format_call("", CalledAs, {M,F}, As, PF),
@@ -313,6 +317,16 @@ format_stacktrace2(S, [{M,F,As}|Fs], N, PF) when is_list(As) ->
format_stacktrace2(_S, [], _N, _PF) ->
"".
+location(L) ->
+ File = proplists:get_value(file, L),
+ Line = proplists:get_value(line, L),
+ if
+ File =/= undefined, Line =/= undefined ->
+ io_lib:format("(~s, line ~w)", [File, Line]);
+ true ->
+ ""
+ end.
+
sep(1, S) -> S;
sep(_, S) -> [$\n | S].
diff --git a/lib/stdlib/src/otp_internal.erl b/lib/stdlib/src/otp_internal.erl
index eeec435165..c1285dab60 100644
--- a/lib/stdlib/src/otp_internal.erl
+++ b/lib/stdlib/src/otp_internal.erl
@@ -461,6 +461,14 @@ obsolete_1(public_key, pem_to_der, 1) ->
obsolete_1(public_key, decode_private_key, A) when A =:= 1; A =:= 2 ->
{deprecated,{public_key,pem_entry_decode,1},"R15A"};
+%% Added in R14B03.
+obsolete_1(docb_gen, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+obsolete_1(docb_transform, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+obsolete_1(docb_xml_check, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+
%% Added in R15B
obsolete_1(asn1rt, F, _) when F == load_driver; F == unload_driver ->
{deprecated,"deprecated (will be removed in R16A); has no effect as drivers are no longer used."};
diff --git a/lib/stdlib/src/proplists.erl b/lib/stdlib/src/proplists.erl
index 68697d0da2..e3eda5d932 100644
--- a/lib/stdlib/src/proplists.erl
+++ b/lib/stdlib/src/proplists.erl
@@ -49,9 +49,10 @@
%% ---------------------------------------------------------------------
--export_type([property/0]).
+-export_type([property/0, proplist/0]).
-type property() :: atom() | tuple().
+-type proplist() :: [property()].
%% ---------------------------------------------------------------------
diff --git a/lib/stdlib/src/qlc.erl b/lib/stdlib/src/qlc.erl
index 5ca04ff023..f5e180b4bd 100644
--- a/lib/stdlib/src/qlc.erl
+++ b/lib/stdlib/src/qlc.erl
@@ -123,7 +123,7 @@
-record(setup, {parent}).
--define(THROWN_ERROR, {?MODULE, throw_error, _}).
+-define(THROWN_ERROR, {?MODULE, throw_error, _, _}).
-export_type([query_handle/0]).
@@ -3701,7 +3701,8 @@ lookup_join(F1, C1, LuF, C2, Rev) ->
maybe_error_logger(allowed, _) ->
ok;
maybe_error_logger(Name, Why) ->
- [_, _, {?MODULE,maybe_error_logger,_} | Stacktrace] = expand_stacktrace(),
+ [_, _, {?MODULE,maybe_error_logger,_,_} | Stacktrace] =
+ expand_stacktrace(),
Trimmer = fun(M, _F, _A) -> M =:= erl_eval end,
Formater = fun(Term, I) -> io_lib:print(Term, I, 80, -1) end,
X = lib:format_stacktrace(1, Stacktrace, Trimmer, Formater),
@@ -3720,7 +3721,7 @@ expand_stacktrace() ->
expand_stacktrace(D) ->
_ = erlang:system_flag(backtrace_depth, D),
{'EXIT', {foo, Stacktrace}} = (catch erlang:error(foo)),
- L = lists:takewhile(fun({M,_,_}) -> M =/= ?MODULE
+ L = lists:takewhile(fun({M,_,_,_}) -> M =/= ?MODULE
end, lists:reverse(Stacktrace)),
if
length(L) < 3 andalso length(Stacktrace) =:= D ->
diff --git a/lib/stdlib/src/re.erl b/lib/stdlib/src/re.erl
index e08258a535..99bcbd722e 100644
--- a/lib/stdlib/src/re.erl
+++ b/lib/stdlib/src/re.erl
@@ -573,10 +573,10 @@ ucompile(RE,Options) ->
re:compile(unicode:characters_to_binary(RE,unicode),Options)
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[RE,Options])),
- erlang:raise(error,AnyError,[{Mod,compile,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,compile,L,Loc}|Rest])
end.
@@ -585,10 +585,10 @@ urun(Subject,RE,Options) ->
urun2(Subject,RE,Options)
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[Subject,RE,Options])),
- erlang:raise(error,AnyError,[{Mod,run,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,run,L,Loc}|Rest])
end.
urun2(Subject0,RE0,Options0) ->
@@ -625,20 +625,20 @@ grun(Subject,RE,{Options,NeedClean}) ->
grun2(Subject,RE,{Options,NeedClean})
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[Subject,RE,Options])),
- erlang:raise(error,AnyError,[{Mod,run,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,run,L,Loc}|Rest])
end;
grun(Subject,RE,{Options,NeedClean,OrigRE}) ->
try
grun2(Subject,RE,{Options,NeedClean})
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[Subject,OrigRE,Options])),
- erlang:raise(error,AnyError,[{Mod,run,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,run,L,Loc}|Rest])
end.
grun2(Subject,RE,{Options,NeedClean}) ->
diff --git a/lib/stdlib/src/shell.erl b/lib/stdlib/src/shell.erl
index e3e23e09bc..964697cae6 100644
--- a/lib/stdlib/src/shell.erl
+++ b/lib/stdlib/src/shell.erl
@@ -1088,7 +1088,7 @@ shell_default(F,As,Bs) ->
end.
shell_undef(F,A) ->
- erlang:error({shell_undef,F,A}).
+ erlang:error({shell_undef,F,A,[]}).
local_func_handler(Shell, RT, Ef) ->
H = fun(Lf) ->
diff --git a/lib/stdlib/src/sofs.erl b/lib/stdlib/src/sofs.erl
index d38b8ab37a..34eb224647 100644
--- a/lib/stdlib/src/sofs.erl
+++ b/lib/stdlib/src/sofs.erl
@@ -81,7 +81,8 @@
-define(ORDTAG, 'OrdSet').
-record(?TAG, {data = [] :: list(), type = type :: term()}).
--record(?ORDTAG, {orddata = {} :: tuple(), ordtype = type :: term()}).
+-record(?ORDTAG, {orddata = {} :: tuple() | atom(),
+ ordtype = type :: term()}).
-define(LIST(S), (S)#?TAG.data).
-define(TYPE(S), (S)#?TAG.type).
@@ -375,7 +376,7 @@ to_sets(S) when ?IS_ORDSET(S) ->
-spec(no_elements(ASet) -> NoElements when
ASet :: a_set() | ordset(),
- NoElements :: pos_integer()).
+ NoElements :: non_neg_integer()).
no_elements(S) when ?IS_SET(S) ->
length(?LIST(S));
no_elements(S) when ?IS_ORDSET(S), is_tuple(?ORDTYPE(S)) ->
diff --git a/lib/stdlib/src/supervisor.erl b/lib/stdlib/src/supervisor.erl
index 023183c5f0..36cc7f4f4b 100644
--- a/lib/stdlib/src/supervisor.erl
+++ b/lib/stdlib/src/supervisor.erl
@@ -738,6 +738,13 @@ restart(one_for_all, Child, State) ->
terminate_children(Children, SupName) ->
terminate_children(Children, SupName, []).
+%% Temporary children should not be restarted and thus should
+%% be skipped when building the list of terminated children, although
+%% we do want them to be shut down as many functions from this module
+%% use this function to just clear everything.
+terminate_children([Child = #child{restart_type=temporary} | Children], SupName, Res) ->
+ do_terminate(Child, SupName),
+ terminate_children(Children, SupName, Res);
terminate_children([Child | Children], SupName, Res) ->
NChild = do_terminate(Child, SupName),
terminate_children(Children, SupName, [NChild | Res]);
diff --git a/lib/stdlib/src/sys.erl b/lib/stdlib/src/sys.erl
index 8ab72c9b50..f34201604c 100644
--- a/lib/stdlib/src/sys.erl
+++ b/lib/stdlib/src/sys.erl
@@ -154,7 +154,7 @@ log_to_file(Name, FileName, Timeout) ->
-spec statistics(Name, Flag) -> 'ok' | {'ok', Statistics} when
Name :: name(),
Flag :: 'true' | 'false' | 'get',
- Statistics :: [StatisticsTuple],
+ Statistics :: [StatisticsTuple] | no_statistics,
StatisticsTuple :: {'start_time', DateTime1}
| {'current_time', DateTime2}
| {'reductions', non_neg_integer()}
@@ -168,7 +168,7 @@ statistics(Name, Flag) ->
-spec statistics(Name, Flag, Timeout) -> 'ok' | {'ok', Statistics} when
Name :: name(),
Flag :: 'true' | 'false' | 'get',
- Statistics :: [StatisticsTuple],
+ Statistics :: [StatisticsTuple] | no_statistics,
StatisticsTuple :: {'start_time', DateTime1}
| {'current_time', DateTime2}
| {'reductions', non_neg_integer()}
diff --git a/lib/stdlib/src/timer.erl b/lib/stdlib/src/timer.erl
index e3d6c905b6..689e42051f 100644
--- a/lib/stdlib/src/timer.erl
+++ b/lib/stdlib/src/timer.erl
@@ -199,7 +199,7 @@ tc(M, F, A) ->
%% Calculate the time difference (in microseconds) of two
%% erlang:now() timestamps, T2-T1.
%%
--spec now_diff(T1, T2) -> Tdiff when
+-spec now_diff(T2, T1) -> Tdiff when
T1 :: erlang:timestamp(),
T2 :: erlang:timestamp(),
Tdiff :: integer().
diff --git a/lib/stdlib/src/unicode.erl b/lib/stdlib/src/unicode.erl
index a5d9965ca2..e9b90befe6 100644
--- a/lib/stdlib/src/unicode.erl
+++ b/lib/stdlib/src/unicode.erl
@@ -73,7 +73,7 @@ characters_to_list_int(ML, Encoding) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,Encoding])),
erlang:raise(error,TheError,[{Mod,characters_to_list,L}|Rest])
@@ -109,7 +109,7 @@ characters_to_binary(ML) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML])),
erlang:raise(error,TheError,[{Mod,characters_to_binary,L}|Rest])
@@ -127,7 +127,7 @@ characters_to_binary_int(ML,InEncoding) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,InEncoding])),
erlang:raise(error,TheError,[{Mod,characters_to_binary,L}|Rest])
@@ -159,7 +159,7 @@ characters_to_binary(ML, latin1, Uni) when is_binary(ML) and ((Uni =:= utf8) or
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,latin1,Uni])),
erlang:raise(error,TheError,
@@ -181,7 +181,7 @@ characters_to_binary(ML,Uni,latin1) when is_binary(ML) and ((Uni =:= utf8) or
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,Uni,latin1])),
erlang:raise(error,TheError,
@@ -200,7 +200,7 @@ characters_to_binary(ML, InEncoding, OutEncoding) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,InEncoding,OutEncoding])),
erlang:raise(error,TheError,[{Mod,characters_to_binary,L}|Rest])
diff --git a/lib/stdlib/src/zip.erl b/lib/stdlib/src/zip.erl
index 524d709431..c82c8159b6 100644
--- a/lib/stdlib/src/zip.erl
+++ b/lib/stdlib/src/zip.erl
@@ -223,7 +223,7 @@ openzip_open(F, Options) ->
do_openzip_open(F, Options) ->
Opts = get_openzip_options(Options),
#openzip_opts{output = Output, open_opts = OpO, cwd = CWD} = Opts,
- Input = get_zip_input(F),
+ Input = get_input(F),
In0 = Input({open, F, OpO -- [write]}, []),
{[#zip_comment{comment = C} | Files], In1} =
get_central_dir(In0, fun raw_file_info_etc/5, Input),
@@ -489,7 +489,7 @@ do_list_dir(F, Options) ->
%% Print zip directory in short form
-spec(t(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
t(F) when is_pid(F) -> zip_t(F);
@@ -513,7 +513,7 @@ do_t(F, RawPrint) ->
%% Print zip directory in long form (like ls -l)
-spec(tt(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
tt(F) when is_pid(F) -> zip_tt(F);
@@ -1174,7 +1174,7 @@ zip_get(Pid) when is_pid(Pid) ->
zip_close(Pid) when is_pid(Pid) ->
request(self(), Pid, close).
--spec(zip_get(FileName, ZipHandle) -> {ok, [Result]} | {error, Reason} when
+-spec(zip_get(FileName, ZipHandle) -> {ok, Result} | {error, Reason} when
FileName :: file:name(),
ZipHandle :: pid(),
Result :: file:name() | {file:name(), binary()},
@@ -1183,7 +1183,7 @@ zip_close(Pid) when is_pid(Pid) ->
zip_get(FileName, Pid) when is_pid(Pid) ->
request(self(), Pid, {get, FileName}).
--spec(zip_list_dir(ZipHandle) -> Result | {error, Reason} when
+-spec(zip_list_dir(ZipHandle) -> {ok, Result} | {error, Reason} when
Result :: [zip_comment() | zip_file()],
ZipHandle :: pid(),
Reason :: term()).
diff --git a/lib/stdlib/test/beam_lib_SUITE.erl b/lib/stdlib/test/beam_lib_SUITE.erl
index 4ccc863795..b7fb1f618f 100644
--- a/lib/stdlib/test/beam_lib_SUITE.erl
+++ b/lib/stdlib/test/beam_lib_SUITE.erl
@@ -242,8 +242,8 @@ cmp(doc) -> ["Compare contents of BEAM files and directories"];
cmp(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, dir1),
- ?line Dir2 = filename:join(PrivDir, dir2),
+ ?line Dir1 = filename:join(PrivDir, "dir1"),
+ ?line Dir2 = filename:join(PrivDir, "dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -292,8 +292,8 @@ cmp_literals(doc) -> ["Compare contents of BEAM files having literals"];
cmp_literals(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, dir1),
- ?line Dir2 = filename:join(PrivDir, dir2),
+ ?line Dir1 = filename:join(PrivDir, "dir1"),
+ ?line Dir2 = filename:join(PrivDir, "dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -330,6 +330,7 @@ strip(Conf) when is_list(Conf) ->
?line {Source2D1, BeamFile2D1} = make_beam(PrivDir, simple2, concat),
?line {Source3D1, BeamFile3D1} = make_beam(PrivDir, make_fun, make_fun),
?line {Source4D1, BeamFile4D1} = make_beam(PrivDir, constant, constant),
+ ?line {Source5D1, BeamFile5D1} = make_beam(PrivDir, lines, lines),
?line NoOfTables = length(ets:all()),
?line P0 = pps(),
@@ -360,13 +361,25 @@ strip(Conf) when is_list(Conf) ->
?line {module, make_fun} = code:load_abs(filename:rootname(BeamFile3D1)),
?line {module, constant} = code:load_abs(filename:rootname(BeamFile4D1)),
+ %% check that line number information is still present after stripping
+ ?line {module, lines} = code:load_abs(filename:rootname(BeamFile5D1)),
+ ?line {'EXIT',{badarith,[{lines,t,1,Info}|_]}} =
+ (catch lines:t(atom)),
+ ?line true = code:delete(lines),
+ ?line false = code:purge(lines),
+ ?line {ok, {lines,BeamFile5D1}} = beam_lib:strip(BeamFile5D1),
+ ?line {module, lines} = code:load_abs(filename:rootname(BeamFile5D1)),
+ ?line {'EXIT',{badarith,[{lines,t,1,Info}|_]}} =
+ (catch lines:t(atom)),
+
?line true = (P0 == pps()),
?line NoOfTables = length(ets:all()),
?line delete_files([SourceD1, BeamFileD1,
Source2D1, BeamFile2D1,
Source3D1, BeamFile3D1,
- Source4D1, BeamFile4D1]),
+ Source4D1, BeamFile4D1,
+ Source5D1, BeamFile5D1]),
ok.
@@ -381,7 +394,7 @@ otp_6711(Conf) when is_list(Conf) ->
(catch {a, beam_lib:strip_files([3])}),
?line PrivDir = ?privdir,
- ?line Dir = filename:join(PrivDir, dir),
+ ?line Dir = filename:join(PrivDir, "dir"),
?line Lib = filename:join(Dir, "lib"),
?line App = filename:join(Lib, "app"),
?line EBin = filename:join(App, "ebin"),
@@ -417,8 +430,8 @@ building(doc) -> "Testing building of BEAM files.";
building(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, b_dir1),
- ?line Dir2 = filename:join(PrivDir, b_dir2),
+ ?line Dir1 = filename:join(PrivDir, "b_dir1"),
+ ?line Dir2 = filename:join(PrivDir, "b_dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -688,7 +701,7 @@ chunk_info(File) ->
Chunks.
make_beam(Dir, Module, F) ->
- ?line FileBase = filename:join(Dir, Module),
+ ?line FileBase = filename:join(Dir, atom_to_list(Module)),
?line Source = FileBase ++ ".erl",
?line BeamFile = FileBase ++ ".beam",
?line simple_file(Source, Module, F),
@@ -773,6 +786,12 @@ simple_file(File, Module, constant2) ->
"t(A) -> "
" {a,b,[2,3],x,y}. "]),
ok = file:write_file(File, B);
+simple_file(File, Module, lines) ->
+ B = list_to_binary(["-module(", atom_to_list(Module), ").\n"
+ "-export([t/1]).\n"
+ "t(A) ->\n"
+ " A+1.\n"]),
+ ok = file:write_file(File, B);
simple_file(File, Module, F) ->
B = list_to_binary(["-module(", atom_to_list(Module), "). "
"-export([t/0]). "
diff --git a/lib/stdlib/test/dets_SUITE.erl b/lib/stdlib/test/dets_SUITE.erl
index 698070368f..b569ed9003 100644
--- a/lib/stdlib/test/dets_SUITE.erl
+++ b/lib/stdlib/test/dets_SUITE.erl
@@ -1516,7 +1516,7 @@ repair(Config, V) ->
if
V =:= 8 ->
%% first estimated number of objects is wrong, repair once more
- ?line {ok, Fd} = file:open(Fname, read_write),
+ ?line {ok, Fd} = file:open(Fname, [read,write]),
NoPos = HeadSize - 8, % no_objects
?line file:pwrite(Fd, NoPos, <<0:32>>), % NoItems
ok = file:close(Fd),
@@ -1857,9 +1857,9 @@ fixtable(Config, Version) when is_list(Config) ->
?line {ok, _} = dets:open_file(T, Args),
%% badarg
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:safe_fixtable(no_table,true)),
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[T,undefined]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[T,undefined],_}|_]}} =
(catch dets:safe_fixtable(T,undefined)),
%% The table is not allowed to grow while the elements are inserted:
@@ -1940,21 +1940,21 @@ match(Config, Version) ->
%% match, badarg
MSpec = [{'_',[],['$_']}],
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:match(no_table, '_')),
- ?line {'EXIT', {badarg, [{dets,match,[T,'_',not_a_number]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match,[T,'_',not_a_number],_}|_]}} =
(catch dets:match(T, '_', not_a_number)),
?line {EC1, _} = dets:select(T, MSpec, 1),
- ?line {'EXIT', {badarg, [{dets,match,[EC1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match,[EC1],_}|_]}} =
(catch dets:match(EC1)),
%% match_object, badarg
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:match_object(no_table, '_')),
- ?line {'EXIT', {badarg, [{dets,match_object,[T,'_',not_a_number]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match_object,[T,'_',not_a_number],_}|_]}} =
(catch dets:match_object(T, '_', not_a_number)),
?line {EC2, _} = dets:select(T, MSpec, 1),
- ?line {'EXIT', {badarg, [{dets,match_object,[EC2]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match_object,[EC2],_}|_]}} =
(catch dets:match_object(EC2)),
dets:safe_fixtable(T, true),
@@ -2118,16 +2118,16 @@ select(Config, Version) ->
%% badarg
MSpec = [{'_',[],['$_']}],
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:select(no_table, MSpec)),
- ?line {'EXIT', {badarg, [{dets,select,[T,<<17>>]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[T,<<17>>],_}|_]}} =
(catch dets:select(T, <<17>>)),
- ?line {'EXIT', {badarg, [{dets,select,[T,[]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[T,[]],_}|_]}} =
(catch dets:select(T, [])),
- ?line {'EXIT', {badarg, [{dets,select,[T,MSpec,not_a_number]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[T,MSpec,not_a_number],_}|_]}} =
(catch dets:select(T, MSpec, not_a_number)),
?line {EC, _} = dets:match(T, '_', 1),
- ?line {'EXIT', {badarg, [{dets,select,[EC]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[EC],_}|_]}} =
(catch dets:select(EC)),
AllSpec = [{'_',[],['$_']}],
@@ -2210,7 +2210,7 @@ update_counter(Config) when is_list(Config) ->
?line file:delete(Fname),
P0 = pps(),
- ?line {'EXIT', {badarg, [{dets,update_counter,[no_table,1,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,update_counter,[no_table,1,1],_}|_]}} =
(catch dets:update_counter(no_table, 1, 1)),
Args = [{file,Fname},{keypos,2}],
@@ -2254,65 +2254,66 @@ badarg(Config) when is_list(Config) ->
%% badargs are tested in match, select and fixtable too.
%% open
- ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple},[]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple},[]],_}|_]}} =
(catch dets:open_file({a,tuple},[])),
- ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple}],_}|_]}} =
(catch dets:open_file({a,tuple})),
- ?line {'EXIT', {badarg, [{dets,open_file,[file,[foo]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,open_file,[file,[foo]],_}|_]}} =
(catch dets:open_file(file,[foo])),
- ?line {'EXIT', {badarg,[{dets,open_file,[{hej,san},[{type,set}|3]]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,open_file,
+ [{hej,san},[{type,set}|3]],_}|_]}} =
(catch dets:open_file({hej,san},[{type,set}|3])),
%% insert
- ?line {'EXIT', {badarg, [{dets,insert,[no_table,{1,2}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[no_table,{1,2}],_}|_]}} =
(catch dets:insert(no_table, {1,2})),
- ?line {'EXIT', {badarg, [{dets,insert,[no_table,[{1,2}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[no_table,[{1,2}]],_}|_]}} =
(catch dets:insert(no_table, [{1,2}])),
- ?line {'EXIT', {badarg, [{dets,insert,[T,{1,2}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[T,{1,2}],_}|_]}} =
(catch dets:insert(T, {1,2})),
- ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2}]],_}|_]}} =
(catch dets:insert(T, [{1,2}])),
- ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2,3}|3]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2,3}|3]],_}|_]}} =
(catch dets:insert(T, [{1,2,3} | 3])),
%% lookup{_keys}
- ?line {'EXIT', {badarg, [{dets,lookup_keys,[badarg,[]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,lookup_keys,[badarg,[]],_}|_]}} =
(catch dets:lookup_keys(T, [])),
- ?line {'EXIT', {badarg, [{dets,lookup,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,lookup,[no_table,1],_}|_]}} =
(catch dets:lookup(no_table, 1)),
- ?line {'EXIT', {badarg, [{dets,lookup_keys,[T,[1|2]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,lookup_keys,[T,[1|2]],_}|_]}} =
(catch dets:lookup_keys(T, [1 | 2])),
%% member
- ?line {'EXIT', {badarg, [{dets,member,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,member,[no_table,1],_}|_]}} =
(catch dets:member(no_table, 1)),
%% sync
- ?line {'EXIT', {badarg, [{dets,sync,[no_table]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,sync,[no_table],_}|_]}} =
(catch dets:sync(no_table)),
%% delete{_keys}
- ?line {'EXIT', {badarg, [{dets,delete,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete,[no_table,1],_}|_]}} =
(catch dets:delete(no_table, 1)),
%% delete_object
- ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,{1,2,3}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,{1,2,3}],_}|_]}} =
(catch dets:delete_object(no_table, {1,2,3})),
- ?line {'EXIT', {badarg, [{dets,delete_object,[T,{1,2}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[T,{1,2}],_}|_]}} =
(catch dets:delete_object(T, {1,2})),
- ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,[{1,2,3}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,[{1,2,3}]],_}|_]}} =
(catch dets:delete_object(no_table, [{1,2,3}])),
- ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2}]],_}|_]}} =
(catch dets:delete_object(T, [{1,2}])),
- ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2,3}|3]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2,3}|3]],_}|_]}} =
(catch dets:delete_object(T, [{1,2,3} | 3])),
%% first,next,slot
- ?line {'EXIT', {badarg, [{dets,first,[no_table]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,first,[no_table],_}|_]}} =
(catch dets:first(no_table)),
- ?line {'EXIT', {badarg, [{dets,next,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,next,[no_table,1],_}|_]}} =
(catch dets:next(no_table, 1)),
- ?line {'EXIT', {badarg, [{dets,slot,[no_table,0]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,slot,[no_table,0],_}|_]}} =
(catch dets:slot(no_table, 0)),
%% info
@@ -2321,26 +2322,26 @@ badarg(Config) when is_list(Config) ->
?line undefined = dets:info(T, foo),
%% match_delete
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:match_delete(no_table, '_')),
%% delete_all_objects
- ?line {'EXIT', {badarg, [{dets,delete_all_objects,[no_table]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_all_objects,[no_table],_}|_]}} =
(catch dets:delete_all_objects(no_table)),
%% select_delete
MSpec = [{'_',[],['$_']}],
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:select_delete(no_table, MSpec)),
- ?line {'EXIT', {badarg, [{dets,select_delete,[T, <<17>>]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select_delete,[T, <<17>>],_}|_]}} =
(catch dets:select_delete(T, <<17>>)),
%% traverse, fold
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:traverse(no_table, fun(_) -> continue end)),
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:foldl(fun(_, A) -> A end, [], no_table)),
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:foldr(fun(_, A) -> A end, [], no_table)),
%% close
@@ -2349,14 +2350,14 @@ badarg(Config) when is_list(Config) ->
?line {error, not_owner} = dets:close(T),
%% init_table
- ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]],_}|_]}} =
(catch dets:init_table(no_table, fun(X) -> X end)),
- ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]],_}|_]}} =
(catch dets:init_table(no_table, fun(X) -> X end, [])),
%% from_ets
Ets = ets:new(ets,[]),
- ?line {'EXIT', {badarg,[{dets,from_ets,[no_table,_]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,from_ets,[no_table,_],_}|_]}} =
(catch dets:from_ets(no_table, Ets)),
ets:delete(Ets),
@@ -3247,7 +3248,7 @@ otp_5402(suite) ->
[];
otp_5402(Config) when is_list(Config) ->
Tab = otp_5402,
- ?line File = filename:join([cannot, write, this, file]),
+ ?line File = filename:join(["cannot", "write", "this", "file"]),
%% close
?line{ok, T} = dets:open_file(Tab, [{ram_file,true},
@@ -3887,7 +3888,7 @@ crash(File, Where) ->
crash(File, Where, 10).
crash(File, Where, What) when is_integer(What) ->
- ?line {ok, Fd} = file:open(File, read_write),
+ ?line {ok, Fd} = file:open(File, [read,write]),
?line file:position(Fd, Where),
?line ok = file:write(Fd, [What]),
?line ok = file:close(Fd).
@@ -4031,7 +4032,7 @@ writable(Fname) ->
?line file:write_file_info(Fname, Info#file_info{mode = Mode}).
truncate(File, Where) ->
- ?line {ok, Fd} = file:open(File, read_write),
+ ?line {ok, Fd} = file:open(File, [read,write]),
?line file:position(Fd, Where),
?line ok = file:truncate(Fd),
?line ok = file:close(Fd).
diff --git a/lib/stdlib/test/epp_SUITE.erl b/lib/stdlib/test/epp_SUITE.erl
index 9b024a5b49..57f3f4eddb 100644
--- a/lib/stdlib/test/epp_SUITE.erl
+++ b/lib/stdlib/test/epp_SUITE.erl
@@ -1280,7 +1280,7 @@ eval_tests(Config, Fun, Tests) ->
check_test(Config, Test) ->
- Filename = 'epp_test.erl',
+ Filename = "epp_test.erl",
?line PrivDir = ?config(priv_dir, Config),
?line File = filename:join(PrivDir, Filename),
?line ok = file:write_file(File, Test),
@@ -1293,7 +1293,7 @@ check_test(Config, Test) ->
compile_test(Config, Test0) ->
Test = [<<"-module(epp_test). -compile(export_all). ">>, Test0],
- Filename = 'epp_test.erl',
+ Filename = "epp_test.erl",
?line PrivDir = ?config(priv_dir, Config),
?line File = filename:join(PrivDir, Filename),
?line ok = file:write_file(File, Test),
diff --git a/lib/stdlib/test/erl_eval_SUITE.erl b/lib/stdlib/test/erl_eval_SUITE.erl
index 0bcf3c5b71..784c7cb86e 100644
--- a/lib/stdlib/test/erl_eval_SUITE.erl
+++ b/lib/stdlib/test/erl_eval_SUITE.erl
@@ -1189,7 +1189,7 @@ lfh() ->
{eval, fun(F, As, Bs) -> local_func(F, As, Bs) end}.
local_func(F, As0, Bs0) when is_atom(F) ->
- {As,Bs} = erl_eval:expr_list(As0, Bs0, {eval,lfh()}),
+ {As,Bs} = erl_eval:expr_list(As0, Bs0, lfh()),
case erlang:function_exported(?MODULE, F, length(As)) of
true ->
{value,apply(?MODULE, F, As),Bs};
diff --git a/lib/stdlib/test/erl_lint_SUITE.erl b/lib/stdlib/test/erl_lint_SUITE.erl
index f980d52e4e..9041adbe5c 100644
--- a/lib/stdlib/test/erl_lint_SUITE.erl
+++ b/lib/stdlib/test/erl_lint_SUITE.erl
@@ -2981,7 +2981,7 @@ run_test(Conf, Test0, Warnings0) ->
run_test2(Conf, Test, Warnings0).
run_test2(Conf, Test, Warnings0) ->
- Filename = 'lint_test.erl',
+ Filename = "lint_test.erl",
DataDir = ?privdir,
File = filename:join(DataDir, Filename),
Opts = case Warnings0 of
diff --git a/lib/stdlib/test/ets_SUITE.erl b/lib/stdlib/test/ets_SUITE.erl
index 9341300f90..02e97fb3a8 100644
--- a/lib/stdlib/test/ets_SUITE.erl
+++ b/lib/stdlib/test/ets_SUITE.erl
@@ -795,16 +795,16 @@ t_ets_dets(Config, Opts) ->
?line true = ets:from_dets(ETab,DTab),
?line 3000 = ets:info(ETab,size),
?line ets:delete(ETab),
- ?line {'EXIT',{badarg,[{ets,to_dets,[ETab,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,to_dets,[ETab,DTab],_}|_]}} =
(catch ets:to_dets(ETab,DTab)),
- ?line {'EXIT',{badarg,[{ets,from_dets,[ETab,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,from_dets,[ETab,DTab],_}|_]}} =
(catch ets:from_dets(ETab,DTab)),
?line ETab2 = ets_new(x,Opts),
?line filltabint(ETab2,3000),
?line dets:close(DTab),
- ?line {'EXIT',{badarg,[{ets,to_dets,[ETab2,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,to_dets,[ETab2,DTab],_}|_]}} =
(catch ets:to_dets(ETab2,DTab)),
- ?line {'EXIT',{badarg,[{ets,from_dets,[ETab2,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,from_dets,[ETab2,DTab],_}|_]}} =
(catch ets:from_dets(ETab2,DTab)),
?line ets:delete(ETab2),
?line (catch file:delete(Fname)),
@@ -2644,7 +2644,7 @@ maybe_sort(L) when is_list(L) ->
%maybe_sort({'EXIT',{Reason, [{Module, Function, _}|_]}}) ->
% {'EXIT',{Reason, [{Module, Function, '_'}]}};
maybe_sort({'EXIT',{Reason, List}}) when is_list(List) ->
- {'EXIT',{Reason, lists:map(fun({Module, Function, _}) ->
+ {'EXIT',{Reason, lists:map(fun({Module, Function, _, _}) ->
{Module, Function, '_'}
end,
List)}};
diff --git a/lib/stdlib/test/file_sorter_SUITE.erl b/lib/stdlib/test/file_sorter_SUITE.erl
index 80d4ea5fdc..74c08912be 100644
--- a/lib/stdlib/test/file_sorter_SUITE.erl
+++ b/lib/stdlib/test/file_sorter_SUITE.erl
@@ -89,7 +89,7 @@ basic(suite) ->
basic(Config) when is_list(Config) ->
Fmt = binary,
Arg = {format,Fmt},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
P0 = pps(),
?line F1s = [F1] = to_files([[]], Fmt, Config),
@@ -455,7 +455,7 @@ inout(suite) ->
[];
inout(Config) when is_list(Config) ->
BTF = {format, binary_term},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is fun.
End = fun(read) -> end_of_input end,
@@ -522,7 +522,7 @@ many(doc) ->
many(suite) ->
[];
many(Config) when is_list(Config) ->
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
PrivDir = ?privdir(Config),
P0 = pps(),
@@ -587,7 +587,7 @@ misc(suite) ->
[];
misc(Config) when is_list(Config) ->
BTF = {format, binary_term},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
FFoo = filename:absname(Foo),
P0 = pps(),
@@ -704,7 +704,7 @@ misc(Config) when is_list(Config) ->
sort(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,5} | XArgs]),
TmpArgs = [{tmpdir,?privdir(Config)} | Args],
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is a fun. Output is a fun.
?line [] = file_sorter:sort(input([], 2, Fmt), output([], Fmt), Args),
@@ -777,7 +777,7 @@ sort(Fmt, XArgs, Config) ->
keysort(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,50}, {no_files, 2} | XArgs]),
TmpArgs = Args ++ [{tmpdir,?privdir(Config)}],
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is files. Output is a file.
?line ok = file_sorter:keysort(2, [], Foo, Args),
@@ -836,7 +836,7 @@ keysort(Fmt, XArgs, Config) ->
merge(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,5} | XArgs]),
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is a file. Output is a fun.
?line [] = file_sorter:merge([], output([], Fmt), Args),
@@ -873,7 +873,7 @@ merge(Fmt, XArgs, Config) ->
keymerge(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,50}, {no_files, 2} | XArgs]),
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is files. Output is a file.
?line ok = file_sorter:keymerge(2, [], Foo, Args),
diff --git a/lib/stdlib/test/filelib_SUITE.erl b/lib/stdlib/test/filelib_SUITE.erl
index a355097fe2..1de639a166 100644
--- a/lib/stdlib/test/filelib_SUITE.erl
+++ b/lib/stdlib/test/filelib_SUITE.erl
@@ -97,11 +97,12 @@ wildcard_errors(Config) when is_list(Config) ->
wcc(Wc, Error) ->
{'EXIT',{{badpattern,Error},
- [{filelib,compile_wildcard,1}|_]}} = (catch filelib:compile_wildcard(Wc)),
+ [{filelib,compile_wildcard,1,_}|_]}} =
+ (catch filelib:compile_wildcard(Wc)),
{'EXIT',{{badpattern,Error},
- [{filelib,wildcard,1}|_]}} = (catch filelib:wildcard(Wc)),
+ [{filelib,wildcard,1,_}|_]}} = (catch filelib:wildcard(Wc)),
{'EXIT',{{badpattern,Error},
- [{filelib,wildcard,2}|_]}} = (catch filelib:wildcard(Wc, ".")).
+ [{filelib,wildcard,2,_}|_]}} = (catch filelib:wildcard(Wc, ".")).
do_wildcard_1(Dir, Wcf0) ->
do_wildcard_2(Dir, Wcf0),
@@ -243,7 +244,7 @@ otp_5960(doc) ->
["Test that filelib:ensure_dir/1 returns ok or {error,Reason}"];
otp_5960(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
- ?line Dir = filename:join(PrivDir, otp_5960_dir),
+ ?line Dir = filename:join(PrivDir, "otp_5960_dir"),
?line Name1 = filename:join(Dir, name1),
?line Name2 = filename:join(Dir, name2),
?line ok = filelib:ensure_dir(Name1), % parent is created
@@ -268,7 +269,7 @@ otp_5960(Config) when is_list(Config) ->
ensure_dir_eexist(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
- ?line Dir = filename:join(PrivDir, ensure_dir_eexist),
+ ?line Dir = filename:join(PrivDir, "ensure_dir_eexist"),
?line Name = filename:join(Dir, "same_name_as_file_and_dir"),
?line ok = filelib:ensure_dir(Name),
?line ok = file:write_file(Name, <<"some string\n">>),
diff --git a/lib/stdlib/test/proc_lib_SUITE.erl b/lib/stdlib/test/proc_lib_SUITE.erl
index 1565aa9bba..c95089117c 100644
--- a/lib/stdlib/test/proc_lib_SUITE.erl
+++ b/lib/stdlib/test/proc_lib_SUITE.erl
@@ -328,7 +328,7 @@ otp_6345(doc) ->
["'monitor' spawn_opt option"];
otp_6345(Config) when is_list(Config) ->
Opts = [link,monitor],
- {'EXIT', {badarg,[{proc_lib,check_for_monitor,_}|_Stack]}} =
+ {'EXIT', {badarg,[{proc_lib,check_for_monitor,_,_}|_Stack]}} =
(catch proc_lib:start(?MODULE, otp_6345_init, [self()],
1000, Opts)),
ok.
diff --git a/lib/stdlib/test/re_SUITE.erl b/lib/stdlib/test/re_SUITE.erl
index c4817c0d38..3b2e637c84 100644
--- a/lib/stdlib/test/re_SUITE.erl
+++ b/lib/stdlib/test/re_SUITE.erl
@@ -454,115 +454,115 @@ error_handling(Config) when is_list(Config) ->
% The malformed precomiled RE is detected after
% the trap to re:grun from grun, in the grun function clause
% that handles precompiled expressions
- ?line {'EXIT',{badarg,[{re,run,["apa",{1,2,3,4},[global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,["apa",{1,2,3,4},[global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run("apa",{1,2,3,4},[global])),
% An invalid capture list will also cause a badarg late,
% but with a non pre compiled RE, the exception should be thrown by the
% grun function clause that handles RE's compiled implicitly by
% the run/3 BIF before trapping.
- ?line {'EXIT',{badarg,[{re,run,["apa","p",[{capture,[1,{a}]},global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,["apa","p",[{capture,[1,{a}]},global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run("apa","p",[{capture,[1,{a}]},global])),
% And so the case of a precompiled expression together with
% a compile-option (binary and list subject):
?line {ok,RE} = re:compile("(p)"),
?line {match,[[{1,1},{1,1}]]} = re:run(<<"apa">>,RE,[global]),
?line {match,[[{1,1},{1,1}]]} = re:run("apa",RE,[global]),
- {'EXIT',{badarg,[{re,run,
- [<<"apa">>,
- {re_pattern,1,0,_},
- [global,unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,
+ [<<"apa">>,
+ {re_pattern,1,0,_},
+ [global,unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run(<<"apa">>,RE,[global,unicode])),
- {'EXIT',{badarg,[{re,run,
- ["apa",
- {re_pattern,1,0,_},
- [global,unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,
+ ["apa",
+ {re_pattern,1,0,_},
+ [global,unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run("apa",RE,[global,unicode])),
?line {'EXIT',{badarg,_}} = (catch re:run("apa","(p",[])),
?line {'EXIT',{badarg,_}} = (catch re:run("apa","(p",[global])),
% The replace errors:
- ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:replace("apa",{1,2,3,4},"X",[])),
- ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:replace("apa",{1,2,3,4},"X",[global])),
?line {'EXIT',{badarg,[{re,replace,
["apa",
{re_pattern,1,0,_},
"X",
- [unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ [unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:replace("apa",RE,"X",[unicode])),
?line <<"aXa">> = iolist_to_binary(re:replace("apa","p","X",[])),
?line {'EXIT',{badarg,[{re,replace,
- ["apa","p","X",[{capture,all,binary}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","p","X",[{capture,all,binary}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","p","X",
[{capture,all,binary}]))),
?line {'EXIT',{badarg,[{re,replace,
- ["apa","p","X",[{capture,all}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","p","X",[{capture,all}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","p","X",
[{capture,all}]))),
?line {'EXIT',{badarg,[{re,replace,
- ["apa","p","X",[{return,banana}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","p","X",[{return,banana}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","p","X",
[{return,banana}]))),
?line {'EXIT',{badarg,_}} = (catch re:replace("apa","(p","X",[])),
% Badarg, not compile error.
?line {'EXIT',{badarg,[{re,replace,
- ["apa","(p","X",[{return,banana}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","(p","X",[{return,banana}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","(p","X",
[{return,banana}]))),
% And the split errors:
?line [<<"a">>,<<"a">>] = (catch re:split("apa","p",[])),
?line [<<"a">>,<<"p">>,<<"a">>] = (catch re:split("apa",RE,[])),
- ?line {'EXIT',{badarg,[{re,split,["apa","p",[global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa","p",[global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa","p",[global])),
- ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa","p",[{capture,all}])),
- ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all,binary}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all,binary}]],_},
+ {?MODULE, error_handling,1,_} | _]}} =
(catch re:split("apa","p",[{capture,all,binary}])),
- ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",{1,2,3,4})),
- ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",{1,2,3,4},[])),
?line {'EXIT',{badarg,[{re,split,
["apa",
RE,
- [unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ [unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",RE,[unicode])),
?line {'EXIT',{badarg,[{re,split,
["apa",
RE,
- [{return,banana}]]},
- {?MODULE, error_handling,1} | _]}} =
+ [{return,banana}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",RE,[{return,banana}])),
?line {'EXIT',{badarg,[{re,split,
["apa",
RE,
- [banana]]},
- {?MODULE, error_handling,1} | _]}} =
+ [banana]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",RE,[banana])),
?line {'EXIT',{badarg,_}} = (catch re:split("apa","(p")),
%Exception on bad argument, not compilation error
?line {'EXIT',{badarg,[{re,split,
["apa",
"(p",
- [banana]]},
- {?MODULE, error_handling,1} | _]}} =
+ [banana]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa","(p",[banana])),
?t:timetrap_cancel(Dog),
ok.
diff --git a/lib/stdlib/test/shell_SUITE.erl b/lib/stdlib/test/shell_SUITE.erl
index 8273377ba1..b6019b86f0 100644
--- a/lib/stdlib/test/shell_SUITE.erl
+++ b/lib/stdlib/test/shell_SUITE.erl
@@ -2388,12 +2388,12 @@ otp_6554(Config) when is_list(Config) ->
comm_err(<<"V = lists:seq(1, 20), case V of a -> ok end.">>),
?line "exception error: no function clause matching" =
comm_err(<<"fun(P) when is_pid(P) -> true end(a).">>),
- ?line "exception error: {function_clause,[{erl_eval,do_apply,[unproper|list]}"++_ =
+ ?line "exception error: {function_clause," =
comm_err(<<"erlang:error(function_clause, [unproper | list]).">>),
?line "exception error: function_clause" =
comm_err(<<"erlang:error(function_clause, 4).">>),
%% Cheating:
- ?line "exception error: no function clause matching erl_eval:do_apply(4)" =
+ ?line "exception error: no function clause matching erl_eval:do_apply(4)" ++ _ =
comm_err(<<"erlang:error(function_clause, [4]).">>),
?line "exception error: no function clause matching" ++ _ =
comm_err(<<"fun(a, b, c, d) -> foo end"
@@ -2406,7 +2406,7 @@ otp_6554(Config) when is_list(Config) ->
comm_err(<<"fun(P, q) when is_pid(P) -> true end(a, b).">>),
?line "exception error: no function clause matching lists:reverse(" ++ _ =
comm_err(<<"F=fun() -> hello end, lists:reverse(F).">>),
- ?line "exception error: no function clause matching lists:reverse(34)" =
+ ?line "exception error: no function clause matching lists:reverse(34) (lists.erl, line " ++ _ =
comm_err(<<"lists:reverse(34).">>),
?line "exception error: no true branch found when evaluating an if expression" =
comm_err(<<"if length([a,b]) > 17 -> a end.">>),
diff --git a/lib/stdlib/test/sofs_SUITE.erl b/lib/stdlib/test/sofs_SUITE.erl
index d6f88a655e..73b282149a 100644
--- a/lib/stdlib/test/sofs_SUITE.erl
+++ b/lib/stdlib/test/sofs_SUITE.erl
@@ -1879,11 +1879,11 @@ digraph(Conf) when is_list(Conf) ->
?line {'EXIT', {badarg, _}} =
(catch family_to_digraph(set([a]))),
- ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_]}|_]}} =
+ ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_],_}|_]}} =
(catch family_to_digraph(set([a]), [foo])),
- ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_]}|_]}} =
+ ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_],_}|_]}} =
(catch family_to_digraph(F, [foo])),
- ?line {'EXIT', {cyclic, [{sofs,family_to_digraph,[_,_]}|_]}} =
+ ?line {'EXIT', {cyclic, [{sofs,family_to_digraph,[_,_],_}|_]}} =
(catch family_to_digraph(family([{a,[a]}]),[acyclic])),
?line G1 = family_to_digraph(E),
diff --git a/lib/stdlib/test/string_SUITE.erl b/lib/stdlib/test/string_SUITE.erl
index 1dcd4be21e..6969c095a0 100644
--- a/lib/stdlib/test/string_SUITE.erl
+++ b/lib/stdlib/test/string_SUITE.erl
@@ -273,9 +273,9 @@ words(Config) when is_list(Config) ->
?line 2 = string:words("2.35", $.),
?line 100 = string:words(string:copies(". ", 100)),
%% invalid arg type
- ?line {'EXIT',_} = (catch string:chars(hej)),
+ ?line {'EXIT',_} = (catch string:chars(hej, 1)),
%% invalid arg type
- ?line {'EXIT',_} = (catch string:chars("hej", " ")),
+ ?line {'EXIT',_} = (catch string:chars("hej", 1, " ")),
ok.
diff --git a/lib/stdlib/test/supervisor_SUITE.erl b/lib/stdlib/test/supervisor_SUITE.erl
index 7a75114cb6..2aa3131aeb 100644
--- a/lib/stdlib/test/supervisor_SUITE.erl
+++ b/lib/stdlib/test/supervisor_SUITE.erl
@@ -44,7 +44,7 @@
permanent_shutdown/1, transient_shutdown/1,
temporary_shutdown/1,
permanent_abnormal/1, transient_abnormal/1,
- temporary_abnormal/1]).
+ temporary_abnormal/1, temporary_bystander/1]).
%% Restart strategy tests
-export([ one_for_one/1,
@@ -77,7 +77,7 @@ all() ->
{group, abnormal_termination}, child_unlink, tree,
count_children_memory, do_not_save_start_parameters_for_temporary_children,
do_not_save_child_specs_for_temporary_children,
- simple_one_for_one_scale_many_temporary_children].
+ simple_one_for_one_scale_many_temporary_children, temporary_bystander].
groups() ->
[{sup_start, [],
@@ -693,6 +693,37 @@ temporary_abnormal(Config) when is_list(Config) ->
[0,0,0,0] = get_child_counts(sup_test).
%%-------------------------------------------------------------------------
+temporary_bystander(doc) ->
+ ["A temporary process killed as part of a rest_for_one or one_for_all "
+ "restart strategy should not be restarted given its args are not "
+ " saved. Otherwise the supervisor hits its limit and crashes."];
+temporary_bystander(suite) -> [];
+temporary_bystander(_Config) ->
+ Child1 = {child1, {supervisor_1, start_child, []}, permanent, 100,
+ worker, []},
+ Child2 = {child2, {supervisor_1, start_child, []}, temporary, 100,
+ worker, []},
+ {ok, SupPid1} = supervisor:start_link(?MODULE, {ok, {{one_for_all, 2, 300}, []}}),
+ {ok, SupPid2} = supervisor:start_link(?MODULE, {ok, {{rest_for_one, 2, 300}, []}}),
+ unlink(SupPid1), % otherwise we crash with it
+ unlink(SupPid2), % otherwise we crash with it
+ {ok, CPid1} = supervisor:start_child(SupPid1, Child1),
+ {ok, _CPid2} = supervisor:start_child(SupPid1, Child2),
+ {ok, CPid3} = supervisor:start_child(SupPid2, Child1),
+ {ok, _CPid4} = supervisor:start_child(SupPid2, Child2),
+ terminate(SupPid1, CPid1, child1, normal),
+ terminate(SupPid2, CPid3, child1, normal),
+ timer:sleep(350),
+ catch link(SupPid1),
+ catch link(SupPid2),
+ %% The supervisor would die attempting to restart child2
+ true = erlang:is_process_alive(SupPid1),
+ true = erlang:is_process_alive(SupPid2),
+ %% Child2 has not been restarted
+ [{child1, _, _, _}] = supervisor:which_children(SupPid1),
+ [{child1, _, _, _}] = supervisor:which_children(SupPid2).
+
+%%-------------------------------------------------------------------------
one_for_one(doc) ->
["Test the one_for_one base case."];
one_for_one(suite) -> [];
diff --git a/lib/stdlib/test/supervisor_bridge_SUITE.erl b/lib/stdlib/test/supervisor_bridge_SUITE.erl
index f2dbad0b3b..c4d696564d 100644
--- a/lib/stdlib/test/supervisor_bridge_SUITE.erl
+++ b/lib/stdlib/test/supervisor_bridge_SUITE.erl
@@ -158,7 +158,7 @@ internal_loop(State) ->
terminate(Reason,{Parent,Worker}) ->
%% This func knows about supervisor_bridge
io:format("Terminating bridge...\n"),
- exit(kill,Worker),
+ exit(Worker,kill),
Parent ! {dying,Reason},
anything.
diff --git a/lib/stdlib/test/sys_SUITE.erl b/lib/stdlib/test/sys_SUITE.erl
index 72b089aa3f..fe039e8bcc 100644
--- a/lib/stdlib/test/sys_SUITE.erl
+++ b/lib/stdlib/test/sys_SUITE.erl
@@ -71,7 +71,7 @@ log_to_file(Config) when is_list(Config) ->
?line ok = sys:log_to_file(?server,TempName),
?line {ok,-44} = public_call(44),
?line ok = sys:log_to_file(?server,false),
- ?line {ok,Fd} = file:open(TempName,read),
+ ?line {ok,Fd} = file:open(TempName,[read]),
?line Msg1 = io:get_line(Fd,''),
?line Msg2 = io:get_line(Fd,''),
?line file:close(Fd),
diff --git a/lib/stdlib/test/tar_SUITE.erl b/lib/stdlib/test/tar_SUITE.erl
index e32704ca65..48f58cd05d 100644
--- a/lib/stdlib/test/tar_SUITE.erl
+++ b/lib/stdlib/test/tar_SUITE.erl
@@ -65,7 +65,7 @@ borderline(Config) when is_list(Config) ->
?line {ok, Cwd} = file:get_cwd(),
?line RootDir = ?config(priv_dir, Config),
- ?line TempDir = remove_prefix(Cwd++"/", filename:join(RootDir, borderline)),
+ ?line TempDir = remove_prefix(Cwd++"/", filename:join(RootDir, "borderline")),
?line ok = file:make_dir(TempDir),
?line Record = 512,
@@ -323,12 +323,12 @@ create_long_names(doc) ->
create_long_names(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
?line ok = file:set_cwd(PrivDir),
- Dirs = [aslfjkshjkhliuf,
- asdhjfehnbfsky,
- sahajfskdfhsz,
- asldfkdlfy4y8rchg,
- f7nafhjgffagkhsfkhsjk,
- dfjasldkfjsdkfjashbv],
+ Dirs = ["aslfjkshjkhliuf",
+ "asdhjfehnbfsky",
+ "sahajfskdfhsz",
+ "asldfkdlfy4y8rchg",
+ "f7nafhjgffagkhsfkhsjk",
+ "dfjasldkfjsdkfjashbv"],
?line DeepDir = make_dirs(Dirs, []),
?line AFile = filename:join(DeepDir, "a_file"),
@@ -487,7 +487,7 @@ extract_from_binary_compressed(Config) when is_list(Config) ->
%% Trying extracting from a binary.
?line ok = erl_tar:extract({binary,Bin}, [compressed,{cwd,ExtractDir}]),
- ?line {ok,List} = file:list_dir(filename:join(ExtractDir, ddll_SUITE_data)),
+ ?line {ok,List} = file:list_dir(filename:join(ExtractDir, "ddll_SUITE_data")),
?line io:format("~p\n", [List]),
?line 19 = length(List),
@@ -676,7 +676,7 @@ cooked_compressed(Config) when is_list(Config) ->
end, List),
%% Clean up.
- ?line delete_files([filename:join(PrivDir, ddll_SUITE_data)]),
+ ?line delete_files([filename:join(PrivDir, "ddll_SUITE_data")]),
ok.
memory(doc) ->
diff --git a/lib/stdlib/test/zip_SUITE.erl b/lib/stdlib/test/zip_SUITE.erl
index d5f2cd52d4..7233c061ef 100644
--- a/lib/stdlib/test/zip_SUITE.erl
+++ b/lib/stdlib/test/zip_SUITE.erl
@@ -375,7 +375,8 @@ zip_options(Config) when is_list(Config) ->
ok = file:set_cwd(?config(data_dir, Config)),
%% Create a zip archive
- {ok, Zip} = zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
+ {ok, {_,Zip}} =
+ zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
%% Open archive
{ok, ZipSrv} = zip:zip_open(Zip, [memory]),
diff --git a/lib/test_server/include/test_server.hrl b/lib/test_server/include/test_server.hrl
index 4b96d84ace..36e7e1f83d 100644
--- a/lib/test_server/include/test_server.hrl
+++ b/lib/test_server/include/test_server.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -20,11 +20,10 @@
-ifdef(line_trace).
-line_trace(true).
-define(line,
- put(test_server_loc,{?MODULE,?LINE}),
io:format(lists:concat([?MODULE,",",integer_to_list(?LINE),": ~p"]),
[erlang:now()]),).
-else.
--define(line,put(test_server_loc,{?MODULE,?LINE}),).
+-define(line,).
-endif.
-define(t,test_server).
-define(config,test_server:lookup_config).
diff --git a/lib/test_server/include/test_server_line.hrl b/lib/test_server/include/test_server_line.hrl
index 60ef860883..3c309d3ee5 100644
--- a/lib/test_server/include/test_server_line.hrl
+++ b/lib/test_server/include/test_server_line.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -16,5 +16,4 @@
%%
%% %CopyrightEnd%
%%
--compile({parse_transform,test_server_line}).
diff --git a/lib/test_server/src/Makefile b/lib/test_server/src/Makefile
index 63a585d526..4bc51873c2 100644
--- a/lib/test_server/src/Makefile
+++ b/lib/test_server/src/Makefile
@@ -43,7 +43,6 @@ MODULES= test_server_ctrl \
test_server_node \
test_server \
test_server_sup \
- test_server_line \
test_server_h \
erl2html2 \
vxworks_client
diff --git a/lib/test_server/src/test_server.app.src b/lib/test_server/src/test_server.app.src
index af2d4dc2cb..7e87583a7b 100644
--- a/lib/test_server/src/test_server.app.src
+++ b/lib/test_server/src/test_server.app.src
@@ -24,7 +24,6 @@
test_server_ctrl,
test_server,
test_server_h,
- test_server_line,
test_server_node,
test_server_sup
]},
diff --git a/lib/test_server/src/test_server.erl b/lib/test_server/src/test_server.erl
index 591329b361..04f92c5738 100644
--- a/lib/test_server/src/test_server.erl
+++ b/lib/test_server/src/test_server.erl
@@ -759,7 +759,6 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
run_test_case_msgloop(Ref,Pid,CaptureStdout,Terminate,
Comment,undefined);
Loc1 ->
- {Mod,Func} = get_mf(Loc1),
%% call end_per_testcase on a separate process,
%% only so that the user has a chance to clean up
%% after init_per_testcase, even after a timetrap timeout
@@ -775,6 +774,7 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
TVal),
{EndConfPid,{Mod,Func},Conf};
_ ->
+ {Mod,Func} = get_mf(Loc1),
%% The framework functions mustn't execute on this
%% group leader process or io will cause deadlock,
%% so we spawn a dedicated process for the operation
@@ -810,7 +810,6 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
run_test_case_msgloop(Ref,Pid,CaptureStdout,Terminate,
Comment,undefined);
Loc1 ->
- {Mod,Func} = get_mf(Loc1),
%% call end_per_testcase on a separate process, only so
%% that the user has a chance to clean up after init_per_testcase,
%% even after abortion
@@ -828,6 +827,7 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
TVal),
{EndConfPid,{Mod,Func},Conf};
_ ->
+ {Mod,Func} = get_mf(Loc1),
spawn_fw_call(Mod,Func,Pid,ErrorMsg,
Loc1,self(),Comment),
undefined
@@ -1307,57 +1307,62 @@ init_per_testcase(Mod, Func, Args) ->
false -> code:load_file(Mod);
_ -> ok
end,
- %% init_per_testcase defined, returns new configuration
- case erlang:function_exported(Mod,init_per_testcase,2) of
+ case erlang:function_exported(Mod, init_per_testcase, 2) of
true ->
- case catch my_apply(Mod, init_per_testcase, [Func|Args]) of
- {'$test_server_ok',{Skip,Reason}} when Skip==skip;
- Skip==skipped ->
- {skip,Reason};
- {'$test_server_ok',Res={skip_and_save,_,_}} ->
- Res;
- {'$test_server_ok',NewConf} when is_list(NewConf) ->
- case lists:filter(fun(T) when is_tuple(T) -> false;
- (_) -> true end, NewConf) of
- [] ->
- {ok,NewConf};
- Bad ->
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase has returned "
- "bad elements in Config: ~p\n",[Bad]},
- {skip,{failed,{Mod,init_per_testcase,bad_return}}}
- end;
- {'$test_server_ok',Res={fail,_Reason}} ->
- Res;
- {'$test_server_ok',_Other} ->
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase did not return "
- "a Config list.\n",[]},
- {skip,{failed,{Mod,init_per_testcase,bad_return}}};
- {'EXIT',Reason} ->
- Line = get_loc(),
- FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase crashed!\n"
- "\tLocation: ~s\n\tReason: ~p\n",
- [FormattedLoc,Reason]},
- {skip,{failed,{Mod,init_per_testcase,Reason}}};
- Other ->
- Line = get_loc(),
- FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase thrown!\n"
- "\tLocation: ~s\n\tReason: ~p\n",
- [FormattedLoc, Other]},
- {skip,{failed,{Mod,init_per_testcase,Other}}}
- end;
+ do_init_per_testcase(Mod, [Func|Args]);
false ->
-%% Optional init_per_testcase not defined
-%% keep quiet.
+ %% Optional init_per_testcase is not defined -- keep quiet.
[Config] = Args,
{ok, Config}
end.
+do_init_per_testcase(Mod, Args) ->
+ try apply(Mod, init_per_testcase, Args) of
+ {Skip,Reason} when Skip =:= skip; Skip =:= skipped ->
+ {skip,Reason};
+ {skip_and_save,_,_}=Res ->
+ Res;
+ NewConf when is_list(NewConf) ->
+ case lists:filter(fun(T) when is_tuple(T) -> false;
+ (_) -> true end, NewConf) of
+ [] ->
+ {ok,NewConf};
+ Bad ->
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase has returned "
+ "bad elements in Config: ~p\n",[Bad]},
+ {skip,{failed,{Mod,init_per_testcase,bad_return}}}
+ end;
+ {fail,_Reason}=Res ->
+ Res;
+ _Other ->
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase did not return "
+ "a Config list.\n",[]},
+ {skip,{failed,{Mod,init_per_testcase,bad_return}}}
+ catch
+ throw:Other ->
+ set_loc(erlang:get_stacktrace()),
+ Line = get_loc(),
+ FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase thrown!\n"
+ "\tLocation: ~s\n\tReason: ~p\n",
+ [FormattedLoc, Other]},
+ {skip,{failed,{Mod,init_per_testcase,Other}}};
+ _:Reason0 ->
+ Stk = erlang:get_stacktrace(),
+ Reason = {Reason0,Stk},
+ set_loc(Stk),
+ Line = get_loc(),
+ FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase crashed!\n"
+ "\tLocation: ~s\n\tReason: ~p\n",
+ [FormattedLoc,Reason]},
+ {skip,{failed,{Mod,init_per_testcase,Reason}}}
+ end.
+
end_per_testcase(Mod, Func, Conf) ->
case erlang:function_exported(Mod,end_per_testcase,2) of
true ->
@@ -1375,57 +1380,79 @@ end_per_testcase(Mod, Func, Conf) ->
do_end_per_testcase(Mod,EndFunc,Func,Conf) ->
put(test_server_init_or_end_conf,{EndFunc,Func}),
put(test_server_loc, {Mod,{EndFunc,Func}}),
- case catch my_apply(Mod, EndFunc, [Func,Conf]) of
- {'$test_server_ok',SaveCfg={save_config,_}} ->
+ try Mod:EndFunc(Func, Conf) of
+ {save_config,_}=SaveCfg ->
SaveCfg;
- {'$test_server_ok',{fail,_}=Fail} ->
+ {fail,_}=Fail ->
Fail;
- {'$test_server_ok',_} ->
- ok;
- {'EXIT',Reason} = Why ->
+ _ ->
+ ok
+ catch
+ throw:Other ->
+ set_loc(erlang:get_stacktrace()),
comment(io_lib:format("<font color=\"red\">"
- "WARNING: ~w crashed!"
+ "WARNING: ~w thrown!"
"</font>\n",[EndFunc])),
group_leader() ! {printout,12,
- "WARNING: ~w crashed!\n"
+ "WARNING: ~w thrown!\n"
"Reason: ~p\n"
"Line: ~s\n",
- [EndFunc, Reason,
+ [EndFunc, Other,
test_server_sup:format_loc(
mod_loc(get_loc()))]},
- {failed,{Mod,end_per_testcase,Why}};
- Other ->
+ {failed,{Mod,end_per_testcase,Other}};
+ Class:Reason ->
+ Stk = erlang:get_stacktrace(),
+ set_loc(Stk),
+ Why = case Class of
+ exit -> {'EXIT',Reason};
+ error -> {'EXIT',{Reason,Stk}}
+ end,
comment(io_lib:format("<font color=\"red\">"
- "WARNING: ~w thrown!"
+ "WARNING: ~w crashed!"
"</font>\n",[EndFunc])),
group_leader() ! {printout,12,
- "WARNING: ~w thrown!\n"
+ "WARNING: ~w crashed!\n"
"Reason: ~p\n"
"Line: ~s\n",
- [EndFunc, Other,
+ [EndFunc, Reason,
test_server_sup:format_loc(
mod_loc(get_loc()))]},
- {failed,{Mod,end_per_testcase,Other}}
+ {failed,{Mod,end_per_testcase,Why}}
end.
get_loc() ->
- case catch test_server_line:get_lines() of
- [] ->
- get(test_server_loc);
- {'EXIT',_} ->
- get(test_server_loc);
- Loc ->
- Loc
- end.
+ get(test_server_loc).
get_loc(Pid) ->
- {dictionary,Dict} = process_info(Pid, dictionary),
- lists:foreach(fun({Key,Val}) -> put(Key,Val) end,Dict),
+ [{current_stacktrace,Stk0},{dictionary,Dict}] =
+ process_info(Pid, [current_stacktrace,dictionary]),
+ lists:foreach(fun({Key,Val}) -> put(Key, Val) end, Dict),
+ Stk = [rewrite_loc_item(Loc) || Loc <- Stk0],
+ put(test_server_loc, Stk),
get_loc().
-get_mf([{M,F,_}|_]) -> {M,F};
-get_mf([{M,F}|_]) -> {M,F};
-get_mf(_) -> {undefined,undefined}.
+%% find the latest known Suite:Testcase
+get_mf(MFs) ->
+ get_mf(MFs, {undefined,undefined}).
+
+get_mf([MF|MFs], Found) when is_tuple(MF) ->
+ ModFunc = {Mod,_} = case MF of
+ {M,F,_} -> {M,F};
+ MF -> MF
+ end,
+ case is_suite(Mod) of
+ true -> ModFunc;
+ false -> get_mf(MFs, ModFunc)
+ end;
+get_mf(_, Found) ->
+ Found.
+
+is_suite(Mod) ->
+ case lists:reverse(atom_to_list(Mod)) of
+ "ETIUS" ++ _ -> true;
+ _ -> false
+ end.
mod_loc(Loc) ->
%% handle diff line num versions
@@ -1498,16 +1525,22 @@ lookup_config(Key,Config) ->
%% timer:tc/3
ts_tc(M, F, A) ->
Before = erlang:now(),
- Val = (catch my_apply(M, F, A)),
+ Result = try
+ apply(M, F, A)
+ catch
+ Type:Reason ->
+ Stk = erlang:get_stacktrace(),
+ set_loc(Stk),
+ case Type of
+ throw ->
+ {failed,{thrown,Reason}};
+ error ->
+ {'EXIT',{Reason,Stk}};
+ exit ->
+ {'EXIT',Reason}
+ end
+ end,
After = erlang:now(),
- Result = case Val of
- {'$test_server_ok', R} ->
- R; % test case ok
- {'EXIT',_Reason} = R ->
- R; % test case crashed
- Other ->
- {failed, {thrown,Other}} % test case was thrown
- end,
Elapsed =
(element(1,After)*1000000000000
+element(2,After)*1000000+element(3,After)) -
@@ -1515,8 +1548,12 @@ ts_tc(M, F, A) ->
+element(2,Before)*1000000+element(3,Before)),
{Elapsed, Result}.
-my_apply(M, F, A) ->
- {'$test_server_ok',apply(M, F, A)}.
+set_loc(Stk) ->
+ Loc = [rewrite_loc_item(I) || {_,_,_,_}=I <- Stk],
+ put(test_server_loc, Loc).
+
+rewrite_loc_item({M,F,_,Loc}) ->
+ {M,F,proplists:get_value(line, Loc, 0)}.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/test_server/src/test_server_line.erl b/lib/test_server/src/test_server_line.erl
deleted file mode 100644
index 848a9c23dd..0000000000
--- a/lib/test_server/src/test_server_line.erl
+++ /dev/null
@@ -1,387 +0,0 @@
-%%
-%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
-%%
-%% The contents of this file are subject to the Erlang Public License,
-%% Version 1.1, (the "License"); you may not use this file except in
-%% compliance with the License. You should have received a copy of the
-%% Erlang Public License along with this software. If not, it can be
-%% retrieved online at http://www.erlang.org/.
-%%
-%% Software distributed under the License is distributed on an "AS IS"
-%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-%% the License for the specific language governing rights and limitations
-%% under the License.
-%%
-%% %CopyrightEnd%
-%%
--module(test_server_line).
-
-%% User interface
--export([get_lines/0]).
--export([clear/0]).
-
-%% Parse transform functions
--export([parse_transform/2]).
--export(['$test_server_line'/3]).
--export(['$test_server_lineQ'/3]).
--export([trace_line/3]).
-
--define(TEST_SERVER_LINE_SIZE, 10).
-%-define(STORAGE_FUNCTION, '$test_server_line').
--define(STORAGE_FUNCTION, '$test_server_lineQ').
-
--include("test_server.hrl").
-
--record(vars, {module, % atom() Module name
- function, % atom() Function name
- arity, % int() Function arity
- lines, % [int()] seen lines
- is_guard=false, % boolean()
- no_lines=[], % [{atom(),integer()}]
- % Functions to exclude
- line_trace=false
- }).
-
-
-
-
-%% Process dictionary littering variant
-%%
-
-'$test_server_line'(Mod, Func, Line) ->
- {Prev,Next} =
- case get('$test_server_line') of
- I when is_integer(I) ->
- if 1 =< I, I < ?TEST_SERVER_LINE_SIZE -> {I,I+1};
- true -> {?TEST_SERVER_LINE_SIZE,1}
- end;
- _ -> {?TEST_SERVER_LINE_SIZE,1}
- end,
- PrevTag = {'$test_server_line',Prev},
- case get(PrevTag) of
- {Mod,Func,_} -> put(PrevTag, {Mod,Func,Line});
- _ ->
- put({'$test_server_line',Next}, {Mod,Func,Line}),
- put('$test_server_line', Next)
- end, ok.
-
-test_server_line_get() ->
- case get('$test_server_line') of
- I when is_integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
- test_server_line_get_1(?TEST_SERVER_LINE_SIZE, I, []);
- _ -> []
- end.
-
-test_server_line_get_1(0, _I, R) ->
- R;
-test_server_line_get_1(Cnt, I, R) ->
- J = if I < ?TEST_SERVER_LINE_SIZE -> I+1;
- true -> 1 end,
- case get({'$test_server_line',J}) of
- undefined ->
- %% Less than ?TEST_SERVER_LINE_SIZE number of lines stored
- %% Start from line 1 and stop at actutual number of lines
- case get({'$test_server_line',1}) of
- undefined -> R; % no lines at all stored
- E -> test_server_line_get_1(I-1,1,[E|R])
- end;
- E ->
- test_server_line_get_1(Cnt-1, J, [E|R])
- end.
-
-test_server_line_clear() ->
- Is = lists:seq(1,?TEST_SERVER_LINE_SIZE),
- lists:foreach(fun (I) -> erase({'$test_server_line',I}) end, Is),
- erase('$test_server_line'),
- ok.
-
-
-%% Queue variant, uses just one process dictionary entry
-%%
-
-'$test_server_lineQ'(Mod, Func, Line) ->
- case get('$test_server_lineQ') of
- {I,Q} when is_integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
- case queue:head(Q) of
- {Mod,Func,_} ->
- %% Replace queue head
- put('$test_server_lineQ',
- {I,queue:cons({Mod,Func,Line}, queue:tail(Q))});
- _ when I < ?TEST_SERVER_LINE_SIZE ->
- put('$test_server_lineQ',
- {I+1,queue:cons({Mod,Func,Line}, Q)});
- _ ->
- %% Waste last in queue
- put('$test_server_lineQ',
- {I,queue:cons({Mod,Func,Line}, queue:lait(Q))})
- end;
- _ ->
- Q = queue:new(),
- put('$test_server_lineQ', {1,queue:cons({Mod,Func,Line}, Q)})
- end, ok.
-
-%test_server_lineQ_get() ->
-% case get('$test_server_lineQ') of
-% {I,Q} when integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
-% queue:to_list(Q);
-% _ -> []
-% end.
-
-test_server_lineQ_clear() ->
- erase('$test_server_lineQ'),
- ok.
-
-
-%% Get line - check if queue or dictionary is used, then get the lines
-%%
-
-get_lines() ->
- case get('$test_server_lineQ') of
- {I,Q} when is_integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
- queue:to_list(Q);
- _ ->
- test_server_line_get()
- end.
-
-%% Clear all dictionary entries
-%%
-clear() ->
- test_server_line_clear(),
- test_server_lineQ_clear().
-
-
-trace_line(Mod,Func,Line) ->
- io:format(lists:concat([Mod,":",Func,",",integer_to_list(Line),": ~p"]),
- [erlang:now()]).
-
-
-%%%=================================================================
-%%%========= **** PARSE TRANSFORM **** ========================
-%%%=================================================================
-parse_transform(Forms, _Options) ->
- transform(Forms, _Options).
-
-%% forms(Fs) -> lists:map(fun (F) -> form(F) end, Fs).
-
-transform(Forms, _Options)->
- Vars0 = #vars{},
- {ok, MungedForms, _Vars} = transform(Forms, [], Vars0),
- MungedForms.
-
-
-transform([Form|Forms], MungedForms, Vars) ->
- case munge(Form, Vars) of
- ignore ->
- transform(Forms, MungedForms, Vars);
- {MungedForm, Vars2} ->
- transform(Forms, [MungedForm|MungedForms], Vars2)
- end;
-transform([], MungedForms, Vars) ->
- {ok, lists:reverse(MungedForms), Vars}.
-
-%% This code traverses the abstract code, stored as the abstract_code
-%% chunk in the BEAM file, as described in absform(3) for Erlang/OTP R8B
-%% (Vsn=abstract_v2).
-%% The abstract format after preprocessing differs slightly from the abstract
-%% format given eg using epp:parse_form, this has been noted in comments.
-munge(Form={attribute,_,module,Module}, Vars) ->
- Vars2 = Vars#vars{module=Module},
- {Form, Vars2};
-
-munge(Form={attribute,_,no_lines,Funcs}, Vars) ->
- Vars2 = Vars#vars{no_lines=Funcs},
- {Form, Vars2};
-
-munge(Form={attribute,_,line_trace,_}, Vars) ->
- Vars2 = Vars#vars{line_trace=true},
- {Form, Vars2};
-
-munge({function,0,module_info,_Arity,_Clauses}, _Vars) ->
- ignore; % module_info will be added again when the forms are recompiled
-munge(Form = {function,Line,Function,Arity,Clauses}, Vars) ->
- case lists:member({Function,Arity},Vars#vars.no_lines) of
- true ->
- %% Line numbers in this function shall not be stored
- {Form,Vars};
- false ->
- Vars2 = Vars#vars{function=Function,
- arity=Arity,
- lines=[]},
- {MungedClauses, Vars3} = munge_clauses(Clauses, Vars2, []),
- {{function,Line,Function,Arity,MungedClauses}, Vars3}
- end;
-munge(Form, Vars) -> % attributes
- {Form, Vars}.
-
-munge_clauses([{clause,Line,Pattern,Guards,Body}|Clauses], Vars, MClauses) ->
- {MungedGuards, _Vars} = munge_exprs(Guards, Vars#vars{is_guard=true},[]),
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- munge_clauses(Clauses, Vars2,
- [{clause,Line,Pattern,MungedGuards,MungedBody}|
- MClauses]);
-munge_clauses([], Vars, MungedClauses) ->
- {lists:reverse(MungedClauses), Vars}.
-
-munge_body([Expr|Body], Vars, MungedBody) ->
- %% Here is the place to add a call to storage function!
- Line = element(2, Expr),
- Lines = Vars#vars.lines,
- case lists:member(Line,Lines) of
- true -> % already a bump at this line!
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_body(Body, Vars2, [MungedExpr|MungedBody]);
- false ->
- Bump = {call, 0, {remote,0,
- {atom,0,?MODULE},
- {atom,0,?STORAGE_FUNCTION}},
- [{atom,0,Vars#vars.module},
- {atom, 0, Vars#vars.function},
- {integer, 0, Line}]},
- Lines2 = [Line|Lines],
-
- {MungedExpr, Vars2} = munge_expr(Expr, Vars#vars{lines=Lines2}),
- MungedBody2 =
- if Vars#vars.line_trace ->
- LineTrace = {call, 0, {remote,0,
- {atom,0,?MODULE},
- {atom,0,trace_line}},
- [{atom,0,Vars#vars.module},
- {atom, 0, Vars#vars.function},
- {integer, 0, Line}]},
- [MungedExpr,LineTrace,Bump|MungedBody];
- true ->
- [MungedExpr,Bump|MungedBody]
- end,
- munge_body(Body, Vars2, MungedBody2)
- end;
-munge_body([], Vars, MungedBody) ->
- {lists:reverse(MungedBody), Vars}.
-
-munge_expr({match,Line,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{match,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({tuple,Line,Exprs}, Vars) ->
- {MungedExprs, Vars2} = munge_exprs(Exprs, Vars, []),
- {{tuple,Line,MungedExprs}, Vars2};
-munge_expr({record,Line,Expr,Exprs}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprName, Vars2} = munge_expr(Expr, Vars),
- {MungedExprFields, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{record,Line,MungedExprName,MungedExprFields}, Vars3};
-munge_expr({record_field,Line,ExprL,ExprR}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{record_field,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({cons,Line,ExprH,ExprT}, Vars) ->
- {MungedExprH, Vars2} = munge_expr(ExprH, Vars),
- {MungedExprT, Vars3} = munge_expr(ExprT, Vars2),
- {{cons,Line,MungedExprH,MungedExprT}, Vars3};
-munge_expr({op,Line,Op,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{op,Line,Op,MungedExprL,MungedExprR}, Vars3};
-munge_expr({op,Line,Op,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{op,Line,Op,MungedExpr}, Vars2};
-munge_expr({'catch',Line,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{'catch',Line,MungedExpr}, Vars2};
-munge_expr({call,Line1,{remote,Line2,ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==false->
- {MungedExprM, Vars2} = munge_expr(ExprM, Vars),
- {MungedExprF, Vars3} = munge_expr(ExprF, Vars2),
- {MungedExprs, Vars4} = munge_exprs(Exprs, Vars3, []),
- {{call,Line1,{remote,Line2,MungedExprM,MungedExprF},MungedExprs}, Vars4};
-munge_expr({call,Line1,{remote,_Line2,_ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==true ->
- %% Difference in abstract format after preprocessing: BIF calls in guards
- %% are translated to {remote,...} (which is not allowed as source form)
- %% NOT NECESSARY FOR Vsn=raw_abstract_v1
- munge_expr({call,Line1,ExprF,Exprs}, Vars);
-munge_expr({call,Line,Expr,Exprs}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedExprs, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{call,Line,MungedExpr,MungedExprs}, Vars3};
-munge_expr({lc,Line,Expr,LC}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedLC, Vars3} = munge_lc(LC, Vars2, []),
- {{lc,Line,MungedExpr,MungedLC}, Vars3};
-munge_expr({block,Line,Body}, Vars) ->
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- {{block,Line,MungedBody}, Vars2};
-munge_expr({'if',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'if',Line,MungedClauses}, Vars2};
-munge_expr({'case',Line,Expr,Clauses}, Vars) ->
- {MungedExpr,Vars2} = munge_expr(Expr,Vars),
- {MungedClauses,Vars3} = munge_clauses(Clauses, Vars2, []),
- {{'case',Line,MungedExpr,MungedClauses}, Vars3};
-munge_expr({'receive',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'receive',Line,MungedClauses}, Vars2};
-munge_expr({'receive',Line,Clauses,Expr,Body}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {MungedExpr, Vars3} = munge_expr(Expr, Vars2),
- {MungedBody, Vars4} = munge_body(Body, Vars3, []),
- {{'receive',Line,MungedClauses,MungedExpr,MungedBody}, Vars4};
-munge_expr({'try',Line,Exprs,Clauses,CatchClauses,After}, Vars) ->
- {MungedExprs, Vars1} = munge_exprs(Exprs, Vars, []),
- {MungedClauses, Vars2} = munge_clauses(Clauses, Vars1, []),
- {MungedCatchClauses, Vars3} = munge_clauses(CatchClauses, Vars2, []),
- {MungedAfter, Vars4} = munge_body(After, Vars3, []),
- {{'try',Line,MungedExprs,MungedClauses,MungedCatchClauses,MungedAfter},
- Vars4};
-%% Difference in abstract format after preprocessing: Funs get an extra
-%% element Extra.
-%% NOT NECESSARY FOR Vsn=raw_abstract_v1
-munge_expr({'fun',Line,{function,Name,Arity},_Extra}, Vars) ->
- {{'fun',Line,{function,Name,Arity}}, Vars};
-munge_expr({'fun',Line,{clauses,Clauses},_Extra}, Vars) ->
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr({'fun',Line,{clauses,Clauses}}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr({bc,Line,Expr,LC}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedLC, Vars3} = munge_lc(LC, Vars2, []),
- {{bc,Line,MungedExpr,MungedLC}, Vars3};
-munge_expr(Form, Vars) -> % var|char|integer|float|string|atom|nil|bin|eof
- {Form, Vars}.
-
-munge_exprs([Expr|Exprs], Vars, MungedExprs) when Vars#vars.is_guard==true,
- is_list(Expr) ->
- {MungedExpr, _Vars} = munge_exprs(Expr, Vars, []),
- munge_exprs(Exprs, Vars, [MungedExpr|MungedExprs]);
-munge_exprs([Expr|Exprs], Vars, MungedExprs) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_exprs(Exprs, Vars2, [MungedExpr|MungedExprs]);
-munge_exprs([], Vars, MungedExprs) ->
- {lists:reverse(MungedExprs), Vars}.
-
-munge_lc([{generate,Line,Pattern,Expr}|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [{generate,Line,Pattern,MungedExpr}|MungedLC]);
-munge_lc([{b_generate,Line,Pattern,Expr}|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [{b_generate,Line,Pattern,MungedExpr}|MungedLC]);
-munge_lc([Expr|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [MungedExpr|MungedLC]);
-munge_lc([], Vars, MungedLC) ->
- {lists:reverse(MungedLC), Vars}.
-
-
-
-
-
-
-
-
-
-
diff --git a/lib/test_server/src/test_server_sup.erl b/lib/test_server/src/test_server_sup.erl
index 53dfb45e3a..ec9be52bd3 100644
--- a/lib/test_server/src/test_server_sup.erl
+++ b/lib/test_server/src/test_server_sup.erl
@@ -51,18 +51,19 @@ timetrap(Timeout0, Scale, Pid) ->
Timeout = if not Scale -> Timeout0;
true -> test_server:timetrap_scale_factor() * Timeout0
end,
+ TruncTO = trunc(Timeout),
receive
- after trunc(Timeout) ->
- Line = test_server:get_loc(Pid),
+ after TruncTO ->
+ MFLs = test_server:get_loc(Pid),
Mon = erlang:monitor(process, Pid),
Trap =
case get(test_server_init_or_end_conf) of
undefined ->
- {timetrap_timeout,trunc(Timeout),Line};
+ {timetrap_timeout,TruncTO,MFLs};
InitOrEnd ->
- {timetrap_timeout,trunc(Timeout),Line,InitOrEnd}
+ {timetrap_timeout,TruncTO,MFLs,InitOrEnd}
end,
- exit(Pid,Trap),
+ exit(Pid, Trap),
receive
{'DOWN', Mon, process, Pid, _} ->
ok
diff --git a/lib/test_server/src/ts_install_cth.erl b/lib/test_server/src/ts_install_cth.erl
index c5444a342f..a41916fd0a 100644
--- a/lib/test_server/src/ts_install_cth.erl
+++ b/lib/test_server/src/ts_install_cth.erl
@@ -49,8 +49,7 @@
-include_lib("kernel/include/file.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -65,19 +64,19 @@ id(_Opts) ->
?MODULE.
%% @doc Always called before any other callback function.
--spec init(Id :: term(), Opts :: proplist()) ->
- State :: #state{}.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
init(_Id, Opts) ->
Nodenames = proplists:get_value(nodenames, Opts, 0),
Nodes = proplists:get_value(nodes, Opts, 0),
TSConfDir = proplists:get_value(ts_conf_dir, Opts),
TargetSystem = proplists:get_value(target_system, Opts, install_local),
InstallOpts = proplists:get_value(install_opts, Opts, []),
- #state{ nodenames = Nodenames,
- nodes = Nodes,
- ts_conf_dir = TSConfDir,
- target_system = TargetSystem,
- install_opts = InstallOpts }.
+ {ok, #state{ nodenames = Nodenames,
+ nodes = Nodes,
+ ts_conf_dir = TSConfDir,
+ target_system = TargetSystem,
+ install_opts = InstallOpts } }.
%% @doc Called before init_per_suite is called.
-spec pre_init_per_suite(Suite :: atom(),
diff --git a/lib/test_server/test/Makefile b/lib/test_server/test/Makefile
index ab72a9d579..198440bb17 100644
--- a/lib/test_server/test/Makefile
+++ b/lib/test_server/test/Makefile
@@ -85,7 +85,7 @@ release_spec: opt
release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(EMAKEFILE) $(ERL_FILES) $(COVERFILE) $(RELSYSDIR)
- $(INSTALL_DATA) test_server.spec test_server.cover $(RELSYSDIR)
+ $(INSTALL_DATA) test_server_test_lib.hrl test_server.spec test_server.cover $(RELSYSDIR)
chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
diff --git a/lib/tools/emacs/erlang.el b/lib/tools/emacs/erlang.el
index 6728bef2a4..a8dd3ec3ac 100644
--- a/lib/tools/emacs/erlang.el
+++ b/lib/tools/emacs/erlang.el
@@ -523,6 +523,32 @@ This is an elisp list of options. Each option can be either:
- a string
Example: '(bin_opt_info (i . \"/path1/include\") (i . \"/path2/include\"))")
+(defvar erlang-compile-command-function-alist
+ '((".erl\\'" . inferior-erlang-compute-erl-compile-command)
+ (".xrl\\'" . inferior-erlang-compute-leex-compile-command)
+ (".yrl\\'" . inferior-erlang-compute-yecc-compile-command)
+ ("." . inferior-erlang-compute-erl-compile-command))
+ "*Alist of filename patterns vs corresponding compilation functions.
+Each element looks like (REGEXP . FUNCTION). Compiling a file whose name
+matches REGEXP specifies FUNCTION to use to compute the compilation
+command. The FUNCTION will be called with two arguments: module name and
+default compilation options, like output directory. The FUNCTION
+is expected to return a string.")
+
+(defvar erlang-leex-compile-opts '()
+ "*Options to pass to leex when compiling xrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
+(defvar erlang-yecc-compile-opts '()
+ "*Options to pass to yecc when compiling yrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
(eval-and-compile
(defvar erlang-regexp-modern-p
(if (> erlang-emacs-major-version 21) t nil)
@@ -5276,6 +5302,22 @@ unless the optional NO-DISPLAY is non-nil."
(file-name-as-directory buffer-dir))))
(defun inferior-erlang-compute-compile-command (module-name opts)
+ (let ((ccfn erlang-compile-command-function-alist)
+ (res (inferior-erlang-compute-erl-compile-command module-name opts))
+ ccfn-entry
+ done)
+ (if (not (null (buffer-file-name)))
+ (while (and (not done) (not (null ccfn)))
+ (setq ccfn-entry (car ccfn))
+ (setq ccfn (cdr ccfn))
+ (if (string-match (car ccfn-entry) (buffer-file-name))
+ (let ((c-fn (cdr ccfn-entry)))
+ (setq done t)
+ (if (not (null c-fn))
+ (setq result (funcall c-fn module-name opts)))))))
+ result))
+
+(defun inferior-erlang-compute-erl-compile-command (module-name opts)
(let* ((out-dir-opt (assoc 'outdir opts))
(out-dir (cdr out-dir-opt)))
(if erlang-compile-use-outdir
@@ -5299,6 +5341,48 @@ unless the optional NO-DISPLAY is non-nil."
(remq out-dir-opt opts))
tmpvar tmpvar tmpvar2)))))
+(defun inferior-erlang-compute-leex-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(LErr1__), f(LErr2__), "
+ "case case leex:file(\"%s\", [%s]) of"
+ " ok -> ok;"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " LErr1__ -> LErr1__ "
+ "end of"
+ " ok -> %s;"
+ " LErr2__ -> LErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-leex-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-compute-yecc-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(YErr1__), f(YErr2__), "
+ "case case yecc:file(\"%s\", [%s]) of"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " YErr1__ -> YErr1__ "
+ "end of"
+ " ok -> %s;"
+ " YErr2__ -> YErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-yecc-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-remove-any-trailing-dot (str)
+ (if (string= (substring str -1) ".")
+ (substring str 0 (1- (length str)))
+ str))
+
(defun inferior-erlang-format-comma-opts (opts)
(if (null opts)
""
diff --git a/lib/tv/src/tv_main.erl b/lib/tv/src/tv_main.erl
index 2f743c2397..283ba4c967 100644
--- a/lib/tv/src/tv_main.erl
+++ b/lib/tv/src/tv_main.erl
@@ -312,7 +312,7 @@ analyze_error(Cause, Node, Table) ->
handle_error(mnesia_not_started, Node, Table);
{badrpc, {'EXIT', {aborted, {node_not_running,_ErrNode}}}} ->
handle_error(mnesia_not_started, Node, Table);
- {'EXIT', {undef, {mnesia,_Fcn,_Args}}} ->
+ {'EXIT', {undef, {mnesia,_Fcn,_Args,_}}} ->
handle_error(mnesia_not_started, Node, Table);
{'EXIT', Reason} ->
diff --git a/lib/tv/src/tv_mnesia_rpc.erl b/lib/tv/src/tv_mnesia_rpc.erl
index a2385714ec..4a75994145 100644
--- a/lib/tv/src/tv_mnesia_rpc.erl
+++ b/lib/tv/src/tv_mnesia_rpc.erl
@@ -87,6 +87,8 @@ chk(Result) ->
throw(mnesia_not_started);
{badrpc, _Reason} ->
throw(mnesia_not_started);
+ {'EXIT', {undef, {mnesia,_Fcn,_Args,_}}} ->
+ throw(mnesia_not_started);
{'EXIT', {undef, {mnesia,_Fcn,_Args}}} ->
throw(mnesia_not_started);
diff --git a/lib/webtool/priv/Makefile b/lib/webtool/priv/Makefile
index 56ab772c45..6e1c6606fe 100644
--- a/lib/webtool/priv/Makefile
+++ b/lib/webtool/priv/Makefile
@@ -39,8 +39,12 @@ HTDOCS_FILES = root/doc/index.html \
root/doc/tool_management.html \
root/doc/start_info.html
-SCRIPTS = bin/start_webtool \
- bin/start_webtool.bat
+ifeq ($(findstring win32,$(TARGET)),win32)
+WIN32_SCRIPTS= bin/start_webtool.bat
+else
+WIN32_SCRIPTS=
+endif
+SCRIPTS = bin/start_webtool $(WIN32_SCRIPTS)
# ----------------------------------------------------
# FLAGS
diff --git a/lib/wx/src/wx_object.erl b/lib/wx/src/wx_object.erl
index bfd38960dd..82c4cfbad5 100644
--- a/lib/wx/src/wx_object.erl
+++ b/lib/wx/src/wx_object.erl
@@ -537,16 +537,16 @@ error_info(_Reason, application_controller, _Msg, _State, _Debug) ->
error_info(Reason, Name, Msg, State, Debug) ->
Reason1 =
case Reason of
- {undef,[{M,F,A}|MFAs]} ->
+ {undef,[{M,F,A,L}|MFAs]} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
Reason;
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
_ ->
diff --git a/lib/wx/test/wxt.erl b/lib/wx/test/wxt.erl
index 1f5b1cc3b1..2f52c58f26 100644
--- a/lib/wx/test/wxt.erl
+++ b/lib/wx/test/wxt.erl
@@ -72,7 +72,7 @@ resolve({Suite0, Case}) when is_atom(Suite0), is_atom(Case) ->
{Suite, Case2} ->
{Suite, Case2}
end;
-resolve(List) when list(List) ->
+resolve(List) when is_list(List) ->
[resolve(Case) || Case <- List].
alias(Suite) when is_atom(Suite) ->
@@ -104,7 +104,7 @@ read_config() ->
end.
%% Write new default config file
-write_config(Config) when list(Config) ->
+write_config(Config) when is_list(Config) ->
Fname = config_fname(),
{ok, Fd} = file:open(Fname, write),
write_list(Fd, Config),
diff --git a/lib/xmerl/include/xmerl_xsd.hrl b/lib/xmerl/include/xmerl_xsd.hrl
index b527accc8c..6dad7d8ff0 100644
--- a/lib/xmerl/include/xmerl_xsd.hrl
+++ b/lib/xmerl/include/xmerl_xsd.hrl
@@ -36,6 +36,7 @@
schema_name,
vsn,
schema_preprocessed=false,
+ external_xsd_base=false,
xsd_base,
xml_options=[],
scope=[],
diff --git a/lib/xmerl/src/xmerl.erl b/lib/xmerl/src/xmerl.erl
index cf78f7bdf7..2332517988 100644
--- a/lib/xmerl/src/xmerl.erl
+++ b/lib/xmerl/src/xmerl.erl
@@ -307,7 +307,7 @@ apply_cb(Ms, F, Df, Args) ->
apply_cb([M|Ms], F, Df, Args, Ms0) ->
case catch apply(M, F, Args) of
- {'EXIT', {undef,[{M,F,_}|_]}} ->
+ {'EXIT', {undef,[{M,F,_,_}|_]}} ->
apply_cb(Ms, F, Df, Args, Ms0);
{'EXIT', Reason} ->
exit(Reason);
diff --git a/lib/xmerl/src/xmerl_scan.erl b/lib/xmerl/src/xmerl_scan.erl
index 059c8f21b6..e598c5f56d 100644
--- a/lib/xmerl/src/xmerl_scan.erl
+++ b/lib/xmerl/src/xmerl_scan.erl
@@ -2276,7 +2276,7 @@ scan_att_chars([H|T], S0, H, Acc, TmpAcc,AttType,IsNorm) -> % End quote
true ->
normalize(Acc,S,IsNorm)
end,
- {lists:reverse(Acc2), T, S2,IsNorm2};
+ {lists:flatten(lists:reverse(Acc2)), T, S2,IsNorm2};
scan_att_chars("&" ++ T, S0, Delim, Acc, TmpAcc,AT,IsNorm) -> % Reference
?bump_col(1),
{ExpRef, T1, S1} = scan_reference(T, S),
diff --git a/lib/xmerl/src/xmerl_xsd.erl b/lib/xmerl/src/xmerl_xsd.erl
index e56f1470c0..f003cc74ba 100644
--- a/lib/xmerl/src/xmerl_xsd.erl
+++ b/lib/xmerl/src/xmerl_xsd.erl
@@ -287,10 +287,19 @@ process_schema(Schema) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schema(Schema,Options) when is_list(Options) ->
- S = initiate_state(Options,Schema),
- process_schema2(xmerl_scan:file(filename:join(S#xsd_state.xsd_base, Schema)),S,Schema);
-process_schema(Schema,State) when is_record(State,xsd_state) ->
- process_schema2(xmerl_scan:file(filename:join(State#xsd_state.xsd_base, Schema)),State,Schema).
+ State = initiate_state(Options,Schema),
+ process_schema(Schema, State);
+process_schema(Schema, State=#xsd_state{fetch_fun=Fetch})->
+ case Fetch(Schema, State) of
+ {ok,{file,File},_} ->
+ process_schema2(xmerl_scan:file(File), State, Schema);
+ {ok,{string,Str},_} ->
+ process_schema2(xmerl_scan:string(Str), State, Schema);
+ {ok,[],_} ->
+ {error,enoent};
+ Err ->
+ Err
+ end.
process_schema2(Err={error,_},_,_) ->
Err;
@@ -319,12 +328,9 @@ process_schemas(Schemas) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schemas(Schemas=[{_,Schema}|_],Options) when is_list(Options) ->
- process_schemas(Schemas,initiate_state(Options,Schema));
+ State = initiate_state(Options,Schema),
+ process_schemas(Schemas, State);
process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
-%% case process_external_schema_once(Schema,if_list_to_atom(NS),State) of
-%% S when is_record(S,xsd_state) ->
-%% case process_schema(filename:join([State#xsd_state.xsd_base,Schema]),State) of
-%% {ok,S} ->
Res=
case Fetch(Schema,State) of
{ok,{file,File},_} ->
@@ -345,20 +351,20 @@ process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
process_schemas([],S) when is_record(S,xsd_state) ->
{ok,S}.
-
initiate_state(Opts,Schema) ->
XSDBase = filename:dirname(Schema),
{{state,S},RestOpts}=new_state(Opts),
S2 = create_tables(S),
- initiate_state2(S2#xsd_state{schema_name = Schema,
- xsd_base = XSDBase,
- fetch_fun = fun fetch/2},RestOpts).
+ S3 = initiate_state2(S2#xsd_state{schema_name = Schema, xsd_base=XSDBase,
+ fetch_fun = fun fetch/2},
+ RestOpts).
+
initiate_state2(S,[]) ->
S;
initiate_state2(S,[{tab2file,Bool}|T]) ->
initiate_state2(S#xsd_state{tab2file=Bool},T);
-initiate_state2(S,[{xsdbase,XSDBase}|T]) ->
- initiate_state2(S#xsd_state{xsd_base=XSDBase},T);
+initiate_state2(S,[{xsdbase, XSDBase}|T]) ->
+ initiate_state2(S#xsd_state{xsd_base=XSDBase, external_xsd_base=true},T);
initiate_state2(S,[{fetch_fun,FetchFun}|T]) ->
initiate_state2(S#xsd_state{fetch_fun=FetchFun},T);
initiate_state2(S,[{fetch_path,FetchPath}|T]) ->
@@ -5232,7 +5238,12 @@ fetch(URI,S) ->
[] -> %% empty systemliteral
[];
_ ->
- filename:join(S#xsd_state.xsd_base, URI)
+ case S#xsd_state.external_xsd_base of
+ true ->
+ filename:join(S#xsd_state.xsd_base, URI);
+ false ->
+ filename:join(S#xsd_state.xsd_base, filename:basename(URI))
+ end
end,
Path = path_locate(S#xsd_state.fetch_path, Filename, Fullname),
?dbg("fetch(~p) -> {file, ~p}.~n", [URI, Path]),
diff --git a/lib/xmerl/test/Makefile b/lib/xmerl/test/Makefile
index 9715aa054a..5a2a585841 100644
--- a/lib/xmerl/test/Makefile
+++ b/lib/xmerl/test/Makefile
@@ -124,4 +124,4 @@ release_tests_spec: opt
@tar cfh - xmerl_xsd_MS2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_NIST2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_Sun2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/xmerl/test/xmerl_SUITE.erl b/lib/xmerl/test/xmerl_SUITE.erl
index 392b2522e8..0c809dbcb6 100644
--- a/lib/xmerl/test/xmerl_SUITE.erl
+++ b/lib/xmerl/test/xmerl_SUITE.erl
@@ -57,7 +57,8 @@ groups() ->
{eventp_tests, [], [sax_parse_and_export]},
{ticket_tests, [],
[ticket_5998, ticket_7211, ticket_7214, ticket_7430,
- ticket_6873, ticket_7496, ticket_8156, ticket_8697]},
+ ticket_6873, ticket_7496, ticket_8156, ticket_8697,
+ ticket_9411]},
{app_test, [], [{xmerl_app_test, all}]},
{appup_test, [], [{xmerl_appup_test, all}]}].
@@ -575,7 +576,17 @@ ticket_8697(Config) ->
?line [16#545C] = HexEntityText,
ok.
+ticket_9411(suite) -> [];
+ticket_9411(doc) ->
+ ["Test that xmerl_scan handles attribute that contains for example &quot"];
+ticket_9411(Config) ->
+ DataDir = ?config(data_dir,Config),
+ ?line {ok, Schema} = xmerl_xsd:process_schema(filename:join([DataDir,"misc/ticket_9411.xsd"])),
+ ?line {ok, Bin} = file:read_file(filename:join([DataDir,"misc/ticket_9411.xml"])),
+ ?line Xml = erlang:binary_to_list(Bin),
+ ?line {E, _} = xmerl_scan:string(Xml),
+ ?line {E, _} = xmerl_xsd:validate(E, Schema).
diff --git a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
index c48a6f897b..fef7431845 100644
--- a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
+++ b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
Binary files differ
diff --git a/lib/xmerl/test/xmerl_xsd_SUITE.erl b/lib/xmerl/test/xmerl_xsd_SUITE.erl
index a0d3b1e667..421fa48054 100644
--- a/lib/xmerl/test/xmerl_xsd_SUITE.erl
+++ b/lib/xmerl/test/xmerl_xsd_SUITE.erl
@@ -62,7 +62,7 @@ groups() ->
sis2, state2file_file2state, union]},
{ticket_tests, [],
[ticket_6910, ticket_7165, ticket_7190, ticket_7288,
- ticket_7736, ticket_8599]},
+ ticket_7736, ticket_8599, ticket_9410]},
{facets, [],
[length, minLength, maxLength, pattern, enumeration,
whiteSpace, maxInclusive, maxExclusive, minExclusive,
@@ -1146,3 +1146,8 @@ ticket_8599(Config) ->
?line {{xmlElement,persons,persons,_,_,_,_,_,_,_,_,_},_GlobalState} = xmerl_xsd:validate(E, S).
+
+ticket_9410(suite) -> [];
+ticket_9410(Config) ->
+ file:set_cwd(filename:join([?config(data_dir,Config),".."])),
+ ?line {ok, _S} = xmerl_xsd:process_schema("xmerl_xsd_SUITE_data/small.xsd").
diff --git a/make/otp_subdir.mk b/make/otp_subdir.mk
index bfbd9997a1..919eee52fc 100644
--- a/make/otp_subdir.mk
+++ b/make/otp_subdir.mk
@@ -30,7 +30,6 @@ opt debug release docs release_docs tests release_tests clean depend valgrind:
if test -f vsn.mk; then \
echo "=== Entering application" `basename $$app_pwd` ; \
fi ; \
- case "$(MAKE)" in *clearmake*) tflag="-T";; *) tflag="";; esac; \
for d in $(SUB_DIRECTORIES); do \
if test -f $$d/SKIP ; then \
echo "=== Skipping subdir $$d, reason:" ; \
@@ -40,11 +39,7 @@ opt debug release docs release_docs tests release_tests clean depend valgrind:
if test ! -d $$d ; then \
echo "=== Skipping subdir $$d, it is missing" ; \
else \
- xflag="" ; \
- if test -f $$d/ignore_config_record.inf; then \
- xflag=$$tflag ; \
- fi ; \
- (cd $$d && $(MAKE) $$xflag $@) || exit $$? ; \
+ (cd $$d && $(MAKE) $@) || exit $$? ; \
fi ; \
fi ; \
done ; \
diff --git a/system/doc/getting_started/seq_prog.xml b/system/doc/getting_started/seq_prog.xml
index bc1758d855..96876ea513 100644
--- a/system/doc/getting_started/seq_prog.xml
+++ b/system/doc/getting_started/seq_prog.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2003</year><year>2009</year>
+ <year>2003</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -41,9 +41,9 @@
<c>erl</c>, you will see something like this.</p>
<pre>
% <input>erl</input>
-Erlang (BEAM) emulator version 5.2 [source] [hipe]
+Erlang R15B (erts-5.9.1) [source] [smp:8:8] [rq:8] [async-threads:0] [hipe] [kernel-poll:false]
-Eshell V5.2 (abort with ^G)
+Eshell V5.9.1 (abort with ^G)
1></pre>
<p>Now type in "2 + 5." as shown below.</p>
<pre>
@@ -245,7 +245,7 @@ convert(N, centimeter) ->
inch in the convert function:</p>
<pre>
12> <input>tut2:convert(3, miles).</input>
-** exception error: no function clause matching tut2:convert(3,miles)</pre>
+** exception error: no function clause matching tut2:convert(3,miles) (tut2.erl, line 4)</pre>
<p>The two parts of the <c>convert</c> function are called its
clauses. Here we see that "miles" is not part of either of
the clauses. The Erlang system can't <em>match</em> either of
@@ -255,11 +255,13 @@ convert(N, centimeter) ->
command <c>v/1</c>:</p>
<pre>
13> <input>v(12).</input>
-{'EXIT',{function_clause,[{tut2,convert,[3,miles]},
- {erl_eval,do_apply,5},
- {shell,exprs,6},
- {shell,eval_exprs,6},
- {shell,eval_loop,3}]}}</pre>
+{'EXIT',{function_clause,[{tut2,convert,
+ [3,miles],
+ [{file,"tut2.erl"},{line,4}]},
+ {erl_eval,do_apply,5,[{file,"erl_eval.erl"},{line,482}]},
+ {shell,exprs,7,[{file,"shell.erl"},{line,666}]},
+ {shell,eval_exprs,7,[{file,"shell.erl"},{line,621}]},
+ {shell,eval_loop,3,[{file,"shell.erl"},{line,606}]}]}}</pre>
</section>
@@ -943,7 +945,7 @@ A == 1 ; B == 7
a_equals_1_or_b_equals_7
66> <input>tut9:test_if(33, 33).</input>
** exception error: no true branch found when evaluating an if expression
- in function tut9:test_if/2</pre>
+ in function tut9:test_if/2 (tut9.erl, line 5)</pre>
<p>Notice that <c>tut9:test_if(33,33)</c> did not cause any
condition to succeed so we got the run time error
<c>if_clause</c>, here nicely formatted by the shell. See the chapter
diff --git a/system/doc/reference_manual/distributed.xml b/system/doc/reference_manual/distributed.xml
index 52222c6d9d..9c8e88250c 100644
--- a/system/doc/reference_manual/distributed.xml
+++ b/system/doc/reference_manual/distributed.xml
@@ -78,7 +78,7 @@ dilbert@uab</pre>
using the command line flag <c>-connect_all false</c>, see
<c>erl(1)</c>.</p>
<p>If a node goes down, all connections to that node are removed.
- Calling <c>erlang:disconnect(Node)</c> will force disconnection
+ Calling <c>erlang:disconnect_node(Node)</c> will force disconnection
of a node.</p>
<p>The list of (visible) nodes currently connected to is returned by
<c>nodes()</c>.</p>