aboutsummaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
-rw-r--r--INSTALL.md6
-rw-r--r--erts/configure.in19
-rw-r--r--erts/doc/src/erlang.xml62
-rw-r--r--erts/doc/src/erts_alloc.xml14
-rw-r--r--erts/doc/src/zlib.xml60
-rw-r--r--erts/emulator/Makefile.in2
-rw-r--r--erts/emulator/beam/beam_bif_load.c30
-rw-r--r--erts/emulator/beam/beam_emu.c2
-rw-r--r--erts/emulator/beam/beam_load.c181
-rw-r--r--erts/emulator/beam/bif.tab8
-rw-r--r--erts/emulator/beam/erl_alloc.c33
-rw-r--r--erts/emulator/beam/erl_alloc.h8
-rw-r--r--erts/emulator/beam/erl_alloc_util.c9
-rw-r--r--erts/emulator/beam/erl_ao_firstfit_alloc.c972
-rw-r--r--erts/emulator/beam/erl_ao_firstfit_alloc.h60
-rw-r--r--erts/emulator/beam/erl_bestfit_alloc.c1
-rw-r--r--erts/emulator/beam/erl_bits.h2
-rw-r--r--erts/emulator/beam/erl_gc.c40
-rw-r--r--erts/emulator/beam/erl_instrument.c8
-rw-r--r--erts/emulator/beam/erl_nif.c20
-rw-r--r--erts/emulator/beam/erl_process.c7
-rw-r--r--erts/emulator/beam/external.c49
-rw-r--r--erts/emulator/beam/external.h1
-rw-r--r--erts/emulator/beam/ops.tab2
-rw-r--r--erts/emulator/drivers/common/inet_drv.c4
-rw-r--r--erts/emulator/hipe/hipe_mode_switch.c7
-rw-r--r--erts/emulator/test/alloc_SUITE_data/allocator_test.h20
-rw-r--r--erts/emulator/test/alloc_SUITE_data/coalesce.c2
-rw-r--r--erts/emulator/test/alloc_SUITE_data/rbtree.c86
-rw-r--r--erts/emulator/test/binary_SUITE.erl16
-rw-r--r--erts/emulator/test/bs_construct_SUITE.erl17
-rw-r--r--erts/emulator/test/code_SUITE.erl32
-rw-r--r--erts/emulator/test/fun_SUITE.erl10
-rw-r--r--erts/emulator/test/hibernate_SUITE.erl31
-rw-r--r--erts/emulator/test/match_spec_SUITE.erl61
-rw-r--r--erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c46
-rw-r--r--erts/emulator/test/nif_SUITE.erl48
-rw-r--r--erts/emulator/test/nif_SUITE_data/nif_SUITE.c84
-rwxr-xr-xerts/emulator/utils/beam_makeops71
-rw-r--r--erts/epmd/src/epmd.c6
-rw-r--r--erts/epmd/src/epmd_cli.c5
-rw-r--r--erts/epmd/src/epmd_int.h9
-rw-r--r--erts/epmd/src/epmd_srv.c23
-rw-r--r--erts/example/matrix_nif.c85
-rw-r--r--erts/lib_src/common/erl_misc_utils.c8
-rw-r--r--erts/lib_src/common/erl_printf_format.c4
-rw-r--r--erts/preloaded/ebin/zlib.beambin12148 -> 11876 bytes
-rw-r--r--erts/preloaded/src/zlib.erl115
-rw-r--r--erts/test/autoimport_SUITE.erl11
-rw-r--r--erts/test/erlc_SUITE.erl27
-rw-r--r--lib/asn1/doc/src/asn1ct.xml6
-rw-r--r--lib/asn1/src/asn1ct.erl29
-rw-r--r--lib/asn1/src/asn1ct_check.erl50
-rw-r--r--lib/asn1/test/asn1_SUITE.erl.src4
-rw-r--r--lib/asn1/test/test_compile_options.erl39
-rw-r--r--lib/common_test/doc/src/common_test_app.xml2
-rw-r--r--lib/common_test/doc/src/ct_hooks.xml8
-rw-r--r--lib/common_test/doc/src/ct_hooks_chapter.xml19
-rw-r--r--lib/common_test/doc/src/run_test_chapter.xml2
-rw-r--r--lib/common_test/src/ct_framework.erl12
-rw-r--r--lib/common_test/src/ct_hooks.erl143
-rw-r--r--lib/common_test/src/ct_run.erl25
-rw-r--r--lib/common_test/test/ct_hooks_SUITE.erl80
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl62
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl11
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl74
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl2
-rw-r--r--lib/compiler/src/compile.erl50
-rw-r--r--lib/compiler/src/sys_pre_expand.erl6
-rw-r--r--lib/compiler/test/error_SUITE.erl65
-rw-r--r--lib/crypto/c_src/Makefile.in5
-rw-r--r--lib/dialyzer/src/dialyzer_dataflow.erl52
-rw-r--r--lib/dialyzer/src/dialyzer_typesig.erl204
-rw-r--r--lib/dialyzer/test/Makefile2
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/asn12
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/inets43
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/mnesia3
-rw-r--r--lib/dialyzer/test/race_SUITE_data/results/extract_translations4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/common_eunit2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/comparisons153
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/failing_funs20
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/flatten2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl8
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/codec_can.erl35
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl121
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/comparisons.erl322
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl250
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl21
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl42
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl7
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl19
-rw-r--r--lib/diameter/doc/src/diameter_dict.xml9
-rw-r--r--lib/diameter/src/compiler/diameter_codegen.erl78
-rw-r--r--lib/diameter/src/compiler/diameter_spec_util.erl50
-rw-r--r--lib/diameter/test/Makefile2
-rw-r--r--lib/docbuilder/src/docb_gen.erl4
-rw-r--r--lib/docbuilder/src/docb_transform.erl2
-rw-r--r--lib/docbuilder/src/docb_xml_check.erl1
-rw-r--r--lib/docbuilder/vsn.mk2
-rw-r--r--lib/edoc/Makefile2
-rw-r--r--lib/edoc/doc/Makefile2
-rw-r--r--lib/edoc/doc/overview.edoc7
-rw-r--r--lib/edoc/doc/src/Makefile2
-rw-r--r--lib/edoc/include/Makefile2
-rw-r--r--lib/edoc/priv/edoc_generate.src3
-rw-r--r--lib/edoc/src/Makefile2
-rw-r--r--lib/edoc/src/edoc.erl19
-rw-r--r--lib/edoc/src/edoc_data.erl2
-rw-r--r--lib/edoc/src/edoc_doclet.erl4
-rw-r--r--lib/edoc/src/edoc_extract.erl10
-rw-r--r--lib/edoc/src/edoc_layout.erl20
-rw-r--r--lib/edoc/src/edoc_lib.erl6
-rw-r--r--lib/edoc/src/edoc_parser.yrl7
-rw-r--r--lib/edoc/src/edoc_report.erl2
-rw-r--r--lib/edoc/src/edoc_run.erl2
-rw-r--r--lib/edoc/src/edoc_scanner.erl2
-rw-r--r--lib/edoc/src/edoc_specs.erl8
-rw-r--r--lib/edoc/src/edoc_tags.erl2
-rw-r--r--lib/edoc/src/edoc_types.erl6
-rw-r--r--lib/edoc/src/edoc_wiki.erl8
-rw-r--r--lib/edoc/src/otpsgml_layout.erl4
-rw-r--r--lib/edoc/test/edoc_SUITE.erl2
-rw-r--r--lib/erl_interface/src/encode/encode_atom.c6
-rw-r--r--lib/erl_interface/src/encode/encode_string.c6
-rw-r--r--lib/et/src/et_wx_viewer.erl4
-rw-r--r--lib/eunit/doc/overview.edoc2
-rw-r--r--lib/eunit/include/eunit.hrl102
-rw-r--r--lib/eunit/src/eunit.app.src16
-rw-r--r--lib/eunit/src/eunit.erl2
-rw-r--r--lib/eunit/src/eunit_data.erl70
-rw-r--r--lib/eunit/src/eunit_server.erl7
-rw-r--r--lib/eunit/src/eunit_surefire.erl58
-rw-r--r--lib/eunit/src/eunit_test.erl72
-rw-r--r--lib/eunit/src/eunit_tests.erl26
-rw-r--r--lib/eunit/vsn.mk2
-rw-r--r--lib/hipe/cerl/erl_bif_types.erl60
-rw-r--r--lib/hipe/main/hipe.hrl.src7
-rw-r--r--lib/ic/doc/src/notes.xml18
-rw-r--r--lib/ic/src/ic_pp.erl472
-rw-r--r--lib/ic/src/ic_pragma.erl19
-rw-r--r--lib/ic/vsn.mk2
-rw-r--r--lib/inets/src/http_server/httpd_file.erl2
-rw-r--r--lib/kernel/doc/src/gen_sctp.xml148
-rw-r--r--lib/kernel/doc/src/gen_tcp.xml25
-rw-r--r--lib/kernel/doc/src/gen_udp.xml21
-rw-r--r--lib/kernel/doc/src/inet.xml58
-rw-r--r--lib/kernel/src/code_server.erl17
-rw-r--r--lib/kernel/src/gen_sctp.erl174
-rw-r--r--lib/kernel/src/gen_tcp.erl120
-rw-r--r--lib/kernel/src/gen_udp.erl87
-rw-r--r--lib/kernel/src/inet.erl147
-rw-r--r--lib/kernel/src/inet_res.erl4
-rw-r--r--lib/kernel/test/application_SUITE.erl44
-rw-r--r--lib/kernel/test/code_SUITE.erl18
-rw-r--r--lib/kernel/test/disk_log_SUITE.erl4
-rw-r--r--lib/kernel/test/erl_prim_loader_SUITE.erl2
-rw-r--r--lib/kernel/test/gen_tcp_api_SUITE.erl8
-rw-r--r--lib/kernel/test/gen_udp_SUITE.erl15
-rw-r--r--lib/kernel/test/global_group_SUITE.erl16
-rw-r--r--lib/kernel/test/init_SUITE.erl2
-rw-r--r--lib/kernel/test/ram_file_SUITE.erl4
-rw-r--r--lib/kernel/test/zlib_SUITE.erl8
-rw-r--r--lib/observer/src/Makefile9
-rw-r--r--lib/odbc/c_src/odbcserver.c1
-rw-r--r--lib/odbc/test/mysql.erl17
-rw-r--r--lib/odbc/test/odbc_connect_SUITE.erl34
-rw-r--r--lib/odbc/test/odbc_data_type_SUITE.erl24
-rw-r--r--lib/odbc/test/odbc_query_SUITE.erl16
-rw-r--r--lib/odbc/test/odbc_start_SUITE.erl17
-rw-r--r--lib/odbc/test/odbc_test.hrl6
-rw-r--r--lib/odbc/test/odbc_test_lib.erl36
-rw-r--r--lib/odbc/test/postgres.erl9
-rw-r--r--lib/parsetools/doc/src/yecc.xml8
-rw-r--r--lib/parsetools/src/leex.erl52
-rw-r--r--lib/parsetools/src/yecc.erl37
-rw-r--r--lib/parsetools/test/leex_SUITE.erl11
-rw-r--r--lib/parsetools/test/yecc_SUITE.erl10
-rw-r--r--lib/percept/src/percept_db.erl11
-rw-r--r--lib/public_key/asn1/README2
-rw-r--r--lib/public_key/doc/src/public_key.xml16
-rw-r--r--lib/public_key/src/public_key.erl7
-rw-r--r--lib/sasl/doc/src/release_handler.xml28
-rw-r--r--lib/sasl/doc/src/systools.xml10
-rw-r--r--lib/sasl/examples/src/Makefile2
-rw-r--r--lib/sasl/src/release_handler.erl52
-rw-r--r--lib/sasl/src/release_handler_1.erl93
-rw-r--r--lib/sasl/src/systools_lib.erl7
-rw-r--r--lib/sasl/src/systools_make.erl180
-rw-r--r--lib/sasl/src/systools_relup.erl68
-rw-r--r--lib/sasl/test/Makefile2
-rw-r--r--lib/sasl/test/release_handler_SUITE.erl307
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/Makefile.src71
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/README19
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup7
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app17
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl11
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app17
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup22
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl11
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app7
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup24
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl11
-rw-r--r--lib/sasl/test/systools_SUITE.erl87
-rw-r--r--lib/snmp/Makefile5
-rw-r--r--lib/snmp/doc/src/Makefile4
-rw-r--r--lib/snmp/doc/src/notes.xml130
-rw-r--r--lib/snmp/doc/src/snmpc.xml15
-rw-r--r--lib/snmp/doc/src/snmpc_cmd.xml28
-rw-r--r--lib/snmp/doc/src/snmpm.xml40
-rw-r--r--lib/snmp/src/agent/snmp_view_based_acm_mib.erl6
-rw-r--r--lib/snmp/src/agent/snmpa_agent.erl2
-rw-r--r--lib/snmp/src/agent/snmpa_conf.erl9
-rw-r--r--lib/snmp/src/agent/snmpa_mpd.erl104
-rw-r--r--lib/snmp/src/app/snmp.appup.src226
-rw-r--r--lib/snmp/src/compile/Makefile11
-rw-r--r--lib/snmp/src/compile/snmpc.erl9
-rw-r--r--lib/snmp/src/compile/snmpc.src14
-rw-r--r--lib/snmp/src/compile/snmpc_lib.hrl15
-rw-r--r--lib/snmp/src/manager/snmpm.erl8
-rw-r--r--lib/snmp/src/manager/snmpm_config.erl515
-rw-r--r--lib/snmp/src/manager/snmpm_mpd.erl47
-rw-r--r--lib/snmp/src/manager/snmpm_net_if.erl31
-rw-r--r--lib/snmp/src/manager/snmpm_server.erl77
-rw-r--r--lib/snmp/src/misc/snmp_conf.erl83
-rw-r--r--lib/snmp/src/misc/snmp_config.erl10
-rw-r--r--lib/snmp/test/snmp_compiler_test.erl48
-rw-r--r--lib/snmp/test/snmp_manager_test.erl185
-rw-r--r--lib/snmp/test/test_config/Makefile18
-rw-r--r--lib/snmp/vsn.mk2
-rw-r--r--lib/ssh/doc/src/notes.xml14
-rw-r--r--lib/ssh/src/ssh.appup.src10
-rwxr-xr-xlib/ssh/src/ssh_sftp.erl12
-rw-r--r--lib/ssh/test/Makefile2
-rw-r--r--lib/ssh/vsn.mk2
-rw-r--r--lib/ssl/c_src/esock_openssl.c2
-rw-r--r--lib/ssl/doc/src/notes.xml6
-rw-r--r--lib/ssl/doc/src/ssl.xml31
-rw-r--r--lib/ssl/doc/src/ssl_protocol.xml4
-rw-r--r--lib/ssl/doc/src/using_ssl.xml8
-rw-r--r--lib/ssl/src/ssl.erl42
-rw-r--r--lib/ssl/src/ssl_connection.erl23
-rw-r--r--lib/ssl/src/ssl_handshake.erl14
-rw-r--r--lib/ssl/src/ssl_internal.hrl3
-rw-r--r--lib/ssl/src/ssl_manager.erl12
-rw-r--r--lib/ssl/src/ssl_record.erl2
-rw-r--r--lib/ssl/src/ssl_session.erl4
-rw-r--r--lib/ssl/src/ssl_session_cache.erl4
-rw-r--r--lib/ssl/src/ssl_ssl2.erl2
-rw-r--r--lib/ssl/test/ssl_packet_SUITE.erl302
-rw-r--r--lib/stdlib/doc/src/dets.xml2
-rw-r--r--lib/stdlib/doc/src/gen_fsm.xml8
-rw-r--r--lib/stdlib/doc/src/supervisor.xml9
-rw-r--r--lib/stdlib/doc/src/unicode_usage.xml2
-rw-r--r--lib/stdlib/src/dets.erl13
-rw-r--r--lib/stdlib/src/erl_compile.erl1
-rw-r--r--lib/stdlib/src/erl_internal.erl1
-rw-r--r--lib/stdlib/src/escript.erl6
-rw-r--r--lib/stdlib/src/eval_bits.erl8
-rw-r--r--lib/stdlib/src/io_lib.erl4
-rw-r--r--lib/stdlib/src/io_lib_fread.erl64
-rw-r--r--lib/stdlib/src/otp_internal.erl8
-rw-r--r--lib/stdlib/src/proplists.erl3
-rw-r--r--lib/stdlib/src/sofs.erl5
-rw-r--r--lib/stdlib/src/supervisor.erl7
-rw-r--r--lib/stdlib/src/sys.erl4
-rw-r--r--lib/stdlib/src/timer.erl2
-rw-r--r--lib/stdlib/src/zip.erl10
-rw-r--r--lib/stdlib/test/beam_lib_SUITE.erl16
-rw-r--r--lib/stdlib/test/dets_SUITE.erl8
-rw-r--r--lib/stdlib/test/epp_SUITE.erl4
-rw-r--r--lib/stdlib/test/erl_eval_SUITE.erl2
-rw-r--r--lib/stdlib/test/erl_lint_SUITE.erl2
-rw-r--r--lib/stdlib/test/ets_SUITE.erl67
-rw-r--r--lib/stdlib/test/file_sorter_SUITE.erl16
-rw-r--r--lib/stdlib/test/filelib_SUITE.erl4
-rw-r--r--lib/stdlib/test/io_SUITE.erl30
-rw-r--r--lib/stdlib/test/string_SUITE.erl4
-rw-r--r--lib/stdlib/test/supervisor_SUITE.erl35
-rw-r--r--lib/stdlib/test/supervisor_bridge_SUITE.erl2
-rw-r--r--lib/stdlib/test/sys_SUITE.erl2
-rw-r--r--lib/stdlib/test/tar_SUITE.erl18
-rw-r--r--lib/stdlib/test/zip_SUITE.erl3
-rw-r--r--lib/test_server/src/ts_install_cth.erl17
-rw-r--r--lib/test_server/test/Makefile2
-rw-r--r--lib/tools/emacs/erlang.el84
-rw-r--r--lib/webtool/priv/Makefile8
-rw-r--r--lib/wx/test/wxt.erl4
-rw-r--r--lib/xmerl/include/xmerl_xsd.hrl1
-rw-r--r--lib/xmerl/src/xmerl_scan.erl2
-rw-r--r--lib/xmerl/src/xmerl_xsd.erl43
-rw-r--r--lib/xmerl/test/Makefile2
-rw-r--r--lib/xmerl/test/xmerl_SUITE.erl13
-rw-r--r--lib/xmerl/test/xmerl_SUITE_data/misc.tar.gzbin47121 -> 47340 bytes
-rw-r--r--lib/xmerl/test/xmerl_xsd_SUITE.erl7
-rw-r--r--system/doc/reference_manual/distributed.xml2
316 files changed, 8248 insertions, 2485 deletions
diff --git a/INSTALL.md b/INSTALL.md
index 1061c5187a..24053b4793 100644
--- a/INSTALL.md
+++ b/INSTALL.md
@@ -27,7 +27,7 @@ on Unix. For detailed instructions on how to
Binary releases for Windows can be found at
<http://www.erlang.org/download.html>.
-Before reading the above mensioned documents you are in any case advised to
+Before reading the above mentioned documents you are in any case advised to
read this document first, since it covers building Erlang/OTP in general as
well as other important information.
@@ -424,7 +424,7 @@ as before, but the build process will take a much longer time.
### Building in Git ###
When building in a Git working directory you also have to have a GNU `autoconf`
-of at least version 2.59 on your system. This since you need to generate the
+of at least version 2.59 on your system, because you need to generate the
`configure` scripts before you can start building.
The `configure` scripts are generated by invoking `./otp_build autoconf` in
@@ -436,7 +436,7 @@ when checking out a branch. Regenerated `configure` scripts imply that you
have to run `configure` and build again.
> *NOTE*: Running `./otp_build autoconf` is **not** needed when building
-> an unmodified version the released source.
+> an unmodified version of the released source.
Other useful information can be found at our github wiki:
<http://wiki.github.com/erlang/otp>
diff --git a/erts/configure.in b/erts/configure.in
index fac07f8b6a..03e27c9dad 100644
--- a/erts/configure.in
+++ b/erts/configure.in
@@ -1673,6 +1673,15 @@ esac
AC_C_BIGENDIAN
+dnl fdatasync syscall (Unix only)
+AC_CHECK_FUNCS([fdatasync])
+
+dnl Find which C libraries are required to use fdatasync
+dnl TODO: Remove check once SunOS >= 5.11 is required by erts.
+dnl fdatasync requires linking against -lrt on SunOS <= 5.10.
+dnl OpenSolaris 2009.06 is SunOS 5.11 and does not require -lrt.
+AC_SEARCH_LIBS(fdatasync, [rt])
+
dnl ----------------------------------------------------------------------
dnl Checks for library functions.
dnl ----------------------------------------------------------------------
@@ -1860,12 +1869,6 @@ fi
dnl Need by run_erl.
AC_CHECK_FUNCS([openpty])
-dnl fdatasync syscall (Unix only)
-AC_CHECK_FUNCS([fdatasync])
-
-dnl Find which C libraries are required to use fdatasync
-AC_SEARCH_LIBS(fdatasync, [rt])
-
AC_CHECK_HEADERS(net/if_dl.h ifaddrs.h netpacket/packet.h)
AC_CHECK_FUNCS([getifaddrs])
@@ -3722,7 +3725,7 @@ case "$erl_xcomp_without_sysroot-$with_ssl" in
SSL_RUNTIME_LIBDIR="$rdir/lib"
SSL_LIBDIR="$dir/lib"
SSL_CRYPTO_LIBNAME=libeay32
- SSL_CRYPTO_LIBNAME=ssleay32
+ SSL_SSL_LIBNAME=ssleay32
elif test -f "$dir/lib/openssl.lib"; then
SSL_RUNTIME_LIBDIR="$rdir/lib"
SSL_LIBDIR="$dir/lib"
@@ -3904,7 +3907,7 @@ dnl so it is - be adoptable
elif test -f "$with_ssl/lib/libeay32.lib"; then
SSL_LIBDIR="$with_ssl/lib"
SSL_CRYPTO_LIBNAME=libeay32
- SSL_CRYPTO_LIBNAME=ssleay32
+ SSL_SSL_LIBNAME=ssleay32
else
# This probably wont work, but that's what the user said, so...
SSL_LIBDIR="$with_ssl/lib"
diff --git a/erts/doc/src/erlang.xml b/erts/doc/src/erlang.xml
index 7cfab0785d..84d4160e6a 100644
--- a/erts/doc/src/erlang.xml
+++ b/erts/doc/src/erlang.xml
@@ -518,6 +518,18 @@
</func>
<func>
+ <name>check_old_code(Module) -> boolean()</name>
+ <fsummary>Check if a module has old code</fsummary>
+ <type>
+ <v>Module = atom()</v>
+ </type>
+ <desc>
+ <p>Returns <c>true</c> if the <c>Module</c> has old code,
+ and <c>false</c> otherwise.</p>
+ <p>See also <seealso marker="kernel:code">code(3)</seealso>.</p>
+ </desc>
+ </func>
+ <func>
<name>check_process_code(Pid, Module) -> boolean()</name>
<fsummary>Check if a process is executing old code for a module</fsummary>
<type>
@@ -1023,6 +1035,56 @@ b</pre>
</desc>
</func>
<func>
+ <name>erlang:external_size(Term) -> integer() >= 0</name>
+ <fsummary>Calculate the maximum size for a term encoded in the Erlang
+ external term format</fsummary>
+ <type>
+ <v>Term = term()</v>
+ </type>
+ <desc>
+ <p>Calculates, without doing the encoding, the maximum byte size for
+ a term encoded in the Erlang external term format. The following
+ condition applies always:</p>
+ <p>
+ <pre>
+> <input>Size1 = byte_size(term_to_binary(Term)),</input>
+> <input>Size2 = erlang:external_size(Term),</input>
+> <input>true = Size1 =&lt; Size2.</input>
+true
+ </pre>
+ </p>
+ <p>This is equivalent to a call to: <code>erlang:external_size(Term, [])
+ </code></p>
+ </desc>
+ </func>
+ <func>
+ <name>erlang:external_size(Term, [Option]) -> integer() >= 0</name>
+ <fsummary>Calculate the maximum size for a term encoded in the Erlang
+ external term format</fsummary>
+ <type>
+ <v>Term = term()</v>
+ <v>Option = {minor_version, Version}</v>
+ </type>
+ <desc>
+ <p>Calculates, without doing the encoding, the maximum byte size for
+ a term encoded in the Erlang external term format. The following
+ condition applies always:</p>
+ <p>
+ <pre>
+> <input>Size1 = byte_size(term_to_binary(Term, Options)),</input>
+> <input>Size2 = erlang:external_size(Term, Options),</input>
+> <input>true = Size1 =&lt; Size2.</input>
+true
+ </pre>
+ </p>
+ <p>The option <c>{minor_version, Version}</c> specifies how floats
+ are encoded. See
+ <seealso marker="#term_to_binary/2">term_to_binary/2</seealso> for
+ a more detailed description.
+ </p>
+ </desc>
+ </func>
+ <func>
<name>float(Number) -> float()</name>
<fsummary>Convert a number to a float</fsummary>
<type>
diff --git a/erts/doc/src/erts_alloc.xml b/erts/doc/src/erts_alloc.xml
index 452e5d990e..90347824d5 100644
--- a/erts/doc/src/erts_alloc.xml
+++ b/erts/doc/src/erts_alloc.xml
@@ -180,6 +180,14 @@
used. The time complexity is proportional to log N, where
N is the number of free blocks.</p>
</item>
+ <tag>Address order first fit</tag>
+ <item>
+ <p>Strategy: Find the block with the lowest address that satisfies the
+ requested block size.</p>
+ <p>Implementation: A balanced binary search tree is
+ used. The time complexity is proportional to log N, where
+ N is the number of free blocks.</p>
+ </item>
<tag>Good fit</tag>
<item>
<p>Strategy: Try to find the best fit, but settle for the best fit
@@ -320,11 +328,11 @@
subsystem identifier, only the specific allocator identified will be
effected:</p>
<taglist>
- <tag><marker id="M_as"><c><![CDATA[+M<S>as bf|aobf|gf|af]]></c></marker></tag>
+ <tag><marker id="M_as"><c><![CDATA[+M<S>as bf|aobf|aoff|gf|af]]></c></marker></tag>
<item>
Allocation strategy. Valid strategies are <c>bf</c> (best fit),
- <c>aobf</c> (address order best fit), <c>gf</c> (good fit),
- and <c>af</c> (a fit). See
+ <c>aobf</c> (address order best fit), <c>aoff</c> (address order first fit),
+ <c>gf</c> (good fit), and <c>af</c> (a fit). See
<seealso marker="#strategy">the description of allocation strategies</seealso> in "the <c>alloc_util</c> framework" section.</item>
<tag><marker id="M_asbcst"><c><![CDATA[+M<S>asbcst <size>]]></c></marker></tag>
<item>
diff --git a/erts/doc/src/zlib.xml b/erts/doc/src/zlib.xml
index 47a649af02..8917ab5c3a 100644
--- a/erts/doc/src/zlib.xml
+++ b/erts/doc/src/zlib.xml
@@ -378,31 +378,31 @@ unpack(Z, Compressed, Dict) ->
<name name="crc32" arity="2"/>
<fsummary>Calculate CRC</fsummary>
<desc>
- <p>Calculate the CRC checksum for <c><anno>Binary</anno></c>.</p>
+ <p>Calculate the CRC checksum for <c><anno>Data</anno></c>.</p>
</desc>
</func>
<func>
<name name="crc32" arity="3"/>
<fsummary>Calculate CRC</fsummary>
<desc>
- <p>Update a running CRC checksum for <c><anno>Binary</anno></c>.
- If <c><anno>Binary</anno></c> is the empty binary, this function returns
+ <p>Update a running CRC checksum for <c><anno>Data</anno></c>.
+ If <c><anno>Data</anno></c> is the empty binary or the empty iolist, this function returns
the required initial value for the crc.</p>
<pre>
-Crc = lists:foldl(fun(Bin,Crc0) ->
- zlib:crc32(Z, Crc0, Bin),
- end, zlib:crc32(Z,&lt;&lt; &gt;&gt;), Bins)</pre>
+Crc = lists:foldl(fun(Data,Crc0) ->
+ zlib:crc32(Z, Crc0, Data),
+ end, zlib:crc32(Z,&lt;&lt; &gt;&gt;), Datas)</pre>
</desc>
</func>
<func>
<name name="crc32_combine" arity="4"/>
<fsummary>Combine two CRC's</fsummary>
<desc>
- <p>Combine two CRC checksums into one. For two binaries,
- <c>Bin1</c> and <c>Bin2</c> with sizes of <c>Size1</c> and
+ <p>Combine two CRC checksums into one. For two binaries or iolists,
+ <c>Data1</c> and <c>Data2</c> with sizes of <c>Size1</c> and
<c><anno>Size2</anno></c>, with CRC checksums <c><anno>CRC1</anno></c> and
<c><anno>CRC2</anno></c>. <c>crc32_combine/4</c> returns the <c><anno>CRC</anno></c>
- checksum of <c>&lt;&lt;Bin1/binary,Bin2/binary&gt;&gt;</c>, requiring
+ checksum of <c>[Data1,Data2]</c>, requiring
only <c><anno>CRC1</anno></c>, <c><anno>CRC2</anno></c>, and <c><anno>Size2</anno></c>.
</p>
</desc>
@@ -411,75 +411,75 @@ Crc = lists:foldl(fun(Bin,Crc0) ->
<name name="adler32" arity="2"/>
<fsummary>Calculate the adler checksum</fsummary>
<desc>
- <p>Calculate the Adler-32 checksum for <c><anno>Binary</anno></c>.</p>
+ <p>Calculate the Adler-32 checksum for <c><anno>Data</anno></c>.</p>
</desc>
</func>
<func>
<name name="adler32" arity="3"/>
<fsummary>Calculate the adler checksum</fsummary>
<desc>
- <p>Update a running Adler-32 checksum for <c><anno>Binary</anno></c>.
- If <c><anno>Binary</anno></c> is the empty binary, this function returns
+ <p>Update a running Adler-32 checksum for <c><anno>Data</anno></c>.
+ If <c><anno>Data</anno></c> is the empty binary or the empty iolist, this function returns
the required initial value for the checksum.</p>
<pre>
-Crc = lists:foldl(fun(Bin,Crc0) ->
- zlib:adler32(Z, Crc0, Bin),
- end, zlib:adler32(Z,&lt;&lt; &gt;&gt;), Bins)</pre>
+Crc = lists:foldl(fun(Data,Crc0) ->
+ zlib:adler32(Z, Crc0, Data),
+ end, zlib:adler32(Z,&lt;&lt; &gt;&gt;), Datas)</pre>
</desc>
</func>
<func>
<name name="adler32_combine" arity="4"/>
<fsummary>Combine two Adler-32 checksums</fsummary>
<desc>
- <p>Combine two Adler-32 checksums into one. For two binaries,
- <c>Bin1</c> and <c>Bin2</c> with sizes of <c>Size1</c> and
+ <p>Combine two Adler-32 checksums into one. For two binaries or iolists,
+ <c>Data1</c> and <c>Data2</c> with sizes of <c>Size1</c> and
<c><anno>Size2</anno></c>, with Adler-32 checksums <c><anno>Adler1</anno></c> and
<c><anno>Adler2</anno></c>. <c>adler32_combine/4</c> returns the <c><anno>Adler</anno></c>
- checksum of <c>&lt;&lt;Bin1/binary,Bin2/binary&gt;&gt;</c>, requiring
+ checksum of <c>[Data1,Data2]</c>, requiring
only <c><anno>Adler1</anno></c>, <c><anno>Adler2</anno></c>, and <c><anno>Size2</anno></c>.
</p>
</desc>
</func>
<func>
<name name="compress" arity="1"/>
- <fsummary>Compress a binary with standard zlib functionality</fsummary>
+ <fsummary>Compress data with standard zlib functionality</fsummary>
<desc>
- <p>Compress a binary (with zlib headers and checksum).</p>
+ <p>Compress data (with zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="uncompress" arity="1"/>
- <fsummary>Uncompress a binary with standard zlib functionality</fsummary>
+ <fsummary>Uncompress data with standard zlib functionality</fsummary>
<desc>
- <p>Uncompress a binary (with zlib headers and checksum).</p>
+ <p>Uncompress data (with zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="zip" arity="1"/>
- <fsummary>Compress a binary without the zlib headers</fsummary>
+ <fsummary>Compress data without the zlib headers</fsummary>
<desc>
- <p>Compress a binary (without zlib headers and checksum).</p>
+ <p>Compress data (without zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="unzip" arity="1"/>
- <fsummary>Uncompress a binary without the zlib headers</fsummary>
+ <fsummary>Uncompress data without the zlib headers</fsummary>
<desc>
- <p>Uncompress a binary (without zlib headers and checksum).</p>
+ <p>Uncompress data (without zlib headers and checksum).</p>
</desc>
</func>
<func>
<name name="gzip" arity="1"/>
- <fsummary>Compress a binary with gz header</fsummary>
+ <fsummary>Compress data with gz header</fsummary>
<desc>
- <p>Compress a binary (with gz headers and checksum).</p>
+ <p>Compress data (with gz headers and checksum).</p>
</desc>
</func>
<func>
<name name="gunzip" arity="1"/>
- <fsummary>Uncompress a binary with gz header</fsummary>
+ <fsummary>Uncompress data with gz header</fsummary>
<desc>
- <p>Uncompress a binary (with gz headers and checksum).</p>
+ <p>Uncompress data (with gz headers and checksum).</p>
</desc>
</func>
</funcs>
diff --git a/erts/emulator/Makefile.in b/erts/emulator/Makefile.in
index d9362a2a8f..b658e79378 100644
--- a/erts/emulator/Makefile.in
+++ b/erts/emulator/Makefile.in
@@ -742,7 +742,7 @@ RUN_OBJS = \
$(OBJDIR)/erl_bif_re.o $(OBJDIR)/erl_unicode.o \
$(OBJDIR)/packet_parser.o $(OBJDIR)/safe_hash.o \
$(OBJDIR)/erl_zlib.o $(OBJDIR)/erl_nif.o \
- $(OBJDIR)/erl_bif_binary.o
+ $(OBJDIR)/erl_bif_binary.o $(OBJDIR)/erl_ao_firstfit_alloc.o
ifeq ($(TARGET),win32)
DRV_OBJS = \
diff --git a/erts/emulator/beam/beam_bif_load.c b/erts/emulator/beam/beam_bif_load.c
index d76a7d8e9f..2561d7a630 100644
--- a/erts/emulator/beam/beam_bif_load.c
+++ b/erts/emulator/beam/beam_bif_load.c
@@ -162,6 +162,23 @@ BIF_RETTYPE code_make_stub_module_3(BIF_ALIST_3)
return res;
}
+BIF_RETTYPE
+check_old_code_1(BIF_ALIST_1)
+{
+ Module* modp;
+
+ if (is_not_atom(BIF_ARG_1)) {
+ BIF_ERROR(BIF_P, BADARG);
+ }
+ modp = erts_get_module(BIF_ARG_1);
+ if (modp == NULL) { /* Doesn't exist. */
+ BIF_RET(am_false);
+ } else if (modp->old_code == NULL) { /* No old code. */
+ BIF_RET(am_false);
+ }
+ BIF_RET(am_true);
+}
+
Eterm
check_process_code_2(BIF_ALIST_2)
{
@@ -175,6 +192,13 @@ check_process_code_2(BIF_ALIST_2)
Eterm res;
if (internal_pid_index(BIF_ARG_1) >= erts_max_processes)
goto error;
+ modp = erts_get_module(BIF_ARG_2);
+ if (modp == NULL) { /* Doesn't exist. */
+ return am_false;
+ } else if (modp->old_code == NULL) { /* No old code. */
+ return am_false;
+ }
+
#ifdef ERTS_SMP
rp = erts_pid2proc_suspend(BIF_P, ERTS_PROC_LOCK_MAIN,
BIF_ARG_1, ERTS_PROC_LOCK_MAIN);
@@ -188,7 +212,6 @@ check_process_code_2(BIF_ALIST_2)
ERTS_BIF_YIELD2(bif_export[BIF_check_process_code_2], BIF_P,
BIF_ARG_1, BIF_ARG_2);
}
- modp = erts_get_module(BIF_ARG_2);
res = check_process_code(rp, modp);
#ifdef ERTS_SMP
if (BIF_P != rp) {
@@ -412,11 +435,6 @@ check_process_code(Process* rp, Module* modp)
#endif
#define INSIDE(a) (start <= (a) && (a) < end)
- if (modp == NULL) { /* Doesn't exist. */
- return am_false;
- } else if (modp->old_code == NULL) { /* No old code. */
- return am_false;
- }
/*
* Pick up limits for the module.
diff --git a/erts/emulator/beam/beam_emu.c b/erts/emulator/beam/beam_emu.c
index fb90a7d4f7..937b3d9e53 100644
--- a/erts/emulator/beam/beam_emu.c
+++ b/erts/emulator/beam/beam_emu.c
@@ -3561,7 +3561,7 @@ void process_main(void)
* Operands: NotUsed Live Dst
*/
do_bs_init_bits_known:
- num_bytes = (num_bits+7) >> 3;
+ num_bytes = ((Uint64)num_bits+(Uint64)7) >> 3;
if (num_bits & 7) {
alloc += ERL_SUB_BIN_SIZE;
}
diff --git a/erts/emulator/beam/beam_load.c b/erts/emulator/beam/beam_load.c
index 57fe25453d..eb10ae59a8 100644
--- a/erts/emulator/beam/beam_load.c
+++ b/erts/emulator/beam/beam_load.c
@@ -332,20 +332,22 @@ typedef struct {
Eterm* func_tab[1]; /* Pointers to each function. */
} LoadedCode;
-#define GetTagAndValue(Stp, Tag, Val) \
- do { \
- BeamInstr __w; \
- GetByte(Stp, __w); \
- Tag = __w & 0x07; \
- if ((__w & 0x08) == 0) { \
- Val = __w >> 4; \
- } else if ((__w & 0x10) == 0) { \
- Val = ((__w >> 5) << 8); \
- GetByte(Stp, __w); \
- Val |= __w; \
- } else { \
- if (!get_int_val(Stp, __w, &(Val))) goto load_error; \
- } \
+#define GetTagAndValue(Stp, Tag, Val) \
+ do { \
+ BeamInstr __w; \
+ GetByte(Stp, __w); \
+ Tag = __w & 0x07; \
+ if ((__w & 0x08) == 0) { \
+ Val = __w >> 4; \
+ } else if ((__w & 0x10) == 0) { \
+ Val = ((__w >> 5) << 8); \
+ GetByte(Stp, __w); \
+ Val |= __w; \
+ } else { \
+ int __res = get_tag_and_value(Stp, __w, (Tag), &(Val)); \
+ if (__res < 0) goto load_error; \
+ Tag = (unsigned) __res; \
+ } \
} while (0)
@@ -489,8 +491,8 @@ static void load_printf(int line, LoaderState* context, char *fmt, ...);
static int transform_engine(LoaderState* st);
static void id_to_string(Uint id, char* s);
static void new_genop(LoaderState* stp);
-static int get_int_val(LoaderState* stp, Uint len_code, BeamInstr* result);
-static int get_erlang_integer(LoaderState* stp, Uint len_code, BeamInstr* result);
+static int get_tag_and_value(LoaderState* stp, Uint len_code,
+ unsigned tag, BeamInstr* result);
static int new_label(LoaderState* stp);
static void new_literal_patch(LoaderState* stp, int pos);
static void new_string_patch(LoaderState* stp, int pos);
@@ -1470,46 +1472,15 @@ load_code(LoaderState* stp)
last_op->arity = 0;
ASSERT(arity <= MAX_OPARGS);
-#define GetValue(Stp, First, Val) \
- do { \
- if (((First) & 0x08) == 0) { \
- Val = (First) >> 4; \
- } else if (((First) & 0x10) == 0) { \
- BeamInstr __w; \
- GetByte(Stp, __w); \
- Val = (((First) >> 5) << 8) | __w; \
- } else { \
- if (!get_int_val(Stp, (First), &(Val))) goto load_error; \
- } \
- } while (0)
-
for (arg = 0; arg < arity; arg++) {
- BeamInstr first;
-
- GetByte(stp, first);
- last_op->a[arg].type = first & 0x07;
+ GetTagAndValue(stp, last_op->a[arg].type, last_op->a[arg].val);
switch (last_op->a[arg].type) {
case TAG_i:
- if ((first & 0x08) == 0) {
- last_op->a[arg].val = first >> 4;
- } else if ((first & 0x10) == 0) {
- BeamInstr w;
- GetByte(stp, w);
- ASSERT(first < 0x800);
- last_op->a[arg].val = ((first >> 5) << 8) | w;
- } else {
- int i = get_erlang_integer(stp, first, &(last_op->a[arg].val));
- if (i < 0) {
- goto load_error;
- }
- last_op->a[arg].type = i;
- }
- break;
case TAG_u:
- GetValue(stp, first, last_op->a[arg].val);
+ case TAG_q:
+ case TAG_o:
break;
case TAG_x:
- GetValue(stp, first, last_op->a[arg].val);
if (last_op->a[arg].val == 0) {
last_op->a[arg].type = TAG_r;
} else if (last_op->a[arg].val >= MAX_REG) {
@@ -1518,7 +1489,6 @@ load_code(LoaderState* stp)
}
break;
case TAG_y:
- GetValue(stp, first, last_op->a[arg].val);
if (last_op->a[arg].val >= MAX_REG) {
LoadError1(stp, "invalid y register number: %u",
last_op->a[arg].val);
@@ -1526,7 +1496,6 @@ load_code(LoaderState* stp)
last_op->a[arg].val += CP_SIZE;
break;
case TAG_a:
- GetValue(stp, first, last_op->a[arg].val);
if (last_op->a[arg].val == 0) {
last_op->a[arg].type = TAG_n;
} else if (last_op->a[arg].val >= stp->num_atoms) {
@@ -1536,7 +1505,6 @@ load_code(LoaderState* stp)
}
break;
case TAG_f:
- GetValue(stp, first, last_op->a[arg].val);
if (last_op->a[arg].val == 0) {
last_op->a[arg].type = TAG_p;
} else if (last_op->a[arg].val >= stp->num_labels) {
@@ -1544,7 +1512,6 @@ load_code(LoaderState* stp)
}
break;
case TAG_h:
- GetValue(stp, first, last_op->a[arg].val);
if (last_op->a[arg].val > 65535) {
LoadError1(stp, "invalid range for character data type: %u",
last_op->a[arg].val);
@@ -1552,11 +1519,9 @@ load_code(LoaderState* stp)
break;
case TAG_z:
{
- BeamInstr ext_tag;
unsigned tag;
- GetValue(stp, first, ext_tag);
- switch (ext_tag) {
+ switch (last_op->a[arg].val) {
case 0: /* Floating point number */
{
Eterm* hp;
@@ -1648,7 +1613,8 @@ load_code(LoaderState* stp)
break;
}
default:
- LoadError1(stp, "invalid extended tag %d", ext_tag);
+ LoadError1(stp, "invalid extended tag %d",
+ last_op->a[arg].val);
break;
}
}
@@ -1659,7 +1625,6 @@ load_code(LoaderState* stp)
}
last_op->arity++;
}
-#undef GetValue
ASSERT(arity == last_op->arity);
@@ -2562,13 +2527,8 @@ should_gen_heap_bin(LoaderState* stp, GenOpArg Src)
static int
binary_too_big(LoaderState* stp, GenOpArg Size)
{
- return Size.type == TAG_u && ((Size.val >> (8*sizeof(Uint)-3)) != 0);
-}
-
-static int
-binary_too_big_bits(LoaderState* stp, GenOpArg Size)
-{
- return Size.type == TAG_u && (((Size.val+7)/8) >> (8*sizeof(Uint)-3) != 0);
+ return Size.type == TAG_o ||
+ (Size.type == TAG_u && ((Size.val >> (8*sizeof(Uint)-3)) != 0));
}
static GenOp*
@@ -4317,41 +4277,9 @@ load_printf(int line, LoaderState* context, char *fmt,...)
erts_send_error_to_logger(context->group_leader, dsbufp);
}
-
-static int
-get_int_val(LoaderState* stp, Uint len_code, BeamInstr* result)
-{
- Uint count;
- Uint val;
-
- len_code >>= 5;
- ASSERT(len_code < 8);
- if (len_code == 7) {
- LoadError0(stp, "can't load integers bigger than 8 bytes yet\n");
- }
- count = len_code + 2;
- if (count == 5) {
- Uint msb;
- GetByte(stp, msb);
- if (msb == 0) {
- count--;
- }
- GetInt(stp, 4, *result);
- } else if (count <= 4) {
- GetInt(stp, count, val);
- *result = ((val << 8*(sizeof(val)-count)) >> 8*(sizeof(val)-count));
- } else {
- LoadError1(stp, "too big integer; %d bytes\n", count);
- }
- return 1;
-
- load_error:
- return 0;
-}
-
-
static int
-get_erlang_integer(LoaderState* stp, Uint len_code, BeamInstr* result)
+get_tag_and_value(LoaderState* stp, Uint len_code,
+ unsigned tag, BeamInstr* result)
{
Uint count;
Sint val;
@@ -4371,17 +4299,62 @@ get_erlang_integer(LoaderState* stp, Uint len_code, BeamInstr* result)
if (len_code < 7) {
count = len_code + 2;
} else {
- Uint tag;
+ unsigned sztag;
UWord len_word;
ASSERT(len_code == 7);
- GetTagAndValue(stp, tag, len_word);
- VerifyTag(stp, TAG_u, tag);
+ GetTagAndValue(stp, sztag, len_word);
+ VerifyTag(stp, sztag, TAG_u);
count = len_word + 9;
}
/*
- * Handle values up to the size of an int, meaning either a small or bignum.
+ * The value for tags except TAG_i must be an unsigned integer
+ * fitting in an Uint. If it does not fit, we'll indicate overflow
+ * by changing the tag to TAG_o.
+ */
+
+ if (tag != TAG_i) {
+ if (count == sizeof(Uint)+1) {
+ Uint msb;
+
+ /*
+ * The encoded value has one more byte than an Uint.
+ * It will still fit in an Uint if the most significant
+ * byte is 0.
+ */
+ GetByte(stp, msb);
+ GetInt(stp, sizeof(Uint), *result);
+ if (msb != 0) {
+ /* Overflow: Negative or too big. */
+ return TAG_o;
+ }
+ } else if (count == sizeof(Uint)) {
+ /*
+ * The value must be positive (or the encoded value would
+ * have been one byte longer).
+ */
+ GetInt(stp, count, *result);
+ } else if (count < sizeof(Uint)) {
+ GetInt(stp, count, *result);
+
+ /*
+ * If the sign bit is set, the value is negative
+ * (not allowed).
+ */
+ if (*result & ((Uint)1 << (count*8-1))) {
+ return TAG_o;
+ }
+ } else {
+ GetInt(stp, count, *result);
+ return TAG_o;
+ }
+ return tag;
+ }
+
+ /*
+ * TAG_i: First handle values up to the size of an Uint (i.e. either
+ * a small or a bignum).
*/
if (count <= sizeof(val)) {
diff --git a/erts/emulator/beam/bif.tab b/erts/emulator/beam/bif.tab
index d9dd80fa8b..831c0b1ce6 100644
--- a/erts/emulator/beam/bif.tab
+++ b/erts/emulator/beam/bif.tab
@@ -87,6 +87,8 @@ bif erlang:exit/2
bif 'erl.lang.proc':signal/2 ebif_signal_2 exit_2
bif erlang:external_size/1
bif 'erl.lang.term':external_size/1 ebif_external_size_1
+bif erlang:external_size/2
+bif 'erl.lang.term':external_size/2 ebif_external_size_2
ubif erlang:float/1
ubif 'erl.lang.number':to_float/1 ebif_to_float_1 float_1
bif erlang:float_to_list/1
@@ -802,6 +804,12 @@ bif prim_file:internal_name2native/1
bif prim_file:internal_native2name/1
bif prim_file:internal_normalize_utf8/1
bif file:native_name_encoding/0
+
+#
+# New in R14B04.
+#
+bif erlang:check_old_code/1
+
#
# Obsolete
#
diff --git a/erts/emulator/beam/erl_alloc.c b/erts/emulator/beam/erl_alloc.c
index 840534ec5e..bbc8a445a7 100644
--- a/erts/emulator/beam/erl_alloc.c
+++ b/erts/emulator/beam/erl_alloc.c
@@ -50,6 +50,9 @@
#include "erl_bestfit_alloc.h"
#define GET_ERL_AF_ALLOC_IMPL
#include "erl_afit_alloc.h"
+#define GET_ERL_AOFF_ALLOC_IMPL
+#include "erl_ao_firstfit_alloc.h"
+
#define ERTS_ALC_DEFAULT_MAX_THR_PREF 16
@@ -85,6 +88,8 @@ typedef union {
char align_bfa[ERTS_ALC_CACHE_LINE_ALIGN_SIZE(sizeof(BFAllctr_t))];
AFAllctr_t afa;
char align_afa[ERTS_ALC_CACHE_LINE_ALIGN_SIZE(sizeof(AFAllctr_t))];
+ AOFFAllctr_t aoffa;
+ char align_aoffa[ERTS_ALC_CACHE_LINE_ALIGN_SIZE(sizeof(AOFFAllctr_t))];
} ErtsAllocatorState_t;
static ErtsAllocatorState_t sbmbc_alloc_state;
@@ -122,7 +127,8 @@ static void *fix_core_alloc(Uint size)
enum allctr_type {
GOODFIT,
BESTFIT,
- AFIT
+ AFIT,
+ AOFIRSTFIT
};
struct au_init {
@@ -134,6 +140,7 @@ struct au_init {
GFAllctrInit_t gf;
BFAllctrInit_t bf;
AFAllctrInit_t af;
+ AOFFAllctrInit_t aoff;
} init;
struct {
int mmbcs;
@@ -147,7 +154,8 @@ struct au_init {
ERTS_DEFAULT_ALLCTR_INIT, \
ERTS_DEFAULT_GF_ALLCTR_INIT, \
ERTS_DEFAULT_BF_ALLCTR_INIT, \
- ERTS_DEFAULT_AF_ALLCTR_INIT \
+ ERTS_DEFAULT_AF_ALLCTR_INIT, \
+ ERTS_DEFAULT_AOFF_ALLCTR_INIT \
}
typedef struct {
@@ -562,6 +570,7 @@ erts_alloc_init(int *argc, char **argv, ErtsAllocInitOpts *eaiop)
erts_afalc_init();
erts_bfalc_init();
erts_gfalc_init();
+ erts_aoffalc_init();
for (i = ERTS_ALC_A_MIN; i <= ERTS_ALC_A_MAX; i++) {
erts_allctrs[i].alloc = NULL;
@@ -597,7 +606,7 @@ erts_alloc_init(int *argc, char **argv, ErtsAllocInitOpts *eaiop)
/* Init low memory variants by cloning */
init.sbmbc_low_alloc = init.sbmbc_alloc;
init.sbmbc_low_alloc.init.util.name_prefix = "sbmbc_low_";
- init.sbmbc_low_alloc.init.util.alloc_no = ERTS_ALC_A_STANDARD_LOW;
+ init.sbmbc_low_alloc.init.util.alloc_no = ERTS_ALC_A_SBMBC_LOW;
init.sbmbc_low_alloc.init.util.low_mem = 1;
init.std_low_alloc = init.std_alloc;
@@ -903,6 +912,12 @@ start_au_allocator(ErtsAlcType_t alctr_n,
&init->init.af,
&init->init.util);
break;
+ case AOFIRSTFIT:
+ as = (void *) erts_aoffalc_start((AOFFAllctr_t *) as0,
+ &init->init.aoff,
+ &init->init.util);
+ break;
+
default:
as = NULL;
ASSERT(0);
@@ -1097,6 +1112,9 @@ handle_au_arg(struct au_init *auip,
else if (strcmp("af", alg) == 0) {
auip->atype = AFIT;
}
+ else if (strcmp("aoff", alg) == 0) {
+ auip->atype = AOFIRSTFIT;
+ }
else {
bad_value(param, sub_param + 1, alg);
}
@@ -2982,6 +3000,7 @@ unsigned long erts_alc_test(unsigned long op,
case 0x2: return erts_bfalc_test(op, a1, a2);
case 0x3: return erts_afalc_test(op, a1, a2);
case 0x4: return erts_mseg_test(op, a1, a2, a3);
+ case 0x5: return erts_aoffalc_test(op, a1, a2);
case 0xf:
switch (op) {
case 0xf00:
@@ -3061,6 +3080,14 @@ unsigned long erts_alc_test(unsigned long op,
&init.init.af,
&init.init.util);
break;
+ case AOFIRSTFIT:
+ allctr = erts_aoffalc_start((AOFFAllctr_t *)
+ erts_alloc(ERTS_ALC_T_UNDEF,
+ sizeof(AOFFAllctr_t)),
+ &init.init.aoff,
+ &init.init.util);
+ break;
+
default:
ASSERT(0);
allctr = NULL;
diff --git a/erts/emulator/beam/erl_alloc.h b/erts/emulator/beam/erl_alloc.h
index ce792d4d17..c35a60da22 100644
--- a/erts/emulator/beam/erl_alloc.h
+++ b/erts/emulator/beam/erl_alloc.h
@@ -99,6 +99,14 @@ unsigned long erts_alc_test(unsigned long,
#define ERTS_ALC_MIN_LONG_LIVED_TIME (10*60*1000)
+#if HALFWORD_HEAP
+#define ERTS_IS_SBMBC_ALLOCATOR_NO__(NO) \
+ ((NO) == ERTS_ALC_A_SBMBC || (NO) == ERTS_ALC_A_SBMBC_LOW)
+#else
+#define ERTS_IS_SBMBC_ALLOCATOR_NO__(NO) \
+ ((NO) == ERTS_ALC_A_SBMBC)
+#endif
+
typedef struct {
int alloc_util;
int enabled;
diff --git a/erts/emulator/beam/erl_alloc_util.c b/erts/emulator/beam/erl_alloc_util.c
index 19c552d8cd..d51ed0c36d 100644
--- a/erts/emulator/beam/erl_alloc_util.c
+++ b/erts/emulator/beam/erl_alloc_util.c
@@ -3436,10 +3436,7 @@ erts_alcu_start(Allctr_t *allctr, AllctrInit_t *init)
allctr->sbmbc_threshold = init->sbmbct;
if (!erts_have_sbmbc_alloc
-#if HALFWORD_HEAP
- || allctr->alloc_no == ERTS_ALC_A_SBMBC_LOW
-#endif
- || allctr->alloc_no == ERTS_ALC_A_SBMBC)
+ || ERTS_IS_SBMBC_ALLOCATOR_NO__(allctr->alloc_no))
allctr->sbmbc_threshold = 0;
if (!allctr->sbmbc_threshold)
@@ -3466,14 +3463,14 @@ erts_alcu_start(Allctr_t *allctr, AllctrInit_t *init)
#ifdef ERTS_ENABLE_LOCK_COUNT
erts_mtx_init_x_opt(&allctr->mutex,
- allctr->alloc_no == ERTS_ALC_A_SBMBC
+ ERTS_IS_SBMBC_ALLOCATOR_NO__(allctr->alloc_no)
? "sbmbc_alloc"
: "alcu_allocator",
make_small(allctr->alloc_no),
ERTS_LCNT_LT_ALLOC);
#else
erts_mtx_init_x(&allctr->mutex,
- allctr->alloc_no == ERTS_ALC_A_SBMBC
+ ERTS_IS_SBMBC_ALLOCATOR_NO__(allctr->alloc_no)
? "sbmbc_alloc"
: "alcu_allocator",
make_small(allctr->alloc_no));
diff --git a/erts/emulator/beam/erl_ao_firstfit_alloc.c b/erts/emulator/beam/erl_ao_firstfit_alloc.c
new file mode 100644
index 0000000000..002852cdad
--- /dev/null
+++ b/erts/emulator/beam/erl_ao_firstfit_alloc.c
@@ -0,0 +1,972 @@
+/*
+ * %CopyrightBegin%
+ *
+ * Copyright Ericsson AB 2003-2009. All Rights Reserved.
+ *
+ * The contents of this file are subject to the Erlang Public License,
+ * Version 1.1, (the "License"); you may not use this file except in
+ * compliance with the License. You should have received a copy of the
+ * Erlang Public License along with this software. If not, it can be
+ * retrieved online at http://www.erlang.org/.
+ *
+ * Software distributed under the License is distributed on an "AS IS"
+ * basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+ * the License for the specific language governing rights and limitations
+ * under the License.
+ *
+ * %CopyrightEnd%
+ */
+
+
+/*
+ * Description: An "address order first fit" allocator
+ * based on a Red-Black (binary search) Tree. The search,
+ * insert, and delete operations are all O(log n) operations
+ * on a Red-Black Tree.
+ * Red-Black Trees are described in "Introduction to Algorithms",
+ * by Thomas H. Cormen, Charles E. Leiserson, and Ronald L. Riverest.
+ *
+ * This module is a callback-module for erl_alloc_util.c
+ *
+ * Algorithm: The tree nodes are free-blocks ordered in address order.
+ * Every node also keeps the size of the largest block in its
+ * sub-tree ('max_size'). By that we can start from root and keep
+ * left (for low addresses) while dismissing entire sub-trees with
+ * too small blocks.
+ *
+ * Authors: Rickard Green/Sverker Eriksson
+ */
+
+
+#ifdef HAVE_CONFIG_H
+# include "config.h"
+#endif
+#include "global.h"
+#define GET_ERL_AOFF_ALLOC_IMPL
+#include "erl_ao_firstfit_alloc.h"
+
+#ifdef DEBUG
+#if 0
+#define HARD_DEBUG
+#endif
+#else
+#undef HARD_DEBUG
+#endif
+
+#define MIN_MBC_SZ (16*1024)
+#define MIN_MBC_FIRST_FREE_SZ (4*1024)
+
+#define TREE_NODE_FLG (((Uint) 1) << 0)
+#define RED_FLG (((Uint) 1) << 1)
+#ifdef HARD_DEBUG
+# define LEFT_VISITED_FLG (((Uint) 1) << 2)
+# define RIGHT_VISITED_FLG (((Uint) 1) << 3)
+#endif
+
+#define IS_RED(N) (((AOFF_RBTree_t *) (N)) \
+ && ((AOFF_RBTree_t *) (N))->flags & RED_FLG)
+#define IS_BLACK(N) (!IS_RED(((AOFF_RBTree_t *) (N))))
+
+#define SET_RED(N) (((AOFF_RBTree_t *) (N))->flags |= RED_FLG)
+#define SET_BLACK(N) (((AOFF_RBTree_t *) (N))->flags &= ~RED_FLG)
+
+#undef ASSERT
+#define ASSERT ASSERT_EXPR
+
+#if 1
+#define RBT_ASSERT ASSERT
+#else
+#define RBT_ASSERT(x)
+#endif
+
+
+/* Types... */
+typedef struct AOFF_RBTree_t_ AOFF_RBTree_t;
+
+struct AOFF_RBTree_t_ {
+ Block_t hdr;
+ Uint flags;
+ AOFF_RBTree_t *parent;
+ AOFF_RBTree_t *left;
+ AOFF_RBTree_t *right;
+ Uint max_sz; /* of all blocks in this sub-tree */
+};
+
+#ifdef HARD_DEBUG
+static AOFF_RBTree_t * check_tree(AOFF_RBTree_t* root, Uint);
+#endif
+
+
+/* Calculate 'max_size' of tree node x by only looking at the direct children
+ * of x and x itself.
+ */
+static ERTS_INLINE Uint node_max_size(AOFF_RBTree_t *x)
+{
+ Uint sz = BLK_SZ(x);
+ if (x->left && x->left->max_sz > sz) {
+ sz = x->left->max_sz;
+ }
+ if (x->right && x->right->max_sz > sz) {
+ sz = x->right->max_sz;
+ }
+ return sz;
+}
+
+/* Set new possibly lower 'max_size' of node and propagate change toward root
+*/
+static ERTS_INLINE void lower_max_size(AOFF_RBTree_t *node,
+ AOFF_RBTree_t* stop_at)
+{
+ AOFF_RBTree_t* x = node;
+ Uint old_max = x->max_sz;
+ Uint new_max = node_max_size(x);
+
+ if (new_max < old_max) {
+ x->max_sz = new_max;
+ while ((x=x->parent) != stop_at && x->max_sz == old_max) {
+ x->max_sz = node_max_size(x);
+ }
+ ASSERT(x == stop_at || x->max_sz > old_max);
+ }
+ else ASSERT(new_max == old_max);
+}
+
+
+/* Prototypes of callback functions */
+static Block_t* aoff_get_free_block(Allctr_t *, Uint, Block_t *, Uint, Uint32 flags);
+static void aoff_link_free_block(Allctr_t *, Block_t*, Uint32 flags);
+static void aoff_unlink_free_block(Allctr_t *allctr, Block_t *del, Uint32 flags);
+
+static Eterm info_options(Allctr_t *, char *, int *, void *, Uint **, Uint *);
+static void init_atoms(void);
+
+
+
+#ifdef DEBUG
+
+/* Destroy all tree fields */
+#define DESTROY_TREE_NODE(N) \
+ sys_memset((void *) (((Block_t *) (N)) + 1), \
+ 0xff, \
+ (sizeof(AOFF_RBTree_t) - sizeof(Block_t)))
+
+#else
+
+#define DESTROY_TREE_NODE(N)
+
+#endif
+
+
+static int atoms_initialized = 0;
+
+void
+erts_aoffalc_init(void)
+{
+ atoms_initialized = 0;
+}
+
+Allctr_t *
+erts_aoffalc_start(AOFFAllctr_t *alc,
+ AOFFAllctrInit_t* aoffinit,
+ AllctrInit_t *init)
+{
+ AOFFAllctr_t nulled_state = {{0}};
+ /* {{0}} is used instead of {0}, in order to avoid (an incorrect) gcc
+ warning. gcc warns if {0} is used as initializer of a struct when
+ the first member is a struct (not if, for example, the third member
+ is a struct). */
+ Allctr_t *allctr = (Allctr_t *) alc;
+
+ sys_memcpy((void *) alc, (void *) &nulled_state, sizeof(AOFFAllctr_t));
+
+ allctr->mbc_header_size = sizeof(Carrier_t);
+ allctr->min_mbc_size = MIN_MBC_SZ;
+ allctr->min_mbc_first_free_size = MIN_MBC_FIRST_FREE_SZ;
+ allctr->min_block_size = sizeof(AOFF_RBTree_t);
+
+ allctr->vsn_str = ERTS_ALC_AOFF_ALLOC_VSN_STR;
+
+
+ /* Callback functions */
+
+ allctr->get_free_block = aoff_get_free_block;
+ allctr->link_free_block = aoff_link_free_block;
+ allctr->unlink_free_block = aoff_unlink_free_block;
+ allctr->info_options = info_options;
+
+ allctr->get_next_mbc_size = NULL;
+ allctr->creating_mbc = NULL;
+ allctr->destroying_mbc = NULL;
+ allctr->init_atoms = init_atoms;
+
+#ifdef ERTS_ALLOC_UTIL_HARD_DEBUG
+ allctr->check_block = NULL;
+ allctr->check_mbc = NULL;
+#endif
+
+ allctr->atoms_initialized = 0;
+
+ if (!erts_alcu_start(allctr, init))
+ return NULL;
+
+ return allctr;
+}
+
+/*
+ * Red-Black Tree operations needed
+ */
+
+static ERTS_INLINE void
+left_rotate(AOFF_RBTree_t **root, AOFF_RBTree_t *x)
+{
+ AOFF_RBTree_t *y = x->right;
+ x->right = y->left;
+ if (y->left)
+ y->left->parent = x;
+ y->parent = x->parent;
+ if (!y->parent) {
+ RBT_ASSERT(*root == x);
+ *root = y;
+ }
+ else if (x == x->parent->left)
+ x->parent->left = y;
+ else {
+ RBT_ASSERT(x == x->parent->right);
+ x->parent->right = y;
+ }
+ y->left = x;
+ x->parent = y;
+
+ y->max_sz = x->max_sz;
+ x->max_sz = node_max_size(x);
+ ASSERT(y->max_sz >= x->max_sz);
+}
+
+static ERTS_INLINE void
+right_rotate(AOFF_RBTree_t **root, AOFF_RBTree_t *x)
+{
+ AOFF_RBTree_t *y = x->left;
+ x->left = y->right;
+ if (y->right)
+ y->right->parent = x;
+ y->parent = x->parent;
+ if (!y->parent) {
+ RBT_ASSERT(*root == x);
+ *root = y;
+ }
+ else if (x == x->parent->right)
+ x->parent->right = y;
+ else {
+ RBT_ASSERT(x == x->parent->left);
+ x->parent->left = y;
+ }
+ y->right = x;
+ x->parent = y;
+ y->max_sz = x->max_sz;
+ x->max_sz = node_max_size(x);
+ ASSERT(y->max_sz >= x->max_sz);
+}
+
+
+/*
+ * Replace node x with node y
+ * NOTE: block header of y is not changed
+ */
+static ERTS_INLINE void
+replace(AOFF_RBTree_t **root, AOFF_RBTree_t *x, AOFF_RBTree_t *y)
+{
+
+ if (!x->parent) {
+ RBT_ASSERT(*root == x);
+ *root = y;
+ }
+ else if (x == x->parent->left)
+ x->parent->left = y;
+ else {
+ RBT_ASSERT(x == x->parent->right);
+ x->parent->right = y;
+ }
+ if (x->left) {
+ RBT_ASSERT(x->left->parent == x);
+ x->left->parent = y;
+ }
+ if (x->right) {
+ RBT_ASSERT(x->right->parent == x);
+ x->right->parent = y;
+ }
+
+ y->flags = x->flags;
+ y->parent = x->parent;
+ y->right = x->right;
+ y->left = x->left;
+
+ y->max_sz = x->max_sz;
+ lower_max_size(y, NULL);
+ DESTROY_TREE_NODE(x);
+}
+
+static void
+tree_insert_fixup(AOFF_RBTree_t** root, AOFF_RBTree_t *blk)
+{
+ AOFF_RBTree_t *x = blk, *y;
+
+ /*
+ * Rearrange the tree so that it satisfies the Red-Black Tree properties
+ */
+
+ RBT_ASSERT(x != *root && IS_RED(x->parent));
+ do {
+
+ /*
+ * x and its parent are both red. Move the red pair up the tree
+ * until we get to the root or until we can separate them.
+ */
+
+ RBT_ASSERT(IS_RED(x));
+ RBT_ASSERT(IS_BLACK(x->parent->parent));
+ RBT_ASSERT(x->parent->parent);
+
+ if (x->parent == x->parent->parent->left) {
+ y = x->parent->parent->right;
+ if (IS_RED(y)) {
+ SET_BLACK(y);
+ x = x->parent;
+ SET_BLACK(x);
+ x = x->parent;
+ SET_RED(x);
+ }
+ else {
+
+ if (x == x->parent->right) {
+ x = x->parent;
+ left_rotate(root, x);
+ }
+
+ RBT_ASSERT(x == x->parent->parent->left->left);
+ RBT_ASSERT(IS_RED(x));
+ RBT_ASSERT(IS_RED(x->parent));
+ RBT_ASSERT(IS_BLACK(x->parent->parent));
+ RBT_ASSERT(IS_BLACK(y));
+
+ SET_BLACK(x->parent);
+ SET_RED(x->parent->parent);
+ right_rotate(root, x->parent->parent);
+
+ RBT_ASSERT(x == x->parent->left);
+ RBT_ASSERT(IS_RED(x));
+ RBT_ASSERT(IS_RED(x->parent->right));
+ RBT_ASSERT(IS_BLACK(x->parent));
+ break;
+ }
+ }
+ else {
+ RBT_ASSERT(x->parent == x->parent->parent->right);
+ y = x->parent->parent->left;
+ if (IS_RED(y)) {
+ SET_BLACK(y);
+ x = x->parent;
+ SET_BLACK(x);
+ x = x->parent;
+ SET_RED(x);
+ }
+ else {
+
+ if (x == x->parent->left) {
+ x = x->parent;
+ right_rotate(root, x);
+ }
+
+ RBT_ASSERT(x == x->parent->parent->right->right);
+ RBT_ASSERT(IS_RED(x));
+ RBT_ASSERT(IS_RED(x->parent));
+ RBT_ASSERT(IS_BLACK(x->parent->parent));
+ RBT_ASSERT(IS_BLACK(y));
+
+ SET_BLACK(x->parent);
+ SET_RED(x->parent->parent);
+ left_rotate(root, x->parent->parent);
+
+ RBT_ASSERT(x == x->parent->right);
+ RBT_ASSERT(IS_RED(x));
+ RBT_ASSERT(IS_RED(x->parent->left));
+ RBT_ASSERT(IS_BLACK(x->parent));
+ break;
+ }
+ }
+ } while (x != *root && IS_RED(x->parent));
+
+ SET_BLACK(*root);
+}
+
+static void
+aoff_unlink_free_block(Allctr_t *allctr, Block_t *del, Uint32 flags)
+{
+ AOFFAllctr_t *alc = (AOFFAllctr_t *) allctr;
+ AOFF_RBTree_t **root = ((flags & ERTS_ALCU_FLG_SBMBC)
+ ? &alc->sbmbc_root : &alc->mbc_root);
+ Uint spliced_is_black;
+ AOFF_RBTree_t *x, *y, *z = (AOFF_RBTree_t *) del;
+ AOFF_RBTree_t null_x; /* null_x is used to get the fixup started when we
+ splice out a node without children. */
+
+ null_x.parent = NULL;
+
+#ifdef HARD_DEBUG
+ check_tree(*root, 0);
+#endif
+
+ /* Remove node from tree... */
+
+ /* Find node to splice out */
+ if (!z->left || !z->right)
+ y = z;
+ else
+ /* Set y to z:s successor */
+ for(y = z->right; y->left; y = y->left);
+ /* splice out y */
+ x = y->left ? y->left : y->right;
+ spliced_is_black = IS_BLACK(y);
+ if (x) {
+ x->parent = y->parent;
+ }
+ else if (spliced_is_black) {
+ x = &null_x;
+ x->flags = 0;
+ SET_BLACK(x);
+ x->right = x->left = NULL;
+ x->max_sz = 0;
+ x->parent = y->parent;
+ y->left = x;
+ }
+
+ if (!y->parent) {
+ RBT_ASSERT(*root == y);
+ *root = x;
+ }
+ else {
+ if (y == y->parent->left) {
+ y->parent->left = x;
+ }
+ else {
+ RBT_ASSERT(y == y->parent->right);
+ y->parent->right = x;
+ }
+ if (y->parent != z) {
+ lower_max_size(y->parent, (y==z ? NULL : z));
+ }
+ }
+ if (y != z) {
+ /* We spliced out the successor of z; replace z by the successor */
+ replace(root, z, y);
+ }
+
+ if (spliced_is_black) {
+ /* We removed a black node which makes the resulting tree
+ violate the Red-Black Tree properties. Fixup tree... */
+
+ while (IS_BLACK(x) && x->parent) {
+
+ /*
+ * x has an "extra black" which we move up the tree
+ * until we reach the root or until we can get rid of it.
+ *
+ * y is the sibbling of x
+ */
+
+ if (x == x->parent->left) {
+ y = x->parent->right;
+ RBT_ASSERT(y);
+ if (IS_RED(y)) {
+ RBT_ASSERT(y->right);
+ RBT_ASSERT(y->left);
+ SET_BLACK(y);
+ RBT_ASSERT(IS_BLACK(x->parent));
+ SET_RED(x->parent);
+ left_rotate(root, x->parent);
+ y = x->parent->right;
+ }
+ RBT_ASSERT(y);
+ RBT_ASSERT(IS_BLACK(y));
+ if (IS_BLACK(y->left) && IS_BLACK(y->right)) {
+ SET_RED(y);
+ x = x->parent;
+ }
+ else {
+ if (IS_BLACK(y->right)) {
+ SET_BLACK(y->left);
+ SET_RED(y);
+ right_rotate(root, y);
+ y = x->parent->right;
+ }
+ RBT_ASSERT(y);
+ if (IS_RED(x->parent)) {
+
+ SET_BLACK(x->parent);
+ SET_RED(y);
+ }
+ RBT_ASSERT(y->right);
+ SET_BLACK(y->right);
+ left_rotate(root, x->parent);
+ x = *root;
+ break;
+ }
+ }
+ else {
+ RBT_ASSERT(x == x->parent->right);
+ y = x->parent->left;
+ RBT_ASSERT(y);
+ if (IS_RED(y)) {
+ RBT_ASSERT(y->right);
+ RBT_ASSERT(y->left);
+ SET_BLACK(y);
+ RBT_ASSERT(IS_BLACK(x->parent));
+ SET_RED(x->parent);
+ right_rotate(root, x->parent);
+ y = x->parent->left;
+ }
+ RBT_ASSERT(y);
+ RBT_ASSERT(IS_BLACK(y));
+ if (IS_BLACK(y->right) && IS_BLACK(y->left)) {
+ SET_RED(y);
+ x = x->parent;
+ }
+ else {
+ if (IS_BLACK(y->left)) {
+ SET_BLACK(y->right);
+ SET_RED(y);
+ left_rotate(root, y);
+ y = x->parent->left;
+ }
+ RBT_ASSERT(y);
+ if (IS_RED(x->parent)) {
+ SET_BLACK(x->parent);
+ SET_RED(y);
+ }
+ RBT_ASSERT(y->left);
+ SET_BLACK(y->left);
+ right_rotate(root, x->parent);
+ x = *root;
+ break;
+ }
+ }
+ }
+ SET_BLACK(x);
+
+ if (null_x.parent) {
+ if (null_x.parent->left == &null_x)
+ null_x.parent->left = NULL;
+ else {
+ RBT_ASSERT(null_x.parent->right == &null_x);
+ null_x.parent->right = NULL;
+ }
+ RBT_ASSERT(!null_x.left);
+ RBT_ASSERT(!null_x.right);
+ }
+ else if (*root == &null_x) {
+ *root = NULL;
+ RBT_ASSERT(!null_x.left);
+ RBT_ASSERT(!null_x.right);
+ }
+ }
+
+ DESTROY_TREE_NODE(del);
+
+#ifdef HARD_DEBUG
+ check_tree(*root, 0);
+#endif
+}
+
+static void
+aoff_link_free_block(Allctr_t *allctr, Block_t *block, Uint32 flags)
+{
+ AOFFAllctr_t *alc = (AOFFAllctr_t *) allctr;
+ AOFF_RBTree_t *blk = (AOFF_RBTree_t *) block;
+ AOFF_RBTree_t **root = ((flags & ERTS_ALCU_FLG_SBMBC)
+ ? &alc->sbmbc_root : &alc->mbc_root);
+ Uint blk_sz = BLK_SZ(blk);
+
+#ifdef HARD_DEBUG
+ check_tree(*root, 0);
+#endif
+
+ blk->flags = 0;
+ blk->left = NULL;
+ blk->right = NULL;
+ blk->max_sz = blk_sz;
+
+ if (!*root) {
+ blk->parent = NULL;
+ SET_BLACK(blk);
+ *root = blk;
+ }
+ else {
+ AOFF_RBTree_t *x = *root;
+ while (1) {
+ if (x->max_sz < blk_sz) {
+ x->max_sz = blk_sz;
+ }
+ if (blk < x) {
+ if (!x->left) {
+ blk->parent = x;
+ x->left = blk;
+ break;
+ }
+ x = x->left;
+ }
+ else {
+ if (!x->right) {
+ blk->parent = x;
+ x->right = blk;
+ break;
+ }
+ x = x->right;
+ }
+
+ }
+
+ /* Insert block into size tree */
+ RBT_ASSERT(blk->parent);
+
+ SET_RED(blk);
+ if (IS_RED(blk->parent))
+ tree_insert_fixup(root, blk);
+ }
+
+#ifdef HARD_DEBUG
+ check_tree(*root, 0);
+#endif
+}
+
+static Block_t *
+aoff_get_free_block(Allctr_t *allctr, Uint size,
+ Block_t *cand_blk, Uint cand_size, Uint32 flags)
+{
+ AOFFAllctr_t *alc = (AOFFAllctr_t *) allctr;
+ AOFF_RBTree_t *x = ((flags & ERTS_ALCU_FLG_SBMBC)
+ ? alc->sbmbc_root : alc->mbc_root);
+ AOFF_RBTree_t *blk = NULL;
+#ifdef HARD_DEBUG
+ AOFF_RBTree_t* dbg_blk = check_tree(x, size);
+#endif
+
+ ASSERT(!cand_blk || cand_size >= size);
+
+ while (x) {
+ if (x->left && x->left->max_sz >= size) {
+ x = x->left;
+ }
+ else if (BLK_SZ(x) >= size) {
+ blk = x;
+ break;
+ }
+ else {
+ x = x->right;
+ }
+ }
+
+#ifdef HARD_DEBUG
+ ASSERT(blk == dbg_blk);
+#endif
+
+ if (!blk)
+ return NULL;
+
+ if (cand_blk && cand_blk < &blk->hdr) {
+ return NULL; /* cand_blk was better */
+ }
+
+ aoff_unlink_free_block(allctr, (Block_t *) blk, flags);
+
+ return (Block_t *) blk;
+}
+
+
+/*
+ * info_options()
+ */
+
+static struct {
+ Eterm as;
+ Eterm aoff;
+#ifdef DEBUG
+ Eterm end_of_atoms;
+#endif
+} am;
+
+static void ERTS_INLINE atom_init(Eterm *atom, char *name)
+{
+ *atom = am_atom_put(name, strlen(name));
+}
+#define AM_INIT(AM) atom_init(&am.AM, #AM)
+
+static void
+init_atoms(void)
+{
+#ifdef DEBUG
+ Eterm *atom;
+#endif
+
+ if (atoms_initialized)
+ return;
+
+#ifdef DEBUG
+ for (atom = (Eterm *) &am; atom <= &am.end_of_atoms; atom++) {
+ *atom = THE_NON_VALUE;
+ }
+#endif
+ AM_INIT(as);
+ AM_INIT(aoff);
+
+#ifdef DEBUG
+ for (atom = (Eterm *) &am; atom < &am.end_of_atoms; atom++) {
+ ASSERT(*atom != THE_NON_VALUE);
+ }
+#endif
+
+ atoms_initialized = 1;
+}
+
+
+#define bld_uint erts_bld_uint
+#define bld_cons erts_bld_cons
+#define bld_tuple erts_bld_tuple
+
+static ERTS_INLINE void
+add_2tup(Uint **hpp, Uint *szp, Eterm *lp, Eterm el1, Eterm el2)
+{
+ *lp = bld_cons(hpp, szp, bld_tuple(hpp, szp, 2, el1, el2), *lp);
+}
+
+static Eterm
+info_options(Allctr_t *allctr,
+ char *prefix,
+ int *print_to_p,
+ void *print_to_arg,
+ Uint **hpp,
+ Uint *szp)
+{
+ Eterm res = THE_NON_VALUE;
+
+ if (print_to_p) {
+ erts_print(*print_to_p,
+ print_to_arg,
+ "%sas: %s\n",
+ prefix,
+ "aoff");
+ }
+
+ if (hpp || szp) {
+
+ if (!atoms_initialized)
+ erl_exit(1, "%s:%d: Internal error: Atoms not initialized",
+ __FILE__, __LINE__);;
+
+ res = NIL;
+ add_2tup(hpp, szp, &res, am.as, am.aoff);
+ }
+
+ return res;
+}
+
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\
+ * NOTE: erts_aoffalc_test() is only supposed to be used for testing. *
+ * *
+ * Keep alloc_SUITE_data/allocator_test.h updated if changes are made *
+ * to erts_aoffalc_test() *
+\* */
+
+unsigned long
+erts_aoffalc_test(unsigned long op, unsigned long a1, unsigned long a2)
+{
+ switch (op) {
+ case 0x500: return (unsigned long) 0; /* IS_AOBF */
+ case 0x501: return (unsigned long) ((AOFFAllctr_t *) a1)->mbc_root;
+ case 0x502: return (unsigned long) ((AOFF_RBTree_t *) a1)->parent;
+ case 0x503: return (unsigned long) ((AOFF_RBTree_t *) a1)->left;
+ case 0x504: return (unsigned long) ((AOFF_RBTree_t *) a1)->right;
+ case 0x506: return (unsigned long) IS_BLACK((AOFF_RBTree_t *) a1);
+ case 0x508: return (unsigned long) 1; /* IS_AOFF */
+ case 0x509: return (unsigned long) ((AOFF_RBTree_t *) a1)->max_sz;
+ default: ASSERT(0); return ~((unsigned long) 0);
+ }
+}
+
+
+/* * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * *\
+ * Debug functions *
+\* */
+
+
+#ifdef HARD_DEBUG
+
+#define IS_LEFT_VISITED(FB) ((FB)->flags & LEFT_VISITED_FLG)
+#define IS_RIGHT_VISITED(FB) ((FB)->flags & RIGHT_VISITED_FLG)
+
+#define SET_LEFT_VISITED(FB) ((FB)->flags |= LEFT_VISITED_FLG)
+#define SET_RIGHT_VISITED(FB) ((FB)->flags |= RIGHT_VISITED_FLG)
+
+#define UNSET_LEFT_VISITED(FB) ((FB)->flags &= ~LEFT_VISITED_FLG)
+#define UNSET_RIGHT_VISITED(FB) ((FB)->flags &= ~RIGHT_VISITED_FLG)
+
+
+#if 0
+# define PRINT_TREE
+#else
+# undef PRINT_TREE
+#endif
+
+#ifdef PRINT_TREE
+static void print_tree(AOFF_RBTree_t*);
+#endif
+
+/*
+ * Checks that the order between parent and children are correct,
+ * and that the Red-Black Tree properies are satisfied. if size > 0,
+ * check_tree() returns the node that satisfies "address order first fit"
+ *
+ * The Red-Black Tree properies are:
+ * 1. Every node is either red or black.
+ * 2. Every leaf (NIL) is black.
+ * 3. If a node is red, then both its children are black.
+ * 4. Every simple path from a node to a descendant leaf
+ * contains the same number of black nodes.
+ *
+ * + own.max_size == MAX(own.size, left.max_size, right.max_size)
+ */
+
+static AOFF_RBTree_t *
+check_tree(AOFF_RBTree_t* root, Uint size)
+{
+ AOFF_RBTree_t *res = NULL;
+ Sint blacks;
+ Sint curr_blacks;
+ AOFF_RBTree_t *x;
+
+#ifdef PRINT_TREE
+ print_tree(root);
+#endif
+
+ if (!root)
+ return res;
+
+ x = root;
+ ASSERT(IS_BLACK(x));
+ ASSERT(!x->parent);
+ curr_blacks = 1;
+ blacks = -1;
+
+ while (x) {
+ if (!IS_LEFT_VISITED(x)) {
+ SET_LEFT_VISITED(x);
+ if (x->left) {
+ x = x->left;
+ if (IS_BLACK(x))
+ curr_blacks++;
+ continue;
+ }
+ else {
+ if (blacks < 0)
+ blacks = curr_blacks;
+ ASSERT(blacks == curr_blacks);
+ }
+ }
+
+ if (!IS_RIGHT_VISITED(x)) {
+ SET_RIGHT_VISITED(x);
+ if (x->right) {
+ x = x->right;
+ if (IS_BLACK(x))
+ curr_blacks++;
+ continue;
+ }
+ else {
+ if (blacks < 0)
+ blacks = curr_blacks;
+ ASSERT(blacks == curr_blacks);
+ }
+ }
+
+
+ if (IS_RED(x)) {
+ ASSERT(IS_BLACK(x->right));
+ ASSERT(IS_BLACK(x->left));
+ }
+
+ ASSERT(x->parent || x == root);
+
+ if (x->left) {
+ ASSERT(x->left->parent == x);
+ ASSERT(x->left < x);
+ ASSERT(x->left->max_sz <= x->max_sz);
+ }
+
+ if (x->right) {
+ ASSERT(x->right->parent == x);
+ ASSERT(x->right > x);
+ ASSERT(x->right->max_sz <= x->max_sz);
+ }
+ ASSERT(x->max_sz >= BLK_SZ(x));
+ ASSERT(x->max_sz == BLK_SZ(x)
+ || x->max_sz == (x->left ? x->left->max_sz : 0)
+ || x->max_sz == (x->right ? x->right->max_sz : 0));
+
+ if (size && BLK_SZ(x) >= size) {
+ if (!res || x < res) {
+ res = x;
+ }
+ }
+
+ UNSET_LEFT_VISITED(x);
+ UNSET_RIGHT_VISITED(x);
+ if (IS_BLACK(x))
+ curr_blacks--;
+ x = x->parent;
+
+ }
+
+ ASSERT(curr_blacks == 0);
+
+ UNSET_LEFT_VISITED(root);
+ UNSET_RIGHT_VISITED(root);
+
+ return res;
+
+}
+
+
+#ifdef PRINT_TREE
+#define INDENT_STEP 2
+
+#include <stdio.h>
+
+static void
+print_tree_aux(AOFF_RBTree_t *x, int indent)
+{
+ int i;
+
+ if (x) {
+ print_tree_aux(x->right, indent + INDENT_STEP);
+ for (i = 0; i < indent; i++) {
+ putc(' ', stderr);
+ }
+ fprintf(stderr, "%s: sz=%lu addr=0x%lx max_size=%lu\r\n",
+ IS_BLACK(x) ? "BLACK" : "RED",
+ BLK_SZ(x), (Uint)x, x->max_sz);
+ print_tree_aux(x->left, indent + INDENT_STEP);
+ }
+}
+
+
+static void
+print_tree(AOFF_RBTree_t* root)
+{
+ fprintf(stderr, " --- AOFF tree begin ---\r\n");
+ print_tree_aux(root, 0);
+ fprintf(stderr, " --- AOFF tree end ---\r\n");
+}
+
+#endif /* PRINT_TREE */
+
+#endif /* HARD_DEBUG */
+
diff --git a/erts/emulator/beam/erl_ao_firstfit_alloc.h b/erts/emulator/beam/erl_ao_firstfit_alloc.h
new file mode 100644
index 0000000000..0bf0ec8cee
--- /dev/null
+++ b/erts/emulator/beam/erl_ao_firstfit_alloc.h
@@ -0,0 +1,60 @@
+/*
+ * %CopyrightBegin%
+ *
+ * Copyright Ericsson AB 2003-2009. All Rights Reserved.
+ *
+ * The contents of this file are subject to the Erlang Public License,
+ * Version 1.1, (the "License"); you may not use this file except in
+ * compliance with the License. You should have received a copy of the
+ * Erlang Public License along with this software. If not, it can be
+ * retrieved online at http://www.erlang.org/.
+ *
+ * Software distributed under the License is distributed on an "AS IS"
+ * basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+ * the License for the specific language governing rights and limitations
+ * under the License.
+ *
+ * %CopyrightEnd%
+ */
+
+
+#ifndef ERL_AO_FIRSTFIT_ALLOC__
+#define ERL_AO_FIRSTFIT_ALLOC__
+
+#include "erl_alloc_util.h"
+
+#define ERTS_ALC_AOFF_ALLOC_VSN_STR "0.9"
+
+typedef struct AOFFAllctr_t_ AOFFAllctr_t;
+
+typedef struct {
+ int dummy;
+} AOFFAllctrInit_t;
+
+#define ERTS_DEFAULT_AOFF_ALLCTR_INIT {0/*dummy*/}
+
+void erts_aoffalc_init(void);
+Allctr_t *erts_aoffalc_start(AOFFAllctr_t *, AOFFAllctrInit_t*, AllctrInit_t *);
+
+#endif /* #ifndef ERL_AO_FIRSTFIT_ALLOC__ */
+
+
+
+#if defined(GET_ERL_AOFF_ALLOC_IMPL) && !defined(ERL_AOFF_ALLOC_IMPL__)
+#define ERL_AOFF_ALLOC_IMPL__
+
+#define GET_ERL_ALLOC_UTIL_IMPL
+#include "erl_alloc_util.h"
+
+
+struct AOFFAllctr_t_ {
+ Allctr_t allctr; /* Has to be first! */
+
+ struct AOFF_RBTree_t_* mbc_root;
+ struct AOFF_RBTree_t_* sbmbc_root;
+};
+
+unsigned long erts_aoffalc_test(unsigned long, unsigned long, unsigned long);
+
+#endif /* #if defined(GET_ERL_AOFF_ALLOC_IMPL)
+ && !defined(ERL_AOFF_ALLOC_IMPL__) */
diff --git a/erts/emulator/beam/erl_bestfit_alloc.c b/erts/emulator/beam/erl_bestfit_alloc.c
index d9b1170a3d..5e3032ddaa 100644
--- a/erts/emulator/beam/erl_bestfit_alloc.c
+++ b/erts/emulator/beam/erl_bestfit_alloc.c
@@ -979,6 +979,7 @@ erts_bfalc_test(unsigned long op, unsigned long a1, unsigned long a2)
case 0x205: return (unsigned long) ((RBTreeList_t *) a1)->next;
case 0x206: return (unsigned long) IS_BLACK((RBTree_t *) a1);
case 0x207: return (unsigned long) IS_TREE_NODE((RBTree_t *) a1);
+ case 0x208: return (unsigned long) 0; /* IS_AOFF */
default: ASSERT(0); return ~((unsigned long) 0);
}
}
diff --git a/erts/emulator/beam/erl_bits.h b/erts/emulator/beam/erl_bits.h
index 0f67733fa4..3309ea706b 100644
--- a/erts/emulator/beam/erl_bits.h
+++ b/erts/emulator/beam/erl_bits.h
@@ -150,7 +150,7 @@ void erts_bits_destroy_state(ERL_BITS_PROTO_0);
* NBYTES(x) returns the number of bytes needed to store x bits.
*/
-#define NBYTES(x) (((x) + 7) >> 3)
+#define NBYTES(x) (((Uint64)(x) + (Uint64) 7) >> 3)
#define BYTE_OFFSET(ofs) ((Uint) (ofs) >> 3)
#define BIT_OFFSET(ofs) ((ofs) & 7)
diff --git a/erts/emulator/beam/erl_gc.c b/erts/emulator/beam/erl_gc.c
index 5edcd667e7..e3445bcdc5 100644
--- a/erts/emulator/beam/erl_gc.c
+++ b/erts/emulator/beam/erl_gc.c
@@ -100,14 +100,14 @@ static Uint combined_message_size(Process* p);
static void remove_message_buffers(Process* p);
static int major_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl);
static int minor_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl);
-static void do_minor(Process *p, int new_sz, Eterm* objv, int nobj);
+static void do_minor(Process *p, Uint new_sz, Eterm* objv, int nobj);
static Eterm* sweep_rootset(Rootset *rootset, Eterm* htop, char* src, Uint src_size);
static Eterm* sweep_one_area(Eterm* n_hp, Eterm* n_htop, char* src, Uint src_size);
static Eterm* sweep_one_heap(Eterm* heap_ptr, Eterm* heap_end, Eterm* htop,
char* src, Uint src_size);
static Eterm* collect_heap_frags(Process* p, Eterm* heap,
Eterm* htop, Eterm* objv, int nobj);
-static Uint adjust_after_fullsweep(Process *p, int size_before,
+static Uint adjust_after_fullsweep(Process *p, Uint size_before,
int need, Eterm *objv, int nobj);
static void shrink_new_heap(Process *p, Uint new_sz, Eterm *objv, int nobj);
static void grow_new_heap(Process *p, Uint new_sz, Eterm* objv, int nobj);
@@ -441,7 +441,15 @@ erts_garbage_collect(Process* p, int need, Eterm* objv, int nobj)
p->last_old_htop = p->old_htop;
#endif
- return ((int) (HEAP_TOP(p) - HEAP_START(p)) / 10);
+ /* FIXME: This function should really return an Sint, i.e., a possibly
+ 64 bit wide signed integer, but that requires updating all the code
+ that calls it. For now, we just return INT_MAX if the result is too
+ large for an int. */
+ {
+ Sint result = (HEAP_TOP(p) - HEAP_START(p)) / 10;
+ if (result >= INT_MAX) return INT_MAX;
+ else return (int) result;
+ }
}
/*
@@ -599,7 +607,7 @@ erts_garbage_collect_literals(Process* p, Eterm* literals, Uint lit_size)
char* area;
Uint area_size;
Eterm* old_htop;
- int n;
+ Uint n;
/*
* Set GC state.
@@ -731,7 +739,7 @@ minor_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
* This improved Estone by more than 1200 estones on my computer
* (Ultra Sparc 10).
*/
- size_t new_sz = erts_next_heap_size(HEAP_TOP(p) - HEAP_START(p), 1);
+ Uint new_sz = erts_next_heap_size(HEAP_TOP(p) - HEAP_START(p), 1);
/* Create new, empty old_heap */
n_old = (Eterm *) ERTS_HEAP_ALLOC(ERTS_ALC_T_OLD_HEAP,
@@ -871,12 +879,12 @@ minor_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
#endif /* HIPE */
static void
-do_minor(Process *p, int new_sz, Eterm* objv, int nobj)
+do_minor(Process *p, Uint new_sz, Eterm* objv, int nobj)
{
Rootset rootset; /* Rootset for GC (stack, dictionary, etc). */
Roots* roots;
Eterm* n_htop;
- int n;
+ Uint n;
Eterm* ptr;
Eterm val;
Eterm gval;
@@ -1079,14 +1087,14 @@ major_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
{
Rootset rootset;
Roots* roots;
- int size_before;
+ Uint size_before;
Eterm* n_heap;
Eterm* n_htop;
char* src = (char *) HEAP_START(p);
Uint src_size = (char *) HEAP_TOP(p) - src;
char* oh = (char *) OLD_HEAP(p);
Uint oh_size = (char *) OLD_HTOP(p) - oh;
- int n;
+ Uint n;
Uint new_sz;
Uint fragments = MBUF_SIZE(p) + combined_message_size(p);
ErlMessage *msgp;
@@ -1312,10 +1320,10 @@ major_collection(Process* p, int need, Eterm* objv, int nobj, Uint *recl)
}
static Uint
-adjust_after_fullsweep(Process *p, int size_before, int need, Eterm *objv, int nobj)
+adjust_after_fullsweep(Process *p, Uint size_before, int need, Eterm *objv, int nobj)
{
- int wanted, sz, size_after, need_after;
- int stack_size = STACK_SZ_ON_HEAP(p);
+ Uint wanted, sz, size_after, need_after;
+ Uint stack_size = STACK_SZ_ON_HEAP(p);
Uint reclaimed_now;
size_after = (HEAP_TOP(p) - HEAP_START(p));
@@ -1915,8 +1923,8 @@ static void
grow_new_heap(Process *p, Uint new_sz, Eterm* objv, int nobj)
{
Eterm* new_heap;
- int heap_size = HEAP_TOP(p) - HEAP_START(p);
- int stack_size = p->hend - p->stop;
+ Uint heap_size = HEAP_TOP(p) - HEAP_START(p);
+ Uint stack_size = p->hend - p->stop;
Sint offs;
ASSERT(HEAP_SIZE(p) < new_sz);
@@ -1954,10 +1962,10 @@ static void
shrink_new_heap(Process *p, Uint new_sz, Eterm *objv, int nobj)
{
Eterm* new_heap;
- int heap_size = HEAP_TOP(p) - HEAP_START(p);
+ Uint heap_size = HEAP_TOP(p) - HEAP_START(p);
Sint offs;
- int stack_size = p->hend - p->stop;
+ Uint stack_size = p->hend - p->stop;
ASSERT(new_sz < p->heap_sz);
sys_memmove(p->heap + new_sz - stack_size, p->stop, stack_size *
diff --git a/erts/emulator/beam/erl_instrument.c b/erts/emulator/beam/erl_instrument.c
index c5615818f2..04ea004ef7 100644
--- a/erts/emulator/beam/erl_instrument.c
+++ b/erts/emulator/beam/erl_instrument.c
@@ -1152,14 +1152,6 @@ erts_instr_get_type_info(Process *proc)
return res;
}
-#if HALFWORD_HEAP
-#define ERTS_IS_SBMBC_ALLOCATOR_NO__(NO) \
- ((NO) == ERTS_ALC_A_SBMBC || (NO) == ERTS_ALC_A_SBMBC_LOW)
-#else
-#define ERTS_IS_SBMBC_ALLOCATOR_NO__(NO) \
- ((NO) == ERTS_ALC_A_SBMBC)
-#endif
-
Uint
erts_instr_init(int stat, int map_stat)
{
diff --git a/erts/emulator/beam/erl_nif.c b/erts/emulator/beam/erl_nif.c
index 68421b4387..6e7ac43676 100644
--- a/erts/emulator/beam/erl_nif.c
+++ b/erts/emulator/beam/erl_nif.c
@@ -578,7 +578,15 @@ int enif_is_identical(Eterm lhs, Eterm rhs)
int enif_compare(Eterm lhs, Eterm rhs)
{
- return CMP(lhs,rhs);
+ Sint result = CMP(lhs,rhs);
+
+ if (result < 0) {
+ return -1;
+ } else if (result > 0) {
+ return 1;
+ }
+
+ return result;
}
int enif_get_tuple(ErlNifEnv* env, Eterm tpl, int* arity, const Eterm** array)
@@ -833,8 +841,11 @@ ERL_NIF_TERM enif_make_uint(ErlNifEnv* env, unsigned i)
ERL_NIF_TERM enif_make_long(ErlNifEnv* env, long i)
{
+ if (IS_SSMALL(i)) {
+ return make_small(i);
+ }
#if SIZEOF_LONG == ERTS_SIZEOF_ETERM
- return IS_SSMALL(i) ? make_small(i) : small_to_big(i, alloc_heap(env,2));
+ return small_to_big(i, alloc_heap(env,2));
#elif SIZEOF_LONG == 8
ensure_heap(env,3);
return erts_sint64_to_big(i, &env->hp);
@@ -843,8 +854,11 @@ ERL_NIF_TERM enif_make_long(ErlNifEnv* env, long i)
ERL_NIF_TERM enif_make_ulong(ErlNifEnv* env, unsigned long i)
{
+ if (IS_USMALL(0,i)) {
+ return make_small(i);
+ }
#if SIZEOF_LONG == ERTS_SIZEOF_ETERM
- return IS_USMALL(0,i) ? make_small(i) : uint_to_big(i,alloc_heap(env,2));
+ return uint_to_big(i,alloc_heap(env,2));
#elif SIZEOF_LONG == 8
ensure_heap(env,3);
return erts_uint64_to_big(i, &env->hp);
diff --git a/erts/emulator/beam/erl_process.c b/erts/emulator/beam/erl_process.c
index 2704359a8f..d8aed63544 100644
--- a/erts/emulator/beam/erl_process.c
+++ b/erts/emulator/beam/erl_process.c
@@ -5782,10 +5782,13 @@ erts_sched_stat_term(Process *p, int total)
void
erts_schedule_misc_op(void (*func)(void *), void *arg)
{
- ErtsRunQueue *rq = erts_get_runq_current(NULL);
+ ErtsRunQueue *rq;
ErtsMiscOpList *molp = misc_op_list_alloc();
+ ErtsSchedulerData *esdp = erts_get_scheduler_data();
- if (!rq) {
+ if (esdp) {
+ rq = esdp->run_queue;
+ } else {
/*
* This can only happen when the sys msg dispatcher
* thread schedules misc ops (this happens *very*
diff --git a/erts/emulator/beam/external.c b/erts/emulator/beam/external.c
index 1a102f7187..6953e7fe7d 100644
--- a/erts/emulator/beam/external.c
+++ b/erts/emulator/beam/external.c
@@ -459,6 +459,12 @@ Uint erts_encode_ext_size(Eterm term)
+ 1 /* VERSION_MAGIC */;
}
+Uint erts_encode_ext_size_2(Eterm term, unsigned dflags)
+{
+ return encode_size_struct2(NULL, term, TERM_TO_BINARY_DFLAGS|dflags)
+ + 1 /* VERSION_MAGIC */;
+}
+
Uint erts_encode_ext_size_ets(Eterm term)
{
return encode_size_struct2(NULL, term, TERM_TO_BINARY_DFLAGS|DFLAGS_INTERNAL_TAGS);
@@ -1262,6 +1268,49 @@ external_size_1(Process* p, Eterm Term)
}
Eterm
+external_size_2(Process* p, Eterm Term, Eterm Flags)
+{
+ Uint size;
+ Uint flags = TERM_TO_BINARY_DFLAGS;
+
+ while (is_list(Flags)) {
+ Eterm arg = CAR(list_val(Flags));
+ Eterm* tp;
+
+ if (is_tuple(arg) && *(tp = tuple_val(arg)) == make_arityval(2)) {
+ if (tp[1] == am_minor_version && is_small(tp[2])) {
+ switch (signed_val(tp[2])) {
+ case 0:
+ break;
+ case 1:
+ flags |= DFLAG_NEW_FLOATS;
+ break;
+ default:
+ goto error;
+ }
+ } else {
+ goto error;
+ }
+ } else {
+ error:
+ BIF_ERROR(p, BADARG);
+ }
+ Flags = CDR(list_val(Flags));
+ }
+ if (is_not_nil(Flags)) {
+ goto error;
+ }
+
+ size = erts_encode_ext_size_2(Term, flags);
+ if (IS_USMALL(0, size)) {
+ BIF_RET(make_small(size));
+ } else {
+ Eterm* hp = HAlloc(p, BIG_UINT_HEAP_SIZE);
+ BIF_RET(uint_to_big(size, hp));
+ }
+}
+
+Eterm
erts_term_to_binary(Process* p, Eterm Term, int level, Uint flags)
{
Uint size;
diff --git a/erts/emulator/beam/external.h b/erts/emulator/beam/external.h
index d8287b96a4..72fe74baf2 100644
--- a/erts/emulator/beam/external.h
+++ b/erts/emulator/beam/external.h
@@ -160,6 +160,7 @@ Uint erts_encode_dist_ext_size(Eterm, Uint32, ErtsAtomCacheMap *);
void erts_encode_dist_ext(Eterm, byte **, Uint32, ErtsAtomCacheMap *);
Uint erts_encode_ext_size(Eterm);
+Uint erts_encode_ext_size_2(Eterm, unsigned);
Uint erts_encode_ext_size_ets(Eterm);
void erts_encode_ext(Eterm, byte **);
byte* erts_encode_ext_ets(Eterm, byte *, struct erl_off_heap_header** ext_off_heap);
diff --git a/erts/emulator/beam/ops.tab b/erts/emulator/beam/ops.tab
index 8a5763b4bb..304ce22ef2 100644
--- a/erts/emulator/beam/ops.tab
+++ b/erts/emulator/beam/ops.tab
@@ -1236,7 +1236,7 @@ i_bs_init_heap I I I d
i_bs_init_heap_bin_heap I I I d
-bs_init_bits Fail Sz Words Regs Flags Dst | binary_too_big_bits(Sz) => system_limit Fail
+bs_init_bits Fail Sz=o Words Regs Flags Dst => system_limit Fail
bs_init_bits Fail Sz=u Words=u==0 Regs Flags Dst => i_bs_init_bits Sz Regs Dst
bs_init_bits Fail Sz=u Words Regs Flags Dst => i_bs_init_bits_heap Sz Words Regs Dst
diff --git a/erts/emulator/drivers/common/inet_drv.c b/erts/emulator/drivers/common/inet_drv.c
index 40c4a0df08..ebc4469a23 100644
--- a/erts/emulator/drivers/common/inet_drv.c
+++ b/erts/emulator/drivers/common/inet_drv.c
@@ -3709,6 +3709,8 @@ static int inet_ctl_fdopen(inet_descriptor* desc, int domain, int type,
/* check that it is a socket and that the socket is bound */
if (IS_SOCKET_ERROR(sock_name(s, (struct sockaddr*) &name, &sz)))
return ctl_error(sock_errno(), rbuf, rsize);
+ if (name.sa.sa_family != domain)
+ return ctl_error(EINVAL, rbuf, rsize);
desc->s = s;
if ((desc->event = sock_create_event(desc)) == INVALID_EVENT)
return ctl_error(sock_errno(), rbuf, rsize);
@@ -9739,7 +9741,7 @@ static int packet_inet_ctl(ErlDrvData e, unsigned int cmd, char* buf, int len,
if (desc->active || (len != 8))
return ctl_error(EINVAL, rbuf, rsize);
timeout = get_int32(buf);
- /* The 2nd arg, Length(4), is ignored for both UDP ans SCTP protocols,
+ /* The 2nd arg, Length(4), is ignored for both UDP and SCTP protocols,
since they are msg-oriented. */
if (enq_async(desc, tbuf, PACKET_REQ_RECV) < 0)
diff --git a/erts/emulator/hipe/hipe_mode_switch.c b/erts/emulator/hipe/hipe_mode_switch.c
index 16f8fb1347..e3e8367b62 100644
--- a/erts/emulator/hipe/hipe_mode_switch.c
+++ b/erts/emulator/hipe/hipe_mode_switch.c
@@ -346,7 +346,12 @@ Process *hipe_mode_switch(Process *p, unsigned cmd, Eterm reg[])
p->arity = callee_arity;
}
- /* If process is in P_WAITING state, we schedule the next process */
+ /* Schedule next process if current process was hibernated or is waiting
+ for messages */
+ if (p->flags & F_HIBERNATE_SCHED) {
+ p->flags &= ~F_HIBERNATE_SCHED;
+ goto do_schedule;
+ }
if (p->status == P_WAITING) {
goto do_schedule;
}
diff --git a/erts/emulator/test/alloc_SUITE_data/allocator_test.h b/erts/emulator/test/alloc_SUITE_data/allocator_test.h
index b869a4079c..8b34375980 100644
--- a/erts/emulator/test/alloc_SUITE_data/allocator_test.h
+++ b/erts/emulator/test/alloc_SUITE_data/allocator_test.h
@@ -82,15 +82,17 @@ typedef void* erts_cond;
#define NO_OF_BKTS ((Ulong) ALC_TEST0(0x102))
#define FIND_BKT(A, I) ((int) ALC_TEST2(0x103, (A), (I)))
-/* From erl_bestfit_alloc.c */
-#define IS_AOBF(A) ((Ulong) ALC_TEST1(0x200, (A)))
-#define RBT_ROOT(A) ((RBT_t *) ALC_TEST1(0x201, (A)))
-#define RBT_PARENT(T) ((RBT_t *) ALC_TEST1(0x202, (T)))
-#define RBT_LEFT(T) ((RBT_t *) ALC_TEST1(0x203, (T)))
-#define RBT_RIGHT(T) ((RBT_t *) ALC_TEST1(0x204, (T)))
-#define RBT_NEXT(T) ((RBTL_t *) ALC_TEST1(0x205, (T)))
-#define RBT_IS_BLACK(T) ((Ulong) ALC_TEST1(0x206, (T)))
-#define RBT_IS_TREE(T) ((Ulong) ALC_TEST1(0x207, (T)))
+/* From erl_bestfit_alloc.c and erl_ao_firstfit_alloc.c */
+#define IS_AOBF(A) ((Ulong) ALC_TEST1(RBT_OP(0), (A)))
+#define RBT_ROOT(A) ((RBT_t *) ALC_TEST1(RBT_OP(1), (A)))
+#define RBT_PARENT(T) ((RBT_t *) ALC_TEST1(RBT_OP(2), (T)))
+#define RBT_LEFT(T) ((RBT_t *) ALC_TEST1(RBT_OP(3), (T)))
+#define RBT_RIGHT(T) ((RBT_t *) ALC_TEST1(RBT_OP(4), (T)))
+#define RBT_NEXT(T) ((RBTL_t *) ALC_TEST1(RBT_OP(5), (T)))
+#define RBT_IS_BLACK(T) ((Ulong) ALC_TEST1(RBT_OP(6), (T)))
+#define RBT_IS_TREE(T) ((Ulong) ALC_TEST1(RBT_OP(7), (T)))
+#define IS_AOFF(A) ((Ulong) ALC_TEST1(RBT_OP(8), (A)))
+#define RBT_MAX_SZ(T) ((Ulong) ALC_TEST1(RBT_OP(9), (T)))
/* From erl_mseg.c */
#define HAVE_MSEG() ((int) ALC_TEST0(0x400))
diff --git a/erts/emulator/test/alloc_SUITE_data/coalesce.c b/erts/emulator/test/alloc_SUITE_data/coalesce.c
index c84da97d35..6f35d3279b 100644
--- a/erts/emulator/test/alloc_SUITE_data/coalesce.c
+++ b/erts/emulator/test/alloc_SUITE_data/coalesce.c
@@ -267,7 +267,7 @@ void
testcase_run(TestCaseState_t *tcs)
{
char *argv_org[] = {"-tmmbcs1024", "-tsbct2048", "-trmbcmt100", "-tas", NULL, NULL};
- char *alg[] = {"af", "gf", "bf", "aobf", NULL};
+ char *alg[] = {"af", "gf", "bf", "aobf", "aoff", NULL};
int i;
for (i = 0; alg[i]; i++) {
diff --git a/erts/emulator/test/alloc_SUITE_data/rbtree.c b/erts/emulator/test/alloc_SUITE_data/rbtree.c
index c97e0aac1a..4e7f821baf 100644
--- a/erts/emulator/test/alloc_SUITE_data/rbtree.c
+++ b/erts/emulator/test/alloc_SUITE_data/rbtree.c
@@ -34,6 +34,14 @@ typedef struct {
#define PRINT_TREE
#endif
+/* Ugly hack to steer the test code towards the right allocator */
+#define RBT_OP(CMD) (current_rbt_type_op_base + (CMD))
+static enum {
+ BESTFIT_OP_BASE = 0x200,
+ AO_FIRSTFIT_OP_BASE = 0x500
+}current_rbt_type_op_base;
+
+
#ifdef PRINT_TREE
#define INDENT_STEP 5
@@ -65,12 +73,11 @@ print_tree_aux(TestCaseState_t *tcs, RBT_t *x, int indent)
static void
-print_tree(TestCaseState_t *tcs, RBT_t *root, int aobf)
+print_tree(TestCaseState_t *tcs, RBT_t *root)
{
- char *type = aobf ? "Size-Adress" : "Size";
- testcase_printf(tcs, " --- %s tree begin ---\r\n", type);
+ testcase_printf(tcs, " --- Tree begin ---\r\n");
print_tree_aux(tcs, root, 0);
- testcase_printf(tcs, " --- %s tree end ---\r\n", type);
+ testcase_printf(tcs, " --- Tree end ---\r\n");
}
#endif
@@ -78,7 +85,8 @@ print_tree(TestCaseState_t *tcs, RBT_t *root, int aobf)
static RBT_t *
check_tree(TestCaseState_t *tcs, Allctr_t *alc, Ulong size)
{
- int i, max_i, address_order;
+ enum { BF, AOBF, AOFF }type;
+ int i, max_i;
char stk[128];
RBT_t *root, *x, *y, *res;
Ulong x_sz, y_sz, is_x_black;
@@ -86,11 +94,14 @@ check_tree(TestCaseState_t *tcs, Allctr_t *alc, Ulong size)
res = NULL;
- address_order = IS_AOBF(alc);
+ if (IS_AOBF(alc)) type = AOBF;
+ else if (IS_AOFF(alc)) type = AOFF;
+ else type = BF;
+
root = RBT_ROOT(alc);
#ifdef PRINT_TREE
- print_tree(tcs, root, address_order);
+ print_tree(tcs, root);
#endif
max_i = i = -1;
@@ -165,12 +176,18 @@ check_tree(TestCaseState_t *tcs, Allctr_t *alc, Ulong size)
if (y) {
y_sz = BLK_SZ(y);
ASSERT(tcs, RBT_PARENT(y) == x);
- if (address_order) {
+ switch (type) {
+ case AOBF:
ASSERT(tcs, y_sz < x_sz || (y_sz == x_sz && y < x));
- }
- else {
+ break;
+ case BF:
ASSERT(tcs, RBT_IS_TREE(y));
ASSERT(tcs, y_sz < x_sz);
+ break;
+ case AOFF:
+ ASSERT(tcs, y < x);
+ ASSERT(tcs, RBT_MAX_SZ(y) <= RBT_MAX_SZ(x));
+ break;
}
}
@@ -178,16 +195,22 @@ check_tree(TestCaseState_t *tcs, Allctr_t *alc, Ulong size)
if (y) {
y_sz = BLK_SZ(y);
ASSERT(tcs, RBT_PARENT(y) == x);
- if (address_order) {
+ switch (type) {
+ case AOBF:
ASSERT(tcs, y_sz > x_sz || (y_sz == x_sz && y > x));
- }
- else {
+ break;
+ case BF:
ASSERT(tcs, RBT_IS_TREE(y));
ASSERT(tcs, y_sz > x_sz);
+ break;
+ case AOFF:
+ ASSERT(tcs, y > x);
+ ASSERT(tcs, RBT_MAX_SZ(y) <= RBT_MAX_SZ(x));
+ break;
}
}
- if (!address_order) {
+ if (type == BF) {
Ulong l_sz;
RBTL_t *l = RBT_NEXT(x);
for (l = RBT_NEXT(x); l; l = RBT_NEXT(l)) {
@@ -202,13 +225,20 @@ check_tree(TestCaseState_t *tcs, Allctr_t *alc, Ulong size)
res = x;
else {
y_sz = BLK_SZ(res);
- if (address_order) {
+ switch (type) {
+ case AOBF:
if (x_sz < y_sz || (x_sz == y_sz && x < res))
res = x;
- }
- else {
- if (!res || x_sz < y_sz)
+ break;
+ case BF:
+ if (x_sz < y_sz)
res = x;
+ break;
+ case AOFF:
+ if (x < res) {
+ res = x;
+ }
+ break;
}
}
}
@@ -257,7 +287,7 @@ static void
test_it(TestCaseState_t *tcs)
{
int i;
- Allctr_t a = ((rbtree_test_data *) tcs->extra)->allocator;
+ Allctr_t* a = ((rbtree_test_data *) tcs->extra)->allocator;
void **blk = ((rbtree_test_data *) tcs->extra)->blk;
void **fence = ((rbtree_test_data *) tcs->extra)->fence;
Ulong min_blk_sz;
@@ -338,6 +368,7 @@ testcase_run(TestCaseState_t *tcs)
{
char *argv1[] = {"-tasbf", NULL};
char *argv2[] = {"-tasaobf", NULL};
+ char *argv3[] = {"-tasaoff", NULL};
Allctr_t *a;
rbtree_test_data *td;
@@ -355,6 +386,7 @@ testcase_run(TestCaseState_t *tcs)
testcase_printf(tcs, "Starting test of best fit...\n");
+ current_rbt_type_op_base = BESTFIT_OP_BASE;
td->allocator = a = START_ALC("rbtree_bf_", 0, argv1);
ASSERT(tcs, a);
@@ -371,6 +403,7 @@ testcase_run(TestCaseState_t *tcs)
testcase_printf(tcs, "Starting test of address order best fit...\n");
+ current_rbt_type_op_base = BESTFIT_OP_BASE;
td->allocator = a = START_ALC("rbtree_aobf_", 0, argv2);
ASSERT(tcs, a);
@@ -383,4 +416,19 @@ testcase_run(TestCaseState_t *tcs)
testcase_printf(tcs, "Address order best fit test succeeded!\n");
+ /* Address order first fit... */
+
+ testcase_printf(tcs, "Starting test of address order first fit...\n");
+
+ current_rbt_type_op_base = AO_FIRSTFIT_OP_BASE;
+ td->allocator = a = START_ALC("rbtree_aoff_", 0, argv3);
+
+ ASSERT(tcs, a);
+
+ test_it(tcs);
+
+ STOP_ALC(a);
+ td->allocator = NULL;
+
+ testcase_printf(tcs, "Address order first fit test succeeded!\n");
}
diff --git a/erts/emulator/test/binary_SUITE.erl b/erts/emulator/test/binary_SUITE.erl
index 4e82381fba..fed5854112 100644
--- a/erts/emulator/test/binary_SUITE.erl
+++ b/erts/emulator/test/binary_SUITE.erl
@@ -478,6 +478,11 @@ terms(Config) when is_list(Config) ->
Sz when is_integer(Sz), size(Bin) =< Sz ->
ok
end,
+ Bin1 = term_to_binary(Term, [{minor_version, 1}]),
+ case erlang:external_size(Bin1, [{minor_version, 1}]) of
+ Sz1 when is_integer(Sz1), size(Bin1) =< Sz1 ->
+ ok
+ end,
Term = binary_to_term(Bin),
Term = binary_to_term(Bin, [safe]),
Unaligned = make_unaligned_sub_binary(Bin),
@@ -510,7 +515,12 @@ terms_float(Config) when is_list(Config) ->
Term = binary_to_term(Bin0),
Bin1 = term_to_binary(Term, [{minor_version,1}]),
Term = binary_to_term(Bin1),
- true = size(Bin1) < size(Bin0)
+ true = size(Bin1) < size(Bin0),
+ Size0 = erlang:external_size(Term),
+ Size00 = erlang:external_size(Term, [{minor_version, 0}]),
+ Size1 = erlang:external_size(Term, [{minor_version, 1}]),
+ true = (Size0 =:= Size00),
+ true = Size1 < Size0
end).
external_size(Config) when is_list(Config) ->
@@ -526,7 +536,9 @@ external_size(Config) when is_list(Config) ->
io:format(" Aligned size: ~p\n", [Sz1]),
io:format("Unaligned size: ~p\n", [Sz2]),
?line ?t:fail()
- end.
+ end,
+ ?line erlang:external_size(Bin) =:= erlang:external_size(Bin, [{minor_version, 1}]),
+ ?line erlang:external_size(Unaligned) =:= erlang:external_size(Unaligned, [{minor_version, 1}]).
external_size_1(Term, Size0, Limit) when Size0 < Limit ->
case erlang:external_size(Term) of
diff --git a/erts/emulator/test/bs_construct_SUITE.erl b/erts/emulator/test/bs_construct_SUITE.erl
index 1959803385..7fdf36711b 100644
--- a/erts/emulator/test/bs_construct_SUITE.erl
+++ b/erts/emulator/test/bs_construct_SUITE.erl
@@ -553,6 +553,11 @@ huge_float_check({'EXIT',{badarg,_}}) -> ok.
huge_binary(Config) when is_list(Config) ->
?line 16777216 = size(<<0:(id(1 bsl 26)),(-1):(id(1 bsl 26))>>),
+ ?line garbage_collect(),
+ ?line id(<<0:((1 bsl 32)-1)>>),
+ ?line garbage_collect(),
+ ?line id(<<0:(id((1 bsl 32)-1))>>),
+ ?line garbage_collect(),
ok.
system_limit(Config) when is_list(Config) ->
@@ -565,6 +570,10 @@ system_limit(Config) when is_list(Config) ->
?line {'EXIT',{system_limit,_}} =
(catch <<(id(<<>>))/binary,0:(id(1 bsl 100))>>),
+ %% Would fail to load.
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:(1 bsl 67)>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:((1 bsl 64)+1)>>),
+
case WordSize of
4 ->
system_limit_32();
@@ -581,6 +590,14 @@ system_limit_32() ->
?line {'EXIT',{system_limit,_}} = (catch <<0:(id(8)),42:536870912/unit:8>>),
?line {'EXIT',{system_limit,_}} =
(catch <<0:(id(8)),42:(id(536870912))/unit:8>>),
+
+ %% The size would be silently truncated, resulting in a crash.
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:(1 bsl 35)>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:((1 bsl 32)+1)>>),
+
+ %% Would fail to load.
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:(1 bsl 43)>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:((1 bsl 40)+1)>>),
ok.
badarg(Config) when is_list(Config) ->
diff --git a/erts/emulator/test/code_SUITE.erl b/erts/emulator/test/code_SUITE.erl
index a062cea117..29cbdedd17 100644
--- a/erts/emulator/test/code_SUITE.erl
+++ b/erts/emulator/test/code_SUITE.erl
@@ -20,7 +20,9 @@
-module(code_SUITE).
-export([all/0, suite/0,groups/0,init_per_suite/1, end_per_suite/1,
init_per_group/2,end_per_group/2,
- new_binary_types/1,t_check_process_code/1,t_check_process_code_ets/1,
+ new_binary_types/1,
+ t_check_process_code/1,t_check_old_code/1,
+ t_check_process_code_ets/1,
external_fun/1,get_chunk/1,module_md5/1,make_stub/1,
make_stub_many_funs/1,constant_pools/1,
false_dependency/1,coverage/1]).
@@ -31,7 +33,7 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[new_binary_types, t_check_process_code,
- t_check_process_code_ets, external_fun, get_chunk,
+ t_check_process_code_ets, t_check_old_code, external_fun, get_chunk,
module_md5, make_stub, make_stub_many_funs,
constant_pools, false_dependency, coverage].
@@ -248,6 +250,32 @@ fun_refc(F) ->
Count.
+%% Test the erlang:check_old_code/1 BIF.
+t_check_old_code(Config) when is_list(Config) ->
+ ?line Data = ?config(data_dir, Config),
+ ?line File = filename:join(Data, "my_code_test"),
+
+ ?line erlang:purge_module(my_code_test),
+ ?line erlang:delete_module(my_code_test),
+ ?line catch erlang:purge_module(my_code_test),
+
+ ?line false = erlang:check_old_code(my_code_test),
+
+ ?line {ok,my_code_test,Code} = compile:file(File, [binary]),
+ ?line {module,my_code_test} = code:load_binary(my_code_test, File, Code),
+
+ ?line false = erlang:check_old_code(my_code_test),
+ ?line {module,my_code_test} = code:load_binary(my_code_test, File, Code),
+ ?line true = erlang:check_old_code(my_code_test),
+
+ ?line true = erlang:purge_module(my_code_test),
+ ?line true = erlang:delete_module(my_code_test),
+ ?line true = erlang:purge_module(my_code_test),
+
+ ?line {'EXIT',_} = (catch erlang:check_old_code([])),
+
+ ok.
+
external_fun(Config) when is_list(Config) ->
?line false = erlang:function_exported(another_code_test, x, 1),
?line ExtFun = erlang:make_fun(id(another_code_test), x, 1),
diff --git a/erts/emulator/test/fun_SUITE.erl b/erts/emulator/test/fun_SUITE.erl
index 7795efe57e..559e540016 100644
--- a/erts/emulator/test/fun_SUITE.erl
+++ b/erts/emulator/test/fun_SUITE.erl
@@ -647,17 +647,11 @@ refc_dist_1() ->
%% Fun is passed in an exit signal. Wait until it is gone.
?line wait_until(fun () -> 4 =/= fun_refc(F2) end),
?line 3 = fun_refc(F2),
- erts_debug:set_internal_state(available_internal_state, true),
- ?line F_refc = case erts_debug:get_internal_state(force_heap_frags) of
- false -> 3;
- true -> 2 % GC after bif already decreased it
- end,
- ?line F_refc = fun_refc(F),
- erts_debug:set_internal_state(available_internal_state, false),
+ ?line true = erlang:garbage_collect(),
+ ?line 2 = fun_refc(F),
refc_dist_send(Node, F).
refc_dist_send(Node, F) ->
- ?line true = erlang:garbage_collect(),
?line Pid = spawn_link(Node,
fun() -> receive
{To,Fun} when is_function(Fun) ->
diff --git a/erts/emulator/test/hibernate_SUITE.erl b/erts/emulator/test/hibernate_SUITE.erl
index 203fa6b48e..82a0aad189 100644
--- a/erts/emulator/test/hibernate_SUITE.erl
+++ b/erts/emulator/test/hibernate_SUITE.erl
@@ -25,16 +25,16 @@
init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
basic/1,dynamic_call/1,min_heap_size/1,bad_args/1,
- messages_in_queue/1,undefined_mfa/1, no_heap/1]).
+ messages_in_queue/1,undefined_mfa/1,no_heap/1,wake_up_and_bif_trap/1]).
%% Used by test cases.
--export([basic_hibernator/1,dynamic_call_hibernator/2,messages_in_queue_restart/2, no_heap_loop/0]).
+-export([basic_hibernator/1,dynamic_call_hibernator/2,messages_in_queue_restart/2, no_heap_loop/0,characters_to_list_trap/1]).
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[basic, dynamic_call, min_heap_size, bad_args, messages_in_queue,
- undefined_mfa, no_heap].
+ undefined_mfa, no_heap, wake_up_and_bif_trap].
groups() ->
[].
@@ -384,6 +384,31 @@ clean_dict() ->
lists:foreach(fun ({Key, _}) -> erase(Key) end, Dict).
%%
+%% Wake up and then immediatly bif trap with a lengthy computation.
+%%
+
+wake_up_and_bif_trap(doc) -> [];
+wake_up_and_bif_trap(suite) -> [];
+wake_up_and_bif_trap(Config) when is_list(Config) ->
+ ?line Self = self(),
+ ?line Pid = spawn_link(fun() -> erlang:hibernate(?MODULE, characters_to_list_trap, [Self]) end),
+ ?line Pid ! wakeup,
+ ?line receive
+ {ok, Pid0} when Pid0 =:= Pid -> ok
+ after 5000 ->
+ ?line ?t:fail(process_blocked)
+ end,
+ ?line unlink(Pid),
+ ?line exit(Pid, bye).
+
+%% Lengthy computation that traps (in characters_to_list_trap_3).
+characters_to_list_trap(Parent) ->
+ Bin0 = <<"abcdefghijklmnopqrstuvwxz0123456789">>,
+ Bin = binary:copy(Bin0, 1500),
+ unicode:characters_to_list(Bin),
+ Parent ! {ok, self()}.
+
+%%
%% Misc
%%
diff --git a/erts/emulator/test/match_spec_SUITE.erl b/erts/emulator/test/match_spec_SUITE.erl
index 2b21fa58f4..461773114e 100644
--- a/erts/emulator/test/match_spec_SUITE.erl
+++ b/erts/emulator/test/match_spec_SUITE.erl
@@ -27,8 +27,9 @@
destructive_in_test_bif/1, guard_exceptions/1,
unary_plus/1, unary_minus/1, moving_labels/1]).
-export([fpe/1]).
+-export([otp_9422/1]).
--export([runner/2]).
+-export([runner/2, loop_runner/3]).
-export([f1/1, f2/2, f3/2, fn/1, fn/2, fn/3]).
-export([do_boxed_and_small/0]).
@@ -57,7 +58,8 @@ all() ->
trace_control_word, silent, silent_no_ms, ms_trace2,
ms_trace3, boxed_and_small, destructive_in_test_bif,
guard_exceptions, unary_plus, unary_minus, fpe,
- moving_labels];
+ moving_labels,
+ otp_9422];
true -> [not_run]
end.
@@ -208,6 +210,43 @@ test_3(Config) when is_list(Config) ->
?line collect(P1, [{trace, P1, call, {?MODULE, f2, [a, b]}, [true]}]),
?line ok.
+otp_9422(doc) -> [];
+otp_9422(Config) when is_list(Config) ->
+ Laps = 1000,
+ ?line Fun1 = fun() -> otp_9422_tracee() end,
+ ?line P1 = spawn_link(?MODULE, loop_runner, [self(), Fun1, Laps]),
+ io:format("spawned ~p as tracee\n", [P1]),
+
+ ?line erlang:trace(P1, true, [call, silent]),
+
+ ?line Fun2 = fun() -> otp_9422_trace_changer() end,
+ ?line P2 = spawn_link(?MODULE, loop_runner, [self(), Fun2, Laps]),
+ io:format("spawned ~p as trace_changer\n", [P2]),
+
+ start_collect(P1),
+ start_collect(P2),
+
+ %%receive after 10*1000 -> ok end,
+
+ stop_collect(P1),
+ stop_collect(P2),
+ ok.
+
+otp_9422_tracee() ->
+ ?MODULE:f1(a),
+ ?MODULE:f1(b),
+ ?MODULE:f1(c).
+
+otp_9422_trace_changer() ->
+ Pat1 = [{[a], [], [{enable_trace, arity}]}],
+ ?line erlang:trace_pattern({?MODULE, f1, 1}, Pat1),
+ Pat2 = [{[b], [], [{disable_trace, arity}]}],
+ ?line erlang:trace_pattern({?MODULE, f1, 1}, Pat2).
+
+
+
+
+
bad_match_spec_bin(Config) when is_list(Config) ->
{'EXIT',{badarg,_}} = (catch ets:match_spec_run([1], <<>>)),
B0 = <<1,2>>,
@@ -932,6 +971,24 @@ runner(Collector, Fun) ->
Collector ! {gone, self()}
end.
+loop_runner(Collector, Fun, Laps) ->
+ receive
+ {go, Collector} ->
+ go
+ end,
+ loop_runner_cont(Collector, Fun, 0, Laps).
+
+loop_runner_cont(_Collector, _Fun, Laps, Laps) ->
+ receive
+ {done, Collector} ->
+ io:format("loop_runner ~p exit after ~p laps\n", [self(), Laps]),
+ Collector ! {gone, self()}
+ end;
+loop_runner_cont(Collector, Fun, N, Laps) ->
+ Fun(),
+ loop_runner_cont(Collector, Fun, N+1, Laps).
+
+
f1(X) ->
{X}.
diff --git a/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c b/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c
index 818023211c..0e4065c26b 100644
--- a/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c
+++ b/erts/emulator/test/mtx_SUITE_data/mtx_SUITE.c
@@ -552,13 +552,19 @@ create_rwlock(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
static ERL_NIF_TERM
rwlock_op(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
{
- rwlock_resource_t *rwlr;
+ /*
+ * Use a union for pointer type conversion to avoid compiler warnings
+ * about strict-aliasing violations with gcc-4.1. gcc >= 4.2 does not
+ * emit the warning.
+ * TODO: Reconsider use of union once gcc-4.1 is obsolete?
+ */
+ union { void* vp; rwlock_resource_t *p; } rwlr;
int blocking, write, wait_locked, wait_unlocked;
if (argc != 5)
goto badarg;
- if (!enif_get_resource(env, argv[0], enif_priv_data(env), (void **) &rwlr))
+ if (!enif_get_resource(env, argv[0], enif_priv_data(env), &rwlr.vp))
goto badarg;
blocking = get_bool(env, argv[1]);
@@ -581,22 +587,22 @@ rwlock_op(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
if (write) {
if (blocking)
- RWMUTEX_WLOCK(rwlr->rwlock);
+ RWMUTEX_WLOCK(rwlr.p->rwlock);
else
- while (EBUSY == RWMUTEX_TRYWLOCK(rwlr->rwlock));
- if (rwlr->lock_check) {
- ASSERT(!ATOMIC_READ(&rwlr->is_locked));
- ATOMIC_SET(&rwlr->is_locked, -1);
+ while (EBUSY == RWMUTEX_TRYWLOCK(rwlr.p->rwlock));
+ if (rwlr.p->lock_check) {
+ ASSERT(!ATOMIC_READ(&rwlr.p->is_locked));
+ ATOMIC_SET(&rwlr.p->is_locked, -1);
}
}
else {
if (blocking)
- RWMUTEX_RLOCK(rwlr->rwlock);
+ RWMUTEX_RLOCK(rwlr.p->rwlock);
else
- while (EBUSY == RWMUTEX_TRYRLOCK(rwlr->rwlock));
- if (rwlr->lock_check) {
- ASSERT(ATOMIC_READ(&rwlr->is_locked) >= 0);
- ATOMIC_INC(&rwlr->is_locked);
+ while (EBUSY == RWMUTEX_TRYRLOCK(rwlr.p->rwlock));
+ if (rwlr.p->lock_check) {
+ ASSERT(ATOMIC_READ(&rwlr.p->is_locked) >= 0);
+ ATOMIC_INC(&rwlr.p->is_locked);
}
}
@@ -604,18 +610,18 @@ rwlock_op(ErlNifEnv *env, int argc, const ERL_NIF_TERM argv[])
milli_sleep(wait_locked);
if (write) {
- if (rwlr->lock_check) {
- ASSERT(ATOMIC_READ(&rwlr->is_locked) == -1);
- ATOMIC_SET(&rwlr->is_locked, 0);
+ if (rwlr.p->lock_check) {
+ ASSERT(ATOMIC_READ(&rwlr.p->is_locked) == -1);
+ ATOMIC_SET(&rwlr.p->is_locked, 0);
}
- RWMUTEX_WUNLOCK(rwlr->rwlock);
+ RWMUTEX_WUNLOCK(rwlr.p->rwlock);
}
else {
- if (rwlr->lock_check) {
- ASSERT(ATOMIC_READ(&rwlr->is_locked) > 0);
- ATOMIC_DEC(&rwlr->is_locked);
+ if (rwlr.p->lock_check) {
+ ASSERT(ATOMIC_READ(&rwlr.p->is_locked) > 0);
+ ATOMIC_DEC(&rwlr.p->is_locked);
}
- RWMUTEX_RUNLOCK(rwlr->rwlock);
+ RWMUTEX_RUNLOCK(rwlr.p->rwlock);
}
if (wait_unlocked)
diff --git a/erts/emulator/test/nif_SUITE.erl b/erts/emulator/test/nif_SUITE.erl
index b9b964f526..f6344791f1 100644
--- a/erts/emulator/test/nif_SUITE.erl
+++ b/erts/emulator/test/nif_SUITE.erl
@@ -257,10 +257,54 @@ types(Config) when is_list(Config) ->
end,
[{},{ok},{{}},{[],{}},{1,2,3,4,5}]),
Stuff = [[],{},0,0.0,(1 bsl 100),(fun()-> ok end),make_ref(),self()],
- [eq_cmp(A,clone(B)) || A<-Stuff, B<-Stuff],
+ [eq_cmp(A,clone(B)) || A<-Stuff, B<-Stuff],
+
+ {IntSz, LongSz} = type_sizes(),
+ UintMax = (1 bsl (IntSz*8)) - 1,
+ IntMax = UintMax bsr 1,
+ IntMin = -(IntMax+1),
+ UlongMax = (1 bsl (LongSz*8)) - 1,
+ LongMax = UlongMax bsr 1,
+ LongMin = -(LongMax+1),
+ Uint64Max = (1 bsl 64) - 1,
+ Int64Max = Uint64Max bsr 1,
+ Int64Min = -(Int64Max+1),
+ Limits = [{IntMin,IntMax},{0,UintMax},{LongMin,LongMax},{0,UlongMax},{Int64Min,Int64Max},{0,Uint64Max}],
+ io:format("Limits = ~p\n", [Limits]),
+ lists:foreach(fun(I) ->
+ R1 = echo_int(I),
+ %%io:format("echo_int(~p) -> ~p\n", [I, R1]),
+ R2 = my_echo_int(I, Limits),
+ ?line R1 = R2,
+ ?line true = (R1 =:= R2),
+ ?line true = (R1 == R2)
+ end, int_list()),
+
?line verify_tmpmem(TmpMem),
+ ?line true = (compare(-1294536544000, -1178704800000) < 0),
+ ?line true = (compare(-1178704800000, -1294536544000) > 0),
+ ?line true = (compare(-295147905179352825856, -36893488147419103232) < 0),
+ ?line true = (compare(-36893488147419103232, -295147905179352825856) > 0),
+ ?line true = (compare(-29514790517935282585612345678, -36893488147419103232) < 0),
+ ?line true = (compare(-36893488147419103232, -29514790517935282585612345678) > 0),
ok.
+int_list() ->
+ Start = 1 bsl 200,
+ int_list([Start], -Start).
+int_list([N | _]=List, End) when N<End ->
+ List;
+int_list([N | _]=List, End) ->
+ int_list([N - (1 + (abs(N) div 3)) | List], End).
+
+my_echo_int(I, Limits) ->
+ lists:map(fun({Min,Max}) ->
+ if I < Min -> false;
+ I > Max -> false;
+ true -> I
+ end
+ end, Limits).
+
clone(X) ->
binary_to_term(term_to_binary(X)).
@@ -1270,6 +1314,8 @@ send_blob_thread(_,_,_) -> ?nif_stub.
join_send_thread(_) -> ?nif_stub.
copy_blob(_) -> ?nif_stub.
send_term(_,_) -> ?nif_stub.
+echo_int(_) -> ?nif_stub.
+type_sizes() -> ?nif_stub.
nif_stub_error(Line) ->
exit({nif_not_loaded,module,?MODULE,line,Line}).
diff --git a/erts/emulator/test/nif_SUITE_data/nif_SUITE.c b/erts/emulator/test/nif_SUITE_data/nif_SUITE.c
index 0bb93daa33..92f1bab8dd 100644
--- a/erts/emulator/test/nif_SUITE_data/nif_SUITE.c
+++ b/erts/emulator/test/nif_SUITE_data/nif_SUITE.c
@@ -28,6 +28,7 @@
static int static_cntA; /* zero by default */
static int static_cntB = NIF_SUITE_LIB_VER * 100;
+static ERL_NIF_TERM atom_false;
static ERL_NIF_TERM atom_self;
static ERL_NIF_TERM atom_ok;
static ERL_NIF_TERM atom_join;
@@ -40,7 +41,18 @@ typedef struct
CallInfo* call_history;
NifModPrivData* nif_mod;
union { ErlNifResourceType* t; long l; } rt_arr[2];
-}PrivData;
+} PrivData;
+
+/*
+ * Use a union for pointer type conversion to avoid compiler warnings
+ * about strict-aliasing violations with gcc-4.1. gcc >= 4.2 does not
+ * emit the warning.
+ * TODO: Reconsider use of union once gcc-4.1 is obsolete?
+ */
+typedef union {
+ void* vp;
+ struct make_term_info* p;
+} mti_t;
void add_call(ErlNifEnv* env, PrivData* data, const char* func_name)
{
@@ -103,7 +115,7 @@ static int load(ErlNifEnv* env, void** priv_data, ERL_NIF_TERM load_info)
msgenv_resource_type = enif_open_resource_type(env,NULL,"nif_SUITE.msgenv",
msgenv_dtor,
ERL_NIF_RT_CREATE, NULL);
-
+ atom_false = enif_make_atom(env,"false");
atom_self = enif_make_atom(env,"self");
atom_ok = enif_make_atom(env,"ok");
atom_join = enif_make_atom(env,"join");
@@ -481,6 +493,45 @@ error:
return enif_make_atom(env,"error");
}
+static ERL_NIF_TERM echo_int(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
+{
+ int sint;
+ unsigned uint;
+ long slong;
+ unsigned long ulong;
+ ErlNifSInt64 sint64;
+ ErlNifUInt64 uint64;
+ ERL_NIF_TERM sint_term = atom_false, uint_term = atom_false;
+ ERL_NIF_TERM slong_term = atom_false, ulong_term = atom_false;
+ ERL_NIF_TERM sint64_term = atom_false, uint64_term = atom_false;
+
+ if (enif_get_int(env, argv[0], &sint)) {
+ sint_term = enif_make_int(env, sint);
+ }
+ if (enif_get_uint(env, argv[0], &uint)) {
+ uint_term = enif_make_uint(env, uint);
+ }
+ if (enif_get_long(env, argv[0], &slong)) {
+ slong_term = enif_make_long(env, slong);
+ }
+ if (enif_get_ulong(env, argv[0], &ulong)) {
+ ulong_term = enif_make_ulong(env, ulong);
+ }
+ if (enif_get_int64(env, argv[0], &sint64)) {
+ sint64_term = enif_make_int64(env, sint64);
+ }
+ if (enif_get_uint64(env, argv[0], &uint64)) {
+ uint64_term = enif_make_uint64(env, uint64);
+ }
+ return enif_make_list6(env, sint_term, uint_term, slong_term, ulong_term, sint64_term, uint64_term);
+}
+
+static ERL_NIF_TERM type_sizes(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
+{
+ return enif_make_tuple2(env, enif_make_int(env, sizeof(int)),
+ enif_make_int(env, sizeof(long)));
+}
+
static ERL_NIF_TERM tuple_2_list(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
int arity = -1;
@@ -667,7 +718,7 @@ static ERL_NIF_TERM get_resource_type(ErlNifEnv* env, int argc, const ERL_NIF_TE
static ERL_NIF_TERM alloc_resource(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
ErlNifBinary data_bin;
- union { ErlNifResourceType* t; long l;} type;
+ union { ErlNifResourceType* t; long l; } type;
union { void* p; long l;} data;
if (!enif_get_long(env, argv[0], &type.l)
|| !enif_inspect_binary(env, argv[1], &data_bin)
@@ -691,7 +742,7 @@ static ERL_NIF_TERM make_resource(ErlNifEnv* env, int argc, const ERL_NIF_TERM a
static ERL_NIF_TERM make_new_resource(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
ErlNifBinary data_bin;
- union { ErlNifResourceType* t; long l;} type;
+ union { ErlNifResourceType* t; long l; } type;
void* data;
ERL_NIF_TERM ret;
if (!enif_get_long(env, argv[0], &type.l)
@@ -709,7 +760,7 @@ static ERL_NIF_TERM make_new_resource(ErlNifEnv* env, int argc, const ERL_NIF_TE
static ERL_NIF_TERM make_new_resource_binary(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
ErlNifBinary data_bin;
- union { struct binary_resource* p; void* vp; long l;} br;
+ union { struct binary_resource* p; void* vp; long l; } br;
void* buf;
ERL_NIF_TERM ret;
if (!enif_inspect_binary(env, argv[0], &data_bin)
@@ -1229,10 +1280,7 @@ static void msgenv_dtor(ErlNifEnv* env, void* obj)
static ERL_NIF_TERM clear_msgenv(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union {
- void* vp;
- struct make_term_info* p;
- }mti;
+ mti_t mti;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)) {
return enif_make_badarg(env);
}
@@ -1245,7 +1293,7 @@ static ERL_NIF_TERM clear_msgenv(ErlNifEnv* env, int argc, const ERL_NIF_TERM ar
static ERL_NIF_TERM grow_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ERL_NIF_TERM term;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)
|| (argc>2 && !enif_get_uint(env,argv[2], &mti.p->n))) {
@@ -1261,7 +1309,7 @@ static ERL_NIF_TERM grow_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[
static ERL_NIF_TERM send_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ErlNifPid to;
ERL_NIF_TERM copy;
int res;
@@ -1276,7 +1324,7 @@ static ERL_NIF_TERM send_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[
static ERL_NIF_TERM send3_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ErlNifPid to;
ERL_NIF_TERM copy;
int res;
@@ -1294,7 +1342,7 @@ static ERL_NIF_TERM send3_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv
void* threaded_sender(void *arg)
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
mti.vp = arg;
enif_mutex_lock(mti.p->mtx);
@@ -1309,7 +1357,7 @@ void* threaded_sender(void *arg)
static ERL_NIF_TERM send_blob_thread(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
ERL_NIF_TERM copy;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)
|| !enif_get_local_pid(env,argv[1], &mti.p->to_pid)) {
@@ -1335,7 +1383,7 @@ static ERL_NIF_TERM send_blob_thread(ErlNifEnv* env, int argc, const ERL_NIF_TER
static ERL_NIF_TERM join_send_thread(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
int err;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)) {
return enif_make_badarg(env);
@@ -1352,7 +1400,7 @@ static ERL_NIF_TERM join_send_thread(ErlNifEnv* env, int argc, const ERL_NIF_TER
static ERL_NIF_TERM copy_blob(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
- union { void* vp; struct make_term_info* p; }mti;
+ mti_t mti;
if (!enif_get_resource(env, argv[0], msgenv_resource_type, &mti.vp)) {
return enif_make_badarg(env);
}
@@ -1417,7 +1465,9 @@ static ErlNifFunc nif_funcs[] =
{"send_blob_thread", 3, send_blob_thread},
{"join_send_thread", 1, join_send_thread},
{"copy_blob", 1, copy_blob},
- {"send_term", 2, send_term}
+ {"send_term", 2, send_term},
+ {"echo_int", 1, echo_int},
+ {"type_sizes", 0, type_sizes}
};
ERL_NIF_INIT(nif_SUITE,nif_funcs,load,reload,upgrade,unload)
diff --git a/erts/emulator/utils/beam_makeops b/erts/emulator/utils/beam_makeops
index e7c57142c0..354439b5e3 100755
--- a/erts/emulator/utils/beam_makeops
+++ b/erts/emulator/utils/beam_makeops
@@ -67,6 +67,10 @@ my $max_gen_operands = 8;
# Must be even. The beam_load.c file must be updated, too.
my $max_spec_operands = 6;
+# The maximum number of primitive genop_types.
+
+my $max_genop_types = 16;
+
my %gen_opnum;
my %num_specific;
my %gen_to_spec;
@@ -106,7 +110,7 @@ my @pred_table;
# Operand types for generic instructions.
my $compiler_types = "uiaxyfhz";
-my $loader_types = "nprvlq";
+my $loader_types = "nprvlqo";
my $genop_types = $compiler_types . $loader_types;
#
@@ -142,34 +146,61 @@ my %arg_size = ('r' => 0, # x(0) - x register zero
my %type_bit;
my @tag_type;
+sub define_type_bit {
+ my($tag,$val) = @_;
+ defined $type_bit{$tag} and
+ sanity("the tag '$tag' has already been defined with the value ",
+ $type_bit{$tag});
+ $type_bit{$tag} = $val;
+}
+
{
my($bit) = 1;
my(%bit);
foreach (split('', $genop_types)) {
push(@tag_type, $_);
- $type_bit{$_} = $bit;
+ define_type_bit($_, $bit);
$bit{$_} = $bit;
$bit *= 2;
}
# Composed types.
- $type_bit{'d'} = $type_bit{'x'} | $type_bit{'y'} | $type_bit{'r'};
- $type_bit{'c'} = $type_bit{'i'} | $type_bit{'a'} | $type_bit{'n'} | $type_bit{'q'};
- $type_bit{'s'} = $type_bit{'d'} | $type_bit{'i'} | $type_bit{'a'} | $type_bit{'n'};
- $type_bit{'j'} = $type_bit{'f'} | $type_bit{'p'};
+ define_type_bit('d', $type_bit{'x'} | $type_bit{'y'} | $type_bit{'r'});
+ define_type_bit('c', $type_bit{'i'} | $type_bit{'a'} |
+ $type_bit{'n'} | $type_bit{'q'});
+ define_type_bit('s', $type_bit{'d'} | $type_bit{'i'} |
+ $type_bit{'a'} | $type_bit{'n'});
+ define_type_bit('j', $type_bit{'f'} | $type_bit{'p'});
# Aliases (for matching purposes).
- $type_bit{'I'} = $type_bit{'u'};
- $type_bit{'t'} = $type_bit{'u'};
- $type_bit{'A'} = $type_bit{'u'};
- $type_bit{'L'} = $type_bit{'u'};
- $type_bit{'b'} = $type_bit{'u'};
- $type_bit{'N'} = $type_bit{'u'};
- $type_bit{'U'} = $type_bit{'u'};
- $type_bit{'e'} = $type_bit{'u'};
- $type_bit{'P'} = $type_bit{'u'};
- $type_bit{'Q'} = $type_bit{'u'};
+ define_type_bit('I', $type_bit{'u'});
+ define_type_bit('t', $type_bit{'u'});
+ define_type_bit('A', $type_bit{'u'});
+ define_type_bit('L', $type_bit{'u'});
+ define_type_bit('b', $type_bit{'u'});
+ define_type_bit('N', $type_bit{'u'});
+ define_type_bit('U', $type_bit{'u'});
+ define_type_bit('e', $type_bit{'u'});
+ define_type_bit('P', $type_bit{'u'});
+ define_type_bit('Q', $type_bit{'u'});
+}
+
+#
+# Sanity checks.
+#
+
+{
+ if (@tag_type > $max_genop_types) {
+ sanity("\$max_genop_types is $max_genop_types, ",
+ "but there are ", scalar(@tag_type),
+ " primitive tags defined\n");
+ }
+
+ foreach my $tag (@tag_type) {
+ sanity("tag '$tag': primitive tags must be named with lowercase letters")
+ unless $tag =~ /^[a-z]$/;
+ }
}
#
@@ -436,12 +467,12 @@ sub emulator_output {
#
my(@bits) = (0) x ($max_spec_operands/2);
- my($shift) = 16;
my($i);
for ($i = 0; $i < $max_spec_operands && defined $args[$i]; $i++) {
my $t = $args[$i];
if (defined $type_bit{$t}) {
- $bits[int($i/2)] |= $type_bit{$t} << (16*($i%2));
+ my $shift = $max_genop_types * ($i % 2);
+ $bits[int($i/2)] |= $type_bit{$t} << $shift;
}
}
@@ -753,6 +784,10 @@ sub error {
die $where, @message, "\n";
}
+sub sanity {
+ die "internal error: ", @_, "\n";
+}
+
sub comment {
my($lang, @comments) = @_;
my($prefix);
diff --git a/erts/epmd/src/epmd.c b/erts/epmd/src/epmd.c
index 08576d923f..2267f9b12b 100644
--- a/erts/epmd/src/epmd.c
+++ b/erts/epmd/src/epmd.c
@@ -324,7 +324,11 @@ static void run_daemon(EpmdVars *g)
}
/* move cwd to root to make sure we are not on a mounted filesystem */
- chdir("/");
+ if (chdir("/") < 0)
+ {
+ dbg_perror(g,"epmd: chdir() failed");
+ epmd_cleanup_exit(g,1);
+ }
umask(0);
diff --git a/erts/epmd/src/epmd_cli.c b/erts/epmd/src/epmd_cli.c
index ac55ba6bb6..2377c0dfe7 100644
--- a/erts/epmd/src/epmd_cli.c
+++ b/erts/epmd/src/epmd_cli.c
@@ -104,7 +104,10 @@ void epmd_call(EpmdVars *g,int what)
fd = conn_to_epmd(g);
put_int16(1,buf);
buf[2] = what;
- write(fd,buf,3);
+ if (write(fd, buf, 3) != 3) {
+ printf("epmd: Can't write to epmd\n");
+ epmd_cleanup_exit(g,1);
+ }
if (read(fd,(char *)&i,4) != 4) {
if (!g->silent)
printf("epmd: no response from local epmd\n");
diff --git a/erts/epmd/src/epmd_int.h b/erts/epmd/src/epmd_int.h
index 2a0de4df9c..a2d7559f9d 100644
--- a/erts/epmd/src/epmd_int.h
+++ b/erts/epmd/src/epmd_int.h
@@ -240,6 +240,14 @@
#define put_int16(i, s) {((unsigned char*)(s))[0] = ((i) >> 8) & 0xff; \
((unsigned char*)(s))[1] = (i) & 0xff;}
+#if defined(__GNUC__)
+# define EPMD_INLINE __inline__
+#elif defined(__WIN32__)
+# define EPMD_INLINE __inline
+#else
+# define EPMD_INLINE
+#endif
+
/* ************************************************************************ */
/* Stuctures used by server */
@@ -295,6 +303,7 @@ typedef struct {
unsigned delay_write;
int max_conn;
int active_conn;
+ int select_fd_top;
char *progname;
Connection *conn;
Nodes nodes;
diff --git a/erts/epmd/src/epmd_srv.c b/erts/epmd/src/epmd_srv.c
index 4d9b454f97..da575affa1 100644
--- a/erts/epmd/src/epmd_srv.c
+++ b/erts/epmd/src/epmd_srv.c
@@ -80,6 +80,13 @@ static int reply(EpmdVars*,int,char *,int);
static void dbg_print_buf(EpmdVars*,char *,int);
static void print_names(EpmdVars*);
+static EPMD_INLINE void select_fd_set(EpmdVars* g, int fd)
+{
+ FD_SET(fd, &g->orig_read_mask);
+ if (fd >= g->select_fd_top) {
+ g->select_fd_top = fd + 1;
+ }
+}
void run(EpmdVars *g)
{
@@ -95,7 +102,8 @@ void run(EpmdVars *g)
dbg_printf(g,2,"try to initiate listening port %d", g->port);
- if (g->addresses != NULL)
+ if (g->addresses != NULL && /* String contains non-separator characters if: */
+ g->addresses[strspn(g->addresses," ,")] != '\000')
{
char *tmp;
char *token;
@@ -171,6 +179,7 @@ void run(EpmdVars *g)
g->max_conn -= num_sockets;
FD_ZERO(&g->orig_read_mask);
+ g->select_fd_top = 0;
for (i = 0; i < num_sockets; i++)
{
@@ -232,14 +241,14 @@ void run(EpmdVars *g)
dbg_perror(g,"failed to listen on socket");
epmd_cleanup_exit(g,1);
}
- FD_SET(listensock[i],&g->orig_read_mask);
+ select_fd_set(g, listensock[i]);
}
dbg_tty_printf(g,2,"entering the main select() loop");
select_again:
while(1)
- {
+ {
fd_set read_mask = g->orig_read_mask;
struct timeval timeout;
int ret;
@@ -251,7 +260,8 @@ void run(EpmdVars *g)
timeout.tv_sec = (g->packet_timeout < IDLE_TIMEOUT) ? 1 : IDLE_TIMEOUT;
timeout.tv_usec = 0;
- if ((ret = select(g->max_conn,&read_mask,(fd_set *)0,(fd_set *)0,&timeout)) < 0) {
+ if ((ret = select(g->select_fd_top,
+ &read_mask, (fd_set *)0,(fd_set *)0,&timeout)) < 0) {
dbg_perror(g,"error in select ");
switch (errno) {
case EAGAIN:
@@ -821,7 +831,7 @@ static int conn_open(EpmdVars *g,int fd)
s = &g->conn[i];
/* From now on we want to know if there are data to be read */
- FD_SET(fd, &g->orig_read_mask);
+ select_fd_set(g, fd);
s->fd = fd;
s->open = EPMD_TRUE;
@@ -886,6 +896,7 @@ int epmd_conn_close(EpmdVars *g,Connection *s)
dbg_tty_printf(g,2,"closing connection on file descriptor %d",s->fd);
FD_CLR(s->fd,&g->orig_read_mask);
+ /* we don't bother lowering g->select_fd_top */
close(s->fd); /* Sometimes already closed but close anyway */
s->open = EPMD_FALSE;
if (s->buf != NULL) { /* Should never be NULL but test anyway */
@@ -1115,7 +1126,7 @@ static Node *node_reg2(EpmdVars *g,
node->extralen = extralen;
memcpy(node->extra,extra,extralen);
strcpy(node->symname,name);
- FD_SET(fd,&g->orig_read_mask);
+ select_fd_set(g, fd);
if (highvsn == 0) {
dbg_tty_printf(g,1,"registering '%s:%d', port %d",
diff --git a/erts/example/matrix_nif.c b/erts/example/matrix_nif.c
index c5e01dade5..43f9526ae3 100644
--- a/erts/example/matrix_nif.c
+++ b/erts/example/matrix_nif.c
@@ -31,7 +31,19 @@ typedef struct
unsigned nrows;
unsigned ncols;
double* data;
-}Matrix;
+} Matrix;
+
+/*
+ * Use a union for pointer type conversion to avoid compiler warnings
+ * about strict-aliasing violations with gcc-4.1. gcc >= 4.2 does not
+ * emit the warning.
+ * TODO: Reconsider use of union once gcc-4.1 is obsolete?
+ */
+typedef union
+{
+ void* vp;
+ Matrix* p;
+} mx_t;
#define POS(MX, ROW, COL) ((MX)->data[(ROW)* (MX)->ncols + (COL)])
@@ -44,8 +56,9 @@ static ErlNifResourceType* resource_type = NULL;
static int load(ErlNifEnv* env, void** priv_data, ERL_NIF_TERM load_info)
{
- ErlNifResourceType* rt = enif_open_resource_type(env, "matrix_nif_example",
- matrix_dtor,
+ ErlNifResourceType* rt = enif_open_resource_type(env, NULL,
+ "matrix_nif_example",
+ matrix_dtor,
ERL_NIF_RT_CREATE, NULL);
if (rt == NULL) {
return -1;
@@ -90,12 +103,12 @@ static ERL_NIF_TERM create(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
}
ret = enif_make_resource(env, mx);
- enif_release_resource(env, mx);
+ enif_release_resource(mx);
return ret;
badarg:
if (mx != NULL) {
- enif_release_resource(env,mx);
+ enif_release_resource(mx);
}
return enif_make_badarg(env);
}
@@ -104,14 +117,14 @@ badarg:
static ERL_NIF_TERM pos(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
/* pos(Matrix, Row, Column) -> float() */
- Matrix* mx;
+ mx_t mx;
unsigned i, j;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mx) ||
- !enif_get_uint(env, argv[1], &i) || (--i >= mx->nrows) ||
- !enif_get_uint(env, argv[2], &j) || (--j >= mx->ncols)) {
+ if (!enif_get_resource(env, argv[0], resource_type, &mx.vp) ||
+ !enif_get_uint(env, argv[1], &i) || (--i >= mx.p->nrows) ||
+ !enif_get_uint(env, argv[2], &j) || (--j >= mx.p->ncols)) {
return enif_make_badarg(env);
}
- return enif_make_double(env, POS(mx, i,j));
+ return enif_make_double(env, POS(mx.p, i,j));
}
static ERL_NIF_TERM add(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
@@ -119,37 +132,38 @@ static ERL_NIF_TERM add(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
/* add(Matrix_A, Matrix_B) -> Matrix_Sum */
unsigned i, j;
ERL_NIF_TERM ret;
- Matrix* mxA = NULL;
- Matrix* mxB = NULL;
- Matrix* mxS = NULL;
+ mx_t mxA, mxB, mxS;
+ mxA.p = NULL;
+ mxB.p = NULL;
+ mxS.p = NULL;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mxA) ||
- !enif_get_resource(env, argv[1], resource_type, (void**)&mxB) ||
- mxA->nrows != mxB->nrows ||
- mxB->ncols != mxB->ncols) {
+ if (!enif_get_resource(env, argv[0], resource_type, &mxA.vp) ||
+ !enif_get_resource(env, argv[1], resource_type, &mxB.vp) ||
+ mxA.p->nrows != mxB.p->nrows ||
+ mxB.p->ncols != mxB.p->ncols) {
return enif_make_badarg(env);
}
- mxS = alloc_matrix(env, mxA->nrows, mxA->ncols);
- for (i = 0; i < mxA->nrows; i++) {
- for (j = 0; j < mxA->ncols; j++) {
- POS(mxS, i, j) = POS(mxA, i, j) + POS(mxB, i, j);
+ mxS.p = alloc_matrix(env, mxA.p->nrows, mxA.p->ncols);
+ for (i = 0; i < mxA.p->nrows; i++) {
+ for (j = 0; j < mxA.p->ncols; j++) {
+ POS(mxS.p, i, j) = POS(mxA.p, i, j) + POS(mxB.p, i, j);
}
}
- ret = enif_make_resource(env, mxS);
- enif_release_resource(env, mxS);
+ ret = enif_make_resource(env, mxS.p);
+ enif_release_resource(mxS.p);
return ret;
}
static ERL_NIF_TERM size_of(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{
/* size(Matrix) -> {Nrows, Ncols} */
- Matrix* mx;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mx)) {
+ mx_t mx;
+ if (!enif_get_resource(env, argv[0], resource_type, &mx.vp)) {
return enif_make_badarg(env);
}
- return enif_make_tuple2(env, enif_make_uint(env, mx->nrows),
- enif_make_uint(env, mx->ncols));
+ return enif_make_tuple2(env, enif_make_uint(env, mx.p->nrows),
+ enif_make_uint(env, mx.p->ncols));
}
static ERL_NIF_TERM to_term(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
@@ -157,16 +171,17 @@ static ERL_NIF_TERM to_term(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
/* to_term(Matrix) -> [[first row], [second row], ...,[last row]] */
unsigned i, j;
ERL_NIF_TERM res;
- Matrix* mx = NULL;
+ mx_t mx;
+ mx.p = NULL;
- if (!enif_get_resource(env, argv[0], resource_type, (void**)&mx)) {
+ if (!enif_get_resource(env, argv[0], resource_type, &mx.vp)) {
return enif_make_badarg(env);
}
res = enif_make_list(env, 0);
- for (i = mx->nrows; i-- > 0; ) {
+ for (i = mx.p->nrows; i-- > 0; ) {
ERL_NIF_TERM row = enif_make_list(env, 0);
- for (j = mx->ncols; j-- > 0; ) {
- row = enif_make_list_cell(env, enif_make_double(env, POS(mx,i,j)),
+ for (j = mx.p->ncols; j-- > 0; ) {
+ row = enif_make_list_cell(env, enif_make_double(env, POS(mx.p,i,j)),
row);
}
res = enif_make_list_cell(env, row, res);
@@ -183,17 +198,17 @@ static int get_number(ErlNifEnv* env, ERL_NIF_TERM term, double* dp)
static Matrix* alloc_matrix(ErlNifEnv* env, unsigned nrows, unsigned ncols)
{
- Matrix* mx = enif_alloc_resource(env, resource_type, sizeof(Matrix));
+ Matrix* mx = enif_alloc_resource(resource_type, sizeof(Matrix));
mx->nrows = nrows;
mx->ncols = ncols;
- mx->data = enif_alloc(env, nrows*ncols*sizeof(double));
+ mx->data = enif_alloc(nrows*ncols*sizeof(double));
return mx;
}
static void matrix_dtor(ErlNifEnv* env, void* obj)
{
Matrix* mx = (Matrix*) obj;
- enif_free(env, mx->data);
+ enif_free(mx->data);
mx->data = NULL;
}
diff --git a/erts/lib_src/common/erl_misc_utils.c b/erts/lib_src/common/erl_misc_utils.c
index 5dbf98c7d1..5e94ff19db 100644
--- a/erts/lib_src/common/erl_misc_utils.c
+++ b/erts/lib_src/common/erl_misc_utils.c
@@ -55,6 +55,12 @@
# ifdef HAVE_UNISTD_H
# include <unistd.h>
# endif
+# if defined(_SC_NPROC_CONF) && !defined(_SC_NPROCESSORS_CONF)
+# define _SC_NPROCESSORS_CONF _SC_NPROC_CONF
+# endif
+# if defined(_SC_NPROC_ONLN) && !defined(_SC_NPROCESSORS_ONLN)
+# define _SC_NPROCESSORS_ONLN _SC_NPROC_ONLN
+# endif
# if (defined(NO_SYSCONF) || !defined(_SC_NPROCESSORS_CONF))
# ifdef HAVE_SYS_SYSCTL_H
# include <sys/sysctl.h>
@@ -1511,7 +1517,7 @@ const char* parse_topology_spec_group(erts_cpu_info_t *cpuinfo, const char* xml,
}
}
- if (cacheLevel == 0) {
+ if (parentCacheLevel == 0) {
*core_p = 0;
*processor_p = (*processor_p)++;
} else {
diff --git a/erts/lib_src/common/erl_printf_format.c b/erts/lib_src/common/erl_printf_format.c
index fba3fd723c..473791dce4 100644
--- a/erts/lib_src/common/erl_printf_format.c
+++ b/erts/lib_src/common/erl_printf_format.c
@@ -388,7 +388,7 @@ static int fmt_double(fmtfn_t fn,void*arg,double val,
max_size++;
if (precision)
max_size += precision;
- else if (fmt && FMTF_alt)
+ else if (fmt & FMTF_alt)
max_size++;
break;
case FMTC_E:
@@ -402,7 +402,7 @@ static int fmt_double(fmtfn_t fn,void*arg,double val,
max_size += 4;
if (precision)
max_size += precision;
- else if (fmt && FMTF_alt)
+ else if (fmt & FMTF_alt)
max_size++;
aexp = exp >= 0 ? exp : -exp;
if (aexp < 100)
diff --git a/erts/preloaded/ebin/zlib.beam b/erts/preloaded/ebin/zlib.beam
index d400269ed0..cda53f7692 100644
--- a/erts/preloaded/ebin/zlib.beam
+++ b/erts/preloaded/ebin/zlib.beam
Binary files differ
diff --git a/erts/preloaded/src/zlib.erl b/erts/preloaded/src/zlib.erl
index 6cc7b27114..210532edac 100644
--- a/erts/preloaded/src/zlib.erl
+++ b/erts/preloaded/src/zlib.erl
@@ -173,7 +173,7 @@ deflateInit(Z, Level, Method, WindowBits, MemLevel, Strategy) ->
-spec deflateSetDictionary(Z, Dictionary) -> Adler32 when
Z :: zstream(),
- Dictionary :: binary(),
+ Dictionary :: iodata(),
Adler32 :: integer().
deflateSetDictionary(Z, Dictionary) ->
call(Z, ?DEFLATE_SETDICT, Dictionary).
@@ -232,7 +232,7 @@ inflateInit(Z, WindowBits) ->
-spec inflateSetDictionary(Z, Dictionary) -> 'ok' when
Z :: zstream(),
- Dictionary :: binary().
+ Dictionary :: iodata().
inflateSetDictionary(Z, Dictionary) ->
call(Z, ?INFLATE_SETDICT, Dictionary).
@@ -283,38 +283,36 @@ getBufSize(Z) ->
crc32(Z) ->
call(Z, ?CRC32_0, []).
--spec crc32(Z, Binary) -> CRC when
+-spec crc32(Z, Data) -> CRC when
Z :: zstream(),
- Binary :: binary(),
+ Data :: iodata(),
CRC :: integer().
-crc32(Z, Binary) ->
- call(Z, ?CRC32_1, Binary).
+crc32(Z, Data) ->
+ call(Z, ?CRC32_1, Data).
--spec crc32(Z, PrevCRC, Binary) -> CRC when
+-spec crc32(Z, PrevCRC, Data) -> CRC when
Z :: zstream(),
PrevCRC :: integer(),
- Binary :: binary(),
+ Data :: iodata(),
CRC :: integer().
-crc32(Z, CRC, Binary) when is_binary(Binary), is_integer(CRC) ->
- call(Z, ?CRC32_2, <<CRC:32, Binary/binary>>);
-crc32(_Z, _CRC, _Binary) ->
- erlang:error(badarg).
+crc32(Z, CRC, Data) ->
+ call(Z, ?CRC32_2, [<<CRC:32>>, Data]).
--spec adler32(Z, Binary) -> CheckSum when
+-spec adler32(Z, Data) -> CheckSum when
Z :: zstream(),
- Binary :: binary(),
+ Data :: iodata(),
CheckSum :: integer().
-adler32(Z, Binary) ->
- call(Z, ?ADLER32_1, Binary).
+adler32(Z, Data) ->
+ call(Z, ?ADLER32_1, Data).
--spec adler32(Z, PrevAdler, Binary) -> CheckSum when
+-spec adler32(Z, PrevAdler, Data) -> CheckSum when
Z :: zstream(),
PrevAdler :: integer(),
- Binary :: binary(),
+ Data :: iodata(),
CheckSum :: integer().
-adler32(Z, Adler, Binary) when is_binary(Binary), is_integer(Adler) ->
- call(Z, ?ADLER32_2, <<Adler:32, Binary/binary>>);
-adler32(_Z, _Adler, _Binary) ->
+adler32(Z, Adler, Data) when is_integer(Adler) ->
+ call(Z, ?ADLER32_2, [<<Adler:32>>, Data]);
+adler32(_Z, _Adler, _Data) ->
erlang:error(badarg).
-spec crc32_combine(Z, CRC1, CRC2, Size2) -> CRC when
@@ -346,76 +344,83 @@ getQSize(Z) ->
call(Z, ?GET_QSIZE, []).
%% compress/uncompress zlib with header
--spec compress(Binary) -> Compressed when
- Binary :: binary(),
+-spec compress(Data) -> Compressed when
+ Data :: iodata(),
Compressed :: binary().
-compress(Binary) ->
+compress(Data) ->
Z = open(),
deflateInit(Z, default),
- Bs = deflate(Z, Binary,finish),
+ Bs = deflate(Z, Data, finish),
deflateEnd(Z),
close(Z),
- list_to_binary(Bs).
+ iolist_to_binary(Bs).
--spec uncompress(Binary) -> Decompressed when
- Binary :: binary(),
+-spec uncompress(Data) -> Decompressed when
+ Data :: iodata(),
Decompressed :: binary().
-uncompress(Binary) when byte_size(Binary) >= 8 ->
- Z = open(),
- inflateInit(Z),
- Bs = inflate(Z, Binary),
- inflateEnd(Z),
- close(Z),
- list_to_binary(Bs);
-uncompress(Binary) when is_binary(Binary) -> erlang:error(data_error);
-uncompress(_) -> erlang:error(badarg).
+uncompress(Data) ->
+ try iolist_size(Data) of
+ Size ->
+ if
+ Size >= 8 ->
+ Z = open(),
+ inflateInit(Z),
+ Bs = inflate(Z, Data),
+ inflateEnd(Z),
+ close(Z),
+ iolist_to_binary(Bs);
+ true ->
+ erlang:error(data_error)
+ end
+ catch
+ _:_ ->
+ erlang:error(badarg)
+ end.
%% unzip/zip zlib without header (zip members)
--spec zip(Binary) -> Compressed when
- Binary :: binary(),
+-spec zip(Data) -> Compressed when
+ Data :: iodata(),
Compressed :: binary().
-zip(Binary) ->
+zip(Data) ->
Z = open(),
deflateInit(Z, default, deflated, -?MAX_WBITS, 8, default),
- Bs = deflate(Z, Binary, finish),
+ Bs = deflate(Z, Data, finish),
deflateEnd(Z),
close(Z),
- list_to_binary(Bs).
+ iolist_to_binary(Bs).
--spec unzip(Binary) -> Decompressed when
- Binary :: binary(),
+-spec unzip(Data) -> Decompressed when
+ Data :: iodata(),
Decompressed :: binary().
-unzip(Binary) ->
+unzip(Data) ->
Z = open(),
inflateInit(Z, -?MAX_WBITS),
- Bs = inflate(Z, Binary),
+ Bs = inflate(Z, Data),
inflateEnd(Z),
close(Z),
- list_to_binary(Bs).
+ iolist_to_binary(Bs).
-spec gzip(Data) -> Compressed when
Data :: iodata(),
Compressed :: binary().
-gzip(Data) when is_binary(Data); is_list(Data) ->
+gzip(Data) ->
Z = open(),
deflateInit(Z, default, deflated, 16+?MAX_WBITS, 8, default),
Bs = deflate(Z, Data, finish),
deflateEnd(Z),
close(Z),
- iolist_to_binary(Bs);
-gzip(_) -> erlang:error(badarg).
+ iolist_to_binary(Bs).
--spec gunzip(Binary) -> Decompressed when
- Binary :: binary(),
+-spec gunzip(Data) -> Decompressed when
+ Data :: iodata(),
Decompressed :: binary().
-gunzip(Data) when is_binary(Data); is_list(Data) ->
+gunzip(Data) ->
Z = open(),
inflateInit(Z, 16+?MAX_WBITS),
Bs = inflate(Z, Data),
inflateEnd(Z),
close(Z),
- iolist_to_binary(Bs);
-gunzip(_) -> erlang:error(badarg).
+ iolist_to_binary(Bs).
-spec collect(zstream()) -> iolist().
collect(Z) ->
diff --git a/erts/test/autoimport_SUITE.erl b/erts/test/autoimport_SUITE.erl
index 0e4708e046..71ed5204b1 100644
--- a/erts/test/autoimport_SUITE.erl
+++ b/erts/test/autoimport_SUITE.erl
@@ -87,10 +87,21 @@ autoimports(Config) when is_list(Config) ->
xml(XMLFile) ->
{ok,File} = file:open(XMLFile,[read]),
+ xskip_to_funcs(file:read_line(File),File),
DocData = xloop(file:read_line(File),File),
+ true = DocData =/= [],
file:close(File),
analyze(DocData).
+%% Skip lines up to and including the <funcs> tag.
+xskip_to_funcs({ok,Line},File) ->
+ case re:run(Line,"\\<funcs\\>",[{capture,none}]) of
+ nomatch ->
+ xskip_to_funcs(file:read_line(File),File);
+ match ->
+ ok
+ end.
+
xloop({ok,Line},File) ->
case re:run(Line,"\\<name\\>",[{capture,none}]) of
nomatch ->
diff --git a/erts/test/erlc_SUITE.erl b/erts/test/erlc_SUITE.erl
index 62e0e6813d..a9e28672e3 100644
--- a/erts/test/erlc_SUITE.erl
+++ b/erts/test/erlc_SUITE.erl
@@ -79,7 +79,7 @@ compile_erl(Config) when is_list(Config) ->
?line run(Config, Cmd, FileName, "-Werror",
["compile: warnings being treated as errors\$",
- "Warning: function foo/0 is unused\$",
+ "function foo/0 is unused\$",
"_ERROR_"]),
%% Check a bad file.
@@ -213,13 +213,34 @@ deep_cwd_1(PrivDir) ->
arg_overflow(Config) when is_list(Config) ->
?line {SrcDir, _OutDir, Cmd} = get_cmd(Config),
?line FileName = filename:join(SrcDir, "erl_test_ok.erl"),
- ?line Args = lists:flatten([ ["-D", integer_to_list(N), "=1 "] ||
- N <- lists:seq(1,10000) ]),
+ %% Each -D option will be expanded to three arguments when
+ %% invoking 'erl'.
+ ?line NumDOptions = num_d_options(),
+ ?line Args = lists:flatten([ ["-D", integer_to_list(N, 36), "=1 "] ||
+ N <- lists:seq(1, NumDOptions) ]),
?line run(Config, Cmd, FileName, Args,
["Warning: function foo/0 is unused\$",
"_OK_"]),
ok.
+num_d_options() ->
+ case {os:type(),os:version()} of
+ {{win32,_},_} ->
+ %% The maximum size of a command line in the command
+ %% shell on Windows is 8191 characters.
+ %% Each -D option is expanded to "@dv NN 1", i.e.
+ %% 8 characters. (Numbers up to 1295 can be expressed
+ %% as two 36-base digits.)
+ 1000;
+ {{unix,linux},Version} when Version < {2,6,23} ->
+ %% On some older 64-bit versions of Linux, the maximum number
+ %% of arguments is 16383.
+ %% See: http://www.in-ulm.de/~mascheck/various/argmax/
+ 5440;
+ {_,_} ->
+ 12000
+ end.
+
erlc() ->
case os:find_executable("erlc") of
false ->
diff --git a/lib/asn1/doc/src/asn1ct.xml b/lib/asn1/doc/src/asn1ct.xml
index 265f8735c2..50458b4a9a 100644
--- a/lib/asn1/doc/src/asn1ct.xml
+++ b/lib/asn1/doc/src/asn1ct.xml
@@ -53,7 +53,7 @@
<v>Option = ber_bin | per_bin | uper_bin | der | compact_bit_string |
noobj | {n2n,EnumTypeName} |{outdir,Dir} | {i,IncludeDir} | optimize |
driver | asn1config | undec_rest | {inline,OutputName} | inline |
- {macro_name_prefix, Prefix} | {record_name_prefix, Prefix} | verbose</v>
+ {macro_name_prefix, Prefix} | {record_name_prefix, Prefix} | verbose | warnings_as_errors</v>
<v>OldOption = ber | per</v>
<v>Reason = term()</v>
<v>Prefix = string()</v>
@@ -289,6 +289,10 @@ Binary = binary()
<p>Causes more verbose information from the compiler
describing what it is doing.</p>
</item>
+ <tag><c>warnings_as_errors</c></tag>
+ <item>
+ <p>Causes warnings to be treated as errors.</p>
+ </item>
</taglist>
<p>Any additional option that is applied will be passed to
the final step when the generated .erl file is compiled.
diff --git a/lib/asn1/src/asn1ct.erl b/lib/asn1/src/asn1ct.erl
index a167d27f82..e26fadd160 100644
--- a/lib/asn1/src/asn1ct.erl
+++ b/lib/asn1/src/asn1ct.erl
@@ -39,7 +39,7 @@
add_tobe_refed_func/1,add_generated_refed_func/1,
maybe_rename_function/3,latest_sindex/0,current_sindex/0,
set_current_sindex/1,next_sindex/0,maybe_saved_sindex/2,
- parse_and_save/2,verbose/3,warning/3,error/3]).
+ parse_and_save/2,verbose/3,warning/3,warning/4,error/3]).
-include("asn1_records.hrl").
-include_lib("stdlib/include/erl_compile.hrl").
@@ -825,10 +825,13 @@ generate({true,{M,_Module,GenTOrV}},OutFile,EncodingRule,Options) ->
case catch specialized_decode_prepare(EncodingRule,M,GenTOrV,Options) of
{error, enoent} -> ok;
{error, Reason} -> warning("Error in configuration "
- "file: ~n~p~n",[Reason],Options);
+ "file: ~n~p~n",[Reason],Options,
+ "Error in configuration file");
{'EXIT',Reason} -> warning("Internal error when "
"analyzing configuration "
- "file: ~n~p~n",[Reason],Options);
+ "file: ~n~p~n",[Reason],Options,
+ "Internal error when "
+ "analyzing configuration");
_ -> ok
end,
@@ -2524,14 +2527,14 @@ type_check(#'Externaltypereference'{}) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% Report functions.
%%
-%% Errors messages are controlled with the 'errors' compiler option
+%% Error messages are controlled with the 'errors' compiler option
%% Warning messages are controlled with the 'warnings' compiler option
%% Verbose messages are controlled with the 'verbose' compiler option
error(Format, Args, S) ->
case is_error(S) of
true ->
- io:format("Error: " ++ Format, Args);
+ io:format(Format, Args);
false ->
ok
end.
@@ -2544,6 +2547,17 @@ warning(Format, Args, S) ->
ok
end.
+warning(Format, Args, S, Reason) ->
+ case {is_werr(S), is_error(S), is_warning(S)} of
+ {true, true, _} ->
+ io:format(Format, Args),
+ throw({error, Reason});
+ {false, _, true} ->
+ io:format(Format, Args);
+ _ ->
+ ok
+ end.
+
verbose(Format, Args, S) ->
case is_verbose(S) of
true ->
@@ -2566,3 +2580,8 @@ is_verbose(S) when is_record(S, state) ->
is_verbose(S#state.options);
is_verbose(O) ->
lists:member(verbose, O).
+
+is_werr(S) when is_record(S, state) ->
+ is_werr(S#state.options);
+is_werr(O) ->
+ lists:member(warnings_as_errors, O).
diff --git a/lib/asn1/src/asn1ct_check.erl b/lib/asn1/src/asn1ct_check.erl
index efd731f052..e318477234 100644
--- a/lib/asn1/src/asn1ct_check.erl
+++ b/lib/asn1/src/asn1ct_check.erl
@@ -2031,7 +2031,7 @@ get_objectset_def2(_S,T = #typedef{typespec=#'ObjectSet'{}},_CField) ->
T;
get_objectset_def2(S,T,_CField) ->
asn1ct:warning("get_objectset_def2: uncontrolled object set structure:~n~p~n",
- [T],S).
+ [T],S,"get_objectset_def2: uncontrolled object set structure").
type_name(S,#type{def=Def}) ->
CurrMod = S#state.mname,
@@ -2705,7 +2705,7 @@ normalize_value(S,Type,{'DEFAULT',Value},NameList) ->
normalize_objectclassfieldvalue(S,Value,NL);
Err ->
asn1ct:warning("could not check default value ~p~nType:~n~p~nNameList:~n~p~n",
- [Value,Type,Err],S),
+ [Value,Type,Err],S,"could not check default value"),
Value
end;
normalize_value(S,Type,Val,NameList) ->
@@ -2791,22 +2791,27 @@ normalize_bitstring(S,Value,Type)->
case catch lists:map(F,RecList) of
{error,Reason} ->
asn1ct:warning("default value not "
- "compatible with type definition ~p~n",
- [Reason],S),
+ "compatible with type definition ~p~n",
+ [Reason],S,
+ "default value not "
+ "compatible with type definition"),
Value;
NewList ->
NewList
end;
_ ->
asn1ct:warning("default value not "
- "compatible with type definition ~p~n",
- [RecList],S),
+ "compatible with type definition ~p~n",
+ [RecList],S,
+ "default value not "
+ "compatible with type definition"),
Value
end;
{Name,String} when is_atom(Name) ->
normalize_bitstring(S,String,Type);
Other ->
- asn1ct:warning("illegal default value ~p~n",[Other],S),
+ asn1ct:warning("illegal default value ~p~n",[Other],S,
+ "illegal default value"),
Value
end.
@@ -2846,12 +2851,14 @@ normalize_octetstring(S,Value,CType) ->
lists:map(fun([])-> ok;
(H)when H > 255->
asn1ct:warning("not legal octet value ~p in OCTET STRING, ~p~n",
- [H,List],S);
+ [H,List],S,
+ "not legal octet value ~p in OCTET STRING");
(_)-> ok
end, List),
List;
Other ->
- asn1ct:warning("unknown default value ~p~n",[Other],S),
+ asn1ct:warning("unknown default value ~p~n",[Other],S,
+ "unknown default value"),
Value
end.
@@ -2908,13 +2915,15 @@ normalize_enumerated(S,{Name,EnumV},CType) when is_atom(Name) ->
normalize_enumerated(S,Value,{CType1,CType2}) when is_list(CType1), is_list(CType2)->
normalize_enumerated(S,Value,CType1++CType2);
normalize_enumerated(S,V,CType) ->
- asn1ct:warning("Enumerated unknown type ~p~n",[CType],S),
+ asn1ct:warning("Enumerated unknown type ~p~n",[CType],S,
+ "Enumerated unknown type"),
V.
normalize_enumerated2(S,V,Enum) ->
case lists:keysearch(V,1,Enum) of
{value,{Val,_}} -> Val;
_ ->
- asn1ct:warning("Enumerated value is not correct ~p~n",[V],S),
+ asn1ct:warning("enumerated value is not correct ~p~n",[V],S,
+ "enumerated value is not correct"),
V
end.
@@ -2925,7 +2934,8 @@ normalize_choice(S,{'CHOICE',{C,V}},CType,NameList) when is_atom(C) ->
{C,normalize_value(S,CT,{'DEFAULT',V},
[Name|NameList])};
Other ->
- asn1ct:warning("Wrong format of type/value ~p/~p~n",[Other,V],S),
+ asn1ct:warning("Wrong format of type/value ~p/~p~n",[Other,V],S,
+ "Wrong format of type/value"),
{C,V}
end;
normalize_choice(S,{'DEFAULT',ValueList},CType,NameList) when is_list(ValueList) ->
@@ -3101,7 +3111,8 @@ normalize_s_of(SorS,S,Value,Type,NameList) when is_list(Value) ->
List when is_list(List) ->
List;
_ ->
- asn1ct:warning("~p could not handle value ~p~n",[SorS,Value],S),
+ asn1ct:warning("~p could not handle value ~p~n",[SorS,Value],S,
+ "could not handle value"),
Value
end;
normalize_s_of(SorS,S,Value,Type,NameList)
@@ -3159,7 +3170,8 @@ get_normalized_value(S,Val,Type,Func,AddArg) ->
V2 = sort_val_if_set(AddArg,NewVal,Type),
call_Func(update_state(S,ExtM),V2,Type,Func,AddArg);
_ ->
- asn1ct:warning("default value not comparable ~p~n",[Val],S),
+ asn1ct:warning("default value not comparable ~p~n",[Val],S,
+ "default value not comparable"),
Val
end.
@@ -5756,7 +5768,8 @@ ascending_order_check1(S,TypeName,
[C1 = #'ComponentType'{tags=[{_,T}|_]},
C2 = #'ComponentType'{tags=[{_,T}|_]}|Rest]) ->
asn1ct:warning("Indistinct tag ~p in SET ~p, components ~p and ~p~n",
- [T,TypeName,C1#'ComponentType'.name,C2#'ComponentType'.name],S),
+ [T,TypeName,C1#'ComponentType'.name,C2#'ComponentType'.name],S,
+ "Indistinct tag in SET"),
ascending_order_check1(S,TypeName,[C2|Rest]);
ascending_order_check1(S,TypeName,
[C1 = #'ComponentType'{tags=[{'UNIVERSAL',T1}|_]},
@@ -5764,9 +5777,10 @@ ascending_order_check1(S,TypeName,
case (decode_type(T1) == decode_type(T2)) of
true ->
asn1ct:warning("Indistinct tags ~p and ~p in"
- " SET ~p, components ~p and ~p~n",
- [T1,T2,TypeName,C1#'ComponentType'.name,
- C2#'ComponentType'.name],S),
+ " SET ~p, components ~p and ~p~n",
+ [T1,T2,TypeName,C1#'ComponentType'.name,
+ C2#'ComponentType'.name],S,
+ "Indistinct tags and in SET"),
ascending_order_check1(S,TypeName,[C2|Rest]);
_ ->
ascending_order_check1(S,TypeName,[C2|Rest])
diff --git a/lib/asn1/test/asn1_SUITE.erl.src b/lib/asn1/test/asn1_SUITE.erl.src
index 582ccd877c..e7f93a4053 100644
--- a/lib/asn1/test/asn1_SUITE.erl.src
+++ b/lib/asn1/test/asn1_SUITE.erl.src
@@ -2236,8 +2236,10 @@ test_compile_options(Config) ->
?line ok = test_compile_options:path(Config),
?line ok = test_compile_options:noobj(Config),
?line ok = test_compile_options:record_name_prefix(Config),
- ?line ok = test_compile_options:verbose(Config)
+ ?line ok = test_compile_options:verbose(Config),
+ ?line ok = test_compile_options:warnings_as_errors(Config)
end.
+
testDoubleEllipses(suite) -> [];
testDoubleEllipses(Config) ->
?line testDoubleEllipses:compile(Config,?BER,[]),
diff --git a/lib/asn1/test/test_compile_options.erl b/lib/asn1/test/test_compile_options.erl
index 5e027cdedb..5cb212eddf 100644
--- a/lib/asn1/test/test_compile_options.erl
+++ b/lib/asn1/test/test_compile_options.erl
@@ -24,7 +24,7 @@
-export([wrong_path/1,comp/2,path/1,ticket_6143/1,noobj/1,
- record_name_prefix/1,verbose/1]).
+ record_name_prefix/1,verbose/1,warnings_as_errors/1]).
%% OTP-5689
wrong_path(Config) ->
@@ -141,6 +141,43 @@ verbose(Config) when is_list(Config) ->
?line [] = test_server:capture_get(),
ok.
+warnings_as_errors(Config) when is_list(Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ Asn1File = filename:join([PrivDir,"WERROR.asn1"]),
+ OutFile = filename:join([PrivDir,"WERROR.erl"]),
+ Opts = [{outdir,PrivDir},noobj,verbose],
+
+ %% Generate WERR.asn to emit warning
+ %% Warning: Wrong format of type/value
+ %% false/{'Externalvaluereference',_,'WERR',noInvokeId}
+ Warn = <<"WERROR DEFINITIONS IMPLICIT TAGS ::=\n"
+ "\n"
+ "BEGIN\n"
+ "\n"
+ "InvokeId ::= CHOICE\n"
+ "{\n"
+ " present INTEGER,\n"
+ " absent NULL\n"
+ "}\n"
+ "\n"
+ "noInvokeId InvokeId ::= absent:NULL\n"
+ "\n"
+ "NoInvokeId InvokeId ::= {noInvokeId}\n"
+ "\n"
+ "END -- end of useful definitions.\n">>,
+ ?line ok = file:write_file(Asn1File, Warn),
+
+ %% Test warnings_as_errors compile
+ ?line false = filelib:is_regular(OutFile),
+ ?line {error, _} = asn1ct:compile(Asn1File, [warnings_as_errors|Opts]),
+ ?line false = filelib:is_regular(OutFile),
+
+ %% Test normal compile
+ ?line ok = asn1ct:compile(Asn1File, Opts),
+ ?line true = filelib:is_regular(OutFile),
+ ?line ok = file:delete(OutFile),
+ ok.
+
outfiles_check(OutDir) ->
outfiles_check(OutDir,outfiles1()).
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml
index c92566de37..57b032b3fd 100644
--- a/lib/common_test/doc/src/common_test_app.xml
+++ b/lib/common_test/doc/src/common_test_app.xml
@@ -144,7 +144,7 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs}]</v>
+ <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
diff --git a/lib/common_test/doc/src/ct_hooks.xml b/lib/common_test/doc/src/ct_hooks.xml
index 7d5c9f4750..0ece3199bb 100644
--- a/lib/common_test/doc/src/ct_hooks.xml
+++ b/lib/common_test/doc/src/ct_hooks.xml
@@ -81,12 +81,14 @@
<funcs>
<func>
- <name>Module:init(Id, Opts) -&gt; State</name>
+ <name>Module:init(Id, Opts) -&gt; {ok, State} |
+ {ok, State, Priority}</name>
<fsummary>Initiates the Common Test Hook</fsummary>
<type>
<v>Id = reference() | term()</v>
<v>Opts = term()</v>
<v>State = term()</v>
+ <v>Priority = integer()</v>
</type>
<desc>
@@ -103,6 +105,10 @@
if <seealso marker="#Module:id-1">id/1</seealso> is not implemented.
</p>
+ <p><c>Priority</c> is the relative priority of this hook. Hooks with a
+ lower priority will be executed first. If no priority is given,
+ it will be set to 0. </p>
+
<p>For details about when init is called see
<seealso marker="ct_hooks_chapter#scope">scope</seealso>
in the User's Guide.</p>
diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml
index fc5ab48e1b..dbb4310040 100644
--- a/lib/common_test/doc/src/ct_hooks_chapter.xml
+++ b/lib/common_test/doc/src/ct_hooks_chapter.xml
@@ -94,9 +94,11 @@
<seealso marker="common_test#Module:init_per_group-2">
init_per_group/2</seealso>. <c>CTH</c> in this case can be either
only the module name of the CTH or a tuple with the module name and the
- initial arguments to the CTH. Eg:
+ initial arguments and optionally the hook priority of the CTH. Eg:
<c>{ct_hooks,[my_cth_module]}</c> or
- <c>{ct_hooks,[{my_cth_module,[{debug,true}]}]}</c></p>
+ <c>{ct_hooks,[{my_cth_module,[{debug,true}]}]}</c> or
+ <c>{ct_hooks,[{my_cth_module,[{debug,true}],500}]}</c>
+ </p>
<section>
<title>Overriding CTHs</title>
@@ -109,7 +111,16 @@
<c>id</c> in both places, Common Test knows that this CTH
has already been installed and will not try to install it again.</p>
</section>
-
+
+ <section>
+ <title>CTH Priority</title>
+ <p>By default each CTH installed will be executed in the order which
+ they are installed. This is not always wanted so common_test allows
+ the user to specify a priority for each hook. The priority can either
+ be specified in the CTH <seealso marker="ct_hooks#Module:init-2">init/2
+ </seealso> function or when installing the hook. The priority given at
+ installation will override the priority returned by the CTH. </p>
+ </section>
</section>
<marker id="scope"/>
@@ -331,7 +342,7 @@ id(Opts) ->
%% any common state.
init(Id, Opts) ->
{ok,D} = file:open(Id,[write]),
- #state{ file_handle = D, total = 0, data = [] }.
+ {ok, #state{ file_handle = D, total = 0, data = [] }}.
%% @doc Called before init_per_suite is called.
pre_init_per_suite(Suite,Config,State) ->
diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml
index e6fb85634f..e668568795 100644
--- a/lib/common_test/doc/src/run_test_chapter.xml
+++ b/lib/common_test/doc/src/run_test_chapter.xml
@@ -488,7 +488,7 @@
LogDir = string()
EventHandlers = atom() | [atom()]
InitArgs = [term()]
- CTHModules = [CTHModule | {CTHModule, CTHInitArgs}]
+ CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]
CTHModule = atom()
CTHInitArgs = term()
DirRef = DirAlias | Dir
diff --git a/lib/common_test/src/ct_framework.erl b/lib/common_test/src/ct_framework.erl
index 809616d8e3..9e597edf38 100644
--- a/lib/common_test/src/ct_framework.erl
+++ b/lib/common_test/src/ct_framework.erl
@@ -240,7 +240,8 @@ add_defaults(Mod,Func,FuncInfo,DoInit) ->
case (catch Mod:suite()) of
{'EXIT',{undef,_}} ->
SuiteInfo = merge_with_suite_defaults(Mod,[]),
- case add_defaults1(Mod,Func,FuncInfo,SuiteInfo,DoInit) of
+ SuiteInfoNoCTH = [I || I <- SuiteInfo, element(1,I) =/= ct_hooks],
+ case add_defaults1(Mod,Func,FuncInfo,SuiteInfoNoCTH,DoInit) of
Error = {error,_} -> {SuiteInfo,Error};
MergedInfo -> {SuiteInfo,MergedInfo}
end;
@@ -251,10 +252,11 @@ add_defaults(Mod,Func,FuncInfo,DoInit) ->
(_) -> false
end, SuiteInfo) of
true ->
- SuiteInfoNoCTH =
- lists:keydelete(ct_hooks,1,SuiteInfo),
- SuiteInfo1 = merge_with_suite_defaults(Mod,SuiteInfoNoCTH),
- case add_defaults1(Mod,Func,FuncInfo,SuiteInfo1,DoInit) of
+ SuiteInfo1 = merge_with_suite_defaults(Mod,SuiteInfo),
+ SuiteInfoNoCTH = [I || I <- SuiteInfo1,
+ element(1,I) =/= ct_hooks],
+ case add_defaults1(Mod,Func,FuncInfo,
+ SuiteInfoNoCTH,DoInit) of
Error = {error,_} -> {SuiteInfo1,Error};
MergedInfo -> {SuiteInfo1,MergedInfo}
end;
diff --git a/lib/common_test/src/ct_hooks.erl b/lib/common_test/src/ct_hooks.erl
index 984e04b90f..f243b87f54 100644
--- a/lib/common_test/src/ct_hooks.erl
+++ b/lib/common_test/src/ct_hooks.erl
@@ -31,11 +31,11 @@
-export([on_tc_skip/2]).
-export([on_tc_fail/2]).
--type proplist() :: [{atom(),term()}].
-
%% If you change this, remember to update ct_util:look -> stop clause as well.
-define(config_name, ct_hooks).
+-record(ct_hook_config, {id, module, prio, scope, opts = [], state = []}).
+
%% -------------------------------------------------------------------------
%% API Functions
%% -------------------------------------------------------------------------
@@ -44,22 +44,22 @@
-spec init(State :: term()) -> ok |
{error, Reason :: term()}.
init(Opts) ->
- call([{Hook, call_id, undefined} || Hook <- get_new_hooks(Opts)],
- ok, init, []).
+ call(get_new_hooks(Opts, undefined), ok, init, []).
%% @doc Called after all suites are done.
-spec terminate(Hooks :: term()) ->
ok.
terminate(Hooks) ->
- call([{HookId, fun call_terminate/3} || {HookId,_,_} <- Hooks],
+ call([{HookId, fun call_terminate/3}
+ || #ct_hook_config{id = HookId} <- Hooks],
ct_hooks_terminate_dummy, terminate, Hooks),
ok.
%% @doc Called as each test case is started. This includes all configuration
%% tests.
-spec init_tc(Mod :: atom(), Func :: atom(), Args :: list()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()}.
@@ -68,11 +68,11 @@ init_tc(ct_framework, _Func, Args) ->
init_tc(Mod, init_per_suite, Config) ->
Info = try proplists:get_value(ct_hooks, Mod:suite(),[]) of
List when is_list(List) ->
- [{ct_hooks,List}];
+ [{?config_name,List}];
CTHook when is_atom(CTHook) ->
- [{ct_hooks,[CTHook]}]
+ [{?config_name,[CTHook]}]
catch error:undef ->
- [{ct_hooks,[]}]
+ [{?config_name,[]}]
end,
call(fun call_generic/3, Config ++ Info, [pre_init_per_suite, Mod]);
init_tc(Mod, end_per_suite, Config) ->
@@ -92,7 +92,7 @@ init_tc(_Mod, TC, Config) ->
Args :: list(),
Result :: term(),
Resturn :: term()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()} |
@@ -131,36 +131,48 @@ on_tc_fail(_How, {Suite, Case, Reason}) ->
%% -------------------------------------------------------------------------
%% Internal Functions
%% -------------------------------------------------------------------------
-call_id(Mod, Config, Meta) when is_atom(Mod) ->
- call_id({Mod, []}, Config, Meta);
-call_id({Mod, Opts}, Config, Scope) ->
+call_id(#ct_hook_config{ module = Mod, opts = Opts} = Hook, Config, Scope) ->
Id = catch_apply(Mod,id,[Opts], make_ref()),
- {Config, {Id, scope(Scope), {Mod, {Id,Opts}}}}.
+ {Config, Hook#ct_hook_config{ id = Id, scope = scope(Scope)}}.
-call_init({Mod,{Id,Opts}},Config,_Meta) ->
- NewState = Mod:init(Id, Opts),
- {Config, {Mod, NewState}}.
-
-call_terminate({Mod, State}, _, _) ->
+call_init(#ct_hook_config{ module = Mod, opts = Opts, id = Id, prio = P} = Hook,
+ Config,_Meta) ->
+ case Mod:init(Id, Opts) of
+ {ok, NewState} when P =:= undefined ->
+ {Config, Hook#ct_hook_config{ state = NewState, prio = 0 } };
+ {ok, NewState} ->
+ {Config, Hook#ct_hook_config{ state = NewState } };
+ {ok, NewState, Prio} when P =:= undefined ->
+ %% Only set prio if not already set when installing hook
+ {Config, Hook#ct_hook_config{ state = NewState, prio = Prio } };
+ {ok, NewState, _} ->
+ {Config, Hook#ct_hook_config{ state = NewState } };
+ NewState -> %% Keep for backward compatability reasons
+ {Config, Hook#ct_hook_config{ state = NewState } }
+ end.
+
+call_terminate(#ct_hook_config{ module = Mod, state = State} = Hook, _, _) ->
catch_apply(Mod,terminate,[State], ok),
- {[],{Mod,State}}.
+ {[],Hook}.
-call_cleanup({Mod, State}, Reason, [Function, _Suite | Args]) ->
+call_cleanup(#ct_hook_config{ module = Mod, state = State} = Hook,
+ Reason, [Function, _Suite | Args]) ->
NewState = catch_apply(Mod,Function, Args ++ [Reason, State],
State),
- {Reason, {Mod, NewState}}.
+ {Reason, Hook#ct_hook_config{ state = NewState } }.
-call_generic({Mod, State}, Value, [Function | Args]) ->
+call_generic(#ct_hook_config{ module = Mod, state = State} = Hook,
+ Value, [Function | Args]) ->
{NewValue, NewState} = catch_apply(Mod, Function, Args ++ [Value, State],
{Value,State}),
- {NewValue, {Mod, NewState}}.
+ {NewValue, Hook#ct_hook_config{ state = NewState } }.
%% Generic call function
call(Fun, Config, Meta) ->
maybe_lock(),
Hooks = get_hooks(),
- Res = call([{HookId,Fun} || {HookId,_, _} <- Hooks] ++
- get_new_hooks(Config, Fun),
+ Res = call(get_new_hooks(Config, Fun) ++
+ [{HookId,Fun} || #ct_hook_config{id = HookId} <- Hooks],
remove(?config_name,Config), Meta, Hooks),
maybe_unlock(),
Res.
@@ -173,19 +185,20 @@ call(Fun, Config, Meta, NoChangeRet) when is_function(Fun) ->
call([{Hook, call_id, NextFun} | Rest], Config, Meta, Hooks) ->
try
- {Config, {NewId, _, _} = NewHook} = call_id(Hook, Config, Meta),
+ {Config, #ct_hook_config{ id = NewId } = NewHook} =
+ call_id(Hook, Config, Meta),
{NewHooks, NewRest} =
- case lists:keyfind(NewId, 1, Hooks) of
+ case lists:keyfind(NewId, #ct_hook_config.id, Hooks) of
false when NextFun =:= undefined ->
{Hooks ++ [NewHook],
- [{NewId, fun call_init/3} | Rest]};
+ [{NewId, call_init} | Rest]};
ExistingHook when is_tuple(ExistingHook) ->
{Hooks, Rest};
_ ->
{Hooks ++ [NewHook],
- [{NewId, fun call_init/3},{NewId,NextFun} | Rest]}
+ [{NewId, call_init}, {NewId,NextFun} | Rest]}
end,
- call(NewRest, Config, Meta, NewHooks)
+ call(resort(NewRest,NewHooks), Config, Meta, NewHooks)
catch Error:Reason ->
Trace = erlang:get_stacktrace(),
ct_logs:log("Suite Hook","Failed to start a CTH: ~p:~p",
@@ -193,13 +206,16 @@ call([{Hook, call_id, NextFun} | Rest], Config, Meta, Hooks) ->
call([], {fail,"Failed to start CTH"
", see the CT Log for details"}, Meta, Hooks)
end;
+call([{HookId, call_init} | Rest], Config, Meta, Hooks) ->
+ call([{HookId, fun call_init/3} | Rest], Config, Meta, Hooks);
call([{HookId, Fun} | Rest], Config, Meta, Hooks) ->
try
- {_,Scope,ModState} = lists:keyfind(HookId, 1, Hooks),
- {NewConf, NewHookInfo} = Fun(ModState, Config, Meta),
+ Hook = lists:keyfind(HookId, #ct_hook_config.id, Hooks),
+ {NewConf, NewHook} = Fun(Hook, Config, Meta),
NewCalls = get_new_hooks(NewConf, Fun),
- NewHooks = lists:keyreplace(HookId, 1, Hooks, {HookId, Scope, NewHookInfo}),
- call(NewCalls ++ Rest, remove(?config_name, NewConf), Meta,
+ NewHooks = lists:keyreplace(HookId, #ct_hook_config.id, Hooks, NewHook),
+ call(resort(NewCalls ++ Rest,NewHooks), %% Resort if call_init changed prio
+ remove(?config_name, NewConf), Meta,
terminate_if_scope_ends(HookId, Meta, NewHooks))
catch throw:{error_in_cth_call,Reason} ->
call(Rest, {fail, Reason}, Meta,
@@ -237,19 +253,26 @@ terminate_if_scope_ends(HookId, [on_tc_skip,Suite,end_per_suite], Hooks) ->
terminate_if_scope_ends(HookId, [Function,Tag|T], Hooks) when T =/= [] ->
terminate_if_scope_ends(HookId,[Function,Tag],Hooks);
terminate_if_scope_ends(HookId, Function, Hooks) ->
- case lists:keyfind(HookId, 1, Hooks) of
- {HookId, Function, _ModState} = Hook ->
+ case lists:keyfind(HookId, #ct_hook_config.id, Hooks) of
+ #ct_hook_config{ id = HookId, scope = Function} = Hook ->
terminate([Hook]),
- lists:keydelete(HookId, 1, Hooks);
+ lists:keydelete(HookId, #ct_hook_config.id, Hooks);
_ ->
Hooks
end.
%% Fetch hook functions
get_new_hooks(Config, Fun) ->
- lists:foldl(fun(NewHook, Acc) ->
- [{NewHook, call_id, Fun} | Acc]
- end, [], get_new_hooks(Config)).
+ lists:map(fun(NewHook) when is_atom(NewHook) ->
+ {#ct_hook_config{ module = NewHook }, call_id, Fun};
+ ({NewHook,Opts}) ->
+ {#ct_hook_config{ module = NewHook,
+ opts = Opts}, call_id, Fun};
+ ({NewHook,Opts,Prio}) ->
+ {#ct_hook_config{ module = NewHook,
+ opts = Opts,
+ prio = Prio }, call_id, Fun}
+ end, get_new_hooks(Config)).
get_new_hooks(Config) when is_list(Config) ->
lists:flatmap(fun({?config_name, HookConfigs}) ->
@@ -264,7 +287,43 @@ save_suite_data_async(Hooks) ->
ct_util:save_suite_data_async(?config_name, Hooks).
get_hooks() ->
- ct_util:read_suite_data(?config_name).
+ lists:keysort(#ct_hook_config.prio,ct_util:read_suite_data(?config_name)).
+
+%% Sort all calls in this order:
+%% call_id < call_init < Hook Priority 1 < .. < Hook Priority N
+%% If Hook Priority is equal, check when it has been installed and
+%% sort on that instead.
+resort(Calls, Hooks) ->
+ lists:sort(
+ fun({_,_,_},_) ->
+ true;
+ (_,{_,_,_}) ->
+ false;
+ ({_,call_init},_) ->
+ true;
+ (_,{_,call_init}) ->
+ false;
+ ({Id1,_},{Id2,_}) ->
+ P1 = (lists:keyfind(Id1, #ct_hook_config.id, Hooks))#ct_hook_config.prio,
+ P2 = (lists:keyfind(Id2, #ct_hook_config.id, Hooks))#ct_hook_config.prio,
+ if
+ P1 == P2 ->
+ %% If priorities are equal, we check the position in the
+ %% hooks list
+ pos(Id1,Hooks) < pos(Id2,Hooks);
+ true ->
+ P1 < P2
+ end
+ end,Calls).
+
+pos(Id,Hooks) ->
+ pos(Id,Hooks,0).
+pos(Id,[#ct_hook_config{ id = Id}|_],Num) ->
+ Num;
+pos(Id,[_|Rest],Num) ->
+ pos(Id,Rest,Num+1).
+
+
catch_apply(M,F,A, Default) ->
try
diff --git a/lib/common_test/src/ct_run.erl b/lib/common_test/src/ct_run.erl
index c01e97b358..877ec9c7dd 100644
--- a/lib/common_test/src/ct_run.erl
+++ b/lib/common_test/src/ct_run.erl
@@ -521,8 +521,8 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
- "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
- "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
+ "\n\t[-event_handler EvHandler1 and EvHandler2 .. EvHandlerN]"
+ "\n\t[-ct_hooks CTHook1 and CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
"\n\t[-no_auto_compile]"
"\n\t[-multiply_timetraps N]"
@@ -540,8 +540,8 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
- "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
- "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
+ "\n\t[-event_handler EvHandler1 and EvHandler2 .. EvHandlerN]"
+ "\n\t[-ct_hooks CTHook1 and CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
"\n\t[-no_auto_compile]"
"\n\t[-multiply_timetraps N]"
@@ -2070,15 +2070,21 @@ ct_hooks_args2opts(Args) ->
ct_hooks_args2opts(
proplists:get_value(ct_hooks, Args, []),[]).
+ct_hooks_args2opts([CTH,Arg,Prio,"and"| Rest],Acc) ->
+ ct_hooks_args2opts(Rest,[{list_to_atom(CTH),
+ parse_cth_args(Arg),
+ parse_cth_args(Prio)}|Acc]);
ct_hooks_args2opts([CTH,Arg,"and"| Rest],Acc) ->
ct_hooks_args2opts(Rest,[{list_to_atom(CTH),
- parse_cth_args(Arg)}|Acc]);
+ parse_cth_args(Arg)}|Acc]);
ct_hooks_args2opts([CTH], Acc) ->
ct_hooks_args2opts([CTH,"and"],Acc);
ct_hooks_args2opts([CTH, "and" | Rest], Acc) ->
ct_hooks_args2opts(Rest,[list_to_atom(CTH)|Acc]);
ct_hooks_args2opts([CTH, Args], Acc) ->
ct_hooks_args2opts([CTH, Args, "and"],Acc);
+ct_hooks_args2opts([CTH, Args, Prio], Acc) ->
+ ct_hooks_args2opts([CTH, Args, Prio, "and"],Acc);
ct_hooks_args2opts([],Acc) ->
lists:reverse(Acc).
@@ -2225,7 +2231,14 @@ opts2args(EnvStartOpts) ->
({ct_hooks,CTHs}) when is_list(CTHs) ->
io:format(user,"ct_hooks: ~p",[CTHs]),
Strs = lists:flatmap(
- fun({CTH,Arg}) ->
+ fun({CTH,Arg,Prio}) ->
+ [atom_to_list(CTH),
+ lists:flatten(
+ io_lib:format("~p",[Arg])),
+ lists:flatten(
+ io_lib:format("~p",[Prio])),
+ "and"];
+ ({CTH,Arg}) ->
[atom_to_list(CTH),
lists:flatten(
io_lib:format("~p",[Arg])),
diff --git a/lib/common_test/test/ct_hooks_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE.erl
index 8574d7aabc..5c99f0f9f7 100644
--- a/lib/common_test/test/ct_hooks_SUITE.erl
+++ b/lib/common_test/test/ct_hooks_SUITE.erl
@@ -83,7 +83,7 @@ all(suite) ->
fail_post_suite_cth, skip_pre_suite_cth,
skip_post_suite_cth, recover_post_suite_cth, update_config_cth,
state_update_cth, options_cth, same_id_cth,
- fail_n_skip_with_minimal_cth
+ fail_n_skip_with_minimal_cth, prio_cth
]
)
.
@@ -209,6 +209,11 @@ fail_n_skip_with_minimal_cth(Config) when is_list(Config) ->
do_test(fail_n_skip_with_minimal_cth, "ct_cth_fail_one_skip_one_SUITE.erl",
[minimal_terminate_cth],Config).
+prio_cth(Config) when is_list(Config) ->
+ do_test(prio_cth, "ct_cth_prio_SUITE.erl",
+ [{empty_cth,[1000],1000},{empty_cth,[900],900},
+ {prio_cth,[1100,100],100},{prio_cth,[1100]}],Config).
+
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
%%%-----------------------------------------------------------------
@@ -296,9 +301,9 @@ test_events(two_empty_cth) ->
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
{?eh,cth,{'_',id,[[]]}},
- {?eh,cth,{'_',init,['_',[]]}},
{?eh,cth,{'_',id,[[]]}},
{?eh,cth,{'_',init,['_',[]]}},
+ {?eh,cth,{'_',init,['_',[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
@@ -365,9 +370,9 @@ test_events(minimal_and_maximal_cth) ->
[
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,cth,{'_',id,[[]]}},
{negative,{?eh,cth,{'_',id,['_',[]]}},
{?eh,cth,{'_',init,['_',[]]}}},
- {?eh,cth,{'_',id,[[]]}},
{?eh,cth,{'_',init,['_',[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
@@ -954,8 +959,8 @@ test_events(same_id_cth) ->
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
{?eh,cth,{'_',id,[[]]}},
- {?eh,cth,{'_',init,[same_id_cth,[]]}},
{?eh,cth,{'_',id,[[]]}},
+ {?eh,cth,{'_',init,[same_id_cth,[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
{negative,
@@ -1001,6 +1006,73 @@ test_events(fail_n_skip_with_minimal_cth) ->
{?eh,stop_logging,[]}
];
+test_events(prio_cth) ->
+
+ GenPre = fun(Func,States) ->
+ [{?eh,cth,{'_',Func,['_','_',State]}} ||
+ State <- States]
+ end,
+
+ GenPost = fun(Func,States) ->
+ [{?eh,cth,{'_',Func,['_','_','_',State]}} ||
+ State <- States]
+ end,
+
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}] ++
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,init_per_suite}}] ++
+ GenPre(pre_init_per_suite,
+ [[1100,100],[800],[900],[1000],[1200,1050],[1100],[1200]]) ++
+ GenPost(post_init_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,init_per_suite,ok}},
+
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,{init_per_group,'_',[]}}}] ++
+ GenPre(pre_init_per_group,
+ [[1100,100],[600,200],[600,600],[700],[800],
+ [900],[1000],[1200,1050],[1100],[1200]]) ++
+ GenPost(post_init_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,{init_per_group,'_',[]},ok}}] ++
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,test_case}}] ++
+ GenPre(pre_init_per_testcase,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ GenPost(post_end_per_testcase,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,test_case,ok}},
+
+ {?eh,tc_start,{ct_cth_prio_SUITE,{end_per_group,'_',[]}}}] ++
+ GenPre(pre_end_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ GenPost(post_end_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,{end_per_group,'_',[]},ok}}],
+
+ {?eh,tc_start,{ct_cth_prio_SUITE,end_per_suite}}] ++
+ GenPre(pre_end_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ GenPost(post_end_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
test_events(ok) ->
ok.
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl
new file mode 100644
index 0000000000..d564398cd0
--- /dev/null
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl
@@ -0,0 +1,62 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(ct_cth_prio_SUITE).
+
+%% Note: This directive should only be used in test suites.
+-compile(export_all).
+
+-include("ct.hrl").
+
+suite() ->
+ ([{timetrap, {minutes, 10}},
+ {ct_hooks, [{empty_cth,[800],800},
+ {prio_cth,[1200]},{prio_cth,[1200,1050],1050}]}]).
+
+%% Test server callback functions
+init_per_suite(Config) ->
+ [{ct_hooks, [{empty_cth,[700],700},
+ {prio_cth,[600,600]},
+ {prio_cth,[600,200],200}]}|Config].
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_group(_G, Config) ->
+ [{ct_hooks, [{empty_cth,[600],600},
+ {prio_cth,[900,900]},{prio_cth,[500,900],900}]}|Config].
+
+end_per_group(_G, _Config) ->
+ ok.
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+all() ->
+ [{group,test_group}].
+
+groups() ->
+ [{test_group,[],[test_case]}].
+
+%% Test cases starts here.
+test_case(Config) when is_list(Config) ->
+ ok.
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
index ebebfd18a9..7befcfa57c 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
@@ -59,8 +59,7 @@
-include_lib("common_test/src/ct_util.hrl").
-include_lib("common_test/include/ct_event.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -71,17 +70,17 @@
%% @doc Always called before any other callback function. Use this to initiate
%% any common state. It should return an state for this CTH.
--spec init(Id :: term(), Opts :: proplist()) ->
- State :: #state{}.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
init(Id, Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
data = {?MODULE, init, [Id, Opts]}}),
- Opts.
+ {ok,Opts}.
%% @doc The ID is used to uniquly identify an CTH instance, if two CTH's
%% return the same ID the seconds CTH is ignored. This function should NOT
%% have any side effects as it might be called multiple times by common test.
--spec id(Opts :: proplist()) ->
+-spec id(Opts :: proplists:proplist()) ->
Id :: term().
id(Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl
new file mode 100644
index 0000000000..82511ab0d3
--- /dev/null
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl
@@ -0,0 +1,74 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+
+-module(prio_cth).
+
+
+-include_lib("common_test/src/ct_util.hrl").
+
+
+%% CT Hooks
+-compile(export_all).
+
+id(Opts) ->
+ empty_cth:id(Opts).
+
+init(Id, Opts) ->
+ {ok, [Prio|_] = State} = empty_cth:init(Id, Opts),
+ {ok, State, Prio}.
+
+pre_init_per_suite(Suite, Config, State) ->
+ empty_cth:pre_init_per_suite(Suite,Config,State).
+
+post_init_per_suite(Suite,Config,Return,State) ->
+ empty_cth:post_init_per_suite(Suite,Config,Return,State).
+
+pre_end_per_suite(Suite,Config,State) ->
+ empty_cth:pre_end_per_suite(Suite,Config,State).
+
+post_end_per_suite(Suite,Config,Return,State) ->
+ empty_cth:post_end_per_suite(Suite,Config,Return,State).
+
+pre_init_per_group(Group,Config,State) ->
+ empty_cth:pre_init_per_group(Group,Config,State).
+
+post_init_per_group(Group,Config,Return,State) ->
+ empty_cth:post_init_per_group(Group,Config,Return,State).
+
+pre_end_per_group(Group,Config,State) ->
+ empty_cth:pre_end_per_group(Group,Config,State).
+
+post_end_per_group(Group,Config,Return,State) ->
+ empty_cth:post_end_per_group(Group,Config,Return,State).
+
+pre_init_per_testcase(TC,Config,State) ->
+ empty_cth:pre_init_per_testcase(TC,Config,State).
+
+post_end_per_testcase(TC,Config,Return,State) ->
+ empty_cth:post_end_per_testcase(TC,Config,Return,State).
+
+on_tc_fail(TC, Reason, State) ->
+ empty_cth:on_tc_fail(TC,Reason,State).
+
+on_tc_skip(TC, Reason, State) ->
+ empty_cth:on_tc_skip(TC,Reason,State).
+
+terminate(State) ->
+ empty_cth:terminate(State).
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
index 35c990c0be..9da48d3a4c 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
@@ -29,7 +29,7 @@
init(Id, Opts) ->
State = empty_cth:init(Id, Opts),
- [init|State].
+ {ok, [init|State]}.
pre_init_per_suite(Suite, Config, State) ->
empty_cth:pre_init_per_suite(Suite,Config,State),
diff --git a/lib/compiler/src/compile.erl b/lib/compiler/src/compile.erl
index ce8a5bf864..e46c667e47 100644
--- a/lib/compiler/src/compile.erl
+++ b/lib/compiler/src/compile.erl
@@ -113,7 +113,7 @@ noenv_forms(Forms, Opt) when is_atom(Opt) ->
noenv_output_generated(Opts) ->
{_,Passes} = passes(file, expand_opts(Opts)),
- any(fun ({save_binary,_F}) -> true;
+ any(fun ({save_binary,_T,_F}) -> true;
(_Other) -> false
end, Passes).
@@ -122,6 +122,7 @@ noenv_output_generated(Opts) ->
%%
-define(pass(P), {P,fun P/1}).
+-define(pass(P,T), {P,fun T/1,fun P/1}).
env_default_opts() ->
Key = "ERL_COMPILER_OPTIONS",
@@ -304,7 +305,7 @@ run_tc({Name,Fun}, St) ->
Val.
comp_ret_ok(#compile{code=Code,warnings=Warn0,module=Mod,options=Opts}=St) ->
- case member(warnings_as_errors, Opts) andalso length(Warn0) > 0 of
+ case werror(St) of
true ->
case member(report_warnings, Opts) of
true ->
@@ -339,6 +340,11 @@ comp_ret_err(#compile{warnings=Warn0,errors=Err0,options=Opts}=St) ->
false -> error
end.
+not_werror(St) -> not werror(St).
+
+werror(#compile{options=Opts,warnings=Ws}) ->
+ Ws =/= [] andalso member(warnings_as_errors, Opts).
+
%% messages_per_file([{File,[Message]}]) -> [{File,[Message]}]
messages_per_file(Ms) ->
T = lists:sort([{File,M} || {File,Messages} <- Ms, M <- Messages]),
@@ -373,7 +379,7 @@ passes(Type, Opts) ->
%% insert a first pass to remove the file (unless the
%% source file is a BEAM file).
{Ext,case last(Passes) of
- {save_binary,_Fun} ->
+ {save_binary,_TestFun,_Fun} ->
case Passes of
[{read_beam_file,_}|_] ->
%% The BEAM is both input and output.
@@ -655,7 +661,7 @@ asm_passes() ->
binary_passes() ->
[{native_compile,fun test_native/1,fun native_compile/1},
- {unless,binary,?pass(save_binary)}].
+ {unless,binary,?pass(save_binary,not_werror)}].
%%%
%%% Compiler passes.
@@ -1379,28 +1385,34 @@ report_errors(#compile{options=Opts,errors=Errors}) ->
end.
report_warnings(#compile{options=Opts,warnings=Ws0}) ->
- case member(report_warnings, Opts) of
+ Werror = member(warnings_as_errors, Opts),
+ P = case Werror of
+ true -> "";
+ false -> "Warning: "
+ end,
+ ReportWerror = Werror andalso member(report_errors, Opts),
+ case member(report_warnings, Opts) orelse ReportWerror of
true ->
- Ws1 = flatmap(fun({{F,_L},Eds}) -> format_message(F, Eds);
- ({F,Eds}) -> format_message(F, Eds) end,
+ Ws1 = flatmap(fun({{F,_L},Eds}) -> format_message(F, P, Eds);
+ ({F,Eds}) -> format_message(F, P, Eds) end,
Ws0),
Ws = lists:sort(Ws1),
foreach(fun({_,Str}) -> io:put_chars(Str) end, Ws);
false -> ok
end.
-format_message(F, [{{Line,Column}=Loc,Mod,E}|Es]) ->
- M = {{F,Loc},io_lib:format("~s:~w:~w Warning: ~s\n",
- [F,Line,Column,Mod:format_error(E)])},
- [M|format_message(F, Es)];
-format_message(F, [{Line,Mod,E}|Es]) ->
- M = {{F,{Line,0}},io_lib:format("~s:~w: Warning: ~s\n",
- [F,Line,Mod:format_error(E)])},
- [M|format_message(F, Es)];
-format_message(F, [{Mod,E}|Es]) ->
- M = {none,io_lib:format("~s: Warning: ~s\n", [F,Mod:format_error(E)])},
- [M|format_message(F, Es)];
-format_message(_, []) -> [].
+format_message(F, P, [{{Line,Column}=Loc,Mod,E}|Es]) ->
+ M = {{F,Loc},io_lib:format("~s:~w:~w ~s~s\n",
+ [F,Line,Column,P,Mod:format_error(E)])},
+ [M|format_message(F, P, Es)];
+format_message(F, P, [{Line,Mod,E}|Es]) ->
+ M = {{F,{Line,0}},io_lib:format("~s:~w: ~s~s\n",
+ [F,Line,P,Mod:format_error(E)])},
+ [M|format_message(F, P, Es)];
+format_message(F, P, [{Mod,E}|Es]) ->
+ M = {none,io_lib:format("~s: ~s~s\n", [F,P,Mod:format_error(E)])},
+ [M|format_message(F, P, Es)];
+format_message(_, _, []) -> [].
%% list_errors(File, ErrorDescriptors) -> ok
diff --git a/lib/compiler/src/sys_pre_expand.erl b/lib/compiler/src/sys_pre_expand.erl
index 480954adac..dd6f24e21f 100644
--- a/lib/compiler/src/sys_pre_expand.erl
+++ b/lib/compiler/src/sys_pre_expand.erl
@@ -223,10 +223,8 @@ attribute(export, Es, _L, St) ->
St#expand{exports=union(from_list(Es), St#expand.exports)};
attribute(import, Is, _L, St) ->
import(Is, St);
-attribute(compile, C, _L, St) when is_list(C) ->
- St#expand{compile=St#expand.compile ++ C};
-attribute(compile, C, _L, St) ->
- St#expand{compile=St#expand.compile ++ [C]};
+attribute(compile, _C, _L, St) ->
+ St;
attribute(Name, Val, Line, St) when is_list(Val) ->
St#expand{attributes=St#expand.attributes ++ [{Name,Line,Val}]};
attribute(Name, Val, Line, St) ->
diff --git a/lib/compiler/test/error_SUITE.erl b/lib/compiler/test/error_SUITE.erl
index 6e0aadf007..eb5e50818e 100644
--- a/lib/compiler/test/error_SUITE.erl
+++ b/lib/compiler/test/error_SUITE.erl
@@ -183,23 +183,47 @@ get_compilation_errors(Config, Filename) ->
E.
warnings_as_errors(Config) when is_list(Config) ->
- Ts = [{warnings_as_errors,
+ ?line TestFile = test_filename(Config),
+ ?line BeamFile = filename:rootname(TestFile, ".erl") ++ ".beam",
+ ?line OutDir = ?config(priv_dir, Config),
+
+ Ts1 = [{warnings_as_errors,
<<"
t() ->
A = unused,
ok.
">>,
- [export_all,warnings_as_errors],
- {error,
- [],
- [{3,erl_lint,{unused_var,'A'}}]} }],
- ?line [] = run(Config, Ts),
+ [warnings_as_errors, export_all, {outdir, OutDir}],
+ {error,
+ [],
+ [{3,erl_lint,{unused_var,'A'}}]} }],
+ ?line [] = run(Ts1, TestFile, write_beam),
+ ?line false = filelib:is_regular(BeamFile),
+
+ Ts2 = [{warning_unused_var,
+ <<"
+ t() ->
+ A = unused,
+ ok.
+ ">>,
+ [return_warnings, export_all, {outdir, OutDir}],
+ {warning,
+ [{3,erl_lint,{unused_var,'A'}}]} }],
+
+ ?line [] = run(Ts2, TestFile, write_beam),
+ ?line true = filelib:is_regular(BeamFile),
+ ?line ok = file:delete(BeamFile),
+
ok.
run(Config, Tests) ->
+ ?line File = test_filename(Config),
+ run(Tests, File, dont_write_beam).
+
+run(Tests, File, WriteBeam) ->
F = fun({N,P,Ws,E}, BadL) ->
- case catch run_test(Config, P, Ws) of
+ case catch run_test(P, File, Ws, WriteBeam) of
E ->
BadL;
Bad ->
@@ -211,8 +235,12 @@ run(Config, Tests) ->
lists:foldl(F, [], Tests).
run2(Config, Tests) ->
+ ?line File = test_filename(Config),
+ run2(Tests, File, dont_write_beam).
+
+run2(Tests, File, WriteBeam) ->
F = fun({N,P,Ws,E}, BadL) ->
- case catch filter(run_test(Config, P, Ws)) of
+ case catch filter(run_test(P, File, Ws, WriteBeam)) of
E ->
BadL;
Bad ->
@@ -231,12 +259,19 @@ filter(X) ->
%% Compiles a test module and returns the list of errors and warnings.
-run_test(Conf, Test0, Warnings) ->
- Filename = 'errors_test.erl',
- ?line DataDir = ?config(priv_dir, Conf),
+test_filename(Conf) ->
+ Filename = "errors_test.erl",
+ DataDir = ?config(priv_dir, Conf),
+ filename:join(DataDir, Filename).
+
+run_test(Test0, File, Warnings, WriteBeam) ->
?line Test = ["-module(errors_test). ", Test0],
- ?line File = filename:join(DataDir, Filename),
- ?line Opts = [binary,return_errors|Warnings],
+ ?line Opts = case WriteBeam of
+ dont_write_beam ->
+ [binary,return_errors|Warnings];
+ write_beam ->
+ [return_errors|Warnings]
+ end,
?line ok = file:write_file(File, Test),
%% Compile once just to print all errors and warnings.
@@ -252,6 +287,10 @@ run_test(Conf, Test0, Warnings) ->
%io:format("compile:file(~s,~p) ->~n~p~n",
% [File,Opts,Ws]),
[];
+ {ok,errors_test,[{_File,Ws}]} ->
+ {warning,Ws};
+ {ok,errors_test,[]} ->
+ [];
{error,[{XFile,Es}],Ws} = _ZZ when is_list(XFile) ->
%io:format("compile:file(~s,~p) ->~n~p~n",
% [File,Opts,_ZZ]),
diff --git a/lib/crypto/c_src/Makefile.in b/lib/crypto/c_src/Makefile.in
index 276c84d601..c2a986c334 100644
--- a/lib/crypto/c_src/Makefile.in
+++ b/lib/crypto/c_src/Makefile.in
@@ -41,6 +41,7 @@ CFLAGS = $(DED_CFLAGS)
SSL_LIBDIR = @SSL_LIBDIR@
SSL_INCLUDE = @SSL_INCLUDE@
SSL_CRYPTO_LIBNAME = @SSL_CRYPTO_LIBNAME@
+SSL_SSL_LIBNAME = @SSL_SSL_LIBNAME@
INCLUDES = $(SSL_INCLUDE) $(DED_INCLUDES)
@@ -84,7 +85,7 @@ DYNAMIC_CRYPTO_LIB=@SSL_DYNAMIC_ONLY@
ifeq ($(DYNAMIC_CRYPTO_LIB),yes)
SSL_DED_LD_RUNTIME_LIBRARY_PATH = @SSL_DED_LD_RUNTIME_LIBRARY_PATH@
-CRYPTO_LINK_LIB=$(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) -l$(SSL_CRYPTO_LIBNAME)
+CRYPTO_LINK_LIB=$(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) -l$(SSL_CRYPTO_LIBNAME) -l$(SSL_SSL_LIBNAME)
else
SSL_DED_LD_RUNTIME_LIBRARY_PATH=
CRYPTO_LINK_LIB=$(SSL_LIBDIR)/lib$(SSL_CRYPTO_LIBNAME).a
@@ -112,7 +113,7 @@ $(LIBDIR)/crypto$(TYPEMARKER).so: $(OBJS)
$(LIBDIR)/crypto$(TYPEMARKER).dll: $(OBJS)
$(INSTALL_DIR) $(LIBDIR)
- $(LD) $(LDFLAGS) -o $@ $(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) $(OBJS) -l$(SSL_CRYPTO_LIBNAME)
+ $(LD) $(LDFLAGS) -o $@ $(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) $(OBJS) -l$(SSL_CRYPTO_LIBNAME) -l$(SSL_SSL_LIBNAME)
clean:
ifeq ($(findstring win32,$(TARGET)), win32)
diff --git a/lib/dialyzer/src/dialyzer_dataflow.erl b/lib/dialyzer/src/dialyzer_dataflow.erl
index 7137dbc036..659297f993 100644
--- a/lib/dialyzer/src/dialyzer_dataflow.erl
+++ b/lib/dialyzer/src/dialyzer_dataflow.erl
@@ -528,7 +528,7 @@ handle_apply(Tree, Map, State) ->
{CallSitesKnown, FunList} =
case state__lookup_call_site(Tree, State2) of
error -> {false, []};
- {ok, [external]} -> {false, {}};
+ {ok, [external]} -> {false, []};
{ok, List} -> {true, List}
end,
case CallSitesKnown of
@@ -554,7 +554,13 @@ handle_apply(Tree, Map, State) ->
{State3, enter_type(Op, OpType1, Map2), t_none()};
false ->
Map3 = enter_type_lists(Args, NewArgs, Map2),
- {State2, enter_type(Op, OpType1, Map3), t_fun_range(OpType1)}
+ Range0 = t_fun_range(OpType1),
+ Range =
+ case t_is_unit(Range0) of
+ true -> t_none();
+ false -> Range0
+ end,
+ {State2, enter_type(Op, OpType1, Map3), Range}
end
end;
true ->
@@ -1414,6 +1420,17 @@ do_clause(C, Arg, ArgType0, OrigArgType, Map,
false ->
true
end;
+ [Pat0, Pat1] -> % binary comprehension
+ case cerl:is_c_cons(Pat0) of
+ true ->
+ not (cerl:is_c_var(cerl:cons_hd(Pat0)) andalso
+ cerl:is_c_var(cerl:cons_tl(Pat0)) andalso
+ cerl:is_c_var(Pat1) andalso
+ cerl:is_literal(Guard) andalso
+ (cerl:concrete(Guard) =:= true));
+ false ->
+ true
+ end;
_ -> true
end;
false ->
@@ -2915,7 +2932,7 @@ state__get_warnings(#state{tree_map = TreeMap, fun_tab = FunTab,
{Warn, Msg} =
case dialyzer_callgraph:lookup_name(FunLbl, Callgraph) of
error -> {true, {unused_fun, []}};
- {ok, {_M, F, A}} = MFA ->
+ {ok, {_M, F, A} = MFA} ->
{not sets:is_element(MFA, NoWarnUnused),
{unused_fun, [F, A]}}
end,
@@ -2935,7 +2952,7 @@ state__get_warnings(#state{tree_map = TreeMap, fun_tab = FunTab,
%% Check if the function has a contract that allows this.
Warn =
case Contract of
- none -> true;
+ none -> not parent_allows_this(FunLbl, State);
{value, C} ->
GenRet = dialyzer_contracts:get_contract_return(C),
not t_is_unit(GenRet)
@@ -3423,6 +3440,33 @@ map_pats(Pats) ->
end,
cerl_trees:map(Fun, Pats).
+parent_allows_this(FunLbl, #state{callgraph = Callgraph, plt = Plt} =State) ->
+ case state__is_escaping(FunLbl, State) of
+ false -> false; % if it isn't escaping it can't be a return value
+ true ->
+ case state__lookup_name(FunLbl, State) of
+ {_M, _F, _A} -> false; % if it has a name it is not a fun
+ _ ->
+ case dialyzer_callgraph:in_neighbours(FunLbl, Callgraph) of
+ [Parent] ->
+ case state__lookup_name(Parent, State) of
+ {_M, _F, _A} = PMFA ->
+ case dialyzer_plt:lookup_contract(Plt, PMFA) of
+ none -> false;
+ {value, C} ->
+ GenRet = dialyzer_contracts:get_contract_return(C),
+ case erl_types:t_is_fun(GenRet) of
+ false -> false; % element of structure? far-fetched...
+ true -> t_is_unit(t_fun_range(GenRet))
+ end
+ end;
+ _ -> false % parent should have a name to have a contract
+ end;
+ _ -> false % called in other funs? far-fetched...
+ end
+ end
+ end.
+
classify_returns(Tree) ->
case find_terminals(cerl:fun_body(Tree)) of
{false, false} -> no_match;
diff --git a/lib/dialyzer/src/dialyzer_typesig.erl b/lib/dialyzer/src/dialyzer_typesig.erl
index c45615d670..06863d89a7 100644
--- a/lib/dialyzer/src/dialyzer_typesig.erl
+++ b/lib/dialyzer/src/dialyzer_typesig.erl
@@ -62,7 +62,8 @@
-type dep() :: integer(). %% type variable names used as constraint ids
-type type_var() :: erl_types:erl_type(). %% actually: {'c','var',_,_}
--record(fun_var, {'fun' :: fun((_) -> erl_types:erl_type()), deps :: [dep()]}).
+-record(fun_var, {'fun' :: fun((_) -> erl_types:erl_type()), deps :: [dep()],
+ origin :: integer()}).
-type constr_op() :: 'eq' | 'sub'.
-type fvar_or_type() :: #fun_var{} | erl_types:erl_type().
@@ -121,8 +122,10 @@
-ifdef(DEBUG).
-define(debug(__String, __Args), io:format(__String, __Args)).
+-define(mk_fun_var(Fun, Vars), mk_fun_var(?LINE, Fun, Vars)).
-else.
-define(debug(__String, __Args), ok).
+-define(mk_fun_var(Fun, Vars), mk_fun_var(Fun, Vars)).
-endif.
%% ============================================================================
@@ -218,10 +221,10 @@ traverse(Tree, DefinedVars, State) ->
binary ->
{State1, SegTypes} = traverse_list(cerl:binary_segments(Tree),
DefinedVars, State),
- Type = mk_fun_var(fun(Map) ->
- TmpSegTypes = lookup_type_list(SegTypes, Map),
- t_bitstr_concat(TmpSegTypes)
- end, SegTypes),
+ Type = ?mk_fun_var(fun(Map) ->
+ TmpSegTypes = lookup_type_list(SegTypes, Map),
+ t_bitstr_concat(TmpSegTypes)
+ end, SegTypes),
{state__store_conj(mk_var(Tree), sub, Type, State1), mk_var(Tree)};
bitstr ->
Size = cerl:bitstr_size(Tree),
@@ -236,7 +239,7 @@ traverse(Tree, DefinedVars, State) ->
N when is_integer(N) -> {State1, t_bitstr(0, N)};
any -> % Size is not a literal
{state__store_conj(SizeType, sub, t_non_neg_integer(), State1),
- mk_fun_var(bitstr_constr(SizeType, UnitVal), [SizeType])}
+ ?mk_fun_var(bitstr_constr(SizeType, UnitVal), [SizeType])}
end,
ValTypeConstr =
case cerl:concrete(cerl:bitstr_type(Tree)) of
@@ -250,8 +253,8 @@ traverse(Tree, DefinedVars, State) ->
case state__is_in_match(State1) of
true ->
Flags = cerl:concrete(cerl:bitstr_flags(Tree)),
- mk_fun_var(bitstr_val_constr(SizeType, UnitVal, Flags),
- [SizeType]);
+ ?mk_fun_var(bitstr_val_constr(SizeType, UnitVal, Flags),
+ [SizeType]);
false -> t_integer()
end;
utf8 -> t_integer();
@@ -281,24 +284,24 @@ traverse(Tree, DefinedVars, State) ->
{State, t_cons(HdVar, TlVar)};
false ->
ConsVar = mk_var(Tree),
- ConsType = mk_fun_var(fun(Map) ->
- t_cons(lookup_type(HdVar, Map),
- lookup_type(TlVar, Map))
- end, [HdVar, TlVar]),
- HdType = mk_fun_var(fun(Map) ->
- Cons = lookup_type(ConsVar, Map),
- case t_is_cons(Cons) of
- false -> t_any();
- true -> t_cons_hd(Cons)
- end
- end, [ConsVar]),
- TlType = mk_fun_var(fun(Map) ->
- Cons = lookup_type(ConsVar, Map),
- case t_is_cons(Cons) of
- false -> t_any();
- true -> t_cons_tl(Cons)
- end
- end, [ConsVar]),
+ ConsType = ?mk_fun_var(fun(Map) ->
+ t_cons(lookup_type(HdVar, Map),
+ lookup_type(TlVar, Map))
+ end, [HdVar, TlVar]),
+ HdType = ?mk_fun_var(fun(Map) ->
+ Cons = lookup_type(ConsVar, Map),
+ case t_is_cons(Cons) of
+ false -> t_any();
+ true -> t_cons_hd(Cons)
+ end
+ end, [ConsVar]),
+ TlType = ?mk_fun_var(fun(Map) ->
+ Cons = lookup_type(ConsVar, Map),
+ case t_is_cons(Cons) of
+ false -> t_any();
+ true -> t_cons_tl(Cons)
+ end
+ end, [ConsVar]),
State2 = state__store_conj_lists([HdVar, TlVar, ConsVar], sub,
[HdType, TlType, ConsType],
State1),
@@ -656,25 +659,25 @@ get_plt_constr(MFA, Dst, ArgVars, State) ->
{RetType, ArgCs} =
case PltRes of
none ->
- {mk_fun_var(fun(Map) ->
- ArgTypes = lookup_type_list(ArgVars, Map),
- dialyzer_contracts:get_contract_return(C, ArgTypes)
- end, ArgVars), GenArgs};
+ {?mk_fun_var(fun(Map) ->
+ ArgTypes = lookup_type_list(ArgVars, Map),
+ dialyzer_contracts:get_contract_return(C, ArgTypes)
+ end, ArgVars), GenArgs};
{value, {PltRetType, PltArgTypes}} ->
%% Need to combine the contract with the success typing.
- {mk_fun_var(
- fun(Map) ->
- ArgTypes0 = lookup_type_list(ArgVars, Map),
- ArgTypes = case FunModule =:= Module of
- false ->
- List = lists:zip(PltArgTypes, ArgTypes0),
- [erl_types:t_unopaque_on_mismatch(T1, T2, Opaques)
- || {T1, T2} <- List];
- true -> ArgTypes0
- end,
- CRet = dialyzer_contracts:get_contract_return(C, ArgTypes),
- t_inf(CRet, PltRetType, opaque)
- end, ArgVars),
+ {?mk_fun_var(
+ fun(Map) ->
+ ArgTypes0 = lookup_type_list(ArgVars, Map),
+ ArgTypes = case FunModule =:= Module of
+ false ->
+ List = lists:zip(PltArgTypes, ArgTypes0),
+ [erl_types:t_unopaque_on_mismatch(T1, T2, Opaques)
+ || {T1, T2} <- List];
+ true -> ArgTypes0
+ end,
+ CRet = dialyzer_contracts:get_contract_return(C, ArgTypes),
+ t_inf(CRet, PltRetType, opaque)
+ end, ArgVars),
[t_inf(X, Y, opaque) || {X, Y} <- lists:zip(GenArgs, PltArgTypes)]}
end,
state__store_conj_lists([Dst|ArgVars], sub, [RetType|ArgCs], State)
@@ -766,10 +769,10 @@ handle_clauses_1([Clause|Tail], TopVar, Arg, DefinedVars,
case SubtrTypes =:= overflow of
true -> S;
false ->
- SubtrPatVar = mk_fun_var(fun(Map) ->
- TmpType = lookup_type(Arg, Map),
- t_subtract_list(TmpType, SubtrTypes)
- end, [Arg]),
+ SubtrPatVar = ?mk_fun_var(fun(Map) ->
+ TmpType = lookup_type(Arg, Map),
+ t_subtract_list(TmpType, SubtrTypes)
+ end, [Arg]),
state__store_conj(Arg, sub, SubtrPatVar, S)
end
end,
@@ -1043,10 +1046,10 @@ handle_guard(Guard, DefinedVars, State) ->
get_bif_constr({erlang, Op, 2}, Dst, Args = [Arg1, Arg2], _State)
when Op =:= '+'; Op =:= '-'; Op =:= '*' ->
- ReturnType = mk_fun_var(fun(Map) ->
- TmpArgTypes = lookup_type_list(Args, Map),
- erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
- end, Args),
+ ReturnType = ?mk_fun_var(fun(Map) ->
+ TmpArgTypes = lookup_type_list(Args, Map),
+ erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
+ end, Args),
ArgFun =
fun(A, Pos) ->
F =
@@ -1074,7 +1077,7 @@ get_bif_constr({erlang, Op, 2}, Dst, Args = [Arg1, Arg2], _State)
end
end
end,
- mk_fun_var(F, [Dst, A])
+ ?mk_fun_var(F, [Dst, A])
end,
Arg1FunVar = ArgFun(Arg2, 2),
Arg2FunVar = ArgFun(Arg1, 1),
@@ -1131,12 +1134,12 @@ get_bif_constr({erlang, Op, 2}, Dst, [Arg1, Arg2] = Args, _State)
'>=' -> {ArgFun(Arg1, Arg2, '>='), ArgFun(Arg2, Arg1, '=<')}
end,
DstArgs = [Dst, Arg1, Arg2],
- Arg1Var = mk_fun_var(Arg1Fun, DstArgs),
- Arg2Var = mk_fun_var(Arg2Fun, DstArgs),
- DstVar = mk_fun_var(fun(Map) ->
- TmpArgTypes = lookup_type_list(Args, Map),
- erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
- end, Args),
+ Arg1Var = ?mk_fun_var(Arg1Fun, DstArgs),
+ Arg2Var = ?mk_fun_var(Arg2Fun, DstArgs),
+ DstVar = ?mk_fun_var(fun(Map) ->
+ TmpArgTypes = lookup_type_list(Args, Map),
+ erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
+ end, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstVar),
mk_constraint(Arg1, sub, Arg1Var),
mk_constraint(Arg2, sub, Arg2Var)]);
@@ -1172,13 +1175,13 @@ get_bif_constr({erlang, '++', 2}, Dst, [Hd, Tl] = Args, _State) ->
end
end,
DstL = [Dst],
- HdVar = mk_fun_var(HdFun, DstL),
- TlVar = mk_fun_var(TlFun, DstL),
+ HdVar = ?mk_fun_var(HdFun, DstL),
+ TlVar = ?mk_fun_var(TlFun, DstL),
ArgTypes = erl_bif_types:arg_types(erlang, '++', 2),
- ReturnType = mk_fun_var(fun(Map) ->
- TmpArgTypes = lookup_type_list(Args, Map),
- erl_bif_types:type(erlang, '++', 2, TmpArgTypes)
- end, Args),
+ ReturnType = ?mk_fun_var(fun(Map) ->
+ TmpArgTypes = lookup_type_list(Args, Map),
+ erl_bif_types:type(erlang, '++', 2, TmpArgTypes)
+ end, Args),
Cs = mk_constraints(Args, sub, ArgTypes),
mk_conj_constraint_list([mk_constraint(Dst, sub, ReturnType),
mk_constraint(Hd, sub, HdVar),
@@ -1209,7 +1212,7 @@ get_bif_constr({erlang, is_function, 2}, Dst, [Fun, Arity], _State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Dst, Arity]),
+ ArgV = ?mk_fun_var(ArgFun, [Dst, Arity]),
mk_conj_constraint_list([mk_constraint(Dst, sub, t_boolean()),
mk_constraint(Arity, sub, t_integer()),
mk_constraint(Fun, sub, ArgV)]);
@@ -1232,12 +1235,12 @@ get_bif_constr({erlang, is_record, 2}, Dst, [Var, Tag] = Args, _State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Dst]),
+ ArgV = ?mk_fun_var(ArgFun, [Dst]),
DstFun = fun(Map) ->
TmpArgTypes = lookup_type_list(Args, Map),
erl_bif_types:type(erlang, is_record, 2, TmpArgTypes)
end,
- DstV = mk_fun_var(DstFun, Args),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Tag, sub, t_atom()),
mk_constraint(Var, sub, ArgV)]);
@@ -1280,7 +1283,7 @@ get_bif_constr({erlang, is_record, 3}, Dst, [Var, Tag, Arity] = Args, State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Tag, Arity, Dst]),
+ ArgV = ?mk_fun_var(ArgFun, [Tag, Arity, Dst]),
DstFun = fun(Map) ->
[TmpVar, TmpTag, TmpArity] = TmpArgTypes = lookup_type_list(Args, Map),
TmpArgTypes2 =
@@ -1314,7 +1317,7 @@ get_bif_constr({erlang, is_record, 3}, Dst, [Var, Tag, Arity] = Args, State) ->
end,
erl_bif_types:type(erlang, is_record, 3, TmpArgTypes2)
end,
- DstV = mk_fun_var(DstFun, Args),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arity, sub, t_integer()),
mk_constraint(Tag, sub, t_atom()),
@@ -1359,9 +1362,9 @@ get_bif_constr({erlang, 'and', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end
end,
- ArgV1 = mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
- ArgV2 = mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
- DstV = mk_fun_var(DstFun, Args),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg1, sub, ArgV1),
mk_constraint(Arg2, sub, ArgV2)]);
@@ -1403,9 +1406,9 @@ get_bif_constr({erlang, 'or', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end
end,
- ArgV1 = mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
- ArgV2 = mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
- DstV = mk_fun_var(DstFun, Args),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
+ DstV = ?mk_fun_var(DstFun, Args),
F = fun(A) ->
try [mk_constraint(A, sub, True)]
catch throw:error -> []
@@ -1433,8 +1436,8 @@ get_bif_constr({erlang, 'not', 1}, Dst, [Arg] = Args, _State) ->
end
end
end,
- ArgV = mk_fun_var(Fun(Dst), [Dst]),
- DstV = mk_fun_var(Fun(Arg), Args),
+ ArgV = ?mk_fun_var(Fun(Dst), [Dst]),
+ DstV = ?mk_fun_var(Fun(Arg), Args),
mk_conj_constraint_list([mk_constraint(Arg, sub, ArgV),
mk_constraint(Dst, sub, DstV)]);
get_bif_constr({erlang, '=:=', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
@@ -1467,9 +1470,9 @@ get_bif_constr({erlang, '=:=', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end,
DstArgs = [Dst, Arg1, Arg2],
- ArgV1 = mk_fun_var(ArgFun(Arg1, Arg2), DstArgs),
- ArgV2 = mk_fun_var(ArgFun(Arg2, Arg1), DstArgs),
- DstV = mk_fun_var(DstFun, Args),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg1, Arg2), DstArgs),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg2, Arg1), DstArgs),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg1, sub, ArgV1),
mk_constraint(Arg2, sub, ArgV2)]);
@@ -1510,10 +1513,10 @@ get_bif_constr({erlang, '==', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end
end,
- DstV = mk_fun_var(DstFun, Args),
+ DstV = ?mk_fun_var(DstFun, Args),
ArgL = [Arg1, Arg2, Dst],
- ArgV1 = mk_fun_var(ArgFun(Arg2, Arg1), ArgL),
- ArgV2 = mk_fun_var(ArgFun(Arg1, Arg2), ArgL),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg2, Arg1), ArgL),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg1, Arg2), ArgL),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg1, sub, ArgV1),
mk_constraint(Arg2, sub, ArgV2)]);
@@ -1531,7 +1534,7 @@ get_bif_constr({erlang, element, 2} = _BIF, Dst, Args,
end,
erl_bif_types:type(erlang, element, 2, ATs2)
end,
- ReturnType = mk_fun_var(Fun, Args),
+ ReturnType = ?mk_fun_var(Fun, Args),
ArgTypes = erl_bif_types:arg_types(erlang, element, 2),
Cs = mk_constraints(Args, sub, ArgTypes),
NewCs =
@@ -1553,7 +1556,7 @@ get_bif_constr({M, F, A} = _BIF, Dst, Args, State) ->
false -> T
end
end,
- ReturnType = mk_fun_var(fun(Map) ->
+ ReturnType = ?mk_fun_var(fun(Map) ->
TmpArgTypes0 = lookup_type_list(Args, Map),
TmpArgTypes = [UnopaqueFun(T) || T<- TmpArgTypes0],
erl_bif_types:type(M, F, A, TmpArgTypes)
@@ -1608,7 +1611,7 @@ get_bif_test_constr(Dst, Arg, Type, State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Dst]),
+ ArgV = ?mk_fun_var(ArgFun, [Dst]),
DstFun = fun(Map) ->
ArgType = lookup_type(Arg, Map),
case t_is_none(t_inf(ArgType, Type)) of
@@ -1633,7 +1636,7 @@ get_bif_test_constr(Dst, Arg, Type, State) ->
end
end
end,
- DstV = mk_fun_var(DstFun, [Arg]),
+ DstV = ?mk_fun_var(DstFun, [Arg]),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg, sub, ArgV)]).
@@ -1684,11 +1687,14 @@ solve_scc(SCC, Map, State, TryingUnit) ->
true ->
?debug("SCC ~w reached fixpoint\n", [SCC]),
NewTypes = unsafe_lookup_type_list(Funs, Map2),
- case lists:all(fun(T) -> t_is_none(t_fun_range(T)) end, NewTypes)
+ case erl_types:any_none([t_fun_range(T) || T <- NewTypes])
andalso TryingUnit =:= false of
true ->
- UnitTypes = [t_fun(state__fun_arity(F, State), t_unit())
- || F <- Funs],
+ UnitTypes =
+ [case t_is_none(t_fun_range(T)) of
+ false -> T;
+ true -> t_fun(t_fun_args(T), t_unit())
+ end || T <- NewTypes],
Map3 = enter_type_lists(Funs, UnitTypes, Map2),
solve_scc(SCC, Map3, State, true);
false ->
@@ -2320,12 +2326,25 @@ mk_constraint(Lhs, Op, Rhs) ->
constraint_opnd_is_any(#fun_var{}) -> false;
constraint_opnd_is_any(Type) -> t_is_any(Type).
+-ifdef(DEBUG).
+
+-spec mk_fun_var(fun((_) -> erl_types:erl_type()), [erl_types:erl_type()],
+ integer()) -> #fun_var{}.
+
+mk_fun_var(Line, Fun, Types) ->
+ Deps = [t_var_name(Var) || Var <- t_collect_vars(t_product(Types))],
+ #fun_var{'fun' = Fun, deps = ordsets:from_list(Deps), origin = Line}.
+
+-else.
+
-spec mk_fun_var(fun((_) -> erl_types:erl_type()), [erl_types:erl_type()]) -> #fun_var{}.
mk_fun_var(Fun, Types) ->
Deps = [t_var_name(Var) || Var <- t_collect_vars(t_product(Types))],
#fun_var{'fun' = Fun, deps = ordsets:from_list(Deps)}.
+-endif.
+
-spec get_deps(constr()) -> [dep()].
get_deps(#constraint{deps = D}) -> D;
@@ -2676,8 +2695,9 @@ find_constraint(Tuple, [_|Cs]) ->
-endif.
-ifdef(DEBUG).
-format_type(#fun_var{deps = Deps}) ->
- io_lib:format("Fun(~s)", [lists:flatten([format_type(t_var(X))||X<-Deps])]);
+format_type(#fun_var{deps = Deps, origin = Origin}) ->
+ io_lib:format("Fun@L~p(~s)",
+ [Origin, lists:flatten([format_type(t_var(X))||X<-Deps])]);
format_type(Type) ->
case cerl:is_literal(Type) of
true -> io_lib:format("~w", [cerl:concrete(Type)]);
diff --git a/lib/dialyzer/test/Makefile b/lib/dialyzer/test/Makefile
index 69a8fd742e..47deb17f1d 100644
--- a/lib/dialyzer/test/Makefile
+++ b/lib/dialyzer/test/Makefile
@@ -26,7 +26,7 @@ include $(ERL_TOP)/make/otp_release_targets.mk
release_tests_spec:
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DATA) $(AUXILIARY_FILES) $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
cd $(RELSYSDIR);\
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/asn1 b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
index ac83366bc8..571e562d0d 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/asn1
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
@@ -2,7 +2,7 @@
asn1ct.erl:1500: The variable Err can never match since previous clauses completely covered the type #type{}
asn1ct.erl:1596: The variable _ can never match since previous clauses completely covered the type 'ber_bin_v2'
asn1ct.erl:1673: The pattern 'all' can never match the type 'asn1_module' | 'exclusive_decode' | 'partial_decode'
-asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()],[any()]>
+asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | [any()] | char()],[any()]>
asn1ct.erl:909: Guard test is_atom(Ext::[49 | 97 | 98 | 100 | 110 | 115]) can never succeed
asn1ct_check.erl:1698: The pattern {'error', _} can never match the type [any()]
asn1ct_check.erl:2733: The pattern {'type', Tag, _, _, _, _} can never match the type 'ASN1_OPEN_TYPE' | {_,_} | {'fixedtypevaluefield',_,_}
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/inets b/lib/dialyzer/test/r9c_SUITE_data/results/inets
index fd5e36a3cd..0177dcc88c 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/inets
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/inets
@@ -3,13 +3,15 @@ ftp.erl:1243: The pattern {'ok', {N, Bytes}} can never match the type 'eof' | {'
ftp.erl:640: The pattern {'closed', _Why} can never match the type 'perm_fname_not_allowed' | 'perm_neg_compl' | 'perm_no_space' | 'pos_compl' | 'pos_interm' | 'pos_interm_acct' | 'trans_neg_compl' | 'trans_no_space' | {'error' | 'perm_fname_not_allowed' | 'perm_neg_compl' | 'perm_no_space' | 'pos_compl' | 'pos_interm' | 'pos_interm_acct' | 'pos_prel' | 'trans_neg_compl' | 'trans_no_space',atom() | [any()] | {'invalid_server_response',[any(),...]}}
http.erl:117: The pattern {'error', Reason} can never match the type #req_headers{connection::[45 | 97 | 101 | 105 | 107 | 108 | 112 | 118,...],content_length::[48,...],other::[{_,_}]}
http.erl:138: Function close_session/2 will never be called
-http_lib.erl:286: The call http_lib:close('ip_comm' | {'ssl',_},any()) will never return since it differs in the 1st argument from the success typing arguments: ('http' | 'https',any())
-http_lib.erl:424: The variable _ can never match since previous clauses completely covered the type any()
-http_lib.erl:438: The variable _ can never match since previous clauses completely covered the type any()
+http_lib.erl:286: The call http_lib:close('ip_comm' | {'ssl',_},port() | {'sslsocket',_,_}) will never return since it differs in the 1st argument from the success typing arguments: ('http' | 'https',port() | {'sslsocket',_,pid() | {_,{'config',_,_,_,_,{_,_,_,_}}} | {'sslsocket',_,pid() | {'sslsocket',_,pid() | {_,_,_}}}})
+http_lib.erl:415: The pattern 61 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:417: The pattern 59 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:420: The pattern 13 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:424: The variable _ can never match since previous clauses completely covered the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:428: Function read_chunk_ext_val/6 will never be called
+http_lib.erl:444: The pattern 10 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:552: Call to missing or unexported function ssl:accept/2
http_lib.erl:99: Function getHeaderValue/2 will never be called
-httpc_handler.erl:322: Function status_continue/2 has no local return
-httpc_handler.erl:37: Function init_connection/2 has no local return
-httpc_handler.erl:65: Function next_response_with_request/2 has no local return
httpc_handler.erl:660: Function exit_session_ok/2 has no local return
httpc_manager.erl:145: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
httpc_manager.erl:160: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
@@ -24,11 +26,14 @@ httpd_manager.erl:885: The pattern {'EXIT', Reason} can never match since previo
httpd_manager.erl:919: Function auth_status/1 will never be called
httpd_manager.erl:926: Function sec_status/1 will never be called
httpd_manager.erl:933: Function acceptor_status/1 will never be called
-httpd_request_handler.erl:374: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 66 | 98 | 100 | 103 | 105 | 111 | 116 | 121,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:378: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:401: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',[[any()]]}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+httpd_request_handler.erl:374: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 66 | 98 | 100 | 103 | 105 | 111 | 116 | 121,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_},socket::port() | {'sslsocket',_,_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
+httpd_request_handler.erl:378: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_},socket::port() | {'sslsocket',_,_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
+httpd_request_handler.erl:401: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_},socket::port() | {'sslsocket',_,_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
+httpd_request_handler.erl:489: The variable Other can never match since previous clauses completely covered the type {'error',_} | {'ok','http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | {'http_request','DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),'*' | binary() | string() | {'abs_path',binary() | [any()]} | {'scheme',binary() | [any()],binary() | [any()]} | {'absoluteURI','http' | 'https',binary() | [any()],'undefined' | non_neg_integer(),binary() | [any()]},{non_neg_integer(),non_neg_integer()}} | {'http_response',{non_neg_integer(),non_neg_integer()},integer(),binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}}
+httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',_}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
httpd_request_handler.erl:645: Function will never be called
+httpd_socket.erl:129: Call to missing or unexported function ssl:accept/2
+httpd_socket.erl:49: The pattern {'ok', _} can never match the type {'error',_}
httpd_sup.erl:63: The variable Else can never match since previous clauses completely covered the type {'error',_} | {'ok',[any()],_,_}
httpd_sup.erl:88: The pattern {'error', Reason} can never match the type {'ok',_,_}
httpd_sup.erl:92: The variable Else can never match since previous clauses completely covered the type {'ok',_,_}
@@ -38,17 +43,17 @@ mod_auth_plain.erl:100: The variable _ can never match since previous clauses co
mod_auth_plain.erl:159: The variable _ can never match since previous clauses completely covered the type [any()]
mod_auth_plain.erl:83: The variable O can never match since previous clauses completely covered the type [any()]
mod_cgi.erl:372: The pattern {'http_response', NewAccResponse} can never match the type 'ok'
-mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
mod_dir.erl:72: The pattern {'error', Reason} can never match the type {'ok',[[[any()] | char()],...]}
-mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [any()] | char()]>
-mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_htaccess.erl:460: The pattern {'error', BadData} can never match the type {'ok',_}
-mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
-mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],string()}
+mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],string()}
+mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_include.erl:716: Function read_error/3 will never be called
mod_include.erl:719: Function read_error/4 will never be called
mod_security_server.erl:386: The variable O can never match since previous clauses completely covered the type [any()]
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
index e199581a0e..2be71ac7d7 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
@@ -6,6 +6,7 @@ mnesia_bup.erl:111: The created fun has no local return
mnesia_bup.erl:574: Function fallback_receiver/2 has no local return
mnesia_bup.erl:967: Function uninstall_fallback_master/2 has no local return
mnesia_checkpoint.erl:1014: The variable Error can never match since previous clauses completely covered the type {'ok',#checkpoint_args{nodes::[any()],retainers::[any(),...]}}
+mnesia_checkpoint.erl:894: The call sys:handle_system_msg(Msg::any(),From::any(),'no_parent','mnesia_checkpoint',[],Cp::#checkpoint_args{}) breaks the contract (Msg,From,Parent,Module,Debug,Misc) -> Void when is_subtype(Msg,term()), is_subtype(From,{pid(),Tag::_}), is_subtype(Parent,pid()), is_subtype(Module,module()), is_subtype(Debug,[dbg_opt()]), is_subtype(Misc,term()), is_subtype(Void,term())
mnesia_controller.erl:1666: The variable Tab can never match since previous clauses completely covered the type [any()]
mnesia_controller.erl:1679: The pattern {'stop', Reason, Reply, State2} can never match the type {'noreply',_} | {'reply',_,_} | {'stop','shutdown',#state{}}
mnesia_controller.erl:1685: The pattern {'noreply', State2, _Timeout} can never match the type {'reply',_,_}
@@ -15,6 +16,7 @@ mnesia_frag.erl:294: The call mnesia_frag:remote_collect(Ref::reference(),{'erro
mnesia_frag.erl:304: The call mnesia_frag:remote_collect(Ref::reference(),{'error',{'node_not_running',_}},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_frag.erl:312: The call mnesia_frag:remote_collect(Ref::reference(),LocalRes::{'error',_},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_index.erl:52: The call mnesia_lib:other_val(Var::{_,'commit_work' | 'index' | 'setorbag' | 'storage_type' | {'index',_}},_ReASoN_::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
+mnesia_lib.erl:1028: The pattern {'EXIT', Reason} can never match the type [any()] | {'error',_}
mnesia_lib.erl:957: The pattern {'ok', {0, _}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_lib.erl:959: The pattern {'ok', {_, Bin}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_loader.erl:36: The call mnesia_lib:other_val(Var::{_,'access_mode' | 'cstruct' | 'db_nodes' | 'setorbag' | 'snmp' | 'storage_type'},Reason::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
@@ -30,5 +32,6 @@ mnesia_schema.erl:1258: Guard test FromS::'disc_copies' | 'disc_only_copies' | '
mnesia_schema.erl:1639: The pattern {'false', 'mandatory'} can never match the type {'false','optional'}
mnesia_schema.erl:2434: The variable Reason can never match since previous clauses completely covered the type {'error',_} | {'ok',_}
mnesia_schema.erl:451: Guard test UseDirAnyway::'false' == 'true' can never succeed
+mnesia_text.erl:180: The variable T can never match since previous clauses completely covered the type {'error',{integer(),atom() | tuple(),_}} | {'ok',_}
mnesia_tm.erl:1522: Function commit_participant/5 has no local return
mnesia_tm.erl:2169: Function system_terminate/4 has no local return
diff --git a/lib/dialyzer/test/race_SUITE_data/results/extract_translations b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
index f7d5abc6f5..62aa1aa511 100644
--- a/lib/dialyzer/test/race_SUITE_data/results/extract_translations
+++ b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
@@ -1,5 +1,5 @@
-extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 135
+extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 135
extract_translations.erl:146: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
-extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 148
+extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 148
extract_translations.erl:154: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
diff --git a/lib/dialyzer/test/small_SUITE_data/results/common_eunit b/lib/dialyzer/test/small_SUITE_data/results/common_eunit
new file mode 100644
index 0000000000..bb5fd1c9ac
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/results/common_eunit
@@ -0,0 +1,2 @@
+
+common_eunit.erl:57: The created fun has no local return
diff --git a/lib/dialyzer/test/small_SUITE_data/results/comparisons b/lib/dialyzer/test/small_SUITE_data/results/comparisons
new file mode 100644
index 0000000000..642585d25e
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/results/comparisons
@@ -0,0 +1,153 @@
+
+comparisons.erl:100: The pattern 'true' can never match the type 'false'
+comparisons.erl:101: The pattern 'true' can never match the type 'false'
+comparisons.erl:102: The pattern 'false' can never match the type 'true'
+comparisons.erl:103: The pattern 'false' can never match the type 'true'
+comparisons.erl:104: The pattern 'true' can never match the type 'false'
+comparisons.erl:105: The pattern 'true' can never match the type 'false'
+comparisons.erl:107: The pattern 'true' can never match the type 'false'
+comparisons.erl:108: The pattern 'true' can never match the type 'false'
+comparisons.erl:109: The pattern 'false' can never match the type 'true'
+comparisons.erl:110: The pattern 'false' can never match the type 'true'
+comparisons.erl:111: The pattern 'true' can never match the type 'false'
+comparisons.erl:112: The pattern 'true' can never match the type 'false'
+comparisons.erl:113: The pattern 'false' can never match the type 'true'
+comparisons.erl:114: The pattern 'false' can never match the type 'true'
+comparisons.erl:115: The pattern 'true' can never match the type 'false'
+comparisons.erl:116: The pattern 'true' can never match the type 'false'
+comparisons.erl:117: The pattern 'false' can never match the type 'true'
+comparisons.erl:118: The pattern 'false' can never match the type 'true'
+comparisons.erl:123: The pattern 'false' can never match the type 'true'
+comparisons.erl:124: The pattern 'false' can never match the type 'true'
+comparisons.erl:125: The pattern 'true' can never match the type 'false'
+comparisons.erl:126: The pattern 'true' can never match the type 'false'
+comparisons.erl:127: The pattern 'false' can never match the type 'true'
+comparisons.erl:128: The pattern 'false' can never match the type 'true'
+comparisons.erl:129: The pattern 'true' can never match the type 'false'
+comparisons.erl:130: The pattern 'true' can never match the type 'false'
+comparisons.erl:132: The pattern 'true' can never match the type 'false'
+comparisons.erl:133: The pattern 'true' can never match the type 'false'
+comparisons.erl:134: The pattern 'false' can never match the type 'true'
+comparisons.erl:135: The pattern 'false' can never match the type 'true'
+comparisons.erl:136: The pattern 'true' can never match the type 'false'
+comparisons.erl:137: The pattern 'true' can never match the type 'false'
+comparisons.erl:138: The pattern 'false' can never match the type 'true'
+comparisons.erl:139: The pattern 'false' can never match the type 'true'
+comparisons.erl:140: The pattern 'true' can never match the type 'false'
+comparisons.erl:141: The pattern 'true' can never match the type 'false'
+comparisons.erl:142: The pattern 'false' can never match the type 'true'
+comparisons.erl:143: The pattern 'false' can never match the type 'true'
+comparisons.erl:144: The pattern 'true' can never match the type 'false'
+comparisons.erl:145: The pattern 'true' can never match the type 'false'
+comparisons.erl:146: The pattern 'false' can never match the type 'true'
+comparisons.erl:147: The pattern 'false' can never match the type 'true'
+comparisons.erl:152: The pattern 'false' can never match the type 'true'
+comparisons.erl:153: The pattern 'false' can never match the type 'true'
+comparisons.erl:154: The pattern 'true' can never match the type 'false'
+comparisons.erl:155: The pattern 'true' can never match the type 'false'
+comparisons.erl:157: The pattern 'true' can never match the type 'false'
+comparisons.erl:158: The pattern 'true' can never match the type 'false'
+comparisons.erl:159: The pattern 'false' can never match the type 'true'
+comparisons.erl:160: The pattern 'false' can never match the type 'true'
+comparisons.erl:161: The pattern 'true' can never match the type 'false'
+comparisons.erl:162: The pattern 'true' can never match the type 'false'
+comparisons.erl:163: The pattern 'false' can never match the type 'true'
+comparisons.erl:164: The pattern 'false' can never match the type 'true'
+comparisons.erl:165: The pattern 'true' can never match the type 'false'
+comparisons.erl:166: The pattern 'true' can never match the type 'false'
+comparisons.erl:167: The pattern 'false' can never match the type 'true'
+comparisons.erl:168: The pattern 'false' can never match the type 'true'
+comparisons.erl:169: The pattern 'true' can never match the type 'false'
+comparisons.erl:170: The pattern 'true' can never match the type 'false'
+comparisons.erl:171: The pattern 'false' can never match the type 'true'
+comparisons.erl:172: The pattern 'false' can never match the type 'true'
+comparisons.erl:173: The pattern 'true' can never match the type 'false'
+comparisons.erl:174: The pattern 'true' can never match the type 'false'
+comparisons.erl:175: The pattern 'false' can never match the type 'true'
+comparisons.erl:176: The pattern 'false' can never match the type 'true'
+comparisons.erl:186: The pattern 'false' can never match the type 'true'
+comparisons.erl:187: The pattern 'false' can never match the type 'true'
+comparisons.erl:188: The pattern 'true' can never match the type 'false'
+comparisons.erl:189: The pattern 'true' can never match the type 'false'
+comparisons.erl:190: The pattern 'false' can never match the type 'true'
+comparisons.erl:191: The pattern 'false' can never match the type 'true'
+comparisons.erl:192: The pattern 'true' can never match the type 'false'
+comparisons.erl:193: The pattern 'true' can never match the type 'false'
+comparisons.erl:203: The pattern 'false' can never match the type 'true'
+comparisons.erl:204: The pattern 'false' can never match the type 'true'
+comparisons.erl:205: The pattern 'true' can never match the type 'false'
+comparisons.erl:206: The pattern 'true' can never match the type 'false'
+comparisons.erl:208: The pattern 'true' can never match the type 'false'
+comparisons.erl:209: The pattern 'true' can never match the type 'false'
+comparisons.erl:210: The pattern 'false' can never match the type 'true'
+comparisons.erl:211: The pattern 'false' can never match the type 'true'
+comparisons.erl:221: The pattern 'true' can never match the type 'false'
+comparisons.erl:222: The pattern 'true' can never match the type 'false'
+comparisons.erl:223: The pattern 'false' can never match the type 'true'
+comparisons.erl:224: The pattern 'false' can never match the type 'true'
+comparisons.erl:225: The pattern 'true' can never match the type 'false'
+comparisons.erl:226: The pattern 'true' can never match the type 'false'
+comparisons.erl:227: The pattern 'false' can never match the type 'true'
+comparisons.erl:228: The pattern 'false' can never match the type 'true'
+comparisons.erl:242: The pattern 'false' can never match the type 'true'
+comparisons.erl:243: The pattern 'false' can never match the type 'true'
+comparisons.erl:244: The pattern 'true' can never match the type 'false'
+comparisons.erl:245: The pattern 'true' can never match the type 'false'
+comparisons.erl:246: The pattern 'false' can never match the type 'true'
+comparisons.erl:247: The pattern 'false' can never match the type 'true'
+comparisons.erl:248: The pattern 'true' can never match the type 'false'
+comparisons.erl:249: The pattern 'true' can never match the type 'false'
+comparisons.erl:251: The pattern 'true' can never match the type 'false'
+comparisons.erl:252: The pattern 'true' can never match the type 'false'
+comparisons.erl:253: The pattern 'false' can never match the type 'true'
+comparisons.erl:254: The pattern 'false' can never match the type 'true'
+comparisons.erl:263: The pattern 'false' can never match the type 'true'
+comparisons.erl:264: The pattern 'false' can never match the type 'true'
+comparisons.erl:265: The pattern 'true' can never match the type 'false'
+comparisons.erl:266: The pattern 'true' can never match the type 'false'
+comparisons.erl:268: The pattern 'true' can never match the type 'false'
+comparisons.erl:269: The pattern 'true' can never match the type 'false'
+comparisons.erl:270: The pattern 'false' can never match the type 'true'
+comparisons.erl:271: The pattern 'false' can never match the type 'true'
+comparisons.erl:272: The pattern 'true' can never match the type 'false'
+comparisons.erl:273: The pattern 'true' can never match the type 'false'
+comparisons.erl:274: The pattern 'false' can never match the type 'true'
+comparisons.erl:275: The pattern 'false' can never match the type 'true'
+comparisons.erl:293: The pattern 'false' can never match the type 'true'
+comparisons.erl:294: The pattern 'false' can never match the type 'true'
+comparisons.erl:295: The pattern 'true' can never match the type 'false'
+comparisons.erl:296: The pattern 'true' can never match the type 'false'
+comparisons.erl:311: The pattern 'true' can never match the type 'false'
+comparisons.erl:312: The pattern 'true' can never match the type 'false'
+comparisons.erl:313: The pattern 'false' can never match the type 'true'
+comparisons.erl:314: The pattern 'false' can never match the type 'true'
+comparisons.erl:44: The pattern 'false' can never match the type 'true'
+comparisons.erl:45: The pattern 'false' can never match the type 'true'
+comparisons.erl:46: The pattern 'true' can never match the type 'false'
+comparisons.erl:47: The pattern 'true' can never match the type 'false'
+comparisons.erl:48: The pattern 'false' can never match the type 'true'
+comparisons.erl:49: The pattern 'false' can never match the type 'true'
+comparisons.erl:50: The pattern 'true' can never match the type 'false'
+comparisons.erl:51: The pattern 'true' can never match the type 'false'
+comparisons.erl:52: The pattern 'false' can never match the type 'true'
+comparisons.erl:53: The pattern 'false' can never match the type 'true'
+comparisons.erl:54: The pattern 'true' can never match the type 'false'
+comparisons.erl:55: The pattern 'true' can never match the type 'false'
+comparisons.erl:69: The pattern 'false' can never match the type 'true'
+comparisons.erl:70: The pattern 'false' can never match the type 'true'
+comparisons.erl:71: The pattern 'true' can never match the type 'false'
+comparisons.erl:72: The pattern 'true' can never match the type 'false'
+comparisons.erl:73: The pattern 'false' can never match the type 'true'
+comparisons.erl:74: The pattern 'false' can never match the type 'true'
+comparisons.erl:75: The pattern 'true' can never match the type 'false'
+comparisons.erl:76: The pattern 'true' can never match the type 'false'
+comparisons.erl:77: The pattern 'false' can never match the type 'true'
+comparisons.erl:78: The pattern 'false' can never match the type 'true'
+comparisons.erl:79: The pattern 'true' can never match the type 'false'
+comparisons.erl:80: The pattern 'true' can never match the type 'false'
+comparisons.erl:94: The pattern 'false' can never match the type 'true'
+comparisons.erl:95: The pattern 'false' can never match the type 'true'
+comparisons.erl:96: The pattern 'true' can never match the type 'false'
+comparisons.erl:97: The pattern 'true' can never match the type 'false'
+comparisons.erl:98: The pattern 'false' can never match the type 'true'
+comparisons.erl:99: The pattern 'false' can never match the type 'true'
diff --git a/lib/dialyzer/test/small_SUITE_data/results/failing_funs b/lib/dialyzer/test/small_SUITE_data/results/failing_funs
new file mode 100644
index 0000000000..a1fb22cbc6
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/results/failing_funs
@@ -0,0 +1,20 @@
+
+failing_funs.erl:101: The created fun has no local return
+failing_funs.erl:104: The created fun has no local return
+failing_funs.erl:127: The created fun has no local return
+failing_funs.erl:135: The created fun has no local return
+failing_funs.erl:138: The created fun has no local return
+failing_funs.erl:13: Function foo3/0 has no local return
+failing_funs.erl:13: The pattern 'b' can never match the type 'a'
+failing_funs.erl:161: The created fun has no local return
+failing_funs.erl:169: The created fun has no local return
+failing_funs.erl:172: The created fun has no local return
+failing_funs.erl:17: The pattern 'b' can never match the type 'a'
+failing_funs.erl:195: The created fun has no local return
+failing_funs.erl:203: The created fun has no local return
+failing_funs.erl:206: The created fun has no local return
+failing_funs.erl:229: The created fun has no local return
+failing_funs.erl:55: The created fun has no local return
+failing_funs.erl:62: The created fun has no local return
+failing_funs.erl:69: The created fun has no local return
+failing_funs.erl:76: The created fun has no local return
diff --git a/lib/dialyzer/test/small_SUITE_data/results/flatten b/lib/dialyzer/test/small_SUITE_data/results/flatten
index 4571214e49..8aa44dd002 100644
--- a/lib/dialyzer/test/small_SUITE_data/results/flatten
+++ b/lib/dialyzer/test/small_SUITE_data/results/flatten
@@ -1,2 +1,2 @@
-flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
diff --git a/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
new file mode 100644
index 0000000000..c1e82bfa59
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
@@ -0,0 +1,8 @@
+-module(test).
+
+-export([bin_compr/0]).
+
+bin_compr() ->
+% [ 0 || {N, V} <- [{a, b}] ]. % Works ok
+ << <<>> || {A, B} <- [{a, b}] >>. % Complains
+% << <<>> || X <- [{a, b}] >>. % Works ok
diff --git a/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
new file mode 100644
index 0000000000..8abf872b37
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
@@ -0,0 +1,35 @@
+%%---------------------------------------------------------------------
+%% From: Peer Stritzinger
+%% Date: 1 May 2011
+%% Subject: Dialyzer v2.2.0 crash
+%%
+%% Binaries of the form <<_:N,_:_*M>> in specs resulted in a crash:
+%% dialyzer: Analysis failed with error: {{case_clause,8},
+%% [{erl_types,t_form_to_string,1},
+%% {erl_types,t_form_to_string,1},
+%% {dialyzer_contracts,contract_to_string_1,1},
+%% {dialyzer_contracts,extra_contract_warning,6},
+%% {dialyzer_contracts,picky_contract_check,7},
+%% because function erl_types:t_form_to_string/1 was not the inverse
+%% of erl_types:t_to_string/2.
+%%
+%% Fixed on the same date and send to OTP for inclusion.
+%%---------------------------------------------------------------------
+-module(codec_can).
+
+-export([recv/3, decode/1]).
+
+-record(can_pkt, {id, data :: binary(), timestamp}).
+
+-type can_pkt() :: #can_pkt{}.
+-type channel() :: atom() | pid() | {atom(),_}.
+
+-spec recv(<<_:64,_:_*8>>, fun((can_pkt()) -> R), channel()) -> R.
+recv(Packet, Fun, Chan) ->
+ #can_pkt{id = Can_id, data = Can_data} = P = decode(Packet),
+ Fun(P).
+
+-spec decode(<<_:64,_:_*8>>) -> #can_pkt{id::<<_:11>>,timestamp::char()}.
+decode(<<_:12, Len:4, Timestamp:16, 0:3, Id:11/bitstring, 0:18,
+ Data:Len/binary, _/binary>>) ->
+ #can_pkt{id = Id, data = Data, timestamp = Timestamp}.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl b/lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl
new file mode 100644
index 0000000000..bca390068e
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl
@@ -0,0 +1,121 @@
+%%=====================================================================
+%% Program with an erroneous type declaration that caused dialyzer to
+%% go into an infinite loop. There are some comments that explain the
+%% symptoms and the culprit: the return of test_fun() is erroneous and
+%% its type should read
+%% fun((config()) -> test_rep() | [test_rep()])
+%% instead. But this should not throw dialyzer into an infinite loop.
+%% This concerned dialyzer in R14B02 (and probably prior).
+%%=====================================================================
+-module(common_eunit).
+
+-export([expand_cases/2]).
+
+-type test_name() :: atom() | {'group', atom()}.
+
+-type test_rep() :: {{atom(), atom(), arity()}, fun()}
+ | {'setup', fun(), fun()}
+ | {'setup', fun(), fun(), fun()}
+ | {atom(), test_rep()}
+ | {atom(), term(), test_rep()}.
+
+-type config() :: [proplists:property()].
+
+-type control() :: tuple() | atom().
+
+%% The combination of the following type and the (erroneous) spec for
+%% expand_cases/2 is the reason for the infinite loop in dialyzer.
+-type test_fun() :: fun((config()) -> test_rep()).
+
+%% If one comments out this spec the infinite loop disappears.
+-spec expand_cases(atom(), test_name() | [test_name()]) -> test_fun().
+expand_cases(Module, Cases) ->
+ if is_list(Cases) ->
+ TestFuns = [expand_case(Module, Case) || Case <- Cases],
+ fun(Config) -> [F(Config) || F <- TestFuns] end;
+ is_atom(Cases); is_tuple(Cases) ->
+ expand_cases(Module, [Cases])
+ end.
+
+-spec expand_case(atom(), test_name()) -> test_fun().
+expand_case(Module, CaseName) when is_atom(CaseName) ->
+ TestFun = fun(Config) ->
+ {{Module, CaseName, 1},
+ fun() -> apply(Module, CaseName, [Config]) end}
+ end,
+ setup_wrapper(Module, TestFun, {init_per_testcase, [CaseName]},
+ {end_per_testcase, [CaseName]});
+expand_case(Module, {group, GroupName}) ->
+ {Control, Cases} = group_specification(Module, GroupName),
+ TestFun = control_wrapper(Control, expand_cases(Module, Cases)),
+ setup_wrapper(Module, TestFun, {init_per_group, [GroupName]},
+ {end_per_group, [GroupName]}).
+
+-spec control_wrapper([control()], test_fun()) -> test_fun().
+control_wrapper([Control|T], TestFun0) ->
+ TestFun1 = control_wrapper(T, TestFun0),
+ fun(Config) ->
+ case Control of
+ parallel ->
+ {inparallel, TestFun1(Config)};
+ sequence ->
+ {inorder, TestFun1(Config)};
+ {timetrap, Time} ->
+ Seconds = case Time of
+ {hours, Hs} -> Hs * 60 * 60;
+ {minutes, Ms} -> Ms * 60;
+ {seconds, Ss} -> Ss;
+ MSs -> MSs / 1000
+ end,
+ {timeout, Seconds, TestFun1(Config)};
+ C when is_atom(C) ->
+ {C, TestFun1(Config)};
+ {C, Arg} ->
+ {C, Arg, TestFun1(Config)}
+ end
+ end;
+control_wrapper([], TestFun) ->
+ TestFun.
+
+-spec setup_wrapper(atom(), test_fun(), Callback, Callback) -> test_fun()
+ when Callback :: {atom(), list()}.
+setup_wrapper(Module, TestFun, {Setup, SA}, {Cleanup, CA}) ->
+ case erlang:function_exported(Module, Setup, length(SA) + 1) of
+ true ->
+ case erlang:function_exported(Module, Cleanup, length(CA) + 1) of
+ true ->
+ fun(Config0) ->
+ {setup,
+ fun() ->
+ apply(Module, Setup, SA ++ [Config0])
+ end,
+ fun(Config1) ->
+ apply(Module, Cleanup, CA ++ [Config1])
+ end,
+ TestFun}
+ end;
+ false ->
+ fun(Config) ->
+ {setup,
+ fun() ->
+ apply(Module, Setup, SA ++ [Config])
+ end,
+ TestFun}
+ end
+ end;
+ false ->
+ TestFun
+ end.
+
+-spec group_specification(atom(), atom()) -> {[control()], [test_name()]}.
+group_specification(Module, GroupName) ->
+ case lists:keyfind(GroupName, 1, Module:groups()) of
+ {_, Control, Cases} when is_list(Control), is_list(Cases) ->
+ {Control, Cases};
+ {_, Cases} when is_list(Cases) ->
+ {[], Cases};
+ false ->
+ exit({missing_group, GroupName});
+ _ ->
+ exit({bad_group_spec, GroupName})
+ end.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/comparisons.erl b/lib/dialyzer/test/small_SUITE_data/src/comparisons.erl
new file mode 100644
index 0000000000..70e3cb6af4
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/comparisons.erl
@@ -0,0 +1,322 @@
+-module(comparisons).
+
+-compile(export_all).
+
+-define(r, get(r)).
+
+integer() -> integer(?r).
+integer(X) when is_integer(X) -> X.
+
+mfloat() -> float(?r).
+mfloat(X) when is_float(X) -> X.
+
+atom() -> atom(?r).
+atom(X) when is_atom(X) -> X.
+
+tuple() -> tuple(?r).
+tuple(X) when is_tuple(X) -> X.
+
+list() -> list(?r).
+list(X) when is_list(X) -> X.
+
+i() -> integer().
+f() -> mfloat().
+n() -> case ?r of 1 -> i(); 2 -> f() end.
+a() -> atom().
+t() -> tuple().
+l() -> list().
+na() -> case ?r of 1 -> n(); 2 -> a() end.
+at() -> case ?r of 1 -> t(); 2 -> a() end.
+tl() -> case ?r of 1 -> t(); 2 -> l() end.
+
+test_i_ll_i() -> case i() < i() of true -> maybe; false -> maybe_too end.
+test_i_le_i() -> case i() =< i() of true -> maybe; false -> maybe_too end.
+test_i_gg_i() -> case i() > i() of true -> maybe; false -> maybe_too end.
+test_i_ge_i() -> case i() >= i() of true -> maybe; false -> maybe_too end.
+test_i_ll_f() -> case i() < f() of true -> maybe; false -> maybe_too end.
+test_i_le_f() -> case i() =< f() of true -> maybe; false -> maybe_too end.
+test_i_gg_f() -> case i() > f() of true -> maybe; false -> maybe_too end.
+test_i_ge_f() -> case i() >= f() of true -> maybe; false -> maybe_too end.
+test_i_ll_n() -> case i() < n() of true -> maybe; false -> maybe_too end.
+test_i_le_n() -> case i() =< n() of true -> maybe; false -> maybe_too end.
+test_i_gg_n() -> case i() > n() of true -> maybe; false -> maybe_too end.
+test_i_ge_n() -> case i() >= n() of true -> maybe; false -> maybe_too end.
+test_i_ll_a() -> case i() < a() of true -> always; false -> never end.
+test_i_le_a() -> case i() =< a() of true -> always; false -> never end.
+test_i_gg_a() -> case i() > a() of true -> never; false -> always end.
+test_i_ge_a() -> case i() >= a() of true -> never; false -> always end.
+test_i_ll_t() -> case i() < t() of true -> always; false -> never end.
+test_i_le_t() -> case i() =< t() of true -> always; false -> never end.
+test_i_gg_t() -> case i() > t() of true -> never; false -> always end.
+test_i_ge_t() -> case i() >= t() of true -> never; false -> always end.
+test_i_ll_l() -> case i() < l() of true -> always; false -> never end.
+test_i_le_l() -> case i() =< l() of true -> always; false -> never end.
+test_i_gg_l() -> case i() > l() of true -> never; false -> always end.
+test_i_ge_l() -> case i() >= l() of true -> never; false -> always end.
+
+test_f_ll_i() -> case f() < i() of true -> maybe; false -> maybe_too end.
+test_f_le_i() -> case f() =< i() of true -> maybe; false -> maybe_too end.
+test_f_gg_i() -> case f() > i() of true -> maybe; false -> maybe_too end.
+test_f_ge_i() -> case f() >= i() of true -> maybe; false -> maybe_too end.
+test_f_ll_f() -> case f() < f() of true -> maybe; false -> maybe_too end.
+test_f_le_f() -> case f() =< f() of true -> maybe; false -> maybe_too end.
+test_f_gg_f() -> case f() > f() of true -> maybe; false -> maybe_too end.
+test_f_ge_f() -> case f() >= f() of true -> maybe; false -> maybe_too end.
+test_f_ll_n() -> case f() < n() of true -> maybe; false -> maybe_too end.
+test_f_le_n() -> case f() =< n() of true -> maybe; false -> maybe_too end.
+test_f_gg_n() -> case f() > n() of true -> maybe; false -> maybe_too end.
+test_f_ge_n() -> case f() >= n() of true -> maybe; false -> maybe_too end.
+test_f_ll_a() -> case f() < a() of true -> always; false -> never end.
+test_f_le_a() -> case f() =< a() of true -> always; false -> never end.
+test_f_gg_a() -> case f() > a() of true -> never; false -> always end.
+test_f_ge_a() -> case f() >= a() of true -> never; false -> always end.
+test_f_ll_t() -> case f() < t() of true -> always; false -> never end.
+test_f_le_t() -> case f() =< t() of true -> always; false -> never end.
+test_f_gg_t() -> case f() > t() of true -> never; false -> always end.
+test_f_ge_t() -> case f() >= t() of true -> never; false -> always end.
+test_f_ll_l() -> case f() < l() of true -> always; false -> never end.
+test_f_le_l() -> case f() =< l() of true -> always; false -> never end.
+test_f_gg_l() -> case f() > l() of true -> never; false -> always end.
+test_f_ge_l() -> case f() >= l() of true -> never; false -> always end.
+
+test_n_ll_i() -> case n() < i() of true -> maybe; false -> maybe_too end.
+test_n_le_i() -> case n() =< i() of true -> maybe; false -> maybe_too end.
+test_n_gg_i() -> case n() > i() of true -> maybe; false -> maybe_too end.
+test_n_ge_i() -> case n() >= i() of true -> maybe; false -> maybe_too end.
+test_n_ll_f() -> case n() < f() of true -> maybe; false -> maybe_too end.
+test_n_le_f() -> case n() =< f() of true -> maybe; false -> maybe_too end.
+test_n_gg_f() -> case n() > f() of true -> maybe; false -> maybe_too end.
+test_n_ge_f() -> case n() >= f() of true -> maybe; false -> maybe_too end.
+test_n_ll_n() -> case n() < n() of true -> maybe; false -> maybe_too end.
+test_n_le_n() -> case n() =< n() of true -> maybe; false -> maybe_too end.
+test_n_gg_n() -> case n() > n() of true -> maybe; false -> maybe_too end.
+test_n_ge_n() -> case n() >= n() of true -> maybe; false -> maybe_too end.
+test_n_ll_a() -> case n() < a() of true -> always; false -> never end.
+test_n_le_a() -> case n() =< a() of true -> always; false -> never end.
+test_n_gg_a() -> case n() > a() of true -> never; false -> always end.
+test_n_ge_a() -> case n() >= a() of true -> never; false -> always end.
+test_n_ll_t() -> case n() < t() of true -> always; false -> never end.
+test_n_le_t() -> case n() =< t() of true -> always; false -> never end.
+test_n_gg_t() -> case n() > t() of true -> never; false -> always end.
+test_n_ge_t() -> case n() >= t() of true -> never; false -> always end.
+test_n_ll_l() -> case n() < l() of true -> always; false -> never end.
+test_n_le_l() -> case n() =< l() of true -> always; false -> never end.
+test_n_gg_l() -> case n() > l() of true -> never; false -> always end.
+test_n_ge_l() -> case n() >= l() of true -> never; false -> always end.
+
+test_a_ll_i() -> case a() < i() of true -> never; false -> always end.
+test_a_le_i() -> case a() =< i() of true -> never; false -> always end.
+test_a_gg_i() -> case a() > i() of true -> always; false -> never end.
+test_a_ge_i() -> case a() >= i() of true -> always; false -> never end.
+test_a_ll_f() -> case a() < f() of true -> never; false -> always end.
+test_a_le_f() -> case a() =< f() of true -> never; false -> always end.
+test_a_gg_f() -> case a() > f() of true -> always; false -> never end.
+test_a_ge_f() -> case a() >= f() of true -> always; false -> never end.
+test_a_ll_n() -> case a() < n() of true -> never; false -> always end.
+test_a_le_n() -> case a() =< n() of true -> never; false -> always end.
+test_a_gg_n() -> case a() > n() of true -> always; false -> never end.
+test_a_ge_n() -> case a() >= n() of true -> always; false -> never end.
+test_a_ll_a() -> case a() < a() of true -> maybe; false -> maybe_too end.
+test_a_le_a() -> case a() =< a() of true -> maybe; false -> maybe_too end.
+test_a_gg_a() -> case a() > a() of true -> maybe; false -> maybe_too end.
+test_a_ge_a() -> case a() >= a() of true -> maybe; false -> maybe_too end.
+test_a_ll_t() -> case a() < t() of true -> always; false -> never end.
+test_a_le_t() -> case a() =< t() of true -> always; false -> never end.
+test_a_gg_t() -> case a() > t() of true -> never; false -> always end.
+test_a_ge_t() -> case a() >= t() of true -> never; false -> always end.
+test_a_ll_l() -> case a() < l() of true -> always; false -> never end.
+test_a_le_l() -> case a() =< l() of true -> always; false -> never end.
+test_a_gg_l() -> case a() > l() of true -> never; false -> always end.
+test_a_ge_l() -> case a() >= l() of true -> never; false -> always end.
+
+test_t_ll_i() -> case t() < i() of true -> never; false -> always end.
+test_t_le_i() -> case t() =< i() of true -> never; false -> always end.
+test_t_gg_i() -> case t() > i() of true -> always; false -> never end.
+test_t_ge_i() -> case t() >= i() of true -> always; false -> never end.
+test_t_ll_f() -> case t() < f() of true -> never; false -> always end.
+test_t_le_f() -> case t() =< f() of true -> never; false -> always end.
+test_t_gg_f() -> case t() > f() of true -> always; false -> never end.
+test_t_ge_f() -> case t() >= f() of true -> always; false -> never end.
+test_t_ll_n() -> case t() < n() of true -> never; false -> always end.
+test_t_le_n() -> case t() =< n() of true -> never; false -> always end.
+test_t_gg_n() -> case t() > n() of true -> always; false -> never end.
+test_t_ge_n() -> case t() >= n() of true -> always; false -> never end.
+test_t_ll_a() -> case t() < a() of true -> never; false -> always end.
+test_t_le_a() -> case t() =< a() of true -> never; false -> always end.
+test_t_gg_a() -> case t() > a() of true -> always; false -> never end.
+test_t_ge_a() -> case t() >= a() of true -> always; false -> never end.
+test_t_ll_t() -> case t() < t() of true -> maybe; false -> maybe_too end.
+test_t_le_t() -> case t() =< t() of true -> maybe; false -> maybe_too end.
+test_t_gg_t() -> case t() > t() of true -> maybe; false -> maybe_too end.
+test_t_ge_t() -> case t() >= t() of true -> maybe; false -> maybe_too end.
+test_t_ll_l() -> case t() < l() of true -> always; false -> never end.
+test_t_le_l() -> case t() =< l() of true -> always; false -> never end.
+test_t_gg_l() -> case t() > l() of true -> never; false -> always end.
+test_t_ge_l() -> case t() >= l() of true -> never; false -> always end.
+
+test_l_ll_i() -> case l() < i() of true -> never; false -> always end.
+test_l_le_i() -> case l() =< i() of true -> never; false -> always end.
+test_l_gg_i() -> case l() > i() of true -> always; false -> never end.
+test_l_ge_i() -> case l() >= i() of true -> always; false -> never end.
+test_l_ll_f() -> case l() < f() of true -> never; false -> always end.
+test_l_le_f() -> case l() =< f() of true -> never; false -> always end.
+test_l_gg_f() -> case l() > f() of true -> always; false -> never end.
+test_l_ge_f() -> case l() >= f() of true -> always; false -> never end.
+test_l_ll_n() -> case l() < n() of true -> never; false -> always end.
+test_l_le_n() -> case l() =< n() of true -> never; false -> always end.
+test_l_gg_n() -> case l() > n() of true -> always; false -> never end.
+test_l_ge_n() -> case l() >= n() of true -> always; false -> never end.
+test_l_ll_a() -> case l() < a() of true -> never; false -> always end.
+test_l_le_a() -> case l() =< a() of true -> never; false -> always end.
+test_l_gg_a() -> case l() > a() of true -> always; false -> never end.
+test_l_ge_a() -> case l() >= a() of true -> always; false -> never end.
+test_l_ll_t() -> case l() < t() of true -> never; false -> always end.
+test_l_le_t() -> case l() =< t() of true -> never; false -> always end.
+test_l_gg_t() -> case l() > t() of true -> always; false -> never end.
+test_l_ge_t() -> case l() >= t() of true -> always; false -> never end.
+test_l_ll_l() -> case l() < l() of true -> maybe; false -> maybe_too end.
+test_l_le_l() -> case l() =< l() of true -> maybe; false -> maybe_too end.
+test_l_gg_l() -> case l() > l() of true -> maybe; false -> maybe_too end.
+test_l_ge_l() -> case l() >= l() of true -> maybe; false -> maybe_too end.
+
+test_n_ll_na() -> case n() < na() of true -> maybe; false -> maybe_too end.
+test_n_le_na() -> case n() =< na() of true -> maybe; false -> maybe_too end.
+test_n_gg_na() -> case n() > na() of true -> maybe; false -> maybe_too end.
+test_n_ge_na() -> case n() >= na() of true -> maybe; false -> maybe_too end.
+test_n_ll_at() -> case n() < at() of true -> always; false -> never end.
+test_n_le_at() -> case n() =< at() of true -> always; false -> never end.
+test_n_gg_at() -> case n() > at() of true -> never; false -> always end.
+test_n_ge_at() -> case n() >= at() of true -> never; false -> always end.
+test_n_ll_tl() -> case n() < tl() of true -> always; false -> never end.
+test_n_le_tl() -> case n() =< tl() of true -> always; false -> never end.
+test_n_gg_tl() -> case n() > tl() of true -> never; false -> always end.
+test_n_ge_tl() -> case n() >= tl() of true -> never; false -> always end.
+
+test_a_ll_na() -> case a() < na() of true -> maybe; false -> maybe_too end.
+test_a_le_na() -> case a() =< na() of true -> maybe; false -> maybe_too end.
+test_a_gg_na() -> case a() > na() of true -> maybe; false -> maybe_too end.
+test_a_ge_na() -> case a() >= na() of true -> maybe; false -> maybe_too end.
+test_a_ll_at() -> case a() < at() of true -> maybe; false -> maybe_too end.
+test_a_le_at() -> case a() =< at() of true -> maybe; false -> maybe_too end.
+test_a_gg_at() -> case a() > at() of true -> maybe; false -> maybe_too end.
+test_a_ge_at() -> case a() >= at() of true -> maybe; false -> maybe_too end.
+test_a_ll_tl() -> case a() < tl() of true -> always; false -> never end.
+test_a_le_tl() -> case a() =< tl() of true -> always; false -> never end.
+test_a_gg_tl() -> case a() > tl() of true -> never; false -> always end.
+test_a_ge_tl() -> case a() >= tl() of true -> never; false -> always end.
+
+test_t_ll_na() -> case t() < na() of true -> never; false -> always end.
+test_t_le_na() -> case t() =< na() of true -> never; false -> always end.
+test_t_gg_na() -> case t() > na() of true -> always; false -> never end.
+test_t_ge_na() -> case t() >= na() of true -> always; false -> never end.
+test_t_ll_at() -> case t() < at() of true -> maybe; false -> maybe_too end.
+test_t_le_at() -> case t() =< at() of true -> maybe; false -> maybe_too end.
+test_t_gg_at() -> case t() > at() of true -> maybe; false -> maybe_too end.
+test_t_ge_at() -> case t() >= at() of true -> maybe; false -> maybe_too end.
+test_t_ll_tl() -> case t() < tl() of true -> maybe; false -> maybe_too end.
+test_t_le_tl() -> case t() =< tl() of true -> maybe; false -> maybe_too end.
+test_t_gg_tl() -> case t() > tl() of true -> maybe; false -> maybe_too end.
+test_t_ge_tl() -> case t() >= tl() of true -> maybe; false -> maybe_too end.
+
+test_l_ll_na() -> case l() < na() of true -> never; false -> always end.
+test_l_le_na() -> case l() =< na() of true -> never; false -> always end.
+test_l_gg_na() -> case l() > na() of true -> always; false -> never end.
+test_l_ge_na() -> case l() >= na() of true -> always; false -> never end.
+test_l_ll_at() -> case l() < at() of true -> never; false -> always end.
+test_l_le_at() -> case l() =< at() of true -> never; false -> always end.
+test_l_gg_at() -> case l() > at() of true -> always; false -> never end.
+test_l_ge_at() -> case l() >= at() of true -> always; false -> never end.
+test_l_ll_tl() -> case l() < tl() of true -> maybe; false -> maybe_too end.
+test_l_le_tl() -> case l() =< tl() of true -> maybe; false -> maybe_too end.
+test_l_gg_tl() -> case l() > tl() of true -> maybe; false -> maybe_too end.
+test_l_ge_tl() -> case l() >= tl() of true -> maybe; false -> maybe_too end.
+
+test_na_ll_n() -> case na() < n() of true -> maybe; false -> maybe_too end.
+test_na_le_n() -> case na() =< n() of true -> maybe; false -> maybe_too end.
+test_na_gg_n() -> case na() > n() of true -> maybe; false -> maybe_too end.
+test_na_ge_n() -> case na() >= n() of true -> maybe; false -> maybe_too end.
+test_na_ll_a() -> case na() < a() of true -> maybe; false -> maybe_too end.
+test_na_le_a() -> case na() =< a() of true -> maybe; false -> maybe_too end.
+test_na_gg_a() -> case na() > a() of true -> maybe; false -> maybe_too end.
+test_na_ge_a() -> case na() >= a() of true -> maybe; false -> maybe_too end.
+test_na_ll_t() -> case na() < t() of true -> always; false -> never end.
+test_na_le_t() -> case na() =< t() of true -> always; false -> never end.
+test_na_gg_t() -> case na() > t() of true -> never; false -> always end.
+test_na_ge_t() -> case na() >= t() of true -> never; false -> always end.
+test_na_ll_l() -> case na() < l() of true -> always; false -> never end.
+test_na_le_l() -> case na() =< l() of true -> always; false -> never end.
+test_na_gg_l() -> case na() > l() of true -> never; false -> always end.
+test_na_ge_l() -> case na() >= l() of true -> never; false -> always end.
+
+test_at_ll_n() -> case at() < n() of true -> never; false -> always end.
+test_at_le_n() -> case at() =< n() of true -> never; false -> always end.
+test_at_gg_n() -> case at() > n() of true -> always; false -> never end.
+test_at_ge_n() -> case at() >= n() of true -> always; false -> never end.
+test_at_ll_a() -> case at() < a() of true -> maybe; false -> maybe_too end.
+test_at_le_a() -> case at() =< a() of true -> maybe; false -> maybe_too end.
+test_at_gg_a() -> case at() > a() of true -> maybe; false -> maybe_too end.
+test_at_ge_a() -> case at() >= a() of true -> maybe; false -> maybe_too end.
+test_at_ll_t() -> case at() < t() of true -> maybe; false -> maybe_too end.
+test_at_le_t() -> case at() =< t() of true -> maybe; false -> maybe_too end.
+test_at_gg_t() -> case at() > t() of true -> maybe; false -> maybe_too end.
+test_at_ge_t() -> case at() >= t() of true -> maybe; false -> maybe_too end.
+test_at_ll_l() -> case at() < l() of true -> always; false -> never end.
+test_at_le_l() -> case at() =< l() of true -> always; false -> never end.
+test_at_gg_l() -> case at() > l() of true -> never; false -> always end.
+test_at_ge_l() -> case at() >= l() of true -> never; false -> always end.
+
+test_tl_ll_n() -> case tl() < n() of true -> never; false -> always end.
+test_tl_le_n() -> case tl() =< n() of true -> never; false -> always end.
+test_tl_gg_n() -> case tl() > n() of true -> always; false -> never end.
+test_tl_ge_n() -> case tl() >= n() of true -> always; false -> never end.
+test_tl_ll_a() -> case tl() < a() of true -> never; false -> always end.
+test_tl_le_a() -> case tl() =< a() of true -> never; false -> always end.
+test_tl_gg_a() -> case tl() > a() of true -> always; false -> never end.
+test_tl_ge_a() -> case tl() >= a() of true -> always; false -> never end.
+test_tl_ll_t() -> case tl() < t() of true -> maybe; false -> maybe_too end.
+test_tl_le_t() -> case tl() =< t() of true -> maybe; false -> maybe_too end.
+test_tl_gg_t() -> case tl() > t() of true -> maybe; false -> maybe_too end.
+test_tl_ge_t() -> case tl() >= t() of true -> maybe; false -> maybe_too end.
+test_tl_ll_l() -> case tl() < l() of true -> maybe; false -> maybe_too end.
+test_tl_le_l() -> case tl() =< l() of true -> maybe; false -> maybe_too end.
+test_tl_gg_l() -> case tl() > l() of true -> maybe; false -> maybe_too end.
+test_tl_ge_l() -> case tl() >= l() of true -> maybe; false -> maybe_too end.
+
+test_na_ll_na() -> case na() < na() of true -> maybe; false -> maybe_too end.
+test_na_le_na() -> case na() =< na() of true -> maybe; false -> maybe_too end.
+test_na_gg_na() -> case na() > na() of true -> maybe; false -> maybe_too end.
+test_na_ge_na() -> case na() >= na() of true -> maybe; false -> maybe_too end.
+test_na_ll_at() -> case na() < at() of true -> maybe; false -> maybe_too end.
+test_na_le_at() -> case na() =< at() of true -> maybe; false -> maybe_too end.
+test_na_gg_at() -> case na() > at() of true -> maybe; false -> maybe_too end.
+test_na_ge_at() -> case na() >= at() of true -> maybe; false -> maybe_too end.
+test_na_ll_tl() -> case na() < tl() of true -> always; false -> never end.
+test_na_le_tl() -> case na() =< tl() of true -> always; false -> never end.
+test_na_gg_tl() -> case na() > tl() of true -> never; false -> always end.
+test_na_ge_tl() -> case na() >= tl() of true -> never; false -> always end.
+
+test_at_ll_na() -> case at() < na() of true -> maybe; false -> maybe_too end.
+test_at_le_na() -> case at() =< na() of true -> maybe; false -> maybe_too end.
+test_at_gg_na() -> case at() > na() of true -> maybe; false -> maybe_too end.
+test_at_ge_na() -> case at() >= na() of true -> maybe; false -> maybe_too end.
+test_at_ll_at() -> case at() < at() of true -> maybe; false -> maybe_too end.
+test_at_le_at() -> case at() =< at() of true -> maybe; false -> maybe_too end.
+test_at_gg_at() -> case at() > at() of true -> maybe; false -> maybe_too end.
+test_at_ge_at() -> case at() >= at() of true -> maybe; false -> maybe_too end.
+test_at_ll_tl() -> case at() < tl() of true -> maybe; false -> maybe_too end.
+test_at_le_tl() -> case at() =< tl() of true -> maybe; false -> maybe_too end.
+test_at_gg_tl() -> case at() > tl() of true -> maybe; false -> maybe_too end.
+test_at_ge_tl() -> case at() >= tl() of true -> maybe; false -> maybe_too end.
+
+test_tl_ll_na() -> case tl() < na() of true -> never; false -> always end.
+test_tl_le_na() -> case tl() =< na() of true -> never; false -> always end.
+test_tl_gg_na() -> case tl() > na() of true -> always; false -> never end.
+test_tl_ge_na() -> case tl() >= na() of true -> always; false -> never end.
+test_tl_ll_at() -> case tl() < at() of true -> maybe; false -> maybe_too end.
+test_tl_le_at() -> case tl() =< at() of true -> maybe; false -> maybe_too end.
+test_tl_gg_at() -> case tl() > at() of true -> maybe; false -> maybe_too end.
+test_tl_ge_at() -> case tl() >= at() of true -> maybe; false -> maybe_too end.
+test_tl_ll_tl() -> case tl() < tl() of true -> maybe; false -> maybe_too end.
+test_tl_le_tl() -> case tl() =< tl() of true -> maybe; false -> maybe_too end.
+test_tl_gg_tl() -> case tl() > tl() of true -> maybe; false -> maybe_too end.
+test_tl_ge_tl() -> case tl() >= tl() of true -> maybe; false -> maybe_too end.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl b/lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl
new file mode 100644
index 0000000000..1784c4a494
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl
@@ -0,0 +1,250 @@
+-module(failing_funs).
+
+-compile(export_all).
+
+% Crashes with system call. No spec.
+foo1() -> halt().
+
+% Crashes with system call. With spec.
+-spec foo2() -> no_return().
+foo2() -> halt().
+
+% Crashes on its own. No spec.
+foo3() -> case a of b -> ok end.
+
+% Crashes on its own. With spec.
+-spec foo4() -> no_return().
+foo4() -> case a of b -> ok end.
+
+% Creates fun that crashes with system call. No spec.
+foo5() -> fun() -> halt() end.
+
+% Creates fun that crashes with system call. With spec.
+-spec foo6() -> fun(() -> no_return()).
+foo6() -> fun() -> halt() end.
+
+% Creates fun from named fun that will crash. Neither have spec.
+foo7() -> fun foo1/0.
+
+% Creates fun from named fun that will crash. Has spec.
+-spec foo8() -> fun(() -> no_return()).
+foo8() -> fun foo1/0.
+
+% Creates fun from named fun that will crash. Named has spec.
+foo9() -> fun foo2/0.
+
+% Creates fun from named fun that will crash. Both have specs.
+-spec foo10() -> fun(() -> no_return()).
+foo10() -> fun foo2/0.
+
+% Creates fun from named fun that will crash. Neither have spec.
+foo11() -> fun foo3/0.
+
+% Creates fun from named fun that will crash. Has spec.
+-spec foo12() -> fun(() -> no_return()).
+foo12() -> fun foo3/0.
+
+% Creates fun from named fun that will crash. Named has spec.
+foo13() -> fun foo4/0.
+
+% Creates fun from named fun that will crash. Both have specs.
+-spec foo14() -> fun(() -> no_return()).
+foo14() -> fun foo4/0.
+
+% Creates fun calling a named fun that will crash. Neither have spec.
+foo15() -> fun() -> foo1() end.
+
+% Creates fun calling a named fun that will crash. Has spec.
+-spec foo16() -> fun(() -> no_return()).
+foo16() -> fun() -> foo1() end.
+
+% Creates fun calling a named fun that will crash. Named has spec.
+foo17() -> fun() -> foo2() end.
+
+% Creates fun calling a named fun that will crash. Both have specs.
+-spec foo18() -> fun(() -> no_return()).
+foo18() -> fun() -> foo2() end.
+
+% Creates fun calling a named fun that will crash. Neither have spec.
+foo19() -> fun() -> foo3() end.
+
+% Creates fun calling a named fun that will crash. Has spec.
+-spec foo20() -> fun(() -> no_return()).
+foo20() -> fun() -> foo3() end.
+
+% Creates fun calling a named fun that will crash. Named has spec.
+foo21() -> fun() -> foo4() end.
+
+% Creates fun calling a named fun that will crash. Both have specs.
+-spec foo22() -> fun(() -> no_return()).
+foo22() -> fun() -> foo4() end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo23() ->
+ Bomb = fun() -> halt() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> halt() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo24() -> fun(() -> no_return()).
+foo24() ->
+ Bomb = fun() -> halt() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> halt() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo25() ->
+ Bomb = fun() -> foo1() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo1() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo26() -> fun(() -> no_return()).
+foo26() ->
+ Bomb = fun foo1/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo1/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo27() ->
+ Bomb = fun foo1/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo1/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo28() -> fun(() -> no_return()).
+foo28() ->
+ Bomb = fun() -> foo1() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo1() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo29() ->
+ Bomb = fun() -> foo2() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo2() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo30() -> fun(() -> no_return()).
+foo30() ->
+ Bomb = fun foo2/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo2/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo31() ->
+ Bomb = fun foo2/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo2/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo32() -> fun(() -> no_return()).
+foo32() ->
+ Bomb = fun() -> foo2() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo2() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo33() ->
+ Bomb = fun() -> foo3() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo3() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo34() -> fun(() -> no_return()).
+foo34() ->
+ Bomb = fun foo3/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo3/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo35() ->
+ Bomb = fun foo3/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo3/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo36() -> fun(() -> no_return()).
+foo36() ->
+ Bomb = fun() -> foo3() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo3() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo37() ->
+ Bomb = fun() -> foo4() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo4() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo38() -> fun(() -> no_return()).
+foo38() ->
+ Bomb = fun foo4/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo4/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo39() ->
+ Bomb = fun foo4/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo4/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo40() -> fun(() -> no_return()).
+foo40() ->
+ Bomb = fun() -> foo4() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo4() end
+ end.
+
+% Obtains two funs with no local return and will return one or die. No spec.
+foo41() ->
+ Bomb = foo5(),
+ case get(42) of
+ a -> Bomb();
+ b -> foo5()
+ end.
+
+% Obtains two funs with no local return and will return one or die. With spec.
+-spec foo42() -> fun(() -> no_return()).
+foo42() ->
+ Bomb = foo5(),
+ case get(42) of
+ a -> Bomb();
+ b -> foo5()
+ end.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
index 4f1268eba8..086df3464b 100644
--- a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
+++ b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
@@ -6,9 +6,7 @@
-export([parse/1]).
--type proplist() :: [{atom(), any()}].
-
--spec parse(string()) -> proplist().
+-spec parse(string()) -> proplists:proplist().
parse(FileName) ->
{ok, IoDevice} = file:open(FileName, [read, binary, {encoding, utf8}]),
do_parse(IoDevice, []).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
new file mode 100644
index 0000000000..2da708cb15
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
@@ -0,0 +1,21 @@
+%%=====================================================================
+%% From: Ken Robinson
+%% Date: 28/04/2011, 17:26
+%%
+%% Program that produced borus "Function has no local return" warnings
+%% due to erlang:list_to_bitstring/1 having erroneous hard coded type
+%% information, namely accepting iolist() instead of bitstrlist().
+%% Fixed 29/04/2011.
+%%=====================================================================
+
+-module(list_to_bitstring).
+
+-export([l2bs/0, l2bs_ok/0]).
+
+%% This function was producing a warning
+l2bs() ->
+ erlang:list_to_bitstring([<<42>>, <<42:13>>]).
+
+%% while this one was ok.
+l2bs_ok() ->
+ erlang:list_to_bitstring([<<42>>, <<42,42>>]).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
new file mode 100644
index 0000000000..5c24902590
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
@@ -0,0 +1,42 @@
+%% Dialyzer couldn't infer that monitor_diskspace would go in an infinite loop
+%% instead of crashing due to the existence of list comprehensions that have a
+%% normal success typing. These were added to the monitor_diskspace's SCC and
+%% dialyzer_typesig didn't try to assign unit() to monitor_diskspace, as it
+%% required all the members of the SCC to return none().
+%%
+%% Testcase was submitted in erlang-questions mailing list by Prashanth Mundkur
+%% (http://erlang.org/pipermail/erlang-questions/2011-May/058063.html)
+
+-module(no_return_bug).
+-export([diskspace/1, monitor_diskspace/2, refresh_tags/1, monitor_launch/0]).
+
+-type diskinfo() :: {non_neg_integer(), non_neg_integer()}.
+
+-spec diskspace(nonempty_string()) -> {'ok', diskinfo()} | {'error', term()}.
+diskspace(Path) ->
+ case Path of
+ "a" -> {ok, {0,0}};
+ _ -> {error, error}
+ end.
+
+-spec monitor_diskspace(nonempty_string(),
+ [{diskinfo(), nonempty_string()}]) ->
+ no_return().
+monitor_diskspace(Root, Vols) ->
+ Df = fun(VolName) ->
+ diskspace(filename:join([Root, VolName]))
+ end,
+ NewVols = [{Space, VolName}
+ || {VolName, {ok, Space}}
+ <- [{VolName, Df(VolName)}
+ || {_OldSpace, VolName} <- Vols]],
+ monitor_diskspace(Root, NewVols).
+
+-spec refresh_tags(nonempty_string()) -> no_return().
+refresh_tags(Root) ->
+ {ok, _} = diskspace(Root),
+ refresh_tags(Root).
+
+monitor_launch() ->
+ spawn_link(fun() -> refresh_tags("abc") end),
+ spawn_link(fun() -> monitor_diskspace("root", [{{0,0}, "a"}]) end).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
new file mode 100644
index 0000000000..63daeee9e3
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
@@ -0,0 +1,7 @@
+-module(nowarnunused).
+
+-compile({nowarn_unused_function, return_error/2}).
+
+-spec return_error(integer(), any()) -> no_return().
+return_error(Line, Message) ->
+ throw({error, {Line, ?MODULE, Message}}).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl b/lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl
new file mode 100644
index 0000000000..d3b504ae04
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl
@@ -0,0 +1,19 @@
+-module(rebar_no_return).
+
+-export([t/0]).
+
+-spec t() -> no_return().
+t() ->
+ F = log_and_halt("baz"),
+ F("foo", 123).
+
+-spec log_and_halt(string()) -> fun((string(),integer()) -> no_return()).
+log_and_halt(Msg) ->
+ fun(_, _) ->
+ abort(Msg)
+ end.
+
+-spec abort(string()) -> no_return().
+abort(Msg) ->
+ io:format("~s~n", [Msg]),
+ halt(1).
diff --git a/lib/diameter/doc/src/diameter_dict.xml b/lib/diameter/doc/src/diameter_dict.xml
index a87f59bad5..e7c530f1b8 100644
--- a/lib/diameter/doc/src/diameter_dict.xml
+++ b/lib/diameter/doc/src/diameter_dict.xml
@@ -105,7 +105,7 @@ quantity is insignificant.</p>
<p>
The tags, their arguments and the contents of each corresponding
section are as follows.
-Each section can occur only once unless otherwise specified.
+Each section can occur at most once unless otherwise specified.
The order in which sections are specified is unimportant.</p>
<taglist>
@@ -115,6 +115,7 @@ The order in which sections are specified is unimportant.</p>
<p>
Defines the integer Number as the Diameter Application Id of the
application in question.
+Required if the dictionary defines <c>@messages</c>.
The section has empty content.</p>
<p>
@@ -370,7 +371,11 @@ Integer values can be prefixed with 0x to be interpreted as
hexidecimal.</p>
<p>
-Can occur 0 or more times (with different values of Name).</p>
+Can occur 0 or more times (with different values of Name).
+The AVP in question can be defined in an inherited dictionary in order
+to introduce additional values.
+An AVP so extended must be referenced by in a <c>@messages</c> or
+<c>@grouped</c> section.</p>
<p>
Example:</p>
diff --git a/lib/diameter/src/compiler/diameter_codegen.erl b/lib/diameter/src/compiler/diameter_codegen.erl
index 213ba0d22c..30caebc544 100644
--- a/lib/diameter/src/compiler/diameter_codegen.erl
+++ b/lib/diameter/src/compiler/diameter_codegen.erl
@@ -250,9 +250,14 @@ f_name(Name) ->
%%% ------------------------------------------------------------------------
f_id(Spec) ->
- Id = orddict:fetch(id, Spec),
{?function, id, 0,
- [{?clause, [], [], [?INTEGER(Id)]}]}.
+ [c_id(orddict:find(id, Spec))]}.
+
+c_id({ok, Id}) ->
+ {?clause, [], [], [?INTEGER(Id)]};
+
+c_id(error) ->
+ ?UNEXPECTED(0).
%%% ------------------------------------------------------------------------
%%% # vendor_id/0
@@ -454,9 +459,10 @@ avp(Spec) ->
Native = get_value(avp_types, Spec),
Custom = get_value(custom_types, Spec),
Imported = get_value(import_avps, Spec),
- avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom).
+ Enums = get_value(enums, Spec),
+ avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom, Enums).
-avp(Native, Imported, Custom) ->
+avp(Native, Imported, Custom, Enums) ->
Dict = orddict:from_list(Native),
report(native, Dict),
@@ -470,8 +476,8 @@ avp(Native, Imported, Custom) ->
false == lists:member(N, CustomNames)
end,
Native))
- ++ lists:flatmap(fun c_imported_avp/1, Imported)
- ++ lists:flatmap(fun(C) -> c_custom_avp(C, Dict) end, Custom).
+ ++ lists:flatmap(fun(I) -> cs_imported_avp(I, Enums) end, Imported)
+ ++ lists:flatmap(fun(C) -> cs_custom_avp(C, Dict) end, Custom).
c_base_avp({AvpName, T}) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
@@ -487,23 +493,35 @@ base_avp(AvpName, 'Grouped') ->
base_avp(_, Type) ->
?APPLY(diameter_types, Type, [?VAR('T'), ?VAR('Data')]).
-c_imported_avp({Mod, Avps}) ->
- lists:map(fun(A) -> imported_avp(Mod, A) end, Avps).
+cs_imported_avp({Mod, Avps}, Enums) ->
+ lists:map(fun(A) -> imported_avp(Mod, A, Enums) end, Avps).
-imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}) ->
+imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}, _) ->
c_base_avp({AvpName, T});
-imported_avp(Mod, {AvpName, _, _, _, _}) ->
+imported_avp(Mod, {AvpName, _, 'Enumerated' = T, _, _}, Enums) ->
+ case lists:keymember(AvpName, 1, Enums) of
+ true ->
+ c_base_avp({AvpName, T});
+ false ->
+ c_imported_avp(Mod, AvpName)
+ end;
+
+imported_avp(Mod, {AvpName, _, _, _, _}, _) ->
+ c_imported_avp(Mod, AvpName).
+
+c_imported_avp(Mod, AvpName) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, avp, [?VAR('T'),
?VAR('Data'),
?ATOM(AvpName)])]}.
-c_custom_avp({Mod, Avps}, Dict) ->
- lists:map(fun(N) -> custom_avp(Mod, N, orddict:fetch(N, Dict)) end, Avps).
+cs_custom_avp({Mod, Avps}, Dict) ->
+ lists:map(fun(N) -> c_custom_avp(Mod, N, orddict:fetch(N, Dict)) end,
+ Avps).
-custom_avp(Mod, AvpName, Type) ->
+c_custom_avp(Mod, AvpName, Type) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, AvpName, [?VAR('T'), ?ATOM(Type), ?VAR('Data')])]}.
@@ -516,9 +534,25 @@ f_enumerated_avp(Spec) ->
{?function, enumerated_avp, 3, enumerated_avp(Spec) ++ [?UNEXPECTED(3)]}.
enumerated_avp(Spec) ->
- lists:flatmap(fun c_enumerated_avp/1, get_value(enums, Spec)).
+ Enums = get_value(enums, Spec),
+ lists:flatmap(fun cs_enumerated_avp/1, Enums)
+ ++ lists:flatmap(fun({M,Es}) -> enumerated_avp(M, Es, Enums) end,
+ get_value(import_enums, Spec)).
+
+enumerated_avp(Mod, Es, Enums) ->
+ lists:flatmap(fun({N,_}) ->
+ cs_enumerated_avp(lists:keymember(N, 1, Enums),
+ Mod,
+ N)
+ end,
+ Es).
-c_enumerated_avp({AvpName, Values}) ->
+cs_enumerated_avp(true, Mod, Name) ->
+ [c_imported_avp(Mod, Name)];
+cs_enumerated_avp(false, _, _) ->
+ [].
+
+cs_enumerated_avp({AvpName, Values}) ->
lists:flatmap(fun(V) -> c_enumerated_avp(AvpName, V) end, Values).
c_enumerated_avp(AvpName, {I,_}) ->
@@ -537,10 +571,14 @@ f_msg_header(Spec) ->
{?function, msg_header, 1, msg_header(Spec) ++ [?UNEXPECTED(1)]}.
msg_header(Spec) ->
+ msg_header(get_value(messages, Spec), Spec).
+
+msg_header([], _) ->
+ [];
+msg_header(Msgs, Spec) ->
ApplId = orddict:fetch(id, Spec),
- lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end,
- get_value(messages, Spec)).
+ lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end, Msgs).
%% Note that any application id in the message header spec is ignored.
@@ -616,10 +654,12 @@ f_empty_value(Spec) ->
{?function, empty_value, 1, empty_value(Spec)}.
empty_value(Spec) ->
+ Imported = lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
Groups = get_value(grouped, Spec)
++ lists:flatmap(fun avps/1, get_value(import_groups, Spec)),
- Enums = get_value(enums, Spec)
- ++ lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
+ Enums = [T || {N,_} = T <- get_value(enums, Spec),
+ not lists:keymember(N, 1, Imported)]
+ ++ Imported,
lists:map(fun c_empty_value/1, Groups ++ Enums)
++ [{?clause, [?VAR('Name')], [], [?CALL(empty, [?VAR('Name')])]}].
diff --git a/lib/diameter/src/compiler/diameter_spec_util.erl b/lib/diameter/src/compiler/diameter_spec_util.erl
index 322d53a199..b60886b678 100644
--- a/lib/diameter/src/compiler/diameter_spec_util.erl
+++ b/lib/diameter/src/compiler/diameter_spec_util.erl
@@ -39,11 +39,11 @@ parse(Path, Options) ->
{ok, B} = file:read_file(Path),
Chunks = chunk(B),
Spec = make_spec(Chunks),
- true = enums_defined(Spec), %% sanity checks
- true = groups_defined(Spec), %%
+ true = groups_defined(Spec), %% sanity checks
true = customs_defined(Spec), %%
Full = import_enums(import_groups(import_avps(insert_codes(Spec),
Options))),
+ true = enums_defined(Full), %% sanity checks
true = v_flags_set(Spec),
Full.
@@ -243,35 +243,48 @@ get_value(Key, Spec) ->
%% with an appropriate type.
enums_defined(Spec) ->
- is_defined(Spec, 'Enumerated', enums).
+ Avps = get_value(avp_types, Spec),
+ Import = get_value(import_enums, Spec),
+ lists:all(fun({N,_}) ->
+ true = enum_defined(N, Avps, Import)
+ end,
+ get_value(enums, Spec)).
-groups_defined(Spec) ->
- is_defined(Spec, 'Grouped', grouped).
+enum_defined(Name, Avps, Import) ->
+ case lists:keyfind(Name, 1, Avps) of
+ {Name, _, 'Enumerated', _, _} ->
+ true;
+ {Name, _, T, _, _} ->
+ ?ERROR({avp_has_wrong_type, Name, 'Enumerated', T});
+ false ->
+ lists:any(fun({_,Is}) -> lists:keymember(Name, 1, Is) end, Import)
+ orelse ?ERROR({avp_not_defined, Name, 'Enumerated'})
+ end.
+%% Note that an AVP is imported only if referenced by a message or
+%% grouped AVP, so the final branch will fail if an enum definition is
+%% extended without this being the case.
-is_defined(Spec, Type, Key) ->
+groups_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(T) -> true = is_local(name(Key, T), Type, Avps) end,
- get_value(Key, Spec)).
+ lists:all(fun({N,_,_,_}) -> true = group_defined(N, Avps) end,
+ get_value(grouped, Spec)).
-name(enums, {N,_}) -> N;
-name(grouped, {N,_,_,_}) -> N.
-
-is_local(Name, Type, Avps) ->
+group_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
- {Name, _, Type, _, _} ->
+ {Name, _, 'Grouped', _, _} ->
true;
{Name, _, T, _, _} ->
- ?ERROR({avp_has_wrong_type, Name, Type, T});
+ ?ERROR({avp_has_wrong_type, Name, 'Grouped', T});
false ->
- ?ERROR({avp_not_defined, Name, Type})
+ ?ERROR({avp_not_defined, Name, 'Grouped'})
end.
customs_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(A) -> true = is_local(A, Avps) end,
+ lists:all(fun(A) -> true = custom_defined(A, Avps) end,
lists:flatmap(fun last/1, get_value(custom_types, Spec))).
-is_local(Name, Avps) ->
+custom_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
{Name, _, T, _, _} when T == 'Grouped';
T == 'Enumerated' ->
@@ -510,6 +523,9 @@ choose(false, _, X) -> X.
%% ------------------------------------------------------------------------
%% import_groups/1
%% import_enums/1
+%%
+%% For each inherited module, store the content of imported AVP's of
+%% type grouped/enumerated in a new key.
import_groups(Spec) ->
orddict:store(import_groups, import(grouped, Spec), Spec).
diff --git a/lib/diameter/test/Makefile b/lib/diameter/test/Makefile
index 823e2f0311..b3648c7bb1 100644
--- a/lib/diameter/test/Makefile
+++ b/lib/diameter/test/Makefile
@@ -404,5 +404,5 @@ release_tests_spec: tests
# $(HRL_FILES) $(ERL_FILES) \
# $(RELSYSDIR)
#
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/docbuilder/src/docb_gen.erl b/lib/docbuilder/src/docb_gen.erl
index 0d8d640324..75494314f1 100644
--- a/lib/docbuilder/src/docb_gen.erl
+++ b/lib/docbuilder/src/docb_gen.erl
@@ -18,6 +18,10 @@
-module(docb_gen).
-export([module/1, module/2, users_guide/1, users_guide/2]).
+-deprecated([{module,1,next_major_release},
+ {module,2,next_major_release},
+ {users_guide,1,next_major_release},
+ {users_guide,2,next_major_release}]).
-record(args, {suffix=".xml",
layout=docb_edoc_xml_cb,
diff --git a/lib/docbuilder/src/docb_transform.erl b/lib/docbuilder/src/docb_transform.erl
index 9c7561b07b..736ac92274 100644
--- a/lib/docbuilder/src/docb_transform.erl
+++ b/lib/docbuilder/src/docb_transform.erl
@@ -18,6 +18,8 @@
-module(docb_transform).
-export([file/1, file/2]).
+-deprecated([{file,1,next_major_release},
+ {file,2,next_major_release}]).
%% file(File) -> ok | {error, Reason}
%% file(File, Opts) -> ok | {error, Reason}
diff --git a/lib/docbuilder/src/docb_xml_check.erl b/lib/docbuilder/src/docb_xml_check.erl
index 8ae5cd2eac..5912e22e7b 100644
--- a/lib/docbuilder/src/docb_xml_check.erl
+++ b/lib/docbuilder/src/docb_xml_check.erl
@@ -18,6 +18,7 @@
-module(docb_xml_check).
-export([validate/1]).
+-deprecated([{validate,1,next_major_release}]).
%% validate(File) -> ok | error | {error, badfile}
%% File = string(), file name with or without ".xml" extension
diff --git a/lib/docbuilder/vsn.mk b/lib/docbuilder/vsn.mk
index 2475966ec2..6df438a537 100644
--- a/lib/docbuilder/vsn.mk
+++ b/lib/docbuilder/vsn.mk
@@ -1 +1 @@
-DOCB_VSN = 0.9.8.10
+DOCB_VSN = 0.9.8.11
diff --git a/lib/edoc/Makefile b/lib/edoc/Makefile
index e512e390e3..1add669398 100644
--- a/lib/edoc/Makefile
+++ b/lib/edoc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/Makefile b/lib/edoc/doc/Makefile
index a0f6484382..c5f68b25d0 100644
--- a/lib/edoc/doc/Makefile
+++ b/lib/edoc/doc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id: Makefile,v 1.1.1.1 2004/10/04 13:53:33 richardc Exp $
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/overview.edoc b/lib/edoc/doc/overview.edoc
index bd603b7a13..fa699c6f08 100644
--- a/lib/edoc/doc/overview.edoc
+++ b/lib/edoc/doc/overview.edoc
@@ -1084,10 +1084,11 @@ Details:
the Erlang programming language.</li>
<li>`boolean()' is the subset of `atom()' consisting
of the atoms `true' and `false'.</li>
- <li>`char()' is a subset of
- `integer()' representing character codes.</li>
+ <li>`char()' is the subset of `integer()' representing
+ Unicode character codes: hex 000000-10FFFF.</li>
<li>`tuple()' is the set of all tuples `{...}'.</li>
- <li>`list(T)' is just an alias for `[T]'.</li>
+ <li>`list(T)' is just an alias for `[T]'; list() is an alias
+ for `list(any())', i.e., `[any()]'.</li>
<li>`nil()' is an alias for the empty list `[]'.</li>
<li>`cons(H,T)' is the list constructor. This is usually not
used directly. It is possible to recursively define `list(T)
diff --git a/lib/edoc/doc/src/Makefile b/lib/edoc/doc/src/Makefile
index 5ee0096f0f..b933094464 100644
--- a/lib/edoc/doc/src/Makefile
+++ b/lib/edoc/doc/src/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/include/Makefile b/lib/edoc/include/Makefile
index 0533c27567..5b2ad38c9d 100644
--- a/lib/edoc/include/Makefile
+++ b/lib/edoc/include/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/priv/edoc_generate.src b/lib/edoc/priv/edoc_generate.src
index e87fdbc902..7ec89207b0 100644
--- a/lib/edoc/priv/edoc_generate.src
+++ b/lib/edoc/priv/edoc_generate.src
@@ -14,9 +14,6 @@
# Portions created by Ericsson are Copyright 1999-2000, Ericsson
# Utvecklings AB. All Rights Reserved.''
#
-# $Id$
-#
-#
#EDOC_DIR=/clearcase/otp/internal_tools/edoc
EDOC_DIR=/home/otp/sgml/edoc-%EDOC_VSN%
diff --git a/lib/edoc/src/Makefile b/lib/edoc/src/Makefile
index 9c5a9d30d1..fcb0b61292 100644
--- a/lib/edoc/src/Makefile
+++ b/lib/edoc/src/Makefile
@@ -23,7 +23,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/edoc-$(VSN)
EBIN = ../ebin
XMERL = ../../xmerl
-ERL_COMPILE_FLAGS += -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
+ERL_COMPILE_FLAGS += -pa $(XMERL) -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
SOURCES= \
edoc.erl edoc_data.erl edoc_doclet.erl edoc_extract.erl \
diff --git a/lib/edoc/src/edoc.erl b/lib/edoc/src/edoc.erl
index 360f2dbc9e..a279f7dcb3 100644
--- a/lib/edoc/src/edoc.erl
+++ b/lib/edoc/src/edoc.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2007 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @version {@version}
@@ -60,8 +58,6 @@
-compile({no_auto_import,[error/1]}).
--import(edoc_report, [report/2, report/3, error/1, error/3]).
-
-include("edoc.hrl").
@@ -179,8 +175,8 @@ application(App, Options) when is_atom(App) ->
Dir when is_list(Dir) ->
application(App, Dir, Options);
_ ->
- report("cannot find application directory for '~s'.",
- [App]),
+ edoc_report:report("cannot find application directory for '~s'.",
+ [App]),
exit(error)
end.
@@ -663,8 +659,8 @@ read_source(Name, Opts0) ->
check_forms(Forms, Name),
Forms;
{error, R} ->
- error({"error reading file '~s'.",
- [edoc_lib:filename(Name)]}),
+ edoc_report:error({"error reading file '~s'.",
+ [edoc_lib:filename(Name)]}),
exit({error, R})
end.
@@ -688,11 +684,10 @@ check_forms(Fs, Name) ->
error_marker ->
case erl_syntax:error_marker_info(F) of
{L, M, D} ->
- error(L, Name, {format_error, M, D});
-
+ edoc_report:error(L, Name, {format_error, M, D});
Other ->
- report(Name, "unknown error in "
- "source code: ~w.", [Other])
+ edoc_report:report(Name, "unknown error in "
+ "source code: ~w.", [Other])
end,
exit(error);
_ ->
diff --git a/lib/edoc/src/edoc_data.erl b/lib/edoc/src/edoc_data.erl
index 27f43dca5a..e3b5a0d51b 100644
--- a/lib/edoc/src/edoc_data.erl
+++ b/lib/edoc/src/edoc_data.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_doclet.erl b/lib/edoc/src/edoc_doclet.erl
index 30eef3e63a..c66be9d7c7 100644
--- a/lib/edoc/src/edoc_doclet.erl
+++ b/lib/edoc/src/edoc_doclet.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003-2006 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -52,7 +50,7 @@
-define(IMAGE, "erlang.png").
-define(NL, "\n").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
%% Sources is the list of inputs in the order they were found. Packages
%% and Modules are sorted lists of atoms without duplicates. (They
diff --git a/lib/edoc/src/edoc_extract.erl b/lib/edoc/src/edoc_extract.erl
index 5e28762c53..1209d86fe5 100644
--- a/lib/edoc/src/edoc_extract.erl
+++ b/lib/edoc/src/edoc_extract.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -238,8 +236,8 @@ file(File, Context, Env, Opts) ->
case file:read_file(File) of
{ok, Bin} ->
{ok, text(binary_to_list(Bin), Context, Env, Opts, File)};
- {error, _R} = Error ->
- Error
+ {error, _} = Error ->
+ Error
end.
@@ -298,8 +296,8 @@ get_module_info(Forms, File) ->
{Name, Vars} = case lists:keyfind(module, 1, L) of
{module, N} when is_atom(N) ->
{N, none};
- {module, {N, _Vs} = NVs} when is_atom(N) ->
- NVs;
+ {module, {N, _}=Mod} when is_atom(N) ->
+ Mod;
_ ->
report(File, "module name missing.", []),
exit(error)
diff --git a/lib/edoc/src/edoc_layout.erl b/lib/edoc/src/edoc_layout.erl
index 3ec87b7060..1c0841815f 100644
--- a/lib/edoc/src/edoc_layout.erl
+++ b/lib/edoc/src/edoc_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @author Richard Carlsson <[email protected]>
%% @copyright 2001-2006 Richard Carlsson
%% @see edoc
@@ -33,7 +31,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(HTML_EXPORT, xmerl_html).
-define(DEFAULT_XML_EXPORT, ?HTML_EXPORT).
@@ -959,12 +957,16 @@ local_label(R) ->
xhtml(Title, CSS, Body) ->
[{html, [?NL,
- {head, [?NL,
- {title, Title},
- ?NL] ++ CSS},
- ?NL,
- {body, [{bgcolor, "white"}], Body},
- ?NL]
+ {head, [?NL,
+ {meta, [{'http-equiv',"Content-Type"},
+ {content, "text/html; charset=ISO-8859-1"}],
+ []},
+ ?NL,
+ {title, Title},
+ ?NL] ++ CSS},
+ ?NL,
+ {body, [{bgcolor, "white"}], Body},
+ ?NL]
},
?NL].
diff --git a/lib/edoc/src/edoc_lib.erl b/lib/edoc/src/edoc_lib.erl
index 585e30a2d2..6c698e83ef 100644
--- a/lib/edoc/src/edoc_lib.erl
+++ b/lib/edoc/src/edoc_lib.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -40,7 +38,7 @@
-import(edoc_report, [report/2, warning/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(FILE_BASE, "/").
@@ -494,7 +492,7 @@ uri_get_file(File0) ->
uri_get_http(URI) ->
%% Try using option full_result=false
case catch {ok, httpc:request(get, {URI,[]}, [],
- [{full_result, false}])} of
+ [{full_result, false}])} of
{'EXIT', _} ->
uri_get_http_r10(URI);
Result ->
diff --git a/lib/edoc/src/edoc_parser.yrl b/lib/edoc/src/edoc_parser.yrl
index 6943f1bdb8..3ce4cde4fb 100644
--- a/lib/edoc/src/edoc_parser.yrl
+++ b/lib/edoc/src/edoc_parser.yrl
@@ -23,9 +23,6 @@
%% USA
%%
%% Author contact: [email protected]
-%%
-%% $Id $
-%%
%% =====================================================================
Nonterminals
@@ -362,10 +359,10 @@ parse_spec(S, L) ->
{ok, Spec} ->
Spec;
{error, E} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end;
{error, E, _} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end.
%% ---------------------------------------------------------------------
diff --git a/lib/edoc/src/edoc_report.erl b/lib/edoc/src/edoc_report.erl
index ee54c60c90..f082513bee 100644
--- a/lib/edoc/src/edoc_report.erl
+++ b/lib/edoc/src/edoc_report.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_run.erl b/lib/edoc/src/edoc_run.erl
index 96e5ea4631..1355db840f 100644
--- a/lib/edoc/src/edoc_run.erl
+++ b/lib/edoc/src/edoc_run.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
diff --git a/lib/edoc/src/edoc_scanner.erl b/lib/edoc/src/edoc_scanner.erl
index 9d2e6f3aed..8e895ad1ad 100644
--- a/lib/edoc/src/edoc_scanner.erl
+++ b/lib/edoc/src/edoc_scanner.erl
@@ -13,8 +13,6 @@
%% AB. Portions created by Ericsson are Copyright 1999, Ericsson
%% Utvecklings AB. All Rights Reserved.''
%%
-%% $Id: $
-%%
%% @private
%% @copyright Richard Carlsson 2001-2003. Portions created by Ericsson
%% are Copyright 1999, Ericsson Utvecklings AB. All Rights Reserved.
diff --git a/lib/edoc/src/edoc_specs.erl b/lib/edoc/src/edoc_specs.erl
index 79a5d142bc..5acf8ac0d5 100644
--- a/lib/edoc/src/edoc_specs.erl
+++ b/lib/edoc/src/edoc_specs.erl
@@ -27,7 +27,6 @@
-include("edoc.hrl").
-include("edoc_types.hrl").
--type proplist() :: [proplists:property()].
-type syntaxTree() :: erl_syntax:syntaxTree().
-define(TOP_TYPE, term).
@@ -87,8 +86,9 @@ dummy_spec(Form) ->
#tag{name = spec, line = element(2, hd(TypeSpecs)),
origin = code, data = S}.
--spec docs(Forms::[syntaxTree()], CommentFun) -> dict() when
- CommentFun :: fun(([syntaxTree()], Line :: term()) -> #tag{}).
+-spec docs(Forms::[syntaxTree()],
+ CommentFun :: fun( ([syntaxTree()], Line :: term()) -> #tag{} ))
+ -> dict().
%% @doc Find comments after -type/-opaque declarations.
%% Postcomments "inside" the type are skipped.
@@ -98,7 +98,7 @@ docs(Forms, CommentFun) ->
-type entry() :: #entry{}.
-type module_info() :: #module{}.
-type entries() :: [entry()].
--spec add_data(Entries::entries(), Options::proplist(),
+-spec add_data(Entries::entries(), Options::proplists:proplist(),
File::file:filename(), Module::module_info()) -> entries().
%% @doc Create tags a la EDoc for Erlang specifications and types.
diff --git a/lib/edoc/src/edoc_tags.erl b/lib/edoc/src/edoc_tags.erl
index 8ee8f87b5f..80989428ce 100644
--- a/lib/edoc/src/edoc_tags.erl
+++ b/lib/edoc/src/edoc_tags.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_types.erl b/lib/edoc/src/edoc_types.erl
index e784b3359a..a54544868c 100644
--- a/lib/edoc/src/edoc_types.erl
+++ b/lib/edoc/src/edoc_types.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -34,13 +32,13 @@
%% @headerfile "edoc_types.hrl"
-include("edoc_types.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
is_predefined(any, 0) -> true;
is_predefined(atom, 0) -> true;
is_predefined(binary, 0) -> true;
-is_predefined(bool, 0) -> true;
+is_predefined(bool, 0) -> true; % kept for backwards compatibility
is_predefined(char, 0) -> true;
is_predefined(cons, 2) -> true;
is_predefined(deep_string, 0) -> true;
diff --git a/lib/edoc/src/edoc_wiki.erl b/lib/edoc/src/edoc_wiki.erl
index ba33198787..2f2d14853c 100644
--- a/lib/edoc/src/edoc_wiki.erl
+++ b/lib/edoc/src/edoc_wiki.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -70,7 +68,7 @@
-export([parse_xml/2, expand_text/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(BASE_HEADING, 3).
@@ -82,8 +80,8 @@ parse_xml(Data, Line) ->
parse_xml_1(Text, Line) ->
Text1 = "<doc>" ++ Text ++ "</doc>",
- Options = [{line, Line}, {encoding, "iso-8859-1"}],
- case catch {ok, xmerl_scan:string(Text1, Options)} of
+ Opts = [{line, Line}, {encoding, 'iso-8859-1'}],
+ case catch {ok, xmerl_scan:string(Text1, Opts)} of
{ok, {E, _}} ->
E#xmlElement.content;
{'EXIT', {fatal, {Reason, L, _C}}} ->
diff --git a/lib/edoc/src/otpsgml_layout.erl b/lib/edoc/src/otpsgml_layout.erl
index 45f74b299e..d425dc0ed8 100644
--- a/lib/edoc/src/otpsgml_layout.erl
+++ b/lib/edoc/src/otpsgml_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @author Richard Carlsson <[email protected]>
%% @author Kenneth Lundin <[email protected]>
%% @copyright 2001-2004 Richard Carlsson
@@ -34,7 +32,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(SGML_EXPORT, xmerl_otpsgml).
-define(DEFAULT_XML_EXPORT, ?SGML_EXPORT).
diff --git a/lib/edoc/test/edoc_SUITE.erl b/lib/edoc/test/edoc_SUITE.erl
index 0d57591e3e..5b95c35756 100644
--- a/lib/edoc/test/edoc_SUITE.erl
+++ b/lib/edoc/test/edoc_SUITE.erl
@@ -13,8 +13,6 @@
%% Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
%% AB. All Rights Reserved.''
%%
-%% $Id$
-%%
-module(edoc_SUITE).
-include_lib("test_server/include/test_server.hrl").
diff --git a/lib/erl_interface/src/encode/encode_atom.c b/lib/erl_interface/src/encode/encode_atom.c
index 69f2d1451c..b1a4479034 100644
--- a/lib/erl_interface/src/encode/encode_atom.c
+++ b/lib/erl_interface/src/encode/encode_atom.c
@@ -17,13 +17,17 @@
* %CopyrightEnd%
*/
#include <string.h>
+#include <limits.h>
#include "eidef.h"
#include "eiext.h"
#include "putget.h"
int ei_encode_atom(char *buf, int *index, const char *p)
{
- return ei_encode_atom_len(buf, index, p, strlen(p));
+ size_t len = strlen(p);
+
+ if (len >= INT_MAX) return -1;
+ return ei_encode_atom_len(buf, index, p, len);
}
int ei_encode_atom_len(char *buf, int *index, const char *p, int len)
diff --git a/lib/erl_interface/src/encode/encode_string.c b/lib/erl_interface/src/encode/encode_string.c
index 1d342cb605..593bbf2b6d 100644
--- a/lib/erl_interface/src/encode/encode_string.c
+++ b/lib/erl_interface/src/encode/encode_string.c
@@ -17,6 +17,7 @@
* %CopyrightEnd%
*/
#include <string.h>
+#include <limits.h>
#include "eidef.h"
#include "eiext.h"
#include "putget.h"
@@ -24,7 +25,10 @@
int ei_encode_string(char *buf, int *index, const char *p)
{
- return ei_encode_string_len(buf, index, p, strlen(p));
+ size_t len = strlen(p);
+
+ if (len >= INT_MAX) return -1;
+ return ei_encode_string_len(buf, index, p, len);
}
int ei_encode_string_len(char *buf, int *index, const char *p, int len)
diff --git a/lib/et/src/et_wx_viewer.erl b/lib/et/src/et_wx_viewer.erl
index 7d4286ed9d..386f8fc86b 100644
--- a/lib/et/src/et_wx_viewer.erl
+++ b/lib/et/src/et_wx_viewer.erl
@@ -257,10 +257,10 @@ parse_opt([H | T], S, CollectorOpt) ->
Actors = [create_actor(Name) || Name <- ActorNames2],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{include, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, include, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, include, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{exclude, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, exclude, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, exclude, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{first_event, _FirstKey} ->
%% NYI
diff --git a/lib/eunit/doc/overview.edoc b/lib/eunit/doc/overview.edoc
index be05a13fba..2583f0be25 100644
--- a/lib/eunit/doc/overview.edoc
+++ b/lib/eunit/doc/overview.edoc
@@ -913,7 +913,7 @@ To make the descriptions simpler, we first list some definitions:
<td>`CleanupX'</td><td>`(X::any(), R::any()) -> any()'</td>
</tr>
<tr>
-<td>`Instantiator'</td><td>`((R::any()) -> Tests | {with, [AbstractTestFun::((any()) -> any())]}'</td>
+<td>`Instantiator'</td><td>`((R::any()) -> Tests) | {with, [AbstractTestFun::((any()) -> any())]}'</td>
</tr>
<tr>
<td>`Where'</td><td>`local | spawn | {spawn, Node::atom()}'</td>
diff --git a/lib/eunit/include/eunit.hrl b/lib/eunit/include/eunit.hrl
index 82ba982f03..493ba60a2d 100644
--- a/lib/eunit/include/eunit.hrl
+++ b/lib/eunit/include/eunit.hrl
@@ -39,6 +39,7 @@
-ifndef(EUNIT_HRL).
-define(EUNIT_HRL, true).
+
%% allow defining TEST to override NOTEST
-ifdef(TEST).
-undef(NOTEST).
@@ -164,7 +165,7 @@
%% This is mostly a convenience which gives more detailed reports.
%% Note: Guard is a guarded pattern, and can not be used for value.
-ifdef(NOASSERT).
--define(assertMatch(Guard,Expr),ok).
+-define(assertMatch(Guard, Expr), ok).
-else.
-define(assertMatch(Guard, Expr),
((fun () ->
@@ -174,17 +175,37 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected, (??Guard)},
+ {pattern, (??Guard)},
{value, __V}]})
end
end)())).
-endif.
-define(_assertMatch(Guard, Expr), ?_test(?assertMatch(Guard, Expr))).
+%% This is the inverse case of assertMatch, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotMatch(Guard, Expr), ok).
+-else.
+-define(assertNotMatch(Guard, Expr),
+ ((fun () ->
+ __V = (Expr),
+ case __V of
+ Guard -> .erlang:error({assertNotMatch_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern, (??Guard)},
+ {value, __V}]});
+ _ -> ok
+ end
+ end)())).
+-endif.
+-define(_assertNotMatch(Guard, Expr), ?_test(?assertNotMatch(Guard, Expr))).
+
%% This is a convenience macro which gives more detailed reports when
%% the expected LHS value is not a pattern, but a computed value
-ifdef(NOASSERT).
--define(assertEqual(Expect,Expr),ok).
+-define(assertEqual(Expect, Expr), ok).
-else.
-define(assertEqual(Expect, Expr),
((fun (__X) ->
@@ -201,9 +222,29 @@
-endif.
-define(_assertEqual(Expect, Expr), ?_test(?assertEqual(Expect, Expr))).
+%% This is the inverse case of assertEqual, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotEqual(Unexpected, Expr), ok).
+-else.
+-define(assertNotEqual(Unexpected, Expr),
+ ((fun (__X) ->
+ case (Expr) of
+ __X -> .erlang:error({assertNotEqual_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {value, __X}]});
+ _ -> ok
+ end
+ end)(Unexpected))).
+-endif.
+-define(_assertNotEqual(Unexpected, Expr),
+ ?_test(?assertNotEqual(Unexpected, Expr))).
+
%% Note: Class and Term are patterns, and can not be used for value.
+%% Term can be a guarded pattern, but Class cannot.
-ifdef(NOASSERT).
--define(assertException(Class, Term, Expr),ok).
+-define(assertException(Class, Term, Expr), ok).
-else.
-define(assertException(Class, Term, Expr),
((fun () ->
@@ -212,7 +253,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_success, __V}]})
@@ -223,7 +264,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_exception,
@@ -243,6 +284,43 @@
-define(_assertExit(Term, Expr), ?_assertException(exit, Term, Expr)).
-define(_assertThrow(Term, Expr), ?_assertException(throw, Term, Expr)).
+%% This is the inverse case of assertException, for convenience.
+%% Note: Class and Term are patterns, and can not be used for value.
+%% Both Class and Term can be guarded patterns.
+-ifdef(NOASSERT).
+-define(assertNotException(Class, Term, Expr), ok).
+-else.
+-define(assertNotException(Class, Term, Expr),
+ ((fun () ->
+ try (Expr) of
+ _ -> ok
+ catch
+ __C:__T ->
+ case __C of
+ Class ->
+ case __T of
+ Term ->
+ .erlang:error({assertNotException_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern,
+ "{ "++(??Class)++" , "
+ ++(??Term)++" , [...] }"},
+ {unexpected_exception,
+ {__C, __T,
+ .erlang:get_stacktrace()
+ }}]});
+ _ -> ok
+ end;
+ _ -> ok
+ end
+ end
+ end)())).
+-endif.
+-define(_assertNotException(Class, Term, Expr),
+ ?_test(?assertNotException(Class, Term, Expr))).
+
%% Macros for running operating system commands. (Note that these
%% require EUnit to be present at runtime, or at least eunit_lib.)
@@ -267,7 +345,7 @@
%% these are only used for testing; they always return 'ok' on success,
%% and have no effect if debugging/testing is turned off
-ifdef(NOASSERT).
--define(assertCmdStatus(N, Cmd),ok).
+-define(assertCmdStatus(N, Cmd), ok).
-else.
-define(assertCmdStatus(N, Cmd),
((fun () ->
@@ -285,7 +363,7 @@
-define(assertCmd(Cmd), ?assertCmdStatus(0, Cmd)).
-ifdef(NOASSERT).
--define(assertCmdOutput(T, Cmd),ok).
+-define(assertCmdOutput(T, Cmd), ok).
-else.
-define(assertCmdOutput(T, Cmd),
((fun () ->
@@ -313,11 +391,12 @@
-define(debugHere, ok).
-define(debugFmt(S, As), ok).
-define(debugVal(E), (E)).
--define(debugTime(S,E), (E)).
+-define(debugTime(S, E), (E)).
-else.
-define(debugMsg(S),
(begin
- .io:fwrite(user, <<"~s:~w: ~s\n">>, [?FILE, ?LINE, S]),
+ .io:fwrite(user, <<"~s:~w:~w: ~s\n">>,
+ [?FILE, ?LINE, self(), S]),
ok
end)).
-define(debugHere, (?debugMsg("<-"))).
@@ -327,7 +406,7 @@
?debugFmt(<<"~s = ~P">>, [(??E), __V, 15]),
__V
end)(E))).
--define(debugTime(S,E),
+-define(debugTime(S, E),
((fun () ->
{__T0, _} = statistics(wall_clock),
__V = (E),
@@ -337,4 +416,5 @@
end)())).
-endif.
+
-endif. % EUNIT_HRL
diff --git a/lib/eunit/src/eunit.app.src b/lib/eunit/src/eunit.app.src
index 4fd76588c3..5e16dfa2ce 100644
--- a/lib/eunit/src/eunit.app.src
+++ b/lib/eunit/src/eunit.app.src
@@ -5,17 +5,17 @@
{vsn, "%VSN%"},
{modules, [eunit,
eunit_autoexport,
- eunit_striptests,
- eunit_server,
+ eunit_data,
+ eunit_lib,
+ eunit_listener,
eunit_proc,
eunit_serial,
+ eunit_server,
+ eunit_striptests,
+ eunit_surefire,
eunit_test,
eunit_tests,
- eunit_lib,
- eunit_listener,
- eunit_data,
- eunit_tty,
- eunit_surefire]},
+ eunit_tty]},
{registered,[]},
- {applications, [stdlib]},
+ {applications, [kernel,stdlib]},
{env, []}]}.
diff --git a/lib/eunit/src/eunit.erl b/lib/eunit/src/eunit.erl
index da35c5c2ec..15fc3bdf32 100644
--- a/lib/eunit/src/eunit.erl
+++ b/lib/eunit/src/eunit.erl
@@ -16,7 +16,7 @@
%% $Id: eunit.erl 339 2009-04-05 14:10:47Z rcarlsson $
%%
%% @copyright 2004-2009 Micka�l R�mond, Richard Carlsson
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% [http://www.process-one.net/]
%% @author Richard Carlsson <[email protected]>
%% [http://user.it.uu.se/~richardc/]
diff --git a/lib/eunit/src/eunit_data.erl b/lib/eunit/src/eunit_data.erl
index 0543b6c543..288dd74ddf 100644
--- a/lib/eunit/src/eunit_data.erl
+++ b/lib/eunit/src/eunit_data.erl
@@ -146,8 +146,10 @@ iter_next(I = #iter{next = [T | Ts]}) ->
iter_prev(#iter{prev = []}) ->
none;
-iter_prev(#iter{prev = [T | Ts], next = Next, pos = Pos} = I) ->
- {T, I#iter{prev = Ts, next = [T | Next], pos = Pos - 1}}.
+iter_prev(#iter{prev = [T | Ts]} = I) ->
+ {T, I#iter{prev = Ts,
+ next = [T | I#iter.next],
+ pos = I#iter.pos - 1}}.
%% ---------------------------------------------------------------------
@@ -363,7 +365,8 @@ parse({file, F} = T) when is_list(F) ->
parse({dir, D}=T) when is_list(D) ->
case eunit_lib:is_string(D) of
true ->
- {data, {"directory \"" ++ D ++ "\"", get_directory_modules(D)}};
+ {data, {"directory \"" ++ D ++ "\"",
+ get_directory_module_tests(D)}};
false ->
bad_test(T)
end;
@@ -385,10 +388,10 @@ parse({S, T1} = T) when is_list(S) ->
end;
parse({S, T1}) when is_binary(S) ->
group(#group{tests = T1, desc = S});
-parse(T) when tuple_size(T) > 2, is_list(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_list(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
-parse(T) when tuple_size(T) > 2, is_binary(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_binary(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
parse(M) when is_atom(M) ->
@@ -596,7 +599,7 @@ testfuns(Es, M, TestSuffix, GeneratorSuffix) ->
%% ---------------------------------------------------------------------
-%% Getting a test set from a file
+%% Getting a test set from a file (text file or object file)
%% @throws {file_read_error, {Reason::atom(), Message::string(),
%% fileName()}}
@@ -625,17 +628,23 @@ get_file_tests(F) ->
is_module_filename(F) ->
filename:extension(F) =:= code:objfile_extension().
+objfile_test({M, File}) ->
+ {setup,
+ fun () ->
+ %% TODO: better error/stacktrace for this internal fun
+ code:purge(M),
+ {module,M} = code:load_abs(filename:rootname(File)),
+ ok
+ end,
+ {module, M}};
objfile_test(File) ->
+ objfile_test({objfile_module(File), File}).
+
+objfile_module(File) ->
try
- {module, M} = lists:keyfind(module, 1, beam_lib:info(File)),
- {setup,
- fun () ->
- %% TODO: better error/stacktrace for this internal fun
- code:purge(M),
- {module,M} = code:load_abs(filename:rootname(File)),
- ok
- end,
- {module, M}}
+ {value, {module, M}} = lists:keysearch(module, 1,
+ beam_lib:info(File)),
+ M
catch
_:_ ->
throw({file_read_error,
@@ -644,15 +653,34 @@ objfile_test(File) ->
%% ---------------------------------------------------------------------
-%% Getting a list of module names from object files in a directory
-
-%% @throws {file_read_error, {Reason::atom(), Message::string(),
-%% fileName()}}
+%% Getting a set of module tests from the object files in a directory
+
+%% @throws {file_read_error,
+%% {Reason::atom(), Message::string(), fileName()}}
+
+get_directory_module_tests(D) ->
+ Ms = get_directory_modules(D),
+ %% for all 'm' in the set, remove 'm_tests' if present
+ F = fun ({M,_}, S) ->
+ Name = atom_to_list(M),
+ case lists:suffix(?DEFAULT_TESTMODULE_SUFFIX, Name) of
+ false ->
+ Name1 = Name ++ ?DEFAULT_TESTMODULE_SUFFIX,
+ M1 = list_to_atom(Name1),
+ dict:erase(M1, S);
+ true ->
+ S
+ end
+ end,
+ [objfile_test(Obj)
+ || Obj <- dict:to_list(lists:foldl(F, dict:from_list(Ms), Ms))].
%% TODO: handle packages (recursive search for files)
-
get_directory_modules(D) ->
- [objfile_test(filename:join(D, F))
+ [begin
+ F1 = filename:join(D, F),
+ {objfile_module(F1), F1}
+ end
|| F <- eunit_lib:list_dir(D), is_module_filename(F)].
diff --git a/lib/eunit/src/eunit_server.erl b/lib/eunit/src/eunit_server.erl
index bf1bb9bcef..2cdfef2668 100644
--- a/lib/eunit/src/eunit_server.erl
+++ b/lib/eunit/src/eunit_server.erl
@@ -59,8 +59,9 @@ watch(Server, Module, Opts) when is_atom(Module) ->
watch_path(Server, Path, Opts) ->
command(Server, {watch, {path, filename:flatten(Path)}, Opts}).
+%% note that the user must use $ at the end to match whole paths only
watch_regexp(Server, Regex, Opts) ->
- case regexp:parse(Regex) of
+ case re:compile(Regex,[anchored]) of
{ok, R} ->
command(Server, {watch, {regexp, R}, Opts});
{error, _}=Error ->
@@ -278,8 +279,8 @@ is_watched(Path, St) ->
match_any(sets:to_list(St#state.regexps), Path).
match_any([R | Rs], Str) ->
- case regexp:first_match(Str, R) of
- {match, _, _} -> true;
+ case re:run(Str, R, [{capture,none}]) of
+ match -> true;
_ -> match_any(Rs, Str)
end;
match_any([], _Str) -> false.
diff --git a/lib/eunit/src/eunit_surefire.erl b/lib/eunit/src/eunit_surefire.erl
index dfb08c90b2..6e0a447105 100644
--- a/lib/eunit/src/eunit_surefire.erl
+++ b/lib/eunit/src/eunit_surefire.erl
@@ -15,7 +15,7 @@
%%
%% $Id: $
%%
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% @copyright 2009 Micka�l R�mond, Paul Guyot
%% @see eunit
%% @doc Surefire reports for EUnit (Format used by Maven and Atlassian
@@ -64,6 +64,7 @@
}).
-record(testsuite,
{
+ id = 0 :: integer(),
name = <<>> :: binary(),
time = 0 :: integer(),
output = <<>> :: binary(),
@@ -76,7 +77,7 @@
-record(state, {verbose = false,
indent = 0,
xmldir = ".",
- testsuite = #testsuite{}
+ testsuites = [] :: [#testsuite{}]
}).
start() ->
@@ -89,55 +90,60 @@ init(Options) ->
XMLDir = proplists:get_value(dir, Options, ?XMLDIR),
St = #state{verbose = proplists:get_bool(verbose, Options),
xmldir = XMLDir,
- testsuite = #testsuite{}},
+ testsuites = []},
receive
{start, _Reference} ->
St
end.
terminate({ok, _Data}, St) ->
- TestSuite = St#state.testsuite,
+ TestSuites = St#state.testsuites,
XmlDir = St#state.xmldir,
- write_report(TestSuite, XmlDir),
+ write_reports(TestSuites, XmlDir),
ok;
terminate({error, _Reason}, _St) ->
%% Don't report any errors here, since eunit_tty takes care of that.
%% Just terminate.
ok.
-handle_begin(group, Data, St) ->
+handle_begin(Kind, Data, St) when Kind == group; Kind == test ->
+ %% Run this code both for groups and tests; test is a bit
+ %% surprising: This is a workaround for the fact that we don't get
+ %% a group (handle_begin(group, ...) for testsuites (modules)
+ %% which only have one test case. In that case we get a test case
+ %% with an id comprised of just one integer - the group id.
NewId = proplists:get_value(id, Data),
case NewId of
[] ->
St;
- [_GroupId] ->
+ [GroupId] ->
Desc = proplists:get_value(desc, Data),
- TestSuite = St#state.testsuite,
- NewTestSuite = TestSuite#testsuite{name = Desc},
- St#state{testsuite=NewTestSuite};
+ TestSuite = #testsuite{id = GroupId, name = Desc},
+ St#state{testsuites=store_suite(TestSuite, St#state.testsuites)};
%% Surefire format is not hierarchic: Ignore subgroups:
_ ->
St
- end;
-handle_begin(test, _Data, St) ->
- St.
+ end.
handle_end(group, Data, St) ->
%% Retrieve existing test suite:
case proplists:get_value(id, Data) of
[] ->
St;
- [_GroupId|_] ->
- TestSuite = St#state.testsuite,
+ [GroupId|_] ->
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Update TestSuite data:
Time = proplists:get_value(time, Data),
Output = proplists:get_value(output, Data),
NewTestSuite = TestSuite#testsuite{ time = Time, output = Output },
- St#state{testsuite=NewTestSuite}
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}
end;
handle_end(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -149,7 +155,7 @@ handle_end(test, Data, St) ->
TestCase = #testcase{name = Name, description = Desc,
time = Time,output = Output},
NewTestSuite = add_testcase_to_testsuite(Result, TestCase, TestSuite),
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
%% Cancel group does not give information on the individual cancelled test case
%% We ignore this event
@@ -157,7 +163,9 @@ handle_cancel(group, _Data, St) ->
St;
handle_cancel(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -171,7 +179,7 @@ handle_cancel(test, Data, St) ->
NewTestSuite = TestSuite#testsuite{
skipped = TestSuite#testsuite.skipped+1,
testcases=[TestCase|TestSuite#testsuite.testcases] },
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
format_name({Module, Function, Arity}, Line) ->
lists:flatten([atom_to_list(Module), ":", atom_to_list(Function), "/",
@@ -183,6 +191,12 @@ format_desc(Desc) when is_binary(Desc) ->
format_desc(Desc) when is_list(Desc) ->
Desc.
+lookup_suite_by_group_id(GroupId, TestSuites) ->
+ #testsuite{} = lists:keyfind(GroupId, #testsuite.id, TestSuites).
+
+store_suite(#testsuite{id=GroupId} = TestSuite, TestSuites) ->
+ lists:keystore(GroupId, #testsuite.id, TestSuites, TestSuite).
+
%% Add testcase to testsuite depending on the result of the test.
add_testcase_to_testsuite(ok, TestCaseTmp, TestSuite) ->
TestCase = TestCaseTmp#testcase{ result = ok },
@@ -214,6 +228,10 @@ add_testcase_to_testsuite({error, Exception}, TestCaseTmp, TestSuite) ->
%% Write a report to the XML directory.
%% This function opens the report file, calls write_report_to/2 and closes the file.
%% ----------------------------------------------------------------------------
+write_reports(TestSuites, XmlDir) ->
+ lists:foreach(fun(TestSuite) -> write_report(TestSuite, XmlDir) end,
+ TestSuites).
+
write_report(#testsuite{name = Name} = TestSuite, XmlDir) ->
Filename = filename:join(XmlDir, lists:flatten(["TEST-", escape_suitename(Name)], ".xml")),
case file:open(Filename, [write, raw]) of
diff --git a/lib/eunit/src/eunit_test.erl b/lib/eunit/src/eunit_test.erl
index d322c4b420..9ac1d1e7d9 100644
--- a/lib/eunit/src/eunit_test.erl
+++ b/lib/eunit/src/eunit_test.erl
@@ -131,12 +131,27 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,"[ _ ]"},
+ {pattern,"[ _ ]"},
{value,[]}]},
_}}
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotMatch(ok, error),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotMatch([_], [42]),
+ {error,{error,{assertNotMatch_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,"[ _ ]"},
+ {value,[42]}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertEqual(ok, ok),
{ok, ok} = run_testfun(F)
end),
@@ -152,6 +167,20 @@ macro_test_() ->
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotEqual(1, 0),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotEqual(2, 1+1),
+ {error,{error,{assertNotEqual_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {value,2}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertException(error, badarith,
erlang:error(badarith)),
{ok, ok} = run_testfun(F)
@@ -162,7 +191,7 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
{unexpected_success,ok}]},
_}}
= run_testfun(F)
@@ -174,15 +203,48 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
+ {unexpected_exception,
+ {error,badarith,_}}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertError(badarith,
+ erlang:error(badarith)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertExit(normal, exit(normal)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertThrow(foo, throw(foo)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith, 42),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarg)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarith)),
+ {error,{error,{assertNotException_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,_},
{unexpected_exception,
{error,badarith,_}}]},
_}}
= run_testfun(F)
end)
]}.
-
-under_eunit_test() -> ?assert(?UNDER_EUNIT).
-endif.
diff --git a/lib/eunit/src/eunit_tests.erl b/lib/eunit/src/eunit_tests.erl
index 37c0b4d6ae..a63d102d98 100644
--- a/lib/eunit/src/eunit_tests.erl
+++ b/lib/eunit/src/eunit_tests.erl
@@ -26,17 +26,17 @@
-include("eunit.hrl").
-ifdef(TEST).
-%% Cause all the other modules to be tested as well as this one.
-full_test_() ->
- %%{application, eunit}. % this currently causes a loop
- %% We use the below until loop detection is implemented
- [eunit_autoexport,
- eunit_striptests,
- eunit_server,
- eunit_proc,
- eunit_serial,
- eunit_test,
- eunit_lib,
- eunit_data,
- eunit_tty].
+id(X) -> X. % for suppressing compiler warnings
-endif.
+
+under_eunit_test() -> ?assert(?UNDER_EUNIT).
+
+let_test() -> ?assertEqual(42, ?LET(X, 17, X+25)).
+
+if_test_() ->
+ [?_assertEqual(17, ?IF(id(1) > 0, 17, 42)),
+ ?_assertEqual(42, ?IF(id(1) < 0, 17, 42))].
+
+matches_test_() ->
+ [?_assert(?MATCHES("hel"++_, "hello")),
+ ?_assertNot(?MATCHES("hal"++_, "hello"))].
diff --git a/lib/eunit/vsn.mk b/lib/eunit/vsn.mk
index d7edd7977b..d933085bbc 100644
--- a/lib/eunit/vsn.mk
+++ b/lib/eunit/vsn.mk
@@ -1 +1 @@
-EUNIT_VSN = 2.1.7
+EUNIT_VSN = 2.2.0
diff --git a/lib/hipe/cerl/erl_bif_types.erl b/lib/hipe/cerl/erl_bif_types.erl
index f1be658054..10d60a4c9a 100644
--- a/lib/hipe/cerl/erl_bif_types.erl
+++ b/lib/hipe/cerl/erl_bif_types.erl
@@ -366,7 +366,7 @@ type(erlang, '>', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMax), is_integer(RhsMin), RhsMin >= LhsMax -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('>', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '>=', 2, Xs = [Lhs, Rhs]) ->
@@ -384,7 +384,7 @@ type(erlang, '>=', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMax), is_integer(RhsMin), RhsMin > LhsMax -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('>=', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '<', 2, Xs = [Lhs, Rhs]) ->
@@ -402,7 +402,7 @@ type(erlang, '<', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMin), is_integer(RhsMax), RhsMax =< LhsMin -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('<', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '=<', 2, Xs = [Lhs, Rhs]) ->
@@ -420,7 +420,7 @@ type(erlang, '=<', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMin), is_integer(RhsMax), RhsMax < LhsMin -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('=<', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '+', 1, Xs) ->
@@ -672,6 +672,9 @@ type(erlang, call_on_load_function, 1, Xs) ->
type(erlang, cancel_timer, 1, Xs) ->
strict(arg_types(erlang, cancel_timer, 1), Xs,
fun (_) -> t_sup(t_integer(), t_atom('false')) end);
+type(erlang, check_old_code, 1, Xs) ->
+ strict(arg_types(erlang, check_old_code, 1), Xs,
+ fun (_) -> t_boolean() end);
type(erlang, check_process_code, 2, Xs) ->
strict(arg_types(erlang, check_process_code, 2), Xs,
fun (_) -> t_boolean() end);
@@ -736,6 +739,7 @@ type(erlang, element, 2, Xs) ->
type(erlang, erase, 0, _) -> t_any();
type(erlang, erase, 1, _) -> t_any();
type(erlang, external_size, 1, _) -> t_integer();
+type(erlang, external_size, 2, _) -> t_integer();
type(erlang, finish_after_on_load, 2, Xs) ->
%% Internal BIF used by on_load.
strict(arg_types(erlang, finish_after_on_load, 2), Xs,
@@ -3175,6 +3179,50 @@ arith(Op, X1, X2) ->
end.
%%=============================================================================
+%% Comparison of terms
+%%=============================================================================
+
+compare(Op, Lhs, Rhs) ->
+ case t_is_none(t_inf(Lhs, Rhs)) of
+ false -> t_boolean();
+ true ->
+ case Op of
+ '<' -> always_smaller(Lhs, Rhs);
+ '>' -> always_smaller(Rhs, Lhs);
+ '=<' -> always_smaller(Lhs, Rhs);
+ '>=' -> always_smaller(Rhs, Lhs)
+ end
+ end.
+
+always_smaller(Type1, Type2) ->
+ {Min1, Max1} = type_ranks(Type1),
+ {Min2, Max2} = type_ranks(Type2),
+ if Max1 < Min2 -> t_atom('true');
+ Min1 > Max2 -> t_atom('false');
+ true -> t_boolean()
+ end.
+
+type_ranks(Type) ->
+ type_ranks(Type, 1, 0, 0, type_order()).
+
+type_ranks(_Type, _I, Min, Max, []) -> {Min, Max};
+type_ranks(Type, I, Min, Max, [TypeClass|Rest]) ->
+ {NewMin, NewMax} =
+ case t_is_none(t_inf(Type, TypeClass)) of
+ true -> {Min, Max};
+ false -> case Min of
+ 0 -> {I, I};
+ _ -> {Min, I}
+ end
+ end,
+ type_ranks(Type, I+1, NewMin, NewMax, Rest).
+
+type_order() ->
+ [t_number(), t_atom(), t_reference(), t_fun(), t_port(), t_pid(), t_tuple(),
+ t_list(), t_binary()].
+
+
+%%=============================================================================
-spec arg_types(atom(), atom(), arity()) -> [erl_types:erl_type()] | 'unknown'.
@@ -3395,6 +3443,8 @@ arg_types(erlang, call_on_load_function, 1) ->
[t_atom()];
arg_types(erlang, cancel_timer, 1) ->
[t_reference()];
+arg_types(erlang, check_old_code, 1) ->
+ [t_atom()];
arg_types(erlang, check_process_code, 2) ->
[t_pid(), t_atom()];
arg_types(erlang, concat_binary, 1) ->
@@ -3441,6 +3491,8 @@ arg_types(erlang, exit, 2) ->
[t_sup(t_pid(), t_port()), t_any()];
arg_types(erlang, external_size, 1) ->
[t_any()]; % takes any term as input
+arg_types(erlang, external_size, 2) ->
+ [t_any(), t_list()]; % takes any term as input and a list of options
arg_types(erlang, finish_after_on_load, 2) ->
[t_atom(), t_boolean()];
arg_types(erlang, float, 1) ->
diff --git a/lib/hipe/main/hipe.hrl.src b/lib/hipe/main/hipe.hrl.src
index a1fbeda9cf..ec55c707ef 100644
--- a/lib/hipe/main/hipe.hrl.src
+++ b/lib/hipe/main/hipe.hrl.src
@@ -50,9 +50,8 @@
%% Flags:
%% DEBUG - Turns on debugging. (Can be defined to a integer
%% value to determine the level of debugging)
-%% VERBOSE - More info is printed...
%% HIPE_LOGGING - Turn on logging of messages with erl_logger.
-%% DO_ASSERT - Turn on Assertions.
+%% DO_ASSERT - Turn on assertions.
%% TIMING - Turn on timing.
%% HIPE_INSTRUMENT_COMPILER - Turn on instrumentation of the compiler.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
@@ -107,13 +106,9 @@
%%
%% Define the exit macro
%%
--ifdef(VERBOSE).
--define(EXIT(Reason), erlang:error({?MODULE,?LINE,Reason})).
--else.
-define(EXIT(Reason),
?msg("EXITED with reason ~w @~w:~w\n", [Reason,?MODULE,?LINE]),
erlang:error({?MODULE,?LINE,Reason})).
--endif.
%%
%% Assertions.
diff --git a/lib/ic/doc/src/notes.xml b/lib/ic/doc/src/notes.xml
index 5f6c31069c..de519d5f84 100644
--- a/lib/ic/doc/src/notes.xml
+++ b/lib/ic/doc/src/notes.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>1998</year><year>2010</year>
+ <year>1998</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -31,6 +31,22 @@
</header>
<section>
+ <title>IC 4.2.27</title>
+
+ <section>
+ <title>Improvements and New Features</title>
+ <list type="bulleted">
+ <item>
+ <p>
+ Reduced compile overhead (Thanks to Haitao Li).</p>
+ <p>
+ Own Id: OTP-9460 </p>
+ </item>
+ </list>
+ </section>
+ </section>
+
+ <section>
<title>IC 4.2.26</title>
<section>
diff --git a/lib/ic/src/ic_pp.erl b/lib/ic/src/ic_pp.erl
index db06118d32..8b53473caa 100644
--- a/lib/ic/src/ic_pp.erl
+++ b/lib/ic/src/ic_pp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -92,6 +92,14 @@
%%
%%======================================================================================
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+-record(mio, {valid = true, %% multiple include valid
+ cmacro, %% controlling macro of the current conditional directive
+ depth = 0, %% conditional directive depth
+ included = []}).
@@ -130,7 +138,7 @@ run(FileList, FileName, IncDir, Flags) ->
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
- {Out, Err, War, _Defs, IfCou} = expand(File, FileName, IncDir, Flags),
+ {Out, Err, War, _Defs, _Mio, IfCou} = expand(File, FileName, IncDir, Flags),
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -155,9 +163,9 @@ run(FileList, FileName, IncDir, Flags) ->
%% The entry for all included files
%%
%%
-%% Output {Out, Defs, Err, War}
+%% Output {Out, Err, War, Defs, MultipleIncludeValid}
%%======================================================================================
-run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir) ->
+run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir, Mio) ->
%%----------------------------------------------------------
%% Run the first phase, i.e tokenise the file
@@ -169,18 +177,21 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
-
- %% Try first pass without file info start/end
- {OutT, ErrT, WarT, DefsT, IfCouT} =
- expand(File, Defs, Err, War, [FileName|IncFile], IncDir),
-
- {Out2, Err2, War2, Defs2, IfCou2} =
- case only_nls(OutT) of
- true -> %% The file is defined before
- {["\n"], ErrT, WarT, DefsT, IfCouT};
- false -> %% The file is not defined before, try second pass
- expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War, [FileName|IncFile], IncDir)
- end,
+ {Out2, Err2, War2, Defs2, Mio2, IfCou2} =
+ expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War,
+ [FileName|IncFile], IncDir,
+ #mio{included=Mio#mio.included}),
+
+ MergeIncluded = sets:to_list(sets:from_list(Mio#mio.included ++ Mio2#mio.included)),
+
+ Mio3 =
+ case {Mio2#mio.valid, Mio2#mio.cmacro} of
+ {V, Macro} when V == false;
+ Macro == undefined ->
+ update_mio(Mio#mio{included=MergeIncluded});
+ {true, _} ->
+ update_mio({include, FileName}, Mio#mio{included=MergeIncluded})
+ end,
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -192,26 +203,7 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
[]
end,
- {Out2, Defs2, Err2++IfError, War2}.
-
-
-
-%% Return true if there is no data
-%% other than new lines
-only_nls([]) ->
- true;
-only_nls(["\n"|Rem]) ->
- only_nls(Rem);
-only_nls(["\r","\n"|Rem]) ->
- only_nls(Rem);
-only_nls([_|_Rem]) ->
- false.
-
-
-
-
-
-
+ {Out2, Defs2, Err2++IfError, War2, Mio3}.
@@ -647,87 +639,86 @@ expand(List, FileName, IncDir, Flags) ->
%% Get all definitions from preprocessor commnads
%% and merge them on top of the file collected.
CLDefs = get_cmd_line_defs(Flags),
- expand(List, [], [], CLDefs, [FileName], IncDir, check_all, [], [], 1, FileName).
-
-expand(List, Defs, Err, War, [FileName|IncFile], IncDir) ->
- expand(List, [], [], Defs, [FileName|IncFile], IncDir, check_all, Err, War, 1, FileName).
+ expand(List, [], [], CLDefs, [FileName], IncDir, #mio{}, check_all, [], [], 1, FileName).
+expand(List, Defs, Err, War, [FileName|IncFile], IncDir, Mio) ->
+ expand(List, [], [], Defs, [FileName|IncFile], IncDir, Mio, check_all, Err, War, 1, FileName).
%%=======================================================
%% Main loop for the expansion
%%=======================================================
-expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, IfCou, Err, War, _L, _FN) ->
+expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, Mio, IfCou, Err, War, _L, _FN) ->
% io:format("~n ===============~n"),
% io:format(" definitions ~p~n",[lists:reverse(Defs)]),
% io:format(" found warnings ~p~n",[lists:reverse(War)]),
% io:format(" found errors ~p~n",[lists:reverse(Err)]),
% io:format(" ===============~n~n~n"),
- {Out, Err, War, Defs, IfCou};
+ {Out, Err, War, Defs, Mio, IfCou};
-expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
%%---------------------------------------
%% Searching for endif,
%% i.e skip all source lines until matching
%% end if is encountered
%%---------------------------------------
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifdef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifndef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "if" ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{{'if', true}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Rem2, Err2, War2, Nl} -> Not implemented yet
{{'if', error}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN)
end;
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "endif" ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
case Endif of
1 ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L+Nl, FN);
_ ->
IfCou2 = {endif, Endif-1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L+Nl, FN)
end;
-expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
%% Solves a bug when spaces in front of hashmark !
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
@@ -736,121 +727,132 @@ expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine},
%%---------------------------------------
%% Check all tokens
%%---------------------------------------
-expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+1, FN);
+expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L+1, FN);
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN) ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN) ->
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{define, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{undef, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{{include, ok}, FileName, FileCont, Rem2, Nl, Err2, War2} ->
- {Out3, Defs3, Err3, War3} =
- run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir),
+ {Out3, Defs3, Err3, War3, Mio2} =
+ run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir, Mio),
Nls = [],
Out4 = Out3++Nls++Out,
- expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, check_all, Err3, War3, L+Nl, FN);
+ expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, Mio2, check_all, Err3, War3, L+Nl, FN);
{{include, error}, Rem2, Nl, Err2, War2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
+
+ {{include, skip}, Rem2} ->
+ Out2 = [$\n|Out],
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+1, FN);
{{ifdef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
{{ifdef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(ifdef, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{ifndef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
- {{ifndef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
+ {{ifndef, false}, Macro, Rem2, Err2, War2, Nl} ->
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio({ifndef, Macro}, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{endif, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(endif, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{'if', true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Removed, Rem2, Nl} -> Not implemented at present
{{'if', error}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio('if', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{'else', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`else' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('else', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{'elif', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`elif' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('elif', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{warning, {WarningText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
War2 = {FileName, L, "warning: #warning "++detokenise(WarningText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, [War2|War], L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, [War2|War], L+Nl, FN);
{error, {ErrorText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
Err2 = {FileName, L, detokenise(ErrorText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
{{line, ok}, {_Removed, Rem2, Nl}, L2, FN2, LineText} ->
Out2 = lists:duplicate(Nl,$\n)++LineText++Out,
[_X|IF] = IncFile,
IncFile2 = [FN2|IF],
- expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, check_all, Err, War, L2, FN2);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, update_mio(Mio), check_all, Err, War, L2, FN2);
{{line, error}, {_Removed, Rem2, Nl}, Err2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
hash_mark ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN);
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN);
{pragma, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{ident, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{not_recognised, {Removed, Rem2, Nl}} ->
Text = lists:reverse([$#|Command]),
RemovedS = lists:reverse([?space|detokenise(Removed)]),
Out2 = [$\n|RemovedS]++Text++Out,
+ Mio2 = update_mio(Mio),
case Command of
[X|_T] when ?is_upper(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_lower(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_underline(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
_ ->
Err2 = {FN, L, "invalid preprocessing directive name"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN)
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN)
end;
Else ->
@@ -859,19 +861,19 @@ expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all
end;
-expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
LL = io_lib:format("~p",[L]),
- expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, Mio, IncDir, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{Y,M,D},{_H,_Mi,_S}} = calendar:universal_time(),
Date = io_lib:format("\"~s ~p ~p\"",[month(M),D,Y]),
- expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{_Y,_M,_D},{H,Mi,S}} = calendar:universal_time(),
HS = if H < 10 -> "0"++integer_to_list(H);
true -> integer_to_list(H)
@@ -883,40 +885,40 @@ expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err,
true -> integer_to_list(S)
end,
Time = io_lib:format("\"~s:~s:~s\"",[HS,MiS,SS]),
- expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
IL = io_lib:format("~p",[length(IncFile)-1]),
- expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
[BF|_T] = lists:reverse(IncFile),
- expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Out2, Err2, War2, Rem2, SelfRef2} =
source_line(Var, Rem, SelfRef, Defs, Err, War, L, FN),
- expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, IfCou, Err2, War2, L, FN);
+ expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err2, War2, L, FN);
-expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
SelfRef2 = lists:delete(Str,SelfRef),
- expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Str2, Rem2, Nl} = expand_string_part([$"|Str], Rem),
- expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+Nl, FN).
+ expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L+Nl, FN).
@@ -954,13 +956,14 @@ expand_string_part([{string_part, Str_part} | Rem], Str, Nl) ->
get_cmd_line_defs(Flags) ->
Adjusted = parse_cmd_line(Flags,[]),
- {_Out, _Err, _War, Defs, _IfCou} =
+ {_Out, _Err, _War, Defs, _IfCou, _Mio} =
expand(tokenise(Adjusted,""),
[],
[],
[],
[],
[],
+ #mio{},
check_all,
[],
[],
@@ -1030,10 +1033,10 @@ collect_undefine([C|Rest],Found) ->
%%======================================================================================
%%======================================================================================
-pp_command(Command, [space|File], Defs, IncDir, Err, War, L, FN) ->
- pp_command(Command, File, Defs, IncDir, Err, War, L, FN);
+pp_command(Command, [space|File], Defs, IncDir, Mio, Err, War, L, FN) ->
+ pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN);
-pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
+pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN) ->
case Command of
%%----------------------------------------
@@ -1081,14 +1084,16 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
%% #include
%%----------------------------------------
"include" ->
- case include(File, IncDir) of
- {error, Rem, Nl, Err2} ->
- {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
- {error, Rem, Nl, Err2, NameNl} ->
- {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
- {ok, FileName, FileCont, Rem, Nl} ->
- {{include, ok}, FileName, FileCont, Rem, Nl, Err, War}
- end;
+ case include(File, IncDir, Mio) of
+ {error, Rem, Nl, Err2} ->
+ {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
+ {error, Rem, Nl, Err2, NameNl} ->
+ {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
+ {ok, FileNamePath, FileCont, Rem, Nl} ->
+ {{include, ok}, FileNamePath, FileCont, Rem, Nl, Err, War};
+ {skip, Rem} ->
+ {{include, skip}, Rem}
+ end;
%%----------------------------------------
%% #ifdef
@@ -1127,14 +1132,14 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end;
{ok, Rem, Name, No_of_para, _Parameters, _Macro, Err2, War2, Nl} ->
case is_defined_before(Name, No_of_para, Defs) of
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end
end;
@@ -1408,29 +1413,32 @@ undef(_Rem) ->
%%===============================================================
%%===============================================================
-include(File, IncDir) ->
+include(File, IncDir, Mio) ->
case include2(File) of
- {ok, FileName, Rem, Nl, FileType} ->
- %% The error handling is lite strange just to make it compatible to gcc
- case {read_inc_file(FileName, IncDir), Nl, FileType} of
- {{ok, FileList, FileNamePath}, _, _} ->
- {ok, FileNamePath, FileList, Rem, Nl};
- {{error, Text}, _, own_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, Text}, 1, sys_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, _Text}, _, sys_file} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
- end;
-
- {error, {_Removed, Rem, Nl}} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ {ok, FileName, Rem, Nl, FileType} ->
+ Result = read_inc_file(FileName, IncDir, Mio),
+ case {Result, Nl, FileType} of
+ {{ok, FileNamePath, FileCont}, _, _} ->
+ {ok, FileNamePath, FileCont, Rem, Nl};
+ {skip, _, _} ->
+ {skip, Rem};
+ {{error, Text}, _, own_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, Text}, 1, sys_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, _Text}, _, sys_file} ->
+ {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ end;
+ {error, {_Removed, Rem, Nl}} ->
+ {error, Rem, Nl, "`#include' expects \#FILENAME\" or <FILENAME>"}
end.
+
+
count_nl([],Nl) ->
Nl;
count_nl([$\n|T],Nl) ->
@@ -1909,18 +1917,37 @@ include_dir(Flags,IncDir) ->
%% Read a included file. Try current dir first then the IncDir list
%%===============================================================
-read_inc_file(FileName, IncDir) ->
- case catch file:read_file(FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, FileName};
+read_inc_file(FileName, IncDir, Mio) ->
+ case find_inc_file(FileName, IncDir) of
+ {ok, AbsFile} ->
+ %% is included before?
+ case lists:member(FileName, Mio#mio.included) of
+ false ->
+ case catch file:read_file(AbsFile) of
+ {ok, Bin} ->
+ FileList = binary_to_list(Bin),
+ {ok, AbsFile, FileList};
+ {error, Text} ->
+ {error, Text}
+ end;
+ true ->
+ skip
+ end;
+ {error, Text} ->
+ {error, Text}
+ end.
+
+find_inc_file(FileName, IncDir) ->
+ case catch file:read_file_info(FileName) of
+ {ok, _} ->
+ {ok, FileName};
{error, _} ->
- read_inc_file2(FileName, IncDir)
+ find_inc_file2(FileName, IncDir)
end.
-read_inc_file2(_FileName, []) ->
+find_inc_file2(_FileName, []) ->
{error, "No such file or directory"};
-read_inc_file2(FileName, [D|Rem]) ->
+find_inc_file2(FileName, [D|Rem]) ->
Dir = case lists:last(D) of
$/ ->
D;
@@ -1928,17 +1955,14 @@ read_inc_file2(FileName, [D|Rem]) ->
D++"/"
end,
- case catch file:read_file(Dir++FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, Dir++FileName};
+ case catch file:read_file_info(Dir++FileName) of
+ {ok, _} ->
+ {ok, Dir++FileName};
{error, _} ->
- read_inc_file2(FileName, Rem)
+ find_inc_file2(FileName, Rem)
end.
-
-
%%===============================================================
%% Read parameters of a macro or a variable in a source line
%%===============================================================
@@ -2135,5 +2159,73 @@ month(11) -> "Nov";
month(12) -> "Dec".
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+update_mio({include, FileName}, #mio{included=Inc}=Mio) ->
+ Mio#mio{valid=false, included=[FileName|Inc]};
+
+%% valid=false & cmacro=undefined indicates it is already decided this file is
+%% not subject to MIO
+update_mio(_, #mio{valid=false, depth=0, cmacro=undefined}=Mio) ->
+ Mio;
+
+%% if valid=true, there is no non-whitespace tokens before this ifndef
+update_mio({'ifndef', Macro}, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, cmacro=Macro, depth=1};
+
+%% detect any tokens before top level #ifndef
+update_mio(_, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false};
+
+%% If cmacro is alreay set, this is after the top level #endif
+update_mio({'ifndef', _}, #mio{valid=true, depth=0}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+
+%% non-top level conditional, just update depth
+update_mio({'ifndef', _}, #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{depth=D+1};
+update_mio('ifdef', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+update_mio('if', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+
+%% top level #else #elif invalidates multiple include optimization
+update_mio('else', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('else', Mio) ->
+ Mio;
+update_mio('elif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('elif', Mio) ->
+ Mio;
+
+%% AT exit to top level, if the controlling macro is not set, this could be the
+%% end of a non-ifndef conditional block, or there were tokens before entering
+%% the #ifndef block. In either way, this invalidates the MIO
+%%
+%% It doesn't matter if `valid` is true at the time of exiting, it is set to
+%% true. This will be used to detect if more tokens are following the top
+%% level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=true, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 1 ->
+ Mio#mio{valid=true, depth=D-1};
+
+%%if more tokens are following the top level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{valid=true, depth=D-1};
+update_mio(_, Mio) ->
+ Mio#mio{valid=false}.
+
+%% clear `valid`, this doesn't matter since #endif will restore it if
+%% appropriate
+update_mio(Mio) ->
+ Mio#mio{valid=false}.
diff --git a/lib/ic/src/ic_pragma.erl b/lib/ic/src/ic_pragma.erl
index 45cb64c9c8..7f2216b9dc 100644
--- a/lib/ic/src/ic_pragma.erl
+++ b/lib/ic/src/ic_pragma.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1998-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1998-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -1600,9 +1600,8 @@ remove_inheriters(S,RS,InheriterList) ->
[_OneOnly] ->
ReducedInhList;
_Other ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits,'_','_'}),
% CodeOptList =
% [X || X <- EtsList, element(1,X) == codeopt],
NoInheriters =remove_inheriters2(S,ReducedInhList,CleanList),
@@ -1648,9 +1647,8 @@ remove_inh([X],[Y],List,EtsList) ->
%%% from others in the list
%%%----------------------------------------------
remove_inherited(S,InheriterList) ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits, '_', '_'}),
remove_inherited(S,InheriterList,CleanList).
@@ -1694,11 +1692,8 @@ remove_inhed([X],[Y],List,EtsList) ->
%% are inherited from scope in the list
%%%----------------------------------------------
get_inherited(S,Scope,OpScopeList) ->
- EtsList = ets:tab2list(S),
- [[element(3,X)] || X <- EtsList,
- element(1,X) == inherits,
- element(2,X) == Scope,
- member([element(3,X)],OpScopeList)].
+ EtsList1 = ets:match(S, {inherits, Scope, '$1'}),
+ [X || X <- EtsList1, member(X, OpScopeList)].
@@ -1771,9 +1766,7 @@ inherits2(_X,Y,Z,EtsList) ->
%% false otherwise
%%
is_inherited_by(Interface1,Interface2,PragmaTab) ->
- FullList = ets:tab2list(PragmaTab),
- InheritsList =
- [X || X <- FullList, element(1,X) == inherits],
+ InheritsList = ets:match(PragmaTab, {inherits, '_', '_'}),
inherits(Interface2,Interface1,InheritsList).
diff --git a/lib/ic/vsn.mk b/lib/ic/vsn.mk
index 6d6c7fa625..6561ccd2a7 100644
--- a/lib/ic/vsn.mk
+++ b/lib/ic/vsn.mk
@@ -1 +1 @@
-IC_VSN = 4.2.26
+IC_VSN = 4.2.27
diff --git a/lib/inets/src/http_server/httpd_file.erl b/lib/inets/src/http_server/httpd_file.erl
index ccc1f7874a..e8a8ab6411 100644
--- a/lib/inets/src/http_server/httpd_file.erl
+++ b/lib/inets/src/http_server/httpd_file.erl
@@ -33,7 +33,7 @@ handle_error(enotdir, Op, ModData, Path) ->
handle_error(404, Op, ModData, Path,
": A component of the file name is not a directory");
handle_error(emfile, Op, _ModData, Path) ->
- handle_error(500, Op, none, Path, ": To many open files");
+ handle_error(500, Op, none, Path, ": Too many open files");
handle_error({enfile,_}, Op, _ModData, Path) ->
handle_error(500, Op, none, Path, ": File table overflow");
handle_error(_Reason, Op, ModData, Path) ->
diff --git a/lib/kernel/doc/src/gen_sctp.xml b/lib/kernel/doc/src/gen_sctp.xml
index 5ceb82ae41..cc49090386 100644
--- a/lib/kernel/doc/src/gen_sctp.xml
+++ b/lib/kernel/doc/src/gen_sctp.xml
@@ -63,14 +63,13 @@
<item><seealso marker="#options">SCTP SOCKET OPTIONS</seealso></item>
<item><seealso marker="#examples">SCTP EXAMPLES</seealso></item>
<item><seealso marker="#seealso">SEE ALSO</seealso></item>
- <item><seealso marker="#authors">AUTHORS</seealso></item>
</list>
<marker id="types"></marker>
</section>
<datatypes>
<datatype>
- <name name="assoc_id"/>
+ <name><marker id="type-assoc_id">assoc_id()</marker></name>
<desc>
<p>An opaque term returned in for example #sctp_paddr_change{}
that identifies an association for an SCTP socket. The term
@@ -80,36 +79,18 @@
</desc>
</datatype>
<datatype>
- <name name="hostname"/>
- </datatype>
- <datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of an SCTP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="sctp_option"/>
+ <name name="option"/>
<desc>
<p>One of the
<seealso marker="#options">SCTP Socket Options.</seealso></p>
- <marker id="type-sctp_socket"></marker>
</desc>
</datatype>
<datatype>
- <name name="sctp_socket"/>
+ <name name="option_name"/>
+ <desc><marker id="type-sctp_socket"></marker></desc>
+ </datatype>
+ <datatype>
+ <name><marker id="type-sctp_socket">sctp_socket()</marker></name>
<desc>
<p>Socket identifier returned from <c>open/*</c>.</p>
<marker id="exports"></marker>
@@ -175,8 +156,8 @@
#sctp_assoc_change{
state = atom(),
error = atom(),
- outbound_streams = int(),
- inbound_streams = int(),
+ outbound_streams = integer(),
+ inbound_streams = integer(),
assoc_id = assoc_id()
} </pre>
<p>The number of outbound and inbound streams can be set by
@@ -300,6 +281,19 @@
The default <c><anno>IP</anno></c> and <c><anno>Port</anno></c> are <c>any</c>
and <c>0</c>, meaning bind to all local addresses on any
one free port.</p>
+
+ <p>Other options are:</p>
+ <taglist>
+ <tag><c>inet6</c></tag>
+ <item>
+ <p>Set up the socket for IPv6.</p>
+ </item>
+ <tag><c>inet</c></tag>
+ <item>
+ <p>Set up the socket for IPv4. This is the default.</p>
+ </item>
+ </taglist>
+
<p>A default set of socket <seealso marker="#options">options</seealso>
is used. In particular, the socket is opened in
<seealso marker="#option-binary">binary</seealso> and
@@ -350,7 +344,7 @@
#sctp_paddr_change{
addr = {ip_address(),port()},
state = atom(),
- error = int(),
+ error = integer(),
assoc_id = assoc_id()
} </pre>
<p>Indicates change of the status of the peer's IP address given by
@@ -387,7 +381,7 @@
<pre>
#sctp_send_failed{
flags = true | false,
- error = int(),
+ error = integer(),
info = #sctp_sndrcvinfo{},
assoc_id = assoc_id()
data = binary()
@@ -407,7 +401,7 @@
<item>
<pre>
#sctp_adaptation_event{
- adaptation_ind = int(),
+ adaptation_ind = integer(),
assoc_id = assoc_id()
} </pre>
<p>Delivered when a peer sends an Adaptation Layer Indication
@@ -505,7 +499,7 @@
</list>
<marker id="option-buffer"></marker>
</item>
- <tag><c>{buffer, int()}</c></tag>
+ <tag><c>{buffer, integer()}</c></tag>
<item>
<p>Determines the size of the user-level software buffer used by
the SCTP driver. Not to be confused with <c>sndbuf</c>
@@ -515,7 +509,7 @@
In fact, the <c>val(buffer)</c> is automatically set to
the above maximum when <c>sndbuf</c> or <c>recbuf</c> values are set.</p>
</item>
- <tag><c>{tos, int()}</c></tag>
+ <tag><c>{tos, integer()}</c></tag>
<item>
<p>Sets the Type-Of-Service field on the IP datagrams being sent,
to the given value, which effectively determines a prioritization
@@ -523,7 +517,7 @@
are system-dependent. TODO: we do not provide
symbolic names for these values yet.</p>
</item>
- <tag><c>{priority, int()}</c></tag>
+ <tag><c>{priority, integer()}</c></tag>
<item>
<p>A protocol-independent equivalent of <c>tos</c> above. Setting
priority implies setting tos as well.</p>
@@ -542,7 +536,7 @@
required for high-throughput servers).</p>
<marker id="option-linger"></marker>
</item>
- <tag><c>{linger, {true|false, int()}</c></tag>
+ <tag><c>{linger, {true|false, integer()}</c></tag>
<item>
<p>Determines the timeout in seconds for flushing unsent data in the
<c>gen_sctp:close/1</c> socket call. If the 1st component of the value
@@ -552,14 +546,14 @@
the flushing time-out in seconds.</p>
<marker id="option-sndbuf"></marker>
</item>
- <tag><c>{sndbuf, int()}</c></tag>
+ <tag><c>{sndbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* send buffer for this socket.
Sending errors would occur for datagrams larger than
<c>val(sndbuf)</c>. Setting this option also adjusts
the size of the driver buffer (see <c>buffer</c> above).</p>
</item>
- <tag><c>{recbuf, int()}</c></tag>
+ <tag><c>{recbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* recv buffer for this socket.
Sending errors would occur for datagrams larger than
@@ -571,9 +565,9 @@
<pre>
#sctp_rtoinfo{
assoc_id = assoc_id(),
- initial = int(),
- max = int(),
- min = int()
+ initial = integer(),
+ max = integer(),
+ min = integer()
} </pre>
<p>Determines re-transmission time-out parameters, in milliseconds,
for the association(s) given by <c>assoc_id</c>.
@@ -586,11 +580,11 @@
<pre>
#sctp_assocparams{
assoc_id = assoc_id(),
- asocmaxrxt = int(),
- number_peer_destinations = int(),
- peer_rwnd = int(),
- local_rwnd = int(),
- cookie_life = int()
+ asocmaxrxt = integer(),
+ number_peer_destinations = integer(),
+ peer_rwnd = integer(),
+ local_rwnd = integer(),
+ cookie_life = integer()
} </pre>
<p>Determines association parameters for the association(s) given by
<c>assoc_id</c>. <c>assoc_id = 0</c> (default) indicates
@@ -601,10 +595,10 @@
<item>
<pre>
#sctp_initmsg{
- num_ostreams = int(),
- max_instreams = int(),
- max_attempts = int(),
- max_init_timeo = int()
+ num_ostreams = integer(),
+ max_instreams = integer(),
+ max_attempts = integer(),
+ max_init_timeo = integer()
} </pre>
<p>Determines the default parameters which this socket attempts
to negotiate with its peer while establishing an association with it.
@@ -630,10 +624,11 @@
</list>
<p></p>
</item>
- <tag><c>{sctp_autoclose, int()|infinity}</c></tag>
+ <tag><c>{sctp_autoclose, integer() >= 0}</c></tag>
<item>
<p>Determines the time (in seconds) after which an idle association is
- automatically closed.</p>
+ automatically closed. <c>0</c> means that the association is
+ never automatically closed.</p>
</item>
<tag><c>{sctp_nodelay, true|false}</c></tag>
<item>
@@ -655,7 +650,7 @@
<p>Turns on|off automatic mapping of IPv4 addresses into IPv6 ones
(if the socket address family is AF_INET6).</p>
</item>
- <tag><c>{sctp_maxseg, int()}</c></tag>
+ <tag><c>{sctp_maxseg, integer()}</c></tag>
<item>
<p>Determines the maximum chunk size if message fragmentation is used.
If <c>0</c>, the chunk size is limited by the Path MTU only.</p>
@@ -693,7 +688,7 @@
<marker id="record-sctp_setadaptation"></marker>
<pre>
#sctp_setadaptation{
- adaptation_ind = int()
+ adaptation_ind = integer()
} </pre>
<p>When set, requests that the local endpoint uses the value given by
<c>adaptation_ind</c> as the Adaptation Indication parameter for
@@ -707,10 +702,10 @@
#sctp_paddrparams{
assoc_id = assoc_id(),
address = {IP, Port},
- hbinterval = int(),
- pathmaxrxt = int(),
- pathmtu = int(),
- sackdelay = int(),
+ hbinterval = integer(),
+ pathmaxrxt = integer(),
+ pathmtu = integer(),
+ sackdelay = integer(),
flags = list()
}
IP = ip_address()
@@ -771,14 +766,14 @@
<marker id="record-sctp_sndrcvinfo"></marker>
<pre>
#sctp_sndrcvinfo{
- stream = int(),
- ssn = int(),
+ stream = integer(),
+ ssn = integer(),
flags = list(),
- ppid = int(),
- context = int(),
- timetolive = int(),
- tsn = int(),
- cumtsn = int(),
+ ppid = integer(),
+ context = integer(),
+ timetolive = integer(),
+ tsn = integer(),
+ cumtsn = integer(),
assoc_id = assoc_id()
} </pre>
<p><c>#sctp_sndrcvinfo{}</c> is used both in this socket option, and as
@@ -853,7 +848,7 @@
<pre>
#sctp_assoc_value{
assoc_id = assoc_id(),
- assoc_value = int()
+ assoc_value = integer()
} </pre>
<p>Rarely used. Determines the ACK time
(given by <c>assoc_value</c> in milliseconds) for
@@ -866,12 +861,12 @@
#sctp_status{
assoc_id = assoc_id(),
state = atom(),
- rwnd = int(),
- unackdata = int(),
- penddata = int(),
- instrms = int(),
- outstrms = int(),
- fragmentation_point = int(),
+ rwnd = integer(),
+ unackdata = integer(),
+ penddata = integer(),
+ instrms = integer(),
+ outstrms = integer(),
+ fragmentation_point = integer(),
primary = #sctp_paddrinfo{}
} </pre>
<p>This option is read-only. It determines the status of
@@ -946,10 +941,10 @@
assoc_id = assoc_id(),
address = {IP, Port},
state = inactive | active,
- cwnd = int(),
- srtt = int(),
- rto = int(),
- mtu = int()
+ cwnd = integer(),
+ srtt = integer(),
+ rto = integer(),
+ mtu = integer()
}
IP = ip_address()
Port = port_number() </pre>
@@ -990,7 +985,7 @@
server(IP, Port) when is_tuple(IP) orelse IP == any orelse IP == loopback,
is_integer(Port) -&gt;
- {ok,S} = gen_sctp:open([{ip,IP},{port,Port}],[{recbuf,65536}]),
+ {ok,S} = gen_sctp:open(Port, [{recbuf,65536}, {ip,IP}]),
io:format("Listening on ~w:~w. ~w~n", [IP,Port,S]),
ok = gen_sctp:listen(S, true),
server_loop(S).
@@ -1119,7 +1114,6 @@ client_loop(S, Peer1, Port1, AssocId1, Peer2, Port2, AssocId2) -&gt;
<seealso marker="gen_udp">gen_udp(3)</seealso>,
<url href="http://www.rfc-archive.org/getrfc.php?rfc=2960">RFC2960</url> (Stream Control Transmission Protocol),
<url href="http://tools.ietf.org/html/draft-ietf-tsvwg-sctpsocket-13">Sockets API Extensions for SCTP.</url></p>
- <marker id="authors"></marker>
</section>
</erlref>
diff --git a/lib/kernel/doc/src/gen_tcp.xml b/lib/kernel/doc/src/gen_tcp.xml
index f1d42d9faa..8a5d40bb16 100644
--- a/lib/kernel/doc/src/gen_tcp.xml
+++ b/lib/kernel/doc/src/gen_tcp.xml
@@ -37,7 +37,7 @@
binary and closing the connection:</p>
<code type="none">
client() ->
- SomeHostInNet = "localhost" % to make it runnable on one machine
+ SomeHostInNet = "localhost", % to make it runnable on one machine
{ok, Sock} = gen_tcp:connect(SomeHostInNet, 5678,
[binary, {packet, 0}]),
ok = gen_tcp:send(Sock, "Some Data"),
@@ -65,25 +65,16 @@ do_recv(Sock, Bs) ->
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
- <name name="port_number"/>
+ <name name="connect_option"/>
</datatype>
<datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="listen_option"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -122,7 +113,7 @@ do_recv(Sock, Bs) ->
<item>
<p>Specify which local port number to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been connected without using
<c>gen_tcp</c>, use this option to pass the file
@@ -196,6 +187,10 @@ do_recv(Sock, Bs) ->
<p>If the host has several network interfaces, this option
specifies which one to listen on.</p>
</item>
+ <tag><c>{port, Port}</c></tag>
+ <item>
+ <p>Specify which local port number to use.</p>
+ </item>
<tag><c>{fd, Fd}</c></tag>
<item>
<p>If a socket has somehow been connected without using
diff --git a/lib/kernel/doc/src/gen_udp.xml b/lib/kernel/doc/src/gen_udp.xml
index c0e783f508..daa9b7d887 100644
--- a/lib/kernel/doc/src/gen_udp.xml
+++ b/lib/kernel/doc/src/gen_udp.xml
@@ -36,25 +36,10 @@
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -87,7 +72,7 @@
<p>If the host has several network interfaces, this option
specifies which one to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been opened without using
<c>gen_udp</c>, use this option to pass the file
diff --git a/lib/kernel/doc/src/inet.xml b/lib/kernel/doc/src/inet.xml
index fd843b00d9..b36c28e027 100644
--- a/lib/kernel/doc/src/inet.xml
+++ b/lib/kernel/doc/src/inet.xml
@@ -105,6 +105,9 @@ fe80::204:acff:fe17:bf38
<name name="ip6_address"/>
</datatype>
<datatype>
+ <name name="port_number"/>
+ </datatype>
+ <datatype>
<name name="posix"/>
<desc><p>An atom which is named from the Posix error codes
used in Unix, and in the runtime libraries of most
@@ -119,7 +122,7 @@ fe80::204:acff:fe17:bf38
</desc>
</datatype>
<datatype>
- <name name="family_option"/>
+ <name name="address_family"/>
</datatype>
</datatypes>
@@ -250,26 +253,15 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getopts(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getopts" arity="2"/>
<fsummary>Get one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt | RawOptReq]</v>
- <v>Opt = atom()</v>
- <v>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueSpec = ValueSize | ValueBin</v>
- <v>ValueSize = integer()</v>
- <v>ValueBin = binary()</v>
- <v>OptionValues = [{Opt, Val} | {raw, Protocol, OptionNum, ValueBin}]</v>
- </type>
<type name="socket_getopt"/>
+ <type name="socket_setopt"/>
<desc>
<p>Gets one or more options for a socket.
See <seealso marker="#setopts/2">setopts/2</seealso>
for a list of available options.</p>
- <p>The number of elements in the returned <c>OptionValues</c>
+ <p>The number of elements in the returned <c><anno>OptionValues</anno></c>
list does not necessarily correspond to the number of options
asked for. If the operating system fails to support an option,
it is simply left out in the returned list. An error tuple is only
@@ -277,12 +269,12 @@ fe80::204:acff:fe17:bf38
(i.e. the socket is closed or the buffer size in a raw request
is too large). This behavior is kept for backward
compatibility reasons.</p>
- <p>A <c>RawOptReq</c> can be used to get information about
+ <p>A raw option request <c>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</c> can be used to get information about
socket options not (explicitly) supported by the emulator. The
use of raw socket options makes the code non portable, but
allows the Erlang programmer to take advantage of unusual features
present on the current platform.</p>
- <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
+ <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
by the protocol level, the option number and either a binary
or the size, in bytes, of the
buffer in which the option value is to be stored. A binary
@@ -325,19 +317,14 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getstat(Socket)</name>
- <name>getstat(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getstat" arity="1"/>
+ <name name="getstat" arity="2"/>
<fsummary>Get one or more statistic options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt]</v>
- <v>OptionValues = [{Opt, Val}]</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="stat_option"/>
<desc>
<p>Gets one or more statistic options for a socket.</p>
- <p><c>getstat(Socket)</c> is equivalent to
- <c>getstat(Socket,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
+ <p><c>getstat(<anno>Socket</anno>)</c> is equivalent to
+ <c>getstat(<anno>Socket</anno>,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
<p>The following options are available:</p>
<taglist>
<tag><c>recv_avg</c></tag>
@@ -394,12 +381,8 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>port(Socket) -> {ok, Port} | {error, any()}</name>
+ <name name="port" arity="1"/>
<fsummary>Return the local port number for a socket</fsummary>
- <type>
- <v>Socket = socket()</v>
- <v>Port = integer()</v>
- </type>
<desc>
<p>Returns the local port number for a socket.</p>
</desc>
@@ -412,16 +395,9 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>setopts(Socket, Options) -> ok | {error, posix()}</name>
+ <name name="setopts" arity="2"/>
<fsummary>Set one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [{Opt, Val} | {raw, Protocol, Option, ValueBin}]</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueBin = binary()</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="socket_setopt"/>
<desc>
<p>Sets one or more options for a socket. The following options
are available:</p>
diff --git a/lib/kernel/src/code_server.erl b/lib/kernel/src/code_server.erl
index 4a1fc7df34..85bbff9cc3 100644
--- a/lib/kernel/src/code_server.erl
+++ b/lib/kernel/src/code_server.erl
@@ -1379,8 +1379,12 @@ absname_vr([[X, $:]|Name], _, _AbsBase) ->
%% Kill all processes running code from *old* Module, and then purge the
%% module. Return true if any processes killed, else false.
-do_purge(Mod) ->
- do_purge(processes(), to_atom(Mod), false).
+do_purge(Mod0) ->
+ Mod = to_atom(Mod0),
+ case erlang:check_old_code(Mod) of
+ false -> false;
+ true -> do_purge(processes(), Mod, false)
+ end.
do_purge([P|Ps], Mod, Purged) ->
case erlang:check_process_code(P, Mod) of
@@ -1399,16 +1403,19 @@ do_purge([], Mod, Purged) ->
Purged.
%% do_soft_purge(Module)
-%% Purge old code only if no procs remain that run old code
+%% Purge old code only if no procs remain that run old code.
%% Return true in that case, false if procs remain (in this
%% case old code is not purged)
do_soft_purge(Mod) ->
- catch do_soft_purge(processes(), Mod).
+ case erlang:check_old_code(Mod) of
+ false -> true;
+ true -> do_soft_purge(processes(), Mod)
+ end.
do_soft_purge([P|Ps], Mod) ->
case erlang:check_process_code(P, Mod) of
- true -> throw(false);
+ true -> false;
false -> do_soft_purge(Ps, Mod)
end;
do_soft_purge([], Mod) ->
diff --git a/lib/kernel/src/gen_sctp.erl b/lib/kernel/src/gen_sctp.erl
index 004f03f231..6cebb7ab97 100644
--- a/lib/kernel/src/gen_sctp.erl
+++ b/lib/kernel/src/gen_sctp.erl
@@ -33,55 +33,85 @@
-export([error_string/1]).
-export([controlling_process/2]).
--opaque assoc_id() :: term().
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
--type sctp_option() ::
- {mode, list | binary} | list | binary
- | {active, true | false | once}
- | {buffer, non_neg_integer()}
- | {tos, integer()}
- | {priority, integer()}
- | {dontroute, boolean()}
- | {reuseaddr, boolean()}
- | {linger, {boolean(), non_neg_integer()}}
- | {sndbuf, non_neg_integer()}
- | {recbuf, non_neg_integer()}
- | {sctp_rtoinfo, #sctp_rtoinfo{}}
- | {sctp_associnfo, #sctp_assocparams{}}
- | {sctp_initmsg, #sctp_initmsg{}}
- | {sctp_autoclose, timeout()}
- | {sctp_nodelay, boolean()}
- | {sctp_disable_fragments, boolean()}
- | {sctp_i_want_mapped_v4_addr, boolean()}
- | {sctp_maxseg, non_neg_integer()}
- | {sctp_primary_addr, #sctp_prim{}}
- | {sctp_set_peer_primary_addr, #sctp_setpeerprim{}}
- | {sctp_adaptation_layer, #sctp_setadaptation{}}
- | {sctp_peer_addr_params, #sctp_paddrparams{}}
- | {sctp_default_send_param, #sctp_sndrcvinfo{}}
- | {sctp_events, #sctp_event_subscribe{}}
- | {sctp_delayed_ack_time, #sctp_assoc_value{}}
- | {sctp_status, #sctp_status{}}
- | {sctp_get_peer_addr_info, #sctp_paddrinfo{}}.
--opaque sctp_socket() :: port().
-
--spec open() -> {ok, Socket} | {error, posix()} when
+-type assoc_id() :: term().
+-type option() ::
+ {active, true | false | once} |
+ {buffer, non_neg_integer()} |
+ {dontroute, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {mode, list | binary} | list | binary |
+ {priority, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sctp_adaptation_layer, #sctp_setadaptation{}} |
+ {sctp_associnfo, #sctp_assocparams{}} |
+ {sctp_autoclose, non_neg_integer()} |
+ {sctp_default_send_param, #sctp_sndrcvinfo{}} |
+ {sctp_delayed_ack_time, #sctp_assoc_value{}} |
+ {sctp_disable_fragments, boolean()} |
+ {sctp_events, #sctp_event_subscribe{}} |
+ {sctp_get_peer_addr_info, #sctp_paddrinfo{}} |
+ {sctp_i_want_mapped_v4_addr, boolean()} |
+ {sctp_initmsg, #sctp_initmsg{}} |
+ {sctp_maxseg, non_neg_integer()} |
+ {sctp_nodelay, boolean()} |
+ {sctp_peer_addr_params, #sctp_paddrparams{}} |
+ {sctp_primary_addr, #sctp_prim{}} |
+ {sctp_rtoinfo, #sctp_rtoinfo{}} |
+ {sctp_set_peer_primary_addr, #sctp_setpeerprim{}} |
+ {sctp_status, #sctp_status{}} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ buffer |
+ dontroute |
+ linger |
+ mode |
+ priority |
+ recbuf |
+ reuseaddr |
+ sctp_adaptation_layer |
+ sctp_associnfo |
+ sctp_autoclose |
+ sctp_default_send_param |
+ sctp_delayed_ack_time |
+ sctp_disable_fragments |
+ sctp_events |
+ sctp_get_peer_addr_info |
+ sctp_i_want_mapped_v4_addr |
+ sctp_initmsg |
+ sctp_maxseg |
+ sctp_nodelay |
+ sctp_peer_addr_params |
+ sctp_primary_addr |
+ sctp_rtoinfo |
+ sctp_set_peer_primary_addr |
+ sctp_status |
+ sndbuf |
+ tos.
+-type sctp_socket() :: port().
+
+-export_type([assoc_id/0, option/0, option_name/0, sctp_socket/0]).
+
+-spec open() -> {ok, Socket} | {error, inet:posix()} when
Socket :: sctp_socket().
open() ->
open([]).
--spec open(Port) -> {ok, Socket} | {error, posix()} when
- Port :: port_number(),
+-spec open(Port) -> {ok, Socket} | {error, inet:posix()} when
+ Port :: inet:port_number(),
Socket :: sctp_socket();
- (Opts) -> {ok, Socket} | {error, posix()} when
+ (Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Opts) when is_list(Opts) ->
@@ -98,11 +128,15 @@ open(Port) when is_integer(Port) ->
open(X) ->
erlang:error(badarg, [X]).
--spec open(Port, Opts) -> {ok, Socket} | {error, posix()} when
+-spec open(Port, Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Port, Opts) when is_integer(Port), is_list(Opts) ->
@@ -110,7 +144,7 @@ open(Port, Opts) when is_integer(Port), is_list(Opts) ->
open(Port, Opts) ->
erlang:error(badarg, [Port,Opts]).
--spec close(Socket) -> ok | {error, posix()} when
+-spec close(Socket) -> ok | {error, inet:posix()} when
Socket :: sctp_socket().
close(S) when is_port(S) ->
@@ -138,22 +172,22 @@ listen(S, Flag) when is_port(S), is_boolean(Flag) ->
listen(S, Flag) ->
erlang:error(badarg, [S,Flag]).
--spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, posix()} when
+-spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Assoc :: #sctp_assoc_change{}.
connect(S, Addr, Port, Opts) ->
connect(S, Addr, Port, Opts, infinity).
-spec connect(Socket, Addr, Port, Opts, Timeout) ->
- {ok, Assoc} | {error, posix()} when
+ {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Timeout :: timeout(),
Assoc :: #sctp_assoc_change{}.
@@ -166,21 +200,21 @@ connect(S, Addr, Port, Opts, Timeout) ->
end.
-spec connect_init(Socket, Addr, Port, Opts) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()].
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()].
connect_init(S, Addr, Port, Opts) ->
connect_init(S, Addr, Port, Opts, infinity).
-spec connect_init(Socket, Addr, Port, Opts, Timeout) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()],
Timeout :: timeout().
connect_init(S, Addr, Port, Opts, Timeout) ->
@@ -232,7 +266,7 @@ eof(S, #sctp_assoc_change{assoc_id=AssocId}) when is_port(S) ->
eof(S, Assoc) ->
erlang:error(badarg, [S,Assoc]).
--spec abort(Socket, Assoc) -> ok | {error, posix()} when
+-spec abort(Socket, Assoc) -> ok | {error, inet:posix()} when
Socket :: sctp_socket(),
Assoc :: #sctp_assoc_change{}.
@@ -294,13 +328,13 @@ send(S, AssocChange, Stream, Data) ->
-spec recv(Socket) -> {ok, {FromIP, FromPort, AncData, Data}}
| {error, Reason} when
Socket :: sctp_socket(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
@@ -311,13 +345,13 @@ recv(S) ->
| {error, Reason} when
Socket :: sctp_socket(),
Timeout :: timeout(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
diff --git a/lib/kernel/src/gen_tcp.erl b/lib/kernel/src/gen_tcp.erl
index bee61ca84a..8ab18c01b4 100644
--- a/lib/kernel/src/gen_tcp.erl
+++ b/lib/kernel/src/gen_tcp.erl
@@ -28,34 +28,108 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {bit8, clear | set | on | off} |
+ {buffer, non_neg_integer()} |
+ {delay_send, boolean()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {exit_on_close, boolean()} |
+ {header, non_neg_integer()} |
+ {high_watermark, non_neg_integer()} |
+ {keepalive, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {low_watermark, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {nodelay, boolean()} |
+ {packet,
+ 0 | 1 | 2 | 4 | raw | sunrm | asn1 |
+ cdr | fcgi | line | tpkt | http | httph | http_bin | httph_bin } |
+ {packet_size, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {send_timeout, non_neg_integer() | infinity} |
+ {send_timeout_close, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ bit8 |
+ buffer |
+ delay_send |
+ deliver |
+ dontroute |
+ exit_on_close |
+ header |
+ high_watermark |
+ keepalive |
+ linger |
+ low_watermark |
+ mode |
+ nodelay |
+ packet |
+ packet_size |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ recbuf |
+ reuseaddr |
+ send_timeout |
+ send_timeout_close |
+ sndbuf |
+ tos.
+-type connect_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {tcp_module, module()} |
+ option().
+-type listen_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {backlog, B :: non_neg_integer()} |
+ {tcp_module, module()} |
+ option().
-type socket() :: port().
+-export_type([option/0, option_name/0, connect_option/0, listen_option/0]).
+
%%
%% Connect a socket
%%
-spec connect(Address, Port, Options) -> {ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts) ->
connect(Address,Port,Opts,infinity).
-spec connect(Address, Port, Options, Timeout) ->
{ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Timeout :: timeout(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts, Time) ->
Timer = inet:start_timer(Time),
@@ -97,10 +171,10 @@ try_connect([], _Port, _Opts, _Timer, _Mod, Err) ->
%%
-spec listen(Port, Options) -> {ok, ListenSocket} | {error, Reason} when
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Options :: [listen_option()],
ListenSocket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
listen(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -119,7 +193,7 @@ listen(Port, Opts) ->
-spec accept(ListenSocket) -> {ok, Socket} | {error, Reason} when
ListenSocket :: socket(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S) ->
case inet_db:lookup_socket(S) of
@@ -133,7 +207,7 @@ accept(S) ->
ListenSocket :: socket(),
Timeout :: timeout(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S, Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -150,7 +224,7 @@ accept(S, Time) when is_port(S) ->
-spec shutdown(Socket, How) -> ok | {error, Reason} when
Socket :: socket(),
How :: read | write | read_write,
- Reason :: posix().
+ Reason :: inet:posix().
shutdown(S, How) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -176,8 +250,8 @@ close(S) ->
-spec send(Socket, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Packet :: string() | binary(),
- Reason :: posix().
+ Packet :: iodata(),
+ Reason :: inet:posix().
send(S, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -195,7 +269,7 @@ send(S, Packet) when is_port(S) ->
Socket :: socket(),
Length :: non_neg_integer(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length) when is_port(S) ->
@@ -211,7 +285,7 @@ recv(S, Length) when is_port(S) ->
Length :: non_neg_integer(),
Timeout :: timeout(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length, Time) when is_port(S) ->
@@ -237,7 +311,7 @@ unrecv(S, Data) when is_port(S) ->
-spec controlling_process(Socket, Pid) -> ok | {error, Reason} when
Socket :: socket(),
Pid :: pid(),
- Reason :: closed | not_owner | posix().
+ Reason :: closed | not_owner | inet:posix().
controlling_process(S, NewOwner) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/gen_udp.erl b/lib/kernel/src/gen_udp.erl
index 7d14615c04..8688799ae9 100644
--- a/lib/kernel/src/gen_udp.erl
+++ b/lib/kernel/src/gen_udp.erl
@@ -25,25 +25,74 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {add_membership, {inet:ip_address(), inet:ip_address()}} |
+ {broadcast, boolean()} |
+ {buffer, non_neg_integer()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {drop_membership, {inet:ip_address(), inet:ip_address()}} |
+ {header, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {multicast_if, inet:ip_address()} |
+ {multicast_loop, boolean()} |
+ {multicast_ttl, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {read_packets, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ broadcast |
+ buffer |
+ deliver |
+ dontroute |
+ header |
+ mode |
+ multicast_if |
+ multicast_loop |
+ multicast_ttl |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ read_packets |
+ recbuf |
+ reuseaddr |
+ sndbuf |
+ tos.
-type socket() :: port().
+-export_type([option/0, option_name/0]).
+
-spec open(Port) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
+ Port :: inet:port_number(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port) ->
open(Port, []).
-spec open(Port, Opts) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
- Opts :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Opts :: [Option],
+ Option :: {ip, inet:ip_address()}
+ | {fd, non_neg_integer()}
+ | {ifaddr, inet:ip_address()}
+ | inet:address_family()
+ | {port, inet:port_number()}
+ | option(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -58,10 +107,10 @@ close(S) ->
-spec send(Socket, Address, Port, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Packet :: iodata(),
+ Reason :: not_owner | inet:posix().
send(S, Address, Port, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -92,10 +141,10 @@ send(S, Packet) when is_port(S) ->
{ok, {Address, Port, Packet}} | {error, Reason} when
Socket :: socket(),
Length :: non_neg_integer(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len) when is_port(S), is_integer(Len) ->
case inet_db:lookup_socket(S) of
@@ -110,10 +159,10 @@ recv(S,Len) when is_port(S), is_integer(Len) ->
Socket :: socket(),
Length :: non_neg_integer(),
Timeout :: timeout(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len,Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/inet.erl b/lib/kernel/src/inet.erl
index 5649188c38..48a6f3db65 100644
--- a/lib/kernel/src/inet.erl
+++ b/lib/kernel/src/inet.erl
@@ -63,8 +63,9 @@
%% timer interface
-export([start_timer/1, timeout/1, timeout/2, stop_timer/1]).
--export_type([family_option/0, hostent/0, hostname/0, ip4_address/0,
- ip6_address/0, ip_address/0, posix/0, socket/0]).
+-export_type([address_family/0, hostent/0, hostname/0, ip4_address/0,
+ ip6_address/0, ip_address/0, posix/0, socket/0,
+ port_number/0]).
%% imports
-import(lists, [append/1, duplicate/2, filter/2, foldl/3]).
@@ -87,98 +88,15 @@
-type ip6_address() :: {0..65535,0..65535,0..65535,0..65535,
0..65535,0..65535,0..65535,0..65535}.
-type ip_address() :: ip4_address() | ip6_address().
--type ip_port() :: 0..65535.
+-type port_number() :: 0..65535.
-type posix() :: exbadport | exbadseq | file:posix().
-type socket() :: port().
-type socket_setopt() ::
- {'raw', non_neg_integer(), non_neg_integer(), binary()} |
- %% TCP/UDP options
- {'reuseaddr', boolean()} |
- {'keepalive', boolean()} |
- {'dontroute', boolean()} |
- {'linger', {boolean(), non_neg_integer()}} |
- {'broadcast', boolean()} |
- {'sndbuf', non_neg_integer()} |
- {'recbuf', non_neg_integer()} |
- {'priority', non_neg_integer()} |
- {'tos', non_neg_integer()} |
- {'nodelay', boolean()} |
- {'multicast_ttl', non_neg_integer()} |
- {'multicast_loop', boolean()} |
- {'multicast_if', ip_address()} |
- {'add_membership', {ip_address(), ip_address()}} |
- {'drop_membership', {ip_address(), ip_address()}} |
- {'header', non_neg_integer()} |
- {'buffer', non_neg_integer()} |
- {'active', boolean() | 'once'} |
- {'packet',
- 0 | 1 | 2 | 4 | 'raw' | 'sunrm' | 'asn1' |
- 'cdr' | 'fcgi' | 'line' | 'tpkt' | 'http' | 'httph' | 'http_bin' | 'httph_bin' } |
- {'mode', 'list' | 'binary'} |
- {'port', 'port', 'term'} |
- {'exit_on_close', boolean()} |
- {'low_watermark', non_neg_integer()} |
- {'high_watermark', non_neg_integer()} |
- {'bit8', 'clear' | 'set' | 'on' | 'off'} |
- {'send_timeout', non_neg_integer() | 'infinity'} |
- {'send_timeout_close', boolean()} |
- {'delay_send', boolean()} |
- {'packet_size', non_neg_integer()} |
- {'read_packets', non_neg_integer()} |
- %% SCTP options
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- {'sctp_associnfo', #sctp_assocparams{}} |
- {'sctp_initmsg', #sctp_initmsg{}} |
- {'sctp_nodelay', boolean()} |
- {'sctp_autoclose', non_neg_integer()} |
- {'sctp_disable_fragments', boolean()} |
- {'sctp_i_want_mapped_v4_addr', boolean()} |
- {'sctp_maxseg', non_neg_integer()} |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- {'sctp_events', #sctp_event_subscribe{}} |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
+ gen_sctp:option() | gen_tcp:option() | gen_udp:option().
-type socket_getopt() ::
- {'raw',
- non_neg_integer(), non_neg_integer(), binary()|non_neg_integer()} |
- %% TCP/UDP options
- 'reuseaddr' | 'keepalive' | 'dontroute' | 'linger' |
- 'broadcast' | 'sndbuf' | 'recbuf' | 'priority' | 'tos' | 'nodelay' |
- 'multicast_ttl' | 'multicast_loop' | 'multicast_if' |
- 'add_membership' | 'drop_membership' |
- 'header' | 'buffer' | 'active' | 'packet' | 'mode' | 'port' |
- 'exit_on_close' | 'low_watermark' | 'high_watermark' | 'bit8' |
- 'send_timeout' | 'send_timeout_close' |
- 'delay_send' | 'packet_size' | 'read_packets' |
- %% SCTP options
- {'sctp_status', #sctp_status{}} |
- 'sctp_get_peer_addr_info' |
- {'sctp_get_peer_addr_info', #sctp_status{}} |
- 'sctp_rtoinfo' |
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- 'sctp_associnfo' |
- {'sctp_associnfo', #sctp_assocparams{}} |
- 'sctp_initmsg' |
- {'sctp_initmsg', #sctp_initmsg{}} |
- 'sctp_nodelay' | 'sctp_autoclose' | 'sctp_disable_fragments' |
- 'sctp_i_want_mapped_v4_addr' | 'sctp_maxseg' |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- 'sctp_adaptation_layer' |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- 'sctp_default_send_param' |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- 'sctp_events' |
- {'sctp_events', #sctp_event_subscribe{}} |
- 'sctp_delayed_ack_time' |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
-
+ gen_sctp:option_name() | gen_tcp:option_name() | gen_udp:option_name().
-type ether_address() :: [0..255].
-type if_setopt() ::
@@ -196,7 +114,7 @@
'addr' | 'broadaddr' | 'dstaddr' |
'mtu' | 'netmask' | 'flags' |'hwaddr'.
--type family_option() :: 'inet' | 'inet6'.
+-type address_family() :: 'inet' | 'inet6'.
-type protocol_option() :: 'tcp' | 'udp' | 'sctp'.
-type stat_option() ::
'recv_cnt' | 'recv_max' | 'recv_avg' | 'recv_oct' | 'recv_dvi' |
@@ -229,7 +147,7 @@ close(Socket) ->
peername(Socket) ->
prim_inet:peername(Socket).
--spec setpeername(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setpeername(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setpeername(Socket, {IP,Port}) ->
@@ -246,7 +164,7 @@ setpeername(Socket, undefined) ->
sockname(Socket) ->
prim_inet:sockname(Socket).
--spec setsockname(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setsockname(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setsockname(Socket, {IP,Port}) ->
@@ -254,7 +172,9 @@ setsockname(Socket, {IP,Port}) ->
setsockname(Socket, undefined) ->
prim_inet:setsockname(Socket, undefined).
--spec port(Socket :: socket()) -> {'ok', ip_port()} | {'error', any()}.
+-spec port(Socket) -> {'ok', Port} | {'error', any()} when
+ Socket :: socket(),
+ Port :: port_number().
port(Socket) ->
case prim_inet:sockname(Socket) of
@@ -268,16 +188,18 @@ port(Socket) ->
send(Socket, Packet) ->
prim_inet:send(Socket, Packet).
--spec setopts(Socket :: socket(), Opts :: [socket_setopt()]) ->
- 'ok' | {'error', posix()}.
+-spec setopts(Socket, Options) -> ok | {error, posix()} when
+ Socket :: socket(),
+ Options :: [socket_setopt()].
setopts(Socket, Opts) ->
prim_inet:setopts(Socket, Opts).
-spec getopts(Socket, Options) ->
- {'ok', [socket_setopt()]} | {'error', posix()} when
+ {'ok', OptionValues} | {'error', posix()} when
Socket :: socket(),
- Options :: [socket_getopt()].
+ Options :: [socket_getopt()],
+ OptionValues :: [socket_setopt()].
getopts(Socket, Opts) ->
prim_inet:getopts(Socket, Opts).
@@ -419,14 +341,19 @@ gethostname() ->
gethostname(Socket) ->
prim_inet:gethostname(Socket).
--spec getstat(Socket :: socket()) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket) ->
prim_inet:getstat(Socket, stats()).
--spec getstat(Socket :: socket(), Statoptions :: [stat_option()]) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket, Options) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ Options :: [stat_option()],
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket,What) ->
prim_inet:getstat(Socket, What).
@@ -441,14 +368,14 @@ gethostbyname(Name) ->
-spec gethostbyname(Hostname, Family) ->
{ok, Hostent} | {error, posix()} when
Hostname :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Hostent :: hostent().
gethostbyname(Name,Family) ->
gethostbyname_tm(Name, Family, false).
-spec gethostbyname(Name :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', #hostent{}} | {'error', posix()}.
@@ -527,14 +454,14 @@ getfd(Socket) ->
-spec getaddr(Host, Family) -> {ok, Address} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Address :: ip_address().
getaddr(Address, Family) ->
getaddr(Address, Family, infinity).
-spec getaddr(Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', ip_address()} | {'error', posix()}.
@@ -553,14 +480,14 @@ getaddr_tm(Address, Family, Timer) ->
-spec getaddrs(Host, Family) ->
{ok, Addresses} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Addresses :: [ip_address()].
getaddrs(Address, Family) ->
getaddrs(Address, Family, infinity).
-spec getaddrs(Host :: ip_address() | string() | atom(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', [ip_address()]} | {'error', posix()}.
@@ -570,7 +497,7 @@ getaddrs(Address, Family, Timeout) ->
stop_timer(Timer),
Res.
--spec getservbyport(Port :: ip_port(), Protocol :: atom() | string()) ->
+-spec getservbyport(Port :: port_number(), Protocol :: atom() | string()) ->
{'ok', string()} | {'error', posix()}.
getservbyport(Port, Proto) ->
@@ -584,7 +511,7 @@ getservbyport(Port, Proto) ->
-spec getservbyname(Name :: atom() | string(),
Protocol :: atom() | string()) ->
- {'ok', ip_port()} | {'error', posix()}.
+ {'ok', port_number()} | {'error', posix()}.
getservbyname(Name, Protocol) when is_atom(Name) ->
case inet_udp:open(0, []) of
@@ -1067,7 +994,7 @@ gethostbyaddr_tm_native(Addr, Timer, Opts) ->
-spec open(Fd :: integer(),
Addr :: ip_address(),
- Port :: ip_port(),
+ Port :: port_number(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
Family :: 'inet' | 'inet6',
@@ -1108,7 +1035,7 @@ open(Fd, _Addr, _Port, Opts, Protocol, Family, Module) ->
-spec fdopen(Fd :: non_neg_integer(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
- Family :: family_option(),
+ Family :: address_family(),
Module :: atom()) ->
{'ok', socket()} | {'error', posix()}.
diff --git a/lib/kernel/src/inet_res.erl b/lib/kernel/src/inet_res.erl
index d1f5644ff7..59ba408d7a 100644
--- a/lib/kernel/src/inet_res.erl
+++ b/lib/kernel/src/inet_res.erl
@@ -407,7 +407,7 @@ gethostbyname(Name) ->
-spec gethostbyname(Name, Family) -> {ok, Hostent} | {error, Reason} when
Name :: dns_name(),
Hostent :: inet:hostent(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family) ->
@@ -418,7 +418,7 @@ gethostbyname(Name,Family) ->
Name :: dns_name(),
Hostent :: inet:hostent(),
Timeout :: timeout(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family,Timeout) ->
diff --git a/lib/kernel/test/application_SUITE.erl b/lib/kernel/test/application_SUITE.erl
index 4ae4151004..2c5b8ccb66 100644
--- a/lib/kernel/test/application_SUITE.erl
+++ b/lib/kernel/test/application_SUITE.erl
@@ -967,7 +967,7 @@ otp_1586(doc) ->
["Test recursive load of applications."];
otp_1586(Conf) when is_list(Conf) ->
Dir = ?config(priv_dir,Conf),
- {ok, Fd} = file:open(filename:join(Dir, "app5.app"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "app5.app"), [write]),
w_app5(Fd),
file:close(Fd),
?line code:add_patha(Dir),
@@ -1021,10 +1021,10 @@ otp_2012(Conf) when is_list(Conf) ->
?line yes = global:register_name(conf_change, CcPid),
% Write a .app file
- {ok, Fd} = file:open("app1.app", write),
+ {ok, Fd} = file:open("app1.app", [write]),
w_app1(Fd),
file:close(Fd),
- {ok, Fd2} = file:open("app2.app", write),
+ {ok, Fd2} = file:open("app2.app", [write]),
w_app1(Fd2),
file:close(Fd2),
@@ -1096,7 +1096,7 @@ otp_2973(doc) ->
["Test of two processes simultanously starting the same application."];
otp_2973(Conf) when is_list(Conf) ->
% Write a .app file
- {ok, Fd} = file:open("app0.app", write),
+ {ok, Fd} = file:open("app0.app", [write]),
w_app(Fd, app0()),
file:close(Fd),
@@ -1138,7 +1138,7 @@ otp_2973(Conf) when is_list(Conf) ->
% Write a .app file
- ?line {ok, Fda} = file:open("app_start_error.app", write),
+ ?line {ok, Fda} = file:open("app_start_error.app", [write]),
?line w_app_start_error(Fda),
?line file:close(Fda),
@@ -1273,12 +1273,12 @@ otp_4066(Conf) when is_list(Conf) ->
App1Nodes = {app1, AllNodes},
Dir = ?config(priv_dir,Conf),
- ?line {ok, FdC} = file:open(filename:join(Dir, "otp_4066.config"), write),
+ ?line {ok, FdC} = file:open(filename:join(Dir, "otp_4066.config"), [write]),
?line write_config(FdC, config_4066(AllNodes, 5000, [App1Nodes])),
?line file:close(FdC),
% Write the app1.app file
- ?line {ok, FdA12} = file:open(filename:join(Dir, "app1.app"), write),
+ ?line {ok, FdA12} = file:open(filename:join(Dir, "app1.app"), [write]),
?line w_app1(FdA12),
?line file:close(FdA12),
@@ -1441,7 +1441,7 @@ otp_5606(Conf) when is_list(Conf) ->
%% Write a config file
Dir = ?config(priv_dir, Conf),
- {ok, Fd} = file:open(filename:join(Dir, "sys.config"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "sys.config"), [write]),
NodeNames = [Ncp1, Ncp2] = node_names([cp1, cp2], Conf),
(config4(NodeNames))(Fd, 10000),
file:close(Fd),
@@ -2436,7 +2436,7 @@ start_node_config_sf(Name, SysConfigFun, Conf) ->
write_config_file(SysConfigFun, Conf) ->
Dir = ?config(priv_dir, Conf),
- {ok, Fd} = file:open(filename:join(Dir, "sys.config"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "sys.config"), [write]),
SysConfigFun(Fd),
file:close(Fd),
filename:join(Dir,"sys").
@@ -2571,15 +2571,15 @@ cc(List) ->
create_app() ->
?line Dir = "./",
?line App1 = Dir ++ "app1",
- ?line {ok, Fd1} = file:open(App1++".app",write),
+ ?line {ok, Fd1} = file:open(App1++".app",[write]),
?line io:format(Fd1, "~p. \n", [app1()]),
?line file:close(Fd1),
?line App2 = Dir ++ "app2",
- ?line {ok, Fd2} = file:open(App2++".app",write),
+ ?line {ok, Fd2} = file:open(App2++".app",[write]),
?line io:format(Fd2, "~p. \n", [app2()]),
?line file:close(Fd2),
?line App3 = Dir ++ "app_sp",
- ?line {ok, Fd3} = file:open(App3++".app",write),
+ ?line {ok, Fd3} = file:open(App3++".app",[write]),
?line io:format(Fd3, "~p. \n", [app_sp()]),
?line file:close(Fd3),
ok.
@@ -2591,7 +2591,7 @@ create_script(ScriptName) ->
?line Apps = which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2610,7 +2610,7 @@ create_script_dc(ScriptName) ->
?line Apps = which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2630,7 +2630,7 @@ create_script_3002(ScriptName) ->
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
?line {value,{_,_,SaslVer}} = lists:keysearch(sasl,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2646,22 +2646,22 @@ create_script_3002(ScriptName) ->
distr_changed_prep(Conf) when is_list(Conf) ->
% Write .app files
- ?line {ok, Fd1} = file:open("app1.app", write),
+ ?line {ok, Fd1} = file:open("app1.app", [write]),
?line w_app1(Fd1),
?line file:close(Fd1),
- ?line {ok, Fd2} = file:open("app2.app", write),
+ ?line {ok, Fd2} = file:open("app2.app", [write]),
?line w_app2(Fd2),
?line file:close(Fd2),
- ?line {ok, Fd3} = file:open("app3.app", write),
+ ?line {ok, Fd3} = file:open("app3.app", [write]),
?line w_app3(Fd3),
?line file:close(Fd3),
- ?line {ok, Fd4} = file:open("app6.app", write),
+ ?line {ok, Fd4} = file:open("app6.app", [write]),
?line w_app6(Fd4),
?line file:close(Fd4),
- ?line {ok, Fd5} = file:open("app7.app", write),
+ ?line {ok, Fd5} = file:open("app7.app", [write]),
?line w_app7(Fd5),
?line file:close(Fd5),
- ?line {ok, Fd6} = file:open("app8.app", write),
+ ?line {ok, Fd6} = file:open("app8.app", [write]),
?line w_app8(Fd6),
?line file:close(Fd6),
@@ -2683,7 +2683,7 @@ distr_changed_prep(Conf) when is_list(Conf) ->
WithSyncTime = config_fun(config_dc(NodeNames)),
?line Dir = ?config(priv_dir,Conf),
- ?line {ok, Fd_dc2} = file:open(filename:join(Dir, "sys2.config"), write),
+ ?line {ok, Fd_dc2} = file:open(filename:join(Dir, "sys2.config"), [write]),
?line (config_dc2(NodeNames))(Fd_dc2),
?line file:close(Fd_dc2),
?line Config2 = filename:join(Dir, "sys2"),
diff --git a/lib/kernel/test/code_SUITE.erl b/lib/kernel/test/code_SUITE.erl
index 3ad49254f1..86cccebc29 100644
--- a/lib/kernel/test/code_SUITE.erl
+++ b/lib/kernel/test/code_SUITE.erl
@@ -258,8 +258,8 @@ replace_path(Config) when is_list(Config) ->
%% Add a completly new application.
- NewAppName = "blurf_blarfer",
- ?line NewAppDir = filename:join(Cwd, NewAppName ++ "-6.33.1"),
+ NewAppName = 'blurf_blarfer',
+ ?line NewAppDir = filename:join(Cwd, atom_to_list(NewAppName) ++ "-6.33.1"),
?line ok = file:make_dir(NewAppDir),
?line true = code:replace_path(NewAppName, NewAppDir),
?line NewAppDir = code:lib_dir(NewAppName),
@@ -410,8 +410,10 @@ all_loaded_1() ->
?line Loaded2 = match_and_remove(Preloaded, Loaded1),
ObjExt = code:objfile_extension(),
- ?line [] = lists:filter(fun({Mod,AbsName}) when is_atom(Mod), is_list(AbsName) ->
- Mod =:= filename:basename(AbsName, ObjExt);
+ ?line [] = lists:filter(fun({Mod,AbsName}) when is_atom(Mod),
+ is_list(AbsName) ->
+ Mod =/= list_to_atom(filename:basename(AbsName,
+ ObjExt));
(_) -> true
end,
Loaded2),
@@ -1023,8 +1025,8 @@ mult_lib_roots(Config) when is_list(Config) ->
"my_dummy_app-c/ebin/code_SUITE_mult_root_module"),
%% Set up ERL_LIBS and start a slave node.
- ErlLibs = filename:join(DataDir, first_root) ++ mult_lib_sep() ++
- filename:join(DataDir, second_root),
+ ErlLibs = filename:join(DataDir, "first_root") ++ mult_lib_sep() ++
+ filename:join(DataDir, "second_root"),
?line {ok,Node} =
?t:start_node(mult_lib_roots, slave,
@@ -1344,7 +1346,7 @@ create_script(Config) ->
?line Apps = application_controller:which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel, 1, Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib, 1, Apps),
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"9.42\"}, \n"
@@ -1409,7 +1411,7 @@ create_big_script(Config,Local) ->
%% Now we should have only "real" applications...
?line [application:load(list_to_atom(Y)) || {match,[Y]} <- [ re:run(X,code:lib_dir()++"/"++"([^/-]*).*/ebin",[{capture,[1],list}]) || X <- code:get_path()],filter_app(Y,Local)],
?line Apps = [ {N,V} || {N,_,V} <- application:loaded_applications()],
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"9.42\"}, \n"
diff --git a/lib/kernel/test/disk_log_SUITE.erl b/lib/kernel/test/disk_log_SUITE.erl
index 4ae47b4762..ee1e2319b5 100644
--- a/lib/kernel/test/disk_log_SUITE.erl
+++ b/lib/kernel/test/disk_log_SUITE.erl
@@ -4917,7 +4917,7 @@ mark(FileName, What) ->
ok = file:close(Fd).
crash(File, Where) ->
- {ok, Fd} = file:open(File, read_write),
+ {ok, Fd} = file:open(File, [read,write]),
file:position(Fd, Where),
ok = file:write(Fd, [10]),
ok = file:close(Fd).
@@ -4933,7 +4933,7 @@ writable(Fname) ->
file:write_file_info(Fname, Info#file_info{mode = Mode}).
truncate(File, Where) ->
- {ok, Fd} = file:open(File, read_write),
+ {ok, Fd} = file:open(File, [read,write]),
file:position(Fd, Where),
ok = file:truncate(Fd),
ok = file:close(Fd).
diff --git a/lib/kernel/test/erl_prim_loader_SUITE.erl b/lib/kernel/test/erl_prim_loader_SUITE.erl
index f47c4603cf..7599a89779 100644
--- a/lib/kernel/test/erl_prim_loader_SUITE.erl
+++ b/lib/kernel/test/erl_prim_loader_SUITE.erl
@@ -547,8 +547,6 @@ host() ->
stop_node(Node) ->
test_server:stop_node(Node).
-get_loader_flag({ose,_}) ->
- " -loader ose_inet ";
get_loader_flag(_) ->
" -loader inet ".
diff --git a/lib/kernel/test/gen_tcp_api_SUITE.erl b/lib/kernel/test/gen_tcp_api_SUITE.erl
index fd4685cdad..cbaec2d6dd 100644
--- a/lib/kernel/test/gen_tcp_api_SUITE.erl
+++ b/lib/kernel/test/gen_tcp_api_SUITE.erl
@@ -158,6 +158,10 @@ t_shutdown_error(Config) when is_list(Config) ->
t_fdopen(Config) when is_list(Config) ->
?line Question = "Aaaa... Long time ago in a small town in Germany,",
+ ?line Question1 = list_to_binary(Question),
+ ?line Question2 = [<<"Aaaa">>, "... ", $L, <<>>, $o, "ng time ago ",
+ ["in ", [], <<"a small town">>, [" in Germany,", <<>>]]],
+ ?line Question1 = iolist_to_binary(Question2),
?line Answer = "there was a shoemaker, Schumacher was his name.",
?line {ok, L} = gen_tcp:listen(0, [{active, false}]),
?line {ok, Port} = inet:port(L),
@@ -167,6 +171,10 @@ t_fdopen(Config) when is_list(Config) ->
?line {ok, Server} = gen_tcp:fdopen(FD, []),
?line ok = gen_tcp:send(Client, Question),
?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
+ ?line ok = gen_tcp:send(Client, Question1),
+ ?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
+ ?line ok = gen_tcp:send(Client, Question2),
+ ?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
?line ok = gen_tcp:send(Server, Answer),
?line {ok, Answer} = gen_tcp:recv(Client, length(Answer), 2000),
?line ok = gen_tcp:close(Client),
diff --git a/lib/kernel/test/gen_udp_SUITE.erl b/lib/kernel/test/gen_udp_SUITE.erl
index d8a5519195..514deaf065 100644
--- a/lib/kernel/test/gen_udp_SUITE.erl
+++ b/lib/kernel/test/gen_udp_SUITE.erl
@@ -201,13 +201,21 @@ binary_passive_recv(suite) ->
binary_passive_recv(doc) ->
["OTP-3823 gen_udp:recv does not return address in binary mode"];
binary_passive_recv(Config) when is_list(Config) ->
- ?line D = "The quick brown fox jumps over a lazy dog",
- ?line B = list_to_binary(D),
+ ?line D1 = "The quick brown fox jumps over a lazy dog",
+ ?line D2 = list_to_binary(D1),
+ ?line D3 = ["The quick", <<" brown ">>, "fox jumps ", <<"over ">>,
+ <<>>, $a, [[], " lazy ", <<"dog">>]],
+ ?line D2 = iolist_to_binary(D3),
+ ?line B = D2,
?line {ok, R} = gen_udp:open(0, [binary, {active, false}]),
?line {ok, RP} = inet:port(R),
?line {ok, S} = gen_udp:open(0),
?line {ok, SP} = inet:port(S),
- ?line ok = gen_udp:send(S, localhost, RP, D),
+ ?line ok = gen_udp:send(S, localhost, RP, D1),
+ ?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
+ ?line ok = gen_udp:send(S, localhost, RP, D2),
+ ?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
+ ?line ok = gen_udp:send(S, localhost, RP, D3),
?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
?line ok = gen_udp:close(S),
?line ok = gen_udp:close(R),
@@ -400,6 +408,7 @@ open_fd(Config) when is_list(Config) ->
{ok,S1} = gen_udp:open(0),
{ok,P2} = inet:port(S1),
{ok,FD} = prim_inet:getfd(S1),
+ {error,einval} = gen_udp:open(P2, [inet6, {fd,FD}]),
{ok,S2} = gen_udp:open(P2, [{fd,FD}]),
{ok,S3} = gen_udp:open(0),
{ok,P3} = inet:port(S3),
diff --git a/lib/kernel/test/global_group_SUITE.erl b/lib/kernel/test/global_group_SUITE.erl
index 13b2fd07b5..799b0d9d05 100644
--- a/lib/kernel/test/global_group_SUITE.erl
+++ b/lib/kernel/test/global_group_SUITE.erl
@@ -100,7 +100,7 @@ start_gg_proc(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd}=file:open(File, write),
+ ?line {ok, Fd}=file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -135,7 +135,7 @@ no_gg_proc(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "no_global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
?line config_no(Fd),
?line NN = node_name(atom_to_list(node())),
@@ -308,7 +308,7 @@ no_gg_proc_sync(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "no_global_group_sync.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz], Config),
@@ -482,7 +482,7 @@ compatible(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group_comp.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz], Config),
@@ -655,7 +655,7 @@ one_grp(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -742,7 +742,7 @@ one_grp_x(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -804,7 +804,7 @@ two_grp(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz,Ncpq] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz,cpq], Config),
@@ -1104,7 +1104,7 @@ hidden_groups(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz,Ncpq] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz,cpq], Config),
diff --git a/lib/kernel/test/init_SUITE.erl b/lib/kernel/test/init_SUITE.erl
index 2db0f7dcb8..b39fadd65f 100644
--- a/lib/kernel/test/init_SUITE.erl
+++ b/lib/kernel/test/init_SUITE.erl
@@ -656,7 +656,7 @@ create_script(Config) ->
?line Apps = application_controller:which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"4.4\"}, \n"
diff --git a/lib/kernel/test/ram_file_SUITE.erl b/lib/kernel/test/ram_file_SUITE.erl
index 9b3fbb91fc..ab95a3ff5f 100644
--- a/lib/kernel/test/ram_file_SUITE.erl
+++ b/lib/kernel/test/ram_file_SUITE.erl
@@ -552,7 +552,7 @@ large_file_light(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
%% Marker for next test case that is to heavy to run in a suite.
?line ok = ?FILE_MODULE:write_file(
- filename:join(PrivDir, large_file_light),
+ filename:join(PrivDir, "large_file_light"),
<<"TAG">>),
%%
?line Data = "abcdefghijklmnopqrstuvwzyz",
@@ -582,7 +582,7 @@ large_file_heavy(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
%% Check previous test case marker.
case ?FILE_MODULE:read_file_info(
- filename:join(PrivDir, large_file_light)) of
+ filename:join(PrivDir, "large_file_light")) of
{ok,_} ->
{skipped,"Too heavy for casual testing!"};
_ ->
diff --git a/lib/kernel/test/zlib_SUITE.erl b/lib/kernel/test/zlib_SUITE.erl
index 9eb84c9167..4ad9c6923d 100644
--- a/lib/kernel/test/zlib_SUITE.erl
+++ b/lib/kernel/test/zlib_SUITE.erl
@@ -412,6 +412,7 @@ api_crc32(Config) when is_list(Config) ->
Compressed = list_to_binary(Compressed1 ++ Compressed2),
CRC1 = ?m( CRC1 when is_integer(CRC1), zlib:crc32(Z1)),
?m(CRC1 when is_integer(CRC1), zlib:crc32(Z1,Bin)),
+ ?m(CRC1 when is_integer(CRC1), zlib:crc32(Z1,binary_to_list(Bin))),
?m(CRC2 when is_integer(CRC2), zlib:crc32(Z1,Compressed)),
CRC2 = ?m(CRC2 when is_integer(CRC2), zlib:crc32(Z1,0,Compressed)),
?m(CRC3 when CRC2 /= CRC3, zlib:crc32(Z1,234,Compressed)),
@@ -437,6 +438,7 @@ api_adler32(Config) when is_list(Config) ->
Compressed2 = ?m(_, zlib:deflate(Z1, <<>>, finish)),
Compressed = list_to_binary(Compressed1 ++ Compressed2),
?m(ADLER1 when is_integer(ADLER1), zlib:adler32(Z1,Bin)),
+ ?m(ADLER1 when is_integer(ADLER1), zlib:adler32(Z1,binary_to_list(Bin))),
ADLER2 = ?m(ADLER2 when is_integer(ADLER2), zlib:adler32(Z1,Compressed)),
?m(ADLER2 when is_integer(ADLER2), zlib:adler32(Z1,1,Compressed)),
?m(ADLER3 when ADLER2 /= ADLER3, zlib:adler32(Z1,234,Compressed)),
@@ -464,6 +466,7 @@ api_un_compress(Config) when is_list(Config) ->
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<120,156,3>>)),
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<120,156,3,0>>)),
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<0,156,3,0,0,0,0,1>>)),
+ ?m(Bin, zlib:uncompress(binary_to_list(Comp))),
?m(Bin, zlib:uncompress(Comp)).
api_un_zip(doc) -> "Test zip";
@@ -472,10 +475,12 @@ api_un_zip(Config) when is_list(Config) ->
?m(?BARG,zlib:zip(not_a_binary)),
Bin = <<1,11,1,23,45>>,
?line Comp = zlib:zip(Bin),
+ ?m(Comp, zlib:zip(binary_to_list(Bin))),
?m(?BARG,zlib:unzip(not_a_binary)),
?m({'EXIT',{data_error,_}}, zlib:unzip(<<171,171,171,171,171>>)),
?m({'EXIT',{data_error,_}}, zlib:unzip(<<>>)),
?m(Bin, zlib:unzip(Comp)),
+ ?m(Bin, zlib:unzip(binary_to_list(Comp))),
%% OTP-6396
B = <<131,104,19,100,0,13,99,95,99,105,100,95,99,115,103,115,110,95,50,97,1,107,0,4,208,161,246,29,107,0,3,237,166,224,107,0,6,66,240,153,0,2,10,1,0,8,97,116,116,97,99,104,101,100,104,2,100,0,22,117,112,100,97,116,101,95,112,100,112,95,99,111,110,116,101,120,116,95,114,101,113,107,0,114,69,3,12,1,11,97,31,113,150,64,104,132,61,64,104,12,3,197,31,113,150,64,104,132,61,64,104,12,1,11,97,31,115,150,64,104,116,73,64,104,0,0,0,0,0,0,65,149,16,61,65,149,16,61,1,241,33,4,5,0,33,4,4,10,6,10,181,4,10,6,10,181,38,15,99,111,109,109,97,110,100,1,114,45,97,112,110,45,49,3,99,111,109,5,109,110,99,57,57,6,109,99,99,50,52,48,4,103,112,114,115,8,0,104,2,104,2,100,0,8,97,99,116,105,118,97,116,101,104,23,100,0,11,112,100,112,95,99,111,110,116,1,120,116,100,0,7,112,114,105,109,97,114,121,97,1,100,0,9,117,110,100,101,102,105,110,101,100,97,1,97,4,97,4,97,7,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,10100,100,0,9,117,110,100,101,102,105,110,101,100,100,0,5,102,97,108,115,101,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,1,101,100,97,0,100,0,9,117,110,100,101,102,105,110,101,100,107,0,4,16,0,1,144,107,0,4,61,139,186,181,107,0,4,10,8,201,49,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,0,101,100,100,0,9,117,110,100,101,102,105,110,101,100,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,21,106,108,0,0,0,3,104,2,97,1,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,167,20,104,2,97,4,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,21,104,2,97,10,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,26,106,100,0,5,118,101,114,57,57,100,0,9,117,110,0,101,102,105,110,101,100,107,0,2,0,244,107,0,4,10,6,102,195,107,0,4,10,6,102,195,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,101,100,107,0,125,248,143,0,203,25115,157,116,65,185,65,172,55,87,164,88,225,50,203,251,115,157,116,65,185,65,172,55,87,164,88,225,50,0,0,82,153,50,0,200,98,87,148,237,193,185,65,149,167,69,144,14,16,153,50,3,81,70,94,13,109,193,1,120,5,181,113,198,118,50,3,81,70,94,13,109,193,185,120,5,181,113,198,118,153,3,81,70,94,13,109,193,185,120,5,181,113,198,118,153,50,16,1,2,3,4,5,6,7,8,9,0,1,2,3,4,5,6,113,92,2,119,128,0,0,108,0,0,1,107,0,114,69,3,12,1,11,97,31,113,150,64,104,132,61,64,104,12,3,11,97,31,113,150,64,104,132,61,64,104,12,1,11,97,31,115,150,64,104,116,73,64,104,0,0,0,0,0,0,65,149,16,61,65,149,16,61,1,241,33,4,0,33,4,4,10,6,10,181,4,10,6,10,181,38,15,99,111,109,109,97,110,100,101,114,45,97,112,110,45,49,3,99,111,109,5,109,110,99,57,57,6,109,99,99,50,52,48,4,103,112,114,115,8,0,106>>,
@@ -504,10 +509,12 @@ api_g_un_zip(Config) when is_list(Config) ->
?m(?BARG,zlib:gzip(not_a_binary)),
Bin = <<1,11,1,23,45>>,
?line Comp = zlib:gzip(Bin),
+ ?m(Comp, zlib:gzip(binary_to_list(Bin))),
?m(?BARG, zlib:gunzip(not_a_binary)),
?m(?DATA_ERROR, zlib:gunzip(<<171,171,171,171,171>>)),
?m(?DATA_ERROR, zlib:gunzip(<<>>)),
?m(Bin, zlib:gunzip(Comp)),
+ ?m(Bin, zlib:gunzip(binary_to_list(Comp))),
%% Bad CRC; bad length.
BadCrc = bad_crc_data(),
@@ -844,6 +851,7 @@ dictionary_usage({run}) ->
?m(ok, zlib:inflateInit(Z2)),
?line {'EXIT',{{need_dictionary,DictID},_}} = (catch zlib:inflate(Z2, Compressed)),
?m(ok, zlib:inflateSetDictionary(Z2, Dict)),
+ ?m(ok, zlib:inflateSetDictionary(Z2, binary_to_list(Dict))),
?line Uncompressed = ?m(B when is_list(B), zlib:inflate(Z2, [])),
?m(ok, zlib:inflateEnd(Z2)),
?m(ok, zlib:close(Z2)),
diff --git a/lib/observer/src/Makefile b/lib/observer/src/Makefile
index 2d06cb6bc4..3875b62101 100644
--- a/lib/observer/src/Makefile
+++ b/lib/observer/src/Makefile
@@ -56,13 +56,16 @@ TARGET_FILES= $(MODULES:%=$(EBIN)/%.$(EMULATOR)) $(APP_TARGET) $(APPUP_TARGET)
PRIVDIR= ../priv
WEBTOOLFILES= $(PRIVDIR)/crashdump_viewer.tool
BINDIR= $(PRIVDIR)/bin
+ifeq ($(findstring win32,$(TARGET)),win32)
+WIN32_EXECUTABLES= $(BINDIR)/etop.bat $(BINDIR)/getop.bat $(BINDIR)/cdv.bat
+else
+WIN32_EXECUTABLES=
+endif
EXECUTABLES= \
$(BINDIR)/etop \
$(BINDIR)/getop \
$(BINDIR)/cdv \
- $(BINDIR)/etop.bat \
- $(BINDIR)/getop.bat \
- $(BINDIR)/cdv.bat
+ $(WIN32_EXECUTABLES)
CDVDIR= $(PRIVDIR)/crashdump_viewer
GIF_FILES= \
$(CDVDIR)/collapsd.gif \
diff --git a/lib/odbc/c_src/odbcserver.c b/lib/odbc/c_src/odbcserver.c
index 11e311d72d..ab2d7fe210 100644
--- a/lib/odbc/c_src/odbcserver.c
+++ b/lib/odbc/c_src/odbcserver.c
@@ -772,6 +772,7 @@ static db_result_msg db_param_query(byte *buffer, db_state *state)
}
associated_result_set(state) = FALSE;
param_query(state) = TRUE;
+ out_params(state) = FALSE;
msg = encode_empty_message();
diff --git a/lib/odbc/test/mysql.erl b/lib/odbc/test/mysql.erl
index 49068c4356..c990793213 100644
--- a/lib/odbc/test/mysql.erl
+++ b/lib/odbc/test/mysql.erl
@@ -26,7 +26,22 @@
%-------------------------------------------------------------------------
connection_string() ->
- "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';".
+ case test_server:os_type() of
+ {unix, linux} ->
+ "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ {unix, sunos} ->
+ solaris_str();
+ {unix, darwin} ->
+ "DSN=MySQLMac;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
+
+solaris_str() ->
+ case erlang:system_info(system_architecture) of
+ "sparc" ++ _ ->
+ "DSN=MySQLSolaris10;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ "i386" ++ _ ->
+ "DSN=MySQLSolaris10i386;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
%-------------------------------------------------------------------------
insert_result() ->
diff --git a/lib/odbc/test/odbc_connect_SUITE.erl b/lib/odbc/test/odbc_connect_SUITE.erl
index e59be772e3..a076c4dfff 100644
--- a/lib/odbc/test/odbc_connect_SUITE.erl
+++ b/lib/odbc/test/odbc_connect_SUITE.erl
@@ -76,20 +76,26 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- case (catch odbc:start()) of
- ok ->
- case catch odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
- {ok, Ref} ->
- odbc:disconnect(Ref),
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC is not properly setup"}
- end;
- _ ->
- {skip,"ODBC not startable"}
- end.
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ case catch odbc:connect(?RDBMS:connection_string(),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
+ {ok, Ref} ->
+ odbc:disconnect(Ref),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config];
+ _ ->
+ {skip, "ODBC is not properly setup"}
+ end;
+ _ ->
+ {skip,"ODBC not startable"}
+ end
+ end.
+
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
diff --git a/lib/odbc/test/odbc_data_type_SUITE.erl b/lib/odbc/test/odbc_data_type_SUITE.erl
index 099ae0aa7d..d61a91f973 100644
--- a/lib/odbc/test/odbc_data_type_SUITE.erl
+++ b/lib/odbc/test/odbc_data_type_SUITE.erl
@@ -89,17 +89,15 @@ init_per_group(GroupName, Config) when GroupName == fixed_char;
end;
init_per_group(unicode, Config) ->
- %% Uses parameterized queries
- case {os:type(), erlang:system_info(wordsize)} of
+ case {os:type(), erlang:system_info({wordsize, external})} of
{{unix, _}, 4} ->
Config;
{{unix, _}, _} ->
- {skip, "Not supported by driver"};
+ {skip, "Postgres drivers pre version psqlODBC 08.04.0200 have utf8-problems"};
_ ->
Config
end;
-
init_per_group(_GroupName, Config) ->
Config.
@@ -115,14 +113,18 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- case (catch odbc:start()) of
- ok ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC not startable"}
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
end.
-
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
diff --git a/lib/odbc/test/odbc_query_SUITE.erl b/lib/odbc/test/odbc_query_SUITE.erl
index 76a214d553..1852678b4b 100644
--- a/lib/odbc/test/odbc_query_SUITE.erl
+++ b/lib/odbc/test/odbc_query_SUITE.erl
@@ -89,6 +89,7 @@ init_per_group(scrollable_cursors, Config) ->
_ ->
Config
end;
+
init_per_group(_,Config) ->
Config.
@@ -105,11 +106,16 @@ end_per_group(_GroupName, Config) ->
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) when is_list(Config) ->
- case (catch odbc:start()) of
- ok ->
- [{tableName, odbc_test_lib:unique_table_name()}| Config];
- _ ->
- {skip, "ODBC not startable"}
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
end.
%%--------------------------------------------------------------------
diff --git a/lib/odbc/test/odbc_start_SUITE.erl b/lib/odbc/test/odbc_start_SUITE.erl
index 440c0ca921..e3a3440559 100644
--- a/lib/odbc/test/odbc_start_SUITE.erl
+++ b/lib/odbc/test/odbc_start_SUITE.erl
@@ -39,11 +39,18 @@
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) ->
- case code:which(odbc) of
- non_existing ->
- {skip, "No ODBC built"};
- _ ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case code:which(odbc) of
+ non_existing ->
+ {skip, "No ODBC built"};
+ _ ->
+ %% Make sure odbc is not already started
+ odbc:stop(),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ end
end.
%%--------------------------------------------------------------------
diff --git a/lib/odbc/test/odbc_test.hrl b/lib/odbc/test/odbc_test.hrl
index 397d04756b..f7bb338a7f 100644
--- a/lib/odbc/test/odbc_test.hrl
+++ b/lib/odbc/test/odbc_test.hrl
@@ -25,14 +25,16 @@
-define(RDBMS, case os:type() of
{unix, sunos} ->
- postgres;
+ mysql;
{unix,linux} ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
mysql;
_ ->
postgres
end;
+ {unix, darwin} ->
+ mysql;
{win32, _} ->
sqlserver
end).
diff --git a/lib/odbc/test/odbc_test_lib.erl b/lib/odbc/test/odbc_test_lib.erl
index 3e78105cf3..4d7d1ae2fa 100644
--- a/lib/odbc/test/odbc_test_lib.erl
+++ b/lib/odbc/test/odbc_test_lib.erl
@@ -36,7 +36,7 @@ match_float(Float, Match, Delta) ->
(Float < Match + Delta) and (Float > Match - Delta).
odbc_check() ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
ok;
Other ->
@@ -71,9 +71,39 @@ strict(_,_) ->
ok.
platform_options() ->
+ [].
+
+skip() ->
case os:type() of
+ {unix, linux} ->
+ Issue = linux_issue(),
+ is_sles9(Issue);
{unix, sunos} ->
- [{scrollable_cursors, off}];
+ not supported_solaris();
_ ->
- []
+ false
end.
+
+supported_solaris() ->
+ case os:version() of
+ {_,10,_} ->
+ true;
+ _ ->
+ false
+ end.
+
+linux_issue() ->
+ {ok, Binary} = file:read_file("/etc/issue"),
+ string:tokens(binary_to_list(Binary), " ").
+
+is_sles11(IssueTokens) ->
+ lists:member("11", IssueTokens).
+
+is_sles10(IssueTokens) ->
+ lists:member("10", IssueTokens).
+
+is_sles9(IssueTokens) ->
+ lists:member("9", IssueTokens).
+
+is_ubuntu(IssueTokens) ->
+ lists:member("Ubuntu", IssueTokens).
diff --git a/lib/odbc/test/postgres.erl b/lib/odbc/test/postgres.erl
index 26a2913d46..d564dbd5ff 100644
--- a/lib/odbc/test/postgres.erl
+++ b/lib/odbc/test/postgres.erl
@@ -30,7 +30,7 @@ connection_string() ->
{unix, sunos} ->
"DSN=Postgres;UID=odbctest";
{unix, linux} ->
- Size = erlang:system_info(wordsize),
+ Size = erlang:system_info({wordsize, external}),
linux_dist_connection_string(Size)
end.
@@ -43,7 +43,12 @@ linux_dist_connection_string(4) ->
end;
linux_dist_connection_string(_) ->
- "DSN=PostgresLinux64;UID=odbctest".
+ case linux_dist() of
+ "ubuntu" ->
+ "DSN=PostgresLinux64Ubuntu;UID=odbctest";
+ _ ->
+ "DSN=PostgresLinux64;UID=odbctest"
+ end.
linux_dist() ->
case file:read_file("/etc/issue") of
diff --git a/lib/parsetools/doc/src/yecc.xml b/lib/parsetools/doc/src/yecc.xml
index c712609cf4..1d2a985d7d 100644
--- a/lib/parsetools/doc/src/yecc.xml
+++ b/lib/parsetools/doc/src/yecc.xml
@@ -425,9 +425,9 @@ myparser:parse_and_scan({Mod, Tokenizer, Args}) </code>
Nonterminals E T F.
Terminals '+' '*' '(' ')' number.
Rootsymbol E.
-E -> E '+' T: ['$1', '$2', '$3'].
+E -> E '+' T: ['$2', '$1', '$3'].
E -> T : '$1'.
-T -> T '*' F: ['$1', '$2', '$3'].
+T -> T '*' F: ['$2', '$1', '$3'].
T -> F : '$1'.
F -> '(' E ')' : '$2'.
F -> number : '$1'. </code>
@@ -438,8 +438,8 @@ Terminals '+' '*' '(' ')' number.
Rootsymbol E.
Left 100 '+'.
Left 200 '*'.
-E -> E '+' E : ['$1', '$2', '$3'].
-E -> E '*' E : ['$1', '$2', '$3'].
+E -> E '+' E : ['$2', '$1', '$3'].
+E -> E '*' E : ['$2', '$1', '$3'].
E -> '(' E ')' : '$2'.
E -> number : '$1'. </code>
<p>3. An overloaded minus operator:</p>
diff --git a/lib/parsetools/src/leex.erl b/lib/parsetools/src/leex.erl
index 942e9928b1..cdf20461d9 100644
--- a/lib/parsetools/src/leex.erl
+++ b/lib/parsetools/src/leex.erl
@@ -73,12 +73,15 @@
%%% Interface to erl_compile.
compile(Input0, Output0,
- #options{warning = WarnLevel, verbose=Verbose, includes=Includes}) ->
+ #options{warning = WarnLevel, verbose=Verbose, includes=Includes,
+ specific=Specific}) ->
Input = assure_extension(shorten_filename(Input0), ".xrl"),
Output = assure_extension(shorten_filename(Output0), ".erl"),
Includefile = lists:sublist(Includes, 1),
+ Werror = proplists:get_bool(warnings_as_errors, Specific),
Opts = [{scannerfile,Output},{includefile,Includefile},{verbose,Verbose},
- {report_errors,true},{report_warnings,WarnLevel > 0}],
+ {report_errors,true},{report_warnings,WarnLevel > 0},
+ {warnings_as_errors, Werror}],
case file(Input, Opts) of
{ok, _} ->
ok;
@@ -107,7 +110,7 @@ file(File, Opts0) ->
St = try
{ok,REAs,Actions,Code,St2} = parse_file(St1),
{DFA,DF} = make_dfa(REAs, St2),
- case werr(St2) of
+ case werror(St2) of
false ->
St3 = out_file(St2, DFA, DF, Actions, Code),
case lists:member(dfa_graph, St3#leex.opts) of
@@ -259,9 +262,9 @@ leex_ret(St) ->
report_warnings(St),
Es = pack_errors(St#leex.errors),
Ws = pack_warnings(St#leex.warnings),
- Werr = werr(St),
+ Werror = werror(St),
if
- Werr ->
+ Werror ->
do_error_return(St, Es, Ws);
Es =:= [] ->
case member(return_warnings, St#leex.opts) of
@@ -278,9 +281,9 @@ do_error_return(St, Es, Ws) ->
false -> error
end.
-werr(St) ->
- member(warnings_as_errors, St#leex.opts)
- andalso length(St#leex.warnings) > 0.
+werror(St) ->
+ St#leex.warnings =/= []
+ andalso member(warnings_as_errors, St#leex.opts).
pack_errors([{File,_} | _] = Es) ->
[{File, flatmap(fun({_,E}) -> [E] end, sort(Es))}];
@@ -304,15 +307,24 @@ report_errors(St) ->
end, report_errors, St#leex.opts).
report_warnings(St) ->
- when_opt(fun () ->
- foreach(fun({File,{none,Mod,W}}) ->
- io:fwrite("~s: Warning: ~s\n",
- [File,Mod:format_error(W)]);
- ({File,{Line,Mod,W}}) ->
- io:fwrite("~s:~w: Warning: ~s\n",
- [File,Line,Mod:format_error(W)])
- end, sort(St#leex.warnings))
- end, report_warnings, St#leex.opts).
+ Werror = member(warnings_as_errors, St#leex.opts),
+ Prefix = case Werror of
+ true -> "";
+ false -> "Warning: "
+ end,
+ ReportWerror = Werror andalso member(report_errors, St#leex.opts),
+ ShouldReport = member(report_warnings, St#leex.opts) orelse ReportWerror,
+ when_bool(fun () ->
+ foreach(fun({File,{none,Mod,W}}) ->
+ io:fwrite("~s: ~s~s\n",
+ [File,Prefix,
+ Mod:format_error(W)]);
+ ({File,{Line,Mod,W}}) ->
+ io:fwrite("~s:~w: ~s~s\n",
+ [File,Line,Prefix,
+ Mod:format_error(W)])
+ end, sort(St#leex.warnings))
+ end, ShouldReport).
-spec add_error(_, #leex{}) -> no_return().
add_error(E, St) ->
@@ -360,6 +372,12 @@ when_opt(Do, Opt, Opts) ->
false -> ok
end.
+when_bool(Do, Bool) ->
+ case Bool of
+ true -> Do();
+ false -> ok
+ end.
+
verbose_print(St, Format, Args) ->
when_opt(fun () -> io:fwrite(Format, Args) end, verbose, St#leex.opts).
diff --git a/lib/parsetools/src/yecc.erl b/lib/parsetools/src/yecc.erl
index 72cff3af92..354d56527d 100644
--- a/lib/parsetools/src/yecc.erl
+++ b/lib/parsetools/src/yecc.erl
@@ -133,12 +133,15 @@
%%% Interface to erl_compile.
compile(Input0, Output0,
- #options{warning = WarnLevel, verbose=Verbose, includes=Includes}) ->
+ #options{warning = WarnLevel, verbose=Verbose, includes=Includes,
+ specific=Specific}) ->
Input = shorten_filename(Input0),
Output = shorten_filename(Output0),
Includefile = lists:sublist(Includes, 1),
+ Werror = proplists:get_bool(warnings_as_errors, Specific),
Opts = [{parserfile,Output}, {includefile,Includefile}, {verbose,Verbose},
- {report_errors, true}, {report_warnings, WarnLevel > 0}],
+ {report_errors, true}, {report_warnings, WarnLevel > 0},
+ {warnings_as_errors, Werror}],
case file(Input, Opts) of
{ok, _OutFile} ->
ok;
@@ -411,15 +414,15 @@ infile(Parent, Infilex, Options) ->
{error, Reason} ->
add_error(St0#yecc.infile, none, {file_error, Reason}, St0)
end,
- case {St#yecc.errors, werr(St)} of
+ case {St#yecc.errors, werror(St)} of
{[], false} -> ok;
_ -> _ = file:delete(St#yecc.outfile)
end,
Parent ! {self(), yecc_ret(St)}.
-werr(St) ->
- member(warnings_as_errors, St#yecc.options)
- andalso length(St#yecc.warnings) > 0.
+werror(St) ->
+ St#yecc.warnings =/= []
+ andalso member(warnings_as_errors, St#yecc.options).
outfile(St0) ->
case file:open(St0#yecc.outfile, [write, delayed_write]) of
@@ -783,9 +786,9 @@ yecc_ret(St0) ->
report_warnings(St),
Es = pack_errors(St#yecc.errors),
Ws = pack_warnings(St#yecc.warnings),
- Werr = werr(St),
+ Werror = werror(St),
if
- Werr ->
+ Werror ->
do_error_return(St, Es, Ws);
Es =:= [] ->
case member(return_warnings, St#yecc.options) of
@@ -849,14 +852,22 @@ report_errors(St) ->
end.
report_warnings(St) ->
- case member(report_warnings, St#yecc.options) of
+ Werror = member(warnings_as_errors, St#yecc.options),
+ Prefix = case Werror of
+ true -> "";
+ false -> "Warning: "
+ end,
+ ReportWerror = Werror andalso member(report_errors, St#yecc.options),
+ case member(report_warnings, St#yecc.options) orelse ReportWerror of
true ->
foreach(fun({File,{none,Mod,W}}) ->
- io:fwrite(<<"~s: Warning: ~s\n">>,
- [File,Mod:format_error(W)]);
+ io:fwrite(<<"~s: ~s~s\n">>,
+ [File,Prefix,
+ Mod:format_error(W)]);
({File,{Line,Mod,W}}) ->
- io:fwrite(<<"~s:~w: Warning: ~s\n">>,
- [File,Line,Mod:format_error(W)])
+ io:fwrite(<<"~s:~w: ~s~s\n">>,
+ [File,Line,Prefix,
+ Mod:format_error(W)])
end, sort(St#yecc.warnings));
false ->
ok
diff --git a/lib/parsetools/test/leex_SUITE.erl b/lib/parsetools/test/leex_SUITE.erl
index 48312445ef..1e50aedf07 100644
--- a/lib/parsetools/test/leex_SUITE.erl
+++ b/lib/parsetools/test/leex_SUITE.erl
@@ -152,6 +152,7 @@ file(Config) when is_list(Config) ->
?line writable(Dotfile),
file:delete(Dotfile),
+ ok = file:delete(Scannerfile),
Warn = <<"Definitions.1998\n"
"D = [0-9]\n"
"Rules.\n"
@@ -159,11 +160,15 @@ file(Config) when is_list(Config) ->
"Erlang code.\n">>,
ok = file:write_file(Filename, Warn),
error = leex:file(Filename, [warnings_as_errors]),
+ false = filelib:is_regular(Scannerfile),
error = leex:file(Filename, [return_warnings,warnings_as_errors]),
- {ok,Scannerfile,[{Filename,[{1,leex,ignored_characters}]}]} =
- leex:file(Filename, [return_warnings]),
+ false = filelib:is_regular(Scannerfile),
{error,_,[{Filename,[{1,leex,ignored_characters}]}]} =
- leex:file(Filename, [return_errors,warnings_as_errors]),
+ leex:file(Filename, [return_errors,warnings_as_errors]),
+ false = filelib:is_regular(Scannerfile),
+ {ok,Scannerfile,[{Filename,[{1,leex,ignored_characters}]}]} =
+ leex:file(Filename, [return_warnings]),
+ true = filelib:is_regular(Scannerfile),
file:delete(Filename),
ok.
diff --git a/lib/parsetools/test/yecc_SUITE.erl b/lib/parsetools/test/yecc_SUITE.erl
index 0133524950..a5f66b48e9 100644
--- a/lib/parsetools/test/yecc_SUITE.erl
+++ b/lib/parsetools/test/yecc_SUITE.erl
@@ -173,6 +173,7 @@ syntax(Config) when is_list(Config) ->
%% Report errors. Very simple test of format_error/1.
Ret = [return, {report, true}],
Filename = filename:join(Dir, "file.yrl"),
+ Parserfile = filename:join(Dir, "file.erl"),
Parserfile1 = filename:join(Dir, "a file"),
?line ok = file:write_file(Filename, <<"">>),
@@ -248,12 +249,17 @@ syntax(Config) when is_list(Config) ->
yecc:file(Filename, Ret),
%% Bad declaration with warnings_as_errors.
+ ok = file:delete(Parserfile),
error = yecc:file(Filename, [warnings_as_errors]),
+ false = filelib:is_regular(Parserfile),
error = yecc:file(Filename, [return_warnings,warnings_as_errors]),
- {ok,_,[{_,[{2,yecc,bad_declaration}]}]} =
- yecc:file(Filename, [return_warnings]),
+ false = filelib:is_regular(Parserfile),
{error,_,[{_,[{2,yecc,bad_declaration}]}]} =
yecc:file(Filename, [return_errors,warnings_as_errors]),
+ false = filelib:is_regular(Parserfile),
+ {ok,_,[{_,[{2,yecc,bad_declaration}]}]} =
+ yecc:file(Filename, [return_warnings]),
+ true = filelib:is_regular(Parserfile),
%% Bad declaration.
?line ok = file:write_file(Filename,
diff --git a/lib/percept/src/percept_db.erl b/lib/percept/src/percept_db.erl
index 52e9afb78f..61b68ce44f 100644
--- a/lib/percept/src/percept_db.erl
+++ b/lib/percept/src/percept_db.erl
@@ -92,7 +92,7 @@ restart(PerceptDB)->
stop_sync(PerceptDB),
do_start().
-%% @spec do_start(pid()) -> pid()
+%% @spec do_start() -> pid()
%% @private
%% @doc starts the percept database.
@@ -131,6 +131,7 @@ stop_sync(Pid)->
{'DOWN', MonitorRef, _Type, Pid, _Info}->
true
after ?STOP_TIMEOUT->
+ erlang:demonitor(MonitorRef, [flush]),
exit(Pid, kill)
end.
@@ -166,14 +167,14 @@ insert(Trace) ->
select(Query) ->
percept_db ! {select, self(), Query},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec select(atom(), list()) -> Result
%% @equiv select({Table,Options})
select(Table, Options) ->
percept_db ! {select, self(), {Table, Options}},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec consolidate() -> Result
%% @doc Checks timestamp and state-flow inconsistencies in the
@@ -213,7 +214,7 @@ loop_percept_db() ->
insert_trace(clean_trace(Trace)),
loop_percept_db();
{select, Pid, Query} ->
- Pid ! select_query(Query),
+ Pid ! {result, select_query(Query)},
loop_percept_db();
{action, stop} ->
stopped;
@@ -222,7 +223,7 @@ loop_percept_db() ->
loop_percept_db();
{operate, Pid, {Table, {Fun, Start}}} ->
Result = ets:foldl(Fun, Start, Table),
- Pid ! Result,
+ Pid ! {result, Result},
loop_percept_db();
Unhandled ->
io:format("loop_percept_db, unhandled query: ~p~n", [Unhandled]),
diff --git a/lib/public_key/asn1/README b/lib/public_key/asn1/README
index 5fb8cf9725..2a880e2d51 100644
--- a/lib/public_key/asn1/README
+++ b/lib/public_key/asn1/README
@@ -46,6 +46,6 @@ diff -r1.1 PKIXAttributeCertificate.asn1
---
> version AttCertVersion, -- version is v2
-4. Defenitions of publuic keys from PKCS-1.asn1 present in
+4. Definitions of public keys from PKCS-1.asn1 present in
PKIX1Algorithms88.asn1 where removed as we take them directly from
PKCS-1.asn1 \ No newline at end of file
diff --git a/lib/public_key/doc/src/public_key.xml b/lib/public_key/doc/src/public_key.xml
index d60d91cd83..9a3832c68b 100644
--- a/lib/public_key/doc/src/public_key.xml
+++ b/lib/public_key/doc/src/public_key.xml
@@ -63,7 +63,7 @@
<p><code>pki_asn1_type() = 'Certificate' | 'RSAPrivateKey'| 'RSAPublicKey'
'DSAPrivateKey' | 'DSAPublicKey' | 'DHParameter' | 'SubjectPublicKeyInfo'</code></p>
- <p><code>pem_entry () = {pki_asn1_type(), binary() %% DER or encrypted DER
+ <p><code>pem_entry () = {pki_asn1_type(), binary(), %% DER or encrypted DER
not_encrypted | {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}}.</code></p>
<p><code>rsa_public_key() = #'RSAPublicKey'{}</code></p>
@@ -72,8 +72,6 @@
<p><code>dsa_public_key() = {integer(), #'Dss-Parms'{}} </code></p>
- <p><code>rsa_private_key() = #'RSAPrivateKey'{} </code></p>
-
<p><code>dsa_private_key() = #'DSAPrivateKey'{}</code></p>
<p><code> public_crypt_options() = [{rsa_pad, rsa_padding()}]. </code></p>
@@ -149,7 +147,7 @@
<name>der_decode(Asn1type, Der) -> term()</name>
<fsummary> Decodes a public key asn1 der encoded entity.</fsummary>
<type>
- <v>Asn1Type = atom() -</v>
+ <v>Asn1Type = atom()</v>
<d> ASN.1 type present in the public_key applications
asn1 specifications.</d>
<v>Der = der_encoded()</v>
@@ -166,7 +164,8 @@
<v>Asn1Type = atom()</v>
<d> Asn1 type present in the public_key applications
ASN.1 specifications.</d>
- <v>Entity = term() - The erlang representation of <c> Asn1Type</c></v>
+ <v>Entity = term()</v>
+ <d>The erlang representation of <c>Asn1Type</c></d>
</type>
<desc>
<p> Encodes a public key entity with ASN.1 DER encoding.</p>
@@ -218,12 +217,13 @@
<fsummary> Creates a pem entry that can be fed to pem_encode/1.</fsummary>
<type>
<v>Asn1Type = pki_asn1_type()</v>
- <v>Entity = term() - The Erlang representation of
+ <v>Entity = term()</v>
+ <d>The Erlang representation of
<c>Asn1Type</c>. If <c>Asn1Type</c> is 'SubjectPublicKeyInfo'
then <c>Entity</c> must be either an rsa_public_key() or a
dsa_public_key() and this function will create the appropriate
'SubjectPublicKeyInfo' entry.
- </v>
+ </d>
<v>CipherInfo = {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}</v>
<v>Password = string()</v>
</type>
@@ -281,7 +281,7 @@
<desc>
<p>Der encodes a pkix x509 certificate or part of such a
certificate. This function must be used for encoding certificates or parts of certificates
- that are decoded/created on the otp format, whereas for the plain format this
+ that are decoded/created in the otp format, whereas for the plain format this
function will directly call der_encode/2. </p>
</desc>
</func>
diff --git a/lib/public_key/src/public_key.erl b/lib/public_key/src/public_key.erl
index 2901020e83..33fcce2c44 100644
--- a/lib/public_key/src/public_key.erl
+++ b/lib/public_key/src/public_key.erl
@@ -488,9 +488,10 @@ pkix_path_validation(PathErr, [Cert | Chain], Options0) when is_atom(PathErr)->
_:_ ->
{error, Reason}
end;
-pkix_path_validation(TrustedCert, CertChain, Options) when
- is_binary(TrustedCert) -> OtpCert = pkix_decode_cert(TrustedCert,
- otp), pkix_path_validation(OtpCert, CertChain, Options);
+pkix_path_validation(TrustedCert, CertChain, Options)
+ when is_binary(TrustedCert) ->
+ OtpCert = pkix_decode_cert(TrustedCert, otp),
+ pkix_path_validation(OtpCert, CertChain, Options);
pkix_path_validation(#'OTPCertificate'{} = TrustedCert, CertChain, Options)
when is_list(CertChain), is_list(Options) ->
diff --git a/lib/sasl/doc/src/release_handler.xml b/lib/sasl/doc/src/release_handler.xml
index 4a973bc5ed..5ac0dc1acc 100644
--- a/lib/sasl/doc/src/release_handler.xml
+++ b/lib/sasl/doc/src/release_handler.xml
@@ -4,7 +4,7 @@
<erlref>
<header>
<copyright>
- <year>1996</year><year>2009</year>
+ <year>1996</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -159,9 +159,12 @@ old reboot_old permanent
<funcs>
<func>
<name>check_install_release(Vsn) -> {ok, OtherVsn, Descr} | {error, Reason}</name>
+ <name>check_install_release(Vsn,Opts) -> {ok, OtherVsn, Descr} | {error, Reason}</name>
<fsummary>Check installation of a release in the system.</fsummary>
<type>
<v>Vsn = OtherVsn = string()</v>
+ <v>Opts = [Opt]</v>
+ <v>Opt = purge</v>
<v>Descr = term()</v>
<v>Reason = term()</v>
</type>
@@ -179,6 +182,11 @@ old reboot_old permanent
upgrade script.</p>
<p>Returns the same as <c>install_release/1</c>. <c>Descr</c>
defaults to "" if no <c>relup</c> file is found.</p>
+ <p>If the option <c>purge</c> is given, all old code that can
+ be soft purged will be purged after all other checks are
+ successfully completed. This can be useful in order to
+ reduce the time needed by <seealso
+ marker="#install_release/1">install_release</seealso>.</p>
</desc>
</func>
<func>
@@ -299,6 +307,24 @@ release_handler:set_unpacked(RelFile, [{myapp,"1.0","/home/user"},...]).
<c>{update_paths,true}</c>, afterwards
<c>code:lib_dir(myapp)</c> will return
<c>/home/user/myapp-1.0</c>.</p>
+ <note>
+ <p>Installing a new release might be quite time consuming if
+ there are many processes in the system. The reason is that
+ each process must be checked for references to old code
+ before a module can be purged. This check might lead to
+ garbage collections and copying of data.</p>
+ <p>If you wish to speed up the execution of
+ <c>install_release</c>, then you may call <seealso
+ marker="#check_install_release/1">check_install_release</seealso>
+ first, using the option <c>purge</c>. This will do the same
+ check for old code, and then purge all modules that can be
+ soft purged. The purged modules will then no longer have any
+ old code, and <c>install_release</c> will not need to do the
+ checks.</p>
+ <p>Obviously, this will not reduce the overall time for the
+ upgrade, but it will allow checks and purge to be executed
+ in the background before the real upgrade is started.</p>
+ </note>
</desc>
</func>
<func>
diff --git a/lib/sasl/doc/src/systools.xml b/lib/sasl/doc/src/systools.xml
index 883c9c372b..8c1c327d74 100644
--- a/lib/sasl/doc/src/systools.xml
+++ b/lib/sasl/doc/src/systools.xml
@@ -45,7 +45,8 @@
<v>Name = string()</v>
<v>UpFrom = DownTo = [Name | {Name,Descr}]</v>
<v>&nbsp;Descr = term()</v>
- <v>Opt = {path,[Dir]} | restart_emulator | silent | noexec | {outdir,Dir}</v>
+ <v>Opt = {path,[Dir]} | restart_emulator | silent | noexec | {outdir,Dir}
+ | warnings_as_errors</v>
<v>&nbsp;Dir = string()</v>
<v>Result = ok | error | {ok,Relup,Module,Warnings} | {error,Module,Error}</v>
<v>&nbsp;Relup - see relup(4)</v>
@@ -122,6 +123,8 @@
<p>If the option <c>noexec</c> is provided, the function returns
the same values as for <c>silent</c> but no <c>relup</c> file
is created.</p>
+ <p>If the option <c>warnings_as_errors</c> is provided, warnings
+ are treated as errors.</p>
</desc>
</func>
<func>
@@ -130,7 +133,8 @@
<fsummary>Generate a boot script <c>.script/.boot</c>.</fsummary>
<type>
<v>Name = string()</v>
- <v>Opt = src_tests | {path,[Dir]} | local | {variables,[Var]} | exref | {exref,[App]}] | silent | {outdir,Dir}</v>
+ <v>Opt = src_tests | {path,[Dir]} | local | {variables,[Var]} | exref | {exref,[App]}]
+ | silent | {outdir,Dir} | warnings_as_errors</v>
<v>&nbsp;Dir = string()</v>
<v>&nbsp;Var = {VarName,Prefix}</v>
<v>&nbsp;&nbsp;VarName = Prefix = string()</v>
@@ -232,6 +236,8 @@
Warnings and errors can be converted to strings by calling
<c>Module:format_warning(Warnings)</c> or
<c>Module:format_error(Error)</c>.</p>
+ <p>If the option <c>warnings_as_errors</c> is provided, warnings
+ are treated as errors.</p>
</desc>
</func>
<func>
diff --git a/lib/sasl/examples/src/Makefile b/lib/sasl/examples/src/Makefile
index 4a4e04a536..c58f651696 100644
--- a/lib/sasl/examples/src/Makefile
+++ b/lib/sasl/examples/src/Makefile
@@ -66,7 +66,7 @@ release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/examples/src
$(INSTALL_DIR) $(RELSYSDIR)/examples/ebin
(cd ..; tar cf - src ebin | (cd $(RELSYSDIR)/examples; tar xf -))
- chmod -f -R ug+w $(RELSYSDIR)/examples
+ chmod -R ug+w $(RELSYSDIR)/examples
release_docs_spec:
diff --git a/lib/sasl/src/release_handler.erl b/lib/sasl/src/release_handler.erl
index ab54b1d00b..bc08f94dff 100644
--- a/lib/sasl/src/release_handler.erl
+++ b/lib/sasl/src/release_handler.erl
@@ -25,8 +25,8 @@
-export([start_link/0,
create_RELEASES/1, create_RELEASES/2, create_RELEASES/4,
unpack_release/1,
- check_install_release/1, install_release/1, install_release/2,
- remove_release/1,
+ check_install_release/1, check_install_release/2,
+ install_release/1, install_release/2, remove_release/1,
which_releases/0, make_permanent/1, reboot_old_release/1,
set_unpacked/2, set_removed/1, install_file/2]).
-export([upgrade_app/2, downgrade_app/2, downgrade_app/3,
@@ -149,15 +149,35 @@ unpack_release(ReleaseName) ->
%%-----------------------------------------------------------------
%% Purpose: Checks the relup script for the specified version.
%% The release must be unpacked.
+%% Options = [purge] - all old code that can be soft purged
+%% will be purged if all checks succeeds. This can be usefull
+%% in order to reduce time needed in the following call to
+%% install_release.
%% Returns: {ok, FromVsn, Descr} | {error, Reason}
-%% Reason = {already_installed, Vsn} |
+%% Reason = {illegal_option, IllegalOpt} |
+%% {already_installed, Vsn} |
%% {bad_relup_file, RelFile} |
%% {no_such_release, Vsn} |
%% {no_such_from_vsn, Vsn} |
%% exit_reason()
%%-----------------------------------------------------------------
check_install_release(Vsn) ->
- call({check_install_release, Vsn}).
+ check_install_release(Vsn, []).
+
+check_install_release(Vsn, Opts) ->
+ case check_check_install_options(Opts, false) of
+ {ok,Purge} ->
+ call({check_install_release, Vsn, Purge});
+ Error ->
+ Error
+ end.
+
+check_check_install_options([purge|Opts], _) ->
+ check_check_install_options(Opts, true);
+check_check_install_options([Illegal|_],_Purge) ->
+ {error,{illegal_option,Illegal}};
+check_check_install_options([],Purge) ->
+ {ok,Purge}.
%%-----------------------------------------------------------------
@@ -541,11 +561,12 @@ handle_call({unpack_release, ReleaseName}, _From, S)
handle_call({unpack_release, _ReleaseName}, _From, S) ->
{reply, {error, client_node}, S};
-handle_call({check_install_release, Vsn}, _From, S) ->
+handle_call({check_install_release, Vsn, Purge}, _From, S) ->
case catch do_check_install_release(S#state.rel_dir,
Vsn,
S#state.releases,
- S#state.masters) of
+ S#state.masters,
+ Purge) of
{ok, CurrentVsn, Descr} ->
{reply, {ok, CurrentVsn, Descr}, S};
{error, Reason} ->
@@ -855,7 +876,7 @@ check_path_response(Path, {ok, _Info}) ->
check_path_response(Path, {error, _Reason}) ->
throw({error, {no_such_directory, Path}}).
-do_check_install_release(RelDir, Vsn, Releases, Masters) ->
+do_check_install_release(RelDir, Vsn, Releases, Masters, Purge) ->
case lists:keysearch(Vsn, #release.vsn, Releases) of
{value, #release{status = current}} ->
{error, {already_installed, Vsn}};
@@ -880,7 +901,20 @@ do_check_install_release(RelDir, Vsn, Releases, Masters) ->
case get_rh_script(LatestRelease, Release, RelDir, Masters) of
{ok, {CurrentVsn, Descr, Script}} ->
case catch check_script(Script, Libs) of
- ok ->
+ {ok,SoftPurgeMods} when Purge=:=true ->
+ %% Get modules with brutal_purge
+ %% instructions, but that can be
+ %% soft purged
+ {ok,BrutalPurgeMods} =
+ release_handler_1:check_old_processes(
+ Script,brutal_purge),
+ lists:foreach(
+ fun(Mod) ->
+ catch erlang:purge_module(Mod)
+ end,
+ SoftPurgeMods ++ BrutalPurgeMods),
+ {ok, CurrentVsn, Descr};
+ {ok,_} ->
{ok, CurrentVsn, Descr};
Else ->
Else
@@ -1967,7 +2001,7 @@ safe_write_file_m(File, Data, Masters) ->
%% 'update_paths' option to release_handler:install_release/2 if the
%% code path shall be updated then.
%% -----------------------------------------------------------------
-get_new_libs([{App,Vsn,LibDir}|CurrentLibs], NewLibs) ->
+get_new_libs([{App,Vsn,_LibDir}|CurrentLibs], NewLibs) ->
case lists:keyfind(App,1,NewLibs) of
{App,NewVsn,_} = LibInfo when NewVsn =/= Vsn ->
[LibInfo | get_new_libs(CurrentLibs,NewLibs)];
diff --git a/lib/sasl/src/release_handler_1.erl b/lib/sasl/src/release_handler_1.erl
index ff62f847ac..ef95606bb5 100644
--- a/lib/sasl/src/release_handler_1.erl
+++ b/lib/sasl/src/release_handler_1.erl
@@ -19,7 +19,8 @@
-module(release_handler_1).
%% External exports
--export([eval_script/1, eval_script/5, check_script/2]).
+-export([eval_script/1, eval_script/5,
+ check_script/2, check_old_processes/2]).
-export([get_current_vsn/1]). %% exported because used in a test case
-record(eval_state, {bins = [], stopped = [], suspended = [], apps = [],
@@ -47,17 +48,20 @@
%%% This is a low-level release handler.
%%%-----------------------------------------------------------------
check_script(Script, LibDirs) ->
- case catch check_old_processes(Script) of
- ok ->
+ case catch check_old_processes(Script,soft_purge) of
+ {ok, PurgeMods} ->
{Before, _After} = split_instructions(Script),
case catch lists:foldl(fun(Instruction, EvalState1) ->
eval(Instruction, EvalState1)
end,
#eval_state{libdirs = LibDirs},
Before) of
- EvalState2 when is_record(EvalState2, eval_state) -> ok;
- {error, Error} -> {error, Error};
- Other -> {error, Other}
+ EvalState2 when is_record(EvalState2, eval_state) ->
+ {ok,PurgeMods};
+ {error, Error} ->
+ {error, Error};
+ Other ->
+ {error, Other}
end;
{error, Mod} ->
{error, {old_processes, Mod}}
@@ -68,8 +72,8 @@ eval_script(Script) ->
eval_script(Script, [], [], [], []).
eval_script(Script, Apps, LibDirs, NewLibs, Opts) ->
- case catch check_old_processes(Script) of
- ok ->
+ case catch check_old_processes(Script,soft_purge) of
+ {ok,_} ->
{Before, After} = split_instructions(Script),
case catch lists:foldl(fun(Instruction, EvalState1) ->
eval(Instruction, EvalState1)
@@ -112,32 +116,63 @@ split_instructions([], Before) ->
{[], lists:reverse(Before)}.
%%-----------------------------------------------------------------
-%% Func: check_old_processes/1
+%% Func: check_old_processes/2
%% Args: Script = [instruction()]
+%% PrePurgeMethod = soft_purge | brutal_purge
%% Purpose: Check if there is any process that runs an old version
-%% of a module that should be soft_purged, (i.e. not purged
-%% at all if there is any such process). Returns {error, Mod}
-%% if so, ok otherwise.
-%% Returns: ok | {error, Mod}
+%% of a module that should be purged according to PrePurgeMethod.
+%% Returns a list of modules that can be soft_purged.
+%%
+%% If PrePurgeMethod == soft_purge, the function will succeed
+%% only if there is no process running old code of any of the
+%% modules. Else it will throw {error,Mod}, where Mod is the
+%% first module found that can not be soft_purged.
+%%
+%% If PrePurgeMethod == brutal_purge, the function will
+%% always succeed and return a list of all modules that are
+%% specified in the script with PrePurgeMethod brutal_purge,
+%% but that can be soft_purged.
+%%
+%% Returns: {ok,PurgeMods} | {error, Mod}
+%% PurgeMods = [Mod]
%% Mod = atom()
%%-----------------------------------------------------------------
-check_old_processes(Script) ->
- lists:foreach(fun({load, {Mod, soft_purge, _PostPurgeMethod}}) ->
- check_old_code(Mod);
- ({remove, {Mod, soft_purge, _PostPurgeMethod}}) ->
- check_old_code(Mod);
- (_) -> ok
- end,
- Script).
+check_old_processes(Script,PrePurgeMethod) ->
+ Procs = erlang:processes(),
+ {ok,lists:flatmap(
+ fun({load, {Mod, PPM, _PostPurgeMethod}}) when PPM==PrePurgeMethod ->
+ check_old_code(Mod,Procs,PrePurgeMethod);
+ ({remove, {Mod, PPM, _PostPurgeMethod}}) when PPM==PrePurgeMethod ->
+ check_old_code(Mod,Procs,PrePurgeMethod);
+ (_) -> []
+ end,
+ Script)}.
+
+check_old_code(Mod,Procs,PrePurgeMethod) ->
+ case erlang:check_old_code(Mod) of
+ true when PrePurgeMethod==soft_purge ->
+ do_check_old_code(Mod,Procs);
+ true when PrePurgeMethod==brutal_purge ->
+ case catch do_check_old_code(Mod,Procs) of
+ {error,Mod} -> [];
+ R -> R
+ end;
+ false ->
+ []
+ end.
+
+
+do_check_old_code(Mod,Procs) ->
+ lists:foreach(
+ fun(Pid) ->
+ case erlang:check_process_code(Pid, Mod) of
+ false -> ok;
+ true -> throw({error, Mod})
+ end
+ end,
+ Procs),
+ [Mod].
-check_old_code(Mod) ->
- lists:foreach(fun(Pid) ->
- case erlang:check_process_code(Pid, Mod) of
- false -> ok;
- true -> throw({error, Mod})
- end
- end,
- erlang:processes()).
%%-----------------------------------------------------------------
%% An unpurged module is a module for which there exist an old
diff --git a/lib/sasl/src/systools_lib.erl b/lib/sasl/src/systools_lib.erl
index f951647b79..1b6ea125d9 100644
--- a/lib/sasl/src/systools_lib.erl
+++ b/lib/sasl/src/systools_lib.erl
@@ -24,7 +24,7 @@
%%
-export([file_term2binary/2, read_term/1, read_term_from_stream/2,
- get_dirs/1, get_path/1]).
+ get_dirs/1, get_path/1, werror/2]).
-include_lib("kernel/include/file.hrl").
@@ -219,6 +219,7 @@ flat([H|T], Ack) ->
flat(T, [H|Ack]);
flat([], Ack) ->
lists:reverse(Ack).
-
-
+
+werror(Options, Warnings) ->
+ lists:member(warnings_as_errors, Options) andalso Warnings =/= [].
diff --git a/lib/sasl/src/systools_make.erl b/lib/sasl/src/systools_make.erl
index 7489ee58d2..7f400f5cce 100644
--- a/lib/sasl/src/systools_make.erl
+++ b/lib/sasl/src/systools_make.erl
@@ -44,10 +44,12 @@
%%-----------------------------------------------------------------
%% Create a boot script from a release file.
-%% Options is a list of {path, Path} | silent | local where path sets
-%% the search path, silent supresses error message printing on console,
-%% local generates a script with references to the directories there
-%% the applications are found.
+%% Options is a list of {path, Path} | silent | local
+%% | warnings_as_errors
+%% where path sets the search path, silent supresses error message
+%% printing on console, local generates a script with references
+%% to the directories there the applications are found,
+%% and warnings_as_errors treats warnings as errors.
%%
%% New options: {path,Path} can contain wildcards
%% src_tests
@@ -85,11 +87,16 @@ make_script(RelName, Output, Flags) when is_list(RelName),
ModTestP = {member(src_tests, Flags),xref_p(Flags)},
case get_release(RelName, Path, ModTestP, machine(Flags)) of
{ok, Release, Appls, Warnings} ->
- case generate_script(Output,Release,Appls,Flags) of
- ok ->
+ case systools_lib:werror(Flags, Warnings) of
+ true ->
return(ok,Warnings,Flags);
- Error ->
- return(Error,Warnings,Flags)
+ false ->
+ case generate_script(Output,Release,Appls,Flags) of
+ ok ->
+ return(ok,Warnings,Flags);
+ Error ->
+ return(Error,Warnings,Flags)
+ end
end;
Error ->
return(Error,[],Flags)
@@ -130,10 +137,21 @@ get_outdir(Flags) ->
return(ok,Warnings,Flags) ->
case member(silent,Flags) of
true ->
- {ok,?MODULE,Warnings};
+ case systools_lib:werror(Flags, Warnings) of
+ true ->
+ error;
+ false ->
+ {ok,?MODULE,Warnings}
+ end;
_ ->
- io:format("~s",[format_warning(Warnings)]),
- ok
+ case member(warnings_as_errors,Flags) of
+ true ->
+ io:format("~s",[format_warning(Warnings, true)]),
+ error;
+ false ->
+ io:format("~s",[format_warning(Warnings)]),
+ ok
+ end
end;
return({error,Mod,Error},_,Flags) ->
case member(silent,Flags) of
@@ -1612,9 +1630,9 @@ var_dir(_Dir, _, _, []) ->
false.
appDir(AppDir) ->
- case reverse(filename:split(AppDir)) of
- ["ebin"|Dir] -> filename:join(reverse(Dir));
- _ -> AppDir
+ case filename:basename(AppDir) of
+ "ebin" -> filename:dirname(AppDir);
+ _ -> AppDir
end.
add_modules(Modules, Tar, AppDir, ToDir, Ext) ->
@@ -1833,78 +1851,89 @@ get_flag(_,_) -> false.
%% Check Options for make_script
check_args_script(Args) ->
cas(Args,
- {undef, undef, undef, undef, undef, undef, undef, undef, []}).
+ {undef, undef, undef, undef, undef, undef, undef, undef,
+ undef, []}).
-cas([], {_Path,_Sil,_Loc,_Test,_Var,_Mach,_Xref,_XrefApps, X}) ->
+cas([], {_Path,_Sil,_Loc,_Test,_Var,_Mach,_Xref,_XrefApps,_Werror, X}) ->
X;
%%% path ---------------------------------------------------------------
-cas([{path, P} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(P) ->
+cas([{path, P} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(P) ->
case check_path(P) of
ok ->
- cas(Args, {P, Sil, Loc, Test, Var, Mach, Xref, XrefApps,X});
+ cas(Args, {P, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
+ Werror, X});
error ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
- X++[{path,P}]})
+ Werror, X++[{path,P}]})
end;
%%% silent -------------------------------------------------------------
-cas([silent | Args], {Path, _Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, silent, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([silent | Args], {Path, _Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, silent, Loc, Test, Var, Mach, Xref, XrefApps,
+ Werror, X});
%%% local --------------------------------------------------------------
-cas([local | Args], {Path, Sil, _Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, local, Test, Var, Mach, Xref, XrefApps, X});
+cas([local | Args], {Path, Sil, _Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, local, Test, Var, Mach, Xref, XrefApps,
+ Werror, X});
%%% src_tests -------------------------------------------------------
-cas([src_tests | Args], {Path, Sil, Loc, _Test, Var, Mach,
- Xref, XrefApps, X}) ->
+cas([src_tests | Args], {Path, Sil, Loc, _Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
cas(Args,
- {Path, Sil, Loc, src_tests, Var, Mach, Xref, XrefApps,X});
+ {Path, Sil, Loc, src_tests, Var, Mach, Xref, Werror, XrefApps,X});
%%% variables ----------------------------------------------------------
-cas([{variables, V} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(V) ->
+cas([{variables, V} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(V) ->
case check_vars(V) of
ok ->
cas(Args,
- {Path, Sil, Loc, Test, V, Mach, Xref, XrefApps, X});
+ {Path, Sil, Loc, Test, V, Mach, Xref, XrefApps, Werror, X});
error ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
- X++[{variables, V}]})
+ Werror, X++[{variables, V}]})
end;
%%% machine ------------------------------------------------------------
-cas([{machine, M} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_atom(M) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([{machine, M} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_atom(M) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
%%% exref --------------------------------------------------------------
-cas([exref | Args], {Path, Sil, Loc, Test, Var, Mach,
- _Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, exref, XrefApps, X});
+cas([exref | Args], {Path, Sil, Loc, Test, Var, Mach, _Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, exref, XrefApps, Werror, X});
%%% exref Apps ---------------------------------------------------------
-cas([{exref, Apps} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(Apps) ->
+cas([{exref, Apps} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(Apps) ->
case check_apps(Apps) of
ok ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach,
- Xref, Apps, X});
+ Xref, Apps, Werror, X});
error ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X++[{exref, Apps}]})
+ Xref, XrefApps, Werror, X++[{exref, Apps}]})
end;
%%% outdir Dir ---------------------------------------------------------
-cas([{outdir, Dir} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(Dir) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([{outdir, Dir} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(Dir) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
%%% otp_build (secret, not documented) ---------------------------------
-cas([otp_build | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([otp_build | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
%%% no_module_tests (kept for backwards compatibility, but ignored) ----
-cas([no_module_tests | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,X});
+cas([no_module_tests | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
+%%% warnings_as_errors (kept for backwards compatibility, but ignored) ----
+cas([warnings_as_errors | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, _Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
+ warnings_as_errors, X});
%%% ERROR --------------------------------------------------------------
-cas([Y | Args], {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,X++[Y]}).
+cas([Y | Args], {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
+ Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror,
+ X++[Y]}).
@@ -2030,7 +2059,6 @@ check_apps([H|T]) when is_atom(H) ->
check_apps(_) ->
error.
-
%% Format error
format_error(badly_formatted_release) ->
@@ -2144,21 +2172,31 @@ form_tar_err({add, File, Error}) ->
%% Format warning
format_warning(Warnings) ->
- map(fun({warning,W}) -> form_warn(W) end, Warnings).
-
-form_warn({source_not_found,{Mod,_,App,_,_}}) ->
- io_lib:format("*WARNING* ~p: Source code not found: ~p.erl~n",
- [App,Mod]);
-form_warn({{parse_error, File},{_,_,App,_,_}}) ->
- io_lib:format("*WARNING* ~p: Parse error: ~p~n",
- [App,File]);
-form_warn({obj_out_of_date,{Mod,_,App,_,_}}) ->
- io_lib:format("*WARNING* ~p: Object code (~p) out of date~n",[App,Mod]);
-form_warn({exref_undef, Undef}) ->
- F = fun({M,F,A}) ->
- io_lib:format("*WARNING* Undefined function ~p:~p/~p~n",
- [M,F,A])
+ format_warning(Warnings, false).
+
+format_warning(Warnings, Werror) ->
+ Prefix = case Werror of
+ true ->
+ "";
+ false ->
+ "*WARNING* "
+ end,
+ map(fun({warning,W}) -> form_warn(Prefix, W) end, Warnings).
+
+form_warn(Prefix, {source_not_found,{Mod,_,App,_,_}}) ->
+ io_lib:format("~s~p: Source code not found: ~p.erl~n",
+ [Prefix,App,Mod]);
+form_warn(Prefix, {{parse_error, File},{_,_,App,_,_}}) ->
+ io_lib:format("~s~p: Parse error: ~p~n",
+ [Prefix,App,File]);
+form_warn(Prefix, {obj_out_of_date,{Mod,_,App,_,_}}) ->
+ io_lib:format("~s~p: Object code (~p) out of date~n",
+ [Prefix,App,Mod]);
+form_warn(Prefix, {exref_undef, Undef}) ->
+ F = fun({M,F,A}) ->
+ io_lib:format("~sUndefined function ~p:~p/~p~n",
+ [Prefix,M,F,A])
end,
map(F, Undef);
-form_warn(What) ->
- io_lib:format("*WARNING* ~p~n", [What]).
+form_warn(Prefix, What) ->
+ io_lib:format("~s ~p~n", [Prefix,What]).
diff --git a/lib/sasl/src/systools_relup.erl b/lib/sasl/src/systools_relup.erl
index ec5486226c..6d9e922900 100644
--- a/lib/sasl/src/systools_relup.erl
+++ b/lib/sasl/src/systools_relup.erl
@@ -122,7 +122,7 @@
%% rel_filename() = description() = string()
%% Opts = [opt()]
%% opt() = {path, [path()]} | silent | noexec | restart_emulator
-%% | {outdir, string()}
+%% | {outdir, string()} | warnings_as_errors
%% path() = [string()]
%% Ret = ok | error | {ok, Relup, Module, Warnings} | {error, Module, Error}
%%
@@ -139,8 +139,9 @@
%%
%% The option `path' sets search path, `silent' suppresses printing of
%% error messages to the console, `noexec' inhibits the creation of
-%% the output "relup" file, and restart_emulator ensures that the new
-%% emulator is restarted (as the final step).
+%% the output "relup" file, restart_emulator ensures that the new
+%% emulator is restarted (as the final step), and `warnings_as_errors'
+%% treats warnings as errors.
%% ----------------------------------------------------------------
mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs) ->
mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs, []).
@@ -153,14 +154,29 @@ mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs, Opts) ->
{false, false} ->
case R of
{ok, _Res, _Mod, Ws} ->
- print_warnings(Ws),
- ok;
+ print_warnings(Ws, Opts),
+ case systools_lib:werror(Opts, Ws) of
+ true ->
+ error;
+ false ->
+ ok
+ end;
Other ->
print_error(Other),
error
end;
- _ ->
- R
+ _ ->
+ case R of
+ {ok, _Res, _Mod, Ws} ->
+ case systools_lib:werror(Opts, Ws) of
+ true ->
+ error;
+ false ->
+ R
+ end;
+ R ->
+ R
+ end
end;
BadArg ->
erlang:error({badarg, BadArg})
@@ -195,7 +211,12 @@ do_mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs, Path, Opts) ->
{Dn, Ws2} = foreach_baserel_dn(TopRel, TopApps, BaseDnRelDcs,
Path, Opts, Ws1),
Relup = {TopRel#release.vsn, Up, Dn},
- write_relup_file(Relup, Opts),
+ case systools_lib:werror(Opts, Ws2) of
+ true ->
+ ok;
+ false ->
+ write_relup_file(Relup, Opts)
+ end,
{ok, Relup, ?MODULE, Ws2};
Other ->
throw(Other)
@@ -527,20 +548,29 @@ format_error(Error) ->
io:format("~p~n", [Error]).
-print_warnings(Ws) when is_list(Ws) ->
- lists:foreach(fun(W) -> print_warning(W) end, Ws);
-print_warnings(W) ->
- print_warning(W).
+print_warnings(Ws, Opts) when is_list(Ws) ->
+ lists:foreach(fun(W) -> print_warning(W, Opts) end, Ws);
+print_warnings(W, Opts) ->
+ print_warning(W, Opts).
-print_warning(W) ->
- S = format_warning(W),
+print_warning(W, Opts) ->
+ Prefix = case lists:member(warnings_as_errors, Opts) of
+ true ->
+ "";
+ false ->
+ "*WARNING* "
+ end,
+ S = format_warning(Prefix, W),
io:format("~s", [S]).
-format_warning({erts_vsn_changed, {Rel1, Rel2}}) ->
- io_lib:format("*WARNING* The ERTS version changed between ~p and ~p~n",
- [Rel1, Rel2]);
-format_warning(What) ->
- io_lib:format("*WARNING* ~p~n",[What]).
+format_warning(W) ->
+ format_warning("*WARNING* ", W).
+
+format_warning(Prefix, {erts_vsn_changed, {Rel1, Rel2}}) ->
+ io_lib:format("~sThe ERTS version changed between ~p and ~p~n",
+ [Prefix, Rel1, Rel2]);
+format_warning(Prefix, What) ->
+ io_lib:format("~s~p~n",[Prefix, What]).
get_reason({error, {open, _, _}}) -> open;
diff --git a/lib/sasl/test/Makefile b/lib/sasl/test/Makefile
index 0bdb79a06a..65be134462 100644
--- a/lib/sasl/test/Makefile
+++ b/lib/sasl/test/Makefile
@@ -86,7 +86,7 @@ release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) sasl.spec sasl.cover $(EMAKEFILE) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cfh - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/sasl/test/release_handler_SUITE.erl b/lib/sasl/test/release_handler_SUITE.erl
index 9c7733b7ec..b44da72d35 100644
--- a/lib/sasl/test/release_handler_SUITE.erl
+++ b/lib/sasl/test/release_handler_SUITE.erl
@@ -55,7 +55,10 @@ win32_cases() ->
%% Cases that can be run on all platforms
cases() ->
- [otp_2740, otp_2760, otp_5761, otp_9402, otp_9417, instructions, eval_appup].
+ [otp_2740, otp_2760, otp_5761, otp_9402, otp_9417,
+ otp_9395_check_old_code, otp_9395_check_and_purge,
+ otp_9395_update_many_mods, otp_9395_rm_many_mods,
+ instructions, eval_appup].
groups() ->
[{release,[],
@@ -556,7 +559,7 @@ otp_2760(Conf) ->
LibDir = filename:join([DataDir,app1_app2,lib1]),
Rel1 = create_and_install_fake_first_release(Dir,[{app1,"1.0",LibDir}]),
- Rel2 = create_fake_upgrade_release(Dir,"after",[],{Rel1,Rel1,[LibDir]}),
+ Rel2 = create_fake_upgrade_release(Dir,"after",[],{[Rel1],[Rel1],[LibDir]}),
Rel2Dir = filename:dirname(Rel2),
%% Start a node with Rel1.boot and check that the app1 module is loaded
@@ -569,9 +572,12 @@ otp_2760(Conf) ->
{ok, []} = rpc:call(Node, release_handler_1, eval_script, [Script]),
false = rpc:call(Node, code, is_loaded, [app1]),
- true = stop_node(Node),
ok.
+otp_2760(cleanup,_Conf) ->
+ stop_node(node_name(otp_2760)).
+
+
%% Test upgrade using other filesystem than the defined in OTP and
%% option {update_paths, true}
otp_5761(Conf) when is_list(Conf) ->
@@ -597,7 +603,7 @@ otp_5761(Conf) when is_list(Conf) ->
"2",
[{app1,"2.0",LibDir2},
{app2,"1.0",LibDir2}],
- {Rel1,Rel1,[LibDir1]}),
+ {[Rel1],[Rel1],[LibDir1]}),
Rel1Dir = filename:dirname(Rel1),
Rel2Dir = filename:dirname(Rel2),
@@ -653,10 +659,11 @@ otp_5761(Conf) when is_list(Conf) ->
App11Dir = rpc:call(Node, code, lib_dir, [app1]),
App2aDir = rpc:call(Node, code, lib_dir, [app2]),
- %% Stop the slave node
- true = stop_node(Node),
ok.
+otp_5761(cleanup,_Conf) ->
+ stop_node(node_name(otp_5761)).
+
%% When a new version of an application is added, but no module is
%% changed - the path was not updated - i.e. code:priv_dir would point
@@ -673,7 +680,7 @@ otp_9402(Conf) when is_list(Conf) ->
Rel2 = create_fake_upgrade_release(Dir,
"2",
[{a,"1.2",LibDir}],
- {Rel1,Rel1,[LibDir]}),
+ {[Rel1],[Rel1],[LibDir]}),
Rel1Dir = filename:dirname(Rel1),
Rel2Dir = filename:dirname(Rel2),
@@ -722,6 +729,9 @@ otp_9402(Conf) when is_list(Conf) ->
ok.
+otp_9402(cleanup,_Conf) ->
+ stop_node(node_name(otp_9402)).
+
%% When a module is deleted in an appup instruction, the upgrade
%% failed if the module was not loaded.
@@ -737,7 +747,7 @@ otp_9417(Conf) when is_list(Conf) ->
Rel2 = create_fake_upgrade_release(Dir,
"2",
[{b,"2.0",LibDir}],
- {Rel1,Rel1,[LibDir]}),
+ {[Rel1],[Rel1],[LibDir]}),
Rel1Dir = filename:dirname(Rel1),
Rel2Dir = filename:dirname(Rel2),
@@ -777,6 +787,282 @@ otp_9417(Conf) when is_list(Conf) ->
{file,BServerBeam} = rpc:call(Node,code,is_loaded,[b_server]),
ok.
+otp_9417(cleanup,_Conf) ->
+ stop_node(node_name(otp_9417)).
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Test that the procedure of checking for old code before an upgrade
+%% can be started is "very much faster" when there is no old code in
+%% the system.
+otp_9395_check_old_code(Conf) when is_list(Conf) ->
+
+ NProcs = 1000,
+ MPath = filename:join([?config(data_dir,Conf),"lib","many_mods-1.0","ebin"]),
+ code:add_path(MPath),
+
+ %% Start NProc processes, each referencing each module
+ {Modules,Pids} = m:start(NProcs),
+
+ %% Load each module again in order to get old code
+ [code:load_file(Mod) || Mod <- Modules],
+ true = erlang:check_old_code(m10),
+
+ S = [point_of_no_return |
+ [{remove,{M,soft_purge,soft_purge}} || M <- Modules]],
+
+ %% Do the old code check, then purge, and redo
+ {T1,{ok,PurgeMods}} = timer:tc(release_handler_1,check_script,[S,[]]),
+ true = (lists:sort(PurgeMods) == lists:sort(Modules)),
+ [code:purge(M) || M <- PurgeMods],
+ {T2,{ok,[]}} = timer:tc(release_handler_1,check_script,[S,[]]),
+
+ %% Cleanup
+ lists:foreach(fun(Pid) -> Pid ! stop end, Pids),
+ lists:foreach(fun(Mod) -> code:purge(Mod),
+ code:delete(Mod),
+ code:purge(Mod)
+ end, Modules),
+ code:del_path(MPath),
+
+ %% Test that second run was much faster than the first
+ if T2 > 0 ->
+ X = T1/T2,
+ ct:log("~p procs, ~p mods -> ~n"
+ "\tWith old code: ~.2f sec~n"
+ "\tAfter purge: ~.2f sec~n"
+ "\tT1/T2: ~.2f",
+ [NProcs,length(Modules),T1/1000000,T2/1000000,X]),
+ if X < 1000 ->
+ ct:fail({not_enough_improvement_after_purge,round(X)});
+ true ->
+ ok
+ end;
+ T1 > 0 -> %% Means T1/T2 = infinite
+ ok;
+ true ->
+ ct:fail({unexpected_values,T1,T2})
+ end,
+ ok.
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Added option 'purge' to check_install_release
+otp_9395_check_and_purge(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9395_check_and_purge"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{b,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{b,"2.0",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9395_check_and_purge, Rel1,
+ filename:join(Rel1Dir,"sys.config")),
+
+ %% Make sure there is old code for b_lib and b_server
+ rpc:call(Node,code,load_file,[b_lib]),
+ rpc:call(Node,code,load_file,[b_lib]),
+ rpc:call(Node,code,load_file,[b_server]),
+ rpc:call(Node,code,load_file,[b_server]),
+ true = rpc:call(Node,erlang,check_old_code,[b_lib]),
+ true = rpc:call(Node,erlang,check_old_code,[b_server]),
+
+ %% Unpack second release, which removes b_lib module and loads b_server
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{b,"2.0",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ %% Do check_install_release, and check that old code still exists
+ {ok, _RelVsn1, []} =
+ rpc:call(Node, release_handler, check_install_release, [RelVsn2]),
+ true = rpc:call(Node,erlang,check_old_code,[b_lib]),
+ true = rpc:call(Node,erlang,check_old_code,[b_server]),
+
+ %% Do check_install_release with option 'purge' and check that old
+ %% code is gone
+ {ok, _RelVsn1, []} =
+ rpc:call(Node, release_handler, check_install_release, [RelVsn2,[purge]]),
+ false = rpc:call(Node,erlang,check_old_code,[b_lib]),
+ false = rpc:call(Node,erlang,check_old_code,[b_server]),
+
+ ok.
+
+otp_9395_check_and_purge(cleanup,_Conf) ->
+ stop_node(node_name(otp_9395_check_and_purge)).
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Upgrade which updates many modules (brutal_purge)
+otp_9395_update_many_mods(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9395_update_many_mods"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{many_mods,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{many_mods,"1.1",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9395_update_many_mods, Rel1,
+ filename:join(Rel1Dir,"sys.config")),
+
+ %% Start a lot of processes on the new node, all with refs to each
+ %% module that will be updated
+ NProcs = 1000,
+ {Modules,Pids1} = rpc:call(Node,m,start,[NProcs]),
+
+ %% Then load modules in order to get old code
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Unpack second release, which updates all mX modules
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{many_mods,"1.1",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ %% First, install release directly and check how much time it takes
+ {TInst0,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst0/1000000]),
+
+ %% Restore to old release, spawn processes again and load to get old code
+ {_,RelVsn1} = init:script_id(),
+ {_TInst1,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn1]]),
+% ct:log("install_release: ~.2f",[_TInst1/1000000]),
+
+ [exit(Pid,kill) || Pid <- Pids1],
+ {Modules,_Pids2} = rpc:call(Node,m,start,[NProcs]),
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Run check_install_release with purge before install this time
+ {TCheck,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, check_install_release,
+ [RelVsn2,[purge]]]),
+ ct:log("check_install_release with purge: ~.2f",[TCheck/1000000]),
+
+ %% Finally install release after check and purge, and check that
+ %% this install was faster than the first.
+ {TInst2,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst2/1000000]),
+
+ true = (TInst2 < TInst0),
+
+ ok.
+
+otp_9395_update_many_mods(cleanup,_Conf) ->
+ stop_node(node_name(otp_9395_update_many_mods)).
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Upgrade which removes many modules (brutal_purge)
+otp_9395_rm_many_mods(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9395_rm_many_mods"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{many_mods,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{many_mods,"2.0",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9395_rm_many_mods, Rel1,
+ filename:join(Rel1Dir,"sys.config")),
+
+ %% Start a lot of processes on the new node, all with refs to each
+ %% module that will be updated
+ NProcs = 1000,
+ {Modules,Pids1} = rpc:call(Node,m,start,[NProcs]),
+
+ %% Then load modules in order to get old code
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Unpack second release, which removes all mX modules
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{many_mods,"2.0",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ %% First, install release directly and check how much time it takes
+ {TInst0,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst0/1000000]),
+
+ %% Restore to old release, spawn processes again and load to get old code
+ {_,RelVsn1} = init:script_id(),
+ {_TInst1,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn1]]),
+% ct:log("install_release: ~.2f",[_TInst1/1000000]),
+
+ [exit(Pid,kill) || Pid <- Pids1],
+ {Modules,_Pids2} = rpc:call(Node,m,start,[NProcs]),
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Run check_install_release with purge before install this time
+ {TCheck,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, check_install_release,
+ [RelVsn2,[purge]]]),
+ ct:log("check_install_release with purge: ~.2f",[TCheck/1000000]),
+
+ %% Finally install release after check and purge, and check that
+ %% this install was faster than the first.
+ {TInst2,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst2/1000000]),
+
+ true = (TInst2 =< TInst0),
+
+ ok.
+
+otp_9395_rm_many_mods(cleanup,_Conf) ->
+ stop_node(node_name(otp_9395_rm_many_mods)).
+
+
+
%% Test upgrade and downgrade of applications
eval_appup(Conf) when is_list(Conf) ->
@@ -1838,9 +2124,8 @@ create_fake_upgrade_release(Dir,RelVsn,AppDirs,{UpFrom,DownTo,ExtraLibs}) ->
%% And a relup file so it can be upgraded to
RelupPath = Paths ++ [filename:join([Lib,"*","ebin"]) || Lib <- ExtraLibs],
- ok = systools:make_relup(Rel,[UpFrom],[DownTo],
- [{path,RelupPath},
- {outdir,RelDir}]),
+ ok = systools:make_relup(Rel,UpFrom,DownTo,[{path,RelupPath},
+ {outdir,RelDir}]),
Rel.
diff --git a/lib/sasl/test/release_handler_SUITE_data/Makefile.src b/lib/sasl/test/release_handler_SUITE_data/Makefile.src
index a12e526d2e..9b07e7ce0a 100644
--- a/lib/sasl/test/release_handler_SUITE_data/Makefile.src
+++ b/lib/sasl/test/release_handler_SUITE_data/Makefile.src
@@ -13,7 +13,30 @@ LIB= \
lib/a-1.0/ebin/a_sup.@EMULATOR@ \
lib/b-1.0/ebin/b_server.@EMULATOR@ \
lib/b-1.0/ebin/b_lib.@EMULATOR@ \
- lib/b-2.0/ebin/b_server.@EMULATOR@
+ lib/b-2.0/ebin/b_server.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m1.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m2.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m3.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m4.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m5.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m6.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m7.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m8.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m9.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m10.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m1.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m2.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m3.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m4.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m5.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m6.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m7.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m8.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m9.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m10.@EMULATOR@ \
+ lib/many_mods-2.0/ebin/m.@EMULATOR@
APP= \
app1_app2/lib1/app1-1.0/ebin/app1_sup.@EMULATOR@ \
@@ -75,6 +98,52 @@ lib/b-1.0/ebin/b_lib.@EMULATOR@: lib/b-1.0/src/b_lib.erl
lib/b-2.0/ebin/b_server.@EMULATOR@: lib/b-2.0/src/b_server.erl
erlc $(EFLAGS) -olib/b-2.0/ebin lib/b-2.0/src/b_server.erl
+lib/many_mods-1.0/ebin/m.@EMULATOR@: lib/many_mods-1.0/src/m.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m.erl
+lib/many_mods-1.0/ebin/m1.@EMULATOR@: lib/many_mods-1.0/src/m1.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m1.erl
+lib/many_mods-1.0/ebin/m2.@EMULATOR@: lib/many_mods-1.0/src/m2.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m2.erl
+lib/many_mods-1.0/ebin/m3.@EMULATOR@: lib/many_mods-1.0/src/m3.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m3.erl
+lib/many_mods-1.0/ebin/m4.@EMULATOR@: lib/many_mods-1.0/src/m4.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m4.erl
+lib/many_mods-1.0/ebin/m5.@EMULATOR@: lib/many_mods-1.0/src/m5.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m5.erl
+lib/many_mods-1.0/ebin/m6.@EMULATOR@: lib/many_mods-1.0/src/m6.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m6.erl
+lib/many_mods-1.0/ebin/m7.@EMULATOR@: lib/many_mods-1.0/src/m7.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m7.erl
+lib/many_mods-1.0/ebin/m8.@EMULATOR@: lib/many_mods-1.0/src/m8.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m8.erl
+lib/many_mods-1.0/ebin/m9.@EMULATOR@: lib/many_mods-1.0/src/m9.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m9.erl
+lib/many_mods-1.0/ebin/m10.@EMULATOR@: lib/many_mods-1.0/src/m10.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m10.erl
+lib/many_mods-1.1/ebin/m.@EMULATOR@: lib/many_mods-1.1/src/m.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m.erl
+lib/many_mods-1.1/ebin/m1.@EMULATOR@: lib/many_mods-1.1/src/m1.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m1.erl
+lib/many_mods-1.1/ebin/m2.@EMULATOR@: lib/many_mods-1.1/src/m2.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m2.erl
+lib/many_mods-1.1/ebin/m3.@EMULATOR@: lib/many_mods-1.1/src/m3.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m3.erl
+lib/many_mods-1.1/ebin/m4.@EMULATOR@: lib/many_mods-1.1/src/m4.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m4.erl
+lib/many_mods-1.1/ebin/m5.@EMULATOR@: lib/many_mods-1.1/src/m5.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m5.erl
+lib/many_mods-1.1/ebin/m6.@EMULATOR@: lib/many_mods-1.1/src/m6.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m6.erl
+lib/many_mods-1.1/ebin/m7.@EMULATOR@: lib/many_mods-1.1/src/m7.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m7.erl
+lib/many_mods-1.1/ebin/m8.@EMULATOR@: lib/many_mods-1.1/src/m8.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m8.erl
+lib/many_mods-1.1/ebin/m9.@EMULATOR@: lib/many_mods-1.1/src/m9.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m9.erl
+lib/many_mods-1.1/ebin/m10.@EMULATOR@: lib/many_mods-1.1/src/m10.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m10.erl
+lib/many_mods-2.0/ebin/m.@EMULATOR@: lib/many_mods-2.0/src/m.erl
+ erlc $(EFLAGS) -olib/many_mods-2.0/ebin lib/many_mods-2.0/src/m.erl
app1_app2/lib1/app1-1.0/ebin/app1_sup.@EMULATOR@: app1_app2/lib1/app1-1.0/src/app1_sup.erl
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/README b/lib/sasl/test/release_handler_SUITE_data/lib/README
index 667d21d4cf..639a4ca0fb 100644
--- a/lib/sasl/test/release_handler_SUITE_data/lib/README
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/README
@@ -13,4 +13,21 @@ start version, includes b_lib and b_server
b-2.0:
can be upgraded to from b-1.0.
-Removes b_lib and updates b_server
+Removes b_lib (soft_purge) and updates b_server (brutal_purge)
+* The diff in purge method is important for test "check_and_purge", in
+ order to check that the purge option to check_install_release works
+ for both methods.
+
+many_mods-1.0:
+start version.
+m:start/1 starts N procs, each calling Mod:bar() in all other modules (m1-m10).
+m1-m10: implements bar() which returns a big constant.
+The point is to get many processes with references to many modules,
+and then load the modules again so that old code exists. See tests
+otp_9395_update_many_mods and otp_9395_rm_many_mods.
+
+many_mods-1.1:
+can be upgraded to from many_mods-1.0. Updates modules m1-m10.
+
+many_mods-2.0:
+can be upgraded to from many_mods-1.0. Removes modules m1-m10. \ No newline at end of file
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup
index d261a37732..001255a88c 100644
--- a/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup
@@ -1,3 +1,6 @@
+%% -*- erlang -*-
{"2.0",
- [{"1.0",[{delete_module,b_lib}, {update,b_server,{advanced,[]}}]}],
- [{"1.0",[{add_module,b_lib},{update,b_server,{advanced,[]}}]}]}.
+ [{"1.0",[{remove_module,b_lib,soft_purge,soft_purge,[]},
+ {update,b_server,{advanced,[]}}]}],
+ [{"1.0",[{add_module,b_lib},
+ {update,b_server,{advanced,[]}}]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app
new file mode 100644
index 0000000000..aa39adfffa
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app
@@ -0,0 +1,17 @@
+%% -*- erlang -*-
+{application, many_mods,
+ [{description, "Application with many modules CXC 138 11"},
+ {vsn, "1.0"},
+ {modules, [{m, 1},
+ {m1,1},
+ {m2,1},
+ {m3,1},
+ {m4,1},
+ {m5,1},
+ {m6,1},
+ {m7,1},
+ {m8,1},
+ {m9,1},
+ {m10,1}]},
+ {registered, []},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl
new file mode 100644
index 0000000000..418102bebb
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl
@@ -0,0 +1,11 @@
+-module(m).
+-compile(export_all).
+
+start(NProcs) ->
+ Modules = [m1,m2,m3,m4,m5,m6,m7,m8,m9,m10],
+ Pids = [spawn_link(fun() ->
+ Cs = [M:bar() || M <- Modules],
+ receive stop -> Cs end
+ end) ||
+ _ <- lists:seq(1,NProcs)],
+ {Modules,Pids}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl
new file mode 100644
index 0000000000..cacc13f5d7
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl
@@ -0,0 +1,4 @@
+-module(m1).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl
new file mode 100644
index 0000000000..81e120b891
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl
@@ -0,0 +1,4 @@
+-module(m10).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl
new file mode 100644
index 0000000000..481276ba7b
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl
@@ -0,0 +1,4 @@
+-module(m2).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl
new file mode 100644
index 0000000000..9a04ed5fc9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl
@@ -0,0 +1,4 @@
+-module(m3).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl
new file mode 100644
index 0000000000..90de9a30c9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl
@@ -0,0 +1,4 @@
+-module(m4).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl
new file mode 100644
index 0000000000..8a9b690dfa
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl
@@ -0,0 +1,4 @@
+-module(m5).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl
new file mode 100644
index 0000000000..cd0d3977ed
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl
@@ -0,0 +1,4 @@
+-module(m6).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl
new file mode 100644
index 0000000000..1f79918d6e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl
@@ -0,0 +1,4 @@
+-module(m7).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl
new file mode 100644
index 0000000000..2ce03a0b7e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl
@@ -0,0 +1,4 @@
+-module(m8).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl
new file mode 100644
index 0000000000..1c5f72e628
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl
@@ -0,0 +1,4 @@
+-module(m9).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app
new file mode 100644
index 0000000000..36c50caf2f
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app
@@ -0,0 +1,17 @@
+%% -*- erlang -*-
+{application, many_mods,
+ [{description, "Application with many modules CXC 138 11"},
+ {vsn, "1.1"},
+ {modules, [{m, 1},
+ {m1,1},
+ {m2,1},
+ {m3,1},
+ {m4,1},
+ {m5,1},
+ {m6,1},
+ {m7,1},
+ {m8,1},
+ {m9,1},
+ {m10,1}]},
+ {registered, []},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup
new file mode 100644
index 0000000000..696435e06f
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup
@@ -0,0 +1,22 @@
+%% -*- erlang -*-
+{"1.1",
+ [{"1.0",[{update,m1},
+ {update,m2},
+ {update,m3},
+ {update,m4},
+ {update,m5},
+ {update,m6},
+ {update,m7},
+ {update,m8},
+ {update,m9},
+ {update,m10}]}],
+ [{"1.0",[{update,m1},
+ {update,m2},
+ {update,m3},
+ {update,m4},
+ {update,m5},
+ {update,m6},
+ {update,m7},
+ {update,m8},
+ {update,m9},
+ {update,m10}]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl
new file mode 100644
index 0000000000..418102bebb
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl
@@ -0,0 +1,11 @@
+-module(m).
+-compile(export_all).
+
+start(NProcs) ->
+ Modules = [m1,m2,m3,m4,m5,m6,m7,m8,m9,m10],
+ Pids = [spawn_link(fun() ->
+ Cs = [M:bar() || M <- Modules],
+ receive stop -> Cs end
+ end) ||
+ _ <- lists:seq(1,NProcs)],
+ {Modules,Pids}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl
new file mode 100644
index 0000000000..cacc13f5d7
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl
@@ -0,0 +1,4 @@
+-module(m1).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl
new file mode 100644
index 0000000000..81e120b891
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl
@@ -0,0 +1,4 @@
+-module(m10).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl
new file mode 100644
index 0000000000..481276ba7b
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl
@@ -0,0 +1,4 @@
+-module(m2).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl
new file mode 100644
index 0000000000..9a04ed5fc9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl
@@ -0,0 +1,4 @@
+-module(m3).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl
new file mode 100644
index 0000000000..90de9a30c9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl
@@ -0,0 +1,4 @@
+-module(m4).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl
new file mode 100644
index 0000000000..8a9b690dfa
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl
@@ -0,0 +1,4 @@
+-module(m5).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl
new file mode 100644
index 0000000000..cd0d3977ed
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl
@@ -0,0 +1,4 @@
+-module(m6).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl
new file mode 100644
index 0000000000..1f79918d6e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl
@@ -0,0 +1,4 @@
+-module(m7).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl
new file mode 100644
index 0000000000..2ce03a0b7e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl
@@ -0,0 +1,4 @@
+-module(m8).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl
new file mode 100644
index 0000000000..1c5f72e628
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl
@@ -0,0 +1,4 @@
+-module(m9).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app
new file mode 100644
index 0000000000..98f6527750
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app
@@ -0,0 +1,7 @@
+%% -*- erlang -*-
+{application, many_mods,
+ [{description, "Application with many modules CXC 138 11"},
+ {vsn, "2.0"},
+ {modules, [{m, 1}]},
+ {registered, []},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup
new file mode 100644
index 0000000000..3a34db78c1
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup
@@ -0,0 +1,24 @@
+%% -*- erlang -*-
+{"2.0",
+ [{"1.0",[{update,m},
+ {delete_module,m1},
+ {delete_module,m2},
+ {delete_module,m3},
+ {delete_module,m4},
+ {delete_module,m5},
+ {delete_module,m6},
+ {delete_module,m7},
+ {delete_module,m8},
+ {delete_module,m9},
+ {delete_module,m10}]}],
+ [{"1.0",[{update,m},
+ {add_module,m1},
+ {add_module,m2},
+ {add_module,m3},
+ {add_module,m4},
+ {add_module,m5},
+ {add_module,m6},
+ {add_module,m7},
+ {add_module,m8},
+ {add_module,m9},
+ {add_module,m10}]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl
new file mode 100644
index 0000000000..2edc1e6be4
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl
@@ -0,0 +1,11 @@
+-module(m).
+-compile(export_all).
+
+start(NProcs) ->
+ Modules = [],
+ Pids = [spawn_link(fun() ->
+ Cs = [M:bar() || M <- Modules],
+ receive stop -> Cs end
+ end) ||
+ _ <- lists:seq(1,NProcs)],
+ {Modules,Pids}.
diff --git a/lib/sasl/test/systools_SUITE.erl b/lib/sasl/test/systools_SUITE.erl
index 9190b111ef..e352247d44 100644
--- a/lib/sasl/test/systools_SUITE.erl
+++ b/lib/sasl/test/systools_SUITE.erl
@@ -48,7 +48,7 @@
included_fail_script/1, included_bug_script/1, exref_script/1]).
-export([ tar_options/1, normal_tar/1, no_mod_vsn_tar/1, variable_tar/1,
src_tests_tar/1, shadow_tar/1, var_tar/1,
- exref_tar/1, link_tar/1]).
+ exref_tar/1, link_tar/1, otp_9507/1]).
-export([ normal_relup/1, abnormal_relup/1, no_appup_relup/1,
bad_appup_relup/1, app_start_type_relup/1, otp_3065/1]).
-export([
@@ -81,7 +81,7 @@ groups() ->
{tar, [],
[tar_options, normal_tar, no_mod_vsn_tar, variable_tar,
src_tests_tar, shadow_tar, var_tar,
- exref_tar, link_tar]},
+ exref_tar, link_tar, otp_9507]},
{relup, [],
[normal_relup, abnormal_relup, no_appup_relup,
bad_appup_relup, app_start_type_relup]},
@@ -396,6 +396,7 @@ src_tests_script(Config) when is_list(Config) ->
?line PSAVE = code:get_path(), % Save path
?line {LatestDir, LatestName} = create_script(latest,Config),
+ ?line BootFile = LatestName ++ ".boot",
?line DataDir = filename:absname(?copydir),
?line LibDir = fname([DataDir, d_missing_src, lib]),
@@ -416,14 +417,32 @@ src_tests_script(Config) when is_list(Config) ->
?line Erl2 = filename:join([P1,"..","src","db2.erl"]),
?line file:delete(Erl2),
- %% Then make script - two warnings should be issued when
- %% src_tests is given
+ %% Then make script
+
+ %% .boot file should not exist
+ ?line ok = file:delete(BootFile),
+ ?line false = filelib:is_regular(BootFile),
+ %% With warnings_as_errors and src_tests option, an error should be issued
+ ?line error =
+ systools:make_script(LatestName, [silent, {path, N}, src_tests,
+ warnings_as_errors]),
+ ?line error =
+ systools:make_script(LatestName, [{path, N}, src_tests,
+ warnings_as_errors]),
+
+ %% due to warnings_as_errors .boot file should still not exist
+ ?line false = filelib:is_regular(BootFile),
+
+ %% Two warnings should be issued when src_tests is given
%% 1. old object code for db1.beam
%% 2. missing source code for db2.beam
?line {ok, _, [{warning,{obj_out_of_date,_}},
{warning,{source_not_found,_}}]} =
systools:make_script(LatestName, [silent, {path, N}, src_tests]),
+ %% .boot file should exist now
+ ?line true = filelib:is_regular(BootFile),
+
%% Without the src_tests option, no warning should be issued
?line {ok, _, []} =
systools:make_script(LatestName, [silent, {path, N}]),
@@ -1066,6 +1085,48 @@ exref_tar(Config) when is_list(Config) ->
?line ok = file:set_cwd(OldDir),
ok.
+
+
+%% otp_9507
+%%
+otp_9507(suite) -> [];
+otp_9507(doc) ->
+ ["make_tar failed when path given as just 'ebin'."];
+otp_9507(Config) when is_list(Config) ->
+ ?line {ok, OldDir} = file:get_cwd(),
+
+ ?line {LatestDir, LatestName} = create_script(latest_small,Config),
+
+ ?line DataDir = filename:absname(?copydir),
+ ?line LibDir = fname([DataDir, d_normal, lib]),
+ ?line FeDir = fname([LibDir, 'fe-3.1']),
+
+ ?line ok = file:set_cwd(FeDir),
+
+ RelName = fname([LatestDir,LatestName]),
+
+ ?line P1 = ["./ebin",
+ fname([DataDir, lib, kernel, ebin]),
+ fname([DataDir, lib, stdlib, ebin])],
+ ?line {ok, _, _} = systools:make_script(RelName, [silent, {path, P1}]),
+ ?line ok = systools:make_tar(RelName, [{path, P1}]),
+ ?line Content1 = tar_contents(RelName),
+
+ ?line P2 = ["ebin",
+ fname([DataDir, lib, kernel, ebin]),
+ fname([DataDir, lib, stdlib, ebin])],
+
+ %% Tickets solves the following line - it used to fail with
+ %% {function_clause,[{filename,join,[[]]},...}
+ ?line ok = systools:make_tar(RelName, [{path, P2}]),
+ ?line Content2 = tar_contents(RelName),
+ true = (Content1 == Content2),
+
+ ?line ok = file:set_cwd(OldDir),
+
+ ok.
+
+
%% The relup stuff.
%%
%%
@@ -1108,6 +1169,21 @@ normal_relup(Config) when is_list(Config) ->
[{path, P}, silent]),
?line ok = check_relup([{db, "2.1"}], [{db, "1.0"}]),
+ %% file should not be written if warnings_as_errors is enabled.
+ %% delete before running tests.
+ ?line ok = file:delete("relup"),
+
+ %% Check that warnings are treated as errors
+ ?line error =
+ systools:make_relup(LatestName, [LatestName2], [LatestName1],
+ [{path, P}, warnings_as_errors]),
+ ?line error =
+ systools:make_relup(LatestName, [LatestName2], [LatestName1],
+ [{path, P}, silent, warnings_as_errors]),
+
+ %% relup file should not exist
+ ?line false = filelib:is_regular("relup"),
+
%% Check that warnings get through
?line ok = systools:make_relup(LatestName, [LatestName2], [LatestName1],
[{path, P}]),
@@ -1117,6 +1193,9 @@ normal_relup(Config) when is_list(Config) ->
[{path, P}, silent]),
?line ok = check_relup([{fe, "3.1"}, {db, "2.1"}], [{db, "1.0"}]),
+ %% relup file should exist now
+ ?line true = filelib:is_regular("relup"),
+
?line ok = file:set_cwd(OldDir),
ok.
diff --git a/lib/snmp/Makefile b/lib/snmp/Makefile
index 20e3d4692a..c55eff04c6 100644
--- a/lib/snmp/Makefile
+++ b/lib/snmp/Makefile
@@ -67,7 +67,7 @@ do_configure: configure
configure: configure.in
autoconf
-.PHONY: info
+.PHONY: info gclean
info:
@echo "OS: $(OS)"
@@ -76,6 +76,9 @@ info:
@echo "SNMP_VSN: $(SNMP_VSN)"
@echo "APP_VSN: $(APP_VSN)"
+gclean:
+ git clean -fXd
+
# ----------------------------------------------------
# Application (source) release targets
diff --git a/lib/snmp/doc/src/Makefile b/lib/snmp/doc/src/Makefile
index 35ed63e103..aa9431477c 100644
--- a/lib/snmp/doc/src/Makefile
+++ b/lib/snmp/doc/src/Makefile
@@ -152,6 +152,7 @@ $(TOP_PDF_FILE): $(XML_FILES)
pdf: $(TOP_PDF_FILE)
html: gifs $(HTML_REF_MAN_FILE)
+html2: html $(INDEX_TARGET)
clean clean_docs: clean_html clean_man clean_pdf
rm -f errs core *~
@@ -228,6 +229,7 @@ clean_man:
clean_html:
@echo "cleaning html:"
rm -rf $(HTMLDIR)/*
+ rm -f $(INDEX_TARGET)
$(MAN7DIR)/%.7: $(MIBSDIR)/%.mib
@echo "processing $*"
@@ -286,7 +288,7 @@ release_docs_spec: docs
$(INSTALL_DATA) $(INFO_FILE) $(RELSYSDIR)
$(INSTALL_DIR) $(RELEASE_PATH)/man/man1
$(INSTALL_DATA) $(MAN1_FILES) $(RELEASE_PATH)/man/man1
- $(INSTALL_DIR) $(RELEASE_PATH)/man/man
+ $(INSTALL_DIR) $(RELEASE_PATH)/man/man3
$(INSTALL_DATA) $(MAN3_FILES) $(RELEASE_PATH)/man/man3
$(INSTALL_DIR) $(RELEASE_PATH)/man/man6
$(INSTALL_DATA) $(MAN6_FILES) $(RELEASE_PATH)/man/man6
diff --git a/lib/snmp/doc/src/notes.xml b/lib/snmp/doc/src/notes.xml
index 6a20d8ee3a..4178192120 100644
--- a/lib/snmp/doc/src/notes.xml
+++ b/lib/snmp/doc/src/notes.xml
@@ -33,6 +33,136 @@
</header>
<section>
+ <title>SNMP Development Toolkit 4.21</title>
+ <p>Version 4.21 supports code replacement in runtime from/to
+ version 4.20.1, 4.20 and 4.19. </p>
+
+ <section>
+ <title>Improvements and new features</title>
+<!--
+ <p>-</p>
+-->
+ <list type="bulleted">
+ <item>
+ <p>[manager] There was no way to specify transport domain.
+ The transport domains was assumed to be IPv4 (transportDomainUdpIpv4).
+ This has now been changed so that it can also be IPv6
+ (transportDomainUdpIpv6).
+ To facilitate this, the transport domain, <c>tdomain</c>,
+ is now a (new) valid option when
+ <seealso marker="snmpm#register_agent">registering</seealso>
+ a new agent (and
+ <seealso marker="snmpm#update_agent_info">updating</seealso>
+ agent info). </p>
+ <p>This also mean that the transport behaviour has changed. </p>
+ <p>Own Id: OTP-9305</p>
+ <p>Aux Id: Seq 11847</p>
+ </item>
+
+ <item>
+ <p>[compiler] Added the option
+ <seealso marker="snmpc#compile">warnings_as_errors</seealso>
+ (for the SNMP MIB compiler (escript) frontend, the option
+ <seealso marker="snmpc(command)#option_wae">--wae</seealso> is used)
+ which specifies whether warnings should be treated as errors. </p>
+ <p>Tuncer Ayaz</p>
+ <p>Own Id: OTP-9437</p>
+ </item>
+ </list>
+
+ </section>
+
+ <section>
+ <title>Fixed Bugs and Malfunctions</title>
+<!--
+ <p>-</p>
+-->
+
+ <list type="bulleted">
+ <item>
+ <p>The snmp config tool could not handle (manager) audit trail config
+ because the option seqno was not handled. </p>
+ <p>Own Id: OTP-9354</p>
+ </item>
+
+ <item>
+ <p>[agent] The SNMP ACM cache was not properly updated when
+ changes where made to the VACM security-to-group, access and
+ view-tree-family tables. </p>
+ <p>Own Id: OTP-9367</p>
+ <p>Aux Id: Seq 11858</p>
+ </item>
+
+ <item>
+ <p>Fixed install directory typo for man3. </p>
+ <p>Peter Lemenkov</p>
+ <p>Hans Ulrich Niedermann</p>
+ <p>Own Id: OTP-9442</p>
+ </item>
+
+ </list>
+ </section>
+
+
+ <section>
+ <title>Incompatibilities</title>
+ <p>-</p>
+ </section>
+
+ </section> <!-- 4.21 -->
+
+
+ <section>
+ <title>SNMP Development Toolkit 4.20.1</title>
+ <p>Version 4.20.1 supports code replacement in runtime from/to
+ version 4.20, 4.19 and 4.18.</p>
+
+ <section>
+ <title>Improvements and new features</title>
+ <p>-</p>
+<!--
+ <list type="bulleted">
+ <item>
+ <p>Added type specs for functions that do not return. </p>
+ <p>Kostis Sagonas</p>
+ <p>Own Id: OTP-9208</p>
+ </item>
+ </list>
+-->
+ </section>
+
+ <section>
+ <title>Fixed Bugs and Malfunctions</title>
+<!--
+ <p>-</p>
+-->
+ <list type="bulleted">
+ <item>
+ <p>[agent] Did not handle transport domains properly in some cases,
+ for instance trap sending. </p>
+ <p>Own Id: OTP-9400</p>
+ </item>
+
+ <item>
+ <p>[agent] Wrong default transport domain, snmpUDPDomain, instead
+ of transportDomainUdpIpv4. </p>
+ <p>Own Id: OTP-9425</p>
+ <p>Aux Id: Seq 11874</p>
+ </item>
+
+ </list>
+ </section>
+
+
+ <section>
+ <title>Incompatibilities</title>
+ <p>-</p>
+ </section>
+
+ </section> <!-- 4.20.1 -->
+
+
+ <section>
<title>SNMP Development Toolkit 4.20</title>
<p>Version 4.20 supports code replacement in runtime from/to
version 4.19 and 4.18.</p>
diff --git a/lib/snmp/doc/src/snmpc.xml b/lib/snmp/doc/src/snmpc.xml
index 771629492d..61d19251c5 100644
--- a/lib/snmp/doc/src/snmpc.xml
+++ b/lib/snmp/doc/src/snmpc.xml
@@ -48,7 +48,11 @@
<type>
<v>File = string()</v>
<v>Options = [opt()]</v>
- <v>opt() = db() | relaxed_row_name_assign_check() | deprecated() | description() | reference() | group_check() | i() | il() | imports() | module() | module_identity() | module_compliance() | agent_capabilities() | outdir() | no_defs() | verbosity() | warnings()</v>
+ <v>opt() = db() | relaxed_row_name_assign_check() | deprecated() |
+ description() | reference() | group_check() | i() | il() |
+ imports() | module() | module_identity() | module_compliance() |
+ agent_capabilities() | outdir() | no_defs() | verbosity() |
+ warnings() | warnings_as_errors()</v>
<v>db() = {db, volatile|persistent|mnesia}</v>
<v>deprecated() = {deprecated, bool()}</v>
<v>relaxed_row_name_assign_check() = relaxed_row_name_assign_check</v>
@@ -66,6 +70,7 @@
<v>outdir() = {outdir, dir()}</v>
<v>verbosity() = {verbosity, silence|warning|info|log|debug|trace}</v>
<v>warnings() = {warnings, bool()}</v>
+ <v>warnings_as_errors() = warnings_as_errors</v>
<v>dir() = string()</v>
<v>BinFileName = string()</v>
</type>
@@ -200,11 +205,17 @@
<item>
<p>The option <c>warnings</c> specifies whether warning
- messages should be shown. </p>
+ messages should be shown. </p>
<p>Default is <c>true</c>. </p>
</item>
+ <item>
+ <p>The option <c>warnings_as_errors</c>, if present, specifies
+ whether warnings should be treated as errors.</p>
+ </item>
+
</list>
+
<p>The MIB compiler understands both SMIv1 and SMIv2 MIBs. It
uses the <c>MODULE-IDENTITY</c> statement to determine if the MIB is
version 1 or 2.
diff --git a/lib/snmp/doc/src/snmpc_cmd.xml b/lib/snmp/doc/src/snmpc_cmd.xml
index 9358382a10..72116f8981 100644
--- a/lib/snmp/doc/src/snmpc_cmd.xml
+++ b/lib/snmp/doc/src/snmpc_cmd.xml
@@ -50,6 +50,8 @@
with definitions of Erlang constants for the objects in
the MIB, see
<seealso marker="snmpc#mib_to_hrl">mib_to_hrl/1</seealso>. </p>
+
+ <marker id="options"></marker>
</desc>
</func>
</funcs>
@@ -58,15 +60,18 @@
<title>Compiler options</title>
<p>The following options are supported (note that most of these relate
to the compilation of the MIB file):</p>
+ <marker id="option_help"></marker>
<taglist>
<tag>--help</tag>
<item>
<p>Prints help info.</p>
+ <marker id="option_version"></marker>
</item>
<tag>--version</tag>
<item>
<p>Prints application and mib format version.</p>
+ <marker id="option_verbosity"></marker>
</item>
<tag>--verbosity <em>verbosity</em></tag>
@@ -74,11 +79,20 @@
<p>Print debug info. </p>
<p><c>verbosity</c> = <c>trace</c> | <c>debug</c> | <c>log</c> | <c>info</c> | <c>silence</c></p>
<p>Defaults to <c>silence</c>.</p>
+ <marker id="option_warnings"></marker>
</item>
<tag>--warnings</tag>
<item>
<p>Print warning messages. </p>
+ <marker id="option_wae"></marker>
+ </item>
+
+ <tag>--wae</tag>
+ <item>
+ <p>Warnings as errors.
+ Indicates that warnings shall be treated as errors. </p>
+ <marker id="option_odir"></marker>
</item>
<tag>--o <em>directory</em></tag>
@@ -86,6 +100,7 @@
<p>The directory where the compiler should place the output files.
If not specified, output files will be placed in the current working
directory.</p>
+ <marker id="option_idir"></marker>
</item>
<tag>--i <em>Directory</em></tag>
@@ -94,6 +109,7 @@
By default, the current working directory is always included. </p>
<p>This option can be present several times, each time specifying
<em>one</em> path. </p>
+ <marker id="option_ildir"></marker>
</item>
<tag>--il <em>Directory</em></tag>
@@ -106,6 +122,7 @@
the current version may be in the system). The current directory
and the "snmp-home"/priv/mibs/ are always listed last in the
include path. </p>
+ <marker id="option_sgc"></marker>
</item>
<tag>--sgc</tag>
@@ -114,42 +131,50 @@
group check of the mib compiler.
That is, should the OBJECT-GROUP and the NOTIFICATION-GROUP
macro(s) be checked for correctness or not. </p>
+ <marker id="option_dep"></marker>
</item>
<tag>--dep</tag>
<item>
<p>Keep deprecated definition(s).
If not specified the compiler will ignore deprecated definitions. </p>
+ <marker id="option_desc"></marker>
</item>
<tag>--desc</tag>
<item>
<p>The DESCRIPTION field will be included. </p>
+ <marker id="option_ref"></marker>
</item>
<tag>--ref</tag>
<item>
<p>The REFERENCE field will be included. </p>
+ <marker id="option_imp"></marker>
</item>
<tag>--imp</tag>
<item>
<p>The IMPORTS field will be included. </p>
+ <marker id="option_mi"></marker>
</item>
<tag>--mi</tag>
<item>
<p>The MODULE-IDENTITY field will be included. </p>
+ <marker id="option_mc"></marker>
</item>
<tag>--mc</tag>
<item>
<p>The MODULE-COMPLIANCE field will be included. </p>
+ <marker id="option_ac"></marker>
</item>
<tag>--ac</tag>
<item>
<p>The AGENT-CAPABILITIES field will be included. </p>
+ <marker id="option_mod"></marker>
</item>
<tag>--mod <em>module</em></tag>
@@ -157,6 +182,7 @@
<p>The module which implements all the instrumentation functions. </p>
<p>The name of all instrumentation functions must be the
same as the corresponding managed object it implements. </p>
+ <marker id="option_nd"></marker>
</item>
<tag>--nd</tag>
@@ -165,6 +191,7 @@
used if a managed object have no instrumentation function.
Instead this will be reported as an error, and the compilation
aborts. </p>
+ <marker id="option_rrnac"></marker>
</item>
<tag>--rrnac</tag>
@@ -176,6 +203,7 @@
This means that the error will be converted to a warning. </p>
<p>By default it is not included, but if this option is present
it will be. </p>
+ <marker id="see_also"></marker>
</item>
</taglist>
diff --git a/lib/snmp/doc/src/snmpm.xml b/lib/snmp/doc/src/snmpm.xml
index b527d171b0..c36a1b2a24 100644
--- a/lib/snmp/doc/src/snmpm.xml
+++ b/lib/snmp/doc/src/snmpm.xml
@@ -283,27 +283,27 @@ sec_level = noAuthNoPriv | authNoPriv | authPriv
<v>TargetName = target_name()</v>
<v>Config = [agent_config()]</v>
<v>agent_config() = {Item, Val}</v>
- <v>Item = engine_id | address | port | community | timeout | max_message_size | version | sec_model | sec_name | sec_level</v>
+ <v>Item = engine_id | address | port | community | timeout | max_message_size | version | sec_model | sec_name | sec_level | tdomain</v>
<v>Val = term()</v>
<v>Reason = term()</v>
</type>
<desc>
<p>Explicitly instruct the manager to handle this agent, with
- <c>UserId</c> as the responsible user. </p>
- <p>Called to instruct the manager that this agent
- shall be handled. This function is used when
- the user knows in advance which agents the
- manager shall handle.
- Note that there is an alternate way to do the same thing:
- Add the agent to the manager config files (see
- <seealso marker="snmp_manager_config_files#agents">agents.conf</seealso>).</p>
+ <c>UserId</c> as the responsible user. </p>
+ <p>Called to instruct the manager that this agent shall be handled.
+ This function is used when the user knows in advance which agents
+ the manager shall handle.
+ Note that there is an alternate way to do the same thing:
+ Add the agent to the manager config files (see
+ <seealso marker="snmp_manager_config_files#agents">agents.conf</seealso>).</p>
<p><c>TargetName</c> is a non-empty string,
- uniquely identifying the agent. </p>
- <p>The type of <c>Val</c> depends on <c>Item</c>: </p>
+ uniquely identifying the agent. </p>
+ <p>The type of <c>Val</c> depends on <c>Item</c>: </p>
<code type="none"><![CDATA[
[mandatory] engine_id = string()
[mandatory] address = ip_address()
[optional] port = integer()
+[optional] tdomain = transportDomainUdpIpv4 | transportDomainUdpIpv6
[optional] community = string()
[optional] timeout = integer() | snmp_timer()
[optional] max_message_size = integer()
@@ -312,7 +312,9 @@ sec_level = noAuthNoPriv | authNoPriv | authPriv
[optional] sec_name = string()
[optional] sec_level = noAuthNoPriv | authNoPriv | authPriv
]]></code>
- <p>Note that if no <c>Port</c> is given, the default value is used.</p>
+ <p>Note that if no <c>tdomain</c> is given, the default value,
+ <c>transportDomainUdpIpv4</c>, is used.</p>
+ <p>Note that if no <c>port</c> is given, the default value is used.</p>
<marker id="unregister_agent"></marker>
</desc>
@@ -348,17 +350,25 @@ sec_level = noAuthNoPriv | authNoPriv | authPriv
</func>
<func>
+ <name>update_agent_info(UserId, TargetName, Info) -> ok | {error, Reason}</name>
<name>update_agent_info(UserId, TargetName, Item, Val) -> ok | {error, Reason}</name>
<fsummary>Update agent config</fsummary>
<type>
<v>UserId = term()</v>
<v>TargetName = target_name()</v>
- <v>Item = atom()</v>
- <v>Val = term()</v>
+ <v>Info = [{item(), item_value()}]</v>
+ <v>Item = item()</v>
+ <v>item() = atom()</v>
+ <v>Val = item_value()</v>
+ <v>item_value() = term()</v>
<v>Reason = term()</v>
</type>
<desc>
- <p>Update agent config.</p>
+ <p>Update agent config. The function <c>update_agent_info/3</c>
+ should be used when several values needs to be updated atomically. </p>
+ <p>See function
+ <seealso marker="#register_agent">register_agent</seealso>)
+ for more info about what kind of items are allowed. </p>
<marker id="which_agents"></marker>
</desc>
diff --git a/lib/snmp/src/agent/snmp_view_based_acm_mib.erl b/lib/snmp/src/agent/snmp_view_based_acm_mib.erl
index 28469a7b4e..37f6dd3f26 100644
--- a/lib/snmp/src/agent/snmp_view_based_acm_mib.erl
+++ b/lib/snmp/src/agent/snmp_view_based_acm_mib.erl
@@ -247,6 +247,7 @@ add_sec2group(SecModel, SecName, GroupName) ->
Key = [Key1, length(Key2) | Key2],
case table_cre_row(vacmSecurityToGroupTable, Key, Row) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
{ok, Key};
false ->
{error, create_failed}
@@ -260,6 +261,7 @@ add_sec2group(SecModel, SecName, GroupName) ->
delete_sec2group(Key) ->
case table_del_row(vacmSecurityToGroupTable, Key) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
ok;
false ->
{error, delete_failed}
@@ -279,6 +281,7 @@ add_access(GroupName, Prefix, SecModel, SecLevel, Match, RV, WV, NV) ->
Key3 = [SM, SL],
Key = Key1 ++ Key2 ++ Key3,
snmpa_vacm:insert([{Key, Row}], false),
+ snmpa_agent:invalidate_ca_cache(),
{ok, Key};
{error, Reason} ->
{error, Reason};
@@ -287,6 +290,7 @@ add_access(GroupName, Prefix, SecModel, SecLevel, Match, RV, WV, NV) ->
end.
delete_access(Key) ->
+ snmpa_agent:invalidate_ca_cache(),
snmpa_vacm:delete(Key).
@@ -299,6 +303,7 @@ add_view_tree_fam(ViewIndex, SubTree, Status, Mask) ->
Key = [length(Key1) | Key1] ++ [length(Key2) | Key2],
case table_cre_row(vacmViewTreeFamilyTable, Key, Row) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
{ok, Key};
false ->
{error, create_failed}
@@ -312,6 +317,7 @@ add_view_tree_fam(ViewIndex, SubTree, Status, Mask) ->
delete_view_tree_fam(Key) ->
case table_del_row(vacmViewTreeFamilyTable, Key) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
ok;
false ->
{error, delete_failed}
diff --git a/lib/snmp/src/agent/snmpa_agent.erl b/lib/snmp/src/agent/snmpa_agent.erl
index 82a7ec647b..6322f0f21d 100644
--- a/lib/snmp/src/agent/snmpa_agent.erl
+++ b/lib/snmp/src/agent/snmpa_agent.erl
@@ -1626,7 +1626,7 @@ invalidate_ca_cache() ->
MasterAgent ! invalidate_ca_cache;
false ->
%% This is running on a sub-agent node,
- %% so sent skip it
+ %% so skip it
ok
end;
_ -> % Not on this node
diff --git a/lib/snmp/src/agent/snmpa_conf.erl b/lib/snmp/src/agent/snmpa_conf.erl
index 4b88eb69f7..c17a6abbd7 100644
--- a/lib/snmp/src/agent/snmpa_conf.erl
+++ b/lib/snmp/src/agent/snmpa_conf.erl
@@ -424,7 +424,8 @@ target_addr_entry(Name,
EngineId,
TMask) ->
target_addr_entry(Name, Ip, 162, TagList,
- ParamsName, EngineId, TMask, 2048).
+ ParamsName, EngineId,
+ TMask, 2048).
target_addr_entry(Name,
Ip,
@@ -435,7 +436,8 @@ target_addr_entry(Name,
TMask,
MaxMessageSize) ->
target_addr_entry(Name, Ip, Udp, 1500, 3, TagList,
- ParamsName, EngineId, TMask, MaxMessageSize).
+ ParamsName, EngineId,
+ TMask, MaxMessageSize).
target_addr_entry(Name,
Ip,
@@ -448,7 +450,8 @@ target_addr_entry(Name,
TMask,
MaxMessageSize) ->
target_addr_entry(Name, snmp_target_mib:default_domain(), Ip, Udp,
- Timeout, RetryCount, TagList, ParamsName,
+ Timeout, RetryCount, TagList,
+ ParamsName, EngineId,
TMask, MaxMessageSize).
target_addr_entry(Name,
diff --git a/lib/snmp/src/agent/snmpa_mpd.erl b/lib/snmp/src/agent/snmpa_mpd.erl
index 14f62b12f3..4f50b1a674 100644
--- a/lib/snmp/src/agent/snmpa_mpd.erl
+++ b/lib/snmp/src/agent/snmpa_mpd.erl
@@ -32,6 +32,7 @@
-include("SNMP-MPD-MIB.hrl").
-include("SNMPv2-TM.hrl").
-include("SNMP-FRAMEWORK-MIB.hrl").
+-include("TRANSPORT-ADDRESS-MIB.hrl").
-define(VMODULE,"MPD").
-include("snmp_verbosity.hrl").
@@ -981,12 +982,15 @@ generate_discovery_msg2(NoteStore, Pdu,
discovery_note_timeout(Timeout) ->
(Timeout div 100) + 1.
-generate_discovery_msg(NoteStore, {?snmpUDPDomain, [A,B,C,D,U1,U2]},
+generate_discovery_msg(NoteStore, {TDomain, TAddress},
Pdu, ScopedPduBytes,
ContextEngineID, ManagerEngineID,
SecModel, SecName, SecLevelFlag,
InitialUserName,
ContextName, Timeout) ->
+
+ {ok, {_Domain, Address}} = transform_taddr(TDomain, TAddress),
+
%% 7.1.7
?vdebug("generate_discovery_msg -> 7.1.7 (~w)", [ManagerEngineID]),
MsgID = generate_msg_id(),
@@ -1027,7 +1031,7 @@ generate_discovery_msg(NoteStore, {?snmpUDPDomain, [A,B,C,D,U1,U2]},
%% Log(Packet),
inc_snmp_out_vars(Pdu),
?vdebug("generate_discovery_msg -> done", []),
- {Packet, {{A,B,C,D}, U1 bsl 8 + U2}};
+ {Packet, Address};
Error ->
throw(Error)
@@ -1057,6 +1061,34 @@ generate_sec_discovery_msg(Message, SecModule,
end.
+transform_taddr(?snmpUDPDomain, TAddress) ->
+ transform_taddr(?transportDomainUdpIpv4, TAddress);
+transform_taddr(?transportDomainUdpIpv4, [A, B, C, D, P1, P2]) ->
+ Domain = transportDomainUdpIpv4,
+ Addr = {A,B,C,D},
+ Port = P1 bsl 8 + P2,
+ Address = {Addr, Port},
+ {ok, {Domain, Address}};
+transform_taddr(?transportDomainUdpIpv4, BadAddr) ->
+ {error, {bad_transportDomainUdpIpv4_address, BadAddr}};
+transform_taddr(?transportDomainUdpIpv6,
+ [A1, A2, A3, A4, A5, A6, A7, A8, P1, P2]) ->
+ Domain = transportDomainUdpIpv6,
+ Addr = {A1, A2, A3, A4, A5, A6, A7, A8},
+ Port = P1 bsl 8 + P2,
+ Address = {Addr, Port},
+ {ok, {Domain, Address}};
+transform_taddr(?transportDomainUdpIpv6, BadAddr) ->
+ {error, {bad_transportDomainUdpIpv6_address, BadAddr}};
+transform_taddr(BadTDomain, TAddress) ->
+ case lists:member(BadTDomain, snmp_conf:all_tdomains()) of
+ true ->
+ {error, {unsupported_tdomain, BadTDomain, TAddress}};
+ false ->
+ {error, {unknown_tdomain, BadTDomain, TAddress}}
+ end.
+
+
process_taddrs(Dests) ->
?vtrace("process_taddrs -> entry with"
"~n Dests: ~p", [Dests]),
@@ -1066,46 +1098,44 @@ process_taddrs([], Acc) ->
?vtrace("process_taddrs -> entry when done with"
"~n Acc: ~p", [Acc]),
lists:reverse(Acc);
-
+
%% v3
-process_taddrs([{{?snmpUDPDomain, [A,B,C,D,U1,U2]}, SecData} | T], Acc) ->
+process_taddrs([{{TDomain, TAddress}, SecData} | T], Acc) ->
?vtrace("process_taddrs -> entry when v3 with"
- "~n A: ~p"
- "~n B: ~p"
- "~n C: ~p"
- "~n D: ~p"
- "~n U1: ~p"
- "~n U2: ~p"
- "~n SecData: ~p", [A, B, C, D, U1, U2, SecData]),
- Entry = {{snmpUDPDomain, {{A,B,C,D}, U1 bsl 8 + U2}}, SecData},
- process_taddrs(T, [Entry | Acc]);
-%% Bad v3
-process_taddrs([{{TDomain, TAddr}, _SecData} | T], Acc) ->
- ?vtrace("process_taddrs -> entry when bad v3 with"
- "~n TDomain: ~p"
- "~n TAddr: ~p", [TDomain, TAddr]),
- user_err("Bad TDomain/TAddr: ~w/~w", [TDomain, TAddr]),
- process_taddrs(T, Acc);
+ "~n TDomain: ~p"
+ "~n TAddress: ~p"
+ "~n SecData: ~p", [TDomain, TAddress, SecData]),
+ case transform_taddr(TDomain, TAddress) of
+ {ok, DestAddr} ->
+ ?vtrace("process_taddrs -> transformed: "
+ "~n DestAddr: ~p", [DestAddr]),
+ Entry = {DestAddr, SecData},
+ process_taddrs(T, [Entry | Acc]);
+ {error, Reason} ->
+ ?vinfo("Failed transforming v3 domain and address"
+ "~n Reason: ~p", [Reason]),
+ user_err("Bad TDomain/TAddress: ~w/~w", [TDomain, TAddress]),
+ process_taddrs(T, Acc)
+ end;
%% v1 & v2
-process_taddrs([{?snmpUDPDomain, [A,B,C,D,U1,U2]} | T], Acc) ->
+process_taddrs([{TDomain, TAddress} | T], Acc) ->
?vtrace("process_taddrs -> entry when v1/v2 with"
- "~n A: ~p"
- "~n B: ~p"
- "~n C: ~p"
- "~n D: ~p"
- "~n U1: ~p"
- "~n U2: ~p", [A, B, C, D, U1, U2]),
- Entry = {snmpUDPDomain, {{A,B,C,D}, U1 bsl 8 + U2}},
- process_taddrs(T, [Entry | Acc]);
-%% Bad v1 or v2
-process_taddrs([{TDomain, TAddr} | T], Acc) ->
- ?vtrace("process_taddrs -> entry when bad v1/v2 with"
- "~n TDomain: ~p"
- "~n TAddr: ~p", [TDomain, TAddr]),
- user_err("Bad TDomain/TAddr: ~w/~w", [TDomain, TAddr]),
- process_taddrs(T, Acc);
+ "~n TDomain: ~p"
+ "~n TAddress: ~p", [TDomain, TAddress]),
+ case transform_taddr(TDomain, TAddress) of
+ {ok, DestAddr} ->
+ ?vtrace("process_taddrs -> transformed: "
+ "~n DestAddr: ~p", [DestAddr]),
+ Entry = DestAddr,
+ process_taddrs(T, [Entry | Acc]);
+ {error, Reason} ->
+ ?vinfo("Failed transforming v1/v2 domain and address: "
+ "~n Reason: ~p", [Reason]),
+ user_err("Bad TDomain/TAddress: ~w/~w", [TDomain, TAddress]),
+ process_taddrs(T, Acc)
+ end;
process_taddrs(Crap, Acc) ->
- throw({error, {taddrs_crap, Crap, Acc}}).
+ throw({error, {bad_taddrs, Crap, Acc}}).
mk_v1_v2_packet_list(To, Packet, Len, Pdu) ->
diff --git a/lib/snmp/src/app/snmp.appup.src b/lib/snmp/src/app/snmp.appup.src
index 5deb40be0f..8e1855b4df 100644
--- a/lib/snmp/src/app/snmp.appup.src
+++ b/lib/snmp/src/app/snmp.appup.src
@@ -22,82 +22,82 @@
%% ----- U p g r a d e -------------------------------------------------------
[
+ {"4.20.1",
+ [
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
+ {"4.20",
+ [
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmp_target_mib, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
{"4.19",
[
{load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
{load_module, snmpa_usm, soft_purge, soft_purge, []},
{load_module, snmpm_usm, soft_purge, soft_purge, []},
{load_module, snmp_log, soft_purge, soft_purge, []},
{load_module, snmp_pdus, soft_purge, soft_purge, []},
{load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_conf, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
{load_module, snmp_misc, soft_purge, soft_purge, []},
{load_module, snmp_config, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
{load_module, snmpa_trap, soft_purge, soft_purge,
[snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
{load_module, snmpa_acm, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd, snmp_target_mib]},
{load_module, snmpa_conf, soft_purge, soft_purge,
- [snmp_notification_mib]},
+ [snmp_config, snmp_notification_mib]},
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
{load_module, snmp_notification_mib, soft_purge, soft_purge,
[snmp_conf, snmp_target_mib]},
{load_module, snmp_community_mib, soft_purge, soft_purge, []},
{load_module, snmp_target_mib, soft_purge, soft_purge,
[snmp_conf]},
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
- {update, snmpa_net_if, soft, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd]},
- {update, snmpa_agent, soft, soft_purge, soft_purge,
- [snmpa_acm, snmpa_mpd, snmpa_trap]}
- ]
- },
- {"4.18",
- [
- {load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
- {load_module, snmpa_usm, soft_purge, soft_purge, []},
- {load_module, snmpm_usm, soft_purge, soft_purge, []},
- {load_module, snmp_misc, soft_purge, soft_purge, []},
- {load_module, snmp_log, soft_purge, soft_purge, []},
- {load_module, snmp_pdus, soft_purge, soft_purge, []},
- {load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmp_config, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmpa_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmpa_vacm, soft_purge, soft_purge, []},
- {load_module, snmpa_trap, soft_purge, soft_purge,
- [snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
- {load_module, snmpa_acm, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd, snmp_target_mib]},
- {load_module, snmpa, soft_purge, soft_purge,
- [snmp_community_mib,
- snmp_framework_mib,
- snmp_standard_mib,
- snmp_target_mib,
- snmp_user_based_sm_mib,
- snmp_view_based_acm_mib]},
- {load_module, snmp_notification_mib, soft_purge, soft_purge,
- [snmp_conf, snmp_target_mib, snmpa_mib_lib]},
- {load_module, snmp_community_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_framework_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_standard_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_target_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_user_based_sm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib, snmpa_vacm]},
- {load_module, snmpa_mib_lib, soft_purge, soft_purge, []},
-
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
-
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
{update, snmpa_net_if, soft, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd]},
{update, snmpa_agent, soft, soft_purge, soft_purge,
@@ -109,84 +109,82 @@
%% ------D o w n g r a d e ---------------------------------------------------
[
+ {"4.20.1",
+ [
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
+ {"4.20",
+ [
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmp_target_mib, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
{"4.19",
[
{load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
{load_module, snmpa_usm, soft_purge, soft_purge, []},
{load_module, snmpm_usm, soft_purge, soft_purge, []},
{load_module, snmp_log, soft_purge, soft_purge, []},
{load_module, snmp_pdus, soft_purge, soft_purge, []},
{load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_conf, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
{load_module, snmp_misc, soft_purge, soft_purge, []},
{load_module, snmp_config, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
{load_module, snmpa_trap, soft_purge, soft_purge,
[snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
{load_module, snmpa_acm, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd, snmp_target_mib]},
{load_module, snmpa_conf, soft_purge, soft_purge,
- [snmp_notification_mib]},
+ [snmp_config, snmp_notification_mib]},
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
{load_module, snmp_notification_mib, soft_purge, soft_purge,
[snmp_conf, snmp_target_mib]},
{load_module, snmp_community_mib, soft_purge, soft_purge, []},
{load_module, snmp_target_mib, soft_purge, soft_purge,
[snmp_conf]},
-
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
-
- {update, snmpa_net_if, soft, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd]},
- {update, snmpa_agent, soft, soft_purge, soft_purge,
- [snmpa_acm, snmpa_mpd, snmpa_trap]}
- ]
- },
- {"4.18",
- [
- {load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
- {load_module, snmpa_usm, soft_purge, soft_purge, []},
- {load_module, snmpm_usm, soft_purge, soft_purge, []},
- {load_module, snmp_misc, soft_purge, soft_purge, []},
- {load_module, snmp_log, soft_purge, soft_purge, []},
- {load_module, snmp_pdus, soft_purge, soft_purge, []},
- {load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmp_config, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmpa_vacm, soft_purge, soft_purge, []},
- {load_module, snmpa_trap, soft_purge, soft_purge,
- [snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
- {load_module, snmpa_acm, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd, snmp_target_mib]},
- {load_module, snmpa, soft_purge, soft_purge,
- [snmp_community_mib,
- snmp_framework_mib,
- snmp_standard_mib,
- snmp_target_mib,
- snmp_user_based_sm_mib,
- snmp_view_based_acm_mib]},
- {load_module, snmp_notification_mib, soft_purge, soft_purge,
- [snmp_conf, snmp_target_mib, snmpa_mib_lib]},
- {load_module, snmp_community_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_framework_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_standard_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_target_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_user_based_sm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib, snmpa_vacm]},
- {load_module, snmpa_mib_lib, soft_purge, soft_purge, []},
-
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
-
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
{update, snmpa_net_if, soft, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd]},
{update, snmpa_agent, soft, soft_purge, soft_purge,
diff --git a/lib/snmp/src/compile/Makefile b/lib/snmp/src/compile/Makefile
index 0ceaf276a6..627af6f185 100644
--- a/lib/snmp/src/compile/Makefile
+++ b/lib/snmp/src/compile/Makefile
@@ -45,11 +45,10 @@ RELSYSDIR = $(RELEASE_PATH)/lib/snmp-$(VSN)
include modules.mk
-ESCRIPT_BIN = $(ESCRIPT_SRC:%.src=$(BIN)/%)
-
-ERL_FILES = $(MODULES:%=%.erl)
-
-TARGET_FILES = $(MODULES:%=$(EBIN)/%.$(EMULATOR)) $(ESCRIPT_BIN)
+ESCRIPT_BIN = $(ESCRIPT_SRC:%.src=$(BIN)/%)
+ERL_FILES = $(MODULES:%=%.erl)
+EBIN_FILES = $(MODULES:%=$(EBIN)/%.$(EMULATOR))
+TARGET_FILES = $(EBIN_FILES) $(ESCRIPT_BIN)
GENERATED_PARSER = $(PARSER_MODULE:%=%.erl)
@@ -125,7 +124,7 @@ release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/src/compiler
$(INSTALL_DATA) $(ESCRIPT_SRC) $(PARSER_SRC) $(ERL_FILES) $(INTERNAL_HRL_FILES) $(RELSYSDIR)/src/compiler
$(INSTALL_DIR) $(RELSYSDIR)/ebin
- $(INSTALL_DATA) $(TARGET_FILES) $(RELSYSDIR)/ebin
+ $(INSTALL_DATA) $(EBIN_FILES) $(RELSYSDIR)/ebin
$(INSTALL_DIR) $(RELSYSDIR)/bin
$(INSTALL_SCRIPT) $(ESCRIPT_BIN) $(RELSYSDIR)/bin
diff --git a/lib/snmp/src/compile/snmpc.erl b/lib/snmp/src/compile/snmpc.erl
index 195c238184..5e6b81f1ec 100644
--- a/lib/snmp/src/compile/snmpc.erl
+++ b/lib/snmp/src/compile/snmpc.erl
@@ -108,6 +108,7 @@ compile(FileName) ->
%% {i, [import_dir_string()]} ["./"]
%% {il, [import_lib_dir_string()]} []
%% {warnings, bool()} true
+%% warnings_as_errors
%% {outdir, string()} "./"
%% description
%% reference
@@ -199,6 +200,8 @@ get_options([reference|Opts], Formats, Args) ->
get_options(Opts, ["~n reference"|Formats], Args);
get_options([{warnings, Val}|Opts], Formats, Args) ->
get_options(Opts, ["~n warnings: ~w"|Formats], [Val|Args]);
+get_options([warnings_as_errors|Opts], Formats, Args) ->
+ get_options(Opts, ["~n warnings_as_errors"|Formats], Args);
get_options([{verbosity, Val}|Opts], Formats, Args) ->
get_options(Opts, ["~n verbosity: ~w"|Formats], [Val|Args]);
get_options([imports|Opts], Formats, Args) ->
@@ -261,6 +264,8 @@ check_options([{group_check, Atom} | T]) when is_atom(Atom) ->
check_options([{warnings, Bool} | T]) ->
check_bool(warnings, Bool),
check_options(T);
+check_options([warnings_as_errors | T]) ->
+ check_options(T);
check_options([{db, volatile} | T]) ->
check_options(T);
check_options([{db, persistent} | T]) ->
@@ -331,6 +336,9 @@ get_agent_capabilities(Options) ->
get_module_compliance(Options) ->
get_bool_option(module_compliance, Options).
+get_warnings_as_errors(Options) ->
+ lists:member(warnings_as_errors, Options).
+
get_relaxed_row_name_assign_check(Options) ->
lists:member(relaxed_row_name_assign_check, Options).
@@ -409,6 +417,7 @@ init(From, MibFileName, Options) ->
put(reference, get_reference(Options)),
put(agent_capabilities, get_agent_capabilities(Options)),
put(module_compliance, get_module_compliance(Options)),
+ put(warnings_as_errors, get_warnings_as_errors(Options)),
File = filename:rootname(MibFileName, ".mib"),
put(filename, filename:basename(File ++ ".mib")),
R = case catch c_impl(File) of
diff --git a/lib/snmp/src/compile/snmpc.src b/lib/snmp/src/compile/snmpc.src
index 5f9b154bfa..4e91ae9a03 100644
--- a/lib/snmp/src/compile/snmpc.src
+++ b/lib/snmp/src/compile/snmpc.src
@@ -50,7 +50,8 @@
%% The default verbosity (silence) will be filled in
%% during argument processing.
verbosity,
- warnings = false
+ warnings = false,
+ warnings_as_errors = false
}).
@@ -74,6 +75,7 @@
%% --version
%% --verbosity V
%% --warnings
+%% --wae
main(Args) when is_list(Args) ->
case (catch process_args(Args)) of
ok ->
@@ -156,7 +158,8 @@ mk_mib_options(#state{outdir = OutDir,
%% The default verbosity (silence) will be filled in
%% during argument processing.
verbosity = V,
- warnings = W}) ->
+ warnings = W,
+ warnings_as_errors = WAE}) ->
[{outdir, OutDir},
{db, DB},
{i, IDs},
@@ -178,7 +181,8 @@ mk_mib_options(#state{outdir = OutDir,
maybe_option(Imp, imports) ++
maybe_option(MI, module_identity) ++
maybe_option(MC, module_compliance) ++
- maybe_option(AC, agent_capabilities).
+ maybe_option(AC, agent_capabilities) ++
+ maybe_option(WE, warnings_as_errors).
maybe_option(true, Opt) -> [Opt];
maybe_option(_, _) -> [].
@@ -292,6 +296,8 @@ process_args(["--nd"|Args], State) ->
process_args(Args, State#state{no_defaults = true});
process_args(["--rrnac"|Args], State) ->
process_args(Args, State#state{relaxed_row_name_assigne_check = true});
+process_args(["--wae"|Args], State) ->
+ process_args(Args, State#state{warnings_as_errors = true});
process_args([MIB], State) ->
Ext = filename:extension(MIB),
if
@@ -371,6 +377,8 @@ usage() ->
"~n a warning. "
"~n By default it is not included, but if this option is "
"~n present it will be. "
+ "~n --wae - Warnings as errors. "
+ "~n Indicates that warnings shall be treated as errors. "
"~n "
"~n", []),
halt(1).
diff --git a/lib/snmp/src/compile/snmpc_lib.hrl b/lib/snmp/src/compile/snmpc_lib.hrl
index 000486e728..35ec9abd03 100644
--- a/lib/snmp/src/compile/snmpc_lib.hrl
+++ b/lib/snmp/src/compile/snmpc_lib.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -20,8 +20,17 @@
-ifndef(snmpc_lib).
-define(snmpc_lib, true).
--define(vwarning(F, A), ?verbosity(warning, F, A, ignore)).
--define(vwarning2(F, A, MibLine), ?verbosity(warning, F, A, MibLine)).
+-define(vwarning(F, A),
+ case get(warnings_as_errors) of
+ true -> snmpc_lib:error(F, A);
+ _ -> ?verbosity(warning, F, A, ignore)
+ end).
+
+-define(vwarning2(F, A, MibLine),
+ case get(warnings_as_errors) of
+ true -> snmpc_lib:error(F, A, MibLine);
+ _ -> ?verbosity(warning, F, A, MibLine)
+ end).
-define(vinfo(F, A), ?verbosity(info, F, A, ignore)).
-define(vinfo2(F, A, MibLine), ?verbosity(info, F, A, MibLine)).
-define(vlog(F, A), ?verbosity(log, F, A, ignore)).
diff --git a/lib/snmp/src/manager/snmpm.erl b/lib/snmp/src/manager/snmpm.erl
index 0d084332de..6d2ac8d747 100644
--- a/lib/snmp/src/manager/snmpm.erl
+++ b/lib/snmp/src/manager/snmpm.erl
@@ -50,7 +50,7 @@
register_agent/2, register_agent/3, register_agent/4,
unregister_agent/2, unregister_agent/3,
which_agents/0, which_agents/1,
- agent_info/2, update_agent_info/4,
+ agent_info/2, update_agent_info/3, update_agent_info/4,
register_usm_user/3, unregister_usm_user/2,
which_usm_users/0, which_usm_users/1,
@@ -167,6 +167,7 @@
-include_lib("snmp/include/snmp_types.hrl").
-include("snmpm_atl.hrl").
-include("snmpm_internal.hrl").
+-include("snmp_verbosity.hrl").
-define(DEFAULT_AGENT_PORT, 161).
@@ -447,8 +448,11 @@ agent_info(Addr, Port, Item) ->
Error
end.
+update_agent_info(UserId, TargetName, Info) when is_list(Info) ->
+ snmpm_config:update_agent_info(UserId, TargetName, Info).
+
update_agent_info(UserId, TargetName, Item, Val) ->
- snmpm_config:update_agent_info(UserId, TargetName, Item, Val).
+ update_agent_info(UserId, TargetName, [{Item, Val}]).
%% Backward compatibility functions
update_agent_info(UserId, Addr, Port, Item, Val) ->
diff --git a/lib/snmp/src/manager/snmpm_config.erl b/lib/snmp/src/manager/snmpm_config.erl
index fd6da3e71a..c2e57abddb 100644
--- a/lib/snmp/src/manager/snmpm_config.erl
+++ b/lib/snmp/src/manager/snmpm_config.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -36,7 +36,8 @@
user_info/0, user_info/1, user_info/2,
register_agent/3, unregister_agent/2,
- agent_info/0, agent_info/2, agent_info/3, update_agent_info/4,
+ agent_info/0, agent_info/2, agent_info/3,
+ update_agent_info/3, update_agent_info/4,
which_agents/0, which_agents/1,
is_known_engine_id/2,
@@ -84,7 +85,9 @@
backup/1,
- mk_target_name/3
+ mk_target_name/3,
+
+ default_transport_domain/0
]).
@@ -127,23 +130,24 @@
%% Macros and Constants:
--define(SERVER, ?MODULE).
--define(BACKUP_DB, snmpm_config_backup).
--define(CONFIG_DB, snmpm_config_db).
+-define(SERVER, ?MODULE).
+-define(BACKUP_DB, snmpm_config_backup).
+-define(CONFIG_DB, snmpm_config_db).
-define(DEFAULT_USER, default_user).
-define(DEFAULT_AGENT_PORT, 161).
--define(IRB_DEFAULT, auto).
-%% -define(IRB_DEFAULT, {user, timer:seconds(15)}).
+-define(IRB_DEFAULT, auto).
+%% -define(IRB_DEFAULT, {user, timer:seconds(15)}).
--define(USER_MOD_DEFAULT, snmpm_user_default).
--define(USER_DATA_DEFAULT, undefined).
+-define(USER_MOD_DEFAULT, snmpm_user_default).
+-define(USER_DATA_DEFAULT, undefined).
%% -define(DEF_ADDR_TAG, default_addr_tag).
-define(DEFAULT_TARGETNAME, default_agent).
--define(DEF_PORT_TAG, default_port_tag).
+-define(DEF_PORT_TAG, default_port_tag).
+-define(SUPPORTED_DOMAINS, [transportDomainUdpIpv4, transportDomainUdpIpv6]).
-ifdef(snmp_debug).
-define(GS_START_LINK(Opts),
@@ -159,6 +163,11 @@
%%%-------------------------------------------------------------------
%%% API
%%%-------------------------------------------------------------------
+
+default_transport_domain() ->
+ transportDomainUdpIpv4.
+
+
start_link(Opts) ->
?d("start_link -> entry with"
"~n Opts: ~p", [Opts]),
@@ -269,9 +278,10 @@ do_user_info(_UserId, BadItem) ->
error({not_found, BadItem}).
-%% A target-name constructed in this way is a string with the following
+%% A target-name constructed in this way is a string with the following:
%% <IP-address>:<Port>-<Version>
-%%
+%% This is intended for backward compatibility and therefor has
+%% only support for IPv4 addresses and *no* other transport domain.
mk_target_name(Addr0, Port, Config) when is_list(Config) ->
Version =
case lists:keysearch(version, 1, Config) of
@@ -280,7 +290,6 @@ mk_target_name(Addr0, Port, Config) when is_list(Config) ->
false ->
select_lowest_supported_version()
end,
-%% p("mk_target_name -> Version: ~p", [Version]),
case normalize_address(Addr0) of
{A, B, C, D} ->
lists:flatten(
@@ -308,57 +317,99 @@ select_lowest_supported_version([H|T], Versions) ->
end.
-register_agent(UserId, _TargetName, _Config) when (UserId =:= user_id) ->
+register_agent(UserId, _TargetName, _Config0) when (UserId =:= user_id) ->
{error, {bad_user_id, UserId}};
-register_agent(UserId, TargetName, Config)
+register_agent(UserId, TargetName, Config0)
when (is_list(TargetName) andalso
(length(TargetName) > 0) andalso
- is_list(Config)) ->
+ is_list(Config0)) ->
-%% p("register_agent -> entry with"
-%% "~n UserId: ~p"
-%% "~n TargetName: ~p"
-%% "~n Config: ~p", [UserId, TargetName, Config]),
+ ?vtrace("register_agent -> entry with"
+ "~n UserId: ~p"
+ "~n TargetName: ~p"
+ "~n Config0: ~p", [UserId, TargetName, Config0]),
%% Check:
%% 1) That the mandatory configs are present
- %% 2) That the illegal config user_id (used internally) is
- %% not present
+ %% 2) That no illegal config, e.g. user_id (used internally),
+ %% is not present
%% 3) Check that there are no invalid or erroneous configs
- %% 4) Chack that the manager is capable to use the selected version
- case verify_agent_config(Config) of
- ok ->
+ %% 4) Check that the manager is capable of using the selected version
+ case verify_agent_config(Config0) of
+ {ok, Config} ->
call({register_agent, UserId, TargetName, Config});
Error ->
Error
end.
-verify_agent_config(Conf) ->
- ok = verify_mandatory(Conf, [engine_id, address, reg_type]),
- case verify_invalid(Conf, [user_id]) of
- ok ->
- case verify_agent_config2(Conf) of
- ok ->
- {ok, Vsns} = system_info(versions),
- Vsn =
- case lists:keysearch(version, 1, Conf) of
- {value, {version, V}} ->
- V;
- false ->
- v1
- end,
- case lists:member(Vsn, Vsns) of
- true ->
- ok;
- false ->
- {error, {version_not_supported_by_manager, Vsn, Vsns}}
- end
- end;
- Error ->
+verify_agent_config(Conf0) ->
+ try
+ begin
+ verify_mandatory(Conf0, [engine_id, address, reg_type]),
+ verify_invalid(Conf0, [user_id]),
+ Conf = verify_agent_config3(Conf0),
+ Vsns = versions(),
+ Vsn = which_version(Conf),
+ verify_version(Vsn, Vsns),
+ {ok, Conf}
+ end
+ catch
+ throw:Error ->
Error
end.
+versions() ->
+ case system_info(versions) of
+ {ok, Vsns} ->
+ Vsns;
+ {error, _} = ERROR ->
+ throw(ERROR)
+ end.
+
+which_version(Conf) ->
+ case lists:keysearch(version, 1, Conf) of
+ {value, {version, V}} ->
+ V;
+ false ->
+ v1
+ end.
+
+verify_version(Vsn, Vsns) ->
+ case lists:member(Vsn, Vsns) of
+ true ->
+ ok;
+ false ->
+ Reason = {version_not_supported_by_manager, Vsn, Vsns},
+ throw({error, Reason})
+ end.
+
+verify_agent_config3(Conf0) ->
+ %% Fix (transport) address and domain
+ {TDomain, Conf1} =
+ case lists:keysearch(tdomain, 1, Conf0) of
+ {value, {tdomain, Dom}} ->
+ {Dom, Conf0};
+ false ->
+ Dom = default_transport_domain(),
+ {Dom, [{tdomain, Dom} | Conf0]}
+ end,
+ Conf2 = case lists:keysearch(address, 1, Conf1) of
+ {value, {address, Address}} ->
+ lists:keyreplace(address, 1, Conf1,
+ {address, {TDomain, Address}});
+ false ->
+ %% This is a mandatory config option,
+ %% a later test will detect this
+ Conf1
+ end,
+ case verify_agent2(Conf2) of
+ {ok, Conf} ->
+ Conf;
+ {error, _} = ERROR ->
+ throw(ERROR)
+ end.
+
verify_agent_config2(Conf) ->
verify_agent2(Conf).
@@ -366,6 +417,7 @@ verify_agent_config2(Conf) ->
unregister_agent(UserId, TargetName) ->
call({unregister_agent, UserId, TargetName}).
+%% This is the old style agent unregistration (using Addr and Port).
unregister_agent(UserId, Addr0, Port) ->
Addr = normalize_address(Addr0),
case do_agent_info(Addr, Port, target_name) of
@@ -421,17 +473,51 @@ which_agents(UserId) ->
Agents = ets:match(snmpm_agent_table, Pat),
[TargetName || [TargetName] <- Agents].
-
-update_agent_info(UserId, TargetName, Item, Val0)
- when (Item =/= user_id) ->
- case (catch verify_val(Item, Val0)) of
- {ok, Val} ->
- call({update_agent_info, UserId, TargetName, Item, Val});
- Error ->
+
+verify_agent_info(TargetName, Info0) ->
+ try
+ begin
+ verify_invalid(Info0, [user_id]),
+ %% Check if address is part of the list and
+ %% if so update it with the domain info.
+ Info =
+ case lists:keysearch(address, 1, Info0) of
+ {value, {address, Addr}} ->
+ %% If domain is part of the info, then use it.
+ %% If not, lookup what is already stored for
+ %% this agent and use that.
+ Domain =
+ case lists:keysearch(tdomain, 1, Info0) of
+ {value, {tdomain, Dom}} ->
+ Dom;
+ false ->
+ {ok, Dom} =
+ agent_info(TargetName, tdomain),
+ Dom
+ end,
+ Addr2 = {Domain, Addr},
+ lists:keyreplace(address, 1, Info0, {address, Addr2});
+ false ->
+ Info0
+ end,
+ verify_agent2(Info)
+ end
+ catch
+ throw:Error ->
Error
end.
-%% Backward compatibillity
+update_agent_info(UserId, TargetName, Info) ->
+ call({update_agent_info, UserId, TargetName, Info}).
+
+%% <BACKWARD-COMPAT-2>
+%% This is wrapped in the interface module, so this function is
+%% only here to catch code-upgrade problems.
+update_agent_info(UserId, TargetName, Item, Val) ->
+ update_agent_info(UserId, TargetName, [{Item, Val}]).
+%% </BACKWARD-COMPAT-2>
+
+%% <BACKWARD-COMPAT-1>
update_agent_info(UserId, Addr, Port, Item, Val) ->
case agent_info(Addr, Port, target_name) of
{ok, TargetName} ->
@@ -439,6 +525,7 @@ update_agent_info(UserId, Addr, Port, Item, Val) ->
Error ->
Error
end.
+%% </BACKWARD-COMPAT-1>
is_known_engine_id(EngineID, TargetName) ->
case agent_info(TargetName, engine_id) of
@@ -650,22 +737,14 @@ unregister_usm_user(EngineID, Name)
call({unregister_usm_user, EngineID, Name}).
verify_usm_user_config(EngineID, Name, Config) ->
- %% case verify_mandatory(Config, []) of
- %% ok ->
- %% case verify_invalid(Config, [engine_id, name]) of
- %% ok ->
- %% verify_usm_user_config2(EngineID, Name, Config);
- %% Error ->
- %% Error
- %% end;
- %% Error ->
- %% Error
- %% end.
- ok = verify_mandatory(Config, []),
- case verify_invalid(Config, [engine_id, name]) of
- ok ->
- verify_usm_user_config2(EngineID, Name, Config);
- Error ->
+ try
+ begin
+ verify_mandatory(Config, []),
+ verify_invalid(Config, [engine_id, name]),
+ verify_usm_user_config2(EngineID, Name, Config)
+ end
+ catch
+ throw:Error ->
Error
end.
@@ -1590,6 +1669,7 @@ check_agent_config2(Agent) ->
throw(Err)
end.
+%% For backward compatibility
check_agent_config({UserId,
TargetName,
Community,
@@ -1597,10 +1677,27 @@ check_agent_config({UserId,
EngineId,
Timeout, MaxMessageSize,
Version, SecModel, SecName, SecLevel}) ->
+ TDomain = default_transport_domain(),
+ check_agent_config({UserId,
+ TargetName,
+ Community,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MaxMessageSize,
+ Version, SecModel, SecName, SecLevel});
+
+check_agent_config({UserId,
+ TargetName,
+ Community,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MaxMessageSize,
+ Version, SecModel, SecName, SecLevel}) ->
?vtrace("check_agent_config -> entry with"
"~n UserId: ~p"
"~n TargetName: ~p"
"~n Community: ~p"
+ "~n TDomain: ~p"
"~n Ip: ~p"
"~n Port: ~p"
"~n EngineId: ~p"
@@ -1610,15 +1707,16 @@ check_agent_config({UserId,
"~n SecModel: ~p"
"~n SecName: ~p"
"~n SecLevel: ~p",
- [UserId, TargetName, Community, Ip, Port,
+ [UserId, TargetName, Community,
+ TDomain, Ip, Port,
EngineId, Timeout, MaxMessageSize,
Version, SecModel, SecName, SecLevel]),
- Addr = normalize_address(Ip),
+ Addr = normalize_address(TDomain, Ip),
?vtrace("check_agent_config -> Addr: ~p", [Addr]),
Agent = {UserId,
TargetName,
Community,
- Addr, Port,
+ TDomain, Addr, Port,
EngineId,
Timeout, MaxMessageSize,
Version, SecModel, SecName, SecLevel},
@@ -1644,6 +1742,7 @@ init_agent_config({UserId, TargetName, Config}) ->
end.
+%% For backward compatibility
verify_agent({UserId,
TargetName,
Comm,
@@ -1651,48 +1750,68 @@ verify_agent({UserId,
EngineId,
Timeout, MMS,
Version, SecModel, SecName, SecLevel}) ->
- ?vtrace("verify_agent -> entry with"
+ TDomain = default_transport_domain(),
+ verify_agent({UserId,
+ TargetName,
+ Comm,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MMS,
+ Version, SecModel, SecName, SecLevel});
+
+verify_agent({UserId,
+ TargetName,
+ Comm,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MMS,
+ Version, SecModel, SecName, SecLevel}) ->
+ ?vdebug("verify_agent -> entry with"
"~n UserId: ~p"
"~n TargetName: ~p", [UserId, TargetName]),
snmp_conf:check_string(TargetName, {gt, 0}),
- case verify_val(address, Ip) of
- {ok, Addr} ->
- snmp_conf:check_integer(Port, {gt, 0}),
- Conf =
- [{reg_type, target_name},
- {address, Addr},
- {port, Port},
- {community, Comm},
- {engine_id, EngineId},
- {timeout, Timeout},
- {max_message_size, MMS},
- {version, Version},
- {sec_model, SecModel},
- {sec_name, SecName},
- {sec_level, SecLevel}
- ],
- case verify_agent2(Conf) of
- ok ->
- {UserId, TargetName, Conf, Version};
- Err ->
- throw(Err)
- end;
-
- Error ->
- ?vlog("verify_agent -> failed: ~n ~p", [Error]),
- throw(Error)
+ snmp_conf:check_integer(Port, {gt, 0}),
+ %% Note that the order of Conf *is* important.
+ %% Some properties may depend on others, so that
+ %% in order to verify one property, another must
+ %% be already verified (and present). An example
+ %% of this is the property 'address', for which
+ %% the property tdomain is needed.
+ Conf0 =
+ [{reg_type, target_name},
+ {tdomain, TDomain},
+ %% This should be taddress, but what the*...
+ {address, {TDomain, Ip}},
+ {port, Port},
+ {community, Comm},
+ {engine_id, EngineId},
+ {timeout, Timeout},
+ {max_message_size, MMS},
+ {version, Version},
+ {sec_model, SecModel},
+ {sec_name, SecName},
+ {sec_level, SecLevel}
+ ],
+ case verify_agent2(Conf0) of
+ {ok, Conf} ->
+ {UserId, TargetName, Conf, Version};
+ Err ->
+ throw(Err)
end.
-verify_agent2([]) ->
- ok;
-verify_agent2([{Item, Val}|Items]) ->
- case verify_val(Item, Val) of
- {ok, _Val} ->
- verify_agent2(Items);
+verify_agent2(Conf) ->
+ verify_agent2(Conf, []).
+
+verify_agent2([], VerifiedConf) ->
+ {ok, VerifiedConf};
+verify_agent2([{Item, Val0}|Items], VerifiedConf) ->
+ case verify_val(Item, Val0) of
+ {ok, Val} ->
+ verify_agent2(Items, [{Item, Val} | VerifiedConf]);
Err ->
Err
end;
-verify_agent2([Bad|_]) ->
+verify_agent2([Bad|_], _VerifiedConf) ->
{error, {bad_agent_config, Bad}}.
@@ -1708,14 +1827,28 @@ read_users_config_file(Dir) ->
check_user_config({Id, Mod, Data}) ->
+ ?vtrace("check_user_config -> entry with"
+ "~n Id: ~p"
+ "~n Mod: ~p"
+ "~n Data: ~p", [Id, Mod, Data]),
check_user_config({Id, Mod, Data, []});
-check_user_config({Id, Mod, _Data, DefaultAgentConfig} = User)
+check_user_config({Id, Mod, Data, DefaultAgentConfig} = _User)
when (Id =/= ?DEFAULT_USER) andalso is_list(DefaultAgentConfig) ->
+ ?vtrace("check_user_config -> entry with"
+ "~n Id: ~p"
+ "~n Mod: ~p"
+ "~n Data: ~p"
+ "~n DefaultAgentConfig: ~p",
+ [Id, Mod, Data, DefaultAgentConfig]),
case (catch verify_user_behaviour(Mod)) of
ok ->
+ ?vtrace("check_user_config -> user behaviour verified", []),
case verify_user_agent_config(DefaultAgentConfig) of
- ok ->
- {ok, User};
+ {ok, DefAgentConf} ->
+ ?vtrace("check_user_config -> "
+ "user agent (default) config verified", []),
+ User2 = {Id, Mod, Data, DefAgentConf},
+ {ok, User2};
{error, Reason} ->
error({bad_default_agent_config, Reason})
end;
@@ -1756,16 +1889,16 @@ verify_user({Id, UserMod, UserData}) ->
verify_user({Id, UserMod, UserData, DefaultAgentConfig})
when (Id =/= ?DEFAULT_USER) andalso is_list(DefaultAgentConfig) ->
?d("verify_user -> entry with"
- "~n Id: ~p"
- "~n UserMod: ~p"
- "~n UserData: ~p"
+ "~n Id: ~p"
+ "~n UserMod: ~p"
+ "~n UserData: ~p"
"~n DefaultAgentConfig: ~p",
[Id, UserMod, UserData, DefaultAgentConfig]),
case (catch verify_user_behaviour(UserMod)) of
ok ->
case verify_user_agent_config(DefaultAgentConfig) of
- ok ->
- Config = default_agent_config(DefaultAgentConfig),
+ {ok, DefAgentConf} ->
+ Config = default_agent_config(DefAgentConf),
{ok, #user{id = Id,
mod = UserMod,
data = UserData,
@@ -1783,10 +1916,15 @@ verify_user({Id, _, _, _}) ->
{error, {bad_user_id, Id}}.
verify_user_agent_config(Conf) ->
- case verify_invalid(Conf, [user_id, engine_id, address]) of
- ok ->
- verify_agent_config2(Conf);
- Error ->
+ try
+ begin
+ verify_invalid(Conf, [user_id, engine_id, address]),
+ verify_agent_config2(Conf)
+ end
+ catch
+ throw:Error ->
+ ?vdebug("verify_user_agent_config -> throw"
+ "~n Error: ~p", [Error]),
Error
end.
@@ -2147,6 +2285,16 @@ handle_call({unregister_agent, UserId, TargetName}, _From, State) ->
Reply = handle_unregister_agent(UserId, TargetName),
{reply, Reply, State};
+handle_call({update_agent_info, UserId, TargetName, Info},
+ _From, State) ->
+ ?vlog("received update_agent_info request: "
+ "~n UserId: ~p"
+ "~n TargetName: ~p"
+ "~n Info: ~p", [UserId, TargetName, Info]),
+ Reply = handle_update_agent_info(UserId, TargetName, Info),
+ {reply, Reply, State};
+
+%% <BACKWARD-COMPAT>
handle_call({update_agent_info, UserId, TargetName, Item, Val},
_From, State) ->
?vlog("received update_agent_info request: "
@@ -2156,6 +2304,7 @@ handle_call({update_agent_info, UserId, TargetName, Item, Val},
"~n Val: ~p", [UserId, TargetName, Item, Val]),
Reply = handle_update_agent_info(UserId, TargetName, Item, Val),
{reply, Reply, State};
+%% </BACKWARD-COMPAT>
handle_call({register_usm_user, User}, _From, State) ->
?vlog("received register_usm_user request: "
@@ -2517,16 +2666,27 @@ handle_register_agent(UserId, TargetName, Config) ->
"~n Config: ~p", [UserId, TargetName, Config]),
case (catch agent_info(TargetName, user_id)) of
{error, _} ->
+ ?vtrace("handle_register_agent -> user_id not found in config", []),
case ets:lookup(snmpm_user_table, UserId) of
[#user{default_agent_config = DefConfig}] ->
+ ?vtrace("handle_register_agent -> "
+ "~n DefConfig: ~p", [DefConfig]),
+ %% First, insert this users default config
+ ?vtrace("handle_register_agent -> store default config", []),
do_handle_register_agent(TargetName, DefConfig),
+ %% Second, insert the config for this agent
+ ?vtrace("handle_register_agent -> store config", []),
do_handle_register_agent(TargetName,
[{user_id, UserId}|Config]),
%% <DIRTY-BACKWARD-COMPATIBILLITY>
%% And now for some (backward compatibillity)
%% dirty crossref stuff
+ ?vtrace("handle_register_agent -> lookup address", []),
{ok, Addr} = agent_info(TargetName, address),
+ ?vtrace("handle_register_agent -> Addr: ~p, lookup Port",
+ [Addr]),
{ok, Port} = agent_info(TargetName, port),
+ ?vtrace("handle_register_agent -> register cross-ref fix", []),
ets:insert(snmpm_agent_table,
{{Addr, Port, target_name}, TargetName}),
%% </DIRTY-BACKWARD-COMPATIBILLITY>
@@ -2551,10 +2711,18 @@ handle_register_agent(UserId, TargetName, Config) ->
do_handle_register_agent(_TargetName, []) ->
ok;
do_handle_register_agent(TargetName, [{Item, Val}|Rest]) ->
+ ?vtrace("handle_register_agent -> entry with"
+ "~n TargetName: ~p"
+ "~n Item: ~p"
+ "~n Val: ~p"
+ "~n Rest: ~p", [TargetName, Item, Val, Rest]),
case (catch do_update_agent_info(TargetName, Item, Val)) of
ok ->
do_handle_register_agent(TargetName, Rest);
{error, Reason} ->
+ ?vtrace("handle_register_agent -> failed updating ~p"
+ "~n Item: ~p"
+ "~n Reason: ~p", [Item, Reason]),
ets:match_delete(snmpm_agent_table, {TargetName, '_'}),
{error, Reason}
end;
@@ -2589,41 +2757,61 @@ handle_unregister_agent(UserId, TargetName) ->
end.
-handle_update_agent_info(UserId, TargetName, Item, Val) ->
+handle_update_agent_info(UserId, TargetName, Info) ->
?vdebug("handle_update_agent_info -> entry with"
"~n UserId: ~p"
"~n TargetName: ~p"
- "~n Item: ~p"
- "~n Val: ~p", [UserId, TargetName, Item, Val]),
+ "~n Info: ~p", [UserId, TargetName, Info]),
+ %% Verify ownership
case (catch agent_info(TargetName, user_id)) of
- {ok, UserId} ->
- do_update_agent_info(TargetName, Item, Val);
+ {ok, UserId} ->
+ handle_update_agent_info(TargetName, Info);
{ok, OtherUserId} ->
{error, {not_owner, OtherUserId}};
Error ->
Error
end.
-do_update_agent_info(TargetName, Item, Val0) ->
-%% p("do_update_agent_info -> entry with"
-%% "~n TargetName: ~p"
-%% "~n Item: ~p"
-%% "~n Val0: ~p", [TargetName, Item, Val0]),
- case verify_val(Item, Val0) of
- {ok, Val} ->
-%% p("do_update_agent_info -> verified value"
-%% "~n Val: ~p", [Val]),
- ets:insert(snmpm_agent_table, {{TargetName, Item}, Val}),
- ok;
+handle_update_agent_info(TargetName, Info0) ->
+ ?vtrace("handle_update_agent_info -> entry with"
+ "~n TargetName: ~p"
+ "~n Info0: ~p", [TargetName, Info0]),
+ %% Verify info
+ try verify_agent_info(TargetName, Info0) of
+ {ok, Info} ->
+ do_update_agent_info(TargetName, Info);
Error ->
- ?vlog("do_update_agent_info -> verify value failed: "
- "~n TargetName: ~p"
- "~n Item: ~p"
- "~n Val0: ~p"
- "~n Error: ~p", [TargetName, Item, Val0, Error]),
- {error, {bad_agent_val, TargetName, Item, Val0}}
+ Error
+ catch
+ throw:Error ->
+ Error;
+ T:E ->
+ {error, {failed_info_verification, Info0, T, E}}
end.
+handle_update_agent_info(UserId, TargetName, Item, Val) ->
+ ?vdebug("handle_update_agent_info -> entry with"
+ "~n UserId: ~p"
+ "~n TargetName: ~p"
+ "~n Item: ~p"
+ "~n Val: ~p", [UserId, TargetName, Item, Val]),
+ handle_update_agent_info(TargetName, [{Item, Val}]).
+
+do_update_agent_info(TargetName, Info) ->
+ InsertItem =
+ fun({Item, Val}) ->
+ ets:insert(snmpm_agent_table, {{TargetName, Item}, Val})
+ end,
+ lists:foreach(InsertItem, Info).
+
+do_update_agent_info(TargetName, Item, Val) ->
+ ?vtrace("do_update_agent_info -> entry with"
+ "~n TargetName: ~p"
+ "~n Item: ~p"
+ "~n Val: ~p", [TargetName, Item, Val]),
+ ets:insert(snmpm_agent_table, {{TargetName, Item}, Val}),
+ ok.
+
handle_register_usm_user(#usm_user{engine_id = EngineID,
name = Name} = User) ->
@@ -2791,7 +2979,7 @@ verify_mandatory(Conf, [Mand|Mands]) ->
true ->
verify_mandatory(Conf, Mands);
false ->
- {error, {missing_mandatory_config, Mand}}
+ throw({error, {missing_mandatory_config, Mand}})
end.
verify_invalid(_, []) ->
@@ -2801,7 +2989,7 @@ verify_invalid(Conf, [Inv|Invs]) ->
false ->
verify_invalid(Conf, Invs);
true ->
- {error, {illegal_config, Inv}}
+ throw({error, {illegal_config, Inv}})
end.
@@ -2810,10 +2998,26 @@ verify_val(user_id, UserId) ->
verify_val(reg_type, RegType)
when (RegType =:= addr_port) orelse (RegType =:= target_name) ->
{ok, RegType};
-verify_val(address, Addr0) ->
- case normalize_address(Addr0) of
+verify_val(tdomain = Item, snmpUDPDomain = _Domain) ->
+ verify_val(Item, transportDomainUdpIpv4);
+verify_val(tdomain, Domain) ->
+ case lists:member(Domain, ?SUPPORTED_DOMAINS) of
+ true ->
+ {ok, Domain};
+ false ->
+ case lists:member(Domain, snmp_conf:all_domains()) of
+ true ->
+ error({unsupported_domain, Domain});
+ false ->
+ error({unknown_domain, Domain})
+ end
+ end;
+verify_val(address, {Domain, Addr0}) ->
+ case normalize_address(Domain, Addr0) of
{_A1, _A2, _A3, _A4} = Addr ->
{ok, Addr};
+ {_A1, _A2, _A3, _A4, _A5, _A6, _A7, _A8} = Addr ->
+ {ok, Addr};
_ when is_list(Addr0) ->
case (catch snmp_conf:check_ip(Addr0)) of
ok ->
@@ -2824,6 +3028,8 @@ verify_val(address, Addr0) ->
_ ->
error({bad_address, Addr0})
end;
+verify_val(address, BadAddress) ->
+ error({bad_address, BadAddress});
verify_val(port, Port) ->
case (catch snmp_conf:check_integer(Port, {gt, 0})) of
ok ->
@@ -2875,7 +3081,7 @@ verify_val(sec_name, BadName) ->
verify_val(sec_level, Level) ->
(catch snmp_conf:check_sec_level(Level));
verify_val(Item, _) ->
- {error, {no_such_item, Item}}.
+ {error, {unknown_item, Item}}.
%%%-------------------------------------------------------------------
@@ -3034,11 +3240,17 @@ init_mini_mib_elems(MibName, [_|T], Res) ->
%%----------------------------------------------------------------------
normalize_address(Addr) ->
- case inet:getaddr(Addr, inet) of
+ normalize_address(snmpUDPDomain, Addr).
+
+normalize_address(snmpUDPDomain, Addr) ->
+ normalize_address(transportDomainUdpIpv4, Addr);
+
+normalize_address(Domain, Addr) ->
+ case inet:getaddr(Addr, td2fam(Domain)) of
{ok, Addr2} ->
Addr2;
_ when is_list(Addr) ->
- case (catch snmp_conf:check_ip(Addr)) of
+ case (catch snmp_conf:check_ip(Domain, Addr)) of
ok ->
list_to_tuple(Addr);
_ ->
@@ -3048,6 +3260,9 @@ normalize_address(Addr) ->
Addr
end.
+td2fam(transportDomainUdpIpv4) -> inet;
+td2fam(transportDomainUdpIpv6) -> inet6.
+
%%----------------------------------------------------------------------
diff --git a/lib/snmp/src/manager/snmpm_mpd.erl b/lib/snmp/src/manager/snmpm_mpd.erl
index 7712370d28..627838e3d4 100644
--- a/lib/snmp/src/manager/snmpm_mpd.erl
+++ b/lib/snmp/src/manager/snmpm_mpd.erl
@@ -92,7 +92,7 @@ reset(#state{v3 = V3}) ->
%% Purpose: This is the main Message Dispatching function. (see
%% section 4.2.1 in rfc2272)
%%-----------------------------------------------------------------
-process_msg(Msg, TDomain, Addr, Port, State, NoteStore, Logger) ->
+process_msg(Msg, Domain, Addr, Port, State, NoteStore, Logger) ->
inc(snmpInPkts),
@@ -102,18 +102,18 @@ process_msg(Msg, TDomain, Addr, Port, State, NoteStore, Logger) ->
#message{version = 'version-1', vsn_hdr = Community, data = Data}
when State#state.v1 =:= true ->
HS = ?empty_msg_size + length(Community),
- process_v1_v2c_msg('version-1', NoteStore, Msg, TDomain,
- Addr, Port,
+ process_v1_v2c_msg('version-1', NoteStore, Msg,
+ Domain, Addr, Port,
Community, Data, HS, Logger);
%% Version 2
#message{version = 'version-2', vsn_hdr = Community, data = Data}
when State#state.v2c =:= true ->
HS = ?empty_msg_size + length(Community),
- process_v1_v2c_msg('version-2', NoteStore, Msg, TDomain,
- Addr, Port,
- Community, Data, HS, Logger);
-
+ (catch process_v1_v2c_msg('version-2', NoteStore, Msg,
+ Domain, Addr, Port,
+ Community, Data, HS, Logger));
+
%% Version 3
#message{version = 'version-3', vsn_hdr = H, data = Data}
when State#state.v3 =:= true ->
@@ -148,17 +148,30 @@ process_msg(Msg, TDomain, Addr, Port, State, NoteStore, Logger) ->
%%-----------------------------------------------------------------
%% Handles a Community based message (v1 or v2c).
%%-----------------------------------------------------------------
-process_v1_v2c_msg(Vsn, _NoteStore, Msg, snmpUDPDomain,
+process_v1_v2c_msg(Vsn, _NoteStore, Msg, Domain,
Addr, Port,
Community, Data, HS, Log) ->
?vdebug("process_v1_v2c_msg -> entry with"
"~n Vsn: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
"~n Port: ~p"
"~n Community: ~p"
- "~n HS: ~p", [Vsn, Addr, Port, Community, HS]),
+ "~n HS: ~p", [Vsn, Domain, Addr, Port, Community, HS]),
+ {TDomain, TAddress} =
+ try
+ begin
+ TD = snmp_conf:mk_tdomain(Domain),
+ TA = snmp_conf:mk_taddress(Domain, Addr, Port),
+ {TD, TA}
+ end
+ catch
+ throw:{error, TReason} ->
+ throw({discarded, {badarg, Domain, TReason}})
+ end,
+
Max = get_max_message_size(),
AgentMax = get_agent_max_message_size(Addr, Port),
PduMS = pdu_ms(Max, AgentMax, HS),
@@ -170,14 +183,14 @@ process_v1_v2c_msg(Vsn, _NoteStore, Msg, snmpUDPDomain,
?vtrace("process_v1_v2c_msg -> was a pdu", []),
Log(Msg),
inc_snmp_in(Pdu),
- MsgData = {Community, sec_model(Vsn)},
+ MsgData = {Community, sec_model(Vsn), TDomain, TAddress},
{ok, Vsn, Pdu, PduMS, MsgData};
Trap when is_record(Trap, trappdu) ->
?vtrace("process_v1_v2c_msg -> was a trap", []),
Log(Msg),
inc_snmp_in(Trap),
- MsgData = {Community, sec_model(Vsn)},
+ MsgData = {Community, sec_model(Vsn), TDomain, TAddress},
{ok, Vsn, Trap, PduMS, MsgData};
{'EXIT', Reason} ->
@@ -185,11 +198,7 @@ process_v1_v2c_msg(Vsn, _NoteStore, Msg, snmpUDPDomain,
"~n Reason: ~p", [Reason]),
inc(snmpInASNParseErrs),
{discarded, Reason}
- end;
-process_v1_v2c_msg(_Vsn, _NoteStore, _Msg, TDomain,
- _Addr, _Port,
- _Comm, _HS, _Data, _Log) ->
- {discarded, {badarg, TDomain}}.
+ end.
pdu_ms(MgrMMS, AgentMMS, HS) when AgentMMS < MgrMMS ->
AgentMMS - HS;
@@ -482,8 +491,8 @@ generate_msg('version-3', NoteStore, Pdu,
generate_v3_msg(NoteStore, Pdu,
SecModel, SecName, SecLevel, CtxEngineID, CtxName,
TargetName, Log);
-generate_msg(Vsn, _NoteStore, Pdu, {Community, _SecModel}, Log) ->
- generate_v1_v2c_msg(Vsn, Pdu, Community, Log).
+generate_msg(Vsn, _NoteStore, Pdu, {Comm, _SecModel}, Log) ->
+ generate_v1_v2c_msg(Vsn, Pdu, Comm, Log).
generate_v3_msg(NoteStore, Pdu,
@@ -627,6 +636,8 @@ generate_response_msg('version-3', Pdu,
generate_v3_response_msg(Pdu, MsgID, SecModel, SecName, SecLevel,
CtxEngineID, CtxName, SecData, Log);
generate_response_msg(Vsn, Pdu, {Comm, _SecModel}, Log) ->
+ generate_v1_v2c_response_msg(Vsn, Pdu, Comm, Log);
+generate_response_msg(Vsn, Pdu, {Comm, _SecModel, _TDomain, _TAddress}, Log) ->
generate_v1_v2c_response_msg(Vsn, Pdu, Comm, Log).
diff --git a/lib/snmp/src/manager/snmpm_net_if.erl b/lib/snmp/src/manager/snmpm_net_if.erl
index a116c9f26b..4d6bd9aa33 100644
--- a/lib/snmp/src/manager/snmpm_net_if.erl
+++ b/lib/snmp/src/manager/snmpm_net_if.erl
@@ -28,7 +28,8 @@
start_link/2,
stop/1,
send_pdu/6, % Backward compatibillity
- send_pdu/7,
+ send_pdu/7, % Backward compatibillity
+ send_pdu/8,
inform_response/4,
@@ -101,16 +102,21 @@ stop(Pid) ->
send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port) ->
send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port, ?DEFAULT_EXTRA_INFO).
-send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo)
+send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo) ->
+ Domain = snmpm_config:default_transport_domain(),
+ send_pdu(Pid, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo).
+
+send_pdu(Pid, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo)
when is_record(Pdu, pdu) ->
?d("send_pdu -> entry with"
"~n Pid: ~p"
"~n Pdu: ~p"
"~n Vsn: ~p"
"~n MsgData: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
- "~n Port: ~p", [Pid, Pdu, Vsn, MsgData, Addr, Port]),
- cast(Pid, {send_pdu, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo}).
+ "~n Port: ~p", [Pid, Pdu, Vsn, MsgData, Domain, Addr, Port]),
+ cast(Pid, {send_pdu, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo}).
note_store(Pid, NoteStore) ->
call(Pid, {note_store, NoteStore}).
@@ -380,15 +386,17 @@ handle_call(Req, From, State) ->
%% {noreply, State, Timeout} |
%% {stop, Reason, State} (terminate/2 is called)
%%--------------------------------------------------------------------
-handle_cast({send_pdu, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo}, State) ->
+handle_cast({send_pdu, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo},
+ State) ->
?vlog("received send_pdu message with"
"~n Pdu: ~p"
"~n Vsn: ~p"
"~n MsgData: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
- "~n Port: ~p", [Pdu, Vsn, MsgData, Addr, Port]),
+ "~n Port: ~p", [Pdu, Vsn, MsgData, Domain, Addr, Port]),
maybe_process_extra_info(ExtraInfo),
- maybe_handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port, State),
+ maybe_handle_send_pdu(Pdu, Vsn, MsgData, Domain, Addr, Port, State),
{noreply, State};
handle_cast({inform_response, Ref, Addr, Port}, State) ->
@@ -545,8 +553,9 @@ handle_recv_msg(Addr, Port, Bytes,
mpd_state = MpdState,
sock = Sock,
log = Log} = State) ->
+ Domain = snmp_conf:which_domain(Addr), % What the ****...
Logger = logger(Log, read, Addr, Port),
- case (catch snmpm_mpd:process_msg(Bytes, snmpUDPDomain, Addr, Port,
+ case (catch snmpm_mpd:process_msg(Bytes, Domain, Addr, Port,
MpdState, NoteStore, Logger)) of
{ok, Vsn, Pdu, MS, ACM} ->
@@ -734,17 +743,17 @@ irgc_stop(Ref) ->
(catch erlang:cancel_timer(Ref)).
-maybe_handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port,
+maybe_handle_send_pdu(Pdu, Vsn, MsgData, Domain, Addr, Port,
#state{filter = FilterMod} = State) ->
case (catch FilterMod:accept_send_pdu(Addr, Port, pdu_type_of(Pdu))) of
false ->
inc(netIfPduOutDrops),
ok;
_ ->
- handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port, State)
+ handle_send_pdu(Pdu, Vsn, MsgData, Domain, Addr, Port, State)
end.
-handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port,
+handle_send_pdu(Pdu, Vsn, MsgData, _Domain, Addr, Port,
#state{server = Pid,
note_store = NoteStore,
sock = Sock,
diff --git a/lib/snmp/src/manager/snmpm_server.erl b/lib/snmp/src/manager/snmpm_server.erl
index 58a58507d6..484954addb 100644
--- a/lib/snmp/src/manager/snmpm_server.erl
+++ b/lib/snmp/src/manager/snmpm_server.erl
@@ -161,7 +161,8 @@
{id,
user_id,
reg_type,
- target,
+ target,
+ domain,
addr,
port,
type,
@@ -1175,11 +1176,12 @@ handle_sync_get(Pid, UserId, TargetName, Oids, SendOpts, From, State) ->
"~n From: ~p",
[Pid, UserId, TargetName, Oids, SendOpts, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_get -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_get_request(Oids, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_sync_get -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
Timeout = ?SYNC_GET_TIMEOUT(SendOpts),
@@ -1190,6 +1192,7 @@ handle_sync_get(Pid, UserId, TargetName, Oids, SendOpts, From, State) ->
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get,
@@ -1227,11 +1230,12 @@ handle_sync_get_next(Pid, UserId, TargetName, Oids, SendOpts,
"~n From: ~p",
[Pid, UserId, TargetName, Oids, SendOpts, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_get_next -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_get_next_request(Oids, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_sync_get_next -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
Timeout = ?SYNC_GET_NEXT_TIMEOUT(SendOpts),
@@ -1242,6 +1246,7 @@ handle_sync_get_next(Pid, UserId, TargetName, Oids, SendOpts,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_next,
@@ -1285,10 +1290,11 @@ handle_sync_get_bulk(Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts,
"~n From: ~p",
[Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_get_bulk -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
- ReqId = send_get_bulk_request(Oids, Vsn, MsgData, Addr, Port,
+ ReqId = send_get_bulk_request(Oids, Vsn, MsgData,
+ Domain, Addr, Port,
NonRep, MaxRep, Extra, State),
?vdebug("handle_sync_get_bulk -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
@@ -1300,6 +1306,7 @@ handle_sync_get_bulk(Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_bulk,
@@ -1339,11 +1346,12 @@ handle_sync_set(Pid, UserId, TargetName, VarsAndVals, SendOpts, From, State) ->
"~n From: ~p",
[Pid, UserId, TargetName, VarsAndVals, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_set -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_set_request(VarsAndVals, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_sync_set -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
Timeout = ?SYNC_SET_TIMEOUT(SendOpts),
@@ -1354,6 +1362,7 @@ handle_sync_set(Pid, UserId, TargetName, VarsAndVals, SendOpts, From, State) ->
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = set,
@@ -1391,10 +1400,11 @@ handle_async_get(Pid, UserId, TargetName, Oids, SendOpts, State) ->
"~n SendOpts: ~p",
[Pid, UserId, TargetName, Oids, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_get -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
- ReqId = send_get_request(Oids, Vsn, MsgData, Addr, Port,
+ ReqId = send_get_request(Oids, Vsn, MsgData,
+ Domain, Addr, Port,
Extra, State),
?vdebug("handle_async_get -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_GET_TIMEOUT(SendOpts),
@@ -1402,6 +1412,7 @@ handle_async_get(Pid, UserId, TargetName, Oids, SendOpts, State) ->
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get,
@@ -1439,17 +1450,19 @@ handle_async_get_next(Pid, UserId, TargetName, Oids, SendOpts, State) ->
"~n SendOpts: ~p",
[Pid, UserId, TargetName, Oids, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_get_next -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_get_next_request(Oids, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_async_get_next -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_GET_NEXT_TIMEOUT(SendOpts),
Req = #request{id = ReqId,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_next,
@@ -1494,10 +1507,11 @@ handle_async_get_bulk(Pid,
"~n SendOpts: ~p",
[Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_get_bulk -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
- ReqId = send_get_bulk_request(Oids, Vsn, MsgData, Addr, Port,
+ ReqId = send_get_bulk_request(Oids, Vsn, MsgData,
+ Domain, Addr, Port,
NonRep, MaxRep, Extra, State),
?vdebug("handle_async_get_bulk -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_GET_BULK_TIMEOUT(SendOpts),
@@ -1505,6 +1519,7 @@ handle_async_get_bulk(Pid,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_bulk,
@@ -1541,17 +1556,19 @@ handle_async_set(Pid, UserId, TargetName, VarsAndVals, SendOpts, State) ->
"~n SendOpts: ~p",
[Pid, UserId, TargetName, VarsAndVals, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_set -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_set_request(VarsAndVals, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_async_set -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_SET_TIMEOUT(SendOpts),
Req = #request{id = ReqId,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = set,
@@ -2907,7 +2924,7 @@ do_gc(Key, Now) ->
%%
%%----------------------------------------------------------------------
-send_get_request(Oids, Vsn, MsgData, Addr, Port, ExtraInfo,
+send_get_request(Oids, Vsn, MsgData, Domain, Addr, Port, ExtraInfo,
#state{net_if = NetIf,
net_if_mod = Mod,
mini_mib = MiniMIB}) ->
@@ -2918,34 +2935,39 @@ send_get_request(Oids, Vsn, MsgData, Addr, Port, ExtraInfo,
"~n Pdu: ~p"
"~n Vsn: ~p"
"~n MsgData: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
- "~n Port: ~p", [Mod, NetIf, Pdu, Vsn, MsgData, Addr, Port]),
- (catch Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo)),
+ "~n Port: ~p",
+ [Mod, NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port]),
+ Res = (catch Mod:send_pdu(NetIf, Pdu, Vsn, MsgData,
+ Domain, Addr, Port, ExtraInfo)),
+ ?vtrace("send_get_request -> send result:"
+ "~n ~p", [Res]),
Pdu#pdu.request_id.
-send_get_next_request(Oids, Vsn, MsgData, Addr, Port, ExtraInfo,
+send_get_next_request(Oids, Vsn, MsgData, Domain, Addr, Port, ExtraInfo,
#state{mini_mib = MiniMIB,
net_if = NetIf,
net_if_mod = Mod}) ->
Pdu = make_pdu(get_next, Oids, MiniMIB),
- Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo),
+ Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo),
Pdu#pdu.request_id.
-send_get_bulk_request(Oids, Vsn, MsgData, Addr, Port,
+send_get_bulk_request(Oids, Vsn, MsgData, Domain, Addr, Port,
NonRep, MaxRep, ExtraInfo,
#state{mini_mib = MiniMIB,
net_if = NetIf,
net_if_mod = Mod}) ->
Pdu = make_pdu(bulk, {NonRep, MaxRep, Oids}, MiniMIB),
- Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo),
+ Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo),
Pdu#pdu.request_id.
-send_set_request(VarsAndVals, Vsn, MsgData, Addr, Port, ExtraInfo,
+send_set_request(VarsAndVals, Vsn, MsgData, Domain, Addr, Port, ExtraInfo,
#state{mini_mib = MiniMIB,
net_if = NetIf,
net_if_mod = Mod}) ->
Pdu = make_pdu(set, VarsAndVals, MiniMIB),
- Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo),
+ Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo),
Pdu#pdu.request_id.
%% send_discovery(Vsn, MsgData, Addr, Port, ExtraInfo,
@@ -3181,10 +3203,11 @@ agent_data(TargetName, SendOpts) ->
{Comm, SecModel}
end,
+ Domain = agent_data_item(tdomain, Info),
Addr = agent_data_item(address, Info),
Port = agent_data_item(port, Info),
RegType = agent_data_item(reg_type, Info),
- {ok, RegType, Addr, Port, version(Version), MsgData};
+ {ok, RegType, Domain, Addr, Port, version(Version), MsgData};
Error ->
Error
end.
diff --git a/lib/snmp/src/misc/snmp_conf.erl b/lib/snmp/src/misc/snmp_conf.erl
index 20f4455d10..7249def24e 100644
--- a/lib/snmp/src/misc/snmp_conf.erl
+++ b/lib/snmp/src/misc/snmp_conf.erl
@@ -37,7 +37,9 @@
check_timer/1,
+ all_domains/0,
check_domain/1,
+ all_tdomains/0,
check_tdomain/1,
mk_tdomain/1,
which_domain/1,
@@ -345,6 +347,25 @@ check_sec_level(BadSecLevel) ->
%% ---------
+all_tdomains() ->
+ [
+ ?transportDomainUdpIpv4,
+ ?transportDomainUdpIpv6,
+ ?transportDomainUdpIpv4z,
+ ?transportDomainUdpIpv6z,
+ ?transportDomainTcpIpv4,
+ ?transportDomainTcpIpv6,
+ ?transportDomainTcpIpv4z,
+ ?transportDomainTcpIpv6z,
+ ?transportDomainSctpIpv4,
+ ?transportDomainSctpIpv6,
+ ?transportDomainSctpIpv4z,
+ ?transportDomainSctpIpv6z,
+ ?transportDomainLocal,
+ ?transportDomainUdpDns,
+ ?transportDomainTcpDns,
+ ?transportDomainSctpDns
+ ].
check_tdomain(TDomain) ->
SupportedTDomains =
@@ -353,25 +374,7 @@ check_tdomain(TDomain) ->
?transportDomainUdpIpv4,
?transportDomainUdpIpv6
],
- AllTDomains =
- [
- ?transportDomainUdpIpv4,
- ?transportDomainUdpIpv6,
- ?transportDomainUdpIpv4z,
- ?transportDomainUdpIpv6z,
- ?transportDomainTcpIpv4,
- ?transportDomainTcpIpv6,
- ?transportDomainTcpIpv4z,
- ?transportDomainTcpIpv6z,
- ?transportDomainSctpIpv4,
- ?transportDomainSctpIpv6,
- ?transportDomainSctpIpv4z,
- ?transportDomainSctpIpv6z,
- ?transportDomainLocal,
- ?transportDomainUdpDns,
- ?transportDomainTcpDns,
- ?transportDomainSctpDns
- ],
+ AllTDomains = all_tdomains(),
case lists:member(TDomain, SupportedTDomains) of
true ->
ok;
@@ -388,7 +391,7 @@ check_tdomain(TDomain) ->
%% ---------
mk_tdomain(snmpUDPDomain) ->
- ?snmpUDPDomain;
+ mk_tdomain(transportDomainUdpIpv4);
mk_tdomain(transportDomainUdpIpv4) ->
?transportDomainUdpIpv4;
mk_tdomain(transportDomainUdpIpv6) ->
@@ -474,6 +477,26 @@ do_check_timer(WaitFor, Factor, Incr, Retry) ->
%% ---------
+all_domains() ->
+ [
+ transportDomainUdpIpv4,
+ transportDomainUdpIpv6,
+ transportDomainUdpIpv4z,
+ transportDomainUdpIpv6z,
+ transportDomainTcpIpv4,
+ transportDomainTcpIpv6,
+ transportDomainTcpIpv4z,
+ transportDomainTcpIpv6z,
+ transportDomainSctpIpv4,
+ transportDomainSctpIpv6,
+ transportDomainSctpIpv4z,
+ transportDomainSctpIpv6z,
+ transportDomainLocal,
+ transportDomainUdpDns,
+ transportDomainTcpDns,
+ transportDomainSctpDns
+ ].
+
check_domain(Domain) ->
SupportedDomains =
[
@@ -481,25 +504,7 @@ check_domain(Domain) ->
transportDomainUdpIpv4,
transportDomainUdpIpv6
],
- AllDomains =
- [
- transportDomainUdpIpv4,
- transportDomainUdpIpv6,
- transportDomainUdpIpv4z,
- transportDomainUdpIpv6z,
- transportDomainTcpIpv4,
- transportDomainTcpIpv6,
- transportDomainTcpIpv4z,
- transportDomainTcpIpv6z,
- transportDomainSctpIpv4,
- transportDomainSctpIpv6,
- transportDomainSctpIpv4z,
- transportDomainSctpIpv6z,
- transportDomainLocal,
- transportDomainUdpDns,
- transportDomainTcpDns,
- transportDomainSctpDns
- ],
+ AllDomains = all_domains(),
case lists:member(Domain, SupportedDomains) of
true ->
ok;
diff --git a/lib/snmp/src/misc/snmp_config.erl b/lib/snmp/src/misc/snmp_config.erl
index fcbc6a88c9..6ab20e3e48 100644
--- a/lib/snmp/src/misc/snmp_config.erl
+++ b/lib/snmp/src/misc/snmp_config.erl
@@ -337,7 +337,7 @@ config_agent_sys() ->
{dir, ATLDir},
{size, ATLSize},
{repair, ATLRepair},
- {seqno, ATLSeqNo}]}];
+ {seqno, ATLSeqNo}]}];
no ->
[]
end,
@@ -568,7 +568,7 @@ config_agent_snmp(Dir, Vsns) ->
false ->
ok
end,
- i("The following agent files were written: agent.conf, "
+ i("The following agent files where written: agent.conf, "
"community.conf,~n"
"standard.conf, target_addr.conf, "
"target_params.conf, ~n"
@@ -776,7 +776,7 @@ config_manager_snmp(Dir, Vsns) ->
Users, Agents, Usms)) of
ok ->
i("~n- - - - - - - - - - - - -"),
- i("The following manager files were written: "
+ i("The following manager files where written: "
"manager.conf, agents.conf " ++
case lists:member(v3, Vsns) of
true ->
@@ -2350,7 +2350,9 @@ write_sys_config_file_manager_atl_opt(Fid, {type, Type}) ->
write_sys_config_file_manager_atl_opt(Fid, {size, Size}) ->
ok = io:format(Fid, "{size, ~w}", [Size]);
write_sys_config_file_manager_atl_opt(Fid, {repair, Rep}) ->
- ok = io:format(Fid, "{repair, ~w}", [Rep]).
+ ok = io:format(Fid, "{repair, ~w}", [Rep]);
+write_sys_config_file_manager_atl_opt(Fid, {seqno, SeqNo}) ->
+ ok = io:format(Fid, "{seqno, ~w}", [SeqNo]).
header() ->
diff --git a/lib/snmp/test/snmp_compiler_test.erl b/lib/snmp/test/snmp_compiler_test.erl
index 2e6020ae7a..c964b08168 100644
--- a/lib/snmp/test/snmp_compiler_test.erl
+++ b/lib/snmp/test/snmp_compiler_test.erl
@@ -47,6 +47,7 @@
module_identity/1,
agent_capabilities/1,
module_compliance/1,
+ warnings_as_errors/1,
otp_6150/1,
otp_8574/1,
@@ -97,9 +98,10 @@ all() ->
description,
oid_conflicts,
imports,
- module_identity,
- agent_capabilities,
- module_compliance,
+ module_identity,
+ agent_capabilities,
+ module_compliance,
+ warnings_as_errors,
{group, tickets}
].
@@ -152,6 +154,8 @@ description(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
oid_conflicts(suite) -> [];
oid_conflicts(Config) when is_list(Config) ->
put(tname,oid_conflicts),
@@ -165,18 +169,24 @@ oid_conflicts(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
imports(suite) ->
[];
imports(Config) when is_list(Config) ->
?SKIP(not_yet_implemented).
+%%======================================================================
+
module_identity(suite) ->
[];
module_identity(Config) when is_list(Config) ->
?SKIP(not_yet_implemented).
+%%======================================================================
+
agent_capabilities(suite) ->
[];
agent_capabilities(Config) when is_list(Config) ->
@@ -218,6 +228,8 @@ agent_capabilities(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
module_compliance(suite) ->
[];
module_compliance(Config) when is_list(Config) ->
@@ -259,6 +271,32 @@ module_compliance(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
+warnings_as_errors(suite) ->
+ ["OTP-9437"];
+warnings_as_errors(Config) when is_list(Config) ->
+ put(tname,warnings_as_errors),
+ p("starting with Config: ~p~n", [Config]),
+ Dir = ?config(comp_dir, Config),
+ MibDir = ?config(mib_dir, Config),
+ MibFile = join(MibDir, "OTP8574-MIB.mib"),
+ OutFile = join(Dir, "OTP8574-MIB.bin"),
+ Opts = [{group_check, false},
+ {outdir, Dir},
+ {verbosity, trace},
+ relaxed_row_name_assign_check],
+ {error, compilation_failed} =
+ snmpc:compile(MibFile, [warnings_as_errors|Opts]),
+ false = filelib:is_regular(OutFile),
+ {ok, _} = snmpc:compile(MibFile, Opts),
+ true = filelib:is_regular(OutFile),
+ ok = file:delete(OutFile),
+ ok.
+
+
+%%======================================================================
+
otp_6150(suite) ->
[];
otp_6150(Config) when is_list(Config) ->
@@ -273,6 +311,8 @@ otp_6150(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
otp_8574(suite) ->
[];
otp_8574(Config) when is_list(Config) ->
@@ -304,6 +344,8 @@ otp_8574(Config) when is_list(Config) ->
end.
+%%======================================================================
+
otp_8595(suite) ->
[];
otp_8595(Config) when is_list(Config) ->
diff --git a/lib/snmp/test/snmp_manager_test.erl b/lib/snmp/test/snmp_manager_test.erl
index 0b536748fb..d18f20d359 100644
--- a/lib/snmp/test/snmp_manager_test.erl
+++ b/lib/snmp/test/snmp_manager_test.erl
@@ -61,6 +61,7 @@
register_agent1/1,
register_agent2/1,
+ register_agent3/1,
info/1,
@@ -383,12 +384,12 @@ end_per_testcase2(Case, Config) ->
all() ->
[
{group, start_and_stop_tests},
- {group, misc_tests},
+ {group, misc_tests},
{group, user_tests},
- {group, agent_tests},
+ {group, agent_tests},
{group, request_tests},
{group, event_tests},
- discovery,
+ discovery,
{group, tickets}
].
@@ -417,7 +418,8 @@ groups() ->
{agent_tests, [],
[
register_agent1,
- register_agent2
+ register_agent2,
+ register_agent3
]
},
{request_tests, [],
@@ -477,14 +479,14 @@ groups() ->
},
{event_tests, [],
[
- trap1,
- trap2,
- inform1,
- inform2,
- inform3,
- inform4,
- inform_swarm,
- report
+ trap1%% ,
+ %% trap2,
+ %% inform1,
+ %% inform2,
+ %% inform3,
+ %% inform4,
+ %% inform_swarm,
+ %% report
]
},
{tickets, [],
@@ -1134,6 +1136,7 @@ register_agent1(suite) ->
register_agent1(Config) when is_list(Config) ->
process_flag(trap_exit, true),
put(tname,ra1),
+
p("starting with Config: ~p~n", [Config]),
ManagerNode = start_manager_node(),
@@ -1164,7 +1167,7 @@ register_agent1(Config) when is_list(Config) ->
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
- p("register user(s) calvin & hobbe"),
+ p("register user(s) user_alfa & user_beta"),
?line ok = mgr_register_user(ManagerNode, user_alfa, snmpm_user_default, []),
?line ok = mgr_register_user(ManagerNode, user_beta, snmpm_user_default, []),
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
@@ -1293,7 +1296,7 @@ register_agent2(Config) when is_list(Config) ->
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
- p("register user(s) calvin & hobbe"),
+ p("register user(s) user_alfa & user_beta"),
?line ok = mgr_register_user(ManagerNode, user_alfa, snmpm_user_default, []),
?line ok = mgr_register_user(ManagerNode, user_beta, snmpm_user_default, []),
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
@@ -1348,7 +1351,7 @@ register_agent2(Config) when is_list(Config) ->
end,
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
-
+
p("unregister user user_alfa"),
?line ok = mgr_unregister_user(ManagerNode, user_alfa),
@@ -1377,7 +1380,157 @@ register_agent2(Config) when is_list(Config) ->
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
- p("unregister user hobbe"),
+ p("unregister user user_beta"),
+ ?line ok = mgr_unregister_user(ManagerNode, user_beta),
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ ?SLEEP(1000),
+
+ p("stop snmp application (with only manager)"),
+ ?line ok = stop_snmp(ManagerNode),
+
+ ?SLEEP(1000),
+
+ stop_node(ManagerNode),
+
+ ?SLEEP(1000),
+
+ p("end"),
+ ok.
+
+
+%%======================================================================
+
+register_agent3(doc) ->
+ ["Test registration of agents with the NEW interface functions "
+ "and specifying transport domain"];
+register_agent3(suite) ->
+ [];
+register_agent3(Config) when is_list(Config) ->
+ process_flag(trap_exit, true),
+ put(tname, ra3),
+ p("starting with Config: ~p~n", [Config]),
+
+ ManagerNode = start_manager_node(),
+
+ ConfDir = ?config(manager_conf_dir, Config),
+ DbDir = ?config(manager_db_dir, Config),
+ LocalHost = snmp_test_lib:localhost(),
+
+
+ write_manager_conf(ConfDir),
+
+ Opts = [{server, [{verbosity, trace}]},
+ {net_if, [{verbosity, trace}]},
+ {note_store, [{verbosity, trace}]},
+ {config, [{verbosity, trace}, {dir, ConfDir}, {db_dir, DbDir}]}],
+
+
+ p("load snmp application"),
+ ?line ok = load_snmp(ManagerNode),
+
+ p("set manager env for the snmp application"),
+ ?line ok = set_mgr_env(ManagerNode, Opts),
+
+ p("starting snmp application (with only manager)"),
+ ?line ok = start_snmp(ManagerNode),
+
+ p("started"),
+
+ ?SLEEP(1000),
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("register user(s) user_alfa & user_beta"),
+ ?line ok = mgr_register_user(ManagerNode, user_alfa, snmpm_user_default, []),
+ ?line ok = mgr_register_user(ManagerNode, user_beta, snmpm_user_default, []),
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("register agent(s)"),
+ TargetName1 = "agent2",
+ ?line ok = mgr_register_agent(ManagerNode, user_alfa, TargetName1,
+ [{tdomain, transportDomainUdpIpv4},
+ {address, LocalHost},
+ {port, 5001},
+ {engine_id, "agentEngineId-1"}]),
+ TargetName2 = "agent3",
+ ?line ok = mgr_register_agent(ManagerNode, user_alfa, TargetName2,
+ [{tdomain, transportDomainUdpIpv6},
+ {address, LocalHost},
+ {port, 5002},
+ {engine_id, "agentEngineId-2"}]),
+ TargetName3 = "agent4",
+ ?line {error, {unsupported_domain, _} = Reason4} =
+ mgr_register_agent(ManagerNode, user_beta, TargetName3,
+ [{tdomain, transportDomainTcpIpv4},
+ {address, LocalHost},
+ {port, 5003},
+ {engine_id, "agentEngineId-3"}]),
+ p("Expected registration failure: ~p", [Reason4]),
+ TargetName4 = "agent5",
+ ?line {error, {unknown_domain, _} = Reason5} =
+ mgr_register_agent(ManagerNode, user_beta, TargetName4,
+ [{tdomain, transportDomainUdpIpv4_bad},
+ {address, LocalHost},
+ {port, 5004},
+ {engine_id, "agentEngineId-4"}]),
+ p("Expected registration failure: ~p", [Reason5]),
+
+ p("verify all agent(s): expect 2"),
+ case mgr_which_agents(ManagerNode) of
+ Agents1 when length(Agents1) =:= 2 ->
+ p("all agents: ~p~n", [Agents1]),
+ ok;
+ Agents1 ->
+ ?FAIL({agent_registration_failure, Agents1})
+ end,
+
+ p("verify user_alfa agent(s)"),
+ case mgr_which_agents(ManagerNode, user_alfa) of
+ Agents2 when length(Agents2) =:= 2 ->
+ p("calvin agents: ~p~n", [Agents2]),
+ ok;
+ Agents2 ->
+ ?FAIL({agent_registration_failure, Agents2})
+ end,
+
+ p("verify user_beta agent(s)"),
+ case mgr_which_agents(ManagerNode, user_beta) of
+ Agents3 when length(Agents3) =:= 0 ->
+ p("hobbe agents: ~p~n", [Agents3]),
+ ok;
+ Agents3 ->
+ ?FAIL({agent_registration_failure, Agents3})
+ end,
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("unregister user user_alfa"),
+ ?line ok = mgr_unregister_user(ManagerNode, user_alfa),
+
+ p("verify all agent(s): expect 0"),
+ case mgr_which_agents(ManagerNode) of
+ Agents4 when length(Agents4) =:= 0 ->
+ p("all agents: ~p~n", [Agents4]),
+ ok;
+ Agents4 ->
+ ?FAIL({agent_unregistration_failure, Agents4})
+ end,
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("verify all agent(s): expect 0"),
+ case mgr_which_agents(ManagerNode) of
+ [] ->
+ ok;
+ Agents5 ->
+ p("all agents: ~p~n", [Agents5]),
+ ?FAIL({agent_unregistration_failure, Agents5})
+ end,
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("unregister user user_beta"),
?line ok = mgr_unregister_user(ManagerNode, user_beta),
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
diff --git a/lib/snmp/test/test_config/Makefile b/lib/snmp/test/test_config/Makefile
index d7bebbc431..d65bb8abe2 100644
--- a/lib/snmp/test/test_config/Makefile
+++ b/lib/snmp/test/test_config/Makefile
@@ -155,23 +155,23 @@ release_spec:
release_tests_spec: clean opt
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DIR) $(RELSYSDIR)/agent
- chmod -f -R u+w $(RELSYSDIR)/agent
+ chmod -R u+w $(RELSYSDIR)/agent
$(INSTALL_DIR) $(RELSYSDIR)/agent/conf
- chmod -f -R u+w $(RELSYSDIR)/agent/conf
+ chmod -R u+w $(RELSYSDIR)/agent/conf
$(INSTALL_DIR) $(RELSYSDIR)/agent/db
- chmod -f -R u+w $(RELSYSDIR)/agent/db
+ chmod -R u+w $(RELSYSDIR)/agent/db
$(INSTALL_DIR) $(RELSYSDIR)/agent/log
- chmod -f -R u+w $(RELSYSDIR)/agent/log
+ chmod -R u+w $(RELSYSDIR)/agent/log
$(INSTALL_DIR) $(RELSYSDIR)/manager
- chmod -f -R u+w $(RELSYSDIR)/manager
+ chmod -R u+w $(RELSYSDIR)/manager
$(INSTALL_DIR) $(RELSYSDIR)/manager/conf
- chmod -f -R u+w $(RELSYSDIR)/manager/conf
+ chmod -R u+w $(RELSYSDIR)/manager/conf
$(INSTALL_DIR) $(RELSYSDIR)/manager/db
- chmod -f -R u+w $(RELSYSDIR)/manager/db
+ chmod -R u+w $(RELSYSDIR)/manager/db
$(INSTALL_DIR) $(RELSYSDIR)/manager/log
- chmod -f -R u+w $(RELSYSDIR)/manager/log
+ chmod -R u+w $(RELSYSDIR)/manager/log
$(INSTALL_DATA) $(SYS_CONFIG_FILES) $(RELSYSDIR)
$(INSTALL_DATA) $(AGENT_CONFIG_FILES) $(RELSYSDIR)/agent/conf
$(INSTALL_DATA) $(MANAGER_CONFIG_FILES) $(RELSYSDIR)/manager/conf
diff --git a/lib/snmp/vsn.mk b/lib/snmp/vsn.mk
index 29228fc59b..08251ab9ea 100644
--- a/lib/snmp/vsn.mk
+++ b/lib/snmp/vsn.mk
@@ -17,6 +17,6 @@
#
# %CopyrightEnd%
-SNMP_VSN = 4.20
+SNMP_VSN = 4.21
PRE_VSN =
APP_VSN = "snmp-$(SNMP_VSN)$(PRE_VSN)"
diff --git a/lib/ssh/doc/src/notes.xml b/lib/ssh/doc/src/notes.xml
index 71f3941577..6fc4fdc43d 100644
--- a/lib/ssh/doc/src/notes.xml
+++ b/lib/ssh/doc/src/notes.xml
@@ -29,6 +29,20 @@
<file>notes.xml</file>
</header>
+<section><title>Ssh 2.0.8</title>
+ <section><title>Fixed Bugs and Malfunctions</title>
+ <list>
+ <item>
+ <p>
+ Calling ssh_sftp:stop_channel/1 resulted in that the trap_exit flag was
+ set to true for the invoking process.</p>
+ <p>
+ Own Id: OTP-9386 Aux Id: seq11865</p>
+ </item>
+ </list>
+ </section>
+</section>
+
<section><title>Ssh 2.0.7</title>
<section><title>Fixed Bugs and Malfunctions</title>
<list>
diff --git a/lib/ssh/src/ssh.appup.src b/lib/ssh/src/ssh.appup.src
index 974145836c..150b7d86dd 100644
--- a/lib/ssh/src/ssh.appup.src
+++ b/lib/ssh/src/ssh.appup.src
@@ -19,13 +19,19 @@
{"%VSN%",
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
],
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
]
}.
diff --git a/lib/ssh/src/ssh_sftp.erl b/lib/ssh/src/ssh_sftp.erl
index 59e09fdd0f..f000558100 100755
--- a/lib/ssh/src/ssh_sftp.erl
+++ b/lib/ssh/src/ssh_sftp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2005-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2005-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -130,9 +130,9 @@ start_channel(Host, Port, Opts) ->
end.
stop_channel(Pid) ->
- case process_info(Pid, [trap_exit]) of
- [{trap_exit, Bool}] ->
- process_flag(trap_exit, true),
+ case is_process_alive(Pid) of
+ true ->
+ OldValue = process_flag(trap_exit, true),
link(Pid),
exit(Pid, ssh_sftp_stop_channel),
receive
@@ -145,9 +145,9 @@ stop_channel(Pid) ->
ok
end
end,
- process_flag(trap_exit, Bool),
+ process_flag(trap_exit, OldValue),
ok;
- undefined ->
+ false ->
ok
end.
diff --git a/lib/ssh/test/Makefile b/lib/ssh/test/Makefile
index 5a2a6de24a..1820924ed6 100644
--- a/lib/ssh/test/Makefile
+++ b/lib/ssh/test/Makefile
@@ -115,7 +115,7 @@ release_tests_spec: opt
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) ssh.spec ssh.cover $(RELSYSDIR)
$(INSTALL_DATA) $(HRL_FILES_NEEDED_IN_TEST) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/ssh/vsn.mk b/lib/ssh/vsn.mk
index d79038df29..fe2b915d17 100644
--- a/lib/ssh/vsn.mk
+++ b/lib/ssh/vsn.mk
@@ -1,5 +1,5 @@
#-*-makefile-*- ; force emacs to enter makefile-mode
-SSH_VSN = 2.0.7
+SSH_VSN = 2.0.8
APP_VSN = "ssh-$(SSH_VSN)"
diff --git a/lib/ssl/c_src/esock_openssl.c b/lib/ssl/c_src/esock_openssl.c
index 2621c9934e..0bc42958f0 100644
--- a/lib/ssl/c_src/esock_openssl.c
+++ b/lib/ssl/c_src/esock_openssl.c
@@ -1024,7 +1024,7 @@ static void info_callback(const SSL *ssl, int where, int ret)
}
}
-/* This function is called whenever a SSL_CTX *ctx structure is
+/* This function is called whenever an SSL_CTX *ctx structure is
* freed.
*/
static void callback_data_free(void *parent, void *ptr, CRYPTO_EX_DATA *ad,
diff --git a/lib/ssl/doc/src/notes.xml b/lib/ssl/doc/src/notes.xml
index b2d17925fd..e090b4e1ef 100644
--- a/lib/ssl/doc/src/notes.xml
+++ b/lib/ssl/doc/src/notes.xml
@@ -554,7 +554,7 @@
Own Id: OTP-8224</p>
</item>
<item>
- <p>A ssl:ssl_accept/3 could crash a connection if the
+ <p>An ssl:ssl_accept/3 could crash a connection if the
timing was wrong.</p> <p>Removed info message if the
socket closed without a proper disconnect from the ssl
layer. </p> <p>ssl:send/2 is now blocking until the
@@ -770,7 +770,7 @@
<item>
<p>
The new ssl implementation released as a alfa in this
- version supports upgrading of a tcp connection to a ssl
+ version supports upgrading of a tcp connection to an ssl
connection so that http client and servers may implement
RFC 2817.</p>
<p>
@@ -789,7 +789,7 @@
very crippled as the control of the ssl-socket was deep
down in openssl making it hard if not impossible to
support all inet options, ipv6 and upgrade of a tcp
- connection to a ssl connection. The alfa version has a
+ connection to an ssl connection. The alfa version has a
few limitations that will be removed before the ssl-4.0
release. Main differences and limitations in the alfa are
listed below.</p>
diff --git a/lib/ssl/doc/src/ssl.xml b/lib/ssl/doc/src/ssl.xml
index 566068beaf..0c4c8796be 100644
--- a/lib/ssl/doc/src/ssl.xml
+++ b/lib/ssl/doc/src/ssl.xml
@@ -35,7 +35,7 @@
<title>SSL</title>
<list type="bulleted">
- <item>ssl requires the crypto an public_key applications.</item>
+ <item>ssl requires the crypto and public_key applications.</item>
<item>Supported SSL/TLS-versions are SSL-3.0 and TLS-1.0 </item>
<item>For security reasons sslv2 is not supported.</item>
<item>Ephemeral Diffie-Hellman cipher suites are supported
@@ -216,7 +216,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
application is encountered. Additionally it will be called
when a certificate is considered valid by the path validation
to allow access to each certificate in the path to the user
- application. Note that the it will differentiate between the
+ application. Note that it will differentiate between the
peer certificate and CA certificates by using valid_peer or
valid as the second argument to the verify fun. See <seealso
marker="public_key:cert_records">the public_key User's
@@ -326,10 +326,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</item>
<tag>{fail_if_no_peer_cert, boolean()}</tag>
- <item>Used together with {verify, verify_peer} by a ssl server.
+ <item>Used together with {verify, verify_peer} by an ssl server.
If set to true, the server will fail if the client does not have
a certificate to send, i.e. sends a empty certificate, if set to
- false it will only fail if the client sends a invalid
+ false it will only fail if the client sends an invalid
certificate (an empty certificate is considered valid).
</item>
@@ -343,10 +343,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
PeerCert, Compression, CipherSuite) -> boolean()}</tag>
<item>Enables the ssl server to have a local policy
for deciding if a session should be reused or not,
- only meaning full if <c>reuse_sessions</c> is set to true.
+ only meaningful if <c>reuse_sessions</c> is set to true.
SuggestedSessionId is a binary(), PeerCert is a DER encoded
certificate, Compression is an enumeration integer
- and CipherSuite of type ciphersuite().
+ and CipherSuite is of type ciphersuite().
</item>
</taglist>
@@ -355,7 +355,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<section>
<title>General</title>
- <p>When a ssl socket is in active mode (the default), data from the
+ <p>When an ssl socket is in active mode (the default), data from the
socket is delivered to the owner of the socket in the form of
messages:
</p>
@@ -396,7 +396,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<name>connect(Socket, SslOptions, Timeout) -> {ok, SslSocket}
| {error, Reason}</name>
<fsummary> Upgrades a gen_tcp, or
- equivalent, connected socket to a ssl socket. </fsummary>
+ equivalent, connected socket to an ssl socket. </fsummary>
<type>
<v>Socket = socket()</v>
<v>SslOptions = [ssloption()]</v>
@@ -405,7 +405,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc> <p>Upgrades a gen_tcp, or equivalent,
- connected socket to a ssl socket i.e. performs the
+ connected socket to an ssl socket i.e. performs the
client-side ssl handshake.</p>
</desc>
</func>
@@ -428,12 +428,12 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>close(SslSocket) -> ok | {error, Reason}</name>
- <fsummary>Close a ssl connection</fsummary>
+ <fsummary>Close an ssl connection</fsummary>
<type>
<v>SslSocket = sslsocket()</v>
<v>Reason = term()</v>
</type>
- <desc><p>Close a ssl connection.</p>
+ <desc><p>Close an ssl connection.</p>
</desc>
</func>
@@ -450,7 +450,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc><p>Assigns a new controlling process to the ssl-socket. A
- controlling process is the owner of a ssl-socket, and receives
+ controlling process is the owner of an ssl-socket, and receives
all messages from the socket.</p>
</desc>
</func>
@@ -496,14 +496,14 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>listen(Port, Options) ->
{ok, ListenSocket} | {error, Reason}</name>
- <fsummary>Creates a ssl listen socket.</fsummary>
+ <fsummary>Creates an ssl listen socket.</fsummary>
<type>
<v>Port = integer()</v>
<v>Options = options()</v>
<v>ListenSocket = sslsocket()</v>
</type>
<desc>
- <p>Creates a ssl listen socket.</p>
+ <p>Creates an ssl listen socket.</p>
</desc>
</func>
@@ -587,6 +587,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
the socket is closed.</p>
</desc>
</func>
+
<func>
<name>setopts(Socket, Options) -> ok | {error, Reason}</name>
<fsummary>Set socket options.</fsummary>
@@ -646,7 +647,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</type>
<desc>
<p> Upgrades a gen_tcp, or
- equivalent, socket to a ssl socket i.e. performs the
+ equivalent, socket to an ssl socket i.e. performs the
ssl server-side handshake.</p>
<p><warning>Note that the listen socket should be in {active, false} mode
before telling the client that the server is ready to upgrade
diff --git a/lib/ssl/doc/src/ssl_protocol.xml b/lib/ssl/doc/src/ssl_protocol.xml
index 6936408881..ca5cc8bc7a 100644
--- a/lib/ssl/doc/src/ssl_protocol.xml
+++ b/lib/ssl/doc/src/ssl_protocol.xml
@@ -31,11 +31,11 @@
</p>
<p>By default erlang ssl is run over the TCP/IP protocol even
- though you could plug in an other reliable transport protocol
+ though you could plug in any other reliable transport protocol
with the same API as gen_tcp.</p>
<p>If a client and server wants to use an upgrade mechanism, such as
- defined by RFC2817, to upgrade a regular TCP/IP connection to a ssl
+ defined by RFC2817, to upgrade a regular TCP/IP connection to an ssl
connection the erlang ssl API supports this. This can be useful for
things such as supporting HTTP and HTTPS on the same port and
implementing virtual hosting.
diff --git a/lib/ssl/doc/src/using_ssl.xml b/lib/ssl/doc/src/using_ssl.xml
index 605290b6f9..ab837a156a 100644
--- a/lib/ssl/doc/src/using_ssl.xml
+++ b/lib/ssl/doc/src/using_ssl.xml
@@ -56,7 +56,7 @@
<code type="erl">1 server> ssl:start().
ok</code>
- <p>Create a ssl listen socket</p>
+ <p>Create an ssl listen socket</p>
<code type="erl">2 server> {ok, ListenSocket} =
ssl:listen(9999, [{certfile, "cert.pem"}, {keyfile, "key.pem"},{reuseaddr, true}]).
{ok,{sslsocket, [...]}}</code>
@@ -90,7 +90,7 @@ ok</code>
<section>
<title>Upgrade example</title>
- <note><p> To upgrade a TCP/IP connection to a ssl connection the
+ <note><p> To upgrade a TCP/IP connection to an ssl connection the
client and server have to aggre to do so. Agreement
may be accompliced by using a protocol such the one used by HTTP
specified in RFC 2817.</p> </note>
@@ -114,7 +114,7 @@ ok</code>
<code type="erl">2 client> {ok, Socket} = gen_tcp:connect("localhost", 9999, [], infinity).</code>
<p>Make sure active is set to false before trying
- to upgrade a connection to a ssl connection, otherwhise
+ to upgrade a connection to an ssl connection, otherwhise
ssl handshake messages may be deliverd to the wrong process.</p>
<code type="erl">4 server> inet:setopts(Socket, [{active, false}]).
ok</code>
@@ -124,7 +124,7 @@ ok</code>
{certfile, "cert.pem"}, {keyfile, "key.pem"}]).
{ok,{sslsocket,[...]}}</code>
- <p> Upgrade to a ssl connection. Note that the client and server
+ <p> Upgrade to an ssl connection. Note that the client and server
must agree upon the upgrade and the server must call
ssl:accept/2 before the client calls ssl:connect/3.</p>
<code type="erl">3 client>{ok, SSLSocket} = ssl:connect(Socket, [{cacertfile, "cacerts.pem"},
diff --git a/lib/ssl/src/ssl.erl b/lib/ssl/src/ssl.erl
index a0aedbbbee..59f8479a4c 100644
--- a/lib/ssl/src/ssl.erl
+++ b/lib/ssl/src/ssl.erl
@@ -49,9 +49,12 @@
inet_ssl, %% inet options for internal ssl socket
cb %% Callback info
}).
--type option() :: socketoption() | ssloption() | transportoption().
--type socketoption() :: term(). %% See gen_tcp and inet, import spec later when there is one to import
--type ssloption() :: {verify, verify_type()} |
+-type connect_option() :: socket_connect_option() | ssl_option() | transport_option().
+-type socket_connect_option() :: gen_tcp:connect_option().
+-type listen_option() :: socket_listen_option() | ssl_option() | transport_option().
+-type socket_listen_option() :: gen_tcp:listen_option().
+
+-type ssl_option() :: {verify, verify_type()} |
{verify_fun, {fun(), InitialUserState::term()}} |
{fail_if_no_peer_cert, boolean()} | {depth, integer()} |
{cert, Der::binary()} | {certfile, path()} | {key, Der::binary()} |
@@ -66,7 +69,7 @@
string(). % (according to old API)
-type ssl_imp() :: new | old.
--type transportoption() :: {CallbackModule::atom(), DataTag::atom(), ClosedTag::atom()}.
+-type transport_option() :: {cb_info, {CallbackModule::atom(), DataTag::atom(), ClosedTag::atom()}}.
%%--------------------------------------------------------------------
@@ -96,15 +99,15 @@ stop() ->
application:stop(ssl).
%%--------------------------------------------------------------------
--spec connect(host() | port(), [option()]) -> {ok, #sslsocket{}} |
+-spec connect(host() | port(), [connect_option()]) -> {ok, #sslsocket{}} |
{error, reason()}.
--spec connect(host() | port(), [option()] | port_num(), timeout() | list()) ->
+-spec connect(host() | port(), [connect_option()] | inet:port_number(), timeout() | list()) ->
{ok, #sslsocket{}} | {error, reason()}.
--spec connect(host() | port(), port_num(), list(), timeout()) ->
+-spec connect(host() | port(), inet:port_number(), list(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Socket, SslOptions) when is_port(Socket) ->
connect(Socket, SslOptions, infinity).
@@ -148,10 +151,10 @@ connect(Host, Port, Options0, Timeout) ->
end.
%%--------------------------------------------------------------------
--spec listen(port_num(), [option()]) ->{ok, #sslsocket{}} | {error, reason()}.
+-spec listen(inet:port_number(), [listen_option()]) ->{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Creates a ssl listen socket.
+%% Description: Creates an ssl listen socket.
%%--------------------------------------------------------------------
listen(_Port, []) ->
{error, enooptions};
@@ -177,7 +180,7 @@ listen(Port, Options0) ->
-spec transport_accept(#sslsocket{}, timeout()) -> {ok, #sslsocket{}} |
{error, reason()}.
%%
-%% Description: Performs transport accept on a ssl listen socket
+%% Description: Performs transport accept on an ssl listen socket
%%--------------------------------------------------------------------
transport_accept(ListenSocket) ->
transport_accept(ListenSocket, infinity).
@@ -214,11 +217,11 @@ transport_accept(#sslsocket{} = ListenSocket, Timeout) ->
%%--------------------------------------------------------------------
-spec ssl_accept(#sslsocket{}) -> ok | {error, reason()}.
--spec ssl_accept(#sslsocket{} | port(), timeout()| [option()]) ->
+-spec ssl_accept(#sslsocket{} | port(), timeout()| [ssl_option() | transport_option()]) ->
ok | {ok, #sslsocket{}} | {error, reason()}.
--spec ssl_accept(port(), [option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
+-spec ssl_accept(port(), [ssl_option()| transport_option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(ListenSocket) ->
@@ -252,7 +255,7 @@ ssl_accept(Socket, SslOptions, Timeout) when is_port(Socket) ->
%%--------------------------------------------------------------------
-spec close(#sslsocket{}) -> term().
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(#sslsocket{pid = {ListenSocket, #config{cb={CbMod,_, _, _}}}, fd = new_ssl}) ->
CbMod:close(ListenSocket);
@@ -373,7 +376,7 @@ select_part(plain, Cert, Opts) ->
end.
%%--------------------------------------------------------------------
--spec peername(#sslsocket{}) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec peername(#sslsocket{}) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: same as inet:peername/1.
%%--------------------------------------------------------------------
@@ -402,7 +405,8 @@ cipher_suites(openssl) ->
[ssl_cipher:openssl_suite_name(S) || S <- ssl_cipher:suites(Version)].
%%--------------------------------------------------------------------
--spec getopts(#sslsocket{}, [atom()]) -> {ok, [{atom(), term()}]} | {error, reason()}.
+-spec getopts(#sslsocket{}, [gen_tcp:option_name()]) ->
+ {ok, [gen_tcp:option()]} | {error, reason()}.
%%
%% Description: Gets options
%%--------------------------------------------------------------------
@@ -425,7 +429,7 @@ getopts(#sslsocket{} = Socket, OptionTags) ->
ssl_broker:getopts(Socket, OptionTags).
%%--------------------------------------------------------------------
--spec setopts(#sslsocket{}, [proplists:property()]) -> ok | {error, reason()}.
+-spec setopts(#sslsocket{}, [gen_tcp:option()]) -> ok | {error, reason()}.
%%
%% Description: Sets options
%%--------------------------------------------------------------------
@@ -466,7 +470,7 @@ shutdown(#sslsocket{pid = Pid, fd = new_ssl}, How) ->
ssl_connection:shutdown(Pid, How).
%%--------------------------------------------------------------------
--spec sockname(#sslsocket{}) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec sockname(#sslsocket{}) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:sockname/1
%%--------------------------------------------------------------------
diff --git a/lib/ssl/src/ssl_connection.erl b/lib/ssl/src/ssl_connection.erl
index 21b021afb0..cec81d551b 100644
--- a/lib/ssl/src/ssl_connection.erl
+++ b/lib/ssl/src/ssl_connection.erl
@@ -127,11 +127,11 @@ send(Pid, Data) ->
recv(Pid, Length, Timeout) ->
sync_send_all_state_event(Pid, {recv, Length}, Timeout).
%%--------------------------------------------------------------------
--spec connect(host(), port_num(), port(), {#ssl_options{}, #socket_options{}},
+-spec connect(host(), inet:port_number(), port(), {#ssl_options{}, #socket_options{}},
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
try start_fsm(client, Host, Port, Socket, Options, User, CbInfo,
@@ -141,11 +141,11 @@ connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
{error, ssl_not_started}
end.
%%--------------------------------------------------------------------
--spec ssl_accept(port_num(), port(), {#ssl_options{}, #socket_options{}},
+-spec ssl_accept(inet:port_number(), port(), {#ssl_options{}, #socket_options{}},
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(Port, Socket, Opts, User, CbInfo, Timeout) ->
@@ -185,7 +185,7 @@ socket_control(Socket, Pid, CbModule) ->
%%--------------------------------------------------------------------
-spec close(pid()) -> ok | {error, reason()}.
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(ConnectionPid) ->
case sync_send_all_state_event(ConnectionPid, close) of
@@ -212,14 +212,14 @@ shutdown(ConnectionPid, How) ->
new_user(ConnectionPid, User) ->
sync_send_all_state_event(ConnectionPid, {new_user, User}).
%%--------------------------------------------------------------------
--spec sockname(pid()) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec sockname(pid()) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:sockname/1
%%--------------------------------------------------------------------
sockname(ConnectionPid) ->
sync_send_all_state_event(ConnectionPid, sockname).
%%--------------------------------------------------------------------
--spec peername(pid()) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec peername(pid()) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:peername/1
%%--------------------------------------------------------------------
@@ -277,7 +277,7 @@ renegotiation(ConnectionPid) ->
%%====================================================================
%%--------------------------------------------------------------------
--spec start_link(atom(), host(), port_num(), port(), list(), pid(), tuple()) ->
+-spec start_link(atom(), host(), inet:port_number(), port(), list(), pid(), tuple()) ->
{ok, pid()} | ignore | {error, reason()}.
%%
%% Description: Creates a gen_fsm process which calls Module:init/1 to
@@ -1778,7 +1778,8 @@ format_reply(binary, _, N, Data) when N > 0 -> % Header mode
format_reply(binary, _, _, Data) ->
Data;
format_reply(list, Packet, _, Data)
- when Packet == http; Packet == {http, headers}; Packet == http_bin; Packet == {http_bin, headers} ->
+ when Packet == http; Packet == {http, headers}; Packet == http_bin; Packet == {http_bin, headers}; Packet == httph;
+ Packet == httph_bin->
Data;
format_reply(list, _,_, Data) ->
binary_to_list(Data).
@@ -2090,7 +2091,9 @@ set_socket_opts(Socket, [{packet, Packet}| Opts], SockOpts, Other) when Packet =
Packet == tpkt;
Packet == line;
Packet == http;
- Packet == http_bin ->
+ Packet == httph;
+ Packet == http_bin;
+ Packet == httph_bin ->
set_socket_opts(Socket, Opts,
SockOpts#socket_options{packet = Packet}, Other);
set_socket_opts(_, [{packet, _} = Opt| _], SockOpts, _) ->
diff --git a/lib/ssl/src/ssl_handshake.erl b/lib/ssl/src/ssl_handshake.erl
index 4e74aec4ac..453ea20f99 100644
--- a/lib/ssl/src/ssl_handshake.erl
+++ b/lib/ssl/src/ssl_handshake.erl
@@ -48,7 +48,7 @@
%% Internal application API
%%====================================================================
%%--------------------------------------------------------------------
--spec client_hello(host(), port_num(), #connection_states{},
+-spec client_hello(host(), inet:port_number(), #connection_states{},
#ssl_options{}, boolean(), der_cert()) -> #client_hello{}.
%%
%% Description: Creates a client hello message.
@@ -106,7 +106,7 @@ hello_request() ->
%%--------------------------------------------------------------------
-spec hello(#server_hello{} | #client_hello{}, #ssl_options{},
- #connection_states{} | {port_num(), #session{}, db_handle(),
+ #connection_states{} | {inet:port_number(), #session{}, db_handle(),
atom(), #connection_states{}, binary()},
boolean()) -> {tls_version(), session_id(), #connection_states{}}|
{tls_version(), {resumed | new, #session{}},
@@ -383,8 +383,9 @@ master_secret(Version, #session{master_secret = Mastersecret},
ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Key calculation failed due to ~p",
- [Reason]),
+ Report = io_lib:format("Key calculation failed due to ~p",
+ [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end;
@@ -400,8 +401,9 @@ master_secret(Version, PremasterSecret, ConnectionStates, Role) ->
SecParams, ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Master secret calculation failed"
- " due to ~p", [Reason]),
+ Report = io_lib:format("Master secret calculation failed"
+ " due to ~p", [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end.
diff --git a/lib/ssl/src/ssl_internal.hrl b/lib/ssl/src/ssl_internal.hrl
index cc66246068..6bf1edc452 100644
--- a/lib/ssl/src/ssl_internal.hrl
+++ b/lib/ssl/src/ssl_internal.hrl
@@ -28,8 +28,7 @@
-type reply() :: term().
-type msg() :: term().
-type from() :: term().
--type host() :: string() | tuple().
--type port_num() :: integer().
+-type host() :: inet:ip_address() | inet:hostname().
-type session_id() :: 0 | binary().
-type tls_version() :: {integer(), integer()}.
-type tls_atom_version() :: sslv3 | tlsv1.
diff --git a/lib/ssl/src/ssl_manager.erl b/lib/ssl/src/ssl_manager.erl
index b02815bfd8..725a085d1f 100644
--- a/lib/ssl/src/ssl_manager.erl
+++ b/lib/ssl/src/ssl_manager.erl
@@ -113,7 +113,7 @@ lookup_trusted_cert(DbHandle, Ref, SerialNumber, Issuer) ->
issuer_candidate(PrevCandidateKey, DbHandle) ->
ssl_certificate_db:issuer_candidate(PrevCandidateKey, DbHandle).
%%--------------------------------------------------------------------
--spec client_session_id(host(), port_num(), #ssl_options{},
+-spec client_session_id(host(), inet:port_number(), #ssl_options{},
der_cert() | undefined) -> session_id().
%%
%% Description: Select a session id for the client.
@@ -122,7 +122,7 @@ client_session_id(Host, Port, SslOpts, OwnCert) ->
call({client_session_id, Host, Port, SslOpts, OwnCert}).
%%--------------------------------------------------------------------
--spec server_session_id(host(), port_num(), #ssl_options{},
+-spec server_session_id(host(), inet:port_number(), #ssl_options{},
der_cert()) -> session_id().
%%
%% Description: Select a session id for the server.
@@ -131,8 +131,8 @@ server_session_id(Port, SuggestedSessionId, SslOpts, OwnCert) ->
call({server_session_id, Port, SuggestedSessionId, SslOpts, OwnCert}).
%%--------------------------------------------------------------------
--spec register_session(port_num(), #session{}) -> ok.
--spec register_session(host(), port_num(), #session{}) -> ok.
+-spec register_session(inet:port_number(), #session{}) -> ok.
+-spec register_session(host(), inet:port_number(), #session{}) -> ok.
%%
%% Description: Make the session available for reuse.
%%--------------------------------------------------------------------
@@ -142,8 +142,8 @@ register_session(Host, Port, Session) ->
register_session(Port, Session) ->
cast({register_session, Port, Session}).
%%--------------------------------------------------------------------
--spec invalidate_session(port_num(), #session{}) -> ok.
--spec invalidate_session(host(), port_num(), #session{}) -> ok.
+-spec invalidate_session(inet:port_number(), #session{}) -> ok.
+-spec invalidate_session(host(), inet:port_number(), #session{}) -> ok.
%%
%% Description: Make the session unavailable for reuse. After
%% a the session has been marked "is_resumable = false" for some while
diff --git a/lib/ssl/src/ssl_record.erl b/lib/ssl/src/ssl_record.erl
index 4c3c0b9c58..72091fdd5f 100644
--- a/lib/ssl/src/ssl_record.erl
+++ b/lib/ssl/src/ssl_record.erl
@@ -342,7 +342,7 @@ get_tls_records_aux(<<?BYTE(?CHANGE_CIPHER_SPEC),?BYTE(MajVer),?BYTE(MinVer),
get_tls_records_aux(Rest, [#ssl_tls{type = ?CHANGE_CIPHER_SPEC,
version = {MajVer, MinVer},
fragment = Data} | Acc]);
-%% Matches a ssl v2 client hello message.
+%% Matches an ssl v2 client hello message.
%% The server must be able to receive such messages, from clients that
%% are willing to use ssl v3 or higher, but have ssl v2 compatibility.
get_tls_records_aux(<<1:1, Length0:15, Data0:Length0/binary, Rest/binary>>,
diff --git a/lib/ssl/src/ssl_session.erl b/lib/ssl/src/ssl_session.erl
index 85c9fcb61c..bf738649f6 100644
--- a/lib/ssl/src/ssl_session.erl
+++ b/lib/ssl/src/ssl_session.erl
@@ -48,7 +48,7 @@ is_new(_ClientSuggestion, _ServerDecision) ->
true.
%%--------------------------------------------------------------------
--spec id({host(), port_num(), #ssl_options{}}, db_handle(), atom(),
+-spec id({host(), inet:port_number(), #ssl_options{}}, db_handle(), atom(),
undefined | binary()) -> binary().
%%
%% Description: Should be called by the client side to get an id
@@ -63,7 +63,7 @@ id(ClientInfo, Cache, CacheCb, OwnCert) ->
end.
%%--------------------------------------------------------------------
--spec id(port_num(), binary(), #ssl_options{}, db_handle(),
+-spec id(inet:port_number(), binary(), #ssl_options{}, db_handle(),
atom(), seconds(), binary()) -> binary().
%%
%% Description: Should be called by the server side to get an id
diff --git a/lib/ssl/src/ssl_session_cache.erl b/lib/ssl/src/ssl_session_cache.erl
index 66610817be..93969f628f 100644
--- a/lib/ssl/src/ssl_session_cache.erl
+++ b/lib/ssl/src/ssl_session_cache.erl
@@ -28,7 +28,7 @@
-export([init/1, terminate/1, lookup/2, update/3, delete/2, foldl/3,
select_session/2]).
--type key() :: {{host(), port_num()}, session_id()} | {port_num(), session_id()}.
+-type key() :: {{host(), inet:port_number()}, session_id()} | {inet:port_number(), session_id()}.
%%--------------------------------------------------------------------
-spec init(list()) -> db_handle(). %% Returns reference to the cache (opaque)
@@ -91,7 +91,7 @@ foldl(Fun, Acc0, Cache) ->
ets:foldl(Fun, Acc0, Cache).
%%--------------------------------------------------------------------
--spec select_session(db_handle(), {host(), port_num()} | port_num()) -> [#session{}].
+-spec select_session(db_handle(), {host(), inet:port_number()} | inet:port_number()) -> [#session{}].
%%
%% Description: Selects a session that could be reused. Should be callable
%% from any process.
diff --git a/lib/ssl/src/ssl_ssl2.erl b/lib/ssl/src/ssl_ssl2.erl
index b1005b1acb..30a3a5fc98 100644
--- a/lib/ssl/src/ssl_ssl2.erl
+++ b/lib/ssl/src/ssl_ssl2.erl
@@ -20,7 +20,7 @@
%%
%%----------------------------------------------------------------------
%% Purpose: Handles sslv2 hello as clients supporting sslv2 and higher
-%% will send a sslv2 hello.
+%% will send an sslv2 hello.
%%----------------------------------------------------------------------
-module(ssl_ssl2).
diff --git a/lib/ssl/test/ssl_packet_SUITE.erl b/lib/ssl/test/ssl_packet_SUITE.erl
index d22d5d2954..9d2599b778 100644
--- a/lib/ssl/test/ssl_packet_SUITE.erl
+++ b/lib/ssl/test/ssl_packet_SUITE.erl
@@ -151,6 +151,9 @@ all() ->
packet_cdr_decode, packet_cdr_decode_list,
packet_http_decode, packet_http_decode_list,
packet_http_bin_decode_multi, packet_http_error_passive,
+ packet_httph_active, packet_httph_bin_active,
+ packet_httph_active_once, packet_httph_bin_active_once,
+ packet_httph_passive, packet_httph_bin_passive,
packet_line_decode, packet_line_decode_list,
packet_asn1_decode, packet_asn1_decode_list,
packet_tpkt_decode, packet_tpkt_decode_list,
@@ -1594,7 +1597,7 @@ client_http_decode(Socket, HttpRequest) ->
%%--------------------------------------------------------------------
packet_http_decode_list(doc) ->
["Test setting the packet option {packet, http}, {mode, list}"
- "(Body will be litst too)"];
+ "(Body will be list too)"];
packet_http_decode_list(suite) ->
[];
packet_http_decode_list(Config) when is_list(Config) ->
@@ -1804,7 +1807,304 @@ server_http_decode_error(Socket, HttpResponse) ->
assert_packet_opt(Socket, http),
ok = ssl:send(Socket, HttpResponse),
ok.
+%%--------------------------------------------------------------------
+packet_httph_active(doc) ->
+ ["Test setting the packet option {packet, httph}"];
+packet_httph_active(suite) ->
+ [];
+packet_httph_active(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_active,
+ []}},
+ {options, [{active, true},
+ {packet, httph},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+server_send_trailer(Socket, Trailer)->
+ ssl:send(Socket, Trailer),
+ ok.
+
+client_http_decode_trailer_active(Socket) ->
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined,"gzip"}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+
+%%--------------------------------------------------------------------
+packet_httph_bin_active(doc) ->
+ ["Test setting the packet option {packet, httph_bin}"];
+packet_httph_bin_active(suite) ->
+ [];
+packet_httph_bin_active(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_bin_active,
+ []}},
+ {options, [{active, true},
+ {packet, httph_bin},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_bin_active(Socket) ->
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined, <<"gzip">>}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+%%--------------------------------------------------------------------
+packet_httph_active_once(doc) ->
+ ["Test setting the packet option {packet, httph}"];
+packet_httph_active_once(suite) ->
+ [];
+packet_httph_active_once(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_active_once,
+ []}},
+ {options, [{active, false},
+ {packet, httph},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+
+client_http_decode_trailer_active_once(Socket) ->
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined,"gzip"}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+%%--------------------------------------------------------------------
+packet_httph_bin_active_once(doc) ->
+ ["Test setting the packet option {packet, httph_bin}"];
+packet_httph_bin_active_once(suite) ->
+ [];
+packet_httph_bin_active_once(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_bin_active_once,
+ []}},
+ {options, [{active, false},
+ {packet, httph_bin},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_bin_active_once(Socket) ->
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined, <<"gzip">>}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+
+%%--------------------------------------------------------------------
+
+packet_httph_passive(doc) ->
+ ["Test setting the packet option {packet, httph}"];
+packet_httph_passive(suite) ->
+ [];
+packet_httph_passive(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_passive,
+ []}},
+ {options, [{active, false},
+ {packet, httph},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_passive(Socket) ->
+ {ok,{http_header,36,'Content-Encoding',undefined,"gzip"}} = ssl:recv(Socket, 0),
+ {ok, http_eoh} = ssl:recv(Socket, 0),
+ ok.
+
+%%--------------------------------------------------------------------
+packet_httph_bin_passive(doc) ->
+ ["Test setting the packet option {packet, httph_bin}"];
+packet_httph_bin_passive(suite) ->
+ [];
+packet_httph_bin_passive(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_bin_passive,
+ []}},
+ {options, [{active, false},
+ {packet, httph_bin},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_bin_passive(Socket) ->
+ {ok,{http_header,36,'Content-Encoding',undefined,<<"gzip">>}} = ssl:recv(Socket, 0),
+ {ok, http_eoh} = ssl:recv(Socket, 0),
+ ok.
%%--------------------------------------------------------------------
packet_line_decode(doc) ->
diff --git a/lib/stdlib/doc/src/dets.xml b/lib/stdlib/doc/src/dets.xml
index 2512c84e18..54fefbe2b8 100644
--- a/lib/stdlib/doc/src/dets.xml
+++ b/lib/stdlib/doc/src/dets.xml
@@ -1105,7 +1105,7 @@ fun(X) -> {continue, X} end. </pre>
<p>Terminate the traversal and return <c>[<anno>Value</anno> | Acc]</c>.</p>
</item>
</taglist>
- <p>Any other value returned by <c><anno>Fun</anno></c> terminates the
+ <p>Any other value <c><anno>OtherValue</anno></c> returned by <c><anno>Fun</anno></c> terminates the
traversal and is immediately returned.
</p>
</desc>
diff --git a/lib/stdlib/doc/src/gen_fsm.xml b/lib/stdlib/doc/src/gen_fsm.xml
index d15383c621..e35b5adace 100644
--- a/lib/stdlib/doc/src/gen_fsm.xml
+++ b/lib/stdlib/doc/src/gen_fsm.xml
@@ -438,7 +438,7 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<fsummary>Initialize process and internal state name and state data.</fsummary>
<type>
<v>Args = term()</v>
- <v>Return = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
+ <v>Result = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
<v>&nbsp;&nbsp;| {ok,StateName,StateData,hibernate}</v>
<v>&nbsp;&nbsp;| {stop,Reason} | ignore</v>
<v>&nbsp;StateName = atom()</v>
@@ -639,9 +639,9 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<v>StateName = atom()</v>
<v>StateData = term()</v>
<v>Result = {next_state,NextStateName,NewStateData}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
- <v>&nbsp;>&nbsp;| {stop,Reason,NewStateData}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
+ <v>&nbsp;&nbsp;| {stop,Reason,NewStateData}</v>
<v>&nbsp;NextStateName = atom()</v>
<v>&nbsp;NewStateData = term()</v>
<v>&nbsp;Timeout = int()>0 | infinity</v>
diff --git a/lib/stdlib/doc/src/supervisor.xml b/lib/stdlib/doc/src/supervisor.xml
index 009aa60faa..edd119d37a 100644
--- a/lib/stdlib/doc/src/supervisor.xml
+++ b/lib/stdlib/doc/src/supervisor.xml
@@ -150,9 +150,12 @@ child_spec() = {Id,StartFunc,Restart,Shutdown,Type,Modules}
<p><c>Restart</c> defines when a terminated child process
should be restarted. A <c>permanent</c> child process should
always be restarted, a <c>temporary</c> child process should
- never be restarted and a <c>transient</c> child process
- should be restarted only if it terminates abnormally, i.e.
- with another exit reason than <c>normal</c>.</p>
+ never be restarted (even when the supervisor's restart strategy
+ is <c>rest_for_one</c> or <c>one_for_all</c> and a sibling's
+ death causes the temporary process to be terminated) and a
+ <c>transient</c> child process should be restarted only if
+ it terminates abnormally, i.e. with another exit reason
+ than <c>normal</c>.</p>
</item>
<item>
<p><c>Shutdown</c> defines how a child process should be
diff --git a/lib/stdlib/doc/src/unicode_usage.xml b/lib/stdlib/doc/src/unicode_usage.xml
index 416df1f02c..b48ad8c1f3 100644
--- a/lib/stdlib/doc/src/unicode_usage.xml
+++ b/lib/stdlib/doc/src/unicode_usage.xml
@@ -52,7 +52,7 @@
<tag>UCS-4</tag>
<item>Basically the same as UTF-32, but without some Unicode semantics, defined by IEEE and has little use as a separate encoding standard. For all normal (and possibly abnormal) usages, UTF-32 and UCS-4 are interchangeable.</item>
</taglist>
-<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a whole in the Unicode range to cope with backward compatibility.</p>
+<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a hole in the Unicode range to cope with backward compatibility.</p>
<p>Additionally, the codepoint 16#FEFF is used for byte order marks (BOM's) and use of that character is not encouraged in other contexts than that. It actually is valid though, as the character "ZWNBS" (Zero Width Non Breaking Space). BOM's are used to identify encodings and byte order for programs where such parameters are not known in advance. Byte order marks are more seldom used than one could expect, put their use is becoming more widely spread as they provide the means for programs to make educated guesses about the Unicode format of a certain file.</p>
</section>
<section>
diff --git a/lib/stdlib/src/dets.erl b/lib/stdlib/src/dets.erl
index 671b5a9dd4..fa0641ffd9 100644
--- a/lib/stdlib/src/dets.erl
+++ b/lib/stdlib/src/dets.erl
@@ -411,7 +411,8 @@ init_table(Tab, InitFun) ->
InitFun :: fun((Arg) -> Res),
Arg :: read | close,
Res :: end_of_input | {[object()], InitFun} | {Data, InitFun} | term(),
- Options :: [{min_no_slots,no_slots()} | {format,term | bchunk}],
+ Options :: Option | [Option],
+ Option :: {min_no_slots,no_slots()} | {format,term | bchunk},
Reason :: term(),
Data :: binary() | tuple().
@@ -871,11 +872,15 @@ to_ets(DTab, ETab) ->
-spec traverse(Name, Fun) -> Return | {'error', Reason} when
Name :: tab_name(),
Fun :: fun((Object) -> FunReturn),
- FunReturn :: 'continue' | {'continue', Val} | {'done', Value},
+ Object :: object(),
+ FunReturn :: 'continue'
+ | {'continue', Val}
+ | {'done', Value}
+ | OtherValue,
+ Return :: [term()] | OtherValue,
Val :: term(),
Value :: term(),
- Object :: object(),
- Return :: [term()],
+ OtherValue :: term(),
Reason :: term().
traverse(Tab, Fun) ->
diff --git a/lib/stdlib/src/erl_compile.erl b/lib/stdlib/src/erl_compile.erl
index abff37e4bc..d833f626bf 100644
--- a/lib/stdlib/src/erl_compile.erl
+++ b/lib/stdlib/src/erl_compile.erl
@@ -41,7 +41,6 @@ compiler(".idl") -> {ic, compile};
compiler(".asn1") -> {asn1ct, compile_asn1};
compiler(".asn") -> {asn1ct, compile_asn};
compiler(".py") -> {asn1ct, compile_py};
-compiler(".xml") -> {xmerl_scan, process};
compiler(_) -> no.
%% Entry from command line.
diff --git a/lib/stdlib/src/erl_internal.erl b/lib/stdlib/src/erl_internal.erl
index 478f05e792..3073fc0fb5 100644
--- a/lib/stdlib/src/erl_internal.erl
+++ b/lib/stdlib/src/erl_internal.erl
@@ -262,6 +262,7 @@ bif(bitsize, 1) -> true;
bif(bit_size, 1) -> true;
bif(bitstring_to_list, 1) -> true;
bif(byte_size, 1) -> true;
+bif(check_old_code, 1) -> true;
bif(check_process_code, 2) -> true;
bif(concat_binary, 1) -> true;
bif(date, 0) -> true;
diff --git a/lib/stdlib/src/escript.erl b/lib/stdlib/src/escript.erl
index d67617260e..cd1bacd2f5 100644
--- a/lib/stdlib/src/escript.erl
+++ b/lib/stdlib/src/escript.erl
@@ -62,10 +62,10 @@
-type zip_create_option() :: term().
-type section() ::
shebang
- | {shebang, shebang()}
+ | {shebang, shebang() | default | undefined}
| comment
- | {comment, comment()}
- | {emu_args, emu_args()}
+ | {comment, comment() | default | undefined}
+ | {emu_args, emu_args() | undefined}
| {source, file:filename() | binary()}
| {beam, file:filename() | binary()}
| {archive, file:filename() | binary()}
diff --git a/lib/stdlib/src/eval_bits.erl b/lib/stdlib/src/eval_bits.erl
index 2cbd6cdae7..2c7192a7e7 100644
--- a/lib/stdlib/src/eval_bits.erl
+++ b/lib/stdlib/src/eval_bits.erl
@@ -34,12 +34,12 @@
%% @type matchfun(). A closure which performs a match given a value, a
%% pattern and an environment
%%
-%% @type field() represents a field in a "bin"
+%% @type field(). Represents a field in a "bin".
%%% Part 1: expression evaluation (binary construction)
%% @spec expr_grp(Fields::[field()], Bindings::bindings(),
-%% EvalFun::evalfun()) ->
+%% EvalFun::evalfun(), term(), term()) ->
%% {value, binary(), bindings()}
%%
%% @doc Returns a tuple with {value,Bin,Bs} where Bin is the binary
@@ -192,9 +192,9 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
end.
%%% Part 3: binary pattern matching
-%% @spec match_bits(Fields::[field()], Bin::binary()
+%% @spec match_bits(Fields::[field()], Bin::binary(),
%% GlobalEnv::bindings(), LocalEnv::bindings(),
-%% MatchFun::matchfun(),EvalFun::evalfun()) ->
+%% MatchFun::matchfun(),EvalFun::evalfun(), term()) ->
%% {match, bindings()}
%% @doc Used to perform matching. If the match succeeds a new
%% environment is returned. If the match have some syntactic or
diff --git a/lib/stdlib/src/io_lib.erl b/lib/stdlib/src/io_lib.erl
index 165e03e506..0252cdf742 100644
--- a/lib/stdlib/src/io_lib.erl
+++ b/lib/stdlib/src/io_lib.erl
@@ -109,9 +109,9 @@ fwrite(Format, Args) ->
fread(Chars, Format) ->
io_lib_fread:fread(Chars, Format).
--spec fread(Continuation, String, Format) -> Return when
+-spec fread(Continuation, CharSpec, Format) -> Return when
Continuation :: continuation() | [],
- String :: string(),
+ CharSpec :: string() | eof,
Format :: string(),
Return :: {'more', Continuation1 :: continuation()}
| {'done', Result, LeftOverChars :: string()},
diff --git a/lib/stdlib/src/io_lib_fread.erl b/lib/stdlib/src/io_lib_fread.erl
index 52aa4d073c..ded1346097 100644
--- a/lib/stdlib/src/io_lib_fread.erl
+++ b/lib/stdlib/src/io_lib_fread.erl
@@ -24,6 +24,10 @@
-import(lists, [reverse/1,reverse/2]).
+-define(is_whitespace(C),
+ ((C) =:= $\s orelse (C) =:= $\t
+ orelse (C) =:= $\r orelse (C) =:= $\n)).
+
%%-----------------------------------------------------------------------
%% fread(Continuation, CharList, FormatString)
@@ -106,31 +110,27 @@ fread_line(Format0, Line, N0, Results0, More, Newline) ->
fread(Format, Line) ->
fread(Format, Line, 0, []).
-fread([$~|Format0], Line, N, Results) ->
+fread([$~|Format0]=AllFormat, Line, N, Results) ->
{Format,F,Sup,Unicode} = fread_field(Format0),
- fread1(Format, F, Sup, Unicode, Line, N, Results, Format0);
-fread([$\s|Format], Line, N, Results) ->
- fread_skip_white(Format, Line, N, Results);
-fread([$\t|Format], Line, N, Results) ->
- fread_skip_white(Format, Line, N, Results);
-fread([$\r|Format], Line, N, Results) ->
- fread_skip_white(Format, Line, N, Results);
-fread([$\n|Format], Line, N, Results) ->
+ fread1(Format, F, Sup, Unicode, Line, N, Results, AllFormat);
+fread([C|Format], Line, N, Results) when ?is_whitespace(C) ->
fread_skip_white(Format, Line, N, Results);
fread([C|Format], [C|Line], N, Results) ->
fread(Format, Line, N+1, Results);
fread([_F|_Format], [_C|_Line], _N, _Results) ->
fread_error(input);
+fread([_|_]=Format, [], N, Results) ->
+ {more,Format,N,Results};
+fread([_|_], eof, 0, []) ->
+ %% This is at start of input so no error.
+ eof;
+fread([_|_], eof, _N, _Results) ->
+ %% This is an error as there is no more input.
+ fread_error(input);
fread([], Line, _N, Results) ->
{ok,reverse(Results),Line}.
-fread_skip_white(Format, [$\s|Line], N, Results) ->
- fread_skip_white(Format, Line, N+1, Results);
-fread_skip_white(Format, [$\t|Line], N, Results) ->
- fread_skip_white(Format, Line, N+1, Results);
-fread_skip_white(Format, [$\r|Line], N, Results) ->
- fread_skip_white(Format, Line, N+1, Results);
-fread_skip_white(Format, [$\n|Line], N, Results) ->
+fread_skip_white(Format, [C|Line], N, Results) when ?is_whitespace(C) ->
fread_skip_white(Format, Line, N+1, Results);
fread_skip_white(Format, Line, N, Results) ->
fread(Format, Line, N, Results).
@@ -166,9 +166,9 @@ fread1([$l|Format], _F, Sup, _U, Line, N, Res, _AllFormat) ->
fread(Format, Line, N, fread_result(Sup, N, Res));
fread1(_Format, _F, _Sup, _U, [], N, Res, AllFormat) ->
%% Need more input here.
- {more,[$~|AllFormat],N,Res};
-fread1(_Format, _F, _Sup, _U, eof, _N, [], _AllFormat) ->
- %% This is at start of format string so no error.
+ {more,AllFormat,N,Res};
+fread1(_Format, _F, _Sup, _U, eof, 0, [], _AllFormat) ->
+ %% This is at start of input so no error.
eof;
fread1(_Format, _F, _Sup, _U, eof, _N, _Res, _AllFormat) ->
%% This is an error as there is no more input.
@@ -386,26 +386,16 @@ fread_string_cs(Line0, N0, true) ->
%% fread_digits(Line, N, Base, Characters)
%% Read segments of things, return "thing" characters in reverse order.
-fread_skip_white([$\s|Line]) -> fread_skip_white(Line);
-fread_skip_white([$\t|Line]) -> fread_skip_white(Line);
-fread_skip_white([$\r|Line]) -> fread_skip_white(Line);
-fread_skip_white([$\n|Line]) -> fread_skip_white(Line);
+fread_skip_white([C|Line]) when ?is_whitespace(C) ->
+ fread_skip_white(Line);
fread_skip_white(Line) -> Line.
-fread_skip_white([$\s|Line], N) ->
- fread_skip_white(Line, N+1);
-fread_skip_white([$\t|Line], N) ->
- fread_skip_white(Line, N+1);
-fread_skip_white([$\r|Line], N) ->
- fread_skip_white(Line, N+1);
-fread_skip_white([$\n|Line], N) ->
+fread_skip_white([C|Line], N) when ?is_whitespace(C) ->
fread_skip_white(Line, N+1);
fread_skip_white(Line, N) -> {Line,N}.
-fread_skip_latin1_nonwhite([$\s|Line], N, Cs) -> {[$\s|Line],N,Cs};
-fread_skip_latin1_nonwhite([$\t|Line], N, Cs) -> {[$\t|Line],N,Cs};
-fread_skip_latin1_nonwhite([$\r|Line], N, Cs) -> {[$\r|Line],N,Cs};
-fread_skip_latin1_nonwhite([$\n|Line], N, Cs) -> {[$\n|Line],N,Cs};
+fread_skip_latin1_nonwhite([C|Line], N, Cs) when ?is_whitespace(C) ->
+ {[C|Line],N,Cs};
fread_skip_latin1_nonwhite([C|Line], N, []) when C > 255 ->
{[C|Line],N,error};
fread_skip_latin1_nonwhite([C|Line], N, Cs) when C > 255 ->
@@ -414,10 +404,8 @@ fread_skip_latin1_nonwhite([C|Line], N, Cs) ->
fread_skip_latin1_nonwhite(Line, N+1, [C|Cs]);
fread_skip_latin1_nonwhite([], N, Cs) -> {[],N,Cs}.
-fread_skip_nonwhite([$\s|Line], N, Cs) -> {[$\s|Line],N,Cs};
-fread_skip_nonwhite([$\t|Line], N, Cs) -> {[$\t|Line],N,Cs};
-fread_skip_nonwhite([$\r|Line], N, Cs) -> {[$\r|Line],N,Cs};
-fread_skip_nonwhite([$\n|Line], N, Cs) -> {[$\n|Line],N,Cs};
+fread_skip_nonwhite([C|Line], N, Cs) when ?is_whitespace(C) ->
+ {[C|Line],N,Cs};
fread_skip_nonwhite([C|Line], N, Cs) ->
fread_skip_nonwhite(Line, N+1, [C|Cs]);
fread_skip_nonwhite([], N, Cs) -> {[],N,Cs}.
diff --git a/lib/stdlib/src/otp_internal.erl b/lib/stdlib/src/otp_internal.erl
index 39d017d430..5129ba5074 100644
--- a/lib/stdlib/src/otp_internal.erl
+++ b/lib/stdlib/src/otp_internal.erl
@@ -461,6 +461,14 @@ obsolete_1(public_key, pem_to_der, 1) ->
obsolete_1(public_key, decode_private_key, A) when A =:= 1; A =:= 2 ->
{deprecated,{public_key,pem_entry_decode,1},"R15A"};
+%% Added in R14B03.
+obsolete_1(docb_gen, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+obsolete_1(docb_transform, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+obsolete_1(docb_xml_check, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+
obsolete_1(_, _, _) ->
no.
diff --git a/lib/stdlib/src/proplists.erl b/lib/stdlib/src/proplists.erl
index 68697d0da2..e3eda5d932 100644
--- a/lib/stdlib/src/proplists.erl
+++ b/lib/stdlib/src/proplists.erl
@@ -49,9 +49,10 @@
%% ---------------------------------------------------------------------
--export_type([property/0]).
+-export_type([property/0, proplist/0]).
-type property() :: atom() | tuple().
+-type proplist() :: [property()].
%% ---------------------------------------------------------------------
diff --git a/lib/stdlib/src/sofs.erl b/lib/stdlib/src/sofs.erl
index d38b8ab37a..34eb224647 100644
--- a/lib/stdlib/src/sofs.erl
+++ b/lib/stdlib/src/sofs.erl
@@ -81,7 +81,8 @@
-define(ORDTAG, 'OrdSet').
-record(?TAG, {data = [] :: list(), type = type :: term()}).
--record(?ORDTAG, {orddata = {} :: tuple(), ordtype = type :: term()}).
+-record(?ORDTAG, {orddata = {} :: tuple() | atom(),
+ ordtype = type :: term()}).
-define(LIST(S), (S)#?TAG.data).
-define(TYPE(S), (S)#?TAG.type).
@@ -375,7 +376,7 @@ to_sets(S) when ?IS_ORDSET(S) ->
-spec(no_elements(ASet) -> NoElements when
ASet :: a_set() | ordset(),
- NoElements :: pos_integer()).
+ NoElements :: non_neg_integer()).
no_elements(S) when ?IS_SET(S) ->
length(?LIST(S));
no_elements(S) when ?IS_ORDSET(S), is_tuple(?ORDTYPE(S)) ->
diff --git a/lib/stdlib/src/supervisor.erl b/lib/stdlib/src/supervisor.erl
index e60706ed05..dc31647eb5 100644
--- a/lib/stdlib/src/supervisor.erl
+++ b/lib/stdlib/src/supervisor.erl
@@ -735,6 +735,13 @@ restart(one_for_all, Child, State) ->
terminate_children(Children, SupName) ->
terminate_children(Children, SupName, []).
+%% Temporary children should not be restarted and thus should
+%% be skipped when building the list of terminated children, although
+%% we do want them to be shut down as many functions from this module
+%% use this function to just clear everything.
+terminate_children([Child = #child{restart_type=temporary} | Children], SupName, Res) ->
+ do_terminate(Child, SupName),
+ terminate_children(Children, SupName, Res);
terminate_children([Child | Children], SupName, Res) ->
NChild = do_terminate(Child, SupName),
terminate_children(Children, SupName, [NChild | Res]);
diff --git a/lib/stdlib/src/sys.erl b/lib/stdlib/src/sys.erl
index 8ab72c9b50..f34201604c 100644
--- a/lib/stdlib/src/sys.erl
+++ b/lib/stdlib/src/sys.erl
@@ -154,7 +154,7 @@ log_to_file(Name, FileName, Timeout) ->
-spec statistics(Name, Flag) -> 'ok' | {'ok', Statistics} when
Name :: name(),
Flag :: 'true' | 'false' | 'get',
- Statistics :: [StatisticsTuple],
+ Statistics :: [StatisticsTuple] | no_statistics,
StatisticsTuple :: {'start_time', DateTime1}
| {'current_time', DateTime2}
| {'reductions', non_neg_integer()}
@@ -168,7 +168,7 @@ statistics(Name, Flag) ->
-spec statistics(Name, Flag, Timeout) -> 'ok' | {'ok', Statistics} when
Name :: name(),
Flag :: 'true' | 'false' | 'get',
- Statistics :: [StatisticsTuple],
+ Statistics :: [StatisticsTuple] | no_statistics,
StatisticsTuple :: {'start_time', DateTime1}
| {'current_time', DateTime2}
| {'reductions', non_neg_integer()}
diff --git a/lib/stdlib/src/timer.erl b/lib/stdlib/src/timer.erl
index e3d6c905b6..689e42051f 100644
--- a/lib/stdlib/src/timer.erl
+++ b/lib/stdlib/src/timer.erl
@@ -199,7 +199,7 @@ tc(M, F, A) ->
%% Calculate the time difference (in microseconds) of two
%% erlang:now() timestamps, T2-T1.
%%
--spec now_diff(T1, T2) -> Tdiff when
+-spec now_diff(T2, T1) -> Tdiff when
T1 :: erlang:timestamp(),
T2 :: erlang:timestamp(),
Tdiff :: integer().
diff --git a/lib/stdlib/src/zip.erl b/lib/stdlib/src/zip.erl
index 524d709431..c82c8159b6 100644
--- a/lib/stdlib/src/zip.erl
+++ b/lib/stdlib/src/zip.erl
@@ -223,7 +223,7 @@ openzip_open(F, Options) ->
do_openzip_open(F, Options) ->
Opts = get_openzip_options(Options),
#openzip_opts{output = Output, open_opts = OpO, cwd = CWD} = Opts,
- Input = get_zip_input(F),
+ Input = get_input(F),
In0 = Input({open, F, OpO -- [write]}, []),
{[#zip_comment{comment = C} | Files], In1} =
get_central_dir(In0, fun raw_file_info_etc/5, Input),
@@ -489,7 +489,7 @@ do_list_dir(F, Options) ->
%% Print zip directory in short form
-spec(t(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
t(F) when is_pid(F) -> zip_t(F);
@@ -513,7 +513,7 @@ do_t(F, RawPrint) ->
%% Print zip directory in long form (like ls -l)
-spec(tt(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
tt(F) when is_pid(F) -> zip_tt(F);
@@ -1174,7 +1174,7 @@ zip_get(Pid) when is_pid(Pid) ->
zip_close(Pid) when is_pid(Pid) ->
request(self(), Pid, close).
--spec(zip_get(FileName, ZipHandle) -> {ok, [Result]} | {error, Reason} when
+-spec(zip_get(FileName, ZipHandle) -> {ok, Result} | {error, Reason} when
FileName :: file:name(),
ZipHandle :: pid(),
Result :: file:name() | {file:name(), binary()},
@@ -1183,7 +1183,7 @@ zip_close(Pid) when is_pid(Pid) ->
zip_get(FileName, Pid) when is_pid(Pid) ->
request(self(), Pid, {get, FileName}).
--spec(zip_list_dir(ZipHandle) -> Result | {error, Reason} when
+-spec(zip_list_dir(ZipHandle) -> {ok, Result} | {error, Reason} when
Result :: [zip_comment() | zip_file()],
ZipHandle :: pid(),
Reason :: term()).
diff --git a/lib/stdlib/test/beam_lib_SUITE.erl b/lib/stdlib/test/beam_lib_SUITE.erl
index 4ccc863795..91fff3cee4 100644
--- a/lib/stdlib/test/beam_lib_SUITE.erl
+++ b/lib/stdlib/test/beam_lib_SUITE.erl
@@ -242,8 +242,8 @@ cmp(doc) -> ["Compare contents of BEAM files and directories"];
cmp(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, dir1),
- ?line Dir2 = filename:join(PrivDir, dir2),
+ ?line Dir1 = filename:join(PrivDir, "dir1"),
+ ?line Dir2 = filename:join(PrivDir, "dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -292,8 +292,8 @@ cmp_literals(doc) -> ["Compare contents of BEAM files having literals"];
cmp_literals(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, dir1),
- ?line Dir2 = filename:join(PrivDir, dir2),
+ ?line Dir1 = filename:join(PrivDir, "dir1"),
+ ?line Dir2 = filename:join(PrivDir, "dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -381,7 +381,7 @@ otp_6711(Conf) when is_list(Conf) ->
(catch {a, beam_lib:strip_files([3])}),
?line PrivDir = ?privdir,
- ?line Dir = filename:join(PrivDir, dir),
+ ?line Dir = filename:join(PrivDir, "dir"),
?line Lib = filename:join(Dir, "lib"),
?line App = filename:join(Lib, "app"),
?line EBin = filename:join(App, "ebin"),
@@ -417,8 +417,8 @@ building(doc) -> "Testing building of BEAM files.";
building(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, b_dir1),
- ?line Dir2 = filename:join(PrivDir, b_dir2),
+ ?line Dir1 = filename:join(PrivDir, "b_dir1"),
+ ?line Dir2 = filename:join(PrivDir, "b_dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -688,7 +688,7 @@ chunk_info(File) ->
Chunks.
make_beam(Dir, Module, F) ->
- ?line FileBase = filename:join(Dir, Module),
+ ?line FileBase = filename:join(Dir, atom_to_list(Module)),
?line Source = FileBase ++ ".erl",
?line BeamFile = FileBase ++ ".beam",
?line simple_file(Source, Module, F),
diff --git a/lib/stdlib/test/dets_SUITE.erl b/lib/stdlib/test/dets_SUITE.erl
index 698070368f..22a9d4a7ff 100644
--- a/lib/stdlib/test/dets_SUITE.erl
+++ b/lib/stdlib/test/dets_SUITE.erl
@@ -1516,7 +1516,7 @@ repair(Config, V) ->
if
V =:= 8 ->
%% first estimated number of objects is wrong, repair once more
- ?line {ok, Fd} = file:open(Fname, read_write),
+ ?line {ok, Fd} = file:open(Fname, [read,write]),
NoPos = HeadSize - 8, % no_objects
?line file:pwrite(Fd, NoPos, <<0:32>>), % NoItems
ok = file:close(Fd),
@@ -3247,7 +3247,7 @@ otp_5402(suite) ->
[];
otp_5402(Config) when is_list(Config) ->
Tab = otp_5402,
- ?line File = filename:join([cannot, write, this, file]),
+ ?line File = filename:join(["cannot", "write", "this", "file"]),
%% close
?line{ok, T} = dets:open_file(Tab, [{ram_file,true},
@@ -3887,7 +3887,7 @@ crash(File, Where) ->
crash(File, Where, 10).
crash(File, Where, What) when is_integer(What) ->
- ?line {ok, Fd} = file:open(File, read_write),
+ ?line {ok, Fd} = file:open(File, [read,write]),
?line file:position(Fd, Where),
?line ok = file:write(Fd, [What]),
?line ok = file:close(Fd).
@@ -4031,7 +4031,7 @@ writable(Fname) ->
?line file:write_file_info(Fname, Info#file_info{mode = Mode}).
truncate(File, Where) ->
- ?line {ok, Fd} = file:open(File, read_write),
+ ?line {ok, Fd} = file:open(File, [read,write]),
?line file:position(Fd, Where),
?line ok = file:truncate(Fd),
?line ok = file:close(Fd).
diff --git a/lib/stdlib/test/epp_SUITE.erl b/lib/stdlib/test/epp_SUITE.erl
index 9b024a5b49..57f3f4eddb 100644
--- a/lib/stdlib/test/epp_SUITE.erl
+++ b/lib/stdlib/test/epp_SUITE.erl
@@ -1280,7 +1280,7 @@ eval_tests(Config, Fun, Tests) ->
check_test(Config, Test) ->
- Filename = 'epp_test.erl',
+ Filename = "epp_test.erl",
?line PrivDir = ?config(priv_dir, Config),
?line File = filename:join(PrivDir, Filename),
?line ok = file:write_file(File, Test),
@@ -1293,7 +1293,7 @@ check_test(Config, Test) ->
compile_test(Config, Test0) ->
Test = [<<"-module(epp_test). -compile(export_all). ">>, Test0],
- Filename = 'epp_test.erl',
+ Filename = "epp_test.erl",
?line PrivDir = ?config(priv_dir, Config),
?line File = filename:join(PrivDir, Filename),
?line ok = file:write_file(File, Test),
diff --git a/lib/stdlib/test/erl_eval_SUITE.erl b/lib/stdlib/test/erl_eval_SUITE.erl
index 0bcf3c5b71..784c7cb86e 100644
--- a/lib/stdlib/test/erl_eval_SUITE.erl
+++ b/lib/stdlib/test/erl_eval_SUITE.erl
@@ -1189,7 +1189,7 @@ lfh() ->
{eval, fun(F, As, Bs) -> local_func(F, As, Bs) end}.
local_func(F, As0, Bs0) when is_atom(F) ->
- {As,Bs} = erl_eval:expr_list(As0, Bs0, {eval,lfh()}),
+ {As,Bs} = erl_eval:expr_list(As0, Bs0, lfh()),
case erlang:function_exported(?MODULE, F, length(As)) of
true ->
{value,apply(?MODULE, F, As),Bs};
diff --git a/lib/stdlib/test/erl_lint_SUITE.erl b/lib/stdlib/test/erl_lint_SUITE.erl
index f980d52e4e..9041adbe5c 100644
--- a/lib/stdlib/test/erl_lint_SUITE.erl
+++ b/lib/stdlib/test/erl_lint_SUITE.erl
@@ -2981,7 +2981,7 @@ run_test(Conf, Test0, Warnings0) ->
run_test2(Conf, Test, Warnings0).
run_test2(Conf, Test, Warnings0) ->
- Filename = 'lint_test.erl',
+ Filename = "lint_test.erl",
DataDir = ?privdir,
File = filename:join(DataDir, Filename),
Opts = case Warnings0 of
diff --git a/lib/stdlib/test/ets_SUITE.erl b/lib/stdlib/test/ets_SUITE.erl
index c9d82ec5f5..3ac6da3d28 100644
--- a/lib/stdlib/test/ets_SUITE.erl
+++ b/lib/stdlib/test/ets_SUITE.erl
@@ -72,6 +72,7 @@
exit_many_many_tables_owner/1]).
-export([write_concurrency/1, heir/1, give_away/1, setopts/1]).
-export([bad_table/1, types/1]).
+-export([otp_9423/1]).
-export([init_per_testcase/2, end_per_testcase/2]).
%% Convenience for manual testing
@@ -143,7 +144,8 @@ all() ->
otp_8166, exit_large_table_owner,
exit_many_large_table_owner, exit_many_tables_owner,
exit_many_many_tables_owner, write_concurrency, heir,
- give_away, setopts, bad_table, types].
+ give_away, setopts, bad_table, types,
+ otp_9423].
groups() ->
[{new, [],
@@ -2715,7 +2717,8 @@ ordered_do(Opts) ->
9,10,11,12,
1,2,3,4,
17,18,19,20,
- 13,14,15,16
+ 13,14,15,16,
+ 1 bsl 33
],
?line lists:foreach(fun(X) ->
ets:insert(T,{X,integer_to_list(X)})
@@ -2730,13 +2733,14 @@ ordered_do(Opts) ->
?line S2 = L2,
?line [{1,"1"}] = ets:slot(T,0),
?line [{28,"28"}] = ets:slot(T,27),
+ ?line [{1 bsl 33,_}] = ets:slot(T,28),
?line 27 = ets:prev(T,28),
?line [{7,"7"}] = ets:slot(T,6),
- ?line '$end_of_table' = ets:next(T,28),
+ ?line '$end_of_table' = ets:next(T,1 bsl 33),
?line [{12,"12"}] = ets:slot(T,11),
- ?line '$end_of_table' = ets:slot(T,28),
+ ?line '$end_of_table' = ets:slot(T,29),
?line [{1,"1"}] = ets:slot(T,0),
- ?line 28 = ets:prev(T,29),
+ ?line 28 = ets:prev(T,1 bsl 33),
?line 1 = ets:next(T,0),
?line pick_all_forward(T),
?line [{7,"7"}] = ets:slot(T,6),
@@ -5420,7 +5424,39 @@ types_do(Opts) ->
?line verify_etsmem(EtsMem).
-
+otp_9423(doc) -> ["vm-deadlock caused by race between ets:delete and others on write_concurrency table"];
+otp_9423(Config) when is_list(Config) ->
+ InitF = fun(_) -> {0,0} end,
+ ExecF = fun({S,F}) ->
+ receive
+ stop ->
+ io:format("~p got stop\n", [self()]),
+ [end_of_work | {"Succeded=",S,"Failed=",F}]
+ after 0 ->
+ %%io:format("~p (~p) doing lookup\n", [self(), {S,F}]),
+ try ets:lookup(otp_9423, key) of
+ [] -> {S+1,F}
+ catch
+ error:badarg -> {S,F+1}
+ end
+ end
+ end,
+ FiniF = fun(R) -> R end,
+ case run_workers(InitF, ExecF, FiniF, infinite, 1) of
+ Pids when is_list(Pids) ->
+ %%[P ! start || P <- Pids],
+ repeat(fun() -> ets:new(otp_9423, [named_table, public, {write_concurrency,true}]),
+ ets:delete(otp_9423)
+ end, 10000),
+ [P ! stop || P <- Pids],
+ wait_pids(Pids),
+ ok;
+
+ Skipped -> Skipped
+ end.
+
+
+
%
% Utility functions:
@@ -5434,21 +5470,30 @@ add_lists([E1|T1], [E2|T2], Acc) ->
add_lists(T1, T2, [E1+E2 | Acc]).
run_workers(InitF,ExecF,FiniF,Laps) ->
+ run_workers(InitF,ExecF,FiniF,Laps, 0).
+run_workers(InitF,ExecF,FiniF,Laps, Exclude) ->
case erlang:system_info(smp_support) of
true ->
- run_workers_do(InitF,ExecF,FiniF,Laps);
+ run_workers_do(InitF,ExecF,FiniF,Laps, Exclude);
false ->
{skipped,"No smp support"}
end.
-
+
run_workers_do(InitF,ExecF,FiniF,Laps) ->
- NumOfProcs = erlang:system_info(schedulers),
+ run_workers_do(InitF,ExecF,FiniF,Laps, 0).
+run_workers_do(InitF,ExecF,FiniF,Laps, Exclude) ->
+ ?line NumOfProcs = case erlang:system_info(schedulers) of
+ N when (N > Exclude) -> N - Exclude
+ end,
io:format("smp starting ~p workers\n",[NumOfProcs]),
Seeds = [{ProcN,random:uniform(9999)} || ProcN <- lists:seq(1,NumOfProcs)],
Parent = self(),
Pids = [spawn_link(fun()-> worker(Seed,InitF,ExecF,FiniF,Laps,Parent,NumOfProcs) end)
|| Seed <- Seeds],
- wait_pids(Pids).
+ case Laps of
+ infinite -> Pids;
+ _ -> wait_pids(Pids)
+ end.
worker({ProcN,Seed}, InitF, ExecF, FiniF, Laps, Parent, NumOfProcs) ->
io:format("smp worker ~p, seed=~p~n",[self(),Seed]),
@@ -5463,6 +5508,8 @@ worker_loop(0, _, State) ->
State;
worker_loop(_, _, [end_of_work|State]) ->
State;
+worker_loop(infinite, ExecF, State) ->
+ worker_loop(infinite,ExecF,ExecF(State));
worker_loop(N, ExecF, State) ->
worker_loop(N-1,ExecF,ExecF(State)).
diff --git a/lib/stdlib/test/file_sorter_SUITE.erl b/lib/stdlib/test/file_sorter_SUITE.erl
index 80d4ea5fdc..74c08912be 100644
--- a/lib/stdlib/test/file_sorter_SUITE.erl
+++ b/lib/stdlib/test/file_sorter_SUITE.erl
@@ -89,7 +89,7 @@ basic(suite) ->
basic(Config) when is_list(Config) ->
Fmt = binary,
Arg = {format,Fmt},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
P0 = pps(),
?line F1s = [F1] = to_files([[]], Fmt, Config),
@@ -455,7 +455,7 @@ inout(suite) ->
[];
inout(Config) when is_list(Config) ->
BTF = {format, binary_term},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is fun.
End = fun(read) -> end_of_input end,
@@ -522,7 +522,7 @@ many(doc) ->
many(suite) ->
[];
many(Config) when is_list(Config) ->
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
PrivDir = ?privdir(Config),
P0 = pps(),
@@ -587,7 +587,7 @@ misc(suite) ->
[];
misc(Config) when is_list(Config) ->
BTF = {format, binary_term},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
FFoo = filename:absname(Foo),
P0 = pps(),
@@ -704,7 +704,7 @@ misc(Config) when is_list(Config) ->
sort(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,5} | XArgs]),
TmpArgs = [{tmpdir,?privdir(Config)} | Args],
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is a fun. Output is a fun.
?line [] = file_sorter:sort(input([], 2, Fmt), output([], Fmt), Args),
@@ -777,7 +777,7 @@ sort(Fmt, XArgs, Config) ->
keysort(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,50}, {no_files, 2} | XArgs]),
TmpArgs = Args ++ [{tmpdir,?privdir(Config)}],
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is files. Output is a file.
?line ok = file_sorter:keysort(2, [], Foo, Args),
@@ -836,7 +836,7 @@ keysort(Fmt, XArgs, Config) ->
merge(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,5} | XArgs]),
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is a file. Output is a fun.
?line [] = file_sorter:merge([], output([], Fmt), Args),
@@ -873,7 +873,7 @@ merge(Fmt, XArgs, Config) ->
keymerge(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,50}, {no_files, 2} | XArgs]),
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is files. Output is a file.
?line ok = file_sorter:keymerge(2, [], Foo, Args),
diff --git a/lib/stdlib/test/filelib_SUITE.erl b/lib/stdlib/test/filelib_SUITE.erl
index a355097fe2..3010f5e760 100644
--- a/lib/stdlib/test/filelib_SUITE.erl
+++ b/lib/stdlib/test/filelib_SUITE.erl
@@ -243,7 +243,7 @@ otp_5960(doc) ->
["Test that filelib:ensure_dir/1 returns ok or {error,Reason}"];
otp_5960(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
- ?line Dir = filename:join(PrivDir, otp_5960_dir),
+ ?line Dir = filename:join(PrivDir, "otp_5960_dir"),
?line Name1 = filename:join(Dir, name1),
?line Name2 = filename:join(Dir, name2),
?line ok = filelib:ensure_dir(Name1), % parent is created
@@ -268,7 +268,7 @@ otp_5960(Config) when is_list(Config) ->
ensure_dir_eexist(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
- ?line Dir = filename:join(PrivDir, ensure_dir_eexist),
+ ?line Dir = filename:join(PrivDir, "ensure_dir_eexist"),
?line Name = filename:join(Dir, "same_name_as_file_and_dir"),
?line ok = filelib:ensure_dir(Name),
?line ok = file:write_file(Name, <<"some string\n">>),
diff --git a/lib/stdlib/test/io_SUITE.erl b/lib/stdlib/test/io_SUITE.erl
index 54a98985cd..bb02a879c2 100644
--- a/lib/stdlib/test/io_SUITE.erl
+++ b/lib/stdlib/test/io_SUITE.erl
@@ -27,7 +27,7 @@
otp_6282/1, otp_6354/1, otp_6495/1, otp_6517/1, otp_6502/1,
manpage/1, otp_6708/1, otp_7084/1, otp_7421/1,
io_lib_collect_line_3_wb/1, cr_whitespace_in_string/1,
- io_fread_newlines/1, otp_8989/1]).
+ io_fread_newlines/1, otp_8989/1, io_lib_fread_literal/1]).
%-define(debug, true).
@@ -62,7 +62,7 @@ all() ->
otp_6282, otp_6354, otp_6495, otp_6517, otp_6502,
manpage, otp_6708, otp_7084, otp_7421,
io_lib_collect_line_3_wb, cr_whitespace_in_string,
- io_fread_newlines, otp_8989].
+ io_fread_newlines, otp_8989, io_lib_fread_literal].
groups() ->
[].
@@ -1995,3 +1995,29 @@ otp_8989(Suite) when is_list(Suite) ->
?line "Hel " = fmt("~-4.*s", [3,Hello]),
?line "Hel " = fmt("~*.*s", [-4,3,Hello]),
ok.
+
+io_lib_fread_literal(doc) ->
+ "OTP-9439 io_lib:fread bug for literate at end";
+io_lib_fread_literal(Suite) when is_list(Suite) ->
+ ?line {more,"~d",0,""} = io_lib:fread("~d", ""),
+ ?line {error,{fread,integer}} = io_lib:fread("~d", " "),
+ ?line {more,"~d",1,""} = io_lib:fread(" ~d", " "),
+ ?line {ok,[17],"X"} = io_lib:fread(" ~d", " 17X"),
+ %%
+ ?line {more,"d",0,""} = io_lib:fread("d", ""),
+ ?line {error,{fread,input}} = io_lib:fread("d", " "),
+ ?line {more,"d",1,""} = io_lib:fread(" d", " "),
+ ?line {ok,[],"X"} = io_lib:fread(" d", " dX"),
+ %%
+ ?line {done,eof,_} = io_lib:fread([], eof, "~d"),
+ ?line {done,eof,_} = io_lib:fread([], eof, " ~d"),
+ ?line {more,C1} = io_lib:fread([], " \n", " ~d"),
+ ?line {done,{error,{fread,input}},_} = io_lib:fread(C1, eof, " ~d"),
+ ?line {done,{ok,[18]},""} = io_lib:fread(C1, "18\n", " ~d"),
+ %%
+ ?line {done,eof,_} = io_lib:fread([], eof, "d"),
+ ?line {done,eof,_} = io_lib:fread([], eof, " d"),
+ ?line {more,C2} = io_lib:fread([], " \n", " d"),
+ ?line {done,{error,{fread,input}},_} = io_lib:fread(C2, eof, " d"),
+ ?line {done,{ok,[]},[]} = io_lib:fread(C2, "d\n", " d"),
+ ok.
diff --git a/lib/stdlib/test/string_SUITE.erl b/lib/stdlib/test/string_SUITE.erl
index 1dcd4be21e..6969c095a0 100644
--- a/lib/stdlib/test/string_SUITE.erl
+++ b/lib/stdlib/test/string_SUITE.erl
@@ -273,9 +273,9 @@ words(Config) when is_list(Config) ->
?line 2 = string:words("2.35", $.),
?line 100 = string:words(string:copies(". ", 100)),
%% invalid arg type
- ?line {'EXIT',_} = (catch string:chars(hej)),
+ ?line {'EXIT',_} = (catch string:chars(hej, 1)),
%% invalid arg type
- ?line {'EXIT',_} = (catch string:chars("hej", " ")),
+ ?line {'EXIT',_} = (catch string:chars("hej", 1, " ")),
ok.
diff --git a/lib/stdlib/test/supervisor_SUITE.erl b/lib/stdlib/test/supervisor_SUITE.erl
index ff5e4c629a..b48450c151 100644
--- a/lib/stdlib/test/supervisor_SUITE.erl
+++ b/lib/stdlib/test/supervisor_SUITE.erl
@@ -42,7 +42,7 @@
-export([ permanent_normal/1, transient_normal/1,
temporary_normal/1,
permanent_abnormal/1, transient_abnormal/1,
- temporary_abnormal/1]).
+ temporary_abnormal/1, temporary_bystander/1]).
%% Restart strategy tests
-export([ one_for_one/1,
@@ -74,7 +74,7 @@ all() ->
{group, abnormal_termination}, child_unlink, tree,
count_children_memory, do_not_save_start_parameters_for_temporary_children,
do_not_save_child_specs_for_temporary_children,
- simple_one_for_one_scale_many_temporary_children].
+ simple_one_for_one_scale_many_temporary_children, temporary_bystander].
groups() ->
[{sup_start, [],
@@ -607,6 +607,37 @@ temporary_abnormal(Config) when is_list(Config) ->
[0,0,0,0] = get_child_counts(sup_test).
%%-------------------------------------------------------------------------
+temporary_bystander(doc) ->
+ ["A temporary process killed as part of a rest_for_one or one_for_all "
+ "restart strategy should not be restarted given its args are not "
+ " saved. Otherwise the supervisor hits its limit and crashes."];
+temporary_bystander(suite) -> [];
+temporary_bystander(_Config) ->
+ Child1 = {child1, {supervisor_1, start_child, []}, permanent, 100,
+ worker, []},
+ Child2 = {child2, {supervisor_1, start_child, []}, temporary, 100,
+ worker, []},
+ {ok, SupPid1} = supervisor:start_link(?MODULE, {ok, {{one_for_all, 2, 300}, []}}),
+ {ok, SupPid2} = supervisor:start_link(?MODULE, {ok, {{rest_for_one, 2, 300}, []}}),
+ unlink(SupPid1), % otherwise we crash with it
+ unlink(SupPid2), % otherwise we crash with it
+ {ok, CPid1} = supervisor:start_child(SupPid1, Child1),
+ {ok, _CPid2} = supervisor:start_child(SupPid1, Child2),
+ {ok, CPid3} = supervisor:start_child(SupPid2, Child1),
+ {ok, _CPid4} = supervisor:start_child(SupPid2, Child2),
+ terminate(SupPid1, CPid1, child1, normal),
+ terminate(SupPid2, CPid3, child1, normal),
+ timer:sleep(350),
+ catch link(SupPid1),
+ catch link(SupPid2),
+ %% The supervisor would die attempting to restart child2
+ true = erlang:is_process_alive(SupPid1),
+ true = erlang:is_process_alive(SupPid2),
+ %% Child2 has not been restarted
+ [{child1, _, _, _}] = supervisor:which_children(SupPid1),
+ [{child1, _, _, _}] = supervisor:which_children(SupPid2).
+
+%%-------------------------------------------------------------------------
one_for_one(doc) ->
["Test the one_for_one base case."];
one_for_one(suite) -> [];
diff --git a/lib/stdlib/test/supervisor_bridge_SUITE.erl b/lib/stdlib/test/supervisor_bridge_SUITE.erl
index f2dbad0b3b..c4d696564d 100644
--- a/lib/stdlib/test/supervisor_bridge_SUITE.erl
+++ b/lib/stdlib/test/supervisor_bridge_SUITE.erl
@@ -158,7 +158,7 @@ internal_loop(State) ->
terminate(Reason,{Parent,Worker}) ->
%% This func knows about supervisor_bridge
io:format("Terminating bridge...\n"),
- exit(kill,Worker),
+ exit(Worker,kill),
Parent ! {dying,Reason},
anything.
diff --git a/lib/stdlib/test/sys_SUITE.erl b/lib/stdlib/test/sys_SUITE.erl
index 72b089aa3f..fe039e8bcc 100644
--- a/lib/stdlib/test/sys_SUITE.erl
+++ b/lib/stdlib/test/sys_SUITE.erl
@@ -71,7 +71,7 @@ log_to_file(Config) when is_list(Config) ->
?line ok = sys:log_to_file(?server,TempName),
?line {ok,-44} = public_call(44),
?line ok = sys:log_to_file(?server,false),
- ?line {ok,Fd} = file:open(TempName,read),
+ ?line {ok,Fd} = file:open(TempName,[read]),
?line Msg1 = io:get_line(Fd,''),
?line Msg2 = io:get_line(Fd,''),
?line file:close(Fd),
diff --git a/lib/stdlib/test/tar_SUITE.erl b/lib/stdlib/test/tar_SUITE.erl
index e32704ca65..48f58cd05d 100644
--- a/lib/stdlib/test/tar_SUITE.erl
+++ b/lib/stdlib/test/tar_SUITE.erl
@@ -65,7 +65,7 @@ borderline(Config) when is_list(Config) ->
?line {ok, Cwd} = file:get_cwd(),
?line RootDir = ?config(priv_dir, Config),
- ?line TempDir = remove_prefix(Cwd++"/", filename:join(RootDir, borderline)),
+ ?line TempDir = remove_prefix(Cwd++"/", filename:join(RootDir, "borderline")),
?line ok = file:make_dir(TempDir),
?line Record = 512,
@@ -323,12 +323,12 @@ create_long_names(doc) ->
create_long_names(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
?line ok = file:set_cwd(PrivDir),
- Dirs = [aslfjkshjkhliuf,
- asdhjfehnbfsky,
- sahajfskdfhsz,
- asldfkdlfy4y8rchg,
- f7nafhjgffagkhsfkhsjk,
- dfjasldkfjsdkfjashbv],
+ Dirs = ["aslfjkshjkhliuf",
+ "asdhjfehnbfsky",
+ "sahajfskdfhsz",
+ "asldfkdlfy4y8rchg",
+ "f7nafhjgffagkhsfkhsjk",
+ "dfjasldkfjsdkfjashbv"],
?line DeepDir = make_dirs(Dirs, []),
?line AFile = filename:join(DeepDir, "a_file"),
@@ -487,7 +487,7 @@ extract_from_binary_compressed(Config) when is_list(Config) ->
%% Trying extracting from a binary.
?line ok = erl_tar:extract({binary,Bin}, [compressed,{cwd,ExtractDir}]),
- ?line {ok,List} = file:list_dir(filename:join(ExtractDir, ddll_SUITE_data)),
+ ?line {ok,List} = file:list_dir(filename:join(ExtractDir, "ddll_SUITE_data")),
?line io:format("~p\n", [List]),
?line 19 = length(List),
@@ -676,7 +676,7 @@ cooked_compressed(Config) when is_list(Config) ->
end, List),
%% Clean up.
- ?line delete_files([filename:join(PrivDir, ddll_SUITE_data)]),
+ ?line delete_files([filename:join(PrivDir, "ddll_SUITE_data")]),
ok.
memory(doc) ->
diff --git a/lib/stdlib/test/zip_SUITE.erl b/lib/stdlib/test/zip_SUITE.erl
index d5f2cd52d4..7233c061ef 100644
--- a/lib/stdlib/test/zip_SUITE.erl
+++ b/lib/stdlib/test/zip_SUITE.erl
@@ -375,7 +375,8 @@ zip_options(Config) when is_list(Config) ->
ok = file:set_cwd(?config(data_dir, Config)),
%% Create a zip archive
- {ok, Zip} = zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
+ {ok, {_,Zip}} =
+ zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
%% Open archive
{ok, ZipSrv} = zip:zip_open(Zip, [memory]),
diff --git a/lib/test_server/src/ts_install_cth.erl b/lib/test_server/src/ts_install_cth.erl
index c5444a342f..a41916fd0a 100644
--- a/lib/test_server/src/ts_install_cth.erl
+++ b/lib/test_server/src/ts_install_cth.erl
@@ -49,8 +49,7 @@
-include_lib("kernel/include/file.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -65,19 +64,19 @@ id(_Opts) ->
?MODULE.
%% @doc Always called before any other callback function.
--spec init(Id :: term(), Opts :: proplist()) ->
- State :: #state{}.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
init(_Id, Opts) ->
Nodenames = proplists:get_value(nodenames, Opts, 0),
Nodes = proplists:get_value(nodes, Opts, 0),
TSConfDir = proplists:get_value(ts_conf_dir, Opts),
TargetSystem = proplists:get_value(target_system, Opts, install_local),
InstallOpts = proplists:get_value(install_opts, Opts, []),
- #state{ nodenames = Nodenames,
- nodes = Nodes,
- ts_conf_dir = TSConfDir,
- target_system = TargetSystem,
- install_opts = InstallOpts }.
+ {ok, #state{ nodenames = Nodenames,
+ nodes = Nodes,
+ ts_conf_dir = TSConfDir,
+ target_system = TargetSystem,
+ install_opts = InstallOpts } }.
%% @doc Called before init_per_suite is called.
-spec pre_init_per_suite(Suite :: atom(),
diff --git a/lib/test_server/test/Makefile b/lib/test_server/test/Makefile
index ab72a9d579..198440bb17 100644
--- a/lib/test_server/test/Makefile
+++ b/lib/test_server/test/Makefile
@@ -85,7 +85,7 @@ release_spec: opt
release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(EMAKEFILE) $(ERL_FILES) $(COVERFILE) $(RELSYSDIR)
- $(INSTALL_DATA) test_server.spec test_server.cover $(RELSYSDIR)
+ $(INSTALL_DATA) test_server_test_lib.hrl test_server.spec test_server.cover $(RELSYSDIR)
chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
diff --git a/lib/tools/emacs/erlang.el b/lib/tools/emacs/erlang.el
index 6728bef2a4..a8dd3ec3ac 100644
--- a/lib/tools/emacs/erlang.el
+++ b/lib/tools/emacs/erlang.el
@@ -523,6 +523,32 @@ This is an elisp list of options. Each option can be either:
- a string
Example: '(bin_opt_info (i . \"/path1/include\") (i . \"/path2/include\"))")
+(defvar erlang-compile-command-function-alist
+ '((".erl\\'" . inferior-erlang-compute-erl-compile-command)
+ (".xrl\\'" . inferior-erlang-compute-leex-compile-command)
+ (".yrl\\'" . inferior-erlang-compute-yecc-compile-command)
+ ("." . inferior-erlang-compute-erl-compile-command))
+ "*Alist of filename patterns vs corresponding compilation functions.
+Each element looks like (REGEXP . FUNCTION). Compiling a file whose name
+matches REGEXP specifies FUNCTION to use to compute the compilation
+command. The FUNCTION will be called with two arguments: module name and
+default compilation options, like output directory. The FUNCTION
+is expected to return a string.")
+
+(defvar erlang-leex-compile-opts '()
+ "*Options to pass to leex when compiling xrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
+(defvar erlang-yecc-compile-opts '()
+ "*Options to pass to yecc when compiling yrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
(eval-and-compile
(defvar erlang-regexp-modern-p
(if (> erlang-emacs-major-version 21) t nil)
@@ -5276,6 +5302,22 @@ unless the optional NO-DISPLAY is non-nil."
(file-name-as-directory buffer-dir))))
(defun inferior-erlang-compute-compile-command (module-name opts)
+ (let ((ccfn erlang-compile-command-function-alist)
+ (res (inferior-erlang-compute-erl-compile-command module-name opts))
+ ccfn-entry
+ done)
+ (if (not (null (buffer-file-name)))
+ (while (and (not done) (not (null ccfn)))
+ (setq ccfn-entry (car ccfn))
+ (setq ccfn (cdr ccfn))
+ (if (string-match (car ccfn-entry) (buffer-file-name))
+ (let ((c-fn (cdr ccfn-entry)))
+ (setq done t)
+ (if (not (null c-fn))
+ (setq result (funcall c-fn module-name opts)))))))
+ result))
+
+(defun inferior-erlang-compute-erl-compile-command (module-name opts)
(let* ((out-dir-opt (assoc 'outdir opts))
(out-dir (cdr out-dir-opt)))
(if erlang-compile-use-outdir
@@ -5299,6 +5341,48 @@ unless the optional NO-DISPLAY is non-nil."
(remq out-dir-opt opts))
tmpvar tmpvar tmpvar2)))))
+(defun inferior-erlang-compute-leex-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(LErr1__), f(LErr2__), "
+ "case case leex:file(\"%s\", [%s]) of"
+ " ok -> ok;"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " LErr1__ -> LErr1__ "
+ "end of"
+ " ok -> %s;"
+ " LErr2__ -> LErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-leex-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-compute-yecc-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(YErr1__), f(YErr2__), "
+ "case case yecc:file(\"%s\", [%s]) of"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " YErr1__ -> YErr1__ "
+ "end of"
+ " ok -> %s;"
+ " YErr2__ -> YErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-yecc-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-remove-any-trailing-dot (str)
+ (if (string= (substring str -1) ".")
+ (substring str 0 (1- (length str)))
+ str))
+
(defun inferior-erlang-format-comma-opts (opts)
(if (null opts)
""
diff --git a/lib/webtool/priv/Makefile b/lib/webtool/priv/Makefile
index 56ab772c45..6e1c6606fe 100644
--- a/lib/webtool/priv/Makefile
+++ b/lib/webtool/priv/Makefile
@@ -39,8 +39,12 @@ HTDOCS_FILES = root/doc/index.html \
root/doc/tool_management.html \
root/doc/start_info.html
-SCRIPTS = bin/start_webtool \
- bin/start_webtool.bat
+ifeq ($(findstring win32,$(TARGET)),win32)
+WIN32_SCRIPTS= bin/start_webtool.bat
+else
+WIN32_SCRIPTS=
+endif
+SCRIPTS = bin/start_webtool $(WIN32_SCRIPTS)
# ----------------------------------------------------
# FLAGS
diff --git a/lib/wx/test/wxt.erl b/lib/wx/test/wxt.erl
index 1f5b1cc3b1..2f52c58f26 100644
--- a/lib/wx/test/wxt.erl
+++ b/lib/wx/test/wxt.erl
@@ -72,7 +72,7 @@ resolve({Suite0, Case}) when is_atom(Suite0), is_atom(Case) ->
{Suite, Case2} ->
{Suite, Case2}
end;
-resolve(List) when list(List) ->
+resolve(List) when is_list(List) ->
[resolve(Case) || Case <- List].
alias(Suite) when is_atom(Suite) ->
@@ -104,7 +104,7 @@ read_config() ->
end.
%% Write new default config file
-write_config(Config) when list(Config) ->
+write_config(Config) when is_list(Config) ->
Fname = config_fname(),
{ok, Fd} = file:open(Fname, write),
write_list(Fd, Config),
diff --git a/lib/xmerl/include/xmerl_xsd.hrl b/lib/xmerl/include/xmerl_xsd.hrl
index b527accc8c..6dad7d8ff0 100644
--- a/lib/xmerl/include/xmerl_xsd.hrl
+++ b/lib/xmerl/include/xmerl_xsd.hrl
@@ -36,6 +36,7 @@
schema_name,
vsn,
schema_preprocessed=false,
+ external_xsd_base=false,
xsd_base,
xml_options=[],
scope=[],
diff --git a/lib/xmerl/src/xmerl_scan.erl b/lib/xmerl/src/xmerl_scan.erl
index 059c8f21b6..e598c5f56d 100644
--- a/lib/xmerl/src/xmerl_scan.erl
+++ b/lib/xmerl/src/xmerl_scan.erl
@@ -2276,7 +2276,7 @@ scan_att_chars([H|T], S0, H, Acc, TmpAcc,AttType,IsNorm) -> % End quote
true ->
normalize(Acc,S,IsNorm)
end,
- {lists:reverse(Acc2), T, S2,IsNorm2};
+ {lists:flatten(lists:reverse(Acc2)), T, S2,IsNorm2};
scan_att_chars("&" ++ T, S0, Delim, Acc, TmpAcc,AT,IsNorm) -> % Reference
?bump_col(1),
{ExpRef, T1, S1} = scan_reference(T, S),
diff --git a/lib/xmerl/src/xmerl_xsd.erl b/lib/xmerl/src/xmerl_xsd.erl
index e56f1470c0..f003cc74ba 100644
--- a/lib/xmerl/src/xmerl_xsd.erl
+++ b/lib/xmerl/src/xmerl_xsd.erl
@@ -287,10 +287,19 @@ process_schema(Schema) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schema(Schema,Options) when is_list(Options) ->
- S = initiate_state(Options,Schema),
- process_schema2(xmerl_scan:file(filename:join(S#xsd_state.xsd_base, Schema)),S,Schema);
-process_schema(Schema,State) when is_record(State,xsd_state) ->
- process_schema2(xmerl_scan:file(filename:join(State#xsd_state.xsd_base, Schema)),State,Schema).
+ State = initiate_state(Options,Schema),
+ process_schema(Schema, State);
+process_schema(Schema, State=#xsd_state{fetch_fun=Fetch})->
+ case Fetch(Schema, State) of
+ {ok,{file,File},_} ->
+ process_schema2(xmerl_scan:file(File), State, Schema);
+ {ok,{string,Str},_} ->
+ process_schema2(xmerl_scan:string(Str), State, Schema);
+ {ok,[],_} ->
+ {error,enoent};
+ Err ->
+ Err
+ end.
process_schema2(Err={error,_},_,_) ->
Err;
@@ -319,12 +328,9 @@ process_schemas(Schemas) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schemas(Schemas=[{_,Schema}|_],Options) when is_list(Options) ->
- process_schemas(Schemas,initiate_state(Options,Schema));
+ State = initiate_state(Options,Schema),
+ process_schemas(Schemas, State);
process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
-%% case process_external_schema_once(Schema,if_list_to_atom(NS),State) of
-%% S when is_record(S,xsd_state) ->
-%% case process_schema(filename:join([State#xsd_state.xsd_base,Schema]),State) of
-%% {ok,S} ->
Res=
case Fetch(Schema,State) of
{ok,{file,File},_} ->
@@ -345,20 +351,20 @@ process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
process_schemas([],S) when is_record(S,xsd_state) ->
{ok,S}.
-
initiate_state(Opts,Schema) ->
XSDBase = filename:dirname(Schema),
{{state,S},RestOpts}=new_state(Opts),
S2 = create_tables(S),
- initiate_state2(S2#xsd_state{schema_name = Schema,
- xsd_base = XSDBase,
- fetch_fun = fun fetch/2},RestOpts).
+ S3 = initiate_state2(S2#xsd_state{schema_name = Schema, xsd_base=XSDBase,
+ fetch_fun = fun fetch/2},
+ RestOpts).
+
initiate_state2(S,[]) ->
S;
initiate_state2(S,[{tab2file,Bool}|T]) ->
initiate_state2(S#xsd_state{tab2file=Bool},T);
-initiate_state2(S,[{xsdbase,XSDBase}|T]) ->
- initiate_state2(S#xsd_state{xsd_base=XSDBase},T);
+initiate_state2(S,[{xsdbase, XSDBase}|T]) ->
+ initiate_state2(S#xsd_state{xsd_base=XSDBase, external_xsd_base=true},T);
initiate_state2(S,[{fetch_fun,FetchFun}|T]) ->
initiate_state2(S#xsd_state{fetch_fun=FetchFun},T);
initiate_state2(S,[{fetch_path,FetchPath}|T]) ->
@@ -5232,7 +5238,12 @@ fetch(URI,S) ->
[] -> %% empty systemliteral
[];
_ ->
- filename:join(S#xsd_state.xsd_base, URI)
+ case S#xsd_state.external_xsd_base of
+ true ->
+ filename:join(S#xsd_state.xsd_base, URI);
+ false ->
+ filename:join(S#xsd_state.xsd_base, filename:basename(URI))
+ end
end,
Path = path_locate(S#xsd_state.fetch_path, Filename, Fullname),
?dbg("fetch(~p) -> {file, ~p}.~n", [URI, Path]),
diff --git a/lib/xmerl/test/Makefile b/lib/xmerl/test/Makefile
index 9715aa054a..5a2a585841 100644
--- a/lib/xmerl/test/Makefile
+++ b/lib/xmerl/test/Makefile
@@ -124,4 +124,4 @@ release_tests_spec: opt
@tar cfh - xmerl_xsd_MS2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_NIST2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_Sun2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/xmerl/test/xmerl_SUITE.erl b/lib/xmerl/test/xmerl_SUITE.erl
index 392b2522e8..0c809dbcb6 100644
--- a/lib/xmerl/test/xmerl_SUITE.erl
+++ b/lib/xmerl/test/xmerl_SUITE.erl
@@ -57,7 +57,8 @@ groups() ->
{eventp_tests, [], [sax_parse_and_export]},
{ticket_tests, [],
[ticket_5998, ticket_7211, ticket_7214, ticket_7430,
- ticket_6873, ticket_7496, ticket_8156, ticket_8697]},
+ ticket_6873, ticket_7496, ticket_8156, ticket_8697,
+ ticket_9411]},
{app_test, [], [{xmerl_app_test, all}]},
{appup_test, [], [{xmerl_appup_test, all}]}].
@@ -575,7 +576,17 @@ ticket_8697(Config) ->
?line [16#545C] = HexEntityText,
ok.
+ticket_9411(suite) -> [];
+ticket_9411(doc) ->
+ ["Test that xmerl_scan handles attribute that contains for example &quot"];
+ticket_9411(Config) ->
+ DataDir = ?config(data_dir,Config),
+ ?line {ok, Schema} = xmerl_xsd:process_schema(filename:join([DataDir,"misc/ticket_9411.xsd"])),
+ ?line {ok, Bin} = file:read_file(filename:join([DataDir,"misc/ticket_9411.xml"])),
+ ?line Xml = erlang:binary_to_list(Bin),
+ ?line {E, _} = xmerl_scan:string(Xml),
+ ?line {E, _} = xmerl_xsd:validate(E, Schema).
diff --git a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
index c48a6f897b..fef7431845 100644
--- a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
+++ b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
Binary files differ
diff --git a/lib/xmerl/test/xmerl_xsd_SUITE.erl b/lib/xmerl/test/xmerl_xsd_SUITE.erl
index a0d3b1e667..421fa48054 100644
--- a/lib/xmerl/test/xmerl_xsd_SUITE.erl
+++ b/lib/xmerl/test/xmerl_xsd_SUITE.erl
@@ -62,7 +62,7 @@ groups() ->
sis2, state2file_file2state, union]},
{ticket_tests, [],
[ticket_6910, ticket_7165, ticket_7190, ticket_7288,
- ticket_7736, ticket_8599]},
+ ticket_7736, ticket_8599, ticket_9410]},
{facets, [],
[length, minLength, maxLength, pattern, enumeration,
whiteSpace, maxInclusive, maxExclusive, minExclusive,
@@ -1146,3 +1146,8 @@ ticket_8599(Config) ->
?line {{xmlElement,persons,persons,_,_,_,_,_,_,_,_,_},_GlobalState} = xmerl_xsd:validate(E, S).
+
+ticket_9410(suite) -> [];
+ticket_9410(Config) ->
+ file:set_cwd(filename:join([?config(data_dir,Config),".."])),
+ ?line {ok, _S} = xmerl_xsd:process_schema("xmerl_xsd_SUITE_data/small.xsd").
diff --git a/system/doc/reference_manual/distributed.xml b/system/doc/reference_manual/distributed.xml
index 52222c6d9d..9c8e88250c 100644
--- a/system/doc/reference_manual/distributed.xml
+++ b/system/doc/reference_manual/distributed.xml
@@ -78,7 +78,7 @@ dilbert@uab</pre>
using the command line flag <c>-connect_all false</c>, see
<c>erl(1)</c>.</p>
<p>If a node goes down, all connections to that node are removed.
- Calling <c>erlang:disconnect(Node)</c> will force disconnection
+ Calling <c>erlang:disconnect_node(Node)</c> will force disconnection
of a node.</p>
<p>The list of (visible) nodes currently connected to is returned by
<c>nodes()</c>.</p>