aboutsummaryrefslogtreecommitdiffstats
path: root/lib/common_test
diff options
context:
space:
mode:
Diffstat (limited to 'lib/common_test')
-rw-r--r--lib/common_test/doc/src/common_test_app.xml11
-rw-r--r--lib/common_test/doc/src/cover_chapter.xml112
-rw-r--r--lib/common_test/doc/src/ct_hooks_chapter.xml43
-rw-r--r--lib/common_test/doc/src/ct_run.xml3
-rw-r--r--lib/common_test/doc/src/notes.xml278
-rw-r--r--lib/common_test/doc/src/run_test_chapter.xml816
-rw-r--r--lib/common_test/doc/src/write_test_chapter.xml52
-rw-r--r--lib/common_test/priv/Makefile.in6
-rw-r--r--lib/common_test/src/Makefile8
-rw-r--r--lib/common_test/src/ct.erl13
-rw-r--r--lib/common_test/src/ct_config.erl13
-rw-r--r--lib/common_test/src/ct_config_plain.erl4
-rw-r--r--lib/common_test/src/ct_conn_log_h.erl33
-rw-r--r--lib/common_test/src/ct_cover.erl32
-rw-r--r--lib/common_test/src/ct_event.erl4
-rw-r--r--lib/common_test/src/ct_framework.erl33
-rw-r--r--lib/common_test/src/ct_gen_conn.erl4
-rw-r--r--lib/common_test/src/ct_groups.erl4
-rw-r--r--lib/common_test/src/ct_hooks.erl6
-rw-r--r--lib/common_test/src/ct_logs.erl145
-rw-r--r--lib/common_test/src/ct_make.erl8
-rw-r--r--lib/common_test/src/ct_master.erl190
-rw-r--r--lib/common_test/src/ct_master_event.erl6
-rw-r--r--lib/common_test/src/ct_master_logs.erl63
-rw-r--r--lib/common_test/src/ct_master_status.erl4
-rw-r--r--lib/common_test/src/ct_netconfc.erl48
-rw-r--r--lib/common_test/src/ct_run.erl587
-rw-r--r--lib/common_test/src/ct_slave.erl67
-rw-r--r--lib/common_test/src/ct_snmp.erl335
-rw-r--r--lib/common_test/src/ct_telnet.erl32
-rw-r--r--lib/common_test/src/ct_telnet_client.erl4
-rw-r--r--lib/common_test/src/ct_testspec.erl373
-rw-r--r--lib/common_test/src/ct_util.erl10
-rw-r--r--lib/common_test/src/ct_util.hrl1
-rw-r--r--lib/common_test/src/cth_conn_log.erl9
-rw-r--r--lib/common_test/src/cth_log_redirect.erl2
-rw-r--r--lib/common_test/src/cth_surefire.erl185
-rw-r--r--lib/common_test/src/unix_telnet.erl4
-rw-r--r--lib/common_test/test/Makefile10
-rw-r--r--lib/common_test/test/common_test.cover10
-rw-r--r--lib/common_test/test/ct_config_info_SUITE.erl14
-rw-r--r--lib/common_test/test/ct_cover_SUITE.erl312
-rw-r--r--lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl156
-rw-r--r--lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore0
-rw-r--r--lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl4
-rw-r--r--lib/common_test/test/ct_error_SUITE.erl509
-rw-r--r--lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl175
-rw-r--r--lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl12
-rw-r--r--lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl258
-rw-r--r--lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl239
-rw-r--r--lib/common_test/test/ct_group_leader_SUITE.erl181
-rw-r--r--lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl252
-rw-r--r--lib/common_test/test/ct_hooks_SUITE.erl2
-rw-r--r--lib/common_test/test/ct_master_SUITE.erl74
-rw-r--r--lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl11
-rw-r--r--lib/common_test/test/ct_netconfc_SUITE.erl5
-rw-r--r--lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl7
-rw-r--r--lib/common_test/test/ct_netconfc_SUITE_data/ns.erl21
-rw-r--r--lib/common_test/test/ct_snmp_SUITE.erl141
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg44
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl395
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf7
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf2
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf6
-rw-r--r--lib/common_test/test/ct_surefire_SUITE.erl374
-rw-r--r--lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl92
-rw-r--r--lib/common_test/test/ct_system_error_SUITE.erl132
-rw-r--r--lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl122
-rw-r--r--lib/common_test/test/ct_test_support.erl102
-rw-r--r--lib/common_test/test/ct_testspec_1_SUITE.erl108
-rw-r--r--lib/common_test/test/ct_testspec_2_SUITE.erl41
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE.erl745
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg111
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg121
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg131
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg211
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec14
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join12
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep15
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep12
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join12
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both12
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join16
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join11
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep13
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both24
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join29
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep25
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl175
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl175
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl174
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl177
-rw-r--r--lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl158
-rw-r--r--lib/common_test/vsn.mk2
105 files changed, 7645 insertions, 1411 deletions
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml
index b6d4a633cb..151159ad69 100644
--- a/lib/common_test/doc/src/common_test_app.xml
+++ b/lib/common_test/doc/src/common_test_app.xml
@@ -4,7 +4,7 @@
<erlref>
<header>
<copyright>
- <year>2003</year><year>2012</year>
+ <year>2003</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -170,7 +170,9 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v>
+ <v> CTHs = [CTHModule |</v>
+ <v>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs} |</v>
+ <v>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
@@ -297,8 +299,9 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} |
- {CTHModule, CTHInitArgs, CTHPriority}]</v>
+ <v> CTHs = [CTHModule |</v>
+ <v> &nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs} |</v>
+ <v> &nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
diff --git a/lib/common_test/doc/src/cover_chapter.xml b/lib/common_test/doc/src/cover_chapter.xml
index 803a71de07..4fa92d5583 100644
--- a/lib/common_test/doc/src/cover_chapter.xml
+++ b/lib/common_test/doc/src/cover_chapter.xml
@@ -108,6 +108,33 @@
specifications</seealso>).</p>
</section>
+ <marker id="cover_stop"></marker>
+ <section>
+ <title>Stopping the cover tool when tests are completed</title>
+ <p>By default the Cover tool is automatically stopped when the
+ tests are completed. This causes the original (non cover
+ compiled) modules to be loaded back in to the test node. If a
+ process at this point is still running old code of any of the
+ modules that are cover compiled, meaning that it has not done
+ any fully qualified function call after the cover compilation,
+ the process will now be killed. To avoid this it is possible to
+ set the value of the <c>cover_stop</c> option to
+ <c>false</c>. This means that the modules will stay cover
+ compiled, and it is therefore only recommended if the erlang
+ node(s) under test is terminated after the test is completed
+ or if cover can be manually stopped.</p>
+
+ <p>The option can be set by using the <c>-cover_stop</c> flag with
+ <c>ct_run</c>, by adding <c>{cover_stop,true|false}</c> to the
+ Opts argument to <c><seealso
+ marker="ct#run_test-1">ct:run_test/1</seealso></c>, or by adding
+ a <c>cover_stop</c> term in your test specification (see chapter
+ about <seealso
+ marker="run_test_chapter#test_specifications">test
+ specifications</seealso>).</p>
+
+ </section>
+
<section>
<title>The cover specification file</title>
<p>These are the terms allowed in a cover specification file:</p>
@@ -148,6 +175,11 @@
%% Specific modules to exclude in cover.
{excl_mods, Mods}.
+
+ %% Cross cover compilation
+ %% Tag = atom(), an identifier for a test run
+ %% Mod = [atom()], modules to compile for accumulated analysis
+ {cross,[{Tag,Mods}]}.
</pre>
<p>The <c>incl_dirs_r</c> and <c>excl_dirs_r</c> terms tell Common
@@ -163,6 +195,81 @@
specification file for Common Test).</p>
</section>
+ <marker id="cross_cover"/>
+ <section>
+ <title>Cross cover analysis</title>
+ <p>The cross cover mechanism allows cover analysis of modules
+ across multiple tests. It is useful if some code, e.g. a library
+ module, is used by many different tests and the accumulated cover
+ result is desirable.</p>
+
+ <p>This can of course also be achieved in a more customized way by
+ using the <c>export</c> parameter in the cover specification and
+ analysing the result off line, but the cross cover mechanism is a
+ build in solution which also provides the logging.</p>
+
+ <p>The mechanism is easiest explained via an example:</p>
+
+ <p>Let's say that there are two systems, <c>s1</c> and <c>s2</c>,
+ which are tested in separate test runs. System <c>s1</c> contains
+ a library module <c>m1</c> which is tested by the <c>s1</c> test
+ run and is included in <c>s1</c>'s cover specification:</p>
+
+<code type="none">
+s1.cover:
+ {incl_mods,[m1]}.</code>
+
+ <p>When analysing code coverage, the result for <c>m1</c> can be
+ seen in the cover log in the <c>s1</c> test result.</p>
+
+ <p>Now, let's imagine that since <c>m1</c> is a library module, it
+ is also used quite a bit by system <c>s2</c>. The <c>s2</c> test
+ run does not specifically test <c>m1</c>, but it might still be
+ interesting to see which parts of <c>m1</c> is actually covered by
+ the <c>s2</c> tests. To do this, <c>m1</c> could be included also
+ in <c>s2</c>'s cover specification:</p>
+
+<code type="none">
+s2.cover:
+ {incl_mods,[m1]}.</code>
+
+ <p>This would give an entry for <c>m1</c> also in the cover log
+ for the <c>s2</c> test run. The problem is that this would only
+ reflect the coverage by <c>s2</c> tests, not the accumulated
+ result over <c>s1</c> and <c>s2</c>. And this is where the cross
+ cover mechanism comes in handy.</p>
+
+ <p>If instead the cover specification for <c>s2</c> was like
+ this:</p>
+
+<code type="none">
+s2.cover:
+ {cross,[{s1,[m1]}]}.</code>
+
+ <p>then <c>m1</c> would be cover compiled in the <c>s2</c> test
+ run, but not shown in the coverage log. Instead, if
+ <c>ct_cover:cross_cover_analyse/2</c> is called after both
+ <c>s1</c> and <c>s2</c> test runs are completed, the accumulated
+ result for <c>m1</c> would be available in the cross cover log for
+ the <c>s1</c> test run.</p>
+
+ <p>The call to the analyse function must be like this:</p>
+
+<code type="none">
+ct_cover:cross_cover_analyse(Level, [{s1,S1LogDir},{s2,S2LogDir}]).</code>
+
+ <p>where <c>S1LogDir</c> and <c>S2LogDir</c> are the directories
+ named <c>&lt;TestName&gt;.logs</c> for each test respectively.</p>
+
+ <p>Note the tags <c>s1</c> and <c>s2</c> which are used in the
+ cover specification file and in the call to
+ <c>ct_cover:cross_cover_analyse/2</c>. The point of these are only
+ to map the modules specified in the cover specification to the log
+ directory specified in the call to the analyse function. The name
+ of the tag has no meaning beyond this.</p>
+
+ </section>
+
<section>
<title>Logging</title>
<p>To view the result of a code coverage test, follow the
@@ -170,6 +277,11 @@
takes you to the code coverage overview page. If you have
successfully performed a detailed coverage analysis, you
find links to each individual module coverage page here.</p>
+
+ <p>If cross cover analysis has been performed, and there are
+ accumulated coverage results for the current test, then the -
+ "Coverdata collected over all tests" link will take you to these
+ results.</p>
</section>
</chapter>
diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml
index 86237f5fc1..fe871eb516 100644
--- a/lib/common_test/doc/src/ct_hooks_chapter.xml
+++ b/lib/common_test/doc/src/ct_hooks_chapter.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2011</year><year>2012</year>
+ <year>2011</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -439,14 +439,14 @@ terminate(State) ->
<table>
<row>
- <cell><em>CTH Name</em></cell>
- <cell><em>Is Built-in</em></cell>
- <cell><em>Description</em></cell>
+ <cell align="left"><em>CTH Name</em></cell>
+ <cell align="left"><em>Is Built-in</em></cell>
+ <cell align="left"><em>Description</em></cell>
</row>
<row>
- <cell>cth_log_redirect</cell>
- <cell>yes</cell>
- <cell>Captures all error_logger and SASL logging events and prints them
+ <cell align="left">cth_log_redirect</cell>
+ <cell align="left">yes</cell>
+ <cell align="left">Captures all error_logger and SASL logging events and prints them
to the current test case log. If an event can not be associated with a
testcase it will be printed in the common test framework log. This will
happen for testcases which are run in parallel and events which occur
@@ -455,14 +455,29 @@ terminate(State) ->
using the normal SASL mechanisms. </cell>
</row>
<row>
- <cell>cth_surefire</cell>
- <cell>no</cell>
- <cell>Captures all test results and outputs them as surefire XML into
- a file. The file which is created is by default called junit_report.xml.
- The name can be by setting the path option for this hook. e.g.
+ <cell align="left">cth_surefire</cell>
+ <cell align="left">no</cell>
+ <cell align="left"><p>Captures all test results and outputs them as surefire
+ XML into a file. The file which is created is by default
+ called junit_report.xml. The file name can be changed by
+ setting the <c>path</c> option for this hook, e.g.</p>
+
<code>-ct_hooks cth_surefire [{path,"/tmp/report.xml"}]</code>
- Surefire XML can forinstance be used by Jenkins to display test
- results.</cell>
+
+ <p>If the <c>url_base</c> option is set, an additional
+ attribute named <c>url</c> will be added to each
+ <c>testsuite</c> and <c>testcase</c> XML element. The value will
+ be constructed from the <c>url_base</c> and a relative path
+ to the test suite or test case log respectively, e.g.</p>
+
+ <code>-ct_hooks cth_surefire [{url_base, "http://myserver.com/"}]</code>
+ <p>will give a url attribute value similar to</p>
+
+ <code>"http://myserver.com/[email protected]_11.19.39/
+x86_64-unknown-linux-gnu.my_test.logs/run.2012-12-12_11.19.39/suite.log.html"</code>
+
+ <p>Surefire XML can for instance be used by Jenkins to display test
+ results.</p></cell>
</row>
</table>
diff --git a/lib/common_test/doc/src/ct_run.xml b/lib/common_test/doc/src/ct_run.xml
index c6749d6960..198290c1be 100644
--- a/lib/common_test/doc/src/ct_run.xml
+++ b/lib/common_test/doc/src/ct_run.xml
@@ -104,6 +104,7 @@
[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]
[-stylesheet CSSFile]
[-cover CoverCfgFile]
+ [-cover_stop Bool]
[-event_handler EvHandler1 EvHandler2 .. EvHandlerN] |
[-event_handler_init EvHandler1 InitArg1 and
EvHandler2 InitArg2 and .. EvHandlerN InitArgN]
@@ -125,6 +126,7 @@
<title>Run tests using test specification</title>
<pre>
ct_run -spec TestSpec1 TestSpec2 .. TestSpecN
+ [-join_specs]
[-config ConfigFile1 ConfigFile2 .. ConfigFileN]
[-userconfig CallbackModule1 ConfigString1 and CallbackModule2
ConfigString2 and .. and CallbackModuleN ConfigStringN]
@@ -138,6 +140,7 @@
[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]
[-stylesheet CSSFile]
[-cover CoverCfgFile]
+ [-cover_stop Bool]
[-event_handler EvHandler1 EvHandler2 .. EvHandlerN] |
[-event_handler_init EvHandler1 InitArg1 and
EvHandler2 InitArg2 and .. EvHandlerN InitArgN]
diff --git a/lib/common_test/doc/src/notes.xml b/lib/common_test/doc/src/notes.xml
index 7e33b71de1..8cbcbad8b2 100644
--- a/lib/common_test/doc/src/notes.xml
+++ b/lib/common_test/doc/src/notes.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2004</year><year>2012</year>
+ <year>2004</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -32,6 +32,282 @@
<file>notes.xml</file>
</header>
+<section><title>Common_Test 1.7</title>
+
+ <section><title>Fixed Bugs and Malfunctions</title>
+ <list>
+ <item>
+ <p>
+ Severe errors detected by <c>test_server</c> (e.g. if log
+ files directories cannot be created) will now be reported
+ to <c>common_test</c> and noted in the <c>common_test</c>
+ logs.</p>
+ <p>
+ Own Id: OTP-9769 Aux Id: kunagi-202 [113] </p>
+ </item>
+ <item>
+ <p>
+ The earlier undocumented cross cover feature for
+ accumulating cover data over multiple tests has now been
+ fixed and documented.</p>
+ <p>
+ Own Id: OTP-9870 Aux Id: kunagi-206 [117] </p>
+ </item>
+ <item>
+ <p>
+ If a busy test case generated lots of error messages,
+ cth_log_redirect:post_end_per_testcase would crash with a
+ timeout while waiting for the error logger to finish
+ handling all error reports. The default timer was 5
+ seconds. This has now been extended to 5 minutes.</p>
+ <p>
+ Own Id: OTP-10040 Aux Id: kunagi-173 [84] </p>
+ </item>
+ <item>
+ <p>When a test case failed because of a timetrap time
+ out, the <c>Config</c> data for the case was lost in the
+ following call to <c>end_per_testcase/2</c>, and also in
+ calls to the CT Hook function
+ <c>post_end_per_testcase/4</c>. This problem has been
+ solved and the <c>Config</c> data is now correctly passed
+ to the above functions after a timetrap timeout
+ failure.</p>
+ <p>
+ Own Id: OTP-10070 Aux Id: kunagi-175 [86] </p>
+ </item>
+ <item>
+ <p>
+ Some calls to deprecated and removed functions in snmp
+ are removed from ct_snmp.</p>
+ <p>
+ Own Id: OTP-10088 Aux Id: kunagi-176 [87] </p>
+ </item>
+ <item>
+ <p>In test_server, the same process would supervise the
+ currently running test case and be group leader (and IO
+ server) for the test case. Furthermore, when running
+ parallel test cases, new temporary supervisor/group
+ leader processes were spawned and the process that was
+ group leader for sequential test cases would not be
+ active. That would lead to several problems:</p>
+ <p>* Processes started by init_per_suite will inherit the
+ group leader of the init_per_suite process (and that
+ group leader would not process IO requests when parallel
+ test cases was running). If later a parallel test case
+ caused such a processto print using (for example)
+ io:format/2, the calling would hang.</p>
+ <p>* Similarly, if a process was spawned from a parallel
+ test case, it would inherit the temporary group leader
+ for that parallel test case. If that spawned process
+ later - when the group of parallel tests have finished -
+ attempted to print something, its group leader would be
+ dead and there would be <c>badarg</c> exception.</p>
+ <p>Those problems have been solved by having group
+ leaders separate from the processes that supervises the
+ test cases, and keeping temporary group leader process
+ for parallel test cases alive until no more process in
+ the system use them as group leaders.</p>
+ <p>Also, a new <c>unexpected_io.log</c> log file
+ (reachable from the summary page of each test suite) has
+ been introduced. All unexpected IO will be printed into
+ it(for example, IO to a group leader for a parallel test
+ case that has finished).</p>
+ <p>
+ Own Id: OTP-10101 Aux Id: OTP-10125 </p>
+ </item>
+ <item>
+ <p>
+ Some bugfixes in <c>ct_snmp:</c></p>
+ <p>
+ <list> <item> ct_snmp will now use the value of the
+ 'agent_vsns' config variable when setting the 'variables'
+ parameter to snmp application agent configuration.
+ Earlier this had to be done separately - i.e. the
+ supported versions had to be specified twice. </item>
+ <item> Snmp application failed to write notify.conf since
+ ct_snmp gave the notify type as a string instead of an
+ atom. This has been corrected. </item> </list></p>
+ <p>
+ Own Id: OTP-10432</p>
+ </item>
+ <item>
+ <p>
+ Some bugfixes in <c>ct_snmp</c>:</p>
+ <p>
+ <list> <item> Functions <c>register_users/2</c>,
+ <c>register_agents/2</c> and <c>register_usm_users/2</c>,
+ and the corresponding <c>unregister_*/1</c> functions
+ were not executable. These are corrected/rewritten.
+ </item> <item> Function <c>update_usm_users/2</c> is
+ removed, and an unregister function is added instead.
+ Update can now be done with unregister_usm_users and then
+ register_usm_users. </item> <item> Functions
+ <c>unregister_*/2</c> are added, so specific
+ users/agents/usm users can be unregistered. </item>
+ <item> Function <c>unload_mibs/1</c> is added for
+ completeness. </item> <item> Overriding configuration
+ files did not work, since the files were written in
+ priv_dir instead of in the configuration dir
+ (priv_dir/conf). This has been corrected. </item> <item>
+ Arguments to <c>register_usm_users/2</c> were faulty
+ documented. This has been corrected. </item> </list></p>
+ <p>
+ Own Id: OTP-10434 Aux Id: kunagi-264 [175] </p>
+ </item>
+ <item>
+ <p>
+ Faulty exported specs in common test has been corrected
+ to <c>ct_netconfc:hook_options/0</c> and
+ <c>inet:hostname/0</c></p>
+ <p>
+ Own Id: OTP-10601</p>
+ </item>
+ <item>
+ <p>
+ The netconf client in common_test did not adjust the
+ window after receiving data. Due to this, the client
+ stopped receiving data after a while. This has been
+ corrected.</p>
+ <p>
+ Own Id: OTP-10646</p>
+ </item>
+ </list>
+ </section>
+
+
+ <section><title>Improvements and New Features</title>
+ <list>
+ <item>
+ <p>It is now possible to let a test specification include
+ other test specifications. Included specs can either be
+ joined with the source spec (and all other joined specs),
+ resulting in one single test run, or they can be executed
+ in separate test runs. Also, a start flag/option,
+ <c>join_specs</c>, has been introduced, to be used in
+ combination with the <c>spec</c> option. With
+ <c>join_specs</c>, Common Test can be told to either join
+ multiple test specifications, or run them separately.
+ Without <c>join_specs</c>, the latter behaviour is
+ default. Note that this is a change compared to earlier
+ versions of Common Test, where specifications could only
+ be joined. More information can be found in the Running
+ Tests chapter in the User's Guide (see the Test
+ Specifications section).</p>
+ <p>
+ *** POTENTIAL INCOMPATIBILITY ***</p>
+ <p>
+ Own Id: OTP-9881 Aux Id: kunagi-350 [261] </p>
+ </item>
+ <item>
+ <p>
+ The <c>ct_slave:start/3</c> function now supports an
+ <c>{env,[{Var,Value}]}</c> option to extend environment
+ for the slave node.</p>
+ <p>
+ Own Id: OTP-10469 Aux Id: kunagi-317 [228] </p>
+ </item>
+ <item>
+ <p> Some examples overflowing the width of PDF pages have
+ been corrected. </p>
+ <p>
+ Own Id: OTP-10665</p>
+ </item>
+ <item>
+ <p>
+ Update common test modules to handle unicode <list>
+ <item> Use UTF-8 encoding for all HTML files, except the
+ HTML version of the test suite generated with
+ erl2html2:convert, which will have the same encoding as
+ the original test suite (.erl) file. </item> <item>
+ Encode link targets in HTML files with
+ test_server_ctrl:uri_encode/1. </item> <item> Use unicode
+ modifier 't' with ~s when appropriate. </item> <item> Use
+ unicode:characters_to_list and
+ unicode:characters_to_binary for conversion between
+ binaries and strings instead of binary_to_list and
+ list_to_binary. </item> </list></p>
+ <p>
+ Own Id: OTP-10783</p>
+ </item>
+ </list>
+ </section>
+
+
+ <section><title>Known Bugs and Problems</title>
+ <list>
+ <item>
+ <p>
+ CT drops error reason when groups/0 crashes.</p>
+ <p>
+ Own Id: OTP-10631 Aux Id: kunagi-345 [256] </p>
+ </item>
+ <item>
+ <p>
+ Event handler on a ct_master node causes hanging.</p>
+ <p>
+ Own Id: OTP-10634 Aux Id: kunagi-347 [258] </p>
+ </item>
+ <item>
+ <p>
+ CT fails to open telnet conn after a timetrap timeout.</p>
+ <p>
+ Own Id: OTP-10648 Aux Id: seq12212 </p>
+ </item>
+ </list>
+ </section>
+
+</section>
+
+<section><title>Common_Test 1.6.3.1</title>
+
+ <section><title>Known Bugs and Problems</title>
+ <list>
+ <item>
+ <p>
+ The following corrections/changes are done in the
+ cth_surefire hook:</p>
+ <p>
+ <list> <item> Earlier there would always be a
+ 'properties' element under the 'testsuites' element. This
+ would exist even if there were no 'property' element
+ inside it. This has been changed so if there are no
+ 'property' elements to display, then there will not be a
+ 'properties' element either. </item> <item> The XML file
+ will now (unless other is specified) be stored in the top
+ log directory. Earlier, the default directory would be
+ the current working directory for the erlang node, which
+ would mostly, but not always, be the top log directory.
+ </item> <item> The 'hostname' attribute in the
+ 'testsuite' element would earlier never have the correct
+ value. This has been corrected. </item> <item> The
+ 'errors' attribute in the 'testsuite' element would
+ earlier display the number of failed testcases. This has
+ been changed and will now always have the value 0, while
+ the 'failures' attribute will show the number of failed
+ testcases. </item> <item> A new attribute 'skipped' is
+ added to the 'testsuite' element. This will display the
+ number of skipped testcases. These would earlier be
+ included in the number of failed test cases. </item>
+ <item> The total number of tests displayed by the 'tests'
+ attribute in the 'testsuite' element would earlier
+ include init/end_per_suite and init/end_per_group. This
+ is no longer the case. The 'tests' attribute will now
+ only count "real" test cases. </item> <item> Earlier,
+ auto skipped test cases would have no value in the 'log'
+ attribute. This is now corrected. </item> <item> A new
+ attributes 'log' is added to the 'testsuite' element.
+ </item> <item> A new option named 'url_base' is added for
+ this hook. If this option is used, a new attribute named
+ 'url' will be added to the 'testcase' and 'testsuite'
+ elements. </item> </list></p>
+ <p>
+ Own Id: OTP-10589</p>
+ </item>
+ </list>
+ </section>
+
+</section>
+
<section><title>Common_Test 1.6.3</title>
<section><title>Fixed Bugs and Malfunctions</title>
diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml
index a0b2c96006..35f89153d3 100644
--- a/lib/common_test/doc/src/run_test_chapter.xml
+++ b/lib/common_test/doc/src/run_test_chapter.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2003</year><year>2012</year>
+ <year>2003</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -155,6 +155,8 @@
<item><c><![CDATA[-stylesheet <css_file>]]></c>, points out a user HTML style sheet (see below).</item>
<item><c><![CDATA[-cover <cover_cfg_file>]]></c>, to perform code coverage test (see
<seealso marker="cover_chapter#cover">Code Coverage Analysis</seealso>).</item>
+ <item><c><![CDATA[-cover_stop <bool>]]></c>, to specify if the cover tool shall be stopped after the test is completed (see
+ <seealso marker="cover_chapter#cover_stop">Code Coverage Analysis</seealso>).</item>
<item><c><![CDATA[-event_handler <event_handlers>]]></c>, to install
<seealso marker="event_handler_chapter#event_handling">event handlers</seealso>.</item>
<item><c><![CDATA[-event_handler_init <event_handlers>]]></c>, to install
@@ -528,369 +530,469 @@
<marker id="test_specifications"></marker>
<section>
<title>Test Specifications</title>
-
- <p>The most flexible way to specify what to test, is to use a so
- called test specification. A test specification is a sequence of
- Erlang terms. The terms are normally declared in a text file (see
- <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c>), but
- may also be passed to Common Test on the form of a list (see
- <c><seealso marker="ct#run_testspec-1">ct:run_testspec/1</seealso></c>).
- There are two general types of terms: configuration terms and test
- specification terms.</p>
- <p>With configuration terms it is possible to e.g. label the test
- run (similar to <c>ct_run -label</c>), evaluate arbitrary expressions
- before starting the test, import configuration data (similar to
- <c>ct_run -config/-userconfig</c>), specify the top level HTML log
- directory (similar to <c>ct_run -logdir</c>), enable code coverage
- analysis (similar to <c>ct_run -cover</c>), install Common Test Hooks
- (similar to <c>ct_run -ch_hooks</c>), install event_handler plugins
- (similar to <c>ct_run -event_handler</c>), specify include directories
- that should be passed to the compiler for automatic compilation
- (similar to <c>ct_run -include</c>), disable the auto compilation
- feature (similar to <c>ct_run -no_auto_compile</c>), set verbosity
- levels (similar to <c>ct_run -verbosity</c>), and more.</p>
- <p>Configuration terms can be combined with <c>ct_run</c> start flags,
- or <c>ct:run_test/1</c> options. The result will for some flags/options
- and terms be that the values are merged (e.g. configuration files,
- include directories, verbosity levels, silent connections), and for
- others that the start flags/options override the test specification
- terms (e.g. log directory, label, style sheet, auto compilation).</p>
- <p>With test specification terms it is possible to state exactly
- which tests should run and in which order. A test term specifies
- either one or more suites, one or more test case groups (possibly nested),
- or one or more test cases in a group (or in multiple groups) or in a suite.</p>
- <p>An arbitrary number of test terms may be declared in sequence.
- Common Test will by default compile the terms into one or more tests
- to be performed in one resulting test run. Note that a term that
- specifies a set of test cases will "swallow" one that only
- specifies a subset of these cases. E.g. the result of merging
- one term that specifies that all cases in suite S should be
- executed, with another term specifying only test case X and Y in
- S, is a test of all cases in S. However, if a term specifying
- test case X and Y in S is merged with a term specifying case Z
- in S, the result is a test of X, Y and Z in S. To disable this
- behaviour, i.e. to instead perform each test sequentially in a "script-like"
- manner, the term <c>merge_tests</c> can be set to <c>false</c> in
- the test specification.</p>
- <p>A test term can also specify one or more test suites, groups,
- or test cases to be skipped. Skipped suites, groups and cases
- are not executed and show up in the HTML log files as
- SKIPPED.</p>
- <p>When a test case group is specified, the resulting test
- executes the <c>init_per_group</c> function, followed by all test
- cases and sub groups (including their configuration functions), and
- finally the <c>end_per_group</c> function. Also if particular
- test cases in a group are specified, <c>init_per_group</c>
- and <c>end_per_group</c> for the group in question are
- called. If a group which is defined (in <c>Suite:group/0</c>) to
- be a sub group of another group, is specified (or if particular test
- cases of a sub group are), Common Test will call the configuration
- functions for the top level groups as well as for the sub group
- in question (making it possible to pass configuration data all
- the way from <c>init_per_suite</c> down to the test cases in the
- sub group).</p>
- <p>The test specification utilizes the same mechanism for specifying
- test case groups by means of names and paths, as explained in the
- <seealso marker="run_test_chapter#group_execution">Group Execution</seealso>
- section above, with the addition of the <c>GroupSpec</c> element
- described next.</p>
- <p>The <c>GroupSpec</c> element makes it possible to specify
- group execution properties that will override those in the
- group definition (i.e. in <c>groups/0</c>). Execution properties for
- sub-groups may be overridden as well. This feature makes it possible to
- change properties of groups at the time of execution,
- without even having to edit the test suite. The very same
- feature is available for <c>group</c> elements in the <c>Suite:all/0</c>
- list. Therefore, more detailed documentation, and examples, can be
- found in the <seealso marker="write_test_chapter#test_case_groups">
- Test case groups</seealso> chapter.</p>
-
- <p>Below is the test specification syntax. Test specifications can
- be used to run tests both in a single test host environment and
- in a distributed Common Test environment (Large Scale
- Testing). The node parameters in the <c>init</c> term are only
- relevant in the latter (see the
- <seealso marker="ct_master_chapter#test_specifications">Large
- Scale Testing</seealso> chapter for information). For more information
- about the various terms, please see the corresponding sections in the
- User's Guide, such as e.g. the
- <seealso marker="run_test_chapter#ct_run"><c>ct_run</c>
- program</seealso> for an overview of available start flags
- (since most flags have a corresponding configuration term), and
- more detailed explanation of e.g.
- <seealso marker="write_test_chapter#logging">Logging</seealso>
- (for the <c>verbosity</c>, <c>stylesheet</c> and <c>basic_html</c> terms),
- <seealso marker="config_file_chapter#top">External Configuration Data</seealso>
- (for the <c>config</c> and <c>userconfig</c> terms),
- <seealso marker="event_handler_chapter#event_handling">Event
- Handling</seealso> (for the <c>event_handler</c> term),
- <seealso marker="ct_hooks_chapter#installing">Common Test Hooks</seealso>
- (for the <c>ct_hooks</c> term), etc.</p>
- <p>Config terms:</p>
- <pre>
- {merge_tests, Bool}.
-
- {define, Constant, Value}.
-
- {node, NodeAlias, Node}.
-
- {init, InitOptions}.
- {init, [NodeAlias], InitOptions}.
-
- {label, Label}.
- {label, NodeRefs, Label}.
-
- {verbosity, VerbosityLevels}.
- {verbosity, NodeRefs, VerbosityLevels}.
-
- {stylesheet, CSSFile}.
- {stylesheet, NodeRefs, CSSFile}.
-
- {silent_connections, ConnTypes}.
- {silent_connections, NodeRefs, ConnTypes}.
-
- {multiply_timetraps, N}.
- {multiply_timetraps, NodeRefs, N}.
-
- {scale_timetraps, Bool}.
- {scale_timetraps, NodeRefs, Bool}.
-
- {cover, CoverSpecFile}.
- {cover, NodeRefs, CoverSpecFile}.
-
- {include, IncludeDirs}.
- {include, NodeRefs, IncludeDirs}.
-
- {auto_compile, Bool},
- {auto_compile, NodeRefs, Bool},
-
- {config, ConfigFiles}.
- {config, ConfigDir, ConfigBaseNames}.
- {config, NodeRefs, ConfigFiles}.
- {config, NodeRefs, ConfigDir, ConfigBaseNames}.
-
- {userconfig, {CallbackModule, ConfigStrings}}.
- {userconfig, NodeRefs, {CallbackModule, ConfigStrings}}.
-
- {logdir, LogDir}.
- {logdir, NodeRefs, LogDir}.
-
- {logopts, LogOpts}.
- {logopts, NodeRefs, LogOpts}.
-
- {create_priv_dir, PrivDirOption}.
- {create_priv_dir, NodeRefs, PrivDirOption}.
-
- {event_handler, EventHandlers}.
- {event_handler, NodeRefs, EventHandlers}.
- {event_handler, EventHandlers, InitArgs}.
- {event_handler, NodeRefs, EventHandlers, InitArgs}.
-
- {ct_hooks, CTHModules}.
- {ct_hooks, NodeRefs, CTHModules}.
-
- {enable_builtin_hooks, Bool}.
-
- {basic_html, Bool}.
- {basic_html, NodeRefs, Bool}.
+ <section>
+ <title>General description</title>
+ <p>The most flexible way to specify what to test, is to use a so
+ called test specification. A test specification is a sequence of
+ Erlang terms. The terms are normally declared in one or more text files
+ (see <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c>), but
+ may also be passed to Common Test on the form of a list (see
+ <c><seealso marker="ct#run_testspec-1">ct:run_testspec/1</seealso></c>).
+ There are two general types of terms: configuration terms and test
+ specification terms.</p>
+ <p>With configuration terms it is possible to e.g. label the test
+ run (similar to <c>ct_run -label</c>), evaluate arbitrary expressions
+ before starting the test, import configuration data (similar to
+ <c>ct_run -config/-userconfig</c>), specify the top level HTML log
+ directory (similar to <c>ct_run -logdir</c>), enable code coverage
+ analysis (similar to <c>ct_run -cover</c>), install Common Test Hooks
+ (similar to <c>ct_run -ch_hooks</c>), install event_handler plugins
+ (similar to <c>ct_run -event_handler</c>), specify include directories
+ that should be passed to the compiler for automatic compilation
+ (similar to <c>ct_run -include</c>), disable the auto compilation
+ feature (similar to <c>ct_run -no_auto_compile</c>), set verbosity
+ levels (similar to <c>ct_run -verbosity</c>), and more.</p>
+ <p>Configuration terms can be combined with <c>ct_run</c> start flags,
+ or <c>ct:run_test/1</c> options. The result will for some flags/options
+ and terms be that the values are merged (e.g. configuration files,
+ include directories, verbosity levels, silent connections), and for
+ others that the start flags/options override the test specification
+ terms (e.g. log directory, label, style sheet, auto compilation).</p>
+ <p>With test specification terms it is possible to state exactly
+ which tests should run and in which order. A test term specifies
+ either one or more suites, one or more test case groups (possibly nested),
+ or one or more test cases in a group (or in multiple groups) or in a suite.</p>
+ <p>An arbitrary number of test terms may be declared in sequence.
+ Common Test will by default compile the terms into one or more tests
+ to be performed in one resulting test run. Note that a term that
+ specifies a set of test cases will "swallow" one that only
+ specifies a subset of these cases. E.g. the result of merging
+ one term that specifies that all cases in suite S should be
+ executed, with another term specifying only test case X and Y in
+ S, is a test of all cases in S. However, if a term specifying
+ test case X and Y in S is merged with a term specifying case Z
+ in S, the result is a test of X, Y and Z in S. To disable this
+ behaviour, i.e. to instead perform each test sequentially in a "script-like"
+ manner, the term <c>merge_tests</c> can be set to <c>false</c> in
+ the test specification.</p>
+ <p>A test term can also specify one or more test suites, groups,
+ or test cases to be skipped. Skipped suites, groups and cases
+ are not executed and show up in the HTML log files as
+ SKIPPED.</p>
+ </section>
+ <section>
+ <title>Using multiple test specification files</title>
+
+ <p>When multiple test specification files are given at startup (either
+ with <c>ct_run -spec file1 file2 ...</c> or
+ <c>ct:run_test([{spec, [File1,File2,...]}])</c>),
+ Common Test will either execute one test run per specification file, or
+ join the files and perform all tests within one single test run. The first
+ behaviour is the default one. The latter requires that the start
+ flag/option <c>join_suites</c> is provided, e.g.
+ <c>run_test -spec ./my_tests1.ts ./my_tests2.ts -join_suites</c>.</p>
+
+ <p>Joining a number of specifications, or running them separately, can
+ also be accomplished with (and may be combined with) test specification
+ file inclusion, described next.</p>
+ </section>
+ <section>
+ <title>Test specification file inclusion</title>
+ <p>With the <c>specs</c> term (see syntax below), it's possible to have
+ a test specification include other specifications. An included
+ specification may either be joined with the source specification,
+ or used to produce a separate test run (like with the <c>join_specs</c>
+ start flag/option above). Example:</p>
+ <pre>
+ %% In specification file "a.spec"
+ {specs, join, ["b.spec", "c.spec"]}.
+ {specs, separate, ["d.spec", "e.spec"]}.
+ %% Config and test terms follow
+ ...</pre>
+ <p>In this example, the test terms defined in files "b.spec" and "c.spec"
+ will be joined with the terms in the source specification "a.spec"
+ (if any). The inclusion of specifications "d.spec" and
+ "e.spec" will result in two separate, and independent, test runs (i.e.
+ one for each included specification).</p>
+ <p>Note that the <c>join</c> option does not imply that the test terms
+ will be merged (see <c>merge_tests</c> above), only that all tests are
+ executed in one single test run.</p>
+ <p>Joined specifications share common configuration settings, such as
+ the list of <c>config</c> files or <c>include</c> directories.
+ For configuration that can not be combined, such as settings for <c>logdir</c>
+ or <c>verbosity</c>, it is up to the user to ensure there are no clashes
+ when the test specifications are joined. Specifications included with
+ the <c>separate</c> option, do not share configuration settings with the
+ source specification. This is useful e.g. if there are clashing
+ configuration settings in included specifications, making it impossible
+ to join them.</p>
+ <p>If <c>{merge_tests,true}</c> is set in the source specification
+ (which is the default setting), terms in joined specifications will be
+ merged with terms in the source specification (according to the
+ description of <c>merge_tests</c> above).</p>
+ <p>Note that it is always the <c>merge_tests</c> setting in the source
+ specification that is used when joined with other specifications.
+ Say e.g. that a source specification A, with tests TA1 and TA2, has
+ <c>{merge_tests,false}</c> set, and it includes another specification,
+ B, with tests TB1 and TB2, that has <c>{merge_tests,true}</c> set.
+ The result will be that the test series: <c>TA1,TA2,merge(TB1,TB2)</c>,
+ is executed. The opposite <c>merge_tests</c> settings would result in the
+ following the test series: <c>merge(merge(TA1,TA2),TB1,TB2)</c>.</p>
+ <p>The <c>specs</c> term may of course be used to nest specifications,
+ i.e. have one specification include other specifications, which in turn
+ include others, etc.</p>
+ </section>
+ <section>
+ <title>Test case groups</title>
+
+ <p>When a test case group is specified, the resulting test
+ executes the <c>init_per_group</c> function, followed by all test
+ cases and sub groups (including their configuration functions), and
+ finally the <c>end_per_group</c> function. Also if particular
+ test cases in a group are specified, <c>init_per_group</c>
+ and <c>end_per_group</c> for the group in question are
+ called. If a group which is defined (in <c>Suite:group/0</c>) to
+ be a sub group of another group, is specified (or if particular test
+ cases of a sub group are), Common Test will call the configuration
+ functions for the top level groups as well as for the sub group
+ in question (making it possible to pass configuration data all
+ the way from <c>init_per_suite</c> down to the test cases in the
+ sub group).</p>
+ <p>The test specification utilizes the same mechanism for specifying
+ test case groups by means of names and paths, as explained in the
+ <seealso marker="run_test_chapter#group_execution">Group Execution</seealso>
+ section above, with the addition of the <c>GroupSpec</c> element
+ described next.</p>
+ <p>The <c>GroupSpec</c> element makes it possible to specify
+ group execution properties that will override those in the
+ group definition (i.e. in <c>groups/0</c>). Execution properties for
+ sub-groups may be overridden as well. This feature makes it possible to
+ change properties of groups at the time of execution,
+ without even having to edit the test suite. The very same
+ feature is available for <c>group</c> elements in the <c>Suite:all/0</c>
+ list. Therefore, more detailed documentation, and examples, can be
+ found in the <seealso marker="write_test_chapter#test_case_groups">
+ Test case groups</seealso> chapter.</p>
+ </section>
- {release_shell, Bool}.</pre>
+ <section>
+ <title>Test specification syntax</title>
+
+ <p>Below is the test specification syntax. Test specifications can
+ be used to run tests both in a single test host environment and
+ in a distributed Common Test environment (Large Scale
+ Testing). The node parameters in the <c>init</c> term are only
+ relevant in the latter (see the
+ <seealso marker="ct_master_chapter#test_specifications">Large
+ Scale Testing</seealso> chapter for information). For more information
+ about the various terms, please see the corresponding sections in the
+ User's Guide, such as e.g. the
+ <seealso marker="run_test_chapter#ct_run"><c>ct_run</c>
+ program</seealso> for an overview of available start flags
+ (since most flags have a corresponding configuration term), and
+ more detailed explanation of e.g.
+ <seealso marker="write_test_chapter#logging">Logging</seealso>
+ (for the <c>verbosity</c>, <c>stylesheet</c> and <c>basic_html</c> terms),
+ <seealso marker="config_file_chapter#top">External Configuration Data</seealso>
+ (for the <c>config</c> and <c>userconfig</c> terms),
+ <seealso marker="event_handler_chapter#event_handling">Event
+ Handling</seealso> (for the <c>event_handler</c> term),
+ <seealso marker="ct_hooks_chapter#installing">Common Test Hooks</seealso>
+ (for the <c>ct_hooks</c> term), etc.</p>
+ </section>
+ <p>Config terms:</p>
+ <pre>
+ {merge_tests, Bool}.
+
+ {define, Constant, Value}.
+
+ {specs, InclSpecsOption, TestSpecs}.
+
+ {node, NodeAlias, Node}.
+
+ {init, InitOptions}.
+ {init, [NodeAlias], InitOptions}.
+
+ {label, Label}.
+ {label, NodeRefs, Label}.
+
+ {verbosity, VerbosityLevels}.
+ {verbosity, NodeRefs, VerbosityLevels}.
+
+ {stylesheet, CSSFile}.
+ {stylesheet, NodeRefs, CSSFile}.
+
+ {silent_connections, ConnTypes}.
+ {silent_connections, NodeRefs, ConnTypes}.
+
+ {multiply_timetraps, N}.
+ {multiply_timetraps, NodeRefs, N}.
+
+ {scale_timetraps, Bool}.
+ {scale_timetraps, NodeRefs, Bool}.
+
+ {cover, CoverSpecFile}.
+ {cover, NodeRefs, CoverSpecFile}.
+
+ {cover_stop, Bool}.
+ {cover_stop, NodeRefs, Bool}.
+
+ {include, IncludeDirs}.
+ {include, NodeRefs, IncludeDirs}.
+
+ {auto_compile, Bool},
+ {auto_compile, NodeRefs, Bool},
+
+ {config, ConfigFiles}.
+ {config, ConfigDir, ConfigBaseNames}.
+ {config, NodeRefs, ConfigFiles}.
+ {config, NodeRefs, ConfigDir, ConfigBaseNames}.
+
+ {userconfig, {CallbackModule, ConfigStrings}}.
+ {userconfig, NodeRefs, {CallbackModule, ConfigStrings}}.
+
+ {logdir, LogDir}.
+ {logdir, NodeRefs, LogDir}.
+
+ {logopts, LogOpts}.
+ {logopts, NodeRefs, LogOpts}.
+
+ {create_priv_dir, PrivDirOption}.
+ {create_priv_dir, NodeRefs, PrivDirOption}.
+
+ {event_handler, EventHandlers}.
+ {event_handler, NodeRefs, EventHandlers}.
+ {event_handler, EventHandlers, InitArgs}.
+ {event_handler, NodeRefs, EventHandlers, InitArgs}.
+
+ {ct_hooks, CTHModules}.
+ {ct_hooks, NodeRefs, CTHModules}.
+
+ {enable_builtin_hooks, Bool}.
+
+ {basic_html, Bool}.
+ {basic_html, NodeRefs, Bool}.
+
+ {release_shell, Bool}.</pre>
+
<p>Test terms:</p>
- <pre>
- {suites, Dir, Suites}.
- {suites, NodeRefs, Dir, Suites}.
-
- {groups, Dir, Suite, Groups}.
- {groups, NodeRefs, Dir, Suite, Groups}.
-
- {groups, Dir, Suite, Groups, {cases,Cases}}.
- {groups, NodeRefs, Dir, Suite, Groups, {cases,Cases}}.
-
- {cases, Dir, Suite, Cases}.
- {cases, NodeRefs, Dir, Suite, Cases}.
-
- {skip_suites, Dir, Suites, Comment}.
- {skip_suites, NodeRefs, Dir, Suites, Comment}.
-
- {skip_groups, Dir, Suite, GroupNames, Comment}.
- {skip_groups, NodeRefs, Dir, Suite, GroupNames, Comment}.
-
- {skip_cases, Dir, Suite, Cases, Comment}.
- {skip_cases, NodeRefs, Dir, Suite, Cases, Comment}.</pre>
-
+ <pre>
+ {suites, Dir, Suites}.
+ {suites, NodeRefs, Dir, Suites}.
+
+ {groups, Dir, Suite, Groups}.
+ {groups, NodeRefs, Dir, Suite, Groups}.
+
+ {groups, Dir, Suite, Groups, {cases,Cases}}.
+ {groups, NodeRefs, Dir, Suite, Groups, {cases,Cases}}.
+
+ {cases, Dir, Suite, Cases}.
+ {cases, NodeRefs, Dir, Suite, Cases}.
+
+ {skip_suites, Dir, Suites, Comment}.
+ {skip_suites, NodeRefs, Dir, Suites, Comment}.
+
+ {skip_groups, Dir, Suite, GroupNames, Comment}.
+ {skip_groups, NodeRefs, Dir, Suite, GroupNames, Comment}.
+
+ {skip_cases, Dir, Suite, Cases, Comment}.
+ {skip_cases, NodeRefs, Dir, Suite, Cases, Comment}.</pre>
+
<p>Types:</p>
- <pre>
- Bool = true | false
- Constant = atom()
- Value = term()
- NodeAlias = atom()
- Node = node()
- NodeRef = NodeAlias | Node | master
- NodeRefs = all_nodes | [NodeRef] | NodeRef
- InitOptions = term()
- Label = atom() | string()
- VerbosityLevels = integer() | [{Category,integer()}]
- Category = atom()
- CSSFile = string()
- ConnTypes = all | [atom()]
- N = integer()
- CoverSpecFile = string()
- IncludeDirs = string() | [string()]
- ConfigFiles = string() | [string()]
- ConfigDir = string()
- ConfigBaseNames = string() | [string()]
- CallbackModule = atom()
- ConfigStrings = string() | [string()]
- LogDir = string()
- LogOpts = [term()]
- PrivDirOption = auto_per_run | auto_per_tc | manual_per_tc
- EventHandlers = atom() | [atom()]
- InitArgs = [term()]
- CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]
- CTHModule = atom()
- CTHInitArgs = term()
- Dir = string()
- Suites = atom() | [atom()] | all
- Suite = atom()
- Groups = GroupPath | [GroupPath] | GroupSpec | [GroupSpec] | all
- GroupPath = [GroupName]
- GroupSpec = GroupName | {GroupName,Properties} | {GroupName,Properties,GroupSpec}
- GroupName = atom()
- GroupNames = GroupName | [GroupName]
- Cases = atom() | [atom()] | all
- Comment = string() | ""</pre>
-
- <p>The difference between the <c>config</c> terms above, is that with
- <c>ConfigDir</c>, <c>ConfigBaseNames</c> is a list of base names,
- i.e. without directory paths. <c>ConfigFiles</c> must be full names,
- including paths. E.g, these two terms have the same meaning:</p>
- <pre>
- {config, ["/home/testuser/tests/config/nodeA.cfg",
- "/home/testuser/tests/config/nodeB.cfg"]}.
-
- {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}.</pre>
-
- <note><p>Any relative paths specified in the test specification, will be
- relative to the directory which contains the test specification file, if
- <c>ct_run -spec TestSpecFile ...</c> or
- <c>ct:run:test([{spec,TestSpecFile},...])</c>
- executes the test. The path will be relative to the top level log directory, if
- <c>ct:run:testspec(TestSpec)</c> executes the test.</p></note>
-
- <p>The <c>define</c> term introduces a constant, which is used to
- replace the name <c>Constant</c> with <c>Value</c>, wherever it's found in
- the test specification. This replacement happens during an initial iteration
- through the test specification. Constants may be used anywhere in the test
- specification, e.g. in arbitrary lists and tuples, and even in strings
- and inside the value part of other constant definitions! A constant can
- also be part of a node name, but that is the only place where a constant
- can be part of an atom.</p>
-
- <note><p>For the sake of readability, the name of the constant must always
- begin with an upper case letter, or a <c>$</c>, <c>?</c>, or <c>_</c>.
- This also means that it must always be single quoted (obviously, since
- the constant name is actually an atom, not text).</p></note>
-
- <p>The main benefit of constants is that they can be used to reduce the size
- (and avoid repetition) of long strings, such as file paths. Compare these
- terms:</p>
-
- <pre>
- %% 1a. no constant
- {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}.
- {suites, "/home/testuser/tests/suites", all}.
-
- %% 1b. with constant
- {define, 'TESTDIR', "/home/testuser/tests"}.
- {config, "'TESTDIR'/config", ["nodeA.cfg","nodeB.cfg"]}.
- {suites, "'TESTDIR'/suites", all}.
-
- %% 2a. no constants
- {config, [testnode@host1, testnode@host2], "../config", ["nodeA.cfg","nodeB.cfg"]}.
- {suites, [testnode@host1, testnode@host2], "../suites", [x_SUITE, y_SUITE]}.
-
- %% 2b. with constants
- {define, 'NODE', testnode}.
- {define, 'NODES', ['NODE'@host1, 'NODE'@host2]}.
- {config, 'NODES', "../config", ["nodeA.cfg","nodeB.cfg"]}.
- {suites, 'NODES', "../suites", [x_SUITE, y_SUITE]}.</pre>
-
- <p>Constants make the test specification term <c>alias</c>, in previous
- versions of Common Test, redundant. This term has been deprecated but will
- remain supported in upcoming Common Test releases. Replacing <c>alias</c>
- terms with <c>define</c> is strongly recommended though! Here's an example
- of such a replacement:</p>
+ <pre>
+ Bool = true | false
+ Constant = atom()
+ Value = term()
+ InclSpecsOption = join | separate
+ TestSpecs = string() | [string()]
+ NodeAlias = atom()
+ Node = node()
+ NodeRef = NodeAlias | Node | master
+ NodeRefs = all_nodes | [NodeRef] | NodeRef
+ InitOptions = term()
+ Label = atom() | string()
+ VerbosityLevels = integer() | [{Category,integer()}]
+ Category = atom()
+ CSSFile = string()
+ ConnTypes = all | [atom()]
+ N = integer()
+ CoverSpecFile = string()
+ IncludeDirs = string() | [string()]
+ ConfigFiles = string() | [string()]
+ ConfigDir = string()
+ ConfigBaseNames = string() | [string()]
+ CallbackModule = atom()
+ ConfigStrings = string() | [string()]
+ LogDir = string()
+ LogOpts = [term()]
+ PrivDirOption = auto_per_run | auto_per_tc | manual_per_tc
+ EventHandlers = atom() | [atom()]
+ InitArgs = [term()]
+ CTHModules = [CTHModule |
+ {CTHModule, CTHInitArgs} |
+ {CTHModule, CTHInitArgs, CTHPriority}]
+ CTHModule = atom()
+ CTHInitArgs = term()
+ Dir = string()
+ Suites = atom() | [atom()] | all
+ Suite = atom()
+ Groups = GroupPath | [GroupPath] | GroupSpec | [GroupSpec] | all
+ GroupPath = [GroupName]
+ GroupSpec = GroupName | {GroupName,Properties} | {GroupName,Properties,GroupSpec}
+ GroupName = atom()
+ GroupNames = GroupName | [GroupName]
+ Cases = atom() | [atom()] | all
+ Comment = string() | ""</pre>
+
+ <section>
+ <p>The difference between the <c>config</c> terms above, is that with
+ <c>ConfigDir</c>, <c>ConfigBaseNames</c> is a list of base names,
+ i.e. without directory paths. <c>ConfigFiles</c> must be full names,
+ including paths. E.g, these two terms have the same meaning:</p>
+ <pre>
+ {config, ["/home/testuser/tests/config/nodeA.cfg",
+ "/home/testuser/tests/config/nodeB.cfg"]}.
+
+ {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}.</pre>
+
+ <note><p>Any relative paths specified in the test specification, will be
+ relative to the directory which contains the test specification file, if
+ <c>ct_run -spec TestSpecFile ...</c> or
+ <c>ct:run:test([{spec,TestSpecFile},...])</c>
+ executes the test. The path will be relative to the top level log directory, if
+ <c>ct:run:testspec(TestSpec)</c> executes the test.</p></note>
+ </section>
- <pre>
- %% using the old alias term
- {config, "/home/testuser/tests/config/nodeA.cfg"}.
- {alias, suite_dir, "/home/testuser/tests/suites"}.
- {groups, suite_dir, x_SUITE, group1}.
-
- %% replacing with constants
- {define, 'TestDir', "/home/testuser/tests"}.
- {define, 'CfgDir', "'TestDir'/config"}.
- {define, 'SuiteDir', "'TestDir'/suites"}.
- {config, 'CfgDir', "nodeA.cfg"}.
- {groups, 'SuiteDir', x_SUITE, group1}.</pre>
-
- <p>Actually, constants could well replace the <c>node</c> term too, but
- this still has declarative value, mainly when used in combination
- with <c>NodeRefs == all_nodes</c> (see types above).</p>
-
- <p>Here follows a simple test specification example:</p>
- <pre>
- {define, 'Top', "/home/test"}.
- {define, 'T1', "'Top'/t1"}.
- {define, 'T2', "'Top'/t2"}.
- {define, 'T3', "'Top'/t3"}.
- {define, 'CfgFile', "config.cfg"}.
+ <section>
+ <title>Constants</title>
+
+ <p>The <c>define</c> term introduces a constant, which is used to
+ replace the name <c>Constant</c> with <c>Value</c>, wherever it's found in
+ the test specification. This replacement happens during an initial iteration
+ through the test specification. Constants may be used anywhere in the test
+ specification, e.g. in arbitrary lists and tuples, and even in strings
+ and inside the value part of other constant definitions! A constant can
+ also be part of a node name, but that is the only place where a constant
+ can be part of an atom.</p>
+
+ <note><p>For the sake of readability, the name of the constant must always
+ begin with an upper case letter, or a <c>$</c>, <c>?</c>, or <c>_</c>.
+ This also means that it must always be single quoted (obviously, since
+ the constant name is actually an atom, not text).</p></note>
+
+ <p>The main benefit of constants is that they can be used to reduce the size
+ (and avoid repetition) of long strings, such as file paths. Compare these
+ terms:</p>
+
+ <pre>
+ %% 1a. no constant
+ {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}.
+ {suites, "/home/testuser/tests/suites", all}.
+
+ %% 1b. with constant
+ {define, 'TESTDIR', "/home/testuser/tests"}.
+ {config, "'TESTDIR'/config", ["nodeA.cfg","nodeB.cfg"]}.
+ {suites, "'TESTDIR'/suites", all}.
+
+ %% 2a. no constants
+ {config, [testnode@host1, testnode@host2], "../config", ["nodeA.cfg","nodeB.cfg"]}.
+ {suites, [testnode@host1, testnode@host2], "../suites", [x_SUITE, y_SUITE]}.
+
+ %% 2b. with constants
+ {define, 'NODE', testnode}.
+ {define, 'NODES', ['NODE'@host1, 'NODE'@host2]}.
+ {config, 'NODES', "../config", ["nodeA.cfg","nodeB.cfg"]}.
+ {suites, 'NODES', "../suites", [x_SUITE, y_SUITE]}.</pre>
+
+ <p>Constants make the test specification term <c>alias</c>, in previous
+ versions of Common Test, redundant. This term has been deprecated but will
+ remain supported in upcoming Common Test releases. Replacing <c>alias</c>
+ terms with <c>define</c> is strongly recommended though! Here's an example
+ of such a replacement:</p>
+
+ <pre>
+ %% using the old alias term
+ {config, "/home/testuser/tests/config/nodeA.cfg"}.
+ {alias, suite_dir, "/home/testuser/tests/suites"}.
+ {groups, suite_dir, x_SUITE, group1}.
+
+ %% replacing with constants
+ {define, 'TestDir', "/home/testuser/tests"}.
+ {define, 'CfgDir', "'TestDir'/config"}.
+ {define, 'SuiteDir', "'TestDir'/suites"}.
+ {config, 'CfgDir', "nodeA.cfg"}.
+ {groups, 'SuiteDir', x_SUITE, group1}.</pre>
+
+ <p>Actually, constants could well replace the <c>node</c> term too, but
+ this still has declarative value, mainly when used in combination
+ with <c>NodeRefs == all_nodes</c> (see types above).</p>
+ </section>
- {logdir, "'Top'/logs"}.
-
- {config, ["'T1'/'CfgFile'", "'T2'/'CfgFile'", "'T3'/'CfgFile'"]}.
-
- {suites, 'T1', all}.
- {skip_suites, 'T1', [t1B_SUITE,t1D_SUITE], "Not implemented"}.
- {skip_cases, 'T1', t1A_SUITE, [test3,test4], "Irrelevant"}.
- {skip_cases, 'T1', t1C_SUITE, [test1], "Ignore"}.
-
- {suites, 'T2', [t2B_SUITE,t2C_SUITE]}.
- {cases, 'T2', t2A_SUITE, [test4,test1,test7]}.
-
- {skip_suites, 'T3', all, "Not implemented"}.</pre>
+ <section>
+ <title>Example</title>
+
+ <p>Here follows a simple test specification example:</p>
+ <pre>
+ {define, 'Top', "/home/test"}.
+ {define, 'T1', "'Top'/t1"}.
+ {define, 'T2', "'Top'/t2"}.
+ {define, 'T3', "'Top'/t3"}.
+ {define, 'CfgFile', "config.cfg"}.
+
+ {logdir, "'Top'/logs"}.
+
+ {config, ["'T1'/'CfgFile'", "'T2'/'CfgFile'", "'T3'/'CfgFile'"]}.
+
+ {suites, 'T1', all}.
+ {skip_suites, 'T1', [t1B_SUITE,t1D_SUITE], "Not implemented"}.
+ {skip_cases, 'T1', t1A_SUITE, [test3,test4], "Irrelevant"}.
+ {skip_cases, 'T1', t1C_SUITE, [test1], "Ignore"}.
+
+ {suites, 'T2', [t2B_SUITE,t2C_SUITE]}.
+ {cases, 'T2', t2A_SUITE, [test4,test1,test7]}.
+
+ {skip_suites, 'T3', all, "Not implemented"}.</pre>
+
+ <p>The example specifies the following:</p>
+ <list>
+ <item>The specified logdir directory will be used for storing
+ the HTML log files (in subdirectories tagged with node name,
+ date and time).</item>
+ <item>The variables in the specified test system config files will be
+ imported for the test.</item>
+ <item>The first test to run includes all suites for system t1. Excluded from
+ the test are however the t1B and t1D suites. Also test cases test3 and
+ test4 in t1A as well as the test1 case in t1C are excluded from
+ the test.</item>
+ <item>Secondly, the test for system t2 should run. The included suites are
+ t2B and t2C. Included are also test cases test4, test1 and test7 in suite
+ t2A. Note that the test cases will be executed in the specified order.</item>
+ <item>Lastly, all suites for systems t3 are to be completely skipped and this
+ should be explicitly noted in the log files.</item>
+ </list>
+ </section>
- <p>The example specifies the following:</p>
- <list>
- <item>The specified logdir directory will be used for storing
- the HTML log files (in subdirectories tagged with node name,
- date and time).</item>
- <item>The variables in the specified test system config files will be
- imported for the test.</item>
- <item>The first test to run includes all suites for system t1. Excluded from
- the test are however the t1B and t1D suites. Also test cases test3 and
- test4 in t1A as well as the test1 case in t1C are excluded from
- the test.</item>
- <item>Secondly, the test for system t2 should run. The included suites are
- t2B and t2C. Included are also test cases test4, test1 and test7 in suite
- t2A. Note that the test cases will be executed in the specified order.</item>
- <item>Lastly, all suites for systems t3 are to be completely skipped and this
- should be explicitly noted in the log files.</item>
- </list>
- <p>With the <c>init</c> term it's possible to specify initialization options
- for nodes defined in the test specification. Currently, there are options
- to start the node and/or to evaluate any function on the node.
- See the <seealso marker="ct_master_chapter#ct_slave">Automatic startup of
- the test target nodes</seealso> chapter for details.</p>
- <p>It is possible for the user to provide a test specification that
- includes (for Common Test) unrecognizable terms. If this is desired,
- the <c>-allow_user_terms</c> flag should be used when starting tests with
- <c>ct_run</c>. This forces Common Test to ignore unrecognizable terms.
- Note that in this mode, Common Test is not able to check the specification
- for errors as efficiently as if the scanner runs in default mode.
- If <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c> is used for starting the tests, the relaxed scanner
- mode is enabled by means of the tuple: <c>{allow_user_terms,true}</c></p>
+ <section>
+ <title>The init term</title>
+ <p>With the <c>init</c> term it's possible to specify initialization options
+ for nodes defined in the test specification. Currently, there are options
+ to start the node and/or to evaluate any function on the node.
+ See the <seealso marker="ct_master_chapter#ct_slave">Automatic startup of
+ the test target nodes</seealso> chapter for details.</p>
+ </section>
+ <section>
+ <title>User specific terms</title>
+ <p>It is possible for the user to provide a test specification that
+ includes (for Common Test) unrecognizable terms. If this is desired,
+ the <c>-allow_user_terms</c> flag should be used when starting tests with
+ <c>ct_run</c>. This forces Common Test to ignore unrecognizable terms.
+ Note that in this mode, Common Test is not able to check the specification
+ for errors as efficiently as if the scanner runs in default mode.
+ If <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c> is used
+ for starting the tests, the relaxed scanner
+ mode is enabled by means of the tuple: <c>{allow_user_terms,true}</c></p>
+ </section>
</section>
<section>
diff --git a/lib/common_test/doc/src/write_test_chapter.xml b/lib/common_test/doc/src/write_test_chapter.xml
index 248d7de8b6..cc8d913994 100644
--- a/lib/common_test/doc/src/write_test_chapter.xml
+++ b/lib/common_test/doc/src/write_test_chapter.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2003</year><year>2012</year>
+ <year>2003</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -982,38 +982,36 @@
<p>Example:</p>
<pre>
+ Some printouts during test case execution:
- Some printouts during test case execution:
+ io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]),
+ ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]),
+ ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]),
+ ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]),
+ ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]),
+ ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]),
- io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]),
- ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]),
- ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]),
- ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]),
- ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]),
- ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]),
+ If starting the test without specifying any verbosity levels:
- If starting the test without specifying any verbosity levels:
+ $ ct_run ...
- $ ct_run ...
+ the following gets printed:
- the following gets printed:
-
- 1. Standard IO, importance = 50
- 2. Uncategorized, importance = 50
- 3. Categorized info, importance = 50
- 5. Categorized error, importance = 75
- 6. Categorized error, importance = 99
-
- If starting the test with:
-
- $ ct_run -verbosity 1 and info 75
-
- the following gets printed:
+ 1. Standard IO, importance = 50
+ 2. Uncategorized, importance = 50
+ 3. Categorized info, importance = 50
+ 5. Categorized error, importance = 75
+ 6. Categorized error, importance = 99
+
+ If starting the test with:
+
+ $ ct_run -verbosity 1 and info 75
+
+ the following gets printed:
- 3. Categorized info, importance = 50
- 4. Categorized info, importance = 25
- 6. Categorized error, importance = 99
- </pre>
+ 3. Categorized info, importance = 50
+ 4. Categorized info, importance = 25
+ 6. Categorized error, importance = 99</pre>
<p>How categories can be mapped to CSS tags is documented in the
<seealso marker="run_test_chapter#html_stylesheet">Running Tests</seealso>
diff --git a/lib/common_test/priv/Makefile.in b/lib/common_test/priv/Makefile.in
index 4372ab124e..5a9fabbe45 100644
--- a/lib/common_test/priv/Makefile.in
+++ b/lib/common_test/priv/Makefile.in
@@ -68,15 +68,15 @@ JS = jquery-latest.js jquery.tablesorter.min.js
include ../../test_server/vsn.mk
debug opt:
- sed -e 's;@CT_VSN@;$(VSN);' \
+ $(V_at)sed -e 's;@CT_VSN@;$(VSN);' \
-e 's;@TS_VSN@;$(TEST_SERVER_VSN);' \
../install.sh.in > install.sh
- chmod 775 install.sh
+ $(V_at)chmod 775 install.sh
docs:
clean:
- rm -f $(SCRIPTS)
+ $(V_at)rm -f $(SCRIPTS)
# ----------------------------------------------------
diff --git a/lib/common_test/src/Makefile b/lib/common_test/src/Makefile
index dd2923ece9..4600c0ad78 100644
--- a/lib/common_test/src/Makefile
+++ b/lib/common_test/src/Makefile
@@ -1,7 +1,7 @@
#
# %CopyrightBegin%
#
-# Copyright Ericsson AB 2003-2012. All Rights Reserved.
+# Copyright Ericsson AB 2003-2013. All Rights Reserved.
#
# The contents of this file are subject to the Erlang Public License,
# Version 1.1, (the "License"); you may not use this file except in
@@ -97,7 +97,7 @@ DTD_FILES = \
# ----------------------------------------------------
ERL_COMPILE_FLAGS += -pa ../ebin -I../include -I $(ERL_TOP)/lib/snmp/include/ \
-I../../test_server/include -I../../xmerl/inc/ \
- -I $(ERL_TOP)/lib/kernel/include
+ -I $(ERL_TOP)/lib/kernel/include -Werror
# ----------------------------------------------------
# Targets
@@ -127,10 +127,10 @@ clean:
# Special Build Targets
# ----------------------------------------------------
$(APP_TARGET): $(APP_SRC) ../vsn.mk
- sed -e 's;%VSN%;$(VSN);' $< > $@
+ $(vsn_verbose)sed -e 's;%VSN%;$(VSN);' $< > $@
$(APPUP_TARGET): $(APPUP_SRC) ../vsn.mk
- sed -e 's;%VSN%;$(VSN);' $< > $@
+ $(vsn_verbose)sed -e 's;%VSN%;$(VSN);' $< > $@
# ----------------------------------------------------
# Release Target
diff --git a/lib/common_test/src/ct.erl b/lib/common_test/src/ct.erl
index ad9bf4e2d6..04a95a53fa 100644
--- a/lib/common_test/src/ct.erl
+++ b/lib/common_test/src/ct.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -144,11 +144,11 @@ run(TestDirs) ->
%%% @spec run_test(Opts) -> Result
%%% Opts = [OptTuples]
%%% OptTuples = {dir,TestDirs} | {suite,Suites} | {group,Groups} |
-%%% {testcase,Cases} | {spec,TestSpecs} | {label,Label} |
-%%% {config,CfgFiles} | {userconfig, UserConfig} |
+%%% {testcase,Cases} | {spec,TestSpecs} | {join_specs,Bool} |
+%%% {label,Label} | {config,CfgFiles} | {userconfig, UserConfig} |
%%% {allow_user_terms,Bool} | {logdir,LogDir} |
%%% {silent_connections,Conns} | {stylesheet,CSSFile} |
-%%% {cover,CoverSpecFile} | {step,StepOpts} |
+%%% {cover,CoverSpecFile} | {cover_stop,Bool} | {step,StepOpts} |
%%% {event_handler,EventHandlers} | {include,InclDirs} |
%%% {auto_compile,Bool} | {create_priv_dir,CreatePrivDir} |
%%% {multiply_timetraps,M} | {scale_timetraps,Bool} |
@@ -735,7 +735,7 @@ fail(Format, Args) ->
%%% overwrites the string set by this function.</p>
comment(Comment) when is_list(Comment) ->
Formatted =
- case (catch io_lib:format("~s",[Comment])) of
+ case (catch io_lib:format("~ts",[Comment])) of
{'EXIT',_} -> % it's a list not a string
io_lib:format("~p",[Comment]);
String ->
@@ -988,8 +988,9 @@ get_testdata(Key) ->
end.
%%%-----------------------------------------------------------------
-%%% @spec abort_current_testcase(Reason) -> ok | {error,no_testcase_running}
+%%% @spec abort_current_testcase(Reason) -> ok | {error,ErrorReason}
%%% Reason = term()
+%%% ErrorReason = no_testcase_running | parallel_group
%%%
%%% @doc <p>When calling this function, the currently executing test case will be aborted.
%%% It is the user's responsibility to know for sure which test case is currently
diff --git a/lib/common_test/src/ct_config.erl b/lib/common_test/src/ct_config.erl
index b1d709bc75..c35cbd3c08 100644
--- a/lib/common_test/src/ct_config.erl
+++ b/lib/common_test/src/ct_config.erl
@@ -1,7 +1,7 @@
%%--------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2010-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2010-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -266,7 +266,10 @@ read_config_files_int([{Callback, File}|Files], FunToSave) ->
read_config_files_int([], _FunToSave) ->
ok.
-store_config(Config, Callback, File) ->
+store_config(Config, Callback, File) when is_tuple(Config) ->
+ store_config([Config], Callback, File);
+
+store_config(Config, Callback, File) when is_list(Config) ->
[ets:insert(?attr_table,
#ct_conf{key=Key,
value=Val,
@@ -607,7 +610,7 @@ encrypt_config_file(SrcFileName, EncryptFileName, {key,Key}) ->
EncBin = crypto:des3_cbc_encrypt(K1, K2, K3, IVec, Bin2),
case file:write_file(EncryptFileName, EncBin) of
ok ->
- io:format("~s --(encrypt)--> ~s~n",
+ io:format("~ts --(encrypt)--> ~ts~n",
[SrcFileName,EncryptFileName]),
ok;
{error,Reason} ->
@@ -649,7 +652,7 @@ decrypt_config_file(EncryptFileName, TargetFileName, {key,Key}) ->
_ ->
case file:write_file(TargetFileName, SrcBin) of
ok ->
- io:format("~s --(decrypt)--> ~s~n",
+ io:format("~ts --(decrypt)--> ~ts~n",
[EncryptFileName,TargetFileName]),
ok;
{error,Reason} ->
@@ -700,7 +703,7 @@ get_crypt_key_from_file() ->
_ ->
case catch string:tokens(binary_to_list(Result), [$\n,$\r]) of
[Key] ->
- io:format("~nCrypt key file: ~s~n", [FullName]),
+ io:format("~nCrypt key file: ~ts~n", [FullName]),
Key;
_ ->
{error,{bad_crypt_file,FullName}}
diff --git a/lib/common_test/src/ct_config_plain.erl b/lib/common_test/src/ct_config_plain.erl
index 237df5c8f3..c6547f0a40 100644
--- a/lib/common_test/src/ct_config_plain.erl
+++ b/lib/common_test/src/ct_config_plain.erl
@@ -1,7 +1,7 @@
%%--------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2010-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -47,7 +47,7 @@ read_config(ConfigFile) ->
{error,no_crypt_file} ->
{error,{config_file_error,
lists:flatten(
- io_lib:format("~s",[file:format_error(Reason)]))}};
+ io_lib:format("~ts",[file:format_error(Reason)]))}};
{error,CryptError} ->
{error,{decrypt_file_error,CryptError}};
_ when is_list(Key) ->
diff --git a/lib/common_test/src/ct_conn_log_h.erl b/lib/common_test/src/ct_conn_log_h.erl
index d7bd18606b..ac08a3e0ad 100644
--- a/lib/common_test/src/ct_conn_log_h.erl
+++ b/lib/common_test/src/ct_conn_log_h.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2012. All Rights Reserved.
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -52,7 +52,7 @@ open_files([],State) ->
do_open_files([{Tag,File}|Logs],Acc) ->
- case file:open(File, [write]) of
+ case file:open(File, [write,{encoding,utf8}]) of
{ok,Fd} ->
do_open_files(Logs,[{Tag,Fd}|Acc]);
{error,Reason} ->
@@ -98,9 +98,9 @@ terminate(_,#state{logs=Logs}) ->
%%% Writing reports
write_report(Time,#conn_log{module=ConnMod}=Info,Data,State) ->
{LogType,Fd} = get_log(Info,State),
- io:format(Fd,"~n~s~s~s",[format_head(ConnMod,LogType,Time),
- format_title(LogType,Info),
- format_data(ConnMod,LogType,Data)]).
+ io:format(Fd,"~n~ts~ts~ts",[format_head(ConnMod,LogType,Time),
+ format_title(LogType,Info),
+ format_data(ConnMod,LogType,Data)]).
write_error(Time,#conn_log{module=ConnMod}=Info,Report,State) ->
case get_log(Info,State) of
@@ -109,9 +109,10 @@ write_error(Time,#conn_log{module=ConnMod}=Info,Report,State) ->
%% sasl error handler, so don't write it again.
ok;
{LogType,Fd} ->
- io:format(Fd,"~n~s~s~s",[format_head(ConnMod,LogType,Time," ERROR"),
- format_title(LogType,Info),
- format_error(LogType,Report)])
+ io:format(Fd,"~n~ts~ts~ts",
+ [format_head(ConnMod,LogType,Time," ERROR"),
+ format_title(LogType,Info),
+ format_error(LogType,Report)])
end.
get_log(Info,State) ->
@@ -140,16 +141,16 @@ format_head(ConnMod,LogType,Time) ->
format_head(ConnMod,LogType,Time,"").
format_head(ConnMod,raw,Time,Text) ->
- io_lib:format("~n~p, ~p~s, ",[now_to_time(Time),ConnMod,Text]);
+ io_lib:format("~n~w, ~w~ts, ",[now_to_time(Time),ConnMod,Text]);
format_head(ConnMod,_,Time,Text) ->
Head = pad_char_end(?WIDTH,pretty_head(now_to_time(Time),ConnMod,Text),$=),
- io_lib:format("~n~s",[Head]).
+ io_lib:format("~n~ts",[Head]).
format_title(raw,#conn_log{client=Client}=Info) ->
- io_lib:format("Client ~p ~s ~s",[Client,actionstr(Info),serverstr(Info)]);
+ io_lib:format("Client ~w ~s ~ts",[Client,actionstr(Info),serverstr(Info)]);
format_title(_,Info) ->
Title = pad_char_end(?WIDTH,pretty_title(Info),$=),
- io_lib:format("~n~s", [Title]).
+ io_lib:format("~n~ts", [Title]).
format_data(_,_,NoData) when NoData == ""; NoData == <<>> ->
"";
@@ -162,8 +163,6 @@ format_error(pretty,Report) ->
[io_lib:format("~n ~p: ~p",[K,V]) || {K,V} <- Report].
-
-
%%%-----------------------------------------------------------------
%%% Helpers
conn_info(LoggingProc, #conn_log{client=undefined} = ConnInfo) ->
@@ -187,12 +186,12 @@ now_to_time({_,_,MicroS}=Now) ->
pretty_head({{{Y,Mo,D},{H,Mi,S}},MicroS},ConnMod,Text0) ->
Text = string:to_upper(atom_to_list(ConnMod) ++ Text0),
- io_lib:format("= ~s ==== ~s-~s-~p::~s:~s:~s,~s ",
+ io_lib:format("= ~s ==== ~s-~s-~w::~s:~s:~s,~s ",
[Text,t(D),month(Mo),Y,t(H),t(Mi),t(S),
micro2milli(MicroS)]).
pretty_title(#conn_log{client=Client}=Info) ->
- io_lib:format("= Client ~p ~s Server ~s ",
+ io_lib:format("= Client ~w ~s Server ~ts ",
[Client,actionstr(Info),serverstr(Info)]).
actionstr(#conn_log{action=send}) -> "----->";
@@ -204,7 +203,7 @@ actionstr(_) -> "<---->".
serverstr(#conn_log{name=undefined,address=Address}) ->
io_lib:format("~p",[Address]);
serverstr(#conn_log{name=Alias,address=Address}) ->
- io_lib:format("~p(~p)",[Alias,Address]).
+ io_lib:format("~w(~p)",[Alias,Address]).
month(1) -> "Jan";
month(2) -> "Feb";
diff --git a/lib/common_test/src/ct_cover.erl b/lib/common_test/src/ct_cover.erl
index d39f50ba00..ae671c750a 100644
--- a/lib/common_test/src/ct_cover.erl
+++ b/lib/common_test/src/ct_cover.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -24,7 +24,7 @@
-module(ct_cover).
--export([get_spec/1, add_nodes/1, remove_nodes/1]).
+-export([get_spec/1, add_nodes/1, remove_nodes/1, cross_cover_analyse/2]).
-include("ct_util.hrl").
@@ -100,6 +100,22 @@ remove_nodes(Nodes) ->
%%%-----------------------------------------------------------------
+%%% @spec cross_cover_analyse(Level,Tests) -> ok
+%%% Level = overview | details
+%%% Tests = [{Tag,Dir}]
+%%% Tag = atom()
+%%% Dir = string()
+%%%
+%%% @doc Accumulate cover results over multiple tests.
+%%% See the chapter about <seealso
+%%% marker="cover_chapter#cross_cover">cross cover
+%%% analysis</seealso> in the users's guide.
+%%%
+cross_cover_analyse(Level,Tests) ->
+ test_server_ctrl:cross_cover_analyse(Level,Tests).
+
+
+%%%-----------------------------------------------------------------
%%% @hidden
%% Read cover specification file and return the parsed info.
@@ -249,9 +265,11 @@ get_app_info(App=#cover{app=Name}, [{excl_mods,Name,Mods1}|Terms]) ->
Mods = App#cover.excl_mods,
get_app_info(App#cover{excl_mods=Mods++Mods1},Terms);
-get_app_info(App=#cover{app=Name}, [{cross_apps,Name,AppMods1}|Terms]) ->
- AppMods = App#cover.cross,
- get_app_info(App#cover{cross=AppMods++AppMods1},Terms);
+get_app_info(App=#cover{app=none}, [{cross,Cross}|Terms]) ->
+ get_app_info(App, [{cross,none,Cross}|Terms]);
+get_app_info(App=#cover{app=Name}, [{cross,Name,Cross1}|Terms]) ->
+ Cross = App#cover.cross,
+ get_app_info(App#cover{cross=Cross++Cross1},Terms);
get_app_info(App=#cover{app=none}, [{src_dirs,Dirs}|Terms]) ->
get_app_info(App, [{src_dirs,none,Dirs}|Terms]);
@@ -354,10 +372,10 @@ remove_excludes_and_dups(CoverData=#cover{excl_mods=Excl,incl_mods=Incl}) ->
files2mods(Info=#cover{excl_mods=ExclFs,
incl_mods=InclFs,
- cross=CrossFs}) ->
+ cross=Cross}) ->
Info#cover{excl_mods=files2mods1(ExclFs),
incl_mods=files2mods1(InclFs),
- cross=files2mods1(CrossFs)}.
+ cross=[{Tag,files2mods1(Fs)} || {Tag,Fs} <- Cross]}.
files2mods1([M|Fs]) when is_atom(M) ->
[M|files2mods1(Fs)];
diff --git a/lib/common_test/src/ct_event.erl b/lib/common_test/src/ct_event.erl
index 49e0635d79..c1c1d943b9 100644
--- a/lib/common_test/src/ct_event.erl
+++ b/lib/common_test/src/ct_event.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -150,7 +150,7 @@ init(RecvPids) ->
%%--------------------------------------------------------------------
handle_event(Event,State=#state{receivers=RecvPids}) ->
print("~n=== ~w ===~n", [?MODULE]),
- print("~p: ~p~n", [Event#event.name,Event#event.data]),
+ print("~w: ~w~n", [Event#event.name,Event#event.data]),
lists:foreach(fun(Recv) -> report_event(Recv,Event) end, RecvPids),
{ok,State}.
diff --git a/lib/common_test/src/ct_framework.erl b/lib/common_test/src/ct_framework.erl
index 403eab66cb..5fe4eaf511 100644
--- a/lib/common_test/src/ct_framework.erl
+++ b/lib/common_test/src/ct_framework.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -750,12 +750,12 @@ error_notification(Mod,Func,_Args,{Error,Loc}) ->
Descr1 = lists:flatten(io_lib:format("~P",[Descr,10])),
if length(Descr1) > 50 ->
Descr2 = string:substr(Descr1,1,50),
- io_lib:format("{badmatch,~s...}",[Descr2]);
+ io_lib:format("{badmatch,~ts...}",[Descr2]);
true ->
- io_lib:format("{badmatch,~s}",[Descr1])
+ io_lib:format("{badmatch,~ts}",[Descr1])
end;
{test_case_failed,Reason} ->
- case (catch io_lib:format("{test_case_failed,~s}", [Reason])) of
+ case (catch io_lib:format("{test_case_failed,~ts}", [Reason])) of
{'EXIT',_} ->
io_lib:format("{test_case_failed,~p}", [Reason]);
Result -> Result
@@ -788,7 +788,7 @@ error_notification(Mod,Func,_Args,{Error,Loc}) ->
"<font color=\"green\">" ++ "(" ++ "</font>"
++ Comment ++
"<font color=\"green\">" ++ ")" ++ "</font>",
- Str = io_lib:format("~s ~s", [ErrorHtml,CommentHtml]),
+ Str = io_lib:format("~ts ~ts", [ErrorHtml,CommentHtml]),
test_server:comment(Str)
end
end,
@@ -803,24 +803,24 @@ error_notification(Mod,Func,_Args,{Error,Loc}) ->
end,
case Loc of
[{?MODULE,error_in_suite}] ->
- PrintErr("Error in suite detected: ~s", [ErrStr]);
+ PrintErr("Error in suite detected: ~ts", [ErrStr]);
R when R == unknown; R == undefined ->
- PrintErr("Error detected: ~s", [ErrStr]);
+ PrintErr("Error detected: ~ts", [ErrStr]);
%% if a function specified by all/0 does not exist, we
%% pick up undef here
[{LastMod,LastFunc}|_] when ErrStr == "undef" ->
- PrintErr("~w:~w could not be executed~nReason: ~s",
+ PrintErr("~w:~w could not be executed~nReason: ~ts",
[LastMod,LastFunc,ErrStr]);
[{LastMod,LastFunc}|_] ->
- PrintErr("~w:~w failed~nReason: ~s", [LastMod,LastFunc,ErrStr]);
+ PrintErr("~w:~w failed~nReason: ~ts", [LastMod,LastFunc,ErrStr]);
[{LastMod,LastFunc,LastLine}|_] ->
%% print error to console, we are only
%% interested in the last executed expression
- PrintErr("~w:~w failed on line ~w~nReason: ~s",
+ PrintErr("~w:~w failed on line ~w~nReason: ~ts",
[LastMod,LastFunc,LastLine,ErrStr]),
case ct_util:read_suite_data({seq,Mod,Func}) of
@@ -1184,13 +1184,19 @@ report(What,Data) ->
ok;
{error,Reason} ->
ct_logs:log("COVER INFO",
- "Importing cover data from: ~s fails! "
+ "Importing cover data from: ~ts fails! "
"Reason: ~p", [Imp,Reason])
end
end, Imps)
end;
tests_done ->
ok;
+ severe_error ->
+ ct_event:sync_notify(#event{name=What,
+ node=node(),
+ data=Data}),
+ ct_util:set_testdata({What,Data}),
+ ok;
tc_start ->
%% Data = {{Suite,Func},LogFileName}
ct_event:sync_notify(#event{name=tc_logfile,
@@ -1343,4 +1349,7 @@ format_comment(Comment) ->
%%%-----------------------------------------------------------------
%%% @spec get_html_wrapper(TestName, PrintLabel, Cwd) -> Header
get_html_wrapper(TestName, PrintLabel, Cwd, TableCols) ->
- ct_logs:get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols).
+ get_html_wrapper(TestName, PrintLabel, Cwd, TableCols, utf8).
+
+get_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding) ->
+ ct_logs:get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding).
diff --git a/lib/common_test/src/ct_gen_conn.erl b/lib/common_test/src/ct_gen_conn.erl
index 1f01d84601..2d4b1d1f52 100644
--- a/lib/common_test/src/ct_gen_conn.erl
+++ b/lib/common_test/src/ct_gen_conn.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -272,7 +272,7 @@ call(Pid, Msg, Timeout) ->
after Timeout ->
erlang:demonitor(MRef, [flush]),
log("ct_gen_conn",
- "Connection process ~p not responding. Killing now!",
+ "Connection process ~w not responding. Killing now!",
[Pid]),
exit(Pid, kill),
{error,{process_down,Pid,forced_termination}}
diff --git a/lib/common_test/src/ct_groups.erl b/lib/common_test/src/ct_groups.erl
index 74ab5e5439..14a8aab881 100644
--- a/lib/common_test/src/ct_groups.erl
+++ b/lib/common_test/src/ct_groups.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -462,7 +462,7 @@ make_conf(Mod, Name, Props, TestSpec) ->
false ->
ct_logs:log("TEST INFO", "init_per_group/2 and "
"end_per_group/2 missing for group "
- "~p in ~p, using default.",
+ "~w in ~w, using default.",
[Name,Mod]),
{{ct_framework,init_per_group},
{ct_framework,end_per_group},
diff --git a/lib/common_test/src/ct_hooks.erl b/lib/common_test/src/ct_hooks.erl
index 1bcc63738e..3d87a82e24 100644
--- a/lib/common_test/src/ct_hooks.erl
+++ b/lib/common_test/src/ct_hooks.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -362,11 +362,11 @@ catch_apply(M,F,A, Default) ->
[{M,F,A,_}|_] when Reason == undef ->
Default;
Trace ->
- ct_logs:log("Suite Hook","Call to CTH failed: ~p:~p",
+ ct_logs:log("Suite Hook","Call to CTH failed: ~w:~p",
[error,{Reason,Trace}]),
throw({error_in_cth_call,
lists:flatten(
- io_lib:format("~p:~p/~p CTH call failed",
+ io_lib:format("~w:~w/~w CTH call failed",
[M,F,length(A)]))})
end
end.
diff --git a/lib/common_test/src/ct_logs.erl b/lib/common_test/src/ct_logs.erl
index 0b7a8bb075..5924930072 100644
--- a/lib/common_test/src/ct_logs.erl
+++ b/lib/common_test/src/ct_logs.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -35,9 +35,10 @@
-export([add_external_logs/1, add_link/3]).
-export([make_last_run_index/0]).
-export([make_all_suites_index/1,make_all_runs_index/1]).
--export([get_ts_html_wrapper/4]).
+-export([get_ts_html_wrapper/5]).
-export([xhtml/2, locate_priv_file/1, make_relative/1]).
-export([insert_javascript/1]).
+-export([uri/1]).
%% Logging stuff directly from testcase
-export([tc_log/3, tc_log/4, tc_log_async/3, tc_print/3, tc_print/4,
@@ -307,8 +308,8 @@ end_log() ->
%%% calling test suite.</p>
add_external_logs(Logs) ->
start_log("External Logs"),
- [cont_log("<a href=~p>~s</a>\n",
- [filename:join("log_private",Log),Log]) || Log <- Logs],
+ [cont_log("<a href=\"~ts\">~ts</a>\n",
+ [uri(filename:join("log_private",Log)),Log]) || Log <- Logs],
end_log().
%%%-----------------------------------------------------------------
@@ -320,8 +321,8 @@ add_external_logs(Logs) ->
%%% @doc Print a link to a given file stored in the priv_dir of the
%%% calling test suite.
add_link(Heading,File,Type) ->
- log(Heading,"<a href=~p type=~p>~s</a>\n",
- [filename:join("log_private",File),Type,File]).
+ log(Heading,"<a href=\"~ts\" type=~p>~ts</a>\n",
+ [uri(filename:join("log_private",File)),Type,File]).
%%%-----------------------------------------------------------------
@@ -469,7 +470,7 @@ ct_log(Category,Format,Args) ->
%%%=================================================================
%%% Internal functions
int_header() ->
- "<div class=\"ct_internal\"><b>*** CT ~s *** ~s</b>".
+ "<div class=\"ct_internal\"><b>*** CT ~s *** ~ts</b>".
int_footer() ->
"</div>".
@@ -692,7 +693,7 @@ logger_loop(State) ->
logger_loop(State);
{set_stylesheet,TC,SSFile} ->
Fd = State#logger_state.ct_log_fd,
- io:format(Fd, "~p loading external style sheet: ~s~n",
+ io:format(Fd, "~p loading external style sheet: ~ts~n",
[TC,SSFile]),
logger_loop(State#logger_state{stylesheet = SSFile});
{clear_stylesheet,_} when State#logger_state.stylesheet == undefined ->
@@ -752,7 +753,7 @@ print_to_log(sync, FromPid, TCGL, List, State) ->
IoProc = if FromPid /= TCGL -> TCGL;
true -> State#logger_state.ct_log_fd
end,
- io:format(IoProc, "~s", [lists:foldl(IoFun, [], List)]),
+ io:format(IoProc, "~ts", [lists:foldl(IoFun, [], List)]),
State;
print_to_log(async, FromPid, TCGL, List, State) ->
@@ -764,7 +765,7 @@ print_to_log(async, FromPid, TCGL, List, State) ->
end,
Printer = fun() ->
test_server:permit_io(IoProc, self()),
- io:format(IoProc, "~s", [lists:foldl(IoFun, [], List)])
+ io:format(IoProc, "~ts", [lists:foldl(IoFun, [], List)])
end,
case State#logger_state.async_print_jobs of
[] ->
@@ -868,7 +869,7 @@ set_evmgr_gl(GL) ->
end.
open_ctlog() ->
- {ok,Fd} = file:open(?ct_log_name,[write]),
+ {ok,Fd} = file:open(?ct_log_name,[write,{encoding,utf8}]),
io:format(Fd, header("Common Test Framework Log", {[],[1,2],[]}), []),
case file:consult(ct_run:variables_file_name("../")) of
{ok,Vars} ->
@@ -878,7 +879,7 @@ open_ctlog() ->
Dir = filename:dirname(Cwd),
Variables = ct_run:variables_file_name(Dir),
io:format(Fd,
- "Can not read the file \'~s\' Reason: ~w\n"
+ "Can not read the file \'~ts\' Reason: ~w\n"
"No configuration found for test!!\n",
[Variables,Reason])
end,
@@ -904,7 +905,7 @@ print_style(Fd,undefined) ->
print_style(Fd,StyleSheet) ->
case file:read_file(StyleSheet) of
{ok,Bin} ->
- Str = binary_to_list(Bin),
+ Str = b2s(Bin,encoding(StyleSheet)),
Pos0 = case string:str(Str,"<style>") of
0 -> string:str(Str,"<STYLE>");
N0 -> N0
@@ -919,9 +920,9 @@ print_style(Fd,StyleSheet) ->
print_style_error(Fd,StyleSheet,missing_style_end_tag);
Pos0 /= 0 ->
Style = string:sub_string(Str,Pos0,Pos1+7),
- io:format(Fd,"~s\n",[Style]);
+ io:format(Fd,"~ts\n",[Style]);
Pos0 == 0 ->
- io:format(Fd,"<style>~s</style>\n",[Str])
+ io:format(Fd,"<style>~ts</style>\n",[Str])
end;
{error,Reason} ->
print_style_error(Fd,StyleSheet,Reason)
@@ -934,7 +935,7 @@ print_style(Fd,StyleSheet) ->
%% [StyleSheet]).
print_style_error(Fd,StyleSheet,Reason) ->
- io:format(Fd,"\n<!-- Failed to load stylesheet ~s: ~p -->\n",
+ io:format(Fd,"\n<!-- Failed to load stylesheet ~ts: ~p -->\n",
[StyleSheet,Reason]),
print_style(Fd,undefined).
@@ -963,7 +964,7 @@ make_last_run_index(StartTime) ->
% io:put_chars("done\n"),
ok;
Err ->
- io:format("Unknown internal error while updating ~s. "
+ io:format("Unknown internal error while updating ~ts. "
"Please report.\n(Err: ~p, ID: 1)",
[AbsIndexName,Err]),
{error, Err}
@@ -1001,7 +1002,7 @@ make_last_run_index1(StartTime,IndexName) ->
%% write current Totals to file, later to be used in all_runs log
write_totals_file(?totals_name,Label,Logs1,Totals),
Index = [Index0|index_footer()],
- case force_write_file(IndexName, Index) of
+ case force_write_file(IndexName, unicode:characters_to_binary(Index)) of
ok ->
ok;
{error, Reason} ->
@@ -1085,7 +1086,7 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip,
CrashDumpName = SuiteName ++ "_erl_crash.dump",
case filelib:is_file(CrashDumpName) of
true ->
- ["&nbsp;<a href=\"", CrashDumpName,
+ ["&nbsp;<a href=\"", uri(CrashDumpName),
"\">(CrashDump)</a>"];
false ->
""
@@ -1115,10 +1116,10 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip,
[] -> "none";
_ -> "<a href=\""++?all_runs_name++"\">Old Runs</a>"
end,
- A = xhtml(["<td><font size=\"-1\"><a href=\"",CtLogFile,
+ A = xhtml(["<td><font size=\"-1\"><a href=\"",uri(CtLogFile),
"\">CT Log</a></font></td>\n",
"<td><font size=\"-1\">",OldRunsLink,"</font></td>\n"],
- ["<td><a href=\"",CtLogFile,"\">CT Log</a></td>\n",
+ ["<td><a href=\"",uri(CtLogFile),"\">CT Log</a></td>\n",
"<td>",OldRunsLink,"</td>\n"]),
{L,T,N,A};
false ->
@@ -1128,7 +1129,8 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip,
if NotBuilt == 0 ->
["<td align=right>",integer_to_list(NotBuilt),"</td>\n"];
true ->
- ["<td align=right><a href=\"",filename:join(CtRunDir,?ct_log_name),"\">",
+ ["<td align=right><a href=\"",
+ uri(filename:join(CtRunDir,?ct_log_name)),"\">",
integer_to_list(NotBuilt),"</a></td>\n"]
end,
FailStr =
@@ -1151,7 +1153,7 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip,
[xhtml("<tr valign=top>\n",
["<tr class=\"",odd_or_even(),"\">\n"]),
xhtml("<td><font size=\"-1\"><a href=\"", "<td><a href=\""),
- LogFile,"\">",SuiteName,"</a>", CrashDumpLink,
+ uri(LogFile),"\">",SuiteName,"</a>", CrashDumpLink,
xhtml("</font></td>\n", "</td>\n"),
Lbl, Timestamp,
"<td align=right>",integer_to_list(Success),"</td>\n",
@@ -1364,8 +1366,9 @@ header1(Title, SubTitle, TableCols) ->
"<head>\n",
"<title>" ++ Title ++ " " ++ SubTitle ++ "</title>\n",
"<meta http-equiv=\"cache-control\" content=\"no-cache\">\n",
+ "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n",
xhtml("",
- ["<link rel=\"stylesheet\" href=\"",CSSFile,"\" type=\"text/css\">\n"]),
+ ["<link rel=\"stylesheet\" href=\"",uri(CSSFile),"\" type=\"text/css\">\n"]),
xhtml("",
["<script type=\"text/javascript\" src=\"",JQueryFile,
"\"></script>\n"]),
@@ -1462,7 +1465,7 @@ count_cases(Dir) ->
LogFile = filename:join(Dir, ?suitelog_name),
case file:read_file(LogFile) of
{ok, Bin} ->
- case count_cases1(binary_to_list(Bin),
+ case count_cases1(b2s(Bin),
{undefined,undefined,undefined,undefined}) of
{error,not_complete} ->
%% The test is not complete - dont write summary
@@ -1557,7 +1560,7 @@ config_table1([{Key,Value}|Vars]) ->
"<td><pre>",io_lib:format("~p",[Value]),"</pre></td></tr>\n"],
["<tr class=\"", odd_or_even(), "\">\n",
"<td>", atom_to_list(Key), "</td>\n",
- "<td>", io_lib:format("~p",[Value]), "</td>\n</tr>\n"]) |
+ "<td>", io_lib:format("~p",[Value]), "</td>\n</tr>\n"]) |
config_table1(Vars)];
config_table1([]) ->
["</tbody>\n</table>\n"].
@@ -1574,8 +1577,9 @@ make_all_runs_index(When) ->
DirsSorted = (catch sort_all_runs(Dirs)),
Header = all_runs_header(),
Index = [runentry(Dir) || Dir <- DirsSorted],
- Result = file:write_file(AbsName,Header++Index++
- all_runs_index_footer()),
+ Result = file:write_file(AbsName,
+ unicode:characters_to_binary(
+ Header++Index++all_runs_index_footer())),
if When == start -> ok;
true -> io:put_chars("done\n")
end,
@@ -1602,10 +1606,27 @@ sort_all_runs(Dirs) ->
interactive_link() ->
[Dir|_] = lists:reverse(filelib:wildcard(logdir_prefix()++"*.*")),
CtLog = filename:join(Dir,"ctlog.html"),
- Body = ["Log from last interactive run: <a href=\"",CtLog,"\">",
- timestamp(Dir),"</a>"],
- file:write_file("last_interactive.html",Body),
- io:format("~n~nUpdated ~s\n"
+ Body =
+ [xhtml(
+ ["<!DOCTYPE HTML PUBLIC \"-//W3C//DTD HTML 3.2 Final//EN\">\n",
+ "<html>\n"],
+ ["<!DOCTYPE html PUBLIC \"-//W3C//DTD XHTML 1.0 Transitional//EN\"\n",
+ "\"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd\">\n",
+ "<html xmlns=\"http://www.w3.org/1999/xhtml\" xml:lang=\"en\" lang=\"en\">\n"]),
+ "<!-- autogenerated by '"++atom_to_list(?MODULE)++"' -->\n",
+ "<head>\n",
+ "<title>Last interactive run</title>\n",
+ "<meta http-equiv=\"cache-control\" content=\"no-cache\">\n",
+ "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n",
+ "</head>\n",
+ "<body>\n",
+ "Log from last interactive run: <a href=\"",uri(CtLog),"\">",
+ timestamp(Dir),"</a>",
+ "</body>\n",
+ "</html>\n"
+ ],
+ file:write_file("last_interactive.html",unicode:characters_to_binary(Body)),
+ io:format("~n~nUpdated ~ts\n"
"Any CT activities will be logged here\n",
[?abs("last_interactive.html")]).
@@ -1655,7 +1676,7 @@ runentry(Dir) ->
TestNames;
true ->
Trunc = Polish(string:substr(TestNames,1,?testname_width-3)),
- lists:flatten(io_lib:format("~s...",[Trunc]))
+ lists:flatten(io_lib:format("~ts...",[Trunc]))
end,
Total = TotSucc+TotFail+AllSkip,
A = xhtml(["<td align=center><font size=\"-1\">",Node,
@@ -1695,7 +1716,7 @@ runentry(Dir) ->
"<td align=right>?</td>\n"],
A++B++C
end,
- Index = filename:join(Dir,?index_name),
+ Index = uri(filename:join(Dir,?index_name)),
[xhtml("<tr>\n", ["<tr class=\"",odd_or_even(),"\">\n"]),
xhtml(["<td><font size=\"-1\"><a href=\"",Index,"\">",timestamp(Dir),"</a>",
TotalsStr,"</font></td>\n"],
@@ -1836,7 +1857,7 @@ make_all_suites_index(NewTestData = {_TestName,DirName}) ->
ok ->
ok;
Err ->
- io:format("Unknown internal error while updating ~s. "
+ io:format("Unknown internal error while updating ~ts. "
"Please report.\n(Err: ~p, ID: 1)",
[AbsIndexName,Err]),
{error, Err}
@@ -1900,7 +1921,7 @@ make_all_suites_index1(When, AbsIndexName, AllLogDirs) ->
ok
end;
Err ->
- io:format("Unknown internal error while updating ~s. "
+ io:format("Unknown internal error while updating ~ts. "
"Please report.\n(Err: ~p, ID: 1)",
[AbsIndexName,Err]),
{error, Err}
@@ -1912,7 +1933,7 @@ make_all_suites_index2(IndexName, AllTestLogDirs) ->
all_suites_index_header(),
0, 0, 0, 0, 0, [], []),
Index = [Index0|index_footer()],
- case force_write_file(IndexName, Index) of
+ case force_write_file(IndexName, unicode:characters_to_binary(Index)) of
ok ->
{ok,CacheData};
{error, Reason} ->
@@ -1970,7 +1991,7 @@ make_all_suites_ix_cached(AbsIndexName, NewTestData, Label, AllTestLogDirs) ->
all_suites_index_header(IndexDir),
0, 0, 0, 0, 0),
Index = [Index0|index_footer()],
- case force_write_file(AbsIndexName, Index) of
+ case force_write_file(AbsIndexName, unicode:characters_to_binary(Index)) of
ok ->
ok;
{error, Reason} ->
@@ -2116,7 +2137,7 @@ simulate_logger_loop() ->
receive
{log,_,_,_,_,_,List} ->
S = [[io_lib:format(Str,Args),io_lib:nl()] || {Str,Args} <- List],
- io:format("~s",[S]),
+ io:format("~ts",[S]),
simulate_logger_loop();
stop ->
ok
@@ -2273,11 +2294,12 @@ make_relative1(DirTs, CwdTs) ->
Ups ++ DirTs.
%%%-----------------------------------------------------------------
-%%% @spec get_ts_html_wrapper(TestName, PrintLabel, Cwd) -> {Mode,Header,Footer}
+%%% @spec get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding)
+%%% -> {Mode,Header,Footer}
%%%
%%% @doc
%%%
-get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols) ->
+get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding) ->
TestName1 = if is_list(TestName) ->
lists:flatten(TestName);
true ->
@@ -2319,14 +2341,16 @@ get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols) ->
"<html>\n",
"<head><title>", TestName1, "</title>\n",
"<meta http-equiv=\"cache-control\" content=\"no-cache\">\n",
+ "<meta http-equiv=\"content-type\" content=\"text/html; charset=",
+ html_encoding(Encoding),"\">\n",
"</head>\n",
"<body", Bgr, " bgcolor=\"white\" text=\"black\" ",
"link=\"blue\" vlink=\"purple\" alink=\"red\">\n",
LabelStr, "\n"],
["<center>\n<br><hr><p>\n",
- "<a href=\"", AllRuns,
+ "<a href=\"", uri(AllRuns),
"\">Test run history\n</a> | ",
- "<a href=\"", TestIndex,
+ "<a href=\"", uri(TestIndex),
"\">Top level test index\n</a>\n</p>\n",
Copyright,"</center>\n</body>\n</html>\n"]};
_ ->
@@ -2363,14 +2387,15 @@ get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols) ->
"<html xmlns=\"http://www.w3.org/1999/xhtml\" xml:lang=\"en\" lang=\"en\">\n",
"<head>\n<title>", TestName1, "</title>\n",
"<meta http-equiv=\"cache-control\" content=\"no-cache\">\n",
- "<link rel=\"stylesheet\" href=\"", CSSFile, "\" type=\"text/css\">\n",
+ "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n",
+ "<link rel=\"stylesheet\" href=\"", uri(CSSFile), "\" type=\"text/css\">\n",
"<script type=\"text/javascript\" src=\"", JQueryFile, "\"></script>\n",
"<script type=\"text/javascript\" src=\"", TableSorterFile, "\"></script>\n"] ++
TableSorterScript ++ ["</head>\n","<body>\n", LabelStr, "\n"],
["<center>\n<br /><hr /><p>\n",
- "<a href=\"", AllRuns,
+ "<a href=\"", uri(AllRuns),
"\">Test run history\n</a> | ",
- "<a href=\"", TestIndex,
+ "<a href=\"", uri(TestIndex),
"\">Top level test index\n</a>\n</p>\n",
Copyright,"</center>\n</body>\n</html>\n"]}
end.
@@ -2460,3 +2485,31 @@ insert_javascript({tablesorter,TableName,
" $(\"#",TableName,"\").trigger(\"update\");\n",
" $(\"#",TableName,"\").trigger(\"appendCache\");\n",
"});\n</script>\n"].
+
+uri("") ->
+ "";
+uri(Href) ->
+ test_server_ctrl:uri_encode(Href).
+
+%% Read magic comment to get encoding of text file.
+%% If no magic comment exists, assume default encoding
+encoding(File) ->
+ case epp:read_encoding(File) of
+ none ->
+ epp:default_encoding();
+ E ->
+ E
+ end.
+
+%% Convert binary to string using default encoding
+b2s(Bin) ->
+ b2s(Bin,epp:default_encoding()).
+
+%% Convert binary to string using given encoding
+b2s(Bin,Encoding) ->
+ unicode:characters_to_list(Bin,Encoding).
+
+html_encoding(latin1) ->
+ "iso-8859-1";
+html_encoding(utf8) ->
+ "utf-8".
diff --git a/lib/common_test/src/ct_make.erl b/lib/common_test/src/ct_make.erl
index 8ddb91d355..d4bd81e78d 100644
--- a/lib/common_test/src/ct_make.erl
+++ b/lib/common_test/src/ct_make.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -280,13 +280,13 @@ recompile(File, NoExec, Load, Opts) ->
do_recompile(_File, true, _Load, _Opts) ->
out_of_date;
do_recompile(File, false, noload, Opts) ->
- io:format("Recompile: ~s\n",[File]),
+ io:format("Recompile: ~ts\n",[File]),
compile:file(File, [report_errors, report_warnings, error_summary |Opts]);
do_recompile(File, false, load, Opts) ->
- io:format("Recompile: ~s\n",[File]),
+ io:format("Recompile: ~ts\n",[File]),
c:c(File, Opts);
do_recompile(File, false, netload, Opts) ->
- io:format("Recompile: ~s\n",[File]),
+ io:format("Recompile: ~ts\n",[File]),
c:nc(File, Opts).
exists(File) ->
diff --git a/lib/common_test/src/ct_master.erl b/lib/common_test/src/ct_master.erl
index 042c5ba267..e516f635d2 100644
--- a/lib/common_test/src/ct_master.erl
+++ b/lib/common_test/src/ct_master.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -51,7 +51,7 @@
%%% {testcase,Cases} | {spec,TestSpecs} | {allow_user_terms,Bool} |
%%% {logdir,LogDir} | {event_handler,EventHandlers} |
%%% {silent_connections,Conns} | {cover,CoverSpecFile} |
-%%% {userconfig, UserCfgFiles}
+%%% {cover_stop,Bool} | {userconfig, UserCfgFiles}
%%% CfgFiles = string() | [string()]
%%% TestDirs = string() | [string()]
%%% Suites = atom() | [atom()]
@@ -82,39 +82,48 @@ run_test(NodeOptsList) when is_list(NodeOptsList) ->
%%% ExclNodes = [atom()]
%%%
%%% @doc Tests are spawned on the nodes as specified in <code>TestSpecs</code>.
-%%% Each specification in TestSpec will be handled separately. It is however possible
-%%% to also specify a list of specifications that should be merged into one before
-%%% the tests are executed. Any test without a particular node specification will
-%%% also be executed on the nodes in <code>InclNodes</code>. Nodes in the
-%%% <code>ExclNodes</code> list will be excluded from the test.
+%%% Each specification in TestSpec will be handled separately. It is however
+%%% possible to also specify a list of specifications that should be merged
+%%% into one before the tests are executed. Any test without a particular node
+%%% specification will also be executed on the nodes in <code>InclNodes</code>.
+%%% Nodes in the <code>ExclNodes</code> list will be excluded from the test.
run([TS|TestSpecs],AllowUserTerms,InclNodes,ExclNodes) when is_list(TS),
is_list(InclNodes),
is_list(ExclNodes) ->
- TS1 =
- case TS of
- List=[S|_] when is_list(S) -> List;
- Spec -> [Spec]
- end,
- Result =
- case catch ct_testspec:collect_tests_from_file(TS1,InclNodes,AllowUserTerms) of
- {error,Reason} ->
- {error,Reason};
- TSRec=#testspec{logdir=AllLogDirs,
- config=StdCfgFiles,
- userconfig=UserCfgFiles,
- include=AllIncludes,
- init=AllInitOpts,
- event_handler=AllEvHs} ->
- AllCfgFiles = {StdCfgFiles, UserCfgFiles},
- RunSkipPerNode = ct_testspec:prepare_tests(TSRec),
- RunSkipPerNode2 = exclude_nodes(ExclNodes,RunSkipPerNode),
- run_all(RunSkipPerNode2,AllLogDirs,AllCfgFiles,AllEvHs,
- AllIncludes,[],[],AllInitOpts,TS1)
- end,
- [{TS,Result} | run(TestSpecs,AllowUserTerms,InclNodes,ExclNodes)];
+ %% Note: [Spec] means run one test with Spec
+ %% [Spec1,Spec2] means run two tests separately
+ %% [[Spec1,Spec2]] means run one test, with the two specs merged
+ case catch ct_testspec:collect_tests_from_file([TS],InclNodes,
+ AllowUserTerms) of
+ {error,Reason} ->
+ [{error,Reason} | run(TestSpecs,AllowUserTerms,InclNodes,ExclNodes)];
+ Tests ->
+ RunResult =
+ lists:map(
+ fun({Specs,TSRec=#testspec{logdir=AllLogDirs,
+ config=StdCfgFiles,
+ userconfig=UserCfgFiles,
+ include=AllIncludes,
+ init=AllInitOpts,
+ event_handler=AllEvHs}}) ->
+ AllCfgFiles =
+ {StdCfgFiles,UserCfgFiles},
+ RunSkipPerNode =
+ ct_testspec:prepare_tests(TSRec),
+ RunSkipPerNode2 =
+ exclude_nodes(ExclNodes,RunSkipPerNode),
+ TSList = if is_integer(hd(TS)) -> [TS];
+ true -> TS end,
+ {Specs,run_all(RunSkipPerNode2,AllLogDirs,
+ AllCfgFiles,AllEvHs,
+ AllIncludes,[],[],AllInitOpts,TSList)}
+ end, Tests),
+ RunResult ++ run(TestSpecs,AllowUserTerms,InclNodes,ExclNodes)
+ end;
run([],_,_,_) ->
[];
-run(TS,AllowUserTerms,InclNodes,ExclNodes) when is_list(InclNodes), is_list(ExclNodes) ->
+run(TS,AllowUserTerms,InclNodes,ExclNodes) when is_list(InclNodes),
+ is_list(ExclNodes) ->
run([TS],AllowUserTerms,InclNodes,ExclNodes).
%%%-----------------------------------------------------------------
@@ -152,29 +161,32 @@ exclude_nodes([],RunSkipPerNode) ->
%%% AllowUserTerms = bool()
%%% Node = atom()
%%%
-%%% @doc Tests are spawned on <code>Node</code> according to <code>TestSpecs</code>.
+%%% @doc Tests are spawned on <code>Node</code> according to
+%%% <code>TestSpecs</code>.
run_on_node([TS|TestSpecs],AllowUserTerms,Node) when is_list(TS),is_atom(Node) ->
- TS1 =
- case TS of
- [List|_] when is_list(List) -> List;
- Spec -> [Spec]
- end,
- Result =
- case catch ct_testspec:collect_tests_from_file(TS1,[Node],AllowUserTerms) of
- {error,Reason} ->
- {error,Reason};
- TSRec=#testspec{logdir=AllLogDirs,
- config=StdCfgFiles,
- init=AllInitOpts,
- include=AllIncludes,
- userconfig=UserCfgFiles,
- event_handler=AllEvHs} ->
- AllCfgFiles = {StdCfgFiles, UserCfgFiles},
- {Run,Skip} = ct_testspec:prepare_tests(TSRec,Node),
- run_all([{Node,Run,Skip}],AllLogDirs,AllCfgFiles,AllEvHs,
- AllIncludes, [],[],AllInitOpts,TS1)
- end,
- [{TS,Result} | run_on_node(TestSpecs,AllowUserTerms,Node)];
+ case catch ct_testspec:collect_tests_from_file([TS],[Node],
+ AllowUserTerms) of
+ {error,Reason} ->
+ [{error,Reason} | run_on_node(TestSpecs,AllowUserTerms,Node)];
+ Tests ->
+ RunResult =
+ lists:map(
+ fun({Specs,TSRec=#testspec{logdir=AllLogDirs,
+ config=StdCfgFiles,
+ init=AllInitOpts,
+ include=AllIncludes,
+ userconfig=UserCfgFiles,
+ event_handler=AllEvHs}}) ->
+ AllCfgFiles = {StdCfgFiles,UserCfgFiles},
+ {Run,Skip} = ct_testspec:prepare_tests(TSRec,Node),
+ TSList = if is_integer(hd(TS)) -> [TS];
+ true -> TS end,
+ {Specs,run_all([{Node,Run,Skip}],AllLogDirs,
+ AllCfgFiles,AllEvHs,
+ AllIncludes, [],[],AllInitOpts,TSList)}
+ end, Tests),
+ RunResult ++ run_on_node(TestSpecs,AllowUserTerms,Node)
+ end;
run_on_node([],_,_) ->
[];
run_on_node(TS,AllowUserTerms,Node) when is_atom(Node) ->
@@ -244,8 +256,9 @@ run_all([],AllLogDirs,_,AllEvHs,_AllIncludes,
{value,{_,Dir}} -> Dir;
false -> "."
end,
- log(tty,"Master Logdir","~s",[MasterLogDir]),
- start_master(lists:reverse(NodeOpts),Handlers,MasterLogDir,LogDirs,InitOptions,Specs),
+ log(tty,"Master Logdir","~ts",[MasterLogDir]),
+ start_master(lists:reverse(NodeOpts),Handlers,MasterLogDir,
+ LogDirs,InitOptions,Specs),
ok.
@@ -297,13 +310,15 @@ start_master(NodeOptsList) ->
start_master(NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Specs) ->
Master = spawn_link(?MODULE,init_master,[self(),NodeOptsList,EvHandlers,
- MasterLogDir,LogDirs,InitOptions,Specs]),
+ MasterLogDir,LogDirs,
+ InitOptions,Specs]),
receive
{Master,Result} -> Result
end.
%%% @hidden
-init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Specs) ->
+init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,
+ InitOptions,Specs) ->
case whereis(ct_master) of
undefined ->
register(ct_master,self()),
@@ -325,13 +340,14 @@ init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Spec
{MLPid,_} = ct_master_logs:start(MasterLogDir,
[N || {N,_} <- NodeOptsList]),
log(all,"Master Logger process started","~w",[MLPid]),
+
case Specs of
[] -> ok;
_ ->
SpecsStr = lists:map(fun(Name) ->
Name ++ " "
end,Specs),
- ct_master_logs:log("Test Specification file(s)","~s",
+ ct_master_logs:log("Test Specification file(s)","~ts",
[lists:flatten(SpecsStr)])
end,
@@ -340,7 +356,7 @@ init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Spec
ct_master_event:add_handler(),
%% add user handlers for master event manager
Add = fun({H,Args}) ->
- log(all,"Adding Event Handler","~p",[H]),
+ log(all,"Adding Event Handler","~w",[H]),
case gen_event:add_handler(?CT_MEVMGR_REF,H,Args) of
ok -> ok;
{'EXIT',Why} -> exit(Why);
@@ -359,7 +375,8 @@ init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Spec
init_master1(Parent,NodeOptsList,InitOptions,LogDirs).
init_master1(Parent,NodeOptsList,InitOptions,LogDirs) ->
- {Inaccessible,NodeOptsList1,InitOptions1} = init_nodes(NodeOptsList,InitOptions),
+ {Inaccessible,NodeOptsList1,InitOptions1} = init_nodes(NodeOptsList,
+ InitOptions),
case Inaccessible of
[] ->
init_master2(Parent,NodeOptsList,LogDirs);
@@ -391,8 +408,9 @@ init_master2(Parent,NodeOptsList,LogDirs) ->
SpawnAndMon =
fun({Node,Opts}) ->
monitor_node(Node,true),
- log(all,"Test Info","Starting test(s) on ~p...",[Node]),
- {spawn_link(Node,?MODULE,init_node_ctrl,[self(),Cookie,Opts]),Node}
+ log(all,"Test Info","Starting test(s) on ~w...",[Node]),
+ {spawn_link(Node,?MODULE,init_node_ctrl,[self(),Cookie,Opts]),
+ Node}
end,
NodeCtrlPids = lists:map(SpawnAndMon,NodeOptsList),
Result = master_loop(#state{node_ctrl_pids=NodeCtrlPids,
@@ -404,7 +422,8 @@ master_loop(#state{node_ctrl_pids=[],
results=Finished}) ->
Str =
lists:map(fun({Node,Result}) ->
- io_lib:format("~-40.40.*s~p\n",[$_,atom_to_list(Node),Result])
+ io_lib:format("~-40.40.*ts~p\n",
+ [$_,atom_to_list(Node),Result])
end,lists:reverse(Finished)),
log(all,"TEST RESULTS",Str,[]),
log(all,"Info","Updating log files",[]),
@@ -437,18 +456,20 @@ master_loop(State=#state{node_ctrl_pids=NodeCtrlPids,
Bad
end,
log(all,"Test Info",
- "Test on node ~w failed! Reason: ~p",[Node,Error]),
+ "Test on node ~w failed! Reason: ~p",
+ [Node,Error]),
{Locks1,Blocked1} =
update_queue(exit,Node,Locks,Blocked),
master_loop(State#state{node_ctrl_pids=NodeCtrlPids1,
- results=[{Node,Error}|Results],
+ results=[{Node,
+ Error}|Results],
locks=Locks1,
blocked=Blocked1})
end;
undefined ->
%% ignore (but report) exit from master_logger etc
log(all,"Test Info",
- "Warning! Process ~p has terminated. Reason: ~p",
+ "Warning! Process ~w has terminated. Reason: ~p",
[Pid,Reason]),
master_loop(State)
end;
@@ -531,7 +552,7 @@ update_queue(take,Node,From,Lock={Op,Resource},Locks,Blocked) ->
%% Blocked: [{{Operation,Resource},Node,WaitingPid},...]
case lists:keysearch(Lock,1,Locks) of
{value,{_Lock,Owner}} -> % other node has lock
- log(html,"Lock Info","Node ~p blocked on ~w by ~w. Resource: ~p",
+ log(html,"Lock Info","Node ~w blocked on ~w by ~w. Resource: ~p",
[Node,Op,Owner,Resource]),
Blocked1 = Blocked ++ [{Lock,Node,From}],
{Locks,Blocked1};
@@ -546,7 +567,7 @@ update_queue(release,Node,_From,Lock={Op,Resource},Locks,Blocked) ->
case lists:keysearch(Lock,1,Blocked) of
{value,E={Lock,SomeNode,WaitingPid}} ->
Blocked1 = lists:delete(E,Blocked),
- log(html,"Lock Info","Node ~p proceeds with ~w. Resource: ~p",
+ log(html,"Lock Info","Node ~w proceeds with ~w. Resource: ~p",
[SomeNode,Op,Resource]),
reply(ok,WaitingPid), % waiting process may start
{Locks1,Blocked1};
@@ -625,7 +646,8 @@ refresh_logs([D|Dirs],Refreshed) ->
refresh_logs([],Refreshed) ->
Str =
lists:map(fun({D,Result}) ->
- io_lib:format("Refreshing logs in ~p... ~p",[D,Result])
+ io_lib:format("Refreshing logs in ~p... ~p",
+ [D,Result])
end,Refreshed),
log(all,"Info",Str,[]).
@@ -638,7 +660,7 @@ init_node_ctrl(MasterPid,Cookie,Opts) ->
process_flag(trap_exit, true),
MasterNode = node(MasterPid),
group_leader(whereis(user),self()),
- io:format("~n********** node_ctrl process ~p started on ~p **********~n",
+ io:format("~n********** node_ctrl process ~w started on ~w **********~n",
[self(),node()]),
%% initially this node must have the same cookie as the master node
%% but now we set it explicitly for the connection so that test suites
@@ -671,7 +693,7 @@ init_node_ctrl(MasterPid,Cookie,Opts) ->
pong ->
MasterPid ! {self(),{result,Result}};
pang ->
- io:format("Warning! Connection to master node ~p is lost. "
+ io:format("Warning! Connection to master node ~w is lost. "
"Can't report result!~n~n", [MasterNode])
end.
@@ -696,8 +718,9 @@ status(MasterPid,Event) ->
log(To,Heading,Str,Args) ->
if To == all ; To == tty ->
- Str1 = ["=== ",Heading," ===\n",io_lib:format(Str,Args),"\n"],
- io:format(Str1,[]);
+ Chars = ["=== ",Heading," ===\n",
+ io_lib:format(Str,Args),"\n"],
+ io:put_chars(Chars);
true ->
ok
end,
@@ -751,21 +774,25 @@ start_nodes(InitOptions)->
IsAlive = lists:member(NodeName, nodes()),
case {HasNodeStart, IsAlive} of
{false, false}->
- io:format("WARNING: Node ~p is not alive but has no node_start option~n", [NodeName]);
+ io:format("WARNING: Node ~w is not alive but has no "
+ "node_start option~n", [NodeName]);
{false, true}->
- io:format("Node ~p is alive~n", [NodeName]);
+ io:format("Node ~w is alive~n", [NodeName]);
{true, false}->
{node_start, NodeStart} = lists:keyfind(node_start, 1, Options),
{value, {callback_module, Callback}, NodeStart2}=
lists:keytake(callback_module, 1, NodeStart),
case Callback:start(Host, Node, NodeStart2) of
{ok, NodeName} ->
- io:format("Node ~p started successfully with callback ~p~n", [NodeName,Callback]);
+ io:format("Node ~w started successfully "
+ "with callback ~w~n", [NodeName,Callback]);
{error, Reason, _NodeName} ->
- io:format("Failed to start node ~p with callback ~p! Reason: ~p~n", [NodeName, Callback, Reason])
+ io:format("Failed to start node ~w with callback ~w! "
+ "Reason: ~p~n", [NodeName, Callback, Reason])
end;
{true, true}->
- io:format("WARNING: Node ~p is alive but has node_start option~n", [NodeName])
+ io:format("WARNING: Node ~w is alive but has node_start "
+ "option~n", [NodeName])
end
end,
InitOptions).
@@ -778,7 +805,8 @@ eval_on_nodes(InitOptions)->
{false,_}->
ok;
{true,false}->
- io:format("WARNING: Node ~p is not alive but has eval option ~n", [NodeName]);
+ io:format("WARNING: Node ~w is not alive but has eval "
+ "option~n", [NodeName]);
{true,true}->
{eval, MFAs} = lists:keyfind(eval, 1, Options),
evaluate(NodeName, MFAs)
@@ -789,9 +817,11 @@ eval_on_nodes(InitOptions)->
evaluate(Node, [{M,F,A}|MFAs])->
case rpc:call(Node, M, F, A) of
{badrpc,Reason}->
- io:format("WARNING: Failed to call ~p:~p/~p on node ~p due to ~p~n", [M,F,length(A),Node,Reason]);
+ io:format("WARNING: Failed to call ~w:~w/~w on node ~w "
+ "due to ~p~n", [M,F,length(A),Node,Reason]);
Result->
- io:format("Called ~p:~p/~p on node ~p, result: ~p~n", [M,F,length(A),Node,Result])
+ io:format("Called ~w:~w/~w on node ~w, result: ~p~n",
+ [M,F,length(A),Node,Result])
end,
evaluate(Node, MFAs);
evaluate(_Node, [])->
diff --git a/lib/common_test/src/ct_master_event.erl b/lib/common_test/src/ct_master_event.erl
index a70baefaaf..5877b7c6f2 100644
--- a/lib/common_test/src/ct_master_event.erl
+++ b/lib/common_test/src/ct_master_event.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -114,13 +114,13 @@ init(_) ->
%% each installed event handler to handle the event.
%%--------------------------------------------------------------------
handle_event(#event{name=start_logging,node=Node,data=RunDir},State) ->
- ct_master_logs:log("CT Master Event Handler","Got ~s from ~p",[RunDir,Node]),
+ ct_master_logs:log("CT Master Event Handler","Got ~ts from ~w",[RunDir,Node]),
ct_master_logs:nodedir(Node,RunDir),
{ok,State};
handle_event(#event{name=Name,node=Node,data=Data},State) ->
print("~n=== ~w ===~n", [?MODULE]),
- print("~p on ~p: ~p~n", [Name,Node,Data]),
+ print("~w on ~w: ~p~n", [Name,Node,Data]),
{ok,State}.
%%--------------------------------------------------------------------
diff --git a/lib/common_test/src/ct_master_logs.erl b/lib/common_test/src/ct_master_logs.erl
index 9e61d5b16f..5393097f57 100644
--- a/lib/common_test/src/ct_master_logs.erl
+++ b/lib/common_test/src/ct_master_logs.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -133,8 +133,8 @@ init(Parent,LogDir,Nodes) ->
end,Nodes)),
io:format(CtLogFd,int_header(),[log_timestamp(now()),"Test Nodes\n"]),
- io:format(CtLogFd,"~s\n",[NodeStr]),
- io:format(CtLogFd,int_footer()++"\n",[]),
+ io:format(CtLogFd,"~ts\n",[NodeStr]),
+ io:put_chars(CtLogFd,[int_footer(),"\n"]),
NodeDirIxFd = open_nodedir_index(RunDirAbs,Time),
Parent ! {started,self(),{Time,RunDirAbs}},
@@ -201,25 +201,22 @@ loop(State) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%
open_ct_master_log(Dir) ->
FullName = filename:join(Dir,?ct_master_log_name),
- {ok,Fd} = file:open(FullName,[write]),
- io:format(Fd,header("Common Test Master Log", {[],[1,2],[]}),[]),
+ {ok,Fd} = file:open(FullName,[write,{encoding,utf8}]),
+ io:put_chars(Fd,header("Common Test Master Log", {[],[1,2],[]})),
%% maybe add config info here later
- io:format(Fd, config_table([]), []),
- io:format(Fd,
- "<style>\n"
- "div.ct_internal { background:lightgrey; color:black }\n"
- "div.default { background:lightgreen; color:black }\n"
- "</style>\n",
- []),
- io:format(Fd,
- xhtml("<br><h2>Progress Log</h2>\n<pre>\n",
- "<br /><h2>Progress Log</h2>\n<pre>\n"),
- []),
+ io:put_chars(Fd,config_table([])),
+ io:put_chars(Fd,
+ "<style>\n"
+ "div.ct_internal { background:lightgrey; color:black }\n"
+ "div.default { background:lightgreen; color:black }\n"
+ "</style>\n"),
+ io:put_chars(Fd,
+ xhtml("<br><h2>Progress Log</h2>\n<pre>\n",
+ "<br /><h2>Progress Log</h2>\n<pre>\n")),
Fd.
close_ct_master_log(Fd) ->
- io:format(Fd,"</pre>",[]),
- io:format(Fd,footer(),[]),
+ io:put_chars(Fd,["</pre>",footer()]),
file:close(Fd).
config_table(Vars) ->
@@ -238,7 +235,7 @@ config_table1([]) ->
["</tbody>\n</table>\n"].
int_header() ->
- "<div class=\"ct_internal\"><b>*** CT MASTER ~s *** ~s</b>".
+ "<div class=\"ct_internal\"><b>*** CT MASTER ~s *** ~ts</b>".
int_footer() ->
"</div>".
@@ -247,21 +244,22 @@ int_footer() ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
open_nodedir_index(Dir,StartTime) ->
FullName = filename:join(Dir,?nodedir_index_name),
- {ok,Fd} = file:open(FullName,[write]),
- io:format(Fd,nodedir_index_header(StartTime),[]),
+ {ok,Fd} = file:open(FullName,[write,{encoding,utf8}]),
+ io:put_chars(Fd,nodedir_index_header(StartTime)),
Fd.
print_nodedir(Node,RunDir,Fd) ->
Index = filename:join(RunDir,"index.html"),
- io:format(Fd,
- ["<tr>\n"
- "<td align=center>",atom_to_list(Node),"</td>\n",
- "<td align=left><a href=\"",Index,"\">",Index,"</a></td>\n",
- "</tr>\n"],[]),
+ io:put_chars(Fd,
+ ["<tr>\n"
+ "<td align=center>",atom_to_list(Node),"</td>\n",
+ "<td align=left><a href=\"",ct_logs:uri(Index),"\">",Index,
+ "</a></td>\n",
+ "</tr>\n"]),
ok.
close_nodedir_index(Fd) ->
- io:format(Fd,index_footer(),[]),
+ io:put_chars(Fd,index_footer()),
file:close(Fd).
nodedir_index_header(StartTime) ->
@@ -286,7 +284,9 @@ make_all_runs_index(LogDir) ->
DirsSorted = (catch sort_all_runs(Dirs)),
Header = all_runs_header(),
Index = [runentry(Dir) || Dir <- DirsSorted],
- Result = file:write_file(FullName,Header++Index++index_footer()),
+ Result = file:write_file(FullName,
+ unicode:characters_to_binary(
+ Header++Index++index_footer())),
Result.
sort_all_runs(Dirs) ->
@@ -326,7 +326,8 @@ runentry(Dir) ->
end,
Index = filename:join(Dir,?nodedir_index_name),
["<tr>\n"
- "<td align=center><a href=\"",Index,"\">",timestamp(Dir),"</a></td>\n",
+ "<td align=center><a href=\"",ct_logs:uri(Index),"\">",
+ timestamp(Dir),"</a></td>\n",
"<td align=center>",MasterStr,"</td>\n",
"<td align=center>",NodesStr,"</td>\n",
"</tr>\n"].
@@ -384,8 +385,10 @@ header(Title, TableCols) ->
"<head>\n",
"<title>" ++ Title ++ "</title>\n",
"<meta http-equiv=\"cache-control\" content=\"no-cache\">\n",
+ "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n",
xhtml("",
- ["<link rel=\"stylesheet\" href=\"",CSSFile,"\" type=\"text/css\">"]),
+ ["<link rel=\"stylesheet\" href=\"",ct_logs:uri(CSSFile),
+ "\" type=\"text/css\">"]),
xhtml("",
["<script type=\"text/javascript\" src=\"",JQueryFile,
"\"></script>\n"]),
diff --git a/lib/common_test/src/ct_master_status.erl b/lib/common_test/src/ct_master_status.erl
index 76060fb7bb..f9f511ecca 100644
--- a/lib/common_test/src/ct_master_status.erl
+++ b/lib/common_test/src/ct_master_status.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -70,7 +70,7 @@ init(_) ->
%%
handle_event(#event{name=Name,node=Node,data=Data},State) ->
print("~n=== ~w ===~n", [?MODULE]),
- print("~p on ~p: ~p~n", [Name,Node,Data]),
+ print("~w on ~w: ~p~n", [Name,Node,Data]),
{ok,State}.
%%--------------------------------------------------------------------
diff --git a/lib/common_test/src/ct_netconfc.erl b/lib/common_test/src/ct_netconfc.erl
index 294b82bff6..1339e53780 100644
--- a/lib/common_test/src/ct_netconfc.erl
+++ b/lib/common_test/src/ct_netconfc.erl
@@ -1,7 +1,7 @@
%%----------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2012. All Rights Reserved.
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -307,7 +307,7 @@
-type option() :: {ssh,host()} | {port,inet:port_number()} | {user,string()} |
{password,string()} | {user_dir,string()} |
{timeout,timeout()}.
--type host() :: inet:host_name() | inet:ip_address().
+-type host() :: inet:hostname() | inet:ip_address().
-type notification() :: {notification, xml_attributes(), notification_content()}.
-type notification_content() :: [event_time()|simple_xml()].
@@ -1073,7 +1073,8 @@ handle_msg({get_event_streams=Op,Streams,Timeout}, From, State) ->
SimpleXml = encode_rpc_operation(get,[Filter]),
do_send_rpc(Op, SimpleXml, Timeout, From, State).
-handle_msg({ssh_cm, _CM, {data, _Ch, _Type, Data}}, State) ->
+handle_msg({ssh_cm, CM, {data, Ch, _Type, Data}}, State) ->
+ ssh_connection:adjust_window(CM,Ch,size(Data)),
handle_data(Data, State);
handle_msg({ssh_cm, _CM, _SshCloseMsg}, State) ->
%% _SshCloseMsg can probably be one of
@@ -1280,10 +1281,11 @@ do_send(Connection, SimpleXml) ->
to_xml_doc(Simple) ->
Prolog = "<?xml version=\"1.0\" encoding=\"UTF-8\"?>",
- Xml = list_to_binary(xmerl:export_simple([Simple],
- xmerl_xml,
- [#xmlAttribute{name=prolog,
- value=Prolog}])),
+ Xml = unicode:characters_to_binary(
+ xmerl:export_simple([Simple],
+ xmerl_xml,
+ [#xmlAttribute{name=prolog,
+ value=Prolog}])),
<<Xml/binary,?END_TAG/binary>>.
%%%-----------------------------------------------------------------
@@ -1687,18 +1689,27 @@ log(#connection{host=Host,port=Port,name=Name},Action,Data) ->
%% Log callback - called from the error handler process
-format_data(raw,Data) ->
- io_lib:format("~n~s~n",[hide_password(Data)]);
-format_data(pretty,Data) ->
- io_lib:format("~n~s~n",[indent(Data)]);
-format_data(html,Data) ->
- io_lib:format("~n~s~n",[html_format(Data)]).
+format_data(How,Data) ->
+ %% Assuming that the data is encoded as UTF-8. If it is not, then
+ %% the printout might be wrong, but the format function will not
+ %% crash!
+ %% FIXME: should probably read encoding from the data and do
+ %% unicode:characters_to_binary(Data,InEncoding,utf8) when calling
+ %% log/3 instead of assuming utf8 in as done here!
+ do_format_data(How,unicode:characters_to_binary(Data)).
+
+do_format_data(raw,Data) ->
+ io_lib:format("~n~ts~n",[hide_password(Data)]);
+do_format_data(pretty,Data) ->
+ io_lib:format("~n~ts~n",[indent(Data)]);
+do_format_data(html,Data) ->
+ io_lib:format("~n~ts~n",[html_format(Data)]).
%%%-----------------------------------------------------------------
%%% Hide password elements from XML data
hide_password(Bin) ->
re:replace(Bin,<<"(<password[^>]*>)[^<]*(</password>)">>,<<"\\1*****\\2">>,
- [global,{return,binary}]).
+ [global,{return,binary},unicode]).
%%%-----------------------------------------------------------------
%%% HTML formatting
@@ -1716,13 +1727,13 @@ indent(Bin) ->
Part ->
indent1(lists:reverse(Part)++String,erase(indent))
end,
- list_to_binary(IndentedString).
+ unicode:characters_to_binary(IndentedString).
%% Normalizes the XML document by removing all space and newline
%% between two XML tags.
%% Returns a list, no matter if the input was a list or a binary.
-normalize(Str) ->
- re:replace(Str,<<">[ \r\n\t]+<">>,<<"><">>,[global,{return,list}]).
+normalize(Bin) ->
+ re:replace(Bin,<<">[ \r\n\t]+<">>,<<"><">>,[global,{return,list},unicode]).
indent1("<?"++Rest1,Indent1) ->
@@ -1805,7 +1816,8 @@ get_tag([]) ->
%%% SSH stuff
ssh_receive_data() ->
receive
- {ssh_cm, _CM, {data, _Ch, _Type, Data}} ->
+ {ssh_cm, CM, {data, Ch, _Type, Data}} ->
+ ssh_connection:adjust_window(CM,Ch,size(Data)),
{ok, Data};
{ssh_cm, _CM, {Closed, _Ch}} = X when Closed == closed; Closed == eof ->
{error,X};
diff --git a/lib/common_test/src/ct_run.erl b/lib/common_test/src/ct_run.erl
index 96b2934382..c0bdbb2a09 100644
--- a/lib/common_test/src/ct_run.erl
+++ b/lib/common_test/src/ct_run.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -58,6 +58,7 @@
vts,
shell,
cover,
+ cover_stop,
coverspec,
step,
logdir,
@@ -147,7 +148,7 @@ script_start(Args) ->
_ -> ""
end
end,
- io:format("~nCommon Test~s starting (cwd is ~s)~n~n",
+ io:format("~nCommon Test~s starting (cwd is ~ts)~n~n",
[CTVsn,Cwd]),
Self = self(),
Pid = spawn_link(fun() -> script_start1(Self, Args) end),
@@ -245,6 +246,7 @@ script_start1(Parent, Args) ->
Vts = get_start_opt(vts, true, Args),
Shell = get_start_opt(shell, true, Args),
Cover = get_start_opt(cover, fun([CoverFile]) -> ?abs(CoverFile) end, Args),
+ CoverStop = get_start_opt(cover_stop, fun([CS]) -> list_to_atom(CS) end, Args),
LogDir = get_start_opt(logdir, fun([LogD]) -> LogD end, Args),
LogOpts = get_start_opt(logopts, fun(Os) -> [list_to_atom(O) || O <- Os] end,
[], Args),
@@ -328,32 +330,33 @@ script_start1(Parent, Args) ->
true
end,
- StartOpts = #opts{label = Label, profile = Profile,
- vts = Vts, shell = Shell, cover = Cover,
- logdir = LogDir, logopts = LogOpts,
- basic_html = BasicHtml,
- verbosity = Verbosity,
- event_handlers = EvHandlers,
- ct_hooks = CTHooks,
- enable_builtin_hooks = EnableBuiltinHooks,
- auto_compile = AutoCompile,
- include = IncludeDirs,
- silent_connections = SilentConns,
- stylesheet = Stylesheet,
- multiply_timetraps = MultTT,
- scale_timetraps = ScaleTT,
- create_priv_dir = CreatePrivDir,
- starter = script},
-
+ Opts = #opts{label = Label, profile = Profile,
+ vts = Vts, shell = Shell,
+ cover = Cover, cover_stop = CoverStop,
+ logdir = LogDir, logopts = LogOpts,
+ basic_html = BasicHtml,
+ verbosity = Verbosity,
+ event_handlers = EvHandlers,
+ ct_hooks = CTHooks,
+ enable_builtin_hooks = EnableBuiltinHooks,
+ auto_compile = AutoCompile,
+ include = IncludeDirs,
+ silent_connections = SilentConns,
+ stylesheet = Stylesheet,
+ multiply_timetraps = MultTT,
+ scale_timetraps = ScaleTT,
+ create_priv_dir = CreatePrivDir,
+ starter = script},
+
%% check if log files should be refreshed or go on to run tests...
- Result = run_or_refresh(StartOpts, Args),
+ Result = run_or_refresh(Opts, Args),
%% send final results to starting process waiting in script_start/0
Parent ! {self(), Result}.
-run_or_refresh(StartOpts = #opts{logdir = LogDir}, Args) ->
+run_or_refresh(Opts = #opts{logdir = LogDir}, Args) ->
case proplists:get_value(refresh_logs, Args) of
undefined ->
- script_start2(StartOpts, Args);
+ script_start2(Opts, Args);
Refresh ->
LogDir1 = case Refresh of
[] -> which(logdir,LogDir);
@@ -375,167 +378,203 @@ run_or_refresh(StartOpts = #opts{logdir = LogDir}, Args) ->
{error,{all_suites_index,ASReason}};
_ ->
file:set_cwd(Cwd),
- io:format("Logs in ~s refreshed!~n~n", [LogDir1]),
+ io:format("Logs in ~ts refreshed!~n~n",
+ [LogDir1]),
timer:sleep(500), % time to flush io before quitting
ok
end
end
end.
-script_start2(StartOpts = #opts{vts = undefined,
- shell = undefined}, Args) ->
- TestSpec = proplists:get_value(spec, Args),
- {Terms,Opts} =
- case TestSpec of
- Specs when Specs =/= [], Specs =/= undefined ->
- %% using testspec as input for test
- Relaxed = get_start_opt(allow_user_terms, true, false, Args),
- case catch ct_testspec:collect_tests_from_file(Specs, Relaxed) of
- {E,Reason} when E == error ; E == 'EXIT' ->
- {{error,Reason},StartOpts};
- TS ->
- SpecStartOpts = get_data_for_node(TS, node()),
-
- Label = choose_val(StartOpts#opts.label,
- SpecStartOpts#opts.label),
-
- Profile = choose_val(StartOpts#opts.profile,
- SpecStartOpts#opts.profile),
-
- LogDir = choose_val(StartOpts#opts.logdir,
- SpecStartOpts#opts.logdir),
-
- AllLogOpts = merge_vals([StartOpts#opts.logopts,
- SpecStartOpts#opts.logopts]),
- AllVerbosity =
- merge_keyvals([StartOpts#opts.verbosity,
- SpecStartOpts#opts.verbosity]),
- AllSilentConns =
- merge_vals([StartOpts#opts.silent_connections,
- SpecStartOpts#opts.silent_connections]),
- Cover =
- choose_val(StartOpts#opts.cover,
- SpecStartOpts#opts.cover),
- MultTT =
- choose_val(StartOpts#opts.multiply_timetraps,
- SpecStartOpts#opts.multiply_timetraps),
- ScaleTT =
- choose_val(StartOpts#opts.scale_timetraps,
- SpecStartOpts#opts.scale_timetraps),
-
- CreatePrivDir =
- choose_val(StartOpts#opts.create_priv_dir,
- SpecStartOpts#opts.create_priv_dir),
-
- AllEvHs =
- merge_vals([StartOpts#opts.event_handlers,
- SpecStartOpts#opts.event_handlers]),
-
- AllCTHooks = merge_vals(
- [StartOpts#opts.ct_hooks,
- SpecStartOpts#opts.ct_hooks]),
-
- EnableBuiltinHooks =
- choose_val(
- StartOpts#opts.enable_builtin_hooks,
- SpecStartOpts#opts.enable_builtin_hooks),
-
- Stylesheet =
- choose_val(StartOpts#opts.stylesheet,
- SpecStartOpts#opts.stylesheet),
-
- AllInclude = merge_vals([StartOpts#opts.include,
- SpecStartOpts#opts.include]),
- application:set_env(common_test, include, AllInclude),
-
- AutoCompile =
- case choose_val(StartOpts#opts.auto_compile,
- SpecStartOpts#opts.auto_compile) of
- undefined ->
- true;
- ACBool ->
- application:set_env(common_test,
- auto_compile,
- ACBool),
- ACBool
- end,
-
- BasicHtml =
- case choose_val(StartOpts#opts.basic_html,
- SpecStartOpts#opts.basic_html) of
- undefined ->
- false;
- BHBool ->
- application:set_env(common_test, basic_html,
- BHBool),
- BHBool
- end,
-
- {TS,StartOpts#opts{label = Label,
- profile = Profile,
- testspecs = Specs,
- cover = Cover,
- logdir = LogDir,
- logopts = AllLogOpts,
- basic_html = BasicHtml,
- verbosity = AllVerbosity,
- silent_connections = AllSilentConns,
- config = SpecStartOpts#opts.config,
- event_handlers = AllEvHs,
- ct_hooks = AllCTHooks,
- enable_builtin_hooks =
- EnableBuiltinHooks,
- stylesheet = Stylesheet,
- auto_compile = AutoCompile,
- include = AllInclude,
- multiply_timetraps = MultTT,
- scale_timetraps = ScaleTT,
- create_priv_dir = CreatePrivDir}}
- end;
- _ ->
- {undefined,StartOpts}
- end,
- %% read config/userconfig from start flags
- InitConfig = ct_config:prepare_config_list(Args),
- TheLogDir = which(logdir, Opts#opts.logdir),
- case {TestSpec,Terms} of
- {_,{error,_}=Error} ->
- Error;
- {[],_} ->
+script_start2(Opts = #opts{vts = undefined,
+ shell = undefined}, Args) ->
+ case proplists:get_value(spec, Args) of
+ Specs when Specs =/= [], Specs =/= undefined ->
+ Specs1 = get_start_opt(join_specs, [Specs], Specs, Args),
+ %% using testspec as input for test
+ Relaxed = get_start_opt(allow_user_terms, true, false, Args),
+ case catch ct_testspec:collect_tests_from_file(Specs1, Relaxed) of
+ {E,Reason} when E == error ; E == 'EXIT' ->
+ {error,Reason};
+ TestSpecData ->
+ execute_all_specs(TestSpecData, Opts, Args, [])
+ end;
+ [] ->
{error,no_testspec_specified};
- {undefined,_} -> % no testspec used
- case check_and_install_configfiles(InitConfig, TheLogDir, Opts) of
+ _ -> % no testspec used
+ %% read config/userconfig from start flags
+ InitConfig = ct_config:prepare_config_list(Args),
+ TheLogDir = which(logdir, Opts#opts.logdir),
+ case check_and_install_configfiles(InitConfig,
+ TheLogDir,
+ Opts) of
ok -> % go on read tests from start flags
script_start3(Opts#opts{config=InitConfig,
logdir=TheLogDir}, Args);
Error ->
Error
- end;
- {_,_} -> % testspec used
- %% merge config from start flags with config from testspec
- AllConfig = merge_vals([InitConfig, Opts#opts.config]),
- case check_and_install_configfiles(AllConfig, TheLogDir, Opts) of
- ok -> % read tests from spec
- {Run,Skip} = ct_testspec:prepare_tests(Terms, node()),
- do_run(Run, Skip, Opts#opts{config=AllConfig,
- logdir=TheLogDir}, Args);
- Error ->
- Error
end
end;
-script_start2(StartOpts, Args) ->
+script_start2(Opts, Args) ->
%% read config/userconfig from start flags
InitConfig = ct_config:prepare_config_list(Args),
- LogDir = which(logdir, StartOpts#opts.logdir),
- case check_and_install_configfiles(InitConfig, LogDir, StartOpts) of
+ LogDir = which(logdir, Opts#opts.logdir),
+ case check_and_install_configfiles(InitConfig, LogDir, Opts) of
ok -> % go on read tests from start flags
- script_start3(StartOpts#opts{config=InitConfig,
- logdir=LogDir}, Args);
+ script_start3(Opts#opts{config=InitConfig,
+ logdir=LogDir}, Args);
+ Error ->
+ Error
+ end.
+
+execute_all_specs([], _, _, Result) ->
+ Result1 = lists:reverse(Result),
+ case lists:keysearch('EXIT', 1, Result1) of
+ {value,{_,_,ExitReason}} ->
+ exit(ExitReason);
+ false ->
+ case lists:keysearch(error, 1, Result1) of
+ {value,Error} ->
+ Error;
+ false ->
+ lists:foldl(fun({Ok,Fail,{UserSkip,AutoSkip}},
+ {Ok1,Fail1,{UserSkip1,AutoSkip1}}) ->
+ {Ok1+Ok,Fail1+Fail,
+ {UserSkip1+UserSkip,
+ AutoSkip1+AutoSkip}}
+ end, {0,0,{0,0}}, Result1)
+ end
+ end;
+
+execute_all_specs([{Specs,TS} | TSs], Opts, Args, Result) ->
+ CombinedOpts = combine_test_opts(TS, Specs, Opts),
+ try execute_one_spec(TS, CombinedOpts, Args) of
+ ExecResult ->
+ execute_all_specs(TSs, Opts, Args, [ExecResult|Result])
+ catch
+ _ : ExitReason ->
+ execute_all_specs(TSs, Opts, Args,
+ [{'EXIT',self(),ExitReason}|Result])
+ end.
+
+execute_one_spec(TS, Opts, Args) ->
+ %% read config/userconfig from start flags
+ InitConfig = ct_config:prepare_config_list(Args),
+ TheLogDir = which(logdir, Opts#opts.logdir),
+ %% merge config from start flags with config from testspec
+ AllConfig = merge_vals([InitConfig, Opts#opts.config]),
+ case check_and_install_configfiles(AllConfig, TheLogDir, Opts) of
+ ok -> % read tests from spec
+ {Run,Skip} = ct_testspec:prepare_tests(TS, node()),
+ do_run(Run, Skip, Opts#opts{config=AllConfig,
+ logdir=TheLogDir}, Args);
Error ->
Error
end.
+combine_test_opts(TS, Specs, Opts) ->
+ TSOpts = get_data_for_node(TS, node()),
+
+ Label = choose_val(Opts#opts.label,
+ TSOpts#opts.label),
+
+ Profile = choose_val(Opts#opts.profile,
+ TSOpts#opts.profile),
+
+ LogDir = choose_val(Opts#opts.logdir,
+ TSOpts#opts.logdir),
+
+ AllLogOpts = merge_vals([Opts#opts.logopts,
+ TSOpts#opts.logopts]),
+ AllVerbosity =
+ merge_keyvals([Opts#opts.verbosity,
+ TSOpts#opts.verbosity]),
+ AllSilentConns =
+ merge_vals([Opts#opts.silent_connections,
+ TSOpts#opts.silent_connections]),
+ Cover =
+ choose_val(Opts#opts.cover,
+ TSOpts#opts.cover),
+ CoverStop =
+ choose_val(Opts#opts.cover_stop,
+ TSOpts#opts.cover_stop),
+ MultTT =
+ choose_val(Opts#opts.multiply_timetraps,
+ TSOpts#opts.multiply_timetraps),
+ ScaleTT =
+ choose_val(Opts#opts.scale_timetraps,
+ TSOpts#opts.scale_timetraps),
+
+ CreatePrivDir =
+ choose_val(Opts#opts.create_priv_dir,
+ TSOpts#opts.create_priv_dir),
+
+ AllEvHs =
+ merge_vals([Opts#opts.event_handlers,
+ TSOpts#opts.event_handlers]),
+
+ AllCTHooks = merge_vals(
+ [Opts#opts.ct_hooks,
+ TSOpts#opts.ct_hooks]),
+
+ EnableBuiltinHooks =
+ choose_val(
+ Opts#opts.enable_builtin_hooks,
+ TSOpts#opts.enable_builtin_hooks),
+
+ Stylesheet =
+ choose_val(Opts#opts.stylesheet,
+ TSOpts#opts.stylesheet),
+
+ AllInclude = merge_vals([Opts#opts.include,
+ TSOpts#opts.include]),
+ application:set_env(common_test, include, AllInclude),
+
+ AutoCompile =
+ case choose_val(Opts#opts.auto_compile,
+ TSOpts#opts.auto_compile) of
+ undefined ->
+ true;
+ ACBool ->
+ application:set_env(common_test,
+ auto_compile,
+ ACBool),
+ ACBool
+ end,
+
+ BasicHtml =
+ case choose_val(Opts#opts.basic_html,
+ TSOpts#opts.basic_html) of
+ undefined ->
+ false;
+ BHBool ->
+ application:set_env(common_test, basic_html,
+ BHBool),
+ BHBool
+ end,
+
+ Opts#opts{label = Label,
+ profile = Profile,
+ testspecs = Specs,
+ cover = Cover,
+ cover_stop = CoverStop,
+ logdir = which(logdir, LogDir),
+ logopts = AllLogOpts,
+ basic_html = BasicHtml,
+ verbosity = AllVerbosity,
+ silent_connections = AllSilentConns,
+ config = TSOpts#opts.config,
+ event_handlers = AllEvHs,
+ ct_hooks = AllCTHooks,
+ enable_builtin_hooks = EnableBuiltinHooks,
+ stylesheet = Stylesheet,
+ auto_compile = AutoCompile,
+ include = AllInclude,
+ multiply_timetraps = MultTT,
+ scale_timetraps = ScaleTT,
+ create_priv_dir = CreatePrivDir}.
+
check_and_install_configfiles(
Configs, LogDir, #opts{
event_handlers = EvHandlers,
@@ -555,12 +594,12 @@ check_and_install_configfiles(
{error,{cant_load_callback_module,Info}}
end.
-script_start3(StartOpts, Args) ->
- StartOpts1 = get_start_opt(step,
- fun(Step) ->
- StartOpts#opts{step = Step,
- cover = undefined}
- end, StartOpts, Args),
+script_start3(Opts, Args) ->
+ Opts1 = get_start_opt(step,
+ fun(Step) ->
+ Opts#opts{step = Step,
+ cover = undefined}
+ end, Opts, Args),
case {proplists:get_value(dir, Args),
proplists:get_value(suite, Args),
groups_and_cases(proplists:get_value(group, Args),
@@ -574,17 +613,17 @@ script_start3(StartOpts, Args) ->
{error,no_dir_specified};
{Dirs,undefined,[]} when is_list(Dirs) ->
- script_start4(StartOpts#opts{tests = tests(Dirs)}, Args);
+ script_start4(Opts#opts{tests = tests(Dirs)}, Args);
{undefined,Suites,[]} when is_list(Suites) ->
Ts = tests([suite_to_test(S) || S <- Suites]),
- script_start4(StartOpts1#opts{tests = Ts}, Args);
+ script_start4(Opts1#opts{tests = Ts}, Args);
{undefined,Suite,GsAndCs} when is_list(Suite) ->
case [suite_to_test(S) || S <- Suite] of
DirMods = [_] ->
Ts = tests(DirMods, GsAndCs),
- script_start4(StartOpts1#opts{tests = Ts}, Args);
+ script_start4(Opts1#opts{tests = Ts}, Args);
[_,_|_] ->
{error,multiple_suites_and_cases};
_ ->
@@ -598,10 +637,10 @@ script_start3(StartOpts, Args) ->
case [suite_to_test(Dir,S) || S <- Suite] of
DirMods when GsAndCs == [] ->
Ts = tests(DirMods),
- script_start4(StartOpts1#opts{tests = Ts}, Args);
+ script_start4(Opts1#opts{tests = Ts}, Args);
DirMods = [_] when GsAndCs /= [] ->
Ts = tests(DirMods, GsAndCs),
- script_start4(StartOpts1#opts{tests = Ts}, Args);
+ script_start4(Opts1#opts{tests = Ts}, Args);
[_,_|_] when GsAndCs /= [] ->
{error,multiple_suites_and_cases};
_ ->
@@ -612,8 +651,8 @@ script_start3(StartOpts, Args) ->
{error,incorrect_start_options};
{undefined,undefined,_} ->
- if StartOpts#opts.vts ; StartOpts#opts.shell ->
- script_start4(StartOpts#opts{tests = []}, Args);
+ if Opts#opts.vts ; Opts#opts.shell ->
+ script_start4(Opts#opts{tests = []}, Args);
true ->
script_usage(),
{error,missing_start_options}
@@ -723,6 +762,7 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
+ "\n\t[-cover_stop Bool]"
"\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
"\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
@@ -742,9 +782,11 @@ script_usage() ->
"\n\t[-logopts LogOpt1 LogOpt2 .. LogOptN]"
"\n\t[-verbosity GenVLvl | [CategoryVLvl1 .. CategoryVLvlN]]"
"\n\t[-allow_user_terms]"
+ "\n\t[-join_specs]"
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
+ "\n\t[-cover_stop Bool]"
"\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
"\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
@@ -839,7 +881,7 @@ run_test1(StartOpts) when is_list(StartOpts) ->
undefined ->
Tracing = start_trace(StartOpts),
{ok,Cwd} = file:get_cwd(),
- io:format("~nCommon Test starting (cwd is ~s)~n~n", [Cwd]),
+ io:format("~nCommon Test starting (cwd is ~ts)~n~n", [Cwd]),
Res =
case ct_repeat:loop_test(func, StartOpts) of
false ->
@@ -938,6 +980,7 @@ run_test2(StartOpts) ->
%% code coverage
Cover = get_start_opt(cover,
fun(CoverFile) -> ?abs(CoverFile) end, StartOpts),
+ CoverStop = get_start_opt(cover_stop, value, StartOpts),
%% timetrap manipulation
MultiplyTT = get_start_opt(multiply_timetraps, value, 1, StartOpts),
@@ -1000,7 +1043,8 @@ run_test2(StartOpts) ->
Step = get_start_opt(step, value, StartOpts),
Opts = #opts{label = Label, profile = Profile,
- cover = Cover, step = Step, logdir = LogDir,
+ cover = Cover, cover_stop = CoverStop,
+ step = Step, logdir = LogDir,
logopts = LogOpts, basic_html = BasicHtml,
config = CfgFiles,
verbosity = Verbosity,
@@ -1033,102 +1077,60 @@ run_test2(StartOpts) ->
end.
run_spec_file(Relaxed,
- Opts = #opts{testspecs = Specs, config = CfgFiles},
+ Opts = #opts{testspecs = Specs},
StartOpts) ->
Specs1 = case Specs of
[X|_] when is_integer(X) -> [Specs];
_ -> Specs
end,
AbsSpecs = lists:map(fun(SF) -> ?abs(SF) end, Specs1),
- log_ts_names(AbsSpecs),
- case catch ct_testspec:collect_tests_from_file(AbsSpecs, Relaxed) of
+ AbsSpecs1 = get_start_opt(join_specs, [AbsSpecs], AbsSpecs, StartOpts),
+ case catch ct_testspec:collect_tests_from_file(AbsSpecs1, Relaxed) of
{Error,CTReason} when Error == error ; Error == 'EXIT' ->
exit({error,CTReason});
- TS ->
- SpecOpts = get_data_for_node(TS, node()),
- Label = choose_val(Opts#opts.label,
- SpecOpts#opts.label),
- Profile = choose_val(Opts#opts.profile,
- SpecOpts#opts.profile),
- LogDir = choose_val(Opts#opts.logdir,
- SpecOpts#opts.logdir),
- AllLogOpts = merge_vals([Opts#opts.logopts,
- SpecOpts#opts.logopts]),
- Stylesheet = choose_val(Opts#opts.stylesheet,
- SpecOpts#opts.stylesheet),
- AllVerbosity = merge_keyvals([Opts#opts.verbosity,
- SpecOpts#opts.verbosity]),
- AllSilentConns = merge_vals([Opts#opts.silent_connections,
- SpecOpts#opts.silent_connections]),
- AllConfig = merge_vals([CfgFiles, SpecOpts#opts.config]),
- Cover = choose_val(Opts#opts.cover,
- SpecOpts#opts.cover),
- MultTT = choose_val(Opts#opts.multiply_timetraps,
- SpecOpts#opts.multiply_timetraps),
- ScaleTT = choose_val(Opts#opts.scale_timetraps,
- SpecOpts#opts.scale_timetraps),
- CreatePrivDir = choose_val(Opts#opts.create_priv_dir,
- SpecOpts#opts.create_priv_dir),
- AllEvHs = merge_vals([Opts#opts.event_handlers,
- SpecOpts#opts.event_handlers]),
- AllInclude = merge_vals([Opts#opts.include,
- SpecOpts#opts.include]),
- AllCTHooks = merge_vals([Opts#opts.ct_hooks,
- SpecOpts#opts.ct_hooks]),
- EnableBuiltinHooks = choose_val(Opts#opts.enable_builtin_hooks,
- SpecOpts#opts.enable_builtin_hooks),
-
- application:set_env(common_test, include, AllInclude),
-
- AutoCompile = case choose_val(Opts#opts.auto_compile,
- SpecOpts#opts.auto_compile) of
- undefined ->
- true;
- ACBool ->
- application:set_env(common_test, auto_compile,
- ACBool),
- ACBool
- end,
+ TestSpecData ->
+ run_all_specs(TestSpecData, Opts, StartOpts, [])
+ end.
- BasicHtml = case choose_val(Opts#opts.basic_html,
- SpecOpts#opts.basic_html) of
- undefined ->
- false;
- BHBool ->
- application:set_env(common_test, basic_html,
- BHBool),
- BHBool
- end,
-
- Opts1 = Opts#opts{label = Label,
- profile = Profile,
- cover = Cover,
- logdir = which(logdir, LogDir),
- logopts = AllLogOpts,
- stylesheet = Stylesheet,
- basic_html = BasicHtml,
- verbosity = AllVerbosity,
- silent_connections = AllSilentConns,
- config = AllConfig,
- event_handlers = AllEvHs,
- auto_compile = AutoCompile,
- include = AllInclude,
- testspecs = AbsSpecs,
- multiply_timetraps = MultTT,
- scale_timetraps = ScaleTT,
- create_priv_dir = CreatePrivDir,
- ct_hooks = AllCTHooks,
- enable_builtin_hooks = EnableBuiltinHooks
- },
-
- case check_and_install_configfiles(AllConfig,Opts1#opts.logdir,
- Opts1) of
- ok ->
- {Run,Skip} = ct_testspec:prepare_tests(TS, node()),
- reformat_result(catch do_run(Run, Skip, Opts1, StartOpts));
- {error,GCFReason} ->
- exit({error,GCFReason})
+run_all_specs([], _, _, TotResult) ->
+ TotResult1 = lists:reverse(TotResult),
+ case lists:keysearch('EXIT', 1, TotResult1) of
+ {value,{_,_,ExitReason}} ->
+ exit(ExitReason);
+ false ->
+ case lists:keysearch(error, 1, TotResult1) of
+ {value,Error} ->
+ Error;
+ false ->
+ lists:foldl(fun({Ok,Fail,{UserSkip,AutoSkip}},
+ {Ok1,Fail1,{UserSkip1,AutoSkip1}}) ->
+ {Ok1+Ok,Fail1+Fail,
+ {UserSkip1+UserSkip,
+ AutoSkip1+AutoSkip}}
+ end, {0,0,{0,0}}, TotResult1)
end
+ end;
+
+run_all_specs([{Specs,TS} | TSs], Opts, StartOpts, TotResult) ->
+ log_ts_names(Specs),
+ Combined = #opts{config = TSConfig} = combine_test_opts(TS, Specs, Opts),
+ AllConfig = merge_vals([Opts#opts.config, TSConfig]),
+ try run_one_spec(TS, Combined#opts{config = AllConfig}, StartOpts) of
+ Result ->
+ run_all_specs(TSs, Opts, StartOpts, [Result | TotResult])
+ catch
+ _ : Reason ->
+ run_all_specs(TSs, Opts, StartOpts, [{error,Reason} | TotResult])
+ end.
+
+run_one_spec(TS, CombinedOpts, StartOpts) ->
+ #opts{logdir = Logdir, config = Config} = CombinedOpts,
+ case check_and_install_configfiles(Config, Logdir, CombinedOpts) of
+ ok ->
+ {Run,Skip} = ct_testspec:prepare_tests(TS, node()),
+ reformat_result(catch do_run(Run, Skip, CombinedOpts, StartOpts));
+ Error ->
+ Error
end.
run_prepared(Run, Skip, Opts = #opts{logdir = LogDir,
@@ -1318,7 +1320,7 @@ run_testspec(TestSpec) ->
run_testspec1(TestSpec) ->
{ok,Cwd} = file:get_cwd(),
- io:format("~nCommon Test starting (cwd is ~s)~n~n", [Cwd]),
+ io:format("~nCommon Test starting (cwd is ~ts)~n~n", [Cwd]),
case catch run_testspec2(TestSpec) of
{'EXIT',Reason} ->
file:set_cwd(Cwd),
@@ -1376,6 +1378,7 @@ get_data_for_node(#testspec{label = Labels,
verbosity = VLvls,
silent_connections = SilentConnsList,
cover = CoverFs,
+ cover_stop = CoverStops,
config = Cfgs,
userconfig = UsrCfgs,
event_handler = EvHs,
@@ -1407,6 +1410,7 @@ get_data_for_node(#testspec{label = Labels,
SCs -> SCs
end,
Cover = proplists:get_value(Node, CoverFs),
+ CoverStop = proplists:get_value(Node, CoverStops),
MT = proplists:get_value(Node, MTs),
ST = proplists:get_value(Node, STs),
CreatePrivDir = proplists:get_value(Node, PDs),
@@ -1425,6 +1429,7 @@ get_data_for_node(#testspec{label = Labels,
verbosity = Verbosity,
silent_connections = SilentConns,
cover = Cover,
+ cover_stop = CoverStop,
config = ConfigFiles,
event_handlers = EvHandlers,
ct_hooks = FiltCTHooks,
@@ -1452,7 +1457,7 @@ refresh_logs(LogDir) ->
{error,{all_runs_index,ARReason}};
_ ->
file:set_cwd(Cwd),
- io:format("Logs in ~s refreshed!~n",[LogDir]),
+ io:format("Logs in ~ts refreshed!~n",[LogDir]),
ok
end
end
@@ -1597,14 +1602,7 @@ do_run(Tests, Misc, LogDir, LogOpts) when is_list(Misc),
StepOpts ->
#opts{step = StepOpts}
end,
- Opts1 =
- case proplists:get_value(cover, Misc) of
- undefined ->
- Opts;
- CoverFile ->
- Opts#opts{cover = CoverFile}
- end,
- do_run(Tests, [], Opts1#opts{logdir = LogDir}, []);
+ do_run(Tests, [], Opts#opts{logdir = LogDir}, []);
do_run(Tests, Skip, Opts, Args) when is_record(Opts, opts) ->
#opts{label = Label, profile = Profile, cover = Cover,
@@ -1638,7 +1636,13 @@ do_run(Tests, Skip, Opts, Args) when is_record(Opts, opts) ->
{error,Reason} ->
exit({error,Reason});
CoverSpec ->
- Opts#opts{coverspec = CoverSpec}
+ CoverStop =
+ case Opts#opts.cover_stop of
+ undefined -> true;
+ Stop -> Stop
+ end,
+ Opts#opts{coverspec = CoverSpec,
+ cover_stop = CoverStop}
end
end,
%% This env variable is used by test_server to determine
@@ -1776,7 +1780,7 @@ possibly_spawn(true, Tests, Skip, Opts) ->
end,
unlink(CTUtilSrv),
SupPid = spawn(Supervisor),
- io:format(user, "~nTest control handed over to process ~p~n~n",
+ io:format(user, "~nTest control handed over to process ~w~n~n",
[SupPid]),
SupPid.
@@ -1864,7 +1868,7 @@ verify_suites(TestSuites) ->
Suite)),
io:format(user,
"Suite ~w not found"
- "in directory ~s~n",
+ "in directory ~ts~n",
[Suite,TestDir]),
{Found,[{DS,[Name]}|NotFound]}
end
@@ -1879,7 +1883,7 @@ verify_suites(TestSuites) ->
ActualDir = filename:dirname(SuiteFile),
{[{ActualDir,Suite}|Found],NotFound};
false ->
- io:format(user, "Directory ~s is "
+ io:format(user, "Directory ~ts is "
"invalid~n", [Dir]),
Name = filename:join(Dir, atom_to_list(Suite)),
{Found,[{DS,[Name]}|NotFound]}
@@ -2119,7 +2123,7 @@ do_run_test(Tests, Skip, Opts) ->
cross = CovCross,
src = _CovSrc}} ->
ct_logs:log("COVER INFO",
- "Using cover specification file: ~s~n"
+ "Using cover specification file: ~ts~n"
"App: ~w~n"
"Cross cover: ~w~n"
"Including ~w modules~n"
@@ -2134,7 +2138,7 @@ do_run_test(Tests, Skip, Opts) ->
DelResult = file:delete(CovExport),
ct_logs:log("COVER INFO",
"Warning! "
- "Export file ~s already exists. "
+ "Export file ~ts already exists. "
"Deleting with result: ~p",
[CovExport,DelResult]);
false ->
@@ -2144,7 +2148,8 @@ do_run_test(Tests, Skip, Opts) ->
%% tell test_server which modules should be cover compiled
%% note that actual compilation is done when tests start
test_server_ctrl:cover(CovApp, CovFile, CovExcl, CovIncl,
- CovCross, CovExport, CovLevel),
+ CovCross, CovExport, CovLevel,
+ Opts#opts.cover_stop),
%% save cover data (used e.g. to add nodes dynamically)
ct_util:set_testdata({cover,CovData}),
%% start cover on specified nodes
@@ -2216,6 +2221,15 @@ do_run_test(Tests, Skip, Opts) ->
end, CleanUp),
[code:del_path(Dir) || Dir <- AddedToPath],
+ %% If a severe error has occurred in the test_server,
+ %% we will generate an exception here.
+ case ct_util:get_testdata(severe_error) of
+ undefined -> ok;
+ SevereError ->
+ ct_logs:log("SEVERE ERROR", "~p\n", [SevereError]),
+ exit(SevereError)
+ end,
+
case ct_util:get_testdata(stats) of
Stats = {_Ok,_Failed,{_UserSkipped,_AutoSkipped}} ->
Stats;
@@ -2606,7 +2620,7 @@ log_ts_names(Specs) ->
List = lists:map(fun(Name) ->
Name ++ " "
end, Specs),
- ct_logs:log("Test Specification file(s)", "~s",
+ ct_logs:log("Test Specification file(s)", "~ts",
[lists:flatten(List)]).
merge_arguments(Args) ->
@@ -2618,6 +2632,9 @@ merge_arguments([LogDir={logdir,_}|Args], Merged) ->
merge_arguments([CoverFile={cover,_}|Args], Merged) ->
merge_arguments(Args, handle_arg(replace, CoverFile, Merged));
+merge_arguments([CoverStop={cover_stop,_}|Args], Merged) ->
+ merge_arguments(Args, handle_arg(replace, CoverStop, Merged));
+
merge_arguments([{'case',TC}|Args], Merged) ->
merge_arguments(Args, handle_arg(merge, {testcase,TC}, Merged));
@@ -2714,10 +2731,10 @@ event_handler_args2opts(Default, Args) ->
event_handler_init_args2opts(EHs)
end.
event_handler_init_args2opts([EH, Arg, "and" | EHs]) ->
- [{list_to_atom(EH),lists:flatten(io_lib:format("~s",[Arg]))} |
+ [{list_to_atom(EH),lists:flatten(io_lib:format("~ts",[Arg]))} |
event_handler_init_args2opts(EHs)];
event_handler_init_args2opts([EH, Arg]) ->
- [{list_to_atom(EH),lists:flatten(io_lib:format("~s",[Arg]))}];
+ [{list_to_atom(EH),lists:flatten(io_lib:format("~ts",[Arg]))}];
event_handler_init_args2opts([]) ->
[].
@@ -2867,6 +2884,10 @@ opts2args(EnvStartOpts) ->
[{allow_user_terms,[]}];
({allow_user_terms,false}) ->
[];
+ ({join_specs,true}) ->
+ [{join_specs,[]}];
+ ({join_specs,false}) ->
+ [];
({auto_compile,false}) ->
[{no_auto_compile,[]}];
({auto_compile,true}) ->
@@ -3035,7 +3056,7 @@ start_trace(Args) ->
false
end;
{_,Error} ->
- io:format("Warning! Tracing not started. Reason: ~s~n~n",
+ io:format("Warning! Tracing not started. Reason: ~ts~n~n",
[file:format_error(Error)]),
false
end;
diff --git a/lib/common_test/src/ct_slave.erl b/lib/common_test/src/ct_slave.erl
index aa3413fa89..1fd8c04f8b 100644
--- a/lib/common_test/src/ct_slave.erl
+++ b/lib/common_test/src/ct_slave.erl
@@ -1,7 +1,7 @@
%%--------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2010. All Rights Reserved.
+%% Copyright Ericsson AB 2010-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -37,7 +37,7 @@
-record(options, {username, password, boot_timeout, init_timeout,
startup_timeout, startup_functions, monitor_master,
- kill_if_fail, erl_flags}).
+ kill_if_fail, erl_flags, env}).
%%%-----------------------------------------------------------------
%%% @spec start(Node) -> Result
@@ -85,7 +85,8 @@ start(Host, Node) ->
%%% {startup_functions, StartupFunctions} |
%%% {monitor_master, Monitor} |
%%% {kill_if_fail, KillIfFail} |
-%%% {erl_flags, ErlangFlags}
+%%% {erl_flags, ErlangFlags} |
+%%% {env, [{EnvVar,Value}]}
%%% Username = string()
%%% Password = string()
%%% BootTimeout = integer()
@@ -99,6 +100,8 @@ start(Host, Node) ->
%%% Monitor = bool()
%%% KillIfFail = bool()
%%% ErlangFlags = string()
+%%% EnvVar = string()
+%%% Value = string()
%%% Result = {ok, NodeName} | {error, already_started, NodeName} |
%%% {error, started_not_connected, NodeName} |
%%% {error, boot_timeout, NodeName} |
@@ -152,6 +155,9 @@ start(Host, Node) ->
%%% <p>Option <code>erlang_flags</code> specifies, which flags will be added
%%% to the parameters of the <code>erl</code> executable.</p>
%%%
+%%% <p>Option <code>env</code> specifies a list of environment variables
+%%% that will extended the environment.</p>
+%%%
%%% <p>Special return values are:
%%% <list>
%%% <item><code>{error, already_started, NodeName}</code> - if the node with
@@ -233,10 +239,12 @@ fetch_options(Options) ->
Monitor = get_option_value(monitor_master, Options, false),
KillIfFail = get_option_value(kill_if_fail, Options, true),
ErlFlags = get_option_value(erl_flags, Options, []),
+ EnvVars = get_option_value(env, Options, []),
#options{username=UserName, password=Password,
boot_timeout=BootTimeout, init_timeout=InitTimeout,
startup_timeout=StartupTimeout, startup_functions=StartupFunctions,
- monitor_master=Monitor, kill_if_fail=KillIfFail, erl_flags=ErlFlags}.
+ monitor_master=Monitor, kill_if_fail=KillIfFail,
+ erl_flags=ErlFlags, env=EnvVars}.
% send a message when slave node is started
% @hidden
@@ -306,11 +314,19 @@ do_start(Host, Node, Options) ->
true->
spawn_remote_node(Host, Node, Options)
end,
+
BootTimeout = Options#options.boot_timeout,
InitTimeout = Options#options.init_timeout,
StartupTimeout = Options#options.startup_timeout,
Result = case wait_for_node_alive(ENode, BootTimeout) of
pong->
+ case test_server:is_cover() of
+ true ->
+ MainCoverNode = cover:get_main_node(),
+ rpc:call(MainCoverNode,cover,start,[ENode]);
+ false ->
+ ok
+ end,
call_functions(ENode, Functions2),
receive
{node_started, ENode}->
@@ -365,9 +381,9 @@ get_cmd(Node, Flags) ->
% spawn node locally
spawn_local_node(Node, Options) ->
- ErlFlags = Options#options.erl_flags,
+ #options{env=Env,erl_flags=ErlFlags} = Options,
Cmd = get_cmd(Node, ErlFlags),
- open_port({spawn, Cmd}, [stream]).
+ open_port({spawn, Cmd}, [stream,{env,Env}]).
% start crypto and ssh if not yet started
check_for_ssh_running() ->
@@ -386,9 +402,10 @@ check_for_ssh_running() ->
% spawn node remotely
spawn_remote_node(Host, Node, Options) ->
- Username = Options#options.username,
- Password = Options#options.password,
- ErlFlags = Options#options.erl_flags,
+ #options{username=Username,
+ password=Password,
+ erl_flags=ErlFlags,
+ env=Env} = Options,
SSHOptions = case {Username, Password} of
{[], []}->
[];
@@ -400,8 +417,17 @@ spawn_remote_node(Host, Node, Options) ->
check_for_ssh_running(),
{ok, SSHConnRef} = ssh:connect(atom_to_list(Host), 22, SSHOptions),
{ok, SSHChannelId} = ssh_connection:session_channel(SSHConnRef, infinity),
+ ssh_setenv(SSHConnRef, SSHChannelId, Env),
ssh_connection:exec(SSHConnRef, SSHChannelId, get_cmd(Node, ErlFlags), infinity).
+
+ssh_setenv(SSHConnRef, SSHChannelId, [{Var, Value} | Vars])
+ when is_list(Var), is_list(Value) ->
+ success = ssh_connection:setenv(SSHConnRef, SSHChannelId,
+ Var, Value, infinity),
+ ssh_setenv(SSHConnRef, SSHChannelId, Vars);
+ssh_setenv(_SSHConnRef, _SSHChannelId, []) -> ok.
+
% call functions on a remote Erlang node
call_functions(_Node, []) ->
ok;
@@ -423,8 +449,29 @@ wait_for_node_alive(Node, N) ->
% call init:stop on a remote node
do_stop(ENode) ->
+ {Cover,MainCoverNode} =
+ case test_server:is_cover() of
+ true ->
+ Main = cover:get_main_node(),
+ rpc:call(Main,cover,flush,[ENode]),
+ {true,Main};
+ false ->
+ {false,undefined}
+ end,
spawn(ENode, init, stop, []),
- wait_for_node_dead(ENode, 5).
+ case wait_for_node_dead(ENode, 5) of
+ {ok,ENode} ->
+ if Cover ->
+ %% To avoid that cover is started again if a node
+ %% with the same name is started later.
+ rpc:call(MainCoverNode,cover,stop,[ENode]);
+ true ->
+ ok
+ end,
+ {ok,ENode};
+ Error ->
+ Error
+ end.
% wait N seconds until node is disconnected
wait_for_node_dead(Node, 0) ->
diff --git a/lib/common_test/src/ct_snmp.erl b/lib/common_test/src/ct_snmp.erl
index 8fe63e8ed1..71038bd4f4 100644
--- a/lib/common_test/src/ct_snmp.erl
+++ b/lib/common_test/src/ct_snmp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -39,7 +39,7 @@
%%% %%% Manager config
%%% [{start_manager, boolean()} % Optional - default is true
%%% {users, [{user_name(), [call_back_module(), user_data()]}]}, %% Optional
-%%% {usm_users, [{usm_user_name(), usm_config()}]},%% Optional - snmp v3 only
+%%% {usm_users, [{usm_user_name(), [usm_config()]}]},%% Optional - snmp v3 only
%%% % managed_agents is optional
%%% {managed_agents,[{agent_name(), [user_name(), agent_ip(), agent_port(), [agent_config()]]}]},
%%% {max_msg_size, integer()}, % Optional - default is 484
@@ -130,7 +130,7 @@
%%% @type agent_config() = {Item, Value}
%%% @type user_name() = atom()
%%% @type usm_user_name() = string()
-%%% @type usm_config() = string()
+%%% @type usm_config() = {Item, Value}
%%% @type call_back_module() = atom()
%%% @type user_data() = term()
%%% @type oids() = [oid()]
@@ -157,8 +157,9 @@
%%% API
-export([start/2, start/3, stop/1, get_values/3, get_next_values/3, set_values/4,
set_info/1, register_users/2, register_agents/2, register_usm_users/2,
- unregister_users/1, unregister_agents/1, update_usm_users/2,
- load_mibs/1]).
+ unregister_users/1, unregister_users/2, unregister_agents/1,
+ unregister_agents/2, unregister_usm_users/1, unregister_usm_users/2,
+ load_mibs/1, unload_mibs/1]).
%% Manager values
-define(CT_SNMP_LOG_FILE, "ct_snmp_set.log").
@@ -250,10 +251,8 @@ stop(Config) ->
%%%
%%% @doc Issues a synchronous snmp get request.
get_values(Agent, Oids, MgrAgentConfName) ->
- [Uid, AgentIp, AgentUdpPort | _] =
- agent_conf(Agent, MgrAgentConfName),
- {ok, SnmpReply, _} =
- snmpm:g(Uid, AgentIp, AgentUdpPort, Oids),
+ [Uid | _] = agent_conf(Agent, MgrAgentConfName),
+ {ok, SnmpReply, _} = snmpm:sync_get2(Uid, target_name(Agent), Oids),
SnmpReply.
%%% @spec get_next_values(Agent, Oids, MgrAgentConfName) -> SnmpReply
@@ -265,10 +264,8 @@ get_values(Agent, Oids, MgrAgentConfName) ->
%%%
%%% @doc Issues a synchronous snmp get next request.
get_next_values(Agent, Oids, MgrAgentConfName) ->
- [Uid, AgentIp, AgentUdpPort | _] =
- agent_conf(Agent, MgrAgentConfName),
- {ok, SnmpReply, _} =
- snmpm:gn(Uid, AgentIp, AgentUdpPort, Oids),
+ [Uid | _] = agent_conf(Agent, MgrAgentConfName),
+ {ok, SnmpReply, _} = snmpm:sync_get_next2(Uid, target_name(Agent), Oids),
SnmpReply.
%%% @spec set_values(Agent, VarsAndVals, MgrAgentConfName, Config) -> SnmpReply
@@ -282,13 +279,11 @@ get_next_values(Agent, Oids, MgrAgentConfName) ->
%%% @doc Issues a synchronous snmp set request.
set_values(Agent, VarsAndVals, MgrAgentConfName, Config) ->
PrivDir = ?config(priv_dir, Config),
- [Uid, AgentIp, AgentUdpPort | _] =
- agent_conf(Agent, MgrAgentConfName),
+ [Uid | _] = agent_conf(Agent, MgrAgentConfName),
Oids = lists:map(fun({Oid, _, _}) -> Oid end, VarsAndVals),
- {ok, SnmpGetReply, _} =
- snmpm:g(Uid, AgentIp, AgentUdpPort, Oids),
- {ok, SnmpSetReply, _} =
- snmpm:s(Uid, AgentIp, AgentUdpPort, VarsAndVals),
+ TargetName = target_name(Agent),
+ {ok, SnmpGetReply, _} = snmpm:sync_get2(Uid, TargetName, Oids),
+ {ok, SnmpSetReply, _} = snmpm:sync_set2(Uid, TargetName, VarsAndVals),
case SnmpSetReply of
{noError, 0, _} when PrivDir /= false ->
log(PrivDir, Agent, SnmpGetReply, VarsAndVals);
@@ -328,12 +323,23 @@ set_info(Config) ->
%%% Reason = term()
%%%
%%% @doc Register the manager entity (=user) responsible for specific agent(s).
-%%% Corresponds to making an entry in users.conf
+%%% Corresponds to making an entry in users.conf.
+%%%
+%%% This function will try to register the given users, without
+%%% checking if any of them already exist. In order to change an
+%%% already registered user, the user must first be unregistered.
register_users(MgrAgentConfName, Users) ->
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users, Users}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- setup_users(Users).
+ case setup_users(Users) of
+ ok ->
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ OldUsers = ct:get_config({MgrAgentConfName,users},[]),
+ NewSnmpVals = lists:keystore(users, 1, SnmpVals,
+ {users, Users ++ OldUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok;
+ Error ->
+ Error
+ end.
%%% @spec register_agents(MgrAgentConfName, ManagedAgents) -> ok | {error, Reason}
%%%
@@ -343,12 +349,24 @@ register_users(MgrAgentConfName, Users) ->
%%%
%%% @doc Explicitly instruct the manager to handle this agent.
%%% Corresponds to making an entry in agents.conf
+%%%
+%%% This function will try to register the given managed agents,
+%%% without checking if any of them already exist. In order to change
+%%% an already registered managed agent, the agent must first be
+%%% unregistered.
register_agents(MgrAgentConfName, ManagedAgents) ->
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals,
- {managed_agents, ManagedAgents}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- setup_managed_agents(ManagedAgents).
+ case setup_managed_agents(MgrAgentConfName,ManagedAgents) of
+ ok ->
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ OldAgents = ct:get_config({MgrAgentConfName,managed_agents},[]),
+ NewSnmpVals = lists:keystore(managed_agents, 1, SnmpVals,
+ {managed_agents,
+ ManagedAgents ++ OldAgents}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok;
+ Error ->
+ Error
+ end.
%%% @spec register_usm_users(MgrAgentConfName, UsmUsers) -> ok | {error, Reason}
%%%
@@ -358,60 +376,115 @@ register_agents(MgrAgentConfName, ManagedAgents) ->
%%%
%%% @doc Explicitly instruct the manager to handle this USM user.
%%% Corresponds to making an entry in usm.conf
+%%%
+%%% This function will try to register the given users, without
+%%% checking if any of them already exist. In order to change an
+%%% already registered user, the user must first be unregistered.
register_usm_users(MgrAgentConfName, UsmUsers) ->
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {usm_users, UsmUsers}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
EngineID = ct:get_config({MgrAgentConfName, engine_id}, ?ENGINE_ID),
- setup_usm_users(UsmUsers, EngineID).
+ case setup_usm_users(UsmUsers, EngineID) of
+ ok ->
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ OldUsmUsers = ct:get_config({MgrAgentConfName,usm_users},[]),
+ NewSnmpVals = lists:keystore(usm_users, 1, SnmpVals,
+ {usm_users, UsmUsers ++ OldUsmUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok;
+ Error ->
+ Error
+ end.
-%%% @spec unregister_users(MgrAgentConfName) -> ok | {error, Reason}
+%%% @spec unregister_users(MgrAgentConfName) -> ok
%%%
%%% MgrAgentConfName = atom()
%%% Reason = term()
%%%
-%%% @doc Removes information added when calling register_users/2.
+%%% @doc Unregister all users.
unregister_users(MgrAgentConfName) ->
- Users = lists:map(fun({UserName, _}) -> UserName end,
- ct:get_config({MgrAgentConfName, users})),
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users, []}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- takedown_users(Users).
+ Users = [Id || {Id,_} <- ct:get_config({MgrAgentConfName, users},[])],
+ unregister_users(MgrAgentConfName,Users).
-%%% @spec unregister_agents(MgrAgentConfName) -> ok | {error, Reason}
+%%% @spec unregister_users(MgrAgentConfName,Users) -> ok
%%%
%%% MgrAgentConfName = atom()
+%%% Users = [user_name()]
%%% Reason = term()
%%%
-%%% @doc Removes information added when calling register_agents/2.
+%%% @doc Unregister the given users.
+unregister_users(MgrAgentConfName,Users) ->
+ takedown_users(Users),
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ AllUsers = ct:get_config({MgrAgentConfName, users},[]),
+ RemainingUsers = lists:filter(fun({Id,_}) ->
+ not lists:member(Id,Users)
+ end,
+ AllUsers),
+ NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users,RemainingUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok.
+
+%%% @spec unregister_agents(MgrAgentConfName) -> ok
+%%%
+%%% MgrAgentConfName = atom()
+%%% Reason = term()
+%%%
+%%% @doc Unregister all managed agents.
unregister_agents(MgrAgentConfName) ->
- ManagedAgents = lists:map(fun({_, [Uid, AgentIP, AgentPort, _]}) ->
- {Uid, AgentIP, AgentPort}
- end,
- ct:get_config({MgrAgentConfName, managed_agents})),
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals,
- {managed_agents, []}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- takedown_managed_agents(ManagedAgents).
+ ManagedAgents = [AgentName ||
+ {AgentName, _} <-
+ ct:get_config({MgrAgentConfName,managed_agents},[])],
+ unregister_agents(MgrAgentConfName,ManagedAgents).
+%%% @spec unregister_agents(MgrAgentConfName,ManagedAgents) -> ok
+%%%
+%%% MgrAgentConfName = atom()
+%%% ManagedAgents = [agent_name()]
+%%% Reason = term()
+%%%
+%%% @doc Unregister the given managed agents.
+unregister_agents(MgrAgentConfName,ManagedAgents) ->
+ takedown_managed_agents(MgrAgentConfName, ManagedAgents),
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ AllAgents = ct:get_config({MgrAgentConfName,managed_agents},[]),
+ RemainingAgents = lists:filter(fun({Name,_}) ->
+ not lists:member(Name,ManagedAgents)
+ end,
+ AllAgents),
+ NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals,
+ {managed_agents,RemainingAgents}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok.
-%%% @spec update_usm_users(MgrAgentConfName, UsmUsers) -> ok | {error, Reason}
+%%% @spec unregister_usm_users(MgrAgentConfName) -> ok
%%%
%%% MgrAgentConfName = atom()
-%%% UsmUsers = usm_users()
%%% Reason = term()
%%%
-%%% @doc Alters information added when calling register_usm_users/2.
-update_usm_users(MgrAgentConfName, UsmUsers) ->
-
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(usm_users, 1, SnmpVals,
- {usm_users, UsmUsers}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
+%%% @doc Unregister all usm users.
+unregister_usm_users(MgrAgentConfName) ->
+ UsmUsers = [Id || {Id,_} <- ct:get_config({MgrAgentConfName, usm_users},[])],
+ unregister_usm_users(MgrAgentConfName,UsmUsers).
+
+%%% @spec unregister_usm_users(MgrAgentConfName,UsmUsers) -> ok
+%%%
+%%% MgrAgentConfName = atom()
+%%% UsmUsers = [usm_user_name()]
+%%% Reason = term()
+%%%
+%%% @doc Unregister the given usm users.
+unregister_usm_users(MgrAgentConfName,UsmUsers) ->
EngineID = ct:get_config({MgrAgentConfName, engine_id}, ?ENGINE_ID),
- do_update_usm_users(UsmUsers, EngineID).
+ takedown_usm_users(UsmUsers,EngineID),
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ AllUsmUsers = ct:get_config({MgrAgentConfName, usm_users},[]),
+ RemainingUsmUsers = lists:filter(fun({Id,_}) ->
+ not lists:member(Id,UsmUsers)
+ end,
+ AllUsmUsers),
+ NewSnmpVals = lists:keyreplace(usm_users, 1, SnmpVals,
+ {usm_users,RemainingUsmUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok.
%%% @spec load_mibs(Mibs) -> ok | {error, Reason}
%%%
@@ -423,6 +496,15 @@ update_usm_users(MgrAgentConfName, UsmUsers) ->
load_mibs(Mibs) ->
snmpa:load_mibs(snmp_master_agent, Mibs).
+%%% @spec unload_mibs(Mibs) -> ok | {error, Reason}
+%%%
+%%% Mibs = [MibName]
+%%% MibName = string()
+%%% Reason = term()
+%%%
+%%% @doc Unload the mibs from the agent 'snmp_master_agent'.
+unload_mibs(Mibs) ->
+ snmpa:unload_mibs(snmp_master_agent, Mibs).
%%%========================================================================
%%% Internal functions
@@ -486,9 +568,8 @@ setup_agent(true, AgentConfName, SnmpConfName,
file:make_dir(DbDir),
snmp_config:write_agent_snmp_files(ConfDir, Vsns, ManagerIP, TrapUdp,
AgentIP, AgentUdp, SysName,
- atom_to_list(NotifType),
- SecType, Passwd, AgentEngineID,
- AgentMaxMsgSize),
+ NotifType, SecType, Passwd,
+ AgentEngineID, AgentMaxMsgSize),
override_default_configuration(Config, AgentConfName),
@@ -497,7 +578,8 @@ setup_agent(true, AgentConfName, SnmpConfName,
{verbosity, trace}]},
{agent_type, master},
{agent_verbosity, trace},
- {net_if, [{verbosity, trace}]}],
+ {net_if, [{verbosity, trace}]},
+ {versions, Vsns}],
ct:get_config({SnmpConfName,agent})),
application:set_env(snmp, agent, SnmpEnv).
%%%---------------------------------------------------------------------------
@@ -535,65 +617,61 @@ manager_register(true, MgrAgentConfName) ->
setup_usm_users(UsmUsers, EngineID),
setup_users(Users),
- setup_managed_agents(Agents).
+ setup_managed_agents(MgrAgentConfName,Agents).
%%%---------------------------------------------------------------------------
setup_users(Users) ->
- lists:foreach(fun({Id, [Module, Data]}) ->
- snmpm:register_user(Id, Module, Data)
- end, Users).
+ while_ok(fun({Id, [Module, Data]}) ->
+ snmpm:register_user(Id, Module, Data)
+ end, Users).
%%%---------------------------------------------------------------------------
-setup_managed_agents([]) ->
- ok;
-
-setup_managed_agents([{_, [Uid, AgentIp, AgentUdpPort, AgentConf]} |
- Rest]) ->
- NewAgentIp = case AgentIp of
- IpTuple when is_tuple(IpTuple) ->
- IpTuple;
- HostName when is_list(HostName) ->
- {ok,Hostent} = inet:gethostbyname(HostName),
- [IpTuple|_] = Hostent#hostent.h_addr_list,
- IpTuple
- end,
- ok = snmpm:register_agent(Uid, NewAgentIp, AgentUdpPort),
- lists:foreach(fun({Item, Val}) ->
- snmpm:update_agent_info(Uid, NewAgentIp,
- AgentUdpPort, Item, Val)
- end, AgentConf),
- setup_managed_agents(Rest).
+setup_managed_agents(AgentConfName,Agents) ->
+ Fun =
+ fun({AgentName, [Uid, AgentIp, AgentUdpPort, AgentConf0]}) ->
+ NewAgentIp = case AgentIp of
+ IpTuple when is_tuple(IpTuple) ->
+ IpTuple;
+ HostName when is_list(HostName) ->
+ {ok,Hostent} = inet:gethostbyname(HostName),
+ [IpTuple|_] = Hostent#hostent.h_addr_list,
+ IpTuple
+ end,
+ AgentConf =
+ case lists:keymember(engine_id,1,AgentConf0) of
+ true ->
+ AgentConf0;
+ false ->
+ DefaultEngineID =
+ ct:get_config({AgentConfName,agent_engine_id},
+ ?AGENT_ENGINE_ID),
+ [{engine_id,DefaultEngineID}|AgentConf0]
+ end,
+ snmpm:register_agent(Uid, target_name(AgentName),
+ [{address,NewAgentIp},{port,AgentUdpPort} |
+ AgentConf])
+ end,
+ while_ok(Fun,Agents).
%%%---------------------------------------------------------------------------
setup_usm_users(UsmUsers, EngineID)->
- lists:foreach(fun({UsmUser, Conf}) ->
- snmpm:register_usm_user(EngineID, UsmUser, Conf)
- end, UsmUsers).
+ while_ok(fun({UsmUser, Conf}) ->
+ snmpm:register_usm_user(EngineID, UsmUser, Conf)
+ end, UsmUsers).
%%%---------------------------------------------------------------------------
takedown_users(Users) ->
- lists:foreach(fun({Id}) ->
+ lists:foreach(fun(Id) ->
snmpm:unregister_user(Id)
end, Users).
%%%---------------------------------------------------------------------------
-takedown_managed_agents([{Uid, AgentIp, AgentUdpPort} |
- Rest]) ->
- NewAgentIp = case AgentIp of
- IpTuple when is_tuple(IpTuple) ->
- IpTuple;
- HostName when is_list(HostName) ->
- {ok,Hostent} = inet:gethostbyname(HostName),
- [IpTuple|_] = Hostent#hostent.h_addr_list,
- IpTuple
- end,
- ok = snmpm:unregister_agent(Uid, NewAgentIp, AgentUdpPort),
- takedown_managed_agents(Rest);
-
-takedown_managed_agents([]) ->
- ok.
+takedown_managed_agents(MgrAgentConfName,ManagedAgents) ->
+ lists:foreach(fun(AgentName) ->
+ [Uid | _] = agent_conf(AgentName, MgrAgentConfName),
+ snmpm:unregister_agent(Uid, target_name(AgentName))
+ end, ManagedAgents).
%%%---------------------------------------------------------------------------
-do_update_usm_users(UsmUsers, EngineID) ->
- lists:foreach(fun({UsmUser, {Item, Val}}) ->
- snmpm:update_usm_user_info(EngineID, UsmUser,
- Item, Val)
- end, UsmUsers).
+takedown_usm_users(UsmUsers, EngineID) ->
+ lists:foreach(fun(Id) ->
+ snmpm:unregister_usm_user(EngineID, Id)
+ end, UsmUsers).
%%%---------------------------------------------------------------------------
log(PrivDir, Agent, {_, _, Varbinds}, NewVarsAndVals) ->
@@ -657,7 +735,7 @@ override_contexts(Config, {data_dir_file, File}) ->
override_contexts(Config, ContextInfo);
override_contexts(Config, Contexts) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"context.conf"),
file:delete(File),
snmp_config:write_agent_context_config(Dir, "", Contexts).
@@ -673,7 +751,7 @@ override_sysinfo(Config, {data_dir_file, File}) ->
override_sysinfo(Config, SysInfo);
override_sysinfo(Config, SysInfo) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"standard.conf"),
file:delete(File),
snmp_config:write_agent_standard_config(Dir, "", SysInfo).
@@ -688,7 +766,7 @@ override_target_address(Config, {data_dir_file, File}) ->
override_target_address(Config, TargetAddressConf);
override_target_address(Config, TargetAddressConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"target_addr.conf"),
file:delete(File),
snmp_config:write_agent_target_addr_config(Dir, "", TargetAddressConf).
@@ -704,7 +782,7 @@ override_target_params(Config, {data_dir_file, File}) ->
override_target_params(Config, TargetParamsConf);
override_target_params(Config, TargetParamsConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"target_params.conf"),
file:delete(File),
snmp_config:write_agent_target_params_config(Dir, "", TargetParamsConf).
@@ -719,7 +797,7 @@ override_notify(Config, {data_dir_file, File}) ->
override_notify(Config, NotifyConf);
override_notify(Config, NotifyConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"notify.conf"),
file:delete(File),
snmp_config:write_agent_notify_config(Dir, "", NotifyConf).
@@ -734,7 +812,7 @@ override_usm(Config, {data_dir_file, File}) ->
override_usm(Config, UsmConf);
override_usm(Config, UsmConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"usm.conf"),
file:delete(File),
snmp_config:write_agent_usm_config(Dir, "", UsmConf).
@@ -749,7 +827,7 @@ override_community(Config, {data_dir_file, File}) ->
override_community(Config, CommunityConf);
override_community(Config, CommunityConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"community.conf"),
file:delete(File),
snmp_config:write_agent_community_config(Dir, "", CommunityConf).
@@ -765,7 +843,20 @@ override_vacm(Config, {data_dir_file, File}) ->
override_vacm(Config, VacmConf);
override_vacm(Config, VacmConf) ->
- Dir = ?config(priv_dir, Config),
- File = filename:join(Dir,"vacm.conf"),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
+ File = filename:join(Dir,"vacm.conf"),
file:delete(File),
snmp_config:write_agent_vacm_config(Dir, "", VacmConf).
+
+%%%---------------------------------------------------------------------------
+
+target_name(Agent) ->
+ atom_to_list(Agent).
+
+while_ok(Fun,[H|T]) ->
+ case Fun(H) of
+ ok -> while_ok(Fun,T);
+ Error -> Error
+ end;
+while_ok(_Fun,[]) ->
+ ok.
diff --git a/lib/common_test/src/ct_telnet.erl b/lib/common_test/src/ct_telnet.erl
index b13c050e32..02186864a5 100644
--- a/lib/common_test/src/ct_telnet.erl
+++ b/lib/common_test/src/ct_telnet.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -201,7 +201,7 @@ open(KeyOrName,ConnType,TargetMod,Extra) ->
close(Connection) ->
case get_handle(Connection) of
{ok,Pid} ->
- log("ct_telnet:close","Handle: ~p",[Pid]),
+ log("ct_telnet:close","Handle: ~w",[Pid]),
case ct_gen_conn:stop(Pid) of
{error,{process_down,Pid,noproc}} ->
{error,already_closed};
@@ -558,7 +558,7 @@ reconnect(Ip,Port,N,State=#state{target_mod=TargetMod,
Error when N==0 ->
Error;
_Error ->
- log("Reconnect failed!","Retries left: ~p",[N]),
+ log("Reconnect failed!","Retries left: ~w",[N]),
timer:sleep(ReconnInt),
reconnect(Ip,Port,N-1,State)
end.
@@ -567,7 +567,7 @@ reconnect(Ip,Port,N,State=#state{target_mod=TargetMod,
%% @hidden
terminate(TelnPid,State) ->
log(heading(terminate,State#state.name),
- "Closing telnet connection.\nId: ~p",
+ "Closing telnet connection.\nId: ~w",
[TelnPid]),
ct_telnet_client:close(TelnPid).
@@ -899,7 +899,7 @@ one_expect(Data,Pattern,EO) ->
[Prompt] when Prompt==prompt; Prompt=={prompt,PromptType} ->
%% Only searching for prompt
log_lines(UptoPrompt),
- try_cont_log("<b>PROMPT:</b> ~s", [PromptType]),
+ try_cont_log("<b>PROMPT:</b> ~ts", [PromptType]),
{match,{prompt,PromptType},Rest};
[{prompt,_OtherPromptType}] ->
%% Only searching for one specific prompt, not thisone
@@ -969,7 +969,7 @@ seq_expect1(Data,[prompt|Patterns],Acc,Rest,EO) ->
{continue,[prompt|Patterns],Acc,LastLine};
PromptType ->
log_lines(Data),
- try_cont_log("<b>PROMPT:</b> ~s", [PromptType]),
+ try_cont_log("<b>PROMPT:</b> ~ts", [PromptType]),
seq_expect(Rest,Patterns,[{prompt,PromptType}|Acc],EO)
end;
seq_expect1(Data,[{prompt,PromptType}|Patterns],Acc,Rest,EO) ->
@@ -980,7 +980,7 @@ seq_expect1(Data,[{prompt,PromptType}|Patterns],Acc,Rest,EO) ->
{continue,[{prompt,PromptType}|Patterns],Acc,LastLine};
PromptType ->
log_lines(Data),
- try_cont_log("<b>PROMPT:</b> ~s", [PromptType]),
+ try_cont_log("<b>PROMPT:</b> ~ts", [PromptType]),
seq_expect(Rest,Patterns,[{prompt,PromptType}|Acc],EO);
_OtherPromptType ->
log_lines(Data),
@@ -1032,13 +1032,13 @@ match_line(Line,Patterns,FoundPrompt,EO) ->
match_line(Line,[prompt|Patterns],false,EO,RetTag) ->
match_line(Line,Patterns,false,EO,RetTag);
match_line(Line,[prompt|_Patterns],FoundPrompt,_EO,RetTag) ->
- try_cont_log(" ~s", [Line]),
- try_cont_log("<b>PROMPT:</b> ~s", [FoundPrompt]),
+ try_cont_log(" ~ts", [Line]),
+ try_cont_log("<b>PROMPT:</b> ~ts", [FoundPrompt]),
{RetTag,{prompt,FoundPrompt}};
match_line(Line,[{prompt,PromptType}|_Patterns],FoundPrompt,_EO,RetTag)
when PromptType==FoundPrompt ->
- try_cont_log(" ~s", [Line]),
- try_cont_log("<b>PROMPT:</b> ~s", [FoundPrompt]),
+ try_cont_log(" ~ts", [Line]),
+ try_cont_log("<b>PROMPT:</b> ~ts", [FoundPrompt]),
{RetTag,{prompt,FoundPrompt}};
match_line(Line,[{prompt,PromptType}|Patterns],FoundPrompt,EO,RetTag)
when PromptType=/=FoundPrompt ->
@@ -1048,7 +1048,7 @@ match_line(Line,[{Tag,Pattern}|Patterns],FoundPrompt,EO,RetTag) ->
nomatch ->
match_line(Line,Patterns,FoundPrompt,EO,RetTag);
{match,Match} ->
- try_cont_log("<b>MATCH:</b> ~s", [Line]),
+ try_cont_log("<b>MATCH:</b> ~ts", [Line]),
{RetTag,{Tag,Match}}
end;
match_line(Line,[Pattern|Patterns],FoundPrompt,EO,RetTag) ->
@@ -1056,13 +1056,13 @@ match_line(Line,[Pattern|Patterns],FoundPrompt,EO,RetTag) ->
nomatch ->
match_line(Line,Patterns,FoundPrompt,EO,RetTag);
{match,Match} ->
- try_cont_log("<b>MATCH:</b> ~s", [Line]),
+ try_cont_log("<b>MATCH:</b> ~ts", [Line]),
{RetTag,Match}
end;
match_line(Line,[],FoundPrompt,EO,match) ->
match_line(Line,EO#eo.haltpatterns,FoundPrompt,EO,halt);
match_line(Line,[],_FoundPrompt,_EO,halt) ->
- try_cont_log(" ~s", [Line]),
+ try_cont_log(" ~ts", [Line]),
nomatch.
one_line([$\n|Rest],Line) ->
@@ -1086,7 +1086,7 @@ log_lines(String) ->
[] ->
ok;
LastLine ->
- try_cont_log(" ~s", [LastLine])
+ try_cont_log(" ~ts", [LastLine])
end.
log_lines_not_last(String) ->
@@ -1094,7 +1094,7 @@ log_lines_not_last(String) ->
{[],LastLine} ->
LastLine;
{String1,LastLine} ->
- try_cont_log("~s",[String1]),
+ try_cont_log("~ts",[String1]),
LastLine
end.
diff --git a/lib/common_test/src/ct_telnet_client.erl b/lib/common_test/src/ct_telnet_client.erl
index d703b39ac5..7329498ed6 100644
--- a/lib/common_test/src/ct_telnet_client.erl
+++ b/lib/common_test/src/ct_telnet_client.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -308,7 +308,7 @@ cmd_dbg(_Cmd) ->
[Opt] -> Opt;
_ -> Opts
end,
- io:format("~s(~w): ~w\n", [CtrlStr,Ctrl,Opts1]);
+ io:format("~ts(~w): ~w\n", [CtrlStr,Ctrl,Opts1]);
Any ->
io:format("Unexpected in cmd_dbg:~n~w~n",[Any])
end.
diff --git a/lib/common_test/src/ct_testspec.erl b/lib/common_test/src/ct_testspec.erl
index 5ce095e38e..e341391a91 100644
--- a/lib/common_test/src/ct_testspec.erl
+++ b/lib/common_test/src/ct_testspec.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -28,7 +28,6 @@
collect_tests_from_file/2, collect_tests_from_file/3]).
-include("ct_util.hrl").
-
-define(testspec_fields, record_info(fields, testspec)).
%%%------------------------------------------------------------------
@@ -93,7 +92,7 @@ prepare_tests(TestSpec) when is_record(TestSpec,testspec) ->
%% run_per_node/2 takes the Run list as input and returns a list
%% of {Node,RunPerNode,[]} tuples where the tests have been sorted
%% on a per node basis.
-run_per_node([{{Node,Dir},Test}|Ts],Result, MergeTests) ->
+run_per_node([{{Node,Dir},Test}|Ts],Result,MergeTests) ->
{value,{Node,{Run,Skip}}} = lists:keysearch(Node,1,Result),
Run1 = case MergeTests of
false ->
@@ -190,7 +189,7 @@ prepare_suites(_Node,_Dir,[],Run,Skip) ->
prepare_cases(Node,Dir,Suite,Cases) ->
case get_skipped_cases(Node,Dir,Suite,Cases) of
- SkipAll=[{{Node,Dir},{Suite,_Cmt}}] -> % all cases to be skipped
+ SkipAll=[{{Node,Dir},{Suite,_Cmt}}] -> % all cases to be skipped
%% note: this adds an 'all' test even if only skip is specified
{[{{Node,Dir},{Suite,all}}],SkipAll};
Skipped ->
@@ -241,34 +240,147 @@ get_skipped_cases1(_,_,_,[]) ->
%%% collect_tests_from_file reads a testspec file and returns a record
%%% containing the data found.
-collect_tests_from_file(Specs, Relaxed) ->
+collect_tests_from_file(Specs,Relaxed) ->
collect_tests_from_file(Specs,[node()],Relaxed).
collect_tests_from_file(Specs,Nodes,Relaxed) when is_list(Nodes) ->
NodeRefs = lists:map(fun(N) -> {undefined,N} end, Nodes),
- catch collect_tests_from_file1(Specs,#testspec{nodes=NodeRefs},Relaxed).
+ %% [Spec1,Spec2,...] means create one testpec record per Spec file
+ %% [[Spec1,Spec2,...]] means merge all specs into one testspec record
+ {Join,Specs1} = if is_list(hd(hd(Specs))) -> {true,hd(Specs)};
+ true -> {false,Specs}
+ end,
+ Specs2 = [filename:absname(S) || S <- Specs1],
+ TS0 = #testspec{nodes=NodeRefs},
+
+ try create_specs(Specs2,TS0,Relaxed,Join) of
+ {{[],_},SeparateTestSpecs} ->
+ filter_and_convert(SeparateTestSpecs);
+ {{_,#testspec{tests=[]}},SeparateTestSpecs} ->
+ filter_and_convert(SeparateTestSpecs);
+ {Joined,SeparateTestSpecs} ->
+ [filter_and_convert(Joined) |
+ filter_and_convert(SeparateTestSpecs)]
+ catch
+ _:Error ->
+ Error
+ end.
+
+filter_and_convert(Joined) when is_tuple(Joined) ->
+ hd(filter_and_convert([Joined]));
+filter_and_convert([{_,#testspec{tests=[]}}|TSs]) ->
+ filter_and_convert(TSs);
+filter_and_convert([{[{SpecFile,MergeTests}|SMs],TestSpec}|TSs]) ->
+ #testspec{config = CfgFiles} = TestSpec,
+ TestSpec1 = TestSpec#testspec{config = delete_dups(CfgFiles),
+ merge_tests = MergeTests},
+ %% set the merge_tests value for the testspec to the value
+ %% of the first test spec in the set
+ [{[SpecFile | [SF || {SF,_} <- SMs]], TestSpec1} | filter_and_convert(TSs)];
+filter_and_convert([]) ->
+ [].
+
+delete_dups(Elems) ->
+ delete_dups1(lists:reverse(Elems),[]).
+
+delete_dups1([E|Es],Keep) ->
+ case lists:member(E,Es) of
+ true ->
+ delete_dups1(Es,Keep);
+ false ->
+ delete_dups1(Es,[E|Keep])
+ end;
+delete_dups1([],Keep) ->
+ Keep.
+
+create_specs(Specs,TestSpec,Relaxed,Join) ->
+ SpecsTree = create_spec_tree(Specs,TestSpec,Join,[]),
+ create_specs(SpecsTree,TestSpec,Relaxed).
-collect_tests_from_file1([Spec|Specs],TestSpec,Relaxed) ->
+create_spec_tree([Spec|Specs],TS,JoinWithNext,Known) ->
SpecDir = filename:dirname(filename:absname(Spec)),
- case file:consult(Spec) of
- {ok,Terms} ->
- case collect_tests(Terms,
- TestSpec#testspec{spec_dir=SpecDir},
- Relaxed) of
- TS = #testspec{tests=Tests, logdir=LogDirs} when Specs == [] ->
- LogDirs1 = lists:delete(".",LogDirs) ++ ["."],
- TS#testspec{tests=lists:flatten(Tests), logdir=LogDirs1};
- TS = #testspec{alias = As, nodes = Ns} ->
- TS1 = TS#testspec{alias = lists:reverse(As),
- nodes = lists:reverse(Ns)},
- collect_tests_from_file1(Specs,TS1,Relaxed)
- end;
- {error,Reason} ->
- ReasonStr =
- lists:flatten(io_lib:format("~s",
- [file:format_error(Reason)])),
- throw({error,{Spec,ReasonStr}})
- end.
+ TS1 = TS#testspec{spec_dir=SpecDir},
+ SpecAbsName = get_absfile(Spec,TS1),
+ case lists:member(SpecAbsName,Known) of
+ true ->
+ throw({error,{cyclic_reference,SpecAbsName}});
+ false ->
+ case file:consult(SpecAbsName) of
+ {ok,Terms} ->
+ Terms1 = replace_names(Terms),
+ {InclJoin,InclSep} = get_included_specs(Terms1,TS1),
+ {SpecAbsName,Terms1,
+ create_spec_tree(InclJoin,TS,true,[SpecAbsName|Known]),
+ create_spec_tree(InclSep,TS,false,[SpecAbsName|Known]),
+ JoinWithNext,
+ create_spec_tree(Specs,TS,JoinWithNext,Known)};
+ {error,Reason} ->
+ ReasonStr =
+ lists:flatten(io_lib:format("~s",
+ [file:format_error(Reason)])),
+ throw({error,{SpecAbsName,ReasonStr}})
+ end
+ end;
+create_spec_tree([],_TS,_JoinWithNext,_Known) ->
+ [].
+
+create_specs({Spec,Terms,InclJoin,InclSep,JoinWithNext,NextSpec},
+ TestSpec,Relaxed) ->
+ SpecDir = filename:dirname(filename:absname(Spec)),
+ TestSpec1 = create_spec(Terms,TestSpec#testspec{spec_dir=SpecDir},
+ JoinWithNext,Relaxed),
+
+ {{JoinSpecs1,JoinTS1},Separate1} = create_specs(InclJoin,TestSpec1,Relaxed),
+
+ {{JoinSpecs2,JoinTS2},Separate2} =
+ case JoinWithNext of
+ true ->
+ create_specs(NextSpec,JoinTS1,Relaxed);
+ false ->
+ {{[],JoinTS1},[]}
+ end,
+ {SepJoinSpecs,Separate3} = create_specs(InclSep,TestSpec,Relaxed),
+ {SepJoinSpecs1,Separate4} =
+ case JoinWithNext of
+ true ->
+ {{[],TestSpec},[]};
+ false ->
+ create_specs(NextSpec,TestSpec,Relaxed)
+ end,
+
+ SpecInfo = {Spec,TestSpec1#testspec.merge_tests},
+ AllSeparate =
+ [TSData || TSData = {Ss,_TS} <- Separate3++Separate1++
+ [SepJoinSpecs]++Separate2++
+ [SepJoinSpecs1]++Separate4,
+ Ss /= []],
+
+ case {JoinWithNext,JoinSpecs1} of
+ {true,_} ->
+ {{[SpecInfo|(JoinSpecs1++JoinSpecs2)],JoinTS2},
+ AllSeparate};
+ {false,[]} ->
+ {{[],TestSpec},
+ [{[SpecInfo],TestSpec1}|AllSeparate]};
+ {false,_} ->
+ {{[SpecInfo|(JoinSpecs1++JoinSpecs2)],JoinTS2},
+ AllSeparate}
+ end;
+create_specs([],TestSpec,_Relaxed) ->
+ {{[],TestSpec},[]}.
+
+create_spec(Terms,TestSpec,JoinedByPrev,Relaxed) ->
+ %% it's the "includer" that decides the value of merge_tests
+ Terms1 = if not JoinedByPrev ->
+ [{set_merge_tests,true}|Terms];
+ true ->
+ [{set_merge_tests,false}|Terms]
+ end,
+ TS = #testspec{tests=Tests, logdir=LogDirs} =
+ collect_tests({false,Terms1},TestSpec,Relaxed),
+ LogDirs1 = lists:delete(".",LogDirs) ++ ["."],
+ TS#testspec{tests=lists:flatten(Tests),
+ logdir=LogDirs1}.
collect_tests_from_list(Terms,Relaxed) ->
collect_tests_from_list(Terms,[node()],Relaxed).
@@ -276,8 +388,8 @@ collect_tests_from_list(Terms,Relaxed) ->
collect_tests_from_list(Terms,Nodes,Relaxed) when is_list(Nodes) ->
{ok,Cwd} = file:get_cwd(),
NodeRefs = lists:map(fun(N) -> {undefined,N} end, Nodes),
- case catch collect_tests(Terms,#testspec{nodes=NodeRefs,
- spec_dir=Cwd},
+ case catch collect_tests({true,Terms},#testspec{nodes=NodeRefs,
+ spec_dir=Cwd},
Relaxed) of
E = {error,_} ->
E;
@@ -287,13 +399,28 @@ collect_tests_from_list(Terms,Nodes,Relaxed) when is_list(Nodes) ->
TS#testspec{tests=lists:flatten(Tests), logdir=LogDirs1}
end.
-collect_tests(Terms,TestSpec,Relaxed) ->
+collect_tests({Replace,Terms},TestSpec=#testspec{alias=As,nodes=Ns},Relaxed) ->
put(relaxed,Relaxed),
- Terms1 = replace_names(Terms),
- TestSpec1 = get_global(Terms1,TestSpec),
- TestSpec2 = get_all_nodes(Terms1,TestSpec1),
- {Terms2, TestSpec3} = filter_init_terms(Terms1, [], TestSpec2),
- add_tests(Terms2,TestSpec3).
+ Terms1 = if Replace -> replace_names(Terms);
+ true -> Terms
+ end,
+ {MergeTestsDef,Terms2} =
+ case proplists:get_value(set_merge_tests,Terms1,true) of
+ false ->
+ %% disable merge_tests
+ {TestSpec#testspec.merge_tests,
+ proplists:delete(merge_tests,Terms1)};
+ true ->
+ {true,Terms1}
+ end,
+ %% reverse nodes and aliases initially to get the order of them right
+ %% in case this spec is being joined with a previous one
+ TestSpec1 = get_global(Terms2,TestSpec#testspec{alias = lists:reverse(As),
+ nodes = lists:reverse(Ns),
+ merge_tests = MergeTestsDef}),
+ TestSpec2 = get_all_nodes(Terms2,TestSpec1),
+ {Terms3, TestSpec3} = filter_init_terms(Terms2, [], TestSpec2),
+ add_tests(Terms3,TestSpec3).
%% replace names (atoms) in the testspec matching those in 'define' terms by
%% searching recursively through tuples and lists
@@ -420,9 +547,30 @@ replace_names_in_node1(NodeStr,Defs=[{Name,Replacement}|Ds]) ->
replace_names_in_node1(NodeStr,[]) ->
NodeStr.
+%% look for other specification files, either to join with the
+%% current spec, or execute as separate test runs
+get_included_specs(Terms,TestSpec) ->
+ get_included_specs(Terms,TestSpec,[],[]).
+
+get_included_specs([{specs,How,SpecOrSpecs}|Ts],TestSpec,Join,Sep) ->
+ Specs = case SpecOrSpecs of
+ [File|_] when is_list(File) ->
+ [get_absfile(Spec,TestSpec) || Spec <- SpecOrSpecs];
+ [Ch|_] when is_integer(Ch) ->
+ [get_absfile(SpecOrSpecs,TestSpec)]
+ end,
+ if How == join ->
+ get_included_specs(Ts,TestSpec,Join++Specs,Sep);
+ true ->
+ get_included_specs(Ts,TestSpec,Join,Sep++Specs)
+ end;
+get_included_specs([_|Ts],TestSpec,Join,Sep) ->
+ get_included_specs(Ts,TestSpec,Join,Sep);
+get_included_specs([],_,Join,Sep) ->
+ {Join,Sep}.
%% global terms that will be used for analysing all other terms in the spec
-get_global([{merge_tests,Bool} | Ts], Spec) ->
+get_global([{merge_tests,Bool}|Ts],Spec) ->
get_global(Ts,Spec#testspec{merge_tests=Bool});
%% the 'define' term replaces the 'alias' and 'node' terms, but we need to keep
@@ -588,7 +736,7 @@ add_option({Key,Value},Node,List,WarnIfExists) when is_list(Value) ->
NewOption = case lists:keyfind(Key,1,OldOptions) of
{Key,OldOption} when WarnIfExists,OldOption/=[]->
io:format("There is an option ~w=~w already "
- "defined for node ~p, skipping new ~w~n",
+ "defined for node ~w, skipping new ~w~n",
[Key,OldOption,Node,Value]),
OldOption;
{Key,OldOption}->
@@ -637,7 +785,7 @@ add_tests([{suites,all_nodes,Dir,Ss}|Ts],Spec) ->
add_tests([{suites,Dir,Ss}|Ts],Spec) ->
add_tests([{suites,all_nodes,Dir,Ss}|Ts],Spec);
add_tests([{suites,Nodes,Dir,Ss}|Ts],Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,suites,[Dir,Ss],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(Nodes,suites,[Dir,Ss],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{suites,Node,Dir,Ss}|Ts],Spec) ->
Tests = Spec#testspec.tests,
@@ -660,11 +808,11 @@ add_tests([{groups,Dir,Suite,Gs}|Ts],Spec) ->
add_tests([{groups,Dir,Suite,Gs,{cases,TCs}}|Ts],Spec) ->
add_tests([{groups,all_nodes,Dir,Suite,Gs,{cases,TCs}}|Ts],Spec);
add_tests([{groups,Nodes,Dir,Suite,Gs}|Ts],Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,groups,[Dir,Suite,Gs],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(Nodes,groups,[Dir,Suite,Gs],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{groups,Nodes,Dir,Suite,Gs,{cases,TCs}}|Ts],
Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,groups,[Dir,Suite,Gs,{cases,TCs}],Ts,
+ Ts1 = per_node(Nodes,groups,[Dir,Suite,Gs,{cases,TCs}],Ts,
Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{groups,Node,Dir,Suite,Gs}|Ts],Spec) ->
@@ -688,7 +836,7 @@ add_tests([{cases,all_nodes,Dir,Suite,Cs}|Ts],Spec) ->
add_tests([{cases,Dir,Suite,Cs}|Ts],Spec) ->
add_tests([{cases,all_nodes,Dir,Suite,Cs}|Ts],Spec);
add_tests([{cases,Nodes,Dir,Suite,Cs}|Ts],Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,cases,[Dir,Suite,Cs],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(Nodes,cases,[Dir,Suite,Cs],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{cases,Node,Dir,Suite,Cs}|Ts],Spec) ->
Tests = Spec#testspec.tests,
@@ -703,7 +851,7 @@ add_tests([{skip_suites,all_nodes,Dir,Ss,Cmt}|Ts],Spec) ->
add_tests([{skip_suites,Dir,Ss,Cmt}|Ts],Spec) ->
add_tests([{skip_suites,all_nodes,Dir,Ss,Cmt}|Ts],Spec);
add_tests([{skip_suites,Nodes,Dir,Ss,Cmt}|Ts],Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,skip_suites,[Dir,Ss,Cmt],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(Nodes,skip_suites,[Dir,Ss,Cmt],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{skip_suites,Node,Dir,Ss,Cmt}|Ts],Spec) ->
Tests = Spec#testspec.tests,
@@ -724,11 +872,11 @@ add_tests([{skip_groups,Dir,Suite,Gs,Cmt}|Ts],Spec) ->
add_tests([{skip_groups,Dir,Suite,Gs,{cases,TCs},Cmt}|Ts],Spec) ->
add_tests([{skip_groups,all_nodes,Dir,Suite,Gs,{cases,TCs},Cmt}|Ts],Spec);
add_tests([{skip_groups,Nodes,Dir,Suite,Gs,Cmt}|Ts],Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,skip_groups,[Dir,Suite,Gs,Cmt],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(Nodes,skip_groups,[Dir,Suite,Gs,Cmt],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{skip_groups,Nodes,Dir,Suite,Gs,{cases,TCs},Cmt}|Ts],
Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,skip_groups,[Dir,Suite,Gs,{cases,TCs},Cmt],Ts,
+ Ts1 = per_node(Nodes,skip_groups,[Dir,Suite,Gs,{cases,TCs},Cmt],Ts,
Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{skip_groups,Node,Dir,Suite,Gs,Cmt}|Ts],Spec) ->
@@ -752,7 +900,7 @@ add_tests([{skip_cases,all_nodes,Dir,Suite,Cs,Cmt}|Ts],Spec) ->
add_tests([{skip_cases,Dir,Suite,Cs,Cmt}|Ts],Spec) ->
add_tests([{skip_cases,all_nodes,Dir,Suite,Cs,Cmt}|Ts],Spec);
add_tests([{skip_cases,Nodes,Dir,Suite,Cs,Cmt}|Ts],Spec) when is_list(Nodes) ->
- Ts1 = separate(Nodes,skip_cases,[Dir,Suite,Cs,Cmt],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(Nodes,skip_cases,[Dir,Suite,Cs,Cmt],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
add_tests([{skip_cases,Node,Dir,Suite,Cs,Cmt}|Ts],Spec) ->
Tests = Spec#testspec.tests,
@@ -783,6 +931,9 @@ add_tests([{release_shell,Bool}|Ts],Spec) ->
add_tests(Ts, Spec#testspec{release_shell = Bool});
%% --- handled/errors ---
+add_tests([{set_merge_tests,_}|Ts],Spec) -> % internal
+ add_tests(Ts,Spec);
+
add_tests([{define,_,_}|Ts],Spec) -> % handled
add_tests(Ts,Spec);
@@ -792,7 +943,10 @@ add_tests([{alias,_,_}|Ts],Spec) -> % handled
add_tests([{node,_,_}|Ts],Spec) -> % handled
add_tests(Ts,Spec);
-add_tests([{merge_tests, _} | Ts], Spec) -> % handled
+add_tests([{merge_tests,_} | Ts], Spec) -> % handled
+ add_tests(Ts,Spec);
+
+add_tests([{specs,_,_} | Ts], Spec) -> % handled
add_tests(Ts,Spec);
%% --------------------------------------------------
@@ -821,7 +975,7 @@ add_tests([{Tag,NodesOrOther,Data}|Ts],Spec) when is_list(NodesOrOther) ->
case lists:all(fun(Test) -> is_node(Test,Spec#testspec.nodes)
end, NodesOrOther) of
true ->
- Ts1 = separate(NodesOrOther,Tag,[Data],Ts,Spec#testspec.nodes),
+ Ts1 = per_node(NodesOrOther,Tag,[Data],Ts,Spec#testspec.nodes),
add_tests(Ts1,Spec);
false ->
add_tests([{Tag,all_nodes,{NodesOrOther,Data}}|Ts],Spec)
@@ -866,7 +1020,18 @@ add_tests([],Spec) -> % done
%% check if it's a CT term that has bad format or if the user seems to
%% have added something of his/her own, which we'll let pass if relaxed
%% mode is enabled.
-check_term(Term) ->
+check_term(Atom) when is_atom(Atom) ->
+ Valid = valid_terms(),
+ case lists:member(Atom,Valid) of
+ true ->
+ valid;
+ false -> % ignore
+ case get(relaxed) of
+ true -> invalid;
+ false -> throw({error,{undefined_term_in_spec,Atom}})
+ end
+ end;
+check_term(Term) when is_tuple(Term) ->
Size = size(Term),
[Name|_] = tuple_to_list(Term),
Valid = valid_terms(),
@@ -894,7 +1059,9 @@ check_term(Term) ->
throw({error,{undefined_term_in_spec,Term}})
end
end
- end.
+ end;
+check_term(Other) ->
+ throw({error,{undefined_term_in_spec,Other}}).
%% specific data handling before saving in testspec record, e.g.
%% converting relative paths to absolute for directories and files
@@ -903,6 +1070,8 @@ handle_data(logdir,Node,Dir,Spec) ->
[{Node,ref2dir(Dir,Spec)}];
handle_data(cover,Node,File,Spec) ->
[{Node,get_absfile(File,Spec)}];
+handle_data(cover_stop,Node,Stop,_Spec) ->
+ [{Node,Stop}];
handle_data(include,Node,Dirs=[D|_],Spec) when is_list(D) ->
[{Node,ref2dir(Dir,Spec)} || Dir <- Dirs];
handle_data(include,Node,Dir=[Ch|_],Spec) when is_integer(Ch) ->
@@ -975,12 +1144,12 @@ update_recorded(Tag,Node,Spec) ->
end.
%% create one test term per node
-separate(Nodes,Tag,Data,Tests,Refs) ->
- Separated = separate(Nodes,Tag,Data,Refs),
+per_node(Nodes,Tag,Data,Tests,Refs) ->
+ Separated = per_node(Nodes,Tag,Data,Refs),
Separated ++ Tests.
-separate([N|Ns],Tag,Data,Refs) ->
- [list_to_tuple([Tag,ref2node(N,Refs)|Data])|separate(Ns,Tag,Data,Refs)];
-separate([],_,_,_) ->
+per_node([N|Ns],Tag,Data,Refs) ->
+ [list_to_tuple([Tag,ref2node(N,Refs)|Data])|per_node(Ns,Tag,Data,Refs)];
+per_node([],_,_,_) ->
[].
%% read the value for FieldName in record Rec#testspec
@@ -1037,14 +1206,21 @@ insert_groups(Node,Dir,Suite,Groups,Cases,Tests,true) when
{[Gr],Cases};
true ->
{Gr,Cases} end || Gr <- Groups],
- case lists:keysearch({Node,Dir},1,Tests) of
- {value,{{Node,Dir},[{all,_}]}} ->
- Tests;
- {value,{{Node,Dir},Suites0}} ->
- Suites1 = insert_groups1(Suite,Groups1,Suites0),
- insert_in_order({{Node,Dir},Suites1},Tests);
- false ->
- insert_in_order({{Node,Dir},[{Suite,Groups1}]},Tests)
+ {Tests1,Done} =
+ lists:foldr(fun(All={{N,D},[{all,_}]},{Replaced,_}) when N == Node,
+ D == Dir ->
+ {[All|Replaced],true};
+ ({{N,D},Suites0},{Replaced,_}) when N == Node,
+ D == Dir ->
+ Suites1 = insert_groups1(Suite,Groups1,Suites0),
+ {[{{N,D},Suites1}|Replaced],true};
+ (T,{Replaced,Match}) ->
+ {[T|Replaced],Match}
+ end, {[],false}, Tests),
+ if not Done ->
+ Tests ++ [{{Node,Dir},[{Suite,Groups1}]}];
+ true ->
+ Tests1
end;
insert_groups(Node,Dir,Suite,Groups,Case,Tests, MergeTests)
when is_atom(Case) ->
@@ -1082,14 +1258,21 @@ insert_groups2([],GrAndCases) ->
insert_cases(Node,Dir,Suite,Cases,Tests,false) when is_list(Cases) ->
append({{Node,Dir},[{Suite,Cases}]},Tests);
insert_cases(Node,Dir,Suite,Cases,Tests,true) when is_list(Cases) ->
- case lists:keysearch({Node,Dir},1,Tests) of
- {value,{{Node,Dir},[{all,_}]}} ->
- Tests;
- {value,{{Node,Dir},Suites0}} ->
- Suites1 = insert_cases1(Suite,Cases,Suites0),
- insert_in_order({{Node,Dir},Suites1},Tests);
- false ->
- insert_in_order({{Node,Dir},[{Suite,Cases}]},Tests)
+ {Tests1,Done} =
+ lists:foldr(fun(All={{N,D},[{all,_}]},{Replaced,_}) when N == Node,
+ D == Dir ->
+ {[All|Replaced],true};
+ ({{N,D},Suites0},{Replaced,_}) when N == Node,
+ D == Dir ->
+ Suites1 = insert_cases1(Suite,Cases,Suites0),
+ {[{{N,D},Suites1}|Replaced],true};
+ (T,{Replaced,Match}) ->
+ {[T|Replaced],Match}
+ end, {[],false}, Tests),
+ if not Done ->
+ Tests ++ [{{Node,Dir},[{Suite,Cases}]}];
+ true ->
+ Tests1
end;
insert_cases(Node,Dir,Suite,Case,Tests,MergeTests) when is_atom(Case) ->
insert_cases(Node,Dir,Suite,[Case],Tests,MergeTests).
@@ -1130,15 +1313,23 @@ skip_groups(Node,Dir,Suite,Groups,Cases,Cmt,Tests,false) when
append({{Node,Dir},Suites1},Tests);
skip_groups(Node,Dir,Suite,Groups,Cases,Cmt,Tests,true) when
((Cases == all) or is_list(Cases)) and is_list(Groups) ->
- Suites =
- case lists:keysearch({Node,Dir},1,Tests) of
- {value,{{Node,Dir},Suites0}} ->
- Suites0;
- false ->
- []
- end,
- Suites1 = skip_groups1(Suite,[{Gr,Cases} || Gr <- Groups],Cmt,Suites),
- insert_in_order({{Node,Dir},Suites1},Tests);
+ {Tests1,Done} =
+ lists:foldr(fun({{N,D},Suites0},{Replaced,_}) when N == Node,
+ D == Dir ->
+ Suites1 = skip_groups1(Suite,
+ [{Gr,Cases} || Gr <- Groups],
+ Cmt,Suites0),
+ {[{{N,D},Suites1}|Replaced],true};
+ (T,{Replaced,Match}) ->
+ {[T|Replaced],Match}
+ end, {[],false}, Tests),
+ if not Done ->
+ Tests ++ [{{Node,Dir},skip_groups1(Suite,
+ [{Gr,Cases} || Gr <- Groups],
+ Cmt,[])}];
+ true ->
+ Tests1
+ end;
skip_groups(Node,Dir,Suite,Groups,Case,Cmt,Tests,MergeTests)
when is_atom(Case) ->
Cases = if Case == all -> all; true -> [Case] end,
@@ -1160,15 +1351,19 @@ skip_cases(Node,Dir,Suite,Cases,Cmt,Tests,false) when is_list(Cases) ->
Suites1 = skip_cases1(Suite,Cases,Cmt,[]),
append({{Node,Dir},Suites1},Tests);
skip_cases(Node,Dir,Suite,Cases,Cmt,Tests,true) when is_list(Cases) ->
- Suites =
- case lists:keysearch({Node,Dir},1,Tests) of
- {value,{{Node,Dir},Suites0}} ->
- Suites0;
- false ->
- []
- end,
- Suites1 = skip_cases1(Suite,Cases,Cmt,Suites),
- insert_in_order({{Node,Dir},Suites1},Tests);
+ {Tests1,Done} =
+ lists:foldr(fun({{N,D},Suites0},{Replaced,_}) when N == Node,
+ D == Dir ->
+ Suites1 = skip_cases1(Suite,Cases,Cmt,Suites0),
+ {[{{N,D},Suites1}|Replaced],true};
+ (T,{Replaced,Match}) ->
+ {[T|Replaced],Match}
+ end, {[],false}, Tests),
+ if not Done ->
+ Tests ++ [{{Node,Dir},skip_cases1(Suite,Cases,Cmt,[])}];
+ true ->
+ Tests1
+ end;
skip_cases(Node,Dir,Suite,Case,Cmt,Tests,MergeTests) when is_atom(Case) ->
skip_cases(Node,Dir,Suite,[Case],Cmt,Tests,MergeTests).
@@ -1258,10 +1453,14 @@ is_node([],_) ->
valid_terms() ->
[
+ {set_merge_tests,2},
{define,3},
+ {specs,3},
{node,3},
{cover,2},
{cover,3},
+ {cover_stop,2},
+ {cover_stop,3},
{config,2},
{config,3},
{config,4},
diff --git a/lib/common_test/src/ct_util.erl b/lib/common_test/src/ct_util.erl
index cf891ed043..0f2b2081d9 100644
--- a/lib/common_test/src/ct_util.erl
+++ b/lib/common_test/src/ct_util.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -396,14 +396,14 @@ loop(Mode,TestData,StartDir) ->
%% A connection crashed - remove the connection but don't die
ct_logs:tc_log_async(ct_error_notify,
"Connection process died: "
- "Pid: ~p, Address: ~p, Callback: ~p\n"
+ "Pid: ~w, Address: ~p, Callback: ~w\n"
"Reason: ~p\n\n",
[Pid,A,CB,Reason]),
catch CB:close(Pid),
loop(Mode,TestData,StartDir);
_ ->
%% Let process crash in case of error, this shouldn't happen!
- io:format("\n\nct_util_server got EXIT from ~p: ~p\n\n",
+ io:format("\n\nct_util_server got EXIT from ~w: ~p\n\n",
[Pid,Reason]),
file:set_cwd(StartDir),
exit(Reason)
@@ -956,7 +956,7 @@ open_url(iexplore, Args, URL) ->
Path = proplists:get_value(default, Paths),
[Cmd | _] = string:tokens(Path, "%"),
Cmd1 = Cmd ++ " " ++ Args ++ " " ++ URL,
- io:format(user, "~nOpening ~s with command:~n ~s~n", [URL,Cmd1]),
+ io:format(user, "~nOpening ~ts with command:~n ~ts~n", [URL,Cmd1]),
open_port({spawn,Cmd1}, []);
_ ->
io:format("~nNo path to iexplore.exe~n",[])
@@ -969,6 +969,6 @@ open_url(Prog, Args, URL) ->
is_list(Prog) -> Prog
end,
Cmd = ProgStr ++ " " ++ Args ++ " " ++ URL,
- io:format(user, "~nOpening ~s with command:~n ~s~n", [URL,Cmd]),
+ io:format(user, "~nOpening ~ts with command:~n ~ts~n", [URL,Cmd]),
open_port({spawn,Cmd},[]),
ok.
diff --git a/lib/common_test/src/ct_util.hrl b/lib/common_test/src/ct_util.hrl
index 196b5e46d0..c9c6514fa4 100644
--- a/lib/common_test/src/ct_util.hrl
+++ b/lib/common_test/src/ct_util.hrl
@@ -38,6 +38,7 @@
verbosity=[],
silent_connections=[],
cover=[],
+ cover_stop=[],
config=[],
userconfig=[],
event_handler=[],
diff --git a/lib/common_test/src/cth_conn_log.erl b/lib/common_test/src/cth_conn_log.erl
index 3af89db3a5..644594e34d 100644
--- a/lib/common_test/src/cth_conn_log.erl
+++ b/lib/common_test/src/cth_conn_log.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2012. All Rights Reserved.
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -58,7 +58,7 @@
-spec init(Id, HookOpts) -> Result when
Id :: term(),
- HookOpts :: ct:hook_options(),
+ HookOpts :: ct_netconfc:hook_options(),
Result :: {ok,[{ct_netconfc:conn_mod(),
{ct_netconfc:log_type(),[ct_netconfc:key_or_name()]}}]}.
init(_Id, HookOpts) ->
@@ -105,8 +105,9 @@ pre_init_per_testcase(TestCase,Config,CthState) ->
"<table borders=1>"
"<b>" ++ ConnModStr ++ " logs:</b>\n" ++
[io_lib:format(
- "<tr><td>~p</td><td><a href=~p>~s</a></td></tr>",
- [S,L,filename:basename(L)])
+ "<tr><td>~p</td><td><a href=\"~ts\">~ts</a>"
+ "</td></tr>",
+ [S,ct_logs:uri(L),filename:basename(L)])
|| {S,L} <- Ls] ++
"</table>",
io:format(Str,[]),
diff --git a/lib/common_test/src/cth_log_redirect.erl b/lib/common_test/src/cth_log_redirect.erl
index 77f57c6195..78ae70f37e 100644
--- a/lib/common_test/src/cth_log_redirect.erl
+++ b/lib/common_test/src/cth_log_redirect.erl
@@ -54,7 +54,7 @@ post_init_per_group(_Group, _Config, Result, State) ->
post_end_per_testcase(_TC, _Config, Result, State) ->
%% Make sure that the event queue is flushed
%% before ending this test case.
- gen_event:call(error_logger, ?MODULE, flush),
+ gen_event:call(error_logger, ?MODULE, flush, 300000),
{Result, State}.
pre_end_per_group(Group, Config, {ct_log, Group}) ->
diff --git a/lib/common_test/src/cth_surefire.erl b/lib/common_test/src/cth_surefire.erl
index 76b0f0b5ea..1a38b6584b 100644
--- a/lib/common_test/src/cth_surefire.erl
+++ b/lib/common_test/src/cth_surefire.erl
@@ -1,3 +1,22 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%--------------------------------------------------------------------
+
%%% @doc Common Test Framework functions handling test specifications.
%%%
%%% <p>This module creates a junit report of the test run if plugged in
@@ -27,18 +46,28 @@
-export([terminate/1]).
-record(state, { filepath, axis, properties, package, hostname,
- curr_suite, curr_suite_ts, curr_group = [], curr_tc,
- curr_log_dir, timer, tc_log,
+ curr_suite, curr_suite_ts, curr_group = [],
+ curr_log_dir, timer, tc_log, url_base,
test_cases = [],
test_suites = [] }).
--record(testcase, { log, group, classname, name, time, failure, timestamp }).
--record(testsuite, { errors, failures, hostname, name, tests,
+-record(testcase, { log, url, group, classname, name, time, result, timestamp }).
+-record(testsuite, { errors, failures, skipped, hostname, name, tests,
time, timestamp, id, package,
- properties, testcases }).
+ properties, testcases, log, url }).
+
+-define(default_report,"junit_report.xml").
+-define(suite_log,"suite.log.html").
+
+%% Number of dirs from log root to testcase log file.
+%% ct_run.<node>.<timestamp>/<test_name>/run.<timestamp>/<tc_log>.html
+-define(log_depth,3).
id(Opts) ->
- filename:absname(proplists:get_value(path, Opts, "junit_report.xml")).
+ case proplists:get_value(path, Opts) of
+ undefined -> ?default_report;
+ Path -> filename:absname(Path)
+ end.
init(Path, Opts) ->
{ok, Host} = inet:gethostname(),
@@ -47,10 +76,24 @@ init(Path, Opts) ->
package = proplists:get_value(package,Opts),
axis = proplists:get_value(axis,Opts,[]),
properties = proplists:get_value(properties,Opts,[]),
+ url_base = proplists:get_value(url_base,Opts),
timer = now() }.
pre_init_per_suite(Suite,Config,#state{ test_cases = [] } = State) ->
- {Config, init_tc(State#state{ curr_suite = Suite, curr_suite_ts = now() },
+ TcLog = proplists:get_value(tc_logfile,Config),
+ CurrLogDir = filename:dirname(TcLog),
+ Path =
+ case State#state.filepath of
+ ?default_report ->
+ RootDir = get_test_root(TcLog),
+ filename:join(RootDir,?default_report);
+ P ->
+ P
+ end,
+ {Config, init_tc(State#state{ filepath = Path,
+ curr_suite = Suite,
+ curr_suite_ts = now(),
+ curr_log_dir = CurrLogDir},
Config) };
pre_init_per_suite(Suite,Config,State) ->
%% Have to close the previous suite
@@ -59,7 +102,8 @@ pre_init_per_suite(Suite,Config,State) ->
post_init_per_suite(_Suite,Config, Result, State) ->
{Result, end_tc(init_per_suite,Config,Result,State)}.
-pre_end_per_suite(_Suite,Config,State) -> {Config, init_tc(State, Config)}.
+pre_end_per_suite(_Suite,Config,State) ->
+ {Config, init_tc(State, Config)}.
post_end_per_suite(_Suite,Config,Result,State) ->
{Result, end_tc(end_per_suite,Config,Result,State)}.
@@ -71,13 +115,15 @@ pre_init_per_group(Group,Config,State) ->
post_init_per_group(_Group,Config,Result,State) ->
{Result, end_tc(init_per_group,Config,Result,State)}.
-pre_end_per_group(_Group,Config,State) -> {Config, init_tc(State, Config)}.
+pre_end_per_group(_Group,Config,State) ->
+ {Config, init_tc(State, Config)}.
post_end_per_group(_Group,Config,Result,State) ->
NewState = end_tc(end_per_group, Config, Result, State),
{Result, NewState#state{ curr_group = tl(NewState#state.curr_group)}}.
-pre_init_per_testcase(_TC,Config,State) -> {Config, init_tc(State, Config)}.
+pre_init_per_testcase(_TC,Config,State) ->
+ {Config, init_tc(State, Config)}.
post_end_per_testcase(TC,Config,Result,State) ->
{Result, end_tc(TC,Config, Result,State)}.
@@ -88,11 +134,19 @@ on_tc_fail(_TC, Res, State) ->
TCs = State#state.test_cases,
TC = hd(TCs),
NewTC = TC#testcase{
- failure =
+ result =
{fail,lists:flatten(io_lib:format("~p",[Res]))} },
State#state{ test_cases = [NewTC | tl(TCs)]}.
-on_tc_skip(Tc,{Type,_Reason} = Res, State) when Type == tc_auto_skip ->
+on_tc_skip(Tc,{Type,_Reason} = Res, State0) when Type == tc_auto_skip ->
+ TcStr = atom_to_list(Tc),
+ State =
+ case State0#state.test_cases of
+ [#testcase{name=TcStr}|TCs] ->
+ State0#state{test_cases=TCs};
+ _ ->
+ State0
+ end,
do_tc_skip(Res, end_tc(Tc,[],Res,init_tc(State,[])));
on_tc_skip(_Tc, _Res, State = #state{test_cases = []}) ->
State;
@@ -103,7 +157,7 @@ do_tc_skip(Res, State) ->
TCs = State#state.test_cases,
TC = hd(TCs),
NewTC = TC#testcase{
- failure =
+ result =
{skipped,lists:flatten(io_lib:format("~p",[Res]))} },
State#state{ test_cases = [NewTC | tl(TCs)]}.
@@ -117,33 +171,52 @@ end_tc(Func, Config, Res, State) when is_atom(Func) ->
end_tc(atom_to_list(Func), Config, Res, State);
end_tc(Name, _Config, _Res, State = #state{ curr_suite = Suite,
curr_group = Groups,
- timer = TS, tc_log = Log } ) ->
+ curr_log_dir = CurrLogDir,
+ timer = TS,
+ tc_log = Log0,
+ url_base = UrlBase } ) ->
+ Log =
+ case Log0 of
+ "" ->
+ LowerSuiteName = string:to_lower(atom_to_list(Suite)),
+ filename:join(CurrLogDir,LowerSuiteName++"."++Name++".html");
+ _ ->
+ Log0
+ end,
+ Url = make_url(UrlBase,Log),
ClassName = atom_to_list(Suite),
PGroup = string:join([ atom_to_list(Group)||
Group <- lists:reverse(Groups)],"."),
TimeTakes = io_lib:format("~f",[timer:now_diff(now(),TS) / 1000000]),
State#state{ test_cases = [#testcase{ log = Log,
+ url = Url,
timestamp = now_to_string(TS),
classname = ClassName,
group = PGroup,
name = Name,
time = TimeTakes,
- failure = passed }| State#state.test_cases]}.
+ result = passed }|
+ State#state.test_cases],
+ tc_log = ""}. % so old tc_log is not set if next is on_tc_skip
close_suite(#state{ test_cases = [] } = State) ->
State;
-close_suite(#state{ test_cases = TCs } = State) ->
- Total = length(TCs),
- Succ = length(lists:filter(fun(#testcase{ failure = F }) ->
- F == passed
- end,TCs)),
- Fail = Total - Succ,
+close_suite(#state{ test_cases = TCs, url_base = UrlBase } = State) ->
+ {Total,Fail,Skip} = count_tcs(TCs,0,0,0),
TimeTaken = timer:now_diff(now(),State#state.curr_suite_ts) / 1000000,
+ SuiteLog = filename:join(State#state.curr_log_dir,?suite_log),
+ SuiteUrl = make_url(UrlBase,SuiteLog),
Suite = #testsuite{ name = atom_to_list(State#state.curr_suite),
package = State#state.package,
+ hostname = State#state.hostname,
time = io_lib:format("~f",[TimeTaken]),
timestamp = now_to_string(State#state.curr_suite_ts),
- errors = Fail, tests = Total,
- testcases = lists:reverse(TCs) },
+ errors = 0,
+ failures = Fail,
+ skipped = Skip,
+ tests = Total,
+ testcases = lists:reverse(TCs),
+ log = SuiteLog,
+ url = SuiteUrl},
State#state{ test_cases = [],
test_suites = [Suite | State#state.test_suites]}.
@@ -159,14 +232,15 @@ terminate(State) ->
-to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, timestamp = TS, failure = F}) ->
+to_xml(#testcase{ group = Group, classname = CL, log = L, url = U, name = N, time = T, timestamp = TS, result = R}) ->
["<testcase ",
- [["group=\"",Group,"\""]||Group /= ""]," "
+ [["group=\"",Group,"\" "]||Group /= ""],
"name=\"",N,"\" "
"time=\"",T,"\" "
- "timestamp=\"",TS,"\" "
+ "timestamp=\"",TS,"\" ",
+ [["url=\"",U,"\" "]||U /= undefined],
"log=\"",L,"\">",
- case F of
+ case R of
passed ->
[];
{skipped,Reason} ->
@@ -176,22 +250,29 @@ to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, ti
["<failure message=\"Test ",N," in ",CL," failed!\" type=\"crash\">",
sanitize(Reason),"</failure>"]
end,"</testcase>"];
-to_xml(#testsuite{ package = P, hostname = H, errors = E, time = Time,
- timestamp = TS, tests = T, name = N, testcases = Cases }) ->
+to_xml(#testsuite{ package = P, hostname = H, errors = E, failures = F,
+ skipped = S, time = Time, timestamp = TS, tests = T, name = N,
+ testcases = Cases, log = Log, url = Url }) ->
["<testsuite ",
[["package=\"",P,"\" "]||P /= undefined],
- [["hostname=\"",P,"\" "]||H /= undefined],
- [["name=\"",N,"\" "]||N /= undefined],
- [["time=\"",Time,"\" "]||Time /= undefined],
- [["timestamp=\"",TS,"\" "]||TS /= undefined],
+ "hostname=\"",H,"\" "
+ "name=\"",N,"\" "
+ "time=\"",Time,"\" "
+ "timestamp=\"",TS,"\" "
"errors=\"",integer_to_list(E),"\" "
- "tests=\"",integer_to_list(T),"\">",
+ "failures=\"",integer_to_list(F),"\" "
+ "skipped=\"",integer_to_list(S),"\" "
+ "tests=\"",integer_to_list(T),"\" ",
+ [["url=\"",Url,"\" "]||Url /= undefined],
+ "log=\"",Log,"\">",
[to_xml(Case) || Case <- Cases],
"</testsuite>"];
to_xml(#state{ test_suites = TestSuites, axis = Axis, properties = Props }) ->
["<testsuites>",properties_to_xml(Axis,Props),
[to_xml(TestSuite) || TestSuite <- TestSuites],"</testsuites>"].
+properties_to_xml([],[]) ->
+ [];
properties_to_xml(Axis,Props) ->
["<properties>",
[["<property name=\"",Name,"\" axis=\"yes\" value=\"",Value,"\" />"] || {Name,Value} <- Axis],
@@ -216,4 +297,38 @@ sanitize([]) ->
now_to_string(Now) ->
{{YY,MM,DD},{HH,Mi,SS}} = calendar:now_to_local_time(Now),
- io_lib:format("~p-~2..0B-~2..0BT~2..0B:~2..0B:~2..0B",[YY,MM,DD,HH,Mi,SS]).
+ io_lib:format("~w-~2..0B-~2..0BT~2..0B:~2..0B:~2..0B",[YY,MM,DD,HH,Mi,SS]).
+
+make_url(undefined,_) ->
+ undefined;
+make_url(_,[]) ->
+ undefined;
+make_url(UrlBase0,Log) ->
+ UrlBase = string:strip(UrlBase0,right,$/),
+ RelativeLog = get_relative_log_url(Log),
+ string:join([UrlBase,RelativeLog],"/").
+
+get_test_root(Log) ->
+ LogParts = filename:split(Log),
+ filename:join(lists:sublist(LogParts,1,length(LogParts)-?log_depth)).
+
+get_relative_log_url(Log) ->
+ LogParts = filename:split(Log),
+ Start = length(LogParts)-?log_depth,
+ Length = ?log_depth+1,
+ string:join(lists:sublist(LogParts,Start,Length),"/").
+
+count_tcs([#testcase{name=ConfCase}|TCs],Ok,F,S)
+ when ConfCase=="init_per_suite";
+ ConfCase=="end_per_suite";
+ ConfCase=="init_per_group";
+ ConfCase=="end_per_group" ->
+ count_tcs(TCs,Ok,F,S);
+count_tcs([#testcase{result=passed}|TCs],Ok,F,S) ->
+ count_tcs(TCs,Ok+1,F,S);
+count_tcs([#testcase{result={fail,_}}|TCs],Ok,F,S) ->
+ count_tcs(TCs,Ok,F+1,S);
+count_tcs([#testcase{result={skipped,_}}|TCs],Ok,F,S) ->
+ count_tcs(TCs,Ok,F,S+1);
+count_tcs([],Ok,F,S) ->
+ {Ok+F+S,F,S}.
diff --git a/lib/common_test/src/unix_telnet.erl b/lib/common_test/src/unix_telnet.erl
index 25b9d4d5d2..99ce92e9f1 100644
--- a/lib/common_test/src/unix_telnet.erl
+++ b/lib/common_test/src/unix_telnet.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -110,7 +110,7 @@ connect1(Ip,Port,Timeout,KeepAlive,Username,Password) ->
case ct_telnet:silent_teln_expect(Pid,[],[prompt],?prx,[]) of
{ok,{prompt,?username},_} ->
ok = ct_telnet_client:send_data(Pid,Username),
- cont_log("Username: ~s",[Username]),
+ cont_log("Username: ~ts",[Username]),
case ct_telnet:silent_teln_expect(Pid,[],prompt,?prx,[]) of
{ok,{prompt,?password},_} ->
ok = ct_telnet_client:send_data(Pid,Password),
diff --git a/lib/common_test/test/Makefile b/lib/common_test/test/Makefile
index 374fd8a824..760cc20410 100644
--- a/lib/common_test/test/Makefile
+++ b/lib/common_test/test/Makefile
@@ -40,6 +40,7 @@ MODULES= \
ct_repeat_1_SUITE \
ct_testspec_1_SUITE \
ct_testspec_2_SUITE \
+ ct_testspec_3_SUITE \
ct_skip_SUITE \
ct_error_SUITE \
ct_test_server_if_1_SUITE \
@@ -52,7 +53,12 @@ MODULES= \
ct_auto_compile_SUITE \
ct_verbosity_SUITE \
ct_shell_SUITE \
- ct_groups_search_SUITE
+ ct_system_error_SUITE \
+ ct_snmp_SUITE \
+ ct_group_leader_SUITE \
+ ct_cover_SUITE \
+ ct_groups_search_SUITE \
+ ct_surefire_SUITE
ERL_FILES= $(MODULES:%=%.erl)
@@ -106,7 +112,7 @@ release_spec: opt
release_tests_spec:
$(INSTALL_DIR) "$(RELSYSDIR)"
$(INSTALL_DATA) $(ERL_FILES) $(COVERFILE) "$(RELSYSDIR)"
- $(INSTALL_DATA) common_test.spec "$(RELSYSDIR)"
+ $(INSTALL_DATA) common_test.spec common_test.cover "$(RELSYSDIR)"
chmod -R u+w "$(RELSYSDIR)"
@tar cf - *_SUITE_data | (cd "$(RELSYSDIR)"; tar xf -)
diff --git a/lib/common_test/test/common_test.cover b/lib/common_test/test/common_test.cover
new file mode 100644
index 0000000000..3aa49623e7
--- /dev/null
+++ b/lib/common_test/test/common_test.cover
@@ -0,0 +1,10 @@
+%% -*- erlang -*-
+{incl_app,common_test,details}.
+{cross,common_test,[{test_server,[erl2html2,
+ test_server,
+ test_server_ctrl,
+ test_server_gl,
+ test_server_h,
+ test_server_io,
+ test_server_node,
+ test_server_sup]}]}.
diff --git a/lib/common_test/test/ct_config_info_SUITE.erl b/lib/common_test/test/ct_config_info_SUITE.erl
index 40da377ee5..10fe8286dd 100644
--- a/lib/common_test/test/ct_config_info_SUITE.erl
+++ b/lib/common_test/test/ct_config_info_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -123,8 +123,7 @@ test_events(config_info) ->
{?eh,tc_done,{config_info_1_SUITE,init_per_suite,ok}},
[{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g1,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {init_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g1,[]},
{failed,{timetrap_timeout,350}}}},
{?eh,tc_auto_skip,{config_info_1_SUITE,t11,
{failed,{config_info_1_SUITE,init_per_group,{timetrap_timeout,350}}}}},
@@ -136,14 +135,12 @@ test_events(config_info) ->
{?eh,tc_done,{config_info_1_SUITE,{init_per_group,g2,[]},ok}},
{?eh,tc_done,{config_info_1_SUITE,t21,ok}},
{?eh,tc_start,{config_info_1_SUITE,{end_per_group,g2,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {end_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g2,[]},
{failed,{timetrap_timeout,450}}}}],
[{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g3,[]}}},
{?eh,tc_done,{config_info_1_SUITE,{init_per_group,g3,[]},ok}},
[{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g4,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {init_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g4,[]},
{failed,{timetrap_timeout,400}}}},
{?eh,tc_auto_skip,{config_info_1_SUITE,t41,
{failed,{config_info_1_SUITE,init_per_group,
@@ -164,8 +161,7 @@ test_events(config_info) ->
{?eh,tc_done,{config_info_1_SUITE,{init_per_group,g5,[]},ok}},
{?eh,tc_done,{config_info_1_SUITE,t51,ok}},
{?eh,tc_start,{config_info_1_SUITE,{end_per_group,g5,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {end_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g5,[]},
{failed,{timetrap_timeout,400}}}}],
{?eh,tc_start,{config_info_1_SUITE,{end_per_group,g3,[]}}},
{?eh,tc_done,{config_info_1_SUITE,{end_per_group,g3,[]},ok}}],
diff --git a/lib/common_test/test/ct_cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE.erl
new file mode 100644
index 0000000000..cb49dc423f
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE.erl
@@ -0,0 +1,312 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_cover_SUITE
+%%%
+%%% Description:
+%%% Test code cover analysis support
+%%%
+%%%-------------------------------------------------------------------
+-module(ct_cover_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+-define(suite, cover_SUITE).
+-define(mod, cover_test_mod).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ case test_server:is_cover() of
+ true ->
+ {skip,"Test server is running cover already - skipping"};
+ false ->
+ ct_test_support:init_per_suite(Config)
+ end.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ Node = fullname(existing_node),
+ case lists:member(Node,nodes()) of
+ true -> rpc:call(Node,erlang,halt,[]);
+ false -> ok
+ end,
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ default,
+ cover_stop_true,
+ cover_stop_false,
+ slave,
+ slave_start_slave,
+ cover_node_option,
+ ct_cover_add_remove_nodes,
+ otp_9956,
+ cross
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%% Check that cover is collected from test node
+%% Also check that cover is by default stopped after test is completed
+default(Config) ->
+ {ok,Events} = run_test(default,Config),
+ false = check_cover(Config),
+ check_calls(Events,1),
+ ok.
+
+%% Check that cover is stopped when cover_stop option is set to true
+cover_stop_true(Config) ->
+ {ok,_Events} = run_test(cover_stop_true,[{cover_stop,true}],Config),
+ false = check_cover(Config).
+
+%% Check that cover is not stopped when cover_stop option is set to false
+cover_stop_false(Config) ->
+ {ok,_Events} = run_test(cover_stop_false,[{cover_stop,false}],Config),
+ {true,[],[?mod]} = check_cover(Config),
+ CTNode = proplists:get_value(ct_node, Config),
+ ok = rpc:call(CTNode,cover,stop,[]),
+ false = check_cover(Config),
+ ok.
+
+%% Let test node start a slave node - check that cover is collected
+%% from both nodes
+slave(Config) ->
+ {ok,Events} = run_test(slave,slave,[],Config),
+ check_calls(Events,2),
+ ok.
+
+%% Let test node start a slave node which in turn starts another slave
+%% node - check that cover is collected from all three nodes
+slave_start_slave(Config) ->
+ {ok,Events} = run_test(slave_start_slave,slave_start_slave,[],Config),
+ check_calls(Events,3),
+ ok.
+
+%% Start a slave node before test starts - the node is listed in cover
+%% spec file.
+%% Check that cover is collected from test node and slave node.
+cover_node_option(Config) ->
+ {ok, HostStr}=inet:gethostname(),
+ Host = list_to_atom(HostStr),
+ DataDir = ?config(data_dir,Config),
+ {ok,Node} = ct_slave:start(Host,existing_node,
+ [{erl_flags,"-pa " ++ DataDir}]),
+ false = check_cover(Node),
+ CoverSpec = default_cover_file_content() ++ [{nodes,[Node]}],
+ CoverFile = create_cover_file(cover_node_option,CoverSpec,Config),
+ {ok,Events} = run_test(cover_node_option,cover_node_option,
+ [{cover,CoverFile}],Config),
+ check_calls(Events,2),
+ {ok,Node} = ct_slave:stop(existing_node),
+ ok.
+
+%% Test ct_cover:add_nodes/1 and ct_cover:remove_nodes/1
+%% Check that cover is collected from added node
+ct_cover_add_remove_nodes(Config) ->
+ {ok, HostStr}=inet:gethostname(),
+ Host = list_to_atom(HostStr),
+ DataDir = ?config(data_dir,Config),
+ {ok,Node} = ct_slave:start(Host,existing_node,
+ [{erl_flags,"-pa " ++ DataDir}]),
+ false = check_cover(Node),
+ {ok,Events} = run_test(ct_cover_add_remove_nodes,ct_cover_add_remove_nodes,
+ [],Config),
+ check_calls(Events,2),
+ {ok,Node} = ct_slave:stop(existing_node),
+ ok.
+
+%% Test that the test suite itself can be cover compiled and that
+%% data_dir is set correctly (OTP-9956)
+otp_9956(Config) ->
+ CoverFile = create_cover_file(otp_9956,[{incl_mods,[?suite]}],Config),
+ {ok,Events} = run_test(otp_9956,otp_9956,[{cover,CoverFile}],Config),
+ check_calls(Events,{?suite,otp_9956,1},1),
+ ok.
+
+%% Test cross cover mechanism
+cross(Config) ->
+ {ok,Events1} = run_test(cross1,Config),
+ check_calls(Events1,1),
+
+ CoverFile2 = create_cover_file(cross1,[{cross,[{cross1,[?mod]}]}],Config),
+ {ok,Events2} = run_test(cross2,[{cover,CoverFile2}],Config),
+ check_calls(Events2,1),
+
+ %% Get the log dirs for each test and run cross cover analyse
+ [D11,D12] = lists:sort(get_run_dirs(Events1)),
+ [D21,D22] = lists:sort(get_run_dirs(Events2)),
+
+ ct_cover:cross_cover_analyse(details,[{cross1,D11},{cross2,D21}]),
+ ct_cover:cross_cover_analyse(details,[{cross1,D12},{cross2,D22}]),
+
+ %% Get the cross cover logs and read for each test
+ [C11,C12,C21,C22] =
+ [filename:join(D,"cross_cover.html") || D <- [D11,D12,D21,D22]],
+
+ {ok,CrossData} = file:read_file(C11),
+ {ok,CrossData} = file:read_file(C12),
+
+ {ok,Def} = file:read_file(C21),
+ {ok,Def} = file:read_file(C22),
+
+ %% A simple test: just check that the test module exists in the
+ %% log from cross1 test, and that it does not exist in the log
+ %% from cross2 test.
+ TestMod = list_to_binary(atom_to_list(?mod)),
+ {_,_} = binary:match(CrossData,TestMod),
+ nomatch = binary:match(Def,TestMod),
+ {_,_} = binary:match(Def,
+ <<"No cross cover modules exist for this application">>),
+
+ ok.
+
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+run_test(Label,Config) ->
+ run_test(Label,[],Config).
+run_test(Label,ExtraOpts,Config) ->
+ run_test(Label,default,ExtraOpts,Config).
+run_test(Label,Testcase,ExtraOpts,Config) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, ?suite),
+ CoverFile =
+ case proplists:get_value(cover,ExtraOpts) of
+ undefined ->
+ create_default_cover_file(Label,Config);
+ CF ->
+ CF
+ end,
+ RestOpts = lists:keydelete(cover,1,ExtraOpts),
+ {Opts,ERPid} = setup([{suite,Suite},{testcase,Testcase},
+ {cover,CoverFile},{label,Label}] ++ RestOpts, Config),
+ execute(Label, Testcase, Opts, ERPid, Config).
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Testcase, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+ TestEvents = events_to_check(Testcase),
+ R = ct_test_support:verify_events(TestEvents, Events, Config),
+ {R,Events}.
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+events_to_check(Testcase) ->
+ OneTest =
+ [{?eh,start_logging,{'DEF','RUNDIR'}}] ++
+ [{?eh,tc_done,{?suite,Testcase,ok}}] ++
+ [{?eh,stop_logging,[]}],
+
+ %% 2 tests (ct:run_test + script_start) is default
+ OneTest ++ OneTest.
+
+check_cover(Config) when is_list(Config) ->
+ CTNode = proplists:get_value(ct_node, Config),
+ check_cover(CTNode);
+check_cover(Node) when is_atom(Node) ->
+ case rpc:call(Node,test_server,is_cover,[]) of
+ true ->
+ {true,
+ rpc:call(Node,cover,which_nodes,[]),
+ rpc:call(Node,cover,modules,[])};
+ false ->
+ false
+ end.
+
+%% Get the log dir "run.<timestamp>" for all (both!) tests
+get_run_dirs(Events) ->
+ [filename:dirname(TCLog) ||
+ {ct_test_support_eh,
+ {event,tc_logfile,_Node,
+ {{?suite,init_per_suite},TCLog}}} <- Events].
+
+%% Check that each coverlog includes N calls to ?mod:foo/0
+check_calls(Events,N) ->
+ check_calls(Events,{?mod,foo,0},N).
+check_calls(Events,MFA,N) ->
+ CoverLogs = [filename:join(D,"all.coverdata") || D <- get_run_dirs(Events)],
+ do_check_logs(CoverLogs,MFA,N).
+
+do_check_logs([CoverLog|CoverLogs],{Mod,_,_} = MFA,N) ->
+ {ok,_} = cover:start(),
+ ok = cover:import(CoverLog),
+ {ok,Calls} = cover:analyse(Mod,calls,function),
+ ok = cover:stop(),
+ {MFA,N} = lists:keyfind(MFA,1,Calls),
+ do_check_logs(CoverLogs,MFA,N);
+do_check_logs([],_,_) ->
+ ok.
+
+fullname(Name) ->
+ {ok,Host} = inet:gethostname(),
+ list_to_atom(atom_to_list(Name) ++ "@" ++ Host).
+
+default_cover_file_content() ->
+ [{incl_mods,[?mod]}].
+
+create_default_cover_file(Filename,Config) ->
+ create_cover_file(Filename,default_cover_file_content(),Config).
+
+create_cover_file(Filename,Terms,Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ File = filename:join(PrivDir,Filename) ++ ".cover",
+ {ok,Fd} = file:open(File,[write]),
+ lists:foreach(fun(Term) ->
+ file:write(Fd,io_lib:format("~p.~n",[Term]))
+ end,Terms),
+ ok = file:close(Fd),
+ File.
diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl
new file mode 100644
index 0000000000..fdc3323f0a
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl
@@ -0,0 +1,156 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+%%----------------------------------------------------------------------
+%% File: cover_SUITE.erl
+%%
+%% Description:
+%% This file contains the test cases for the code coverage support
+%%
+%% @author Support
+%% @doc Test of code coverage support in common_test
+%% @end
+%%----------------------------------------------------------------------
+%%----------------------------------------------------------------------
+-module(cover_SUITE).
+-include_lib("common_test/include/ct.hrl").
+
+-compile(export_all).
+
+%% Default timetrap timeout (set in init_per_testcase).
+-define(default_timeout, ?t:minutes(1)).
+
+suite() ->
+ [].
+
+all() ->
+ [].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(Config) ->
+ Config.
+
+init_per_testcase(_Case, Config) ->
+ Dog = test_server:timetrap(?default_timeout),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(Case, Config) ->
+ %% try apply(?MODULE,Case,[cleanup,Config])
+ %% catch error:undef -> ok
+ %% end,
+
+ kill_slaves(Case,nodes()),
+ Dog=?config(watchdog, Config),
+ test_server:timetrap_cancel(Dog),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+break(_Config) ->
+ test_server:break(""),
+ ok.
+
+default(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ ok.
+
+slave(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ N1 = nodename(slave,1),
+ {ok,Node} = ct_slave:start(N1),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]),
+ {ok,Node} = ct_slave:stop(N1),
+ ok.
+
+slave_start_slave(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ N1 = nodename(slave_start_slave,1),
+ N2 = nodename(slave_start_slave,2),
+ {ok,Node} = ct_slave:start(N1),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]),
+ {ok,Node2} = rpc:call(Node,ct_slave,start,[N2]),
+ rpc:call(Node2,cover_test_mod,foo,[]),
+ {ok,Node2} = rpc:call(Node,ct_slave,stop,[N2]),
+ {ok,Node} = ct_slave:stop(N1),
+ ok.
+
+cover_node_option(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ Node = fullname(existing_node),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]),
+ ok.
+
+ct_cover_add_remove_nodes(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ Node = fullname(existing_node),
+ Beam = rpc:call(Node,code,which,[cover_test_mod]),
+ false = (Beam == cover_compiled),
+
+ rpc:call(Node,cover_test_mod,foo,[]), % should not be collected
+ {ok,[Node]} = ct_cover:add_nodes([Node]),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]), % should be collected
+ ok = ct_cover:remove_nodes([Node]),
+ rpc:call(Node,cover_test_mod,foo,[]), % should not be collected
+
+ Beam = rpc:call(Node,code,which,[cover_test_mod]),
+
+ ok.
+
+otp_9956(Config) ->
+ cover_compiled = code:which(?MODULE),
+ DataDir = ?config(data_dir,Config),
+ absolute = filename:pathtype(DataDir),
+ true = filelib:is_dir(DataDir),
+ ok.
+
+
+%%%-----------------------------------------------------------------
+%%% Internal
+nodename(Case,N) ->
+ list_to_atom(nodeprefix(Case) ++ integer_to_list(N)).
+
+nodeprefix(Case) ->
+ atom_to_list(?MODULE) ++ "_" ++ atom_to_list(Case) ++ "_node".
+
+
+fullname(Name) ->
+ {ok,Host} = inet:gethostname(),
+ list_to_atom(atom_to_list(Name) ++ "@" ++ Host).
+
+kill_slaves(Case, [Node|Nodes]) ->
+ Prefix = nodeprefix(Case),
+ case lists:prefix(Prefix,atom_to_list(Node)) of
+ true ->
+ rpc:call(Node,erlang,halt,[]);
+ _ ->
+ ok
+ end,
+ kill_slaves(Case,Nodes);
+kill_slaves(_,[]) ->
+ ok.
diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore
new file mode 100644
index 0000000000..e69de29bb2
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore
diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl b/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl
new file mode 100644
index 0000000000..d4f69452c3
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl
@@ -0,0 +1,4 @@
+-module(cover_test_mod).
+-compile(export_all).
+foo() ->
+ ok.
diff --git a/lib/common_test/test/ct_error_SUITE.erl b/lib/common_test/test/ct_error_SUITE.erl
index 338e76264e..86ec71c98e 100644
--- a/lib/common_test/test/ct_error_SUITE.erl
+++ b/lib/common_test/test/ct_error_SUITE.erl
@@ -44,8 +44,12 @@
%% there will be clashes with logging processes etc).
%%--------------------------------------------------------------------
init_per_suite(Config) ->
- Config1 = ct_test_support:init_per_suite(Config),
- Config1.
+ DataDir = ?config(data_dir, Config),
+ TestDir = filename:join(DataDir, "error/test/"),
+ CTH = filename:join(TestDir, "verify_config.erl"),
+ ct:pal("Compiling ~p: ~p",
+ [CTH,compile:file(CTH,[{outdir,TestDir},debug_info])]),
+ ct_test_support:init_per_suite([{path_dirs,[TestDir]} | Config]).
end_per_suite(Config) ->
ct_test_support:end_per_suite(Config).
@@ -61,7 +65,8 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[cfg_error, lib_error, no_compile, timetrap_end_conf,
timetrap_normal, timetrap_extended, timetrap_parallel,
- timetrap_fun, misc_errors].
+ timetrap_fun, timetrap_fun_group, misc_errors,
+ config_restored].
groups() ->
[].
@@ -251,6 +256,24 @@ timetrap_fun(Config) when is_list(Config) ->
%%%-----------------------------------------------------------------
%%%
+timetrap_fun_group(Config) when is_list(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Join = fun(D, S) -> filename:join(D, "error/test/"++S) end,
+ Suites = [Join(DataDir, "timetrap_8_SUITE")],
+ {Opts,ERPid} = setup([{suite,Suites}], Config),
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(timetrap_fun_group,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(timetrap_fun_group),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config).
+
+%%%-----------------------------------------------------------------
+%%%
misc_errors(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
Join = fun(D, S) -> filename:join(D, "error/test/"++S) end,
@@ -267,6 +290,24 @@ misc_errors(Config) when is_list(Config) ->
TestEvents = events_to_check(misc_errors),
ok = ct_test_support:verify_events(TestEvents, Events, Config).
+%%%-----------------------------------------------------------------
+%%%
+config_restored(Config) when is_list(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "error/test/config_restored_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},
+ {ct_hooks,[verify_config]}],
+ Config),
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(config_restored,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(config_restored),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config).
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
@@ -429,8 +470,7 @@ test_events(cfg_error) ->
{'EXIT',{init_per_group_fails,g1}}}}}}],
[{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g2,[]}}},
- {?eh,tc_done,{cfg_error_8_SUITE,
- {init_per_group,unknown,[]},
+ {?eh,tc_done,{cfg_error_8_SUITE,{init_per_group,g2,[]},
{failed,{timetrap_timeout,2000}}}},
{?eh,tc_auto_skip,{cfg_error_8_SUITE,tc1,
{failed,{cfg_error_8_SUITE,init_per_group,
@@ -500,7 +540,7 @@ test_events(cfg_error) ->
{?eh,tc_done,{cfg_error_8_SUITE,tc1,ok}},
{?eh,test_stats,{9,0,{0,14}}},
{?eh,tc_start,{cfg_error_8_SUITE,{end_per_group,g12,[]}}},
- {?eh,tc_done,{cfg_error_8_SUITE,{end_per_group,unknown,[]},
+ {?eh,tc_done,{cfg_error_8_SUITE,{end_per_group,g12,[]},
{failed,{timetrap_timeout,2000}}}}],
{?eh,tc_start,{cfg_error_8_SUITE,end_per_suite}},
@@ -971,11 +1011,423 @@ test_events(timetrap_fun) ->
{?eh,stop_logging,[]}
];
+test_events(timetrap_fun_group) ->
+ [
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{1,1,58}},
+ {?eh,tc_start,{timetrap_8_SUITE,init_per_suite}},
+ {?eh,tc_done,{timetrap_8_SUITE,init_per_suite,ok}},
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g0,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g0,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,1,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,2,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g0,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g0,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g1,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,3,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,4,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g1,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g2,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,5,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,6,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g2,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g3,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g3,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc4}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc4,
+ {failed,{timetrap_timeout,{'$approx',2000}}}}},
+ {?eh,test_stats,{0,7,{0,0}}},
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g1,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,8,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,9,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g1,[]},ok}}],
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g2,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,10,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,11,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g2,[]},ok}}],
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g3,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g3,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g4,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g4,[]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,1}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,2}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g5,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g5,[]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,3}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,4}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g6,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g6,[]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{0,11,{0,5}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{0,11,{0,6}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g7,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g7,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{1,11,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g7,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g7,[]},
+ {user_timetrap_error,{kaboom,'_'}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g8,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g8,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{2,11,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g8,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g8,[]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g9,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g9,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{3,11,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,test_stats,{3,12,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g9,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g9,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g10,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g10,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,test_stats,{3,13,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{4,13,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g10,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g10,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g11,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g11,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc3}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc3,
+ {failed,{timetrap_timeout,{'$approx',4000}}}}},
+ {?eh,test_stats,{4,14,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,15,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g11,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g11,[]},ok}}],
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg0,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg0,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,16,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,17,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg0,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg0,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,18,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,19,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,20,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,21,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg3,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg3,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc4}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc4,
+ {failed,{timetrap_timeout,{'$approx',2000}}}}},
+ {?eh,test_stats,{4,22,{0,6}}},
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]},
+ ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,23,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,24,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]},
+ ok}}]},
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]},
+ ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,25,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,26,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]},
+ ok}}]},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg3,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg3,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg4,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg4,[parallel]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,7}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,8}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg5,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg5,[parallel]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,9}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,10}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg6,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg6,[parallel]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{4,26,{0,11}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{4,26,{0,12}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg7,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg7,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{5,26,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg7,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg7,[parallel]},
+ {user_timetrap_error,{kaboom,'_'}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg8,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg8,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{6,26,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg8,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg8,[parallel]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg9,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg9,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ %% Due to parallelism only checking final test stat in group
+ {?eh,test_stats,{7,27,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg9,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg9,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg10,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg10,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ %% Due to parallelism only checking final test stat in group
+ {?eh,test_stats,{8,28,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg10,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg10,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg11,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg11,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc3}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc3,
+ {failed,{timetrap_timeout,{'$approx',4000}}}}},
+ {?eh,test_stats,{8,29,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{8,30,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg11,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg11,[parallel]},ok}}]},
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,sg1,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,sg1,[sequence]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{9,30,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,test_stats,{9,31,{0,12}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{9,31,{0,13}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{9,31,{0,14}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,sg1,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,sg1,[sequence]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,sg2,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,sg2,[sequence]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{10,31,{0,14}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{10,32,{0,14}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{10,32,{0,15}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{10,32,{0,16}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,sg2,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,sg2,[sequence]},ok}}],
+
+ {?eh,tc_start,{timetrap_8_SUITE,end_per_suite}},
+ {?eh,tc_done,{timetrap_8_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}
+ ];
+
test_events(misc_errors) ->
[
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
- {?eh,start_info,{1,1,7}},
+ {?eh,start_info,{1,1,9}},
{?eh,tc_start,{misc_error_1_SUITE,ct_fail_1}},
{?eh,tc_done,{misc_error_1_SUITE,ct_fail_1,
{failed,{error,{test_case_failed,{error,this_is_expected}}}}}},
@@ -1002,7 +1454,48 @@ test_events(misc_errors) ->
{?eh,tc_start,{misc_error_1_SUITE,killed_by_signal_2}},
{?eh,tc_done,{misc_error_1_SUITE,killed_by_signal_2,
{failed,testcase_aborted_or_killed}}},
- {?eh,test_stats,{0,7,{0,0}}},
+ {parallel,
+ [{?eh,tc_start,{misc_error_1_SUITE,p1}},
+ {?eh,tc_done,{misc_error_1_SUITE,p1,ok}},
+ {?eh,tc_start,{misc_error_1_SUITE,p2}},
+ {?eh,tc_done,{misc_error_1_SUITE,p2,ok}}]},
+ {?eh,test_stats,{2,7,{0,0}}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}
+ ];
+
+test_events(config_restored) ->
+ [
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{1,1,4}},
+ {?eh,tc_start,{config_restored_SUITE,init_per_suite}},
+ {?eh,tc_done,{config_restored_SUITE,init_per_suite,ok}},
+ {?eh,tc_start,{config_restored_SUITE,to_tc}},
+ {?eh,cth,{verify_config,post_end_per_testcase,{to_tc,diff_ok}}},
+ {?eh,tc_done,
+ {config_restored_SUITE,to_tc,{failed,{timetrap_timeout,1000}}}},
+ {?eh,test_stats,{0,1,{0,0}}},
+ {?eh,tc_start,{config_restored_SUITE,exit_tc}},
+ {?eh,cth,{verify_config,post_end_per_testcase,{exit_tc,diff_ok}}},
+ {?eh,tc_done,{config_restored_SUITE,exit_tc,
+ {failed,{error,{test_case_failed,"Goodbye!"}}}}},
+ {?eh,test_stats,{0,2,{0,0}}},
+ [{?eh,tc_start,{config_restored_SUITE,{init_per_group,g1,[]}}},
+ {?eh,tc_start,{config_restored_SUITE,to_tc}},
+ {?eh,cth,{verify_config,post_end_per_testcase,{to_tc,diff_ok}}},
+ {?eh,tc_done,
+ {config_restored_SUITE,to_tc,{failed,{timetrap_timeout,1000}}}},
+ {?eh,test_stats,{0,3,{0,0}}},
+ {?eh,tc_start,{config_restored_SUITE,exit_tc}},
+ {?eh,cth,{verify_config,post_end_per_testcase,{exit_tc,diff_ok}}},
+ {?eh,tc_done,{config_restored_SUITE,exit_tc,
+ {failed,{error,{test_case_failed,"Goodbye!"}}}}},
+ {?eh,test_stats,{0,4,{0,0}}},
+ {?eh,tc_start,{config_restored_SUITE,{end_per_group,g1,[]}}},
+ {?eh,tc_done,{config_restored_SUITE,{end_per_group,g1,[]},ok}}],
+ {?eh,tc_start,{config_restored_SUITE,end_per_suite}},
+ {?eh,tc_done,{config_restored_SUITE,end_per_suite,ok}},
{?eh,test_done,{'DEF','STOP_TIME'}},
{?eh,stop_logging,[]}
].
diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl
new file mode 100644
index 0000000000..fb47f2bcb9
--- /dev/null
+++ b/lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl
@@ -0,0 +1,175 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(config_restored_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% Function: suite() -> Info
+%% Info = [tuple()]
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,1000}].
+
+%%--------------------------------------------------------------------
+%% Function: init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = [{init_per_suite,?MODULE} | Config],
+ TabPid = spawn(fun() ->
+ ets:new(?MODULE, [named_table, set, public]),
+ receive _ -> ok end
+ end),
+ [{tab,TabPid} | Config1].
+
+%%--------------------------------------------------------------------
+%% Function: end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_suite(Config) ->
+ ets:delete(?MODULE),
+ exit(?config(tab, Config), kill),
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_group(GroupName, Config) ->
+ [{init_per_group,GroupName} | Config].
+
+%%--------------------------------------------------------------------
+%% Function: end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_testcase(TC, Config) ->
+ Config1 = [{init_per_testcase,TC} | Config],
+ ets:insert(?MODULE, {config,Config}),
+ %% ct:pal("Config after init_per_testcase(~w) = ~p", [TC,Config1]),
+ Config1.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_testcase(TC, Config) ->
+ ct:pal("Config in end_per_testcase(~w) = ~p", [TC,Config]),
+ [{_,MemConfig}] = ets:lookup(?MODULE, config),
+ diff_config(Config, MemConfig, [tc_status]),
+ ?MODULE = proplists:get_value(init_per_suite, Config),
+ TC = proplists:get_value(init_per_testcase, Config),
+ case ?config(tc_group_properties, Config) of
+ undefined ->
+ ok;
+ Props ->
+ GName = proplists:get_value(name, Props),
+ GName = proplists:get_value(init_per_group, Config)
+ end,
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%%--------------------------------------------------------------------
+groups() ->
+ [{g1,[],[to_tc, exit_tc]}].
+
+%%--------------------------------------------------------------------
+%% Function: all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%%--------------------------------------------------------------------
+all() ->
+ [to_tc, exit_tc,
+ {group,g1}].
+
+
+to_tc(Config) ->
+ %% ct:pal("Config for to_tc = ~p", [Config]),
+ [{_,MemConfig}] = ets:lookup(?MODULE, config),
+ diff_config(Config, MemConfig, []),
+ ct:sleep(2000).
+
+exit_tc(Config) ->
+ %% ct:pal("Config for exit_tc = ~p", [Config]),
+ [{_,MemConfig}] = ets:lookup(?MODULE, config),
+ diff_config(Config, MemConfig, []),
+ ct:fail("Goodbye!").
+
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+
+diff_config(Cfg1, Cfg2, DiffKeys) ->
+ diff_config(Cfg1, Cfg2, DiffKeys, []).
+
+diff_config([{K,V} | Cfg1], Cfg2, DiffKeys, RemKeys) ->
+ case proplists:get_value(K, Cfg2) of
+ undefined ->
+ diff_config(Cfg1, Cfg2, proplists:delete(K, DiffKeys), RemKeys);
+ V ->
+ diff_config(Cfg1, proplists:delete(K, Cfg2), DiffKeys, RemKeys);
+ _Other ->
+ case proplists:is_defined(K, DiffKeys) of
+ true ->
+ diff_config(Cfg1, Cfg2, proplists:delete(K, DiffKeys), RemKeys);
+ false ->
+ diff_config(Cfg1, Cfg2, DiffKeys, [K | RemKeys])
+ end
+ end;
+diff_config([], [], [], []) ->
+ ct:pal("Diff ok!", []),
+ ok;
+diff_config([], Cfg2, DiffKeys, RemKeys) ->
+ Result = {diff_failed, {cfg2,Cfg2}, {diffkeys,DiffKeys}, {remkeys,RemKeys}},
+ ct:pal("Diff failed! Result = ~p", [Result]),
+ exit(Result).
+
diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl
index 99c3ed05ec..61f3fa7e59 100644
--- a/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl
+++ b/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl
@@ -96,7 +96,7 @@ end_per_testcase(_TestCase, _Config) ->
%% N = integer() | forever
%%--------------------------------------------------------------------
groups() ->
- [].
+ [{p,[parallel],[p1,p2]}].
%%--------------------------------------------------------------------
%% Function: all() -> GroupsAndTestCases | {skip,Reason}
@@ -107,7 +107,8 @@ groups() ->
%%--------------------------------------------------------------------
all() ->
[ct_fail_1, ct_fail_2, ct_fail_3, ts_fail_1, ts_fail_2,
- killed_by_signal_1, killed_by_signal_2].
+ killed_by_signal_1, killed_by_signal_2,
+ {group,p}].
ct_fail_1(_) ->
ct:fail({error,this_is_expected}),
@@ -152,3 +153,10 @@ killed_by_signal_2(_) ->
end),
ct:sleep(1000),
exit(this_should_not_be_seen).
+
+p1(_) ->
+ {error,parallel_group} = ct:abort_current_testcase(aborted),
+ ok.
+
+p2(_) ->
+ receive after 1000 -> ok end.
diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl
new file mode 100644
index 0000000000..ff138f38b5
--- /dev/null
+++ b/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl
@@ -0,0 +1,258 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(timetrap_8_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+-define(TO, 4).
+
+%%--------------------------------------------------------------------
+%% Function: suite() -> Info
+%% Info = [tuple()]
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,?TO}]}}].
+
+%%--------------------------------------------------------------------
+%% Function: init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_group(G6, Config) when G6==g6; G6==pg6 ->
+ ct:sleep({seconds,1}),
+ Config;
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_group(G7or8, _Config) when G7or8==g7; G7or8==pg7; G7or8==g8; G7or8==pg8 ->
+ ct:sleep({seconds,5}),
+ ok;
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_testcase(_, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_testcase(_, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%%--------------------------------------------------------------------
+groups() ->
+ [
+ {g0,[],[tc0,tc2]}, % group override suite and tc overrides group
+ {g1,[],[tc0,tc2]}, % group override suite and tc overrides group
+ {g2,[],[tc1,tc2]}, % tc override group
+ {g3,[],[tc4,{group,g1},{group,g2}]}, % subgroup override group
+ {g4,[],[tc0,tc2]}, % exit during init_per_group
+ {g5,[],[tc0,tc2]}, % exit during init_per_group
+ {g6,[],[tc0,tc2]}, % timeout during init_per_group
+ {g7,[],[tc5]}, % exit during end_per_group
+ {g8,[],[tc5]}, % timeout during end_per_group
+ {g9,[],[tc5,tc0]}, % exit during testcase
+ {g10,[],[tc0,tc5]}, % exit during testcase
+ {g11,[],[tc3,tc2]}, % suite is valid if nothing else is specified
+ {pg0,[parallel],[tc0,tc2]}, % group override suite and tc overrides group
+ {pg1,[parallel],[tc0,tc2]}, % group override suite and tc overrides group
+ {pg2,[parallel],[tc1,tc2]}, % tc override group
+ {pg3,[parallel],[tc4,{group,pg1},{group,pg2}]}, % subgroup override group
+ {pg4,[parallel],[tc0,tc2]}, % exit during init_per_group
+ {pg5,[parallel],[tc0,tc2]}, % exit during init_per_group
+ {pg6,[parallel],[tc0,tc2]}, % timeout during init_per_group
+ {pg7,[parallel],[tc5]}, % exit during end_per_group
+ {pg8,[parallel],[tc5]}, % timeout during end_per_group
+ {pg9,[parallel],[tc5,tc0]}, % exit during testcase
+ {pg10,[parallel],[tc0,tc5]},% exit during testcase
+ {pg11,[parallel],[tc3,tc2]},% suite is valid if nothing else is specified
+ {sg1,[sequence],[tc5,tc0,tc1,tc2]}, % exit during sequencial testcase
+ {sg2,[sequence],[tc5,tc0,tc1,tc2]}].% timeout during sequencial testcase
+
+group(g0) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}];
+group(g1) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(1000) end}];
+group(g2) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(3000) end}];
+group(g3) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(2000) end}];
+group(g4) ->
+ [{timetrap,{timetrap_utils,timetrap_exit,[kaboom]}}];
+group(g5) ->
+ [{timetrap,fun() -> exit(kaboom) end}];
+group(g6) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(g7) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(g8) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(g9) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(g10) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(g11) ->
+ [];
+group(pg0) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}];
+group(pg1) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(1000) end}];
+group(pg2) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(3000) end}];
+group(pg3) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(2000) end}];
+group(pg4) ->
+ [{timetrap,{timetrap_utils,timetrap_exit,[kaboom]}}];
+group(pg5) ->
+ [{timetrap,fun() -> exit(kaboom) end}];
+group(pg6) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(pg7) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(pg8) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(pg9) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(pg10) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(pg11) ->
+ [];
+group(sg1) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(sg2) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}].
+
+
+%%--------------------------------------------------------------------
+%% Function: all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%%--------------------------------------------------------------------
+all() ->
+ [
+ {group,g0},
+ {group,g1},
+ {group,g2},
+ {group,g3},
+ {group,g4},
+ {group,g5},
+ {group,g6},
+ {group,g7},
+ {group,g8},
+ {group,g9},
+ {group,g10},
+ {group,g11},
+ {group,pg0},
+ {group,pg1},
+ {group,pg2},
+ {group,pg3},
+ {group,pg4},
+ {group,pg5},
+ {group,pg6},
+ {group,pg7},
+ {group,pg8},
+ {group,pg9},
+ {group,pg10},
+ {group,pg11},
+ {group,sg1},
+ {group,sg2}].
+
+
+
+tc0(_) ->
+ ct:comment("TO set by group"),
+ ct:sleep({seconds,5}),
+ ok.
+
+tc1() ->
+ [{timetrap,{timetrap_utils,timetrap_val,[1000]}}].
+tc1(_) ->
+ ct:comment("TO after 1 sec"),
+ ct:sleep({seconds,2}),
+ ok.
+
+tc2() ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(500) end}].
+tc2(_) ->
+ ct:comment("TO after 0.5 sec"),
+ ct:sleep({seconds,2}),
+ ok.
+
+tc3(_) ->
+ ct:comment(io_lib:format("TO after ~w sec", [?TO])),
+ ct:sleep({seconds,5}),
+ ok.
+
+tc4(_) ->
+ ct:comment("TO set by group"),
+ ct:sleep({seconds,5}),
+ ok.
+
+tc5(_) ->
+ ct:comment("No TO in this testcase, maybe later"),
+ ok.
diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl
new file mode 100644
index 0000000000..40a54b9f99
--- /dev/null
+++ b/lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl
@@ -0,0 +1,239 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%% @doc Common Test Example Suite Callback module.
+%%%
+%%% <p>This module gives an example of a common test CTH (Common Test Hook).
+%%% There are many ways to add a CTH to a test run, you can do it either in
+%%% the command line using -ct_hook, in a test spec using
+%%% {ct_hook,M} or in the suite it self by returning ct_hook
+%%% from either suite/0, init_per_suite/1, init_per_group/2 and
+%%% init_per_testcase/2. The scope of the CTH is determined by where is it
+%%% started. If it is started in the command line or test spec then it will
+%%% be stopped at the end of all tests. If it is started in init_per_suite,
+%%% it will be stopped after end_per_suite and so on. See terminate
+%%% documentation for a table describing the scoping machanics.
+%%%
+%%% All of callbacks except init/1 in a CTH are optional.</p>
+
+-module(verify_config).
+
+%% CT Hooks
+-export([id/1]).
+-export([init/2]).
+
+-export([pre_init_per_suite/3]).
+-export([post_init_per_suite/4]).
+-export([pre_end_per_suite/3]).
+-export([post_end_per_suite/4]).
+
+-export([pre_init_per_group/3]).
+-export([post_init_per_group/4]).
+-export([pre_end_per_group/3]).
+-export([post_end_per_group/4]).
+
+-export([pre_init_per_testcase/3]).
+-export([post_end_per_testcase/4]).
+
+-export([on_tc_fail/3]).
+-export([on_tc_skip/3]).
+
+-export([terminate/1]).
+
+-include_lib("common_test/src/ct_util.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-type config() :: proplists:proplist().
+-type reason() :: term().
+-type skip_or_fail() :: {skip, reason()} |
+ {auto_skip, reason()} |
+ {fail, reason()} |
+ {'EXIT',reason()}.
+
+-record(state, { id = ?MODULE :: term()}).
+
+%% @doc Always called before any other callback function. Use this to initiate
+%% any common state. It should return an state for this CTH.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
+init(Id, Opts) ->
+ {ok,Opts}.
+
+%% @doc The ID is used to uniquly identify an CTH instance, if two CTH's
+%% return the same ID the seconds CTH is ignored. This function should NOT
+%% have any side effects as it might be called multiple times by common test.
+-spec id(Opts :: proplists:proplist()) ->
+ Id :: term().
+id(Opts) ->
+ now().
+
+%% @doc Called before init_per_suite is called. Note that this callback is
+%% only called if the CTH is added before init_per_suite is run (eg. in a test
+%% specification, suite/0 function etc).
+%% You can change the config in the this function.
+-spec pre_init_per_suite(Suite :: atom(),
+ Config :: config(),
+ State :: #state{}) ->
+ {config() | skip_or_fail(), NewState :: #state{}}.
+pre_init_per_suite(Suite,Config,State) ->
+ {Config, State}.
+
+%% @doc Called after init_per_suite.
+%% you can change the return value in this function.
+-spec post_init_per_suite(Suite :: atom(),
+ Config :: config(),
+ Return :: config() | skip_or_fail(),
+ State :: #state{}) ->
+ {config() | skip_or_fail(), NewState :: #state{}}.
+post_init_per_suite(Suite,Config,Return,State) ->
+ {Return, State}.
+
+%% @doc Called before end_per_suite. The config/state can be changed here,
+%% though it will only affect the *end_per_suite function.
+-spec pre_end_per_suite(Suite :: atom(),
+ Config :: config() | skip_or_fail(),
+ State :: #state{}) ->
+ {ok | skip_or_fail(), NewState :: #state{}}.
+pre_end_per_suite(Suite,Config,State) ->
+ {Config, State}.
+
+%% @doc Called after end_per_suite. Note that the config cannot be
+%% changed here, only the status of the suite.
+-spec post_end_per_suite(Suite :: atom(),
+ Config :: config(),
+ Return :: term(),
+ State :: #state{}) ->
+ {ok | skip_or_fail(), NewState :: #state{}}.
+post_end_per_suite(Suite,Config,Return,State) ->
+ {Return, State}.
+
+%% @doc Called before each init_per_group.
+%% You can change the config in this function.
+-spec pre_init_per_group(Group :: atom(),
+ Config :: config(),
+ State :: #state{}) ->
+ {config() | skip_or_fail(), NewState :: #state{}}.
+pre_init_per_group(Group,Config,State) ->
+ {Config, State}.
+
+%% @doc Called after each init_per_group.
+%% You can change the return value in this function.
+-spec post_init_per_group(Group :: atom(),
+ Config :: config(),
+ Return :: config() | skip_or_fail(),
+ State :: #state{}) ->
+ {config() | skip_or_fail(), NewState :: #state{}}.
+post_init_per_group(Group,Config,Return,State) ->
+ {Return, State}.
+
+%% @doc Called after each end_per_group. The config/state can be changed here,
+%% though it will only affect the *end_per_group functions.
+-spec pre_end_per_group(Group :: atom(),
+ Config :: config() | skip_or_fail(),
+ State :: #state{}) ->
+ {ok | skip_or_fail(), NewState :: #state{}}.
+pre_end_per_group(Group,Config,State) ->
+ {Config, State}.
+
+%% @doc Called after each end_per_group. Note that the config cannot be
+%% changed here, only the status of the group.
+-spec post_end_per_group(Group :: atom(),
+ Config :: config(),
+ Return :: term(),
+ State :: #state{}) ->
+ {ok | skip_or_fail(), NewState :: #state{}}.
+post_end_per_group(Group,Config,Return,State) ->
+ {Return, State}.
+
+%% @doc Called before each test case.
+%% You can change the config in this function.
+-spec pre_init_per_testcase(TC :: atom(),
+ Config :: config(),
+ State :: #state{}) ->
+ {config() | skip_or_fail(), NewState :: #state{}}.
+pre_init_per_testcase(TC,Config,State) ->
+ {Config, State}.
+
+%% @doc Called after each test case. Note that the config cannot be
+%% changed here, only the status of the test case.
+-spec post_end_per_testcase(TC :: atom(),
+ Config :: config(),
+ Return :: term(),
+ State :: #state{}) ->
+ {ok | skip_or_fail(), NewState :: #state{}}.
+post_end_per_testcase(TC,Config,Return,State) ->
+ %% check that config has been restored
+ ct:pal("Config in verify_config:post_end_per_testcase(~w) = ~p",
+ [TC,Config]),
+ [{_,MemConfig}] = ets:lookup(config_restored_SUITE, config),
+ try config_restored_SUITE:diff_config(Config, MemConfig, [tc_status]) of
+ ok ->
+ gen_event:notify(
+ ?CT_EVMGR_REF, #event{ name = cth, node = node(),
+ data = {?MODULE, post_end_per_testcase,
+ {TC,diff_ok}}})
+ catch
+ _:_ ->
+ gen_event:notify(
+ ?CT_EVMGR_REF, #event{ name = cth, node = node(),
+ data = {?MODULE, post_end_per_testcase,
+ {TC,diff_failed}}})
+ end,
+ {Return, State}.
+
+%% @doc Called after post_init_per_suite, post_end_per_suite, post_init_per_group,
+%% post_end_per_group and post_end_per_tc if the suite, group or test case failed.
+%% This function should be used for extra cleanup which might be needed.
+%% It is not possible to modify the config or the status of the test run.
+-spec on_tc_fail(TC :: init_per_suite | end_per_suite |
+ init_per_group | end_per_group | atom(),
+ Reason :: term(), State :: #state{}) ->
+ NewState :: #state{}.
+on_tc_fail(TC, Reason, State) ->
+ State.
+
+%% @doc Called when a test case is skipped by either user action
+%% or due to an init function failing. Test case can be
+%% end_per_suite, init_per_group, end_per_group and the actual test cases.
+-spec on_tc_skip(TC :: end_per_suite |
+ init_per_group | end_per_group | atom(),
+ {tc_auto_skip, {failed, {Mod :: atom(), Function :: atom(), Reason :: term()}}} |
+ {tc_user_skip, {skipped, Reason :: term()}},
+ State :: #state{}) ->
+ NewState :: #state{}.
+on_tc_skip(TC, Reason, State) ->
+ State.
+
+%% @doc Called when the scope of the CTH is done, this depends on
+%% when the CTH was specified. This translation table describes when this
+%% function is called.
+%%
+%% | Started in | terminate called |
+%% |---------------------|-------------------------|
+%% | command_line | after all tests are run |
+%% | test spec | after all tests are run |
+%% | suite/0 | after SUITE is done |
+%% | init_per_suite/1 | after SUITE is done |
+%% | init_per_group/2 | after group is done |
+%% |-----------------------------------------------|
+%%
+-spec terminate(State :: #state{}) ->
+ term().
+terminate(State) ->
+ ok.
diff --git a/lib/common_test/test/ct_group_leader_SUITE.erl b/lib/common_test/test/ct_group_leader_SUITE.erl
new file mode 100644
index 0000000000..cde3061d6a
--- /dev/null
+++ b/lib/common_test/test/ct_group_leader_SUITE.erl
@@ -0,0 +1,181 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_system_error_SUITE
+%%%
+%%% Description:
+%%%
+%%% Test the group leader functionality in the test_server application.
+%%%-------------------------------------------------------------------
+-module(ct_group_leader_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ basic
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+basic(Config) ->
+ TC = basic,
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "group_leader_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},{label,TC}], Config),
+ SuiteLog = execute(TC, Opts, ERPid, Config),
+ {ok,Data} = file:read_file(SuiteLog),
+ Lines = binary:split(Data, <<"\n">>, [global]),
+ {ok,RE} = re:compile("(\\S+):(\\S+)$"),
+ Cases0 = [begin
+ {match,[M,F]} = re:run(Case, RE, [{capture,all_but_first,list}]),
+ {list_to_atom(M),list_to_atom(F)}
+ end || <<"=case ",Case/binary>> <- Lines],
+ Cases = [MF || {_,F}=MF <- Cases0,
+ F =/= init_per_suite,
+ F =/= end_per_suite,
+ F =/= init_per_group,
+ F =/= end_per_group],
+ io:format("~p\n", [Cases]),
+ [] = verify_cases(events_to_check(TC), Cases, false),
+ ok.
+
+verify_cases([{parallel,P}|Ts], Cases0, Par) ->
+ Cases = verify_cases(P, Cases0, true),
+ verify_cases(Ts, Cases, Par);
+verify_cases([{?eh,tc_done,{M,F,_}}|Ts], Cases0, false) ->
+ [{M,F}|Cases] = Cases0,
+ verify_cases(Ts, Cases, false);
+verify_cases([{?eh,tc_done,{M,F,_}}|Ts], Cases0, true) ->
+ case lists:member({M,F}, Cases0) of
+ true ->
+ Cases = Cases0 -- [{M,F}],
+ verify_cases(Ts, Cases, true);
+ false ->
+ io:format("~p not found\n", [{M,F}]),
+ ?t:fail()
+ end;
+verify_cases([{?eh,_,_}|Ts], Cases, Par) ->
+ verify_cases(Ts, Cases, Par);
+verify_cases([], Cases, _) ->
+ Cases;
+verify_cases([List|Ts], Cases0, Par) when is_list(List) ->
+ Cases = verify_cases(List, Cases0, false),
+ verify_cases(Ts, Cases, Par).
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(Name),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config),
+ {event,tc_logfile,_,{_,File}} =
+ lists:keyfind(tc_logfile, 2, [Ev || {?eh,Ev} <- Events]),
+ LogDir = filename:dirname(File),
+ filename:join(LogDir, "suite.log").
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+
+events_to_check(_Test) ->
+ [{?eh,tc_done,{group_leader_SUITE,tc1,ok}},
+ {parallel,[{?eh,tc_start,{group_leader_SUITE,p1}},
+ {?eh,tc_done,{group_leader_SUITE,p1,ok}},
+ {?eh,tc_start,{group_leader_SUITE,p2}},
+ {?eh,tc_done,{group_leader_SUITE,p2,ok}}]},
+ {?eh,tc_done,{group_leader_SUITE,p_restart_my_io_server,ok}},
+ {?eh,tc_done,{group_leader_SUITE,p3,ok}},
+ {parallel,[
+ {?eh,tc_start,{group_leader_SUITE,p10}},
+ {?eh,tc_start,{group_leader_SUITE,p11}},
+ {?eh,tc_done,{group_leader_SUITE,p10,ok}},
+ {?eh,tc_done,{group_leader_SUITE,p11,ok}},
+ [{?eh,tc_done,{group_leader_SUITE,s1,ok}},
+ {?eh,tc_done,{group_leader_SUITE,s2,ok}},
+ {?eh,tc_done,{group_leader_SUITE,s3,ok}}],
+ {?eh,tc_start,{group_leader_SUITE,p12}},
+ {?eh,tc_done,{group_leader_SUITE,p12,ok}},
+ [{?eh,tc_done,{group_leader_SUITE,s4,ok}},
+ {?eh,tc_done,{group_leader_SUITE,s5,ok}}],
+ {?eh,tc_start,{group_leader_SUITE,p13}},
+ {?eh,tc_done,{group_leader_SUITE,p13,ok}} ]},
+ {?eh,tc_done,{group_leader_SUITE,cap1,ok}},
+ {?eh,tc_done,{group_leader_SUITE,cap2,ok}},
+ {parallel,[{?eh,tc_start,{group_leader_SUITE,cap1}},
+ {?eh,tc_done,{group_leader_SUITE,cap1,ok}},
+ {?eh,tc_start,{group_leader_SUITE,cap2}},
+ {?eh,tc_done,{group_leader_SUITE,cap2,ok}}]},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}
+ ].
diff --git a/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl b/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl
new file mode 100644
index 0000000000..3f1844b4ae
--- /dev/null
+++ b/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl
@@ -0,0 +1,252 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(group_leader_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{seconds,10}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ start_my_io_server(),
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ my_io_server ! die,
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [{p,[parallel],[p1,p2]},
+ {p_restart,[parallel],[p_restart_my_io_server]},
+ {seq,[],[s1,s2,s3]},
+ {seq2,[],[s4,s5]},
+ {seq_in_par,[parallel],[p10,p11,{group,seq},p12,{group,seq2},p13]},
+ {capture_io,[parallel],[cap1,cap2]}].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [tc1,{group,p},{group,p_restart},p3,
+ {group,seq_in_par},
+ cap1,cap2,
+ {group,capture_io}].
+
+tc1(_C) ->
+ ok.
+
+p1(_) ->
+ %% OTP-10101:
+ %%
+ %% External apps/processes started by init_per_suite (common operation),
+ %% will inherit the group leader of the init_per_suite process, i.e. the
+ %% test_server test case control process (executing run_test_case_msgloop/7).
+ %% If, later, a parallel test case triggers the external app to print with
+ %% e.g. io:format() (also common operation), the calling process will hang!
+ %% The reason for this is that a parallel test case has a dedicated IO
+ %% server process, other than the central test case control process. The
+ %% latter process is not executing run_test_case_msgloop/7 and will not
+ %% respond to IO messages. The process is still group leader for the
+ %% external app, however, which is wrong. It's the IO process for the
+ %% parallel test case that should be group leader - but only for the
+ %% particular invokation, since other parallel test cases could be
+ %% invoking the external app too.
+ print("hej\n").
+
+p2(_) ->
+ print("hopp\n").
+
+p_restart_my_io_server(_) ->
+ %% Restart the IO server and change its group leader. This used
+ %% to set to the group leader to a process that would soon die.
+ Ref = erlang:monitor(process, my_io_server),
+ my_io_server ! die,
+ receive
+ {'DOWN',Ref,_,_,_} ->
+ start_my_io_server()
+ end.
+
+p3(_) ->
+ %% OTP-10125. This would crash since the group leader process
+ %% for the my_io_server had died.
+ print("hoppsan\n").
+
+print(String) ->
+ my_io_server ! {print,self(),String},
+ receive
+ {printed,String} ->
+ ok
+ end.
+
+start_my_io_server() ->
+ Parent = self(),
+ Pid = spawn(fun() -> my_io_server(Parent) end),
+ receive
+ {Pid,started} ->
+ io:format("~p\n", [process_info(Pid)]),
+ ok
+ end.
+
+my_io_server(Parent) ->
+ register(my_io_server, self()),
+ Parent ! {self(),started},
+ my_io_server_loop().
+
+my_io_server_loop() ->
+ receive
+ {print,From,String} ->
+ io:put_chars(String),
+ From ! {printed,String},
+ my_io_server_loop();
+ die ->
+ ok
+ end.
+
+p10(_) ->
+ receive after 1 -> ok end.
+
+p11(_) ->
+ ok.
+
+p12(_) ->
+ ok.
+
+p13(_) ->
+ ok.
+
+s1(_) ->
+ ok.
+
+s2(_) ->
+ ok.
+
+s3(_) ->
+ ok.
+
+s4(_) ->
+ ok.
+
+s5(_) ->
+ ok.
+
+cap1(_) ->
+ ct:capture_start(),
+ IO = gen_io(cap1, 10, []),
+ ct:capture_stop(),
+ IO = ct:capture_get(),
+ ok.
+
+cap2(_) ->
+ ct:capture_start(),
+ {Pid,Ref} = spawn_monitor(fun() ->
+ exit(gen_io(cap2, 42, []))
+ end),
+ receive
+ {'DOWN',Ref,process,Pid,IO} ->
+ ct:capture_stop(),
+ IO = ct:capture_get(),
+ ok
+ end.
+
+gen_io(_, 0, Acc) ->
+ lists:reverse(Acc);
+gen_io(Label, N, Acc) ->
+ S = lists:flatten(io_lib:format("~s: ~p\n", [Label,N])),
+ io:put_chars(S),
+ gen_io(Label, N-1, [S|Acc]).
diff --git a/lib/common_test/test/ct_hooks_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE.erl
index 405df1e978..796a0832d7 100644
--- a/lib/common_test/test/ct_hooks_SUITE.erl
+++ b/lib/common_test/test/ct_hooks_SUITE.erl
@@ -64,7 +64,7 @@ end_per_testcase(TestCase, Config) ->
suite() ->
- [{timetrap,{seconds,20}}].
+ [{timetrap,{minutes,1}}].
all() ->
all(suite).
diff --git a/lib/common_test/test/ct_master_SUITE.erl b/lib/common_test/test/ct_master_SUITE.erl
index 27243a0067..0f336d2d79 100644
--- a/lib/common_test/test/ct_master_SUITE.erl
+++ b/lib/common_test/test/ct_master_SUITE.erl
@@ -109,7 +109,7 @@ ct_master_test(Config) when is_list(Config) ->
ERPid = ct_test_support:start_event_receiver(Config),
- [{TSFile,ok}] = run_test(ct_master_test, FileName, Config),
+ [{[TSFile],ok}] = run_test(ct_master_test, FileName, Config),
Events = ct_test_support:get_events(ERPid, Config),
@@ -117,14 +117,8 @@ ct_master_test(Config) when is_list(Config) ->
reformat(Events, ?eh),
PrivDir, []),
- find_events(NodeNames, [{tc_start,{master_SUITE,init_per_suite}},
- {tc_start,{master_SUITE,first_testcase}},
- {tc_start,{master_SUITE,second_testcase}},
- {tc_start,{master_SUITE,third_testcase}},
- {tc_start,{master_SUITE,end_per_suite}}],
- Events),
-
- ok.
+ TestEvents = events_to_check(ct_master_test),
+ ok = find_events(NodeNames, TestEvents, Events, Config).
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
@@ -153,13 +147,18 @@ make_spec(DataDir, FileName, NodeNames, Suites, Config) ->
CM = [{config,master,filename:join(DataDir,"master/config.txt")}],
+ Env = [{"THIS_MUST_BE_SET","yes"},
+ {"SO_MUST_THIS","value"}],
NS = lists:map(
fun(NodeName) ->
{init,NodeName,[
{node_start,[{startup_functions,[]},
- {monitor_master,true}]},
- {eval,{erlang,nodes,[]}}
- ]
+ {monitor_master,true},
+ {boot_timeout,10},
+ {init_timeout,10},
+ {startup_timeout,10},
+ {env,Env}]},
+ {eval,{erlang,nodes,[]}}]
}
end,
NodeNames),
@@ -196,13 +195,12 @@ get_log_dir(_,PrivDir,NodeName) ->
run_test(_Name, FileName, Config) ->
%% run the test twice, using different html versions
- [{FileName,ok}] = ct_test_support:run({ct_master,run,[FileName]},
- [{ct_master,basic_html,[true]}],
- Config),
- timer:sleep(5000),
- [{FileName,ok}] = ct_test_support:run({ct_master,run,[FileName]},
- [{ct_master,basic_html,[false]}],
- Config).
+ [{[FileName],ok}] = ct_test_support:run({ct_master,run,[FileName]},
+ [{ct_master,basic_html,[true]}],
+ Config),
+ [{[FileName],ok}] = ct_test_support:run({ct_master,run,[FileName]},
+ [{ct_master,basic_html,[false]}],
+ Config).
reformat(Events, EH) ->
ct_test_support:reformat(Events, EH).
@@ -210,28 +208,26 @@ reformat(Events, EH) ->
%%%-----------------------------------------------------------------
%%% TEST EVENTS
%%%-----------------------------------------------------------------
-find_events([], _CheckEvents, _) ->
- ok;
-find_events([NodeName|NodeNames],CheckEvents,AllEvents) ->
- find_events(NodeNames, CheckEvents,
- remove_events(add_host(NodeName),CheckEvents, AllEvents, [])).
-
-remove_events(Node,[{Name,Data} | RestChecks],
- [{?eh,#event{ name = Name, node = Node, data = Data }}|RestEvs],
- Acc) ->
- remove_events(Node, RestChecks, RestEvs, Acc);
-remove_events(Node, Checks, [Event|RestEvs], Acc) ->
- remove_events(Node, Checks, RestEvs, [Event | Acc]);
-remove_events(_Node, [], [], Acc) ->
- lists:reverse(Acc);
-remove_events(Node, Events, [], Acc) ->
- test_server:format("Could not find events: ~p in ~p for node ~p",
- [Events, lists:reverse(Acc), Node]),
- exit(event_not_found).
+
+find_events(NodeNames, TestEvents, Events, Config) ->
+ [begin
+ Node = add_host(Node0),
+ io:format("Searching for events for node: ~s", [Node]),
+ ok = ct_test_support:verify_events(TestEvents, Events, Node, Config),
+ io:nl()
+ end || Node0 <- NodeNames],
+ ok.
add_host(NodeName) ->
{ok, HostName} = inet:gethostname(),
list_to_atom(atom_to_list(NodeName)++"@"++HostName).
-expected_events(_) ->
- [].
+events_to_check(_) ->
+ [{?eh,tc_start,{master_SUITE,first_testcase}},
+ {?eh,tc_done,{master_SUITE,first_testcase,ok}},
+ {?eh,tc_start,{master_SUITE,second_testcase}},
+ {?eh,tc_done,{master_SUITE,second_testcase,ok}},
+ {?eh,tc_start,{master_SUITE,third_testcase}},
+ {?eh,tc_done,{master_SUITE,third_testcase,ok}},
+ {?eh,tc_start,{master_SUITE,env_vars}},
+ {?eh,tc_done,{master_SUITE,env_vars,ok}}].
diff --git a/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl b/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl
index 032d69ad9f..df54c4419c 100644
--- a/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl
+++ b/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2010. All Rights Reserved.
+%% Copyright Ericsson AB 2010-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -39,7 +39,8 @@ init_per_suite(Config) ->
end_per_suite(_) ->
ok.
-all() -> [first_testcase, second_testcase, third_testcase].
+all() -> [first_testcase, second_testcase, third_testcase,
+ env_vars].
init_per_testcase(_, Config) ->
Config.
@@ -56,3 +57,9 @@ second_testcase(_)->
third_testcase(_)->
A = 4,
A = 2*2.
+
+env_vars(_) ->
+ io:format("~p\n", [os:getenv()]),
+ "yes" = os:getenv("THIS_MUST_BE_SET"),
+ "value" = os:getenv("SO_MUST_THIS"),
+ ok.
diff --git a/lib/common_test/test/ct_netconfc_SUITE.erl b/lib/common_test/test/ct_netconfc_SUITE.erl
index 3042a924fe..c89a4cdabe 100644
--- a/lib/common_test/test/ct_netconfc_SUITE.erl
+++ b/lib/common_test/test/ct_netconfc_SUITE.erl
@@ -43,12 +43,11 @@
%% there will be clashes with logging processes etc).
%%--------------------------------------------------------------------
init_per_suite(Config) ->
- Config1 = ct_test_support:init_per_suite(Config),
case application:load(crypto) of
- {error,Reason} ->
+ {error,Reason} when Reason=/={already_loaded,crypto} ->
{skip, Reason};
_ ->
- Config1
+ ct_test_support:init_per_suite(Config)
end.
end_per_suite(Config) ->
diff --git a/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl b/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl
index d337158bce..54526e8e83 100644
--- a/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl
+++ b/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl
@@ -1044,12 +1044,9 @@ gen_dsa(LSize,NSize) when is_integer(LSize), is_integer(NSize) ->
Key = gen_dsa2(LSize, NSize),
{Key, encode_key(Key)}.
-encode_key(Key = #'RSAPrivateKey'{}) ->
- {ok, Der} = 'OTP-PUB-KEY':encode('RSAPrivateKey', Key),
- {'RSAPrivateKey', list_to_binary(Der), not_encrypted};
encode_key(Key = #'DSAPrivateKey'{}) ->
- {ok, Der} = 'OTP-PUB-KEY':encode('DSAPrivateKey', Key),
- {'DSAPrivateKey', list_to_binary(Der), not_encrypted}.
+ Der = public_key:der_encode('DSAPrivateKey', Key),
+ {'DSAPrivateKey', Der, not_encrypted}.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl b/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl
index 2427f37f52..09217f60a3 100644
--- a/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl
+++ b/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl
@@ -1,7 +1,7 @@
%%--------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2012. All Rights Reserved.
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -426,7 +426,7 @@ reply(ConnRef,Reply) ->
send(ConnRef, make_msg(Reply)).
from_simple(Simple) ->
- list_to_binary(xmerl:export_simple_element(Simple,xmerl_xml)).
+ unicode_c2b(xmerl:export_simple_element(Simple,xmerl_xml)).
xml(Content) ->
<<"<?xml version=\"1.0\" encoding=\"UTF-8\"?>\n",
@@ -435,30 +435,30 @@ xml(Content) ->
rpc_reply(Content) when is_binary(Content) ->
MsgId = case erase(msg_id) of
undefined -> <<>>;
- Id -> list_to_binary([" message-id=\"",Id,"\""])
+ Id -> unicode_c2b([" message-id=\"",Id,"\""])
end,
<<"<rpc-reply xmlns=\"",?NETCONF_NAMESPACE,"\"",MsgId/binary,">\n",
Content/binary,"\n</rpc-reply>">>;
rpc_reply(Content) ->
- rpc_reply(list_to_binary(Content)).
+ rpc_reply(unicode_c2b(Content)).
session_id(no_session_id) ->
<<>>;
session_id(SessionId0) ->
- SessionId = list_to_binary(integer_to_list(SessionId0)),
+ SessionId = unicode_c2b(integer_to_list(SessionId0)),
<<"<session-id>",SessionId/binary,"</session-id>\n">>.
capabilities(undefined) ->
- CapsXml = list_to_binary([["<capability>",C,"</capability>\n"]
+ CapsXml = unicode_c2b([["<capability>",C,"</capability>\n"]
|| C <- ?CAPABILITIES]),
<<"<capabilities>\n",CapsXml/binary,"</capabilities>\n">>;
capabilities({base,Vsn}) ->
- CapsXml = list_to_binary([["<capability>",C,"</capability>\n"]
+ CapsXml = unicode_c2b([["<capability>",C,"</capability>\n"]
|| C <- ?CAPABILITIES_VSN(Vsn)]),
<<"<capabilities>\n",CapsXml/binary,"</capabilities>\n">>;
capabilities(no_base) ->
[_|Caps] = ?CAPABILITIES,
- CapsXml = list_to_binary([["<capability>",C,"</capability>\n"] || C <- Caps]),
+ CapsXml = unicode_c2b([["<capability>",C,"</capability>\n"] || C <- Caps]),
<<"<capabilities>\n",CapsXml/binary,"</capabilities>\n">>;
capabilities(no_caps) ->
<<>>.
@@ -553,3 +553,8 @@ make_msg(Xml) when is_binary(Xml) ->
xml(Xml);
make_msg(Simple) when is_tuple(Simple) ->
xml(from_simple(Simple)).
+
+%%%-----------------------------------------------------------------
+%%% Convert to unicode binary, since we use UTF-8 encoding in XML
+unicode_c2b(Characters) ->
+ unicode:characters_to_binary(Characters).
diff --git a/lib/common_test/test/ct_snmp_SUITE.erl b/lib/common_test/test/ct_snmp_SUITE.erl
new file mode 100644
index 0000000000..f8b4543770
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE.erl
@@ -0,0 +1,141 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_snmp_SUITE
+%%%
+%%% Description:
+%%% Test ct_snmp module
+%%%
+%%%-------------------------------------------------------------------
+-module(ct_snmp_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ default
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+default(Config) when is_list(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "snmp_SUITE"),
+ CfgFile = filename:join(DataDir, "snmp.cfg"),
+ {Opts,ERPid} = setup([{suite,Suite},{config,CfgFile},
+ {label,default}], Config),
+
+ ok = execute(default, Opts, ERPid, Config).
+
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(Name,Config),
+ ct_test_support:verify_events(TestEvents, Events, Config).
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+events_to_check(_TestName,Config) ->
+ {module,_} = code:load_abs(filename:join(?config(data_dir,Config),
+ snmp_SUITE)),
+ TCs = get_tcs(),
+ code:purge(snmp_SUITE),
+ code:delete(snmp_SUITE),
+
+ OneTest =
+ [{?eh,start_logging,{'DEF','RUNDIR'}}] ++
+ [{?eh,tc_done,{snmp_SUITE,TC,ok}} || TC <- TCs] ++
+ [{?eh,stop_logging,[]}],
+
+ %% 2 tests (ct:run_test + script_start) is default
+ OneTest ++ OneTest.
+
+
+get_tcs() ->
+ All = snmp_SUITE:all(),
+ Groups =
+ try snmp_SUITE:groups()
+ catch error:undef -> []
+ end,
+ flatten_tcs(All,Groups).
+
+flatten_tcs([H|T],Groups) when is_atom(H) ->
+ [H|flatten_tcs(T,Groups)];
+flatten_tcs([{group,Group}|T],Groups) ->
+ TCs = proplists:get_value(Group,Groups),
+ flatten_tcs(TCs ++ T,Groups);
+flatten_tcs([],_) ->
+ [].
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg b/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg
new file mode 100644
index 0000000000..895e097de6
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg
@@ -0,0 +1,44 @@
+%% -*- erlang -*-
+{snmp1, [{start_agent,true},
+ {users,[{user_name,[snmpm_user_default,[]]}]},
+ {managed_agents,[{agent_name, [user_name, {127,0,0,1}, 4000,
+ [{engine_id,"ct_snmp-test-engine"},
+ {version,v2}]]}]},
+ {engine_id,"ct_snmp-test-engine"},
+ {agent_vsns,[v2]}
+ ]}.
+{snmp2, [{start_agent,true},
+ {engine_id,"ct_snmp-test-engine"}
+ ]}.
+{snmp3, [{start_agent,true},
+ {engine_id,"ct_snmp-test-engine"},
+ {agent_vsns,[v1,v2,v3]},
+ {agent_contexts,{data_dir_file,"context.conf"}},
+ {agent_usm,{data_dir_file,"usm.conf"}},
+ {agent_community,{data_dir_file,"community.conf"}},
+ {agent_notify_def,{data_dir_file,"notify.conf"}},
+ {agent_sysinfo,{data_dir_file,"standard.conf"}},
+ {agent_target_address_def,{data_dir_file,"target_addr.conf"}},
+ {agent_target_param_def,{data_dir_file,"target_params.conf"}},
+ {agent_vacm,{data_dir_file,"vacm.conf"}}]}.
+{snmp_app1,[{manager, [{config, [{verbosity, silence}]},
+ {server,[{verbosity,silence}]},
+ {net_if,[{verbosity,silence}]},
+ {versions,[v2]}
+ ]},
+ {agent, [{config, [{verbosity, silence}]},
+ {net_if,[{verbosity,silence}]},
+ {mib_server,[{verbosity,silence}]},
+ {local_db,[{verbosity,silence}]},
+ {agent_verbosity,silence}
+ ]}]}.
+{snmp_app2,[{manager, [{config, [{verbosity, silence}]},
+ {server,[{verbosity,silence}]},
+ {net_if,[{verbosity,silence}]}
+ ]},
+ {agent, [{config, [{verbosity, silence}]},
+ {net_if,[{verbosity,silence}]},
+ {mib_server,[{verbosity,silence}]},
+ {local_db,[{verbosity,silence}]},
+ {agent_verbosity,silence}
+ ]}]}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl
new file mode 100644
index 0000000000..16b2b5690c
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl
@@ -0,0 +1,395 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+%%----------------------------------------------------------------------
+%% File: ct_snmp_SUITE.erl
+%%
+%% Description:
+%% This file contains the test cases for the ct_snmp API.
+%%
+%% @author Support
+%% @doc Test of SNMP support in common_test
+%% @end
+%%----------------------------------------------------------------------
+%%----------------------------------------------------------------------
+-module(snmp_SUITE).
+-include_lib("common_test/include/ct.hrl").
+-include_lib("snmp/include/STANDARD-MIB.hrl").
+-include_lib("snmp/include/SNMP-USER-BASED-SM-MIB.hrl").
+-include_lib("snmp/include/snmp_types.hrl").
+
+-compile(export_all).
+
+%% Default timetrap timeout (set in init_per_testcase).
+-define(default_timeout, ?t:minutes(1)).
+
+-define(AGENT_UDP, 4000).
+
+suite() ->
+ [
+ {require, snmp1, snmp1},
+ {require, snmp_app1, snmp_app1},
+ {require, snmp2, snmp2},
+ {require, snmp_app2, snmp_app2},
+ {require, snmp3, snmp3}
+ ].
+
+all() ->
+ [start_stop,
+ {group,get_set},
+ {group,register},
+ {group,override},
+ set_info].
+
+
+groups() ->
+ [{get_set,[get_values,
+ get_next_values,
+ set_values,
+ load_mibs]},
+ {register,[register_users,
+ register_users_fail,
+ register_agents,
+ register_agents_fail,
+ register_usm_users,
+ register_usm_users_fail]},
+ {override,[override_usm,
+ override_standard,
+ override_context,
+ override_community,
+ override_notify,
+ override_target_addr,
+ override_target_params,
+ override_vacm]}].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(Config) ->
+ Config.
+
+init_per_group(get_set, Config) ->
+ ok = ct_snmp:start(Config,snmp1,snmp_app1),
+ Config;
+init_per_group(register, Config) ->
+ ok = ct_snmp:start(Config,snmp2,snmp_app2),
+ Config;
+init_per_group(_, Config) ->
+ ok = ct_snmp:start(Config,snmp3,snmp_app2),
+ Config.
+
+end_per_group(_Group, Config) ->
+ catch ct_snmp:stop(Config),
+ Config.
+
+init_per_testcase(_Case, Config) ->
+ Dog = test_server:timetrap(?default_timeout),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(Case, Config) ->
+ try apply(?MODULE,Case,[cleanup,Config])
+ catch error:undef -> ok
+ end,
+ Dog=?config(watchdog, Config),
+ test_server:timetrap_cancel(Dog),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+break(_Config) ->
+ test_server:break(""),
+ ok.
+
+start_stop(Config) ->
+ ok = ct_snmp:start(Config,snmp1,snmp_app1),
+ timer:sleep(1000),
+ {snmp,_,_} = lists:keyfind(snmp,1,application:which_applications()),
+ [_|_] = filelib:wildcard("*/*.conf",?config(priv_dir,Config)),
+
+ ok = ct_snmp:stop(Config),
+ timer:sleep(1000),
+ false = lists:keyfind(snmp,1,application:which_applications()),
+ [] = filelib:wildcard("*/*.conf",?config(priv_dir,Config)),
+ ok.
+
+get_values(_Config) ->
+ Oids1 = [?sysDescr_instance, ?sysName_instance],
+ {noError,_,V1} = ct_snmp:get_values(agent_name,Oids1,snmp1),
+ [#varbind{oid=?sysDescr_instance,value="Erlang SNMP agent"},
+ #varbind{oid=?sysName_instance,value="ct_test"}] = V1,
+ ok.
+
+get_next_values(_Config) ->
+ Oids2 = [?system],
+ {noError,_,V2} = ct_snmp:get_next_values(agent_name,Oids2,snmp1),
+ [#varbind{oid=?sysDescr_instance,value="Erlang SNMP agent"}] = V2,
+ ok.
+
+set_values(Config) ->
+ Oid3 = ?sysName_instance,
+ NewName = "ct_test changed by " ++ atom_to_list(?MODULE),
+ VarsAndVals = [{Oid3,s,NewName}],
+ {noError,_,_} =
+ ct_snmp:set_values(agent_name,VarsAndVals,snmp1,Config),
+
+ Oids4 = [?sysName_instance],
+ {noError,_,V4} = ct_snmp:get_values(agent_name,Oids4,snmp1),
+ [#varbind{oid=?sysName_instance,value=NewName}] = V4,
+
+ ok.
+
+load_mibs(_Config) ->
+ [{'SNMPv2-MIB',_}=SnmpV2Mib] = snmpa:which_mibs(),
+ Mib = filename:join([code:priv_dir(snmp),"mibs","SNMP-USER-BASED-SM-MIB"]),
+ ok = ct_snmp:load_mibs([Mib]),
+ TwoMibs = [_,_] = snmpa:which_mibs(),
+ [{'SNMP-USER-BASED-SM-MIB',_}] = lists:delete(SnmpV2Mib,TwoMibs),
+ ok = ct_snmp:unload_mibs([Mib]),
+ [{'SNMPv2-MIB',_}] = snmpa:which_mibs(),
+ ok.
+
+
+register_users(_Config) ->
+ [] = snmpm:which_users(),
+ ok = ct_snmp:register_users(snmp2,[{reg_user1,[snmpm_user_default,[]]}]),
+ [_] = snmpm:which_users(),
+ [_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:register_users(snmp2,[{reg_user2,[snmpm_user_default,[]]}]),
+ [_,_] = snmpm:which_users(),
+ [_,_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:register_users(snmp2,[{reg_user3,[snmpm_user_default,[]]}]),
+ [_,_,_] = snmpm:which_users(),
+ [_,_,_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:unregister_users(snmp2,[reg_user3]),
+ [_,_] = snmpm:which_users(),
+ [_,_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:unregister_users(snmp2),
+ [] = snmpm:which_users(),
+ [] = ct:get_config({snmp2,users}),
+ ok.
+register_users(cleanup,_Config) ->
+ ct_snmp:unregister_users(snmp2).
+
+register_users_fail(_Config) ->
+ [] = snmpm:which_users(),
+ {error,_} = ct_snmp:register_users(snmp2,[{reg_user3,[unknown_module,[]]}]),
+ [] = snmpm:which_users(),
+ ok.
+register_users_fail(cleanup,_Config) ->
+ ct_snmp:unregister_users(snmp2).
+
+register_agents(_Config) ->
+ {ok, HostName} = inet:gethostname(),
+ {ok, Addr} = inet:getaddr(HostName, inet),
+
+ [] = snmpm:which_agents(),
+ ok = ct_snmp:register_users(snmp2,[{reg_user1,[snmpm_user_default,[]]}]),
+ ok = ct_snmp:register_agents(snmp2,[{reg_agent1,
+ [reg_user1,Addr,?AGENT_UDP,[]]}]),
+ [_] = snmpm:which_agents(),
+ [_] = ct:get_config({snmp2,managed_agents}),
+ ok = ct_snmp:register_agents(snmp2,[{reg_agent2,
+ [reg_user1,Addr,?AGENT_UDP,[]]}]),
+ [_,_] = snmpm:which_agents(),
+ [_,_] = ct:get_config({snmp2,managed_agents}),
+
+ ok = ct_snmp:register_agents(snmp2,[{reg_agent3,
+ [reg_user1,Addr,?AGENT_UDP,[]]}]),
+ [_,_,_] = snmpm:which_agents(),
+ [_,_,_] = ct:get_config({snmp2,managed_agents}),
+
+ ok = ct_snmp:unregister_agents(snmp2,[reg_agent3]),
+ [_,_] = snmpm:which_agents(),
+ [_,_] = ct:get_config({snmp2,managed_agents}),
+
+ ok = ct_snmp:unregister_agents(snmp2),
+ ok = ct_snmp:unregister_users(snmp2),
+ [] = snmpm:which_agents(),
+ [] = ct:get_config({snmp2,managed_agents}),
+ ok.
+register_agents(cleanup,_Config) ->
+ ct_snmp:unregister_agents(snmp2),
+ ct_snmp:unregister_users(snmp2).
+
+register_agents_fail(_Config) ->
+ {ok, HostName} = inet:gethostname(),
+ {ok, Addr} = inet:getaddr(HostName, inet),
+
+ [] = snmpm:which_agents(),
+ {error,_}
+ = ct_snmp:register_agents(snmp2,[{reg_agent3,
+ [unknown_user,Addr,?AGENT_UDP,[]]}]),
+ [] = snmpm:which_agents(),
+ ok.
+register_agents_fail(cleanup,_Config) ->
+ ct_snmp:unregister_agents(snmp2).
+
+register_usm_users(_Config) ->
+ [] = snmpm:which_usm_users(),
+ ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user1",[]}]),
+ [_] = snmpm:which_usm_users(),
+ [_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user2",[]}]),
+ [_,_] = snmpm:which_usm_users(),
+ [_,_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user3",[]}]),
+ [_,_,_] = snmpm:which_usm_users(),
+ [_,_,_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:unregister_usm_users(snmp2,["reg_usm_user3"]),
+ [_,_] = snmpm:which_usm_users(),
+ [_,_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:unregister_usm_users(snmp2),
+ [] = snmpm:which_usm_users(),
+ [] = ct:get_config({snmp2,usm_users}),
+ ok.
+register_usm_users(cleanup,_Config) ->
+ ct_snmp:unregister_usm_users(snmp2).
+
+register_usm_users_fail(_Config) ->
+ [] = snmpm:which_usm_users(),
+ {error,_}
+ = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user3",
+ [{sec_name,invalid_data_type}]}]),
+ [] = snmpm:which_usm_users(),
+ ok.
+register_usm_users_fail(cleanup,_Config) ->
+ ct_snmp:unregister_usm_users(snmp2).
+
+%% Test that functionality for overriding default configuration file
+%% works - i.e. that the files are written and that the configuration
+%% is actually used.
+%%
+%% Note that the config files used in this test case do not
+%% necessarily make up a reasonable configuration for the snmp
+%% application...
+override_usm(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ Mib = filename:join([code:priv_dir(snmp),"mibs","SNMP-USER-BASED-SM-MIB"]),
+ ok = ct_snmp:load_mibs([Mib]),
+
+ %% Check that usm.conf is overwritten
+ {ok,MyUsm} = snmpa_conf:read_usm_config(DataDir),
+ {ok,UsedUsm} = snmpa_conf:read_usm_config(ConfDir),
+ true = (MyUsm == UsedUsm),
+
+ %% Check that the usm user is actually configured...
+ [{Index,"secname"}] =
+ snmp_user_based_sm_mib:usmUserTable(get_next,?usmUserEntry,[3]),
+ true = lists:suffix("usm_user_name",Index),
+ ok.
+
+override_standard(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that standard.conf is overwritten
+ {ok,MyStandard} = snmpa_conf:read_standard_config(DataDir),
+ {ok,UsedStandard} = snmpa_conf:read_standard_config(ConfDir),
+ true = (MyStandard == UsedStandard),
+
+ %% Check that the values from standard.conf is actually configured...
+ {value,"name for override test"} = snmp_standard_mib:sysName(get),
+ {value,"agent for ct_snmp override test"} = snmp_standard_mib:sysDescr(get),
+ ok.
+
+override_context(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that context.conf is overwritten
+ {ok,MyContext} = snmpa_conf:read_context_config(DataDir),
+ {ok,UsedContext} = snmpa_conf:read_context_config(ConfDir),
+ true = (MyContext == UsedContext),
+ ok.
+
+override_community(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that community.conf is overwritten
+ {ok,MyCommunity} = snmpa_conf:read_community_config(DataDir),
+ {ok,UsedCommunity} = snmpa_conf:read_community_config(ConfDir),
+ true = (MyCommunity == UsedCommunity),
+ ok.
+
+override_notify(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that notify.conf is overwritten
+ {ok,MyNotify} = snmpa_conf:read_notify_config(DataDir),
+ {ok,UsedNotify} = snmpa_conf:read_notify_config(ConfDir),
+ true = (MyNotify == UsedNotify),
+ ok.
+
+override_target_addr(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that target_addr.conf is overwritten
+ {ok,MyTargetAddr} = snmpa_conf:read_target_addr_config(DataDir),
+ {ok,UsedTargetAddr} = snmpa_conf:read_target_addr_config(ConfDir),
+ true = (MyTargetAddr == UsedTargetAddr),
+ ok.
+
+override_target_params(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that target_params.conf is overwritten
+ {ok,MyTargetParams} = snmpa_conf:read_target_params_config(DataDir),
+ {ok,UsedTargetParams} = snmpa_conf:read_target_params_config(ConfDir),
+ true = (MyTargetParams == UsedTargetParams),
+ ok.
+
+override_vacm(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that vacm.conf is overwritten
+ {ok,MyVacm} = snmpa_conf:read_vacm_config(DataDir),
+ {ok,UsedVacm} = snmpa_conf:read_vacm_config(ConfDir),
+ true = (MyVacm == UsedVacm),
+ ok.
+
+
+
+
+%% NOTE!! This test must always be executed last in the suite, and
+%% should match all set requests performed in the suite. I.e. if you
+%% add a set request, you must add an entry in the return value of
+%% ct_snmp:set_info/1 below.
+set_info(Config) ->
+ %% From test case set_values/1:
+ Oid1 = ?sysName_instance,
+ NewValue1 = "ct_test changed by " ++ atom_to_list(?MODULE),
+
+ %% The test...
+ [{_AgentName,_,[{Oid1,_,NewValue1}]}]
+ = ct_snmp:set_info(Config),
+ ok.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf
new file mode 100644
index 0000000000..5a64df6605
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf
@@ -0,0 +1 @@
+{"public", "public", "initial", "", ""}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf
new file mode 100644
index 0000000000..feed5e1d11
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf
@@ -0,0 +1 @@
+"testcontext".
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf
new file mode 100644
index 0000000000..367ba3aa4b
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf
@@ -0,0 +1 @@
+{"standard inform", "std_inform", inform}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf
new file mode 100644
index 0000000000..79908fb355
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf
@@ -0,0 +1,7 @@
+{sysDescr, "agent for ct_snmp override test"}.
+{sysObjectID, [1,2,3]}.
+{sysContact, "[email protected]"}.
+{sysLocation, "erlang"}.
+{sysServices, 72}.
+{snmpEnableAuthenTraps, enabled}.
+{sysName, "name for override test"}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf
new file mode 100644
index 0000000000..d02672a074
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf
@@ -0,0 +1,2 @@
+{"target1", snmpUDPDomain, [147,214,122,73], 5000, 1500, 3, "std_trap", "target_v3", "", [], 2048}.
+{"target2", snmpUDPDomain, [147,214,122,73], 5000, 1500, 3, "std_inform", "target_v3", "", [], 2048}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf
new file mode 100644
index 0000000000..5a9a619422
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf
@@ -0,0 +1 @@
+{"target_v3", v3, usm, "initial", noAuthNoPriv}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf
new file mode 100644
index 0000000000..d6e245914e
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf
@@ -0,0 +1 @@
+{"ct_snmp-test-engine","usm_user_name","secname",zeroDotZero,usmNoAuthProtocol,"","",usmNoPrivProtocol,"","","","",""}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf
new file mode 100644
index 0000000000..158fe02e3b
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf
@@ -0,0 +1,6 @@
+{vacmSecurityToGroup, usm, "initial", "initial"}.
+{vacmAccess, "initial", "", any, noAuthNoPriv, exact, "restricted", "", "restricted"}.
+{vacmAccess, "initial", "", usm, authNoPriv, exact, "internet", "internet", "internet"}.
+{vacmAccess, "initial", "", usm, authPriv, exact, "internet", "internet", "internet"}.
+{vacmViewTreeFamily, "restricted", [1,3,6,1], included, null}.
+{vacmViewTreeFamily, "internet", [1,3,6,1], included, null}.
diff --git a/lib/common_test/test/ct_surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE.erl
new file mode 100644
index 0000000000..b86b47f0a2
--- /dev/null
+++ b/lib/common_test/test/ct_surefire_SUITE.erl
@@ -0,0 +1,374 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_surefire_SUITE
+%%%
+%%% Description:
+%%% Test cth_surefire hook
+%%%
+%%%-------------------------------------------------------------------
+-module(ct_surefire_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-include_lib("xmerl/include/xmerl.hrl").
+-include_lib("kernel/include/file.hrl").
+
+-define(eh, ct_test_support_eh).
+
+-define(url_base,"http://my.host.com/").
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ default,
+ absolute_path,
+ relative_path,
+ url,
+ logdir
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+default(Config) when is_list(Config) ->
+ run(default,[cth_surefire],"junit_report.xml",Config).
+
+absolute_path(Config) when is_list(Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ Path = filename:join(PrivDir,"abspath.xml"),
+ run(absolute_path,[{cth_surefire,[{path,Path}]}],Path,Config).
+
+relative_path(Config) when is_list(Config) ->
+ Path = "relpath.xml",
+ run(relative_path,[{cth_surefire,[{path,Path}]}],Path,Config).
+
+url(Config) when is_list(Config) ->
+ Path = "url.xml",
+ run(url,[{cth_surefire,[{url_base,?url_base},{path,Path}]}],
+ Path,Config).
+
+logdir(Config) when is_list(Config) ->
+ Opts = ct_test_support:get_opts(Config),
+ LogDir =
+ case lists:keyfind(logdir,1,Opts) of
+ {logdir,LD} -> LD;
+ false -> ?config(priv_dir,Config)
+ end,
+ MyLogDir = filename:join(LogDir,"specific_logdir"),
+ ensure_exists_empty(MyLogDir),
+ Path = "logdir.xml",
+ run(logdir,[{cth_surefire,[{path,Path}]}],Path,Config,[{logdir,MyLogDir}]).
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+run(Case,CTHs,Report,Config) ->
+ run(Case,CTHs,Report,Config,[]).
+run(Case,CTHs,Report,Config,ExtraOpts) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "surefire_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},{ct_hooks,CTHs},{label,Case}|ExtraOpts],
+ Config),
+ ok = execute(Case, Opts, ERPid, Config),
+ LogDir =
+ case lists:keyfind(logdir,1,Opts) of
+ {logdir,LD} -> LD;
+ false -> ?config(priv_dir,Config)
+ end,
+ Re = filename:join([LogDir,"*",Report]),
+ check_xml(Case,Re).
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Opts1 =
+ case lists:keymember(logdir,1,Test) of
+ true -> lists:keydelete(logdir,1,Opts0);
+ false -> Opts0
+ end,
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts1 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(Name),
+ ct_test_support:verify_events(TestEvents, Events, Config).
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+events_to_check(Test) ->
+ %% 2 tests (ct:run_test + script_start) is default
+ events_to_check(Test, 2).
+
+events_to_check(_, 0) ->
+ [];
+events_to_check(Test, N) ->
+ test_events(Test) ++ events_to_check(Test, N-1).
+
+test_events(_) ->
+ [{?eh,start_logging,'_'},
+ {?eh,start_info,{1,1,9}},
+ {?eh,tc_start,{surefire_SUITE,init_per_suite}},
+ {?eh,tc_done,{surefire_SUITE,init_per_suite,ok}},
+ {?eh,tc_start,{surefire_SUITE,tc_ok}},
+ {?eh,tc_done,{surefire_SUITE,tc_ok,ok}},
+ {?eh,test_stats,{1,0,{0,0}}},
+ {?eh,tc_start,{surefire_SUITE,tc_fail}},
+ {?eh,tc_done,{surefire_SUITE,tc_fail,
+ {failed,{error,{test_case_failed,"this test should fail"}}}}},
+ {?eh,test_stats,{1,1,{0,0}}},
+ {?eh,tc_start,{surefire_SUITE,tc_skip}},
+ {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}},
+ {?eh,test_stats,{1,1,{1,0}}},
+ {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}},
+ {?eh,tc_done,{surefire_SUITE,tc_autoskip_require,
+ {skipped,{require_failed,'_'}}}},
+ {?eh,test_stats,{1,1,{1,1}}},
+ [{?eh,tc_start,{surefire_SUITE,{init_per_group,g,[]}}},
+ {?eh,tc_done,{surefire_SUITE,{init_per_group,g,[]},ok}},
+ {?eh,tc_start,{surefire_SUITE,tc_ok}},
+ {?eh,tc_done,{surefire_SUITE,tc_ok,ok}},
+ {?eh,test_stats,{2,1,{1,1}}},
+ {?eh,tc_start,{surefire_SUITE,tc_fail}},
+ {?eh,tc_done,{surefire_SUITE,tc_fail,
+ {failed,{error,{test_case_failed,"this test should fail"}}}}},
+ {?eh,test_stats,{2,2,{1,1}}},
+ {?eh,tc_start,{surefire_SUITE,tc_skip}},
+ {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}},
+ {?eh,test_stats,{2,2,{2,1}}},
+ {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}},
+ {?eh,tc_done,{surefire_SUITE,tc_autoskip_require,
+ {skipped,{require_failed,'_'}}}},
+ {?eh,test_stats,{2,2,{2,2}}},
+ {?eh,tc_start,{surefire_SUITE,{end_per_group,g,[]}}},
+ {?eh,tc_done,{surefire_SUITE,{end_per_group,g,[]},ok}}],
+ [{?eh,tc_start,{surefire_SUITE,{init_per_group,g_fail,[]}}},
+ {?eh,tc_done,{surefire_SUITE,{init_per_group,g_fail,[]},
+ {failed,{error,all_cases_should_be_skipped}}}},
+ {?eh,tc_auto_skip,{surefire_SUITE,tc_ok,
+ {failed,
+ {surefire_SUITE,init_per_group,
+ {'EXIT',all_cases_should_be_skipped}}}}},
+ {?eh,test_stats,{2,2,{2,3}}},
+ {?eh,tc_auto_skip,{surefire_SUITE,end_per_group,
+ {failed,
+ {surefire_SUITE,init_per_group,
+ {'EXIT',all_cases_should_be_skipped}}}}}],
+ {?eh,tc_start,{surefire_SUITE,end_per_suite}},
+ {?eh,tc_done,{surefire_SUITE,end_per_suite,ok}},
+ {?eh,stop_logging,[]}].
+
+
+%%%-----------------------------------------------------------------
+%%% Check generated xml log files
+check_xml(Case,XmlRe) ->
+ case filelib:wildcard(XmlRe) of
+ [] ->
+ ct:fail("No xml files found with regexp ~p~n", [XmlRe]);
+ [_] = Xmls when Case==absolute_path ->
+ do_check_xml(Case,Xmls);
+ [_,_] = Xmls ->
+ do_check_xml(Case,Xmls)
+ end.
+
+%% Allowed structure:
+%% <testsuites>
+%% <testsuite>
+%% <properties>
+%% <property/>
+%% ...
+%% </properties>
+%% <testcase>
+%% [<failure/> | <error/> | <skipped/> ]
+%% </testcase>
+%% ...
+%% </testsuite>
+%% ...
+%% </testsuites>
+do_check_xml(Case,[Xml|Xmls]) ->
+ ct:log("Checking <a href=~p>~s</a>~n",[Xml,Xml]),
+ {E,_} = xmerl_scan:file(Xml),
+ Expected = events_to_result(lists:flatten(test_events(Case))),
+ ParseResult = testsuites(Case,E),
+ ct:log("Expecting: ~p~n",[[Expected]]),
+ ct:log("Actual : ~p~n",[ParseResult]),
+ [Expected] = ParseResult,
+ do_check_xml(Case,Xmls);
+do_check_xml(_,[]) ->
+ ok.
+
+%% Scanning the XML to get the same type of result as events_to_result/1
+testsuites(Case,#xmlElement{name=testsuites,content=TS}) ->
+ %% OTP-10589 - move properties element to <testsuite>
+ false = lists:keytake(properties,#xmlElement.name,TS),
+ testsuite(Case,TS).
+
+testsuite(Case,[#xmlElement{name=testsuite,content=TC,attributes=A}|TS]) ->
+ {ET,EF,ES} = events_to_numbers(lists:flatten(test_events(Case))),
+ {T,E,F,S} = get_numbers_from_attrs(A,false,false,false,false),
+ ct:log("Expecting total:~p, error:~p, failure:~p, skipped:~p~n",[ET,0,EF,ES]),
+ ct:log("Actual total:~p, error:~p, failure:~p, skipped:~p~n",[T,E,F,S]),
+ {ET,0,EF,ES} = {T,E,F,S},
+
+ %% properties should only be there if given a options to hook
+ false = lists:keytake(properties,#xmlElement.name,TC),
+ %% system-out and system-err is not used by common_test
+ false = lists:keytake('system-out',#xmlElement.name,TC),
+ false = lists:keytake('system-err',#xmlElement.name,TC),
+ R=testcase(Case,TC),
+ [R|testsuite(Case,TS)];
+testsuite(_Case,[]) ->
+ [].
+
+testcase(url=Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) ->
+ R = failed_or_skipped(C),
+ case R of
+ [s] ->
+ case lists:keyfind(url,#xmlAttribute.name,A) of
+ false -> ok;
+ #xmlAttribute{value=UrlAttr} ->
+ lists:keyfind(url,#xmlAttribute.name,A),
+ true = lists:prefix(?url_base,UrlAttr)
+ end;
+ _ ->
+ #xmlAttribute{value=UrlAttr} =
+ lists:keyfind(url,#xmlAttribute.name,A),
+ true = lists:prefix(?url_base,UrlAttr)
+ end,
+ [R|testcase(Case,TC)];
+testcase(Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) ->
+ false = lists:keyfind(url,#xmlAttribute.name,A),
+ R = failed_or_skipped(C),
+ [R|testcase(Case,TC)];
+testcase(_Case,[]) ->
+ [].
+
+failed_or_skipped([#xmlElement{name=failure}|E]) ->
+ [f|failed_or_skipped(E)];
+failed_or_skipped([#xmlElement{name=error}|E]) ->
+ [e|failed_or_skipped(E)];
+failed_or_skipped([#xmlElement{name=skipped}|E]) ->
+ [s|failed_or_skipped(E)];
+failed_or_skipped([]) ->
+ [].
+
+%% Using the expected events to produce the expected result of the XML scanning.
+%% The result is a list of test suites:
+%% Testsuites = [Testsuite]
+%% Testsuite = [Testcase]
+%% Testcase = [] | [f] | [s], indicating ok, failed and skipped respectively
+events_to_result([{?eh,tc_done,{_Suite,_Case,R}}|E]) ->
+ [result(R)|events_to_result(E)];
+events_to_result([{?eh,tc_auto_skip,_}|E]) ->
+ [[s]|events_to_result(E)];
+events_to_result([_|E]) ->
+ events_to_result(E);
+events_to_result([]) ->
+ [].
+
+result(ok) ->[];
+result({skipped,_}) -> [s];
+result({failed,_}) -> [f].
+
+%% Using the expected events' last test_stats element to produce the
+%% expected number of totla, errors, failed and skipped testcases.
+events_to_numbers(E) ->
+ RevE = lists:reverse(E),
+ {?eh,test_stats,{Ok,F,{US,AS}}} = lists:keyfind(test_stats,2,RevE),
+ {Ok+F+US+AS,F,US+AS}.
+
+get_numbers_from_attrs([#xmlAttribute{name=tests,value=X}|A],false,E,F,S) ->
+ get_numbers_from_attrs(A,list_to_integer(X),E,F,S);
+get_numbers_from_attrs([#xmlAttribute{name=errors,value=X}|A],T,false,F,S) ->
+ get_numbers_from_attrs(A,T,list_to_integer(X),F,S);
+get_numbers_from_attrs([#xmlAttribute{name=failures,value=X}|A],T,E,false,S) ->
+ get_numbers_from_attrs(A,T,E,list_to_integer(X),S);
+get_numbers_from_attrs([#xmlAttribute{name=skipped,value=X}|A],T,E,F,false) ->
+ get_numbers_from_attrs(A,T,E,F,list_to_integer(X));
+get_numbers_from_attrs([_|A],T,E,F,S) ->
+ get_numbers_from_attrs(A,T,E,F,S);
+get_numbers_from_attrs([],T,E,F,S) ->
+ {T,E,F,S}.
+
+ensure_exists_empty(Dir) ->
+ case file:list_dir(Dir) of
+ {error,enoent} ->
+ file:make_dir(Dir);
+ {ok,Files} ->
+ del_files(Dir,Files)
+ end.
+
+del_files(Dir,[F0|Fs] ) ->
+ F = filename:join(Dir,F0),
+ case file:read_file_info(F) of
+ {ok,#file_info{type=directory}} ->
+ {ok,Files} = file:list_dir(F),
+ del_files(F,Files),
+ file:del_dir(F),
+ del_files(Dir,Fs);
+ _ ->
+ file:delete(F),
+ del_files(Dir,Fs)
+ end;
+del_files(_,[]) ->
+ ok.
diff --git a/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl
new file mode 100644
index 0000000000..677aee46c5
--- /dev/null
+++ b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl
@@ -0,0 +1,92 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+%%----------------------------------------------------------------------
+%% File: surefire_SUITE.erl
+%%
+%% Description:
+%% This file contains the test cases for cth_surefire.
+%%
+%% @author Support
+%% @doc Test of surefire support in common_test
+%% @end
+%%----------------------------------------------------------------------
+%%----------------------------------------------------------------------
+-module(surefire_SUITE).
+-include_lib("common_test/include/ct.hrl").
+
+-compile(export_all).
+
+%% Default timetrap timeout (set in init_per_testcase).
+-define(default_timeout, ?t:minutes(1)).
+
+all() ->
+ testcases() ++ [{group,g},{group,g_fail}].
+
+groups() ->
+ [{g,testcases()},
+ {g_fail,[tc_ok]}].
+
+testcases() ->
+ [tc_ok,
+ tc_fail,
+ tc_skip,
+ tc_autoskip_require].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(Config) ->
+ Config.
+
+init_per_group(g_fail, _Config) ->
+ exit(all_cases_should_be_skipped);
+init_per_group(_, Config) ->
+ Config.
+
+end_per_group(_Group, Config) ->
+ Config.
+
+init_per_testcase(_Case, Config) ->
+ Dog = test_server:timetrap(?default_timeout),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(_Case, Config) ->
+ Dog=?config(watchdog, Config),
+ test_server:timetrap_cancel(Dog),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+break(_Config) ->
+ test_server:break(""),
+ ok.
+
+tc_ok(_Config) ->
+ ok.
+
+tc_fail(_Config) ->
+ ct:fail("this test should fail").
+
+tc_skip(_Config) ->
+ {skip,"this test is skipped"}.
+
+tc_autoskip_require() ->
+ [{require,whatever}].
+tc_autoskip_require(Config) ->
+ ct:fail("this test should never be executed - it should be autoskipped").
diff --git a/lib/common_test/test/ct_system_error_SUITE.erl b/lib/common_test/test/ct_system_error_SUITE.erl
new file mode 100644
index 0000000000..f2d6ef4b1b
--- /dev/null
+++ b/lib/common_test/test/ct_system_error_SUITE.erl
@@ -0,0 +1,132 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_system_error_SUITE
+%%%
+%%% Description:
+%%%
+%%% Test that severe system errors (such as failure to write logs) are
+%%% noticed and handled.
+%%%-------------------------------------------------------------------
+-module(ct_system_error_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ test_server_failing_logs
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+test_server_failing_logs(Config) ->
+ TC = test_server_failing_logs,
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "a_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},{label,TC}], Config),
+ crash_test_server(Config),
+ {error,{cannot_create_log_dir,__}} = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+ ct_test_support:log_events(TC,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(TC),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config).
+
+crash_test_server(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Root = proplists:get_value(logdir, ct_test_support:get_opts(Config)),
+ [$@|Host] = lists:dropwhile(fun(C) ->
+ C =/= $@
+ end, atom_to_list(node())),
+ Format = filename:join(Root,
+ "ct_run.ct@" ++ Host ++
+ ".~4..0w-~2..0w-~2..0w_"
+ "~2..0w.~2..0w.~2..0w"),
+ [C2,C1|_] = lists:reverse(filename:split(DataDir)),
+ LogDir = C1 ++ "." ++ C2 ++ ".a_SUITE.logs",
+ T = calendar:datetime_to_gregorian_seconds(calendar:local_time()),
+ [begin
+ {{Y,Mon,D},{H,Min,S}} =
+ calendar:gregorian_seconds_to_datetime(T+Offset),
+ Dir0 = io_lib:format(Format, [Y,Mon,D,H,Min,S]),
+ Dir = lists:flatten(Dir0),
+ file:make_dir(Dir),
+ File = filename:join(Dir, LogDir),
+ file:write_file(File, "anything goes\n")
+ end || Offset <- lists:seq(0, 20)],
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+
+events_to_check(_Test) ->
+ [{?eh,severe_error,{cannot_create_log_dir,{'_','_'}}}].
diff --git a/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl b/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl
new file mode 100644
index 0000000000..c6e3ddfd5d
--- /dev/null
+++ b/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl
@@ -0,0 +1,122 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(a_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{seconds,10}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [tc1].
+
+tc1(_C) ->
+ ok.
diff --git a/lib/common_test/test/ct_test_support.erl b/lib/common_test/test/ct_test_support.erl
index 80cca4a1cc..7c33fd404d 100644
--- a/lib/common_test/test/ct_test_support.erl
+++ b/lib/common_test/test/ct_test_support.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -32,7 +32,7 @@
run/2, run/3, run/4, get_opts/1, wait_for_ct_stop/1]).
-export([handle_event/2, start_event_receiver/1, get_events/2,
- verify_events/3, reformat/2, log_events/4,
+ verify_events/3, verify_events/4, reformat/2, log_events/4,
join_abs_dirs/2]).
-export([ct_test_halt/1]).
@@ -117,8 +117,7 @@ end_per_suite(Config) ->
CTNode = proplists:get_value(ct_node, Config),
PrivDir = proplists:get_value(priv_dir, Config),
true = rpc:call(CTNode, code, del_path, [filename:join(PrivDir,"")]),
- cover:stop(CTNode),
- slave:stop(CTNode),
+ slave_stop(CTNode),
ok.
%%%-----------------------------------------------------------------
@@ -149,8 +148,7 @@ end_per_testcase(_TestCase, Config) ->
case wait_for_ct_stop(CTNode) of
%% Common test was not stopped to we restart node.
false ->
- cover:stop(CTNode),
- slave:stop(CTNode),
+ slave_stop(CTNode),
start_slave(Config,proplists:get_value(trace_level,Config)),
{fail, "Could not stop common_test"};
true ->
@@ -364,6 +362,14 @@ verify_events(TEvs, Evs, Config) ->
ok
end.
+verify_events(TEvs, Evs, Node, Config) ->
+ case catch verify_events1(TEvs, Evs, Node, Config) of
+ {'EXIT',Reason} ->
+ Reason;
+ _ ->
+ ok
+ end.
+
verify_events1([TestEv|_], [{TEH,#event{name=stop_logging,node=Node,data=_}}|_], Node, _)
when element(1,TestEv) == TEH, element(2,TestEv) =/= stop_logging ->
test_server:format("Failed to find ~p in the list of events!~n", [TestEv]),
@@ -612,8 +618,11 @@ locate({parallel,TEvs}, Node, Evs, Config) ->
fun({EH,#event{name=tc_auto_skip,
node=EvNode,
data={Mod,end_per_group,Reason}}}) when
- EH == TEH, EvNode == Node, Mod == M, Reason == R ->
- false;
+ EH == TEH, EvNode == Node, Mod == M ->
+ case match_data(R, Reason) of
+ match -> false;
+ _ -> true
+ end;
({EH,#event{name=stop_logging,
node=EvNode,data=_}}) when
EH == TEH, EvNode == Node ->
@@ -627,23 +636,12 @@ locate({parallel,TEvs}, Node, Evs, Config) ->
[_AutoSkip | RemEvs2] ->
{Done,RemEvs2,length(RemEvs2)}
end;
- %% match other event than test case
- (TEv={TEH,N,D}, Acc) when D == '_' ->
- case [E || E={EH,#event{name=Name,
- node=EvNode,
- data=_}} <- Evs1,
- EH == TEH, EvNode == Node, Name == N] of
- [] ->
- exit({unmatched,TEv});
- _ ->
- test_server:format("Found ~p!", [TEv]),
- Acc
- end;
(TEv={TEH,N,D}, Acc) ->
case [E || E={EH,#event{name=Name,
node=EvNode,
data=Data}} <- Evs1,
- EH == TEH, EvNode == Node, Name == N, Data == D] of
+ EH == TEH, EvNode == Node, Name == N,
+ match == match_data(D,Data)] of
[] ->
exit({unmatched,TEv});
_ ->
@@ -1002,33 +1000,39 @@ locate({TEH,Name,Data}, Node, [{TEH,#event{name=Name,
data = EvData,
node = Node}}|Evs],
Config) ->
- try match_data(Data, EvData) of
+ case match_data(Data, EvData) of
match ->
- {Config,Evs}
- catch _:_ ->
+ {Config,Evs};
+ _ ->
nomatch
end;
locate({_TEH,_Name,_Data}, _Node, [_|_Evs], _Config) ->
nomatch.
-match_data(D,D) ->
+match_data(Data, EvData) ->
+ try do_match_data(Data, EvData)
+ catch _:_ ->
+ nomatch
+ end.
+
+do_match_data(D,D) ->
match;
-match_data('_',_) ->
+do_match_data('_',_) ->
match;
-match_data(Fun,Data) when is_function(Fun) ->
+do_match_data(Fun,Data) when is_function(Fun) ->
Fun(Data);
-match_data('$proplist',Proplist) ->
- match_data(
+do_match_data('$proplist',Proplist) ->
+ do_match_data(
fun(List) ->
lists:foreach(fun({_,_}) -> ok end,List)
end,Proplist);
-match_data([H1|MatchT],[H2|ValT]) ->
- match_data(H1,H2),
- match_data(MatchT,ValT);
-match_data(Tuple1,Tuple2) when is_tuple(Tuple1),is_tuple(Tuple2) ->
- match_data(tuple_to_list(Tuple1),tuple_to_list(Tuple2));
-match_data([],[]) ->
+do_match_data([H1|MatchT],[H2|ValT]) ->
+ do_match_data(H1,H2),
+ do_match_data(MatchT,ValT);
+do_match_data(Tuple1,Tuple2) when is_tuple(Tuple1),is_tuple(Tuple2) ->
+ do_match_data(tuple_to_list(Tuple1),tuple_to_list(Tuple2));
+do_match_data([],[]) ->
match.
result_match({SkipOrFail,{ErrorInd,{Why,'_'}}},
@@ -1039,10 +1043,13 @@ result_match({SkipOrFail,{ErrorInd,{EMod,EFunc,{Why,'_'}}}},
true;
result_match({failed,{timetrap_timeout,{'$approx',Num}}},
{failed,{timetrap_timeout,Value}}) ->
- if Value >= trunc(Num-0.02*Num),
- Value =< trunc(Num+0.02*Num) -> true;
+ if Value >= trunc(Num-0.05*Num),
+ Value =< trunc(Num+0.05*Num) -> true;
true -> false
end;
+result_match({user_timetrap_error,{Why,'_'}},
+ {user_timetrap_error,{Why,_Stack}}) ->
+ true;
result_match(Result, Result) ->
true;
result_match(_, _) ->
@@ -1125,6 +1132,8 @@ reformat([{_EH,#event{name=test_start,data=_}} | Events], EH) ->
[{EH,test_start,{'DEF',{'START_TIME','LOGDIR'}}} | reformat(Events, EH)];
reformat([{_EH,#event{name=test_done,data=_}} | Events], EH) ->
[{EH,test_done,{'DEF','STOP_TIME'}} | reformat(Events, EH)];
+reformat([{_EH,#event{name=tc_logfile,data=_}} | Events], EH) ->
+ reformat(Events, EH);
reformat([{_EH,#event{name=test_stats,data=Data}} | Events], EH) ->
[{EH,test_stats,Data} | reformat(Events, EH)];
%% use this to only print the last test_stats event:
@@ -1259,3 +1268,22 @@ rm_files([F | Fs]) ->
rm_files([]) ->
ok.
+%%%-----------------------------------------------------------------
+%%%
+slave_stop(Node) ->
+ Cover = test_server:is_cover(),
+ if Cover-> cover:flush(Node);
+ true -> ok
+ end,
+ erlang:monitor_node(Node, true),
+ slave:stop(Node),
+ receive
+ {nodedown, Node} ->
+ if Cover -> cover:stop(Node);
+ true -> ok
+ end
+ after 5000 ->
+ erlang:monitor_node(Node, false),
+ receive {nodedown, Node} -> ok after 0 -> ok end %flush
+ end,
+ ok.
diff --git a/lib/common_test/test/ct_testspec_1_SUITE.erl b/lib/common_test/test/ct_testspec_1_SUITE.erl
index b7e19f25dd..6a4a4acd80 100644
--- a/lib/common_test/test/ct_testspec_1_SUITE.erl
+++ b/lib/common_test/test/ct_testspec_1_SUITE.erl
@@ -58,7 +58,7 @@ end_per_testcase(TestCase, Config) ->
suite() -> [{ct_hooks,[ts_install_cth]}].
-all() ->
+all() ->
[all_suites, skip_all_suites, suite, skip_suite,
all_testcases, skip_all_testcases, testcase,
skip_testcase, all_groups, skip_all_groups, group,
@@ -67,23 +67,23 @@ all() ->
skip_group_testcase, topgroup, subgroup, skip_subgroup,
subgroup_all_testcases, skip_subgroup_all_testcases,
subgroup_testcase, skip_subgroup_testcase,
- sub_skipped_by_top, testcase_in_multiple_groups,
- order_of_tests_in_multiple_dirs_no_merge_tests,
- order_of_tests_in_multiple_suites_no_merge_tests,
- order_of_suites_in_multiple_dirs_no_merge_tests,
- order_of_groups_in_multiple_dirs_no_merge_tests,
- order_of_groups_in_multiple_suites_no_merge_tests,
- order_of_tests_in_multiple_dirs,
- order_of_tests_in_multiple_suites,
- order_of_suites_in_multiple_dirs,
- order_of_groups_in_multiple_dirs,
- order_of_groups_in_multiple_suites,
- order_of_tests_in_multiple_suites_with_skip_no_merge_tests,
- order_of_tests_in_multiple_suites_with_skip,
+ sub_skipped_by_top, testcase_many_groups,
+ order_of_tests_many_dirs_no_merge_tests,
+ order_of_tests_many_suites_no_merge_tests,
+ order_of_suites_many_dirs_no_merge_tests,
+ order_of_groups_many_dirs_no_merge_tests,
+ order_of_groups_many_suites_no_merge_tests,
+ order_of_tests_many_dirs,
+ order_of_tests_many_suites,
+ order_of_suites_many_dirs,
+ order_of_groups_many_dirs,
+ order_of_groups_many_suites,
+ order_of_tests_many_suites_with_skip_no_merge_tests,
+ order_of_tests_many_suites_with_skip,
all_plus_one_tc_no_merge_tests,
all_plus_one_tc].
-groups() ->
+groups() ->
[].
init_per_group(_GroupName, Config) ->
@@ -373,19 +373,19 @@ sub_skipped_by_top(Config) when is_list(Config) ->
%%%-----------------------------------------------------------------
%%%
-testcase_in_multiple_groups(Config) when is_list(Config) ->
+testcase_many_groups(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir = filename:join(DataDir, "groups_1"),
TestSpec = [{cases,TestDir,groups_12_SUITE,[testcase_1a,testcase_1b]},
{skip_cases,TestDir,groups_12_SUITE,[testcase_1b],"SKIPPED!"}],
- setup_and_execute(testcase_in_multiple_groups, TestSpec, Config).
+ setup_and_execute(testcase_many_groups, TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
+order_of_tests_many_dirs_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -395,13 +395,13 @@ order_of_tests_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
{cases,TestDir2,groups_22_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_dirs_no_merge_tests,
+ setup_and_execute(order_of_tests_many_dirs_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites_no_merge_tests(Config) when is_list(Config) ->
+order_of_tests_many_suites_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -410,13 +410,13 @@ order_of_tests_in_multiple_suites_no_merge_tests(Config) when is_list(Config) ->
{cases,TestDir1,groups_11_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_suites_no_merge_tests,
+ setup_and_execute(order_of_tests_many_suites_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_suites_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
+order_of_suites_many_dirs_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -426,13 +426,13 @@ order_of_suites_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
{suites,TestDir2,groups_22_SUITE},
{suites,TestDir1,groups_11_SUITE}],
- setup_and_execute(order_of_suites_in_multiple_dirs_no_merge_tests,
+ setup_and_execute(order_of_suites_many_dirs_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
+order_of_groups_many_dirs_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -442,13 +442,13 @@ order_of_groups_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
{groups,TestDir2,groups_22_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_dirs_no_merge_tests,
+ setup_and_execute(order_of_groups_many_dirs_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_suites_no_merge_tests(Config)
+order_of_groups_many_suites_no_merge_tests(Config)
when is_list(Config) ->
DataDir = ?config(data_dir, Config),
@@ -458,13 +458,13 @@ order_of_groups_in_multiple_suites_no_merge_tests(Config)
{groups,TestDir1,groups_11_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_suites_no_merge_tests,
+ setup_and_execute(order_of_groups_many_suites_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites_with_skip_no_merge_tests(Config)
+order_of_tests_many_suites_with_skip_no_merge_tests(Config)
when is_list(Config) ->
DataDir = ?config(data_dir, Config),
@@ -477,14 +477,14 @@ order_of_tests_in_multiple_suites_with_skip_no_merge_tests(Config)
{skip_cases,TestDir1,groups_12_SUITE,[testcase_1b],"Skip it"}],
setup_and_execute(
- order_of_tests_in_multiple_suites_with_skip_no_merge_tests,
+ order_of_tests_many_suites_with_skip_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_dirs(Config) when is_list(Config) ->
+order_of_tests_many_dirs(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -493,13 +493,13 @@ order_of_tests_in_multiple_dirs(Config) when is_list(Config) ->
{cases,TestDir2,groups_22_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_dirs,
+ setup_and_execute(order_of_tests_many_dirs,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites(Config) when is_list(Config) ->
+order_of_tests_many_suites(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -507,13 +507,13 @@ order_of_tests_in_multiple_suites(Config) when is_list(Config) ->
{cases,TestDir1,groups_11_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_suites,
+ setup_and_execute(order_of_tests_many_suites,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_suites_in_multiple_dirs(Config) when is_list(Config) ->
+order_of_suites_many_dirs(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -522,13 +522,13 @@ order_of_suites_in_multiple_dirs(Config) when is_list(Config) ->
{suites,TestDir2,groups_22_SUITE},
{suites,TestDir1,groups_11_SUITE}],
- setup_and_execute(order_of_suites_in_multiple_dirs,
+ setup_and_execute(order_of_suites_many_dirs,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_dirs(Config) when is_list(Config) ->
+order_of_groups_many_dirs(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -537,13 +537,13 @@ order_of_groups_in_multiple_dirs(Config) when is_list(Config) ->
{groups,TestDir2,groups_22_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_dirs,
+ setup_and_execute(order_of_groups_many_dirs,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_suites(Config) when is_list(Config) ->
+order_of_groups_many_suites(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -551,13 +551,13 @@ order_of_groups_in_multiple_suites(Config) when is_list(Config) ->
{groups,TestDir1,groups_11_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_suites,
+ setup_and_execute(order_of_groups_many_suites,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites_with_skip(Config) when is_list(Config) ->
+order_of_tests_many_suites_with_skip(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -567,7 +567,7 @@ order_of_tests_in_multiple_suites_with_skip(Config) when is_list(Config) ->
{cases,TestDir1,groups_11_SUITE,[testcase_2]},
{skip_cases,TestDir1,groups_12_SUITE,[testcase_1b],"Skip it!"}],
- setup_and_execute(order_of_tests_in_multiple_suites_with_skip,
+ setup_and_execute(order_of_tests_many_suites_with_skip,
TestSpec, Config).
%%%-----------------------------------------------------------------
@@ -1204,10 +1204,10 @@ test_events(sub_skipped_by_top) ->
{negative,{?eh,tc_start,'_'},{?eh,stop_logging,'_'}}
];
-test_events(testcase_in_multiple_groups) ->
+test_events(testcase_many_groups) ->
[];
-test_events(order_of_tests_in_multiple_dirs_no_merge_tests) ->
+test_events(order_of_tests_many_dirs_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done, {groups_12_SUITE,testcase_1a,
@@ -1219,7 +1219,7 @@ test_events(order_of_tests_in_multiple_dirs_no_merge_tests) ->
{failed,{error,{test_case_failed,no_group_data}}}}},
{?eh,stop_logging,[]}
];
-test_events(order_of_tests_in_multiple_suites_no_merge_tests) ->
+test_events(order_of_tests_many_suites_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
@@ -1229,7 +1229,7 @@ test_events(order_of_tests_in_multiple_suites_no_merge_tests) ->
{?eh,tc_done,{groups_12_SUITE,testcase_1b,'_'}},
{?eh,stop_logging,[]}
];
-test_events(order_of_suites_in_multiple_dirs_no_merge_tests) ->
+test_events(order_of_suites_many_dirs_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,init_per_suite}},
{?eh,tc_done,{groups_12_SUITE,init_per_suite,'_'}},
@@ -1244,7 +1244,7 @@ test_events(order_of_suites_in_multiple_dirs_no_merge_tests) ->
{?eh,tc_start,{groups_11_SUITE,end_per_suite}},
{?eh,tc_done,{groups_11_SUITE,end_per_suite,'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_dirs_no_merge_tests) ->
+test_events(order_of_groups_many_dirs_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1257,7 +1257,7 @@ test_events(order_of_groups_in_multiple_dirs_no_merge_tests) ->
{?eh,tc_done, {groups_12_SUITE,{end_per_group,test_group_1b,'_'},'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_suites_no_merge_tests) ->
+test_events(order_of_groups_many_suites_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1270,7 +1270,7 @@ test_events(order_of_groups_in_multiple_suites_no_merge_tests) ->
{?eh,tc_done, {groups_12_SUITE,{end_per_group,test_group_1b,'_'},'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_tests_in_multiple_suites_with_skip_no_merge_tests) ->
+test_events(order_of_tests_many_suites_with_skip_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
@@ -1282,7 +1282,7 @@ test_events(order_of_tests_in_multiple_suites_with_skip_no_merge_tests) ->
{?eh,stop_logging,[]}
];
-test_events(order_of_tests_in_multiple_dirs) ->
+test_events(order_of_tests_many_dirs) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,
@@ -1296,7 +1296,7 @@ test_events(order_of_tests_in_multiple_dirs) ->
{?eh,tc_done,{groups_22_SUITE,testcase_1,ok}},
{?eh,stop_logging,[]}
];
-test_events(order_of_tests_in_multiple_suites) ->
+test_events(order_of_tests_many_suites) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
@@ -1308,7 +1308,7 @@ test_events(order_of_tests_in_multiple_suites) ->
{?eh,tc_done,{groups_11_SUITE,testcase_1,ok}},
{?eh,stop_logging,[]}
];
-test_events(order_of_suites_in_multiple_dirs) ->
+test_events(order_of_suites_many_dirs) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,init_per_suite}},
{?eh,tc_done,{groups_12_SUITE,init_per_suite,'_'}},
@@ -1325,7 +1325,7 @@ test_events(order_of_suites_in_multiple_dirs) ->
{?eh,tc_start,{groups_22_SUITE,end_per_suite}},
{?eh,tc_done,{groups_22_SUITE,end_per_suite,'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_dirs) ->
+test_events(order_of_groups_many_dirs) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1338,7 +1338,7 @@ test_events(order_of_groups_in_multiple_dirs) ->
{?eh,tc_done, {groups_22_SUITE,{end_per_group,test_group_1a,'_'},'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_suites) ->
+test_events(order_of_groups_many_suites) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1352,7 +1352,7 @@ test_events(order_of_groups_in_multiple_suites) ->
{?eh,stop_logging,[]}];
-test_events(order_of_tests_in_multiple_suites_with_skip) ->
+test_events(order_of_tests_many_suites_with_skip) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
diff --git a/lib/common_test/test/ct_testspec_2_SUITE.erl b/lib/common_test/test/ct_testspec_2_SUITE.erl
index 9d2dc84ad3..beaba0eaac 100644
--- a/lib/common_test/test/ct_testspec_2_SUITE.erl
+++ b/lib/common_test/test/ct_testspec_2_SUITE.erl
@@ -479,7 +479,7 @@ multiple_specs(_Config) ->
"multiple_specs.1.spec"),
SpecFile2 = ct_test_support:write_testspec(Spec2,SpecDir,
"multiple_specs.2.spec"),
- FileResult = ct_testspec:collect_tests_from_file([SpecFile1,SpecFile2],
+ FileResult = ct_testspec:collect_tests_from_file([[SpecFile1,SpecFile2]],
false),
ct:pal("TESTSPEC RECORD FROM FILE:~n~p~n", [rec2proplist(FileResult)]),
@@ -490,7 +490,7 @@ multiple_specs(_Config) ->
[{Node2,get_absdir(filename:join(SpecDir,CfgDir))} || CfgDir <- CfgDir2]],
LogDirV = get_absdir(filename:join(SpecDir,"../logs")),
- Verify = #testspec{merge_tests = false,
+ Verify = #testspec{merge_tests = true,
spec_dir = SpecDir,
nodes = [{undefined,Node},{n1,Node1},{n2,Node2}],
alias = [{to1,TO1V},{to2,TO2V}],
@@ -500,22 +500,13 @@ multiple_specs(_Config) ->
logdir = [{Node,LogDirV},{Node1,LogDirV},{Node2,LogDirV},"."],
config = CFGs,
tests = [{{Node1,TO1V},
- [{x_SUITE,[all]}]},
- {{Node1,TO1V},
- [{y_SUITE,[{g1,all},{g2,all}]}]},
- {{Node1,TO1V},
- [{y_SUITE,[tc1,tc2]}]},
- {{Node1,TO1V},
- [{z_SUITE,[{all,{skip,"skipped"}}]}]},
- {{Node2,TO2V},
- [{x_SUITE,[all]}]},
- {{Node2,TO2V},
- [{y_SUITE,[all]}]},
- {{Node2,TO2V},
- [{x_SUITE,[{{g1,all},{skip,"skipped"}},
- {{g2,all},{skip,"skipped"}}]}]},
+ [{x_SUITE,[all]},
+ {y_SUITE,[{g1,all},{g2,all},tc1,tc2]},
+ {z_SUITE,[{all,{skip,"skipped"}}]}]},
{{Node2,TO2V},
- [{y_SUITE,[{tc1,{skip,"skipped"}},
+ [{x_SUITE,[all,{{g1,all},{skip,"skipped"}},
+ {{g2,all},{skip,"skipped"}}]},
+ {y_SUITE,[all,{tc1,{skip,"skipped"}},
{tc2,{skip,"skipped"}}]}]}]},
verify_result(Verify,FileResult,FileResult).
@@ -524,7 +515,7 @@ multiple_specs(_Config) ->
%%%
misc_config_terms(_Config) ->
CfgDir = "../cfgs/to1",
-
+ TODir = "../tests/to1",
Spec =
[{node,x,n1@h1},{node,y,n2@h2},
@@ -554,7 +545,9 @@ misc_config_terms(_Config) ->
{create_priv_dir,[auto_per_tc]},
{create_priv_dir,n1@h1,[manual_per_tc]},
- {create_priv_dir,n2@h2,[auto_per_run]}
+ {create_priv_dir,n2@h2,[auto_per_run]},
+
+ {suites,n1@h1,TODir,[x_SUITE]}
],
{ok,SpecDir} = file:get_cwd(),
@@ -599,7 +592,9 @@ misc_config_terms(_Config) ->
{n2@h2,CSS2}],
create_priv_dir = [{Node,[auto_per_tc]},
{n1@h1,[manual_per_tc]},
- {n2@h2,[auto_per_run]}]
+ {n2@h2,[auto_per_run]}],
+ tests = [{{n1@h1,get_absdir(filename:join(SpecDir,TODir))},
+ [{x_SUITE,[all]}]}]
},
verify_result(Verify,ListResult,FileResult).
@@ -688,10 +683,10 @@ define_names_1(_Config) ->
%%% HELP FUNCTIONS
%%%-----------------------------------------------------------------
-verify_result(Verify,ListResult,FileResult) ->
+verify_result(VerificationRec,ListResult,FileResult) ->
{_,TSLTuples} = rec2proplist(ListResult),
{_,TSFTuples} = rec2proplist(FileResult),
- {_,VTuples} = rec2proplist(Verify),
+ {_,VTuples} = rec2proplist(VerificationRec),
VResult =
(catch lists:foldl(fun({Tag,Val},{[{Tag,Val}|TSL],[{Tag,Val}|TSF]}) ->
{TSL,TSF};
@@ -720,6 +715,8 @@ read_config(S) ->
rec2proplist(E={error,_What}) ->
exit({invalid_testspec_record,E});
+rec2proplist([{Specs,Rec}]) when is_list(Specs) ->
+ rec2proplist(Rec);
rec2proplist(Rec) ->
[RecName|RecList] = tuple_to_list(Rec),
FieldNames =
diff --git a/lib/common_test/test/ct_testspec_3_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE.erl
new file mode 100644
index 0000000000..e2f57c2c64
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE.erl
@@ -0,0 +1,745 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_testspec_1_SUITE
+%%%
+%%% Description:
+%%% Test test specifications
+%%%
+%%% The suites used for the test are located in the data directory.
+%%%-------------------------------------------------------------------
+-module(ct_testspec_3_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Config1 = ct_test_support:init_per_suite(Config),
+ SpecsDir1 = filename:join(DataDir, "specs1"),
+ SpecsDir2 = filename:join(DataDir, "specs2"),
+ [{specs_dir1,SpecsDir1},{specs_dir2,SpecsDir2} | Config1].
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [start_separate,
+ start_join,
+ incl_separate1,
+ incl_separate2,
+ incl_join1,
+ incl_join2,
+ incl_both1,
+ incl_both2,
+ incl_both_and_join1,
+ incl_both_and_join2,
+ rec_incl_separate1,
+ rec_incl_separate2,
+ rec_incl_join1,
+ rec_incl_join2,
+ rec_incl_separate_join1,
+ rec_incl_separate_join2,
+ rec_incl_join_separate1,
+ rec_incl_join_separate2
+ ].
+
+groups() ->
+ [].
+
+init_per_group(_GroupName, Config) ->
+ Config.
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+
+start_separate(Config) ->
+ Specs = [fname(specs_dir1, "flat_spec1", Config),
+ fname(specs_dir2, "flat_spec2", Config)],
+ setup_and_execute(start_separate, Specs, [], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+start_join(Config) ->
+ Specs = [fname(specs_dir1, "flat_spec1", Config),
+ fname(specs_dir2, "flat_spec2", Config)],
+ setup_and_execute(start_join, Specs, [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+incl_separate1(Config) ->
+ Specs = [fname(specs_dir1, "spec_sep1", Config),
+ fname(specs_dir2, "spec_sep2", Config)],
+ setup_and_execute(incl_separate1, Specs, [], Config).
+
+incl_separate2(Config) ->
+ Specs = [fname(specs_dir1, "spec_sep1", Config),
+ fname(specs_dir2, "spec_sep2", Config)],
+ setup_and_execute(incl_separate2, Specs, [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+incl_join1(Config) ->
+ Specs = [fname(specs_dir1, "spec_join1", Config),
+ fname(specs_dir2, "spec_join2", Config)],
+ setup_and_execute(incl_join1, Specs, [], Config).
+
+incl_join2(Config) ->
+ Specs = [fname(specs_dir1, "spec_join1", Config),
+ fname(specs_dir2, "spec_join2", Config)],
+ setup_and_execute(incl_join2, Specs, [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+incl_both1(Config) ->
+ Specs = [fname(specs_dir1, "spec_both1", Config),
+ fname(specs_dir2, "spec_both2", Config)],
+ setup_and_execute(incl_both1, Specs, [], Config).
+
+incl_both2(Config) ->
+ Specs = [fname(specs_dir1, "spec_both1", Config),
+ fname(specs_dir2, "spec_both2", Config)],
+ setup_and_execute(incl_both2, Specs, [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+incl_both_and_join1(Config) ->
+ Specs = [fname(specs_dir1, "spec_both_join1", Config),
+ fname(specs_dir2, "spec_both_join2", Config)],
+ setup_and_execute(incl_both_and_join1, Specs, [], Config).
+
+incl_both_and_join2(Config) ->
+ Specs = [fname(specs_dir1, "spec_both_join1", Config),
+ fname(specs_dir2, "spec_both_join2", Config)],
+ setup_and_execute(incl_both_and_join2, Specs, [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+rec_incl_separate1(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_sep1", Config),
+ fname(specs_dir2, "rec_spec_sep2", Config)],
+ setup_and_execute(rec_incl_separate1, Specs, [], Config).
+
+rec_incl_separate2(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_sep1", Config),
+ fname(specs_dir2, "rec_spec_sep2", Config)],
+ setup_and_execute(rec_incl_separate2, Specs, [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+rec_incl_join1(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_join1", Config),
+ fname(specs_dir2, "rec_spec_join2", Config)],
+ setup_and_execute(rec_incl_join1, Specs, [], Config).
+
+rec_incl_join2(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_join1", Config),
+ fname(specs_dir2, "rec_spec_join2", Config)],
+ setup_and_execute(rec_incl_join2, Specs, [{join_specs,true}], Config).
+
+
+%%%-----------------------------------------------------------------
+%%%
+
+rec_incl_separate_join1(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_sep_join1", Config),
+ fname(specs_dir2, "rec_spec_sep_join2", Config)],
+ setup_and_execute(rec_incl_separate_join1, Specs, [], Config).
+
+rec_incl_separate_join2(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_sep_join1", Config),
+ fname(specs_dir2, "rec_spec_sep_join2", Config)],
+ setup_and_execute(rec_incl_separate_join2, Specs,
+ [{join_specs,true}], Config).
+
+%%%-----------------------------------------------------------------
+%%%
+
+rec_incl_join_separate1(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_join_sep1", Config),
+ fname(specs_dir2, "rec_spec_join_sep2", Config)],
+ setup_and_execute(rec_incl_join_separate1, Specs, [], Config).
+
+rec_incl_join_separate2(Config) ->
+ Specs = [fname(specs_dir1, "rec_spec_join_sep1", Config),
+ fname(specs_dir2, "rec_spec_join_sep2", Config)],
+ setup_and_execute(rec_incl_join_separate2, Specs,
+ [{join_specs,true}], Config).
+
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+fname(Tag, File, Config) ->
+ filename:join(?config(Tag, Config), File).
+
+check_parameter(TCID) ->
+ {ok,{config,TCID}}.
+
+read_config(TCID) ->
+ {ok,[{tcname,list_to_atom(TCID)}]}.
+
+setup_and_execute(TCName, Specs, TestOpts, Config) ->
+
+ TestID = {userconfig,{?MODULE,atom_to_list(TCName)}},
+ TestTerms = [TestID,{spec,Specs},{label,TCName}] ++ TestOpts,
+
+ {Opts,ERPid} = setup(TestTerms, Config),
+
+ case ct_test_support:run(Opts, Config) of
+ ok ->
+ ok;
+ Error ->
+ ct:pal("Error executing with opts: ~p", [Opts]),
+ exit(Error)
+ end,
+
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(TCName,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(TCName),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config).
+
+setup(Test, Config) when is_tuple(Test) ->
+ setup([Test], Config);
+setup(Tests, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ Tests ++ [{event_handler,{?eh,EvHArgs}}],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+%reformat(Events, _EH) ->
+% Events.
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+events_to_check(Test) ->
+ %% 2 tests (ct:run_test + script_start) is default
+ events_to_check(Test, 2).
+
+events_to_check(_, 0) ->
+ [];
+events_to_check(Test, N) ->
+ test_events(Test) ++ events_to_check(Test, N-1).
+
+test_events(start_separate) ->
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(start_join) ->
+ [
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{4,4,20}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{4,8,{4,4}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_separate1) ->
+ [
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{1,1,5}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_separate2) ->
+ [
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{1,1,5}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_join1) ->
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{4,4,20}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{4,8,{4,4}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{4,4,20}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{4,8,{4,4}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_join2) ->
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{4,4,20}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{4,8,{4,4}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_both1) ->
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_both2) ->
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{4,4,20}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,ok_tc}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{4,8,{4,4}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{3,2,15}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t12_SUITE,init_per_suite}},
+ {?eh,tc_done,{t12_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t12_SUITE,end_per_suite}},
+ {?eh,tc_done,{t12_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t22_SUITE,init_per_suite}},
+ {?eh,tc_done,{t22_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{3,6,{3,3}}},
+ {?eh,tc_start,{t22_SUITE,end_per_suite}},
+ {?eh,tc_done,{t22_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]},
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{2,2,10}},
+ {?eh,tc_start,{t11_SUITE,init_per_suite}},
+ {?eh,tc_done,{t11_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{1,2,{1,1}}},
+ {?eh,tc_start,{t11_SUITE,end_per_suite}},
+ {?eh,tc_done,{t11_SUITE,end_per_suite,ok}},
+ {?eh,tc_start,{t21_SUITE,init_per_suite}},
+ {?eh,tc_done,{t21_SUITE,init_per_suite,ok}},
+ {?eh,test_stats,{2,4,{2,2}}},
+ {?eh,tc_start,{t21_SUITE,end_per_suite}},
+ {?eh,tc_done,{t21_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
+test_events(incl_both_and_join1) -> [];
+test_events(incl_both_and_join2) -> [];
+test_events(rec_incl_separate1) -> [];
+test_events(rec_incl_separate2) -> [];
+test_events(rec_incl_join1) -> [];
+test_events(rec_incl_join2) -> [];
+test_events(rec_incl_separate_join1) -> [];
+test_events(rec_incl_separate_join2) -> [];
+test_events(rec_incl_join_separate1) -> [];
+test_events(rec_incl_join_separate2) -> [];
+
+test_events(_) ->
+ [].
+
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg11 b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg11
new file mode 100644
index 0000000000..bc672568da
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg11
@@ -0,0 +1 @@
+{file, cfg11}. \ No newline at end of file
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg12 b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg12
new file mode 100644
index 0000000000..30f2cf6857
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg12
@@ -0,0 +1 @@
+{file, cfg12}. \ No newline at end of file
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg13 b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg13
new file mode 100644
index 0000000000..1860ec78e5
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg13
@@ -0,0 +1 @@
+{file, cfg13}. \ No newline at end of file
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg21 b/lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg21
new file mode 100644
index 0000000000..b18d35443e
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg21
@@ -0,0 +1 @@
+{file, cfg21}. \ No newline at end of file
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec1
new file mode 100644
index 0000000000..eff87222ea
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec1
@@ -0,0 +1,4 @@
+{config, "../config1/cfg11"}.
+{suites, "../tests1", t11_SUITE}.
+{suites, "../tests1", t11_SUITE}.
+{suites, "../tests2", t21_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join1
new file mode 100644
index 0000000000..a3387f48a3
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join1
@@ -0,0 +1,2 @@
+{specs,join,"spec_join1"}.
+{specs,join,"../specs2/spec_join2"}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep1
new file mode 100644
index 0000000000..fe127eb4b9
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep1
@@ -0,0 +1,5 @@
+{specs,join,"spec_sep1"}.
+{specs,join,"../specs2/spec_sep2"}.
+
+{config, "../config1/cfg13"}.
+{suites, "../tests2", t23_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep1
new file mode 100644
index 0000000000..c778aa68a6
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep1
@@ -0,0 +1,2 @@
+{specs,separate,"spec_sep1"}.
+{specs,separate,"../specs2/spec_sep2"}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join1
new file mode 100644
index 0000000000..7cb5a05fff
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join1
@@ -0,0 +1,2 @@
+{specs,separate,"spec_join1"}.
+{specs,separate,"../specs2/spec_join2"}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both1
new file mode 100644
index 0000000000..46111614dc
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both1
@@ -0,0 +1,2 @@
+{specs, join, "../specs1/flat_spec1"}.
+{specs, separate, "../specs2/flat_spec2"}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join1
new file mode 100644
index 0000000000..f52b3ed030
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join1
@@ -0,0 +1,6 @@
+{specs, join, "../specs1/flat_spec1"}.
+{specs, separate, "../specs2/flat_spec2"}.
+{merge_tests,false}.
+{config, "../config1/cfg12"}.
+{suites, "../tests1", t11_SUITE}.
+{suites, "../tests2", t21_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join1
new file mode 100644
index 0000000000..baaaf35be4
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join1
@@ -0,0 +1 @@
+{specs, join, ["../specs2/flat_spec2", "flat_spec1"]}. \ No newline at end of file
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep1
new file mode 100644
index 0000000000..89456c35e0
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep1
@@ -0,0 +1,3 @@
+{specs, separate, "../specs2/flat_spec2"}.
+{specs, separate, "flat_spec1"}.
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec2
new file mode 100644
index 0000000000..758d1e2514
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec2
@@ -0,0 +1,5 @@
+{merge_tests, false}.
+{config, "../config2/cfg21"}.
+{suites, "../tests1", t12_SUITE}.
+{suites, "../tests1", t12_SUITE}.
+{suites, "../tests2", t22_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join2
new file mode 100644
index 0000000000..19d3a3d8e2
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join2
@@ -0,0 +1,5 @@
+{specs,join,"spec_join2"}.
+{specs,join,"../specs1/spec_join1"}.
+
+{config, "../config1/cfg13"}.
+{suites, "../tests2", t23_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep2
new file mode 100644
index 0000000000..930e68c847
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep2
@@ -0,0 +1,5 @@
+{specs,join,"spec_sep2"}.
+{specs,join,"../specs1/spec_sep1"}.
+
+{config, "../config1/cfg13"}.
+{suites, "../tests2", t23_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep2
new file mode 100644
index 0000000000..5026f329a7
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep2
@@ -0,0 +1,5 @@
+{specs,separate,"spec_sep2"}.
+{specs,separate,"../specs1/spec_sep1"}.
+
+{config, "../config1/cfg13"}.
+{suites, "../tests2", t23_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join2
new file mode 100644
index 0000000000..17057088b4
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join2
@@ -0,0 +1,5 @@
+{specs,separate,"spec_join2"}.
+{specs,separate,"../specs1/spec_join1"}.
+
+{config, "../config1/cfg13"}.
+{suites, "../tests2", t23_SUITE}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both2
new file mode 100644
index 0000000000..4c83115d23
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both2
@@ -0,0 +1,4 @@
+{specs, separate, "../specs1/flat_spec1"}.
+{specs, join, "../specs2/flat_spec2"}.
+{config, "../config1/cfg12"}.
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join2
new file mode 100644
index 0000000000..ad81bfb4cc
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join2
@@ -0,0 +1,9 @@
+{merge_tests,true}.
+{config, "../config1/cfg12"}.
+{suites, "../tests1", t11_SUITE}.
+{suites, "../tests2", t21_SUITE}.
+{suites, "../tests1", t12_SUITE}.
+{suites, "../tests2", t22_SUITE}.
+
+{specs, separate, "../specs1/flat_spec1"}.
+{specs, join, "../specs2/flat_spec2"}.
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join2
new file mode 100644
index 0000000000..d652dbd78f
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join2
@@ -0,0 +1,5 @@
+{specs, join, ["../specs1/flat_spec1"]}.
+{specs, join, ["flat_spec2"]}.
+{config, "../config1/cfg12"}.
+{suites, "../tests2", t22_SUITE}.
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep2
new file mode 100644
index 0000000000..8d37f508b8
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep2
@@ -0,0 +1,5 @@
+{specs, separate, "../specs1/flat_spec1"}.
+{specs, separate, "flat_spec2"}.
+{config, "../config1/cfg12"}.
+{suites, "../tests2", t22_SUITE}.
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl
new file mode 100644
index 0000000000..bbe79ed3fe
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl
@@ -0,0 +1,175 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(t11_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{require,file},
+ {require,tcname},
+ {timetrap,{seconds,1}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ %% verify that expected config file can be read
+ case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of
+ {start_separate,[cfg11]} -> ok;
+ {start_join,[cfg11,cfg21]} -> ok;
+ {incl_separate1,[cfg11]} -> ok;
+ {incl_separate2,[cfg11]} -> ok;
+ {incl_join1,[cfg21,cfg11]} -> ok;
+ {incl_join1,[cfg12,cfg11,cfg21]} -> ok;
+ {incl_join2,[cfg21,cfg11,cfg12]} -> ok;
+ {incl_both1,[cfg11]} -> ok;
+ {incl_both2,[cfg11,cfg12,cfg21]} -> ok;
+ {incl_both2,[cfg11]} -> ok;
+ _ -> ok
+
+ end,
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(autoskip_tc, Config) ->
+ exit(kaboom),
+ Config;
+
+init_per_testcase(userskip_tc, Config) ->
+ {skip,"user skipped"};
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc].
+
+%%--------------------------------------------------------------------
+%% @spec TestCase(Config0) ->
+%% ok | exit() | {skip,Reason} | {comment,Comment} |
+%% {save_config,Config1} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% Comment = term()
+%% @end
+%%--------------------------------------------------------------------
+ok_tc(_) ->
+ ok.
+
+exit_tc(_) ->
+ exit(kaboom),
+ ok.
+
+to_tc(_) ->
+ ct:timetrap(1),
+ ct:sleep(100),
+ ok.
+
+autoskip_tc(_) ->
+ ok.
+
+userskip_tc(_) ->
+ ok.
+
+
+
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl
new file mode 100644
index 0000000000..810298d348
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl
@@ -0,0 +1,175 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(t12_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{require,file},
+ {require,tcname},
+ {timetrap,{seconds,30}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ %% verify that expected config file can be read
+ case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of
+ {start_separate,[cfg21]} -> ok;
+ {start_join,[cfg11,cfg21]} -> ok;
+ {incl_separate1,[cfg21]} -> ok;
+ {incl_separate2,[cfg21]} -> ok;
+ {incl_join1,[cfg21,cfg11]} -> ok;
+ {incl_join1,[cfg12,cfg11,cfg21]} -> ok;
+ {incl_join2,[cfg21,cfg11,cfg12]} -> ok;
+ {incl_both1,[cfg21]} -> ok;
+ {incl_both1,[cfg12,cfg21]} -> ok;
+ {incl_both2,[cfg11,cfg12,cfg21]} -> ok;
+ {incl_both2,[cfg21]} -> ok;
+ _ -> ok
+ end,
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(autoskip_tc, Config) ->
+ exit(kaboom),
+ Config;
+
+init_per_testcase(userskip_tc, Config) ->
+ {skip,"user skipped"};
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc].
+
+%%--------------------------------------------------------------------
+%% @spec TestCase(Config0) ->
+%% ok | exit() | {skip,Reason} | {comment,Comment} |
+%% {save_config,Config1} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% Comment = term()
+%% @end
+%%--------------------------------------------------------------------
+ok_tc(_) ->
+ ok.
+
+exit_tc(_) ->
+ exit(kaboom),
+ ok.
+
+to_tc(_) ->
+ ct:timetrap(1),
+ ct:sleep(100),
+ ok.
+
+autoskip_tc(_) ->
+ ok.
+
+userskip_tc(_) ->
+ ok.
+
+
+
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl
new file mode 100644
index 0000000000..9348cd8caf
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl
@@ -0,0 +1,174 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(t21_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{require,file},
+ {require,tcname},
+ {timetrap,{seconds,1}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ %% verify that expected config file can be read
+ case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of
+ {start_separate,[cfg11]} -> ok;
+ {start_join,[cfg11,cfg21]} -> ok;
+ {incl_separate1,[cfg11]} -> ok;
+ {incl_separate2,[cfg11]} -> ok;
+ {incl_join1,[cfg21,cfg11]} -> ok;
+ {incl_join1,[cfg12,cfg11,cfg21]} -> ok;
+ {incl_join2,[cfg21,cfg11,cfg12]} -> ok;
+ {incl_both1,[cfg11]} -> ok;
+ {incl_both2,[cfg11,cfg12,cfg21]} -> ok;
+ {incl_both2,[cfg11]} -> ok;
+ _ -> ok
+ end,
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(autoskip_tc, Config) ->
+ exit(kaboom),
+ Config;
+
+init_per_testcase(userskip_tc, Config) ->
+ {skip,"user skipped"};
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc].
+
+%%--------------------------------------------------------------------
+%% @spec TestCase(Config0) ->
+%% ok | exit() | {skip,Reason} | {comment,Comment} |
+%% {save_config,Config1} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% Comment = term()
+%% @end
+%%--------------------------------------------------------------------
+ok_tc(_) ->
+ ok.
+
+exit_tc(_) ->
+ exit(kaboom),
+ ok.
+
+to_tc(_) ->
+ ct:timetrap(1),
+ ct:sleep(100),
+ ok.
+
+autoskip_tc(_) ->
+ ok.
+
+userskip_tc(_) ->
+ ok.
+
+
+
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl
new file mode 100644
index 0000000000..a92018ec70
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl
@@ -0,0 +1,177 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(t22_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{require,file},
+ {require,tcname},
+ {timetrap,{seconds,30}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ %% verify that expected config file can be read
+ case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of
+ {start_separate,[cfg21]} -> ok;
+ {start_join,[cfg11,cfg21]} -> ok;
+ {incl_separate1,[cfg12]} -> ok;
+ {incl_separate1,[cfg21]} -> ok;
+ {incl_separate2,[cfg12]} -> ok;
+ {incl_separate2,[cfg21]} -> ok;
+ {incl_join1,[cfg21,cfg11]} -> ok;
+ {incl_join1,[cfg12,cfg11,cfg21]} -> ok;
+ {incl_join2,[cfg21,cfg11,cfg12]} -> ok;
+ {incl_both1,[cfg21]} -> ok;
+ {incl_both1,[cfg12,cfg21]} -> ok;
+ {incl_both2,[cfg11,cfg12,cfg21]} -> ok;
+ {incl_both2,[cfg21]} -> ok;
+ _ -> ok
+ end,
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(autoskip_tc, Config) ->
+ exit(kaboom),
+ Config;
+
+init_per_testcase(userskip_tc, Config) ->
+ {skip,"user skipped"};
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc].
+
+%%--------------------------------------------------------------------
+%% @spec TestCase(Config0) ->
+%% ok | exit() | {skip,Reason} | {comment,Comment} |
+%% {save_config,Config1} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% Comment = term()
+%% @end
+%%--------------------------------------------------------------------
+ok_tc(_) ->
+ ok.
+
+exit_tc(_) ->
+ exit(kaboom),
+ ok.
+
+to_tc(_) ->
+ ct:timetrap(1),
+ ct:sleep(100),
+ ok.
+
+autoskip_tc(_) ->
+ ok.
+
+userskip_tc(_) ->
+ ok.
+
+
+
+
diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl
new file mode 100644
index 0000000000..d01fac3144
--- /dev/null
+++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl
@@ -0,0 +1,158 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(t23_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{seconds,30}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(autoskip_tc, Config) ->
+ exit(kaboom),
+ Config;
+
+init_per_testcase(userskip_tc, Config) ->
+ {skip,"user skipped"};
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc].
+
+%%--------------------------------------------------------------------
+%% @spec TestCase(Config0) ->
+%% ok | exit() | {skip,Reason} | {comment,Comment} |
+%% {save_config,Config1} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% Comment = term()
+%% @end
+%%--------------------------------------------------------------------
+ok_tc(_) ->
+ ok.
+
+exit_tc(_) ->
+ exit(kaboom),
+ ok.
+
+to_tc(_) ->
+ ct:timetrap(1),
+ ct:sleep(100),
+ ok.
+
+autoskip_tc(_) ->
+ ok.
+
+userskip_tc(_) ->
+ ok.
+
+
+
+
diff --git a/lib/common_test/vsn.mk b/lib/common_test/vsn.mk
index f9bb22867e..c92fb2ca37 100644
--- a/lib/common_test/vsn.mk
+++ b/lib/common_test/vsn.mk
@@ -1 +1 @@
-COMMON_TEST_VSN = 1.6.3
+COMMON_TEST_VSN = 1.7