diff options
Diffstat (limited to 'lib/common_test')
109 files changed, 8613 insertions, 1859 deletions
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml index b6d4a633cb..151159ad69 100644 --- a/lib/common_test/doc/src/common_test_app.xml +++ b/lib/common_test/doc/src/common_test_app.xml @@ -4,7 +4,7 @@ <erlref> <header> <copyright> - <year>2003</year><year>2012</year> + <year>2003</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -170,7 +170,9 @@ <v> UserData = term()</v> <v> Conns = [atom()]</v> <v> CSSFile = string()</v> - <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v> + <v> CTHs = [CTHModule |</v> + <v> {CTHModule, CTHInitArgs} |</v> + <v> {CTHModule, CTHInitArgs, CTHPriority}]</v> <v> CTHModule = atom()</v> <v> CTHInitArgs = term()</v> </type> @@ -297,8 +299,9 @@ <v> UserData = term()</v> <v> Conns = [atom()]</v> <v> CSSFile = string()</v> - <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | - {CTHModule, CTHInitArgs, CTHPriority}]</v> + <v> CTHs = [CTHModule |</v> + <v> {CTHModule, CTHInitArgs} |</v> + <v> {CTHModule, CTHInitArgs, CTHPriority}]</v> <v> CTHModule = atom()</v> <v> CTHInitArgs = term()</v> </type> diff --git a/lib/common_test/doc/src/cover_chapter.xml b/lib/common_test/doc/src/cover_chapter.xml index 803a71de07..736486350b 100644 --- a/lib/common_test/doc/src/cover_chapter.xml +++ b/lib/common_test/doc/src/cover_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2006</year><year>2012</year> + <year>2006</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -74,12 +74,6 @@ executed during the test. In overview mode, only the code coverage overview page gets printed.</p> - <p><em>Note:</em> Currently, for Common Test to be able to print - code coverage HTML files for the modules included in the - analysis, the source code files of these modules must be - located in the same directory as the corresponding <c>.beam</c> - files. This is a limitation that will be removed later.</p> - <p>You can choose to export and import code coverage data between tests. If you specify the name of an export file in the cover specification file, Common Test will export collected coverage @@ -108,6 +102,33 @@ specifications</seealso>).</p> </section> + <marker id="cover_stop"></marker> + <section> + <title>Stopping the cover tool when tests are completed</title> + <p>By default the Cover tool is automatically stopped when the + tests are completed. This causes the original (non cover + compiled) modules to be loaded back in to the test node. If a + process at this point is still running old code of any of the + modules that are cover compiled, meaning that it has not done + any fully qualified function call after the cover compilation, + the process will now be killed. To avoid this it is possible to + set the value of the <c>cover_stop</c> option to + <c>false</c>. This means that the modules will stay cover + compiled, and it is therefore only recommended if the erlang + node(s) under test is terminated after the test is completed + or if cover can be manually stopped.</p> + + <p>The option can be set by using the <c>-cover_stop</c> flag with + <c>ct_run</c>, by adding <c>{cover_stop,true|false}</c> to the + Opts argument to <c><seealso + marker="ct#run_test-1">ct:run_test/1</seealso></c>, or by adding + a <c>cover_stop</c> term in your test specification (see chapter + about <seealso + marker="run_test_chapter#test_specifications">test + specifications</seealso>).</p> + + </section> + <section> <title>The cover specification file</title> <p>These are the terms allowed in a cover specification file:</p> @@ -148,6 +169,11 @@ %% Specific modules to exclude in cover. {excl_mods, Mods}. + + %% Cross cover compilation + %% Tag = atom(), an identifier for a test run + %% Mod = [atom()], modules to compile for accumulated analysis + {cross,[{Tag,Mods}]}. </pre> <p>The <c>incl_dirs_r</c> and <c>excl_dirs_r</c> terms tell Common @@ -163,6 +189,81 @@ specification file for Common Test).</p> </section> + <marker id="cross_cover"/> + <section> + <title>Cross cover analysis</title> + <p>The cross cover mechanism allows cover analysis of modules + across multiple tests. It is useful if some code, e.g. a library + module, is used by many different tests and the accumulated cover + result is desirable.</p> + + <p>This can of course also be achieved in a more customized way by + using the <c>export</c> parameter in the cover specification and + analysing the result off line, but the cross cover mechanism is a + build in solution which also provides the logging.</p> + + <p>The mechanism is easiest explained via an example:</p> + + <p>Let's say that there are two systems, <c>s1</c> and <c>s2</c>, + which are tested in separate test runs. System <c>s1</c> contains + a library module <c>m1</c> which is tested by the <c>s1</c> test + run and is included in <c>s1</c>'s cover specification:</p> + +<code type="none"> +s1.cover: + {incl_mods,[m1]}.</code> + + <p>When analysing code coverage, the result for <c>m1</c> can be + seen in the cover log in the <c>s1</c> test result.</p> + + <p>Now, let's imagine that since <c>m1</c> is a library module, it + is also used quite a bit by system <c>s2</c>. The <c>s2</c> test + run does not specifically test <c>m1</c>, but it might still be + interesting to see which parts of <c>m1</c> is actually covered by + the <c>s2</c> tests. To do this, <c>m1</c> could be included also + in <c>s2</c>'s cover specification:</p> + +<code type="none"> +s2.cover: + {incl_mods,[m1]}.</code> + + <p>This would give an entry for <c>m1</c> also in the cover log + for the <c>s2</c> test run. The problem is that this would only + reflect the coverage by <c>s2</c> tests, not the accumulated + result over <c>s1</c> and <c>s2</c>. And this is where the cross + cover mechanism comes in handy.</p> + + <p>If instead the cover specification for <c>s2</c> was like + this:</p> + +<code type="none"> +s2.cover: + {cross,[{s1,[m1]}]}.</code> + + <p>then <c>m1</c> would be cover compiled in the <c>s2</c> test + run, but not shown in the coverage log. Instead, if + <c>ct_cover:cross_cover_analyse/2</c> is called after both + <c>s1</c> and <c>s2</c> test runs are completed, the accumulated + result for <c>m1</c> would be available in the cross cover log for + the <c>s1</c> test run.</p> + + <p>The call to the analyse function must be like this:</p> + +<code type="none"> +ct_cover:cross_cover_analyse(Level, [{s1,S1LogDir},{s2,S2LogDir}]).</code> + + <p>where <c>S1LogDir</c> and <c>S2LogDir</c> are the directories + named <c><TestName>.logs</c> for each test respectively.</p> + + <p>Note the tags <c>s1</c> and <c>s2</c> which are used in the + cover specification file and in the call to + <c>ct_cover:cross_cover_analyse/2</c>. The point of these are only + to map the modules specified in the cover specification to the log + directory specified in the call to the analyse function. The name + of the tag has no meaning beyond this.</p> + + </section> + <section> <title>Logging</title> <p>To view the result of a code coverage test, follow the @@ -170,6 +271,11 @@ takes you to the code coverage overview page. If you have successfully performed a detailed coverage analysis, you find links to each individual module coverage page here.</p> + + <p>If cross cover analysis has been performed, and there are + accumulated coverage results for the current test, then the - + "Coverdata collected over all tests" link will take you to these + results.</p> </section> </chapter> diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml index 86237f5fc1..fe871eb516 100644 --- a/lib/common_test/doc/src/ct_hooks_chapter.xml +++ b/lib/common_test/doc/src/ct_hooks_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2011</year><year>2012</year> + <year>2011</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -439,14 +439,14 @@ terminate(State) -> <table> <row> - <cell><em>CTH Name</em></cell> - <cell><em>Is Built-in</em></cell> - <cell><em>Description</em></cell> + <cell align="left"><em>CTH Name</em></cell> + <cell align="left"><em>Is Built-in</em></cell> + <cell align="left"><em>Description</em></cell> </row> <row> - <cell>cth_log_redirect</cell> - <cell>yes</cell> - <cell>Captures all error_logger and SASL logging events and prints them + <cell align="left">cth_log_redirect</cell> + <cell align="left">yes</cell> + <cell align="left">Captures all error_logger and SASL logging events and prints them to the current test case log. If an event can not be associated with a testcase it will be printed in the common test framework log. This will happen for testcases which are run in parallel and events which occur @@ -455,14 +455,29 @@ terminate(State) -> using the normal SASL mechanisms. </cell> </row> <row> - <cell>cth_surefire</cell> - <cell>no</cell> - <cell>Captures all test results and outputs them as surefire XML into - a file. The file which is created is by default called junit_report.xml. - The name can be by setting the path option for this hook. e.g. + <cell align="left">cth_surefire</cell> + <cell align="left">no</cell> + <cell align="left"><p>Captures all test results and outputs them as surefire + XML into a file. The file which is created is by default + called junit_report.xml. The file name can be changed by + setting the <c>path</c> option for this hook, e.g.</p> + <code>-ct_hooks cth_surefire [{path,"/tmp/report.xml"}]</code> - Surefire XML can forinstance be used by Jenkins to display test - results.</cell> + + <p>If the <c>url_base</c> option is set, an additional + attribute named <c>url</c> will be added to each + <c>testsuite</c> and <c>testcase</c> XML element. The value will + be constructed from the <c>url_base</c> and a relative path + to the test suite or test case log respectively, e.g.</p> + + <code>-ct_hooks cth_surefire [{url_base, "http://myserver.com/"}]</code> + <p>will give a url attribute value similar to</p> + + <code>"http://myserver.com/[email protected]_11.19.39/ +x86_64-unknown-linux-gnu.my_test.logs/run.2012-12-12_11.19.39/suite.log.html"</code> + + <p>Surefire XML can for instance be used by Jenkins to display test + results.</p></cell> </row> </table> diff --git a/lib/common_test/doc/src/ct_run.xml b/lib/common_test/doc/src/ct_run.xml index c6749d6960..d871908952 100644 --- a/lib/common_test/doc/src/ct_run.xml +++ b/lib/common_test/doc/src/ct_run.xml @@ -4,7 +4,7 @@ <comref> <header> <copyright> - <year>2007</year><year>2012</year> + <year>2007</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -104,6 +104,7 @@ [-silent_connections [ConnType1 ConnType2 .. ConnTypeN]] [-stylesheet CSSFile] [-cover CoverCfgFile] + [-cover_stop Bool] [-event_handler EvHandler1 EvHandler2 .. EvHandlerN] | [-event_handler_init EvHandler1 InitArg1 and EvHandler2 InitArg2 and .. EvHandlerN InitArgN] @@ -125,6 +126,7 @@ <title>Run tests using test specification</title> <pre> ct_run -spec TestSpec1 TestSpec2 .. TestSpecN + [-join_specs] [-config ConfigFile1 ConfigFile2 .. ConfigFileN] [-userconfig CallbackModule1 ConfigString1 and CallbackModule2 ConfigString2 and .. and CallbackModuleN ConfigStringN] @@ -138,6 +140,7 @@ [-silent_connections [ConnType1 ConnType2 .. ConnTypeN]] [-stylesheet CSSFile] [-cover CoverCfgFile] + [-cover_stop Bool] [-event_handler EvHandler1 EvHandler2 .. EvHandlerN] | [-event_handler_init EvHandler1 InitArg1 and EvHandler2 InitArg2 and .. EvHandlerN InitArgN] diff --git a/lib/common_test/doc/src/notes.xml b/lib/common_test/doc/src/notes.xml index 7e33b71de1..5d2c065385 100644 --- a/lib/common_test/doc/src/notes.xml +++ b/lib/common_test/doc/src/notes.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2004</year><year>2012</year> + <year>2004</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -32,6 +32,345 @@ <file>notes.xml</file> </header> +<section><title>Common_Test 1.7.1</title> + + <section><title>Fixed Bugs and Malfunctions</title> + <list> + <item> + <p> + If an event handler installed in the CT Master event + manager took too long to respond during the termination + phase, CT Master crashed because of a timeout after 5 + secs. This would leave the system in a bad state. The + problem has been solved by means of a 30 min timeout + value and if CT Master gets a timeout after that time, it + now kills the event manager and shuts down properly.</p> + <p> + Own Id: OTP-10634 Aux Id: kunagi-347 [258] </p> + </item> + <item> + <p> + Printing with any of the ct printout functions from an + event handler installed by Common Test, would cause a + deadlock. This problem has been solved.</p> + <p> + Own Id: OTP-10826 Aux Id: seq12250 </p> + </item> + <item> + <p> + Using the force_stop flag/option to interrupt a test run + caused a crash in Common Test. This problem has been + solved.</p> + <p> + Own Id: OTP-10832</p> + </item> + </list> + </section> + + + <section><title>Improvements and New Features</title> + <list> + <item> + <p> + Removed depricated run_test program, use ct_run instead.</p> + <p> + *** POTENTIAL INCOMPATIBILITY ***</p> + <p> + Own Id: OTP-9052</p> + </item> + </list> + </section> + + + <section><title>Known Bugs and Problems</title> + <list> + <item> + <p> + Test case execution time increases with size of test run.</p> + <p> + Own Id: OTP-10855</p> + </item> + </list> + </section> + +</section> + +<section><title>Common_Test 1.7</title> + + <section><title>Fixed Bugs and Malfunctions</title> + <list> + <item> + <p> + Severe errors detected by <c>test_server</c> (e.g. if log + files directories cannot be created) will now be reported + to <c>common_test</c> and noted in the <c>common_test</c> + logs.</p> + <p> + Own Id: OTP-9769 Aux Id: kunagi-202 [113] </p> + </item> + <item> + <p> + The earlier undocumented cross cover feature for + accumulating cover data over multiple tests has now been + fixed and documented.</p> + <p> + Own Id: OTP-9870 Aux Id: kunagi-206 [117] </p> + </item> + <item> + <p> + If a busy test case generated lots of error messages, + cth_log_redirect:post_end_per_testcase would crash with a + timeout while waiting for the error logger to finish + handling all error reports. The default timer was 5 + seconds. This has now been extended to 5 minutes.</p> + <p> + Own Id: OTP-10040 Aux Id: kunagi-173 [84] </p> + </item> + <item> + <p>When a test case failed because of a timetrap time + out, the <c>Config</c> data for the case was lost in the + following call to <c>end_per_testcase/2</c>, and also in + calls to the CT Hook function + <c>post_end_per_testcase/4</c>. This problem has been + solved and the <c>Config</c> data is now correctly passed + to the above functions after a timetrap timeout + failure.</p> + <p> + Own Id: OTP-10070 Aux Id: kunagi-175 [86] </p> + </item> + <item> + <p> + Some calls to deprecated and removed functions in snmp + are removed from ct_snmp.</p> + <p> + Own Id: OTP-10088 Aux Id: kunagi-176 [87] </p> + </item> + <item> + <p>In test_server, the same process would supervise the + currently running test case and be group leader (and IO + server) for the test case. Furthermore, when running + parallel test cases, new temporary supervisor/group + leader processes were spawned and the process that was + group leader for sequential test cases would not be + active. That would lead to several problems:</p> + <p>* Processes started by init_per_suite will inherit the + group leader of the init_per_suite process (and that + group leader would not process IO requests when parallel + test cases was running). If later a parallel test case + caused such a processto print using (for example) + io:format/2, the calling would hang.</p> + <p>* Similarly, if a process was spawned from a parallel + test case, it would inherit the temporary group leader + for that parallel test case. If that spawned process + later - when the group of parallel tests have finished - + attempted to print something, its group leader would be + dead and there would be <c>badarg</c> exception.</p> + <p>Those problems have been solved by having group + leaders separate from the processes that supervises the + test cases, and keeping temporary group leader process + for parallel test cases alive until no more process in + the system use them as group leaders.</p> + <p>Also, a new <c>unexpected_io.log</c> log file + (reachable from the summary page of each test suite) has + been introduced. All unexpected IO will be printed into + it(for example, IO to a group leader for a parallel test + case that has finished).</p> + <p> + Own Id: OTP-10101 Aux Id: OTP-10125 </p> + </item> + <item> + <p> + Some bugfixes in <c>ct_snmp:</c></p> + <p> + <list> <item> ct_snmp will now use the value of the + 'agent_vsns' config variable when setting the 'variables' + parameter to snmp application agent configuration. + Earlier this had to be done separately - i.e. the + supported versions had to be specified twice. </item> + <item> Snmp application failed to write notify.conf since + ct_snmp gave the notify type as a string instead of an + atom. This has been corrected. </item> </list></p> + <p> + Own Id: OTP-10432</p> + </item> + <item> + <p> + Some bugfixes in <c>ct_snmp</c>:</p> + <p> + <list> <item> Functions <c>register_users/2</c>, + <c>register_agents/2</c> and <c>register_usm_users/2</c>, + and the corresponding <c>unregister_*/1</c> functions + were not executable. These are corrected/rewritten. + </item> <item> Function <c>update_usm_users/2</c> is + removed, and an unregister function is added instead. + Update can now be done with unregister_usm_users and then + register_usm_users. </item> <item> Functions + <c>unregister_*/2</c> are added, so specific + users/agents/usm users can be unregistered. </item> + <item> Function <c>unload_mibs/1</c> is added for + completeness. </item> <item> Overriding configuration + files did not work, since the files were written in + priv_dir instead of in the configuration dir + (priv_dir/conf). This has been corrected. </item> <item> + Arguments to <c>register_usm_users/2</c> were faulty + documented. This has been corrected. </item> </list></p> + <p> + Own Id: OTP-10434 Aux Id: kunagi-264 [175] </p> + </item> + <item> + <p> + Faulty exported specs in common test has been corrected + to <c>ct_netconfc:hook_options/0</c> and + <c>inet:hostname/0</c></p> + <p> + Own Id: OTP-10601</p> + </item> + <item> + <p> + The netconf client in common_test did not adjust the + window after receiving data. Due to this, the client + stopped receiving data after a while. This has been + corrected.</p> + <p> + Own Id: OTP-10646</p> + </item> + </list> + </section> + + + <section><title>Improvements and New Features</title> + <list> + <item> + <p>It is now possible to let a test specification include + other test specifications. Included specs can either be + joined with the source spec (and all other joined specs), + resulting in one single test run, or they can be executed + in separate test runs. Also, a start flag/option, + <c>join_specs</c>, has been introduced, to be used in + combination with the <c>spec</c> option. With + <c>join_specs</c>, Common Test can be told to either join + multiple test specifications, or run them separately. + Without <c>join_specs</c>, the latter behaviour is + default. Note that this is a change compared to earlier + versions of Common Test, where specifications could only + be joined. More information can be found in the Running + Tests chapter in the User's Guide (see the Test + Specifications section).</p> + <p> + *** POTENTIAL INCOMPATIBILITY ***</p> + <p> + Own Id: OTP-9881 Aux Id: kunagi-350 [261] </p> + </item> + <item> + <p> + The <c>ct_slave:start/3</c> function now supports an + <c>{env,[{Var,Value}]}</c> option to extend environment + for the slave node.</p> + <p> + Own Id: OTP-10469 Aux Id: kunagi-317 [228] </p> + </item> + <item> + <p> Some examples overflowing the width of PDF pages have + been corrected. </p> + <p> + Own Id: OTP-10665</p> + </item> + <item> + <p> + Update common test modules to handle unicode <list> + <item> Use UTF-8 encoding for all HTML files, except the + HTML version of the test suite generated with + erl2html2:convert, which will have the same encoding as + the original test suite (.erl) file. </item> <item> + Encode link targets in HTML files with + test_server_ctrl:uri_encode/1. </item> <item> Use unicode + modifier 't' with ~s when appropriate. </item> <item> Use + unicode:characters_to_list and + unicode:characters_to_binary for conversion between + binaries and strings instead of binary_to_list and + list_to_binary. </item> </list></p> + <p> + Own Id: OTP-10783</p> + </item> + </list> + </section> + + + <section><title>Known Bugs and Problems</title> + <list> + <item> + <p> + CT drops error reason when groups/0 crashes.</p> + <p> + Own Id: OTP-10631 Aux Id: kunagi-345 [256] </p> + </item> + <item> + <p> + Event handler on a ct_master node causes hanging.</p> + <p> + Own Id: OTP-10634 Aux Id: kunagi-347 [258] </p> + </item> + <item> + <p> + CT fails to open telnet conn after a timetrap timeout.</p> + <p> + Own Id: OTP-10648 Aux Id: seq12212 </p> + </item> + </list> + </section> + +</section> + +<section><title>Common_Test 1.6.3.1</title> + + <section><title>Known Bugs and Problems</title> + <list> + <item> + <p> + The following corrections/changes are done in the + cth_surefire hook:</p> + <p> + <list> <item> Earlier there would always be a + 'properties' element under the 'testsuites' element. This + would exist even if there were no 'property' element + inside it. This has been changed so if there are no + 'property' elements to display, then there will not be a + 'properties' element either. </item> <item> The XML file + will now (unless other is specified) be stored in the top + log directory. Earlier, the default directory would be + the current working directory for the erlang node, which + would mostly, but not always, be the top log directory. + </item> <item> The 'hostname' attribute in the + 'testsuite' element would earlier never have the correct + value. This has been corrected. </item> <item> The + 'errors' attribute in the 'testsuite' element would + earlier display the number of failed testcases. This has + been changed and will now always have the value 0, while + the 'failures' attribute will show the number of failed + testcases. </item> <item> A new attribute 'skipped' is + added to the 'testsuite' element. This will display the + number of skipped testcases. These would earlier be + included in the number of failed test cases. </item> + <item> The total number of tests displayed by the 'tests' + attribute in the 'testsuite' element would earlier + include init/end_per_suite and init/end_per_group. This + is no longer the case. The 'tests' attribute will now + only count "real" test cases. </item> <item> Earlier, + auto skipped test cases would have no value in the 'log' + attribute. This is now corrected. </item> <item> A new + attributes 'log' is added to the 'testsuite' element. + </item> <item> A new option named 'url_base' is added for + this hook. If this option is used, a new attribute named + 'url' will be added to the 'testcase' and 'testsuite' + elements. </item> </list></p> + <p> + Own Id: OTP-10589</p> + </item> + </list> + </section> + +</section> + <section><title>Common_Test 1.6.3</title> <section><title>Fixed Bugs and Malfunctions</title> diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml index a0b2c96006..35f89153d3 100644 --- a/lib/common_test/doc/src/run_test_chapter.xml +++ b/lib/common_test/doc/src/run_test_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2003</year><year>2012</year> + <year>2003</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -155,6 +155,8 @@ <item><c><![CDATA[-stylesheet <css_file>]]></c>, points out a user HTML style sheet (see below).</item> <item><c><![CDATA[-cover <cover_cfg_file>]]></c>, to perform code coverage test (see <seealso marker="cover_chapter#cover">Code Coverage Analysis</seealso>).</item> + <item><c><![CDATA[-cover_stop <bool>]]></c>, to specify if the cover tool shall be stopped after the test is completed (see + <seealso marker="cover_chapter#cover_stop">Code Coverage Analysis</seealso>).</item> <item><c><![CDATA[-event_handler <event_handlers>]]></c>, to install <seealso marker="event_handler_chapter#event_handling">event handlers</seealso>.</item> <item><c><![CDATA[-event_handler_init <event_handlers>]]></c>, to install @@ -528,369 +530,469 @@ <marker id="test_specifications"></marker> <section> <title>Test Specifications</title> - - <p>The most flexible way to specify what to test, is to use a so - called test specification. A test specification is a sequence of - Erlang terms. The terms are normally declared in a text file (see - <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c>), but - may also be passed to Common Test on the form of a list (see - <c><seealso marker="ct#run_testspec-1">ct:run_testspec/1</seealso></c>). - There are two general types of terms: configuration terms and test - specification terms.</p> - <p>With configuration terms it is possible to e.g. label the test - run (similar to <c>ct_run -label</c>), evaluate arbitrary expressions - before starting the test, import configuration data (similar to - <c>ct_run -config/-userconfig</c>), specify the top level HTML log - directory (similar to <c>ct_run -logdir</c>), enable code coverage - analysis (similar to <c>ct_run -cover</c>), install Common Test Hooks - (similar to <c>ct_run -ch_hooks</c>), install event_handler plugins - (similar to <c>ct_run -event_handler</c>), specify include directories - that should be passed to the compiler for automatic compilation - (similar to <c>ct_run -include</c>), disable the auto compilation - feature (similar to <c>ct_run -no_auto_compile</c>), set verbosity - levels (similar to <c>ct_run -verbosity</c>), and more.</p> - <p>Configuration terms can be combined with <c>ct_run</c> start flags, - or <c>ct:run_test/1</c> options. The result will for some flags/options - and terms be that the values are merged (e.g. configuration files, - include directories, verbosity levels, silent connections), and for - others that the start flags/options override the test specification - terms (e.g. log directory, label, style sheet, auto compilation).</p> - <p>With test specification terms it is possible to state exactly - which tests should run and in which order. A test term specifies - either one or more suites, one or more test case groups (possibly nested), - or one or more test cases in a group (or in multiple groups) or in a suite.</p> - <p>An arbitrary number of test terms may be declared in sequence. - Common Test will by default compile the terms into one or more tests - to be performed in one resulting test run. Note that a term that - specifies a set of test cases will "swallow" one that only - specifies a subset of these cases. E.g. the result of merging - one term that specifies that all cases in suite S should be - executed, with another term specifying only test case X and Y in - S, is a test of all cases in S. However, if a term specifying - test case X and Y in S is merged with a term specifying case Z - in S, the result is a test of X, Y and Z in S. To disable this - behaviour, i.e. to instead perform each test sequentially in a "script-like" - manner, the term <c>merge_tests</c> can be set to <c>false</c> in - the test specification.</p> - <p>A test term can also specify one or more test suites, groups, - or test cases to be skipped. Skipped suites, groups and cases - are not executed and show up in the HTML log files as - SKIPPED.</p> - <p>When a test case group is specified, the resulting test - executes the <c>init_per_group</c> function, followed by all test - cases and sub groups (including their configuration functions), and - finally the <c>end_per_group</c> function. Also if particular - test cases in a group are specified, <c>init_per_group</c> - and <c>end_per_group</c> for the group in question are - called. If a group which is defined (in <c>Suite:group/0</c>) to - be a sub group of another group, is specified (or if particular test - cases of a sub group are), Common Test will call the configuration - functions for the top level groups as well as for the sub group - in question (making it possible to pass configuration data all - the way from <c>init_per_suite</c> down to the test cases in the - sub group).</p> - <p>The test specification utilizes the same mechanism for specifying - test case groups by means of names and paths, as explained in the - <seealso marker="run_test_chapter#group_execution">Group Execution</seealso> - section above, with the addition of the <c>GroupSpec</c> element - described next.</p> - <p>The <c>GroupSpec</c> element makes it possible to specify - group execution properties that will override those in the - group definition (i.e. in <c>groups/0</c>). Execution properties for - sub-groups may be overridden as well. This feature makes it possible to - change properties of groups at the time of execution, - without even having to edit the test suite. The very same - feature is available for <c>group</c> elements in the <c>Suite:all/0</c> - list. Therefore, more detailed documentation, and examples, can be - found in the <seealso marker="write_test_chapter#test_case_groups"> - Test case groups</seealso> chapter.</p> - - <p>Below is the test specification syntax. Test specifications can - be used to run tests both in a single test host environment and - in a distributed Common Test environment (Large Scale - Testing). The node parameters in the <c>init</c> term are only - relevant in the latter (see the - <seealso marker="ct_master_chapter#test_specifications">Large - Scale Testing</seealso> chapter for information). For more information - about the various terms, please see the corresponding sections in the - User's Guide, such as e.g. the - <seealso marker="run_test_chapter#ct_run"><c>ct_run</c> - program</seealso> for an overview of available start flags - (since most flags have a corresponding configuration term), and - more detailed explanation of e.g. - <seealso marker="write_test_chapter#logging">Logging</seealso> - (for the <c>verbosity</c>, <c>stylesheet</c> and <c>basic_html</c> terms), - <seealso marker="config_file_chapter#top">External Configuration Data</seealso> - (for the <c>config</c> and <c>userconfig</c> terms), - <seealso marker="event_handler_chapter#event_handling">Event - Handling</seealso> (for the <c>event_handler</c> term), - <seealso marker="ct_hooks_chapter#installing">Common Test Hooks</seealso> - (for the <c>ct_hooks</c> term), etc.</p> - <p>Config terms:</p> - <pre> - {merge_tests, Bool}. - - {define, Constant, Value}. - - {node, NodeAlias, Node}. - - {init, InitOptions}. - {init, [NodeAlias], InitOptions}. - - {label, Label}. - {label, NodeRefs, Label}. - - {verbosity, VerbosityLevels}. - {verbosity, NodeRefs, VerbosityLevels}. - - {stylesheet, CSSFile}. - {stylesheet, NodeRefs, CSSFile}. - - {silent_connections, ConnTypes}. - {silent_connections, NodeRefs, ConnTypes}. - - {multiply_timetraps, N}. - {multiply_timetraps, NodeRefs, N}. - - {scale_timetraps, Bool}. - {scale_timetraps, NodeRefs, Bool}. - - {cover, CoverSpecFile}. - {cover, NodeRefs, CoverSpecFile}. - - {include, IncludeDirs}. - {include, NodeRefs, IncludeDirs}. - - {auto_compile, Bool}, - {auto_compile, NodeRefs, Bool}, - - {config, ConfigFiles}. - {config, ConfigDir, ConfigBaseNames}. - {config, NodeRefs, ConfigFiles}. - {config, NodeRefs, ConfigDir, ConfigBaseNames}. - - {userconfig, {CallbackModule, ConfigStrings}}. - {userconfig, NodeRefs, {CallbackModule, ConfigStrings}}. - - {logdir, LogDir}. - {logdir, NodeRefs, LogDir}. - - {logopts, LogOpts}. - {logopts, NodeRefs, LogOpts}. - - {create_priv_dir, PrivDirOption}. - {create_priv_dir, NodeRefs, PrivDirOption}. - - {event_handler, EventHandlers}. - {event_handler, NodeRefs, EventHandlers}. - {event_handler, EventHandlers, InitArgs}. - {event_handler, NodeRefs, EventHandlers, InitArgs}. - - {ct_hooks, CTHModules}. - {ct_hooks, NodeRefs, CTHModules}. - - {enable_builtin_hooks, Bool}. - - {basic_html, Bool}. - {basic_html, NodeRefs, Bool}. + <section> + <title>General description</title> + <p>The most flexible way to specify what to test, is to use a so + called test specification. A test specification is a sequence of + Erlang terms. The terms are normally declared in one or more text files + (see <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c>), but + may also be passed to Common Test on the form of a list (see + <c><seealso marker="ct#run_testspec-1">ct:run_testspec/1</seealso></c>). + There are two general types of terms: configuration terms and test + specification terms.</p> + <p>With configuration terms it is possible to e.g. label the test + run (similar to <c>ct_run -label</c>), evaluate arbitrary expressions + before starting the test, import configuration data (similar to + <c>ct_run -config/-userconfig</c>), specify the top level HTML log + directory (similar to <c>ct_run -logdir</c>), enable code coverage + analysis (similar to <c>ct_run -cover</c>), install Common Test Hooks + (similar to <c>ct_run -ch_hooks</c>), install event_handler plugins + (similar to <c>ct_run -event_handler</c>), specify include directories + that should be passed to the compiler for automatic compilation + (similar to <c>ct_run -include</c>), disable the auto compilation + feature (similar to <c>ct_run -no_auto_compile</c>), set verbosity + levels (similar to <c>ct_run -verbosity</c>), and more.</p> + <p>Configuration terms can be combined with <c>ct_run</c> start flags, + or <c>ct:run_test/1</c> options. The result will for some flags/options + and terms be that the values are merged (e.g. configuration files, + include directories, verbosity levels, silent connections), and for + others that the start flags/options override the test specification + terms (e.g. log directory, label, style sheet, auto compilation).</p> + <p>With test specification terms it is possible to state exactly + which tests should run and in which order. A test term specifies + either one or more suites, one or more test case groups (possibly nested), + or one or more test cases in a group (or in multiple groups) or in a suite.</p> + <p>An arbitrary number of test terms may be declared in sequence. + Common Test will by default compile the terms into one or more tests + to be performed in one resulting test run. Note that a term that + specifies a set of test cases will "swallow" one that only + specifies a subset of these cases. E.g. the result of merging + one term that specifies that all cases in suite S should be + executed, with another term specifying only test case X and Y in + S, is a test of all cases in S. However, if a term specifying + test case X and Y in S is merged with a term specifying case Z + in S, the result is a test of X, Y and Z in S. To disable this + behaviour, i.e. to instead perform each test sequentially in a "script-like" + manner, the term <c>merge_tests</c> can be set to <c>false</c> in + the test specification.</p> + <p>A test term can also specify one or more test suites, groups, + or test cases to be skipped. Skipped suites, groups and cases + are not executed and show up in the HTML log files as + SKIPPED.</p> + </section> + <section> + <title>Using multiple test specification files</title> + + <p>When multiple test specification files are given at startup (either + with <c>ct_run -spec file1 file2 ...</c> or + <c>ct:run_test([{spec, [File1,File2,...]}])</c>), + Common Test will either execute one test run per specification file, or + join the files and perform all tests within one single test run. The first + behaviour is the default one. The latter requires that the start + flag/option <c>join_suites</c> is provided, e.g. + <c>run_test -spec ./my_tests1.ts ./my_tests2.ts -join_suites</c>.</p> + + <p>Joining a number of specifications, or running them separately, can + also be accomplished with (and may be combined with) test specification + file inclusion, described next.</p> + </section> + <section> + <title>Test specification file inclusion</title> + <p>With the <c>specs</c> term (see syntax below), it's possible to have + a test specification include other specifications. An included + specification may either be joined with the source specification, + or used to produce a separate test run (like with the <c>join_specs</c> + start flag/option above). Example:</p> + <pre> + %% In specification file "a.spec" + {specs, join, ["b.spec", "c.spec"]}. + {specs, separate, ["d.spec", "e.spec"]}. + %% Config and test terms follow + ...</pre> + <p>In this example, the test terms defined in files "b.spec" and "c.spec" + will be joined with the terms in the source specification "a.spec" + (if any). The inclusion of specifications "d.spec" and + "e.spec" will result in two separate, and independent, test runs (i.e. + one for each included specification).</p> + <p>Note that the <c>join</c> option does not imply that the test terms + will be merged (see <c>merge_tests</c> above), only that all tests are + executed in one single test run.</p> + <p>Joined specifications share common configuration settings, such as + the list of <c>config</c> files or <c>include</c> directories. + For configuration that can not be combined, such as settings for <c>logdir</c> + or <c>verbosity</c>, it is up to the user to ensure there are no clashes + when the test specifications are joined. Specifications included with + the <c>separate</c> option, do not share configuration settings with the + source specification. This is useful e.g. if there are clashing + configuration settings in included specifications, making it impossible + to join them.</p> + <p>If <c>{merge_tests,true}</c> is set in the source specification + (which is the default setting), terms in joined specifications will be + merged with terms in the source specification (according to the + description of <c>merge_tests</c> above).</p> + <p>Note that it is always the <c>merge_tests</c> setting in the source + specification that is used when joined with other specifications. + Say e.g. that a source specification A, with tests TA1 and TA2, has + <c>{merge_tests,false}</c> set, and it includes another specification, + B, with tests TB1 and TB2, that has <c>{merge_tests,true}</c> set. + The result will be that the test series: <c>TA1,TA2,merge(TB1,TB2)</c>, + is executed. The opposite <c>merge_tests</c> settings would result in the + following the test series: <c>merge(merge(TA1,TA2),TB1,TB2)</c>.</p> + <p>The <c>specs</c> term may of course be used to nest specifications, + i.e. have one specification include other specifications, which in turn + include others, etc.</p> + </section> + <section> + <title>Test case groups</title> + + <p>When a test case group is specified, the resulting test + executes the <c>init_per_group</c> function, followed by all test + cases and sub groups (including their configuration functions), and + finally the <c>end_per_group</c> function. Also if particular + test cases in a group are specified, <c>init_per_group</c> + and <c>end_per_group</c> for the group in question are + called. If a group which is defined (in <c>Suite:group/0</c>) to + be a sub group of another group, is specified (or if particular test + cases of a sub group are), Common Test will call the configuration + functions for the top level groups as well as for the sub group + in question (making it possible to pass configuration data all + the way from <c>init_per_suite</c> down to the test cases in the + sub group).</p> + <p>The test specification utilizes the same mechanism for specifying + test case groups by means of names and paths, as explained in the + <seealso marker="run_test_chapter#group_execution">Group Execution</seealso> + section above, with the addition of the <c>GroupSpec</c> element + described next.</p> + <p>The <c>GroupSpec</c> element makes it possible to specify + group execution properties that will override those in the + group definition (i.e. in <c>groups/0</c>). Execution properties for + sub-groups may be overridden as well. This feature makes it possible to + change properties of groups at the time of execution, + without even having to edit the test suite. The very same + feature is available for <c>group</c> elements in the <c>Suite:all/0</c> + list. Therefore, more detailed documentation, and examples, can be + found in the <seealso marker="write_test_chapter#test_case_groups"> + Test case groups</seealso> chapter.</p> + </section> - {release_shell, Bool}.</pre> + <section> + <title>Test specification syntax</title> + + <p>Below is the test specification syntax. Test specifications can + be used to run tests both in a single test host environment and + in a distributed Common Test environment (Large Scale + Testing). The node parameters in the <c>init</c> term are only + relevant in the latter (see the + <seealso marker="ct_master_chapter#test_specifications">Large + Scale Testing</seealso> chapter for information). For more information + about the various terms, please see the corresponding sections in the + User's Guide, such as e.g. the + <seealso marker="run_test_chapter#ct_run"><c>ct_run</c> + program</seealso> for an overview of available start flags + (since most flags have a corresponding configuration term), and + more detailed explanation of e.g. + <seealso marker="write_test_chapter#logging">Logging</seealso> + (for the <c>verbosity</c>, <c>stylesheet</c> and <c>basic_html</c> terms), + <seealso marker="config_file_chapter#top">External Configuration Data</seealso> + (for the <c>config</c> and <c>userconfig</c> terms), + <seealso marker="event_handler_chapter#event_handling">Event + Handling</seealso> (for the <c>event_handler</c> term), + <seealso marker="ct_hooks_chapter#installing">Common Test Hooks</seealso> + (for the <c>ct_hooks</c> term), etc.</p> + </section> + <p>Config terms:</p> + <pre> + {merge_tests, Bool}. + + {define, Constant, Value}. + + {specs, InclSpecsOption, TestSpecs}. + + {node, NodeAlias, Node}. + + {init, InitOptions}. + {init, [NodeAlias], InitOptions}. + + {label, Label}. + {label, NodeRefs, Label}. + + {verbosity, VerbosityLevels}. + {verbosity, NodeRefs, VerbosityLevels}. + + {stylesheet, CSSFile}. + {stylesheet, NodeRefs, CSSFile}. + + {silent_connections, ConnTypes}. + {silent_connections, NodeRefs, ConnTypes}. + + {multiply_timetraps, N}. + {multiply_timetraps, NodeRefs, N}. + + {scale_timetraps, Bool}. + {scale_timetraps, NodeRefs, Bool}. + + {cover, CoverSpecFile}. + {cover, NodeRefs, CoverSpecFile}. + + {cover_stop, Bool}. + {cover_stop, NodeRefs, Bool}. + + {include, IncludeDirs}. + {include, NodeRefs, IncludeDirs}. + + {auto_compile, Bool}, + {auto_compile, NodeRefs, Bool}, + + {config, ConfigFiles}. + {config, ConfigDir, ConfigBaseNames}. + {config, NodeRefs, ConfigFiles}. + {config, NodeRefs, ConfigDir, ConfigBaseNames}. + + {userconfig, {CallbackModule, ConfigStrings}}. + {userconfig, NodeRefs, {CallbackModule, ConfigStrings}}. + + {logdir, LogDir}. + {logdir, NodeRefs, LogDir}. + + {logopts, LogOpts}. + {logopts, NodeRefs, LogOpts}. + + {create_priv_dir, PrivDirOption}. + {create_priv_dir, NodeRefs, PrivDirOption}. + + {event_handler, EventHandlers}. + {event_handler, NodeRefs, EventHandlers}. + {event_handler, EventHandlers, InitArgs}. + {event_handler, NodeRefs, EventHandlers, InitArgs}. + + {ct_hooks, CTHModules}. + {ct_hooks, NodeRefs, CTHModules}. + + {enable_builtin_hooks, Bool}. + + {basic_html, Bool}. + {basic_html, NodeRefs, Bool}. + + {release_shell, Bool}.</pre> + <p>Test terms:</p> - <pre> - {suites, Dir, Suites}. - {suites, NodeRefs, Dir, Suites}. - - {groups, Dir, Suite, Groups}. - {groups, NodeRefs, Dir, Suite, Groups}. - - {groups, Dir, Suite, Groups, {cases,Cases}}. - {groups, NodeRefs, Dir, Suite, Groups, {cases,Cases}}. - - {cases, Dir, Suite, Cases}. - {cases, NodeRefs, Dir, Suite, Cases}. - - {skip_suites, Dir, Suites, Comment}. - {skip_suites, NodeRefs, Dir, Suites, Comment}. - - {skip_groups, Dir, Suite, GroupNames, Comment}. - {skip_groups, NodeRefs, Dir, Suite, GroupNames, Comment}. - - {skip_cases, Dir, Suite, Cases, Comment}. - {skip_cases, NodeRefs, Dir, Suite, Cases, Comment}.</pre> - + <pre> + {suites, Dir, Suites}. + {suites, NodeRefs, Dir, Suites}. + + {groups, Dir, Suite, Groups}. + {groups, NodeRefs, Dir, Suite, Groups}. + + {groups, Dir, Suite, Groups, {cases,Cases}}. + {groups, NodeRefs, Dir, Suite, Groups, {cases,Cases}}. + + {cases, Dir, Suite, Cases}. + {cases, NodeRefs, Dir, Suite, Cases}. + + {skip_suites, Dir, Suites, Comment}. + {skip_suites, NodeRefs, Dir, Suites, Comment}. + + {skip_groups, Dir, Suite, GroupNames, Comment}. + {skip_groups, NodeRefs, Dir, Suite, GroupNames, Comment}. + + {skip_cases, Dir, Suite, Cases, Comment}. + {skip_cases, NodeRefs, Dir, Suite, Cases, Comment}.</pre> + <p>Types:</p> - <pre> - Bool = true | false - Constant = atom() - Value = term() - NodeAlias = atom() - Node = node() - NodeRef = NodeAlias | Node | master - NodeRefs = all_nodes | [NodeRef] | NodeRef - InitOptions = term() - Label = atom() | string() - VerbosityLevels = integer() | [{Category,integer()}] - Category = atom() - CSSFile = string() - ConnTypes = all | [atom()] - N = integer() - CoverSpecFile = string() - IncludeDirs = string() | [string()] - ConfigFiles = string() | [string()] - ConfigDir = string() - ConfigBaseNames = string() | [string()] - CallbackModule = atom() - ConfigStrings = string() | [string()] - LogDir = string() - LogOpts = [term()] - PrivDirOption = auto_per_run | auto_per_tc | manual_per_tc - EventHandlers = atom() | [atom()] - InitArgs = [term()] - CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}] - CTHModule = atom() - CTHInitArgs = term() - Dir = string() - Suites = atom() | [atom()] | all - Suite = atom() - Groups = GroupPath | [GroupPath] | GroupSpec | [GroupSpec] | all - GroupPath = [GroupName] - GroupSpec = GroupName | {GroupName,Properties} | {GroupName,Properties,GroupSpec} - GroupName = atom() - GroupNames = GroupName | [GroupName] - Cases = atom() | [atom()] | all - Comment = string() | ""</pre> - - <p>The difference between the <c>config</c> terms above, is that with - <c>ConfigDir</c>, <c>ConfigBaseNames</c> is a list of base names, - i.e. without directory paths. <c>ConfigFiles</c> must be full names, - including paths. E.g, these two terms have the same meaning:</p> - <pre> - {config, ["/home/testuser/tests/config/nodeA.cfg", - "/home/testuser/tests/config/nodeB.cfg"]}. - - {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}.</pre> - - <note><p>Any relative paths specified in the test specification, will be - relative to the directory which contains the test specification file, if - <c>ct_run -spec TestSpecFile ...</c> or - <c>ct:run:test([{spec,TestSpecFile},...])</c> - executes the test. The path will be relative to the top level log directory, if - <c>ct:run:testspec(TestSpec)</c> executes the test.</p></note> - - <p>The <c>define</c> term introduces a constant, which is used to - replace the name <c>Constant</c> with <c>Value</c>, wherever it's found in - the test specification. This replacement happens during an initial iteration - through the test specification. Constants may be used anywhere in the test - specification, e.g. in arbitrary lists and tuples, and even in strings - and inside the value part of other constant definitions! A constant can - also be part of a node name, but that is the only place where a constant - can be part of an atom.</p> - - <note><p>For the sake of readability, the name of the constant must always - begin with an upper case letter, or a <c>$</c>, <c>?</c>, or <c>_</c>. - This also means that it must always be single quoted (obviously, since - the constant name is actually an atom, not text).</p></note> - - <p>The main benefit of constants is that they can be used to reduce the size - (and avoid repetition) of long strings, such as file paths. Compare these - terms:</p> - - <pre> - %% 1a. no constant - {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}. - {suites, "/home/testuser/tests/suites", all}. - - %% 1b. with constant - {define, 'TESTDIR', "/home/testuser/tests"}. - {config, "'TESTDIR'/config", ["nodeA.cfg","nodeB.cfg"]}. - {suites, "'TESTDIR'/suites", all}. - - %% 2a. no constants - {config, [testnode@host1, testnode@host2], "../config", ["nodeA.cfg","nodeB.cfg"]}. - {suites, [testnode@host1, testnode@host2], "../suites", [x_SUITE, y_SUITE]}. - - %% 2b. with constants - {define, 'NODE', testnode}. - {define, 'NODES', ['NODE'@host1, 'NODE'@host2]}. - {config, 'NODES', "../config", ["nodeA.cfg","nodeB.cfg"]}. - {suites, 'NODES', "../suites", [x_SUITE, y_SUITE]}.</pre> - - <p>Constants make the test specification term <c>alias</c>, in previous - versions of Common Test, redundant. This term has been deprecated but will - remain supported in upcoming Common Test releases. Replacing <c>alias</c> - terms with <c>define</c> is strongly recommended though! Here's an example - of such a replacement:</p> + <pre> + Bool = true | false + Constant = atom() + Value = term() + InclSpecsOption = join | separate + TestSpecs = string() | [string()] + NodeAlias = atom() + Node = node() + NodeRef = NodeAlias | Node | master + NodeRefs = all_nodes | [NodeRef] | NodeRef + InitOptions = term() + Label = atom() | string() + VerbosityLevels = integer() | [{Category,integer()}] + Category = atom() + CSSFile = string() + ConnTypes = all | [atom()] + N = integer() + CoverSpecFile = string() + IncludeDirs = string() | [string()] + ConfigFiles = string() | [string()] + ConfigDir = string() + ConfigBaseNames = string() | [string()] + CallbackModule = atom() + ConfigStrings = string() | [string()] + LogDir = string() + LogOpts = [term()] + PrivDirOption = auto_per_run | auto_per_tc | manual_per_tc + EventHandlers = atom() | [atom()] + InitArgs = [term()] + CTHModules = [CTHModule | + {CTHModule, CTHInitArgs} | + {CTHModule, CTHInitArgs, CTHPriority}] + CTHModule = atom() + CTHInitArgs = term() + Dir = string() + Suites = atom() | [atom()] | all + Suite = atom() + Groups = GroupPath | [GroupPath] | GroupSpec | [GroupSpec] | all + GroupPath = [GroupName] + GroupSpec = GroupName | {GroupName,Properties} | {GroupName,Properties,GroupSpec} + GroupName = atom() + GroupNames = GroupName | [GroupName] + Cases = atom() | [atom()] | all + Comment = string() | ""</pre> + + <section> + <p>The difference between the <c>config</c> terms above, is that with + <c>ConfigDir</c>, <c>ConfigBaseNames</c> is a list of base names, + i.e. without directory paths. <c>ConfigFiles</c> must be full names, + including paths. E.g, these two terms have the same meaning:</p> + <pre> + {config, ["/home/testuser/tests/config/nodeA.cfg", + "/home/testuser/tests/config/nodeB.cfg"]}. + + {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}.</pre> + + <note><p>Any relative paths specified in the test specification, will be + relative to the directory which contains the test specification file, if + <c>ct_run -spec TestSpecFile ...</c> or + <c>ct:run:test([{spec,TestSpecFile},...])</c> + executes the test. The path will be relative to the top level log directory, if + <c>ct:run:testspec(TestSpec)</c> executes the test.</p></note> + </section> - <pre> - %% using the old alias term - {config, "/home/testuser/tests/config/nodeA.cfg"}. - {alias, suite_dir, "/home/testuser/tests/suites"}. - {groups, suite_dir, x_SUITE, group1}. - - %% replacing with constants - {define, 'TestDir', "/home/testuser/tests"}. - {define, 'CfgDir', "'TestDir'/config"}. - {define, 'SuiteDir', "'TestDir'/suites"}. - {config, 'CfgDir', "nodeA.cfg"}. - {groups, 'SuiteDir', x_SUITE, group1}.</pre> - - <p>Actually, constants could well replace the <c>node</c> term too, but - this still has declarative value, mainly when used in combination - with <c>NodeRefs == all_nodes</c> (see types above).</p> - - <p>Here follows a simple test specification example:</p> - <pre> - {define, 'Top', "/home/test"}. - {define, 'T1', "'Top'/t1"}. - {define, 'T2', "'Top'/t2"}. - {define, 'T3', "'Top'/t3"}. - {define, 'CfgFile', "config.cfg"}. + <section> + <title>Constants</title> + + <p>The <c>define</c> term introduces a constant, which is used to + replace the name <c>Constant</c> with <c>Value</c>, wherever it's found in + the test specification. This replacement happens during an initial iteration + through the test specification. Constants may be used anywhere in the test + specification, e.g. in arbitrary lists and tuples, and even in strings + and inside the value part of other constant definitions! A constant can + also be part of a node name, but that is the only place where a constant + can be part of an atom.</p> + + <note><p>For the sake of readability, the name of the constant must always + begin with an upper case letter, or a <c>$</c>, <c>?</c>, or <c>_</c>. + This also means that it must always be single quoted (obviously, since + the constant name is actually an atom, not text).</p></note> + + <p>The main benefit of constants is that they can be used to reduce the size + (and avoid repetition) of long strings, such as file paths. Compare these + terms:</p> + + <pre> + %% 1a. no constant + {config, "/home/testuser/tests/config", ["nodeA.cfg","nodeB.cfg"]}. + {suites, "/home/testuser/tests/suites", all}. + + %% 1b. with constant + {define, 'TESTDIR', "/home/testuser/tests"}. + {config, "'TESTDIR'/config", ["nodeA.cfg","nodeB.cfg"]}. + {suites, "'TESTDIR'/suites", all}. + + %% 2a. no constants + {config, [testnode@host1, testnode@host2], "../config", ["nodeA.cfg","nodeB.cfg"]}. + {suites, [testnode@host1, testnode@host2], "../suites", [x_SUITE, y_SUITE]}. + + %% 2b. with constants + {define, 'NODE', testnode}. + {define, 'NODES', ['NODE'@host1, 'NODE'@host2]}. + {config, 'NODES', "../config", ["nodeA.cfg","nodeB.cfg"]}. + {suites, 'NODES', "../suites", [x_SUITE, y_SUITE]}.</pre> + + <p>Constants make the test specification term <c>alias</c>, in previous + versions of Common Test, redundant. This term has been deprecated but will + remain supported in upcoming Common Test releases. Replacing <c>alias</c> + terms with <c>define</c> is strongly recommended though! Here's an example + of such a replacement:</p> + + <pre> + %% using the old alias term + {config, "/home/testuser/tests/config/nodeA.cfg"}. + {alias, suite_dir, "/home/testuser/tests/suites"}. + {groups, suite_dir, x_SUITE, group1}. + + %% replacing with constants + {define, 'TestDir', "/home/testuser/tests"}. + {define, 'CfgDir', "'TestDir'/config"}. + {define, 'SuiteDir', "'TestDir'/suites"}. + {config, 'CfgDir', "nodeA.cfg"}. + {groups, 'SuiteDir', x_SUITE, group1}.</pre> + + <p>Actually, constants could well replace the <c>node</c> term too, but + this still has declarative value, mainly when used in combination + with <c>NodeRefs == all_nodes</c> (see types above).</p> + </section> - {logdir, "'Top'/logs"}. - - {config, ["'T1'/'CfgFile'", "'T2'/'CfgFile'", "'T3'/'CfgFile'"]}. - - {suites, 'T1', all}. - {skip_suites, 'T1', [t1B_SUITE,t1D_SUITE], "Not implemented"}. - {skip_cases, 'T1', t1A_SUITE, [test3,test4], "Irrelevant"}. - {skip_cases, 'T1', t1C_SUITE, [test1], "Ignore"}. - - {suites, 'T2', [t2B_SUITE,t2C_SUITE]}. - {cases, 'T2', t2A_SUITE, [test4,test1,test7]}. - - {skip_suites, 'T3', all, "Not implemented"}.</pre> + <section> + <title>Example</title> + + <p>Here follows a simple test specification example:</p> + <pre> + {define, 'Top', "/home/test"}. + {define, 'T1', "'Top'/t1"}. + {define, 'T2', "'Top'/t2"}. + {define, 'T3', "'Top'/t3"}. + {define, 'CfgFile', "config.cfg"}. + + {logdir, "'Top'/logs"}. + + {config, ["'T1'/'CfgFile'", "'T2'/'CfgFile'", "'T3'/'CfgFile'"]}. + + {suites, 'T1', all}. + {skip_suites, 'T1', [t1B_SUITE,t1D_SUITE], "Not implemented"}. + {skip_cases, 'T1', t1A_SUITE, [test3,test4], "Irrelevant"}. + {skip_cases, 'T1', t1C_SUITE, [test1], "Ignore"}. + + {suites, 'T2', [t2B_SUITE,t2C_SUITE]}. + {cases, 'T2', t2A_SUITE, [test4,test1,test7]}. + + {skip_suites, 'T3', all, "Not implemented"}.</pre> + + <p>The example specifies the following:</p> + <list> + <item>The specified logdir directory will be used for storing + the HTML log files (in subdirectories tagged with node name, + date and time).</item> + <item>The variables in the specified test system config files will be + imported for the test.</item> + <item>The first test to run includes all suites for system t1. Excluded from + the test are however the t1B and t1D suites. Also test cases test3 and + test4 in t1A as well as the test1 case in t1C are excluded from + the test.</item> + <item>Secondly, the test for system t2 should run. The included suites are + t2B and t2C. Included are also test cases test4, test1 and test7 in suite + t2A. Note that the test cases will be executed in the specified order.</item> + <item>Lastly, all suites for systems t3 are to be completely skipped and this + should be explicitly noted in the log files.</item> + </list> + </section> - <p>The example specifies the following:</p> - <list> - <item>The specified logdir directory will be used for storing - the HTML log files (in subdirectories tagged with node name, - date and time).</item> - <item>The variables in the specified test system config files will be - imported for the test.</item> - <item>The first test to run includes all suites for system t1. Excluded from - the test are however the t1B and t1D suites. Also test cases test3 and - test4 in t1A as well as the test1 case in t1C are excluded from - the test.</item> - <item>Secondly, the test for system t2 should run. The included suites are - t2B and t2C. Included are also test cases test4, test1 and test7 in suite - t2A. Note that the test cases will be executed in the specified order.</item> - <item>Lastly, all suites for systems t3 are to be completely skipped and this - should be explicitly noted in the log files.</item> - </list> - <p>With the <c>init</c> term it's possible to specify initialization options - for nodes defined in the test specification. Currently, there are options - to start the node and/or to evaluate any function on the node. - See the <seealso marker="ct_master_chapter#ct_slave">Automatic startup of - the test target nodes</seealso> chapter for details.</p> - <p>It is possible for the user to provide a test specification that - includes (for Common Test) unrecognizable terms. If this is desired, - the <c>-allow_user_terms</c> flag should be used when starting tests with - <c>ct_run</c>. This forces Common Test to ignore unrecognizable terms. - Note that in this mode, Common Test is not able to check the specification - for errors as efficiently as if the scanner runs in default mode. - If <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c> is used for starting the tests, the relaxed scanner - mode is enabled by means of the tuple: <c>{allow_user_terms,true}</c></p> + <section> + <title>The init term</title> + <p>With the <c>init</c> term it's possible to specify initialization options + for nodes defined in the test specification. Currently, there are options + to start the node and/or to evaluate any function on the node. + See the <seealso marker="ct_master_chapter#ct_slave">Automatic startup of + the test target nodes</seealso> chapter for details.</p> + </section> + <section> + <title>User specific terms</title> + <p>It is possible for the user to provide a test specification that + includes (for Common Test) unrecognizable terms. If this is desired, + the <c>-allow_user_terms</c> flag should be used when starting tests with + <c>ct_run</c>. This forces Common Test to ignore unrecognizable terms. + Note that in this mode, Common Test is not able to check the specification + for errors as efficiently as if the scanner runs in default mode. + If <c><seealso marker="ct#run_test-1">ct:run_test/1</seealso></c> is used + for starting the tests, the relaxed scanner + mode is enabled by means of the tuple: <c>{allow_user_terms,true}</c></p> + </section> </section> <section> diff --git a/lib/common_test/doc/src/write_test_chapter.xml b/lib/common_test/doc/src/write_test_chapter.xml index 248d7de8b6..cc8d913994 100644 --- a/lib/common_test/doc/src/write_test_chapter.xml +++ b/lib/common_test/doc/src/write_test_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2003</year><year>2012</year> + <year>2003</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -982,38 +982,36 @@ <p>Example:</p> <pre> + Some printouts during test case execution: - Some printouts during test case execution: + io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]), + ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]), + ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]), + ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]), + ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]), + ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]), - io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]), - ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]), - ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]), - ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]), - ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]), - ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]), + If starting the test without specifying any verbosity levels: - If starting the test without specifying any verbosity levels: + $ ct_run ... - $ ct_run ... + the following gets printed: - the following gets printed: - - 1. Standard IO, importance = 50 - 2. Uncategorized, importance = 50 - 3. Categorized info, importance = 50 - 5. Categorized error, importance = 75 - 6. Categorized error, importance = 99 - - If starting the test with: - - $ ct_run -verbosity 1 and info 75 - - the following gets printed: + 1. Standard IO, importance = 50 + 2. Uncategorized, importance = 50 + 3. Categorized info, importance = 50 + 5. Categorized error, importance = 75 + 6. Categorized error, importance = 99 + + If starting the test with: + + $ ct_run -verbosity 1 and info 75 + + the following gets printed: - 3. Categorized info, importance = 50 - 4. Categorized info, importance = 25 - 6. Categorized error, importance = 99 - </pre> + 3. Categorized info, importance = 50 + 4. Categorized info, importance = 25 + 6. Categorized error, importance = 99</pre> <p>How categories can be mapped to CSS tags is documented in the <seealso marker="run_test_chapter#html_stylesheet">Running Tests</seealso> diff --git a/lib/common_test/priv/Makefile.in b/lib/common_test/priv/Makefile.in index 4372ab124e..5a9fabbe45 100644 --- a/lib/common_test/priv/Makefile.in +++ b/lib/common_test/priv/Makefile.in @@ -68,15 +68,15 @@ JS = jquery-latest.js jquery.tablesorter.min.js include ../../test_server/vsn.mk debug opt: - sed -e 's;@CT_VSN@;$(VSN);' \ + $(V_at)sed -e 's;@CT_VSN@;$(VSN);' \ -e 's;@TS_VSN@;$(TEST_SERVER_VSN);' \ ../install.sh.in > install.sh - chmod 775 install.sh + $(V_at)chmod 775 install.sh docs: clean: - rm -f $(SCRIPTS) + $(V_at)rm -f $(SCRIPTS) # ---------------------------------------------------- diff --git a/lib/common_test/priv/auxdir/config.guess b/lib/common_test/priv/auxdir/config.guess index 38a833903b..f475ceb413 100755 --- a/lib/common_test/priv/auxdir/config.guess +++ b/lib/common_test/priv/auxdir/config.guess @@ -1,14 +1,12 @@ #! /bin/sh # Attempt to guess a canonical system name. -# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, -# 2000, 2001, 2002, 2003, 2004, 2005, 2006 Free Software Foundation, -# Inc. +# Copyright 1992-2013 Free Software Foundation, Inc. -timestamp='2007-05-17' +timestamp='2013-02-12' # This file is free software; you can redistribute it and/or modify it # under the terms of the GNU General Public License as published by -# the Free Software Foundation; either version 2 of the License, or +# the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, but @@ -17,26 +15,22 @@ timestamp='2007-05-17' # General Public License for more details. # # You should have received a copy of the GNU General Public License -# along with this program; if not, write to the Free Software -# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA -# 02110-1301, USA. +# along with this program; if not, see <http://www.gnu.org/licenses/>. # # As a special exception to the GNU General Public License, if you # distribute this file as part of a program that contains a # configuration script generated by Autoconf, you may include it under -# the same distribution terms that you use for the rest of that program. - - -# Originally written by Per Bothner <[email protected]>. -# Please send patches to <[email protected]>. Submit a context -# diff and a properly formatted ChangeLog entry. +# the same distribution terms that you use for the rest of that +# program. This Exception is an additional permission under section 7 +# of the GNU General Public License, version 3 ("GPLv3"). +# +# Originally written by Per Bothner. # -# This script attempts to guess a canonical system name similar to -# config.sub. If it succeeds, it prints the system name on stdout, and -# exits with 0. Otherwise, it exits with 1. +# You can get the latest version of this script from: +# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD # -# The plan is that this can be called by configure scripts if you -# don't specify an explicit build system type. +# Please send patches with a ChangeLog entry to [email protected]. + me=`echo "$0" | sed -e 's,.*/,,'` @@ -56,8 +50,7 @@ version="\ GNU config.guess ($timestamp) Originally written by Per Bothner. -Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, 2005 -Free Software Foundation, Inc. +Copyright 1992-2013 Free Software Foundation, Inc. This is free software; see the source for copying conditions. There is NO warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE." @@ -144,7 +137,7 @@ UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in *:NetBSD:*:*) # NetBSD (nbsd) targets should (where applicable) match one or - # more of the tupples: *-*-netbsdelf*, *-*-netbsdaout*, + # more of the tuples: *-*-netbsdelf*, *-*-netbsdaout*, # *-*-netbsdecoff* and *-*-netbsd*. For targets that recently # switched to ELF, *-*-netbsd* would select the old # object file format. This provides both forward @@ -170,7 +163,7 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in arm*|i386|m68k|ns32k|sh3*|sparc|vax) eval $set_cc_for_build if echo __ELF__ | $CC_FOR_BUILD -E - 2>/dev/null \ - | grep __ELF__ >/dev/null + | grep -q __ELF__ then # Once all utilities can be ECOFF (netbsdecoff) or a.out (netbsdaout). # Return netbsd for either. FIX? @@ -180,7 +173,7 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in fi ;; *) - os=netbsd + os=netbsd ;; esac # The OS release @@ -201,6 +194,10 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in # CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM is used. echo "${machine}-${os}${release}" exit ;; + *:Bitrig:*:*) + UNAME_MACHINE_ARCH=`arch | sed 's/Bitrig.//'` + echo ${UNAME_MACHINE_ARCH}-unknown-bitrig${UNAME_RELEASE} + exit ;; *:OpenBSD:*:*) UNAME_MACHINE_ARCH=`arch | sed 's/OpenBSD.//'` echo ${UNAME_MACHINE_ARCH}-unknown-openbsd${UNAME_RELEASE} @@ -223,7 +220,7 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'` ;; *5.*) - UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $4}'` + UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $4}'` ;; esac # According to Compaq, /usr/sbin/psrinfo has been available on @@ -269,7 +266,10 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in # A Xn.n version is an unreleased experimental baselevel. # 1.2 uses "1.2" for uname -r. echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[PVTX]//' | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'` - exit ;; + # Reset EXIT trap before exiting to avoid spurious non-zero exit code. + exitcode=$? + trap '' 0 + exit $exitcode ;; Alpha\ *:Windows_NT*:*) # How do we know it's Interix rather than the generic POSIX subsystem? # Should we change UNAME_MACHINE based on the output of uname instead @@ -295,12 +295,12 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in echo s390-ibm-zvmoe exit ;; *:OS400:*:*) - echo powerpc-ibm-os400 + echo powerpc-ibm-os400 exit ;; arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*) echo arm-acorn-riscix${UNAME_RELEASE} exit ;; - arm:riscos:*:*|arm:RISCOS:*:*) + arm*:riscos:*:*|arm*:RISCOS:*:*) echo arm-unknown-riscos exit ;; SR2?01:HI-UX/MPP:*:* | SR8000:HI-UX/MPP:*:*) @@ -324,14 +324,33 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in case `/usr/bin/uname -p` in sparc) echo sparc-icl-nx7; exit ;; esac ;; + s390x:SunOS:*:*) + echo ${UNAME_MACHINE}-ibm-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit ;; sun4H:SunOS:5.*:*) echo sparc-hal-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` exit ;; sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*) echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` exit ;; - i86pc:SunOS:5.*:* | ix86xen:SunOS:5.*:*) - echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + i86pc:AuroraUX:5.*:* | i86xen:AuroraUX:5.*:*) + echo i386-pc-auroraux${UNAME_RELEASE} + exit ;; + i86pc:SunOS:5.*:* | i86xen:SunOS:5.*:*) + eval $set_cc_for_build + SUN_ARCH="i386" + # If there is a compiler, see if it is configured for 64-bit objects. + # Note that the Sun cc does not turn __LP64__ into 1 like gcc does. + # This test works for both compilers. + if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then + if (echo '#ifdef __amd64'; echo IS_64BIT_ARCH; echo '#endif') | \ + (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \ + grep IS_64BIT_ARCH >/dev/null + then + SUN_ARCH="x86_64" + fi + fi + echo ${SUN_ARCH}-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` exit ;; sun4*:SunOS:6*:*) # According to config.sub, this is the proper way to canonicalize @@ -375,23 +394,23 @@ case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in # MiNT. But MiNT is downward compatible to TOS, so this should # be no problem. atarist[e]:*MiNT:*:* | atarist[e]:*mint:*:* | atarist[e]:*TOS:*:*) - echo m68k-atari-mint${UNAME_RELEASE} + echo m68k-atari-mint${UNAME_RELEASE} exit ;; atari*:*MiNT:*:* | atari*:*mint:*:* | atarist[e]:*TOS:*:*) echo m68k-atari-mint${UNAME_RELEASE} - exit ;; + exit ;; *falcon*:*MiNT:*:* | *falcon*:*mint:*:* | *falcon*:*TOS:*:*) - echo m68k-atari-mint${UNAME_RELEASE} + echo m68k-atari-mint${UNAME_RELEASE} exit ;; milan*:*MiNT:*:* | milan*:*mint:*:* | *milan*:*TOS:*:*) - echo m68k-milan-mint${UNAME_RELEASE} - exit ;; + echo m68k-milan-mint${UNAME_RELEASE} + exit ;; hades*:*MiNT:*:* | hades*:*mint:*:* | *hades*:*TOS:*:*) - echo m68k-hades-mint${UNAME_RELEASE} - exit ;; + echo m68k-hades-mint${UNAME_RELEASE} + exit ;; *:*MiNT:*:* | *:*mint:*:* | *:*TOS:*:*) - echo m68k-unknown-mint${UNAME_RELEASE} - exit ;; + echo m68k-unknown-mint${UNAME_RELEASE} + exit ;; m68k:machten:*:*) echo m68k-apple-machten${UNAME_RELEASE} exit ;; @@ -461,8 +480,8 @@ EOF echo m88k-motorola-sysv3 exit ;; AViiON:dgux:*:*) - # DG/UX returns AViiON for all architectures - UNAME_PROCESSOR=`/usr/bin/uname -p` + # DG/UX returns AViiON for all architectures + UNAME_PROCESSOR=`/usr/bin/uname -p` if [ $UNAME_PROCESSOR = mc88100 ] || [ $UNAME_PROCESSOR = mc88110 ] then if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx ] || \ @@ -475,7 +494,7 @@ EOF else echo i586-dg-dgux${UNAME_RELEASE} fi - exit ;; + exit ;; M88*:DolphinOS:*:*) # DolphinOS (SVR3) echo m88k-dolphin-sysv3 exit ;; @@ -532,7 +551,7 @@ EOF echo rs6000-ibm-aix3.2 fi exit ;; - *:AIX:*:[45]) + *:AIX:*:[4567]) IBM_CPU_ID=`/usr/sbin/lsdev -C -c processor -S available | sed 1q | awk '{ print $1 }'` if /usr/sbin/lsattr -El ${IBM_CPU_ID} | grep ' POWER' >/dev/null 2>&1; then IBM_ARCH=rs6000 @@ -575,52 +594,52 @@ EOF 9000/[678][0-9][0-9]) if [ -x /usr/bin/getconf ]; then sc_cpu_version=`/usr/bin/getconf SC_CPU_VERSION 2>/dev/null` - sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null` - case "${sc_cpu_version}" in - 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0 - 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1 - 532) # CPU_PA_RISC2_0 - case "${sc_kernel_bits}" in - 32) HP_ARCH="hppa2.0n" ;; - 64) HP_ARCH="hppa2.0w" ;; + sc_kernel_bits=`/usr/bin/getconf SC_KERNEL_BITS 2>/dev/null` + case "${sc_cpu_version}" in + 523) HP_ARCH="hppa1.0" ;; # CPU_PA_RISC1_0 + 528) HP_ARCH="hppa1.1" ;; # CPU_PA_RISC1_1 + 532) # CPU_PA_RISC2_0 + case "${sc_kernel_bits}" in + 32) HP_ARCH="hppa2.0n" ;; + 64) HP_ARCH="hppa2.0w" ;; '') HP_ARCH="hppa2.0" ;; # HP-UX 10.20 - esac ;; - esac + esac ;; + esac fi if [ "${HP_ARCH}" = "" ]; then eval $set_cc_for_build - sed 's/^ //' << EOF >$dummy.c + sed 's/^ //' << EOF >$dummy.c - #define _HPUX_SOURCE - #include <stdlib.h> - #include <unistd.h> + #define _HPUX_SOURCE + #include <stdlib.h> + #include <unistd.h> - int main () - { - #if defined(_SC_KERNEL_BITS) - long bits = sysconf(_SC_KERNEL_BITS); - #endif - long cpu = sysconf (_SC_CPU_VERSION); + int main () + { + #if defined(_SC_KERNEL_BITS) + long bits = sysconf(_SC_KERNEL_BITS); + #endif + long cpu = sysconf (_SC_CPU_VERSION); - switch (cpu) - { - case CPU_PA_RISC1_0: puts ("hppa1.0"); break; - case CPU_PA_RISC1_1: puts ("hppa1.1"); break; - case CPU_PA_RISC2_0: - #if defined(_SC_KERNEL_BITS) - switch (bits) - { - case 64: puts ("hppa2.0w"); break; - case 32: puts ("hppa2.0n"); break; - default: puts ("hppa2.0"); break; - } break; - #else /* !defined(_SC_KERNEL_BITS) */ - puts ("hppa2.0"); break; - #endif - default: puts ("hppa1.0"); break; - } - exit (0); - } + switch (cpu) + { + case CPU_PA_RISC1_0: puts ("hppa1.0"); break; + case CPU_PA_RISC1_1: puts ("hppa1.1"); break; + case CPU_PA_RISC2_0: + #if defined(_SC_KERNEL_BITS) + switch (bits) + { + case 64: puts ("hppa2.0w"); break; + case 32: puts ("hppa2.0n"); break; + default: puts ("hppa2.0"); break; + } break; + #else /* !defined(_SC_KERNEL_BITS) */ + puts ("hppa2.0"); break; + #endif + default: puts ("hppa1.0"); break; + } + exit (0); + } EOF (CCOPTS= $CC_FOR_BUILD -o $dummy $dummy.c 2>/dev/null) && HP_ARCH=`$dummy` test -z "$HP_ARCH" && HP_ARCH=hppa @@ -640,7 +659,7 @@ EOF # => hppa64-hp-hpux11.23 if echo __LP64__ | (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | - grep __LP64__ >/dev/null + grep -q __LP64__ then HP_ARCH="hppa2.0w" else @@ -711,22 +730,22 @@ EOF exit ;; C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*) echo c1-convex-bsd - exit ;; + exit ;; C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*) if getsysinfo -f scalar_acc then echo c32-convex-bsd else echo c2-convex-bsd fi - exit ;; + exit ;; C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*) echo c34-convex-bsd - exit ;; + exit ;; C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*) echo c38-convex-bsd - exit ;; + exit ;; C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*) echo c4-convex-bsd - exit ;; + exit ;; CRAY*Y-MP:*:*:*) echo ymp-cray-unicos${UNAME_RELEASE} | sed -e 's/\.[^.]*$/.X/' exit ;; @@ -750,14 +769,14 @@ EOF exit ;; F30[01]:UNIX_System_V:*:* | F700:UNIX_System_V:*:*) FUJITSU_PROC=`uname -m | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz'` - FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'` - FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'` - echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" - exit ;; + FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'` + FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'` + echo "${FUJITSU_PROC}-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" + exit ;; 5000:UNIX_System_V:4.*:*) - FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'` - FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'` - echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" + FUJITSU_SYS=`uname -p | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/\///'` + FUJITSU_REL=`echo ${UNAME_RELEASE} | tr 'ABCDEFGHIJKLMNOPQRSTUVWXYZ' 'abcdefghijklmnopqrstuvwxyz' | sed -e 's/ /_/'` + echo "sparc-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" exit ;; i*86:BSD/386:*:* | i*86:BSD/OS:*:* | *:Ascend\ Embedded/OS:*:*) echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE} @@ -769,40 +788,51 @@ EOF echo ${UNAME_MACHINE}-unknown-bsdi${UNAME_RELEASE} exit ;; *:FreeBSD:*:*) - case ${UNAME_MACHINE} in - pc98) - echo i386-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;; + UNAME_PROCESSOR=`/usr/bin/uname -p` + case ${UNAME_PROCESSOR} in amd64) echo x86_64-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;; *) - echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;; + echo ${UNAME_PROCESSOR}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` ;; esac exit ;; i*:CYGWIN*:*) echo ${UNAME_MACHINE}-pc-cygwin exit ;; + *:MINGW64*:*) + echo ${UNAME_MACHINE}-pc-mingw64 + exit ;; *:MINGW*:*) echo ${UNAME_MACHINE}-pc-mingw32 exit ;; + i*:MSYS*:*) + echo ${UNAME_MACHINE}-pc-msys + exit ;; i*:windows32*:*) - # uname -m includes "-pc" on this system. - echo ${UNAME_MACHINE}-mingw32 + # uname -m includes "-pc" on this system. + echo ${UNAME_MACHINE}-mingw32 exit ;; i*:PW*:*) echo ${UNAME_MACHINE}-pc-pw32 exit ;; - *:Interix*:[3456]*) - case ${UNAME_MACHINE} in - x86) + *:Interix*:*) + case ${UNAME_MACHINE} in + x86) echo i586-pc-interix${UNAME_RELEASE} exit ;; - EM64T | authenticamd) + authenticamd | genuineintel | EM64T) echo x86_64-unknown-interix${UNAME_RELEASE} exit ;; + IA64) + echo ia64-unknown-interix${UNAME_RELEASE} + exit ;; esac ;; [345]86:Windows_95:* | [345]86:Windows_98:* | [345]86:Windows_NT:*) echo i${UNAME_MACHINE}-pc-mks exit ;; + 8664:Windows_NT:*) + echo x86_64-pc-mks + exit ;; i*:Windows_NT*:* | Pentium*:Windows_NT*:*) # How do we know it's Interix rather than the generic POSIX subsystem? # It also conflicts with pre-2.0 versions of AT&T UWIN. Should we @@ -832,20 +862,68 @@ EOF i*86:Minix:*:*) echo ${UNAME_MACHINE}-pc-minix exit ;; - arm*:Linux:*:*) + aarch64:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit ;; + aarch64_be:Linux:*:*) + UNAME_MACHINE=aarch64_be echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; + alpha:Linux:*:*) + case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in + EV5) UNAME_MACHINE=alphaev5 ;; + EV56) UNAME_MACHINE=alphaev56 ;; + PCA56) UNAME_MACHINE=alphapca56 ;; + PCA57) UNAME_MACHINE=alphapca56 ;; + EV6) UNAME_MACHINE=alphaev6 ;; + EV67) UNAME_MACHINE=alphaev67 ;; + EV68*) UNAME_MACHINE=alphaev68 ;; + esac + objdump --private-headers /bin/sh | grep -q ld.so.1 + if test "$?" = 0 ; then LIBC="libc1" ; else LIBC="" ; fi + echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} + exit ;; + arm*:Linux:*:*) + eval $set_cc_for_build + if echo __ARM_EABI__ | $CC_FOR_BUILD -E - 2>/dev/null \ + | grep -q __ARM_EABI__ + then + echo ${UNAME_MACHINE}-unknown-linux-gnu + else + if echo __ARM_PCS_VFP | $CC_FOR_BUILD -E - 2>/dev/null \ + | grep -q __ARM_PCS_VFP + then + echo ${UNAME_MACHINE}-unknown-linux-gnueabi + else + echo ${UNAME_MACHINE}-unknown-linux-gnueabihf + fi + fi + exit ;; avr32*:Linux:*:*) echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; cris:Linux:*:*) - echo cris-axis-linux-gnu + echo ${UNAME_MACHINE}-axis-linux-gnu exit ;; crisv32:Linux:*:*) - echo crisv32-axis-linux-gnu + echo ${UNAME_MACHINE}-axis-linux-gnu exit ;; frv:Linux:*:*) - echo frv-unknown-linux-gnu + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit ;; + hexagon:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu + exit ;; + i*86:Linux:*:*) + LIBC=gnu + eval $set_cc_for_build + sed 's/^ //' << EOF >$dummy.c + #ifdef __dietlibc__ + LIBC=dietlibc + #endif +EOF + eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^LIBC'` + echo "${UNAME_MACHINE}-pc-linux-${LIBC}" exit ;; ia64:Linux:*:*) echo ${UNAME_MACHINE}-unknown-linux-gnu @@ -856,74 +934,36 @@ EOF m68*:Linux:*:*) echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; - mips:Linux:*:*) - eval $set_cc_for_build - sed 's/^ //' << EOF >$dummy.c - #undef CPU - #undef mips - #undef mipsel - #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL) - CPU=mipsel - #else - #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB) - CPU=mips - #else - CPU= - #endif - #endif -EOF - eval "`$CC_FOR_BUILD -E $dummy.c 2>/dev/null | sed -n ' - /^CPU/{ - s: ::g - p - }'`" - test x"${CPU}" != x && { echo "${CPU}-unknown-linux-gnu"; exit; } - ;; - mips64:Linux:*:*) + mips:Linux:*:* | mips64:Linux:*:*) eval $set_cc_for_build sed 's/^ //' << EOF >$dummy.c #undef CPU - #undef mips64 - #undef mips64el + #undef ${UNAME_MACHINE} + #undef ${UNAME_MACHINE}el #if defined(__MIPSEL__) || defined(__MIPSEL) || defined(_MIPSEL) || defined(MIPSEL) - CPU=mips64el + CPU=${UNAME_MACHINE}el #else #if defined(__MIPSEB__) || defined(__MIPSEB) || defined(_MIPSEB) || defined(MIPSEB) - CPU=mips64 + CPU=${UNAME_MACHINE} #else CPU= #endif #endif EOF - eval "`$CC_FOR_BUILD -E $dummy.c 2>/dev/null | sed -n ' - /^CPU/{ - s: ::g - p - }'`" + eval `$CC_FOR_BUILD -E $dummy.c 2>/dev/null | grep '^CPU'` test x"${CPU}" != x && { echo "${CPU}-unknown-linux-gnu"; exit; } ;; - or32:Linux:*:*) - echo or32-unknown-linux-gnu + or1k:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; - ppc:Linux:*:*) - echo powerpc-unknown-linux-gnu + or32:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; - ppc64:Linux:*:*) - echo powerpc64-unknown-linux-gnu + padre:Linux:*:*) + echo sparc-unknown-linux-gnu exit ;; - alpha:Linux:*:*) - case `sed -n '/^cpu model/s/^.*: \(.*\)/\1/p' < /proc/cpuinfo` in - EV5) UNAME_MACHINE=alphaev5 ;; - EV56) UNAME_MACHINE=alphaev56 ;; - PCA56) UNAME_MACHINE=alphapca56 ;; - PCA57) UNAME_MACHINE=alphapca56 ;; - EV6) UNAME_MACHINE=alphaev6 ;; - EV67) UNAME_MACHINE=alphaev67 ;; - EV68*) UNAME_MACHINE=alphaev68 ;; - esac - objdump --private-headers /bin/sh | grep ld.so.1 >/dev/null - if test "$?" = 0 ; then LIBC="libc1" ; else LIBC="" ; fi - echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} + parisc64:Linux:*:* | hppa64:Linux:*:*) + echo hppa64-unknown-linux-gnu exit ;; parisc:Linux:*:* | hppa:Linux:*:*) # Look for CPU level @@ -933,14 +973,17 @@ EOF *) echo hppa-unknown-linux-gnu ;; esac exit ;; - parisc64:Linux:*:* | hppa64:Linux:*:*) - echo hppa64-unknown-linux-gnu + ppc64:Linux:*:*) + echo powerpc64-unknown-linux-gnu + exit ;; + ppc:Linux:*:*) + echo powerpc-unknown-linux-gnu exit ;; s390:Linux:*:* | s390x:Linux:*:*) echo ${UNAME_MACHINE}-ibm-linux exit ;; sh64*:Linux:*:*) - echo ${UNAME_MACHINE}-unknown-linux-gnu + echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; sh*:Linux:*:*) echo ${UNAME_MACHINE}-unknown-linux-gnu @@ -948,81 +991,18 @@ EOF sparc:Linux:*:* | sparc64:Linux:*:*) echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; - tile:Linux:*:*) - echo tile-unknown-linux-gnu + tile*:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; vax:Linux:*:*) echo ${UNAME_MACHINE}-dec-linux-gnu exit ;; x86_64:Linux:*:*) - echo x86_64-unknown-linux-gnu + echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; - xtensa:Linux:*:*) - echo xtensa-unknown-linux-gnu + xtensa*:Linux:*:*) + echo ${UNAME_MACHINE}-unknown-linux-gnu exit ;; - i*86:Linux:*:*) - # The BFD linker knows what the default object file format is, so - # first see if it will tell us. cd to the root directory to prevent - # problems with other programs or directories called `ld' in the path. - # Set LC_ALL=C to ensure ld outputs messages in English. - ld_supported_targets=`cd /; LC_ALL=C ld --help 2>&1 \ - | sed -ne '/supported targets:/!d - s/[ ][ ]*/ /g - s/.*supported targets: *// - s/ .*// - p'` - case "$ld_supported_targets" in - elf32-i386) - TENTATIVE="${UNAME_MACHINE}-pc-linux-gnu" - ;; - a.out-i386-linux) - echo "${UNAME_MACHINE}-pc-linux-gnuaout" - exit ;; - coff-i386) - echo "${UNAME_MACHINE}-pc-linux-gnucoff" - exit ;; - "") - # Either a pre-BFD a.out linker (linux-gnuoldld) or - # one that does not give us useful --help. - echo "${UNAME_MACHINE}-pc-linux-gnuoldld" - exit ;; - esac - # Determine whether the default compiler is a.out or elf - eval $set_cc_for_build - sed 's/^ //' << EOF >$dummy.c - #include <features.h> - #ifdef __ELF__ - # ifdef __GLIBC__ - # if __GLIBC__ >= 2 - LIBC=gnu - # else - LIBC=gnulibc1 - # endif - # else - LIBC=gnulibc1 - # endif - #else - #if defined(__INTEL_COMPILER) || defined(__PGI) || defined(__SUNPRO_C) || defined(__SUNPRO_CC) - LIBC=gnu - #else - LIBC=gnuaout - #endif - #endif - #ifdef __dietlibc__ - LIBC=dietlibc - #endif -EOF - eval "`$CC_FOR_BUILD -E $dummy.c 2>/dev/null | sed -n ' - /^LIBC/{ - s: ::g - p - }'`" - test x"${LIBC}" != x && { - echo "${UNAME_MACHINE}-pc-linux-${LIBC}" - exit - } - test x"${TENTATIVE}" != x && { echo "${TENTATIVE}"; exit; } - ;; i*86:DYNIX/ptx:4*:*) # ptx 4.0 does uname -s correctly, with DYNIX/ptx in there. # earlier versions are messed up and put the nodename in both @@ -1030,11 +1010,11 @@ EOF echo i386-sequent-sysv4 exit ;; i*86:UNIX_SV:4.2MP:2.*) - # Unixware is an offshoot of SVR4, but it has its own version - # number series starting with 2... - # I am not positive that other SVR4 systems won't match this, + # Unixware is an offshoot of SVR4, but it has its own version + # number series starting with 2... + # I am not positive that other SVR4 systems won't match this, # I just have to hope. -- rms. - # Use sysv4.2uw... so that sysv4* matches it. + # Use sysv4.2uw... so that sysv4* matches it. echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION} exit ;; i*86:OS/2:*:*) @@ -1051,7 +1031,7 @@ EOF i*86:syllable:*:*) echo ${UNAME_MACHINE}-pc-syllable exit ;; - i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.0*:*) + i*86:LynxOS:2.*:* | i*86:LynxOS:3.[01]*:* | i*86:LynxOS:4.[02]*:*) echo i386-unknown-lynxos${UNAME_RELEASE} exit ;; i*86:*DOS:*:*) @@ -1066,7 +1046,7 @@ EOF fi exit ;; i*86:*:5:[678]*) - # UnixWare 7.x, OpenUNIX and OpenServer 6. + # UnixWare 7.x, OpenUNIX and OpenServer 6. case `/bin/uname -X | grep "^Machine"` in *486*) UNAME_MACHINE=i486 ;; *Pentium) UNAME_MACHINE=i586 ;; @@ -1094,10 +1074,13 @@ EOF exit ;; pc:*:*:*) # Left here for compatibility: - # uname -m prints for DJGPP always 'pc', but it prints nothing about - # the processor, so we play safe by assuming i386. - echo i386-pc-msdosdjgpp - exit ;; + # uname -m prints for DJGPP always 'pc', but it prints nothing about + # the processor, so we play safe by assuming i586. + # Note: whatever this is, it MUST be the same as what config.sub + # prints for the "djgpp" host, or else GDB configury will decide that + # this is a cross-build. + echo i586-pc-msdosdjgpp + exit ;; Intel:Mach:3*:*) echo i386-pc-mach3 exit ;; @@ -1132,8 +1115,18 @@ EOF /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \ && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;; 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*) - /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ - && { echo i486-ncr-sysv4; exit; } ;; + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && { echo i486-ncr-sysv4; exit; } ;; + NCR*:*:4.2:* | MPRAS*:*:4.2:*) + OS_REL='.3' + test -r /etc/.relid \ + && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid` + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && { echo i486-ncr-sysv4.3${OS_REL}; exit; } + /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \ + && { echo i586-ncr-sysv4.3${OS_REL}; exit; } + /bin/uname -p 2>/dev/null | /bin/grep pteron >/dev/null \ + && { echo i586-ncr-sysv4.3${OS_REL}; exit; } ;; m68*:LynxOS:2.*:* | m68*:LynxOS:3.0*:*) echo m68k-unknown-lynxos${UNAME_RELEASE} exit ;; @@ -1146,7 +1139,7 @@ EOF rs6000:LynxOS:2.*:*) echo rs6000-unknown-lynxos${UNAME_RELEASE} exit ;; - PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.0*:*) + PowerPC:LynxOS:2.*:* | PowerPC:LynxOS:3.[01]*:* | PowerPC:LynxOS:4.[02]*:*) echo powerpc-unknown-lynxos${UNAME_RELEASE} exit ;; SM[BE]S:UNIX_SV:*:*) @@ -1166,10 +1159,10 @@ EOF echo ns32k-sni-sysv fi exit ;; - PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort - # says <[email protected]> - echo i586-unisys-sysv4 - exit ;; + PENTIUM:*:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort + # says <[email protected]> + echo i586-unisys-sysv4 + exit ;; *:UNIX_System_V:4*:FTX*) # From Gerald Hewes <[email protected]>. # How about differentiating between stratus architectures? -djm @@ -1195,11 +1188,11 @@ EOF exit ;; R[34]000:*System_V*:*:* | R4000:UNIX_SYSV:*:* | R*000:UNIX_SV:*:*) if [ -d /usr/nec ]; then - echo mips-nec-sysv${UNAME_RELEASE} + echo mips-nec-sysv${UNAME_RELEASE} else - echo mips-unknown-sysv${UNAME_RELEASE} + echo mips-unknown-sysv${UNAME_RELEASE} fi - exit ;; + exit ;; BeBox:BeOS:*:*) # BeOS running on hardware made by Be, PPC only. echo powerpc-be-beos exit ;; @@ -1209,6 +1202,12 @@ EOF BePC:BeOS:*:*) # BeOS running on Intel PC compatible. echo i586-pc-beos exit ;; + BePC:Haiku:*:*) # Haiku running on Intel PC compatible. + echo i586-pc-haiku + exit ;; + x86_64:Haiku:*:*) + echo x86_64-unknown-haiku + exit ;; SX-4:SUPER-UX:*:*) echo sx4-nec-superux${UNAME_RELEASE} exit ;; @@ -1236,6 +1235,16 @@ EOF *:Darwin:*:*) UNAME_PROCESSOR=`uname -p` || UNAME_PROCESSOR=unknown case $UNAME_PROCESSOR in + i386) + eval $set_cc_for_build + if [ "$CC_FOR_BUILD" != 'no_compiler_found' ]; then + if (echo '#ifdef __LP64__'; echo IS_64BIT_ARCH; echo '#endif') | \ + (CCOPTS= $CC_FOR_BUILD -E - 2>/dev/null) | \ + grep IS_64BIT_ARCH >/dev/null + then + UNAME_PROCESSOR="x86_64" + fi + fi ;; unknown) UNAME_PROCESSOR=powerpc ;; esac echo ${UNAME_PROCESSOR}-apple-darwin${UNAME_RELEASE} @@ -1251,7 +1260,10 @@ EOF *:QNX:*:4*) echo i386-pc-qnx exit ;; - NSE-?:NONSTOP_KERNEL:*:*) + NEO-?:NONSTOP_KERNEL:*:*) + echo neo-tandem-nsk${UNAME_RELEASE} + exit ;; + NSE-*:NONSTOP_KERNEL:*:*) echo nse-tandem-nsk${UNAME_RELEASE} exit ;; NSR-?:NONSTOP_KERNEL:*:*) @@ -1296,13 +1308,13 @@ EOF echo pdp10-unknown-its exit ;; SEI:*:*:SEIUX) - echo mips-sei-seiux${UNAME_RELEASE} + echo mips-sei-seiux${UNAME_RELEASE} exit ;; *:DragonFly:*:*) echo ${UNAME_MACHINE}-unknown-dragonfly`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` exit ;; *:*VMS:*:*) - UNAME_MACHINE=`(uname -p) 2>/dev/null` + UNAME_MACHINE=`(uname -p) 2>/dev/null` case "${UNAME_MACHINE}" in A*) echo alpha-dec-vms ; exit ;; I*) echo ia64-dec-vms ; exit ;; @@ -1317,11 +1329,14 @@ EOF i*86:rdos:*:*) echo ${UNAME_MACHINE}-pc-rdos exit ;; + i*86:AROS:*:*) + echo ${UNAME_MACHINE}-pc-aros + exit ;; + x86_64:VMkernel:*:*) + echo ${UNAME_MACHINE}-unknown-esx + exit ;; esac -#echo '(No uname command or uname output not recognized.)' 1>&2 -#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2 - eval $set_cc_for_build cat >$dummy.c <<EOF #ifdef _SEQUENT_ @@ -1339,11 +1354,11 @@ main () #include <sys/param.h> printf ("m68k-sony-newsos%s\n", #ifdef NEWSOS4 - "4" + "4" #else - "" + "" #endif - ); exit (0); + ); exit (0); #endif #endif @@ -1477,9 +1492,9 @@ This script, last modified $timestamp, has failed to recognize the operating system you are using. It is advised that you download the most up to date version of the config scripts from - http://savannah.gnu.org/cgi-bin/viewcvs/*checkout*/config/config/config.guess + http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.guess;hb=HEAD and - http://savannah.gnu.org/cgi-bin/viewcvs/*checkout*/config/config/config.sub + http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD If the version you run ($0) is already up to date, please send the following data and any information you think might be diff --git a/lib/common_test/priv/auxdir/config.sub b/lib/common_test/priv/auxdir/config.sub index f43233b104..bb6edbdb47 100755 --- a/lib/common_test/priv/auxdir/config.sub +++ b/lib/common_test/priv/auxdir/config.sub @@ -1,44 +1,40 @@ #! /bin/sh # Configuration validation subroutine script. -# Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, -# 2000, 2001, 2002, 2003, 2004, 2005, 2006 Free Software Foundation, -# Inc. +# Copyright 1992-2013 Free Software Foundation, Inc. -timestamp='2007-04-29' +timestamp='2013-02-12' -# This file is (in principle) common to ALL GNU software. -# The presence of a machine in this file suggests that SOME GNU software -# can handle that machine. It does not imply ALL GNU software can. -# -# This file is free software; you can redistribute it and/or modify -# it under the terms of the GNU General Public License as published by -# the Free Software Foundation; either version 2 of the License, or +# This file is free software; you can redistribute it and/or modify it +# under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # -# This program is distributed in the hope that it will be useful, -# but WITHOUT ANY WARRANTY; without even the implied warranty of -# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -# GNU General Public License for more details. +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. # # You should have received a copy of the GNU General Public License -# along with this program; if not, write to the Free Software -# Foundation, Inc., 51 Franklin Street - Fifth Floor, Boston, MA -# 02110-1301, USA. +# along with this program; if not, see <http://www.gnu.org/licenses/>. # # As a special exception to the GNU General Public License, if you # distribute this file as part of a program that contains a # configuration script generated by Autoconf, you may include it under -# the same distribution terms that you use for the rest of that program. +# the same distribution terms that you use for the rest of that +# program. This Exception is an additional permission under section 7 +# of the GNU General Public License, version 3 ("GPLv3"). -# Please send patches to <[email protected]>. Submit a context -# diff and a properly formatted ChangeLog entry. +# Please send patches with a ChangeLog entry to [email protected]. # # Configuration subroutine to validate and canonicalize a configuration type. # Supply the specified configuration type as an argument. # If it is invalid, we print an error message on stderr and exit with code 1. # Otherwise, we print the canonical config type on stdout and succeed. +# You can get the latest version of this script from: +# http://git.savannah.gnu.org/gitweb/?p=config.git;a=blob_plain;f=config.sub;hb=HEAD + # This file is supposed to be the same for all GNU packages # and recognize all the CPU types, system types and aliases # that are meaningful with *any* GNU software. @@ -72,8 +68,7 @@ Report bugs and patches to <[email protected]>." version="\ GNU config.sub ($timestamp) -Copyright (C) 1992, 1993, 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, 2003, 2004, 2005 -Free Software Foundation, Inc. +Copyright 1992-2013 Free Software Foundation, Inc. This is free software; see the source for copying conditions. There is NO warranty; not even for MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE." @@ -120,12 +115,18 @@ esac # Here we must recognize all the valid KERNEL-OS combinations. maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'` case $maybe_os in - nto-qnx* | linux-gnu* | linux-dietlibc | linux-newlib* | linux-uclibc* | \ - uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | knetbsd*-gnu* | netbsd*-gnu* | \ + nto-qnx* | linux-gnu* | linux-android* | linux-dietlibc | linux-newlib* | \ + linux-musl* | linux-uclibc* | uclinux-uclibc* | uclinux-gnu* | kfreebsd*-gnu* | \ + knetbsd*-gnu* | netbsd*-gnu* | \ + kopensolaris*-gnu* | \ storm-chaos* | os2-emx* | rtmk-nova*) os=-$maybe_os basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'` ;; + android-linux) + os=-linux-android + basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`-unknown + ;; *) basic_machine=`echo $1 | sed 's/-[^-]*$//'` if [ $basic_machine != $1 ] @@ -148,10 +149,13 @@ case $os in -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\ -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \ -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \ - -apple | -axis | -knuth | -cray) + -apple | -axis | -knuth | -cray | -microblaze*) os= basic_machine=$1 ;; + -bluegene*) + os=-cnk + ;; -sim | -cisco | -oki | -wec | -winbond) os= basic_machine=$1 @@ -166,10 +170,10 @@ case $os in os=-chorusos basic_machine=$1 ;; - -chorusrdb) - os=-chorusrdb + -chorusrdb) + os=-chorusrdb basic_machine=$1 - ;; + ;; -hiux*) os=-hiuxwe2 ;; @@ -214,6 +218,12 @@ case $os in -isc*) basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` ;; + -lynx*178) + os=-lynxos178 + ;; + -lynx*5) + os=-lynxos5 + ;; -lynx*) os=-lynxos ;; @@ -238,24 +248,34 @@ case $basic_machine in # Some are omitted here because they have special meanings below. 1750a | 580 \ | a29k \ + | aarch64 | aarch64_be \ | alpha | alphaev[4-8] | alphaev56 | alphaev6[78] | alphapca5[67] \ | alpha64 | alpha64ev[4-8] | alpha64ev56 | alpha64ev6[78] | alpha64pca5[67] \ | am33_2.0 \ - | arc | arm | arm[bl]e | arme[lb] | armv[2345] | armv[345][lb] | avr | avr32 \ + | arc \ + | arm | arm[bl]e | arme[lb] | armv[2-8] | armv[3-8][lb] | armv7[arm] \ + | avr | avr32 \ + | be32 | be64 \ | bfin \ | c4x | clipper \ | d10v | d30v | dlx | dsp16xx \ + | epiphany \ | fido | fr30 | frv \ | h8300 | h8500 | hppa | hppa1.[01] | hppa2.0 | hppa2.0[nw] | hppa64 \ + | hexagon \ | i370 | i860 | i960 | ia64 \ | ip2k | iq2000 \ + | le32 | le64 \ + | lm32 \ | m32c | m32r | m32rle | m68000 | m68k | m88k \ - | maxq | mb | microblaze | mcore | mep \ + | maxq | mb | microblaze | microblazeel | mcore | mep | metag \ | mips | mipsbe | mipseb | mipsel | mipsle \ | mips16 \ | mips64 | mips64el \ - | mips64vr | mips64vrel \ + | mips64octeon | mips64octeonel \ | mips64orion | mips64orionel \ + | mips64r5900 | mips64r5900el \ + | mips64vr | mips64vrel \ | mips64vr4100 | mips64vr4100el \ | mips64vr4300 | mips64vr4300el \ | mips64vr5000 | mips64vr5000el \ @@ -266,31 +286,45 @@ case $basic_machine in | mipsisa64r2 | mipsisa64r2el \ | mipsisa64sb1 | mipsisa64sb1el \ | mipsisa64sr71k | mipsisa64sr71kel \ + | mipsr5900 | mipsr5900el \ | mipstx39 | mipstx39el \ | mn10200 | mn10300 \ + | moxie \ | mt \ | msp430 \ - | nios | nios2 \ + | nds32 | nds32le | nds32be \ + | nios | nios2 | nios2eb | nios2el \ | ns16k | ns32k \ - | or32 \ + | open8 \ + | or1k | or32 \ | pdp10 | pdp11 | pj | pjl \ - | powerpc | powerpc64 | powerpc64le | powerpcle | ppcbe \ + | powerpc | powerpc64 | powerpc64le | powerpcle \ | pyramid \ + | rl78 | rx \ | score \ - | sh | sh[1234] | sh[24]a | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \ + | sh | sh[1234] | sh[24]a | sh[24]aeb | sh[23]e | sh[34]eb | sheb | shbe | shle | sh[1234]le | sh3ele \ | sh64 | sh64le \ | sparc | sparc64 | sparc64b | sparc64v | sparc86x | sparclet | sparclite \ | sparcv8 | sparcv9 | sparcv9b | sparcv9v \ - | spu | strongarm \ - | tahoe | thumb | tic4x | tic80 | tron \ - | v850 | v850e \ + | spu \ + | tahoe | tic4x | tic54x | tic55x | tic6x | tic80 | tron \ + | ubicom32 \ + | v850 | v850e | v850e1 | v850e2 | v850es | v850e2v3 \ | we32k \ - | x86 | xc16x | xscale | xscalee[bl] | xstormy16 | xtensa \ - | z8k) + | x86 | xc16x | xstormy16 | xtensa \ + | z8k | z80) basic_machine=$basic_machine-unknown ;; - m6811 | m68hc11 | m6812 | m68hc12) - # Motorola 68HC11/12. + c54x) + basic_machine=tic54x-unknown + ;; + c55x) + basic_machine=tic55x-unknown + ;; + c6x) + basic_machine=tic6x-unknown + ;; + m6811 | m68hc11 | m6812 | m68hc12 | m68hcs12x | picochip) basic_machine=$basic_machine-unknown os=-none ;; @@ -300,6 +334,21 @@ case $basic_machine in basic_machine=mt-unknown ;; + strongarm | thumb | xscale) + basic_machine=arm-unknown + ;; + xgate) + basic_machine=$basic_machine-unknown + os=-none + ;; + xscaleeb) + basic_machine=armeb-unknown + ;; + + xscaleel) + basic_machine=armel-unknown + ;; + # We use `pc' rather than `unknown' # because (1) that's what they normally are, and # (2) the word "unknown" tends to confuse beginning users. @@ -314,29 +363,37 @@ case $basic_machine in # Recognize the basic CPU types with company name. 580-* \ | a29k-* \ + | aarch64-* | aarch64_be-* \ | alpha-* | alphaev[4-8]-* | alphaev56-* | alphaev6[78]-* \ | alpha64-* | alpha64ev[4-8]-* | alpha64ev56-* | alpha64ev6[78]-* \ | alphapca5[67]-* | alpha64pca5[67]-* | arc-* \ | arm-* | armbe-* | armle-* | armeb-* | armv*-* \ | avr-* | avr32-* \ + | be32-* | be64-* \ | bfin-* | bs2000-* \ - | c[123]* | c30-* | [cjt]90-* | c4x-* | c54x-* | c55x-* | c6x-* \ + | c[123]* | c30-* | [cjt]90-* | c4x-* \ | clipper-* | craynv-* | cydra-* \ | d10v-* | d30v-* | dlx-* \ | elxsi-* \ | f30[01]-* | f700-* | fido-* | fr30-* | frv-* | fx80-* \ | h8300-* | h8500-* \ | hppa-* | hppa1.[01]-* | hppa2.0-* | hppa2.0[nw]-* | hppa64-* \ + | hexagon-* \ | i*86-* | i860-* | i960-* | ia64-* \ | ip2k-* | iq2000-* \ + | le32-* | le64-* \ + | lm32-* \ | m32c-* | m32r-* | m32rle-* \ | m68000-* | m680[012346]0-* | m68360-* | m683?2-* | m68k-* \ - | m88110-* | m88k-* | maxq-* | mcore-* \ + | m88110-* | m88k-* | maxq-* | mcore-* | metag-* \ + | microblaze-* | microblazeel-* \ | mips-* | mipsbe-* | mipseb-* | mipsel-* | mipsle-* \ | mips16-* \ | mips64-* | mips64el-* \ - | mips64vr-* | mips64vrel-* \ + | mips64octeon-* | mips64octeonel-* \ | mips64orion-* | mips64orionel-* \ + | mips64r5900-* | mips64r5900el-* \ + | mips64vr-* | mips64vrel-* \ | mips64vr4100-* | mips64vr4100el-* \ | mips64vr4300-* | mips64vr4300el-* \ | mips64vr5000-* | mips64vr5000el-* \ @@ -347,31 +404,41 @@ case $basic_machine in | mipsisa64r2-* | mipsisa64r2el-* \ | mipsisa64sb1-* | mipsisa64sb1el-* \ | mipsisa64sr71k-* | mipsisa64sr71kel-* \ + | mipsr5900-* | mipsr5900el-* \ | mipstx39-* | mipstx39el-* \ | mmix-* \ | mt-* \ | msp430-* \ - | nios-* | nios2-* \ + | nds32-* | nds32le-* | nds32be-* \ + | nios-* | nios2-* | nios2eb-* | nios2el-* \ | none-* | np1-* | ns16k-* | ns32k-* \ + | open8-* \ | orion-* \ | pdp10-* | pdp11-* | pj-* | pjl-* | pn-* | power-* \ - | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* | ppcbe-* \ + | powerpc-* | powerpc64-* | powerpc64le-* | powerpcle-* \ | pyramid-* \ - | romp-* | rs6000-* \ - | sh-* | sh[1234]-* | sh[24]a-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \ + | rl78-* | romp-* | rs6000-* | rx-* \ + | sh-* | sh[1234]-* | sh[24]a-* | sh[24]aeb-* | sh[23]e-* | sh[34]eb-* | sheb-* | shbe-* \ | shle-* | sh[1234]le-* | sh3ele-* | sh64-* | sh64le-* \ | sparc-* | sparc64-* | sparc64b-* | sparc64v-* | sparc86x-* | sparclet-* \ | sparclite-* \ - | sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | strongarm-* | sv1-* | sx?-* \ - | tahoe-* | thumb-* \ + | sparcv8-* | sparcv9-* | sparcv9b-* | sparcv9v-* | sv1-* | sx?-* \ + | tahoe-* \ | tic30-* | tic4x-* | tic54x-* | tic55x-* | tic6x-* | tic80-* \ + | tile*-* \ | tron-* \ - | v850-* | v850e-* | vax-* \ + | ubicom32-* \ + | v850-* | v850e-* | v850e1-* | v850es-* | v850e2-* | v850e2v3-* \ + | vax-* \ | we32k-* \ - | x86-* | x86_64-* | xc16x-* | xps100-* | xscale-* | xscalee[bl]-* \ - | xstormy16-* | xtensa-* \ + | x86-* | x86_64-* | xc16x-* | xps100-* \ + | xstormy16-* | xtensa*-* \ | ymp-* \ - | z8k-*) + | z8k-* | z80-*) + ;; + # Recognize the basic CPU types without company name, with glob match. + xtensa*) + basic_machine=$basic_machine-unknown ;; # Recognize the various machine names and aliases which stand # for a CPU type and a company and sometimes even an OS. @@ -389,7 +456,7 @@ case $basic_machine in basic_machine=a29k-amd os=-udi ;; - abacus) + abacus) basic_machine=abacus-unknown ;; adobe68k) @@ -435,6 +502,10 @@ case $basic_machine in basic_machine=m68k-apollo os=-bsd ;; + aros) + basic_machine=i386-pc + os=-aros + ;; aux) basic_machine=m68k-apple os=-aux @@ -443,10 +514,35 @@ case $basic_machine in basic_machine=ns32k-sequent os=-dynix ;; + blackfin) + basic_machine=bfin-unknown + os=-linux + ;; + blackfin-*) + basic_machine=bfin-`echo $basic_machine | sed 's/^[^-]*-//'` + os=-linux + ;; + bluegene*) + basic_machine=powerpc-ibm + os=-cnk + ;; + c54x-*) + basic_machine=tic54x-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + c55x-*) + basic_machine=tic55x-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + c6x-*) + basic_machine=tic6x-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; c90) basic_machine=c90-cray os=-unicos ;; + cegcc) + basic_machine=arm-unknown + os=-cegcc + ;; convex-c1) basic_machine=c1-convex os=-bsd @@ -475,8 +571,8 @@ case $basic_machine in basic_machine=craynv-cray os=-unicosmp ;; - cr16c) - basic_machine=cr16c-unknown + cr16 | cr16-*) + basic_machine=cr16-unknown os=-elf ;; crds | unos) @@ -514,6 +610,10 @@ case $basic_machine in basic_machine=m88k-motorola os=-sysv3 ;; + dicos) + basic_machine=i686-pc + os=-dicos + ;; djgpp) basic_machine=i586-pc os=-msdosdjgpp @@ -629,7 +729,6 @@ case $basic_machine in i370-ibm* | ibm*) basic_machine=i370-ibm ;; -# I'm not sure what "Sysv32" means. Should this be sysv3.2? i*86v32) basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` os=-sysv32 @@ -668,6 +767,14 @@ case $basic_machine in basic_machine=m68k-isi os=-sysv ;; + m68knommu) + basic_machine=m68k-unknown + os=-linux + ;; + m68knommu-*) + basic_machine=m68k-`echo $basic_machine | sed 's/^[^-]*-//'` + os=-linux + ;; m88k-omron*) basic_machine=m88k-omron ;; @@ -679,6 +786,13 @@ case $basic_machine in basic_machine=ns32k-utek os=-sysv ;; + microblaze*) + basic_machine=microblaze-xilinx + ;; + mingw64) + basic_machine=x86_64-pc + os=-mingw64 + ;; mingw32) basic_machine=i386-pc os=-mingw32 @@ -715,10 +829,18 @@ case $basic_machine in ms1-*) basic_machine=`echo $basic_machine | sed -e 's/ms1-/mt-/'` ;; + msys) + basic_machine=i386-pc + os=-msys + ;; mvs) basic_machine=i370-ibm os=-mvs ;; + nacl) + basic_machine=le32-unknown + os=-nacl + ;; ncr3000) basic_machine=i486-ncr os=-sysv4 @@ -783,6 +905,12 @@ case $basic_machine in np1) basic_machine=np1-gould ;; + neo-tandem) + basic_machine=neo-tandem + ;; + nse-tandem) + basic_machine=nse-tandem + ;; nsr-tandem) basic_machine=nsr-tandem ;; @@ -813,6 +941,14 @@ case $basic_machine in basic_machine=i860-intel os=-osf ;; + parisc) + basic_machine=hppa-unknown + os=-linux + ;; + parisc-*) + basic_machine=hppa-`echo $basic_machine | sed 's/^[^-]*-//'` + os=-linux + ;; pbd) basic_machine=sparc-tti ;; @@ -857,9 +993,10 @@ case $basic_machine in ;; power) basic_machine=power-ibm ;; - ppc) basic_machine=powerpc-unknown + ppc | ppcbe) basic_machine=powerpc-unknown ;; - ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'` + ppc-* | ppcbe-*) + basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'` ;; ppcle | powerpclittle | ppc-le | powerpc-little) basic_machine=powerpcle-unknown @@ -884,7 +1021,11 @@ case $basic_machine in basic_machine=i586-unknown os=-pw32 ;; - rdos) + rdos | rdos64) + basic_machine=x86_64-pc + os=-rdos + ;; + rdos32) basic_machine=i386-pc os=-rdos ;; @@ -953,6 +1094,9 @@ case $basic_machine in basic_machine=i860-stratus os=-sysv4 ;; + strongarm-* | thumb-*) + basic_machine=arm-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; sun2) basic_machine=m68000-sun ;; @@ -1009,17 +1153,9 @@ case $basic_machine in basic_machine=t90-cray os=-unicos ;; - tic54x | c54x*) - basic_machine=tic54x-unknown - os=-coff - ;; - tic55x | c55x*) - basic_machine=tic55x-unknown - os=-coff - ;; - tic6x | c6x*) - basic_machine=tic6x-unknown - os=-coff + tile*) + basic_machine=$basic_machine-unknown + os=-linux-gnu ;; tx39) basic_machine=mipstx39-unknown @@ -1027,10 +1163,6 @@ case $basic_machine in tx39el) basic_machine=mipstx39el-unknown ;; - tile*) - basic_machine=tile-tilera - os=-linux-gnu - ;; toad1) basic_machine=pdp10-xkl os=-tops20 @@ -1092,6 +1224,9 @@ case $basic_machine in xps | xps100) basic_machine=xps100-honeywell ;; + xscale-* | xscalee[bl]-*) + basic_machine=`echo $basic_machine | sed 's/^xscale/arm/'` + ;; ymp) basic_machine=ymp-cray os=-unicos @@ -1100,6 +1235,10 @@ case $basic_machine in basic_machine=z8k-unknown os=-sim ;; + z80-*-coff) + basic_machine=z80-unknown + os=-sim + ;; none) basic_machine=none-none os=-none @@ -1138,7 +1277,7 @@ case $basic_machine in we32k) basic_machine=we32k-att ;; - sh[1234] | sh[24]a | sh[34]eb | sh[1234]le | sh[23]ele) + sh[1234] | sh[24]a | sh[24]aeb | sh[34]eb | sh[1234]le | sh[23]ele) basic_machine=sh-unknown ;; sparc | sparcv8 | sparcv9 | sparcv9b | sparcv9v) @@ -1185,9 +1324,12 @@ esac if [ x"$os" != x"" ] then case $os in - # First match some system type aliases - # that might get confused with valid system types. + # First match some system type aliases + # that might get confused with valid system types. # -solaris* is a basic system type, with this one exception. + -auroraux) + os=-auroraux + ;; -solaris1 | -solaris1.*) os=`echo $os | sed -e 's|solaris1|sunos4|'` ;; @@ -1208,21 +1350,23 @@ case $os in # Each alternative MUST END IN A *, to match a version number. # -sysv* is not here because it comes later, after sysvr4. -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \ - | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\ - | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \ + | -*vms* | -sco* | -esix* | -isc* | -aix* | -cnk* | -sunos | -sunos[34]*\ + | -hpux* | -unos* | -osf* | -luna* | -dgux* | -auroraux* | -solaris* \ + | -sym* | -kopensolaris* | -plan9* \ | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \ - | -aos* \ + | -aos* | -aros* \ | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \ | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \ | -hiux* | -386bsd* | -knetbsd* | -mirbsd* | -netbsd* \ - | -openbsd* | -solidbsd* \ + | -bitrig* | -openbsd* | -solidbsd* \ | -ekkobsd* | -kfreebsd* | -freebsd* | -riscix* | -lynxos* \ | -bosx* | -nextstep* | -cxux* | -aout* | -elf* | -oabi* \ | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \ | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \ - | -chorusos* | -chorusrdb* \ - | -cygwin* | -pe* | -psos* | -moss* | -proelf* | -rtems* \ - | -mingw32* | -linux-gnu* | -linux-newlib* | -linux-uclibc* \ + | -chorusos* | -chorusrdb* | -cegcc* \ + | -cygwin* | -msys* | -pe* | -psos* | -moss* | -proelf* | -rtems* \ + | -mingw32* | -mingw64* | -linux-gnu* | -linux-android* \ + | -linux-newlib* | -linux-musl* | -linux-uclibc* \ | -uxpv* | -beos* | -mpeix* | -udk* \ | -interix* | -uwin* | -mks* | -rhapsody* | -darwin* | -opened* \ | -openstep* | -oskit* | -conix* | -pw32* | -nonstopux* \ @@ -1230,7 +1374,7 @@ case $os in | -os2* | -vos* | -palmos* | -uclinux* | -nucleus* \ | -morphos* | -superux* | -rtmk* | -rtmk-nova* | -windiss* \ | -powermax* | -dnix* | -nx6 | -nx7 | -sei* | -dragonfly* \ - | -skyos* | -haiku* | -rdos* | -toppers* | -drops*) + | -skyos* | -haiku* | -rdos* | -toppers* | -drops* | -es*) # Remember, each alternative MUST END IN *, to match a version number. ;; -qnx*) @@ -1269,7 +1413,7 @@ case $os in -opened*) os=-openedition ;; - -os400*) + -os400*) os=-os400 ;; -wince*) @@ -1318,7 +1462,7 @@ case $os in -sinix*) os=-sysv4 ;; - -tpf*) + -tpf*) os=-tpf ;; -triton*) @@ -1354,12 +1498,14 @@ case $os in -aros*) os=-aros ;; - -kaos*) - os=-kaos - ;; -zvmoe) os=-zvmoe ;; + -dicos*) + os=-dicos + ;; + -nacl*) + ;; -none) ;; *) @@ -1382,10 +1528,10 @@ else # system, and we'll never get to this point. case $basic_machine in - score-*) + score-*) os=-elf ;; - spu-*) + spu-*) os=-elf ;; *-acorn) @@ -1397,8 +1543,20 @@ case $basic_machine in arm*-semi) os=-aout ;; - c4x-* | tic4x-*) - os=-coff + c4x-* | tic4x-*) + os=-coff + ;; + hexagon-*) + os=-elf + ;; + tic54x-*) + os=-coff + ;; + tic55x-*) + os=-coff + ;; + tic6x-*) + os=-coff ;; # This must come before the *-dec entry. pdp10-*) @@ -1418,14 +1576,11 @@ case $basic_machine in ;; m68000-sun) os=-sunos3 - # This also exists in the configure program, but was not the - # default. - # os=-sunos4 ;; m68*-cisco) os=-aout ;; - mep-*) + mep-*) os=-elf ;; mips*-cisco) @@ -1434,6 +1589,9 @@ case $basic_machine in mips*-*) os=-elf ;; + or1k-*) + os=-elf + ;; or32-*) os=-coff ;; @@ -1452,7 +1610,7 @@ case $basic_machine in *-ibm) os=-aix ;; - *-knuth) + *-knuth) os=-mmixware ;; *-wec) @@ -1557,7 +1715,7 @@ case $basic_machine in -sunos*) vendor=sun ;; - -aix*) + -cnk*|-aix*) vendor=ibm ;; -beos*) @@ -1628,3 +1786,4 @@ exit # time-stamp-format: "%:y-%02m-%02d" # time-stamp-end: "'" # End: + diff --git a/lib/common_test/src/Makefile b/lib/common_test/src/Makefile index dd2923ece9..4600c0ad78 100644 --- a/lib/common_test/src/Makefile +++ b/lib/common_test/src/Makefile @@ -1,7 +1,7 @@ # # %CopyrightBegin% # -# Copyright Ericsson AB 2003-2012. All Rights Reserved. +# Copyright Ericsson AB 2003-2013. All Rights Reserved. # # The contents of this file are subject to the Erlang Public License, # Version 1.1, (the "License"); you may not use this file except in @@ -97,7 +97,7 @@ DTD_FILES = \ # ---------------------------------------------------- ERL_COMPILE_FLAGS += -pa ../ebin -I../include -I $(ERL_TOP)/lib/snmp/include/ \ -I../../test_server/include -I../../xmerl/inc/ \ - -I $(ERL_TOP)/lib/kernel/include + -I $(ERL_TOP)/lib/kernel/include -Werror # ---------------------------------------------------- # Targets @@ -127,10 +127,10 @@ clean: # Special Build Targets # ---------------------------------------------------- $(APP_TARGET): $(APP_SRC) ../vsn.mk - sed -e 's;%VSN%;$(VSN);' $< > $@ + $(vsn_verbose)sed -e 's;%VSN%;$(VSN);' $< > $@ $(APPUP_TARGET): $(APPUP_SRC) ../vsn.mk - sed -e 's;%VSN%;$(VSN);' $< > $@ + $(vsn_verbose)sed -e 's;%VSN%;$(VSN);' $< > $@ # ---------------------------------------------------- # Release Target diff --git a/lib/common_test/src/ct.erl b/lib/common_test/src/ct.erl index ad9bf4e2d6..04a95a53fa 100644 --- a/lib/common_test/src/ct.erl +++ b/lib/common_test/src/ct.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2012. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -144,11 +144,11 @@ run(TestDirs) -> %%% @spec run_test(Opts) -> Result %%% Opts = [OptTuples] %%% OptTuples = {dir,TestDirs} | {suite,Suites} | {group,Groups} | -%%% {testcase,Cases} | {spec,TestSpecs} | {label,Label} | -%%% {config,CfgFiles} | {userconfig, UserConfig} | +%%% {testcase,Cases} | {spec,TestSpecs} | {join_specs,Bool} | +%%% {label,Label} | {config,CfgFiles} | {userconfig, UserConfig} | %%% {allow_user_terms,Bool} | {logdir,LogDir} | %%% {silent_connections,Conns} | {stylesheet,CSSFile} | -%%% {cover,CoverSpecFile} | {step,StepOpts} | +%%% {cover,CoverSpecFile} | {cover_stop,Bool} | {step,StepOpts} | %%% {event_handler,EventHandlers} | {include,InclDirs} | %%% {auto_compile,Bool} | {create_priv_dir,CreatePrivDir} | %%% {multiply_timetraps,M} | {scale_timetraps,Bool} | @@ -735,7 +735,7 @@ fail(Format, Args) -> %%% overwrites the string set by this function.</p> comment(Comment) when is_list(Comment) -> Formatted = - case (catch io_lib:format("~s",[Comment])) of + case (catch io_lib:format("~ts",[Comment])) of {'EXIT',_} -> % it's a list not a string io_lib:format("~p",[Comment]); String -> @@ -988,8 +988,9 @@ get_testdata(Key) -> end. %%%----------------------------------------------------------------- -%%% @spec abort_current_testcase(Reason) -> ok | {error,no_testcase_running} +%%% @spec abort_current_testcase(Reason) -> ok | {error,ErrorReason} %%% Reason = term() +%%% ErrorReason = no_testcase_running | parallel_group %%% %%% @doc <p>When calling this function, the currently executing test case will be aborted. %%% It is the user's responsibility to know for sure which test case is currently diff --git a/lib/common_test/src/ct_config.erl b/lib/common_test/src/ct_config.erl index b1d709bc75..c35cbd3c08 100644 --- a/lib/common_test/src/ct_config.erl +++ b/lib/common_test/src/ct_config.erl @@ -1,7 +1,7 @@ %%-------------------------------------------------------------------- %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2010-2012. All Rights Reserved. +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -266,7 +266,10 @@ read_config_files_int([{Callback, File}|Files], FunToSave) -> read_config_files_int([], _FunToSave) -> ok. -store_config(Config, Callback, File) -> +store_config(Config, Callback, File) when is_tuple(Config) -> + store_config([Config], Callback, File); + +store_config(Config, Callback, File) when is_list(Config) -> [ets:insert(?attr_table, #ct_conf{key=Key, value=Val, @@ -607,7 +610,7 @@ encrypt_config_file(SrcFileName, EncryptFileName, {key,Key}) -> EncBin = crypto:des3_cbc_encrypt(K1, K2, K3, IVec, Bin2), case file:write_file(EncryptFileName, EncBin) of ok -> - io:format("~s --(encrypt)--> ~s~n", + io:format("~ts --(encrypt)--> ~ts~n", [SrcFileName,EncryptFileName]), ok; {error,Reason} -> @@ -649,7 +652,7 @@ decrypt_config_file(EncryptFileName, TargetFileName, {key,Key}) -> _ -> case file:write_file(TargetFileName, SrcBin) of ok -> - io:format("~s --(decrypt)--> ~s~n", + io:format("~ts --(decrypt)--> ~ts~n", [EncryptFileName,TargetFileName]), ok; {error,Reason} -> @@ -700,7 +703,7 @@ get_crypt_key_from_file() -> _ -> case catch string:tokens(binary_to_list(Result), [$\n,$\r]) of [Key] -> - io:format("~nCrypt key file: ~s~n", [FullName]), + io:format("~nCrypt key file: ~ts~n", [FullName]), Key; _ -> {error,{bad_crypt_file,FullName}} diff --git a/lib/common_test/src/ct_config_plain.erl b/lib/common_test/src/ct_config_plain.erl index 237df5c8f3..c6547f0a40 100644 --- a/lib/common_test/src/ct_config_plain.erl +++ b/lib/common_test/src/ct_config_plain.erl @@ -1,7 +1,7 @@ %%-------------------------------------------------------------------- %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2010-2011. All Rights Reserved. +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -47,7 +47,7 @@ read_config(ConfigFile) -> {error,no_crypt_file} -> {error,{config_file_error, lists:flatten( - io_lib:format("~s",[file:format_error(Reason)]))}}; + io_lib:format("~ts",[file:format_error(Reason)]))}}; {error,CryptError} -> {error,{decrypt_file_error,CryptError}}; _ when is_list(Key) -> diff --git a/lib/common_test/src/ct_conn_log_h.erl b/lib/common_test/src/ct_conn_log_h.erl index d7bd18606b..ac08a3e0ad 100644 --- a/lib/common_test/src/ct_conn_log_h.erl +++ b/lib/common_test/src/ct_conn_log_h.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2012. All Rights Reserved. +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -52,7 +52,7 @@ open_files([],State) -> do_open_files([{Tag,File}|Logs],Acc) -> - case file:open(File, [write]) of + case file:open(File, [write,{encoding,utf8}]) of {ok,Fd} -> do_open_files(Logs,[{Tag,Fd}|Acc]); {error,Reason} -> @@ -98,9 +98,9 @@ terminate(_,#state{logs=Logs}) -> %%% Writing reports write_report(Time,#conn_log{module=ConnMod}=Info,Data,State) -> {LogType,Fd} = get_log(Info,State), - io:format(Fd,"~n~s~s~s",[format_head(ConnMod,LogType,Time), - format_title(LogType,Info), - format_data(ConnMod,LogType,Data)]). + io:format(Fd,"~n~ts~ts~ts",[format_head(ConnMod,LogType,Time), + format_title(LogType,Info), + format_data(ConnMod,LogType,Data)]). write_error(Time,#conn_log{module=ConnMod}=Info,Report,State) -> case get_log(Info,State) of @@ -109,9 +109,10 @@ write_error(Time,#conn_log{module=ConnMod}=Info,Report,State) -> %% sasl error handler, so don't write it again. ok; {LogType,Fd} -> - io:format(Fd,"~n~s~s~s",[format_head(ConnMod,LogType,Time," ERROR"), - format_title(LogType,Info), - format_error(LogType,Report)]) + io:format(Fd,"~n~ts~ts~ts", + [format_head(ConnMod,LogType,Time," ERROR"), + format_title(LogType,Info), + format_error(LogType,Report)]) end. get_log(Info,State) -> @@ -140,16 +141,16 @@ format_head(ConnMod,LogType,Time) -> format_head(ConnMod,LogType,Time,""). format_head(ConnMod,raw,Time,Text) -> - io_lib:format("~n~p, ~p~s, ",[now_to_time(Time),ConnMod,Text]); + io_lib:format("~n~w, ~w~ts, ",[now_to_time(Time),ConnMod,Text]); format_head(ConnMod,_,Time,Text) -> Head = pad_char_end(?WIDTH,pretty_head(now_to_time(Time),ConnMod,Text),$=), - io_lib:format("~n~s",[Head]). + io_lib:format("~n~ts",[Head]). format_title(raw,#conn_log{client=Client}=Info) -> - io_lib:format("Client ~p ~s ~s",[Client,actionstr(Info),serverstr(Info)]); + io_lib:format("Client ~w ~s ~ts",[Client,actionstr(Info),serverstr(Info)]); format_title(_,Info) -> Title = pad_char_end(?WIDTH,pretty_title(Info),$=), - io_lib:format("~n~s", [Title]). + io_lib:format("~n~ts", [Title]). format_data(_,_,NoData) when NoData == ""; NoData == <<>> -> ""; @@ -162,8 +163,6 @@ format_error(pretty,Report) -> [io_lib:format("~n ~p: ~p",[K,V]) || {K,V} <- Report]. - - %%%----------------------------------------------------------------- %%% Helpers conn_info(LoggingProc, #conn_log{client=undefined} = ConnInfo) -> @@ -187,12 +186,12 @@ now_to_time({_,_,MicroS}=Now) -> pretty_head({{{Y,Mo,D},{H,Mi,S}},MicroS},ConnMod,Text0) -> Text = string:to_upper(atom_to_list(ConnMod) ++ Text0), - io_lib:format("= ~s ==== ~s-~s-~p::~s:~s:~s,~s ", + io_lib:format("= ~s ==== ~s-~s-~w::~s:~s:~s,~s ", [Text,t(D),month(Mo),Y,t(H),t(Mi),t(S), micro2milli(MicroS)]). pretty_title(#conn_log{client=Client}=Info) -> - io_lib:format("= Client ~p ~s Server ~s ", + io_lib:format("= Client ~w ~s Server ~ts ", [Client,actionstr(Info),serverstr(Info)]). actionstr(#conn_log{action=send}) -> "----->"; @@ -204,7 +203,7 @@ actionstr(_) -> "<---->". serverstr(#conn_log{name=undefined,address=Address}) -> io_lib:format("~p",[Address]); serverstr(#conn_log{name=Alias,address=Address}) -> - io_lib:format("~p(~p)",[Alias,Address]). + io_lib:format("~w(~p)",[Alias,Address]). month(1) -> "Jan"; month(2) -> "Feb"; diff --git a/lib/common_test/src/ct_cover.erl b/lib/common_test/src/ct_cover.erl index d39f50ba00..ae671c750a 100644 --- a/lib/common_test/src/ct_cover.erl +++ b/lib/common_test/src/ct_cover.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2009. All Rights Reserved. +%% Copyright Ericsson AB 2006-2012. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -24,7 +24,7 @@ -module(ct_cover). --export([get_spec/1, add_nodes/1, remove_nodes/1]). +-export([get_spec/1, add_nodes/1, remove_nodes/1, cross_cover_analyse/2]). -include("ct_util.hrl"). @@ -100,6 +100,22 @@ remove_nodes(Nodes) -> %%%----------------------------------------------------------------- +%%% @spec cross_cover_analyse(Level,Tests) -> ok +%%% Level = overview | details +%%% Tests = [{Tag,Dir}] +%%% Tag = atom() +%%% Dir = string() +%%% +%%% @doc Accumulate cover results over multiple tests. +%%% See the chapter about <seealso +%%% marker="cover_chapter#cross_cover">cross cover +%%% analysis</seealso> in the users's guide. +%%% +cross_cover_analyse(Level,Tests) -> + test_server_ctrl:cross_cover_analyse(Level,Tests). + + +%%%----------------------------------------------------------------- %%% @hidden %% Read cover specification file and return the parsed info. @@ -249,9 +265,11 @@ get_app_info(App=#cover{app=Name}, [{excl_mods,Name,Mods1}|Terms]) -> Mods = App#cover.excl_mods, get_app_info(App#cover{excl_mods=Mods++Mods1},Terms); -get_app_info(App=#cover{app=Name}, [{cross_apps,Name,AppMods1}|Terms]) -> - AppMods = App#cover.cross, - get_app_info(App#cover{cross=AppMods++AppMods1},Terms); +get_app_info(App=#cover{app=none}, [{cross,Cross}|Terms]) -> + get_app_info(App, [{cross,none,Cross}|Terms]); +get_app_info(App=#cover{app=Name}, [{cross,Name,Cross1}|Terms]) -> + Cross = App#cover.cross, + get_app_info(App#cover{cross=Cross++Cross1},Terms); get_app_info(App=#cover{app=none}, [{src_dirs,Dirs}|Terms]) -> get_app_info(App, [{src_dirs,none,Dirs}|Terms]); @@ -354,10 +372,10 @@ remove_excludes_and_dups(CoverData=#cover{excl_mods=Excl,incl_mods=Incl}) -> files2mods(Info=#cover{excl_mods=ExclFs, incl_mods=InclFs, - cross=CrossFs}) -> + cross=Cross}) -> Info#cover{excl_mods=files2mods1(ExclFs), incl_mods=files2mods1(InclFs), - cross=files2mods1(CrossFs)}. + cross=[{Tag,files2mods1(Fs)} || {Tag,Fs} <- Cross]}. files2mods1([M|Fs]) when is_atom(M) -> [M|files2mods1(Fs)]; diff --git a/lib/common_test/src/ct_event.erl b/lib/common_test/src/ct_event.erl index 49e0635d79..c1c1d943b9 100644 --- a/lib/common_test/src/ct_event.erl +++ b/lib/common_test/src/ct_event.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2012. All Rights Reserved. +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -150,7 +150,7 @@ init(RecvPids) -> %%-------------------------------------------------------------------- handle_event(Event,State=#state{receivers=RecvPids}) -> print("~n=== ~w ===~n", [?MODULE]), - print("~p: ~p~n", [Event#event.name,Event#event.data]), + print("~w: ~w~n", [Event#event.name,Event#event.data]), lists:foreach(fun(Recv) -> report_event(Recv,Event) end, RecvPids), {ok,State}. diff --git a/lib/common_test/src/ct_framework.erl b/lib/common_test/src/ct_framework.erl index 403eab66cb..5fe4eaf511 100644 --- a/lib/common_test/src/ct_framework.erl +++ b/lib/common_test/src/ct_framework.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2004-2012. All Rights Reserved. +%% Copyright Ericsson AB 2004-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -750,12 +750,12 @@ error_notification(Mod,Func,_Args,{Error,Loc}) -> Descr1 = lists:flatten(io_lib:format("~P",[Descr,10])), if length(Descr1) > 50 -> Descr2 = string:substr(Descr1,1,50), - io_lib:format("{badmatch,~s...}",[Descr2]); + io_lib:format("{badmatch,~ts...}",[Descr2]); true -> - io_lib:format("{badmatch,~s}",[Descr1]) + io_lib:format("{badmatch,~ts}",[Descr1]) end; {test_case_failed,Reason} -> - case (catch io_lib:format("{test_case_failed,~s}", [Reason])) of + case (catch io_lib:format("{test_case_failed,~ts}", [Reason])) of {'EXIT',_} -> io_lib:format("{test_case_failed,~p}", [Reason]); Result -> Result @@ -788,7 +788,7 @@ error_notification(Mod,Func,_Args,{Error,Loc}) -> "<font color=\"green\">" ++ "(" ++ "</font>" ++ Comment ++ "<font color=\"green\">" ++ ")" ++ "</font>", - Str = io_lib:format("~s ~s", [ErrorHtml,CommentHtml]), + Str = io_lib:format("~ts ~ts", [ErrorHtml,CommentHtml]), test_server:comment(Str) end end, @@ -803,24 +803,24 @@ error_notification(Mod,Func,_Args,{Error,Loc}) -> end, case Loc of [{?MODULE,error_in_suite}] -> - PrintErr("Error in suite detected: ~s", [ErrStr]); + PrintErr("Error in suite detected: ~ts", [ErrStr]); R when R == unknown; R == undefined -> - PrintErr("Error detected: ~s", [ErrStr]); + PrintErr("Error detected: ~ts", [ErrStr]); %% if a function specified by all/0 does not exist, we %% pick up undef here [{LastMod,LastFunc}|_] when ErrStr == "undef" -> - PrintErr("~w:~w could not be executed~nReason: ~s", + PrintErr("~w:~w could not be executed~nReason: ~ts", [LastMod,LastFunc,ErrStr]); [{LastMod,LastFunc}|_] -> - PrintErr("~w:~w failed~nReason: ~s", [LastMod,LastFunc,ErrStr]); + PrintErr("~w:~w failed~nReason: ~ts", [LastMod,LastFunc,ErrStr]); [{LastMod,LastFunc,LastLine}|_] -> %% print error to console, we are only %% interested in the last executed expression - PrintErr("~w:~w failed on line ~w~nReason: ~s", + PrintErr("~w:~w failed on line ~w~nReason: ~ts", [LastMod,LastFunc,LastLine,ErrStr]), case ct_util:read_suite_data({seq,Mod,Func}) of @@ -1184,13 +1184,19 @@ report(What,Data) -> ok; {error,Reason} -> ct_logs:log("COVER INFO", - "Importing cover data from: ~s fails! " + "Importing cover data from: ~ts fails! " "Reason: ~p", [Imp,Reason]) end end, Imps) end; tests_done -> ok; + severe_error -> + ct_event:sync_notify(#event{name=What, + node=node(), + data=Data}), + ct_util:set_testdata({What,Data}), + ok; tc_start -> %% Data = {{Suite,Func},LogFileName} ct_event:sync_notify(#event{name=tc_logfile, @@ -1343,4 +1349,7 @@ format_comment(Comment) -> %%%----------------------------------------------------------------- %%% @spec get_html_wrapper(TestName, PrintLabel, Cwd) -> Header get_html_wrapper(TestName, PrintLabel, Cwd, TableCols) -> - ct_logs:get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols). + get_html_wrapper(TestName, PrintLabel, Cwd, TableCols, utf8). + +get_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding) -> + ct_logs:get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding). diff --git a/lib/common_test/src/ct_gen_conn.erl b/lib/common_test/src/ct_gen_conn.erl index 1f01d84601..2d4b1d1f52 100644 --- a/lib/common_test/src/ct_gen_conn.erl +++ b/lib/common_test/src/ct_gen_conn.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2012. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -272,7 +272,7 @@ call(Pid, Msg, Timeout) -> after Timeout -> erlang:demonitor(MRef, [flush]), log("ct_gen_conn", - "Connection process ~p not responding. Killing now!", + "Connection process ~w not responding. Killing now!", [Pid]), exit(Pid, kill), {error,{process_down,Pid,forced_termination}} diff --git a/lib/common_test/src/ct_groups.erl b/lib/common_test/src/ct_groups.erl index 74ab5e5439..14a8aab881 100644 --- a/lib/common_test/src/ct_groups.erl +++ b/lib/common_test/src/ct_groups.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2004-2012. All Rights Reserved. +%% Copyright Ericsson AB 2004-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -462,7 +462,7 @@ make_conf(Mod, Name, Props, TestSpec) -> false -> ct_logs:log("TEST INFO", "init_per_group/2 and " "end_per_group/2 missing for group " - "~p in ~p, using default.", + "~w in ~w, using default.", [Name,Mod]), {{ct_framework,init_per_group}, {ct_framework,end_per_group}, diff --git a/lib/common_test/src/ct_hooks.erl b/lib/common_test/src/ct_hooks.erl index 1bcc63738e..3d87a82e24 100644 --- a/lib/common_test/src/ct_hooks.erl +++ b/lib/common_test/src/ct_hooks.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2004-2012. All Rights Reserved. +%% Copyright Ericsson AB 2004-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -362,11 +362,11 @@ catch_apply(M,F,A, Default) -> [{M,F,A,_}|_] when Reason == undef -> Default; Trace -> - ct_logs:log("Suite Hook","Call to CTH failed: ~p:~p", + ct_logs:log("Suite Hook","Call to CTH failed: ~w:~p", [error,{Reason,Trace}]), throw({error_in_cth_call, lists:flatten( - io_lib:format("~p:~p/~p CTH call failed", + io_lib:format("~w:~w/~w CTH call failed", [M,F,length(A)]))}) end end. diff --git a/lib/common_test/src/ct_logs.erl b/lib/common_test/src/ct_logs.erl index 0b7a8bb075..0b204a681a 100644 --- a/lib/common_test/src/ct_logs.erl +++ b/lib/common_test/src/ct_logs.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2012. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -35,9 +35,10 @@ -export([add_external_logs/1, add_link/3]). -export([make_last_run_index/0]). -export([make_all_suites_index/1,make_all_runs_index/1]). --export([get_ts_html_wrapper/4]). +-export([get_ts_html_wrapper/5]). -export([xhtml/2, locate_priv_file/1, make_relative/1]). -export([insert_javascript/1]). +-export([uri/1]). %% Logging stuff directly from testcase -export([tc_log/3, tc_log/4, tc_log_async/3, tc_print/3, tc_print/4, @@ -307,8 +308,8 @@ end_log() -> %%% calling test suite.</p> add_external_logs(Logs) -> start_log("External Logs"), - [cont_log("<a href=~p>~s</a>\n", - [filename:join("log_private",Log),Log]) || Log <- Logs], + [cont_log("<a href=\"~ts\">~ts</a>\n", + [uri(filename:join("log_private",Log)),Log]) || Log <- Logs], end_log(). %%%----------------------------------------------------------------- @@ -320,8 +321,8 @@ add_external_logs(Logs) -> %%% @doc Print a link to a given file stored in the priv_dir of the %%% calling test suite. add_link(Heading,File,Type) -> - log(Heading,"<a href=~p type=~p>~s</a>\n", - [filename:join("log_private",File),Type,File]). + log(Heading,"<a href=\"~ts\" type=~p>~ts</a>\n", + [uri(filename:join("log_private",File)),Type,File]). %%%----------------------------------------------------------------- @@ -396,9 +397,9 @@ tc_print(Category,Format,Args) -> %%% <p>This function is called by <code>ct</code> when printing %%% stuff from a testcase on the user console.</p> tc_print(Category,Importance,Format,Args) -> - VLvl = case ct_util:get_testdata({verbosity,Category}) of + VLvl = case ct_util:get_verbosity(Category) of undefined -> - ct_util:get_testdata({verbosity,'$unspecified'}); + ct_util:get_verbosity('$unspecified'); {error,bad_invocation} -> ?MAX_VERBOSITY; Val -> @@ -469,7 +470,7 @@ ct_log(Category,Format,Args) -> %%%================================================================= %%% Internal functions int_header() -> - "<div class=\"ct_internal\"><b>*** CT ~s *** ~s</b>". + "<div class=\"ct_internal\"><b>*** CT ~s *** ~ts</b>". int_footer() -> "</div>". @@ -692,7 +693,7 @@ logger_loop(State) -> logger_loop(State); {set_stylesheet,TC,SSFile} -> Fd = State#logger_state.ct_log_fd, - io:format(Fd, "~p loading external style sheet: ~s~n", + io:format(Fd, "~p loading external style sheet: ~ts~n", [TC,SSFile]), logger_loop(State#logger_state{stylesheet = SSFile}); {clear_stylesheet,_} when State#logger_state.stylesheet == undefined -> @@ -752,7 +753,7 @@ print_to_log(sync, FromPid, TCGL, List, State) -> IoProc = if FromPid /= TCGL -> TCGL; true -> State#logger_state.ct_log_fd end, - io:format(IoProc, "~s", [lists:foldl(IoFun, [], List)]), + io:format(IoProc, "~ts", [lists:foldl(IoFun, [], List)]), State; print_to_log(async, FromPid, TCGL, List, State) -> @@ -764,7 +765,7 @@ print_to_log(async, FromPid, TCGL, List, State) -> end, Printer = fun() -> test_server:permit_io(IoProc, self()), - io:format(IoProc, "~s", [lists:foldl(IoFun, [], List)]) + io:format(IoProc, "~ts", [lists:foldl(IoFun, [], List)]) end, case State#logger_state.async_print_jobs of [] -> @@ -868,7 +869,7 @@ set_evmgr_gl(GL) -> end. open_ctlog() -> - {ok,Fd} = file:open(?ct_log_name,[write]), + {ok,Fd} = file:open(?ct_log_name,[write,{encoding,utf8}]), io:format(Fd, header("Common Test Framework Log", {[],[1,2],[]}), []), case file:consult(ct_run:variables_file_name("../")) of {ok,Vars} -> @@ -878,7 +879,7 @@ open_ctlog() -> Dir = filename:dirname(Cwd), Variables = ct_run:variables_file_name(Dir), io:format(Fd, - "Can not read the file \'~s\' Reason: ~w\n" + "Can not read the file \'~ts\' Reason: ~w\n" "No configuration found for test!!\n", [Variables,Reason]) end, @@ -904,7 +905,7 @@ print_style(Fd,undefined) -> print_style(Fd,StyleSheet) -> case file:read_file(StyleSheet) of {ok,Bin} -> - Str = binary_to_list(Bin), + Str = b2s(Bin,encoding(StyleSheet)), Pos0 = case string:str(Str,"<style>") of 0 -> string:str(Str,"<STYLE>"); N0 -> N0 @@ -919,9 +920,9 @@ print_style(Fd,StyleSheet) -> print_style_error(Fd,StyleSheet,missing_style_end_tag); Pos0 /= 0 -> Style = string:sub_string(Str,Pos0,Pos1+7), - io:format(Fd,"~s\n",[Style]); + io:format(Fd,"~ts\n",[Style]); Pos0 == 0 -> - io:format(Fd,"<style>~s</style>\n",[Str]) + io:format(Fd,"<style>~ts</style>\n",[Str]) end; {error,Reason} -> print_style_error(Fd,StyleSheet,Reason) @@ -934,7 +935,7 @@ print_style(Fd,StyleSheet) -> %% [StyleSheet]). print_style_error(Fd,StyleSheet,Reason) -> - io:format(Fd,"\n<!-- Failed to load stylesheet ~s: ~p -->\n", + io:format(Fd,"\n<!-- Failed to load stylesheet ~ts: ~p -->\n", [StyleSheet,Reason]), print_style(Fd,undefined). @@ -963,7 +964,7 @@ make_last_run_index(StartTime) -> % io:put_chars("done\n"), ok; Err -> - io:format("Unknown internal error while updating ~s. " + io:format("Unknown internal error while updating ~ts. " "Please report.\n(Err: ~p, ID: 1)", [AbsIndexName,Err]), {error, Err} @@ -1001,7 +1002,7 @@ make_last_run_index1(StartTime,IndexName) -> %% write current Totals to file, later to be used in all_runs log write_totals_file(?totals_name,Label,Logs1,Totals), Index = [Index0|index_footer()], - case force_write_file(IndexName, Index) of + case force_write_file(IndexName, unicode:characters_to_binary(Index)) of ok -> ok; {error, Reason} -> @@ -1085,7 +1086,7 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip, CrashDumpName = SuiteName ++ "_erl_crash.dump", case filelib:is_file(CrashDumpName) of true -> - [" <a href=\"", CrashDumpName, + [" <a href=\"", uri(CrashDumpName), "\">(CrashDump)</a>"]; false -> "" @@ -1115,10 +1116,10 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip, [] -> "none"; _ -> "<a href=\""++?all_runs_name++"\">Old Runs</a>" end, - A = xhtml(["<td><font size=\"-1\"><a href=\"",CtLogFile, + A = xhtml(["<td><font size=\"-1\"><a href=\"",uri(CtLogFile), "\">CT Log</a></font></td>\n", "<td><font size=\"-1\">",OldRunsLink,"</font></td>\n"], - ["<td><a href=\"",CtLogFile,"\">CT Log</a></td>\n", + ["<td><a href=\"",uri(CtLogFile),"\">CT Log</a></td>\n", "<td>",OldRunsLink,"</td>\n"]), {L,T,N,A}; false -> @@ -1128,7 +1129,8 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip, if NotBuilt == 0 -> ["<td align=right>",integer_to_list(NotBuilt),"</td>\n"]; true -> - ["<td align=right><a href=\"",filename:join(CtRunDir,?ct_log_name),"\">", + ["<td align=right><a href=\"", + uri(filename:join(CtRunDir,?ct_log_name)),"\">", integer_to_list(NotBuilt),"</a></td>\n"] end, FailStr = @@ -1151,7 +1153,7 @@ make_one_index_entry1(SuiteName, Link, Label, Success, Fail, UserSkip, AutoSkip, [xhtml("<tr valign=top>\n", ["<tr class=\"",odd_or_even(),"\">\n"]), xhtml("<td><font size=\"-1\"><a href=\"", "<td><a href=\""), - LogFile,"\">",SuiteName,"</a>", CrashDumpLink, + uri(LogFile),"\">",SuiteName,"</a>", CrashDumpLink, xhtml("</font></td>\n", "</td>\n"), Lbl, Timestamp, "<td align=right>",integer_to_list(Success),"</td>\n", @@ -1364,8 +1366,9 @@ header1(Title, SubTitle, TableCols) -> "<head>\n", "<title>" ++ Title ++ " " ++ SubTitle ++ "</title>\n", "<meta http-equiv=\"cache-control\" content=\"no-cache\">\n", + "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n", xhtml("", - ["<link rel=\"stylesheet\" href=\"",CSSFile,"\" type=\"text/css\">\n"]), + ["<link rel=\"stylesheet\" href=\"",uri(CSSFile),"\" type=\"text/css\">\n"]), xhtml("", ["<script type=\"text/javascript\" src=\"",JQueryFile, "\"></script>\n"]), @@ -1462,7 +1465,7 @@ count_cases(Dir) -> LogFile = filename:join(Dir, ?suitelog_name), case file:read_file(LogFile) of {ok, Bin} -> - case count_cases1(binary_to_list(Bin), + case count_cases1(b2s(Bin), {undefined,undefined,undefined,undefined}) of {error,not_complete} -> %% The test is not complete - dont write summary @@ -1472,8 +1475,9 @@ count_cases(Dir) -> write_summary(SumFile, Summary), Summary end; - {error, _Reason} -> - io:format("\nFailed to read ~p (skipped)\n", [LogFile]), + {error, Reason} -> + io:format("\nFailed to read ~p: ~p (skipped)\n", + [LogFile,Reason]), error end end. @@ -1557,7 +1561,7 @@ config_table1([{Key,Value}|Vars]) -> "<td><pre>",io_lib:format("~p",[Value]),"</pre></td></tr>\n"], ["<tr class=\"", odd_or_even(), "\">\n", "<td>", atom_to_list(Key), "</td>\n", - "<td>", io_lib:format("~p",[Value]), "</td>\n</tr>\n"]) | + "<td>", io_lib:format("~p",[Value]), "</td>\n</tr>\n"]) | config_table1(Vars)]; config_table1([]) -> ["</tbody>\n</table>\n"]. @@ -1574,8 +1578,9 @@ make_all_runs_index(When) -> DirsSorted = (catch sort_all_runs(Dirs)), Header = all_runs_header(), Index = [runentry(Dir) || Dir <- DirsSorted], - Result = file:write_file(AbsName,Header++Index++ - all_runs_index_footer()), + Result = file:write_file(AbsName, + unicode:characters_to_binary( + Header++Index++all_runs_index_footer())), if When == start -> ok; true -> io:put_chars("done\n") end, @@ -1602,10 +1607,27 @@ sort_all_runs(Dirs) -> interactive_link() -> [Dir|_] = lists:reverse(filelib:wildcard(logdir_prefix()++"*.*")), CtLog = filename:join(Dir,"ctlog.html"), - Body = ["Log from last interactive run: <a href=\"",CtLog,"\">", - timestamp(Dir),"</a>"], - file:write_file("last_interactive.html",Body), - io:format("~n~nUpdated ~s\n" + Body = + [xhtml( + ["<!DOCTYPE HTML PUBLIC \"-//W3C//DTD HTML 3.2 Final//EN\">\n", + "<html>\n"], + ["<!DOCTYPE html PUBLIC \"-//W3C//DTD XHTML 1.0 Transitional//EN\"\n", + "\"http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd\">\n", + "<html xmlns=\"http://www.w3.org/1999/xhtml\" xml:lang=\"en\" lang=\"en\">\n"]), + "<!-- autogenerated by '"++atom_to_list(?MODULE)++"' -->\n", + "<head>\n", + "<title>Last interactive run</title>\n", + "<meta http-equiv=\"cache-control\" content=\"no-cache\">\n", + "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n", + "</head>\n", + "<body>\n", + "Log from last interactive run: <a href=\"",uri(CtLog),"\">", + timestamp(Dir),"</a>", + "</body>\n", + "</html>\n" + ], + file:write_file("last_interactive.html",unicode:characters_to_binary(Body)), + io:format("~n~nUpdated ~ts\n" "Any CT activities will be logged here\n", [?abs("last_interactive.html")]). @@ -1655,7 +1677,7 @@ runentry(Dir) -> TestNames; true -> Trunc = Polish(string:substr(TestNames,1,?testname_width-3)), - lists:flatten(io_lib:format("~s...",[Trunc])) + lists:flatten(io_lib:format("~ts...",[Trunc])) end, Total = TotSucc+TotFail+AllSkip, A = xhtml(["<td align=center><font size=\"-1\">",Node, @@ -1695,7 +1717,7 @@ runentry(Dir) -> "<td align=right>?</td>\n"], A++B++C end, - Index = filename:join(Dir,?index_name), + Index = uri(filename:join(Dir,?index_name)), [xhtml("<tr>\n", ["<tr class=\"",odd_or_even(),"\">\n"]), xhtml(["<td><font size=\"-1\"><a href=\"",Index,"\">",timestamp(Dir),"</a>", TotalsStr,"</font></td>\n"], @@ -1836,7 +1858,7 @@ make_all_suites_index(NewTestData = {_TestName,DirName}) -> ok -> ok; Err -> - io:format("Unknown internal error while updating ~s. " + io:format("Unknown internal error while updating ~ts. " "Please report.\n(Err: ~p, ID: 1)", [AbsIndexName,Err]), {error, Err} @@ -1900,7 +1922,7 @@ make_all_suites_index1(When, AbsIndexName, AllLogDirs) -> ok end; Err -> - io:format("Unknown internal error while updating ~s. " + io:format("Unknown internal error while updating ~ts. " "Please report.\n(Err: ~p, ID: 1)", [AbsIndexName,Err]), {error, Err} @@ -1912,7 +1934,7 @@ make_all_suites_index2(IndexName, AllTestLogDirs) -> all_suites_index_header(), 0, 0, 0, 0, 0, [], []), Index = [Index0|index_footer()], - case force_write_file(IndexName, Index) of + case force_write_file(IndexName, unicode:characters_to_binary(Index)) of ok -> {ok,CacheData}; {error, Reason} -> @@ -1970,7 +1992,7 @@ make_all_suites_ix_cached(AbsIndexName, NewTestData, Label, AllTestLogDirs) -> all_suites_index_header(IndexDir), 0, 0, 0, 0, 0), Index = [Index0|index_footer()], - case force_write_file(AbsIndexName, Index) of + case force_write_file(AbsIndexName, unicode:characters_to_binary(Index)) of ok -> ok; {error, Reason} -> @@ -2116,7 +2138,7 @@ simulate_logger_loop() -> receive {log,_,_,_,_,_,List} -> S = [[io_lib:format(Str,Args),io_lib:nl()] || {Str,Args} <- List], - io:format("~s",[S]), + io:format("~ts",[S]), simulate_logger_loop(); stop -> ok @@ -2273,11 +2295,12 @@ make_relative1(DirTs, CwdTs) -> Ups ++ DirTs. %%%----------------------------------------------------------------- -%%% @spec get_ts_html_wrapper(TestName, PrintLabel, Cwd) -> {Mode,Header,Footer} +%%% @spec get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding) +%%% -> {Mode,Header,Footer} %%% %%% @doc %%% -get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols) -> +get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols, Encoding) -> TestName1 = if is_list(TestName) -> lists:flatten(TestName); true -> @@ -2319,14 +2342,16 @@ get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols) -> "<html>\n", "<head><title>", TestName1, "</title>\n", "<meta http-equiv=\"cache-control\" content=\"no-cache\">\n", + "<meta http-equiv=\"content-type\" content=\"text/html; charset=", + html_encoding(Encoding),"\">\n", "</head>\n", "<body", Bgr, " bgcolor=\"white\" text=\"black\" ", "link=\"blue\" vlink=\"purple\" alink=\"red\">\n", LabelStr, "\n"], ["<center>\n<br><hr><p>\n", - "<a href=\"", AllRuns, + "<a href=\"", uri(AllRuns), "\">Test run history\n</a> | ", - "<a href=\"", TestIndex, + "<a href=\"", uri(TestIndex), "\">Top level test index\n</a>\n</p>\n", Copyright,"</center>\n</body>\n</html>\n"]}; _ -> @@ -2363,14 +2388,15 @@ get_ts_html_wrapper(TestName, PrintLabel, Cwd, TableCols) -> "<html xmlns=\"http://www.w3.org/1999/xhtml\" xml:lang=\"en\" lang=\"en\">\n", "<head>\n<title>", TestName1, "</title>\n", "<meta http-equiv=\"cache-control\" content=\"no-cache\">\n", - "<link rel=\"stylesheet\" href=\"", CSSFile, "\" type=\"text/css\">\n", + "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n", + "<link rel=\"stylesheet\" href=\"", uri(CSSFile), "\" type=\"text/css\">\n", "<script type=\"text/javascript\" src=\"", JQueryFile, "\"></script>\n", "<script type=\"text/javascript\" src=\"", TableSorterFile, "\"></script>\n"] ++ TableSorterScript ++ ["</head>\n","<body>\n", LabelStr, "\n"], ["<center>\n<br /><hr /><p>\n", - "<a href=\"", AllRuns, + "<a href=\"", uri(AllRuns), "\">Test run history\n</a> | ", - "<a href=\"", TestIndex, + "<a href=\"", uri(TestIndex), "\">Top level test index\n</a>\n</p>\n", Copyright,"</center>\n</body>\n</html>\n"]} end. @@ -2460,3 +2486,31 @@ insert_javascript({tablesorter,TableName, " $(\"#",TableName,"\").trigger(\"update\");\n", " $(\"#",TableName,"\").trigger(\"appendCache\");\n", "});\n</script>\n"]. + +uri("") -> + ""; +uri(Href) -> + test_server_ctrl:uri_encode(Href). + +%% Read magic comment to get encoding of text file. +%% If no magic comment exists, assume default encoding +encoding(File) -> + case epp:read_encoding(File) of + none -> + epp:default_encoding(); + E -> + E + end. + +%% Convert binary to string using default encoding +b2s(Bin) -> + b2s(Bin,epp:default_encoding()). + +%% Convert binary to string using given encoding +b2s(Bin,Encoding) -> + unicode:characters_to_list(Bin,Encoding). + +html_encoding(latin1) -> + "iso-8859-1"; +html_encoding(utf8) -> + "utf-8". diff --git a/lib/common_test/src/ct_make.erl b/lib/common_test/src/ct_make.erl index 8ddb91d355..d4bd81e78d 100644 --- a/lib/common_test/src/ct_make.erl +++ b/lib/common_test/src/ct_make.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2009-2011. All Rights Reserved. +%% Copyright Ericsson AB 2009-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -280,13 +280,13 @@ recompile(File, NoExec, Load, Opts) -> do_recompile(_File, true, _Load, _Opts) -> out_of_date; do_recompile(File, false, noload, Opts) -> - io:format("Recompile: ~s\n",[File]), + io:format("Recompile: ~ts\n",[File]), compile:file(File, [report_errors, report_warnings, error_summary |Opts]); do_recompile(File, false, load, Opts) -> - io:format("Recompile: ~s\n",[File]), + io:format("Recompile: ~ts\n",[File]), c:c(File, Opts); do_recompile(File, false, netload, Opts) -> - io:format("Recompile: ~s\n",[File]), + io:format("Recompile: ~ts\n",[File]), c:nc(File, Opts). exists(File) -> diff --git a/lib/common_test/src/ct_master.erl b/lib/common_test/src/ct_master.erl index 042c5ba267..b42ff73846 100644 --- a/lib/common_test/src/ct_master.erl +++ b/lib/common_test/src/ct_master.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2012. All Rights Reserved. +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -51,7 +51,7 @@ %%% {testcase,Cases} | {spec,TestSpecs} | {allow_user_terms,Bool} | %%% {logdir,LogDir} | {event_handler,EventHandlers} | %%% {silent_connections,Conns} | {cover,CoverSpecFile} | -%%% {userconfig, UserCfgFiles} +%%% {cover_stop,Bool} | {userconfig, UserCfgFiles} %%% CfgFiles = string() | [string()] %%% TestDirs = string() | [string()] %%% Suites = atom() | [atom()] @@ -82,39 +82,48 @@ run_test(NodeOptsList) when is_list(NodeOptsList) -> %%% ExclNodes = [atom()] %%% %%% @doc Tests are spawned on the nodes as specified in <code>TestSpecs</code>. -%%% Each specification in TestSpec will be handled separately. It is however possible -%%% to also specify a list of specifications that should be merged into one before -%%% the tests are executed. Any test without a particular node specification will -%%% also be executed on the nodes in <code>InclNodes</code>. Nodes in the -%%% <code>ExclNodes</code> list will be excluded from the test. +%%% Each specification in TestSpec will be handled separately. It is however +%%% possible to also specify a list of specifications that should be merged +%%% into one before the tests are executed. Any test without a particular node +%%% specification will also be executed on the nodes in <code>InclNodes</code>. +%%% Nodes in the <code>ExclNodes</code> list will be excluded from the test. run([TS|TestSpecs],AllowUserTerms,InclNodes,ExclNodes) when is_list(TS), is_list(InclNodes), is_list(ExclNodes) -> - TS1 = - case TS of - List=[S|_] when is_list(S) -> List; - Spec -> [Spec] - end, - Result = - case catch ct_testspec:collect_tests_from_file(TS1,InclNodes,AllowUserTerms) of - {error,Reason} -> - {error,Reason}; - TSRec=#testspec{logdir=AllLogDirs, - config=StdCfgFiles, - userconfig=UserCfgFiles, - include=AllIncludes, - init=AllInitOpts, - event_handler=AllEvHs} -> - AllCfgFiles = {StdCfgFiles, UserCfgFiles}, - RunSkipPerNode = ct_testspec:prepare_tests(TSRec), - RunSkipPerNode2 = exclude_nodes(ExclNodes,RunSkipPerNode), - run_all(RunSkipPerNode2,AllLogDirs,AllCfgFiles,AllEvHs, - AllIncludes,[],[],AllInitOpts,TS1) - end, - [{TS,Result} | run(TestSpecs,AllowUserTerms,InclNodes,ExclNodes)]; + %% Note: [Spec] means run one test with Spec + %% [Spec1,Spec2] means run two tests separately + %% [[Spec1,Spec2]] means run one test, with the two specs merged + case catch ct_testspec:collect_tests_from_file([TS],InclNodes, + AllowUserTerms) of + {error,Reason} -> + [{error,Reason} | run(TestSpecs,AllowUserTerms,InclNodes,ExclNodes)]; + Tests -> + RunResult = + lists:map( + fun({Specs,TSRec=#testspec{logdir=AllLogDirs, + config=StdCfgFiles, + userconfig=UserCfgFiles, + include=AllIncludes, + init=AllInitOpts, + event_handler=AllEvHs}}) -> + AllCfgFiles = + {StdCfgFiles,UserCfgFiles}, + RunSkipPerNode = + ct_testspec:prepare_tests(TSRec), + RunSkipPerNode2 = + exclude_nodes(ExclNodes,RunSkipPerNode), + TSList = if is_integer(hd(TS)) -> [TS]; + true -> TS end, + {Specs,run_all(RunSkipPerNode2,AllLogDirs, + AllCfgFiles,AllEvHs, + AllIncludes,[],[],AllInitOpts,TSList)} + end, Tests), + RunResult ++ run(TestSpecs,AllowUserTerms,InclNodes,ExclNodes) + end; run([],_,_,_) -> []; -run(TS,AllowUserTerms,InclNodes,ExclNodes) when is_list(InclNodes), is_list(ExclNodes) -> +run(TS,AllowUserTerms,InclNodes,ExclNodes) when is_list(InclNodes), + is_list(ExclNodes) -> run([TS],AllowUserTerms,InclNodes,ExclNodes). %%%----------------------------------------------------------------- @@ -152,29 +161,32 @@ exclude_nodes([],RunSkipPerNode) -> %%% AllowUserTerms = bool() %%% Node = atom() %%% -%%% @doc Tests are spawned on <code>Node</code> according to <code>TestSpecs</code>. +%%% @doc Tests are spawned on <code>Node</code> according to +%%% <code>TestSpecs</code>. run_on_node([TS|TestSpecs],AllowUserTerms,Node) when is_list(TS),is_atom(Node) -> - TS1 = - case TS of - [List|_] when is_list(List) -> List; - Spec -> [Spec] - end, - Result = - case catch ct_testspec:collect_tests_from_file(TS1,[Node],AllowUserTerms) of - {error,Reason} -> - {error,Reason}; - TSRec=#testspec{logdir=AllLogDirs, - config=StdCfgFiles, - init=AllInitOpts, - include=AllIncludes, - userconfig=UserCfgFiles, - event_handler=AllEvHs} -> - AllCfgFiles = {StdCfgFiles, UserCfgFiles}, - {Run,Skip} = ct_testspec:prepare_tests(TSRec,Node), - run_all([{Node,Run,Skip}],AllLogDirs,AllCfgFiles,AllEvHs, - AllIncludes, [],[],AllInitOpts,TS1) - end, - [{TS,Result} | run_on_node(TestSpecs,AllowUserTerms,Node)]; + case catch ct_testspec:collect_tests_from_file([TS],[Node], + AllowUserTerms) of + {error,Reason} -> + [{error,Reason} | run_on_node(TestSpecs,AllowUserTerms,Node)]; + Tests -> + RunResult = + lists:map( + fun({Specs,TSRec=#testspec{logdir=AllLogDirs, + config=StdCfgFiles, + init=AllInitOpts, + include=AllIncludes, + userconfig=UserCfgFiles, + event_handler=AllEvHs}}) -> + AllCfgFiles = {StdCfgFiles,UserCfgFiles}, + {Run,Skip} = ct_testspec:prepare_tests(TSRec,Node), + TSList = if is_integer(hd(TS)) -> [TS]; + true -> TS end, + {Specs,run_all([{Node,Run,Skip}],AllLogDirs, + AllCfgFiles,AllEvHs, + AllIncludes, [],[],AllInitOpts,TSList)} + end, Tests), + RunResult ++ run_on_node(TestSpecs,AllowUserTerms,Node) + end; run_on_node([],_,_) -> []; run_on_node(TS,AllowUserTerms,Node) when is_atom(Node) -> @@ -244,8 +256,9 @@ run_all([],AllLogDirs,_,AllEvHs,_AllIncludes, {value,{_,Dir}} -> Dir; false -> "." end, - log(tty,"Master Logdir","~s",[MasterLogDir]), - start_master(lists:reverse(NodeOpts),Handlers,MasterLogDir,LogDirs,InitOptions,Specs), + log(tty,"Master Logdir","~ts",[MasterLogDir]), + start_master(lists:reverse(NodeOpts),Handlers,MasterLogDir, + LogDirs,InitOptions,Specs), ok. @@ -297,13 +310,15 @@ start_master(NodeOptsList) -> start_master(NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Specs) -> Master = spawn_link(?MODULE,init_master,[self(),NodeOptsList,EvHandlers, - MasterLogDir,LogDirs,InitOptions,Specs]), + MasterLogDir,LogDirs, + InitOptions,Specs]), receive {Master,Result} -> Result end. %%% @hidden -init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Specs) -> +init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs, + InitOptions,Specs) -> case whereis(ct_master) of undefined -> register(ct_master,self()), @@ -325,13 +340,14 @@ init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Spec {MLPid,_} = ct_master_logs:start(MasterLogDir, [N || {N,_} <- NodeOptsList]), log(all,"Master Logger process started","~w",[MLPid]), + case Specs of [] -> ok; _ -> SpecsStr = lists:map(fun(Name) -> Name ++ " " end,Specs), - ct_master_logs:log("Test Specification file(s)","~s", + ct_master_logs:log("Test Specification file(s)","~ts", [lists:flatten(SpecsStr)]) end, @@ -340,7 +356,7 @@ init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Spec ct_master_event:add_handler(), %% add user handlers for master event manager Add = fun({H,Args}) -> - log(all,"Adding Event Handler","~p",[H]), + log(all,"Adding Event Handler","~w",[H]), case gen_event:add_handler(?CT_MEVMGR_REF,H,Args) of ok -> ok; {'EXIT',Why} -> exit(Why); @@ -359,7 +375,8 @@ init_master(Parent,NodeOptsList,EvHandlers,MasterLogDir,LogDirs,InitOptions,Spec init_master1(Parent,NodeOptsList,InitOptions,LogDirs). init_master1(Parent,NodeOptsList,InitOptions,LogDirs) -> - {Inaccessible,NodeOptsList1,InitOptions1} = init_nodes(NodeOptsList,InitOptions), + {Inaccessible,NodeOptsList1,InitOptions1} = init_nodes(NodeOptsList, + InitOptions), case Inaccessible of [] -> init_master2(Parent,NodeOptsList,LogDirs); @@ -391,8 +408,9 @@ init_master2(Parent,NodeOptsList,LogDirs) -> SpawnAndMon = fun({Node,Opts}) -> monitor_node(Node,true), - log(all,"Test Info","Starting test(s) on ~p...",[Node]), - {spawn_link(Node,?MODULE,init_node_ctrl,[self(),Cookie,Opts]),Node} + log(all,"Test Info","Starting test(s) on ~w...",[Node]), + {spawn_link(Node,?MODULE,init_node_ctrl,[self(),Cookie,Opts]), + Node} end, NodeCtrlPids = lists:map(SpawnAndMon,NodeOptsList), Result = master_loop(#state{node_ctrl_pids=NodeCtrlPids, @@ -404,12 +422,13 @@ master_loop(#state{node_ctrl_pids=[], results=Finished}) -> Str = lists:map(fun({Node,Result}) -> - io_lib:format("~-40.40.*s~p\n",[$_,atom_to_list(Node),Result]) + io_lib:format("~-40.40.*ts~p\n", + [$_,atom_to_list(Node),Result]) end,lists:reverse(Finished)), log(all,"TEST RESULTS",Str,[]), log(all,"Info","Updating log files",[]), refresh_logs(LogDirs,[]), - + ct_master_event:stop(), ct_master_logs:stop(), ok; @@ -437,18 +456,20 @@ master_loop(State=#state{node_ctrl_pids=NodeCtrlPids, Bad end, log(all,"Test Info", - "Test on node ~w failed! Reason: ~p",[Node,Error]), + "Test on node ~w failed! Reason: ~p", + [Node,Error]), {Locks1,Blocked1} = update_queue(exit,Node,Locks,Blocked), master_loop(State#state{node_ctrl_pids=NodeCtrlPids1, - results=[{Node,Error}|Results], + results=[{Node, + Error}|Results], locks=Locks1, blocked=Blocked1}) end; undefined -> %% ignore (but report) exit from master_logger etc log(all,"Test Info", - "Warning! Process ~p has terminated. Reason: ~p", + "Warning! Process ~w has terminated. Reason: ~p", [Pid,Reason]), master_loop(State) end; @@ -531,7 +552,7 @@ update_queue(take,Node,From,Lock={Op,Resource},Locks,Blocked) -> %% Blocked: [{{Operation,Resource},Node,WaitingPid},...] case lists:keysearch(Lock,1,Locks) of {value,{_Lock,Owner}} -> % other node has lock - log(html,"Lock Info","Node ~p blocked on ~w by ~w. Resource: ~p", + log(html,"Lock Info","Node ~w blocked on ~w by ~w. Resource: ~p", [Node,Op,Owner,Resource]), Blocked1 = Blocked ++ [{Lock,Node,From}], {Locks,Blocked1}; @@ -546,7 +567,7 @@ update_queue(release,Node,_From,Lock={Op,Resource},Locks,Blocked) -> case lists:keysearch(Lock,1,Blocked) of {value,E={Lock,SomeNode,WaitingPid}} -> Blocked1 = lists:delete(E,Blocked), - log(html,"Lock Info","Node ~p proceeds with ~w. Resource: ~p", + log(html,"Lock Info","Node ~w proceeds with ~w. Resource: ~p", [SomeNode,Op,Resource]), reply(ok,WaitingPid), % waiting process may start {Locks1,Blocked1}; @@ -625,7 +646,8 @@ refresh_logs([D|Dirs],Refreshed) -> refresh_logs([],Refreshed) -> Str = lists:map(fun({D,Result}) -> - io_lib:format("Refreshing logs in ~p... ~p",[D,Result]) + io_lib:format("Refreshing logs in ~p... ~p", + [D,Result]) end,Refreshed), log(all,"Info",Str,[]). @@ -638,7 +660,7 @@ init_node_ctrl(MasterPid,Cookie,Opts) -> process_flag(trap_exit, true), MasterNode = node(MasterPid), group_leader(whereis(user),self()), - io:format("~n********** node_ctrl process ~p started on ~p **********~n", + io:format("~n********** node_ctrl process ~w started on ~w **********~n", [self(),node()]), %% initially this node must have the same cookie as the master node %% but now we set it explicitly for the connection so that test suites @@ -671,7 +693,7 @@ init_node_ctrl(MasterPid,Cookie,Opts) -> pong -> MasterPid ! {self(),{result,Result}}; pang -> - io:format("Warning! Connection to master node ~p is lost. " + io:format("Warning! Connection to master node ~w is lost. " "Can't report result!~n~n", [MasterNode]) end. @@ -696,8 +718,9 @@ status(MasterPid,Event) -> log(To,Heading,Str,Args) -> if To == all ; To == tty -> - Str1 = ["=== ",Heading," ===\n",io_lib:format(Str,Args),"\n"], - io:format(Str1,[]); + Chars = ["=== ",Heading," ===\n", + io_lib:format(Str,Args),"\n"], + io:put_chars(Chars); true -> ok end, @@ -751,21 +774,25 @@ start_nodes(InitOptions)-> IsAlive = lists:member(NodeName, nodes()), case {HasNodeStart, IsAlive} of {false, false}-> - io:format("WARNING: Node ~p is not alive but has no node_start option~n", [NodeName]); + io:format("WARNING: Node ~w is not alive but has no " + "node_start option~n", [NodeName]); {false, true}-> - io:format("Node ~p is alive~n", [NodeName]); + io:format("Node ~w is alive~n", [NodeName]); {true, false}-> {node_start, NodeStart} = lists:keyfind(node_start, 1, Options), {value, {callback_module, Callback}, NodeStart2}= lists:keytake(callback_module, 1, NodeStart), case Callback:start(Host, Node, NodeStart2) of {ok, NodeName} -> - io:format("Node ~p started successfully with callback ~p~n", [NodeName,Callback]); + io:format("Node ~w started successfully " + "with callback ~w~n", [NodeName,Callback]); {error, Reason, _NodeName} -> - io:format("Failed to start node ~p with callback ~p! Reason: ~p~n", [NodeName, Callback, Reason]) + io:format("Failed to start node ~w with callback ~w! " + "Reason: ~p~n", [NodeName, Callback, Reason]) end; {true, true}-> - io:format("WARNING: Node ~p is alive but has node_start option~n", [NodeName]) + io:format("WARNING: Node ~w is alive but has node_start " + "option~n", [NodeName]) end end, InitOptions). @@ -778,7 +805,8 @@ eval_on_nodes(InitOptions)-> {false,_}-> ok; {true,false}-> - io:format("WARNING: Node ~p is not alive but has eval option ~n", [NodeName]); + io:format("WARNING: Node ~w is not alive but has eval " + "option~n", [NodeName]); {true,true}-> {eval, MFAs} = lists:keyfind(eval, 1, Options), evaluate(NodeName, MFAs) @@ -789,9 +817,11 @@ eval_on_nodes(InitOptions)-> evaluate(Node, [{M,F,A}|MFAs])-> case rpc:call(Node, M, F, A) of {badrpc,Reason}-> - io:format("WARNING: Failed to call ~p:~p/~p on node ~p due to ~p~n", [M,F,length(A),Node,Reason]); + io:format("WARNING: Failed to call ~w:~w/~w on node ~w " + "due to ~p~n", [M,F,length(A),Node,Reason]); Result-> - io:format("Called ~p:~p/~p on node ~p, result: ~p~n", [M,F,length(A),Node,Result]) + io:format("Called ~w:~w/~w on node ~w, result: ~p~n", + [M,F,length(A),Node,Result]) end, evaluate(Node, MFAs); evaluate(_Node, [])-> diff --git a/lib/common_test/src/ct_master_event.erl b/lib/common_test/src/ct_master_event.erl index a70baefaaf..fd97ab16f7 100644 --- a/lib/common_test/src/ct_master_event.erl +++ b/lib/common_test/src/ct_master_event.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2009. All Rights Reserved. +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -66,16 +66,30 @@ add_handler(Args) -> %% Description: Stops the event manager %%-------------------------------------------------------------------- stop() -> - flush(), - gen_event:stop(?CT_MEVMGR_REF). + case flush() of + {error,Reason} -> + ct_master_logs:log("Error", + "No response from CT Master Event.\n" + "Reason = ~p\n" + "Terminating now!\n",[Reason]), + %% communication with event manager fails, kill it + catch exit(whereis(?CT_MEVMGR_REF), kill); + _ -> + gen_event:stop(?CT_MEVMGR_REF) + end. flush() -> - case gen_event:call(?CT_MEVMGR_REF,?MODULE,flush) of + try gen_event:call(?CT_MEVMGR_REF,?MODULE,flush,1800000) of flushing -> timer:sleep(1), flush(); done -> - ok + ok; + Error = {error,_} -> + Error + catch + _:Reason -> + {error,Reason} end. %%-------------------------------------------------------------------- @@ -114,13 +128,13 @@ init(_) -> %% each installed event handler to handle the event. %%-------------------------------------------------------------------- handle_event(#event{name=start_logging,node=Node,data=RunDir},State) -> - ct_master_logs:log("CT Master Event Handler","Got ~s from ~p",[RunDir,Node]), + ct_master_logs:log("CT Master Event Handler","Got ~ts from ~w",[RunDir,Node]), ct_master_logs:nodedir(Node,RunDir), {ok,State}; handle_event(#event{name=Name,node=Node,data=Data},State) -> print("~n=== ~w ===~n", [?MODULE]), - print("~p on ~p: ~p~n", [Name,Node,Data]), + print("~w on ~w: ~p~n", [Name,Node,Data]), {ok,State}. %%-------------------------------------------------------------------- diff --git a/lib/common_test/src/ct_master_logs.erl b/lib/common_test/src/ct_master_logs.erl index 9e61d5b16f..5393097f57 100644 --- a/lib/common_test/src/ct_master_logs.erl +++ b/lib/common_test/src/ct_master_logs.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2012. All Rights Reserved. +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -133,8 +133,8 @@ init(Parent,LogDir,Nodes) -> end,Nodes)), io:format(CtLogFd,int_header(),[log_timestamp(now()),"Test Nodes\n"]), - io:format(CtLogFd,"~s\n",[NodeStr]), - io:format(CtLogFd,int_footer()++"\n",[]), + io:format(CtLogFd,"~ts\n",[NodeStr]), + io:put_chars(CtLogFd,[int_footer(),"\n"]), NodeDirIxFd = open_nodedir_index(RunDirAbs,Time), Parent ! {started,self(),{Time,RunDirAbs}}, @@ -201,25 +201,22 @@ loop(State) -> %%%%%%%%%%%%%%%%%%%%%%%%%%%% open_ct_master_log(Dir) -> FullName = filename:join(Dir,?ct_master_log_name), - {ok,Fd} = file:open(FullName,[write]), - io:format(Fd,header("Common Test Master Log", {[],[1,2],[]}),[]), + {ok,Fd} = file:open(FullName,[write,{encoding,utf8}]), + io:put_chars(Fd,header("Common Test Master Log", {[],[1,2],[]})), %% maybe add config info here later - io:format(Fd, config_table([]), []), - io:format(Fd, - "<style>\n" - "div.ct_internal { background:lightgrey; color:black }\n" - "div.default { background:lightgreen; color:black }\n" - "</style>\n", - []), - io:format(Fd, - xhtml("<br><h2>Progress Log</h2>\n<pre>\n", - "<br /><h2>Progress Log</h2>\n<pre>\n"), - []), + io:put_chars(Fd,config_table([])), + io:put_chars(Fd, + "<style>\n" + "div.ct_internal { background:lightgrey; color:black }\n" + "div.default { background:lightgreen; color:black }\n" + "</style>\n"), + io:put_chars(Fd, + xhtml("<br><h2>Progress Log</h2>\n<pre>\n", + "<br /><h2>Progress Log</h2>\n<pre>\n")), Fd. close_ct_master_log(Fd) -> - io:format(Fd,"</pre>",[]), - io:format(Fd,footer(),[]), + io:put_chars(Fd,["</pre>",footer()]), file:close(Fd). config_table(Vars) -> @@ -238,7 +235,7 @@ config_table1([]) -> ["</tbody>\n</table>\n"]. int_header() -> - "<div class=\"ct_internal\"><b>*** CT MASTER ~s *** ~s</b>". + "<div class=\"ct_internal\"><b>*** CT MASTER ~s *** ~ts</b>". int_footer() -> "</div>". @@ -247,21 +244,22 @@ int_footer() -> %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% open_nodedir_index(Dir,StartTime) -> FullName = filename:join(Dir,?nodedir_index_name), - {ok,Fd} = file:open(FullName,[write]), - io:format(Fd,nodedir_index_header(StartTime),[]), + {ok,Fd} = file:open(FullName,[write,{encoding,utf8}]), + io:put_chars(Fd,nodedir_index_header(StartTime)), Fd. print_nodedir(Node,RunDir,Fd) -> Index = filename:join(RunDir,"index.html"), - io:format(Fd, - ["<tr>\n" - "<td align=center>",atom_to_list(Node),"</td>\n", - "<td align=left><a href=\"",Index,"\">",Index,"</a></td>\n", - "</tr>\n"],[]), + io:put_chars(Fd, + ["<tr>\n" + "<td align=center>",atom_to_list(Node),"</td>\n", + "<td align=left><a href=\"",ct_logs:uri(Index),"\">",Index, + "</a></td>\n", + "</tr>\n"]), ok. close_nodedir_index(Fd) -> - io:format(Fd,index_footer(),[]), + io:put_chars(Fd,index_footer()), file:close(Fd). nodedir_index_header(StartTime) -> @@ -286,7 +284,9 @@ make_all_runs_index(LogDir) -> DirsSorted = (catch sort_all_runs(Dirs)), Header = all_runs_header(), Index = [runentry(Dir) || Dir <- DirsSorted], - Result = file:write_file(FullName,Header++Index++index_footer()), + Result = file:write_file(FullName, + unicode:characters_to_binary( + Header++Index++index_footer())), Result. sort_all_runs(Dirs) -> @@ -326,7 +326,8 @@ runentry(Dir) -> end, Index = filename:join(Dir,?nodedir_index_name), ["<tr>\n" - "<td align=center><a href=\"",Index,"\">",timestamp(Dir),"</a></td>\n", + "<td align=center><a href=\"",ct_logs:uri(Index),"\">", + timestamp(Dir),"</a></td>\n", "<td align=center>",MasterStr,"</td>\n", "<td align=center>",NodesStr,"</td>\n", "</tr>\n"]. @@ -384,8 +385,10 @@ header(Title, TableCols) -> "<head>\n", "<title>" ++ Title ++ "</title>\n", "<meta http-equiv=\"cache-control\" content=\"no-cache\">\n", + "<meta http-equiv=\"content-type\" content=\"text/html; charset=utf-8\">\n", xhtml("", - ["<link rel=\"stylesheet\" href=\"",CSSFile,"\" type=\"text/css\">"]), + ["<link rel=\"stylesheet\" href=\"",ct_logs:uri(CSSFile), + "\" type=\"text/css\">"]), xhtml("", ["<script type=\"text/javascript\" src=\"",JQueryFile, "\"></script>\n"]), diff --git a/lib/common_test/src/ct_master_status.erl b/lib/common_test/src/ct_master_status.erl index 76060fb7bb..f9f511ecca 100644 --- a/lib/common_test/src/ct_master_status.erl +++ b/lib/common_test/src/ct_master_status.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2009. All Rights Reserved. +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -70,7 +70,7 @@ init(_) -> %% handle_event(#event{name=Name,node=Node,data=Data},State) -> print("~n=== ~w ===~n", [?MODULE]), - print("~p on ~p: ~p~n", [Name,Node,Data]), + print("~w on ~w: ~p~n", [Name,Node,Data]), {ok,State}. %%-------------------------------------------------------------------- diff --git a/lib/common_test/src/ct_netconfc.erl b/lib/common_test/src/ct_netconfc.erl index 294b82bff6..1339e53780 100644 --- a/lib/common_test/src/ct_netconfc.erl +++ b/lib/common_test/src/ct_netconfc.erl @@ -1,7 +1,7 @@ %%---------------------------------------------------------------------- %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2012. All Rights Reserved. +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -307,7 +307,7 @@ -type option() :: {ssh,host()} | {port,inet:port_number()} | {user,string()} | {password,string()} | {user_dir,string()} | {timeout,timeout()}. --type host() :: inet:host_name() | inet:ip_address(). +-type host() :: inet:hostname() | inet:ip_address(). -type notification() :: {notification, xml_attributes(), notification_content()}. -type notification_content() :: [event_time()|simple_xml()]. @@ -1073,7 +1073,8 @@ handle_msg({get_event_streams=Op,Streams,Timeout}, From, State) -> SimpleXml = encode_rpc_operation(get,[Filter]), do_send_rpc(Op, SimpleXml, Timeout, From, State). -handle_msg({ssh_cm, _CM, {data, _Ch, _Type, Data}}, State) -> +handle_msg({ssh_cm, CM, {data, Ch, _Type, Data}}, State) -> + ssh_connection:adjust_window(CM,Ch,size(Data)), handle_data(Data, State); handle_msg({ssh_cm, _CM, _SshCloseMsg}, State) -> %% _SshCloseMsg can probably be one of @@ -1280,10 +1281,11 @@ do_send(Connection, SimpleXml) -> to_xml_doc(Simple) -> Prolog = "<?xml version=\"1.0\" encoding=\"UTF-8\"?>", - Xml = list_to_binary(xmerl:export_simple([Simple], - xmerl_xml, - [#xmlAttribute{name=prolog, - value=Prolog}])), + Xml = unicode:characters_to_binary( + xmerl:export_simple([Simple], + xmerl_xml, + [#xmlAttribute{name=prolog, + value=Prolog}])), <<Xml/binary,?END_TAG/binary>>. %%%----------------------------------------------------------------- @@ -1687,18 +1689,27 @@ log(#connection{host=Host,port=Port,name=Name},Action,Data) -> %% Log callback - called from the error handler process -format_data(raw,Data) -> - io_lib:format("~n~s~n",[hide_password(Data)]); -format_data(pretty,Data) -> - io_lib:format("~n~s~n",[indent(Data)]); -format_data(html,Data) -> - io_lib:format("~n~s~n",[html_format(Data)]). +format_data(How,Data) -> + %% Assuming that the data is encoded as UTF-8. If it is not, then + %% the printout might be wrong, but the format function will not + %% crash! + %% FIXME: should probably read encoding from the data and do + %% unicode:characters_to_binary(Data,InEncoding,utf8) when calling + %% log/3 instead of assuming utf8 in as done here! + do_format_data(How,unicode:characters_to_binary(Data)). + +do_format_data(raw,Data) -> + io_lib:format("~n~ts~n",[hide_password(Data)]); +do_format_data(pretty,Data) -> + io_lib:format("~n~ts~n",[indent(Data)]); +do_format_data(html,Data) -> + io_lib:format("~n~ts~n",[html_format(Data)]). %%%----------------------------------------------------------------- %%% Hide password elements from XML data hide_password(Bin) -> re:replace(Bin,<<"(<password[^>]*>)[^<]*(</password>)">>,<<"\\1*****\\2">>, - [global,{return,binary}]). + [global,{return,binary},unicode]). %%%----------------------------------------------------------------- %%% HTML formatting @@ -1716,13 +1727,13 @@ indent(Bin) -> Part -> indent1(lists:reverse(Part)++String,erase(indent)) end, - list_to_binary(IndentedString). + unicode:characters_to_binary(IndentedString). %% Normalizes the XML document by removing all space and newline %% between two XML tags. %% Returns a list, no matter if the input was a list or a binary. -normalize(Str) -> - re:replace(Str,<<">[ \r\n\t]+<">>,<<"><">>,[global,{return,list}]). +normalize(Bin) -> + re:replace(Bin,<<">[ \r\n\t]+<">>,<<"><">>,[global,{return,list},unicode]). indent1("<?"++Rest1,Indent1) -> @@ -1805,7 +1816,8 @@ get_tag([]) -> %%% SSH stuff ssh_receive_data() -> receive - {ssh_cm, _CM, {data, _Ch, _Type, Data}} -> + {ssh_cm, CM, {data, Ch, _Type, Data}} -> + ssh_connection:adjust_window(CM,Ch,size(Data)), {ok, Data}; {ssh_cm, _CM, {Closed, _Ch}} = X when Closed == closed; Closed == eof -> {error,X}; diff --git a/lib/common_test/src/ct_run.erl b/lib/common_test/src/ct_run.erl index 96b2934382..49f00429ae 100644 --- a/lib/common_test/src/ct_run.erl +++ b/lib/common_test/src/ct_run.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2004-2012. All Rights Reserved. +%% Copyright Ericsson AB 2004-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -58,6 +58,7 @@ vts, shell, cover, + cover_stop, coverspec, step, logdir, @@ -147,7 +148,7 @@ script_start(Args) -> _ -> "" end end, - io:format("~nCommon Test~s starting (cwd is ~s)~n~n", + io:format("~nCommon Test~s starting (cwd is ~ts)~n~n", [CTVsn,Cwd]), Self = self(), Pid = spawn_link(fun() -> script_start1(Self, Args) end), @@ -245,6 +246,7 @@ script_start1(Parent, Args) -> Vts = get_start_opt(vts, true, Args), Shell = get_start_opt(shell, true, Args), Cover = get_start_opt(cover, fun([CoverFile]) -> ?abs(CoverFile) end, Args), + CoverStop = get_start_opt(cover_stop, fun([CS]) -> list_to_atom(CS) end, Args), LogDir = get_start_opt(logdir, fun([LogD]) -> LogD end, Args), LogOpts = get_start_opt(logopts, fun(Os) -> [list_to_atom(O) || O <- Os] end, [], Args), @@ -328,32 +330,33 @@ script_start1(Parent, Args) -> true end, - StartOpts = #opts{label = Label, profile = Profile, - vts = Vts, shell = Shell, cover = Cover, - logdir = LogDir, logopts = LogOpts, - basic_html = BasicHtml, - verbosity = Verbosity, - event_handlers = EvHandlers, - ct_hooks = CTHooks, - enable_builtin_hooks = EnableBuiltinHooks, - auto_compile = AutoCompile, - include = IncludeDirs, - silent_connections = SilentConns, - stylesheet = Stylesheet, - multiply_timetraps = MultTT, - scale_timetraps = ScaleTT, - create_priv_dir = CreatePrivDir, - starter = script}, - + Opts = #opts{label = Label, profile = Profile, + vts = Vts, shell = Shell, + cover = Cover, cover_stop = CoverStop, + logdir = LogDir, logopts = LogOpts, + basic_html = BasicHtml, + verbosity = Verbosity, + event_handlers = EvHandlers, + ct_hooks = CTHooks, + enable_builtin_hooks = EnableBuiltinHooks, + auto_compile = AutoCompile, + include = IncludeDirs, + silent_connections = SilentConns, + stylesheet = Stylesheet, + multiply_timetraps = MultTT, + scale_timetraps = ScaleTT, + create_priv_dir = CreatePrivDir, + starter = script}, + %% check if log files should be refreshed or go on to run tests... - Result = run_or_refresh(StartOpts, Args), + Result = run_or_refresh(Opts, Args), %% send final results to starting process waiting in script_start/0 Parent ! {self(), Result}. -run_or_refresh(StartOpts = #opts{logdir = LogDir}, Args) -> +run_or_refresh(Opts = #opts{logdir = LogDir}, Args) -> case proplists:get_value(refresh_logs, Args) of undefined -> - script_start2(StartOpts, Args); + script_start2(Opts, Args); Refresh -> LogDir1 = case Refresh of [] -> which(logdir,LogDir); @@ -375,167 +378,203 @@ run_or_refresh(StartOpts = #opts{logdir = LogDir}, Args) -> {error,{all_suites_index,ASReason}}; _ -> file:set_cwd(Cwd), - io:format("Logs in ~s refreshed!~n~n", [LogDir1]), + io:format("Logs in ~ts refreshed!~n~n", + [LogDir1]), timer:sleep(500), % time to flush io before quitting ok end end end. -script_start2(StartOpts = #opts{vts = undefined, - shell = undefined}, Args) -> - TestSpec = proplists:get_value(spec, Args), - {Terms,Opts} = - case TestSpec of - Specs when Specs =/= [], Specs =/= undefined -> - %% using testspec as input for test - Relaxed = get_start_opt(allow_user_terms, true, false, Args), - case catch ct_testspec:collect_tests_from_file(Specs, Relaxed) of - {E,Reason} when E == error ; E == 'EXIT' -> - {{error,Reason},StartOpts}; - TS -> - SpecStartOpts = get_data_for_node(TS, node()), - - Label = choose_val(StartOpts#opts.label, - SpecStartOpts#opts.label), - - Profile = choose_val(StartOpts#opts.profile, - SpecStartOpts#opts.profile), - - LogDir = choose_val(StartOpts#opts.logdir, - SpecStartOpts#opts.logdir), - - AllLogOpts = merge_vals([StartOpts#opts.logopts, - SpecStartOpts#opts.logopts]), - AllVerbosity = - merge_keyvals([StartOpts#opts.verbosity, - SpecStartOpts#opts.verbosity]), - AllSilentConns = - merge_vals([StartOpts#opts.silent_connections, - SpecStartOpts#opts.silent_connections]), - Cover = - choose_val(StartOpts#opts.cover, - SpecStartOpts#opts.cover), - MultTT = - choose_val(StartOpts#opts.multiply_timetraps, - SpecStartOpts#opts.multiply_timetraps), - ScaleTT = - choose_val(StartOpts#opts.scale_timetraps, - SpecStartOpts#opts.scale_timetraps), - - CreatePrivDir = - choose_val(StartOpts#opts.create_priv_dir, - SpecStartOpts#opts.create_priv_dir), - - AllEvHs = - merge_vals([StartOpts#opts.event_handlers, - SpecStartOpts#opts.event_handlers]), - - AllCTHooks = merge_vals( - [StartOpts#opts.ct_hooks, - SpecStartOpts#opts.ct_hooks]), - - EnableBuiltinHooks = - choose_val( - StartOpts#opts.enable_builtin_hooks, - SpecStartOpts#opts.enable_builtin_hooks), - - Stylesheet = - choose_val(StartOpts#opts.stylesheet, - SpecStartOpts#opts.stylesheet), - - AllInclude = merge_vals([StartOpts#opts.include, - SpecStartOpts#opts.include]), - application:set_env(common_test, include, AllInclude), - - AutoCompile = - case choose_val(StartOpts#opts.auto_compile, - SpecStartOpts#opts.auto_compile) of - undefined -> - true; - ACBool -> - application:set_env(common_test, - auto_compile, - ACBool), - ACBool - end, - - BasicHtml = - case choose_val(StartOpts#opts.basic_html, - SpecStartOpts#opts.basic_html) of - undefined -> - false; - BHBool -> - application:set_env(common_test, basic_html, - BHBool), - BHBool - end, - - {TS,StartOpts#opts{label = Label, - profile = Profile, - testspecs = Specs, - cover = Cover, - logdir = LogDir, - logopts = AllLogOpts, - basic_html = BasicHtml, - verbosity = AllVerbosity, - silent_connections = AllSilentConns, - config = SpecStartOpts#opts.config, - event_handlers = AllEvHs, - ct_hooks = AllCTHooks, - enable_builtin_hooks = - EnableBuiltinHooks, - stylesheet = Stylesheet, - auto_compile = AutoCompile, - include = AllInclude, - multiply_timetraps = MultTT, - scale_timetraps = ScaleTT, - create_priv_dir = CreatePrivDir}} - end; - _ -> - {undefined,StartOpts} - end, - %% read config/userconfig from start flags - InitConfig = ct_config:prepare_config_list(Args), - TheLogDir = which(logdir, Opts#opts.logdir), - case {TestSpec,Terms} of - {_,{error,_}=Error} -> - Error; - {[],_} -> +script_start2(Opts = #opts{vts = undefined, + shell = undefined}, Args) -> + case proplists:get_value(spec, Args) of + Specs when Specs =/= [], Specs =/= undefined -> + Specs1 = get_start_opt(join_specs, [Specs], Specs, Args), + %% using testspec as input for test + Relaxed = get_start_opt(allow_user_terms, true, false, Args), + case catch ct_testspec:collect_tests_from_file(Specs1, Relaxed) of + {E,Reason} when E == error ; E == 'EXIT' -> + {error,Reason}; + TestSpecData -> + execute_all_specs(TestSpecData, Opts, Args, []) + end; + [] -> {error,no_testspec_specified}; - {undefined,_} -> % no testspec used - case check_and_install_configfiles(InitConfig, TheLogDir, Opts) of + _ -> % no testspec used + %% read config/userconfig from start flags + InitConfig = ct_config:prepare_config_list(Args), + TheLogDir = which(logdir, Opts#opts.logdir), + case check_and_install_configfiles(InitConfig, + TheLogDir, + Opts) of ok -> % go on read tests from start flags script_start3(Opts#opts{config=InitConfig, logdir=TheLogDir}, Args); Error -> Error - end; - {_,_} -> % testspec used - %% merge config from start flags with config from testspec - AllConfig = merge_vals([InitConfig, Opts#opts.config]), - case check_and_install_configfiles(AllConfig, TheLogDir, Opts) of - ok -> % read tests from spec - {Run,Skip} = ct_testspec:prepare_tests(Terms, node()), - do_run(Run, Skip, Opts#opts{config=AllConfig, - logdir=TheLogDir}, Args); - Error -> - Error end end; -script_start2(StartOpts, Args) -> +script_start2(Opts, Args) -> %% read config/userconfig from start flags InitConfig = ct_config:prepare_config_list(Args), - LogDir = which(logdir, StartOpts#opts.logdir), - case check_and_install_configfiles(InitConfig, LogDir, StartOpts) of + LogDir = which(logdir, Opts#opts.logdir), + case check_and_install_configfiles(InitConfig, LogDir, Opts) of ok -> % go on read tests from start flags - script_start3(StartOpts#opts{config=InitConfig, - logdir=LogDir}, Args); + script_start3(Opts#opts{config=InitConfig, + logdir=LogDir}, Args); Error -> Error end. +execute_all_specs([], _, _, Result) -> + Result1 = lists:reverse(Result), + case lists:keysearch('EXIT', 1, Result1) of + {value,{_,_,ExitReason}} -> + exit(ExitReason); + false -> + case lists:keysearch(error, 1, Result1) of + {value,Error} -> + Error; + false -> + lists:foldl(fun({Ok,Fail,{UserSkip,AutoSkip}}, + {Ok1,Fail1,{UserSkip1,AutoSkip1}}) -> + {Ok1+Ok,Fail1+Fail, + {UserSkip1+UserSkip, + AutoSkip1+AutoSkip}} + end, {0,0,{0,0}}, Result1) + end + end; + +execute_all_specs([{Specs,TS} | TSs], Opts, Args, Result) -> + CombinedOpts = combine_test_opts(TS, Specs, Opts), + try execute_one_spec(TS, CombinedOpts, Args) of + ExecResult -> + execute_all_specs(TSs, Opts, Args, [ExecResult|Result]) + catch + _ : ExitReason -> + execute_all_specs(TSs, Opts, Args, + [{'EXIT',self(),ExitReason}|Result]) + end. + +execute_one_spec(TS, Opts, Args) -> + %% read config/userconfig from start flags + InitConfig = ct_config:prepare_config_list(Args), + TheLogDir = which(logdir, Opts#opts.logdir), + %% merge config from start flags with config from testspec + AllConfig = merge_vals([InitConfig, Opts#opts.config]), + case check_and_install_configfiles(AllConfig, TheLogDir, Opts) of + ok -> % read tests from spec + {Run,Skip} = ct_testspec:prepare_tests(TS, node()), + do_run(Run, Skip, Opts#opts{config=AllConfig, + logdir=TheLogDir}, Args); + Error -> + Error + end. + +combine_test_opts(TS, Specs, Opts) -> + TSOpts = get_data_for_node(TS, node()), + + Label = choose_val(Opts#opts.label, + TSOpts#opts.label), + + Profile = choose_val(Opts#opts.profile, + TSOpts#opts.profile), + + LogDir = choose_val(Opts#opts.logdir, + TSOpts#opts.logdir), + + AllLogOpts = merge_vals([Opts#opts.logopts, + TSOpts#opts.logopts]), + AllVerbosity = + merge_keyvals([Opts#opts.verbosity, + TSOpts#opts.verbosity]), + AllSilentConns = + merge_vals([Opts#opts.silent_connections, + TSOpts#opts.silent_connections]), + Cover = + choose_val(Opts#opts.cover, + TSOpts#opts.cover), + CoverStop = + choose_val(Opts#opts.cover_stop, + TSOpts#opts.cover_stop), + MultTT = + choose_val(Opts#opts.multiply_timetraps, + TSOpts#opts.multiply_timetraps), + ScaleTT = + choose_val(Opts#opts.scale_timetraps, + TSOpts#opts.scale_timetraps), + + CreatePrivDir = + choose_val(Opts#opts.create_priv_dir, + TSOpts#opts.create_priv_dir), + + AllEvHs = + merge_vals([Opts#opts.event_handlers, + TSOpts#opts.event_handlers]), + + AllCTHooks = merge_vals( + [Opts#opts.ct_hooks, + TSOpts#opts.ct_hooks]), + + EnableBuiltinHooks = + choose_val( + Opts#opts.enable_builtin_hooks, + TSOpts#opts.enable_builtin_hooks), + + Stylesheet = + choose_val(Opts#opts.stylesheet, + TSOpts#opts.stylesheet), + + AllInclude = merge_vals([Opts#opts.include, + TSOpts#opts.include]), + application:set_env(common_test, include, AllInclude), + + AutoCompile = + case choose_val(Opts#opts.auto_compile, + TSOpts#opts.auto_compile) of + undefined -> + true; + ACBool -> + application:set_env(common_test, + auto_compile, + ACBool), + ACBool + end, + + BasicHtml = + case choose_val(Opts#opts.basic_html, + TSOpts#opts.basic_html) of + undefined -> + false; + BHBool -> + application:set_env(common_test, basic_html, + BHBool), + BHBool + end, + + Opts#opts{label = Label, + profile = Profile, + testspecs = Specs, + cover = Cover, + cover_stop = CoverStop, + logdir = which(logdir, LogDir), + logopts = AllLogOpts, + basic_html = BasicHtml, + verbosity = AllVerbosity, + silent_connections = AllSilentConns, + config = TSOpts#opts.config, + event_handlers = AllEvHs, + ct_hooks = AllCTHooks, + enable_builtin_hooks = EnableBuiltinHooks, + stylesheet = Stylesheet, + auto_compile = AutoCompile, + include = AllInclude, + multiply_timetraps = MultTT, + scale_timetraps = ScaleTT, + create_priv_dir = CreatePrivDir}. + check_and_install_configfiles( Configs, LogDir, #opts{ event_handlers = EvHandlers, @@ -555,12 +594,12 @@ check_and_install_configfiles( {error,{cant_load_callback_module,Info}} end. -script_start3(StartOpts, Args) -> - StartOpts1 = get_start_opt(step, - fun(Step) -> - StartOpts#opts{step = Step, - cover = undefined} - end, StartOpts, Args), +script_start3(Opts, Args) -> + Opts1 = get_start_opt(step, + fun(Step) -> + Opts#opts{step = Step, + cover = undefined} + end, Opts, Args), case {proplists:get_value(dir, Args), proplists:get_value(suite, Args), groups_and_cases(proplists:get_value(group, Args), @@ -574,17 +613,17 @@ script_start3(StartOpts, Args) -> {error,no_dir_specified}; {Dirs,undefined,[]} when is_list(Dirs) -> - script_start4(StartOpts#opts{tests = tests(Dirs)}, Args); + script_start4(Opts#opts{tests = tests(Dirs)}, Args); {undefined,Suites,[]} when is_list(Suites) -> Ts = tests([suite_to_test(S) || S <- Suites]), - script_start4(StartOpts1#opts{tests = Ts}, Args); + script_start4(Opts1#opts{tests = Ts}, Args); {undefined,Suite,GsAndCs} when is_list(Suite) -> case [suite_to_test(S) || S <- Suite] of DirMods = [_] -> Ts = tests(DirMods, GsAndCs), - script_start4(StartOpts1#opts{tests = Ts}, Args); + script_start4(Opts1#opts{tests = Ts}, Args); [_,_|_] -> {error,multiple_suites_and_cases}; _ -> @@ -598,10 +637,10 @@ script_start3(StartOpts, Args) -> case [suite_to_test(Dir,S) || S <- Suite] of DirMods when GsAndCs == [] -> Ts = tests(DirMods), - script_start4(StartOpts1#opts{tests = Ts}, Args); + script_start4(Opts1#opts{tests = Ts}, Args); DirMods = [_] when GsAndCs /= [] -> Ts = tests(DirMods, GsAndCs), - script_start4(StartOpts1#opts{tests = Ts}, Args); + script_start4(Opts1#opts{tests = Ts}, Args); [_,_|_] when GsAndCs /= [] -> {error,multiple_suites_and_cases}; _ -> @@ -612,8 +651,8 @@ script_start3(StartOpts, Args) -> {error,incorrect_start_options}; {undefined,undefined,_} -> - if StartOpts#opts.vts ; StartOpts#opts.shell -> - script_start4(StartOpts#opts{tests = []}, Args); + if Opts#opts.vts ; Opts#opts.shell -> + script_start4(Opts#opts{tests = []}, Args); true -> script_usage(), {error,missing_start_options} @@ -723,6 +762,7 @@ script_usage() -> "\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]" "\n\t[-stylesheet CSSFile]" "\n\t[-cover CoverCfgFile]" + "\n\t[-cover_stop Bool]" "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]" "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]" "\n\t[-include InclDir1 InclDir2 .. InclDirN]" @@ -742,9 +782,11 @@ script_usage() -> "\n\t[-logopts LogOpt1 LogOpt2 .. LogOptN]" "\n\t[-verbosity GenVLvl | [CategoryVLvl1 .. CategoryVLvlN]]" "\n\t[-allow_user_terms]" + "\n\t[-join_specs]" "\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]" "\n\t[-stylesheet CSSFile]" "\n\t[-cover CoverCfgFile]" + "\n\t[-cover_stop Bool]" "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]" "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]" "\n\t[-include InclDir1 InclDir2 .. InclDirN]" @@ -839,7 +881,7 @@ run_test1(StartOpts) when is_list(StartOpts) -> undefined -> Tracing = start_trace(StartOpts), {ok,Cwd} = file:get_cwd(), - io:format("~nCommon Test starting (cwd is ~s)~n~n", [Cwd]), + io:format("~nCommon Test starting (cwd is ~ts)~n~n", [Cwd]), Res = case ct_repeat:loop_test(func, StartOpts) of false -> @@ -938,6 +980,7 @@ run_test2(StartOpts) -> %% code coverage Cover = get_start_opt(cover, fun(CoverFile) -> ?abs(CoverFile) end, StartOpts), + CoverStop = get_start_opt(cover_stop, value, StartOpts), %% timetrap manipulation MultiplyTT = get_start_opt(multiply_timetraps, value, 1, StartOpts), @@ -1000,7 +1043,8 @@ run_test2(StartOpts) -> Step = get_start_opt(step, value, StartOpts), Opts = #opts{label = Label, profile = Profile, - cover = Cover, step = Step, logdir = LogDir, + cover = Cover, cover_stop = CoverStop, + step = Step, logdir = LogDir, logopts = LogOpts, basic_html = BasicHtml, config = CfgFiles, verbosity = Verbosity, @@ -1033,102 +1077,60 @@ run_test2(StartOpts) -> end. run_spec_file(Relaxed, - Opts = #opts{testspecs = Specs, config = CfgFiles}, + Opts = #opts{testspecs = Specs}, StartOpts) -> Specs1 = case Specs of [X|_] when is_integer(X) -> [Specs]; _ -> Specs end, AbsSpecs = lists:map(fun(SF) -> ?abs(SF) end, Specs1), - log_ts_names(AbsSpecs), - case catch ct_testspec:collect_tests_from_file(AbsSpecs, Relaxed) of + AbsSpecs1 = get_start_opt(join_specs, [AbsSpecs], AbsSpecs, StartOpts), + case catch ct_testspec:collect_tests_from_file(AbsSpecs1, Relaxed) of {Error,CTReason} when Error == error ; Error == 'EXIT' -> exit({error,CTReason}); - TS -> - SpecOpts = get_data_for_node(TS, node()), - Label = choose_val(Opts#opts.label, - SpecOpts#opts.label), - Profile = choose_val(Opts#opts.profile, - SpecOpts#opts.profile), - LogDir = choose_val(Opts#opts.logdir, - SpecOpts#opts.logdir), - AllLogOpts = merge_vals([Opts#opts.logopts, - SpecOpts#opts.logopts]), - Stylesheet = choose_val(Opts#opts.stylesheet, - SpecOpts#opts.stylesheet), - AllVerbosity = merge_keyvals([Opts#opts.verbosity, - SpecOpts#opts.verbosity]), - AllSilentConns = merge_vals([Opts#opts.silent_connections, - SpecOpts#opts.silent_connections]), - AllConfig = merge_vals([CfgFiles, SpecOpts#opts.config]), - Cover = choose_val(Opts#opts.cover, - SpecOpts#opts.cover), - MultTT = choose_val(Opts#opts.multiply_timetraps, - SpecOpts#opts.multiply_timetraps), - ScaleTT = choose_val(Opts#opts.scale_timetraps, - SpecOpts#opts.scale_timetraps), - CreatePrivDir = choose_val(Opts#opts.create_priv_dir, - SpecOpts#opts.create_priv_dir), - AllEvHs = merge_vals([Opts#opts.event_handlers, - SpecOpts#opts.event_handlers]), - AllInclude = merge_vals([Opts#opts.include, - SpecOpts#opts.include]), - AllCTHooks = merge_vals([Opts#opts.ct_hooks, - SpecOpts#opts.ct_hooks]), - EnableBuiltinHooks = choose_val(Opts#opts.enable_builtin_hooks, - SpecOpts#opts.enable_builtin_hooks), - - application:set_env(common_test, include, AllInclude), - - AutoCompile = case choose_val(Opts#opts.auto_compile, - SpecOpts#opts.auto_compile) of - undefined -> - true; - ACBool -> - application:set_env(common_test, auto_compile, - ACBool), - ACBool - end, + TestSpecData -> + run_all_specs(TestSpecData, Opts, StartOpts, []) + end. - BasicHtml = case choose_val(Opts#opts.basic_html, - SpecOpts#opts.basic_html) of - undefined -> - false; - BHBool -> - application:set_env(common_test, basic_html, - BHBool), - BHBool - end, - - Opts1 = Opts#opts{label = Label, - profile = Profile, - cover = Cover, - logdir = which(logdir, LogDir), - logopts = AllLogOpts, - stylesheet = Stylesheet, - basic_html = BasicHtml, - verbosity = AllVerbosity, - silent_connections = AllSilentConns, - config = AllConfig, - event_handlers = AllEvHs, - auto_compile = AutoCompile, - include = AllInclude, - testspecs = AbsSpecs, - multiply_timetraps = MultTT, - scale_timetraps = ScaleTT, - create_priv_dir = CreatePrivDir, - ct_hooks = AllCTHooks, - enable_builtin_hooks = EnableBuiltinHooks - }, - - case check_and_install_configfiles(AllConfig,Opts1#opts.logdir, - Opts1) of - ok -> - {Run,Skip} = ct_testspec:prepare_tests(TS, node()), - reformat_result(catch do_run(Run, Skip, Opts1, StartOpts)); - {error,GCFReason} -> - exit({error,GCFReason}) +run_all_specs([], _, _, TotResult) -> + TotResult1 = lists:reverse(TotResult), + case lists:keysearch('EXIT', 1, TotResult1) of + {value,{_,_,ExitReason}} -> + exit(ExitReason); + false -> + case lists:keysearch(error, 1, TotResult1) of + {value,Error} -> + Error; + false -> + lists:foldl(fun({Ok,Fail,{UserSkip,AutoSkip}}, + {Ok1,Fail1,{UserSkip1,AutoSkip1}}) -> + {Ok1+Ok,Fail1+Fail, + {UserSkip1+UserSkip, + AutoSkip1+AutoSkip}} + end, {0,0,{0,0}}, TotResult1) end + end; + +run_all_specs([{Specs,TS} | TSs], Opts, StartOpts, TotResult) -> + log_ts_names(Specs), + Combined = #opts{config = TSConfig} = combine_test_opts(TS, Specs, Opts), + AllConfig = merge_vals([Opts#opts.config, TSConfig]), + try run_one_spec(TS, Combined#opts{config = AllConfig}, StartOpts) of + Result -> + run_all_specs(TSs, Opts, StartOpts, [Result | TotResult]) + catch + _ : Reason -> + run_all_specs(TSs, Opts, StartOpts, [{error,Reason} | TotResult]) + end. + +run_one_spec(TS, CombinedOpts, StartOpts) -> + #opts{logdir = Logdir, config = Config} = CombinedOpts, + case check_and_install_configfiles(Config, Logdir, CombinedOpts) of + ok -> + {Run,Skip} = ct_testspec:prepare_tests(TS, node()), + reformat_result(catch do_run(Run, Skip, CombinedOpts, StartOpts)); + Error -> + Error end. run_prepared(Run, Skip, Opts = #opts{logdir = LogDir, @@ -1318,7 +1320,7 @@ run_testspec(TestSpec) -> run_testspec1(TestSpec) -> {ok,Cwd} = file:get_cwd(), - io:format("~nCommon Test starting (cwd is ~s)~n~n", [Cwd]), + io:format("~nCommon Test starting (cwd is ~ts)~n~n", [Cwd]), case catch run_testspec2(TestSpec) of {'EXIT',Reason} -> file:set_cwd(Cwd), @@ -1376,6 +1378,7 @@ get_data_for_node(#testspec{label = Labels, verbosity = VLvls, silent_connections = SilentConnsList, cover = CoverFs, + cover_stop = CoverStops, config = Cfgs, userconfig = UsrCfgs, event_handler = EvHs, @@ -1407,6 +1410,7 @@ get_data_for_node(#testspec{label = Labels, SCs -> SCs end, Cover = proplists:get_value(Node, CoverFs), + CoverStop = proplists:get_value(Node, CoverStops), MT = proplists:get_value(Node, MTs), ST = proplists:get_value(Node, STs), CreatePrivDir = proplists:get_value(Node, PDs), @@ -1425,6 +1429,7 @@ get_data_for_node(#testspec{label = Labels, verbosity = Verbosity, silent_connections = SilentConns, cover = Cover, + cover_stop = CoverStop, config = ConfigFiles, event_handlers = EvHandlers, ct_hooks = FiltCTHooks, @@ -1452,7 +1457,7 @@ refresh_logs(LogDir) -> {error,{all_runs_index,ARReason}}; _ -> file:set_cwd(Cwd), - io:format("Logs in ~s refreshed!~n",[LogDir]), + io:format("Logs in ~ts refreshed!~n",[LogDir]), ok end end @@ -1597,14 +1602,7 @@ do_run(Tests, Misc, LogDir, LogOpts) when is_list(Misc), StepOpts -> #opts{step = StepOpts} end, - Opts1 = - case proplists:get_value(cover, Misc) of - undefined -> - Opts; - CoverFile -> - Opts#opts{cover = CoverFile} - end, - do_run(Tests, [], Opts1#opts{logdir = LogDir}, []); + do_run(Tests, [], Opts#opts{logdir = LogDir}, []); do_run(Tests, Skip, Opts, Args) when is_record(Opts, opts) -> #opts{label = Label, profile = Profile, cover = Cover, @@ -1638,7 +1636,13 @@ do_run(Tests, Skip, Opts, Args) when is_record(Opts, opts) -> {error,Reason} -> exit({error,Reason}); CoverSpec -> - Opts#opts{coverspec = CoverSpec} + CoverStop = + case Opts#opts.cover_stop of + undefined -> true; + Stop -> Stop + end, + Opts#opts{coverspec = CoverSpec, + cover_stop = CoverStop} end end, %% This env variable is used by test_server to determine @@ -1776,7 +1780,7 @@ possibly_spawn(true, Tests, Skip, Opts) -> end, unlink(CTUtilSrv), SupPid = spawn(Supervisor), - io:format(user, "~nTest control handed over to process ~p~n~n", + io:format(user, "~nTest control handed over to process ~w~n~n", [SupPid]), SupPid. @@ -1864,7 +1868,7 @@ verify_suites(TestSuites) -> Suite)), io:format(user, "Suite ~w not found" - "in directory ~s~n", + "in directory ~ts~n", [Suite,TestDir]), {Found,[{DS,[Name]}|NotFound]} end @@ -1879,7 +1883,7 @@ verify_suites(TestSuites) -> ActualDir = filename:dirname(SuiteFile), {[{ActualDir,Suite}|Found],NotFound}; false -> - io:format(user, "Directory ~s is " + io:format(user, "Directory ~ts is " "invalid~n", [Dir]), Name = filename:join(Dir, atom_to_list(Suite)), {Found,[{DS,[Name]}|NotFound]} @@ -2119,7 +2123,7 @@ do_run_test(Tests, Skip, Opts) -> cross = CovCross, src = _CovSrc}} -> ct_logs:log("COVER INFO", - "Using cover specification file: ~s~n" + "Using cover specification file: ~ts~n" "App: ~w~n" "Cross cover: ~w~n" "Including ~w modules~n" @@ -2134,7 +2138,7 @@ do_run_test(Tests, Skip, Opts) -> DelResult = file:delete(CovExport), ct_logs:log("COVER INFO", "Warning! " - "Export file ~s already exists. " + "Export file ~ts already exists. " "Deleting with result: ~p", [CovExport,DelResult]); false -> @@ -2144,7 +2148,8 @@ do_run_test(Tests, Skip, Opts) -> %% tell test_server which modules should be cover compiled %% note that actual compilation is done when tests start test_server_ctrl:cover(CovApp, CovFile, CovExcl, CovIncl, - CovCross, CovExport, CovLevel), + CovCross, CovExport, CovLevel, + Opts#opts.cover_stop), %% save cover data (used e.g. to add nodes dynamically) ct_util:set_testdata({cover,CovData}), %% start cover on specified nodes @@ -2216,6 +2221,15 @@ do_run_test(Tests, Skip, Opts) -> end, CleanUp), [code:del_path(Dir) || Dir <- AddedToPath], + %% If a severe error has occurred in the test_server, + %% we will generate an exception here. + case ct_util:get_testdata(severe_error) of + undefined -> ok; + SevereError -> + ct_logs:log("SEVERE ERROR", "~p\n", [SevereError]), + exit(SevereError) + end, + case ct_util:get_testdata(stats) of Stats = {_Ok,_Failed,{_UserSkipped,_AutoSkipped}} -> Stats; @@ -2277,8 +2291,12 @@ add_jobs([{TestDir,all,_}|Tests], Skip, Opts, CleanUp) -> {'EXIT',_} -> CleanUp; _ -> - wait_for_idle(), - add_jobs(Tests, Skip, Opts, CleanUp) + case wait_for_idle() of + ok -> + add_jobs(Tests, Skip, Opts, CleanUp); + _ -> + CleanUp + end end; add_jobs([{TestDir,[Suite],all}|Tests], Skip, Opts, CleanUp) when is_atom(Suite) -> @@ -2291,8 +2309,12 @@ add_jobs([{TestDir,Suites,all}|Tests], Skip, {'EXIT',_} -> CleanUp; _ -> - wait_for_idle(), - add_jobs(Tests, Skip, Opts, CleanUp) + case wait_for_idle() of + ok -> + add_jobs(Tests, Skip, Opts, CleanUp); + _ -> + CleanUp + end end; add_jobs([{TestDir,Suite,all}|Tests], Skip, Opts, CleanUp) -> case maybe_interpret(Suite, all, Opts) of @@ -2304,8 +2326,12 @@ add_jobs([{TestDir,Suite,all}|Tests], Skip, Opts, CleanUp) -> {'EXIT',_} -> CleanUp; _ -> - wait_for_idle(), - add_jobs(Tests, Skip, Opts, [Suite|CleanUp]) + case wait_for_idle() of + ok -> + add_jobs(Tests, Skip, Opts, [Suite|CleanUp]); + _ -> + CleanUp + end end; Error -> Error @@ -2344,8 +2370,12 @@ add_jobs([{TestDir,Suite,Confs}|Tests], Skip, Opts, CleanUp) when {'EXIT',_} -> CleanUp; _ -> - wait_for_idle(), - add_jobs(Tests, Skip, Opts, [Suite|CleanUp]) + case wait_for_idle() of + ok -> + add_jobs(Tests, Skip, Opts, [Suite|CleanUp]); + _ -> + CleanUp + end end; Error -> Error @@ -2370,8 +2400,12 @@ add_jobs([{TestDir,Suite,Cases}|Tests], {'EXIT',_} -> CleanUp; _ -> - wait_for_idle(), - add_jobs(Tests, Skip, Opts, [Suite|CleanUp]) + case wait_for_idle() of + ok -> + add_jobs(Tests, Skip, Opts, [Suite|CleanUp]); + _ -> + CleanUp + end end; Error -> Error @@ -2387,8 +2421,12 @@ add_jobs([{TestDir,Suite,Case}|Tests], Skip, Opts, CleanUp) when is_atom(Case) - {'EXIT',_} -> CleanUp; _ -> - wait_for_idle(), - add_jobs(Tests, Skip, Opts, [Suite|CleanUp]) + case wait_for_idle() of + ok -> + add_jobs(Tests, Skip, Opts, [Suite|CleanUp]); + _ -> + CleanUp + end end; Error -> Error @@ -2398,7 +2436,13 @@ add_jobs([], _, _, CleanUp) -> wait_for_idle() -> ct_util:update_last_run_index(), - Notify = fun(Me) -> Me ! idle end, + Notify = fun(Me,IdleState) -> Me ! {idle,IdleState}, + receive + {Me,proceed} -> ok + after + 30000 -> ok + end + end, case catch test_server_ctrl:idle_notify(Notify) of {'EXIT',_} -> error; @@ -2406,11 +2450,14 @@ wait_for_idle() -> %% so we don't hang forever if test_server dies Ref = erlang:monitor(process, TSPid), Result = receive - idle -> ok; + {idle,abort} -> aborted; + {idle,_} -> ok; {'DOWN', Ref, _, _, _} -> error end, erlang:demonitor(Ref, [flush]), ct_util:update_last_run_index(), + %% let test_server_ctrl proceed (and possibly shut down) now + TSPid ! {self(),proceed}, Result end. @@ -2606,7 +2653,7 @@ log_ts_names(Specs) -> List = lists:map(fun(Name) -> Name ++ " " end, Specs), - ct_logs:log("Test Specification file(s)", "~s", + ct_logs:log("Test Specification file(s)", "~ts", [lists:flatten(List)]). merge_arguments(Args) -> @@ -2618,6 +2665,9 @@ merge_arguments([LogDir={logdir,_}|Args], Merged) -> merge_arguments([CoverFile={cover,_}|Args], Merged) -> merge_arguments(Args, handle_arg(replace, CoverFile, Merged)); +merge_arguments([CoverStop={cover_stop,_}|Args], Merged) -> + merge_arguments(Args, handle_arg(replace, CoverStop, Merged)); + merge_arguments([{'case',TC}|Args], Merged) -> merge_arguments(Args, handle_arg(merge, {testcase,TC}, Merged)); @@ -2714,10 +2764,10 @@ event_handler_args2opts(Default, Args) -> event_handler_init_args2opts(EHs) end. event_handler_init_args2opts([EH, Arg, "and" | EHs]) -> - [{list_to_atom(EH),lists:flatten(io_lib:format("~s",[Arg]))} | + [{list_to_atom(EH),lists:flatten(io_lib:format("~ts",[Arg]))} | event_handler_init_args2opts(EHs)]; event_handler_init_args2opts([EH, Arg]) -> - [{list_to_atom(EH),lists:flatten(io_lib:format("~s",[Arg]))}]; + [{list_to_atom(EH),lists:flatten(io_lib:format("~ts",[Arg]))}]; event_handler_init_args2opts([]) -> []. @@ -2867,6 +2917,10 @@ opts2args(EnvStartOpts) -> [{allow_user_terms,[]}]; ({allow_user_terms,false}) -> []; + ({join_specs,true}) -> + [{join_specs,[]}]; + ({join_specs,false}) -> + []; ({auto_compile,false}) -> [{no_auto_compile,[]}]; ({auto_compile,true}) -> @@ -2900,11 +2954,11 @@ opts2args(EnvStartOpts) -> [{event_handler_init,[atom_to_list(EH),ArgStr]}]; ({event_handler,{EHs,Arg}}) when is_list(EHs) -> ArgStr = lists:flatten(io_lib:format("~p", [Arg])), - Strs = lists:map(fun(EH) -> - [atom_to_list(EH), - ArgStr,"and"] - end, EHs), - [_LastAnd|StrsR] = lists:reverse(lists:flatten(Strs)), + Strs = lists:flatmap(fun(EH) -> + [atom_to_list(EH), + ArgStr,"and"] + end, EHs), + [_LastAnd | StrsR] = lists:reverse(Strs), [{event_handler_init,lists:reverse(StrsR)}]; ({logopts,LOs}) when is_list(LOs) -> [{logopts,[atom_to_list(LO) || LO <- LOs]}]; @@ -3035,7 +3089,7 @@ start_trace(Args) -> false end; {_,Error} -> - io:format("Warning! Tracing not started. Reason: ~s~n~n", + io:format("Warning! Tracing not started. Reason: ~ts~n~n", [file:format_error(Error)]), false end; diff --git a/lib/common_test/src/ct_slave.erl b/lib/common_test/src/ct_slave.erl index aa3413fa89..872c39de04 100644 --- a/lib/common_test/src/ct_slave.erl +++ b/lib/common_test/src/ct_slave.erl @@ -1,7 +1,7 @@ %%-------------------------------------------------------------------- %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2010. All Rights Reserved. +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -37,18 +37,19 @@ -record(options, {username, password, boot_timeout, init_timeout, startup_timeout, startup_functions, monitor_master, - kill_if_fail, erl_flags}). + kill_if_fail, erl_flags, env}). %%%----------------------------------------------------------------- %%% @spec start(Node) -> Result %%% Node = atom() %%% Result = {ok, NodeName} | -%%% {error, already_started, NodeName} | -%%% {error, started_not_connected, NodeName} | -%%% {error, boot_timeout, NodeName} | -%%% {error, init_timeout, NodeName} | -%%% {error, startup_timeout, NodeName} | -%%% {error, not_alive, NodeName} +%%% {error, Reason, NodeName} +%%% Reason = already_started | +%%% started_not_connected | +%%% boot_timeout | +%%% init_timeout | +%%% startup_timeout | +%%% not_alive %%% NodeName = atom() %%% @doc Starts an Erlang node with name <code>Node</code> on the local host. %%% @see start/3 @@ -56,20 +57,28 @@ start(Node) -> start(gethostname(), Node). %%%----------------------------------------------------------------- -%%% @spec start(Host, Node) -> Result -%%% Node = atom() -%%% Host = atom() +%%% @spec start(HostOrNode, NodeOrOpts) -> Result +%%% HostOrNode = atom() +%%% NodeOrOpts = atom() | list() %%% Result = {ok, NodeName} | -%%% {error, already_started, NodeName} | -%%% {error, started_not_connected, NodeName} | -%%% {error, boot_timeout, NodeName} | -%%% {error, init_timeout, NodeName} | -%%% {error, startup_timeout, NodeName} | -%%% {error, not_alive, NodeName} +%%% {error, Reason, NodeName} +%%% Reason = already_started | +%%% started_not_connected | +%%% boot_timeout | +%%% init_timeout | +%%% startup_timeout | +%%% not_alive %%% NodeName = atom() -%%% @doc Starts an Erlang node with name <code>Node</code> on host -%%% <code>Host</code> with the default options. +%%% @doc Starts an Erlang node with default options on a specified +%%% host, or on the local host with specified options. That is, +%%% the call is interpreted as <code>start(Host, Node)</code> when the +%%% second argument is atom-valued and <code>start(Node, Opts)</code> +%%% when it's list-valued. %%% @see start/3 +start(_HostOrNode = Node, _NodeOrOpts = Opts) %% match to satiate edoc + when is_list(Opts) -> + start(gethostname(), Node, Opts); + start(Host, Node) -> start(Host, Node, []). @@ -85,7 +94,8 @@ start(Host, Node) -> %%% {startup_functions, StartupFunctions} | %%% {monitor_master, Monitor} | %%% {kill_if_fail, KillIfFail} | -%%% {erl_flags, ErlangFlags} +%%% {erl_flags, ErlangFlags} | +%%% {env, [{EnvVar,Value}]} %%% Username = string() %%% Password = string() %%% BootTimeout = integer() @@ -99,12 +109,16 @@ start(Host, Node) -> %%% Monitor = bool() %%% KillIfFail = bool() %%% ErlangFlags = string() -%%% Result = {ok, NodeName} | {error, already_started, NodeName} | -%%% {error, started_not_connected, NodeName} | -%%% {error, boot_timeout, NodeName} | -%%% {error, init_timeout, NodeName} | -%%% {error, startup_timeout, NodeName} | -%%% {error, not_alive, NodeName} +%%% EnvVar = string() +%%% Value = string() +%%% Result = {ok, NodeName} | +%%% {error, Reason, NodeName} +%%% Reason = already_started | +%%% started_not_connected | +%%% boot_timeout | +%%% init_timeout | +%%% startup_timeout | +%%% not_alive %%% NodeName = atom() %%% @doc Starts an Erlang node with name <code>Node</code> on host %%% <code>Host</code> as specified by the combination of options in @@ -152,6 +166,9 @@ start(Host, Node) -> %%% <p>Option <code>erlang_flags</code> specifies, which flags will be added %%% to the parameters of the <code>erl</code> executable.</p> %%% +%%% <p>Option <code>env</code> specifies a list of environment variables +%%% that will extended the environment.</p> +%%% %%% <p>Special return values are: %%% <list> %%% <item><code>{error, already_started, NodeName}</code> - if the node with @@ -163,7 +180,7 @@ start(Host, Node) -> %%% <code>NodeName</code> is the name of current node in this case.</item> %%% </list></p> %%% -start(Host, Node, Options) -> +start(Host, Node, Opts) -> ENode = enodename(Host, Node), case erlang:is_alive() of false-> @@ -171,7 +188,7 @@ start(Host, Node, Options) -> true-> case is_started(ENode) of false-> - OptionsRec = fetch_options(Options), + OptionsRec = fetch_options(Opts), do_start(Host, Node, OptionsRec); {true, not_connected}-> {error, started_not_connected, ENode}; @@ -183,9 +200,11 @@ start(Host, Node, Options) -> %%% @spec stop(Node) -> Result %%% Node = atom() %%% Result = {ok, NodeName} | -%%% {error, not_started, NodeName} | -%%% {error, not_connected, NodeName} | -%%% {error, stop_timeout, NodeName} +%%% {error, Reason, NodeName} +%%% Reason = not_started | +%%% not_connected | +%%% stop_timeout + %%% NodeName = atom() %%% @doc Stops the running Erlang node with name <code>Node</code> on %%% the localhost. @@ -196,9 +215,10 @@ stop(Node) -> %%% Host = atom() %%% Node = atom() %%% Result = {ok, NodeName} | -%%% {error, not_started, NodeName} | -%%% {error, not_connected, NodeName} | -%%% {error, stop_timeout, NodeName} +%%% {error, Reason, NodeName} +%%% Reason = not_started | +%%% not_connected | +%%% stop_timeout %%% NodeName = atom() %%% @doc Stops the running Erlang node with name <code>Node</code> on %%% host <code>Host</code>. @@ -233,10 +253,12 @@ fetch_options(Options) -> Monitor = get_option_value(monitor_master, Options, false), KillIfFail = get_option_value(kill_if_fail, Options, true), ErlFlags = get_option_value(erl_flags, Options, []), + EnvVars = get_option_value(env, Options, []), #options{username=UserName, password=Password, boot_timeout=BootTimeout, init_timeout=InitTimeout, startup_timeout=StartupTimeout, startup_functions=StartupFunctions, - monitor_master=Monitor, kill_if_fail=KillIfFail, erl_flags=ErlFlags}. + monitor_master=Monitor, kill_if_fail=KillIfFail, + erl_flags=ErlFlags, env=EnvVars}. % send a message when slave node is started % @hidden @@ -306,11 +328,19 @@ do_start(Host, Node, Options) -> true-> spawn_remote_node(Host, Node, Options) end, + BootTimeout = Options#options.boot_timeout, InitTimeout = Options#options.init_timeout, StartupTimeout = Options#options.startup_timeout, Result = case wait_for_node_alive(ENode, BootTimeout) of pong-> + case test_server:is_cover() of + true -> + MainCoverNode = cover:get_main_node(), + rpc:call(MainCoverNode,cover,start,[ENode]); + false -> + ok + end, call_functions(ENode, Functions2), receive {node_started, ENode}-> @@ -365,9 +395,9 @@ get_cmd(Node, Flags) -> % spawn node locally spawn_local_node(Node, Options) -> - ErlFlags = Options#options.erl_flags, + #options{env=Env,erl_flags=ErlFlags} = Options, Cmd = get_cmd(Node, ErlFlags), - open_port({spawn, Cmd}, [stream]). + open_port({spawn, Cmd}, [stream,{env,Env}]). % start crypto and ssh if not yet started check_for_ssh_running() -> @@ -386,9 +416,10 @@ check_for_ssh_running() -> % spawn node remotely spawn_remote_node(Host, Node, Options) -> - Username = Options#options.username, - Password = Options#options.password, - ErlFlags = Options#options.erl_flags, + #options{username=Username, + password=Password, + erl_flags=ErlFlags, + env=Env} = Options, SSHOptions = case {Username, Password} of {[], []}-> []; @@ -400,8 +431,17 @@ spawn_remote_node(Host, Node, Options) -> check_for_ssh_running(), {ok, SSHConnRef} = ssh:connect(atom_to_list(Host), 22, SSHOptions), {ok, SSHChannelId} = ssh_connection:session_channel(SSHConnRef, infinity), + ssh_setenv(SSHConnRef, SSHChannelId, Env), ssh_connection:exec(SSHConnRef, SSHChannelId, get_cmd(Node, ErlFlags), infinity). + +ssh_setenv(SSHConnRef, SSHChannelId, [{Var, Value} | Vars]) + when is_list(Var), is_list(Value) -> + success = ssh_connection:setenv(SSHConnRef, SSHChannelId, + Var, Value, infinity), + ssh_setenv(SSHConnRef, SSHChannelId, Vars); +ssh_setenv(_SSHConnRef, _SSHChannelId, []) -> ok. + % call functions on a remote Erlang node call_functions(_Node, []) -> ok; @@ -423,8 +463,29 @@ wait_for_node_alive(Node, N) -> % call init:stop on a remote node do_stop(ENode) -> + {Cover,MainCoverNode} = + case test_server:is_cover() of + true -> + Main = cover:get_main_node(), + rpc:call(Main,cover,flush,[ENode]), + {true,Main}; + false -> + {false,undefined} + end, spawn(ENode, init, stop, []), - wait_for_node_dead(ENode, 5). + case wait_for_node_dead(ENode, 5) of + {ok,ENode} -> + if Cover -> + %% To avoid that cover is started again if a node + %% with the same name is started later. + rpc:call(MainCoverNode,cover,stop,[ENode]); + true -> + ok + end, + {ok,ENode}; + Error -> + Error + end. % wait N seconds until node is disconnected wait_for_node_dead(Node, 0) -> diff --git a/lib/common_test/src/ct_snmp.erl b/lib/common_test/src/ct_snmp.erl index 8fe63e8ed1..71038bd4f4 100644 --- a/lib/common_test/src/ct_snmp.erl +++ b/lib/common_test/src/ct_snmp.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2004-2010. All Rights Reserved. +%% Copyright Ericsson AB 2004-2012. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -39,7 +39,7 @@ %%% %%% Manager config %%% [{start_manager, boolean()} % Optional - default is true %%% {users, [{user_name(), [call_back_module(), user_data()]}]}, %% Optional -%%% {usm_users, [{usm_user_name(), usm_config()}]},%% Optional - snmp v3 only +%%% {usm_users, [{usm_user_name(), [usm_config()]}]},%% Optional - snmp v3 only %%% % managed_agents is optional %%% {managed_agents,[{agent_name(), [user_name(), agent_ip(), agent_port(), [agent_config()]]}]}, %%% {max_msg_size, integer()}, % Optional - default is 484 @@ -130,7 +130,7 @@ %%% @type agent_config() = {Item, Value} %%% @type user_name() = atom() %%% @type usm_user_name() = string() -%%% @type usm_config() = string() +%%% @type usm_config() = {Item, Value} %%% @type call_back_module() = atom() %%% @type user_data() = term() %%% @type oids() = [oid()] @@ -157,8 +157,9 @@ %%% API -export([start/2, start/3, stop/1, get_values/3, get_next_values/3, set_values/4, set_info/1, register_users/2, register_agents/2, register_usm_users/2, - unregister_users/1, unregister_agents/1, update_usm_users/2, - load_mibs/1]). + unregister_users/1, unregister_users/2, unregister_agents/1, + unregister_agents/2, unregister_usm_users/1, unregister_usm_users/2, + load_mibs/1, unload_mibs/1]). %% Manager values -define(CT_SNMP_LOG_FILE, "ct_snmp_set.log"). @@ -250,10 +251,8 @@ stop(Config) -> %%% %%% @doc Issues a synchronous snmp get request. get_values(Agent, Oids, MgrAgentConfName) -> - [Uid, AgentIp, AgentUdpPort | _] = - agent_conf(Agent, MgrAgentConfName), - {ok, SnmpReply, _} = - snmpm:g(Uid, AgentIp, AgentUdpPort, Oids), + [Uid | _] = agent_conf(Agent, MgrAgentConfName), + {ok, SnmpReply, _} = snmpm:sync_get2(Uid, target_name(Agent), Oids), SnmpReply. %%% @spec get_next_values(Agent, Oids, MgrAgentConfName) -> SnmpReply @@ -265,10 +264,8 @@ get_values(Agent, Oids, MgrAgentConfName) -> %%% %%% @doc Issues a synchronous snmp get next request. get_next_values(Agent, Oids, MgrAgentConfName) -> - [Uid, AgentIp, AgentUdpPort | _] = - agent_conf(Agent, MgrAgentConfName), - {ok, SnmpReply, _} = - snmpm:gn(Uid, AgentIp, AgentUdpPort, Oids), + [Uid | _] = agent_conf(Agent, MgrAgentConfName), + {ok, SnmpReply, _} = snmpm:sync_get_next2(Uid, target_name(Agent), Oids), SnmpReply. %%% @spec set_values(Agent, VarsAndVals, MgrAgentConfName, Config) -> SnmpReply @@ -282,13 +279,11 @@ get_next_values(Agent, Oids, MgrAgentConfName) -> %%% @doc Issues a synchronous snmp set request. set_values(Agent, VarsAndVals, MgrAgentConfName, Config) -> PrivDir = ?config(priv_dir, Config), - [Uid, AgentIp, AgentUdpPort | _] = - agent_conf(Agent, MgrAgentConfName), + [Uid | _] = agent_conf(Agent, MgrAgentConfName), Oids = lists:map(fun({Oid, _, _}) -> Oid end, VarsAndVals), - {ok, SnmpGetReply, _} = - snmpm:g(Uid, AgentIp, AgentUdpPort, Oids), - {ok, SnmpSetReply, _} = - snmpm:s(Uid, AgentIp, AgentUdpPort, VarsAndVals), + TargetName = target_name(Agent), + {ok, SnmpGetReply, _} = snmpm:sync_get2(Uid, TargetName, Oids), + {ok, SnmpSetReply, _} = snmpm:sync_set2(Uid, TargetName, VarsAndVals), case SnmpSetReply of {noError, 0, _} when PrivDir /= false -> log(PrivDir, Agent, SnmpGetReply, VarsAndVals); @@ -328,12 +323,23 @@ set_info(Config) -> %%% Reason = term() %%% %%% @doc Register the manager entity (=user) responsible for specific agent(s). -%%% Corresponds to making an entry in users.conf +%%% Corresponds to making an entry in users.conf. +%%% +%%% This function will try to register the given users, without +%%% checking if any of them already exist. In order to change an +%%% already registered user, the user must first be unregistered. register_users(MgrAgentConfName, Users) -> - {snmp, SnmpVals} = ct:get_config(MgrAgentConfName), - NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users, Users}), - ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}), - setup_users(Users). + case setup_users(Users) of + ok -> + SnmpVals = ct:get_config(MgrAgentConfName), + OldUsers = ct:get_config({MgrAgentConfName,users},[]), + NewSnmpVals = lists:keystore(users, 1, SnmpVals, + {users, Users ++ OldUsers}), + ct_config:update_config(MgrAgentConfName, NewSnmpVals), + ok; + Error -> + Error + end. %%% @spec register_agents(MgrAgentConfName, ManagedAgents) -> ok | {error, Reason} %%% @@ -343,12 +349,24 @@ register_users(MgrAgentConfName, Users) -> %%% %%% @doc Explicitly instruct the manager to handle this agent. %%% Corresponds to making an entry in agents.conf +%%% +%%% This function will try to register the given managed agents, +%%% without checking if any of them already exist. In order to change +%%% an already registered managed agent, the agent must first be +%%% unregistered. register_agents(MgrAgentConfName, ManagedAgents) -> - {snmp, SnmpVals} = ct:get_config(MgrAgentConfName), - NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals, - {managed_agents, ManagedAgents}), - ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}), - setup_managed_agents(ManagedAgents). + case setup_managed_agents(MgrAgentConfName,ManagedAgents) of + ok -> + SnmpVals = ct:get_config(MgrAgentConfName), + OldAgents = ct:get_config({MgrAgentConfName,managed_agents},[]), + NewSnmpVals = lists:keystore(managed_agents, 1, SnmpVals, + {managed_agents, + ManagedAgents ++ OldAgents}), + ct_config:update_config(MgrAgentConfName, NewSnmpVals), + ok; + Error -> + Error + end. %%% @spec register_usm_users(MgrAgentConfName, UsmUsers) -> ok | {error, Reason} %%% @@ -358,60 +376,115 @@ register_agents(MgrAgentConfName, ManagedAgents) -> %%% %%% @doc Explicitly instruct the manager to handle this USM user. %%% Corresponds to making an entry in usm.conf +%%% +%%% This function will try to register the given users, without +%%% checking if any of them already exist. In order to change an +%%% already registered user, the user must first be unregistered. register_usm_users(MgrAgentConfName, UsmUsers) -> - {snmp, SnmpVals} = ct:get_config(MgrAgentConfName), - NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {usm_users, UsmUsers}), - ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}), EngineID = ct:get_config({MgrAgentConfName, engine_id}, ?ENGINE_ID), - setup_usm_users(UsmUsers, EngineID). + case setup_usm_users(UsmUsers, EngineID) of + ok -> + SnmpVals = ct:get_config(MgrAgentConfName), + OldUsmUsers = ct:get_config({MgrAgentConfName,usm_users},[]), + NewSnmpVals = lists:keystore(usm_users, 1, SnmpVals, + {usm_users, UsmUsers ++ OldUsmUsers}), + ct_config:update_config(MgrAgentConfName, NewSnmpVals), + ok; + Error -> + Error + end. -%%% @spec unregister_users(MgrAgentConfName) -> ok | {error, Reason} +%%% @spec unregister_users(MgrAgentConfName) -> ok %%% %%% MgrAgentConfName = atom() %%% Reason = term() %%% -%%% @doc Removes information added when calling register_users/2. +%%% @doc Unregister all users. unregister_users(MgrAgentConfName) -> - Users = lists:map(fun({UserName, _}) -> UserName end, - ct:get_config({MgrAgentConfName, users})), - {snmp, SnmpVals} = ct:get_config(MgrAgentConfName), - NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users, []}), - ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}), - takedown_users(Users). + Users = [Id || {Id,_} <- ct:get_config({MgrAgentConfName, users},[])], + unregister_users(MgrAgentConfName,Users). -%%% @spec unregister_agents(MgrAgentConfName) -> ok | {error, Reason} +%%% @spec unregister_users(MgrAgentConfName,Users) -> ok %%% %%% MgrAgentConfName = atom() +%%% Users = [user_name()] %%% Reason = term() %%% -%%% @doc Removes information added when calling register_agents/2. +%%% @doc Unregister the given users. +unregister_users(MgrAgentConfName,Users) -> + takedown_users(Users), + SnmpVals = ct:get_config(MgrAgentConfName), + AllUsers = ct:get_config({MgrAgentConfName, users},[]), + RemainingUsers = lists:filter(fun({Id,_}) -> + not lists:member(Id,Users) + end, + AllUsers), + NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users,RemainingUsers}), + ct_config:update_config(MgrAgentConfName, NewSnmpVals), + ok. + +%%% @spec unregister_agents(MgrAgentConfName) -> ok +%%% +%%% MgrAgentConfName = atom() +%%% Reason = term() +%%% +%%% @doc Unregister all managed agents. unregister_agents(MgrAgentConfName) -> - ManagedAgents = lists:map(fun({_, [Uid, AgentIP, AgentPort, _]}) -> - {Uid, AgentIP, AgentPort} - end, - ct:get_config({MgrAgentConfName, managed_agents})), - {snmp, SnmpVals} = ct:get_config(MgrAgentConfName), - NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals, - {managed_agents, []}), - ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}), - takedown_managed_agents(ManagedAgents). + ManagedAgents = [AgentName || + {AgentName, _} <- + ct:get_config({MgrAgentConfName,managed_agents},[])], + unregister_agents(MgrAgentConfName,ManagedAgents). +%%% @spec unregister_agents(MgrAgentConfName,ManagedAgents) -> ok +%%% +%%% MgrAgentConfName = atom() +%%% ManagedAgents = [agent_name()] +%%% Reason = term() +%%% +%%% @doc Unregister the given managed agents. +unregister_agents(MgrAgentConfName,ManagedAgents) -> + takedown_managed_agents(MgrAgentConfName, ManagedAgents), + SnmpVals = ct:get_config(MgrAgentConfName), + AllAgents = ct:get_config({MgrAgentConfName,managed_agents},[]), + RemainingAgents = lists:filter(fun({Name,_}) -> + not lists:member(Name,ManagedAgents) + end, + AllAgents), + NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals, + {managed_agents,RemainingAgents}), + ct_config:update_config(MgrAgentConfName, NewSnmpVals), + ok. -%%% @spec update_usm_users(MgrAgentConfName, UsmUsers) -> ok | {error, Reason} +%%% @spec unregister_usm_users(MgrAgentConfName) -> ok %%% %%% MgrAgentConfName = atom() -%%% UsmUsers = usm_users() %%% Reason = term() %%% -%%% @doc Alters information added when calling register_usm_users/2. -update_usm_users(MgrAgentConfName, UsmUsers) -> - - {snmp, SnmpVals} = ct:get_config(MgrAgentConfName), - NewSnmpVals = lists:keyreplace(usm_users, 1, SnmpVals, - {usm_users, UsmUsers}), - ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}), +%%% @doc Unregister all usm users. +unregister_usm_users(MgrAgentConfName) -> + UsmUsers = [Id || {Id,_} <- ct:get_config({MgrAgentConfName, usm_users},[])], + unregister_usm_users(MgrAgentConfName,UsmUsers). + +%%% @spec unregister_usm_users(MgrAgentConfName,UsmUsers) -> ok +%%% +%%% MgrAgentConfName = atom() +%%% UsmUsers = [usm_user_name()] +%%% Reason = term() +%%% +%%% @doc Unregister the given usm users. +unregister_usm_users(MgrAgentConfName,UsmUsers) -> EngineID = ct:get_config({MgrAgentConfName, engine_id}, ?ENGINE_ID), - do_update_usm_users(UsmUsers, EngineID). + takedown_usm_users(UsmUsers,EngineID), + SnmpVals = ct:get_config(MgrAgentConfName), + AllUsmUsers = ct:get_config({MgrAgentConfName, usm_users},[]), + RemainingUsmUsers = lists:filter(fun({Id,_}) -> + not lists:member(Id,UsmUsers) + end, + AllUsmUsers), + NewSnmpVals = lists:keyreplace(usm_users, 1, SnmpVals, + {usm_users,RemainingUsmUsers}), + ct_config:update_config(MgrAgentConfName, NewSnmpVals), + ok. %%% @spec load_mibs(Mibs) -> ok | {error, Reason} %%% @@ -423,6 +496,15 @@ update_usm_users(MgrAgentConfName, UsmUsers) -> load_mibs(Mibs) -> snmpa:load_mibs(snmp_master_agent, Mibs). +%%% @spec unload_mibs(Mibs) -> ok | {error, Reason} +%%% +%%% Mibs = [MibName] +%%% MibName = string() +%%% Reason = term() +%%% +%%% @doc Unload the mibs from the agent 'snmp_master_agent'. +unload_mibs(Mibs) -> + snmpa:unload_mibs(snmp_master_agent, Mibs). %%%======================================================================== %%% Internal functions @@ -486,9 +568,8 @@ setup_agent(true, AgentConfName, SnmpConfName, file:make_dir(DbDir), snmp_config:write_agent_snmp_files(ConfDir, Vsns, ManagerIP, TrapUdp, AgentIP, AgentUdp, SysName, - atom_to_list(NotifType), - SecType, Passwd, AgentEngineID, - AgentMaxMsgSize), + NotifType, SecType, Passwd, + AgentEngineID, AgentMaxMsgSize), override_default_configuration(Config, AgentConfName), @@ -497,7 +578,8 @@ setup_agent(true, AgentConfName, SnmpConfName, {verbosity, trace}]}, {agent_type, master}, {agent_verbosity, trace}, - {net_if, [{verbosity, trace}]}], + {net_if, [{verbosity, trace}]}, + {versions, Vsns}], ct:get_config({SnmpConfName,agent})), application:set_env(snmp, agent, SnmpEnv). %%%--------------------------------------------------------------------------- @@ -535,65 +617,61 @@ manager_register(true, MgrAgentConfName) -> setup_usm_users(UsmUsers, EngineID), setup_users(Users), - setup_managed_agents(Agents). + setup_managed_agents(MgrAgentConfName,Agents). %%%--------------------------------------------------------------------------- setup_users(Users) -> - lists:foreach(fun({Id, [Module, Data]}) -> - snmpm:register_user(Id, Module, Data) - end, Users). + while_ok(fun({Id, [Module, Data]}) -> + snmpm:register_user(Id, Module, Data) + end, Users). %%%--------------------------------------------------------------------------- -setup_managed_agents([]) -> - ok; - -setup_managed_agents([{_, [Uid, AgentIp, AgentUdpPort, AgentConf]} | - Rest]) -> - NewAgentIp = case AgentIp of - IpTuple when is_tuple(IpTuple) -> - IpTuple; - HostName when is_list(HostName) -> - {ok,Hostent} = inet:gethostbyname(HostName), - [IpTuple|_] = Hostent#hostent.h_addr_list, - IpTuple - end, - ok = snmpm:register_agent(Uid, NewAgentIp, AgentUdpPort), - lists:foreach(fun({Item, Val}) -> - snmpm:update_agent_info(Uid, NewAgentIp, - AgentUdpPort, Item, Val) - end, AgentConf), - setup_managed_agents(Rest). +setup_managed_agents(AgentConfName,Agents) -> + Fun = + fun({AgentName, [Uid, AgentIp, AgentUdpPort, AgentConf0]}) -> + NewAgentIp = case AgentIp of + IpTuple when is_tuple(IpTuple) -> + IpTuple; + HostName when is_list(HostName) -> + {ok,Hostent} = inet:gethostbyname(HostName), + [IpTuple|_] = Hostent#hostent.h_addr_list, + IpTuple + end, + AgentConf = + case lists:keymember(engine_id,1,AgentConf0) of + true -> + AgentConf0; + false -> + DefaultEngineID = + ct:get_config({AgentConfName,agent_engine_id}, + ?AGENT_ENGINE_ID), + [{engine_id,DefaultEngineID}|AgentConf0] + end, + snmpm:register_agent(Uid, target_name(AgentName), + [{address,NewAgentIp},{port,AgentUdpPort} | + AgentConf]) + end, + while_ok(Fun,Agents). %%%--------------------------------------------------------------------------- setup_usm_users(UsmUsers, EngineID)-> - lists:foreach(fun({UsmUser, Conf}) -> - snmpm:register_usm_user(EngineID, UsmUser, Conf) - end, UsmUsers). + while_ok(fun({UsmUser, Conf}) -> + snmpm:register_usm_user(EngineID, UsmUser, Conf) + end, UsmUsers). %%%--------------------------------------------------------------------------- takedown_users(Users) -> - lists:foreach(fun({Id}) -> + lists:foreach(fun(Id) -> snmpm:unregister_user(Id) end, Users). %%%--------------------------------------------------------------------------- -takedown_managed_agents([{Uid, AgentIp, AgentUdpPort} | - Rest]) -> - NewAgentIp = case AgentIp of - IpTuple when is_tuple(IpTuple) -> - IpTuple; - HostName when is_list(HostName) -> - {ok,Hostent} = inet:gethostbyname(HostName), - [IpTuple|_] = Hostent#hostent.h_addr_list, - IpTuple - end, - ok = snmpm:unregister_agent(Uid, NewAgentIp, AgentUdpPort), - takedown_managed_agents(Rest); - -takedown_managed_agents([]) -> - ok. +takedown_managed_agents(MgrAgentConfName,ManagedAgents) -> + lists:foreach(fun(AgentName) -> + [Uid | _] = agent_conf(AgentName, MgrAgentConfName), + snmpm:unregister_agent(Uid, target_name(AgentName)) + end, ManagedAgents). %%%--------------------------------------------------------------------------- -do_update_usm_users(UsmUsers, EngineID) -> - lists:foreach(fun({UsmUser, {Item, Val}}) -> - snmpm:update_usm_user_info(EngineID, UsmUser, - Item, Val) - end, UsmUsers). +takedown_usm_users(UsmUsers, EngineID) -> + lists:foreach(fun(Id) -> + snmpm:unregister_usm_user(EngineID, Id) + end, UsmUsers). %%%--------------------------------------------------------------------------- log(PrivDir, Agent, {_, _, Varbinds}, NewVarsAndVals) -> @@ -657,7 +735,7 @@ override_contexts(Config, {data_dir_file, File}) -> override_contexts(Config, ContextInfo); override_contexts(Config, Contexts) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"context.conf"), file:delete(File), snmp_config:write_agent_context_config(Dir, "", Contexts). @@ -673,7 +751,7 @@ override_sysinfo(Config, {data_dir_file, File}) -> override_sysinfo(Config, SysInfo); override_sysinfo(Config, SysInfo) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"standard.conf"), file:delete(File), snmp_config:write_agent_standard_config(Dir, "", SysInfo). @@ -688,7 +766,7 @@ override_target_address(Config, {data_dir_file, File}) -> override_target_address(Config, TargetAddressConf); override_target_address(Config, TargetAddressConf) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"target_addr.conf"), file:delete(File), snmp_config:write_agent_target_addr_config(Dir, "", TargetAddressConf). @@ -704,7 +782,7 @@ override_target_params(Config, {data_dir_file, File}) -> override_target_params(Config, TargetParamsConf); override_target_params(Config, TargetParamsConf) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"target_params.conf"), file:delete(File), snmp_config:write_agent_target_params_config(Dir, "", TargetParamsConf). @@ -719,7 +797,7 @@ override_notify(Config, {data_dir_file, File}) -> override_notify(Config, NotifyConf); override_notify(Config, NotifyConf) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"notify.conf"), file:delete(File), snmp_config:write_agent_notify_config(Dir, "", NotifyConf). @@ -734,7 +812,7 @@ override_usm(Config, {data_dir_file, File}) -> override_usm(Config, UsmConf); override_usm(Config, UsmConf) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"usm.conf"), file:delete(File), snmp_config:write_agent_usm_config(Dir, "", UsmConf). @@ -749,7 +827,7 @@ override_community(Config, {data_dir_file, File}) -> override_community(Config, CommunityConf); override_community(Config, CommunityConf) -> - Dir = ?config(priv_dir, Config), + Dir = filename:join(?config(priv_dir, Config),"conf"), File = filename:join(Dir,"community.conf"), file:delete(File), snmp_config:write_agent_community_config(Dir, "", CommunityConf). @@ -765,7 +843,20 @@ override_vacm(Config, {data_dir_file, File}) -> override_vacm(Config, VacmConf); override_vacm(Config, VacmConf) -> - Dir = ?config(priv_dir, Config), - File = filename:join(Dir,"vacm.conf"), + Dir = filename:join(?config(priv_dir, Config),"conf"), + File = filename:join(Dir,"vacm.conf"), file:delete(File), snmp_config:write_agent_vacm_config(Dir, "", VacmConf). + +%%%--------------------------------------------------------------------------- + +target_name(Agent) -> + atom_to_list(Agent). + +while_ok(Fun,[H|T]) -> + case Fun(H) of + ok -> while_ok(Fun,T); + Error -> Error + end; +while_ok(_Fun,[]) -> + ok. diff --git a/lib/common_test/src/ct_telnet.erl b/lib/common_test/src/ct_telnet.erl index b13c050e32..02186864a5 100644 --- a/lib/common_test/src/ct_telnet.erl +++ b/lib/common_test/src/ct_telnet.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2012. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -201,7 +201,7 @@ open(KeyOrName,ConnType,TargetMod,Extra) -> close(Connection) -> case get_handle(Connection) of {ok,Pid} -> - log("ct_telnet:close","Handle: ~p",[Pid]), + log("ct_telnet:close","Handle: ~w",[Pid]), case ct_gen_conn:stop(Pid) of {error,{process_down,Pid,noproc}} -> {error,already_closed}; @@ -558,7 +558,7 @@ reconnect(Ip,Port,N,State=#state{target_mod=TargetMod, Error when N==0 -> Error; _Error -> - log("Reconnect failed!","Retries left: ~p",[N]), + log("Reconnect failed!","Retries left: ~w",[N]), timer:sleep(ReconnInt), reconnect(Ip,Port,N-1,State) end. @@ -567,7 +567,7 @@ reconnect(Ip,Port,N,State=#state{target_mod=TargetMod, %% @hidden terminate(TelnPid,State) -> log(heading(terminate,State#state.name), - "Closing telnet connection.\nId: ~p", + "Closing telnet connection.\nId: ~w", [TelnPid]), ct_telnet_client:close(TelnPid). @@ -899,7 +899,7 @@ one_expect(Data,Pattern,EO) -> [Prompt] when Prompt==prompt; Prompt=={prompt,PromptType} -> %% Only searching for prompt log_lines(UptoPrompt), - try_cont_log("<b>PROMPT:</b> ~s", [PromptType]), + try_cont_log("<b>PROMPT:</b> ~ts", [PromptType]), {match,{prompt,PromptType},Rest}; [{prompt,_OtherPromptType}] -> %% Only searching for one specific prompt, not thisone @@ -969,7 +969,7 @@ seq_expect1(Data,[prompt|Patterns],Acc,Rest,EO) -> {continue,[prompt|Patterns],Acc,LastLine}; PromptType -> log_lines(Data), - try_cont_log("<b>PROMPT:</b> ~s", [PromptType]), + try_cont_log("<b>PROMPT:</b> ~ts", [PromptType]), seq_expect(Rest,Patterns,[{prompt,PromptType}|Acc],EO) end; seq_expect1(Data,[{prompt,PromptType}|Patterns],Acc,Rest,EO) -> @@ -980,7 +980,7 @@ seq_expect1(Data,[{prompt,PromptType}|Patterns],Acc,Rest,EO) -> {continue,[{prompt,PromptType}|Patterns],Acc,LastLine}; PromptType -> log_lines(Data), - try_cont_log("<b>PROMPT:</b> ~s", [PromptType]), + try_cont_log("<b>PROMPT:</b> ~ts", [PromptType]), seq_expect(Rest,Patterns,[{prompt,PromptType}|Acc],EO); _OtherPromptType -> log_lines(Data), @@ -1032,13 +1032,13 @@ match_line(Line,Patterns,FoundPrompt,EO) -> match_line(Line,[prompt|Patterns],false,EO,RetTag) -> match_line(Line,Patterns,false,EO,RetTag); match_line(Line,[prompt|_Patterns],FoundPrompt,_EO,RetTag) -> - try_cont_log(" ~s", [Line]), - try_cont_log("<b>PROMPT:</b> ~s", [FoundPrompt]), + try_cont_log(" ~ts", [Line]), + try_cont_log("<b>PROMPT:</b> ~ts", [FoundPrompt]), {RetTag,{prompt,FoundPrompt}}; match_line(Line,[{prompt,PromptType}|_Patterns],FoundPrompt,_EO,RetTag) when PromptType==FoundPrompt -> - try_cont_log(" ~s", [Line]), - try_cont_log("<b>PROMPT:</b> ~s", [FoundPrompt]), + try_cont_log(" ~ts", [Line]), + try_cont_log("<b>PROMPT:</b> ~ts", [FoundPrompt]), {RetTag,{prompt,FoundPrompt}}; match_line(Line,[{prompt,PromptType}|Patterns],FoundPrompt,EO,RetTag) when PromptType=/=FoundPrompt -> @@ -1048,7 +1048,7 @@ match_line(Line,[{Tag,Pattern}|Patterns],FoundPrompt,EO,RetTag) -> nomatch -> match_line(Line,Patterns,FoundPrompt,EO,RetTag); {match,Match} -> - try_cont_log("<b>MATCH:</b> ~s", [Line]), + try_cont_log("<b>MATCH:</b> ~ts", [Line]), {RetTag,{Tag,Match}} end; match_line(Line,[Pattern|Patterns],FoundPrompt,EO,RetTag) -> @@ -1056,13 +1056,13 @@ match_line(Line,[Pattern|Patterns],FoundPrompt,EO,RetTag) -> nomatch -> match_line(Line,Patterns,FoundPrompt,EO,RetTag); {match,Match} -> - try_cont_log("<b>MATCH:</b> ~s", [Line]), + try_cont_log("<b>MATCH:</b> ~ts", [Line]), {RetTag,Match} end; match_line(Line,[],FoundPrompt,EO,match) -> match_line(Line,EO#eo.haltpatterns,FoundPrompt,EO,halt); match_line(Line,[],_FoundPrompt,_EO,halt) -> - try_cont_log(" ~s", [Line]), + try_cont_log(" ~ts", [Line]), nomatch. one_line([$\n|Rest],Line) -> @@ -1086,7 +1086,7 @@ log_lines(String) -> [] -> ok; LastLine -> - try_cont_log(" ~s", [LastLine]) + try_cont_log(" ~ts", [LastLine]) end. log_lines_not_last(String) -> @@ -1094,7 +1094,7 @@ log_lines_not_last(String) -> {[],LastLine} -> LastLine; {String1,LastLine} -> - try_cont_log("~s",[String1]), + try_cont_log("~ts",[String1]), LastLine end. diff --git a/lib/common_test/src/ct_telnet_client.erl b/lib/common_test/src/ct_telnet_client.erl index d703b39ac5..7329498ed6 100644 --- a/lib/common_test/src/ct_telnet_client.erl +++ b/lib/common_test/src/ct_telnet_client.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2010. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -308,7 +308,7 @@ cmd_dbg(_Cmd) -> [Opt] -> Opt; _ -> Opts end, - io:format("~s(~w): ~w\n", [CtrlStr,Ctrl,Opts1]); + io:format("~ts(~w): ~w\n", [CtrlStr,Ctrl,Opts1]); Any -> io:format("Unexpected in cmd_dbg:~n~w~n",[Any]) end. diff --git a/lib/common_test/src/ct_testspec.erl b/lib/common_test/src/ct_testspec.erl index 5ce095e38e..71b03c0ea6 100644 --- a/lib/common_test/src/ct_testspec.erl +++ b/lib/common_test/src/ct_testspec.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2012. All Rights Reserved. +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -28,7 +28,6 @@ collect_tests_from_file/2, collect_tests_from_file/3]). -include("ct_util.hrl"). - -define(testspec_fields, record_info(fields, testspec)). %%%------------------------------------------------------------------ @@ -93,7 +92,7 @@ prepare_tests(TestSpec) when is_record(TestSpec,testspec) -> %% run_per_node/2 takes the Run list as input and returns a list %% of {Node,RunPerNode,[]} tuples where the tests have been sorted %% on a per node basis. -run_per_node([{{Node,Dir},Test}|Ts],Result, MergeTests) -> +run_per_node([{{Node,Dir},Test}|Ts],Result,MergeTests) -> {value,{Node,{Run,Skip}}} = lists:keysearch(Node,1,Result), Run1 = case MergeTests of false -> @@ -190,7 +189,7 @@ prepare_suites(_Node,_Dir,[],Run,Skip) -> prepare_cases(Node,Dir,Suite,Cases) -> case get_skipped_cases(Node,Dir,Suite,Cases) of - SkipAll=[{{Node,Dir},{Suite,_Cmt}}] -> % all cases to be skipped + SkipAll=[{{Node,Dir},{Suite,_Cmt}}] -> % all cases to be skipped %% note: this adds an 'all' test even if only skip is specified {[{{Node,Dir},{Suite,all}}],SkipAll}; Skipped -> @@ -241,34 +240,147 @@ get_skipped_cases1(_,_,_,[]) -> %%% collect_tests_from_file reads a testspec file and returns a record %%% containing the data found. -collect_tests_from_file(Specs, Relaxed) -> +collect_tests_from_file(Specs,Relaxed) -> collect_tests_from_file(Specs,[node()],Relaxed). collect_tests_from_file(Specs,Nodes,Relaxed) when is_list(Nodes) -> NodeRefs = lists:map(fun(N) -> {undefined,N} end, Nodes), - catch collect_tests_from_file1(Specs,#testspec{nodes=NodeRefs},Relaxed). + %% [Spec1,Spec2,...] means create one testpec record per Spec file + %% [[Spec1,Spec2,...]] means merge all specs into one testspec record + {Join,Specs1} = if is_list(hd(hd(Specs))) -> {true,hd(Specs)}; + true -> {false,Specs} + end, + Specs2 = [filename:absname(S) || S <- Specs1], + TS0 = #testspec{nodes=NodeRefs}, + + try create_specs(Specs2,TS0,Relaxed,Join) of + {{[],_},SeparateTestSpecs} -> + filter_and_convert(SeparateTestSpecs); + {{_,#testspec{tests=[]}},SeparateTestSpecs} -> + filter_and_convert(SeparateTestSpecs); + {Joined,SeparateTestSpecs} -> + [filter_and_convert(Joined) | + filter_and_convert(SeparateTestSpecs)] + catch + _:Error -> + Error + end. + +filter_and_convert(Joined) when is_tuple(Joined) -> + hd(filter_and_convert([Joined])); +filter_and_convert([{_,#testspec{tests=[]}}|TSs]) -> + filter_and_convert(TSs); +filter_and_convert([{[{SpecFile,MergeTests}|SMs],TestSpec}|TSs]) -> + #testspec{config = CfgFiles} = TestSpec, + TestSpec1 = TestSpec#testspec{config = delete_dups(CfgFiles), + merge_tests = MergeTests}, + %% set the merge_tests value for the testspec to the value + %% of the first test spec in the set + [{[SpecFile | [SF || {SF,_} <- SMs]], TestSpec1} | filter_and_convert(TSs)]; +filter_and_convert([]) -> + []. + +delete_dups(Elems) -> + delete_dups1(lists:reverse(Elems),[]). -collect_tests_from_file1([Spec|Specs],TestSpec,Relaxed) -> +delete_dups1([E|Es],Keep) -> + case lists:member(E,Es) of + true -> + delete_dups1(Es,Keep); + false -> + delete_dups1(Es,[E|Keep]) + end; +delete_dups1([],Keep) -> + Keep. + +create_specs(Specs,TestSpec,Relaxed,Join) -> + SpecsTree = create_spec_tree(Specs,TestSpec,Join,[]), + create_specs(SpecsTree,TestSpec,Relaxed). + +create_spec_tree([Spec|Specs],TS,JoinWithNext,Known) -> SpecDir = filename:dirname(filename:absname(Spec)), - case file:consult(Spec) of - {ok,Terms} -> - case collect_tests(Terms, - TestSpec#testspec{spec_dir=SpecDir}, - Relaxed) of - TS = #testspec{tests=Tests, logdir=LogDirs} when Specs == [] -> - LogDirs1 = lists:delete(".",LogDirs) ++ ["."], - TS#testspec{tests=lists:flatten(Tests), logdir=LogDirs1}; - TS = #testspec{alias = As, nodes = Ns} -> - TS1 = TS#testspec{alias = lists:reverse(As), - nodes = lists:reverse(Ns)}, - collect_tests_from_file1(Specs,TS1,Relaxed) - end; - {error,Reason} -> - ReasonStr = - lists:flatten(io_lib:format("~s", - [file:format_error(Reason)])), - throw({error,{Spec,ReasonStr}}) - end. + TS1 = TS#testspec{spec_dir=SpecDir}, + SpecAbsName = get_absfile(Spec,TS1), + case lists:member(SpecAbsName,Known) of + true -> + throw({error,{cyclic_reference,SpecAbsName}}); + false -> + case file:consult(SpecAbsName) of + {ok,Terms} -> + Terms1 = replace_names(Terms), + {InclJoin,InclSep} = get_included_specs(Terms1,TS1), + {SpecAbsName,Terms1, + create_spec_tree(InclJoin,TS,true,[SpecAbsName|Known]), + create_spec_tree(InclSep,TS,false,[SpecAbsName|Known]), + JoinWithNext, + create_spec_tree(Specs,TS,JoinWithNext,Known)}; + {error,Reason} -> + ReasonStr = + lists:flatten(io_lib:format("~s", + [file:format_error(Reason)])), + throw({error,{SpecAbsName,ReasonStr}}) + end + end; +create_spec_tree([],_TS,_JoinWithNext,_Known) -> + []. + +create_specs({Spec,Terms,InclJoin,InclSep,JoinWithNext,NextSpec}, + TestSpec,Relaxed) -> + SpecDir = filename:dirname(filename:absname(Spec)), + TestSpec1 = create_spec(Terms,TestSpec#testspec{spec_dir=SpecDir}, + JoinWithNext,Relaxed), + + {{JoinSpecs1,JoinTS1},Separate1} = create_specs(InclJoin,TestSpec1,Relaxed), + + {{JoinSpecs2,JoinTS2},Separate2} = + case JoinWithNext of + true -> + create_specs(NextSpec,JoinTS1,Relaxed); + false -> + {{[],JoinTS1},[]} + end, + {SepJoinSpecs,Separate3} = create_specs(InclSep,TestSpec,Relaxed), + {SepJoinSpecs1,Separate4} = + case JoinWithNext of + true -> + {{[],TestSpec},[]}; + false -> + create_specs(NextSpec,TestSpec,Relaxed) + end, + + SpecInfo = {Spec,TestSpec1#testspec.merge_tests}, + AllSeparate = + [TSData || TSData = {Ss,_TS} <- Separate3++Separate1++ + [SepJoinSpecs]++Separate2++ + [SepJoinSpecs1]++Separate4, + Ss /= []], + + case {JoinWithNext,JoinSpecs1} of + {true,_} -> + {{[SpecInfo|(JoinSpecs1++JoinSpecs2)],JoinTS2}, + AllSeparate}; + {false,[]} -> + {{[],TestSpec}, + [{[SpecInfo],TestSpec1}|AllSeparate]}; + {false,_} -> + {{[SpecInfo|(JoinSpecs1++JoinSpecs2)],JoinTS2}, + AllSeparate} + end; +create_specs([],TestSpec,_Relaxed) -> + {{[],TestSpec},[]}. + +create_spec(Terms,TestSpec,JoinedByPrev,Relaxed) -> + %% it's the "includer" that decides the value of merge_tests + Terms1 = if not JoinedByPrev -> + [{set_merge_tests,true}|Terms]; + true -> + [{set_merge_tests,false}|Terms] + end, + TS = #testspec{tests=Tests, logdir=LogDirs} = + collect_tests({false,Terms1},TestSpec,Relaxed), + LogDirs1 = lists:delete(".",LogDirs) ++ ["."], + TS#testspec{tests=lists:flatten(Tests), + logdir=LogDirs1}. collect_tests_from_list(Terms,Relaxed) -> collect_tests_from_list(Terms,[node()],Relaxed). @@ -276,8 +388,8 @@ collect_tests_from_list(Terms,Relaxed) -> collect_tests_from_list(Terms,Nodes,Relaxed) when is_list(Nodes) -> {ok,Cwd} = file:get_cwd(), NodeRefs = lists:map(fun(N) -> {undefined,N} end, Nodes), - case catch collect_tests(Terms,#testspec{nodes=NodeRefs, - spec_dir=Cwd}, + case catch collect_tests({true,Terms},#testspec{nodes=NodeRefs, + spec_dir=Cwd}, Relaxed) of E = {error,_} -> E; @@ -287,13 +399,28 @@ collect_tests_from_list(Terms,Nodes,Relaxed) when is_list(Nodes) -> TS#testspec{tests=lists:flatten(Tests), logdir=LogDirs1} end. -collect_tests(Terms,TestSpec,Relaxed) -> +collect_tests({Replace,Terms},TestSpec=#testspec{alias=As,nodes=Ns},Relaxed) -> put(relaxed,Relaxed), - Terms1 = replace_names(Terms), - TestSpec1 = get_global(Terms1,TestSpec), - TestSpec2 = get_all_nodes(Terms1,TestSpec1), - {Terms2, TestSpec3} = filter_init_terms(Terms1, [], TestSpec2), - add_tests(Terms2,TestSpec3). + Terms1 = if Replace -> replace_names(Terms); + true -> Terms + end, + {MergeTestsDef,Terms2} = + case proplists:get_value(set_merge_tests,Terms1,true) of + false -> + %% disable merge_tests + {TestSpec#testspec.merge_tests, + proplists:delete(merge_tests,Terms1)}; + true -> + {true,Terms1} + end, + %% reverse nodes and aliases initially to get the order of them right + %% in case this spec is being joined with a previous one + TestSpec1 = get_global(Terms2,TestSpec#testspec{alias = lists:reverse(As), + nodes = lists:reverse(Ns), + merge_tests = MergeTestsDef}), + TestSpec2 = get_all_nodes(Terms2,TestSpec1), + {Terms3, TestSpec3} = filter_init_terms(Terms2, [], TestSpec2), + add_tests(Terms3,TestSpec3). %% replace names (atoms) in the testspec matching those in 'define' terms by %% searching recursively through tuples and lists @@ -420,9 +547,30 @@ replace_names_in_node1(NodeStr,Defs=[{Name,Replacement}|Ds]) -> replace_names_in_node1(NodeStr,[]) -> NodeStr. +%% look for other specification files, either to join with the +%% current spec, or execute as separate test runs +get_included_specs(Terms,TestSpec) -> + get_included_specs(Terms,TestSpec,[],[]). + +get_included_specs([{specs,How,SpecOrSpecs}|Ts],TestSpec,Join,Sep) -> + Specs = case SpecOrSpecs of + [File|_] when is_list(File) -> + [get_absfile(Spec,TestSpec) || Spec <- SpecOrSpecs]; + [Ch|_] when is_integer(Ch) -> + [get_absfile(SpecOrSpecs,TestSpec)] + end, + if How == join -> + get_included_specs(Ts,TestSpec,Join++Specs,Sep); + true -> + get_included_specs(Ts,TestSpec,Join,Sep++Specs) + end; +get_included_specs([_|Ts],TestSpec,Join,Sep) -> + get_included_specs(Ts,TestSpec,Join,Sep); +get_included_specs([],_,Join,Sep) -> + {Join,Sep}. %% global terms that will be used for analysing all other terms in the spec -get_global([{merge_tests,Bool} | Ts], Spec) -> +get_global([{merge_tests,Bool}|Ts],Spec) -> get_global(Ts,Spec#testspec{merge_tests=Bool}); %% the 'define' term replaces the 'alias' and 'node' terms, but we need to keep @@ -588,7 +736,7 @@ add_option({Key,Value},Node,List,WarnIfExists) when is_list(Value) -> NewOption = case lists:keyfind(Key,1,OldOptions) of {Key,OldOption} when WarnIfExists,OldOption/=[]-> io:format("There is an option ~w=~w already " - "defined for node ~p, skipping new ~w~n", + "defined for node ~w, skipping new ~w~n", [Key,OldOption,Node,Value]), OldOption; {Key,OldOption}-> @@ -637,7 +785,7 @@ add_tests([{suites,all_nodes,Dir,Ss}|Ts],Spec) -> add_tests([{suites,Dir,Ss}|Ts],Spec) -> add_tests([{suites,all_nodes,Dir,Ss}|Ts],Spec); add_tests([{suites,Nodes,Dir,Ss}|Ts],Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,suites,[Dir,Ss],Ts,Spec#testspec.nodes), + Ts1 = per_node(Nodes,suites,[Dir,Ss],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{suites,Node,Dir,Ss}|Ts],Spec) -> Tests = Spec#testspec.tests, @@ -660,11 +808,11 @@ add_tests([{groups,Dir,Suite,Gs}|Ts],Spec) -> add_tests([{groups,Dir,Suite,Gs,{cases,TCs}}|Ts],Spec) -> add_tests([{groups,all_nodes,Dir,Suite,Gs,{cases,TCs}}|Ts],Spec); add_tests([{groups,Nodes,Dir,Suite,Gs}|Ts],Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,groups,[Dir,Suite,Gs],Ts,Spec#testspec.nodes), + Ts1 = per_node(Nodes,groups,[Dir,Suite,Gs],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{groups,Nodes,Dir,Suite,Gs,{cases,TCs}}|Ts], Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,groups,[Dir,Suite,Gs,{cases,TCs}],Ts, + Ts1 = per_node(Nodes,groups,[Dir,Suite,Gs,{cases,TCs}],Ts, Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{groups,Node,Dir,Suite,Gs}|Ts],Spec) -> @@ -688,7 +836,7 @@ add_tests([{cases,all_nodes,Dir,Suite,Cs}|Ts],Spec) -> add_tests([{cases,Dir,Suite,Cs}|Ts],Spec) -> add_tests([{cases,all_nodes,Dir,Suite,Cs}|Ts],Spec); add_tests([{cases,Nodes,Dir,Suite,Cs}|Ts],Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,cases,[Dir,Suite,Cs],Ts,Spec#testspec.nodes), + Ts1 = per_node(Nodes,cases,[Dir,Suite,Cs],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{cases,Node,Dir,Suite,Cs}|Ts],Spec) -> Tests = Spec#testspec.tests, @@ -703,7 +851,7 @@ add_tests([{skip_suites,all_nodes,Dir,Ss,Cmt}|Ts],Spec) -> add_tests([{skip_suites,Dir,Ss,Cmt}|Ts],Spec) -> add_tests([{skip_suites,all_nodes,Dir,Ss,Cmt}|Ts],Spec); add_tests([{skip_suites,Nodes,Dir,Ss,Cmt}|Ts],Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,skip_suites,[Dir,Ss,Cmt],Ts,Spec#testspec.nodes), + Ts1 = per_node(Nodes,skip_suites,[Dir,Ss,Cmt],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{skip_suites,Node,Dir,Ss,Cmt}|Ts],Spec) -> Tests = Spec#testspec.tests, @@ -724,11 +872,11 @@ add_tests([{skip_groups,Dir,Suite,Gs,Cmt}|Ts],Spec) -> add_tests([{skip_groups,Dir,Suite,Gs,{cases,TCs},Cmt}|Ts],Spec) -> add_tests([{skip_groups,all_nodes,Dir,Suite,Gs,{cases,TCs},Cmt}|Ts],Spec); add_tests([{skip_groups,Nodes,Dir,Suite,Gs,Cmt}|Ts],Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,skip_groups,[Dir,Suite,Gs,Cmt],Ts,Spec#testspec.nodes), + Ts1 = per_node(Nodes,skip_groups,[Dir,Suite,Gs,Cmt],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{skip_groups,Nodes,Dir,Suite,Gs,{cases,TCs},Cmt}|Ts], Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,skip_groups,[Dir,Suite,Gs,{cases,TCs},Cmt],Ts, + Ts1 = per_node(Nodes,skip_groups,[Dir,Suite,Gs,{cases,TCs},Cmt],Ts, Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{skip_groups,Node,Dir,Suite,Gs,Cmt}|Ts],Spec) -> @@ -752,7 +900,7 @@ add_tests([{skip_cases,all_nodes,Dir,Suite,Cs,Cmt}|Ts],Spec) -> add_tests([{skip_cases,Dir,Suite,Cs,Cmt}|Ts],Spec) -> add_tests([{skip_cases,all_nodes,Dir,Suite,Cs,Cmt}|Ts],Spec); add_tests([{skip_cases,Nodes,Dir,Suite,Cs,Cmt}|Ts],Spec) when is_list(Nodes) -> - Ts1 = separate(Nodes,skip_cases,[Dir,Suite,Cs,Cmt],Ts,Spec#testspec.nodes), + Ts1 = per_node(Nodes,skip_cases,[Dir,Suite,Cs,Cmt],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); add_tests([{skip_cases,Node,Dir,Suite,Cs,Cmt}|Ts],Spec) -> Tests = Spec#testspec.tests, @@ -783,6 +931,9 @@ add_tests([{release_shell,Bool}|Ts],Spec) -> add_tests(Ts, Spec#testspec{release_shell = Bool}); %% --- handled/errors --- +add_tests([{set_merge_tests,_}|Ts],Spec) -> % internal + add_tests(Ts,Spec); + add_tests([{define,_,_}|Ts],Spec) -> % handled add_tests(Ts,Spec); @@ -792,7 +943,10 @@ add_tests([{alias,_,_}|Ts],Spec) -> % handled add_tests([{node,_,_}|Ts],Spec) -> % handled add_tests(Ts,Spec); -add_tests([{merge_tests, _} | Ts], Spec) -> % handled +add_tests([{merge_tests,_} | Ts], Spec) -> % handled + add_tests(Ts,Spec); + +add_tests([{specs,_,_} | Ts], Spec) -> % handled add_tests(Ts,Spec); %% -------------------------------------------------- @@ -821,7 +975,7 @@ add_tests([{Tag,NodesOrOther,Data}|Ts],Spec) when is_list(NodesOrOther) -> case lists:all(fun(Test) -> is_node(Test,Spec#testspec.nodes) end, NodesOrOther) of true -> - Ts1 = separate(NodesOrOther,Tag,[Data],Ts,Spec#testspec.nodes), + Ts1 = per_node(NodesOrOther,Tag,[Data],Ts,Spec#testspec.nodes), add_tests(Ts1,Spec); false -> add_tests([{Tag,all_nodes,{NodesOrOther,Data}}|Ts],Spec) @@ -866,7 +1020,7 @@ add_tests([],Spec) -> % done %% check if it's a CT term that has bad format or if the user seems to %% have added something of his/her own, which we'll let pass if relaxed %% mode is enabled. -check_term(Term) -> +check_term(Term) when is_tuple(Term) -> Size = size(Term), [Name|_] = tuple_to_list(Term), Valid = valid_terms(), @@ -903,6 +1057,8 @@ handle_data(logdir,Node,Dir,Spec) -> [{Node,ref2dir(Dir,Spec)}]; handle_data(cover,Node,File,Spec) -> [{Node,get_absfile(File,Spec)}]; +handle_data(cover_stop,Node,Stop,_Spec) -> + [{Node,Stop}]; handle_data(include,Node,Dirs=[D|_],Spec) when is_list(D) -> [{Node,ref2dir(Dir,Spec)} || Dir <- Dirs]; handle_data(include,Node,Dir=[Ch|_],Spec) when is_integer(Ch) -> @@ -975,12 +1131,12 @@ update_recorded(Tag,Node,Spec) -> end. %% create one test term per node -separate(Nodes,Tag,Data,Tests,Refs) -> - Separated = separate(Nodes,Tag,Data,Refs), +per_node(Nodes,Tag,Data,Tests,Refs) -> + Separated = per_node(Nodes,Tag,Data,Refs), Separated ++ Tests. -separate([N|Ns],Tag,Data,Refs) -> - [list_to_tuple([Tag,ref2node(N,Refs)|Data])|separate(Ns,Tag,Data,Refs)]; -separate([],_,_,_) -> +per_node([N|Ns],Tag,Data,Refs) -> + [list_to_tuple([Tag,ref2node(N,Refs)|Data])|per_node(Ns,Tag,Data,Refs)]; +per_node([],_,_,_) -> []. %% read the value for FieldName in record Rec#testspec @@ -1037,14 +1193,21 @@ insert_groups(Node,Dir,Suite,Groups,Cases,Tests,true) when {[Gr],Cases}; true -> {Gr,Cases} end || Gr <- Groups], - case lists:keysearch({Node,Dir},1,Tests) of - {value,{{Node,Dir},[{all,_}]}} -> - Tests; - {value,{{Node,Dir},Suites0}} -> - Suites1 = insert_groups1(Suite,Groups1,Suites0), - insert_in_order({{Node,Dir},Suites1},Tests); - false -> - insert_in_order({{Node,Dir},[{Suite,Groups1}]},Tests) + {Tests1,Done} = + lists:foldr(fun(All={{N,D},[{all,_}]},{Replaced,_}) when N == Node, + D == Dir -> + {[All|Replaced],true}; + ({{N,D},Suites0},{Replaced,_}) when N == Node, + D == Dir -> + Suites1 = insert_groups1(Suite,Groups1,Suites0), + {[{{N,D},Suites1}|Replaced],true}; + (T,{Replaced,Match}) -> + {[T|Replaced],Match} + end, {[],false}, Tests), + if not Done -> + Tests ++ [{{Node,Dir},[{Suite,Groups1}]}]; + true -> + Tests1 end; insert_groups(Node,Dir,Suite,Groups,Case,Tests, MergeTests) when is_atom(Case) -> @@ -1082,14 +1245,21 @@ insert_groups2([],GrAndCases) -> insert_cases(Node,Dir,Suite,Cases,Tests,false) when is_list(Cases) -> append({{Node,Dir},[{Suite,Cases}]},Tests); insert_cases(Node,Dir,Suite,Cases,Tests,true) when is_list(Cases) -> - case lists:keysearch({Node,Dir},1,Tests) of - {value,{{Node,Dir},[{all,_}]}} -> - Tests; - {value,{{Node,Dir},Suites0}} -> - Suites1 = insert_cases1(Suite,Cases,Suites0), - insert_in_order({{Node,Dir},Suites1},Tests); - false -> - insert_in_order({{Node,Dir},[{Suite,Cases}]},Tests) + {Tests1,Done} = + lists:foldr(fun(All={{N,D},[{all,_}]},{Replaced,_}) when N == Node, + D == Dir -> + {[All|Replaced],true}; + ({{N,D},Suites0},{Replaced,_}) when N == Node, + D == Dir -> + Suites1 = insert_cases1(Suite,Cases,Suites0), + {[{{N,D},Suites1}|Replaced],true}; + (T,{Replaced,Match}) -> + {[T|Replaced],Match} + end, {[],false}, Tests), + if not Done -> + Tests ++ [{{Node,Dir},[{Suite,Cases}]}]; + true -> + Tests1 end; insert_cases(Node,Dir,Suite,Case,Tests,MergeTests) when is_atom(Case) -> insert_cases(Node,Dir,Suite,[Case],Tests,MergeTests). @@ -1130,15 +1300,23 @@ skip_groups(Node,Dir,Suite,Groups,Cases,Cmt,Tests,false) when append({{Node,Dir},Suites1},Tests); skip_groups(Node,Dir,Suite,Groups,Cases,Cmt,Tests,true) when ((Cases == all) or is_list(Cases)) and is_list(Groups) -> - Suites = - case lists:keysearch({Node,Dir},1,Tests) of - {value,{{Node,Dir},Suites0}} -> - Suites0; - false -> - [] - end, - Suites1 = skip_groups1(Suite,[{Gr,Cases} || Gr <- Groups],Cmt,Suites), - insert_in_order({{Node,Dir},Suites1},Tests); + {Tests1,Done} = + lists:foldr(fun({{N,D},Suites0},{Replaced,_}) when N == Node, + D == Dir -> + Suites1 = skip_groups1(Suite, + [{Gr,Cases} || Gr <- Groups], + Cmt,Suites0), + {[{{N,D},Suites1}|Replaced],true}; + (T,{Replaced,Match}) -> + {[T|Replaced],Match} + end, {[],false}, Tests), + if not Done -> + Tests ++ [{{Node,Dir},skip_groups1(Suite, + [{Gr,Cases} || Gr <- Groups], + Cmt,[])}]; + true -> + Tests1 + end; skip_groups(Node,Dir,Suite,Groups,Case,Cmt,Tests,MergeTests) when is_atom(Case) -> Cases = if Case == all -> all; true -> [Case] end, @@ -1160,15 +1338,19 @@ skip_cases(Node,Dir,Suite,Cases,Cmt,Tests,false) when is_list(Cases) -> Suites1 = skip_cases1(Suite,Cases,Cmt,[]), append({{Node,Dir},Suites1},Tests); skip_cases(Node,Dir,Suite,Cases,Cmt,Tests,true) when is_list(Cases) -> - Suites = - case lists:keysearch({Node,Dir},1,Tests) of - {value,{{Node,Dir},Suites0}} -> - Suites0; - false -> - [] - end, - Suites1 = skip_cases1(Suite,Cases,Cmt,Suites), - insert_in_order({{Node,Dir},Suites1},Tests); + {Tests1,Done} = + lists:foldr(fun({{N,D},Suites0},{Replaced,_}) when N == Node, + D == Dir -> + Suites1 = skip_cases1(Suite,Cases,Cmt,Suites0), + {[{{N,D},Suites1}|Replaced],true}; + (T,{Replaced,Match}) -> + {[T|Replaced],Match} + end, {[],false}, Tests), + if not Done -> + Tests ++ [{{Node,Dir},skip_cases1(Suite,Cases,Cmt,[])}]; + true -> + Tests1 + end; skip_cases(Node,Dir,Suite,Case,Cmt,Tests,MergeTests) when is_atom(Case) -> skip_cases(Node,Dir,Suite,[Case],Cmt,Tests,MergeTests). @@ -1258,10 +1440,14 @@ is_node([],_) -> valid_terms() -> [ + {set_merge_tests,2}, {define,3}, + {specs,3}, {node,3}, {cover,2}, {cover,3}, + {cover_stop,2}, + {cover_stop,3}, {config,2}, {config,3}, {config,4}, diff --git a/lib/common_test/src/ct_util.erl b/lib/common_test/src/ct_util.erl index cf891ed043..02e58d0786 100644 --- a/lib/common_test/src/ct_util.erl +++ b/lib/common_test/src/ct_util.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2012. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -39,7 +39,8 @@ delete_suite_data/0, delete_suite_data/1, match_delete_suite_data/1, delete_testdata/0, delete_testdata/1, set_testdata/1, get_testdata/1, get_testdata/2, - set_testdata_async/1, update_testdata/2, update_testdata/3]). + set_testdata_async/1, update_testdata/2, update_testdata/3, + set_verbosity/1, get_verbosity/1]). -export([override_silence_all_connections/0, override_silence_connections/1, get_overridden_silenced_connections/0, @@ -128,6 +129,10 @@ do_start(Parent, Mode, LogDir, Verbosity) -> create_table(?conn_table,#conn.handle), create_table(?board_table,2), create_table(?suite_table,#suite_data.key), + + create_table(?verbosity_table,1), + [ets:insert(?verbosity_table,{Cat,Lvl}) || {Cat,Lvl} <- Verbosity], + {ok,StartDir} = file:get_cwd(), case file:set_cwd(LogDir) of ok -> ok; @@ -202,7 +207,7 @@ do_start(Parent, Mode, LogDir, Verbosity) -> self() ! {{stop,{self(),{user_error,CTHReason}}}, {Parent,make_ref()}} end, - loop(Mode, [{{verbosity,Cat},Lvl} || {Cat,Lvl} <- Verbosity], StartDir). + loop(Mode, [], StartDir). create_table(TableName,KeyPos) -> create_table(TableName,set,KeyPos). @@ -278,6 +283,19 @@ reset_cwd() -> get_start_dir() -> call(get_start_dir). +%% handle verbosity outside ct_util_server (let the client read +%% the verbosity table) to avoid possible deadlock situations +set_verbosity(Elem = {_Category,_Level}) -> + ets:insert(?verbosity_table, Elem), + ok. +get_verbosity(Category) -> + case ets:lookup(?verbosity_table, Category) of + [{Category,Level}] -> + Level; + _ -> + undefined + end. + loop(Mode,TestData,StartDir) -> receive {update_last_run_index,From} -> @@ -377,6 +395,7 @@ loop(Mode,TestData,StartDir) -> ets:delete(?conn_table), ets:delete(?board_table), ets:delete(?suite_table), + ets:delete(?verbosity_table), ct_logs:close(Info, StartDir), ct_event:stop(), ct_config:stop(), @@ -396,14 +415,14 @@ loop(Mode,TestData,StartDir) -> %% A connection crashed - remove the connection but don't die ct_logs:tc_log_async(ct_error_notify, "Connection process died: " - "Pid: ~p, Address: ~p, Callback: ~p\n" + "Pid: ~w, Address: ~p, Callback: ~w\n" "Reason: ~p\n\n", [Pid,A,CB,Reason]), catch CB:close(Pid), loop(Mode,TestData,StartDir); _ -> %% Let process crash in case of error, this shouldn't happen! - io:format("\n\nct_util_server got EXIT from ~p: ~p\n\n", + io:format("\n\nct_util_server got EXIT from ~w: ~p\n\n", [Pid,Reason]), file:set_cwd(StartDir), exit(Reason) @@ -921,7 +940,9 @@ ct_make_ref_loop(N) -> From ! {self(),N}, ct_make_ref_loop(N+1) end. - + +abs_name("/") -> + "/"; abs_name(Dir0) -> Abs = filename:absname(Dir0), Dir = case lists:reverse(Abs) of @@ -956,7 +977,7 @@ open_url(iexplore, Args, URL) -> Path = proplists:get_value(default, Paths), [Cmd | _] = string:tokens(Path, "%"), Cmd1 = Cmd ++ " " ++ Args ++ " " ++ URL, - io:format(user, "~nOpening ~s with command:~n ~s~n", [URL,Cmd1]), + io:format(user, "~nOpening ~ts with command:~n ~ts~n", [URL,Cmd1]), open_port({spawn,Cmd1}, []); _ -> io:format("~nNo path to iexplore.exe~n",[]) @@ -969,6 +990,6 @@ open_url(Prog, Args, URL) -> is_list(Prog) -> Prog end, Cmd = ProgStr ++ " " ++ Args ++ " " ++ URL, - io:format(user, "~nOpening ~s with command:~n ~s~n", [URL,Cmd]), + io:format(user, "~nOpening ~ts with command:~n ~ts~n", [URL,Cmd]), open_port({spawn,Cmd},[]), ok. diff --git a/lib/common_test/src/ct_util.hrl b/lib/common_test/src/ct_util.hrl index 196b5e46d0..7c01e17c36 100644 --- a/lib/common_test/src/ct_util.hrl +++ b/lib/common_test/src/ct_util.hrl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2003-2012. All Rights Reserved. +%% Copyright Ericsson AB 2003-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -21,6 +21,7 @@ -define(conn_table,ct_connections). -define(board_table,ct_boards). -define(suite_table,ct_suite_data). +-define(verbosity_table,ct_verbosity_table). -record(conn, {handle, targetref, @@ -38,6 +39,7 @@ verbosity=[], silent_connections=[], cover=[], + cover_stop=[], config=[], userconfig=[], event_handler=[], diff --git a/lib/common_test/src/cth_conn_log.erl b/lib/common_test/src/cth_conn_log.erl index 3af89db3a5..644594e34d 100644 --- a/lib/common_test/src/cth_conn_log.erl +++ b/lib/common_test/src/cth_conn_log.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2012. All Rights Reserved. +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -58,7 +58,7 @@ -spec init(Id, HookOpts) -> Result when Id :: term(), - HookOpts :: ct:hook_options(), + HookOpts :: ct_netconfc:hook_options(), Result :: {ok,[{ct_netconfc:conn_mod(), {ct_netconfc:log_type(),[ct_netconfc:key_or_name()]}}]}. init(_Id, HookOpts) -> @@ -105,8 +105,9 @@ pre_init_per_testcase(TestCase,Config,CthState) -> "<table borders=1>" "<b>" ++ ConnModStr ++ " logs:</b>\n" ++ [io_lib:format( - "<tr><td>~p</td><td><a href=~p>~s</a></td></tr>", - [S,L,filename:basename(L)]) + "<tr><td>~p</td><td><a href=\"~ts\">~ts</a>" + "</td></tr>", + [S,ct_logs:uri(L),filename:basename(L)]) || {S,L} <- Ls] ++ "</table>", io:format(Str,[]), diff --git a/lib/common_test/src/cth_log_redirect.erl b/lib/common_test/src/cth_log_redirect.erl index 77f57c6195..78ae70f37e 100644 --- a/lib/common_test/src/cth_log_redirect.erl +++ b/lib/common_test/src/cth_log_redirect.erl @@ -54,7 +54,7 @@ post_init_per_group(_Group, _Config, Result, State) -> post_end_per_testcase(_TC, _Config, Result, State) -> %% Make sure that the event queue is flushed %% before ending this test case. - gen_event:call(error_logger, ?MODULE, flush), + gen_event:call(error_logger, ?MODULE, flush, 300000), {Result, State}. pre_end_per_group(Group, Config, {ct_log, Group}) -> diff --git a/lib/common_test/src/cth_surefire.erl b/lib/common_test/src/cth_surefire.erl index 76b0f0b5ea..1a38b6584b 100644 --- a/lib/common_test/src/cth_surefire.erl +++ b/lib/common_test/src/cth_surefire.erl @@ -1,3 +1,22 @@ +%%-------------------------------------------------------------------- +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%%-------------------------------------------------------------------- + %%% @doc Common Test Framework functions handling test specifications. %%% %%% <p>This module creates a junit report of the test run if plugged in @@ -27,18 +46,28 @@ -export([terminate/1]). -record(state, { filepath, axis, properties, package, hostname, - curr_suite, curr_suite_ts, curr_group = [], curr_tc, - curr_log_dir, timer, tc_log, + curr_suite, curr_suite_ts, curr_group = [], + curr_log_dir, timer, tc_log, url_base, test_cases = [], test_suites = [] }). --record(testcase, { log, group, classname, name, time, failure, timestamp }). --record(testsuite, { errors, failures, hostname, name, tests, +-record(testcase, { log, url, group, classname, name, time, result, timestamp }). +-record(testsuite, { errors, failures, skipped, hostname, name, tests, time, timestamp, id, package, - properties, testcases }). + properties, testcases, log, url }). + +-define(default_report,"junit_report.xml"). +-define(suite_log,"suite.log.html"). + +%% Number of dirs from log root to testcase log file. +%% ct_run.<node>.<timestamp>/<test_name>/run.<timestamp>/<tc_log>.html +-define(log_depth,3). id(Opts) -> - filename:absname(proplists:get_value(path, Opts, "junit_report.xml")). + case proplists:get_value(path, Opts) of + undefined -> ?default_report; + Path -> filename:absname(Path) + end. init(Path, Opts) -> {ok, Host} = inet:gethostname(), @@ -47,10 +76,24 @@ init(Path, Opts) -> package = proplists:get_value(package,Opts), axis = proplists:get_value(axis,Opts,[]), properties = proplists:get_value(properties,Opts,[]), + url_base = proplists:get_value(url_base,Opts), timer = now() }. pre_init_per_suite(Suite,Config,#state{ test_cases = [] } = State) -> - {Config, init_tc(State#state{ curr_suite = Suite, curr_suite_ts = now() }, + TcLog = proplists:get_value(tc_logfile,Config), + CurrLogDir = filename:dirname(TcLog), + Path = + case State#state.filepath of + ?default_report -> + RootDir = get_test_root(TcLog), + filename:join(RootDir,?default_report); + P -> + P + end, + {Config, init_tc(State#state{ filepath = Path, + curr_suite = Suite, + curr_suite_ts = now(), + curr_log_dir = CurrLogDir}, Config) }; pre_init_per_suite(Suite,Config,State) -> %% Have to close the previous suite @@ -59,7 +102,8 @@ pre_init_per_suite(Suite,Config,State) -> post_init_per_suite(_Suite,Config, Result, State) -> {Result, end_tc(init_per_suite,Config,Result,State)}. -pre_end_per_suite(_Suite,Config,State) -> {Config, init_tc(State, Config)}. +pre_end_per_suite(_Suite,Config,State) -> + {Config, init_tc(State, Config)}. post_end_per_suite(_Suite,Config,Result,State) -> {Result, end_tc(end_per_suite,Config,Result,State)}. @@ -71,13 +115,15 @@ pre_init_per_group(Group,Config,State) -> post_init_per_group(_Group,Config,Result,State) -> {Result, end_tc(init_per_group,Config,Result,State)}. -pre_end_per_group(_Group,Config,State) -> {Config, init_tc(State, Config)}. +pre_end_per_group(_Group,Config,State) -> + {Config, init_tc(State, Config)}. post_end_per_group(_Group,Config,Result,State) -> NewState = end_tc(end_per_group, Config, Result, State), {Result, NewState#state{ curr_group = tl(NewState#state.curr_group)}}. -pre_init_per_testcase(_TC,Config,State) -> {Config, init_tc(State, Config)}. +pre_init_per_testcase(_TC,Config,State) -> + {Config, init_tc(State, Config)}. post_end_per_testcase(TC,Config,Result,State) -> {Result, end_tc(TC,Config, Result,State)}. @@ -88,11 +134,19 @@ on_tc_fail(_TC, Res, State) -> TCs = State#state.test_cases, TC = hd(TCs), NewTC = TC#testcase{ - failure = + result = {fail,lists:flatten(io_lib:format("~p",[Res]))} }, State#state{ test_cases = [NewTC | tl(TCs)]}. -on_tc_skip(Tc,{Type,_Reason} = Res, State) when Type == tc_auto_skip -> +on_tc_skip(Tc,{Type,_Reason} = Res, State0) when Type == tc_auto_skip -> + TcStr = atom_to_list(Tc), + State = + case State0#state.test_cases of + [#testcase{name=TcStr}|TCs] -> + State0#state{test_cases=TCs}; + _ -> + State0 + end, do_tc_skip(Res, end_tc(Tc,[],Res,init_tc(State,[]))); on_tc_skip(_Tc, _Res, State = #state{test_cases = []}) -> State; @@ -103,7 +157,7 @@ do_tc_skip(Res, State) -> TCs = State#state.test_cases, TC = hd(TCs), NewTC = TC#testcase{ - failure = + result = {skipped,lists:flatten(io_lib:format("~p",[Res]))} }, State#state{ test_cases = [NewTC | tl(TCs)]}. @@ -117,33 +171,52 @@ end_tc(Func, Config, Res, State) when is_atom(Func) -> end_tc(atom_to_list(Func), Config, Res, State); end_tc(Name, _Config, _Res, State = #state{ curr_suite = Suite, curr_group = Groups, - timer = TS, tc_log = Log } ) -> + curr_log_dir = CurrLogDir, + timer = TS, + tc_log = Log0, + url_base = UrlBase } ) -> + Log = + case Log0 of + "" -> + LowerSuiteName = string:to_lower(atom_to_list(Suite)), + filename:join(CurrLogDir,LowerSuiteName++"."++Name++".html"); + _ -> + Log0 + end, + Url = make_url(UrlBase,Log), ClassName = atom_to_list(Suite), PGroup = string:join([ atom_to_list(Group)|| Group <- lists:reverse(Groups)],"."), TimeTakes = io_lib:format("~f",[timer:now_diff(now(),TS) / 1000000]), State#state{ test_cases = [#testcase{ log = Log, + url = Url, timestamp = now_to_string(TS), classname = ClassName, group = PGroup, name = Name, time = TimeTakes, - failure = passed }| State#state.test_cases]}. + result = passed }| + State#state.test_cases], + tc_log = ""}. % so old tc_log is not set if next is on_tc_skip close_suite(#state{ test_cases = [] } = State) -> State; -close_suite(#state{ test_cases = TCs } = State) -> - Total = length(TCs), - Succ = length(lists:filter(fun(#testcase{ failure = F }) -> - F == passed - end,TCs)), - Fail = Total - Succ, +close_suite(#state{ test_cases = TCs, url_base = UrlBase } = State) -> + {Total,Fail,Skip} = count_tcs(TCs,0,0,0), TimeTaken = timer:now_diff(now(),State#state.curr_suite_ts) / 1000000, + SuiteLog = filename:join(State#state.curr_log_dir,?suite_log), + SuiteUrl = make_url(UrlBase,SuiteLog), Suite = #testsuite{ name = atom_to_list(State#state.curr_suite), package = State#state.package, + hostname = State#state.hostname, time = io_lib:format("~f",[TimeTaken]), timestamp = now_to_string(State#state.curr_suite_ts), - errors = Fail, tests = Total, - testcases = lists:reverse(TCs) }, + errors = 0, + failures = Fail, + skipped = Skip, + tests = Total, + testcases = lists:reverse(TCs), + log = SuiteLog, + url = SuiteUrl}, State#state{ test_cases = [], test_suites = [Suite | State#state.test_suites]}. @@ -159,14 +232,15 @@ terminate(State) -> -to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, timestamp = TS, failure = F}) -> +to_xml(#testcase{ group = Group, classname = CL, log = L, url = U, name = N, time = T, timestamp = TS, result = R}) -> ["<testcase ", - [["group=\"",Group,"\""]||Group /= ""]," " + [["group=\"",Group,"\" "]||Group /= ""], "name=\"",N,"\" " "time=\"",T,"\" " - "timestamp=\"",TS,"\" " + "timestamp=\"",TS,"\" ", + [["url=\"",U,"\" "]||U /= undefined], "log=\"",L,"\">", - case F of + case R of passed -> []; {skipped,Reason} -> @@ -176,22 +250,29 @@ to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, ti ["<failure message=\"Test ",N," in ",CL," failed!\" type=\"crash\">", sanitize(Reason),"</failure>"] end,"</testcase>"]; -to_xml(#testsuite{ package = P, hostname = H, errors = E, time = Time, - timestamp = TS, tests = T, name = N, testcases = Cases }) -> +to_xml(#testsuite{ package = P, hostname = H, errors = E, failures = F, + skipped = S, time = Time, timestamp = TS, tests = T, name = N, + testcases = Cases, log = Log, url = Url }) -> ["<testsuite ", [["package=\"",P,"\" "]||P /= undefined], - [["hostname=\"",P,"\" "]||H /= undefined], - [["name=\"",N,"\" "]||N /= undefined], - [["time=\"",Time,"\" "]||Time /= undefined], - [["timestamp=\"",TS,"\" "]||TS /= undefined], + "hostname=\"",H,"\" " + "name=\"",N,"\" " + "time=\"",Time,"\" " + "timestamp=\"",TS,"\" " "errors=\"",integer_to_list(E),"\" " - "tests=\"",integer_to_list(T),"\">", + "failures=\"",integer_to_list(F),"\" " + "skipped=\"",integer_to_list(S),"\" " + "tests=\"",integer_to_list(T),"\" ", + [["url=\"",Url,"\" "]||Url /= undefined], + "log=\"",Log,"\">", [to_xml(Case) || Case <- Cases], "</testsuite>"]; to_xml(#state{ test_suites = TestSuites, axis = Axis, properties = Props }) -> ["<testsuites>",properties_to_xml(Axis,Props), [to_xml(TestSuite) || TestSuite <- TestSuites],"</testsuites>"]. +properties_to_xml([],[]) -> + []; properties_to_xml(Axis,Props) -> ["<properties>", [["<property name=\"",Name,"\" axis=\"yes\" value=\"",Value,"\" />"] || {Name,Value} <- Axis], @@ -216,4 +297,38 @@ sanitize([]) -> now_to_string(Now) -> {{YY,MM,DD},{HH,Mi,SS}} = calendar:now_to_local_time(Now), - io_lib:format("~p-~2..0B-~2..0BT~2..0B:~2..0B:~2..0B",[YY,MM,DD,HH,Mi,SS]). + io_lib:format("~w-~2..0B-~2..0BT~2..0B:~2..0B:~2..0B",[YY,MM,DD,HH,Mi,SS]). + +make_url(undefined,_) -> + undefined; +make_url(_,[]) -> + undefined; +make_url(UrlBase0,Log) -> + UrlBase = string:strip(UrlBase0,right,$/), + RelativeLog = get_relative_log_url(Log), + string:join([UrlBase,RelativeLog],"/"). + +get_test_root(Log) -> + LogParts = filename:split(Log), + filename:join(lists:sublist(LogParts,1,length(LogParts)-?log_depth)). + +get_relative_log_url(Log) -> + LogParts = filename:split(Log), + Start = length(LogParts)-?log_depth, + Length = ?log_depth+1, + string:join(lists:sublist(LogParts,Start,Length),"/"). + +count_tcs([#testcase{name=ConfCase}|TCs],Ok,F,S) + when ConfCase=="init_per_suite"; + ConfCase=="end_per_suite"; + ConfCase=="init_per_group"; + ConfCase=="end_per_group" -> + count_tcs(TCs,Ok,F,S); +count_tcs([#testcase{result=passed}|TCs],Ok,F,S) -> + count_tcs(TCs,Ok+1,F,S); +count_tcs([#testcase{result={fail,_}}|TCs],Ok,F,S) -> + count_tcs(TCs,Ok,F+1,S); +count_tcs([#testcase{result={skipped,_}}|TCs],Ok,F,S) -> + count_tcs(TCs,Ok,F,S+1); +count_tcs([],Ok,F,S) -> + {Ok+F+S,F,S}. diff --git a/lib/common_test/src/unix_telnet.erl b/lib/common_test/src/unix_telnet.erl index 25b9d4d5d2..99ce92e9f1 100644 --- a/lib/common_test/src/unix_telnet.erl +++ b/lib/common_test/src/unix_telnet.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2004-2010. All Rights Reserved. +%% Copyright Ericsson AB 2004-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -110,7 +110,7 @@ connect1(Ip,Port,Timeout,KeepAlive,Username,Password) -> case ct_telnet:silent_teln_expect(Pid,[],[prompt],?prx,[]) of {ok,{prompt,?username},_} -> ok = ct_telnet_client:send_data(Pid,Username), - cont_log("Username: ~s",[Username]), + cont_log("Username: ~ts",[Username]), case ct_telnet:silent_teln_expect(Pid,[],prompt,?prx,[]) of {ok,{prompt,?password},_} -> ok = ct_telnet_client:send_data(Pid,Password), diff --git a/lib/common_test/test/Makefile b/lib/common_test/test/Makefile index 374fd8a824..bd746f87a7 100644 --- a/lib/common_test/test/Makefile +++ b/lib/common_test/test/Makefile @@ -1,7 +1,7 @@ # # %CopyrightBegin% # -# Copyright Ericsson AB 2008-2012. All Rights Reserved. +# Copyright Ericsson AB 2008-2013. All Rights Reserved. # # The contents of this file are subject to the Erlang Public License, # Version 1.1, (the "License"); you may not use this file except in @@ -40,6 +40,7 @@ MODULES= \ ct_repeat_1_SUITE \ ct_testspec_1_SUITE \ ct_testspec_2_SUITE \ + ct_testspec_3_SUITE \ ct_skip_SUITE \ ct_error_SUITE \ ct_test_server_if_1_SUITE \ @@ -52,7 +53,12 @@ MODULES= \ ct_auto_compile_SUITE \ ct_verbosity_SUITE \ ct_shell_SUITE \ - ct_groups_search_SUITE + ct_system_error_SUITE \ + ct_snmp_SUITE \ + ct_group_leader_SUITE \ + ct_cover_SUITE \ + ct_groups_search_SUITE \ + ct_surefire_SUITE ERL_FILES= $(MODULES:%=%.erl) @@ -106,7 +112,7 @@ release_spec: opt release_tests_spec: $(INSTALL_DIR) "$(RELSYSDIR)" $(INSTALL_DATA) $(ERL_FILES) $(COVERFILE) "$(RELSYSDIR)" - $(INSTALL_DATA) common_test.spec "$(RELSYSDIR)" + $(INSTALL_DATA) common_test.spec common_test.cover "$(RELSYSDIR)" chmod -R u+w "$(RELSYSDIR)" @tar cf - *_SUITE_data | (cd "$(RELSYSDIR)"; tar xf -) diff --git a/lib/common_test/test/common_test.cover b/lib/common_test/test/common_test.cover new file mode 100644 index 0000000000..3aa49623e7 --- /dev/null +++ b/lib/common_test/test/common_test.cover @@ -0,0 +1,10 @@ +%% -*- erlang -*- +{incl_app,common_test,details}. +{cross,common_test,[{test_server,[erl2html2, + test_server, + test_server_ctrl, + test_server_gl, + test_server_h, + test_server_io, + test_server_node, + test_server_sup]}]}. diff --git a/lib/common_test/test/ct_config_info_SUITE.erl b/lib/common_test/test/ct_config_info_SUITE.erl index 40da377ee5..10fe8286dd 100644 --- a/lib/common_test/test/ct_config_info_SUITE.erl +++ b/lib/common_test/test/ct_config_info_SUITE.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2009-2011. All Rights Reserved. +%% Copyright Ericsson AB 2009-2012. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -123,8 +123,7 @@ test_events(config_info) -> {?eh,tc_done,{config_info_1_SUITE,init_per_suite,ok}}, [{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g1,[]}}}, - {?eh,tc_done,{config_info_1_SUITE, - {init_per_group,unknown,[]}, + {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g1,[]}, {failed,{timetrap_timeout,350}}}}, {?eh,tc_auto_skip,{config_info_1_SUITE,t11, {failed,{config_info_1_SUITE,init_per_group,{timetrap_timeout,350}}}}}, @@ -136,14 +135,12 @@ test_events(config_info) -> {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g2,[]},ok}}, {?eh,tc_done,{config_info_1_SUITE,t21,ok}}, {?eh,tc_start,{config_info_1_SUITE,{end_per_group,g2,[]}}}, - {?eh,tc_done,{config_info_1_SUITE, - {end_per_group,unknown,[]}, + {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g2,[]}, {failed,{timetrap_timeout,450}}}}], [{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g3,[]}}}, {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g3,[]},ok}}, [{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g4,[]}}}, - {?eh,tc_done,{config_info_1_SUITE, - {init_per_group,unknown,[]}, + {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g4,[]}, {failed,{timetrap_timeout,400}}}}, {?eh,tc_auto_skip,{config_info_1_SUITE,t41, {failed,{config_info_1_SUITE,init_per_group, @@ -164,8 +161,7 @@ test_events(config_info) -> {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g5,[]},ok}}, {?eh,tc_done,{config_info_1_SUITE,t51,ok}}, {?eh,tc_start,{config_info_1_SUITE,{end_per_group,g5,[]}}}, - {?eh,tc_done,{config_info_1_SUITE, - {end_per_group,unknown,[]}, + {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g5,[]}, {failed,{timetrap_timeout,400}}}}], {?eh,tc_start,{config_info_1_SUITE,{end_per_group,g3,[]}}}, {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g3,[]},ok}}], diff --git a/lib/common_test/test/ct_cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE.erl new file mode 100644 index 0000000000..ec2680f664 --- /dev/null +++ b/lib/common_test/test/ct_cover_SUITE.erl @@ -0,0 +1,321 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_cover_SUITE +%%% +%%% Description: +%%% Test code cover analysis support +%%% +%%%------------------------------------------------------------------- +-module(ct_cover_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-define(eh, ct_test_support_eh). +-define(suite, cover_SUITE). +-define(mod, cover_test_mod). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + case test_server:is_cover() of + true -> + {skip,"Test server is running cover already - skipping"}; + false -> + ct_test_support:init_per_suite(Config) + end. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + try apply(?MODULE,TestCase,[cleanup,Config]) + catch error:undef -> ok + end, + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [ + default, + cover_stop_true, + cover_stop_false, + slave, + slave_start_slave, + cover_node_option, + ct_cover_add_remove_nodes, + otp_9956, + cross + ]. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%% Check that cover is collected from test node +%% Also check that cover is by default stopped after test is completed +default(Config) -> + {ok,Events} = run_test(default,Config), + false = check_cover(Config), + check_calls(Events,1), + ok. + +%% Check that cover is stopped when cover_stop option is set to true +cover_stop_true(Config) -> + {ok,_Events} = run_test(cover_stop_true,[{cover_stop,true}],Config), + false = check_cover(Config). + +%% Check that cover is not stopped when cover_stop option is set to false +cover_stop_false(Config) -> + {ok,_Events} = run_test(cover_stop_false,[{cover_stop,false}],Config), + {true,[],[?mod]} = check_cover(Config), + CTNode = proplists:get_value(ct_node, Config), + ok = rpc:call(CTNode,cover,stop,[]), + false = check_cover(Config), + ok. + +%% Let test node start a slave node - check that cover is collected +%% from both nodes +slave(Config) -> + {ok,Events} = run_test(slave,slave,[],Config), + check_calls(Events,2), + ok. + +%% Let test node start a slave node which in turn starts another slave +%% node - check that cover is collected from all three nodes +slave_start_slave(Config) -> + {ok,Events} = run_test(slave_start_slave,slave_start_slave,[],Config), + check_calls(Events,3), + ok. + +%% Start a slave node before test starts - the node is listed in cover +%% spec file. +%% Check that cover is collected from test node and slave node. +cover_node_option(Config) -> + DataDir = ?config(data_dir,Config), + {ok,Node} = start_slave(existing_node_1, "-pa " ++ DataDir), + false = check_cover(Node), + CoverSpec = default_cover_file_content() ++ [{nodes,[Node]}], + CoverFile = create_cover_file(cover_node_option,CoverSpec,Config), + {ok,Events} = run_test(cover_node_option,cover_node_option, + [{cover,CoverFile}],Config), + check_calls(Events,2), + {ok,Node} = ct_slave:stop(existing_node_1), + ok. + +cover_node_option(cleanup,_Config) -> + _ = ct_slave:stop(existing_node_1), + ok. + +%% Test ct_cover:add_nodes/1 and ct_cover:remove_nodes/1 +%% Check that cover is collected from added node +ct_cover_add_remove_nodes(Config) -> + DataDir = ?config(data_dir,Config), + {ok,Node} = start_slave(existing_node_2, "-pa " ++ DataDir), + false = check_cover(Node), + {ok,Events} = run_test(ct_cover_add_remove_nodes,ct_cover_add_remove_nodes, + [],Config), + check_calls(Events,2), + {ok,Node} = ct_slave:stop(existing_node_2), + ok. + +ct_cover_add_remove_nodes(cleanup,_Config) -> + _ = ct_slave:stop(existing_node_2), + ok. + +%% Test that the test suite itself can be cover compiled and that +%% data_dir is set correctly (OTP-9956) +otp_9956(Config) -> + CoverFile = create_cover_file(otp_9956,[{incl_mods,[?suite]}],Config), + {ok,Events} = run_test(otp_9956,otp_9956,[{cover,CoverFile}],Config), + check_calls(Events,{?suite,otp_9956,1},1), + ok. + +%% Test cross cover mechanism +cross(Config) -> + {ok,Events1} = run_test(cross1,Config), + check_calls(Events1,1), + + CoverFile2 = create_cover_file(cross1,[{cross,[{cross1,[?mod]}]}],Config), + {ok,Events2} = run_test(cross2,[{cover,CoverFile2}],Config), + check_calls(Events2,1), + + %% Get the log dirs for each test and run cross cover analyse + [D11,D12] = lists:sort(get_run_dirs(Events1)), + [D21,D22] = lists:sort(get_run_dirs(Events2)), + + ct_cover:cross_cover_analyse(details,[{cross1,D11},{cross2,D21}]), + ct_cover:cross_cover_analyse(details,[{cross1,D12},{cross2,D22}]), + + %% Get the cross cover logs and read for each test + [C11,C12,C21,C22] = + [filename:join(D,"cross_cover.html") || D <- [D11,D12,D21,D22]], + + {ok,CrossData} = file:read_file(C11), + {ok,CrossData} = file:read_file(C12), + + {ok,Def} = file:read_file(C21), + {ok,Def} = file:read_file(C22), + + %% A simple test: just check that the test module exists in the + %% log from cross1 test, and that it does not exist in the log + %% from cross2 test. + TestMod = list_to_binary(atom_to_list(?mod)), + {_,_} = binary:match(CrossData,TestMod), + nomatch = binary:match(Def,TestMod), + {_,_} = binary:match(Def, + <<"No cross cover modules exist for this application">>), + + ok. + + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- +run_test(Label,Config) -> + run_test(Label,[],Config). +run_test(Label,ExtraOpts,Config) -> + run_test(Label,default,ExtraOpts,Config). +run_test(Label,Testcase,ExtraOpts,Config) -> + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, ?suite), + CoverFile = + case proplists:get_value(cover,ExtraOpts) of + undefined -> + create_default_cover_file(Label,Config); + CF -> + CF + end, + RestOpts = lists:keydelete(cover,1,ExtraOpts), + {Opts,ERPid} = setup([{suite,Suite},{testcase,Testcase}, + {cover,CoverFile},{label,Label}] ++ RestOpts, Config), + execute(Label, Testcase, Opts, ERPid, Config). + +setup(Test, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +execute(Name, Testcase, Opts, ERPid, Config) -> + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(Name, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + TestEvents = events_to_check(Testcase), + R = ct_test_support:verify_events(TestEvents, Events, Config), + {R,Events}. + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). + +events_to_check(Testcase) -> + OneTest = + [{?eh,start_logging,{'DEF','RUNDIR'}}] ++ + [{?eh,tc_done,{?suite,Testcase,ok}}] ++ + [{?eh,stop_logging,[]}], + + %% 2 tests (ct:run_test + script_start) is default + OneTest ++ OneTest. + +check_cover(Config) when is_list(Config) -> + CTNode = proplists:get_value(ct_node, Config), + check_cover(CTNode); +check_cover(Node) when is_atom(Node) -> + case rpc:call(Node,test_server,is_cover,[]) of + true -> + {true, + rpc:call(Node,cover,which_nodes,[]), + rpc:call(Node,cover,modules,[])}; + false -> + false + end. + +%% Get the log dir "run.<timestamp>" for all (both!) tests +get_run_dirs(Events) -> + [filename:dirname(TCLog) || + {ct_test_support_eh, + {event,tc_logfile,_Node, + {{?suite,init_per_suite},TCLog}}} <- Events]. + +%% Check that each coverlog includes N calls to ?mod:foo/0 +check_calls(Events,N) -> + check_calls(Events,{?mod,foo,0},N). +check_calls(Events,MFA,N) -> + CoverLogs = [filename:join(D,"all.coverdata") || D <- get_run_dirs(Events)], + do_check_logs(CoverLogs,MFA,N). + +do_check_logs([CoverLog|CoverLogs],{Mod,_,_} = MFA,N) -> + {ok,_} = cover:start(), + ok = cover:import(CoverLog), + {ok,Calls} = cover:analyse(Mod,calls,function), + ok = cover:stop(), + {MFA,N} = lists:keyfind(MFA,1,Calls), + do_check_logs(CoverLogs,MFA,N); +do_check_logs([],_,_) -> + ok. + +fullname(Name) -> + {ok,Host} = inet:gethostname(), + list_to_atom(atom_to_list(Name) ++ "@" ++ Host). + +default_cover_file_content() -> + [{incl_mods,[?mod]}]. + +create_default_cover_file(Filename,Config) -> + create_cover_file(Filename,default_cover_file_content(),Config). + +create_cover_file(Filename,Terms,Config) -> + PrivDir = ?config(priv_dir,Config), + File = filename:join(PrivDir,Filename) ++ ".cover", + {ok,Fd} = file:open(File,[write]), + lists:foreach(fun(Term) -> + file:write(Fd,io_lib:format("~p.~n",[Term])) + end,Terms), + ok = file:close(Fd), + File. + +start_slave(Name,Args) -> + {ok, HostStr}=inet:gethostname(), + Host = list_to_atom(HostStr), + ct_slave:start(Host,Name, + [{erl_flags,Args}, + {boot_timeout,10}, % extending some timers for slow test hosts + {init_timeout,10}, + {startup_timeout,10}]). diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl new file mode 100644 index 0000000000..d967590c72 --- /dev/null +++ b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl @@ -0,0 +1,164 @@ +%%-------------------------------------------------------------------- +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +%%---------------------------------------------------------------------- +%% File: cover_SUITE.erl +%% +%% Description: +%% This file contains the test cases for the code coverage support +%% +%% @author Support +%% @doc Test of code coverage support in common_test +%% @end +%%---------------------------------------------------------------------- +%%---------------------------------------------------------------------- +-module(cover_SUITE). +-include_lib("common_test/include/ct.hrl"). + +-compile(export_all). + +%% Default timetrap timeout (set in init_per_testcase). +-define(default_timeout, ?t:minutes(1)). + +suite() -> + []. + +all() -> + []. + +init_per_suite(Config) -> + Config. + +end_per_suite(Config) -> + Config. + +init_per_testcase(_Case, Config) -> + Dog = test_server:timetrap(?default_timeout), + [{watchdog, Dog}|Config]. + +end_per_testcase(Case, Config) -> + %% try apply(?MODULE,Case,[cleanup,Config]) + %% catch error:undef -> ok + %% end, + + kill_slaves(Case,nodes()), + Dog=?config(watchdog, Config), + test_server:timetrap_cancel(Dog), + ok. + +%%%----------------------------------------------------------------- +%%% Test cases +break(_Config) -> + test_server:break(""), + ok. + +default(Config) -> + cover_compiled = code:which(cover_test_mod), + cover_test_mod:foo(), + ok. + +slave(Config) -> + cover_compiled = code:which(cover_test_mod), + cover_test_mod:foo(), + N1 = nodename(slave,1), + {ok,Node} = start_slave(N1), + cover_compiled = rpc:call(Node,code,which,[cover_test_mod]), + rpc:call(Node,cover_test_mod,foo,[]), + {ok,Node} = ct_slave:stop(N1), + ok. + +slave_start_slave(Config) -> + cover_compiled = code:which(cover_test_mod), + cover_test_mod:foo(), + N1 = nodename(slave_start_slave,1), + N2 = nodename(slave_start_slave,2), + {ok,Node} = start_slave(N1), + cover_compiled = rpc:call(Node,code,which,[cover_test_mod]), + rpc:call(Node,cover_test_mod,foo,[]), + {ok,Node2} = rpc:call(Node,ct_slave,start,[N2]), + rpc:call(Node2,cover_test_mod,foo,[]), + {ok,Node2} = rpc:call(Node,ct_slave,stop,[N2]), + {ok,Node} = ct_slave:stop(N1), + ok. + +cover_node_option(Config) -> + cover_compiled = code:which(cover_test_mod), + cover_test_mod:foo(), + Node = fullname(existing_node_1), + cover_compiled = rpc:call(Node,code,which,[cover_test_mod]), + rpc:call(Node,cover_test_mod,foo,[]), + ok. + +ct_cover_add_remove_nodes(Config) -> + cover_compiled = code:which(cover_test_mod), + cover_test_mod:foo(), + Node = fullname(existing_node_2), + Beam = rpc:call(Node,code,which,[cover_test_mod]), + false = (Beam == cover_compiled), + + rpc:call(Node,cover_test_mod,foo,[]), % should not be collected + {ok,[Node]} = ct_cover:add_nodes([Node]), + cover_compiled = rpc:call(Node,code,which,[cover_test_mod]), + rpc:call(Node,cover_test_mod,foo,[]), % should be collected + ok = ct_cover:remove_nodes([Node]), + rpc:call(Node,cover_test_mod,foo,[]), % should not be collected + + Beam = rpc:call(Node,code,which,[cover_test_mod]), + + ok. + +otp_9956(Config) -> + cover_compiled = code:which(?MODULE), + DataDir = ?config(data_dir,Config), + absolute = filename:pathtype(DataDir), + true = filelib:is_dir(DataDir), + ok. + + +%%%----------------------------------------------------------------- +%%% Internal +nodename(Case,N) -> + list_to_atom(nodeprefix(Case) ++ integer_to_list(N)). + +nodeprefix(Case) -> + atom_to_list(?MODULE) ++ "_" ++ atom_to_list(Case) ++ "_node". + + +fullname(Name) -> + {ok,Host} = inet:gethostname(), + list_to_atom(atom_to_list(Name) ++ "@" ++ Host). + +kill_slaves(Case, [Node|Nodes]) -> + Prefix = nodeprefix(Case), + case lists:prefix(Prefix,atom_to_list(Node)) of + true -> + rpc:call(Node,erlang,halt,[]); + _ -> + ok + end, + kill_slaves(Case,Nodes); +kill_slaves(_,[]) -> + ok. + +start_slave(Name) -> + {ok, HostStr}=inet:gethostname(), + Host = list_to_atom(HostStr), + ct_slave:start(Host,Name, + [{boot_timeout,10}, % extending some timers for slow test hosts + {init_timeout,10}, + {startup_timeout,10}]). diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore new file mode 100644 index 0000000000..e69de29bb2 --- /dev/null +++ b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl b/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl new file mode 100644 index 0000000000..d4f69452c3 --- /dev/null +++ b/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl @@ -0,0 +1,4 @@ +-module(cover_test_mod). +-compile(export_all). +foo() -> + ok. diff --git a/lib/common_test/test/ct_error_SUITE.erl b/lib/common_test/test/ct_error_SUITE.erl index 338e76264e..3881ced17d 100644 --- a/lib/common_test/test/ct_error_SUITE.erl +++ b/lib/common_test/test/ct_error_SUITE.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2009-2012. All Rights Reserved. +%% Copyright Ericsson AB 2009-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -44,8 +44,12 @@ %% there will be clashes with logging processes etc). %%-------------------------------------------------------------------- init_per_suite(Config) -> - Config1 = ct_test_support:init_per_suite(Config), - Config1. + DataDir = ?config(data_dir, Config), + TestDir = filename:join(DataDir, "error/test/"), + CTH = filename:join(TestDir, "verify_config.erl"), + ct:pal("Compiling ~p: ~p", + [CTH,compile:file(CTH,[{outdir,TestDir},debug_info])]), + ct_test_support:init_per_suite([{path_dirs,[TestDir]} | Config]). end_per_suite(Config) -> ct_test_support:end_per_suite(Config). @@ -61,7 +65,8 @@ suite() -> [{ct_hooks,[ts_install_cth]}]. all() -> [cfg_error, lib_error, no_compile, timetrap_end_conf, timetrap_normal, timetrap_extended, timetrap_parallel, - timetrap_fun, misc_errors]. + timetrap_fun, timetrap_fun_group, misc_errors, + config_restored]. groups() -> []. @@ -251,6 +256,24 @@ timetrap_fun(Config) when is_list(Config) -> %%%----------------------------------------------------------------- %%% +timetrap_fun_group(Config) when is_list(Config) -> + DataDir = ?config(data_dir, Config), + Join = fun(D, S) -> filename:join(D, "error/test/"++S) end, + Suites = [Join(DataDir, "timetrap_8_SUITE")], + {Opts,ERPid} = setup([{suite,Suites}], Config), + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(timetrap_fun_group, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(timetrap_fun_group), + ok = ct_test_support:verify_events(TestEvents, Events, Config). + +%%%----------------------------------------------------------------- +%%% misc_errors(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), Join = fun(D, S) -> filename:join(D, "error/test/"++S) end, @@ -267,6 +290,24 @@ misc_errors(Config) when is_list(Config) -> TestEvents = events_to_check(misc_errors), ok = ct_test_support:verify_events(TestEvents, Events, Config). +%%%----------------------------------------------------------------- +%%% +config_restored(Config) when is_list(Config) -> + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "error/test/config_restored_SUITE"), + {Opts,ERPid} = setup([{suite,Suite}, + {ct_hooks,[verify_config]}], + Config), + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(config_restored, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(config_restored), + ok = ct_test_support:verify_events(TestEvents, Events, Config). %%%----------------------------------------------------------------- %%% HELP FUNCTIONS @@ -429,8 +470,7 @@ test_events(cfg_error) -> {'EXIT',{init_per_group_fails,g1}}}}}}], [{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g2,[]}}}, - {?eh,tc_done,{cfg_error_8_SUITE, - {init_per_group,unknown,[]}, + {?eh,tc_done,{cfg_error_8_SUITE,{init_per_group,g2,[]}, {failed,{timetrap_timeout,2000}}}}, {?eh,tc_auto_skip,{cfg_error_8_SUITE,tc1, {failed,{cfg_error_8_SUITE,init_per_group, @@ -500,7 +540,7 @@ test_events(cfg_error) -> {?eh,tc_done,{cfg_error_8_SUITE,tc1,ok}}, {?eh,test_stats,{9,0,{0,14}}}, {?eh,tc_start,{cfg_error_8_SUITE,{end_per_group,g12,[]}}}, - {?eh,tc_done,{cfg_error_8_SUITE,{end_per_group,unknown,[]}, + {?eh,tc_done,{cfg_error_8_SUITE,{end_per_group,g12,[]}, {failed,{timetrap_timeout,2000}}}}], {?eh,tc_start,{cfg_error_8_SUITE,end_per_suite}}, @@ -971,11 +1011,423 @@ test_events(timetrap_fun) -> {?eh,stop_logging,[]} ]; +test_events(timetrap_fun_group) -> + [ + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{1,1,58}}, + {?eh,tc_start,{timetrap_8_SUITE,init_per_suite}}, + {?eh,tc_done,{timetrap_8_SUITE,init_per_suite,ok}}, + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g0,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g0,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{0,1,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{0,2,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g0,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g0,[]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g1,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g1,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{0,3,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{0,4,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g1,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g1,[]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g2,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g2,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc1}}, + {?eh,tc_done,{timetrap_8_SUITE,tc1, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{0,5,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{0,6,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g2,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g2,[]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g3,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g3,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc4}}, + {?eh,tc_done,{timetrap_8_SUITE,tc4, + {failed,{timetrap_timeout,{'$approx',2000}}}}}, + {?eh,test_stats,{0,7,{0,0}}}, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g1,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g1,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{0,8,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{0,9,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g1,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g1,[]},ok}}], + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g2,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g2,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc1}}, + {?eh,tc_done,{timetrap_8_SUITE,tc1, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{0,10,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{0,11,{0,0}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g2,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g2,[]},ok}}], + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g3,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g3,[]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g4,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g4,[]}, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{0,11,{0,1}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{0,11,{0,2}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g5,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g5,[]}, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{0,11,{0,3}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{0,11,{0,4}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g6,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g6,[]}, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0, + {failed,{timetrap_8_SUITE,init_per_group, + {timetrap_timeout,'_'}}}}}, + {?eh,test_stats,{0,11,{0,5}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,init_per_group, + {timetrap_timeout,'_'}}}}}, + {?eh,test_stats,{0,11,{0,6}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group, + {failed,{timetrap_8_SUITE,init_per_group, + {timetrap_timeout,'_'}}}}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g7,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g7,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{1,11,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g7,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g7,[]}, + {user_timetrap_error,{kaboom,'_'}}}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g8,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g8,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{2,11,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g8,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g8,[]}, + {failed,{timetrap_timeout,{'$approx',500}}}}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g9,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g9,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{3,11,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,test_stats,{3,12,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g9,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g9,[]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g10,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g10,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,test_stats,{3,13,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{4,13,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g10,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g10,[]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g11,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g11,[]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc3}}, + {?eh,tc_done,{timetrap_8_SUITE,tc3, + {failed,{timetrap_timeout,{'$approx',4000}}}}}, + {?eh,test_stats,{4,14,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{4,15,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g11,[]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g11,[]},ok}}], + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg0,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg0,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{4,16,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{4,17,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg0,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg0,[parallel]},ok}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{4,18,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{4,19,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]},ok}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc1}}, + {?eh,tc_done,{timetrap_8_SUITE,tc1, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{4,20,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{4,21,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]},ok}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg3,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg3,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc4}}, + {?eh,tc_done,{timetrap_8_SUITE,tc4, + {failed,{timetrap_timeout,{'$approx',2000}}}}}, + {?eh,test_stats,{4,22,{0,6}}}, + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}, + ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{4,23,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{4,24,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}, + ok}}]}, + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}, + ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc1}}, + {?eh,tc_done,{timetrap_8_SUITE,tc1, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{4,25,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{4,26,{0,6}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}, + ok}}]}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg3,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg3,[parallel]},ok}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg4,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg4,[parallel]}, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{4,26,{0,7}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{4,26,{0,8}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg5,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg5,[parallel]}, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{4,26,{0,9}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}, + {?eh,test_stats,{4,26,{0,10}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group, + {failed,{timetrap_8_SUITE,init_per_group, + {user_timetrap_error,{kaboom,'_'}}}}}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg6,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg6,[parallel]}, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0, + {failed,{timetrap_8_SUITE,init_per_group, + {timetrap_timeout,'_'}}}}}, + {?eh,test_stats,{4,26,{0,11}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,init_per_group, + {timetrap_timeout,'_'}}}}}, + {?eh,test_stats,{4,26,{0,12}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group, + {failed,{timetrap_8_SUITE,init_per_group, + {timetrap_timeout,'_'}}}}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg7,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg7,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{5,26,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg7,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg7,[parallel]}, + {user_timetrap_error,{kaboom,'_'}}}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg8,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg8,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{6,26,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg8,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg8,[parallel]}, + {failed,{timetrap_timeout,{'$approx',500}}}}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg9,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg9,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {user_timetrap_error,{kaboom,'_'}}}}, + %% Due to parallelism only checking final test stat in group + {?eh,test_stats,{7,27,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg9,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg9,[parallel]},ok}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg10,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg10,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + %% Due to parallelism only checking final test stat in group + {?eh,test_stats,{8,28,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg10,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg10,[parallel]},ok}}]}, + + {parallel, + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg11,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg11,[parallel]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc3}}, + {?eh,tc_done,{timetrap_8_SUITE,tc3, + {failed,{timetrap_timeout,{'$approx',4000}}}}}, + {?eh,test_stats,{8,29,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc2}}, + {?eh,tc_done,{timetrap_8_SUITE,tc2, + {failed,{timetrap_timeout,{'$approx',500}}}}}, + {?eh,test_stats,{8,30,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg11,[parallel]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg11,[parallel]},ok}}]}, + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,sg1,[sequence]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,sg1,[sequence]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{9,30,{0,12}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {user_timetrap_error,{kaboom,'_'}}}}, + {?eh,test_stats,{9,31,{0,12}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc1, + {failed,{timetrap_8_SUITE,tc0}}}}, + {?eh,test_stats,{9,31,{0,13}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,tc0}}}}, + {?eh,test_stats,{9,31,{0,14}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,sg1,[sequence]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,sg1,[sequence]},ok}}], + + [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,sg2,[sequence]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,sg2,[sequence]},ok}}, + {?eh,tc_start,{timetrap_8_SUITE,tc5}}, + {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}}, + {?eh,test_stats,{10,31,{0,14}}}, + {?eh,tc_start,{timetrap_8_SUITE,tc0}}, + {?eh,tc_done,{timetrap_8_SUITE,tc0, + {failed,{timetrap_timeout,{'$approx',1000}}}}}, + {?eh,test_stats,{10,32,{0,14}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc1, + {failed,{timetrap_8_SUITE,tc0}}}}, + {?eh,test_stats,{10,32,{0,15}}}, + {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2, + {failed,{timetrap_8_SUITE,tc0}}}}, + {?eh,test_stats,{10,32,{0,16}}}, + {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,sg2,[sequence]}}}, + {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,sg2,[sequence]},ok}}], + + {?eh,tc_start,{timetrap_8_SUITE,end_per_suite}}, + {?eh,tc_done,{timetrap_8_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]} + ]; + test_events(misc_errors) -> [ {?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, - {?eh,start_info,{1,1,7}}, + {?eh,start_info,{1,1,9}}, {?eh,tc_start,{misc_error_1_SUITE,ct_fail_1}}, {?eh,tc_done,{misc_error_1_SUITE,ct_fail_1, {failed,{error,{test_case_failed,{error,this_is_expected}}}}}}, @@ -1002,7 +1454,48 @@ test_events(misc_errors) -> {?eh,tc_start,{misc_error_1_SUITE,killed_by_signal_2}}, {?eh,tc_done,{misc_error_1_SUITE,killed_by_signal_2, {failed,testcase_aborted_or_killed}}}, - {?eh,test_stats,{0,7,{0,0}}}, + {parallel, + [{?eh,tc_start,{misc_error_1_SUITE,p1}}, + {?eh,tc_done,{misc_error_1_SUITE,p1,ok}}, + {?eh,tc_start,{misc_error_1_SUITE,p2}}, + {?eh,tc_done,{misc_error_1_SUITE,p2,ok}}]}, + {?eh,test_stats,{2,7,{0,0}}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]} + ]; + +test_events(config_restored) -> + [ + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{1,1,4}}, + {?eh,tc_start,{config_restored_SUITE,init_per_suite}}, + {?eh,tc_done,{config_restored_SUITE,init_per_suite,ok}}, + {?eh,tc_start,{config_restored_SUITE,to_tc}}, + {?eh,cth,{verify_config,post_end_per_testcase,{to_tc,diff_ok}}}, + {?eh,tc_done, + {config_restored_SUITE,to_tc,{failed,{timetrap_timeout,1000}}}}, + {?eh,test_stats,{0,1,{0,0}}}, + {?eh,tc_start,{config_restored_SUITE,exit_tc}}, + {?eh,cth,{verify_config,post_end_per_testcase,{exit_tc,diff_ok}}}, + {?eh,tc_done,{config_restored_SUITE,exit_tc, + {failed,{error,{test_case_failed,"Goodbye!"}}}}}, + {?eh,test_stats,{0,2,{0,0}}}, + [{?eh,tc_start,{config_restored_SUITE,{init_per_group,g1,[]}}}, + {?eh,tc_start,{config_restored_SUITE,to_tc}}, + {?eh,cth,{verify_config,post_end_per_testcase,{to_tc,diff_ok}}}, + {?eh,tc_done, + {config_restored_SUITE,to_tc,{failed,{timetrap_timeout,1000}}}}, + {?eh,test_stats,{0,3,{0,0}}}, + {?eh,tc_start,{config_restored_SUITE,exit_tc}}, + {?eh,cth,{verify_config,post_end_per_testcase,{exit_tc,diff_ok}}}, + {?eh,tc_done,{config_restored_SUITE,exit_tc, + {failed,{error,{test_case_failed,"Goodbye!"}}}}}, + {?eh,test_stats,{0,4,{0,0}}}, + {?eh,tc_start,{config_restored_SUITE,{end_per_group,g1,[]}}}, + {?eh,tc_done,{config_restored_SUITE,{end_per_group,g1,[]},ok}}], + {?eh,tc_start,{config_restored_SUITE,end_per_suite}}, + {?eh,tc_done,{config_restored_SUITE,end_per_suite,ok}}, {?eh,test_done,{'DEF','STOP_TIME'}}, {?eh,stop_logging,[]} ]. diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl new file mode 100644 index 0000000000..bcbf972a36 --- /dev/null +++ b/lib/common_test/test/ct_error_SUITE_data/error/test/config_restored_SUITE.erl @@ -0,0 +1,175 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +-module(config_restored_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% Function: suite() -> Info +%% Info = [tuple()] +%%-------------------------------------------------------------------- +suite() -> + [{timetrap,1000}]. + +%%-------------------------------------------------------------------- +%% Function: init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config1 = [{init_per_suite,?MODULE} | Config], + TabPid = spawn(fun() -> + ets:new(?MODULE, [named_table, set, public]), + receive _ -> ok end + end), + [{tab,TabPid} | Config1]. + +%%-------------------------------------------------------------------- +%% Function: end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%%-------------------------------------------------------------------- +end_per_suite(Config) -> + ets:delete(?MODULE), + exit(?config(tab, Config), kill), + ok. + +%%-------------------------------------------------------------------- +%% Function: init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%%-------------------------------------------------------------------- +init_per_group(GroupName, Config) -> + [{init_per_group,GroupName} | Config]. + +%%-------------------------------------------------------------------- +%% Function: end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% Function: init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%%-------------------------------------------------------------------- +init_per_testcase(TC, Config) -> + Config1 = [{init_per_testcase,TC} | Config], + ets:insert(?MODULE, {config,Config}), + %% ct:pal("Config after init_per_testcase(~w) = ~p", [TC,Config1]), + Config1. + +%%-------------------------------------------------------------------- +%% Function: end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%%-------------------------------------------------------------------- +end_per_testcase(TC, Config) -> + ct:pal("Config in end_per_testcase(~w) = ~p", [TC,Config]), + [{_,MemConfig}] = ets:lookup(?MODULE, config), + diff_config(Config, MemConfig, [tc_status]), + ?MODULE = proplists:get_value(init_per_suite, Config), + TC = proplists:get_value(init_per_testcase, Config), + case ?config(tc_group_properties, Config) of + undefined -> + ok; + Props -> + GName = proplists:get_value(name, Props), + GName = proplists:get_value(init_per_group, Config) + end, + ok. + +%%-------------------------------------------------------------------- +%% Function: groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%%-------------------------------------------------------------------- +groups() -> + [{g1,[],[to_tc, exit_tc]}]. + +%%-------------------------------------------------------------------- +%% Function: all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%%-------------------------------------------------------------------- +all() -> + [to_tc, exit_tc, + {group,g1}]. + + +to_tc(Config) -> + %% ct:pal("Config for to_tc = ~p", [Config]), + [{_,MemConfig}] = ets:lookup(?MODULE, config), + diff_config(Config, MemConfig, []), + ct:sleep(2000). + +exit_tc(Config) -> + %% ct:pal("Config for exit_tc = ~p", [Config]), + [{_,MemConfig}] = ets:lookup(?MODULE, config), + diff_config(Config, MemConfig, []), + ct:fail("Goodbye!"). + + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS + +diff_config(Cfg1, Cfg2, DiffKeys) -> + diff_config(Cfg1, Cfg2, DiffKeys, []). + +diff_config([{K,V} | Cfg1], Cfg2, DiffKeys, RemKeys) -> + case proplists:get_value(K, Cfg2) of + undefined -> + diff_config(Cfg1, Cfg2, proplists:delete(K, DiffKeys), RemKeys); + V -> + diff_config(Cfg1, proplists:delete(K, Cfg2), DiffKeys, RemKeys); + _Other -> + case proplists:is_defined(K, DiffKeys) of + true -> + diff_config(Cfg1, Cfg2, proplists:delete(K, DiffKeys), RemKeys); + false -> + diff_config(Cfg1, Cfg2, DiffKeys, [K | RemKeys]) + end + end; +diff_config([], [], [], []) -> + ct:pal("Diff ok!", []), + ok; +diff_config([], Cfg2, DiffKeys, RemKeys) -> + Result = {diff_failed, {cfg2,Cfg2}, {diffkeys,DiffKeys}, {remkeys,RemKeys}}, + ct:pal("Diff failed! Result = ~p", [Result]), + exit(Result). + diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl index 99c3ed05ec..61f3fa7e59 100644 --- a/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl +++ b/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl @@ -96,7 +96,7 @@ end_per_testcase(_TestCase, _Config) -> %% N = integer() | forever %%-------------------------------------------------------------------- groups() -> - []. + [{p,[parallel],[p1,p2]}]. %%-------------------------------------------------------------------- %% Function: all() -> GroupsAndTestCases | {skip,Reason} @@ -107,7 +107,8 @@ groups() -> %%-------------------------------------------------------------------- all() -> [ct_fail_1, ct_fail_2, ct_fail_3, ts_fail_1, ts_fail_2, - killed_by_signal_1, killed_by_signal_2]. + killed_by_signal_1, killed_by_signal_2, + {group,p}]. ct_fail_1(_) -> ct:fail({error,this_is_expected}), @@ -152,3 +153,10 @@ killed_by_signal_2(_) -> end), ct:sleep(1000), exit(this_should_not_be_seen). + +p1(_) -> + {error,parallel_group} = ct:abort_current_testcase(aborted), + ok. + +p2(_) -> + receive after 1000 -> ok end. diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl new file mode 100644 index 0000000000..ff138f38b5 --- /dev/null +++ b/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl @@ -0,0 +1,258 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +-module(timetrap_8_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +-define(TO, 4). + +%%-------------------------------------------------------------------- +%% Function: suite() -> Info +%% Info = [tuple()] +%%-------------------------------------------------------------------- +suite() -> + [{timetrap,{timetrap_utils,timetrap_val,[{seconds,?TO}]}}]. + +%%-------------------------------------------------------------------- +%% Function: init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config. + +%%-------------------------------------------------------------------- +%% Function: end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% Function: init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%%-------------------------------------------------------------------- +init_per_group(G6, Config) when G6==g6; G6==pg6 -> + ct:sleep({seconds,1}), + Config; +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% Function: end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%%-------------------------------------------------------------------- +end_per_group(G7or8, _Config) when G7or8==g7; G7or8==pg7; G7or8==g8; G7or8==pg8 -> + ct:sleep({seconds,5}), + ok; +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% Function: init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%%-------------------------------------------------------------------- +init_per_testcase(_, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% Function: end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%%-------------------------------------------------------------------- +end_per_testcase(_, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% Function: groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%%-------------------------------------------------------------------- +groups() -> + [ + {g0,[],[tc0,tc2]}, % group override suite and tc overrides group + {g1,[],[tc0,tc2]}, % group override suite and tc overrides group + {g2,[],[tc1,tc2]}, % tc override group + {g3,[],[tc4,{group,g1},{group,g2}]}, % subgroup override group + {g4,[],[tc0,tc2]}, % exit during init_per_group + {g5,[],[tc0,tc2]}, % exit during init_per_group + {g6,[],[tc0,tc2]}, % timeout during init_per_group + {g7,[],[tc5]}, % exit during end_per_group + {g8,[],[tc5]}, % timeout during end_per_group + {g9,[],[tc5,tc0]}, % exit during testcase + {g10,[],[tc0,tc5]}, % exit during testcase + {g11,[],[tc3,tc2]}, % suite is valid if nothing else is specified + {pg0,[parallel],[tc0,tc2]}, % group override suite and tc overrides group + {pg1,[parallel],[tc0,tc2]}, % group override suite and tc overrides group + {pg2,[parallel],[tc1,tc2]}, % tc override group + {pg3,[parallel],[tc4,{group,pg1},{group,pg2}]}, % subgroup override group + {pg4,[parallel],[tc0,tc2]}, % exit during init_per_group + {pg5,[parallel],[tc0,tc2]}, % exit during init_per_group + {pg6,[parallel],[tc0,tc2]}, % timeout during init_per_group + {pg7,[parallel],[tc5]}, % exit during end_per_group + {pg8,[parallel],[tc5]}, % timeout during end_per_group + {pg9,[parallel],[tc5,tc0]}, % exit during testcase + {pg10,[parallel],[tc0,tc5]},% exit during testcase + {pg11,[parallel],[tc3,tc2]},% suite is valid if nothing else is specified + {sg1,[sequence],[tc5,tc0,tc1,tc2]}, % exit during sequencial testcase + {sg2,[sequence],[tc5,tc0,tc1,tc2]}].% timeout during sequencial testcase + +group(g0) -> + [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}]; +group(g1) -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(1000) end}]; +group(g2) -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(3000) end}]; +group(g3) -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(2000) end}]; +group(g4) -> + [{timetrap,{timetrap_utils,timetrap_exit,[kaboom]}}]; +group(g5) -> + [{timetrap,fun() -> exit(kaboom) end}]; +group(g6) -> + [{timetrap,{timetrap_utils,timetrap_val,[500]}}]; +group(g7) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(g8) -> + [{timetrap,{timetrap_utils,timetrap_val,[500]}}]; +group(g9) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(g10) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(g11) -> + []; +group(pg0) -> + [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}]; +group(pg1) -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(1000) end}]; +group(pg2) -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(3000) end}]; +group(pg3) -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(2000) end}]; +group(pg4) -> + [{timetrap,{timetrap_utils,timetrap_exit,[kaboom]}}]; +group(pg5) -> + [{timetrap,fun() -> exit(kaboom) end}]; +group(pg6) -> + [{timetrap,{timetrap_utils,timetrap_val,[500]}}]; +group(pg7) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(pg8) -> + [{timetrap,{timetrap_utils,timetrap_val,[500]}}]; +group(pg9) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(pg10) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(pg11) -> + []; +group(sg1) -> + [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}]; +group(sg2) -> + [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}]. + + +%%-------------------------------------------------------------------- +%% Function: all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%%-------------------------------------------------------------------- +all() -> + [ + {group,g0}, + {group,g1}, + {group,g2}, + {group,g3}, + {group,g4}, + {group,g5}, + {group,g6}, + {group,g7}, + {group,g8}, + {group,g9}, + {group,g10}, + {group,g11}, + {group,pg0}, + {group,pg1}, + {group,pg2}, + {group,pg3}, + {group,pg4}, + {group,pg5}, + {group,pg6}, + {group,pg7}, + {group,pg8}, + {group,pg9}, + {group,pg10}, + {group,pg11}, + {group,sg1}, + {group,sg2}]. + + + +tc0(_) -> + ct:comment("TO set by group"), + ct:sleep({seconds,5}), + ok. + +tc1() -> + [{timetrap,{timetrap_utils,timetrap_val,[1000]}}]. +tc1(_) -> + ct:comment("TO after 1 sec"), + ct:sleep({seconds,2}), + ok. + +tc2() -> + [{timetrap,fun() -> timetrap_utils:timetrap_val(500) end}]. +tc2(_) -> + ct:comment("TO after 0.5 sec"), + ct:sleep({seconds,2}), + ok. + +tc3(_) -> + ct:comment(io_lib:format("TO after ~w sec", [?TO])), + ct:sleep({seconds,5}), + ok. + +tc4(_) -> + ct:comment("TO set by group"), + ct:sleep({seconds,5}), + ok. + +tc5(_) -> + ct:comment("No TO in this testcase, maybe later"), + ok. diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl new file mode 100644 index 0000000000..446dd8bfdf --- /dev/null +++ b/lib/common_test/test/ct_error_SUITE_data/error/test/verify_config.erl @@ -0,0 +1,239 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%% @doc Common Test Example Suite Callback module. +%%% +%%% <p>This module gives an example of a common test CTH (Common Test Hook). +%%% There are many ways to add a CTH to a test run, you can do it either in +%%% the command line using -ct_hook, in a test spec using +%%% {ct_hook,M} or in the suite it self by returning ct_hook +%%% from either suite/0, init_per_suite/1, init_per_group/2 and +%%% init_per_testcase/2. The scope of the CTH is determined by where is it +%%% started. If it is started in the command line or test spec then it will +%%% be stopped at the end of all tests. If it is started in init_per_suite, +%%% it will be stopped after end_per_suite and so on. See terminate +%%% documentation for a table describing the scoping machanics. +%%% +%%% All of callbacks except init/1 in a CTH are optional.</p> + +-module(verify_config). + +%% CT Hooks +-export([id/1]). +-export([init/2]). + +-export([pre_init_per_suite/3]). +-export([post_init_per_suite/4]). +-export([pre_end_per_suite/3]). +-export([post_end_per_suite/4]). + +-export([pre_init_per_group/3]). +-export([post_init_per_group/4]). +-export([pre_end_per_group/3]). +-export([post_end_per_group/4]). + +-export([pre_init_per_testcase/3]). +-export([post_end_per_testcase/4]). + +-export([on_tc_fail/3]). +-export([on_tc_skip/3]). + +-export([terminate/1]). + +-include_lib("common_test/src/ct_util.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-type config() :: proplists:proplist(). +-type reason() :: term(). +-type skip_or_fail() :: {skip, reason()} | + {auto_skip, reason()} | + {fail, reason()} | + {'EXIT',reason()}. + +-record(state, { id = ?MODULE :: term()}). + +%% @doc Always called before any other callback function. Use this to initiate +%% any common state. It should return an state for this CTH. +-spec init(Id :: term(), Opts :: proplists:proplist()) -> + {ok, State :: #state{}}. +init(Id, Opts) -> + {ok,Opts}. + +%% @doc The ID is used to uniquly identify an CTH instance, if two CTH's +%% return the same ID the seconds CTH is ignored. This function should NOT +%% have any side effects as it might be called multiple times by common test. +-spec id(Opts :: proplists:proplist()) -> + Id :: term(). +id(Opts) -> + now(). + +%% @doc Called before init_per_suite is called. Note that this callback is +%% only called if the CTH is added before init_per_suite is run (eg. in a test +%% specification, suite/0 function etc). +%% You can change the config in the this function. +-spec pre_init_per_suite(Suite :: atom(), + Config :: config(), + State :: #state{}) -> + {config() | skip_or_fail(), NewState :: #state{}}. +pre_init_per_suite(Suite,Config,State) -> + {Config, State}. + +%% @doc Called after init_per_suite. +%% you can change the return value in this function. +-spec post_init_per_suite(Suite :: atom(), + Config :: config(), + Return :: config() | skip_or_fail(), + State :: #state{}) -> + {config() | skip_or_fail(), NewState :: #state{}}. +post_init_per_suite(Suite,Config,Return,State) -> + {Return, State}. + +%% @doc Called before end_per_suite. The config/state can be changed here, +%% though it will only affect the *end_per_suite function. +-spec pre_end_per_suite(Suite :: atom(), + Config :: config() | skip_or_fail(), + State :: #state{}) -> + {ok | skip_or_fail(), NewState :: #state{}}. +pre_end_per_suite(Suite,Config,State) -> + {Config, State}. + +%% @doc Called after end_per_suite. Note that the config cannot be +%% changed here, only the status of the suite. +-spec post_end_per_suite(Suite :: atom(), + Config :: config(), + Return :: term(), + State :: #state{}) -> + {ok | skip_or_fail(), NewState :: #state{}}. +post_end_per_suite(Suite,Config,Return,State) -> + {Return, State}. + +%% @doc Called before each init_per_group. +%% You can change the config in this function. +-spec pre_init_per_group(Group :: atom(), + Config :: config(), + State :: #state{}) -> + {config() | skip_or_fail(), NewState :: #state{}}. +pre_init_per_group(Group,Config,State) -> + {Config, State}. + +%% @doc Called after each init_per_group. +%% You can change the return value in this function. +-spec post_init_per_group(Group :: atom(), + Config :: config(), + Return :: config() | skip_or_fail(), + State :: #state{}) -> + {config() | skip_or_fail(), NewState :: #state{}}. +post_init_per_group(Group,Config,Return,State) -> + {Return, State}. + +%% @doc Called after each end_per_group. The config/state can be changed here, +%% though it will only affect the *end_per_group functions. +-spec pre_end_per_group(Group :: atom(), + Config :: config() | skip_or_fail(), + State :: #state{}) -> + {ok | skip_or_fail(), NewState :: #state{}}. +pre_end_per_group(Group,Config,State) -> + {Config, State}. + +%% @doc Called after each end_per_group. Note that the config cannot be +%% changed here, only the status of the group. +-spec post_end_per_group(Group :: atom(), + Config :: config(), + Return :: term(), + State :: #state{}) -> + {ok | skip_or_fail(), NewState :: #state{}}. +post_end_per_group(Group,Config,Return,State) -> + {Return, State}. + +%% @doc Called before each test case. +%% You can change the config in this function. +-spec pre_init_per_testcase(TC :: atom(), + Config :: config(), + State :: #state{}) -> + {config() | skip_or_fail(), NewState :: #state{}}. +pre_init_per_testcase(TC,Config,State) -> + {Config, State}. + +%% @doc Called after each test case. Note that the config cannot be +%% changed here, only the status of the test case. +-spec post_end_per_testcase(TC :: atom(), + Config :: config(), + Return :: term(), + State :: #state{}) -> + {ok | skip_or_fail(), NewState :: #state{}}. +post_end_per_testcase(TC,Config,Return,State) -> + %% check that config has been restored + ct:pal("Config in verify_config:post_end_per_testcase(~w) = ~p", + [TC,Config]), + [{_,MemConfig}] = ets:lookup(config_restored_SUITE, config), + try config_restored_SUITE:diff_config(Config, MemConfig, [tc_status]) of + ok -> + gen_event:notify( + ?CT_EVMGR_REF, #event{ name = cth, node = node(), + data = {?MODULE, post_end_per_testcase, + {TC,diff_ok}}}) + catch + _:_ -> + gen_event:notify( + ?CT_EVMGR_REF, #event{ name = cth, node = node(), + data = {?MODULE, post_end_per_testcase, + {TC,diff_failed}}}) + end, + {Return, State}. + +%% @doc Called after post_init_per_suite, post_end_per_suite, post_init_per_group, +%% post_end_per_group and post_end_per_tc if the suite, group or test case failed. +%% This function should be used for extra cleanup which might be needed. +%% It is not possible to modify the config or the status of the test run. +-spec on_tc_fail(TC :: init_per_suite | end_per_suite | + init_per_group | end_per_group | atom(), + Reason :: term(), State :: #state{}) -> + NewState :: #state{}. +on_tc_fail(TC, Reason, State) -> + State. + +%% @doc Called when a test case is skipped by either user action +%% or due to an init function failing. Test case can be +%% end_per_suite, init_per_group, end_per_group and the actual test cases. +-spec on_tc_skip(TC :: end_per_suite | + init_per_group | end_per_group | atom(), + {tc_auto_skip, {failed, {Mod :: atom(), Function :: atom(), Reason :: term()}}} | + {tc_user_skip, {skipped, Reason :: term()}}, + State :: #state{}) -> + NewState :: #state{}. +on_tc_skip(TC, Reason, State) -> + State. + +%% @doc Called when the scope of the CTH is done, this depends on +%% when the CTH was specified. This translation table describes when this +%% function is called. +%% +%% | Started in | terminate called | +%% |---------------------|-------------------------| +%% | command_line | after all tests are run | +%% | test spec | after all tests are run | +%% | suite/0 | after SUITE is done | +%% | init_per_suite/1 | after SUITE is done | +%% | init_per_group/2 | after group is done | +%% |-----------------------------------------------| +%% +-spec terminate(State :: #state{}) -> + term(). +terminate(State) -> + ok. diff --git a/lib/common_test/test/ct_group_leader_SUITE.erl b/lib/common_test/test/ct_group_leader_SUITE.erl new file mode 100644 index 0000000000..cde3061d6a --- /dev/null +++ b/lib/common_test/test/ct_group_leader_SUITE.erl @@ -0,0 +1,181 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_system_error_SUITE +%%% +%%% Description: +%%% +%%% Test the group leader functionality in the test_server application. +%%%------------------------------------------------------------------- +-module(ct_group_leader_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-define(eh, ct_test_support_eh). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config1 = ct_test_support:init_per_suite(Config), + Config1. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [ + basic + ]. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%%%----------------------------------------------------------------- +%%% +basic(Config) -> + TC = basic, + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "group_leader_SUITE"), + {Opts,ERPid} = setup([{suite,Suite},{label,TC}], Config), + SuiteLog = execute(TC, Opts, ERPid, Config), + {ok,Data} = file:read_file(SuiteLog), + Lines = binary:split(Data, <<"\n">>, [global]), + {ok,RE} = re:compile("(\\S+):(\\S+)$"), + Cases0 = [begin + {match,[M,F]} = re:run(Case, RE, [{capture,all_but_first,list}]), + {list_to_atom(M),list_to_atom(F)} + end || <<"=case ",Case/binary>> <- Lines], + Cases = [MF || {_,F}=MF <- Cases0, + F =/= init_per_suite, + F =/= end_per_suite, + F =/= init_per_group, + F =/= end_per_group], + io:format("~p\n", [Cases]), + [] = verify_cases(events_to_check(TC), Cases, false), + ok. + +verify_cases([{parallel,P}|Ts], Cases0, Par) -> + Cases = verify_cases(P, Cases0, true), + verify_cases(Ts, Cases, Par); +verify_cases([{?eh,tc_done,{M,F,_}}|Ts], Cases0, false) -> + [{M,F}|Cases] = Cases0, + verify_cases(Ts, Cases, false); +verify_cases([{?eh,tc_done,{M,F,_}}|Ts], Cases0, true) -> + case lists:member({M,F}, Cases0) of + true -> + Cases = Cases0 -- [{M,F}], + verify_cases(Ts, Cases, true); + false -> + io:format("~p not found\n", [{M,F}]), + ?t:fail() + end; +verify_cases([{?eh,_,_}|Ts], Cases, Par) -> + verify_cases(Ts, Cases, Par); +verify_cases([], Cases, _) -> + Cases; +verify_cases([List|Ts], Cases0, Par) when is_list(List) -> + Cases = verify_cases(List, Cases0, false), + verify_cases(Ts, Cases, Par). + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- + +setup(Test, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +execute(Name, Opts, ERPid, Config) -> + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(Name, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(Name), + ok = ct_test_support:verify_events(TestEvents, Events, Config), + {event,tc_logfile,_,{_,File}} = + lists:keyfind(tc_logfile, 2, [Ev || {?eh,Ev} <- Events]), + LogDir = filename:dirname(File), + filename:join(LogDir, "suite.log"). + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). + +%%%----------------------------------------------------------------- +%%% TEST EVENTS +%%%----------------------------------------------------------------- + +events_to_check(_Test) -> + [{?eh,tc_done,{group_leader_SUITE,tc1,ok}}, + {parallel,[{?eh,tc_start,{group_leader_SUITE,p1}}, + {?eh,tc_done,{group_leader_SUITE,p1,ok}}, + {?eh,tc_start,{group_leader_SUITE,p2}}, + {?eh,tc_done,{group_leader_SUITE,p2,ok}}]}, + {?eh,tc_done,{group_leader_SUITE,p_restart_my_io_server,ok}}, + {?eh,tc_done,{group_leader_SUITE,p3,ok}}, + {parallel,[ + {?eh,tc_start,{group_leader_SUITE,p10}}, + {?eh,tc_start,{group_leader_SUITE,p11}}, + {?eh,tc_done,{group_leader_SUITE,p10,ok}}, + {?eh,tc_done,{group_leader_SUITE,p11,ok}}, + [{?eh,tc_done,{group_leader_SUITE,s1,ok}}, + {?eh,tc_done,{group_leader_SUITE,s2,ok}}, + {?eh,tc_done,{group_leader_SUITE,s3,ok}}], + {?eh,tc_start,{group_leader_SUITE,p12}}, + {?eh,tc_done,{group_leader_SUITE,p12,ok}}, + [{?eh,tc_done,{group_leader_SUITE,s4,ok}}, + {?eh,tc_done,{group_leader_SUITE,s5,ok}}], + {?eh,tc_start,{group_leader_SUITE,p13}}, + {?eh,tc_done,{group_leader_SUITE,p13,ok}} ]}, + {?eh,tc_done,{group_leader_SUITE,cap1,ok}}, + {?eh,tc_done,{group_leader_SUITE,cap2,ok}}, + {parallel,[{?eh,tc_start,{group_leader_SUITE,cap1}}, + {?eh,tc_done,{group_leader_SUITE,cap1,ok}}, + {?eh,tc_start,{group_leader_SUITE,cap2}}, + {?eh,tc_done,{group_leader_SUITE,cap2,ok}}]}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]} + ]. diff --git a/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl b/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl new file mode 100644 index 0000000000..3f1844b4ae --- /dev/null +++ b/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl @@ -0,0 +1,252 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +-module(group_leader_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{timetrap,{seconds,10}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + start_my_io_server(), + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + my_io_server ! die, + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + [{p,[parallel],[p1,p2]}, + {p_restart,[parallel],[p_restart_my_io_server]}, + {seq,[],[s1,s2,s3]}, + {seq2,[],[s4,s5]}, + {seq_in_par,[parallel],[p10,p11,{group,seq},p12,{group,seq2},p13]}, + {capture_io,[parallel],[cap1,cap2]}]. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [tc1,{group,p},{group,p_restart},p3, + {group,seq_in_par}, + cap1,cap2, + {group,capture_io}]. + +tc1(_C) -> + ok. + +p1(_) -> + %% OTP-10101: + %% + %% External apps/processes started by init_per_suite (common operation), + %% will inherit the group leader of the init_per_suite process, i.e. the + %% test_server test case control process (executing run_test_case_msgloop/7). + %% If, later, a parallel test case triggers the external app to print with + %% e.g. io:format() (also common operation), the calling process will hang! + %% The reason for this is that a parallel test case has a dedicated IO + %% server process, other than the central test case control process. The + %% latter process is not executing run_test_case_msgloop/7 and will not + %% respond to IO messages. The process is still group leader for the + %% external app, however, which is wrong. It's the IO process for the + %% parallel test case that should be group leader - but only for the + %% particular invokation, since other parallel test cases could be + %% invoking the external app too. + print("hej\n"). + +p2(_) -> + print("hopp\n"). + +p_restart_my_io_server(_) -> + %% Restart the IO server and change its group leader. This used + %% to set to the group leader to a process that would soon die. + Ref = erlang:monitor(process, my_io_server), + my_io_server ! die, + receive + {'DOWN',Ref,_,_,_} -> + start_my_io_server() + end. + +p3(_) -> + %% OTP-10125. This would crash since the group leader process + %% for the my_io_server had died. + print("hoppsan\n"). + +print(String) -> + my_io_server ! {print,self(),String}, + receive + {printed,String} -> + ok + end. + +start_my_io_server() -> + Parent = self(), + Pid = spawn(fun() -> my_io_server(Parent) end), + receive + {Pid,started} -> + io:format("~p\n", [process_info(Pid)]), + ok + end. + +my_io_server(Parent) -> + register(my_io_server, self()), + Parent ! {self(),started}, + my_io_server_loop(). + +my_io_server_loop() -> + receive + {print,From,String} -> + io:put_chars(String), + From ! {printed,String}, + my_io_server_loop(); + die -> + ok + end. + +p10(_) -> + receive after 1 -> ok end. + +p11(_) -> + ok. + +p12(_) -> + ok. + +p13(_) -> + ok. + +s1(_) -> + ok. + +s2(_) -> + ok. + +s3(_) -> + ok. + +s4(_) -> + ok. + +s5(_) -> + ok. + +cap1(_) -> + ct:capture_start(), + IO = gen_io(cap1, 10, []), + ct:capture_stop(), + IO = ct:capture_get(), + ok. + +cap2(_) -> + ct:capture_start(), + {Pid,Ref} = spawn_monitor(fun() -> + exit(gen_io(cap2, 42, [])) + end), + receive + {'DOWN',Ref,process,Pid,IO} -> + ct:capture_stop(), + IO = ct:capture_get(), + ok + end. + +gen_io(_, 0, Acc) -> + lists:reverse(Acc); +gen_io(Label, N, Acc) -> + S = lists:flatten(io_lib:format("~s: ~p\n", [Label,N])), + io:put_chars(S), + gen_io(Label, N-1, [S|Acc]). diff --git a/lib/common_test/test/ct_hooks_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE.erl index 405df1e978..796a0832d7 100644 --- a/lib/common_test/test/ct_hooks_SUITE.erl +++ b/lib/common_test/test/ct_hooks_SUITE.erl @@ -64,7 +64,7 @@ end_per_testcase(TestCase, Config) -> suite() -> - [{timetrap,{seconds,20}}]. + [{timetrap,{minutes,1}}]. all() -> all(suite). diff --git a/lib/common_test/test/ct_master_SUITE.erl b/lib/common_test/test/ct_master_SUITE.erl index 27243a0067..7408cbe376 100644 --- a/lib/common_test/test/ct_master_SUITE.erl +++ b/lib/common_test/test/ct_master_SUITE.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2010-2012. All Rights Reserved. +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -109,7 +109,7 @@ ct_master_test(Config) when is_list(Config) -> ERPid = ct_test_support:start_event_receiver(Config), - [{TSFile,ok}] = run_test(ct_master_test, FileName, Config), + [{[TSFile],ok}] = run_test(ct_master_test, FileName, Config), Events = ct_test_support:get_events(ERPid, Config), @@ -117,14 +117,8 @@ ct_master_test(Config) when is_list(Config) -> reformat(Events, ?eh), PrivDir, []), - find_events(NodeNames, [{tc_start,{master_SUITE,init_per_suite}}, - {tc_start,{master_SUITE,first_testcase}}, - {tc_start,{master_SUITE,second_testcase}}, - {tc_start,{master_SUITE,third_testcase}}, - {tc_start,{master_SUITE,end_per_suite}}], - Events), - - ok. + TestEvents = events_to_check(ct_master_test), + ok = find_events(NodeNames, TestEvents, Events, Config). %%%----------------------------------------------------------------- %%% HELP FUNCTIONS @@ -153,13 +147,18 @@ make_spec(DataDir, FileName, NodeNames, Suites, Config) -> CM = [{config,master,filename:join(DataDir,"master/config.txt")}], + Env = [{"THIS_MUST_BE_SET","yes"}, + {"SO_MUST_THIS","value"}], NS = lists:map( fun(NodeName) -> {init,NodeName,[ {node_start,[{startup_functions,[]}, - {monitor_master,true}]}, - {eval,{erlang,nodes,[]}} - ] + {monitor_master,true}, + {boot_timeout,10}, + {init_timeout,10}, + {startup_timeout,10}, + {env,Env}]}, + {eval,{erlang,nodes,[]}}] } end, NodeNames), @@ -196,13 +195,12 @@ get_log_dir(_,PrivDir,NodeName) -> run_test(_Name, FileName, Config) -> %% run the test twice, using different html versions - [{FileName,ok}] = ct_test_support:run({ct_master,run,[FileName]}, - [{ct_master,basic_html,[true]}], - Config), - timer:sleep(5000), - [{FileName,ok}] = ct_test_support:run({ct_master,run,[FileName]}, - [{ct_master,basic_html,[false]}], - Config). + [{[FileName],ok}] = ct_test_support:run({ct_master,run,[FileName]}, + [{ct_master,basic_html,[true]}], + Config), + [{[FileName],ok}] = ct_test_support:run({ct_master,run,[FileName]}, + [{ct_master,basic_html,[false]}], + Config). reformat(Events, EH) -> ct_test_support:reformat(Events, EH). @@ -210,28 +208,26 @@ reformat(Events, EH) -> %%%----------------------------------------------------------------- %%% TEST EVENTS %%%----------------------------------------------------------------- -find_events([], _CheckEvents, _) -> - ok; -find_events([NodeName|NodeNames],CheckEvents,AllEvents) -> - find_events(NodeNames, CheckEvents, - remove_events(add_host(NodeName),CheckEvents, AllEvents, [])). - -remove_events(Node,[{Name,Data} | RestChecks], - [{?eh,#event{ name = Name, node = Node, data = Data }}|RestEvs], - Acc) -> - remove_events(Node, RestChecks, RestEvs, Acc); -remove_events(Node, Checks, [Event|RestEvs], Acc) -> - remove_events(Node, Checks, RestEvs, [Event | Acc]); -remove_events(_Node, [], [], Acc) -> - lists:reverse(Acc); -remove_events(Node, Events, [], Acc) -> - test_server:format("Could not find events: ~p in ~p for node ~p", - [Events, lists:reverse(Acc), Node]), - exit(event_not_found). + +find_events(NodeNames, TestEvents, Events, Config) -> + [begin + Node = add_host(Node0), + io:format("Searching for events for node: ~s", [Node]), + ok = ct_test_support:verify_events(TestEvents, Events, Node, Config), + io:nl() + end || Node0 <- NodeNames], + ok. add_host(NodeName) -> {ok, HostName} = inet:gethostname(), list_to_atom(atom_to_list(NodeName)++"@"++HostName). -expected_events(_) -> - []. +events_to_check(_) -> + [{?eh,tc_start,{master_SUITE,first_testcase}}, + {?eh,tc_done,{master_SUITE,first_testcase,ok}}, + {?eh,tc_start,{master_SUITE,second_testcase}}, + {?eh,tc_done,{master_SUITE,second_testcase,ok}}, + {?eh,tc_start,{master_SUITE,third_testcase}}, + {?eh,tc_done,{master_SUITE,third_testcase,ok}}, + {?eh,tc_start,{master_SUITE,env_vars}}, + {?eh,tc_done,{master_SUITE,env_vars,ok}}]. diff --git a/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl b/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl index 032d69ad9f..df54c4419c 100644 --- a/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl +++ b/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2010. All Rights Reserved. +%% Copyright Ericsson AB 2010-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -39,7 +39,8 @@ init_per_suite(Config) -> end_per_suite(_) -> ok. -all() -> [first_testcase, second_testcase, third_testcase]. +all() -> [first_testcase, second_testcase, third_testcase, + env_vars]. init_per_testcase(_, Config) -> Config. @@ -56,3 +57,9 @@ second_testcase(_)-> third_testcase(_)-> A = 4, A = 2*2. + +env_vars(_) -> + io:format("~p\n", [os:getenv()]), + "yes" = os:getenv("THIS_MUST_BE_SET"), + "value" = os:getenv("SO_MUST_THIS"), + ok. diff --git a/lib/common_test/test/ct_netconfc_SUITE.erl b/lib/common_test/test/ct_netconfc_SUITE.erl index 3042a924fe..c89a4cdabe 100644 --- a/lib/common_test/test/ct_netconfc_SUITE.erl +++ b/lib/common_test/test/ct_netconfc_SUITE.erl @@ -43,12 +43,11 @@ %% there will be clashes with logging processes etc). %%-------------------------------------------------------------------- init_per_suite(Config) -> - Config1 = ct_test_support:init_per_suite(Config), case application:load(crypto) of - {error,Reason} -> + {error,Reason} when Reason=/={already_loaded,crypto} -> {skip, Reason}; _ -> - Config1 + ct_test_support:init_per_suite(Config) end. end_per_suite(Config) -> diff --git a/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl b/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl index d337158bce..54526e8e83 100644 --- a/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl +++ b/lib/common_test/test/ct_netconfc_SUITE_data/netconfc1_SUITE.erl @@ -1044,12 +1044,9 @@ gen_dsa(LSize,NSize) when is_integer(LSize), is_integer(NSize) -> Key = gen_dsa2(LSize, NSize), {Key, encode_key(Key)}. -encode_key(Key = #'RSAPrivateKey'{}) -> - {ok, Der} = 'OTP-PUB-KEY':encode('RSAPrivateKey', Key), - {'RSAPrivateKey', list_to_binary(Der), not_encrypted}; encode_key(Key = #'DSAPrivateKey'{}) -> - {ok, Der} = 'OTP-PUB-KEY':encode('DSAPrivateKey', Key), - {'DSAPrivateKey', list_to_binary(Der), not_encrypted}. + Der = public_key:der_encode('DSAPrivateKey', Key), + {'DSAPrivateKey', Der, not_encrypted}. %%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%% diff --git a/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl b/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl index 2427f37f52..09217f60a3 100644 --- a/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl +++ b/lib/common_test/test/ct_netconfc_SUITE_data/ns.erl @@ -1,7 +1,7 @@ %%-------------------------------------------------------------------- %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2012. All Rights Reserved. +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -426,7 +426,7 @@ reply(ConnRef,Reply) -> send(ConnRef, make_msg(Reply)). from_simple(Simple) -> - list_to_binary(xmerl:export_simple_element(Simple,xmerl_xml)). + unicode_c2b(xmerl:export_simple_element(Simple,xmerl_xml)). xml(Content) -> <<"<?xml version=\"1.0\" encoding=\"UTF-8\"?>\n", @@ -435,30 +435,30 @@ xml(Content) -> rpc_reply(Content) when is_binary(Content) -> MsgId = case erase(msg_id) of undefined -> <<>>; - Id -> list_to_binary([" message-id=\"",Id,"\""]) + Id -> unicode_c2b([" message-id=\"",Id,"\""]) end, <<"<rpc-reply xmlns=\"",?NETCONF_NAMESPACE,"\"",MsgId/binary,">\n", Content/binary,"\n</rpc-reply>">>; rpc_reply(Content) -> - rpc_reply(list_to_binary(Content)). + rpc_reply(unicode_c2b(Content)). session_id(no_session_id) -> <<>>; session_id(SessionId0) -> - SessionId = list_to_binary(integer_to_list(SessionId0)), + SessionId = unicode_c2b(integer_to_list(SessionId0)), <<"<session-id>",SessionId/binary,"</session-id>\n">>. capabilities(undefined) -> - CapsXml = list_to_binary([["<capability>",C,"</capability>\n"] + CapsXml = unicode_c2b([["<capability>",C,"</capability>\n"] || C <- ?CAPABILITIES]), <<"<capabilities>\n",CapsXml/binary,"</capabilities>\n">>; capabilities({base,Vsn}) -> - CapsXml = list_to_binary([["<capability>",C,"</capability>\n"] + CapsXml = unicode_c2b([["<capability>",C,"</capability>\n"] || C <- ?CAPABILITIES_VSN(Vsn)]), <<"<capabilities>\n",CapsXml/binary,"</capabilities>\n">>; capabilities(no_base) -> [_|Caps] = ?CAPABILITIES, - CapsXml = list_to_binary([["<capability>",C,"</capability>\n"] || C <- Caps]), + CapsXml = unicode_c2b([["<capability>",C,"</capability>\n"] || C <- Caps]), <<"<capabilities>\n",CapsXml/binary,"</capabilities>\n">>; capabilities(no_caps) -> <<>>. @@ -553,3 +553,8 @@ make_msg(Xml) when is_binary(Xml) -> xml(Xml); make_msg(Simple) when is_tuple(Simple) -> xml(from_simple(Simple)). + +%%%----------------------------------------------------------------- +%%% Convert to unicode binary, since we use UTF-8 encoding in XML +unicode_c2b(Characters) -> + unicode:characters_to_binary(Characters). diff --git a/lib/common_test/test/ct_snmp_SUITE.erl b/lib/common_test/test/ct_snmp_SUITE.erl new file mode 100644 index 0000000000..f8b4543770 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE.erl @@ -0,0 +1,141 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_snmp_SUITE +%%% +%%% Description: +%%% Test ct_snmp module +%%% +%%%------------------------------------------------------------------- +-module(ct_snmp_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-define(eh, ct_test_support_eh). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config1 = ct_test_support:init_per_suite(Config), + Config1. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [ + default + ]. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%%%----------------------------------------------------------------- +%%% +default(Config) when is_list(Config) -> + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "snmp_SUITE"), + CfgFile = filename:join(DataDir, "snmp.cfg"), + {Opts,ERPid} = setup([{suite,Suite},{config,CfgFile}, + {label,default}], Config), + + ok = execute(default, Opts, ERPid, Config). + + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- + +setup(Test, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +execute(Name, Opts, ERPid, Config) -> + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(Name, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(Name,Config), + ct_test_support:verify_events(TestEvents, Events, Config). + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). + +%%%----------------------------------------------------------------- +%%% TEST EVENTS +%%%----------------------------------------------------------------- +events_to_check(_TestName,Config) -> + {module,_} = code:load_abs(filename:join(?config(data_dir,Config), + snmp_SUITE)), + TCs = get_tcs(), + code:purge(snmp_SUITE), + code:delete(snmp_SUITE), + + OneTest = + [{?eh,start_logging,{'DEF','RUNDIR'}}] ++ + [{?eh,tc_done,{snmp_SUITE,TC,ok}} || TC <- TCs] ++ + [{?eh,stop_logging,[]}], + + %% 2 tests (ct:run_test + script_start) is default + OneTest ++ OneTest. + + +get_tcs() -> + All = snmp_SUITE:all(), + Groups = + try snmp_SUITE:groups() + catch error:undef -> [] + end, + flatten_tcs(All,Groups). + +flatten_tcs([H|T],Groups) when is_atom(H) -> + [H|flatten_tcs(T,Groups)]; +flatten_tcs([{group,Group}|T],Groups) -> + TCs = proplists:get_value(Group,Groups), + flatten_tcs(TCs ++ T,Groups); +flatten_tcs([],_) -> + []. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg b/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg new file mode 100644 index 0000000000..895e097de6 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg @@ -0,0 +1,44 @@ +%% -*- erlang -*- +{snmp1, [{start_agent,true}, + {users,[{user_name,[snmpm_user_default,[]]}]}, + {managed_agents,[{agent_name, [user_name, {127,0,0,1}, 4000, + [{engine_id,"ct_snmp-test-engine"}, + {version,v2}]]}]}, + {engine_id,"ct_snmp-test-engine"}, + {agent_vsns,[v2]} + ]}. +{snmp2, [{start_agent,true}, + {engine_id,"ct_snmp-test-engine"} + ]}. +{snmp3, [{start_agent,true}, + {engine_id,"ct_snmp-test-engine"}, + {agent_vsns,[v1,v2,v3]}, + {agent_contexts,{data_dir_file,"context.conf"}}, + {agent_usm,{data_dir_file,"usm.conf"}}, + {agent_community,{data_dir_file,"community.conf"}}, + {agent_notify_def,{data_dir_file,"notify.conf"}}, + {agent_sysinfo,{data_dir_file,"standard.conf"}}, + {agent_target_address_def,{data_dir_file,"target_addr.conf"}}, + {agent_target_param_def,{data_dir_file,"target_params.conf"}}, + {agent_vacm,{data_dir_file,"vacm.conf"}}]}. +{snmp_app1,[{manager, [{config, [{verbosity, silence}]}, + {server,[{verbosity,silence}]}, + {net_if,[{verbosity,silence}]}, + {versions,[v2]} + ]}, + {agent, [{config, [{verbosity, silence}]}, + {net_if,[{verbosity,silence}]}, + {mib_server,[{verbosity,silence}]}, + {local_db,[{verbosity,silence}]}, + {agent_verbosity,silence} + ]}]}. +{snmp_app2,[{manager, [{config, [{verbosity, silence}]}, + {server,[{verbosity,silence}]}, + {net_if,[{verbosity,silence}]} + ]}, + {agent, [{config, [{verbosity, silence}]}, + {net_if,[{verbosity,silence}]}, + {mib_server,[{verbosity,silence}]}, + {local_db,[{verbosity,silence}]}, + {agent_verbosity,silence} + ]}]}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl new file mode 100644 index 0000000000..16b2b5690c --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl @@ -0,0 +1,395 @@ +%%-------------------------------------------------------------------- +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +%%---------------------------------------------------------------------- +%% File: ct_snmp_SUITE.erl +%% +%% Description: +%% This file contains the test cases for the ct_snmp API. +%% +%% @author Support +%% @doc Test of SNMP support in common_test +%% @end +%%---------------------------------------------------------------------- +%%---------------------------------------------------------------------- +-module(snmp_SUITE). +-include_lib("common_test/include/ct.hrl"). +-include_lib("snmp/include/STANDARD-MIB.hrl"). +-include_lib("snmp/include/SNMP-USER-BASED-SM-MIB.hrl"). +-include_lib("snmp/include/snmp_types.hrl"). + +-compile(export_all). + +%% Default timetrap timeout (set in init_per_testcase). +-define(default_timeout, ?t:minutes(1)). + +-define(AGENT_UDP, 4000). + +suite() -> + [ + {require, snmp1, snmp1}, + {require, snmp_app1, snmp_app1}, + {require, snmp2, snmp2}, + {require, snmp_app2, snmp_app2}, + {require, snmp3, snmp3} + ]. + +all() -> + [start_stop, + {group,get_set}, + {group,register}, + {group,override}, + set_info]. + + +groups() -> + [{get_set,[get_values, + get_next_values, + set_values, + load_mibs]}, + {register,[register_users, + register_users_fail, + register_agents, + register_agents_fail, + register_usm_users, + register_usm_users_fail]}, + {override,[override_usm, + override_standard, + override_context, + override_community, + override_notify, + override_target_addr, + override_target_params, + override_vacm]}]. + +init_per_suite(Config) -> + Config. + +end_per_suite(Config) -> + Config. + +init_per_group(get_set, Config) -> + ok = ct_snmp:start(Config,snmp1,snmp_app1), + Config; +init_per_group(register, Config) -> + ok = ct_snmp:start(Config,snmp2,snmp_app2), + Config; +init_per_group(_, Config) -> + ok = ct_snmp:start(Config,snmp3,snmp_app2), + Config. + +end_per_group(_Group, Config) -> + catch ct_snmp:stop(Config), + Config. + +init_per_testcase(_Case, Config) -> + Dog = test_server:timetrap(?default_timeout), + [{watchdog, Dog}|Config]. + +end_per_testcase(Case, Config) -> + try apply(?MODULE,Case,[cleanup,Config]) + catch error:undef -> ok + end, + Dog=?config(watchdog, Config), + test_server:timetrap_cancel(Dog), + ok. + +%%%----------------------------------------------------------------- +%%% Test cases +break(_Config) -> + test_server:break(""), + ok. + +start_stop(Config) -> + ok = ct_snmp:start(Config,snmp1,snmp_app1), + timer:sleep(1000), + {snmp,_,_} = lists:keyfind(snmp,1,application:which_applications()), + [_|_] = filelib:wildcard("*/*.conf",?config(priv_dir,Config)), + + ok = ct_snmp:stop(Config), + timer:sleep(1000), + false = lists:keyfind(snmp,1,application:which_applications()), + [] = filelib:wildcard("*/*.conf",?config(priv_dir,Config)), + ok. + +get_values(_Config) -> + Oids1 = [?sysDescr_instance, ?sysName_instance], + {noError,_,V1} = ct_snmp:get_values(agent_name,Oids1,snmp1), + [#varbind{oid=?sysDescr_instance,value="Erlang SNMP agent"}, + #varbind{oid=?sysName_instance,value="ct_test"}] = V1, + ok. + +get_next_values(_Config) -> + Oids2 = [?system], + {noError,_,V2} = ct_snmp:get_next_values(agent_name,Oids2,snmp1), + [#varbind{oid=?sysDescr_instance,value="Erlang SNMP agent"}] = V2, + ok. + +set_values(Config) -> + Oid3 = ?sysName_instance, + NewName = "ct_test changed by " ++ atom_to_list(?MODULE), + VarsAndVals = [{Oid3,s,NewName}], + {noError,_,_} = + ct_snmp:set_values(agent_name,VarsAndVals,snmp1,Config), + + Oids4 = [?sysName_instance], + {noError,_,V4} = ct_snmp:get_values(agent_name,Oids4,snmp1), + [#varbind{oid=?sysName_instance,value=NewName}] = V4, + + ok. + +load_mibs(_Config) -> + [{'SNMPv2-MIB',_}=SnmpV2Mib] = snmpa:which_mibs(), + Mib = filename:join([code:priv_dir(snmp),"mibs","SNMP-USER-BASED-SM-MIB"]), + ok = ct_snmp:load_mibs([Mib]), + TwoMibs = [_,_] = snmpa:which_mibs(), + [{'SNMP-USER-BASED-SM-MIB',_}] = lists:delete(SnmpV2Mib,TwoMibs), + ok = ct_snmp:unload_mibs([Mib]), + [{'SNMPv2-MIB',_}] = snmpa:which_mibs(), + ok. + + +register_users(_Config) -> + [] = snmpm:which_users(), + ok = ct_snmp:register_users(snmp2,[{reg_user1,[snmpm_user_default,[]]}]), + [_] = snmpm:which_users(), + [_] = ct:get_config({snmp2,users}), + ok = ct_snmp:register_users(snmp2,[{reg_user2,[snmpm_user_default,[]]}]), + [_,_] = snmpm:which_users(), + [_,_] = ct:get_config({snmp2,users}), + ok = ct_snmp:register_users(snmp2,[{reg_user3,[snmpm_user_default,[]]}]), + [_,_,_] = snmpm:which_users(), + [_,_,_] = ct:get_config({snmp2,users}), + ok = ct_snmp:unregister_users(snmp2,[reg_user3]), + [_,_] = snmpm:which_users(), + [_,_] = ct:get_config({snmp2,users}), + ok = ct_snmp:unregister_users(snmp2), + [] = snmpm:which_users(), + [] = ct:get_config({snmp2,users}), + ok. +register_users(cleanup,_Config) -> + ct_snmp:unregister_users(snmp2). + +register_users_fail(_Config) -> + [] = snmpm:which_users(), + {error,_} = ct_snmp:register_users(snmp2,[{reg_user3,[unknown_module,[]]}]), + [] = snmpm:which_users(), + ok. +register_users_fail(cleanup,_Config) -> + ct_snmp:unregister_users(snmp2). + +register_agents(_Config) -> + {ok, HostName} = inet:gethostname(), + {ok, Addr} = inet:getaddr(HostName, inet), + + [] = snmpm:which_agents(), + ok = ct_snmp:register_users(snmp2,[{reg_user1,[snmpm_user_default,[]]}]), + ok = ct_snmp:register_agents(snmp2,[{reg_agent1, + [reg_user1,Addr,?AGENT_UDP,[]]}]), + [_] = snmpm:which_agents(), + [_] = ct:get_config({snmp2,managed_agents}), + ok = ct_snmp:register_agents(snmp2,[{reg_agent2, + [reg_user1,Addr,?AGENT_UDP,[]]}]), + [_,_] = snmpm:which_agents(), + [_,_] = ct:get_config({snmp2,managed_agents}), + + ok = ct_snmp:register_agents(snmp2,[{reg_agent3, + [reg_user1,Addr,?AGENT_UDP,[]]}]), + [_,_,_] = snmpm:which_agents(), + [_,_,_] = ct:get_config({snmp2,managed_agents}), + + ok = ct_snmp:unregister_agents(snmp2,[reg_agent3]), + [_,_] = snmpm:which_agents(), + [_,_] = ct:get_config({snmp2,managed_agents}), + + ok = ct_snmp:unregister_agents(snmp2), + ok = ct_snmp:unregister_users(snmp2), + [] = snmpm:which_agents(), + [] = ct:get_config({snmp2,managed_agents}), + ok. +register_agents(cleanup,_Config) -> + ct_snmp:unregister_agents(snmp2), + ct_snmp:unregister_users(snmp2). + +register_agents_fail(_Config) -> + {ok, HostName} = inet:gethostname(), + {ok, Addr} = inet:getaddr(HostName, inet), + + [] = snmpm:which_agents(), + {error,_} + = ct_snmp:register_agents(snmp2,[{reg_agent3, + [unknown_user,Addr,?AGENT_UDP,[]]}]), + [] = snmpm:which_agents(), + ok. +register_agents_fail(cleanup,_Config) -> + ct_snmp:unregister_agents(snmp2). + +register_usm_users(_Config) -> + [] = snmpm:which_usm_users(), + ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user1",[]}]), + [_] = snmpm:which_usm_users(), + [_] = ct:get_config({snmp2,usm_users}), + ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user2",[]}]), + [_,_] = snmpm:which_usm_users(), + [_,_] = ct:get_config({snmp2,usm_users}), + ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user3",[]}]), + [_,_,_] = snmpm:which_usm_users(), + [_,_,_] = ct:get_config({snmp2,usm_users}), + ok = ct_snmp:unregister_usm_users(snmp2,["reg_usm_user3"]), + [_,_] = snmpm:which_usm_users(), + [_,_] = ct:get_config({snmp2,usm_users}), + ok = ct_snmp:unregister_usm_users(snmp2), + [] = snmpm:which_usm_users(), + [] = ct:get_config({snmp2,usm_users}), + ok. +register_usm_users(cleanup,_Config) -> + ct_snmp:unregister_usm_users(snmp2). + +register_usm_users_fail(_Config) -> + [] = snmpm:which_usm_users(), + {error,_} + = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user3", + [{sec_name,invalid_data_type}]}]), + [] = snmpm:which_usm_users(), + ok. +register_usm_users_fail(cleanup,_Config) -> + ct_snmp:unregister_usm_users(snmp2). + +%% Test that functionality for overriding default configuration file +%% works - i.e. that the files are written and that the configuration +%% is actually used. +%% +%% Note that the config files used in this test case do not +%% necessarily make up a reasonable configuration for the snmp +%% application... +override_usm(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + Mib = filename:join([code:priv_dir(snmp),"mibs","SNMP-USER-BASED-SM-MIB"]), + ok = ct_snmp:load_mibs([Mib]), + + %% Check that usm.conf is overwritten + {ok,MyUsm} = snmpa_conf:read_usm_config(DataDir), + {ok,UsedUsm} = snmpa_conf:read_usm_config(ConfDir), + true = (MyUsm == UsedUsm), + + %% Check that the usm user is actually configured... + [{Index,"secname"}] = + snmp_user_based_sm_mib:usmUserTable(get_next,?usmUserEntry,[3]), + true = lists:suffix("usm_user_name",Index), + ok. + +override_standard(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that standard.conf is overwritten + {ok,MyStandard} = snmpa_conf:read_standard_config(DataDir), + {ok,UsedStandard} = snmpa_conf:read_standard_config(ConfDir), + true = (MyStandard == UsedStandard), + + %% Check that the values from standard.conf is actually configured... + {value,"name for override test"} = snmp_standard_mib:sysName(get), + {value,"agent for ct_snmp override test"} = snmp_standard_mib:sysDescr(get), + ok. + +override_context(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that context.conf is overwritten + {ok,MyContext} = snmpa_conf:read_context_config(DataDir), + {ok,UsedContext} = snmpa_conf:read_context_config(ConfDir), + true = (MyContext == UsedContext), + ok. + +override_community(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that community.conf is overwritten + {ok,MyCommunity} = snmpa_conf:read_community_config(DataDir), + {ok,UsedCommunity} = snmpa_conf:read_community_config(ConfDir), + true = (MyCommunity == UsedCommunity), + ok. + +override_notify(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that notify.conf is overwritten + {ok,MyNotify} = snmpa_conf:read_notify_config(DataDir), + {ok,UsedNotify} = snmpa_conf:read_notify_config(ConfDir), + true = (MyNotify == UsedNotify), + ok. + +override_target_addr(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that target_addr.conf is overwritten + {ok,MyTargetAddr} = snmpa_conf:read_target_addr_config(DataDir), + {ok,UsedTargetAddr} = snmpa_conf:read_target_addr_config(ConfDir), + true = (MyTargetAddr == UsedTargetAddr), + ok. + +override_target_params(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that target_params.conf is overwritten + {ok,MyTargetParams} = snmpa_conf:read_target_params_config(DataDir), + {ok,UsedTargetParams} = snmpa_conf:read_target_params_config(ConfDir), + true = (MyTargetParams == UsedTargetParams), + ok. + +override_vacm(Config) -> + DataDir = ?config(data_dir,Config), + PrivDir = ?config(priv_dir,Config), + ConfDir = filename:join(PrivDir,"conf"), + + %% Check that vacm.conf is overwritten + {ok,MyVacm} = snmpa_conf:read_vacm_config(DataDir), + {ok,UsedVacm} = snmpa_conf:read_vacm_config(ConfDir), + true = (MyVacm == UsedVacm), + ok. + + + + +%% NOTE!! This test must always be executed last in the suite, and +%% should match all set requests performed in the suite. I.e. if you +%% add a set request, you must add an entry in the return value of +%% ct_snmp:set_info/1 below. +set_info(Config) -> + %% From test case set_values/1: + Oid1 = ?sysName_instance, + NewValue1 = "ct_test changed by " ++ atom_to_list(?MODULE), + + %% The test... + [{_AgentName,_,[{Oid1,_,NewValue1}]}] + = ct_snmp:set_info(Config), + ok. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf new file mode 100644 index 0000000000..5a64df6605 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf @@ -0,0 +1 @@ +{"public", "public", "initial", "", ""}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf new file mode 100644 index 0000000000..feed5e1d11 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf @@ -0,0 +1 @@ +"testcontext". diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf new file mode 100644 index 0000000000..367ba3aa4b --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf @@ -0,0 +1 @@ +{"standard inform", "std_inform", inform}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf new file mode 100644 index 0000000000..79908fb355 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf @@ -0,0 +1,7 @@ +{sysDescr, "agent for ct_snmp override test"}. +{sysObjectID, [1,2,3]}. +{sysContact, "[email protected]"}. +{sysLocation, "erlang"}. +{sysServices, 72}. +{snmpEnableAuthenTraps, enabled}. +{sysName, "name for override test"}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf new file mode 100644 index 0000000000..d02672a074 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf @@ -0,0 +1,2 @@ +{"target1", snmpUDPDomain, [147,214,122,73], 5000, 1500, 3, "std_trap", "target_v3", "", [], 2048}. +{"target2", snmpUDPDomain, [147,214,122,73], 5000, 1500, 3, "std_inform", "target_v3", "", [], 2048}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf new file mode 100644 index 0000000000..5a9a619422 --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf @@ -0,0 +1 @@ +{"target_v3", v3, usm, "initial", noAuthNoPriv}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf new file mode 100644 index 0000000000..d6e245914e --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf @@ -0,0 +1 @@ +{"ct_snmp-test-engine","usm_user_name","secname",zeroDotZero,usmNoAuthProtocol,"","",usmNoPrivProtocol,"","","","",""}. diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf new file mode 100644 index 0000000000..158fe02e3b --- /dev/null +++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf @@ -0,0 +1,6 @@ +{vacmSecurityToGroup, usm, "initial", "initial"}. +{vacmAccess, "initial", "", any, noAuthNoPriv, exact, "restricted", "", "restricted"}. +{vacmAccess, "initial", "", usm, authNoPriv, exact, "internet", "internet", "internet"}. +{vacmAccess, "initial", "", usm, authPriv, exact, "internet", "internet", "internet"}. +{vacmViewTreeFamily, "restricted", [1,3,6,1], included, null}. +{vacmViewTreeFamily, "internet", [1,3,6,1], included, null}. diff --git a/lib/common_test/test/ct_surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE.erl new file mode 100644 index 0000000000..b86b47f0a2 --- /dev/null +++ b/lib/common_test/test/ct_surefire_SUITE.erl @@ -0,0 +1,374 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_surefire_SUITE +%%% +%%% Description: +%%% Test cth_surefire hook +%%% +%%%------------------------------------------------------------------- +-module(ct_surefire_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-include_lib("xmerl/include/xmerl.hrl"). +-include_lib("kernel/include/file.hrl"). + +-define(eh, ct_test_support_eh). + +-define(url_base,"http://my.host.com/"). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config1 = ct_test_support:init_per_suite(Config), + Config1. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [ + default, + absolute_path, + relative_path, + url, + logdir + ]. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%%%----------------------------------------------------------------- +%%% +default(Config) when is_list(Config) -> + run(default,[cth_surefire],"junit_report.xml",Config). + +absolute_path(Config) when is_list(Config) -> + PrivDir = ?config(priv_dir,Config), + Path = filename:join(PrivDir,"abspath.xml"), + run(absolute_path,[{cth_surefire,[{path,Path}]}],Path,Config). + +relative_path(Config) when is_list(Config) -> + Path = "relpath.xml", + run(relative_path,[{cth_surefire,[{path,Path}]}],Path,Config). + +url(Config) when is_list(Config) -> + Path = "url.xml", + run(url,[{cth_surefire,[{url_base,?url_base},{path,Path}]}], + Path,Config). + +logdir(Config) when is_list(Config) -> + Opts = ct_test_support:get_opts(Config), + LogDir = + case lists:keyfind(logdir,1,Opts) of + {logdir,LD} -> LD; + false -> ?config(priv_dir,Config) + end, + MyLogDir = filename:join(LogDir,"specific_logdir"), + ensure_exists_empty(MyLogDir), + Path = "logdir.xml", + run(logdir,[{cth_surefire,[{path,Path}]}],Path,Config,[{logdir,MyLogDir}]). + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- +run(Case,CTHs,Report,Config) -> + run(Case,CTHs,Report,Config,[]). +run(Case,CTHs,Report,Config,ExtraOpts) -> + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "surefire_SUITE"), + {Opts,ERPid} = setup([{suite,Suite},{ct_hooks,CTHs},{label,Case}|ExtraOpts], + Config), + ok = execute(Case, Opts, ERPid, Config), + LogDir = + case lists:keyfind(logdir,1,Opts) of + {logdir,LD} -> LD; + false -> ?config(priv_dir,Config) + end, + Re = filename:join([LogDir,"*",Report]), + check_xml(Case,Re). + +setup(Test, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Opts1 = + case lists:keymember(logdir,1,Test) of + true -> lists:keydelete(logdir,1,Opts0); + false -> Opts0 + end, + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts1 ++ [{event_handler,{?eh,EvHArgs}}|Test], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +execute(Name, Opts, ERPid, Config) -> + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(Name, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(Name), + ct_test_support:verify_events(TestEvents, Events, Config). + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). + +%%%----------------------------------------------------------------- +%%% TEST EVENTS +%%%----------------------------------------------------------------- +events_to_check(Test) -> + %% 2 tests (ct:run_test + script_start) is default + events_to_check(Test, 2). + +events_to_check(_, 0) -> + []; +events_to_check(Test, N) -> + test_events(Test) ++ events_to_check(Test, N-1). + +test_events(_) -> + [{?eh,start_logging,'_'}, + {?eh,start_info,{1,1,9}}, + {?eh,tc_start,{surefire_SUITE,init_per_suite}}, + {?eh,tc_done,{surefire_SUITE,init_per_suite,ok}}, + {?eh,tc_start,{surefire_SUITE,tc_ok}}, + {?eh,tc_done,{surefire_SUITE,tc_ok,ok}}, + {?eh,test_stats,{1,0,{0,0}}}, + {?eh,tc_start,{surefire_SUITE,tc_fail}}, + {?eh,tc_done,{surefire_SUITE,tc_fail, + {failed,{error,{test_case_failed,"this test should fail"}}}}}, + {?eh,test_stats,{1,1,{0,0}}}, + {?eh,tc_start,{surefire_SUITE,tc_skip}}, + {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}}, + {?eh,test_stats,{1,1,{1,0}}}, + {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}}, + {?eh,tc_done,{surefire_SUITE,tc_autoskip_require, + {skipped,{require_failed,'_'}}}}, + {?eh,test_stats,{1,1,{1,1}}}, + [{?eh,tc_start,{surefire_SUITE,{init_per_group,g,[]}}}, + {?eh,tc_done,{surefire_SUITE,{init_per_group,g,[]},ok}}, + {?eh,tc_start,{surefire_SUITE,tc_ok}}, + {?eh,tc_done,{surefire_SUITE,tc_ok,ok}}, + {?eh,test_stats,{2,1,{1,1}}}, + {?eh,tc_start,{surefire_SUITE,tc_fail}}, + {?eh,tc_done,{surefire_SUITE,tc_fail, + {failed,{error,{test_case_failed,"this test should fail"}}}}}, + {?eh,test_stats,{2,2,{1,1}}}, + {?eh,tc_start,{surefire_SUITE,tc_skip}}, + {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}}, + {?eh,test_stats,{2,2,{2,1}}}, + {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}}, + {?eh,tc_done,{surefire_SUITE,tc_autoskip_require, + {skipped,{require_failed,'_'}}}}, + {?eh,test_stats,{2,2,{2,2}}}, + {?eh,tc_start,{surefire_SUITE,{end_per_group,g,[]}}}, + {?eh,tc_done,{surefire_SUITE,{end_per_group,g,[]},ok}}], + [{?eh,tc_start,{surefire_SUITE,{init_per_group,g_fail,[]}}}, + {?eh,tc_done,{surefire_SUITE,{init_per_group,g_fail,[]}, + {failed,{error,all_cases_should_be_skipped}}}}, + {?eh,tc_auto_skip,{surefire_SUITE,tc_ok, + {failed, + {surefire_SUITE,init_per_group, + {'EXIT',all_cases_should_be_skipped}}}}}, + {?eh,test_stats,{2,2,{2,3}}}, + {?eh,tc_auto_skip,{surefire_SUITE,end_per_group, + {failed, + {surefire_SUITE,init_per_group, + {'EXIT',all_cases_should_be_skipped}}}}}], + {?eh,tc_start,{surefire_SUITE,end_per_suite}}, + {?eh,tc_done,{surefire_SUITE,end_per_suite,ok}}, + {?eh,stop_logging,[]}]. + + +%%%----------------------------------------------------------------- +%%% Check generated xml log files +check_xml(Case,XmlRe) -> + case filelib:wildcard(XmlRe) of + [] -> + ct:fail("No xml files found with regexp ~p~n", [XmlRe]); + [_] = Xmls when Case==absolute_path -> + do_check_xml(Case,Xmls); + [_,_] = Xmls -> + do_check_xml(Case,Xmls) + end. + +%% Allowed structure: +%% <testsuites> +%% <testsuite> +%% <properties> +%% <property/> +%% ... +%% </properties> +%% <testcase> +%% [<failure/> | <error/> | <skipped/> ] +%% </testcase> +%% ... +%% </testsuite> +%% ... +%% </testsuites> +do_check_xml(Case,[Xml|Xmls]) -> + ct:log("Checking <a href=~p>~s</a>~n",[Xml,Xml]), + {E,_} = xmerl_scan:file(Xml), + Expected = events_to_result(lists:flatten(test_events(Case))), + ParseResult = testsuites(Case,E), + ct:log("Expecting: ~p~n",[[Expected]]), + ct:log("Actual : ~p~n",[ParseResult]), + [Expected] = ParseResult, + do_check_xml(Case,Xmls); +do_check_xml(_,[]) -> + ok. + +%% Scanning the XML to get the same type of result as events_to_result/1 +testsuites(Case,#xmlElement{name=testsuites,content=TS}) -> + %% OTP-10589 - move properties element to <testsuite> + false = lists:keytake(properties,#xmlElement.name,TS), + testsuite(Case,TS). + +testsuite(Case,[#xmlElement{name=testsuite,content=TC,attributes=A}|TS]) -> + {ET,EF,ES} = events_to_numbers(lists:flatten(test_events(Case))), + {T,E,F,S} = get_numbers_from_attrs(A,false,false,false,false), + ct:log("Expecting total:~p, error:~p, failure:~p, skipped:~p~n",[ET,0,EF,ES]), + ct:log("Actual total:~p, error:~p, failure:~p, skipped:~p~n",[T,E,F,S]), + {ET,0,EF,ES} = {T,E,F,S}, + + %% properties should only be there if given a options to hook + false = lists:keytake(properties,#xmlElement.name,TC), + %% system-out and system-err is not used by common_test + false = lists:keytake('system-out',#xmlElement.name,TC), + false = lists:keytake('system-err',#xmlElement.name,TC), + R=testcase(Case,TC), + [R|testsuite(Case,TS)]; +testsuite(_Case,[]) -> + []. + +testcase(url=Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) -> + R = failed_or_skipped(C), + case R of + [s] -> + case lists:keyfind(url,#xmlAttribute.name,A) of + false -> ok; + #xmlAttribute{value=UrlAttr} -> + lists:keyfind(url,#xmlAttribute.name,A), + true = lists:prefix(?url_base,UrlAttr) + end; + _ -> + #xmlAttribute{value=UrlAttr} = + lists:keyfind(url,#xmlAttribute.name,A), + true = lists:prefix(?url_base,UrlAttr) + end, + [R|testcase(Case,TC)]; +testcase(Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) -> + false = lists:keyfind(url,#xmlAttribute.name,A), + R = failed_or_skipped(C), + [R|testcase(Case,TC)]; +testcase(_Case,[]) -> + []. + +failed_or_skipped([#xmlElement{name=failure}|E]) -> + [f|failed_or_skipped(E)]; +failed_or_skipped([#xmlElement{name=error}|E]) -> + [e|failed_or_skipped(E)]; +failed_or_skipped([#xmlElement{name=skipped}|E]) -> + [s|failed_or_skipped(E)]; +failed_or_skipped([]) -> + []. + +%% Using the expected events to produce the expected result of the XML scanning. +%% The result is a list of test suites: +%% Testsuites = [Testsuite] +%% Testsuite = [Testcase] +%% Testcase = [] | [f] | [s], indicating ok, failed and skipped respectively +events_to_result([{?eh,tc_done,{_Suite,_Case,R}}|E]) -> + [result(R)|events_to_result(E)]; +events_to_result([{?eh,tc_auto_skip,_}|E]) -> + [[s]|events_to_result(E)]; +events_to_result([_|E]) -> + events_to_result(E); +events_to_result([]) -> + []. + +result(ok) ->[]; +result({skipped,_}) -> [s]; +result({failed,_}) -> [f]. + +%% Using the expected events' last test_stats element to produce the +%% expected number of totla, errors, failed and skipped testcases. +events_to_numbers(E) -> + RevE = lists:reverse(E), + {?eh,test_stats,{Ok,F,{US,AS}}} = lists:keyfind(test_stats,2,RevE), + {Ok+F+US+AS,F,US+AS}. + +get_numbers_from_attrs([#xmlAttribute{name=tests,value=X}|A],false,E,F,S) -> + get_numbers_from_attrs(A,list_to_integer(X),E,F,S); +get_numbers_from_attrs([#xmlAttribute{name=errors,value=X}|A],T,false,F,S) -> + get_numbers_from_attrs(A,T,list_to_integer(X),F,S); +get_numbers_from_attrs([#xmlAttribute{name=failures,value=X}|A],T,E,false,S) -> + get_numbers_from_attrs(A,T,E,list_to_integer(X),S); +get_numbers_from_attrs([#xmlAttribute{name=skipped,value=X}|A],T,E,F,false) -> + get_numbers_from_attrs(A,T,E,F,list_to_integer(X)); +get_numbers_from_attrs([_|A],T,E,F,S) -> + get_numbers_from_attrs(A,T,E,F,S); +get_numbers_from_attrs([],T,E,F,S) -> + {T,E,F,S}. + +ensure_exists_empty(Dir) -> + case file:list_dir(Dir) of + {error,enoent} -> + file:make_dir(Dir); + {ok,Files} -> + del_files(Dir,Files) + end. + +del_files(Dir,[F0|Fs] ) -> + F = filename:join(Dir,F0), + case file:read_file_info(F) of + {ok,#file_info{type=directory}} -> + {ok,Files} = file:list_dir(F), + del_files(F,Files), + file:del_dir(F), + del_files(Dir,Fs); + _ -> + file:delete(F), + del_files(Dir,Fs) + end; +del_files(_,[]) -> + ok. diff --git a/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl new file mode 100644 index 0000000000..677aee46c5 --- /dev/null +++ b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl @@ -0,0 +1,92 @@ +%%-------------------------------------------------------------------- +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +%%---------------------------------------------------------------------- +%% File: surefire_SUITE.erl +%% +%% Description: +%% This file contains the test cases for cth_surefire. +%% +%% @author Support +%% @doc Test of surefire support in common_test +%% @end +%%---------------------------------------------------------------------- +%%---------------------------------------------------------------------- +-module(surefire_SUITE). +-include_lib("common_test/include/ct.hrl"). + +-compile(export_all). + +%% Default timetrap timeout (set in init_per_testcase). +-define(default_timeout, ?t:minutes(1)). + +all() -> + testcases() ++ [{group,g},{group,g_fail}]. + +groups() -> + [{g,testcases()}, + {g_fail,[tc_ok]}]. + +testcases() -> + [tc_ok, + tc_fail, + tc_skip, + tc_autoskip_require]. + +init_per_suite(Config) -> + Config. + +end_per_suite(Config) -> + Config. + +init_per_group(g_fail, _Config) -> + exit(all_cases_should_be_skipped); +init_per_group(_, Config) -> + Config. + +end_per_group(_Group, Config) -> + Config. + +init_per_testcase(_Case, Config) -> + Dog = test_server:timetrap(?default_timeout), + [{watchdog, Dog}|Config]. + +end_per_testcase(_Case, Config) -> + Dog=?config(watchdog, Config), + test_server:timetrap_cancel(Dog), + ok. + +%%%----------------------------------------------------------------- +%%% Test cases +break(_Config) -> + test_server:break(""), + ok. + +tc_ok(_Config) -> + ok. + +tc_fail(_Config) -> + ct:fail("this test should fail"). + +tc_skip(_Config) -> + {skip,"this test is skipped"}. + +tc_autoskip_require() -> + [{require,whatever}]. +tc_autoskip_require(Config) -> + ct:fail("this test should never be executed - it should be autoskipped"). diff --git a/lib/common_test/test/ct_system_error_SUITE.erl b/lib/common_test/test/ct_system_error_SUITE.erl new file mode 100644 index 0000000000..f2d6ef4b1b --- /dev/null +++ b/lib/common_test/test/ct_system_error_SUITE.erl @@ -0,0 +1,132 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_system_error_SUITE +%%% +%%% Description: +%%% +%%% Test that severe system errors (such as failure to write logs) are +%%% noticed and handled. +%%%------------------------------------------------------------------- +-module(ct_system_error_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-define(eh, ct_test_support_eh). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config1 = ct_test_support:init_per_suite(Config), + Config1. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [ + test_server_failing_logs + ]. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%%%----------------------------------------------------------------- +%%% +test_server_failing_logs(Config) -> + TC = test_server_failing_logs, + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "a_SUITE"), + {Opts,ERPid} = setup([{suite,Suite},{label,TC}], Config), + crash_test_server(Config), + {error,{cannot_create_log_dir,__}} = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + ct_test_support:log_events(TC, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(TC), + ok = ct_test_support:verify_events(TestEvents, Events, Config). + +crash_test_server(Config) -> + DataDir = ?config(data_dir, Config), + Root = proplists:get_value(logdir, ct_test_support:get_opts(Config)), + [$@|Host] = lists:dropwhile(fun(C) -> + C =/= $@ + end, atom_to_list(node())), + Format = filename:join(Root, + "ct_run.ct@" ++ Host ++ + ".~4..0w-~2..0w-~2..0w_" + "~2..0w.~2..0w.~2..0w"), + [C2,C1|_] = lists:reverse(filename:split(DataDir)), + LogDir = C1 ++ "." ++ C2 ++ ".a_SUITE.logs", + T = calendar:datetime_to_gregorian_seconds(calendar:local_time()), + [begin + {{Y,Mon,D},{H,Min,S}} = + calendar:gregorian_seconds_to_datetime(T+Offset), + Dir0 = io_lib:format(Format, [Y,Mon,D,H,Min,S]), + Dir = lists:flatten(Dir0), + file:make_dir(Dir), + File = filename:join(Dir, LogDir), + file:write_file(File, "anything goes\n") + end || Offset <- lists:seq(0, 20)], + ok. + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- + +setup(Test, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). + +%%%----------------------------------------------------------------- +%%% TEST EVENTS +%%%----------------------------------------------------------------- + +events_to_check(_Test) -> + [{?eh,severe_error,{cannot_create_log_dir,{'_','_'}}}]. diff --git a/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl b/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl new file mode 100644 index 0000000000..c6e3ddfd5d --- /dev/null +++ b/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl @@ -0,0 +1,122 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +-module(a_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{timetrap,{seconds,10}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + []. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [tc1]. + +tc1(_C) -> + ok. diff --git a/lib/common_test/test/ct_test_support.erl b/lib/common_test/test/ct_test_support.erl index 80cca4a1cc..5e109e98e9 100644 --- a/lib/common_test/test/ct_test_support.erl +++ b/lib/common_test/test/ct_test_support.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2008-2012. All Rights Reserved. +%% Copyright Ericsson AB 2008-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -32,7 +32,7 @@ run/2, run/3, run/4, get_opts/1, wait_for_ct_stop/1]). -export([handle_event/2, start_event_receiver/1, get_events/2, - verify_events/3, reformat/2, log_events/4, + verify_events/3, verify_events/4, reformat/2, log_events/4, join_abs_dirs/2]). -export([ct_test_halt/1]). @@ -117,8 +117,7 @@ end_per_suite(Config) -> CTNode = proplists:get_value(ct_node, Config), PrivDir = proplists:get_value(priv_dir, Config), true = rpc:call(CTNode, code, del_path, [filename:join(PrivDir,"")]), - cover:stop(CTNode), - slave:stop(CTNode), + slave_stop(CTNode), ok. %%%----------------------------------------------------------------- @@ -149,8 +148,7 @@ end_per_testcase(_TestCase, Config) -> case wait_for_ct_stop(CTNode) of %% Common test was not stopped to we restart node. false -> - cover:stop(CTNode), - slave:stop(CTNode), + slave_stop(CTNode), start_slave(Config,proplists:get_value(trace_level,Config)), {fail, "Could not stop common_test"}; true -> @@ -314,8 +312,10 @@ wait_for_ct_stop(Retries, CTNode) -> undefined -> true; Pid -> + Info = (catch process_info(Pid)), test_server:format(0, "Waiting for CT (~p) to finish (~p)...", [Pid,Retries]), + test_server:format(0, "Process info for ~p:~n~p", [Info]), timer:sleep(5000), wait_for_ct_stop(Retries-1, CTNode) end. @@ -330,12 +330,17 @@ handle_event(EH, Event) -> start_event_receiver(Config) -> CTNode = proplists:get_value(ct_node, Config), - spawn_link(CTNode, fun() -> er() end). + Level = proplists:get_value(trace_level, Config), + ER = spawn_link(CTNode, fun() -> er() end), + test_server:format(Level, "~nEvent receiver ~w started!~n", [ER]), + ER. get_events(_, Config) -> CTNode = proplists:get_value(ct_node, Config), + Level = proplists:get_value(trace_level, Config), {event_receiver,CTNode} ! {self(),get_events}, Events = receive {event_receiver,Evs} -> Evs end, + test_server:format(Level, "Stopping event receiver!~n", []), {event_receiver,CTNode} ! stop, Events. @@ -364,6 +369,14 @@ verify_events(TEvs, Evs, Config) -> ok end. +verify_events(TEvs, Evs, Node, Config) -> + case catch verify_events1(TEvs, Evs, Node, Config) of + {'EXIT',Reason} -> + Reason; + _ -> + ok + end. + verify_events1([TestEv|_], [{TEH,#event{name=stop_logging,node=Node,data=_}}|_], Node, _) when element(1,TestEv) == TEH, element(2,TestEv) =/= stop_logging -> test_server:format("Failed to find ~p in the list of events!~n", [TestEv]), @@ -612,8 +625,11 @@ locate({parallel,TEvs}, Node, Evs, Config) -> fun({EH,#event{name=tc_auto_skip, node=EvNode, data={Mod,end_per_group,Reason}}}) when - EH == TEH, EvNode == Node, Mod == M, Reason == R -> - false; + EH == TEH, EvNode == Node, Mod == M -> + case match_data(R, Reason) of + match -> false; + _ -> true + end; ({EH,#event{name=stop_logging, node=EvNode,data=_}}) when EH == TEH, EvNode == Node -> @@ -627,23 +643,12 @@ locate({parallel,TEvs}, Node, Evs, Config) -> [_AutoSkip | RemEvs2] -> {Done,RemEvs2,length(RemEvs2)} end; - %% match other event than test case - (TEv={TEH,N,D}, Acc) when D == '_' -> - case [E || E={EH,#event{name=Name, - node=EvNode, - data=_}} <- Evs1, - EH == TEH, EvNode == Node, Name == N] of - [] -> - exit({unmatched,TEv}); - _ -> - test_server:format("Found ~p!", [TEv]), - Acc - end; (TEv={TEH,N,D}, Acc) -> case [E || E={EH,#event{name=Name, node=EvNode, data=Data}} <- Evs1, - EH == TEH, EvNode == Node, Name == N, Data == D] of + EH == TEH, EvNode == Node, Name == N, + match == match_data(D,Data)] of [] -> exit({unmatched,TEv}); _ -> @@ -1002,33 +1007,39 @@ locate({TEH,Name,Data}, Node, [{TEH,#event{name=Name, data = EvData, node = Node}}|Evs], Config) -> - try match_data(Data, EvData) of + case match_data(Data, EvData) of match -> - {Config,Evs} - catch _:_ -> + {Config,Evs}; + _ -> nomatch end; locate({_TEH,_Name,_Data}, _Node, [_|_Evs], _Config) -> nomatch. -match_data(D,D) -> +match_data(Data, EvData) -> + try do_match_data(Data, EvData) + catch _:_ -> + nomatch + end. + +do_match_data(D,D) -> match; -match_data('_',_) -> +do_match_data('_',_) -> match; -match_data(Fun,Data) when is_function(Fun) -> +do_match_data(Fun,Data) when is_function(Fun) -> Fun(Data); -match_data('$proplist',Proplist) -> - match_data( +do_match_data('$proplist',Proplist) -> + do_match_data( fun(List) -> lists:foreach(fun({_,_}) -> ok end,List) end,Proplist); -match_data([H1|MatchT],[H2|ValT]) -> - match_data(H1,H2), - match_data(MatchT,ValT); -match_data(Tuple1,Tuple2) when is_tuple(Tuple1),is_tuple(Tuple2) -> - match_data(tuple_to_list(Tuple1),tuple_to_list(Tuple2)); -match_data([],[]) -> +do_match_data([H1|MatchT],[H2|ValT]) -> + do_match_data(H1,H2), + do_match_data(MatchT,ValT); +do_match_data(Tuple1,Tuple2) when is_tuple(Tuple1),is_tuple(Tuple2) -> + do_match_data(tuple_to_list(Tuple1),tuple_to_list(Tuple2)); +do_match_data([],[]) -> match. result_match({SkipOrFail,{ErrorInd,{Why,'_'}}}, @@ -1039,10 +1050,13 @@ result_match({SkipOrFail,{ErrorInd,{EMod,EFunc,{Why,'_'}}}}, true; result_match({failed,{timetrap_timeout,{'$approx',Num}}}, {failed,{timetrap_timeout,Value}}) -> - if Value >= trunc(Num-0.02*Num), - Value =< trunc(Num+0.02*Num) -> true; + if Value >= trunc(Num-0.05*Num), + Value =< trunc(Num+0.05*Num) -> true; true -> false end; +result_match({user_timetrap_error,{Why,'_'}}, + {user_timetrap_error,{Why,_Stack}}) -> + true; result_match(Result, Result) -> true; result_match(_, _) -> @@ -1125,6 +1139,8 @@ reformat([{_EH,#event{name=test_start,data=_}} | Events], EH) -> [{EH,test_start,{'DEF',{'START_TIME','LOGDIR'}}} | reformat(Events, EH)]; reformat([{_EH,#event{name=test_done,data=_}} | Events], EH) -> [{EH,test_done,{'DEF','STOP_TIME'}} | reformat(Events, EH)]; +reformat([{_EH,#event{name=tc_logfile,data=_}} | Events], EH) -> + reformat(Events, EH); reformat([{_EH,#event{name=test_stats,data=Data}} | Events], EH) -> [{EH,test_stats,Data} | reformat(Events, EH)]; %% use this to only print the last test_stats event: @@ -1259,3 +1275,22 @@ rm_files([F | Fs]) -> rm_files([]) -> ok. +%%%----------------------------------------------------------------- +%%% +slave_stop(Node) -> + Cover = test_server:is_cover(), + if Cover-> cover:flush(Node); + true -> ok + end, + erlang:monitor_node(Node, true), + slave:stop(Node), + receive + {nodedown, Node} -> + if Cover -> cover:stop(Node); + true -> ok + end + after 5000 -> + erlang:monitor_node(Node, false), + receive {nodedown, Node} -> ok after 0 -> ok end %flush + end, + ok. diff --git a/lib/common_test/test/ct_testspec_1_SUITE.erl b/lib/common_test/test/ct_testspec_1_SUITE.erl index b7e19f25dd..6a4a4acd80 100644 --- a/lib/common_test/test/ct_testspec_1_SUITE.erl +++ b/lib/common_test/test/ct_testspec_1_SUITE.erl @@ -58,7 +58,7 @@ end_per_testcase(TestCase, Config) -> suite() -> [{ct_hooks,[ts_install_cth]}]. -all() -> +all() -> [all_suites, skip_all_suites, suite, skip_suite, all_testcases, skip_all_testcases, testcase, skip_testcase, all_groups, skip_all_groups, group, @@ -67,23 +67,23 @@ all() -> skip_group_testcase, topgroup, subgroup, skip_subgroup, subgroup_all_testcases, skip_subgroup_all_testcases, subgroup_testcase, skip_subgroup_testcase, - sub_skipped_by_top, testcase_in_multiple_groups, - order_of_tests_in_multiple_dirs_no_merge_tests, - order_of_tests_in_multiple_suites_no_merge_tests, - order_of_suites_in_multiple_dirs_no_merge_tests, - order_of_groups_in_multiple_dirs_no_merge_tests, - order_of_groups_in_multiple_suites_no_merge_tests, - order_of_tests_in_multiple_dirs, - order_of_tests_in_multiple_suites, - order_of_suites_in_multiple_dirs, - order_of_groups_in_multiple_dirs, - order_of_groups_in_multiple_suites, - order_of_tests_in_multiple_suites_with_skip_no_merge_tests, - order_of_tests_in_multiple_suites_with_skip, + sub_skipped_by_top, testcase_many_groups, + order_of_tests_many_dirs_no_merge_tests, + order_of_tests_many_suites_no_merge_tests, + order_of_suites_many_dirs_no_merge_tests, + order_of_groups_many_dirs_no_merge_tests, + order_of_groups_many_suites_no_merge_tests, + order_of_tests_many_dirs, + order_of_tests_many_suites, + order_of_suites_many_dirs, + order_of_groups_many_dirs, + order_of_groups_many_suites, + order_of_tests_many_suites_with_skip_no_merge_tests, + order_of_tests_many_suites_with_skip, all_plus_one_tc_no_merge_tests, all_plus_one_tc]. -groups() -> +groups() -> []. init_per_group(_GroupName, Config) -> @@ -373,19 +373,19 @@ sub_skipped_by_top(Config) when is_list(Config) -> %%%----------------------------------------------------------------- %%% -testcase_in_multiple_groups(Config) when is_list(Config) -> +testcase_many_groups(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir = filename:join(DataDir, "groups_1"), TestSpec = [{cases,TestDir,groups_12_SUITE,[testcase_1a,testcase_1b]}, {skip_cases,TestDir,groups_12_SUITE,[testcase_1b],"SKIPPED!"}], - setup_and_execute(testcase_in_multiple_groups, TestSpec, Config). + setup_and_execute(testcase_many_groups, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_tests_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) -> +order_of_tests_many_dirs_no_merge_tests(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -395,13 +395,13 @@ order_of_tests_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) -> {cases,TestDir2,groups_22_SUITE,[testcase_1]}, {cases,TestDir1,groups_12_SUITE,[testcase_1b]}], - setup_and_execute(order_of_tests_in_multiple_dirs_no_merge_tests, + setup_and_execute(order_of_tests_many_dirs_no_merge_tests, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_tests_in_multiple_suites_no_merge_tests(Config) when is_list(Config) -> +order_of_tests_many_suites_no_merge_tests(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -410,13 +410,13 @@ order_of_tests_in_multiple_suites_no_merge_tests(Config) when is_list(Config) -> {cases,TestDir1,groups_11_SUITE,[testcase_1]}, {cases,TestDir1,groups_12_SUITE,[testcase_1b]}], - setup_and_execute(order_of_tests_in_multiple_suites_no_merge_tests, + setup_and_execute(order_of_tests_many_suites_no_merge_tests, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_suites_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) -> +order_of_suites_many_dirs_no_merge_tests(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -426,13 +426,13 @@ order_of_suites_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) -> {suites,TestDir2,groups_22_SUITE}, {suites,TestDir1,groups_11_SUITE}], - setup_and_execute(order_of_suites_in_multiple_dirs_no_merge_tests, + setup_and_execute(order_of_suites_many_dirs_no_merge_tests, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_groups_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) -> +order_of_groups_many_dirs_no_merge_tests(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -442,13 +442,13 @@ order_of_groups_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) -> {groups,TestDir2,groups_22_SUITE,test_group_1a}, {groups,TestDir1,groups_12_SUITE,test_group_1b}], - setup_and_execute(order_of_groups_in_multiple_dirs_no_merge_tests, + setup_and_execute(order_of_groups_many_dirs_no_merge_tests, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_groups_in_multiple_suites_no_merge_tests(Config) +order_of_groups_many_suites_no_merge_tests(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), @@ -458,13 +458,13 @@ order_of_groups_in_multiple_suites_no_merge_tests(Config) {groups,TestDir1,groups_11_SUITE,test_group_1a}, {groups,TestDir1,groups_12_SUITE,test_group_1b}], - setup_and_execute(order_of_groups_in_multiple_suites_no_merge_tests, + setup_and_execute(order_of_groups_many_suites_no_merge_tests, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_tests_in_multiple_suites_with_skip_no_merge_tests(Config) +order_of_tests_many_suites_with_skip_no_merge_tests(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), @@ -477,14 +477,14 @@ order_of_tests_in_multiple_suites_with_skip_no_merge_tests(Config) {skip_cases,TestDir1,groups_12_SUITE,[testcase_1b],"Skip it"}], setup_and_execute( - order_of_tests_in_multiple_suites_with_skip_no_merge_tests, + order_of_tests_many_suites_with_skip_no_merge_tests, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_tests_in_multiple_dirs(Config) when is_list(Config) -> +order_of_tests_many_dirs(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -493,13 +493,13 @@ order_of_tests_in_multiple_dirs(Config) when is_list(Config) -> {cases,TestDir2,groups_22_SUITE,[testcase_1]}, {cases,TestDir1,groups_12_SUITE,[testcase_1b]}], - setup_and_execute(order_of_tests_in_multiple_dirs, + setup_and_execute(order_of_tests_many_dirs, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_tests_in_multiple_suites(Config) when is_list(Config) -> +order_of_tests_many_suites(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -507,13 +507,13 @@ order_of_tests_in_multiple_suites(Config) when is_list(Config) -> {cases,TestDir1,groups_11_SUITE,[testcase_1]}, {cases,TestDir1,groups_12_SUITE,[testcase_1b]}], - setup_and_execute(order_of_tests_in_multiple_suites, + setup_and_execute(order_of_tests_many_suites, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_suites_in_multiple_dirs(Config) when is_list(Config) -> +order_of_suites_many_dirs(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -522,13 +522,13 @@ order_of_suites_in_multiple_dirs(Config) when is_list(Config) -> {suites,TestDir2,groups_22_SUITE}, {suites,TestDir1,groups_11_SUITE}], - setup_and_execute(order_of_suites_in_multiple_dirs, + setup_and_execute(order_of_suites_many_dirs, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_groups_in_multiple_dirs(Config) when is_list(Config) -> +order_of_groups_many_dirs(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -537,13 +537,13 @@ order_of_groups_in_multiple_dirs(Config) when is_list(Config) -> {groups,TestDir2,groups_22_SUITE,test_group_1a}, {groups,TestDir1,groups_12_SUITE,test_group_1b}], - setup_and_execute(order_of_groups_in_multiple_dirs, + setup_and_execute(order_of_groups_many_dirs, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_groups_in_multiple_suites(Config) when is_list(Config) -> +order_of_groups_many_suites(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -551,13 +551,13 @@ order_of_groups_in_multiple_suites(Config) when is_list(Config) -> {groups,TestDir1,groups_11_SUITE,test_group_1a}, {groups,TestDir1,groups_12_SUITE,test_group_1b}], - setup_and_execute(order_of_groups_in_multiple_suites, + setup_and_execute(order_of_groups_many_suites, TestSpec, Config). %%%----------------------------------------------------------------- %%% -order_of_tests_in_multiple_suites_with_skip(Config) when is_list(Config) -> +order_of_tests_many_suites_with_skip(Config) when is_list(Config) -> DataDir = ?config(data_dir, Config), TestDir1 = filename:join(DataDir, "groups_1"), @@ -567,7 +567,7 @@ order_of_tests_in_multiple_suites_with_skip(Config) when is_list(Config) -> {cases,TestDir1,groups_11_SUITE,[testcase_2]}, {skip_cases,TestDir1,groups_12_SUITE,[testcase_1b],"Skip it!"}], - setup_and_execute(order_of_tests_in_multiple_suites_with_skip, + setup_and_execute(order_of_tests_many_suites_with_skip, TestSpec, Config). %%%----------------------------------------------------------------- @@ -1204,10 +1204,10 @@ test_events(sub_skipped_by_top) -> {negative,{?eh,tc_start,'_'},{?eh,stop_logging,'_'}} ]; -test_events(testcase_in_multiple_groups) -> +test_events(testcase_many_groups) -> []; -test_events(order_of_tests_in_multiple_dirs_no_merge_tests) -> +test_events(order_of_tests_many_dirs_no_merge_tests) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,testcase_1a}}, {?eh,tc_done, {groups_12_SUITE,testcase_1a, @@ -1219,7 +1219,7 @@ test_events(order_of_tests_in_multiple_dirs_no_merge_tests) -> {failed,{error,{test_case_failed,no_group_data}}}}}, {?eh,stop_logging,[]} ]; -test_events(order_of_tests_in_multiple_suites_no_merge_tests) -> +test_events(order_of_tests_many_suites_no_merge_tests) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,testcase_1a}}, {?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}}, @@ -1229,7 +1229,7 @@ test_events(order_of_tests_in_multiple_suites_no_merge_tests) -> {?eh,tc_done,{groups_12_SUITE,testcase_1b,'_'}}, {?eh,stop_logging,[]} ]; -test_events(order_of_suites_in_multiple_dirs_no_merge_tests) -> +test_events(order_of_suites_many_dirs_no_merge_tests) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,init_per_suite}}, {?eh,tc_done,{groups_12_SUITE,init_per_suite,'_'}}, @@ -1244,7 +1244,7 @@ test_events(order_of_suites_in_multiple_dirs_no_merge_tests) -> {?eh,tc_start,{groups_11_SUITE,end_per_suite}}, {?eh,tc_done,{groups_11_SUITE,end_per_suite,'_'}}, {?eh,stop_logging,[]}]; -test_events(order_of_groups_in_multiple_dirs_no_merge_tests) -> +test_events(order_of_groups_many_dirs_no_merge_tests) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}}, @@ -1257,7 +1257,7 @@ test_events(order_of_groups_in_multiple_dirs_no_merge_tests) -> {?eh,tc_done, {groups_12_SUITE,{end_per_group,test_group_1b,'_'},'_'}}, {?eh,stop_logging,[]}]; -test_events(order_of_groups_in_multiple_suites_no_merge_tests) -> +test_events(order_of_groups_many_suites_no_merge_tests) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}}, @@ -1270,7 +1270,7 @@ test_events(order_of_groups_in_multiple_suites_no_merge_tests) -> {?eh,tc_done, {groups_12_SUITE,{end_per_group,test_group_1b,'_'},'_'}}, {?eh,stop_logging,[]}]; -test_events(order_of_tests_in_multiple_suites_with_skip_no_merge_tests) -> +test_events(order_of_tests_many_suites_with_skip_no_merge_tests) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,testcase_1a}}, {?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}}, @@ -1282,7 +1282,7 @@ test_events(order_of_tests_in_multiple_suites_with_skip_no_merge_tests) -> {?eh,stop_logging,[]} ]; -test_events(order_of_tests_in_multiple_dirs) -> +test_events(order_of_tests_many_dirs) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,testcase_1a}}, {?eh,tc_done, @@ -1296,7 +1296,7 @@ test_events(order_of_tests_in_multiple_dirs) -> {?eh,tc_done,{groups_22_SUITE,testcase_1,ok}}, {?eh,stop_logging,[]} ]; -test_events(order_of_tests_in_multiple_suites) -> +test_events(order_of_tests_many_suites) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,testcase_1a}}, {?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}}, @@ -1308,7 +1308,7 @@ test_events(order_of_tests_in_multiple_suites) -> {?eh,tc_done,{groups_11_SUITE,testcase_1,ok}}, {?eh,stop_logging,[]} ]; -test_events(order_of_suites_in_multiple_dirs) -> +test_events(order_of_suites_many_dirs) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,init_per_suite}}, {?eh,tc_done,{groups_12_SUITE,init_per_suite,'_'}}, @@ -1325,7 +1325,7 @@ test_events(order_of_suites_in_multiple_dirs) -> {?eh,tc_start,{groups_22_SUITE,end_per_suite}}, {?eh,tc_done,{groups_22_SUITE,end_per_suite,'_'}}, {?eh,stop_logging,[]}]; -test_events(order_of_groups_in_multiple_dirs) -> +test_events(order_of_groups_many_dirs) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}}, @@ -1338,7 +1338,7 @@ test_events(order_of_groups_in_multiple_dirs) -> {?eh,tc_done, {groups_22_SUITE,{end_per_group,test_group_1a,'_'},'_'}}, {?eh,stop_logging,[]}]; -test_events(order_of_groups_in_multiple_suites) -> +test_events(order_of_groups_many_suites) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}}, @@ -1352,7 +1352,7 @@ test_events(order_of_groups_in_multiple_suites) -> {?eh,stop_logging,[]}]; -test_events(order_of_tests_in_multiple_suites_with_skip) -> +test_events(order_of_tests_many_suites_with_skip) -> [{?eh,start_logging,{'DEF','RUNDIR'}}, {?eh,tc_start,{groups_12_SUITE,testcase_1a}}, {?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}}, diff --git a/lib/common_test/test/ct_testspec_2_SUITE.erl b/lib/common_test/test/ct_testspec_2_SUITE.erl index 9d2dc84ad3..518352e87c 100644 --- a/lib/common_test/test/ct_testspec_2_SUITE.erl +++ b/lib/common_test/test/ct_testspec_2_SUITE.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2009-2012. All Rights Reserved. +%% Copyright Ericsson AB 2009-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -479,7 +479,7 @@ multiple_specs(_Config) -> "multiple_specs.1.spec"), SpecFile2 = ct_test_support:write_testspec(Spec2,SpecDir, "multiple_specs.2.spec"), - FileResult = ct_testspec:collect_tests_from_file([SpecFile1,SpecFile2], + FileResult = ct_testspec:collect_tests_from_file([[SpecFile1,SpecFile2]], false), ct:pal("TESTSPEC RECORD FROM FILE:~n~p~n", [rec2proplist(FileResult)]), @@ -490,7 +490,7 @@ multiple_specs(_Config) -> [{Node2,get_absdir(filename:join(SpecDir,CfgDir))} || CfgDir <- CfgDir2]], LogDirV = get_absdir(filename:join(SpecDir,"../logs")), - Verify = #testspec{merge_tests = false, + Verify = #testspec{merge_tests = true, spec_dir = SpecDir, nodes = [{undefined,Node},{n1,Node1},{n2,Node2}], alias = [{to1,TO1V},{to2,TO2V}], @@ -500,22 +500,13 @@ multiple_specs(_Config) -> logdir = [{Node,LogDirV},{Node1,LogDirV},{Node2,LogDirV},"."], config = CFGs, tests = [{{Node1,TO1V}, - [{x_SUITE,[all]}]}, - {{Node1,TO1V}, - [{y_SUITE,[{g1,all},{g2,all}]}]}, - {{Node1,TO1V}, - [{y_SUITE,[tc1,tc2]}]}, - {{Node1,TO1V}, - [{z_SUITE,[{all,{skip,"skipped"}}]}]}, - {{Node2,TO2V}, - [{x_SUITE,[all]}]}, - {{Node2,TO2V}, - [{y_SUITE,[all]}]}, - {{Node2,TO2V}, - [{x_SUITE,[{{g1,all},{skip,"skipped"}}, - {{g2,all},{skip,"skipped"}}]}]}, + [{x_SUITE,[all]}, + {y_SUITE,[{g1,all},{g2,all},tc1,tc2]}, + {z_SUITE,[{all,{skip,"skipped"}}]}]}, {{Node2,TO2V}, - [{y_SUITE,[{tc1,{skip,"skipped"}}, + [{x_SUITE,[all,{{g1,all},{skip,"skipped"}}, + {{g2,all},{skip,"skipped"}}]}, + {y_SUITE,[all,{tc1,{skip,"skipped"}}, {tc2,{skip,"skipped"}}]}]}]}, verify_result(Verify,FileResult,FileResult). @@ -524,7 +515,7 @@ multiple_specs(_Config) -> %%% misc_config_terms(_Config) -> CfgDir = "../cfgs/to1", - + TODir = "../tests/to1", Spec = [{node,x,n1@h1},{node,y,n2@h2}, @@ -554,7 +545,9 @@ misc_config_terms(_Config) -> {create_priv_dir,[auto_per_tc]}, {create_priv_dir,n1@h1,[manual_per_tc]}, - {create_priv_dir,n2@h2,[auto_per_run]} + {create_priv_dir,n2@h2,[auto_per_run]}, + + {suites,n1@h1,TODir,[x_SUITE]} ], {ok,SpecDir} = file:get_cwd(), @@ -599,7 +592,9 @@ misc_config_terms(_Config) -> {n2@h2,CSS2}], create_priv_dir = [{Node,[auto_per_tc]}, {n1@h1,[manual_per_tc]}, - {n2@h2,[auto_per_run]}] + {n2@h2,[auto_per_run]}], + tests = [{{n1@h1,get_absdir(filename:join(SpecDir,TODir))}, + [{x_SUITE,[all]}]}] }, verify_result(Verify,ListResult,FileResult). @@ -688,10 +683,10 @@ define_names_1(_Config) -> %%% HELP FUNCTIONS %%%----------------------------------------------------------------- -verify_result(Verify,ListResult,FileResult) -> +verify_result(VerificationRec,ListResult,FileResult) -> {_,TSLTuples} = rec2proplist(ListResult), {_,TSFTuples} = rec2proplist(FileResult), - {_,VTuples} = rec2proplist(Verify), + {_,VTuples} = rec2proplist(VerificationRec), VResult = (catch lists:foldl(fun({Tag,Val},{[{Tag,Val}|TSL],[{Tag,Val}|TSF]}) -> {TSL,TSF}; @@ -720,6 +715,8 @@ read_config(S) -> rec2proplist(E={error,_What}) -> exit({invalid_testspec_record,E}); +rec2proplist([{Specs,Rec}]) when is_list(Specs) -> + rec2proplist(Rec); rec2proplist(Rec) -> [RecName|RecList] = tuple_to_list(Rec), FieldNames = diff --git a/lib/common_test/test/ct_testspec_3_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE.erl new file mode 100644 index 0000000000..6b4b729552 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE.erl @@ -0,0 +1,745 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2009-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_testspec_1_SUITE +%%% +%%% Description: +%%% Test test specifications +%%% +%%% The suites used for the test are located in the data directory. +%%%------------------------------------------------------------------- +-module(ct_testspec_3_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-define(eh, ct_test_support_eh). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + DataDir = ?config(data_dir, Config), + Config1 = ct_test_support:init_per_suite(Config), + SpecsDir1 = filename:join(DataDir, "specs1"), + SpecsDir2 = filename:join(DataDir, "specs2"), + [{specs_dir1,SpecsDir1},{specs_dir2,SpecsDir2} | Config1]. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [start_separate, + start_join, + incl_separate1, + incl_separate2, + incl_join1, + incl_join2, + incl_both1, + incl_both2, + incl_both_and_join1, + incl_both_and_join2, + rec_incl_separate1, + rec_incl_separate2, + rec_incl_join1, + rec_incl_join2, + rec_incl_separate_join1, + rec_incl_separate_join2, + rec_incl_join_separate1, + rec_incl_join_separate2 + ]. + +groups() -> + []. + +init_per_group(_GroupName, Config) -> + Config. + +end_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%%%----------------------------------------------------------------- +%%% + +start_separate(Config) -> + Specs = [fname(specs_dir1, "flat_spec1", Config), + fname(specs_dir2, "flat_spec2", Config)], + setup_and_execute(start_separate, Specs, [], Config). + +%%%----------------------------------------------------------------- +%%% + +start_join(Config) -> + Specs = [fname(specs_dir1, "flat_spec1", Config), + fname(specs_dir2, "flat_spec2", Config)], + setup_and_execute(start_join, Specs, [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +incl_separate1(Config) -> + Specs = [fname(specs_dir1, "spec_sep1", Config), + fname(specs_dir2, "spec_sep2", Config)], + setup_and_execute(incl_separate1, Specs, [], Config). + +incl_separate2(Config) -> + Specs = [fname(specs_dir1, "spec_sep1", Config), + fname(specs_dir2, "spec_sep2", Config)], + setup_and_execute(incl_separate2, Specs, [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +incl_join1(Config) -> + Specs = [fname(specs_dir1, "spec_join1", Config), + fname(specs_dir2, "spec_join2", Config)], + setup_and_execute(incl_join1, Specs, [], Config). + +incl_join2(Config) -> + Specs = [fname(specs_dir1, "spec_join1", Config), + fname(specs_dir2, "spec_join2", Config)], + setup_and_execute(incl_join2, Specs, [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +incl_both1(Config) -> + Specs = [fname(specs_dir1, "spec_both1", Config), + fname(specs_dir2, "spec_both2", Config)], + setup_and_execute(incl_both1, Specs, [], Config). + +incl_both2(Config) -> + Specs = [fname(specs_dir1, "spec_both1", Config), + fname(specs_dir2, "spec_both2", Config)], + setup_and_execute(incl_both2, Specs, [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +incl_both_and_join1(Config) -> + Specs = [fname(specs_dir1, "spec_both_join1", Config), + fname(specs_dir2, "spec_both_join2", Config)], + setup_and_execute(incl_both_and_join1, Specs, [], Config). + +incl_both_and_join2(Config) -> + Specs = [fname(specs_dir1, "spec_both_join1", Config), + fname(specs_dir2, "spec_both_join2", Config)], + setup_and_execute(incl_both_and_join2, Specs, [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +rec_incl_separate1(Config) -> + Specs = [fname(specs_dir1, "rec_spec_sep1", Config), + fname(specs_dir2, "rec_spec_sep2", Config)], + setup_and_execute(rec_incl_separate1, Specs, [], Config). + +rec_incl_separate2(Config) -> + Specs = [fname(specs_dir1, "rec_spec_sep1", Config), + fname(specs_dir2, "rec_spec_sep2", Config)], + setup_and_execute(rec_incl_separate2, Specs, [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +rec_incl_join1(Config) -> + Specs = [fname(specs_dir1, "rec_spec_join1", Config), + fname(specs_dir2, "rec_spec_join2", Config)], + setup_and_execute(rec_incl_join1, Specs, [], Config). + +rec_incl_join2(Config) -> + Specs = [fname(specs_dir1, "rec_spec_join1", Config), + fname(specs_dir2, "rec_spec_join2", Config)], + setup_and_execute(rec_incl_join2, Specs, [{join_specs,true}], Config). + + +%%%----------------------------------------------------------------- +%%% + +rec_incl_separate_join1(Config) -> + Specs = [fname(specs_dir1, "rec_spec_sep_join1", Config), + fname(specs_dir2, "rec_spec_sep_join2", Config)], + setup_and_execute(rec_incl_separate_join1, Specs, [], Config). + +rec_incl_separate_join2(Config) -> + Specs = [fname(specs_dir1, "rec_spec_sep_join1", Config), + fname(specs_dir2, "rec_spec_sep_join2", Config)], + setup_and_execute(rec_incl_separate_join2, Specs, + [{join_specs,true}], Config). + +%%%----------------------------------------------------------------- +%%% + +rec_incl_join_separate1(Config) -> + Specs = [fname(specs_dir1, "rec_spec_join_sep1", Config), + fname(specs_dir2, "rec_spec_join_sep2", Config)], + setup_and_execute(rec_incl_join_separate1, Specs, [], Config). + +rec_incl_join_separate2(Config) -> + Specs = [fname(specs_dir1, "rec_spec_join_sep1", Config), + fname(specs_dir2, "rec_spec_join_sep2", Config)], + setup_and_execute(rec_incl_join_separate2, Specs, + [{join_specs,true}], Config). + + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- + +fname(Tag, File, Config) -> + filename:join(?config(Tag, Config), File). + +check_parameter(TCID) -> + {ok,{config,TCID}}. + +read_config(TCID) -> + {ok,[{tcname,list_to_atom(TCID)}]}. + +setup_and_execute(TCName, Specs, TestOpts, Config) -> + + TestID = {userconfig,{?MODULE,atom_to_list(TCName)}}, + TestTerms = [TestID,{spec,Specs},{label,TCName}] ++ TestOpts, + + {Opts,ERPid} = setup(TestTerms, Config), + + case ct_test_support:run(Opts, Config) of + ok -> + ok; + Error -> + ct:pal("Error executing with opts: ~p", [Opts]), + exit(Error) + end, + + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(TCName, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(TCName), + ok = ct_test_support:verify_events(TestEvents, Events, Config). + +setup(Test, Config) when is_tuple(Test) -> + setup([Test], Config); +setup(Tests, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts0 ++ Tests ++ [{event_handler,{?eh,EvHArgs}}], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). +%reformat(Events, _EH) -> +% Events. + +%%%----------------------------------------------------------------- +%%% TEST EVENTS +%%%----------------------------------------------------------------- +events_to_check(Test) -> + %% 2 tests (ct:run_test + script_start) is default + events_to_check(Test, 2). + +events_to_check(_, 0) -> + []; +events_to_check(Test, N) -> + test_events(Test) ++ events_to_check(Test, N-1). + +test_events(start_separate) -> + [{?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(start_join) -> + [ + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{4,4,20}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{4,8,{4,4}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_separate1) -> + [ + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{1,1,5}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_separate2) -> + [ + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{1,1,5}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_join1) -> + [{?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{4,4,20}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{4,8,{4,4}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{4,4,20}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{4,8,{4,4}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_join2) -> + [{?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{4,4,20}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{4,8,{4,4}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_both1) -> + [{?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_both2) -> + [{?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{4,4,20}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,ok_tc}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{4,8,{4,4}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{3,2,15}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t12_SUITE,init_per_suite}}, + {?eh,tc_done,{t12_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t12_SUITE,end_per_suite}}, + {?eh,tc_done,{t12_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t22_SUITE,init_per_suite}}, + {?eh,tc_done,{t22_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{3,6,{3,3}}}, + {?eh,tc_start,{t22_SUITE,end_per_suite}}, + {?eh,tc_done,{t22_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}, + {?eh,start_logging,{'DEF','RUNDIR'}}, + {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}, + {?eh,start_info,{2,2,10}}, + {?eh,tc_start,{t11_SUITE,init_per_suite}}, + {?eh,tc_done,{t11_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{1,2,{1,1}}}, + {?eh,tc_start,{t11_SUITE,end_per_suite}}, + {?eh,tc_done,{t11_SUITE,end_per_suite,ok}}, + {?eh,tc_start,{t21_SUITE,init_per_suite}}, + {?eh,tc_done,{t21_SUITE,init_per_suite,ok}}, + {?eh,test_stats,{2,4,{2,2}}}, + {?eh,tc_start,{t21_SUITE,end_per_suite}}, + {?eh,tc_done,{t21_SUITE,end_per_suite,ok}}, + {?eh,test_done,{'DEF','STOP_TIME'}}, + {?eh,stop_logging,[]}]; + +test_events(incl_both_and_join1) -> []; +test_events(incl_both_and_join2) -> []; +test_events(rec_incl_separate1) -> []; +test_events(rec_incl_separate2) -> []; +test_events(rec_incl_join1) -> []; +test_events(rec_incl_join2) -> []; +test_events(rec_incl_separate_join1) -> []; +test_events(rec_incl_separate_join2) -> []; +test_events(rec_incl_join_separate1) -> []; +test_events(rec_incl_join_separate2) -> []; + +test_events(_) -> + []. + + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg11 b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg11 new file mode 100644 index 0000000000..bc672568da --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg11 @@ -0,0 +1 @@ +{file, cfg11}.
\ No newline at end of file diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg12 b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg12 new file mode 100644 index 0000000000..30f2cf6857 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg12 @@ -0,0 +1 @@ +{file, cfg12}.
\ No newline at end of file diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg13 b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg13 new file mode 100644 index 0000000000..1860ec78e5 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config1/cfg13 @@ -0,0 +1 @@ +{file, cfg13}.
\ No newline at end of file diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg21 b/lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg21 new file mode 100644 index 0000000000..b18d35443e --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/config2/cfg21 @@ -0,0 +1 @@ +{file, cfg21}.
\ No newline at end of file diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec1 new file mode 100644 index 0000000000..eff87222ea --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/flat_spec1 @@ -0,0 +1,4 @@ +{config, "../config1/cfg11"}. +{suites, "../tests1", t11_SUITE}. +{suites, "../tests1", t11_SUITE}. +{suites, "../tests2", t21_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join1 new file mode 100644 index 0000000000..a3387f48a3 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join1 @@ -0,0 +1,2 @@ +{specs,join,"spec_join1"}. +{specs,join,"../specs2/spec_join2"}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep1 new file mode 100644 index 0000000000..fe127eb4b9 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_join_sep1 @@ -0,0 +1,5 @@ +{specs,join,"spec_sep1"}. +{specs,join,"../specs2/spec_sep2"}. + +{config, "../config1/cfg13"}. +{suites, "../tests2", t23_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep1 new file mode 100644 index 0000000000..c778aa68a6 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep1 @@ -0,0 +1,2 @@ +{specs,separate,"spec_sep1"}. +{specs,separate,"../specs2/spec_sep2"}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join1 new file mode 100644 index 0000000000..7cb5a05fff --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/rec_spec_sep_join1 @@ -0,0 +1,2 @@ +{specs,separate,"spec_join1"}. +{specs,separate,"../specs2/spec_join2"}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both1 new file mode 100644 index 0000000000..46111614dc --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both1 @@ -0,0 +1,2 @@ +{specs, join, "../specs1/flat_spec1"}. +{specs, separate, "../specs2/flat_spec2"}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join1 new file mode 100644 index 0000000000..f52b3ed030 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_both_join1 @@ -0,0 +1,6 @@ +{specs, join, "../specs1/flat_spec1"}. +{specs, separate, "../specs2/flat_spec2"}. +{merge_tests,false}. +{config, "../config1/cfg12"}. +{suites, "../tests1", t11_SUITE}. +{suites, "../tests2", t21_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join1 new file mode 100644 index 0000000000..baaaf35be4 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_join1 @@ -0,0 +1 @@ +{specs, join, ["../specs2/flat_spec2", "flat_spec1"]}.
\ No newline at end of file diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep1 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep1 new file mode 100644 index 0000000000..89456c35e0 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs1/spec_sep1 @@ -0,0 +1,3 @@ +{specs, separate, "../specs2/flat_spec2"}. +{specs, separate, "flat_spec1"}. + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec2 new file mode 100644 index 0000000000..758d1e2514 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/flat_spec2 @@ -0,0 +1,5 @@ +{merge_tests, false}. +{config, "../config2/cfg21"}. +{suites, "../tests1", t12_SUITE}. +{suites, "../tests1", t12_SUITE}. +{suites, "../tests2", t22_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join2 new file mode 100644 index 0000000000..19d3a3d8e2 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join2 @@ -0,0 +1,5 @@ +{specs,join,"spec_join2"}. +{specs,join,"../specs1/spec_join1"}. + +{config, "../config1/cfg13"}. +{suites, "../tests2", t23_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep2 new file mode 100644 index 0000000000..930e68c847 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_join_sep2 @@ -0,0 +1,5 @@ +{specs,join,"spec_sep2"}. +{specs,join,"../specs1/spec_sep1"}. + +{config, "../config1/cfg13"}. +{suites, "../tests2", t23_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep2 new file mode 100644 index 0000000000..5026f329a7 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep2 @@ -0,0 +1,5 @@ +{specs,separate,"spec_sep2"}. +{specs,separate,"../specs1/spec_sep1"}. + +{config, "../config1/cfg13"}. +{suites, "../tests2", t23_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join2 new file mode 100644 index 0000000000..17057088b4 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/rec_spec_sep_join2 @@ -0,0 +1,5 @@ +{specs,separate,"spec_join2"}. +{specs,separate,"../specs1/spec_join1"}. + +{config, "../config1/cfg13"}. +{suites, "../tests2", t23_SUITE}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both2 new file mode 100644 index 0000000000..4c83115d23 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both2 @@ -0,0 +1,4 @@ +{specs, separate, "../specs1/flat_spec1"}. +{specs, join, "../specs2/flat_spec2"}. +{config, "../config1/cfg12"}. + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join2 new file mode 100644 index 0000000000..ad81bfb4cc --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_both_join2 @@ -0,0 +1,9 @@ +{merge_tests,true}. +{config, "../config1/cfg12"}. +{suites, "../tests1", t11_SUITE}. +{suites, "../tests2", t21_SUITE}. +{suites, "../tests1", t12_SUITE}. +{suites, "../tests2", t22_SUITE}. + +{specs, separate, "../specs1/flat_spec1"}. +{specs, join, "../specs2/flat_spec2"}. diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join2 new file mode 100644 index 0000000000..d652dbd78f --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_join2 @@ -0,0 +1,5 @@ +{specs, join, ["../specs1/flat_spec1"]}. +{specs, join, ["flat_spec2"]}. +{config, "../config1/cfg12"}. +{suites, "../tests2", t22_SUITE}. + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep2 b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep2 new file mode 100644 index 0000000000..8d37f508b8 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/specs2/spec_sep2 @@ -0,0 +1,5 @@ +{specs, separate, "../specs1/flat_spec1"}. +{specs, separate, "flat_spec2"}. +{config, "../config1/cfg12"}. +{suites, "../tests2", t22_SUITE}. + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl new file mode 100644 index 0000000000..b8216c3596 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t11_SUITE.erl @@ -0,0 +1,175 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2008-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +-module(t11_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{require,file}, + {require,tcname}, + {timetrap,{seconds,1}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + %% verify that expected config file can be read + case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of + {start_separate,[cfg11]} -> ok; + {start_join,[cfg11,cfg21]} -> ok; + {incl_separate1,[cfg11]} -> ok; + {incl_separate2,[cfg11]} -> ok; + {incl_join1,[cfg21,cfg11]} -> ok; + {incl_join1,[cfg12,cfg11,cfg21]} -> ok; + {incl_join2,[cfg21,cfg11,cfg12]} -> ok; + {incl_both1,[cfg11]} -> ok; + {incl_both2,[cfg11,cfg12,cfg21]} -> ok; + {incl_both2,[cfg11]} -> ok; + _ -> ok + + end, + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(autoskip_tc, Config) -> + exit(kaboom), + Config; + +init_per_testcase(userskip_tc, Config) -> + {skip,"user skipped"}; + +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + []. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc]. + +%%-------------------------------------------------------------------- +%% @spec TestCase(Config0) -> +%% ok | exit() | {skip,Reason} | {comment,Comment} | +%% {save_config,Config1} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% Comment = term() +%% @end +%%-------------------------------------------------------------------- +ok_tc(_) -> + ok. + +exit_tc(_) -> + exit(kaboom), + ok. + +to_tc(_) -> + ct:timetrap(1), + ct:sleep(100), + ok. + +autoskip_tc(_) -> + ok. + +userskip_tc(_) -> + ok. + + + + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl new file mode 100644 index 0000000000..7c51aca246 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests1/t12_SUITE.erl @@ -0,0 +1,175 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2008-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +-module(t12_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{require,file}, + {require,tcname}, + {timetrap,{seconds,30}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + %% verify that expected config file can be read + case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of + {start_separate,[cfg21]} -> ok; + {start_join,[cfg11,cfg21]} -> ok; + {incl_separate1,[cfg21]} -> ok; + {incl_separate2,[cfg21]} -> ok; + {incl_join1,[cfg21,cfg11]} -> ok; + {incl_join1,[cfg12,cfg11,cfg21]} -> ok; + {incl_join2,[cfg21,cfg11,cfg12]} -> ok; + {incl_both1,[cfg21]} -> ok; + {incl_both1,[cfg12,cfg21]} -> ok; + {incl_both2,[cfg11,cfg12,cfg21]} -> ok; + {incl_both2,[cfg21]} -> ok; + _ -> ok + end, + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(autoskip_tc, Config) -> + exit(kaboom), + Config; + +init_per_testcase(userskip_tc, Config) -> + {skip,"user skipped"}; + +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + []. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc]. + +%%-------------------------------------------------------------------- +%% @spec TestCase(Config0) -> +%% ok | exit() | {skip,Reason} | {comment,Comment} | +%% {save_config,Config1} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% Comment = term() +%% @end +%%-------------------------------------------------------------------- +ok_tc(_) -> + ok. + +exit_tc(_) -> + exit(kaboom), + ok. + +to_tc(_) -> + ct:timetrap(1), + ct:sleep(100), + ok. + +autoskip_tc(_) -> + ok. + +userskip_tc(_) -> + ok. + + + + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl new file mode 100644 index 0000000000..36c1b4279b --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t21_SUITE.erl @@ -0,0 +1,174 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2008-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +-module(t21_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{require,file}, + {require,tcname}, + {timetrap,{seconds,1}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + %% verify that expected config file can be read + case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of + {start_separate,[cfg11]} -> ok; + {start_join,[cfg11,cfg21]} -> ok; + {incl_separate1,[cfg11]} -> ok; + {incl_separate2,[cfg11]} -> ok; + {incl_join1,[cfg21,cfg11]} -> ok; + {incl_join1,[cfg12,cfg11,cfg21]} -> ok; + {incl_join2,[cfg21,cfg11,cfg12]} -> ok; + {incl_both1,[cfg11]} -> ok; + {incl_both2,[cfg11,cfg12,cfg21]} -> ok; + {incl_both2,[cfg11]} -> ok; + _ -> ok + end, + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(autoskip_tc, Config) -> + exit(kaboom), + Config; + +init_per_testcase(userskip_tc, Config) -> + {skip,"user skipped"}; + +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + []. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc]. + +%%-------------------------------------------------------------------- +%% @spec TestCase(Config0) -> +%% ok | exit() | {skip,Reason} | {comment,Comment} | +%% {save_config,Config1} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% Comment = term() +%% @end +%%-------------------------------------------------------------------- +ok_tc(_) -> + ok. + +exit_tc(_) -> + exit(kaboom), + ok. + +to_tc(_) -> + ct:timetrap(1), + ct:sleep(100), + ok. + +autoskip_tc(_) -> + ok. + +userskip_tc(_) -> + ok. + + + + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl new file mode 100644 index 0000000000..3f6336c7e2 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t22_SUITE.erl @@ -0,0 +1,177 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2008-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +-module(t22_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{require,file}, + {require,tcname}, + {timetrap,{seconds,30}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + %% verify that expected config file can be read + case {ct:get_config(tcname),ct:get_config(file,undefined,[all])} of + {start_separate,[cfg21]} -> ok; + {start_join,[cfg11,cfg21]} -> ok; + {incl_separate1,[cfg12]} -> ok; + {incl_separate1,[cfg21]} -> ok; + {incl_separate2,[cfg12]} -> ok; + {incl_separate2,[cfg21]} -> ok; + {incl_join1,[cfg21,cfg11]} -> ok; + {incl_join1,[cfg12,cfg11,cfg21]} -> ok; + {incl_join2,[cfg21,cfg11,cfg12]} -> ok; + {incl_both1,[cfg21]} -> ok; + {incl_both1,[cfg12,cfg21]} -> ok; + {incl_both2,[cfg11,cfg12,cfg21]} -> ok; + {incl_both2,[cfg21]} -> ok; + _ -> ok + end, + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(autoskip_tc, Config) -> + exit(kaboom), + Config; + +init_per_testcase(userskip_tc, Config) -> + {skip,"user skipped"}; + +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + []. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc]. + +%%-------------------------------------------------------------------- +%% @spec TestCase(Config0) -> +%% ok | exit() | {skip,Reason} | {comment,Comment} | +%% {save_config,Config1} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% Comment = term() +%% @end +%%-------------------------------------------------------------------- +ok_tc(_) -> + ok. + +exit_tc(_) -> + exit(kaboom), + ok. + +to_tc(_) -> + ct:timetrap(1), + ct:sleep(100), + ok. + +autoskip_tc(_) -> + ok. + +userskip_tc(_) -> + ok. + + + + diff --git a/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl new file mode 100644 index 0000000000..d836ab57c1 --- /dev/null +++ b/lib/common_test/test/ct_testspec_3_SUITE_data/tests2/t23_SUITE.erl @@ -0,0 +1,158 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2008-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +-module(t23_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). + +%%-------------------------------------------------------------------- +%% @spec suite() -> Info +%% Info = [tuple()] +%% @end +%%-------------------------------------------------------------------- +suite() -> + [{timetrap,{seconds,30}}]. + +%%-------------------------------------------------------------------- +%% @spec init_per_suite(Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_suite(Config0) -> void() | {save_config,Config1} +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_suite(_Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_group(GroupName, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_group(_GroupName, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_group(GroupName, Config0) -> +%% void() | {save_config,Config1} +%% GroupName = atom() +%% Config0 = Config1 = [tuple()] +%% @end +%%-------------------------------------------------------------------- +end_per_group(_GroupName, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec init_per_testcase(TestCase, Config0) -> +%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +init_per_testcase(autoskip_tc, Config) -> + exit(kaboom), + Config; + +init_per_testcase(userskip_tc, Config) -> + {skip,"user skipped"}; + +init_per_testcase(_TestCase, Config) -> + Config. + +%%-------------------------------------------------------------------- +%% @spec end_per_testcase(TestCase, Config0) -> +%% void() | {save_config,Config1} | {fail,Reason} +%% TestCase = atom() +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +end_per_testcase(_TestCase, _Config) -> + ok. + +%%-------------------------------------------------------------------- +%% @spec groups() -> [Group] +%% Group = {GroupName,Properties,GroupsAndTestCases} +%% GroupName = atom() +%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}] +%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase] +%% TestCase = atom() +%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}} +%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail | +%% repeat_until_any_ok | repeat_until_any_fail +%% N = integer() | forever +%% @end +%%-------------------------------------------------------------------- +groups() -> + []. + +%%-------------------------------------------------------------------- +%% @spec all() -> GroupsAndTestCases | {skip,Reason} +%% GroupsAndTestCases = [{group,GroupName} | TestCase] +%% GroupName = atom() +%% TestCase = atom() +%% Reason = term() +%% @end +%%-------------------------------------------------------------------- +all() -> + [ok_tc, exit_tc, to_tc, autoskip_tc, userskip_tc]. + +%%-------------------------------------------------------------------- +%% @spec TestCase(Config0) -> +%% ok | exit() | {skip,Reason} | {comment,Comment} | +%% {save_config,Config1} | {skip_and_save,Reason,Config1} +%% Config0 = Config1 = [tuple()] +%% Reason = term() +%% Comment = term() +%% @end +%%-------------------------------------------------------------------- +ok_tc(_) -> + ok. + +exit_tc(_) -> + exit(kaboom), + ok. + +to_tc(_) -> + ct:timetrap(1), + ct:sleep(100), + ok. + +autoskip_tc(_) -> + ok. + +userskip_tc(_) -> + ok. + + + + diff --git a/lib/common_test/test/ct_verbosity_SUITE.erl b/lib/common_test/test/ct_verbosity_SUITE.erl index 349319de94..32488b1db9 100644 --- a/lib/common_test/test/ct_verbosity_SUITE.erl +++ b/lib/common_test/test/ct_verbosity_SUITE.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2009-2012. All Rights Reserved. +%% Copyright Ericsson AB 2009-2013. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -44,8 +44,11 @@ %% there will be clashes with logging processes etc). %%-------------------------------------------------------------------- init_per_suite(Config) -> - Config1 = ct_test_support:init_per_suite(Config), - Config1. + DataDir = ?config(data_dir, Config), + EvH = filename:join(DataDir,"simple_evh.erl"), + ct:pal("Compiling ~s: ~p", [EvH,compile:file(EvH,[{outdir,DataDir}, + debug_info])]), + ct_test_support:init_per_suite([{path_dirs,[DataDir]} | Config]). end_per_suite(Config) -> ct_test_support:end_per_suite(Config). @@ -56,7 +59,8 @@ init_per_testcase(TestCase, Config) -> end_per_testcase(TestCase, Config) -> ct_test_support:end_per_testcase(TestCase, Config). -suite() -> [{ct_hooks,[ts_install_cth]}]. +suite() -> [{timetrap,{minutes,2}}, + {ct_hooks,[ts_install_cth]}]. all() -> [ @@ -67,7 +71,8 @@ all() -> change_default, combine_categories, testspec_only, - merge_with_testspec + merge_with_testspec, + possible_deadlock ]. %%-------------------------------------------------------------------- @@ -173,6 +178,17 @@ merge_with_testspec(Config) -> ok = execute(TC, Opts, ERPid, Config). %%%----------------------------------------------------------------- +%%% +possible_deadlock(Config) -> + TC = possible_deadlock, + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "io_test_SUITE"), + {Opts,ERPid} = setup([{suite,Suite},{label,TC}, + {event_handler,[simple_evh]}], Config), + ok = execute(TC, Opts, ERPid, Config). + + +%%%----------------------------------------------------------------- %%% HELP FUNCTIONS %%%----------------------------------------------------------------- @@ -180,7 +196,14 @@ setup(Test, Config) -> Opts0 = ct_test_support:get_opts(Config), Level = ?config(trace_level, Config), EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], - Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test], + Opts = + case proplists:get_value(event_handler, Test) of + undefined -> + Opts0 ++ [{event_handler,{?eh,EvHArgs}} | Test]; + EvHs -> + Opts0 ++ [{event_handler,{[?eh|EvHs],EvHArgs}} | + proplists:delete(event_handler, Test)] + end, ERPid = ct_test_support:start_event_receiver(Config), {Opts,ERPid}. diff --git a/lib/common_test/test/ct_verbosity_SUITE_data/simple_evh.erl b/lib/common_test/test/ct_verbosity_SUITE_data/simple_evh.erl new file mode 100644 index 0000000000..3e744f2596 --- /dev/null +++ b/lib/common_test/test/ct_verbosity_SUITE_data/simple_evh.erl @@ -0,0 +1,171 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2006-2013. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%% @doc Common Test Framework Event Handler +%%% +%%% <p>This module implements an event handler that CT uses to +%%% handle status and progress notifications during test runs. +%%% The notifications are handled locally (per node) and passed +%%% on to ct_master when CT runs in distributed mode. This +%%% module may be used as a template for other event handlers +%%% that can be plugged in to handle local logging and reporting.</p> +-module(simple_evh). + +-behaviour(gen_event). + +%% gen_event callbacks +-export([init/1, handle_event/2, handle_call/2, + handle_info/2, terminate/2, code_change/3]). + +-include_lib("common_test/include/ct_event.hrl"). +-include_lib("common_test/src/ct_util.hrl"). + +%%==================================================================== +%% gen_event callbacks +%%==================================================================== +%%-------------------------------------------------------------------- +%% Function: init(Args) -> {ok, State} +%% Description: Whenever a new event handler is added to an event manager, +%% this function is called to initialize the event handler. +%%-------------------------------------------------------------------- +init(_) -> + io:format("Event handler ~w started!~n", [?MODULE]), + {ok,[]}. + +%%-------------------------------------------------------------------- +%% Function: +%% handle_event(Event, State) -> {ok, State} | +%% {swap_handler, Args1, State1, Mod2, Args2} | +%% remove_handler +%% Description:Whenever an event manager receives an event sent using +%% gen_event:notify/2 or gen_event:sync_notify/2, this function is called for +%% each installed event handler to handle the event. +%%-------------------------------------------------------------------- +handle_event(Event = #event{name = test_stats},State) -> + %% this could cause a deadlock + ct:pal("~p: ~p~n", [Event#event.name,Event#event.data]), + {ok,State}; +handle_event(_Event,State) -> + {ok,State}. + +%%============================== EVENTS ============================== +%% +%% Name = test_start +%% Data = {StartTime,LogDir} +%% +%% Name = start_info +%% Data = {Tests,Suites,Cases} +%% Tests = Suites = Cases = integer() +%% +%% Name = test_done +%% Data = EndTime +%% +%% Name = start_make +%% Data = Dir +%% +%% Name = finished_make +%% Data = Dir +%% +%% Name = tc_start +%% Data = {Suite,CaseOrGroup} +%% CaseOrGroup = atom() | {Conf,GroupName,GroupProperties} +%% Conf = init_per_group | end_per_group +%% GroupName = atom() +%% GroupProperties = list() +%% +%% Name = tc_done +%% Data = {Suite,CaseOrGroup,Result} +%% CaseOrGroup = atom() | {Conf,GroupName,GroupProperties} +%% Conf = init_per_group | end_per_group +%% GroupName = atom() +%% GroupProperties = list() +%% Result = ok | {skipped,Reason} | {failed,Reason} +%% +%% Name = tc_user_skip +%% Data = {Suite,Case,Comment} +%% Comment = string() +%% +%% Name = tc_auto_skip +%% Data = {Suite,Case,Comment} +%% Comment = string() +%% +%% Name = test_stats +%% Data = {Ok,Failed,Skipped} +%% Ok = Failed = integer() +%% Skipped = {UserSkipped,AutoSkipped} +%% UserSkipped = AutoSkipped = integer() +%% +%% Name = start_logging +%% Data = CtRunDir +%% +%% Name = stop_logging +%% Data = [] +%% +%% Name = start_write_file +%% Data = FullNameFile +%% +%% Name = finished_write_file +%% Data = FullNameFile +%% +%% Name = +%% Data = +%% + +%%-------------------------------------------------------------------- +%% Function: +%% handle_call(Request, State) -> {ok, Reply, State} | +%% {swap_handler, Reply, Args1, State1, +%% Mod2, Args2} | +%% {remove_handler, Reply} +%% Description: Whenever an event manager receives a request sent using +%% gen_event:call/3,4, this function is called for the specified event +%% handler to handle the request. +%%-------------------------------------------------------------------- +handle_call(_Req, State) -> + Reply = ok, + {ok, Reply, State}. + +%%-------------------------------------------------------------------- +%% Function: +%% handle_info(Info, State) -> {ok, State} | +%% {swap_handler, Args1, State1, Mod2, Args2} | +%% remove_handler +%% Description: This function is called for each installed event handler when +%% an event manager receives any other message than an event or a synchronous +%% request (or a system message). +%%-------------------------------------------------------------------- +handle_info(_Info, State) -> + {ok, State}. + +%%-------------------------------------------------------------------- +%% Function: terminate(Reason, State) -> void() +%% Description:Whenever an event handler is deleted from an event manager, +%% this function is called. It should be the opposite of Module:init/1 and +%% do any necessary cleaning up. +%%-------------------------------------------------------------------- +terminate(_Reason, _State) -> + ok. + +%%-------------------------------------------------------------------- +%% Function: code_change(OldVsn, State, Extra) -> {ok, NewState} +%% Description: Convert process state when code is changed +%%-------------------------------------------------------------------- +code_change(_OldVsn, State, _Extra) -> + {ok, State}. + diff --git a/lib/common_test/vsn.mk b/lib/common_test/vsn.mk index f9bb22867e..87d762b697 100644 --- a/lib/common_test/vsn.mk +++ b/lib/common_test/vsn.mk @@ -1 +1 @@ -COMMON_TEST_VSN = 1.6.3 +COMMON_TEST_VSN = 1.7.1 |