aboutsummaryrefslogtreecommitdiffstats
path: root/lib/common_test
diff options
context:
space:
mode:
Diffstat (limited to 'lib/common_test')
-rw-r--r--lib/common_test/doc/src/common_test_app.xml11
-rw-r--r--lib/common_test/doc/src/cover_chapter.xml112
-rw-r--r--lib/common_test/doc/src/ct_hooks_chapter.xml43
-rw-r--r--lib/common_test/doc/src/ct_run.xml4
-rw-r--r--lib/common_test/doc/src/notes.xml144
-rw-r--r--lib/common_test/doc/src/run_test_chapter.xml207
-rw-r--r--lib/common_test/doc/src/write_test_chapter.xml52
-rw-r--r--lib/common_test/src/Makefile3
-rw-r--r--lib/common_test/src/ct.erl8
-rw-r--r--lib/common_test/src/ct_config.erl2
-rw-r--r--lib/common_test/src/ct_conn_log_h.erl6
-rw-r--r--lib/common_test/src/ct_cover.erl32
-rw-r--r--lib/common_test/src/ct_framework.erl374
-rw-r--r--lib/common_test/src/ct_groups.erl599
-rw-r--r--lib/common_test/src/ct_master.erl7
-rw-r--r--lib/common_test/src/ct_master_logs.erl41
-rw-r--r--lib/common_test/src/ct_netconfc.erl41
-rw-r--r--lib/common_test/src/ct_run.erl205
-rw-r--r--lib/common_test/src/ct_slave.erl67
-rw-r--r--lib/common_test/src/ct_snmp.erl335
-rw-r--r--lib/common_test/src/ct_testspec.erl28
-rw-r--r--lib/common_test/src/ct_util.hrl1
-rw-r--r--lib/common_test/src/cth_conn_log.erl2
-rw-r--r--lib/common_test/src/cth_log_redirect.erl2
-rw-r--r--lib/common_test/src/cth_surefire.erl183
-rw-r--r--lib/common_test/test/Makefile10
-rw-r--r--lib/common_test/test/common_test.cover10
-rw-r--r--lib/common_test/test/ct_config_SUITE.erl5
-rw-r--r--lib/common_test/test/ct_config_info_SUITE.erl14
-rw-r--r--lib/common_test/test/ct_cover_SUITE.erl312
-rw-r--r--lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl156
-rw-r--r--lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore0
-rw-r--r--lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl4
-rw-r--r--lib/common_test/test/ct_error_SUITE.erl446
-rw-r--r--lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl12
-rw-r--r--lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl258
-rw-r--r--lib/common_test/test/ct_group_leader_SUITE.erl181
-rw-r--r--lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl252
-rw-r--r--lib/common_test/test/ct_groups_search_SUITE.erl1245
-rw-r--r--lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_1_SUITE.erl83
-rw-r--r--lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_2_SUITE.erl102
-rw-r--r--lib/common_test/test/ct_master_SUITE.erl57
-rw-r--r--lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl9
-rw-r--r--lib/common_test/test/ct_netconfc_SUITE.erl2
-rw-r--r--lib/common_test/test/ct_snmp_SUITE.erl141
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg44
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl395
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf7
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf2
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf1
-rw-r--r--lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf6
-rw-r--r--lib/common_test/test/ct_surefire_SUITE.erl351
-rw-r--r--lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl92
-rw-r--r--lib/common_test/test/ct_system_error_SUITE.erl132
-rw-r--r--lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl122
-rw-r--r--lib/common_test/test/ct_test_support.erl94
-rw-r--r--lib/common_test/test/ct_testspec_1_SUITE.erl108
-rw-r--r--lib/common_test/vsn.mk2
62 files changed, 6321 insertions, 847 deletions
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml
index b6d4a633cb..151159ad69 100644
--- a/lib/common_test/doc/src/common_test_app.xml
+++ b/lib/common_test/doc/src/common_test_app.xml
@@ -4,7 +4,7 @@
<erlref>
<header>
<copyright>
- <year>2003</year><year>2012</year>
+ <year>2003</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -170,7 +170,9 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v>
+ <v> CTHs = [CTHModule |</v>
+ <v>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs} |</v>
+ <v>&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
@@ -297,8 +299,9 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} |
- {CTHModule, CTHInitArgs, CTHPriority}]</v>
+ <v> CTHs = [CTHModule |</v>
+ <v> &nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs} |</v>
+ <v> &nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;&nbsp;{CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
diff --git a/lib/common_test/doc/src/cover_chapter.xml b/lib/common_test/doc/src/cover_chapter.xml
index 803a71de07..4fa92d5583 100644
--- a/lib/common_test/doc/src/cover_chapter.xml
+++ b/lib/common_test/doc/src/cover_chapter.xml
@@ -108,6 +108,33 @@
specifications</seealso>).</p>
</section>
+ <marker id="cover_stop"></marker>
+ <section>
+ <title>Stopping the cover tool when tests are completed</title>
+ <p>By default the Cover tool is automatically stopped when the
+ tests are completed. This causes the original (non cover
+ compiled) modules to be loaded back in to the test node. If a
+ process at this point is still running old code of any of the
+ modules that are cover compiled, meaning that it has not done
+ any fully qualified function call after the cover compilation,
+ the process will now be killed. To avoid this it is possible to
+ set the value of the <c>cover_stop</c> option to
+ <c>false</c>. This means that the modules will stay cover
+ compiled, and it is therefore only recommended if the erlang
+ node(s) under test is terminated after the test is completed
+ or if cover can be manually stopped.</p>
+
+ <p>The option can be set by using the <c>-cover_stop</c> flag with
+ <c>ct_run</c>, by adding <c>{cover_stop,true|false}</c> to the
+ Opts argument to <c><seealso
+ marker="ct#run_test-1">ct:run_test/1</seealso></c>, or by adding
+ a <c>cover_stop</c> term in your test specification (see chapter
+ about <seealso
+ marker="run_test_chapter#test_specifications">test
+ specifications</seealso>).</p>
+
+ </section>
+
<section>
<title>The cover specification file</title>
<p>These are the terms allowed in a cover specification file:</p>
@@ -148,6 +175,11 @@
%% Specific modules to exclude in cover.
{excl_mods, Mods}.
+
+ %% Cross cover compilation
+ %% Tag = atom(), an identifier for a test run
+ %% Mod = [atom()], modules to compile for accumulated analysis
+ {cross,[{Tag,Mods}]}.
</pre>
<p>The <c>incl_dirs_r</c> and <c>excl_dirs_r</c> terms tell Common
@@ -163,6 +195,81 @@
specification file for Common Test).</p>
</section>
+ <marker id="cross_cover"/>
+ <section>
+ <title>Cross cover analysis</title>
+ <p>The cross cover mechanism allows cover analysis of modules
+ across multiple tests. It is useful if some code, e.g. a library
+ module, is used by many different tests and the accumulated cover
+ result is desirable.</p>
+
+ <p>This can of course also be achieved in a more customized way by
+ using the <c>export</c> parameter in the cover specification and
+ analysing the result off line, but the cross cover mechanism is a
+ build in solution which also provides the logging.</p>
+
+ <p>The mechanism is easiest explained via an example:</p>
+
+ <p>Let's say that there are two systems, <c>s1</c> and <c>s2</c>,
+ which are tested in separate test runs. System <c>s1</c> contains
+ a library module <c>m1</c> which is tested by the <c>s1</c> test
+ run and is included in <c>s1</c>'s cover specification:</p>
+
+<code type="none">
+s1.cover:
+ {incl_mods,[m1]}.</code>
+
+ <p>When analysing code coverage, the result for <c>m1</c> can be
+ seen in the cover log in the <c>s1</c> test result.</p>
+
+ <p>Now, let's imagine that since <c>m1</c> is a library module, it
+ is also used quite a bit by system <c>s2</c>. The <c>s2</c> test
+ run does not specifically test <c>m1</c>, but it might still be
+ interesting to see which parts of <c>m1</c> is actually covered by
+ the <c>s2</c> tests. To do this, <c>m1</c> could be included also
+ in <c>s2</c>'s cover specification:</p>
+
+<code type="none">
+s2.cover:
+ {incl_mods,[m1]}.</code>
+
+ <p>This would give an entry for <c>m1</c> also in the cover log
+ for the <c>s2</c> test run. The problem is that this would only
+ reflect the coverage by <c>s2</c> tests, not the accumulated
+ result over <c>s1</c> and <c>s2</c>. And this is where the cross
+ cover mechanism comes in handy.</p>
+
+ <p>If instead the cover specification for <c>s2</c> was like
+ this:</p>
+
+<code type="none">
+s2.cover:
+ {cross,[{s1,[m1]}]}.</code>
+
+ <p>then <c>m1</c> would be cover compiled in the <c>s2</c> test
+ run, but not shown in the coverage log. Instead, if
+ <c>ct_cover:cross_cover_analyse/2</c> is called after both
+ <c>s1</c> and <c>s2</c> test runs are completed, the accumulated
+ result for <c>m1</c> would be available in the cross cover log for
+ the <c>s1</c> test run.</p>
+
+ <p>The call to the analyse function must be like this:</p>
+
+<code type="none">
+ct_cover:cross_cover_analyse(Level, [{s1,S1LogDir},{s2,S2LogDir}]).</code>
+
+ <p>where <c>S1LogDir</c> and <c>S2LogDir</c> are the directories
+ named <c>&lt;TestName&gt;.logs</c> for each test respectively.</p>
+
+ <p>Note the tags <c>s1</c> and <c>s2</c> which are used in the
+ cover specification file and in the call to
+ <c>ct_cover:cross_cover_analyse/2</c>. The point of these are only
+ to map the modules specified in the cover specification to the log
+ directory specified in the call to the analyse function. The name
+ of the tag has no meaning beyond this.</p>
+
+ </section>
+
<section>
<title>Logging</title>
<p>To view the result of a code coverage test, follow the
@@ -170,6 +277,11 @@
takes you to the code coverage overview page. If you have
successfully performed a detailed coverage analysis, you
find links to each individual module coverage page here.</p>
+
+ <p>If cross cover analysis has been performed, and there are
+ accumulated coverage results for the current test, then the -
+ "Coverdata collected over all tests" link will take you to these
+ results.</p>
</section>
</chapter>
diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml
index 86237f5fc1..fe871eb516 100644
--- a/lib/common_test/doc/src/ct_hooks_chapter.xml
+++ b/lib/common_test/doc/src/ct_hooks_chapter.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2011</year><year>2012</year>
+ <year>2011</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -439,14 +439,14 @@ terminate(State) ->
<table>
<row>
- <cell><em>CTH Name</em></cell>
- <cell><em>Is Built-in</em></cell>
- <cell><em>Description</em></cell>
+ <cell align="left"><em>CTH Name</em></cell>
+ <cell align="left"><em>Is Built-in</em></cell>
+ <cell align="left"><em>Description</em></cell>
</row>
<row>
- <cell>cth_log_redirect</cell>
- <cell>yes</cell>
- <cell>Captures all error_logger and SASL logging events and prints them
+ <cell align="left">cth_log_redirect</cell>
+ <cell align="left">yes</cell>
+ <cell align="left">Captures all error_logger and SASL logging events and prints them
to the current test case log. If an event can not be associated with a
testcase it will be printed in the common test framework log. This will
happen for testcases which are run in parallel and events which occur
@@ -455,14 +455,29 @@ terminate(State) ->
using the normal SASL mechanisms. </cell>
</row>
<row>
- <cell>cth_surefire</cell>
- <cell>no</cell>
- <cell>Captures all test results and outputs them as surefire XML into
- a file. The file which is created is by default called junit_report.xml.
- The name can be by setting the path option for this hook. e.g.
+ <cell align="left">cth_surefire</cell>
+ <cell align="left">no</cell>
+ <cell align="left"><p>Captures all test results and outputs them as surefire
+ XML into a file. The file which is created is by default
+ called junit_report.xml. The file name can be changed by
+ setting the <c>path</c> option for this hook, e.g.</p>
+
<code>-ct_hooks cth_surefire [{path,"/tmp/report.xml"}]</code>
- Surefire XML can forinstance be used by Jenkins to display test
- results.</cell>
+
+ <p>If the <c>url_base</c> option is set, an additional
+ attribute named <c>url</c> will be added to each
+ <c>testsuite</c> and <c>testcase</c> XML element. The value will
+ be constructed from the <c>url_base</c> and a relative path
+ to the test suite or test case log respectively, e.g.</p>
+
+ <code>-ct_hooks cth_surefire [{url_base, "http://myserver.com/"}]</code>
+ <p>will give a url attribute value similar to</p>
+
+ <code>"http://myserver.com/[email protected]_11.19.39/
+x86_64-unknown-linux-gnu.my_test.logs/run.2012-12-12_11.19.39/suite.log.html"</code>
+
+ <p>Surefire XML can for instance be used by Jenkins to display test
+ results.</p></cell>
</row>
</table>
diff --git a/lib/common_test/doc/src/ct_run.xml b/lib/common_test/doc/src/ct_run.xml
index 9cc5495af7..0750f560b3 100644
--- a/lib/common_test/doc/src/ct_run.xml
+++ b/lib/common_test/doc/src/ct_run.xml
@@ -90,7 +90,7 @@
<pre>
ct_run [-dir TestDir1 TestDir2 .. TestDirN] |
[[-dir TestDir] -suite Suite1 Suite2 .. SuiteN
- [[-group Group1 Group2 .. GroupN] [-case Case1 Case2 .. CaseN]]]
+ [[-group Groups1 Groups2 .. GroupsN] [-case Case1 Case2 .. CaseN]]]
[-step [config | keep_inactive]]
[-config ConfigFile1 ConfigFile2 .. ConfigFileN]
[-userconfig CallbackModule1 ConfigString1 and CallbackModule2
@@ -104,6 +104,7 @@
[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]
[-stylesheet CSSFile]
[-cover CoverCfgFile]
+ [-cover_stop Bool]
[-event_handler EvHandler1 EvHandler2 .. EvHandlerN] |
[-event_handler_init EvHandler1 InitArg1 and
EvHandler2 InitArg2 and .. EvHandlerN InitArgN]
@@ -138,6 +139,7 @@
[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]
[-stylesheet CSSFile]
[-cover CoverCfgFile]
+ [-cover_stop Bool]
[-event_handler EvHandler1 EvHandler2 .. EvHandlerN] |
[-event_handler_init EvHandler1 InitArg1 and
EvHandler2 InitArg2 and .. EvHandlerN InitArgN]
diff --git a/lib/common_test/doc/src/notes.xml b/lib/common_test/doc/src/notes.xml
index abe8cb2041..8c3b13951d 100644
--- a/lib/common_test/doc/src/notes.xml
+++ b/lib/common_test/doc/src/notes.xml
@@ -32,6 +32,150 @@
<file>notes.xml</file>
</header>
+<section><title>Common_Test 1.6.3.1</title>
+
+ <section><title>Known Bugs and Problems</title>
+ <list>
+ <item>
+ <p>
+ The following corrections/changes are done in the
+ cth_surefire hook:</p>
+ <p>
+ <list> <item> Earlier there would always be a
+ 'properties' element under the 'testsuites' element. This
+ would exist even if there were no 'property' element
+ inside it. This has been changed so if there are no
+ 'property' elements to display, then there will not be a
+ 'properties' element either. </item> <item> The XML file
+ will now (unless other is specified) be stored in the top
+ log directory. Earlier, the default directory would be
+ the current working directory for the erlang node, which
+ would mostly, but not always, be the top log directory.
+ </item> <item> The 'hostname' attribute in the
+ 'testsuite' element would earlier never have the correct
+ value. This has been corrected. </item> <item> The
+ 'errors' attribute in the 'testsuite' element would
+ earlier display the number of failed testcases. This has
+ been changed and will now always have the value 0, while
+ the 'failures' attribute will show the number of failed
+ testcases. </item> <item> A new attribute 'skipped' is
+ added to the 'testsuite' element. This will display the
+ number of skipped testcases. These would earlier be
+ included in the number of failed test cases. </item>
+ <item> The total number of tests displayed by the 'tests'
+ attribute in the 'testsuite' element would earlier
+ include init/end_per_suite and init/end_per_group. This
+ is no longer the case. The 'tests' attribute will now
+ only count "real" test cases. </item> <item> Earlier,
+ auto skipped test cases would have no value in the 'log'
+ attribute. This is now corrected. </item> <item> A new
+ attributes 'log' is added to the 'testsuite' element.
+ </item> <item> A new option named 'url_base' is added for
+ this hook. If this option is used, a new attribute named
+ 'url' will be added to the 'testcase' and 'testsuite'
+ elements. </item> </list></p>
+ <p>
+ Own Id: OTP-10589</p>
+ </item>
+ </list>
+ </section>
+
+</section>
+
+<section><title>Common_Test 1.6.3</title>
+
+ <section><title>Fixed Bugs and Malfunctions</title>
+ <list>
+ <item>
+ <p>
+ The ct:run_test/1 option 'config' only worked with a
+ single config file, not a list of files. This has been
+ fixed.</p>
+ <p>
+ Own Id: OTP-10495</p>
+ </item>
+ <item>
+ <p>
+ ct_netconfc:close_session sometimes returned
+ {error,closed} because the ssh connection was closed
+ (from the server side) before the rpc-reply was received
+ by the client. This is normal and can not be helped. It
+ has been corrected so the return will be 'ok' in this
+ case. Other error situations will still give
+ {error,Reason}.</p>
+ <p>
+ Own Id: OTP-10510 Aux Id: kunagi-320 [231] </p>
+ </item>
+ <item>
+ <p>
+ ct_netconfc:close_session sometimes returned
+ {error,closed} or (if the connection was named)
+ {error,{process_down,Pid,normal}} because the ssh
+ connection was closed (from the server side) before the
+ rpc-reply was received by the client. This is normal and
+ can not be helped. It has been corrected so the return
+ will be 'ok' in this situation.</p>
+ <p>
+ Own Id: OTP-10570</p>
+ </item>
+ <item>
+ <p>
+ Fix bug where ct:require of same name with same config
+ would return name_in_use.</p>
+ <p>
+ Own Id: OTP-10572</p>
+ </item>
+ </list>
+ </section>
+
+
+ <section><title>Improvements and New Features</title>
+ <list>
+ <item>
+ <p>
+ A new test case group search functionality has been
+ implemented that makes Common Test search automatically
+ through the group definitions tree (the return value of
+ groups/0) and create tests for all paths of nested groups
+ that match the specification. It also allows for
+ specifying unique paths to sub groups in order to avoid
+ execution of unwanted tests. This new feature can be used
+ whenever starting a test run by means of the ct_run
+ program, the ct:run_test/1 API function, or a Test
+ Specification. Details can be found in the Test Case
+ Group Execution section in the Running Tests chapter.</p>
+ <p>
+ Own Id: OTP-10466 Aux Id: kunagi-276 [187] </p>
+ </item>
+ </list>
+ </section>
+
+
+ <section><title>Known Bugs and Problems</title>
+ <list>
+ <item>
+ <p>
+ Restore Config data if lost when test case fails.</p>
+ <p>
+ Own Id: OTP-10070 Aux Id: kunagi-175 [86] </p>
+ </item>
+ <item>
+ <p>
+ IO server error in test_server.</p>
+ <p>
+ Own Id: OTP-10125 Aux Id: OTP-10101, kunagi-177 [88] </p>
+ </item>
+ <item>
+ <p>
+ Faulty connection handling in common_test.</p>
+ <p>
+ Own Id: OTP-10126 Aux Id: kunagi-178 [89] </p>
+ </item>
+ </list>
+ </section>
+
+</section>
+
<section><title>Common_Test 1.6.2.1</title>
<section><title>Fixed Bugs and Malfunctions</title>
diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml
index ea62df27cc..d5f5d89e05 100644
--- a/lib/common_test/doc/src/run_test_chapter.xml
+++ b/lib/common_test/doc/src/run_test_chapter.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2003</year><year>2012</year>
+ <year>2003</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -119,7 +119,7 @@
<item><c><![CDATA[ct_run -userconfig <callbackmodulename> <configfilenames> -suite <suiteswithfullpath>]]></c>
</item>
<item><c><![CDATA[ct_run -config <configfilenames> -suite <suitewithfullpath>
- -group <groupnames> -case <casenames>]]></c></item>
+ -group <groups> -case <casenames>]]></c></item>
</list>
<p>Examples:</p>
<p><c>$ ct_run -config $CFGS/sys1.cfg $CFGS/sys2.cfg -dir $SYS1_TEST $SYS2_TEST</c></p>
@@ -137,6 +137,8 @@
<p><c>$ ct_run -suite ./testdir/x_SUITE ./testdir/y_SUITE</c></p>
+ <p>For more details on <seealso marker="run_test_chapter#group_execution">test case group execution</seealso>, please see below.</p>
+
<p>Other flags that may be used with <c>ct_run</c>:</p>
<list>
<item><c><![CDATA[-logdir <dir>]]></c>, specifies where the HTML log files are to be written.</item>
@@ -153,6 +155,8 @@
<item><c><![CDATA[-stylesheet <css_file>]]></c>, points out a user HTML style sheet (see below).</item>
<item><c><![CDATA[-cover <cover_cfg_file>]]></c>, to perform code coverage test (see
<seealso marker="cover_chapter#cover">Code Coverage Analysis</seealso>).</item>
+ <item><c><![CDATA[-cover_stop <bool>]]></c>, to specify if the cover tool shall be stopped after the test is completed (see
+ <seealso marker="cover_chapter#cover_stop">Code Coverage Analysis</seealso>).</item>
<item><c><![CDATA[-event_handler <event_handlers>]]></c>, to install
<seealso marker="event_handler_chapter#event_handling">event handlers</seealso>.</item>
<item><c><![CDATA[-event_handler_init <event_handlers>]]></c>, to install
@@ -267,6 +271,163 @@
<c><seealso marker="ct#run_test-1">ct</seealso></c> manual page.</p>
</section>
+ <marker id="group_execution"></marker>
+ <section>
+ <title>Test case group execution</title>
+
+ <p>With the <c>ct_run</c> flag, or <c>ct:run_test/1</c> option <c>group</c>,
+ one or more test case groups can be specified, optionally in combination
+ with specific test cases. The syntax for specifying groups is as follows
+ (on the command line):</p>
+
+ <pre>
+ <![CDATA[$ ct_run -group <group_names_or_paths> [-case <cases>]]]></pre>
+ <p>or (in the Erlang shell):</p>
+ <pre>
+ <![CDATA[1> ct:run_test([{group,GroupsNamesOrPaths}, {case,Cases}]).]]></pre>
+
+ <p>The <c>group_names_or_paths</c> parameter specifies either one
+ or more group names and/or one or more group paths. At start up,
+ Common Test will search for matching groups in the group definitions
+ tree (i.e. the list returned from <c>Suite:groups/0</c>, please see the
+ <seealso marker="write_test_chapter#test_case_groups">Test case groups</seealso>
+ chapter for details).
+ Given a group name, say <c>g</c>, Common Test will search for all paths
+ that lead to <c>g</c>. By path here we mean a sequence of nested groups,
+ all of which have to be followed in order to get from the top level
+ group to <c>g</c>. Actually, what Common Test needs to do in order to
+ execute the test cases in group <c>g</c>, is to call the
+ <c>init_per_group/2</c> function for each group in the path to
+ <c>g</c>, as well as all corresponding <c>end_per_group/2</c>
+ functions afterwards. The obvious reason for this is that the configuration
+ of a test case in <c>g</c> (and its <c>Config</c> input data) depends on
+ <c>init_per_testcase(TestCase, Config)</c> and its return value, which
+ in turn depends on <c>init_per_group(g, Config)</c> and its return value,
+ which in turn depends on <c>init_per_group/2</c> of the group above
+ <c>g</c>, etc, all the way up to the top level group.</p>
+
+ <p>As you may have already realized, this means that if there is more than
+ one way to locate a group (and its test cases) in a path, the result of the
+ group search operation is a number of tests, all of which will be performed.
+ Common Test actually interprets a group specification that consists of a
+ single name this way:</p>
+
+ <p>"Search and find all paths in the group definitions tree that lead
+ to the specified group and, for each path, create a test which (1) executes
+ all configuration functions in the path to the specified group, then (2)
+ executes all - or all matching - test cases in this group, as well as (3)
+ all - or all matching - test cases in all sub groups of the group".
+ </p>
+
+ <p>It is also possible for the user to specify a specific group path with
+ the <c>group_names_or_paths</c> parameter. With this type of specification it's
+ possible to avoid execution of unwanted groups (in otherwise matching paths),
+ and/or the execution of sub groups. The syntax of the group path is a list of
+ group names in the path, e.g. on the command line:
+ </p>
+ <p><c>$ ct_run -suite "./x_SUITE" -group [g1,g3,g4] -case tc1 tc5</c></p>
+ <p>or similarly in the Erlang shell (requires a list within the groups list):</p>
+ <p><c>1> ct:run_test([{suite,"./x_SUITE"}, {group,[[g1,g3,g4]]}, {testcase,[tc1,tc5]}]).</c></p>
+
+ <p>The last group in the specified path will be the terminating group in
+ the test, i.e. no sub groups following this group will be executed. In the
+ example above, <c>g4</c> is the terminating group, hence Common Test will
+ execute a test that calls all init configuration functions in the path to
+ <c>g4</c>, i.e. <c>g1..g3..g4</c>. It will then call test cases <c>tc1</c>
+ and <c>tc5</c> in <c>g4</c> and finally all end configuration functions in order
+ <c>g4..g3..g1</c>.</p>
+
+ <p>Note that the group path specification doesn't necessarily
+ have to include <em>all</em> groups in the path to the terminating group.
+ Common Test will search for all matching paths if given an incomplete group
+ path.</p>
+
+ <p>Note also that it's possible to combine group names and group paths with the
+ <c>group_names_or_paths</c> parameter. Each element is treated as
+ an individual specification in combination with the <c>cases</c> parameter.
+ See examples below.</p>
+
+ <p>Examples:</p>
+ <pre>
+ -module(x_SUITE).
+ ...
+ %% The group definitions:
+ groups() ->
+ [{top1,[],[tc11,tc12,
+ {sub11,[],[tc12,tc13]},
+ {sub12,[],[tc14,tc15,
+ {sub121,[],[tc12,tc16]}]}]},
+
+ {top2,[],[{group,sub21},{group,sub22}]},
+ {sub21,[],[tc21,{group,sub2X2}]},
+ {sub22,[],[{group,sub221},tc21,tc22,{group,sub2X2}]},
+ {sub221,[],[tc21,tc23]},
+ {sub2X2,[],[tc21,tc24]}].
+ </pre>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group all</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,all}]).</c></p>
+ <p>Two tests will be executed, one for all cases and all sub groups under <c>top1</c>,
+ and one for all under <c>top2</c>. (We would get the same result with
+ <c>-group top1 top2</c>, or <c>{group,[top1,top2]}</c>.</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group top1</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[top1]}]).</c></p>
+ <p>This will execute one test for all cases and sub groups under <c>top1</c>.</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group top1 -case tc12</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[top1]}, {testcase,[tc12]}]).</c></p>
+ <p>This will run a test that executes <c>tc12</c> in <c>top1</c> and any sub group
+ under <c>top1</c> where it can be found (<c>sub11</c> and <c>sub121</c>).</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group [top1] -case tc12</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[[top1]]}, {testcase,[tc12]}]).</c></p>
+ <p>This will execute <c>tc12</c> <em>only</em> in group <c>top1</c>.</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group top1 -case tc16</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[top1]}, {testcase,[tc16]}]).</c></p>
+ <p>This will search <c>top1</c> and all its sub groups for <c>tc16</c> and the result
+ will be that this test case executes in group <c>sub121</c>. (The specific path:
+ <c>-group [sub121]</c> or <c>{group,[[sub121]]}</c>, would have given
+ us the same result in this example).</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group sub12 [sub12]</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[sub12,[sub12]]}]).</c></p>
+ <p>This will execute two tests, one that includes all cases and sub groups under
+ <c>sub12</c>, and one with <em>only</em> the test cases in <c>sub12</c>.</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group sub2X2</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[sub2X2]}]).</c></p>
+ <p>In this example, Common Test will find and execute two tests, one for the path from
+ <c>top2</c> to <c>sub2X2</c> via <c>sub21</c>, and one from <c>top2</c> to <c>sub2X2</c>
+ via <c>sub22</c>.</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group [sub21,sub2X2]</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[[sub21,sub2X2]]}]).</c></p>
+ <p>Here, by specifying the unique path: <c>top2 -> sub21 -> sub2X2</c>, only one test
+ is executed. The second possible path from <c>top2</c> to <c>sub2X2</c> (above)
+ will be discarded.</p>
+ <br></br>
+ <p><c>$ ct_run -suite "x_SUITE" -group [sub22] -case tc22 tc21</c></p>
+ <p><c>1> ct:run_test([{suite,"x_SUITE"}, {group,[[sub22]]}, {testcase,[tc22,tc21]}]).</c></p>
+ <p>In this example only the test cases for <c>sub22</c> will be executed, and in
+ reverse order compared to the group definition.</p>
+ <br></br>
+
+ <p>If a test case that belongs to a group (according to the group definition), is executed
+ without a group specification, i.e. simply by means of (command line):</p>
+ <p><c>$ ct_run -suite "my_SUITE" -case my_tc</c></p>
+ <p>or (Erlang shell):</p>
+ <p><c>1> ct:run_test([{suite,"my_SUITE"}, {testcase,my_tc}]).</c></p>
+ <p>then Common Test ignores the group definition and executes the test case in the scope of the
+ test suite only (no group configuration functions are called).</p>
+
+ <p>The group specification feature, exactly as it has been presented in this section, can also
+ be used in <seealso marker="run_test_chapter#test_specifications">Test
+ Specifications</seealso> (with some extra features added). Please see below.</p>
+ </section>
+
+
<section>
<title>Running the interactive shell mode</title>
@@ -398,8 +559,8 @@
terms (e.g. log directory, label, style sheet, auto compilation).</p>
<p>With test specification terms it is possible to state exactly
which tests should run and in which order. A test term specifies
- either one or more suites, one or more test case groups, or one
- or more test cases in a group or suite.</p>
+ either one or more suites, one or more test case groups (possibly nested),
+ or one or more test cases in a group (or in multiple groups) or in a suite.</p>
<p>An arbitrary number of test terms may be declared in sequence.
Common Test will by default compile the terms into one or more tests
to be performed in one resulting test run. Note that a term that
@@ -418,28 +579,32 @@
are not executed and show up in the HTML log files as
SKIPPED.</p>
<p>When a test case group is specified, the resulting test
- executes the
- <c>init_per_group</c> function, followed by all test cases and
- sub groups (including their configuration functions), and
+ executes the <c>init_per_group</c> function, followed by all test
+ cases and sub groups (including their configuration functions), and
finally the <c>end_per_group</c> function. Also if particular
test cases in a group are specified, <c>init_per_group</c>
and <c>end_per_group</c> for the group in question are
called. If a group which is defined (in <c>Suite:group/0</c>) to
- be a sub group of another group, is specified (or particular test
+ be a sub group of another group, is specified (or if particular test
cases of a sub group are), Common Test will call the configuration
functions for the top level groups as well as for the sub group
in question (making it possible to pass configuration data all
the way from <c>init_per_suite</c> down to the test cases in the
sub group).</p>
-
- <p>With the <c>GroupSpec</c> element (below) it's possible to specify
- group execution properties that will override those specified in the
+ <p>The test specification utilizes the same mechanism for specifying
+ test case groups by means of names and paths, as explained in the
+ <seealso marker="run_test_chapter#group_execution">Group Execution</seealso>
+ section above, with the addition of the <c>GroupSpec</c> element
+ described next.</p>
+ <p>The <c>GroupSpec</c> element makes it possible to specify
+ group execution properties that will override those in the
group definition (i.e. in <c>groups/0</c>). Execution properties for
sub-groups may be overridden as well. This feature makes it possible to
change properties of groups at the time of execution,
- without even having to edit the test suite. More detailed documentation,
- and examples, can be found in the
- <seealso marker="write_test_chapter#test_case_groups">
+ without even having to edit the test suite. The very same
+ feature is available for <c>group</c> elements in the <c>Suite:all/0</c>
+ list. Therefore, more detailed documentation, and examples, can be
+ found in the <seealso marker="write_test_chapter#test_case_groups">
Test case groups</seealso> chapter.</p>
<p>Below is the test specification syntax. Test specifications can
@@ -495,6 +660,9 @@
{cover, CoverSpecFile}.
{cover, NodeRefs, CoverSpecFile}.
+ {cover_stop, Bool}.
+ {cover_stop, NodeRefs, Bool}.
+
{include, IncludeDirs}.
{include, NodeRefs, IncludeDirs}.
@@ -541,8 +709,8 @@
{groups, Dir, Suite, Groups}.
{groups, NodeRefs, Dir, Suite, Groups}.
- {groups, Dir, Suite, GroupSpec, {cases,Cases}}.
- {groups, NodeRefs, Dir, Suite, GroupSpec, {cases,Cases}}.
+ {groups, Dir, Suite, Groups, {cases,Cases}}.
+ {groups, NodeRefs, Dir, Suite, Groups, {cases,Cases}}.
{cases, Dir, Suite, Cases}.
{cases, NodeRefs, Dir, Suite, Cases}.
@@ -584,13 +752,16 @@
PrivDirOption = auto_per_run | auto_per_tc | manual_per_tc
EventHandlers = atom() | [atom()]
InitArgs = [term()]
- CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]
+ CTHModules = [CTHModule |
+ {CTHModule, CTHInitArgs} |
+ {CTHModule, CTHInitArgs, CTHPriority}]
CTHModule = atom()
CTHInitArgs = term()
Dir = string()
Suites = atom() | [atom()] | all
Suite = atom()
- Groups = GroupSpec | [GroupSpec] | all
+ Groups = GroupPath | [GroupPath] | GroupSpec | [GroupSpec] | all
+ GroupPath = [GroupName]
GroupSpec = GroupName | {GroupName,Properties} | {GroupName,Properties,GroupSpec}
GroupName = atom()
GroupNames = GroupName | [GroupName]
diff --git a/lib/common_test/doc/src/write_test_chapter.xml b/lib/common_test/doc/src/write_test_chapter.xml
index 248d7de8b6..cc8d913994 100644
--- a/lib/common_test/doc/src/write_test_chapter.xml
+++ b/lib/common_test/doc/src/write_test_chapter.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2003</year><year>2012</year>
+ <year>2003</year><year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -982,38 +982,36 @@
<p>Example:</p>
<pre>
+ Some printouts during test case execution:
- Some printouts during test case execution:
+ io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]),
+ ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]),
+ ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]),
+ ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]),
+ ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]),
+ ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]),
- io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]),
- ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]),
- ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]),
- ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]),
- ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]),
- ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]),
+ If starting the test without specifying any verbosity levels:
- If starting the test without specifying any verbosity levels:
+ $ ct_run ...
- $ ct_run ...
+ the following gets printed:
- the following gets printed:
-
- 1. Standard IO, importance = 50
- 2. Uncategorized, importance = 50
- 3. Categorized info, importance = 50
- 5. Categorized error, importance = 75
- 6. Categorized error, importance = 99
-
- If starting the test with:
-
- $ ct_run -verbosity 1 and info 75
-
- the following gets printed:
+ 1. Standard IO, importance = 50
+ 2. Uncategorized, importance = 50
+ 3. Categorized info, importance = 50
+ 5. Categorized error, importance = 75
+ 6. Categorized error, importance = 99
+
+ If starting the test with:
+
+ $ ct_run -verbosity 1 and info 75
+
+ the following gets printed:
- 3. Categorized info, importance = 50
- 4. Categorized info, importance = 25
- 6. Categorized error, importance = 99
- </pre>
+ 3. Categorized info, importance = 50
+ 4. Categorized info, importance = 25
+ 6. Categorized error, importance = 99</pre>
<p>How categories can be mapped to CSS tags is documented in the
<seealso marker="run_test_chapter#html_stylesheet">Running Tests</seealso>
diff --git a/lib/common_test/src/Makefile b/lib/common_test/src/Makefile
index f7dce195d7..dd2923ece9 100644
--- a/lib/common_test/src/Makefile
+++ b/lib/common_test/src/Makefile
@@ -73,7 +73,8 @@ MODULES= \
cth_surefire \
ct_netconfc \
ct_conn_log_h \
- cth_conn_log
+ cth_conn_log \
+ ct_groups
TARGET_MODULES= $(MODULES:%=$(EBIN)/%)
BEAM_FILES= $(MODULES:%=$(EBIN)/%.$(EMULATOR))
diff --git a/lib/common_test/src/ct.erl b/lib/common_test/src/ct.erl
index 5014309c0f..8eafdff29f 100644
--- a/lib/common_test/src/ct.erl
+++ b/lib/common_test/src/ct.erl
@@ -148,7 +148,7 @@ run(TestDirs) ->
%%% {config,CfgFiles} | {userconfig, UserConfig} |
%%% {allow_user_terms,Bool} | {logdir,LogDir} |
%%% {silent_connections,Conns} | {stylesheet,CSSFile} |
-%%% {cover,CoverSpecFile} | {step,StepOpts} |
+%%% {cover,CoverSpecFile} | {cover_stop,Bool} | {step,StepOpts} |
%%% {event_handler,EventHandlers} | {include,InclDirs} |
%%% {auto_compile,Bool} | {create_priv_dir,CreatePrivDir} |
%%% {multiply_timetraps,M} | {scale_timetraps,Bool} |
@@ -161,7 +161,8 @@ run(TestDirs) ->
%%% TestDirs = [string()] | string()
%%% Suites = [string()] | [atom()] | string() | atom()
%%% Cases = [atom()] | atom()
-%%% Groups = [atom()] | atom()
+%%% Groups = GroupNameOrPath | [GroupNameOrPath]
+%%% GroupNameOrPath = [atom()] | atom() | all
%%% TestSpecs = [string()] | string()
%%% Label = string() | atom()
%%% CfgFiles = [string()] | string()
@@ -987,8 +988,9 @@ get_testdata(Key) ->
end.
%%%-----------------------------------------------------------------
-%%% @spec abort_current_testcase(Reason) -> ok | {error,no_testcase_running}
+%%% @spec abort_current_testcase(Reason) -> ok | {error,ErrorReason}
%%% Reason = term()
+%%% ErrorReason = no_testcase_running | parallel_group
%%%
%%% @doc <p>When calling this function, the currently executing test case will be aborted.
%%% It is the user's responsibility to know for sure which test case is currently
diff --git a/lib/common_test/src/ct_config.erl b/lib/common_test/src/ct_config.erl
index 06a8e12f55..b1d709bc75 100644
--- a/lib/common_test/src/ct_config.erl
+++ b/lib/common_test/src/ct_config.erl
@@ -171,7 +171,7 @@ process_default_configs(Opts) ->
lists:flatmap(fun({config,[_|_] = FileOrFiles}) ->
case {io_lib:printable_list(FileOrFiles),
io_lib:printable_list(hd(FileOrFiles))} of
- {true,true} ->
+ {false,true} ->
FileOrFiles;
{true,false} ->
[FileOrFiles];
diff --git a/lib/common_test/src/ct_conn_log_h.erl b/lib/common_test/src/ct_conn_log_h.erl
index bf27238121..d7bd18606b 100644
--- a/lib/common_test/src/ct_conn_log_h.erl
+++ b/lib/common_test/src/ct_conn_log_h.erl
@@ -64,10 +64,16 @@ do_open_files([],Acc) ->
handle_event({_Type, GL, _Msg}, State) when node(GL) /= node() ->
{ok, State};
handle_event({_Type,_GL,{Pid,{ct_connection,Action,ConnName},Report}},State) ->
+ %% NOTE: if the format of this event is changed
+ %% ({ct_connection,Action,ConnName}) then remember to change
+ %% test_server_h:report_receiver as well!!!
Info = conn_info(Pid,#conn_log{name=ConnName,action=Action}),
write_report(now(),Info,Report,State),
{ok, State};
handle_event({_Type,_GL,{Pid,Info=#conn_log{},Report}},State) ->
+ %% NOTE: if the format of this event is changed
+ %% (Info=#conn_log{}) then remember to change
+ %% test_server_h:report_receiver as well!!!
write_report(now(),conn_info(Pid,Info),Report,State),
{ok, State};
handle_event({error_report,_,{Pid,_,[{ct_connection,ConnName}|R]}},State) ->
diff --git a/lib/common_test/src/ct_cover.erl b/lib/common_test/src/ct_cover.erl
index d39f50ba00..ae671c750a 100644
--- a/lib/common_test/src/ct_cover.erl
+++ b/lib/common_test/src/ct_cover.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -24,7 +24,7 @@
-module(ct_cover).
--export([get_spec/1, add_nodes/1, remove_nodes/1]).
+-export([get_spec/1, add_nodes/1, remove_nodes/1, cross_cover_analyse/2]).
-include("ct_util.hrl").
@@ -100,6 +100,22 @@ remove_nodes(Nodes) ->
%%%-----------------------------------------------------------------
+%%% @spec cross_cover_analyse(Level,Tests) -> ok
+%%% Level = overview | details
+%%% Tests = [{Tag,Dir}]
+%%% Tag = atom()
+%%% Dir = string()
+%%%
+%%% @doc Accumulate cover results over multiple tests.
+%%% See the chapter about <seealso
+%%% marker="cover_chapter#cross_cover">cross cover
+%%% analysis</seealso> in the users's guide.
+%%%
+cross_cover_analyse(Level,Tests) ->
+ test_server_ctrl:cross_cover_analyse(Level,Tests).
+
+
+%%%-----------------------------------------------------------------
%%% @hidden
%% Read cover specification file and return the parsed info.
@@ -249,9 +265,11 @@ get_app_info(App=#cover{app=Name}, [{excl_mods,Name,Mods1}|Terms]) ->
Mods = App#cover.excl_mods,
get_app_info(App#cover{excl_mods=Mods++Mods1},Terms);
-get_app_info(App=#cover{app=Name}, [{cross_apps,Name,AppMods1}|Terms]) ->
- AppMods = App#cover.cross,
- get_app_info(App#cover{cross=AppMods++AppMods1},Terms);
+get_app_info(App=#cover{app=none}, [{cross,Cross}|Terms]) ->
+ get_app_info(App, [{cross,none,Cross}|Terms]);
+get_app_info(App=#cover{app=Name}, [{cross,Name,Cross1}|Terms]) ->
+ Cross = App#cover.cross,
+ get_app_info(App#cover{cross=Cross++Cross1},Terms);
get_app_info(App=#cover{app=none}, [{src_dirs,Dirs}|Terms]) ->
get_app_info(App, [{src_dirs,none,Dirs}|Terms]);
@@ -354,10 +372,10 @@ remove_excludes_and_dups(CoverData=#cover{excl_mods=Excl,incl_mods=Incl}) ->
files2mods(Info=#cover{excl_mods=ExclFs,
incl_mods=InclFs,
- cross=CrossFs}) ->
+ cross=Cross}) ->
Info#cover{excl_mods=files2mods1(ExclFs),
incl_mods=files2mods1(InclFs),
- cross=files2mods1(CrossFs)}.
+ cross=[{Tag,files2mods1(Fs)} || {Tag,Fs} <- Cross]}.
files2mods1([M|Fs]) when is_atom(M) ->
[M|files2mods1(Fs)];
diff --git a/lib/common_test/src/ct_framework.erl b/lib/common_test/src/ct_framework.erl
index 4d47731239..c1abf27e9f 100644
--- a/lib/common_test/src/ct_framework.erl
+++ b/lib/common_test/src/ct_framework.erl
@@ -32,8 +32,6 @@
-export([error_in_suite/1, init_per_suite/1, end_per_suite/1,
init_per_group/2, end_per_group/2]).
--export([make_all_conf/3, make_conf/5]).
-
-include("ct_event.hrl").
-include("ct_util.hrl").
@@ -876,13 +874,13 @@ get_suite(Mod, all) ->
{'EXIT',_} ->
get_all(Mod, []);
GroupDefs when is_list(GroupDefs) ->
- case catch find_groups(Mod, all, all, GroupDefs) of
+ case catch ct_groups:find_groups(Mod, all, all, GroupDefs) of
{error,_} = Error ->
%% this makes test_server call error_in_suite as first
%% (and only) test case so we can report Error properly
[{?MODULE,error_in_suite,[[Error]]}];
ConfTests ->
- get_all(Mod, ConfTests)
+ get_all(Mod, ConfTests)
end;
_ ->
E = "Bad return value from "++atom_to_list(Mod)++":groups/0",
@@ -901,7 +899,7 @@ get_suite(Mod, Group={conf,Props,_Init,TCs,_End}) ->
{'EXIT',_} ->
[Group];
GroupDefs when is_list(GroupDefs) ->
- case catch find_groups(Mod, Name, TCs, GroupDefs) of
+ case catch ct_groups:find_groups(Mod, Name, TCs, GroupDefs) of
{error,_} = Error ->
%% this makes test_server call error_in_suite as first
%% (and only) test case so we can report Error properly
@@ -916,12 +914,13 @@ get_suite(Mod, Group={conf,Props,_Init,TCs,_End}) ->
%% init/end functions for top groups will be executed
case catch ?val(name, element(2, hd(ConfTests))) of
Name -> % top group
- delete_subs(ConfTests, ConfTests);
+ ct_groups:delete_subs(ConfTests, ConfTests);
_ ->
[]
end;
false ->
- ConfTests1 = delete_subs(ConfTests, ConfTests),
+ ConfTests1 = ct_groups:delete_subs(ConfTests,
+ ConfTests),
case ?val(override, Props) of
undefined ->
ConfTests1;
@@ -930,9 +929,9 @@ get_suite(Mod, Group={conf,Props,_Init,TCs,_End}) ->
ORSpec ->
ORSpec1 = if is_tuple(ORSpec) -> [ORSpec];
true -> ORSpec end,
- search_and_override(ConfTests1,
- ORSpec1, Mod)
- end
+ ct_groups:search_and_override(ConfTests1,
+ ORSpec1, Mod)
+ end
end
end;
_ ->
@@ -976,234 +975,6 @@ get_all_cases1(_, []) ->
%%%-----------------------------------------------------------------
-find_groups(Mod, Name, TCs, GroupDefs) ->
- Found = find(Mod, Name, TCs, GroupDefs, [], GroupDefs, false),
- trim(Found).
-
-find(Mod, all, _TCs, [{Name,Props,Tests} | Gs], Known, Defs, _)
- when is_atom(Name), is_list(Props), is_list(Tests) ->
- cyclic_test(Mod, Name, Known),
- [make_conf(Mod, Name, Props,
- find(Mod, all, all, Tests, [Name | Known], Defs, true)) |
- find(Mod, all, all, Gs, [], Defs, true)];
-
-find(Mod, Name, TCs, [{Name,Props,Tests} | _Gs], Known, Defs, false)
- when is_atom(Name), is_list(Props), is_list(Tests) ->
- cyclic_test(Mod, Name, Known),
- case TCs of
- all ->
- [make_conf(Mod, Name, Props,
- find(Mod, Name, TCs, Tests, [Name | Known], Defs, true))];
- _ ->
- Tests1 = [TC || TC <- TCs,
- lists:member(TC, Tests) == true],
- [make_conf(Mod, Name, Props, Tests1)]
- end;
-
-find(Mod, Name, TCs, [{Name1,Props,Tests} | Gs], Known, Defs, false)
- when is_atom(Name1), is_list(Props), is_list(Tests) ->
- cyclic_test(Mod, Name1, Known),
- [make_conf(Mod,Name1,Props,
- find(Mod, Name, TCs, Tests, [Name1 | Known], Defs, false)) |
- find(Mod, Name, TCs, Gs, [], Defs, false)];
-
-find(Mod, Name, _TCs, [{Name,_Props,_Tests} | _Gs], _Known, _Defs, true)
- when is_atom(Name) ->
- E = "Duplicate groups named "++atom_to_list(Name)++" in "++
- atom_to_list(Mod)++":groups/0",
- throw({error,list_to_atom(E)});
-
-find(Mod, Name, all, [{Name1,Props,Tests} | Gs], Known, Defs, true)
- when is_atom(Name1), is_list(Props), is_list(Tests) ->
- cyclic_test(Mod, Name1, Known),
- [make_conf(Mod, Name1, Props,
- find(Mod, Name, all, Tests, [Name1 | Known], Defs, true)) |
- find(Mod, Name, all, Gs, [], Defs, true)];
-
-find(Mod, Name, TCs, [{group,Name1} | Gs], Known, Defs, Found)
- when is_atom(Name1) ->
- find(Mod, Name, TCs, [expand(Mod, Name1, Defs) | Gs], Known, Defs, Found);
-
-%% Undocumented remote group feature, use with caution
-find(Mod, Name, TCs, [{group, ExtMod, ExtGrp} | Gs], Known, Defs, true)
- when is_atom(ExtMod), is_atom(ExtGrp) ->
- ExternalDefs = ExtMod:groups(),
- ExternalTCs = find(ExtMod, ExtGrp, TCs, [{group, ExtGrp}],
- [], ExternalDefs, false),
- ExternalTCs ++ find(Mod, Name, TCs, Gs, Known, Defs, true);
-
-find(Mod, Name, TCs, [{Name1,Tests} | Gs], Known, Defs, Found)
- when is_atom(Name1), is_list(Tests) ->
- find(Mod, Name, TCs, [{Name1,[],Tests} | Gs], Known, Defs, Found);
-
-find(Mod, Name, TCs, [_TC | Gs], Known, Defs, false) ->
- find(Mod, Name, TCs, Gs, Known, Defs, false);
-
-find(Mod, Name, TCs, [TC | Gs], Known, Defs, true) when is_atom(TC) ->
- [{Mod, TC} | find(Mod, Name, TCs, Gs, Known, Defs, true)];
-
-find(Mod, Name, TCs, [{ExternalTC, Case} = TC | Gs], Known, Defs, true)
- when is_atom(ExternalTC),
- is_atom(Case) ->
- [TC | find(Mod, Name, TCs, Gs, Known, Defs, true)];
-
-find(Mod, _Name, _TCs, [BadTerm | _Gs], Known, _Defs, _Found) ->
- Where = if length(Known) == 0 ->
- atom_to_list(Mod)++":groups/0";
- true ->
- "group "++atom_to_list(lists:last(Known))++
- " in "++atom_to_list(Mod)++":groups/0"
- end,
- Term = io_lib:format("~p", [BadTerm]),
- E = "Bad term "++lists:flatten(Term)++" in "++Where,
- throw({error,list_to_atom(E)});
-
-find(_Mod, _Name, _TCs, [], _Known, _Defs, false) ->
- ['$NOMATCH'];
-
-find(_Mod, _Name, _TCs, [], _Known, _Defs, _Found) ->
- [].
-
-delete_subs([{conf, _,_,_,_} = Conf | Confs], All) ->
- All1 = delete_conf(Conf, All),
- case is_sub(Conf, All1) of
- true ->
- delete_subs(Confs, All1);
- false ->
- delete_subs(Confs, All)
- end;
-delete_subs([_Else | Confs], All) ->
- delete_subs(Confs, All);
-delete_subs([], All) ->
- All.
-
-delete_conf({conf,Props,_,_,_}, Confs) ->
- Name = ?val(name, Props),
- [Conf || Conf = {conf,Props0,_,_,_} <- Confs,
- Name =/= ?val(name, Props0)].
-
-is_sub({conf,Props,_,_,_}=Conf, [{conf,_,_,Tests,_} | Confs]) ->
- Name = ?val(name, Props),
- case lists:any(fun({conf,Props0,_,_,_}) ->
- case ?val(name, Props0) of
- N when N == Name ->
- true;
- _ ->
- false
- end;
- (_) ->
- false
- end, Tests) of
- true ->
- true;
- false ->
- is_sub(Conf, Tests) or is_sub(Conf, Confs)
- end;
-
-is_sub(Conf, [_TC | Tests]) ->
- is_sub(Conf, Tests);
-
-is_sub(_Conf, []) ->
- false.
-
-trim(['$NOMATCH' | Tests]) ->
- trim(Tests);
-
-trim([{conf,Props,Init,Tests,End} | Confs]) ->
- case trim(Tests) of
- [] ->
- trim(Confs);
- Trimmed ->
- [{conf,Props,Init,Trimmed,End} | trim(Confs)]
- end;
-
-trim([TC | Tests]) ->
- [TC | trim(Tests)];
-
-trim([]) ->
- [].
-
-cyclic_test(Mod, Name, Names) ->
- case lists:member(Name, Names) of
- true ->
- E = "Cyclic reference to group "++atom_to_list(Name)++
- " in "++atom_to_list(Mod)++":groups/0",
- throw({error,list_to_atom(E)});
- false ->
- ok
- end.
-
-expand(Mod, Name, Defs) ->
- case lists:keysearch(Name, 1, Defs) of
- {value,Def} ->
- Def;
- false ->
- E = "Invalid group "++atom_to_list(Name)++
- " in "++atom_to_list(Mod)++":groups/0",
- throw({error,list_to_atom(E)})
- end.
-
-make_all_conf(Dir, Mod, _Props) ->
- case code:is_loaded(Mod) of
- false ->
- code:load_abs(filename:join(Dir,atom_to_list(Mod)));
- _ ->
- ok
- end,
- make_all_conf(Mod).
-
-make_all_conf(Mod) ->
- case catch apply(Mod, groups, []) of
- {'EXIT',_} ->
- {error,{invalid_group_definition,Mod}};
- GroupDefs when is_list(GroupDefs) ->
- case catch find_groups(Mod, all, all, GroupDefs) of
- {error,_} = Error ->
- %% this makes test_server call error_in_suite as first
- %% (and only) test case so we can report Error properly
- [{?MODULE,error_in_suite,[[Error]]}];
- [] ->
- {error,{invalid_group_spec,Mod}};
- ConfTests ->
- [{conf,Props,Init,all,End} ||
- {conf,Props,Init,_,End}
- <- delete_subs(ConfTests, ConfTests)]
- end
- end.
-
-make_conf(Dir, Mod, Name, Props, TestSpec) ->
- case code:is_loaded(Mod) of
- false ->
- code:load_abs(filename:join(Dir,atom_to_list(Mod)));
- _ ->
- ok
- end,
- make_conf(Mod, Name, Props, TestSpec).
-
-make_conf(Mod, Name, Props, TestSpec) ->
- case code:is_loaded(Mod) of
- false ->
- code:load_file(Mod);
- _ ->
- ok
- end,
- {InitConf,EndConf,ExtraProps} =
- case erlang:function_exported(Mod,init_per_group,2) of
- true ->
- {{Mod,init_per_group},{Mod,end_per_group},[]};
- false ->
- ct_logs:log("TEST INFO", "init_per_group/2 and "
- "end_per_group/2 missing for group "
- "~p in ~p, using default.",
- [Name,Mod]),
- {{?MODULE,init_per_group},
- {?MODULE,end_per_group},
- [{suite,Mod}]}
- end,
- {conf,[{name,Name}|Props++ExtraProps],InitConf,TestSpec,EndConf}.
-
-%%%-----------------------------------------------------------------
-
get_all(Mod, ConfTests) ->
case catch apply(Mod, all, []) of
{'EXIT',_} ->
@@ -1218,133 +989,24 @@ get_all(Mod, ConfTests) ->
[{?MODULE,error_in_suite,[[{error,What}]]}];
SeqsAndTCs ->
%% expand group references in all() using ConfTests
- case catch expand_groups(SeqsAndTCs, ConfTests, Mod) of
+ case catch ct_groups:expand_groups(SeqsAndTCs,
+ ConfTests,
+ Mod) of
{error,_} = Error ->
[{?MODULE,error_in_suite,[[Error]]}];
Tests ->
- delete_subs(Tests, Tests)
+ ct_groups:delete_subs(Tests, Tests)
end
end;
Skip = {skip,_Reason} ->
Skip;
_ ->
Reason =
- list_to_atom("Bad return value from "++atom_to_list(Mod)++":all/0"),
+ list_to_atom("Bad return value from "++
+ atom_to_list(Mod)++":all/0"),
[{?MODULE,error_in_suite,[[{error,Reason}]]}]
end.
-expand_groups([H | T], ConfTests, Mod) ->
- [expand_groups(H, ConfTests, Mod) | expand_groups(T, ConfTests, Mod)];
-expand_groups([], _ConfTests, _Mod) ->
- [];
-expand_groups({group,Name}, ConfTests, Mod) ->
- expand_groups({group,Name,default,[]}, ConfTests, Mod);
-expand_groups({group,Name,default}, ConfTests, Mod) ->
- expand_groups({group,Name,default,[]}, ConfTests, Mod);
-expand_groups({group,Name,ORProps}, ConfTests, Mod) when is_list(ORProps) ->
- expand_groups({group,Name,ORProps,[]}, ConfTests, Mod);
-expand_groups({group,Name,ORProps,SubORSpec}, ConfTests, Mod) ->
- FindConf =
- fun(Conf = {conf,Props,Init,Ts,End}) ->
- case ?val(name, Props) of
- Name when ORProps == default ->
- [Conf];
- Name ->
- [{conf,[{name,Name}|ORProps],Init,Ts,End}];
- _ ->
- []
- end
- end,
- case lists:flatmap(FindConf, ConfTests) of
- [] ->
- throw({error,invalid_ref_msg(Name, Mod)});
- Matching when SubORSpec == [] ->
- Matching;
- Matching ->
- override_props(Matching, SubORSpec, Name,Mod)
- end;
-expand_groups(SeqOrTC, _ConfTests, _Mod) ->
- SeqOrTC.
-
-%% search deep for the matching conf test and modify it and any
-%% sub tests according to the override specification
-search_and_override([Conf = {conf,Props,Init,Tests,End}], ORSpec, Mod) ->
- Name = ?val(name, Props),
- case lists:keysearch(Name, 1, ORSpec) of
- {value,{Name,default}} ->
- [Conf];
- {value,{Name,ORProps}} ->
- [{conf,[{name,Name}|ORProps],Init,Tests,End}];
- {value,{Name,default,[]}} ->
- [Conf];
- {value,{Name,default,SubORSpec}} ->
- override_props([Conf], SubORSpec, Name,Mod);
- {value,{Name,ORProps,SubORSpec}} ->
- override_props([{conf,[{name,Name}|ORProps],
- Init,Tests,End}], SubORSpec, Name,Mod);
- _ ->
- [{conf,Props,Init,search_and_override(Tests,ORSpec,Mod),End}]
- end.
-
-%% Modify the Tests element according to the override specification
-override_props([{conf,Props,Init,Tests,End} | Confs], SubORSpec, Name,Mod) ->
- {Subs,SubORSpec1} = override_sub_props(Tests, [], SubORSpec, Mod),
- [{conf,Props,Init,Subs,End} | override_props(Confs, SubORSpec1, Name,Mod)];
-override_props([], [], _,_) ->
- [];
-override_props([], SubORSpec, Name,Mod) ->
- Es = [invalid_ref_msg(Name, element(1,Spec), Mod) || Spec <- SubORSpec],
- throw({error,Es}).
-
-override_sub_props([], New, ORSpec, _) ->
- {?rev(New),ORSpec};
-override_sub_props([T = {conf,Props,Init,Tests,End} | Ts],
- New, ORSpec, Mod) ->
- Name = ?val(name, Props),
- case lists:keysearch(Name, 1, ORSpec) of
- {value,Spec} -> % group found in spec
- Props1 =
- case element(2, Spec) of
- default -> Props;
- ORProps -> [{name,Name} | ORProps]
- end,
- case catch element(3, Spec) of
- Undef when Undef == [] ; 'EXIT' == element(1, Undef) ->
- override_sub_props(Ts, [{conf,Props1,Init,Tests,End} | New],
- lists:keydelete(Name, 1, ORSpec), Mod);
- SubORSpec when is_list(SubORSpec) ->
- case override_sub_props(Tests, [], SubORSpec, Mod) of
- {Subs,[]} ->
- override_sub_props(Ts, [{conf,Props1,Init,
- Subs,End} | New],
- lists:keydelete(Name, 1, ORSpec),
- Mod);
- {_,NonEmptySpec} ->
- Es = [invalid_ref_msg(Name, element(1, GrRef),
- Mod) || GrRef <- NonEmptySpec],
- throw({error,Es})
- end;
- BadGrSpec ->
- throw({error,{invalid_form,BadGrSpec}})
- end;
- _ -> % not a group in spec
- override_sub_props(Ts, [T | New], ORSpec, Mod)
- end;
-override_sub_props([TC | Ts], New, ORSpec, Mod) ->
- override_sub_props(Ts, [TC | New], ORSpec, Mod).
-
-invalid_ref_msg(Name, Mod) ->
- E = "Invalid reference to group "++
- atom_to_list(Name)++" in "++
- atom_to_list(Mod)++":all/0",
- list_to_atom(E).
-
-invalid_ref_msg(Name0, Name1, Mod) ->
- E = "Invalid reference to group "++
- atom_to_list(Name1)++" from "++atom_to_list(Name0)++
- " in "++atom_to_list(Mod)++":all/0",
- list_to_atom(E).
-
%%!============================================================
%%! The support for sequences by means of using sequences/0
%%! will be removed in OTP R15. The code below is only kept
@@ -1529,6 +1191,12 @@ report(What,Data) ->
end;
tests_done ->
ok;
+ severe_error ->
+ ct_event:sync_notify(#event{name=What,
+ node=node(),
+ data=Data}),
+ ct_util:set_testdata({What,Data}),
+ ok;
tc_start ->
%% Data = {{Suite,Func},LogFileName}
ct_event:sync_notify(#event{name=tc_logfile,
diff --git a/lib/common_test/src/ct_groups.erl b/lib/common_test/src/ct_groups.erl
new file mode 100644
index 0000000000..74ab5e5439
--- /dev/null
+++ b/lib/common_test/src/ct_groups.erl
@@ -0,0 +1,599 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%% @doc Common Test Framework callback module.
+%%%
+%%% <p>This module contains CT internal help functions for searching
+%%% through groups specification trees and producing resulting
+%%% tests.</p>
+
+-module(ct_groups).
+
+-export([find_groups/4]).
+-export([make_all_conf/3, make_all_conf/4, make_conf/5]).
+-export([delete_subs/2]).
+-export([expand_groups/3, search_and_override/3]).
+
+-define(val(Key, List), proplists:get_value(Key, List)).
+-define(val(Key, List, Def), proplists:get_value(Key, List, Def)).
+-define(rev(L), lists:reverse(L)).
+
+find_groups(Mod, GrNames, TCs, GroupDefs) when is_atom(GrNames) ;
+ (length(GrNames) == 1) ->
+ find_groups1(Mod, GrNames, TCs, GroupDefs);
+
+find_groups(Mod, Groups, TCs, GroupDefs) when Groups /= [] ->
+ lists:append([find_groups1(Mod, [GrNames], TCs, GroupDefs) ||
+ GrNames <- Groups]);
+
+find_groups(_Mod, [], _TCs, _GroupDefs) ->
+ [].
+
+%% GrNames == atom(): Single group name, perform full search
+%% GrNames == list(): List of groups, find all matching paths
+%% GrNames == [list()]: Search path terminated by last group in GrNames
+find_groups1(Mod, GrNames, TCs, GroupDefs) ->
+ {GrNames1,FindAll} =
+ case GrNames of
+ Name when is_atom(Name), Name /= all ->
+ {[Name],true};
+ [Path] when is_list(Path) ->
+ {Path,false};
+ Path ->
+ {Path,true}
+ end,
+ TCs1 = if (is_atom(TCs) and (TCs /= all)) or is_tuple(TCs) ->
+ [TCs];
+ true ->
+ TCs
+ end,
+ Found = find(Mod, GrNames1, TCs1, GroupDefs, [],
+ GroupDefs, FindAll),
+ [Conf || Conf <- Found, Conf /= 'NOMATCH'].
+
+%% Locate all groups
+find(Mod, all, all, [{Name,Props,Tests} | Gs], Known, Defs, _)
+ when is_atom(Name), is_list(Props), is_list(Tests) ->
+ cyclic_test(Mod, Name, Known),
+ trim(make_conf(Mod, Name, Props,
+ find(Mod, all, all, Tests, [Name | Known],
+ Defs, true))) ++
+ find(Mod, all, all, Gs, Known, Defs, true);
+
+%% Locate particular TCs in all groups
+find(Mod, all, TCs, [{Name,Props,Tests} | Gs], Known, Defs, _)
+ when is_atom(Name), is_list(Props), is_list(Tests) ->
+ cyclic_test(Mod, Name, Known),
+ Tests1 = rm_unwanted_tcs(Tests, TCs, []),
+ trim(make_conf(Mod, Name, Props,
+ find(Mod, all, TCs, Tests1, [Name | Known],
+ Defs, true))) ++
+ find(Mod, all, TCs, Gs, Known, Defs, true);
+
+%% Found next group is in search path
+find(Mod, [Name|GrNames]=SPath, TCs, [{Name,Props,Tests} | Gs], Known,
+ Defs, FindAll) when is_atom(Name), is_list(Props), is_list(Tests) ->
+ cyclic_test(Mod, Name, Known),
+ Tests1 = rm_unwanted_tcs(Tests, TCs, GrNames),
+ trim(make_conf(Mod, Name, Props,
+ find(Mod, GrNames, TCs, Tests1, [Name|Known],
+ Defs, FindAll))) ++
+ find(Mod, SPath, TCs, Gs, Known, Defs, FindAll);
+
+%% Group path terminated, stop the search
+find(Mod, [], TCs, Tests, _Known, _Defs, false) ->
+ Cases = lists:flatmap(fun(TC) when is_atom(TC), TCs == all ->
+ [{Mod,TC}];
+ ({group,_}) ->
+ [];
+ ({_,_}=TC) when TCs == all ->
+ [TC];
+ (TC) ->
+ if is_atom(TC) ->
+ Tuple = {Mod,TC},
+ case lists:member(Tuple, TCs) of
+ true ->
+ [Tuple];
+ false ->
+ case lists:member(TC, TCs) of
+ true -> [{Mod,TC}];
+ false -> []
+ end
+ end;
+ true ->
+ []
+ end
+ end, Tests),
+ if Cases == [] -> ['NOMATCH'];
+ true -> Cases
+ end;
+
+%% No more groups
+find(_Mod, [_|_], _TCs, [], _Known, _Defs, _) ->
+ ['NOMATCH'];
+
+%% Found group not next in search path
+find(Mod, GrNames, TCs, [{Name,Props,Tests} | Gs], Known,
+ Defs, FindAll) when is_atom(Name), is_list(Props), is_list(Tests) ->
+ cyclic_test(Mod, Name, Known),
+ Tests1 = rm_unwanted_tcs(Tests, TCs, GrNames),
+ trim(make_conf(Mod, Name, Props,
+ find(Mod, GrNames, TCs, Tests1, [Name|Known],
+ Defs, FindAll))) ++
+ find(Mod, GrNames, TCs, Gs, Known, Defs, FindAll);
+
+%% A nested group defined on top level found
+find(Mod, GrNames, TCs, [{group,Name1} | Gs], Known, Defs, FindAll)
+ when is_atom(Name1) ->
+ find(Mod, GrNames, TCs, [expand(Mod, Name1, Defs) | Gs], Known,
+ Defs, FindAll);
+
+%% Undocumented remote group feature, use with caution
+find(Mod, GrNames, TCs, [{group, ExtMod, ExtGrp} | Gs], Known,
+ Defs, FindAll) when is_atom(ExtMod), is_atom(ExtGrp) ->
+ ExternalDefs = ExtMod:groups(),
+ ExternalTCs = find(ExtMod, ExtGrp, TCs, [{group, ExtGrp}],
+ [], ExternalDefs, FindAll),
+ ExternalTCs ++ find(Mod, GrNames, TCs, Gs, Known, Defs, FindAll);
+
+%% Group definition without properties, add an empty property list
+find(Mod, GrNames, TCs, [{Name1,Tests} | Gs], Known, Defs, FindAll)
+ when is_atom(Name1), is_list(Tests) ->
+ find(Mod, GrNames, TCs, [{Name1,[],Tests} | Gs], Known, Defs, FindAll);
+
+%% Save, and keep searching
+find(Mod, GrNames, TCs, [{ExternalTC, Case} = TC | Gs], Known,
+ Defs, FindAll) when is_atom(ExternalTC),
+ is_atom(Case) ->
+ [TC | find(Mod, GrNames, TCs, Gs, Known, Defs, FindAll)];
+
+%% Save test case
+find(Mod, GrNames, all, [TC | Gs], Known,
+ Defs, FindAll) when is_atom(TC) ->
+ [{Mod,TC} | find(Mod, GrNames, all, Gs, Known, Defs, FindAll)];
+
+%% Save test case
+find(Mod, GrNames, all, [{M,TC} | Gs], Known,
+ Defs, FindAll) when is_atom(M), M /= group, is_atom(TC) ->
+ [{M,TC} | find(Mod, GrNames, all, Gs, Known, Defs, FindAll)];
+
+%% Check if test case should be saved
+find(Mod, GrNames, TCs, [TC | Gs], Known,
+ Defs, FindAll) when is_atom(TC) orelse
+ ((size(TC) == 2) and (element(1,TC) /= group)) ->
+ Case =
+ if is_atom(TC) ->
+ Tuple = {Mod,TC},
+ case lists:member(Tuple, TCs) of
+ true ->
+ Tuple;
+ false ->
+ case lists:member(TC, TCs) of
+ true -> {Mod,TC};
+ false -> []
+ end
+ end;
+ true ->
+ case lists:member(TC, TCs) of
+ true -> {Mod,TC};
+ false -> []
+ end
+ end,
+ if Case == [] ->
+ find(Mod, GrNames, TCs, Gs, Known, Defs, FindAll);
+ true ->
+ [Case | find(Mod, GrNames, TCs, Gs, Known, Defs, FindAll)]
+ end;
+
+%% Unexpeted term in group list
+find(Mod, _GrNames, _TCs, [BadTerm | _Gs], Known, _Defs, _FindAll) ->
+ Where = if length(Known) == 0 ->
+ atom_to_list(Mod)++":groups/0";
+ true ->
+ "group "++atom_to_list(lists:last(Known))++
+ " in "++atom_to_list(Mod)++":groups/0"
+ end,
+ Term = io_lib:format("~p", [BadTerm]),
+ E = "Bad term "++lists:flatten(Term)++" in "++Where,
+ throw({error,list_to_atom(E)});
+
+%% No more groups
+find(_Mod, _GrNames, _TCs, [], _Known, _Defs, _) ->
+ [].
+
+%%%-----------------------------------------------------------------
+
+%% We have to always search bottom up to only remove a branch
+%% if there's 'NOMATCH' in the leaf (otherwise, the branch should
+%% be kept)
+
+trim({conf,Props,Init,Tests,End}) ->
+ try trim(Tests) of
+ [] -> [];
+ Tests1 -> [{conf,Props,Init,Tests1,End}]
+ catch
+ throw:_ -> []
+ end;
+
+trim(Tests) when is_list(Tests) ->
+ %% we need to compare the result of trimming each test on this
+ %% level, and only let a 'NOMATCH' fail the level if no
+ %% successful sub group can be found
+ Tests1 =
+ lists:flatmap(fun(Test) ->
+ IsConf = case Test of
+ {conf,_,_,_,_} ->
+ true;
+ _ ->
+ false
+ end,
+ try trim_test(Test) of
+ [] -> [];
+ Test1 when IsConf -> [{conf,Test1}];
+ Test1 -> [Test1]
+ catch
+ throw:_ -> ['NOMATCH']
+ end
+ end, Tests),
+ case lists:keymember(conf, 1, Tests1) of
+ true -> % at least one successful group
+ lists:flatmap(fun({conf,Test}) -> [Test];
+ ('NOMATCH') -> []; % ignore any 'NOMATCH'
+ (Test) -> [Test]
+ end, Tests1);
+ false ->
+ case lists:member('NOMATCH', Tests1) of
+ true ->
+ throw('NOMATCH');
+ false ->
+ Tests1
+ end
+ end.
+
+trim_test({conf,Props,Init,Tests,End}) ->
+ case trim(Tests) of
+ [] ->
+ [];
+ Tests1 ->
+ {conf,Props,Init,Tests1,End}
+ end;
+
+trim_test('NOMATCH') ->
+ throw('NOMATCH');
+
+trim_test(Test) ->
+ Test.
+
+%% GrNames is [] if the terminating group has been found. From
+%% that point, all specified test should be included (as well as
+%% sub groups for deeper search).
+rm_unwanted_tcs(Tests, all, []) ->
+ Tests;
+
+rm_unwanted_tcs(Tests, TCs, []) ->
+ sort_tests(lists:flatmap(fun(Test) when is_tuple(Test),
+ (size(Test) > 2) ->
+ [Test];
+ (Test={group,_}) ->
+ [Test];
+ (Test={_M,TC}) ->
+ case lists:member(TC, TCs) of
+ true -> [Test];
+ false -> []
+ end;
+ (Test) when is_atom(Test) ->
+ case lists:keysearch(Test, 2, TCs) of
+ {value,_} ->
+ [Test];
+ _ ->
+ case lists:member(Test, TCs) of
+ true -> [Test];
+ false -> []
+ end
+ end;
+ (Test) -> [Test]
+ end, Tests), TCs);
+
+rm_unwanted_tcs(Tests, _TCs, _) ->
+ [Test || Test <- Tests, not is_atom(Test)].
+
+%% make sure the order of tests is according to the order in TCs
+sort_tests(Tests, TCs) when is_list(TCs)->
+ lists:sort(fun(T1, T2) ->
+ case {is_tc(T1),is_tc(T2)} of
+ {true,true} ->
+ (position(T1, TCs) =<
+ position(T2, TCs));
+ {false,true} ->
+ (position(T2, TCs) == (length(TCs)+1));
+ _ -> true
+
+ end
+ end, Tests);
+sort_tests(Tests, _) ->
+ Tests.
+
+is_tc(T) when is_atom(T) -> true;
+is_tc({group,_}) -> false;
+is_tc({_M,T}) when is_atom(T) -> true;
+is_tc(_) -> false.
+
+position(T, TCs) ->
+ position(T, TCs, 1).
+
+position(T, [T|_TCs], Pos) ->
+ Pos;
+position(T, [{_,T}|_TCs], Pos) ->
+ Pos;
+position({M,T}, [T|_TCs], Pos) when M /= group ->
+ Pos;
+position(T, [_|TCs], Pos) ->
+ position(T, TCs, Pos+1);
+position(_, [], Pos) ->
+ Pos.
+
+%%%-----------------------------------------------------------------
+
+delete_subs([{conf, _,_,_,_} = Conf | Confs], All) ->
+ All1 = delete_conf(Conf, All),
+ case is_sub(Conf, All1) of
+ true ->
+ delete_subs(Confs, All1);
+ false ->
+ delete_subs(Confs, All)
+ end;
+delete_subs([_Else | Confs], All) ->
+ delete_subs(Confs, All);
+delete_subs([], All) ->
+ All.
+
+delete_conf({conf,Props,_,_,_}, Confs) ->
+ Name = ?val(name, Props),
+ [Conf || Conf = {conf,Props0,_,_,_} <- Confs,
+ Name =/= ?val(name, Props0)].
+
+is_sub({conf,Props,_,_,_}=Conf, [{conf,_,_,Tests,_} | Confs]) ->
+ Name = ?val(name, Props),
+ case lists:any(fun({conf,Props0,_,_,_}) ->
+ case ?val(name, Props0) of
+ N when N == Name ->
+ true;
+ _ ->
+ false
+ end;
+ (_) ->
+ false
+ end, Tests) of
+ true ->
+ true;
+ false ->
+ is_sub(Conf, Tests) orelse is_sub(Conf, Confs)
+ end;
+
+is_sub(Conf, [_TC | Tests]) ->
+ is_sub(Conf, Tests);
+
+is_sub(_Conf, []) ->
+ false.
+
+
+cyclic_test(Mod, Name, Names) ->
+ case lists:member(Name, Names) of
+ true ->
+ E = "Cyclic reference to group "++atom_to_list(Name)++
+ " in "++atom_to_list(Mod)++":groups/0",
+ throw({error,list_to_atom(E)});
+ false ->
+ ok
+ end.
+
+expand(Mod, Name, Defs) ->
+ case lists:keysearch(Name, 1, Defs) of
+ {value,Def} ->
+ Def;
+ false ->
+ E = "Invalid group "++atom_to_list(Name)++
+ " in "++atom_to_list(Mod)++":groups/0",
+ throw({error,list_to_atom(E)})
+ end.
+
+make_all_conf(Dir, Mod, Props, TestSpec) ->
+ case code:is_loaded(Mod) of
+ false ->
+ code:load_abs(filename:join(Dir,atom_to_list(Mod)));
+ _ ->
+ ok
+ end,
+ make_all_conf(Mod, Props, TestSpec).
+
+make_all_conf(Mod, Props, TestSpec) ->
+ case catch apply(Mod, groups, []) of
+ {'EXIT',_} ->
+ exit({invalid_group_definition,Mod});
+ GroupDefs when is_list(GroupDefs) ->
+ case catch find_groups(Mod, all, TestSpec, GroupDefs) of
+ {error,_} = Error ->
+ %% this makes test_server call error_in_suite as first
+ %% (and only) test case so we can report Error properly
+ [{ct_framework,error_in_suite,[[Error]]}];
+ [] ->
+ exit({invalid_group_spec,Mod});
+ _ConfTests ->
+ make_conf(Mod, all, Props, TestSpec)
+ end
+ end.
+
+make_conf(Dir, Mod, Name, Props, TestSpec) ->
+ case code:is_loaded(Mod) of
+ false ->
+ code:load_abs(filename:join(Dir,atom_to_list(Mod)));
+ _ ->
+ ok
+ end,
+ make_conf(Mod, Name, Props, TestSpec).
+
+make_conf(Mod, Name, Props, TestSpec) ->
+ case code:is_loaded(Mod) of
+ false ->
+ code:load_file(Mod);
+ _ ->
+ ok
+ end,
+ {InitConf,EndConf,ExtraProps} =
+ case erlang:function_exported(Mod,init_per_group,2) of
+ true ->
+ {{Mod,init_per_group},{Mod,end_per_group},[]};
+ false ->
+ ct_logs:log("TEST INFO", "init_per_group/2 and "
+ "end_per_group/2 missing for group "
+ "~p in ~p, using default.",
+ [Name,Mod]),
+ {{ct_framework,init_per_group},
+ {ct_framework,end_per_group},
+ [{suite,Mod}]}
+ end,
+ {conf,[{name,Name}|Props++ExtraProps],InitConf,TestSpec,EndConf}.
+
+%%%-----------------------------------------------------------------
+
+expand_groups([H | T], ConfTests, Mod) ->
+ [expand_groups(H, ConfTests, Mod) | expand_groups(T, ConfTests, Mod)];
+expand_groups([], _ConfTests, _Mod) ->
+ [];
+expand_groups({group,Name}, ConfTests, Mod) ->
+ expand_groups({group,Name,default,[]}, ConfTests, Mod);
+expand_groups({group,Name,default}, ConfTests, Mod) ->
+ expand_groups({group,Name,default,[]}, ConfTests, Mod);
+expand_groups({group,Name,ORProps}, ConfTests, Mod) when is_list(ORProps) ->
+ expand_groups({group,Name,ORProps,[]}, ConfTests, Mod);
+expand_groups({group,Name,ORProps,SubORSpec}, ConfTests, Mod) ->
+ FindConf =
+ fun(Conf = {conf,Props,Init,Ts,End}) ->
+ case ?val(name, Props) of
+ Name when ORProps == default ->
+ [Conf];
+ Name ->
+ Props1 = case ?val(suite, Props) of
+ undefined ->
+ ORProps;
+ SuiteName ->
+ [{suite,SuiteName}|ORProps]
+ end,
+ [{conf,[{name,Name}|Props1],Init,Ts,End}];
+ _ ->
+ []
+ end
+ end,
+ case lists:flatmap(FindConf, ConfTests) of
+ [] ->
+ throw({error,invalid_ref_msg(Name, Mod)});
+ Matching when SubORSpec == [] ->
+ Matching;
+ Matching ->
+ override_props(Matching, SubORSpec, Name,Mod)
+ end;
+expand_groups(SeqOrTC, _ConfTests, _Mod) ->
+ SeqOrTC.
+
+%% search deep for the matching conf test and modify it and any
+%% sub tests according to the override specification
+search_and_override([Conf = {conf,Props,Init,Tests,End}], ORSpec, Mod) ->
+ InsProps = fun(GrName, undefined, Ps) ->
+ [{name,GrName} | Ps];
+ (GrName, Suite, Ps) ->
+ [{name,GrName}, {suite,Suite} | Ps]
+ end,
+ Name = ?val(name, Props),
+ Suite = ?val(suite, Props),
+ case lists:keysearch(Name, 1, ORSpec) of
+ {value,{Name,default}} ->
+ [Conf];
+ {value,{Name,ORProps}} ->
+ [{conf,InsProps(Name,Suite,ORProps),Init,Tests,End}];
+ {value,{Name,default,[]}} ->
+ [Conf];
+ {value,{Name,default,SubORSpec}} ->
+ override_props([Conf], SubORSpec, Name,Mod);
+ {value,{Name,ORProps,SubORSpec}} ->
+ override_props([{conf,InsProps(Name,Suite,ORProps),
+ Init,Tests,End}], SubORSpec, Name,Mod);
+ _ ->
+ [{conf,Props,Init,search_and_override(Tests,ORSpec,Mod),End}]
+ end.
+
+%% Modify the Tests element according to the override specification
+override_props([{conf,Props,Init,Tests,End} | Confs], SubORSpec, Name,Mod) ->
+ {Subs,SubORSpec1} = override_sub_props(Tests, [], SubORSpec, Mod),
+ [{conf,Props,Init,Subs,End} | override_props(Confs, SubORSpec1, Name,Mod)];
+override_props([], [], _,_) ->
+ [];
+override_props([], SubORSpec, Name,Mod) ->
+ Es = [invalid_ref_msg(Name, element(1,Spec), Mod) || Spec <- SubORSpec],
+ throw({error,Es}).
+
+override_sub_props([], New, ORSpec, _) ->
+ {?rev(New),ORSpec};
+override_sub_props([T = {conf,Props,Init,Tests,End} | Ts],
+ New, ORSpec, Mod) ->
+ Name = ?val(name, Props),
+ Suite = ?val(suite, Props),
+ case lists:keysearch(Name, 1, ORSpec) of
+ {value,Spec} -> % group found in spec
+ Props1 =
+ case element(2, Spec) of
+ default -> Props;
+ ORProps when Suite == undefined -> [{name,Name} | ORProps];
+ ORProps -> [{name,Name}, {suite,Suite} | ORProps]
+ end,
+ case catch element(3, Spec) of
+ Undef when Undef == [] ; 'EXIT' == element(1, Undef) ->
+ override_sub_props(Ts, [{conf,Props1,Init,Tests,End} | New],
+ lists:keydelete(Name, 1, ORSpec), Mod);
+ SubORSpec when is_list(SubORSpec) ->
+ case override_sub_props(Tests, [], SubORSpec, Mod) of
+ {Subs,[]} ->
+ override_sub_props(Ts, [{conf,Props1,Init,
+ Subs,End} | New],
+ lists:keydelete(Name, 1, ORSpec),
+ Mod);
+ {_,NonEmptySpec} ->
+ Es = [invalid_ref_msg(Name, element(1, GrRef),
+ Mod) || GrRef <- NonEmptySpec],
+ throw({error,Es})
+ end;
+ BadGrSpec ->
+ throw({error,{invalid_form,BadGrSpec}})
+ end;
+ _ -> % not a group in spec
+ override_sub_props(Ts, [T | New], ORSpec, Mod)
+ end;
+override_sub_props([TC | Ts], New, ORSpec, Mod) ->
+ override_sub_props(Ts, [TC | New], ORSpec, Mod).
+
+invalid_ref_msg(Name, Mod) ->
+ E = "Invalid reference to group "++
+ atom_to_list(Name)++" in "++
+ atom_to_list(Mod)++":all/0",
+ list_to_atom(E).
+
+invalid_ref_msg(Name0, Name1, Mod) ->
+ E = "Invalid reference to group "++
+ atom_to_list(Name1)++" from "++atom_to_list(Name0)++
+ " in "++atom_to_list(Mod)++":all/0",
+ list_to_atom(E).
diff --git a/lib/common_test/src/ct_master.erl b/lib/common_test/src/ct_master.erl
index 042c5ba267..f29eba605c 100644
--- a/lib/common_test/src/ct_master.erl
+++ b/lib/common_test/src/ct_master.erl
@@ -51,7 +51,7 @@
%%% {testcase,Cases} | {spec,TestSpecs} | {allow_user_terms,Bool} |
%%% {logdir,LogDir} | {event_handler,EventHandlers} |
%%% {silent_connections,Conns} | {cover,CoverSpecFile} |
-%%% {userconfig, UserCfgFiles}
+%%% {cover_stop,Bool} | {userconfig, UserCfgFiles}
%%% CfgFiles = string() | [string()]
%%% TestDirs = string() | [string()]
%%% Suites = atom() | [atom()]
@@ -696,8 +696,9 @@ status(MasterPid,Event) ->
log(To,Heading,Str,Args) ->
if To == all ; To == tty ->
- Str1 = ["=== ",Heading," ===\n",io_lib:format(Str,Args),"\n"],
- io:format(Str1,[]);
+ Chars = ["=== ",Heading," ===\n",
+ io_lib:format(Str,Args),"\n"],
+ io:put_chars(Chars);
true ->
ok
end,
diff --git a/lib/common_test/src/ct_master_logs.erl b/lib/common_test/src/ct_master_logs.erl
index 9e61d5b16f..84f175c0a9 100644
--- a/lib/common_test/src/ct_master_logs.erl
+++ b/lib/common_test/src/ct_master_logs.erl
@@ -134,7 +134,7 @@ init(Parent,LogDir,Nodes) ->
io:format(CtLogFd,int_header(),[log_timestamp(now()),"Test Nodes\n"]),
io:format(CtLogFd,"~s\n",[NodeStr]),
- io:format(CtLogFd,int_footer()++"\n",[]),
+ io:put_chars(CtLogFd,[int_footer(),"\n"]),
NodeDirIxFd = open_nodedir_index(RunDirAbs,Time),
Parent ! {started,self(),{Time,RunDirAbs}},
@@ -202,24 +202,21 @@ loop(State) ->
open_ct_master_log(Dir) ->
FullName = filename:join(Dir,?ct_master_log_name),
{ok,Fd} = file:open(FullName,[write]),
- io:format(Fd,header("Common Test Master Log", {[],[1,2],[]}),[]),
+ io:put_chars(Fd,header("Common Test Master Log", {[],[1,2],[]})),
%% maybe add config info here later
- io:format(Fd, config_table([]), []),
- io:format(Fd,
- "<style>\n"
- "div.ct_internal { background:lightgrey; color:black }\n"
- "div.default { background:lightgreen; color:black }\n"
- "</style>\n",
- []),
- io:format(Fd,
- xhtml("<br><h2>Progress Log</h2>\n<pre>\n",
- "<br /><h2>Progress Log</h2>\n<pre>\n"),
- []),
+ io:put_chars(Fd,config_table([])),
+ io:put_chars(Fd,
+ "<style>\n"
+ "div.ct_internal { background:lightgrey; color:black }\n"
+ "div.default { background:lightgreen; color:black }\n"
+ "</style>\n"),
+ io:put_chars(Fd,
+ xhtml("<br><h2>Progress Log</h2>\n<pre>\n",
+ "<br /><h2>Progress Log</h2>\n<pre>\n")),
Fd.
close_ct_master_log(Fd) ->
- io:format(Fd,"</pre>",[]),
- io:format(Fd,footer(),[]),
+ io:put_chars(Fd,["</pre>",footer()]),
file:close(Fd).
config_table(Vars) ->
@@ -248,20 +245,20 @@ int_footer() ->
open_nodedir_index(Dir,StartTime) ->
FullName = filename:join(Dir,?nodedir_index_name),
{ok,Fd} = file:open(FullName,[write]),
- io:format(Fd,nodedir_index_header(StartTime),[]),
+ io:put_chars(Fd,nodedir_index_header(StartTime)),
Fd.
print_nodedir(Node,RunDir,Fd) ->
Index = filename:join(RunDir,"index.html"),
- io:format(Fd,
- ["<tr>\n"
- "<td align=center>",atom_to_list(Node),"</td>\n",
- "<td align=left><a href=\"",Index,"\">",Index,"</a></td>\n",
- "</tr>\n"],[]),
+ io:put_chars(Fd,
+ ["<tr>\n"
+ "<td align=center>",atom_to_list(Node),"</td>\n",
+ "<td align=left><a href=\"",Index,"\">",Index,"</a></td>\n",
+ "</tr>\n"]),
ok.
close_nodedir_index(Fd) ->
- io:format(Fd,index_footer(),[]),
+ io:put_chars(Fd,index_footer()),
file:close(Fd).
nodedir_index_header(StartTime) ->
diff --git a/lib/common_test/src/ct_netconfc.erl b/lib/common_test/src/ct_netconfc.erl
index 52fe9599ce..1ccbc86d8f 100644
--- a/lib/common_test/src/ct_netconfc.erl
+++ b/lib/common_test/src/ct_netconfc.erl
@@ -307,7 +307,7 @@
-type option() :: {ssh,host()} | {port,inet:port_number()} | {user,string()} |
{password,string()} | {user_dir,string()} |
{timeout,timeout()}.
--type host() :: inet:host_name() | inet:ip_address().
+-type host() :: inet:hostname() | inet:ip_address().
-type notification() :: {notification, xml_attributes(), notification_content()}.
-type notification_content() :: [event_time()|simple_xml()].
@@ -968,7 +968,7 @@ close_session(Client) ->
%% @end
%%----------------------------------------------------------------------
close_session(Client, Timeout) ->
- call(Client,{send_rpc_op, close_session, [], Timeout}).
+ call(Client,{send_rpc_op, close_session, [], Timeout}, true).
%%----------------------------------------------------------------------
@@ -1073,7 +1073,8 @@ handle_msg({get_event_streams=Op,Streams,Timeout}, From, State) ->
SimpleXml = encode_rpc_operation(get,[Filter]),
do_send_rpc(Op, SimpleXml, Timeout, From, State).
-handle_msg({ssh_cm, _CM, {data, _Ch, _Type, Data}}, State) ->
+handle_msg({ssh_cm, CM, {data, Ch, _Type, Data}}, State) ->
+ ssh_connection:adjust_window(CM,Ch,size(Data)),
handle_data(Data, State);
handle_msg({ssh_cm, _CM, _SshCloseMsg}, State) ->
%% _SshCloseMsg can probably be one of
@@ -1121,17 +1122,38 @@ close(Client) ->
%% Internal functions
%%----------------------------------------------------------------------
call(Client, Msg) ->
- call(Client, Msg, infinity).
-call(Client, Msg, Timeout) ->
+ call(Client, Msg, infinity, false).
+call(Client, Msg, Timeout) when is_integer(Timeout); Timeout==infinity ->
+ call(Client, Msg, Timeout, false);
+call(Client, Msg, WaitStop) when is_boolean(WaitStop) ->
+ call(Client, Msg, infinity, WaitStop).
+call(Client, Msg, Timeout, WaitStop) ->
case get_handle(Client) of
{ok,Pid} ->
case ct_gen_conn:call(Pid,Msg,Timeout) of
- {error,{process_down,Client,noproc}} ->
+ {error,{process_down,Pid,noproc}} ->
{error,no_such_client};
- {error,{process_down,Client,normal}} ->
+ {error,{process_down,Pid,normal}} when WaitStop ->
+ %% This will happen when server closes connection
+ %% before clien received rpc-reply on
+ %% close-session.
+ ok;
+ {error,{process_down,Pid,normal}} ->
{error,closed};
- {error,{process_down,Client,Reason}} ->
+ {error,{process_down,Pid,Reason}} ->
{error,{closed,Reason}};
+ Other when WaitStop ->
+ MRef = erlang:monitor(process,Pid),
+ receive
+ {'DOWN',MRef,process,Pid,Normal} when Normal==normal;
+ Normal==noproc ->
+ Other;
+ {'DOWN',MRef,process,Pid,Reason} ->
+ {error,{{closed,Reason},Other}}
+ after Timeout ->
+ erlang:demonitor(MRef, [flush]),
+ {error,{timeout,Other}}
+ end;
Other ->
Other
end;
@@ -1784,7 +1806,8 @@ get_tag([]) ->
%%% SSH stuff
ssh_receive_data() ->
receive
- {ssh_cm, _CM, {data, _Ch, _Type, Data}} ->
+ {ssh_cm, CM, {data, Ch, _Type, Data}} ->
+ ssh_connection:adjust_window(CM,Ch,size(Data)),
{ok, Data};
{ssh_cm, _CM, {Closed, _Ch}} = X when Closed == closed; Closed == eof ->
{error,X};
diff --git a/lib/common_test/src/ct_run.erl b/lib/common_test/src/ct_run.erl
index 3383244bf4..eb05c90ba8 100644
--- a/lib/common_test/src/ct_run.erl
+++ b/lib/common_test/src/ct_run.erl
@@ -58,6 +58,7 @@
vts,
shell,
cover,
+ cover_stop,
coverspec,
step,
logdir,
@@ -245,6 +246,7 @@ script_start1(Parent, Args) ->
Vts = get_start_opt(vts, true, Args),
Shell = get_start_opt(shell, true, Args),
Cover = get_start_opt(cover, fun([CoverFile]) -> ?abs(CoverFile) end, Args),
+ CoverStop = get_start_opt(cover_stop, fun([CS]) -> list_to_atom(CS) end, Args),
LogDir = get_start_opt(logdir, fun([LogD]) -> LogD end, Args),
LogOpts = get_start_opt(logopts, fun(Os) -> [list_to_atom(O) || O <- Os] end,
[], Args),
@@ -329,7 +331,8 @@ script_start1(Parent, Args) ->
end,
StartOpts = #opts{label = Label, profile = Profile,
- vts = Vts, shell = Shell, cover = Cover,
+ vts = Vts, shell = Shell,
+ cover = Cover, cover_stop = CoverStop,
logdir = LogDir, logopts = LogOpts,
basic_html = BasicHtml,
verbosity = Verbosity,
@@ -416,6 +419,9 @@ script_start2(StartOpts = #opts{vts = undefined,
Cover =
choose_val(StartOpts#opts.cover,
SpecStartOpts#opts.cover),
+ CoverStop =
+ choose_val(StartOpts#opts.cover_stop,
+ SpecStartOpts#opts.cover_stop),
MultTT =
choose_val(StartOpts#opts.multiply_timetraps,
SpecStartOpts#opts.multiply_timetraps),
@@ -475,6 +481,7 @@ script_start2(StartOpts = #opts{vts = undefined,
profile = Profile,
testspecs = Specs,
cover = Cover,
+ cover_stop = CoverStop,
logdir = LogDir,
logopts = AllLogOpts,
basic_html = BasicHtml,
@@ -723,6 +730,7 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
+ "\n\t[-cover_stop Bool]"
"\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
"\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
@@ -745,6 +753,7 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
+ "\n\t[-cover_stop Bool]"
"\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
"\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
@@ -938,6 +947,7 @@ run_test2(StartOpts) ->
%% code coverage
Cover = get_start_opt(cover,
fun(CoverFile) -> ?abs(CoverFile) end, StartOpts),
+ CoverStop = get_start_opt(cover_stop, value, StartOpts),
%% timetrap manipulation
MultiplyTT = get_start_opt(multiply_timetraps, value, 1, StartOpts),
@@ -1000,7 +1010,8 @@ run_test2(StartOpts) ->
Step = get_start_opt(step, value, StartOpts),
Opts = #opts{label = Label, profile = Profile,
- cover = Cover, step = Step, logdir = LogDir,
+ cover = Cover, cover_stop = CoverStop,
+ step = Step, logdir = LogDir,
logopts = LogOpts, basic_html = BasicHtml,
config = CfgFiles,
verbosity = Verbosity,
@@ -1063,6 +1074,8 @@ run_spec_file(Relaxed,
AllConfig = merge_vals([CfgFiles, SpecOpts#opts.config]),
Cover = choose_val(Opts#opts.cover,
SpecOpts#opts.cover),
+ CoverStop = choose_val(Opts#opts.cover_stop,
+ SpecOpts#opts.cover_stop),
MultTT = choose_val(Opts#opts.multiply_timetraps,
SpecOpts#opts.multiply_timetraps),
ScaleTT = choose_val(Opts#opts.scale_timetraps,
@@ -1103,6 +1116,7 @@ run_spec_file(Relaxed,
Opts1 = Opts#opts{label = Label,
profile = Profile,
cover = Cover,
+ cover_stop = CoverStop,
logdir = which(logdir, LogDir),
logopts = AllLogOpts,
stylesheet = Stylesheet,
@@ -1272,7 +1286,8 @@ run_dir(Opts = #opts{logdir = LogDir,
reformat_result(catch do_run(tests(Dir2, Mod),
[], Opts1, StartOpts));
_ ->
- reformat_result(catch do_run(tests(Dir2, Mod, GsAndCs),
+ reformat_result(catch do_run(tests(Dir2, Mod,
+ GsAndCs),
[], Opts1, StartOpts))
end;
@@ -1281,7 +1296,8 @@ run_dir(Opts = #opts{logdir = LogDir,
[_,_|_] when GsAndCs /= [] ->
exit({error,multiple_suites_and_cases});
[{Dir2,Mod}] when GsAndCs /= [] ->
- reformat_result(catch do_run(tests(Dir2, Mod, GsAndCs),
+ reformat_result(catch do_run(tests(Dir2, Mod,
+ GsAndCs),
[], Opts1, StartOpts));
DirMods ->
reformat_result(catch do_run(tests(DirMods),
@@ -1374,6 +1390,7 @@ get_data_for_node(#testspec{label = Labels,
verbosity = VLvls,
silent_connections = SilentConnsList,
cover = CoverFs,
+ cover_stop = CoverStops,
config = Cfgs,
userconfig = UsrCfgs,
event_handler = EvHs,
@@ -1405,6 +1422,7 @@ get_data_for_node(#testspec{label = Labels,
SCs -> SCs
end,
Cover = proplists:get_value(Node, CoverFs),
+ CoverStop = proplists:get_value(Node, CoverStops),
MT = proplists:get_value(Node, MTs),
ST = proplists:get_value(Node, STs),
CreatePrivDir = proplists:get_value(Node, PDs),
@@ -1423,6 +1441,7 @@ get_data_for_node(#testspec{label = Labels,
verbosity = Verbosity,
silent_connections = SilentConns,
cover = Cover,
+ cover_stop = CoverStop,
config = ConfigFiles,
event_handlers = EvHandlers,
ct_hooks = FiltCTHooks,
@@ -1536,17 +1555,36 @@ groups_and_cases(Gs, Cs) when ((Gs == undefined) or (Gs == [])) and
((Cs == undefined) or (Cs == [])) ->
[];
groups_and_cases(Gs, Cs) when Gs == undefined ; Gs == [] ->
- [ensure_atom(C) || C <- listify(Cs)];
-groups_and_cases(Gs, Cs) when Cs == undefined ; Cs == [] ->
- [{ensure_atom(G),all} || G <- listify(Gs)];
-groups_and_cases(G, Cs) when is_atom(G) ->
- [{G,[ensure_atom(C) || C <- listify(Cs)]}];
-groups_and_cases([G], Cs) ->
- [{ensure_atom(G),[ensure_atom(C) || C <- listify(Cs)]}];
-groups_and_cases([_,_|_] , Cs) when Cs =/= [] ->
- {error,multiple_groups_and_cases};
-groups_and_cases(_Gs, _Cs) ->
- {error,incorrect_group_or_case_option}.
+ if (Cs == all) or (Cs == [all]) or (Cs == ["all"]) -> all;
+ true -> [ensure_atom(C) || C <- listify(Cs)]
+ end;
+groups_and_cases(GOrGs, Cs) when (is_atom(GOrGs) orelse
+ (is_list(GOrGs) andalso
+ (is_atom(hd(GOrGs)) orelse
+ (is_list(hd(GOrGs)) andalso
+ is_atom(hd(hd(GOrGs))))))) ->
+ if (Cs == undefined) or (Cs == []) or
+ (Cs == all) or (Cs == [all]) or (Cs == ["all"]) ->
+ [{GOrGs,all}];
+ true ->
+ [{GOrGs,[ensure_atom(C) || C <- listify(Cs)]}]
+ end;
+groups_and_cases(Gs, Cs) when is_integer(hd(hd(Gs))) ->
+ %% if list of strings, this comes from 'ct_run -group G1 G2 ...' and
+ %% we need to parse the strings
+ Gs1 =
+ if (Gs == [all]) or (Gs == ["all"]) ->
+ all;
+ true ->
+ lists:map(fun(G) ->
+ {ok,Ts,_} = erl_scan:string(G++"."),
+ {ok,Term} = erl_parse:parse_term(Ts),
+ Term
+ end, Gs)
+ end,
+ groups_and_cases(Gs1, Cs);
+groups_and_cases(Gs, Cs) ->
+ {error,{incorrect_group_or_case_option,Gs,Cs}}.
tests(TestDir, Suites, []) when is_list(TestDir), is_integer(hd(TestDir)) ->
[{?testdir(TestDir,Suites),ensure_atom(Suites),all}];
@@ -1576,14 +1614,7 @@ do_run(Tests, Misc, LogDir, LogOpts) when is_list(Misc),
StepOpts ->
#opts{step = StepOpts}
end,
- Opts1 =
- case proplists:get_value(cover, Misc) of
- undefined ->
- Opts;
- CoverFile ->
- Opts#opts{cover = CoverFile}
- end,
- do_run(Tests, [], Opts1#opts{logdir = LogDir}, []);
+ do_run(Tests, [], Opts#opts{logdir = LogDir}, []);
do_run(Tests, Skip, Opts, Args) when is_record(Opts, opts) ->
#opts{label = Label, profile = Profile, cover = Cover,
@@ -1617,7 +1648,13 @@ do_run(Tests, Skip, Opts, Args) when is_record(Opts, opts) ->
{error,Reason} ->
exit({error,Reason});
CoverSpec ->
- Opts#opts{coverspec = CoverSpec}
+ CoverStop =
+ case Opts#opts.cover_stop of
+ undefined -> true;
+ Stop -> Stop
+ end,
+ Opts#opts{coverspec = CoverSpec,
+ cover_stop = CoverStop}
end
end,
%% This env variable is used by test_server to determine
@@ -1687,11 +1724,15 @@ compile_and_run(Tests, Skip, Opts, Args) ->
SavedErrors = save_make_errors(SuiteMakeErrors),
ct_repeat:log_loop_info(Args),
- {Tests1,Skip1} = final_tests(Tests,Skip,SavedErrors),
-
- ReleaseSh = proplists:get_value(release_shell, Args),
- ct_util:set_testdata({release_shell,ReleaseSh}),
- possibly_spawn(ReleaseSh == true, Tests1, Skip1, Opts);
+ try final_tests(Tests,Skip,SavedErrors) of
+ {Tests1,Skip1} ->
+ ReleaseSh = proplists:get_value(release_shell, Args),
+ ct_util:set_testdata({release_shell,ReleaseSh}),
+ possibly_spawn(ReleaseSh == true, Tests1, Skip1, Opts)
+ catch
+ _:BadFormat ->
+ {error,BadFormat}
+ end;
false ->
io:nl(),
ct_util:stop(clean),
@@ -1961,22 +2002,21 @@ final_tests1([{TestDir,Suite,GrsOrCs}|Tests], Final, Skip, Bad) when
%% for now, only flat group defs are allowed as
%% start options and test spec terms
fun({all,all}) ->
- ct_framework:make_all_conf(TestDir,
- Suite, []);
+ [ct_groups:make_conf(TestDir, Suite, all, [], all)];
({skipped,Group,TCs}) ->
- [ct_framework:make_conf(TestDir, Suite,
- Group, [skipped], TCs)];
- ({GrSpec = {Group,_},TCs}) ->
+ [ct_groups:make_conf(TestDir, Suite,
+ Group, [skipped], TCs)];
+ ({GrSpec = {GroupName,_},TCs}) ->
Props = [{override,GrSpec}],
- [ct_framework:make_conf(TestDir, Suite,
- Group, Props, TCs)];
- ({GrSpec = {Group,_,_},TCs}) ->
+ [ct_groups:make_conf(TestDir, Suite,
+ GroupName, Props, TCs)];
+ ({GrSpec = {GroupName,_,_},TCs}) ->
Props = [{override,GrSpec}],
- [ct_framework:make_conf(TestDir, Suite,
- Group, Props, TCs)];
- ({Group,TCs}) ->
- [ct_framework:make_conf(TestDir, Suite,
- Group, [], TCs)];
+ [ct_groups:make_conf(TestDir, Suite,
+ GroupName, Props, TCs)];
+ ({GroupOrGroups,TCs}) ->
+ [ct_groups:make_conf(TestDir, Suite,
+ GroupOrGroups, [], TCs)];
(TC) ->
[TC]
end, GrsOrCs),
@@ -1988,12 +2028,12 @@ final_tests1([], Final, Skip, _Bad) ->
{lists:reverse(Final),Skip}.
final_skip([{TestDir,Suite,{all,all},Reason}|Skips], Final) ->
- SkipConf = ct_framework:make_conf(TestDir, Suite, all, [], all),
+ SkipConf = ct_groups:make_conf(TestDir, Suite, all, [], all),
Skip = {TestDir,Suite,SkipConf,Reason},
final_skip(Skips, [Skip|Final]);
final_skip([{TestDir,Suite,{Group,TCs},Reason}|Skips], Final) ->
- Conf = ct_framework:make_conf(TestDir, Suite, Group, [], TCs),
+ Conf = ct_groups:make_conf(TestDir, Suite, Group, [], TCs),
Skip = {TestDir,Suite,Conf,Reason},
final_skip(Skips, [Skip|Final]);
@@ -2120,7 +2160,8 @@ do_run_test(Tests, Skip, Opts) ->
%% tell test_server which modules should be cover compiled
%% note that actual compilation is done when tests start
test_server_ctrl:cover(CovApp, CovFile, CovExcl, CovIncl,
- CovCross, CovExport, CovLevel),
+ CovCross, CovExport, CovLevel,
+ Opts#opts.cover_stop),
%% save cover data (used e.g. to add nodes dynamically)
ct_util:set_testdata({cover,CovData}),
%% start cover on specified nodes
@@ -2192,6 +2233,15 @@ do_run_test(Tests, Skip, Opts) ->
end, CleanUp),
[code:del_path(Dir) || Dir <- AddedToPath],
+ %% If a severe error has occurred in the test_server,
+ %% we will generate an exception here.
+ case ct_util:get_testdata(severe_error) of
+ undefined -> ok;
+ SevereError ->
+ ct_logs:log("SEVERE ERROR", "~p\n", [SevereError]),
+ exit(SevereError)
+ end,
+
case ct_util:get_testdata(stats) of
Stats = {_Ok,_Failed,{_UserSkipped,_AutoSkipped}} ->
Stats;
@@ -2256,9 +2306,11 @@ add_jobs([{TestDir,all,_}|Tests], Skip, Opts, CleanUp) ->
wait_for_idle(),
add_jobs(Tests, Skip, Opts, CleanUp)
end;
-add_jobs([{TestDir,[Suite],all}|Tests], Skip, Opts, CleanUp) when is_atom(Suite) ->
+add_jobs([{TestDir,[Suite],all}|Tests], Skip,
+ Opts, CleanUp) when is_atom(Suite) ->
add_jobs([{TestDir,Suite,all}|Tests], Skip, Opts, CleanUp);
-add_jobs([{TestDir,Suites,all}|Tests], Skip, Opts, CleanUp) when is_list(Suites) ->
+add_jobs([{TestDir,Suites,all}|Tests], Skip,
+ Opts, CleanUp) when is_list(Suites) ->
Name = get_name(TestDir) ++ ".suites",
case catch test_server_ctrl:add_module_with_skip(Name, Suites,
skiplist(TestDir,Skip)) of
@@ -2273,7 +2325,8 @@ add_jobs([{TestDir,Suite,all}|Tests], Skip, Opts, CleanUp) ->
ok ->
Name = get_name(TestDir) ++ "." ++ atom_to_list(Suite),
case catch test_server_ctrl:add_module_with_skip(Name, [Suite],
- skiplist(TestDir,Skip)) of
+ skiplist(TestDir,
+ Skip)) of
{'EXIT',_} ->
CleanUp;
_ ->
@@ -2296,15 +2349,24 @@ add_jobs([{TestDir,Suite,Confs}|Tests], Skip, Opts, CleanUp) when
GrTestName =
case Confs of
[Conf] ->
- "." ++ atom_to_list(Group(Conf)) ++ TCTestName(TestCases(Conf));
+ case Group(Conf) of
+ GrName when is_atom(GrName) ->
+ "." ++ atom_to_list(GrName) ++
+ TCTestName(TestCases(Conf));
+ _ ->
+ ".groups" ++ TCTestName(TestCases(Conf))
+ end;
_ ->
".groups"
end,
TestName = get_name(TestDir) ++ "." ++ atom_to_list(Suite) ++ GrTestName,
case maybe_interpret(Suite, init_per_group, Opts) of
ok ->
- case catch test_server_ctrl:add_conf_with_skip(TestName, Suite, Confs,
- skiplist(TestDir,Skip)) of
+ case catch test_server_ctrl:add_conf_with_skip(TestName,
+ Suite,
+ Confs,
+ skiplist(TestDir,
+ Skip)) of
{'EXIT',_} ->
CleanUp;
_ ->
@@ -2316,18 +2378,21 @@ add_jobs([{TestDir,Suite,Confs}|Tests], Skip, Opts, CleanUp) when
end;
%% test case
-add_jobs([{TestDir,Suite,[Case]}|Tests], Skip, Opts, CleanUp) when is_atom(Case) ->
+add_jobs([{TestDir,Suite,[Case]}|Tests],
+ Skip, Opts, CleanUp) when is_atom(Case) ->
add_jobs([{TestDir,Suite,Case}|Tests], Skip, Opts, CleanUp);
-add_jobs([{TestDir,Suite,Cases}|Tests], Skip, Opts, CleanUp) when is_list(Cases) ->
+add_jobs([{TestDir,Suite,Cases}|Tests],
+ Skip, Opts, CleanUp) when is_list(Cases) ->
Cases1 = lists:map(fun({GroupName,_}) when is_atom(GroupName) -> GroupName;
(Case) -> Case
end, Cases),
case maybe_interpret(Suite, Cases1, Opts) of
ok ->
- Name = get_name(TestDir) ++ "." ++ atom_to_list(Suite) ++ ".cases",
+ Name = get_name(TestDir) ++ "." ++ atom_to_list(Suite) ++ ".cases",
case catch test_server_ctrl:add_cases_with_skip(Name, Suite, Cases1,
- skiplist(TestDir,Skip)) of
+ skiplist(TestDir,
+ Skip)) of
{'EXIT',_} ->
CleanUp;
_ ->
@@ -2343,7 +2408,8 @@ add_jobs([{TestDir,Suite,Case}|Tests], Skip, Opts, CleanUp) when is_atom(Case) -
Name = get_name(TestDir) ++ "." ++ atom_to_list(Suite) ++ "." ++
atom_to_list(Case),
case catch test_server_ctrl:add_case_with_skip(Name, Suite, Case,
- skiplist(TestDir,Skip)) of
+ skiplist(TestDir,
+ Skip)) of
{'EXIT',_} ->
CleanUp;
_ ->
@@ -2378,7 +2444,8 @@ skiplist(Dir, [{Dir,all,Cmt}|Skip]) ->
%% we need to turn 'all' into list of modules since
%% test_server doesn't do skips on Dir level
Ss = filelib:wildcard(filename:join(Dir, "*_SUITE.beam")),
- [{list_to_atom(filename:basename(S,".beam")),Cmt} || S <- Ss] ++ skiplist(Dir,Skip);
+ [{list_to_atom(filename:basename(S,".beam")),Cmt} || S <- Ss] ++
+ skiplist(Dir,Skip);
skiplist(Dir, [{Dir,S,Cmt}|Skip]) ->
[{S,Cmt} | skiplist(Dir, Skip)];
skiplist(Dir, [{Dir,S,C,Cmt}|Skip]) ->
@@ -2438,8 +2505,10 @@ run_make(Targets, TestDir0, Mod, UserInclude) ->
FileTest = fun(F, suites) -> is_suite(F);
(F, helpmods) -> not is_suite(F)
end,
- Files = lists:flatmap(fun({F,out_of_date}) ->
- case FileTest(F, Targets) of
+ Files =
+ lists:flatmap(fun({F,out_of_date}) ->
+ case FileTest(F,
+ Targets) of
true -> [F];
false -> []
end;
@@ -2575,6 +2644,9 @@ merge_arguments([LogDir={logdir,_}|Args], Merged) ->
merge_arguments([CoverFile={cover,_}|Args], Merged) ->
merge_arguments(Args, handle_arg(replace, CoverFile, Merged));
+merge_arguments([CoverStop={cover_stop,_}|Args], Merged) ->
+ merge_arguments(Args, handle_arg(replace, CoverStop, Merged));
+
merge_arguments([{'case',TC}|Args], Merged) ->
merge_arguments(Args, handle_arg(merge, {testcase,TC}, Merged));
@@ -2783,11 +2855,14 @@ opts2args(EnvStartOpts) ->
lists:flatmap(fun({exit_status,ExitStatusOpt}) when is_atom(ExitStatusOpt) ->
[{exit_status,[atom_to_list(ExitStatusOpt)]}];
({halt_with,{HaltM,HaltF}}) ->
- [{halt_with,[atom_to_list(HaltM),atom_to_list(HaltF)]}];
+ [{halt_with,[atom_to_list(HaltM),
+ atom_to_list(HaltF)]}];
({interactive_mode,true}) ->
[{shell,[]}];
- ({config,CfgFiles}) ->
- [{ct_config,[CfgFiles]}];
+ ({config,CfgFile}) when is_integer(hd(CfgFile)) ->
+ [{ct_config,[CfgFile]}];
+ ({config,CfgFiles}) when is_list(hd(CfgFiles)) ->
+ [{ct_config,CfgFiles}];
({userconfig,{CBM,CfgStr=[X|_]}}) when is_integer(X) ->
[{userconfig,[atom_to_list(CBM),CfgStr]}];
({userconfig,{CBM,CfgStrs}}) when is_list(CfgStrs) ->
@@ -2805,6 +2880,12 @@ opts2args(EnvStartOpts) ->
end, UserCfg),
[_LastAnd|StrsR] = lists:reverse(lists:flatten(Strs)),
[{userconfig,lists:reverse(StrsR)}];
+ ({group,G}) when is_atom(G) ->
+ [{group,[atom_to_list(G)]}];
+ ({group,Gs}) when is_list(Gs) ->
+ LOfGStrs = [lists:flatten(io_lib:format("~w",[G])) ||
+ G <- Gs],
+ [{group,LOfGStrs}];
({testcase,Case}) when is_atom(Case) ->
[{'case',[atom_to_list(Case)]}];
({testcase,Cases}) ->
diff --git a/lib/common_test/src/ct_slave.erl b/lib/common_test/src/ct_slave.erl
index aa3413fa89..1fd8c04f8b 100644
--- a/lib/common_test/src/ct_slave.erl
+++ b/lib/common_test/src/ct_slave.erl
@@ -1,7 +1,7 @@
%%--------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2010. All Rights Reserved.
+%% Copyright Ericsson AB 2010-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -37,7 +37,7 @@
-record(options, {username, password, boot_timeout, init_timeout,
startup_timeout, startup_functions, monitor_master,
- kill_if_fail, erl_flags}).
+ kill_if_fail, erl_flags, env}).
%%%-----------------------------------------------------------------
%%% @spec start(Node) -> Result
@@ -85,7 +85,8 @@ start(Host, Node) ->
%%% {startup_functions, StartupFunctions} |
%%% {monitor_master, Monitor} |
%%% {kill_if_fail, KillIfFail} |
-%%% {erl_flags, ErlangFlags}
+%%% {erl_flags, ErlangFlags} |
+%%% {env, [{EnvVar,Value}]}
%%% Username = string()
%%% Password = string()
%%% BootTimeout = integer()
@@ -99,6 +100,8 @@ start(Host, Node) ->
%%% Monitor = bool()
%%% KillIfFail = bool()
%%% ErlangFlags = string()
+%%% EnvVar = string()
+%%% Value = string()
%%% Result = {ok, NodeName} | {error, already_started, NodeName} |
%%% {error, started_not_connected, NodeName} |
%%% {error, boot_timeout, NodeName} |
@@ -152,6 +155,9 @@ start(Host, Node) ->
%%% <p>Option <code>erlang_flags</code> specifies, which flags will be added
%%% to the parameters of the <code>erl</code> executable.</p>
%%%
+%%% <p>Option <code>env</code> specifies a list of environment variables
+%%% that will extended the environment.</p>
+%%%
%%% <p>Special return values are:
%%% <list>
%%% <item><code>{error, already_started, NodeName}</code> - if the node with
@@ -233,10 +239,12 @@ fetch_options(Options) ->
Monitor = get_option_value(monitor_master, Options, false),
KillIfFail = get_option_value(kill_if_fail, Options, true),
ErlFlags = get_option_value(erl_flags, Options, []),
+ EnvVars = get_option_value(env, Options, []),
#options{username=UserName, password=Password,
boot_timeout=BootTimeout, init_timeout=InitTimeout,
startup_timeout=StartupTimeout, startup_functions=StartupFunctions,
- monitor_master=Monitor, kill_if_fail=KillIfFail, erl_flags=ErlFlags}.
+ monitor_master=Monitor, kill_if_fail=KillIfFail,
+ erl_flags=ErlFlags, env=EnvVars}.
% send a message when slave node is started
% @hidden
@@ -306,11 +314,19 @@ do_start(Host, Node, Options) ->
true->
spawn_remote_node(Host, Node, Options)
end,
+
BootTimeout = Options#options.boot_timeout,
InitTimeout = Options#options.init_timeout,
StartupTimeout = Options#options.startup_timeout,
Result = case wait_for_node_alive(ENode, BootTimeout) of
pong->
+ case test_server:is_cover() of
+ true ->
+ MainCoverNode = cover:get_main_node(),
+ rpc:call(MainCoverNode,cover,start,[ENode]);
+ false ->
+ ok
+ end,
call_functions(ENode, Functions2),
receive
{node_started, ENode}->
@@ -365,9 +381,9 @@ get_cmd(Node, Flags) ->
% spawn node locally
spawn_local_node(Node, Options) ->
- ErlFlags = Options#options.erl_flags,
+ #options{env=Env,erl_flags=ErlFlags} = Options,
Cmd = get_cmd(Node, ErlFlags),
- open_port({spawn, Cmd}, [stream]).
+ open_port({spawn, Cmd}, [stream,{env,Env}]).
% start crypto and ssh if not yet started
check_for_ssh_running() ->
@@ -386,9 +402,10 @@ check_for_ssh_running() ->
% spawn node remotely
spawn_remote_node(Host, Node, Options) ->
- Username = Options#options.username,
- Password = Options#options.password,
- ErlFlags = Options#options.erl_flags,
+ #options{username=Username,
+ password=Password,
+ erl_flags=ErlFlags,
+ env=Env} = Options,
SSHOptions = case {Username, Password} of
{[], []}->
[];
@@ -400,8 +417,17 @@ spawn_remote_node(Host, Node, Options) ->
check_for_ssh_running(),
{ok, SSHConnRef} = ssh:connect(atom_to_list(Host), 22, SSHOptions),
{ok, SSHChannelId} = ssh_connection:session_channel(SSHConnRef, infinity),
+ ssh_setenv(SSHConnRef, SSHChannelId, Env),
ssh_connection:exec(SSHConnRef, SSHChannelId, get_cmd(Node, ErlFlags), infinity).
+
+ssh_setenv(SSHConnRef, SSHChannelId, [{Var, Value} | Vars])
+ when is_list(Var), is_list(Value) ->
+ success = ssh_connection:setenv(SSHConnRef, SSHChannelId,
+ Var, Value, infinity),
+ ssh_setenv(SSHConnRef, SSHChannelId, Vars);
+ssh_setenv(_SSHConnRef, _SSHChannelId, []) -> ok.
+
% call functions on a remote Erlang node
call_functions(_Node, []) ->
ok;
@@ -423,8 +449,29 @@ wait_for_node_alive(Node, N) ->
% call init:stop on a remote node
do_stop(ENode) ->
+ {Cover,MainCoverNode} =
+ case test_server:is_cover() of
+ true ->
+ Main = cover:get_main_node(),
+ rpc:call(Main,cover,flush,[ENode]),
+ {true,Main};
+ false ->
+ {false,undefined}
+ end,
spawn(ENode, init, stop, []),
- wait_for_node_dead(ENode, 5).
+ case wait_for_node_dead(ENode, 5) of
+ {ok,ENode} ->
+ if Cover ->
+ %% To avoid that cover is started again if a node
+ %% with the same name is started later.
+ rpc:call(MainCoverNode,cover,stop,[ENode]);
+ true ->
+ ok
+ end,
+ {ok,ENode};
+ Error ->
+ Error
+ end.
% wait N seconds until node is disconnected
wait_for_node_dead(Node, 0) ->
diff --git a/lib/common_test/src/ct_snmp.erl b/lib/common_test/src/ct_snmp.erl
index 8fe63e8ed1..71038bd4f4 100644
--- a/lib/common_test/src/ct_snmp.erl
+++ b/lib/common_test/src/ct_snmp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -39,7 +39,7 @@
%%% %%% Manager config
%%% [{start_manager, boolean()} % Optional - default is true
%%% {users, [{user_name(), [call_back_module(), user_data()]}]}, %% Optional
-%%% {usm_users, [{usm_user_name(), usm_config()}]},%% Optional - snmp v3 only
+%%% {usm_users, [{usm_user_name(), [usm_config()]}]},%% Optional - snmp v3 only
%%% % managed_agents is optional
%%% {managed_agents,[{agent_name(), [user_name(), agent_ip(), agent_port(), [agent_config()]]}]},
%%% {max_msg_size, integer()}, % Optional - default is 484
@@ -130,7 +130,7 @@
%%% @type agent_config() = {Item, Value}
%%% @type user_name() = atom()
%%% @type usm_user_name() = string()
-%%% @type usm_config() = string()
+%%% @type usm_config() = {Item, Value}
%%% @type call_back_module() = atom()
%%% @type user_data() = term()
%%% @type oids() = [oid()]
@@ -157,8 +157,9 @@
%%% API
-export([start/2, start/3, stop/1, get_values/3, get_next_values/3, set_values/4,
set_info/1, register_users/2, register_agents/2, register_usm_users/2,
- unregister_users/1, unregister_agents/1, update_usm_users/2,
- load_mibs/1]).
+ unregister_users/1, unregister_users/2, unregister_agents/1,
+ unregister_agents/2, unregister_usm_users/1, unregister_usm_users/2,
+ load_mibs/1, unload_mibs/1]).
%% Manager values
-define(CT_SNMP_LOG_FILE, "ct_snmp_set.log").
@@ -250,10 +251,8 @@ stop(Config) ->
%%%
%%% @doc Issues a synchronous snmp get request.
get_values(Agent, Oids, MgrAgentConfName) ->
- [Uid, AgentIp, AgentUdpPort | _] =
- agent_conf(Agent, MgrAgentConfName),
- {ok, SnmpReply, _} =
- snmpm:g(Uid, AgentIp, AgentUdpPort, Oids),
+ [Uid | _] = agent_conf(Agent, MgrAgentConfName),
+ {ok, SnmpReply, _} = snmpm:sync_get2(Uid, target_name(Agent), Oids),
SnmpReply.
%%% @spec get_next_values(Agent, Oids, MgrAgentConfName) -> SnmpReply
@@ -265,10 +264,8 @@ get_values(Agent, Oids, MgrAgentConfName) ->
%%%
%%% @doc Issues a synchronous snmp get next request.
get_next_values(Agent, Oids, MgrAgentConfName) ->
- [Uid, AgentIp, AgentUdpPort | _] =
- agent_conf(Agent, MgrAgentConfName),
- {ok, SnmpReply, _} =
- snmpm:gn(Uid, AgentIp, AgentUdpPort, Oids),
+ [Uid | _] = agent_conf(Agent, MgrAgentConfName),
+ {ok, SnmpReply, _} = snmpm:sync_get_next2(Uid, target_name(Agent), Oids),
SnmpReply.
%%% @spec set_values(Agent, VarsAndVals, MgrAgentConfName, Config) -> SnmpReply
@@ -282,13 +279,11 @@ get_next_values(Agent, Oids, MgrAgentConfName) ->
%%% @doc Issues a synchronous snmp set request.
set_values(Agent, VarsAndVals, MgrAgentConfName, Config) ->
PrivDir = ?config(priv_dir, Config),
- [Uid, AgentIp, AgentUdpPort | _] =
- agent_conf(Agent, MgrAgentConfName),
+ [Uid | _] = agent_conf(Agent, MgrAgentConfName),
Oids = lists:map(fun({Oid, _, _}) -> Oid end, VarsAndVals),
- {ok, SnmpGetReply, _} =
- snmpm:g(Uid, AgentIp, AgentUdpPort, Oids),
- {ok, SnmpSetReply, _} =
- snmpm:s(Uid, AgentIp, AgentUdpPort, VarsAndVals),
+ TargetName = target_name(Agent),
+ {ok, SnmpGetReply, _} = snmpm:sync_get2(Uid, TargetName, Oids),
+ {ok, SnmpSetReply, _} = snmpm:sync_set2(Uid, TargetName, VarsAndVals),
case SnmpSetReply of
{noError, 0, _} when PrivDir /= false ->
log(PrivDir, Agent, SnmpGetReply, VarsAndVals);
@@ -328,12 +323,23 @@ set_info(Config) ->
%%% Reason = term()
%%%
%%% @doc Register the manager entity (=user) responsible for specific agent(s).
-%%% Corresponds to making an entry in users.conf
+%%% Corresponds to making an entry in users.conf.
+%%%
+%%% This function will try to register the given users, without
+%%% checking if any of them already exist. In order to change an
+%%% already registered user, the user must first be unregistered.
register_users(MgrAgentConfName, Users) ->
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users, Users}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- setup_users(Users).
+ case setup_users(Users) of
+ ok ->
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ OldUsers = ct:get_config({MgrAgentConfName,users},[]),
+ NewSnmpVals = lists:keystore(users, 1, SnmpVals,
+ {users, Users ++ OldUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok;
+ Error ->
+ Error
+ end.
%%% @spec register_agents(MgrAgentConfName, ManagedAgents) -> ok | {error, Reason}
%%%
@@ -343,12 +349,24 @@ register_users(MgrAgentConfName, Users) ->
%%%
%%% @doc Explicitly instruct the manager to handle this agent.
%%% Corresponds to making an entry in agents.conf
+%%%
+%%% This function will try to register the given managed agents,
+%%% without checking if any of them already exist. In order to change
+%%% an already registered managed agent, the agent must first be
+%%% unregistered.
register_agents(MgrAgentConfName, ManagedAgents) ->
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals,
- {managed_agents, ManagedAgents}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- setup_managed_agents(ManagedAgents).
+ case setup_managed_agents(MgrAgentConfName,ManagedAgents) of
+ ok ->
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ OldAgents = ct:get_config({MgrAgentConfName,managed_agents},[]),
+ NewSnmpVals = lists:keystore(managed_agents, 1, SnmpVals,
+ {managed_agents,
+ ManagedAgents ++ OldAgents}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok;
+ Error ->
+ Error
+ end.
%%% @spec register_usm_users(MgrAgentConfName, UsmUsers) -> ok | {error, Reason}
%%%
@@ -358,60 +376,115 @@ register_agents(MgrAgentConfName, ManagedAgents) ->
%%%
%%% @doc Explicitly instruct the manager to handle this USM user.
%%% Corresponds to making an entry in usm.conf
+%%%
+%%% This function will try to register the given users, without
+%%% checking if any of them already exist. In order to change an
+%%% already registered user, the user must first be unregistered.
register_usm_users(MgrAgentConfName, UsmUsers) ->
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {usm_users, UsmUsers}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
EngineID = ct:get_config({MgrAgentConfName, engine_id}, ?ENGINE_ID),
- setup_usm_users(UsmUsers, EngineID).
+ case setup_usm_users(UsmUsers, EngineID) of
+ ok ->
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ OldUsmUsers = ct:get_config({MgrAgentConfName,usm_users},[]),
+ NewSnmpVals = lists:keystore(usm_users, 1, SnmpVals,
+ {usm_users, UsmUsers ++ OldUsmUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok;
+ Error ->
+ Error
+ end.
-%%% @spec unregister_users(MgrAgentConfName) -> ok | {error, Reason}
+%%% @spec unregister_users(MgrAgentConfName) -> ok
%%%
%%% MgrAgentConfName = atom()
%%% Reason = term()
%%%
-%%% @doc Removes information added when calling register_users/2.
+%%% @doc Unregister all users.
unregister_users(MgrAgentConfName) ->
- Users = lists:map(fun({UserName, _}) -> UserName end,
- ct:get_config({MgrAgentConfName, users})),
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users, []}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- takedown_users(Users).
+ Users = [Id || {Id,_} <- ct:get_config({MgrAgentConfName, users},[])],
+ unregister_users(MgrAgentConfName,Users).
-%%% @spec unregister_agents(MgrAgentConfName) -> ok | {error, Reason}
+%%% @spec unregister_users(MgrAgentConfName,Users) -> ok
%%%
%%% MgrAgentConfName = atom()
+%%% Users = [user_name()]
%%% Reason = term()
%%%
-%%% @doc Removes information added when calling register_agents/2.
+%%% @doc Unregister the given users.
+unregister_users(MgrAgentConfName,Users) ->
+ takedown_users(Users),
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ AllUsers = ct:get_config({MgrAgentConfName, users},[]),
+ RemainingUsers = lists:filter(fun({Id,_}) ->
+ not lists:member(Id,Users)
+ end,
+ AllUsers),
+ NewSnmpVals = lists:keyreplace(users, 1, SnmpVals, {users,RemainingUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok.
+
+%%% @spec unregister_agents(MgrAgentConfName) -> ok
+%%%
+%%% MgrAgentConfName = atom()
+%%% Reason = term()
+%%%
+%%% @doc Unregister all managed agents.
unregister_agents(MgrAgentConfName) ->
- ManagedAgents = lists:map(fun({_, [Uid, AgentIP, AgentPort, _]}) ->
- {Uid, AgentIP, AgentPort}
- end,
- ct:get_config({MgrAgentConfName, managed_agents})),
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals,
- {managed_agents, []}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
- takedown_managed_agents(ManagedAgents).
+ ManagedAgents = [AgentName ||
+ {AgentName, _} <-
+ ct:get_config({MgrAgentConfName,managed_agents},[])],
+ unregister_agents(MgrAgentConfName,ManagedAgents).
+%%% @spec unregister_agents(MgrAgentConfName,ManagedAgents) -> ok
+%%%
+%%% MgrAgentConfName = atom()
+%%% ManagedAgents = [agent_name()]
+%%% Reason = term()
+%%%
+%%% @doc Unregister the given managed agents.
+unregister_agents(MgrAgentConfName,ManagedAgents) ->
+ takedown_managed_agents(MgrAgentConfName, ManagedAgents),
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ AllAgents = ct:get_config({MgrAgentConfName,managed_agents},[]),
+ RemainingAgents = lists:filter(fun({Name,_}) ->
+ not lists:member(Name,ManagedAgents)
+ end,
+ AllAgents),
+ NewSnmpVals = lists:keyreplace(managed_agents, 1, SnmpVals,
+ {managed_agents,RemainingAgents}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok.
-%%% @spec update_usm_users(MgrAgentConfName, UsmUsers) -> ok | {error, Reason}
+%%% @spec unregister_usm_users(MgrAgentConfName) -> ok
%%%
%%% MgrAgentConfName = atom()
-%%% UsmUsers = usm_users()
%%% Reason = term()
%%%
-%%% @doc Alters information added when calling register_usm_users/2.
-update_usm_users(MgrAgentConfName, UsmUsers) ->
-
- {snmp, SnmpVals} = ct:get_config(MgrAgentConfName),
- NewSnmpVals = lists:keyreplace(usm_users, 1, SnmpVals,
- {usm_users, UsmUsers}),
- ct_config:update_config(MgrAgentConfName, {snmp, NewSnmpVals}),
+%%% @doc Unregister all usm users.
+unregister_usm_users(MgrAgentConfName) ->
+ UsmUsers = [Id || {Id,_} <- ct:get_config({MgrAgentConfName, usm_users},[])],
+ unregister_usm_users(MgrAgentConfName,UsmUsers).
+
+%%% @spec unregister_usm_users(MgrAgentConfName,UsmUsers) -> ok
+%%%
+%%% MgrAgentConfName = atom()
+%%% UsmUsers = [usm_user_name()]
+%%% Reason = term()
+%%%
+%%% @doc Unregister the given usm users.
+unregister_usm_users(MgrAgentConfName,UsmUsers) ->
EngineID = ct:get_config({MgrAgentConfName, engine_id}, ?ENGINE_ID),
- do_update_usm_users(UsmUsers, EngineID).
+ takedown_usm_users(UsmUsers,EngineID),
+ SnmpVals = ct:get_config(MgrAgentConfName),
+ AllUsmUsers = ct:get_config({MgrAgentConfName, usm_users},[]),
+ RemainingUsmUsers = lists:filter(fun({Id,_}) ->
+ not lists:member(Id,UsmUsers)
+ end,
+ AllUsmUsers),
+ NewSnmpVals = lists:keyreplace(usm_users, 1, SnmpVals,
+ {usm_users,RemainingUsmUsers}),
+ ct_config:update_config(MgrAgentConfName, NewSnmpVals),
+ ok.
%%% @spec load_mibs(Mibs) -> ok | {error, Reason}
%%%
@@ -423,6 +496,15 @@ update_usm_users(MgrAgentConfName, UsmUsers) ->
load_mibs(Mibs) ->
snmpa:load_mibs(snmp_master_agent, Mibs).
+%%% @spec unload_mibs(Mibs) -> ok | {error, Reason}
+%%%
+%%% Mibs = [MibName]
+%%% MibName = string()
+%%% Reason = term()
+%%%
+%%% @doc Unload the mibs from the agent 'snmp_master_agent'.
+unload_mibs(Mibs) ->
+ snmpa:unload_mibs(snmp_master_agent, Mibs).
%%%========================================================================
%%% Internal functions
@@ -486,9 +568,8 @@ setup_agent(true, AgentConfName, SnmpConfName,
file:make_dir(DbDir),
snmp_config:write_agent_snmp_files(ConfDir, Vsns, ManagerIP, TrapUdp,
AgentIP, AgentUdp, SysName,
- atom_to_list(NotifType),
- SecType, Passwd, AgentEngineID,
- AgentMaxMsgSize),
+ NotifType, SecType, Passwd,
+ AgentEngineID, AgentMaxMsgSize),
override_default_configuration(Config, AgentConfName),
@@ -497,7 +578,8 @@ setup_agent(true, AgentConfName, SnmpConfName,
{verbosity, trace}]},
{agent_type, master},
{agent_verbosity, trace},
- {net_if, [{verbosity, trace}]}],
+ {net_if, [{verbosity, trace}]},
+ {versions, Vsns}],
ct:get_config({SnmpConfName,agent})),
application:set_env(snmp, agent, SnmpEnv).
%%%---------------------------------------------------------------------------
@@ -535,65 +617,61 @@ manager_register(true, MgrAgentConfName) ->
setup_usm_users(UsmUsers, EngineID),
setup_users(Users),
- setup_managed_agents(Agents).
+ setup_managed_agents(MgrAgentConfName,Agents).
%%%---------------------------------------------------------------------------
setup_users(Users) ->
- lists:foreach(fun({Id, [Module, Data]}) ->
- snmpm:register_user(Id, Module, Data)
- end, Users).
+ while_ok(fun({Id, [Module, Data]}) ->
+ snmpm:register_user(Id, Module, Data)
+ end, Users).
%%%---------------------------------------------------------------------------
-setup_managed_agents([]) ->
- ok;
-
-setup_managed_agents([{_, [Uid, AgentIp, AgentUdpPort, AgentConf]} |
- Rest]) ->
- NewAgentIp = case AgentIp of
- IpTuple when is_tuple(IpTuple) ->
- IpTuple;
- HostName when is_list(HostName) ->
- {ok,Hostent} = inet:gethostbyname(HostName),
- [IpTuple|_] = Hostent#hostent.h_addr_list,
- IpTuple
- end,
- ok = snmpm:register_agent(Uid, NewAgentIp, AgentUdpPort),
- lists:foreach(fun({Item, Val}) ->
- snmpm:update_agent_info(Uid, NewAgentIp,
- AgentUdpPort, Item, Val)
- end, AgentConf),
- setup_managed_agents(Rest).
+setup_managed_agents(AgentConfName,Agents) ->
+ Fun =
+ fun({AgentName, [Uid, AgentIp, AgentUdpPort, AgentConf0]}) ->
+ NewAgentIp = case AgentIp of
+ IpTuple when is_tuple(IpTuple) ->
+ IpTuple;
+ HostName when is_list(HostName) ->
+ {ok,Hostent} = inet:gethostbyname(HostName),
+ [IpTuple|_] = Hostent#hostent.h_addr_list,
+ IpTuple
+ end,
+ AgentConf =
+ case lists:keymember(engine_id,1,AgentConf0) of
+ true ->
+ AgentConf0;
+ false ->
+ DefaultEngineID =
+ ct:get_config({AgentConfName,agent_engine_id},
+ ?AGENT_ENGINE_ID),
+ [{engine_id,DefaultEngineID}|AgentConf0]
+ end,
+ snmpm:register_agent(Uid, target_name(AgentName),
+ [{address,NewAgentIp},{port,AgentUdpPort} |
+ AgentConf])
+ end,
+ while_ok(Fun,Agents).
%%%---------------------------------------------------------------------------
setup_usm_users(UsmUsers, EngineID)->
- lists:foreach(fun({UsmUser, Conf}) ->
- snmpm:register_usm_user(EngineID, UsmUser, Conf)
- end, UsmUsers).
+ while_ok(fun({UsmUser, Conf}) ->
+ snmpm:register_usm_user(EngineID, UsmUser, Conf)
+ end, UsmUsers).
%%%---------------------------------------------------------------------------
takedown_users(Users) ->
- lists:foreach(fun({Id}) ->
+ lists:foreach(fun(Id) ->
snmpm:unregister_user(Id)
end, Users).
%%%---------------------------------------------------------------------------
-takedown_managed_agents([{Uid, AgentIp, AgentUdpPort} |
- Rest]) ->
- NewAgentIp = case AgentIp of
- IpTuple when is_tuple(IpTuple) ->
- IpTuple;
- HostName when is_list(HostName) ->
- {ok,Hostent} = inet:gethostbyname(HostName),
- [IpTuple|_] = Hostent#hostent.h_addr_list,
- IpTuple
- end,
- ok = snmpm:unregister_agent(Uid, NewAgentIp, AgentUdpPort),
- takedown_managed_agents(Rest);
-
-takedown_managed_agents([]) ->
- ok.
+takedown_managed_agents(MgrAgentConfName,ManagedAgents) ->
+ lists:foreach(fun(AgentName) ->
+ [Uid | _] = agent_conf(AgentName, MgrAgentConfName),
+ snmpm:unregister_agent(Uid, target_name(AgentName))
+ end, ManagedAgents).
%%%---------------------------------------------------------------------------
-do_update_usm_users(UsmUsers, EngineID) ->
- lists:foreach(fun({UsmUser, {Item, Val}}) ->
- snmpm:update_usm_user_info(EngineID, UsmUser,
- Item, Val)
- end, UsmUsers).
+takedown_usm_users(UsmUsers, EngineID) ->
+ lists:foreach(fun(Id) ->
+ snmpm:unregister_usm_user(EngineID, Id)
+ end, UsmUsers).
%%%---------------------------------------------------------------------------
log(PrivDir, Agent, {_, _, Varbinds}, NewVarsAndVals) ->
@@ -657,7 +735,7 @@ override_contexts(Config, {data_dir_file, File}) ->
override_contexts(Config, ContextInfo);
override_contexts(Config, Contexts) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"context.conf"),
file:delete(File),
snmp_config:write_agent_context_config(Dir, "", Contexts).
@@ -673,7 +751,7 @@ override_sysinfo(Config, {data_dir_file, File}) ->
override_sysinfo(Config, SysInfo);
override_sysinfo(Config, SysInfo) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"standard.conf"),
file:delete(File),
snmp_config:write_agent_standard_config(Dir, "", SysInfo).
@@ -688,7 +766,7 @@ override_target_address(Config, {data_dir_file, File}) ->
override_target_address(Config, TargetAddressConf);
override_target_address(Config, TargetAddressConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"target_addr.conf"),
file:delete(File),
snmp_config:write_agent_target_addr_config(Dir, "", TargetAddressConf).
@@ -704,7 +782,7 @@ override_target_params(Config, {data_dir_file, File}) ->
override_target_params(Config, TargetParamsConf);
override_target_params(Config, TargetParamsConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"target_params.conf"),
file:delete(File),
snmp_config:write_agent_target_params_config(Dir, "", TargetParamsConf).
@@ -719,7 +797,7 @@ override_notify(Config, {data_dir_file, File}) ->
override_notify(Config, NotifyConf);
override_notify(Config, NotifyConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"notify.conf"),
file:delete(File),
snmp_config:write_agent_notify_config(Dir, "", NotifyConf).
@@ -734,7 +812,7 @@ override_usm(Config, {data_dir_file, File}) ->
override_usm(Config, UsmConf);
override_usm(Config, UsmConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"usm.conf"),
file:delete(File),
snmp_config:write_agent_usm_config(Dir, "", UsmConf).
@@ -749,7 +827,7 @@ override_community(Config, {data_dir_file, File}) ->
override_community(Config, CommunityConf);
override_community(Config, CommunityConf) ->
- Dir = ?config(priv_dir, Config),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
File = filename:join(Dir,"community.conf"),
file:delete(File),
snmp_config:write_agent_community_config(Dir, "", CommunityConf).
@@ -765,7 +843,20 @@ override_vacm(Config, {data_dir_file, File}) ->
override_vacm(Config, VacmConf);
override_vacm(Config, VacmConf) ->
- Dir = ?config(priv_dir, Config),
- File = filename:join(Dir,"vacm.conf"),
+ Dir = filename:join(?config(priv_dir, Config),"conf"),
+ File = filename:join(Dir,"vacm.conf"),
file:delete(File),
snmp_config:write_agent_vacm_config(Dir, "", VacmConf).
+
+%%%---------------------------------------------------------------------------
+
+target_name(Agent) ->
+ atom_to_list(Agent).
+
+while_ok(Fun,[H|T]) ->
+ case Fun(H) of
+ ok -> while_ok(Fun,T);
+ Error -> Error
+ end;
+while_ok(_Fun,[]) ->
+ ok.
diff --git a/lib/common_test/src/ct_testspec.erl b/lib/common_test/src/ct_testspec.erl
index a8b67d0329..202d8f9373 100644
--- a/lib/common_test/src/ct_testspec.erl
+++ b/lib/common_test/src/ct_testspec.erl
@@ -903,6 +903,8 @@ handle_data(logdir,Node,Dir,Spec) ->
[{Node,ref2dir(Dir,Spec)}];
handle_data(cover,Node,File,Spec) ->
[{Node,get_absfile(File,Spec)}];
+handle_data(cover_stop,Node,Stop,_Spec) ->
+ [{Node,Stop}];
handle_data(include,Node,Dirs=[D|_],Spec) when is_list(D) ->
[{Node,ref2dir(Dir,Spec)} || Dir <- Dirs];
handle_data(include,Node,Dir=[Ch|_],Spec) when is_integer(Ch) ->
@@ -1026,20 +1028,24 @@ insert_groups(Node,Dir,Suite,Group,Cases,Tests,MergeTests)
insert_groups(Node,Dir,Suite,[Group],Cases,Tests,MergeTests);
insert_groups(Node,Dir,Suite,Groups,Cases,Tests,false) when
((Cases == all) or is_list(Cases)) and is_list(Groups) ->
- Groups1 = [{Gr,Cases} || Gr <- Groups],
+ Groups1 = [if is_list(Gr) -> % preserve group path
+ {[Gr],Cases};
+ true ->
+ {Gr,Cases} end || Gr <- Groups],
append({{Node,Dir},[{Suite,Groups1}]},Tests);
insert_groups(Node,Dir,Suite,Groups,Cases,Tests,true) when
((Cases == all) or is_list(Cases)) and is_list(Groups) ->
+ Groups1 = [if is_list(Gr) -> % preserve group path
+ {[Gr],Cases};
+ true ->
+ {Gr,Cases} end || Gr <- Groups],
case lists:keysearch({Node,Dir},1,Tests) of
{value,{{Node,Dir},[{all,_}]}} ->
Tests;
{value,{{Node,Dir},Suites0}} ->
- Suites1 = insert_groups1(Suite,
- [{Gr,Cases} || Gr <- Groups],
- Suites0),
+ Suites1 = insert_groups1(Suite,Groups1,Suites0),
insert_in_order({{Node,Dir},Suites1},Tests);
false ->
- Groups1 = [{Gr,Cases} || Gr <- Groups],
insert_in_order({{Node,Dir},[{Suite,Groups1}]},Tests)
end;
insert_groups(Node,Dir,Suite,Groups,Case,Tests, MergeTests)
@@ -1062,13 +1068,13 @@ insert_groups1(Suite,Groups,Suites0) ->
insert_groups2(_Groups,all) ->
all;
-insert_groups2([Group={GrName,Cases}|Groups],GrAndCases) ->
- case lists:keysearch(GrName,1,GrAndCases) of
- {value,{GrName,all}} ->
+insert_groups2([Group={Gr,Cases}|Groups],GrAndCases) ->
+ case lists:keysearch(Gr,1,GrAndCases) of
+ {value,{Gr,all}} ->
GrAndCases;
- {value,{GrName,Cases0}} ->
+ {value,{Gr,Cases0}} ->
Cases1 = insert_in_order(Cases,Cases0),
- insert_groups2(Groups,insert_in_order({GrName,Cases1},GrAndCases));
+ insert_groups2(Groups,insert_in_order({Gr,Cases1},GrAndCases));
false ->
insert_groups2(Groups,insert_in_order(Group,GrAndCases))
end;
@@ -1258,6 +1264,8 @@ valid_terms() ->
{node,3},
{cover,2},
{cover,3},
+ {cover_stop,2},
+ {cover_stop,3},
{config,2},
{config,3},
{config,4},
diff --git a/lib/common_test/src/ct_util.hrl b/lib/common_test/src/ct_util.hrl
index 196b5e46d0..c9c6514fa4 100644
--- a/lib/common_test/src/ct_util.hrl
+++ b/lib/common_test/src/ct_util.hrl
@@ -38,6 +38,7 @@
verbosity=[],
silent_connections=[],
cover=[],
+ cover_stop=[],
config=[],
userconfig=[],
event_handler=[],
diff --git a/lib/common_test/src/cth_conn_log.erl b/lib/common_test/src/cth_conn_log.erl
index 3af89db3a5..255f3ec78a 100644
--- a/lib/common_test/src/cth_conn_log.erl
+++ b/lib/common_test/src/cth_conn_log.erl
@@ -58,7 +58,7 @@
-spec init(Id, HookOpts) -> Result when
Id :: term(),
- HookOpts :: ct:hook_options(),
+ HookOpts :: ct_netconfc:hook_options(),
Result :: {ok,[{ct_netconfc:conn_mod(),
{ct_netconfc:log_type(),[ct_netconfc:key_or_name()]}}]}.
init(_Id, HookOpts) ->
diff --git a/lib/common_test/src/cth_log_redirect.erl b/lib/common_test/src/cth_log_redirect.erl
index 77f57c6195..78ae70f37e 100644
--- a/lib/common_test/src/cth_log_redirect.erl
+++ b/lib/common_test/src/cth_log_redirect.erl
@@ -54,7 +54,7 @@ post_init_per_group(_Group, _Config, Result, State) ->
post_end_per_testcase(_TC, _Config, Result, State) ->
%% Make sure that the event queue is flushed
%% before ending this test case.
- gen_event:call(error_logger, ?MODULE, flush),
+ gen_event:call(error_logger, ?MODULE, flush, 300000),
{Result, State}.
pre_end_per_group(Group, Config, {ct_log, Group}) ->
diff --git a/lib/common_test/src/cth_surefire.erl b/lib/common_test/src/cth_surefire.erl
index 76b0f0b5ea..e6eaad8d48 100644
--- a/lib/common_test/src/cth_surefire.erl
+++ b/lib/common_test/src/cth_surefire.erl
@@ -1,3 +1,22 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%--------------------------------------------------------------------
+
%%% @doc Common Test Framework functions handling test specifications.
%%%
%%% <p>This module creates a junit report of the test run if plugged in
@@ -27,18 +46,28 @@
-export([terminate/1]).
-record(state, { filepath, axis, properties, package, hostname,
- curr_suite, curr_suite_ts, curr_group = [], curr_tc,
- curr_log_dir, timer, tc_log,
+ curr_suite, curr_suite_ts, curr_group = [],
+ curr_log_dir, timer, tc_log, url_base,
test_cases = [],
test_suites = [] }).
--record(testcase, { log, group, classname, name, time, failure, timestamp }).
--record(testsuite, { errors, failures, hostname, name, tests,
+-record(testcase, { log, url, group, classname, name, time, result, timestamp }).
+-record(testsuite, { errors, failures, skipped, hostname, name, tests,
time, timestamp, id, package,
- properties, testcases }).
+ properties, testcases, log, url }).
+
+-define(default_report,"junit_report.xml").
+-define(suite_log,"suite.log.html").
+
+%% Number of dirs from log root to testcase log file.
+%% ct_run.<node>.<timestamp>/<test_name>/run.<timestamp>/<tc_log>.html
+-define(log_depth,3).
id(Opts) ->
- filename:absname(proplists:get_value(path, Opts, "junit_report.xml")).
+ case proplists:get_value(path, Opts) of
+ undefined -> ?default_report;
+ Path -> filename:absname(Path)
+ end.
init(Path, Opts) ->
{ok, Host} = inet:gethostname(),
@@ -47,10 +76,24 @@ init(Path, Opts) ->
package = proplists:get_value(package,Opts),
axis = proplists:get_value(axis,Opts,[]),
properties = proplists:get_value(properties,Opts,[]),
+ url_base = proplists:get_value(url_base,Opts),
timer = now() }.
pre_init_per_suite(Suite,Config,#state{ test_cases = [] } = State) ->
- {Config, init_tc(State#state{ curr_suite = Suite, curr_suite_ts = now() },
+ TcLog = proplists:get_value(tc_logfile,Config),
+ CurrLogDir = filename:dirname(TcLog),
+ Path =
+ case State#state.filepath of
+ ?default_report ->
+ RootDir = get_test_root(TcLog),
+ filename:join(RootDir,?default_report);
+ P ->
+ P
+ end,
+ {Config, init_tc(State#state{ filepath = Path,
+ curr_suite = Suite,
+ curr_suite_ts = now(),
+ curr_log_dir = CurrLogDir},
Config) };
pre_init_per_suite(Suite,Config,State) ->
%% Have to close the previous suite
@@ -59,7 +102,8 @@ pre_init_per_suite(Suite,Config,State) ->
post_init_per_suite(_Suite,Config, Result, State) ->
{Result, end_tc(init_per_suite,Config,Result,State)}.
-pre_end_per_suite(_Suite,Config,State) -> {Config, init_tc(State, Config)}.
+pre_end_per_suite(_Suite,Config,State) ->
+ {Config, init_tc(State, Config)}.
post_end_per_suite(_Suite,Config,Result,State) ->
{Result, end_tc(end_per_suite,Config,Result,State)}.
@@ -71,13 +115,15 @@ pre_init_per_group(Group,Config,State) ->
post_init_per_group(_Group,Config,Result,State) ->
{Result, end_tc(init_per_group,Config,Result,State)}.
-pre_end_per_group(_Group,Config,State) -> {Config, init_tc(State, Config)}.
+pre_end_per_group(_Group,Config,State) ->
+ {Config, init_tc(State, Config)}.
post_end_per_group(_Group,Config,Result,State) ->
NewState = end_tc(end_per_group, Config, Result, State),
{Result, NewState#state{ curr_group = tl(NewState#state.curr_group)}}.
-pre_init_per_testcase(_TC,Config,State) -> {Config, init_tc(State, Config)}.
+pre_init_per_testcase(_TC,Config,State) ->
+ {Config, init_tc(State, Config)}.
post_end_per_testcase(TC,Config,Result,State) ->
{Result, end_tc(TC,Config, Result,State)}.
@@ -88,11 +134,19 @@ on_tc_fail(_TC, Res, State) ->
TCs = State#state.test_cases,
TC = hd(TCs),
NewTC = TC#testcase{
- failure =
+ result =
{fail,lists:flatten(io_lib:format("~p",[Res]))} },
State#state{ test_cases = [NewTC | tl(TCs)]}.
-on_tc_skip(Tc,{Type,_Reason} = Res, State) when Type == tc_auto_skip ->
+on_tc_skip(Tc,{Type,_Reason} = Res, State0) when Type == tc_auto_skip ->
+ TcStr = atom_to_list(Tc),
+ State =
+ case State0#state.test_cases of
+ [#testcase{name=TcStr}|TCs] ->
+ State0#state{test_cases=TCs};
+ _ ->
+ State0
+ end,
do_tc_skip(Res, end_tc(Tc,[],Res,init_tc(State,[])));
on_tc_skip(_Tc, _Res, State = #state{test_cases = []}) ->
State;
@@ -103,7 +157,7 @@ do_tc_skip(Res, State) ->
TCs = State#state.test_cases,
TC = hd(TCs),
NewTC = TC#testcase{
- failure =
+ result =
{skipped,lists:flatten(io_lib:format("~p",[Res]))} },
State#state{ test_cases = [NewTC | tl(TCs)]}.
@@ -117,33 +171,52 @@ end_tc(Func, Config, Res, State) when is_atom(Func) ->
end_tc(atom_to_list(Func), Config, Res, State);
end_tc(Name, _Config, _Res, State = #state{ curr_suite = Suite,
curr_group = Groups,
- timer = TS, tc_log = Log } ) ->
+ curr_log_dir = CurrLogDir,
+ timer = TS,
+ tc_log = Log0,
+ url_base = UrlBase } ) ->
+ Log =
+ case Log0 of
+ "" ->
+ LowerSuiteName = string:to_lower(atom_to_list(Suite)),
+ filename:join(CurrLogDir,LowerSuiteName++"."++Name++".html");
+ _ ->
+ Log0
+ end,
+ Url = make_url(UrlBase,Log),
ClassName = atom_to_list(Suite),
PGroup = string:join([ atom_to_list(Group)||
Group <- lists:reverse(Groups)],"."),
TimeTakes = io_lib:format("~f",[timer:now_diff(now(),TS) / 1000000]),
State#state{ test_cases = [#testcase{ log = Log,
+ url = Url,
timestamp = now_to_string(TS),
classname = ClassName,
group = PGroup,
name = Name,
time = TimeTakes,
- failure = passed }| State#state.test_cases]}.
+ result = passed }|
+ State#state.test_cases],
+ tc_log = ""}. % so old tc_log is not set if next is on_tc_skip
close_suite(#state{ test_cases = [] } = State) ->
State;
-close_suite(#state{ test_cases = TCs } = State) ->
- Total = length(TCs),
- Succ = length(lists:filter(fun(#testcase{ failure = F }) ->
- F == passed
- end,TCs)),
- Fail = Total - Succ,
+close_suite(#state{ test_cases = TCs, url_base = UrlBase } = State) ->
+ {Total,Fail,Skip} = count_tcs(TCs,0,0,0),
TimeTaken = timer:now_diff(now(),State#state.curr_suite_ts) / 1000000,
+ SuiteLog = filename:join(State#state.curr_log_dir,?suite_log),
+ SuiteUrl = make_url(UrlBase,SuiteLog),
Suite = #testsuite{ name = atom_to_list(State#state.curr_suite),
package = State#state.package,
+ hostname = State#state.hostname,
time = io_lib:format("~f",[TimeTaken]),
timestamp = now_to_string(State#state.curr_suite_ts),
- errors = Fail, tests = Total,
- testcases = lists:reverse(TCs) },
+ errors = 0,
+ failures = Fail,
+ skipped = Skip,
+ tests = Total,
+ testcases = lists:reverse(TCs),
+ log = SuiteLog,
+ url = SuiteUrl},
State#state{ test_cases = [],
test_suites = [Suite | State#state.test_suites]}.
@@ -159,14 +232,15 @@ terminate(State) ->
-to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, timestamp = TS, failure = F}) ->
+to_xml(#testcase{ group = Group, classname = CL, log = L, url = U, name = N, time = T, timestamp = TS, result = R}) ->
["<testcase ",
- [["group=\"",Group,"\""]||Group /= ""]," "
+ [["group=\"",Group,"\" "]||Group /= ""],
"name=\"",N,"\" "
"time=\"",T,"\" "
- "timestamp=\"",TS,"\" "
+ "timestamp=\"",TS,"\" ",
+ [["url=\"",U,"\" "]||U /= undefined],
"log=\"",L,"\">",
- case F of
+ case R of
passed ->
[];
{skipped,Reason} ->
@@ -176,22 +250,29 @@ to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, ti
["<failure message=\"Test ",N," in ",CL," failed!\" type=\"crash\">",
sanitize(Reason),"</failure>"]
end,"</testcase>"];
-to_xml(#testsuite{ package = P, hostname = H, errors = E, time = Time,
- timestamp = TS, tests = T, name = N, testcases = Cases }) ->
+to_xml(#testsuite{ package = P, hostname = H, errors = E, failures = F,
+ skipped = S, time = Time, timestamp = TS, tests = T, name = N,
+ testcases = Cases, log = Log, url = Url }) ->
["<testsuite ",
[["package=\"",P,"\" "]||P /= undefined],
- [["hostname=\"",P,"\" "]||H /= undefined],
- [["name=\"",N,"\" "]||N /= undefined],
- [["time=\"",Time,"\" "]||Time /= undefined],
- [["timestamp=\"",TS,"\" "]||TS /= undefined],
+ "hostname=\"",H,"\" "
+ "name=\"",N,"\" "
+ "time=\"",Time,"\" "
+ "timestamp=\"",TS,"\" "
"errors=\"",integer_to_list(E),"\" "
- "tests=\"",integer_to_list(T),"\">",
+ "failures=\"",integer_to_list(F),"\" "
+ "skipped=\"",integer_to_list(S),"\" "
+ "tests=\"",integer_to_list(T),"\" ",
+ [["url=\"",Url,"\" "]||Url /= undefined],
+ "log=\"",Log,"\">",
[to_xml(Case) || Case <- Cases],
"</testsuite>"];
to_xml(#state{ test_suites = TestSuites, axis = Axis, properties = Props }) ->
["<testsuites>",properties_to_xml(Axis,Props),
[to_xml(TestSuite) || TestSuite <- TestSuites],"</testsuites>"].
+properties_to_xml([],[]) ->
+ [];
properties_to_xml(Axis,Props) ->
["<properties>",
[["<property name=\"",Name,"\" axis=\"yes\" value=\"",Value,"\" />"] || {Name,Value} <- Axis],
@@ -217,3 +298,37 @@ sanitize([]) ->
now_to_string(Now) ->
{{YY,MM,DD},{HH,Mi,SS}} = calendar:now_to_local_time(Now),
io_lib:format("~p-~2..0B-~2..0BT~2..0B:~2..0B:~2..0B",[YY,MM,DD,HH,Mi,SS]).
+
+make_url(undefined,_) ->
+ undefined;
+make_url(_,[]) ->
+ undefined;
+make_url(UrlBase0,Log) ->
+ UrlBase = string:strip(UrlBase0,right,$/),
+ RelativeLog = get_relative_log_url(Log),
+ string:join([UrlBase,RelativeLog],"/").
+
+get_test_root(Log) ->
+ LogParts = filename:split(Log),
+ filename:join(lists:sublist(LogParts,1,length(LogParts)-?log_depth)).
+
+get_relative_log_url(Log) ->
+ LogParts = filename:split(Log),
+ Start = length(LogParts)-?log_depth,
+ Length = ?log_depth+1,
+ string:join(lists:sublist(LogParts,Start,Length),"/").
+
+count_tcs([#testcase{name=ConfCase}|TCs],Ok,F,S)
+ when ConfCase=="init_per_suite";
+ ConfCase=="end_per_suite";
+ ConfCase=="init_per_group";
+ ConfCase=="end_per_group" ->
+ count_tcs(TCs,Ok,F,S);
+count_tcs([#testcase{result=passed}|TCs],Ok,F,S) ->
+ count_tcs(TCs,Ok+1,F,S);
+count_tcs([#testcase{result={fail,_}}|TCs],Ok,F,S) ->
+ count_tcs(TCs,Ok,F+1,S);
+count_tcs([#testcase{result={skipped,_}}|TCs],Ok,F,S) ->
+ count_tcs(TCs,Ok,F,S+1);
+count_tcs([],Ok,F,S) ->
+ {Ok+F+S,F,S}.
diff --git a/lib/common_test/test/Makefile b/lib/common_test/test/Makefile
index 686ee43aa3..d469d03e04 100644
--- a/lib/common_test/test/Makefile
+++ b/lib/common_test/test/Makefile
@@ -51,7 +51,13 @@ MODULES= \
ct_basic_html_SUITE \
ct_auto_compile_SUITE \
ct_verbosity_SUITE \
- ct_shell_SUITE
+ ct_shell_SUITE \
+ ct_system_error_SUITE \
+ ct_snmp_SUITE \
+ ct_group_leader_SUITE \
+ ct_cover_SUITE \
+ ct_groups_search_SUITE \
+ ct_surefire_SUITE
ERL_FILES= $(MODULES:%=%.erl)
@@ -105,7 +111,7 @@ release_spec: opt
release_tests_spec:
$(INSTALL_DIR) "$(RELSYSDIR)"
$(INSTALL_DATA) $(ERL_FILES) $(COVERFILE) "$(RELSYSDIR)"
- $(INSTALL_DATA) common_test.spec "$(RELSYSDIR)"
+ $(INSTALL_DATA) common_test.spec common_test.cover "$(RELSYSDIR)"
chmod -R u+w "$(RELSYSDIR)"
@tar cf - *_SUITE_data | (cd "$(RELSYSDIR)"; tar xf -)
diff --git a/lib/common_test/test/common_test.cover b/lib/common_test/test/common_test.cover
new file mode 100644
index 0000000000..3aa49623e7
--- /dev/null
+++ b/lib/common_test/test/common_test.cover
@@ -0,0 +1,10 @@
+%% -*- erlang -*-
+{incl_app,common_test,details}.
+{cross,common_test,[{test_server,[erl2html2,
+ test_server,
+ test_server_ctrl,
+ test_server_gl,
+ test_server_h,
+ test_server_io,
+ test_server_node,
+ test_server_sup]}]}.
diff --git a/lib/common_test/test/ct_config_SUITE.erl b/lib/common_test/test/ct_config_SUITE.erl
index 1e1df908db..d92be9ec6e 100644
--- a/lib/common_test/test/ct_config_SUITE.erl
+++ b/lib/common_test/test/ct_config_SUITE.erl
@@ -88,8 +88,8 @@ require(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
run_test(config_static_SUITE,
Config,
- [{config, filename:join(DataDir, "config/shadow.txt")},
- {config, filename:join(DataDir, "config/config.txt")}],
+ [{config, [filename:join(DataDir, "config/shadow.txt"),
+ filename:join(DataDir, "config/config.txt")]}],
["config_static_SUITE"]).
install_config(Config) when is_list(Config) ->
@@ -174,6 +174,7 @@ run_test(Name, Config, CTConfig, SuiteNames)->
Joiner = fun(Suite) -> filename:join(DataDir, "config/test/"++Suite) end,
Suites = lists:map(Joiner, SuiteNames),
{Opts,ERPid} = setup_env({suite,Suites}, Config, CTConfig),
+
ok = ct_test_support:run(Opts, Config),
TestEvents = ct_test_support:get_events(ERPid, Config),
ct_test_support:log_events(Name,
diff --git a/lib/common_test/test/ct_config_info_SUITE.erl b/lib/common_test/test/ct_config_info_SUITE.erl
index 40da377ee5..10fe8286dd 100644
--- a/lib/common_test/test/ct_config_info_SUITE.erl
+++ b/lib/common_test/test/ct_config_info_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -123,8 +123,7 @@ test_events(config_info) ->
{?eh,tc_done,{config_info_1_SUITE,init_per_suite,ok}},
[{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g1,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {init_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g1,[]},
{failed,{timetrap_timeout,350}}}},
{?eh,tc_auto_skip,{config_info_1_SUITE,t11,
{failed,{config_info_1_SUITE,init_per_group,{timetrap_timeout,350}}}}},
@@ -136,14 +135,12 @@ test_events(config_info) ->
{?eh,tc_done,{config_info_1_SUITE,{init_per_group,g2,[]},ok}},
{?eh,tc_done,{config_info_1_SUITE,t21,ok}},
{?eh,tc_start,{config_info_1_SUITE,{end_per_group,g2,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {end_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g2,[]},
{failed,{timetrap_timeout,450}}}}],
[{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g3,[]}}},
{?eh,tc_done,{config_info_1_SUITE,{init_per_group,g3,[]},ok}},
[{?eh,tc_start,{config_info_1_SUITE,{init_per_group,g4,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {init_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{init_per_group,g4,[]},
{failed,{timetrap_timeout,400}}}},
{?eh,tc_auto_skip,{config_info_1_SUITE,t41,
{failed,{config_info_1_SUITE,init_per_group,
@@ -164,8 +161,7 @@ test_events(config_info) ->
{?eh,tc_done,{config_info_1_SUITE,{init_per_group,g5,[]},ok}},
{?eh,tc_done,{config_info_1_SUITE,t51,ok}},
{?eh,tc_start,{config_info_1_SUITE,{end_per_group,g5,[]}}},
- {?eh,tc_done,{config_info_1_SUITE,
- {end_per_group,unknown,[]},
+ {?eh,tc_done,{config_info_1_SUITE,{end_per_group,g5,[]},
{failed,{timetrap_timeout,400}}}}],
{?eh,tc_start,{config_info_1_SUITE,{end_per_group,g3,[]}}},
{?eh,tc_done,{config_info_1_SUITE,{end_per_group,g3,[]},ok}}],
diff --git a/lib/common_test/test/ct_cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE.erl
new file mode 100644
index 0000000000..cb49dc423f
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE.erl
@@ -0,0 +1,312 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_cover_SUITE
+%%%
+%%% Description:
+%%% Test code cover analysis support
+%%%
+%%%-------------------------------------------------------------------
+-module(ct_cover_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+-define(suite, cover_SUITE).
+-define(mod, cover_test_mod).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ case test_server:is_cover() of
+ true ->
+ {skip,"Test server is running cover already - skipping"};
+ false ->
+ ct_test_support:init_per_suite(Config)
+ end.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ Node = fullname(existing_node),
+ case lists:member(Node,nodes()) of
+ true -> rpc:call(Node,erlang,halt,[]);
+ false -> ok
+ end,
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ default,
+ cover_stop_true,
+ cover_stop_false,
+ slave,
+ slave_start_slave,
+ cover_node_option,
+ ct_cover_add_remove_nodes,
+ otp_9956,
+ cross
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%% Check that cover is collected from test node
+%% Also check that cover is by default stopped after test is completed
+default(Config) ->
+ {ok,Events} = run_test(default,Config),
+ false = check_cover(Config),
+ check_calls(Events,1),
+ ok.
+
+%% Check that cover is stopped when cover_stop option is set to true
+cover_stop_true(Config) ->
+ {ok,_Events} = run_test(cover_stop_true,[{cover_stop,true}],Config),
+ false = check_cover(Config).
+
+%% Check that cover is not stopped when cover_stop option is set to false
+cover_stop_false(Config) ->
+ {ok,_Events} = run_test(cover_stop_false,[{cover_stop,false}],Config),
+ {true,[],[?mod]} = check_cover(Config),
+ CTNode = proplists:get_value(ct_node, Config),
+ ok = rpc:call(CTNode,cover,stop,[]),
+ false = check_cover(Config),
+ ok.
+
+%% Let test node start a slave node - check that cover is collected
+%% from both nodes
+slave(Config) ->
+ {ok,Events} = run_test(slave,slave,[],Config),
+ check_calls(Events,2),
+ ok.
+
+%% Let test node start a slave node which in turn starts another slave
+%% node - check that cover is collected from all three nodes
+slave_start_slave(Config) ->
+ {ok,Events} = run_test(slave_start_slave,slave_start_slave,[],Config),
+ check_calls(Events,3),
+ ok.
+
+%% Start a slave node before test starts - the node is listed in cover
+%% spec file.
+%% Check that cover is collected from test node and slave node.
+cover_node_option(Config) ->
+ {ok, HostStr}=inet:gethostname(),
+ Host = list_to_atom(HostStr),
+ DataDir = ?config(data_dir,Config),
+ {ok,Node} = ct_slave:start(Host,existing_node,
+ [{erl_flags,"-pa " ++ DataDir}]),
+ false = check_cover(Node),
+ CoverSpec = default_cover_file_content() ++ [{nodes,[Node]}],
+ CoverFile = create_cover_file(cover_node_option,CoverSpec,Config),
+ {ok,Events} = run_test(cover_node_option,cover_node_option,
+ [{cover,CoverFile}],Config),
+ check_calls(Events,2),
+ {ok,Node} = ct_slave:stop(existing_node),
+ ok.
+
+%% Test ct_cover:add_nodes/1 and ct_cover:remove_nodes/1
+%% Check that cover is collected from added node
+ct_cover_add_remove_nodes(Config) ->
+ {ok, HostStr}=inet:gethostname(),
+ Host = list_to_atom(HostStr),
+ DataDir = ?config(data_dir,Config),
+ {ok,Node} = ct_slave:start(Host,existing_node,
+ [{erl_flags,"-pa " ++ DataDir}]),
+ false = check_cover(Node),
+ {ok,Events} = run_test(ct_cover_add_remove_nodes,ct_cover_add_remove_nodes,
+ [],Config),
+ check_calls(Events,2),
+ {ok,Node} = ct_slave:stop(existing_node),
+ ok.
+
+%% Test that the test suite itself can be cover compiled and that
+%% data_dir is set correctly (OTP-9956)
+otp_9956(Config) ->
+ CoverFile = create_cover_file(otp_9956,[{incl_mods,[?suite]}],Config),
+ {ok,Events} = run_test(otp_9956,otp_9956,[{cover,CoverFile}],Config),
+ check_calls(Events,{?suite,otp_9956,1},1),
+ ok.
+
+%% Test cross cover mechanism
+cross(Config) ->
+ {ok,Events1} = run_test(cross1,Config),
+ check_calls(Events1,1),
+
+ CoverFile2 = create_cover_file(cross1,[{cross,[{cross1,[?mod]}]}],Config),
+ {ok,Events2} = run_test(cross2,[{cover,CoverFile2}],Config),
+ check_calls(Events2,1),
+
+ %% Get the log dirs for each test and run cross cover analyse
+ [D11,D12] = lists:sort(get_run_dirs(Events1)),
+ [D21,D22] = lists:sort(get_run_dirs(Events2)),
+
+ ct_cover:cross_cover_analyse(details,[{cross1,D11},{cross2,D21}]),
+ ct_cover:cross_cover_analyse(details,[{cross1,D12},{cross2,D22}]),
+
+ %% Get the cross cover logs and read for each test
+ [C11,C12,C21,C22] =
+ [filename:join(D,"cross_cover.html") || D <- [D11,D12,D21,D22]],
+
+ {ok,CrossData} = file:read_file(C11),
+ {ok,CrossData} = file:read_file(C12),
+
+ {ok,Def} = file:read_file(C21),
+ {ok,Def} = file:read_file(C22),
+
+ %% A simple test: just check that the test module exists in the
+ %% log from cross1 test, and that it does not exist in the log
+ %% from cross2 test.
+ TestMod = list_to_binary(atom_to_list(?mod)),
+ {_,_} = binary:match(CrossData,TestMod),
+ nomatch = binary:match(Def,TestMod),
+ {_,_} = binary:match(Def,
+ <<"No cross cover modules exist for this application">>),
+
+ ok.
+
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+run_test(Label,Config) ->
+ run_test(Label,[],Config).
+run_test(Label,ExtraOpts,Config) ->
+ run_test(Label,default,ExtraOpts,Config).
+run_test(Label,Testcase,ExtraOpts,Config) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, ?suite),
+ CoverFile =
+ case proplists:get_value(cover,ExtraOpts) of
+ undefined ->
+ create_default_cover_file(Label,Config);
+ CF ->
+ CF
+ end,
+ RestOpts = lists:keydelete(cover,1,ExtraOpts),
+ {Opts,ERPid} = setup([{suite,Suite},{testcase,Testcase},
+ {cover,CoverFile},{label,Label}] ++ RestOpts, Config),
+ execute(Label, Testcase, Opts, ERPid, Config).
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Testcase, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+ TestEvents = events_to_check(Testcase),
+ R = ct_test_support:verify_events(TestEvents, Events, Config),
+ {R,Events}.
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+events_to_check(Testcase) ->
+ OneTest =
+ [{?eh,start_logging,{'DEF','RUNDIR'}}] ++
+ [{?eh,tc_done,{?suite,Testcase,ok}}] ++
+ [{?eh,stop_logging,[]}],
+
+ %% 2 tests (ct:run_test + script_start) is default
+ OneTest ++ OneTest.
+
+check_cover(Config) when is_list(Config) ->
+ CTNode = proplists:get_value(ct_node, Config),
+ check_cover(CTNode);
+check_cover(Node) when is_atom(Node) ->
+ case rpc:call(Node,test_server,is_cover,[]) of
+ true ->
+ {true,
+ rpc:call(Node,cover,which_nodes,[]),
+ rpc:call(Node,cover,modules,[])};
+ false ->
+ false
+ end.
+
+%% Get the log dir "run.<timestamp>" for all (both!) tests
+get_run_dirs(Events) ->
+ [filename:dirname(TCLog) ||
+ {ct_test_support_eh,
+ {event,tc_logfile,_Node,
+ {{?suite,init_per_suite},TCLog}}} <- Events].
+
+%% Check that each coverlog includes N calls to ?mod:foo/0
+check_calls(Events,N) ->
+ check_calls(Events,{?mod,foo,0},N).
+check_calls(Events,MFA,N) ->
+ CoverLogs = [filename:join(D,"all.coverdata") || D <- get_run_dirs(Events)],
+ do_check_logs(CoverLogs,MFA,N).
+
+do_check_logs([CoverLog|CoverLogs],{Mod,_,_} = MFA,N) ->
+ {ok,_} = cover:start(),
+ ok = cover:import(CoverLog),
+ {ok,Calls} = cover:analyse(Mod,calls,function),
+ ok = cover:stop(),
+ {MFA,N} = lists:keyfind(MFA,1,Calls),
+ do_check_logs(CoverLogs,MFA,N);
+do_check_logs([],_,_) ->
+ ok.
+
+fullname(Name) ->
+ {ok,Host} = inet:gethostname(),
+ list_to_atom(atom_to_list(Name) ++ "@" ++ Host).
+
+default_cover_file_content() ->
+ [{incl_mods,[?mod]}].
+
+create_default_cover_file(Filename,Config) ->
+ create_cover_file(Filename,default_cover_file_content(),Config).
+
+create_cover_file(Filename,Terms,Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ File = filename:join(PrivDir,Filename) ++ ".cover",
+ {ok,Fd} = file:open(File,[write]),
+ lists:foreach(fun(Term) ->
+ file:write(Fd,io_lib:format("~p.~n",[Term]))
+ end,Terms),
+ ok = file:close(Fd),
+ File.
diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl
new file mode 100644
index 0000000000..fdc3323f0a
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE.erl
@@ -0,0 +1,156 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+%%----------------------------------------------------------------------
+%% File: cover_SUITE.erl
+%%
+%% Description:
+%% This file contains the test cases for the code coverage support
+%%
+%% @author Support
+%% @doc Test of code coverage support in common_test
+%% @end
+%%----------------------------------------------------------------------
+%%----------------------------------------------------------------------
+-module(cover_SUITE).
+-include_lib("common_test/include/ct.hrl").
+
+-compile(export_all).
+
+%% Default timetrap timeout (set in init_per_testcase).
+-define(default_timeout, ?t:minutes(1)).
+
+suite() ->
+ [].
+
+all() ->
+ [].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(Config) ->
+ Config.
+
+init_per_testcase(_Case, Config) ->
+ Dog = test_server:timetrap(?default_timeout),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(Case, Config) ->
+ %% try apply(?MODULE,Case,[cleanup,Config])
+ %% catch error:undef -> ok
+ %% end,
+
+ kill_slaves(Case,nodes()),
+ Dog=?config(watchdog, Config),
+ test_server:timetrap_cancel(Dog),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+break(_Config) ->
+ test_server:break(""),
+ ok.
+
+default(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ ok.
+
+slave(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ N1 = nodename(slave,1),
+ {ok,Node} = ct_slave:start(N1),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]),
+ {ok,Node} = ct_slave:stop(N1),
+ ok.
+
+slave_start_slave(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ N1 = nodename(slave_start_slave,1),
+ N2 = nodename(slave_start_slave,2),
+ {ok,Node} = ct_slave:start(N1),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]),
+ {ok,Node2} = rpc:call(Node,ct_slave,start,[N2]),
+ rpc:call(Node2,cover_test_mod,foo,[]),
+ {ok,Node2} = rpc:call(Node,ct_slave,stop,[N2]),
+ {ok,Node} = ct_slave:stop(N1),
+ ok.
+
+cover_node_option(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ Node = fullname(existing_node),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]),
+ ok.
+
+ct_cover_add_remove_nodes(Config) ->
+ cover_compiled = code:which(cover_test_mod),
+ cover_test_mod:foo(),
+ Node = fullname(existing_node),
+ Beam = rpc:call(Node,code,which,[cover_test_mod]),
+ false = (Beam == cover_compiled),
+
+ rpc:call(Node,cover_test_mod,foo,[]), % should not be collected
+ {ok,[Node]} = ct_cover:add_nodes([Node]),
+ cover_compiled = rpc:call(Node,code,which,[cover_test_mod]),
+ rpc:call(Node,cover_test_mod,foo,[]), % should be collected
+ ok = ct_cover:remove_nodes([Node]),
+ rpc:call(Node,cover_test_mod,foo,[]), % should not be collected
+
+ Beam = rpc:call(Node,code,which,[cover_test_mod]),
+
+ ok.
+
+otp_9956(Config) ->
+ cover_compiled = code:which(?MODULE),
+ DataDir = ?config(data_dir,Config),
+ absolute = filename:pathtype(DataDir),
+ true = filelib:is_dir(DataDir),
+ ok.
+
+
+%%%-----------------------------------------------------------------
+%%% Internal
+nodename(Case,N) ->
+ list_to_atom(nodeprefix(Case) ++ integer_to_list(N)).
+
+nodeprefix(Case) ->
+ atom_to_list(?MODULE) ++ "_" ++ atom_to_list(Case) ++ "_node".
+
+
+fullname(Name) ->
+ {ok,Host} = inet:gethostname(),
+ list_to_atom(atom_to_list(Name) ++ "@" ++ Host).
+
+kill_slaves(Case, [Node|Nodes]) ->
+ Prefix = nodeprefix(Case),
+ case lists:prefix(Prefix,atom_to_list(Node)) of
+ true ->
+ rpc:call(Node,erlang,halt,[]);
+ _ ->
+ ok
+ end,
+ kill_slaves(Case,Nodes);
+kill_slaves(_,[]) ->
+ ok.
diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore
new file mode 100644
index 0000000000..e69de29bb2
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE_data/cover_SUITE_data/.gitignore
diff --git a/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl b/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl
new file mode 100644
index 0000000000..d4f69452c3
--- /dev/null
+++ b/lib/common_test/test/ct_cover_SUITE_data/cover_test_mod.erl
@@ -0,0 +1,4 @@
+-module(cover_test_mod).
+-compile(export_all).
+foo() ->
+ ok.
diff --git a/lib/common_test/test/ct_error_SUITE.erl b/lib/common_test/test/ct_error_SUITE.erl
index 338e76264e..6d90b29f41 100644
--- a/lib/common_test/test/ct_error_SUITE.erl
+++ b/lib/common_test/test/ct_error_SUITE.erl
@@ -61,7 +61,7 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[cfg_error, lib_error, no_compile, timetrap_end_conf,
timetrap_normal, timetrap_extended, timetrap_parallel,
- timetrap_fun, misc_errors].
+ timetrap_fun, timetrap_fun_group, misc_errors].
groups() ->
[].
@@ -251,6 +251,24 @@ timetrap_fun(Config) when is_list(Config) ->
%%%-----------------------------------------------------------------
%%%
+timetrap_fun_group(Config) when is_list(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Join = fun(D, S) -> filename:join(D, "error/test/"++S) end,
+ Suites = [Join(DataDir, "timetrap_8_SUITE")],
+ {Opts,ERPid} = setup([{suite,Suites}], Config),
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(timetrap_fun_group,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(timetrap_fun_group),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config).
+
+%%%-----------------------------------------------------------------
+%%%
misc_errors(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
Join = fun(D, S) -> filename:join(D, "error/test/"++S) end,
@@ -429,8 +447,7 @@ test_events(cfg_error) ->
{'EXIT',{init_per_group_fails,g1}}}}}}],
[{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g2,[]}}},
- {?eh,tc_done,{cfg_error_8_SUITE,
- {init_per_group,unknown,[]},
+ {?eh,tc_done,{cfg_error_8_SUITE,{init_per_group,g2,[]},
{failed,{timetrap_timeout,2000}}}},
{?eh,tc_auto_skip,{cfg_error_8_SUITE,tc1,
{failed,{cfg_error_8_SUITE,init_per_group,
@@ -500,7 +517,7 @@ test_events(cfg_error) ->
{?eh,tc_done,{cfg_error_8_SUITE,tc1,ok}},
{?eh,test_stats,{9,0,{0,14}}},
{?eh,tc_start,{cfg_error_8_SUITE,{end_per_group,g12,[]}}},
- {?eh,tc_done,{cfg_error_8_SUITE,{end_per_group,unknown,[]},
+ {?eh,tc_done,{cfg_error_8_SUITE,{end_per_group,g12,[]},
{failed,{timetrap_timeout,2000}}}}],
{?eh,tc_start,{cfg_error_8_SUITE,end_per_suite}},
@@ -971,11 +988,423 @@ test_events(timetrap_fun) ->
{?eh,stop_logging,[]}
];
+test_events(timetrap_fun_group) ->
+ [
+ {?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,start_info,{1,1,58}},
+ {?eh,tc_start,{timetrap_8_SUITE,init_per_suite}},
+ {?eh,tc_done,{timetrap_8_SUITE,init_per_suite,ok}},
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g0,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g0,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,1,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,2,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g0,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g0,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g1,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,3,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,4,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g1,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g2,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,5,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,6,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g2,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g3,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g3,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc4}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc4,
+ {failed,{timetrap_timeout,{'$approx',2000}}}}},
+ {?eh,test_stats,{0,7,{0,0}}},
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g1,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,8,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,9,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g1,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g1,[]},ok}}],
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g2,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{0,10,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{0,11,{0,0}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g2,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g2,[]},ok}}],
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g3,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g3,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g4,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g4,[]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,1}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,2}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g5,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g5,[]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,3}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{0,11,{0,4}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g6,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g6,[]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{0,11,{0,5}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{0,11,{0,6}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g7,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g7,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{1,11,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g7,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g7,[]},
+ {user_timetrap_error,{kaboom,'_'}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g8,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g8,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{2,11,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g8,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g8,[]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g9,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g9,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{3,11,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,test_stats,{3,12,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g9,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g9,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g10,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g10,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,test_stats,{3,13,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{4,13,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g10,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g10,[]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,g11,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,g11,[]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc3}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc3,
+ {failed,{timetrap_timeout,{'$approx',4000}}}}},
+ {?eh,test_stats,{4,14,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,15,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,g11,[]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,g11,[]},ok}}],
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg0,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg0,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,16,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,17,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg0,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg0,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,18,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,19,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,20,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,21,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg3,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg3,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc4}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc4,
+ {failed,{timetrap_timeout,{'$approx',2000}}}}},
+ {?eh,test_stats,{4,22,{0,6}}},
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg1,[parallel]},
+ ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,23,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,24,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg1,[parallel]},
+ ok}}]},
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg2,[parallel]},
+ ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc1}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{4,25,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{4,26,{0,6}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg2,[parallel]},
+ ok}}]},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg3,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg3,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg4,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg4,[parallel]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,7}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,8}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg5,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg5,[parallel]},
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,9}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}},
+ {?eh,test_stats,{4,26,{0,10}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {user_timetrap_error,{kaboom,'_'}}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg6,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg6,[parallel]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{4,26,{0,11}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}},
+ {?eh,test_stats,{4,26,{0,12}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,end_per_group,
+ {failed,{timetrap_8_SUITE,init_per_group,
+ {timetrap_timeout,'_'}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg7,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg7,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{5,26,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg7,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg7,[parallel]},
+ {user_timetrap_error,{kaboom,'_'}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg8,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg8,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{6,26,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg8,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg8,[parallel]},
+ {failed,{timetrap_timeout,{'$approx',500}}}}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg9,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg9,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ %% Due to parallelism only checking final test stat in group
+ {?eh,test_stats,{7,27,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg9,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg9,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg10,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg10,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ %% Due to parallelism only checking final test stat in group
+ {?eh,test_stats,{8,28,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg10,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg10,[parallel]},ok}}]},
+
+ {parallel,
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,pg11,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,pg11,[parallel]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc3}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc3,
+ {failed,{timetrap_timeout,{'$approx',4000}}}}},
+ {?eh,test_stats,{8,29,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc2}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_timeout,{'$approx',500}}}}},
+ {?eh,test_stats,{8,30,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,pg11,[parallel]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,pg11,[parallel]},ok}}]},
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,sg1,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,sg1,[sequence]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{9,30,{0,12}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {user_timetrap_error,{kaboom,'_'}}}},
+ {?eh,test_stats,{9,31,{0,12}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{9,31,{0,13}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{9,31,{0,14}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,sg1,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,sg1,[sequence]},ok}}],
+
+ [{?eh,tc_start,{timetrap_8_SUITE,{init_per_group,sg2,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{init_per_group,sg2,[sequence]},ok}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc5}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc5,ok}},
+ {?eh,test_stats,{10,31,{0,14}}},
+ {?eh,tc_start,{timetrap_8_SUITE,tc0}},
+ {?eh,tc_done,{timetrap_8_SUITE,tc0,
+ {failed,{timetrap_timeout,{'$approx',1000}}}}},
+ {?eh,test_stats,{10,32,{0,14}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc1,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{10,32,{0,15}}},
+ {?eh,tc_auto_skip,{timetrap_8_SUITE,tc2,
+ {failed,{timetrap_8_SUITE,tc0}}}},
+ {?eh,test_stats,{10,32,{0,16}}},
+ {?eh,tc_start,{timetrap_8_SUITE,{end_per_group,sg2,[sequence]}}},
+ {?eh,tc_done,{timetrap_8_SUITE,{end_per_group,sg2,[sequence]},ok}}],
+
+ {?eh,tc_start,{timetrap_8_SUITE,end_per_suite}},
+ {?eh,tc_done,{timetrap_8_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}
+ ];
+
test_events(misc_errors) ->
[
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
- {?eh,start_info,{1,1,7}},
+ {?eh,start_info,{1,1,9}},
{?eh,tc_start,{misc_error_1_SUITE,ct_fail_1}},
{?eh,tc_done,{misc_error_1_SUITE,ct_fail_1,
{failed,{error,{test_case_failed,{error,this_is_expected}}}}}},
@@ -1002,7 +1431,12 @@ test_events(misc_errors) ->
{?eh,tc_start,{misc_error_1_SUITE,killed_by_signal_2}},
{?eh,tc_done,{misc_error_1_SUITE,killed_by_signal_2,
{failed,testcase_aborted_or_killed}}},
- {?eh,test_stats,{0,7,{0,0}}},
+ {parallel,
+ [{?eh,tc_start,{misc_error_1_SUITE,p1}},
+ {?eh,tc_done,{misc_error_1_SUITE,p1,ok}},
+ {?eh,tc_start,{misc_error_1_SUITE,p2}},
+ {?eh,tc_done,{misc_error_1_SUITE,p2,ok}}]},
+ {?eh,test_stats,{2,7,{0,0}}},
{?eh,test_done,{'DEF','STOP_TIME'}},
{?eh,stop_logging,[]}
].
diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl
index 99c3ed05ec..61f3fa7e59 100644
--- a/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl
+++ b/lib/common_test/test/ct_error_SUITE_data/error/test/misc_error_1_SUITE.erl
@@ -96,7 +96,7 @@ end_per_testcase(_TestCase, _Config) ->
%% N = integer() | forever
%%--------------------------------------------------------------------
groups() ->
- [].
+ [{p,[parallel],[p1,p2]}].
%%--------------------------------------------------------------------
%% Function: all() -> GroupsAndTestCases | {skip,Reason}
@@ -107,7 +107,8 @@ groups() ->
%%--------------------------------------------------------------------
all() ->
[ct_fail_1, ct_fail_2, ct_fail_3, ts_fail_1, ts_fail_2,
- killed_by_signal_1, killed_by_signal_2].
+ killed_by_signal_1, killed_by_signal_2,
+ {group,p}].
ct_fail_1(_) ->
ct:fail({error,this_is_expected}),
@@ -152,3 +153,10 @@ killed_by_signal_2(_) ->
end),
ct:sleep(1000),
exit(this_should_not_be_seen).
+
+p1(_) ->
+ {error,parallel_group} = ct:abort_current_testcase(aborted),
+ ok.
+
+p2(_) ->
+ receive after 1000 -> ok end.
diff --git a/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl b/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl
new file mode 100644
index 0000000000..ff138f38b5
--- /dev/null
+++ b/lib/common_test/test/ct_error_SUITE_data/error/test/timetrap_8_SUITE.erl
@@ -0,0 +1,258 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(timetrap_8_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+-define(TO, 4).
+
+%%--------------------------------------------------------------------
+%% Function: suite() -> Info
+%% Info = [tuple()]
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,?TO}]}}].
+
+%%--------------------------------------------------------------------
+%% Function: init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_group(G6, Config) when G6==g6; G6==pg6 ->
+ ct:sleep({seconds,1}),
+ Config;
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_group(G7or8, _Config) when G7or8==g7; G7or8==pg7; G7or8==g8; G7or8==pg8 ->
+ ct:sleep({seconds,5}),
+ ok;
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%%--------------------------------------------------------------------
+init_per_testcase(_, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Function: end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%%--------------------------------------------------------------------
+end_per_testcase(_, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% Function: groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%%--------------------------------------------------------------------
+groups() ->
+ [
+ {g0,[],[tc0,tc2]}, % group override suite and tc overrides group
+ {g1,[],[tc0,tc2]}, % group override suite and tc overrides group
+ {g2,[],[tc1,tc2]}, % tc override group
+ {g3,[],[tc4,{group,g1},{group,g2}]}, % subgroup override group
+ {g4,[],[tc0,tc2]}, % exit during init_per_group
+ {g5,[],[tc0,tc2]}, % exit during init_per_group
+ {g6,[],[tc0,tc2]}, % timeout during init_per_group
+ {g7,[],[tc5]}, % exit during end_per_group
+ {g8,[],[tc5]}, % timeout during end_per_group
+ {g9,[],[tc5,tc0]}, % exit during testcase
+ {g10,[],[tc0,tc5]}, % exit during testcase
+ {g11,[],[tc3,tc2]}, % suite is valid if nothing else is specified
+ {pg0,[parallel],[tc0,tc2]}, % group override suite and tc overrides group
+ {pg1,[parallel],[tc0,tc2]}, % group override suite and tc overrides group
+ {pg2,[parallel],[tc1,tc2]}, % tc override group
+ {pg3,[parallel],[tc4,{group,pg1},{group,pg2}]}, % subgroup override group
+ {pg4,[parallel],[tc0,tc2]}, % exit during init_per_group
+ {pg5,[parallel],[tc0,tc2]}, % exit during init_per_group
+ {pg6,[parallel],[tc0,tc2]}, % timeout during init_per_group
+ {pg7,[parallel],[tc5]}, % exit during end_per_group
+ {pg8,[parallel],[tc5]}, % timeout during end_per_group
+ {pg9,[parallel],[tc5,tc0]}, % exit during testcase
+ {pg10,[parallel],[tc0,tc5]},% exit during testcase
+ {pg11,[parallel],[tc3,tc2]},% suite is valid if nothing else is specified
+ {sg1,[sequence],[tc5,tc0,tc1,tc2]}, % exit during sequencial testcase
+ {sg2,[sequence],[tc5,tc0,tc1,tc2]}].% timeout during sequencial testcase
+
+group(g0) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}];
+group(g1) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(1000) end}];
+group(g2) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(3000) end}];
+group(g3) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(2000) end}];
+group(g4) ->
+ [{timetrap,{timetrap_utils,timetrap_exit,[kaboom]}}];
+group(g5) ->
+ [{timetrap,fun() -> exit(kaboom) end}];
+group(g6) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(g7) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(g8) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(g9) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(g10) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(g11) ->
+ [];
+group(pg0) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}];
+group(pg1) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(1000) end}];
+group(pg2) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(3000) end}];
+group(pg3) ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(2000) end}];
+group(pg4) ->
+ [{timetrap,{timetrap_utils,timetrap_exit,[kaboom]}}];
+group(pg5) ->
+ [{timetrap,fun() -> exit(kaboom) end}];
+group(pg6) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(pg7) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(pg8) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[500]}}];
+group(pg9) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(pg10) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(pg11) ->
+ [];
+group(sg1) ->
+ [{timetrap,fun() -> ct:sleep(1000),exit(kaboom) end}];
+group(sg2) ->
+ [{timetrap,{timetrap_utils,timetrap_val,[{seconds,1}]}}].
+
+
+%%--------------------------------------------------------------------
+%% Function: all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%%--------------------------------------------------------------------
+all() ->
+ [
+ {group,g0},
+ {group,g1},
+ {group,g2},
+ {group,g3},
+ {group,g4},
+ {group,g5},
+ {group,g6},
+ {group,g7},
+ {group,g8},
+ {group,g9},
+ {group,g10},
+ {group,g11},
+ {group,pg0},
+ {group,pg1},
+ {group,pg2},
+ {group,pg3},
+ {group,pg4},
+ {group,pg5},
+ {group,pg6},
+ {group,pg7},
+ {group,pg8},
+ {group,pg9},
+ {group,pg10},
+ {group,pg11},
+ {group,sg1},
+ {group,sg2}].
+
+
+
+tc0(_) ->
+ ct:comment("TO set by group"),
+ ct:sleep({seconds,5}),
+ ok.
+
+tc1() ->
+ [{timetrap,{timetrap_utils,timetrap_val,[1000]}}].
+tc1(_) ->
+ ct:comment("TO after 1 sec"),
+ ct:sleep({seconds,2}),
+ ok.
+
+tc2() ->
+ [{timetrap,fun() -> timetrap_utils:timetrap_val(500) end}].
+tc2(_) ->
+ ct:comment("TO after 0.5 sec"),
+ ct:sleep({seconds,2}),
+ ok.
+
+tc3(_) ->
+ ct:comment(io_lib:format("TO after ~w sec", [?TO])),
+ ct:sleep({seconds,5}),
+ ok.
+
+tc4(_) ->
+ ct:comment("TO set by group"),
+ ct:sleep({seconds,5}),
+ ok.
+
+tc5(_) ->
+ ct:comment("No TO in this testcase, maybe later"),
+ ok.
diff --git a/lib/common_test/test/ct_group_leader_SUITE.erl b/lib/common_test/test/ct_group_leader_SUITE.erl
new file mode 100644
index 0000000000..cde3061d6a
--- /dev/null
+++ b/lib/common_test/test/ct_group_leader_SUITE.erl
@@ -0,0 +1,181 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_system_error_SUITE
+%%%
+%%% Description:
+%%%
+%%% Test the group leader functionality in the test_server application.
+%%%-------------------------------------------------------------------
+-module(ct_group_leader_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ basic
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+basic(Config) ->
+ TC = basic,
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "group_leader_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},{label,TC}], Config),
+ SuiteLog = execute(TC, Opts, ERPid, Config),
+ {ok,Data} = file:read_file(SuiteLog),
+ Lines = binary:split(Data, <<"\n">>, [global]),
+ {ok,RE} = re:compile("(\\S+):(\\S+)$"),
+ Cases0 = [begin
+ {match,[M,F]} = re:run(Case, RE, [{capture,all_but_first,list}]),
+ {list_to_atom(M),list_to_atom(F)}
+ end || <<"=case ",Case/binary>> <- Lines],
+ Cases = [MF || {_,F}=MF <- Cases0,
+ F =/= init_per_suite,
+ F =/= end_per_suite,
+ F =/= init_per_group,
+ F =/= end_per_group],
+ io:format("~p\n", [Cases]),
+ [] = verify_cases(events_to_check(TC), Cases, false),
+ ok.
+
+verify_cases([{parallel,P}|Ts], Cases0, Par) ->
+ Cases = verify_cases(P, Cases0, true),
+ verify_cases(Ts, Cases, Par);
+verify_cases([{?eh,tc_done,{M,F,_}}|Ts], Cases0, false) ->
+ [{M,F}|Cases] = Cases0,
+ verify_cases(Ts, Cases, false);
+verify_cases([{?eh,tc_done,{M,F,_}}|Ts], Cases0, true) ->
+ case lists:member({M,F}, Cases0) of
+ true ->
+ Cases = Cases0 -- [{M,F}],
+ verify_cases(Ts, Cases, true);
+ false ->
+ io:format("~p not found\n", [{M,F}]),
+ ?t:fail()
+ end;
+verify_cases([{?eh,_,_}|Ts], Cases, Par) ->
+ verify_cases(Ts, Cases, Par);
+verify_cases([], Cases, _) ->
+ Cases;
+verify_cases([List|Ts], Cases0, Par) when is_list(List) ->
+ Cases = verify_cases(List, Cases0, false),
+ verify_cases(Ts, Cases, Par).
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(Name),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config),
+ {event,tc_logfile,_,{_,File}} =
+ lists:keyfind(tc_logfile, 2, [Ev || {?eh,Ev} <- Events]),
+ LogDir = filename:dirname(File),
+ filename:join(LogDir, "suite.log").
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+
+events_to_check(_Test) ->
+ [{?eh,tc_done,{group_leader_SUITE,tc1,ok}},
+ {parallel,[{?eh,tc_start,{group_leader_SUITE,p1}},
+ {?eh,tc_done,{group_leader_SUITE,p1,ok}},
+ {?eh,tc_start,{group_leader_SUITE,p2}},
+ {?eh,tc_done,{group_leader_SUITE,p2,ok}}]},
+ {?eh,tc_done,{group_leader_SUITE,p_restart_my_io_server,ok}},
+ {?eh,tc_done,{group_leader_SUITE,p3,ok}},
+ {parallel,[
+ {?eh,tc_start,{group_leader_SUITE,p10}},
+ {?eh,tc_start,{group_leader_SUITE,p11}},
+ {?eh,tc_done,{group_leader_SUITE,p10,ok}},
+ {?eh,tc_done,{group_leader_SUITE,p11,ok}},
+ [{?eh,tc_done,{group_leader_SUITE,s1,ok}},
+ {?eh,tc_done,{group_leader_SUITE,s2,ok}},
+ {?eh,tc_done,{group_leader_SUITE,s3,ok}}],
+ {?eh,tc_start,{group_leader_SUITE,p12}},
+ {?eh,tc_done,{group_leader_SUITE,p12,ok}},
+ [{?eh,tc_done,{group_leader_SUITE,s4,ok}},
+ {?eh,tc_done,{group_leader_SUITE,s5,ok}}],
+ {?eh,tc_start,{group_leader_SUITE,p13}},
+ {?eh,tc_done,{group_leader_SUITE,p13,ok}} ]},
+ {?eh,tc_done,{group_leader_SUITE,cap1,ok}},
+ {?eh,tc_done,{group_leader_SUITE,cap2,ok}},
+ {parallel,[{?eh,tc_start,{group_leader_SUITE,cap1}},
+ {?eh,tc_done,{group_leader_SUITE,cap1,ok}},
+ {?eh,tc_start,{group_leader_SUITE,cap2}},
+ {?eh,tc_done,{group_leader_SUITE,cap2,ok}}]},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}
+ ].
diff --git a/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl b/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl
new file mode 100644
index 0000000000..3f1844b4ae
--- /dev/null
+++ b/lib/common_test/test/ct_group_leader_SUITE_data/group_leader_SUITE.erl
@@ -0,0 +1,252 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(group_leader_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{seconds,10}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ start_my_io_server(),
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ my_io_server ! die,
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [{p,[parallel],[p1,p2]},
+ {p_restart,[parallel],[p_restart_my_io_server]},
+ {seq,[],[s1,s2,s3]},
+ {seq2,[],[s4,s5]},
+ {seq_in_par,[parallel],[p10,p11,{group,seq},p12,{group,seq2},p13]},
+ {capture_io,[parallel],[cap1,cap2]}].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [tc1,{group,p},{group,p_restart},p3,
+ {group,seq_in_par},
+ cap1,cap2,
+ {group,capture_io}].
+
+tc1(_C) ->
+ ok.
+
+p1(_) ->
+ %% OTP-10101:
+ %%
+ %% External apps/processes started by init_per_suite (common operation),
+ %% will inherit the group leader of the init_per_suite process, i.e. the
+ %% test_server test case control process (executing run_test_case_msgloop/7).
+ %% If, later, a parallel test case triggers the external app to print with
+ %% e.g. io:format() (also common operation), the calling process will hang!
+ %% The reason for this is that a parallel test case has a dedicated IO
+ %% server process, other than the central test case control process. The
+ %% latter process is not executing run_test_case_msgloop/7 and will not
+ %% respond to IO messages. The process is still group leader for the
+ %% external app, however, which is wrong. It's the IO process for the
+ %% parallel test case that should be group leader - but only for the
+ %% particular invokation, since other parallel test cases could be
+ %% invoking the external app too.
+ print("hej\n").
+
+p2(_) ->
+ print("hopp\n").
+
+p_restart_my_io_server(_) ->
+ %% Restart the IO server and change its group leader. This used
+ %% to set to the group leader to a process that would soon die.
+ Ref = erlang:monitor(process, my_io_server),
+ my_io_server ! die,
+ receive
+ {'DOWN',Ref,_,_,_} ->
+ start_my_io_server()
+ end.
+
+p3(_) ->
+ %% OTP-10125. This would crash since the group leader process
+ %% for the my_io_server had died.
+ print("hoppsan\n").
+
+print(String) ->
+ my_io_server ! {print,self(),String},
+ receive
+ {printed,String} ->
+ ok
+ end.
+
+start_my_io_server() ->
+ Parent = self(),
+ Pid = spawn(fun() -> my_io_server(Parent) end),
+ receive
+ {Pid,started} ->
+ io:format("~p\n", [process_info(Pid)]),
+ ok
+ end.
+
+my_io_server(Parent) ->
+ register(my_io_server, self()),
+ Parent ! {self(),started},
+ my_io_server_loop().
+
+my_io_server_loop() ->
+ receive
+ {print,From,String} ->
+ io:put_chars(String),
+ From ! {printed,String},
+ my_io_server_loop();
+ die ->
+ ok
+ end.
+
+p10(_) ->
+ receive after 1 -> ok end.
+
+p11(_) ->
+ ok.
+
+p12(_) ->
+ ok.
+
+p13(_) ->
+ ok.
+
+s1(_) ->
+ ok.
+
+s2(_) ->
+ ok.
+
+s3(_) ->
+ ok.
+
+s4(_) ->
+ ok.
+
+s5(_) ->
+ ok.
+
+cap1(_) ->
+ ct:capture_start(),
+ IO = gen_io(cap1, 10, []),
+ ct:capture_stop(),
+ IO = ct:capture_get(),
+ ok.
+
+cap2(_) ->
+ ct:capture_start(),
+ {Pid,Ref} = spawn_monitor(fun() ->
+ exit(gen_io(cap2, 42, []))
+ end),
+ receive
+ {'DOWN',Ref,process,Pid,IO} ->
+ ct:capture_stop(),
+ IO = ct:capture_get(),
+ ok
+ end.
+
+gen_io(_, 0, Acc) ->
+ lists:reverse(Acc);
+gen_io(Label, N, Acc) ->
+ S = lists:flatten(io_lib:format("~s: ~p\n", [Label,N])),
+ io:put_chars(S),
+ gen_io(Label, N-1, [S|Acc]).
diff --git a/lib/common_test/test/ct_groups_search_SUITE.erl b/lib/common_test/test/ct_groups_search_SUITE.erl
new file mode 100644
index 0000000000..6b1c1f4634
--- /dev/null
+++ b/lib/common_test/test/ct_groups_search_SUITE.erl
@@ -0,0 +1,1245 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File:
+%%%
+%%% Description:
+%%%
+%%%
+%%% The suites used for the test are located in the data directory.
+%%%
+%%% The group(s) and case(s) are specified according to this:
+%%%
+%%% Tests = ct_groups:find_groups(Mod, GroupPaths, TestCases, GroupDef)
+%%%
+%%% GroupPaths = GroupPath | [GroupPath]
+%%% GroupPath = atom() | [atom()]
+%%%
+%%% CT will find all paths that include GroupPath. GroupPath can be a
+%%% single group, or a list of groups along the path to TestCases.
+%%% If GroupPath is the latter, the last group in the list must be
+%%% the "terminating" group in the path, or it will be impossible to
+%%% execute test cases in higher level groups *only*, as in this case:
+%%% groups() -> [{g1,[],[tc1,{g2,[],[tc2]}]}].
+%%% Compare: find_groups(x, g1, all, groups()), and
+%%% find_groups(x, [[g1]], all, groups())
+%%%
+%%% Some examples:
+%%%
+%%% GroupPaths = g1, means find all paths with g1 included
+%%% GroupPaths = [g1], -''-
+%%% GroupPaths = [g1,g2], search twice - once for g1 and once for g2
+%%% GroupPaths = [[g1,g2]], find cases under group g1 and sub group g2
+%%% GroupPaths = [[g1,g2],[g1,g3]], find cases for g1-g2 AND g1-g3
+%%%
+%%% TestCases = all | atom() | [atom()]
+%%%
+%%%-------------------------------------------------------------------
+
+-module(ct_groups_search_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/src/ct_util.hrl").
+
+
+-define(eh, ct_test_support_eh).
+
+-define(M1, groups_search_dummy_1_SUITE).
+-define(M2, groups_search_dummy_2_SUITE).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+init_per_suite(Config) ->
+ DataDir = proplists:get_value(data_dir, Config),
+ code:add_patha(DataDir),
+ M1Erl = filename:join(DataDir, atom_to_list(?M1)++".erl"),
+ M2Erl = filename:join(DataDir, atom_to_list(?M2)++".erl"),
+ {ok,?M1} = compile:file(M1Erl, [{outdir,DataDir}]),
+ {ok,?M2} = compile:file(M2Erl, [{outdir,DataDir}]),
+ {module,?M1} = code:load_file(?M1),
+ {module,?M2} = code:load_file(?M2),
+
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+groups() ->
+ [
+ {find_groups,[],[all_groups,
+ testcases_in_all_groups,
+ all_in_top_group1,
+ all_in_top_group2,
+ all_in_sub_group1,
+ all_in_sub_group2,
+ testcase_in_top_group1,
+ testcase_in_top_group2,
+ testcase_in_sub_group1,
+ testcase_in_sub_group2,
+ testcase_in_top_groups1,
+ testcase_in_top_groups2,
+ testcase_in_top_groups3,
+ testcase_in_top_groups4,
+ testcase_in_top_groups5,
+ testcase_in_top_groups6,
+ testcase_in_top_groups7,
+ testcase_in_sub_groups1,
+ testcase_in_sub_groups2,
+ testcase_in_sub_groups3,
+ testcase_in_sub_groups4,
+ testcase_in_sub_groups5,
+ testcase_in_sub_groups6,
+ testcase_in_sub_groups7,
+ testcase_in_sub_groups8,
+ testcase_in_sub_groups9,
+ testcase_in_sub_groups10,
+ testcase_in_sub_groups11,
+ testcase_in_sub_groups12,
+ testcase_in_sub_groups13,
+ bad_testcase_in_sub_groups1]},
+
+ {run_groups,[sequence],[run_groups_with_options,
+ run_groups_with_testspec]}
+ ].
+
+all() ->
+ [{group,find_groups,[parallel]},
+ {group,run_groups}].
+
+
+
+%%--------------------------------------------------------------------
+%% TEST CASES CHECKING RETURN VALUE ONLY
+%%--------------------------------------------------------------------
+
+all_groups(_) ->
+ GPath = all, TCs = all,
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ Top1 = ct_groups:find_groups(?M1, top1, TCs, groups1()),
+ Top2 = ct_groups:find_groups(?M1, top2, TCs, groups1()),
+
+ All = Top1 ++ Top2 ++ [{conf,[{name,sub2}],
+ {?M1,init_per_group},
+ [{?M1,sub2_tc1},{?M1,sub2_tc2}],
+ {?M1,end_per_group}}],
+
+ All = Found,
+
+ {?M1,GPath,TCs,Top1++Top2}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcases_in_all_groups(_) ->
+ GPath = all, TCs = [tc3,sub_tc2],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [Top1 =
+ {conf,[{name,top1}],{?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub11}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,tc3},{?M2,sub_tc2},
+ {conf,[{name,sub121}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ Top2 =
+ {conf,[{name,top2}],{?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,tc3},{?M2,sub_tc2},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{?M2,tc3},{?M2,sub_tc2},
+ {conf,[{name,sub221}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,tc3},{?M2,sub_tc2},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],{?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{?M2,tc3},{?M2,sub_tc2},
+ {conf,[{name,sub221}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],{?M2,end_per_group}},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],{?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub221}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],{?M2,end_per_group}},
+
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},[{?M2,tc3},{?M2,sub_tc2}],{?M2,end_per_group}}]
+
+ = Found,
+
+ {?M2,GPath,TCs,[Top1,Top2]}.
+
+%%%-----------------------------------------------------------------
+%%%
+all_in_top_group1(_) ->
+ GPath= top1, TCs = all,
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [{conf,[{name,top1}],
+ {?M1,init_per_group},
+ [{?M1,top1_tc1},{?M1,top1_tc2},
+ {conf,[{name,sub1}],
+ {?M1,init_per_group},
+ [{?M1,sub1_tc1},{?M1,sub1_tc2}],
+ {?M1,end_per_group}}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+all_in_top_group2(_) ->
+ GPath= top2, TCs = all,
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [{conf,[{name,top2}],
+ {?M1,init_per_group},
+ [{conf,[{name,sub2}],
+ {?M1,init_per_group},
+ [{?M1,sub2_tc1},{?M1,sub2_tc2}],
+ {?M1,end_per_group}},
+ {?M1,top2_tc1},{?M1,top2_tc2}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+all_in_sub_group1(_) ->
+ GPath = sub1, TCs = all,
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [{conf,[{name,top1}],
+ {?M1,init_per_group},
+ [{conf,[{name,sub1}],
+ {?M1,init_per_group},
+ [{?M1,sub1_tc1},{?M1,sub1_tc2}],
+ {?M1,end_per_group}}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+all_in_sub_group2(_) ->
+ GPath = sub2, TCs = all,
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [Top2 =
+ {conf,[{name,top2}],
+ {?M1,init_per_group},
+ [{conf,[{name,sub2}],
+ {?M1,init_per_group},
+ [{?M1,sub2_tc1},{?M1,sub2_tc2}],
+ {?M1,end_per_group}}],
+ {?M1,end_per_group}},
+
+ {conf,[{name,sub2}],
+ {?M1,init_per_group},
+ [{?M1,sub2_tc1},{?M1,sub2_tc2}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Top2}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_group1(_) ->
+ GPath = top1, TCs = [top1_tc2],
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [{conf,[{name,top1}],
+ {?M1,init_per_group},
+ [{?M1,top1_tc2}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_group2(_) ->
+ GPath = top2, TCs = [top2_tc2],
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [{conf,[{name,top2}],
+ {?M1,init_per_group},
+ [{?M1,top2_tc2}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_group1(_) ->
+ GPath = sub1, TCs = [sub1_tc2],
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [{conf,[{name,top1}],
+ {?M1,init_per_group},
+ [{conf,[{name,sub1}],
+ {?M1,init_per_group},
+ [{?M1,sub1_tc2}],
+ {?M1,end_per_group}}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_group2(_) ->
+ GPath = sub2, TCs = [sub2_tc2],
+
+ Found = ct_groups:find_groups(?M1, GPath, TCs, groups1()),
+
+ [Top2 =
+ {conf,[{name,top2}],
+ {?M1,init_per_group},
+ [{conf,[{name,sub2}],
+ {?M1,init_per_group},
+ [{?M1,sub2_tc2}],
+ {?M1,end_per_group}}],
+ {?M1,end_per_group}},
+
+ {conf,[{name,sub2}],
+ {?M1,init_per_group},
+ [{?M1,sub2_tc2}],
+ {?M1,end_per_group}}] = Found,
+
+ {?M1,GPath,TCs,Top2}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups1(_) ->
+ GPath = [top1,top2], TCs = all,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{?M2,top1_tc1},{?M2,top_tc2},{?M2,tc3},
+ {conf,[{name,sub11}],
+ {?M2,init_per_group},
+ [{?M2,sub11_tc1},{?M2,sub_tc2},{?M2,tc3}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,sub12_tc1},{?M2,sub_tc2},{?M2,tc3},
+ {conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,sub121_tc1},{?M2,sub_tc2},{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,sub21_tc1},{?M2,sub_tc2},{?M2,tc3},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1},{?M2,sub_tc2},{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+ {?M2,top2_tc1},{?M2,top_tc2},{?M2,tc3},
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub221}],
+ {?M2,init_per_group},
+ [{?M2,sub221_tc1},{?M2,sub_tc2},{?M2,tc3}],
+ {?M2,end_per_group}},
+ {?M2,sub22_tc1},{?M2,sub_tc2},{?M2,tc3},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1},{?M2,sub_tc2},{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups2(_) ->
+ GPath = [top1,top2], TCs = tc3,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub11}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub221}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups3(_) ->
+ GPath = [top1,top2], TCs = top1_tc1,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{?M2,top1_tc1}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups4(_) ->
+ GPath = [top1,top2], TCs = sub2xx_tc1,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups5(_) ->
+ GPath = [top1,top2], TCs = [sub21_tc1,sub22_tc1],
+
+ Found = ct_groups:find_groups(?M2, [top1,top2], [sub21_tc1,sub22_tc1],
+ groups2()),
+
+ [{conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,sub21_tc1}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{?M2,sub22_tc1}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups6(_) ->
+ GPath = [[top1],[top2]], TCs = tc3,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}},
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_top_groups7(_) ->
+ GPath = [[top1],[top2]], TCs = all,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{?M2,top1_tc1},
+ {?M2,top_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}},
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{?M2,top2_tc1},
+ {?M2,top_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups1(_) ->
+ GPath = [sub121], TCs = tc3,
+
+ Found = ct_groups:find_groups(?M2, sub121, tc3, groups2()),
+ Found = ct_groups:find_groups(?M2, [sub121], tc3, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups2(_) ->
+ GPath = sub12, TCs = tc3,
+
+ Found = ct_groups:find_groups(?M2, sub12, tc3, groups2()),
+ Found = ct_groups:find_groups(?M2, [sub12], tc3, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,tc3},
+ {conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ FoundX = ct_groups:find_groups(?M2, [[sub12]], tc3, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = FoundX,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups3(_) ->
+ GPath = [sub121,sub221], TCs = all,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [Top1 =
+ {conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,sub121_tc1},
+ {?M2,sub_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ Top2 =
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub221}],
+ {?M2,init_per_group},
+ [{?M2,sub221_tc1},
+ {?M2,sub_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub221}],
+ {?M2,init_per_group},
+ [{?M2,sub221_tc1},
+ {?M2,sub_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub221}],
+ {?M2,init_per_group},
+ [{?M2,sub221_tc1},
+ {?M2,sub_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,[Top1,Top2]}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups4(_) ->
+ GPath = [top1,sub21], TCs = sub_tc2,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [Top1 =
+ {conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub11}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2},
+ {conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ Top2 =
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2},
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,[Top1,Top2]}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups5(_) ->
+ GPath = [[top1,sub12]], TCs = sub12_tc1,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,sub12_tc1}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups6(_) ->
+ GPath = [[top1,sub12]], TCs = [sub_tc2],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups7(_) ->
+ GPath = [[top1,sub12]], TCs = [sub12_tc1,sub_tc2],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{?M2,sub12_tc1},
+ {?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups8(_) ->
+ GPath = [[top2,sub22]], TCs = [sub22_tc1,sub_tc2],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{?M2,sub22_tc1},
+ {?M2,sub_tc2}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups9(_) ->
+ GPath = [[sub2xx]], TCs = tc3,
+
+ Found = ct_groups:find_groups(?M2, sub2xx, tc3, groups2()),
+ Found = ct_groups:find_groups(?M2, [[sub2xx]], tc3, groups2()),
+
+ [Top2 =
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Top2}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups10(_) ->
+ GPath = [[sub22,sub2xx]], TCs = tc3,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [Top2 =
+ {conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Top2}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups11(_) ->
+ GPath = [[top1,sub12,sub121]], TCs = all,
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top1}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub12}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub121}],
+ {?M2,init_per_group},
+ [{?M2,sub121_tc1},
+ {?M2,sub_tc2},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups12(_) ->
+ GPath = [[top2,sub2xx]], TCs = [sub2xx_tc1,tc3],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub21}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}},
+ {conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+testcase_in_sub_groups13(_) ->
+ GPath = [[top2,sub22,sub2xx]], TCs = [top2_tc1,sub2xx_tc1,tc3],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [{conf,[{name,top2}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub22}],
+ {?M2,init_per_group},
+ [{conf,[{name,sub2xx}],
+ {?M2,init_per_group},
+ [{?M2,sub2xx_tc1},
+ {?M2,tc3}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}],
+ {?M2,end_per_group}}] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+bad_testcase_in_sub_groups1(_) ->
+ GPath = [sub2xx], TCs = [top2_tc1],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%%
+bad_testcase_in_sub_groups2(_) ->
+ GPath = [sub12,sub2xx], TCs = [top1_tc1,top2_tc1],
+
+ Found = ct_groups:find_groups(?M2, GPath, TCs, groups2()),
+
+ [] = Found,
+
+ {?M2,GPath,TCs,Found}.
+
+%%%-----------------------------------------------------------------
+%%% CASES EXECUTING THE TESTS
+%%%-----------------------------------------------------------------
+
+run_groups_with_options(Config) ->
+ DataDir = ?config(data_dir, Config),
+
+ {M1All,M1Rest,M2All,M2Rest} = get_all_groups_and_cases(Config),
+
+ M1AllGrs = lists:flatmap(fun({Path,_,_}) when is_atom(hd(Path)) -> Path;
+ ({Path,_,_}) when is_list(hd(Path)) -> Path;
+ ({Path,_,_}) -> [Path]
+ end, M1All),
+
+ %% ct:pal("NOW RUNNING M1 TEST: ~p", [M1All]),
+
+ {OptsM11,ERPidM11} = setup([{dir,DataDir},{suite,?M1},
+ {group,M1AllGrs},{label,m1_all_cases}], Config),
+ M1AllGrInfo = {M1AllGrs,lists:flatten([Found || {_,_,Found} <- M1All])},
+ ok = execute(m1_all_cases, M1AllGrInfo, OptsM11, ERPidM11, Config),
+
+ lists:foldl(
+ fun({GrPath,TCs,Found}, N) ->
+ TestName = list_to_atom("m1_spec_cases_" ++ integer_to_list(N)),
+ %% ct:pal("NOW RUNNING M1 TEST ~p: ~p + ~p",
+ %% [TestName,GrPath,TCs]),
+ {OptsM12,ERPidM12} = setup([{dir,DataDir},{suite,?M1},
+ {group,GrPath},{testcase,TCs},
+ {label,TestName}], Config),
+ ok = execute(TestName, {GrPath,TCs,Found},
+ OptsM12, ERPidM12, Config),
+ N+1
+ end, 1, M1Rest),
+
+ %% ct:pal("NOW RUNNING M2 TEST: ~p", [M2All]),
+
+ M2AllGrs = lists:flatmap(fun({Path,_,_}) when is_atom(hd(Path)) -> Path;
+ ({Path,_,_}) when is_list(hd(Path)) -> Path;
+ ({Path,_,_}) -> [Path]
+ end, M2All),
+
+
+ {OptsM21,ERPidM21} = setup([{dir,DataDir},{suite,?M2},
+ {group,M2AllGrs},{testcase,all},
+ {label,m2_all_cases}], Config),
+ M2AllGrInfo = {M2AllGrs,lists:flatten([Found || {_,_,Found} <- M2All])},
+ ok = execute(m2_all_cases, M2AllGrInfo, OptsM21, ERPidM21, Config),
+
+ lists:foldl(
+ fun({GrPath,TCs,Found}, N) ->
+ TestName = list_to_atom("m2_spec_cases_" ++ integer_to_list(N)),
+ %% ct:pal("NOW RUNNING M2 TEST ~p: ~p + ~p", [TestName,GrPath,TCs]),
+ {OptsM22,ERPidM22} = setup([{dir,DataDir},{suite,?M2},
+ {group,GrPath},{testcase,TCs},
+ {label,TestName}], Config),
+ ok = execute(TestName, {GrPath,TCs,Found},
+ OptsM22, ERPidM22, Config),
+ N+1
+ end, 1, M2Rest),
+ ok.
+
+
+%%%-----------------------------------------------------------------
+%%%
+run_groups_with_testspec(Config) ->
+ Name = run_groups_with_testspec,
+ DataDir = ?config(data_dir, Config),
+ PrivDir = ?config(priv_dir, Config),
+
+ {M1All,M1Rest,M2All,M2Rest} = get_all_groups_and_cases(Config),
+
+ M1AllGrs = lists:flatmap(fun({Path,_,_}) when is_atom(hd(Path)) -> Path;
+ ({Path,_,_}) when is_list(hd(Path)) -> Path;
+ ({Path,_,_}) -> [Path]
+ end, M1All),
+ M1AllTerm = {groups,DataDir,?M1,M1AllGrs},
+
+ M1RestTerms = lists:map(
+ fun({GrPath,TCs,_}) ->
+ {groups,DataDir,?M1,GrPath,{cases,TCs}}
+ end, M1Rest),
+
+ M2AllGrs = lists:flatmap(fun({Path,_,_}) when is_atom(hd(Path)) -> Path;
+ ({Path,_,_}) when is_list(hd(Path)) -> Path;
+ ({Path,_,_}) -> [Path]
+ end, M2All),
+ M2AllTerm = {groups,DataDir,?M2,M2AllGrs,{cases,all}},
+
+ M2RestTerms = lists:map(
+ fun({GrPath,TCs,_}) ->
+ {groups,DataDir,?M2,GrPath,{cases,TCs}}
+ end, M2Rest),
+
+ GroupTerms = lists:flatten([M1AllTerm,
+ M1RestTerms,
+ M2AllTerm,
+ M2RestTerms]),
+
+ TestSpec = [{merge_tests,false},
+ {label,Name}] ++ GroupTerms,
+
+ ct:pal("Here's the test spec:~n~p", [TestSpec]),
+
+ TestSpecName = ct_test_support:write_testspec(TestSpec, PrivDir,
+ "groups_search_spec"),
+
+ {Opts,ERPid} = setup([{spec,TestSpecName}], Config),
+ GroupInfo =
+ [{M1AllTerm,lists:flatten([Found || {_,_,Found} <- M1All])} |
+ M1Rest] ++
+ [{M2AllTerm,lists:flatten([Found || {_,_,Found} <- M2All])} |
+ M2Rest],
+ ok = execute(Name, GroupInfo, Opts, ERPid, Config).
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+groups1() ->
+ [{top1,[],[top1_tc1,top1_tc2,{sub1,[],[sub1_tc1,sub1_tc2]}]},
+ {top2,[],[{group,sub2},top2_tc1,top2_tc2]},
+ {sub2,[],[sub2_tc1,sub2_tc2]}].
+
+groups2() ->
+ [{top1,[],[top1_tc1,top_tc2,tc3,
+ {sub11,[],[sub11_tc1,sub_tc2,tc3]},
+ {sub12,[],[sub12_tc1,sub_tc2,tc3,
+ {sub121,[],[sub121_tc1,sub_tc2,tc3]}]}]},
+ {top2,[],[{group,sub21},top2_tc1,top_tc2,tc3,{group,sub22}]},
+ {sub21,[],[sub21_tc1,sub_tc2,tc3,{group,sub2xx}]},
+ {sub22,[],[{group,sub221},sub22_tc1,sub_tc2,tc3,{group,sub2xx}]},
+ {sub221,[],[sub221_tc1,sub_tc2,tc3]},
+ {sub2xx,[],[sub2xx_tc1,sub_tc2,tc3]}].
+
+get_all_groups_and_cases(Config) ->
+ {value,{_,_,FindGrTCs}} = lists:keysearch(find_groups, 1, groups()),
+
+ MGTFs = [apply(?MODULE, TC, [Config]) || TC <- FindGrTCs],
+
+ ct:pal("Extracted data from ~p test cases", [length(MGTFs)]),
+
+ lists:foldr(fun({M,Gs,TCs,F},
+ {M11,M12,M21,M22}) ->
+ case {M,Gs,TCs} of
+ {?M1,all,_} -> {M11,[{Gs,TCs,F}|M12],M21,M22};
+ {?M1,_,all} -> {[{Gs,all,F}|M11],M12,M21,M22};
+ {?M1,_,_} -> {M11,[{Gs,TCs,F}|M12],M21,M22};
+ {?M2,all,_} -> {M11,M12,M21,[{Gs,TCs,F}|M22]};
+ {?M2,_,all} -> {M11,M12,[{Gs,all,F}|M21],M22};
+ {?M2,_,_} -> {M11,M12,M21,[{Gs,TCs,F}|M22]}
+ end
+ end, {[],[],[],[]}, MGTFs).
+
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, TestParams, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+ Events1 = reformat(Events, ?eh),
+ ct_test_support:log_events(Name,
+ Events1,
+ ?config(priv_dir, Config),
+ Opts),
+ verify_events(Name, TestParams, Events1).
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+verify_events(Name, Params, Events) ->
+ %% 2 tests (ct:run_test + script_start) is default
+ verify_events(Name, Params, Events, 2).
+
+verify_events(_, _, _, 0) ->
+ ok;
+verify_events(Name, Params, Events, N) ->
+ test_events(Name, Params, Events),
+ verify_events(Name, Params, Events, N-1).
+
+%%%-----------------------------------------------------------------
+%%% check run_groups_with_options
+
+test_events(TestName, {GrPath,Found}, Events) ->
+ test_events(TestName, {GrPath,all,Found}, Events);
+
+test_events(TestName, {GrPath,TCs,Found}, Events)
+ when TestName /= run_groups_with_testspec ->
+ try check_events(Events, flatten_tests(Found)) of
+ ok -> ok
+ catch
+ throw:Reason ->
+ ct:pal("Test failed for ~p with group path ~p and cases ~p"
+ "~nReason: ~p", [TestName,GrPath,TCs,Reason]),
+ throw(failed)
+ end;
+
+%%%-----------------------------------------------------------------
+%%% check run_groups_with_testspec
+
+test_events(run_groups_with_testspec, Params, Events) ->
+ AllFound = lists:flatmap(fun({_All,Found}) when is_tuple(Found) ->
+ [Found];
+ ({_All,Found}) ->
+ Found;
+ ({_Gr,_TCs,Found}) when is_tuple(Found) ->
+ [Found];
+ ({_Gr,_TCs,Found}) ->
+ Found
+ end, Params),
+ try check_events(Events, flatten_tests(AllFound)) of
+ ok -> ok
+ catch
+ throw:Reason ->
+ ct:pal("Test failed for run_groups_with_testspec."
+ "~nReason: ~p", [Reason]),
+ throw(failed)
+ end.
+
+flatten_tests({conf,[{name,G}|_],{Mod,_I},Tests,_E}) ->
+ lists:flatten([{group,Mod,G} | flatten_tests(Tests)]);
+flatten_tests([{conf,[{name,G}|_],{Mod,_I},Tests,_E} | Confs]) ->
+ lists:flatten([{group,Mod,G} | flatten_tests(Tests)]) ++
+ lists:flatten(flatten_tests(Confs));
+flatten_tests([{_Mod,_TC} = Case | Tests]) ->
+ lists:flatten([Case | flatten_tests(Tests)]);
+flatten_tests([]) ->
+ [].
+
+check_events([{_,tc_start,{Mod,{init_per_group,G,_}}} | Evs],
+ [{group,Mod,G} | Check]) ->
+ check_events(Evs, Check);
+check_events([{_,tc_start,{Mod,TC}} | Evs],
+ [{Mod,TC} | Check]) when is_atom(TC) ->
+ check_events(Evs, Check);
+check_events([{_,tc_start,{Mod,{init_per_group,G,_}}} | _Evs], Check) ->
+ ct:pal("CHECK FAILED!~nGroup ~p in ~p not found in ~p.",
+ [G,Mod,Check]),
+ throw({test_not_found,{Mod,G}});
+check_events([{_,tc_start,{Mod,TC}} | _Evs], Check)
+ when is_atom(TC), TC /= init_per_suite, TC /= end_per_suite ->
+ ct:pal("CHECK FAILED!~nCase ~p in ~p not found in ~p.",
+ [TC,Mod,Check]),
+ throw({test_not_found,{Mod,TC}});
+check_events([Group | Evs], Check) when is_list(Group) ->
+ Check1 = check_events(Group, Check),
+ check_events(Evs, Check1);
+check_events(_, []) ->
+ ok;
+check_events([Elem | Evs], Check) when is_tuple(Elem) ->
+ check_events(Evs, Check);
+check_events([], Check = [_|_]) ->
+ ct:pal("CHECK FAILED!~nTests remain: ~p", [Check]),
+ throw({tests_remain,Check});
+check_events([Wut | _],_) ->
+ throw({unexpected,Wut}).
+
diff --git a/lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_1_SUITE.erl b/lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_1_SUITE.erl
new file mode 100644
index 0000000000..1c5b572f92
--- /dev/null
+++ b/lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_1_SUITE.erl
@@ -0,0 +1,83 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(groups_search_dummy_1_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+
+all() ->
+ [{group,top1},
+ {group,top2}].
+
+groups() ->
+ [{top1,[],[top1_tc1,top1_tc2,{sub1,[],[sub1_tc1,sub1_tc2]}]},
+ {top2,[],[{group,sub2},top2_tc1,top2_tc2]},
+ {sub2,[],[sub2_tc1,sub2_tc2]}].
+
+%%%-----------------------------------------------------------------
+%%% CONFIG FUNCS
+%%%-----------------------------------------------------------------
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+init_per_group(_, Config) ->
+ Config.
+
+end_per_group(_, _Config) ->
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% TEST CASES
+%%%-----------------------------------------------------------------
+
+top1_tc1(_) ->
+ ok.
+
+top1_tc2(_) ->
+ ok.
+
+sub1_tc1(_) ->
+ ok.
+
+sub1_tc2(_) ->
+ ok.
+
+top2_tc1(_) ->
+ ok.
+
+top2_tc2(_) ->
+ ok.
+
+sub2_tc1(_) ->
+ ok.
+
+sub2_tc2(_) ->
+ ok.
diff --git a/lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_2_SUITE.erl b/lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_2_SUITE.erl
new file mode 100644
index 0000000000..060012de29
--- /dev/null
+++ b/lib/common_test/test/ct_groups_search_SUITE_data/groups_search_dummy_2_SUITE.erl
@@ -0,0 +1,102 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(groups_search_dummy_2_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+
+all() ->
+ [{group,top1},
+ {group,top2}].
+
+groups() ->
+ [{top1,[],[top1_tc1,top_tc2,tc3,
+ {sub11,[],[sub11_tc1,sub_tc2,tc3]},
+ {sub12,[],[sub12_tc1,sub_tc2,tc3,
+ {sub121,[],[sub121_tc1,sub_tc2,tc3]}]}]},
+
+ {top2,[],[{group,sub21},top2_tc1,top_tc2,tc3,{group,sub22}]},
+ {sub21,[],[sub21_tc1,sub_tc2,tc3,{group,sub2xx}]},
+ {sub22,[],[{group,sub221},sub22_tc1,sub_tc2,tc3,{group,sub2xx}]},
+ {sub221,[],[sub221_tc1,sub_tc2,tc3]},
+ {sub2xx,[],[sub2xx_tc1,sub_tc2,tc3]}].
+
+%%%-----------------------------------------------------------------
+%%% CONFIG FUNCS
+%%%-----------------------------------------------------------------
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+init_per_group(_, Config) ->
+ Config.
+
+end_per_group(_, _Config) ->
+ ok.
+
+%%%------------------------------------------------------------------
+%%% TEST CASES
+%%%------------------------------------------------------------------
+
+top1_tc1(_) ->
+ ok.
+
+top_tc2(_) ->
+ ok.
+
+tc3(_) ->
+ ok.
+
+sub_tc2(_) ->
+ ok.
+
+sub11_tc1(_) ->
+ ok.
+
+sub12_tc1(_) ->
+ ok.
+
+sub121_tc1(_) ->
+ ok.
+
+top2_tc1(_) ->
+ ok.
+
+sub21_tc1(_) ->
+ ok.
+
+sub22_tc1(_) ->
+ ok.
+
+sub221_tc1(_) ->
+ ok.
+
+sub2xx_tc1(_) ->
+ ok.
diff --git a/lib/common_test/test/ct_master_SUITE.erl b/lib/common_test/test/ct_master_SUITE.erl
index 27243a0067..56a343a96f 100644
--- a/lib/common_test/test/ct_master_SUITE.erl
+++ b/lib/common_test/test/ct_master_SUITE.erl
@@ -117,14 +117,8 @@ ct_master_test(Config) when is_list(Config) ->
reformat(Events, ?eh),
PrivDir, []),
- find_events(NodeNames, [{tc_start,{master_SUITE,init_per_suite}},
- {tc_start,{master_SUITE,first_testcase}},
- {tc_start,{master_SUITE,second_testcase}},
- {tc_start,{master_SUITE,third_testcase}},
- {tc_start,{master_SUITE,end_per_suite}}],
- Events),
-
- ok.
+ TestEvents = events_to_check(ct_master_test),
+ ok = find_events(NodeNames, TestEvents, Events, Config).
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
@@ -153,13 +147,15 @@ make_spec(DataDir, FileName, NodeNames, Suites, Config) ->
CM = [{config,master,filename:join(DataDir,"master/config.txt")}],
+ Env = [{"THIS_MUST_BE_SET","yes"},
+ {"SO_MUST_THIS","value"}],
NS = lists:map(
fun(NodeName) ->
{init,NodeName,[
{node_start,[{startup_functions,[]},
- {monitor_master,true}]},
- {eval,{erlang,nodes,[]}}
- ]
+ {monitor_master,true},
+ {env,Env}]},
+ {eval,{erlang,nodes,[]}}]
}
end,
NodeNames),
@@ -199,7 +195,6 @@ run_test(_Name, FileName, Config) ->
[{FileName,ok}] = ct_test_support:run({ct_master,run,[FileName]},
[{ct_master,basic_html,[true]}],
Config),
- timer:sleep(5000),
[{FileName,ok}] = ct_test_support:run({ct_master,run,[FileName]},
[{ct_master,basic_html,[false]}],
Config).
@@ -210,28 +205,26 @@ reformat(Events, EH) ->
%%%-----------------------------------------------------------------
%%% TEST EVENTS
%%%-----------------------------------------------------------------
-find_events([], _CheckEvents, _) ->
- ok;
-find_events([NodeName|NodeNames],CheckEvents,AllEvents) ->
- find_events(NodeNames, CheckEvents,
- remove_events(add_host(NodeName),CheckEvents, AllEvents, [])).
-
-remove_events(Node,[{Name,Data} | RestChecks],
- [{?eh,#event{ name = Name, node = Node, data = Data }}|RestEvs],
- Acc) ->
- remove_events(Node, RestChecks, RestEvs, Acc);
-remove_events(Node, Checks, [Event|RestEvs], Acc) ->
- remove_events(Node, Checks, RestEvs, [Event | Acc]);
-remove_events(_Node, [], [], Acc) ->
- lists:reverse(Acc);
-remove_events(Node, Events, [], Acc) ->
- test_server:format("Could not find events: ~p in ~p for node ~p",
- [Events, lists:reverse(Acc), Node]),
- exit(event_not_found).
+
+find_events(NodeNames, TestEvents, Events, Config) ->
+ [begin
+ Node = add_host(Node0),
+ io:format("Searching for events for node: ~s", [Node]),
+ ok = ct_test_support:verify_events(TestEvents, Events, Node, Config),
+ io:nl()
+ end || Node0 <- NodeNames],
+ ok.
add_host(NodeName) ->
{ok, HostName} = inet:gethostname(),
list_to_atom(atom_to_list(NodeName)++"@"++HostName).
-expected_events(_) ->
- [].
+events_to_check(_) ->
+ [{?eh,tc_start,{master_SUITE,first_testcase}},
+ {?eh,tc_done,{master_SUITE,first_testcase,ok}},
+ {?eh,tc_start,{master_SUITE,second_testcase}},
+ {?eh,tc_done,{master_SUITE,second_testcase,ok}},
+ {?eh,tc_start,{master_SUITE,third_testcase}},
+ {?eh,tc_done,{master_SUITE,third_testcase,ok}},
+ {?eh,tc_start,{master_SUITE,env_vars}},
+ {?eh,tc_done,{master_SUITE,env_vars,ok}}].
diff --git a/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl b/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl
index 032d69ad9f..8a5009ad62 100644
--- a/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl
+++ b/lib/common_test/test/ct_master_SUITE_data/master/master_SUITE.erl
@@ -39,7 +39,8 @@ init_per_suite(Config) ->
end_per_suite(_) ->
ok.
-all() -> [first_testcase, second_testcase, third_testcase].
+all() -> [first_testcase, second_testcase, third_testcase,
+ env_vars].
init_per_testcase(_, Config) ->
Config.
@@ -56,3 +57,9 @@ second_testcase(_)->
third_testcase(_)->
A = 4,
A = 2*2.
+
+env_vars(_) ->
+ io:format("~p\n", [os:getenv()]),
+ "yes" = os:getenv("THIS_MUST_BE_SET"),
+ "value" = os:getenv("SO_MUST_THIS"),
+ ok.
diff --git a/lib/common_test/test/ct_netconfc_SUITE.erl b/lib/common_test/test/ct_netconfc_SUITE.erl
index 30084a6228..3042a924fe 100644
--- a/lib/common_test/test/ct_netconfc_SUITE.erl
+++ b/lib/common_test/test/ct_netconfc_SUITE.erl
@@ -113,7 +113,7 @@ reformat(Events, EH) ->
%%%-----------------------------------------------------------------
%%% TEST EVENTS
%%%-----------------------------------------------------------------
-events_to_check(Test,Config) ->
+events_to_check(default,Config) ->
{module,_} = code:load_abs(filename:join(?config(data_dir,Config),
netconfc1_SUITE)),
TCs = netconfc1_SUITE:all(),
diff --git a/lib/common_test/test/ct_snmp_SUITE.erl b/lib/common_test/test/ct_snmp_SUITE.erl
new file mode 100644
index 0000000000..f8b4543770
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE.erl
@@ -0,0 +1,141 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_snmp_SUITE
+%%%
+%%% Description:
+%%% Test ct_snmp module
+%%%
+%%%-------------------------------------------------------------------
+-module(ct_snmp_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ default
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+default(Config) when is_list(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "snmp_SUITE"),
+ CfgFile = filename:join(DataDir, "snmp.cfg"),
+ {Opts,ERPid} = setup([{suite,Suite},{config,CfgFile},
+ {label,default}], Config),
+
+ ok = execute(default, Opts, ERPid, Config).
+
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(Name,Config),
+ ct_test_support:verify_events(TestEvents, Events, Config).
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+events_to_check(_TestName,Config) ->
+ {module,_} = code:load_abs(filename:join(?config(data_dir,Config),
+ snmp_SUITE)),
+ TCs = get_tcs(),
+ code:purge(snmp_SUITE),
+ code:delete(snmp_SUITE),
+
+ OneTest =
+ [{?eh,start_logging,{'DEF','RUNDIR'}}] ++
+ [{?eh,tc_done,{snmp_SUITE,TC,ok}} || TC <- TCs] ++
+ [{?eh,stop_logging,[]}],
+
+ %% 2 tests (ct:run_test + script_start) is default
+ OneTest ++ OneTest.
+
+
+get_tcs() ->
+ All = snmp_SUITE:all(),
+ Groups =
+ try snmp_SUITE:groups()
+ catch error:undef -> []
+ end,
+ flatten_tcs(All,Groups).
+
+flatten_tcs([H|T],Groups) when is_atom(H) ->
+ [H|flatten_tcs(T,Groups)];
+flatten_tcs([{group,Group}|T],Groups) ->
+ TCs = proplists:get_value(Group,Groups),
+ flatten_tcs(TCs ++ T,Groups);
+flatten_tcs([],_) ->
+ [].
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg b/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg
new file mode 100644
index 0000000000..895e097de6
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp.cfg
@@ -0,0 +1,44 @@
+%% -*- erlang -*-
+{snmp1, [{start_agent,true},
+ {users,[{user_name,[snmpm_user_default,[]]}]},
+ {managed_agents,[{agent_name, [user_name, {127,0,0,1}, 4000,
+ [{engine_id,"ct_snmp-test-engine"},
+ {version,v2}]]}]},
+ {engine_id,"ct_snmp-test-engine"},
+ {agent_vsns,[v2]}
+ ]}.
+{snmp2, [{start_agent,true},
+ {engine_id,"ct_snmp-test-engine"}
+ ]}.
+{snmp3, [{start_agent,true},
+ {engine_id,"ct_snmp-test-engine"},
+ {agent_vsns,[v1,v2,v3]},
+ {agent_contexts,{data_dir_file,"context.conf"}},
+ {agent_usm,{data_dir_file,"usm.conf"}},
+ {agent_community,{data_dir_file,"community.conf"}},
+ {agent_notify_def,{data_dir_file,"notify.conf"}},
+ {agent_sysinfo,{data_dir_file,"standard.conf"}},
+ {agent_target_address_def,{data_dir_file,"target_addr.conf"}},
+ {agent_target_param_def,{data_dir_file,"target_params.conf"}},
+ {agent_vacm,{data_dir_file,"vacm.conf"}}]}.
+{snmp_app1,[{manager, [{config, [{verbosity, silence}]},
+ {server,[{verbosity,silence}]},
+ {net_if,[{verbosity,silence}]},
+ {versions,[v2]}
+ ]},
+ {agent, [{config, [{verbosity, silence}]},
+ {net_if,[{verbosity,silence}]},
+ {mib_server,[{verbosity,silence}]},
+ {local_db,[{verbosity,silence}]},
+ {agent_verbosity,silence}
+ ]}]}.
+{snmp_app2,[{manager, [{config, [{verbosity, silence}]},
+ {server,[{verbosity,silence}]},
+ {net_if,[{verbosity,silence}]}
+ ]},
+ {agent, [{config, [{verbosity, silence}]},
+ {net_if,[{verbosity,silence}]},
+ {mib_server,[{verbosity,silence}]},
+ {local_db,[{verbosity,silence}]},
+ {agent_verbosity,silence}
+ ]}]}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl
new file mode 100644
index 0000000000..16b2b5690c
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE.erl
@@ -0,0 +1,395 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+%%----------------------------------------------------------------------
+%% File: ct_snmp_SUITE.erl
+%%
+%% Description:
+%% This file contains the test cases for the ct_snmp API.
+%%
+%% @author Support
+%% @doc Test of SNMP support in common_test
+%% @end
+%%----------------------------------------------------------------------
+%%----------------------------------------------------------------------
+-module(snmp_SUITE).
+-include_lib("common_test/include/ct.hrl").
+-include_lib("snmp/include/STANDARD-MIB.hrl").
+-include_lib("snmp/include/SNMP-USER-BASED-SM-MIB.hrl").
+-include_lib("snmp/include/snmp_types.hrl").
+
+-compile(export_all).
+
+%% Default timetrap timeout (set in init_per_testcase).
+-define(default_timeout, ?t:minutes(1)).
+
+-define(AGENT_UDP, 4000).
+
+suite() ->
+ [
+ {require, snmp1, snmp1},
+ {require, snmp_app1, snmp_app1},
+ {require, snmp2, snmp2},
+ {require, snmp_app2, snmp_app2},
+ {require, snmp3, snmp3}
+ ].
+
+all() ->
+ [start_stop,
+ {group,get_set},
+ {group,register},
+ {group,override},
+ set_info].
+
+
+groups() ->
+ [{get_set,[get_values,
+ get_next_values,
+ set_values,
+ load_mibs]},
+ {register,[register_users,
+ register_users_fail,
+ register_agents,
+ register_agents_fail,
+ register_usm_users,
+ register_usm_users_fail]},
+ {override,[override_usm,
+ override_standard,
+ override_context,
+ override_community,
+ override_notify,
+ override_target_addr,
+ override_target_params,
+ override_vacm]}].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(Config) ->
+ Config.
+
+init_per_group(get_set, Config) ->
+ ok = ct_snmp:start(Config,snmp1,snmp_app1),
+ Config;
+init_per_group(register, Config) ->
+ ok = ct_snmp:start(Config,snmp2,snmp_app2),
+ Config;
+init_per_group(_, Config) ->
+ ok = ct_snmp:start(Config,snmp3,snmp_app2),
+ Config.
+
+end_per_group(_Group, Config) ->
+ catch ct_snmp:stop(Config),
+ Config.
+
+init_per_testcase(_Case, Config) ->
+ Dog = test_server:timetrap(?default_timeout),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(Case, Config) ->
+ try apply(?MODULE,Case,[cleanup,Config])
+ catch error:undef -> ok
+ end,
+ Dog=?config(watchdog, Config),
+ test_server:timetrap_cancel(Dog),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+break(_Config) ->
+ test_server:break(""),
+ ok.
+
+start_stop(Config) ->
+ ok = ct_snmp:start(Config,snmp1,snmp_app1),
+ timer:sleep(1000),
+ {snmp,_,_} = lists:keyfind(snmp,1,application:which_applications()),
+ [_|_] = filelib:wildcard("*/*.conf",?config(priv_dir,Config)),
+
+ ok = ct_snmp:stop(Config),
+ timer:sleep(1000),
+ false = lists:keyfind(snmp,1,application:which_applications()),
+ [] = filelib:wildcard("*/*.conf",?config(priv_dir,Config)),
+ ok.
+
+get_values(_Config) ->
+ Oids1 = [?sysDescr_instance, ?sysName_instance],
+ {noError,_,V1} = ct_snmp:get_values(agent_name,Oids1,snmp1),
+ [#varbind{oid=?sysDescr_instance,value="Erlang SNMP agent"},
+ #varbind{oid=?sysName_instance,value="ct_test"}] = V1,
+ ok.
+
+get_next_values(_Config) ->
+ Oids2 = [?system],
+ {noError,_,V2} = ct_snmp:get_next_values(agent_name,Oids2,snmp1),
+ [#varbind{oid=?sysDescr_instance,value="Erlang SNMP agent"}] = V2,
+ ok.
+
+set_values(Config) ->
+ Oid3 = ?sysName_instance,
+ NewName = "ct_test changed by " ++ atom_to_list(?MODULE),
+ VarsAndVals = [{Oid3,s,NewName}],
+ {noError,_,_} =
+ ct_snmp:set_values(agent_name,VarsAndVals,snmp1,Config),
+
+ Oids4 = [?sysName_instance],
+ {noError,_,V4} = ct_snmp:get_values(agent_name,Oids4,snmp1),
+ [#varbind{oid=?sysName_instance,value=NewName}] = V4,
+
+ ok.
+
+load_mibs(_Config) ->
+ [{'SNMPv2-MIB',_}=SnmpV2Mib] = snmpa:which_mibs(),
+ Mib = filename:join([code:priv_dir(snmp),"mibs","SNMP-USER-BASED-SM-MIB"]),
+ ok = ct_snmp:load_mibs([Mib]),
+ TwoMibs = [_,_] = snmpa:which_mibs(),
+ [{'SNMP-USER-BASED-SM-MIB',_}] = lists:delete(SnmpV2Mib,TwoMibs),
+ ok = ct_snmp:unload_mibs([Mib]),
+ [{'SNMPv2-MIB',_}] = snmpa:which_mibs(),
+ ok.
+
+
+register_users(_Config) ->
+ [] = snmpm:which_users(),
+ ok = ct_snmp:register_users(snmp2,[{reg_user1,[snmpm_user_default,[]]}]),
+ [_] = snmpm:which_users(),
+ [_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:register_users(snmp2,[{reg_user2,[snmpm_user_default,[]]}]),
+ [_,_] = snmpm:which_users(),
+ [_,_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:register_users(snmp2,[{reg_user3,[snmpm_user_default,[]]}]),
+ [_,_,_] = snmpm:which_users(),
+ [_,_,_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:unregister_users(snmp2,[reg_user3]),
+ [_,_] = snmpm:which_users(),
+ [_,_] = ct:get_config({snmp2,users}),
+ ok = ct_snmp:unregister_users(snmp2),
+ [] = snmpm:which_users(),
+ [] = ct:get_config({snmp2,users}),
+ ok.
+register_users(cleanup,_Config) ->
+ ct_snmp:unregister_users(snmp2).
+
+register_users_fail(_Config) ->
+ [] = snmpm:which_users(),
+ {error,_} = ct_snmp:register_users(snmp2,[{reg_user3,[unknown_module,[]]}]),
+ [] = snmpm:which_users(),
+ ok.
+register_users_fail(cleanup,_Config) ->
+ ct_snmp:unregister_users(snmp2).
+
+register_agents(_Config) ->
+ {ok, HostName} = inet:gethostname(),
+ {ok, Addr} = inet:getaddr(HostName, inet),
+
+ [] = snmpm:which_agents(),
+ ok = ct_snmp:register_users(snmp2,[{reg_user1,[snmpm_user_default,[]]}]),
+ ok = ct_snmp:register_agents(snmp2,[{reg_agent1,
+ [reg_user1,Addr,?AGENT_UDP,[]]}]),
+ [_] = snmpm:which_agents(),
+ [_] = ct:get_config({snmp2,managed_agents}),
+ ok = ct_snmp:register_agents(snmp2,[{reg_agent2,
+ [reg_user1,Addr,?AGENT_UDP,[]]}]),
+ [_,_] = snmpm:which_agents(),
+ [_,_] = ct:get_config({snmp2,managed_agents}),
+
+ ok = ct_snmp:register_agents(snmp2,[{reg_agent3,
+ [reg_user1,Addr,?AGENT_UDP,[]]}]),
+ [_,_,_] = snmpm:which_agents(),
+ [_,_,_] = ct:get_config({snmp2,managed_agents}),
+
+ ok = ct_snmp:unregister_agents(snmp2,[reg_agent3]),
+ [_,_] = snmpm:which_agents(),
+ [_,_] = ct:get_config({snmp2,managed_agents}),
+
+ ok = ct_snmp:unregister_agents(snmp2),
+ ok = ct_snmp:unregister_users(snmp2),
+ [] = snmpm:which_agents(),
+ [] = ct:get_config({snmp2,managed_agents}),
+ ok.
+register_agents(cleanup,_Config) ->
+ ct_snmp:unregister_agents(snmp2),
+ ct_snmp:unregister_users(snmp2).
+
+register_agents_fail(_Config) ->
+ {ok, HostName} = inet:gethostname(),
+ {ok, Addr} = inet:getaddr(HostName, inet),
+
+ [] = snmpm:which_agents(),
+ {error,_}
+ = ct_snmp:register_agents(snmp2,[{reg_agent3,
+ [unknown_user,Addr,?AGENT_UDP,[]]}]),
+ [] = snmpm:which_agents(),
+ ok.
+register_agents_fail(cleanup,_Config) ->
+ ct_snmp:unregister_agents(snmp2).
+
+register_usm_users(_Config) ->
+ [] = snmpm:which_usm_users(),
+ ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user1",[]}]),
+ [_] = snmpm:which_usm_users(),
+ [_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user2",[]}]),
+ [_,_] = snmpm:which_usm_users(),
+ [_,_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user3",[]}]),
+ [_,_,_] = snmpm:which_usm_users(),
+ [_,_,_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:unregister_usm_users(snmp2,["reg_usm_user3"]),
+ [_,_] = snmpm:which_usm_users(),
+ [_,_] = ct:get_config({snmp2,usm_users}),
+ ok = ct_snmp:unregister_usm_users(snmp2),
+ [] = snmpm:which_usm_users(),
+ [] = ct:get_config({snmp2,usm_users}),
+ ok.
+register_usm_users(cleanup,_Config) ->
+ ct_snmp:unregister_usm_users(snmp2).
+
+register_usm_users_fail(_Config) ->
+ [] = snmpm:which_usm_users(),
+ {error,_}
+ = ct_snmp:register_usm_users(snmp2,[{"reg_usm_user3",
+ [{sec_name,invalid_data_type}]}]),
+ [] = snmpm:which_usm_users(),
+ ok.
+register_usm_users_fail(cleanup,_Config) ->
+ ct_snmp:unregister_usm_users(snmp2).
+
+%% Test that functionality for overriding default configuration file
+%% works - i.e. that the files are written and that the configuration
+%% is actually used.
+%%
+%% Note that the config files used in this test case do not
+%% necessarily make up a reasonable configuration for the snmp
+%% application...
+override_usm(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ Mib = filename:join([code:priv_dir(snmp),"mibs","SNMP-USER-BASED-SM-MIB"]),
+ ok = ct_snmp:load_mibs([Mib]),
+
+ %% Check that usm.conf is overwritten
+ {ok,MyUsm} = snmpa_conf:read_usm_config(DataDir),
+ {ok,UsedUsm} = snmpa_conf:read_usm_config(ConfDir),
+ true = (MyUsm == UsedUsm),
+
+ %% Check that the usm user is actually configured...
+ [{Index,"secname"}] =
+ snmp_user_based_sm_mib:usmUserTable(get_next,?usmUserEntry,[3]),
+ true = lists:suffix("usm_user_name",Index),
+ ok.
+
+override_standard(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that standard.conf is overwritten
+ {ok,MyStandard} = snmpa_conf:read_standard_config(DataDir),
+ {ok,UsedStandard} = snmpa_conf:read_standard_config(ConfDir),
+ true = (MyStandard == UsedStandard),
+
+ %% Check that the values from standard.conf is actually configured...
+ {value,"name for override test"} = snmp_standard_mib:sysName(get),
+ {value,"agent for ct_snmp override test"} = snmp_standard_mib:sysDescr(get),
+ ok.
+
+override_context(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that context.conf is overwritten
+ {ok,MyContext} = snmpa_conf:read_context_config(DataDir),
+ {ok,UsedContext} = snmpa_conf:read_context_config(ConfDir),
+ true = (MyContext == UsedContext),
+ ok.
+
+override_community(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that community.conf is overwritten
+ {ok,MyCommunity} = snmpa_conf:read_community_config(DataDir),
+ {ok,UsedCommunity} = snmpa_conf:read_community_config(ConfDir),
+ true = (MyCommunity == UsedCommunity),
+ ok.
+
+override_notify(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that notify.conf is overwritten
+ {ok,MyNotify} = snmpa_conf:read_notify_config(DataDir),
+ {ok,UsedNotify} = snmpa_conf:read_notify_config(ConfDir),
+ true = (MyNotify == UsedNotify),
+ ok.
+
+override_target_addr(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that target_addr.conf is overwritten
+ {ok,MyTargetAddr} = snmpa_conf:read_target_addr_config(DataDir),
+ {ok,UsedTargetAddr} = snmpa_conf:read_target_addr_config(ConfDir),
+ true = (MyTargetAddr == UsedTargetAddr),
+ ok.
+
+override_target_params(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that target_params.conf is overwritten
+ {ok,MyTargetParams} = snmpa_conf:read_target_params_config(DataDir),
+ {ok,UsedTargetParams} = snmpa_conf:read_target_params_config(ConfDir),
+ true = (MyTargetParams == UsedTargetParams),
+ ok.
+
+override_vacm(Config) ->
+ DataDir = ?config(data_dir,Config),
+ PrivDir = ?config(priv_dir,Config),
+ ConfDir = filename:join(PrivDir,"conf"),
+
+ %% Check that vacm.conf is overwritten
+ {ok,MyVacm} = snmpa_conf:read_vacm_config(DataDir),
+ {ok,UsedVacm} = snmpa_conf:read_vacm_config(ConfDir),
+ true = (MyVacm == UsedVacm),
+ ok.
+
+
+
+
+%% NOTE!! This test must always be executed last in the suite, and
+%% should match all set requests performed in the suite. I.e. if you
+%% add a set request, you must add an entry in the return value of
+%% ct_snmp:set_info/1 below.
+set_info(Config) ->
+ %% From test case set_values/1:
+ Oid1 = ?sysName_instance,
+ NewValue1 = "ct_test changed by " ++ atom_to_list(?MODULE),
+
+ %% The test...
+ [{_AgentName,_,[{Oid1,_,NewValue1}]}]
+ = ct_snmp:set_info(Config),
+ ok.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf
new file mode 100644
index 0000000000..5a64df6605
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/community.conf
@@ -0,0 +1 @@
+{"public", "public", "initial", "", ""}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf
new file mode 100644
index 0000000000..feed5e1d11
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/context.conf
@@ -0,0 +1 @@
+"testcontext".
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf
new file mode 100644
index 0000000000..367ba3aa4b
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/notify.conf
@@ -0,0 +1 @@
+{"standard inform", "std_inform", inform}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf
new file mode 100644
index 0000000000..79908fb355
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/standard.conf
@@ -0,0 +1,7 @@
+{sysDescr, "agent for ct_snmp override test"}.
+{sysObjectID, [1,2,3]}.
+{sysContact, "[email protected]"}.
+{sysLocation, "erlang"}.
+{sysServices, 72}.
+{snmpEnableAuthenTraps, enabled}.
+{sysName, "name for override test"}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf
new file mode 100644
index 0000000000..d02672a074
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_addr.conf
@@ -0,0 +1,2 @@
+{"target1", snmpUDPDomain, [147,214,122,73], 5000, 1500, 3, "std_trap", "target_v3", "", [], 2048}.
+{"target2", snmpUDPDomain, [147,214,122,73], 5000, 1500, 3, "std_inform", "target_v3", "", [], 2048}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf
new file mode 100644
index 0000000000..5a9a619422
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/target_params.conf
@@ -0,0 +1 @@
+{"target_v3", v3, usm, "initial", noAuthNoPriv}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf
new file mode 100644
index 0000000000..d6e245914e
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/usm.conf
@@ -0,0 +1 @@
+{"ct_snmp-test-engine","usm_user_name","secname",zeroDotZero,usmNoAuthProtocol,"","",usmNoPrivProtocol,"","","","",""}.
diff --git a/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf
new file mode 100644
index 0000000000..158fe02e3b
--- /dev/null
+++ b/lib/common_test/test/ct_snmp_SUITE_data/snmp_SUITE_data/vacm.conf
@@ -0,0 +1,6 @@
+{vacmSecurityToGroup, usm, "initial", "initial"}.
+{vacmAccess, "initial", "", any, noAuthNoPriv, exact, "restricted", "", "restricted"}.
+{vacmAccess, "initial", "", usm, authNoPriv, exact, "internet", "internet", "internet"}.
+{vacmAccess, "initial", "", usm, authPriv, exact, "internet", "internet", "internet"}.
+{vacmViewTreeFamily, "restricted", [1,3,6,1], included, null}.
+{vacmViewTreeFamily, "internet", [1,3,6,1], included, null}.
diff --git a/lib/common_test/test/ct_surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE.erl
new file mode 100644
index 0000000000..69e98cef48
--- /dev/null
+++ b/lib/common_test/test/ct_surefire_SUITE.erl
@@ -0,0 +1,351 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_surefire_SUITE
+%%%
+%%% Description:
+%%% Test cth_surefire hook
+%%%
+%%%-------------------------------------------------------------------
+-module(ct_surefire_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-include_lib("xmerl/include/xmerl.hrl").
+
+-define(eh, ct_test_support_eh).
+
+-define(url_base,"http://my.host.com/").
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ default,
+ absolute_path,
+ relative_path,
+ url,
+ logdir
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+default(Config) when is_list(Config) ->
+ run(default,[cth_surefire],Config),
+ PrivDir = ?config(priv_dir,Config),
+ XmlRe = filename:join([PrivDir,"*","junit_report.xml"]),
+ check_xml(default,XmlRe).
+
+absolute_path(Config) when is_list(Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ Path = filename:join(PrivDir,"abspath.xml"),
+ run(absolute_path,[{cth_surefire,[{path,Path}]}],Config),
+ check_xml(absolute_path,Path).
+
+relative_path(Config) when is_list(Config) ->
+ Path = "relpath.xml",
+ run(relative_path,[{cth_surefire,[{path,Path}]}],Config),
+ PrivDir = ?config(priv_dir,Config),
+ XmlRe = filename:join([PrivDir,"*",Path]),
+ check_xml(relative_path,XmlRe).
+
+url(Config) when is_list(Config) ->
+ Path = "url.xml",
+ run(url,[{cth_surefire,[{url_base,?url_base},
+ {path,Path}]}],Config),
+ PrivDir = ?config(priv_dir,Config),
+ XmlRe = filename:join([PrivDir,"*",Path]),
+ check_xml(url,XmlRe).
+
+logdir(Config) when is_list(Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ LogDir = filename:join(PrivDir,"specific_logdir"),
+ file:make_dir(LogDir),
+ Path = "logdir.xml",
+ run(logdir,[{cth_surefire,[{path,Path}]}],Config,[{logdir,LogDir}]),
+ PrivDir = ?config(priv_dir,Config),
+ XmlRe = filename:join([LogDir,"*",Path]),
+ check_xml(logdir,XmlRe).
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+run(Case,CTHs,Config) ->
+ run(Case,CTHs,Config,[]).
+run(Case,CTHs,Config,ExtraOpts) ->
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "surefire_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},{ct_hooks,CTHs},{label,Case}|ExtraOpts],
+ Config),
+ ok = execute(Case, Opts, ERPid, Config).
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Opts1 =
+ case lists:keymember(logdir,1,Test) of
+ true -> lists:keydelete(logdir,1,Opts0);
+ false -> Opts0
+ end,
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts1 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+execute(Name, Opts, ERPid, Config) ->
+ ok = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+
+ ct_test_support:log_events(Name,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(Name),
+ ct_test_support:verify_events(TestEvents, Events, Config).
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+events_to_check(Test) ->
+ %% 2 tests (ct:run_test + script_start) is default
+ events_to_check(Test, 2).
+
+events_to_check(_, 0) ->
+ [];
+events_to_check(Test, N) ->
+ test_events(Test) ++ events_to_check(Test, N-1).
+
+test_events(_) ->
+ [{?eh,start_logging,'_'},
+ {?eh,start_info,{1,1,9}},
+ {?eh,tc_start,{surefire_SUITE,init_per_suite}},
+ {?eh,tc_done,{surefire_SUITE,init_per_suite,ok}},
+ {?eh,tc_start,{surefire_SUITE,tc_ok}},
+ {?eh,tc_done,{surefire_SUITE,tc_ok,ok}},
+ {?eh,test_stats,{1,0,{0,0}}},
+ {?eh,tc_start,{surefire_SUITE,tc_fail}},
+ {?eh,tc_done,{surefire_SUITE,tc_fail,
+ {failed,{error,{test_case_failed,"this test should fail"}}}}},
+ {?eh,test_stats,{1,1,{0,0}}},
+ {?eh,tc_start,{surefire_SUITE,tc_skip}},
+ {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}},
+ {?eh,test_stats,{1,1,{1,0}}},
+ {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}},
+ {?eh,tc_done,{surefire_SUITE,tc_autoskip_require,
+ {skipped,{require_failed,'_'}}}},
+ {?eh,test_stats,{1,1,{1,1}}},
+ [{?eh,tc_start,{surefire_SUITE,{init_per_group,g,[]}}},
+ {?eh,tc_done,{surefire_SUITE,{init_per_group,g,[]},ok}},
+ {?eh,tc_start,{surefire_SUITE,tc_ok}},
+ {?eh,tc_done,{surefire_SUITE,tc_ok,ok}},
+ {?eh,test_stats,{2,1,{1,1}}},
+ {?eh,tc_start,{surefire_SUITE,tc_fail}},
+ {?eh,tc_done,{surefire_SUITE,tc_fail,
+ {failed,{error,{test_case_failed,"this test should fail"}}}}},
+ {?eh,test_stats,{2,2,{1,1}}},
+ {?eh,tc_start,{surefire_SUITE,tc_skip}},
+ {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}},
+ {?eh,test_stats,{2,2,{2,1}}},
+ {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}},
+ {?eh,tc_done,{surefire_SUITE,tc_autoskip_require,
+ {skipped,{require_failed,'_'}}}},
+ {?eh,test_stats,{2,2,{2,2}}},
+ {?eh,tc_start,{surefire_SUITE,{end_per_group,g,[]}}},
+ {?eh,tc_done,{surefire_SUITE,{end_per_group,g,[]},ok}}],
+ [{?eh,tc_start,{surefire_SUITE,{init_per_group,g_fail,[]}}},
+ {?eh,tc_done,{surefire_SUITE,{init_per_group,g_fail,[]},
+ {failed,{error,all_cases_should_be_skipped}}}},
+ {?eh,tc_auto_skip,{surefire_SUITE,tc_ok,
+ {failed,
+ {surefire_SUITE,init_per_group,
+ {'EXIT',all_cases_should_be_skipped}}}}},
+ {?eh,test_stats,{2,2,{2,3}}},
+ {?eh,tc_auto_skip,{surefire_SUITE,end_per_group,
+ {failed,
+ {surefire_SUITE,init_per_group,
+ {'EXIT',all_cases_should_be_skipped}}}}}],
+ {?eh,tc_start,{surefire_SUITE,end_per_suite}},
+ {?eh,tc_done,{surefire_SUITE,end_per_suite,ok}},
+ {?eh,stop_logging,[]}].
+
+
+%%%-----------------------------------------------------------------
+%%% Check generated xml log files
+check_xml(Case,XmlRe) ->
+ case filelib:wildcard(XmlRe) of
+ [] ->
+ ct:fail("No xml files found with regexp ~p~n", [XmlRe]);
+ [_] = Xmls when Case==absolute_path ->
+ do_check_xml(Case,Xmls);
+ [_,_] = Xmls ->
+ do_check_xml(Case,Xmls)
+ end.
+
+%% Allowed structure:
+%% <testsuites>
+%% <testsuite>
+%% <properties>
+%% <property/>
+%% ...
+%% </properties>
+%% <testcase>
+%% [<failure/> | <error/> | <skipped/> ]
+%% </testcase>
+%% ...
+%% </testsuite>
+%% ...
+%% </testsuites>
+do_check_xml(Case,[Xml|Xmls]) ->
+ ct:log("Checking <a href=~p>~s</a>~n",[Xml,Xml]),
+ {E,_} = xmerl_scan:file(Xml),
+ Expected = events_to_result(lists:flatten(test_events(Case))),
+ ParseResult = testsuites(Case,E),
+ ct:log("Expecting: ~p~n",[[Expected]]),
+ ct:log("Actual : ~p~n",[ParseResult]),
+ [Expected] = ParseResult,
+ do_check_xml(Case,Xmls);
+do_check_xml(_,[]) ->
+ ok.
+
+%% Scanning the XML to get the same type of result as events_to_result/1
+testsuites(Case,#xmlElement{name=testsuites,content=TS}) ->
+ %% OTP-10589 - move properties element to <testsuite>
+ false = lists:keytake(properties,#xmlElement.name,TS),
+ testsuite(Case,TS).
+
+testsuite(Case,[#xmlElement{name=testsuite,content=TC,attributes=A}|TS]) ->
+ {ET,EF,ES} = events_to_numbers(lists:flatten(test_events(Case))),
+ {T,E,F,S} = get_numbers_from_attrs(A,false,false,false,false),
+ ct:log("Expecting total:~p, error:~p, failure:~p, skipped:~p~n",[ET,0,EF,ES]),
+ ct:log("Actual total:~p, error:~p, failure:~p, skipped:~p~n",[T,E,F,S]),
+ {ET,0,EF,ES} = {T,E,F,S},
+
+ %% properties should only be there if given a options to hook
+ false = lists:keytake(properties,#xmlElement.name,TC),
+ %% system-out and system-err is not used by common_test
+ false = lists:keytake('system-out',#xmlElement.name,TC),
+ false = lists:keytake('system-err',#xmlElement.name,TC),
+ R=testcase(Case,TC),
+ [R|testsuite(Case,TS)];
+testsuite(_Case,[]) ->
+ [].
+
+testcase(url=Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) ->
+ R = failed_or_skipped(C),
+ case R of
+ [s] ->
+ case lists:keyfind(url,#xmlAttribute.name,A) of
+ false -> ok;
+ #xmlAttribute{value=UrlAttr} ->
+ lists:keyfind(url,#xmlAttribute.name,A),
+ true = lists:prefix(?url_base,UrlAttr)
+ end;
+ _ ->
+ #xmlAttribute{value=UrlAttr} =
+ lists:keyfind(url,#xmlAttribute.name,A),
+ true = lists:prefix(?url_base,UrlAttr)
+ end,
+ [R|testcase(Case,TC)];
+testcase(Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) ->
+ false = lists:keyfind(url,#xmlAttribute.name,A),
+ R = failed_or_skipped(C),
+ [R|testcase(Case,TC)];
+testcase(_Case,[]) ->
+ [].
+
+failed_or_skipped([#xmlElement{name=failure}|E]) ->
+ [f|failed_or_skipped(E)];
+failed_or_skipped([#xmlElement{name=error}|E]) ->
+ [e|failed_or_skipped(E)];
+failed_or_skipped([#xmlElement{name=skipped}|E]) ->
+ [s|failed_or_skipped(E)];
+failed_or_skipped([]) ->
+ [].
+
+%% Using the expected events to produce the expected result of the XML scanning.
+%% The result is a list of test suites:
+%% Testsuites = [Testsuite]
+%% Testsuite = [Testcase]
+%% Testcase = [] | [f] | [s], indicating ok, failed and skipped respectively
+events_to_result([{?eh,tc_done,{_Suite,_Case,R}}|E]) ->
+ [result(R)|events_to_result(E)];
+events_to_result([{?eh,tc_auto_skip,_}|E]) ->
+ [[s]|events_to_result(E)];
+events_to_result([_|E]) ->
+ events_to_result(E);
+events_to_result([]) ->
+ [].
+
+result(ok) ->[];
+result({skipped,_}) -> [s];
+result({failed,_}) -> [f].
+
+%% Using the expected events' last test_stats element to produce the
+%% expected number of totla, errors, failed and skipped testcases.
+events_to_numbers(E) ->
+ RevE = lists:reverse(E),
+ {?eh,test_stats,{Ok,F,{US,AS}}} = lists:keyfind(test_stats,2,RevE),
+ {Ok+F+US+AS,F,US+AS}.
+
+get_numbers_from_attrs([#xmlAttribute{name=tests,value=X}|A],false,E,F,S) ->
+ get_numbers_from_attrs(A,list_to_integer(X),E,F,S);
+get_numbers_from_attrs([#xmlAttribute{name=errors,value=X}|A],T,false,F,S) ->
+ get_numbers_from_attrs(A,T,list_to_integer(X),F,S);
+get_numbers_from_attrs([#xmlAttribute{name=failures,value=X}|A],T,E,false,S) ->
+ get_numbers_from_attrs(A,T,E,list_to_integer(X),S);
+get_numbers_from_attrs([#xmlAttribute{name=skipped,value=X}|A],T,E,F,false) ->
+ get_numbers_from_attrs(A,T,E,F,list_to_integer(X));
+get_numbers_from_attrs([_|A],T,E,F,S) ->
+ get_numbers_from_attrs(A,T,E,F,S);
+get_numbers_from_attrs([],T,E,F,S) ->
+ {T,E,F,S}.
diff --git a/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl
new file mode 100644
index 0000000000..677aee46c5
--- /dev/null
+++ b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl
@@ -0,0 +1,92 @@
+%%--------------------------------------------------------------------
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+%%----------------------------------------------------------------------
+%% File: surefire_SUITE.erl
+%%
+%% Description:
+%% This file contains the test cases for cth_surefire.
+%%
+%% @author Support
+%% @doc Test of surefire support in common_test
+%% @end
+%%----------------------------------------------------------------------
+%%----------------------------------------------------------------------
+-module(surefire_SUITE).
+-include_lib("common_test/include/ct.hrl").
+
+-compile(export_all).
+
+%% Default timetrap timeout (set in init_per_testcase).
+-define(default_timeout, ?t:minutes(1)).
+
+all() ->
+ testcases() ++ [{group,g},{group,g_fail}].
+
+groups() ->
+ [{g,testcases()},
+ {g_fail,[tc_ok]}].
+
+testcases() ->
+ [tc_ok,
+ tc_fail,
+ tc_skip,
+ tc_autoskip_require].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(Config) ->
+ Config.
+
+init_per_group(g_fail, _Config) ->
+ exit(all_cases_should_be_skipped);
+init_per_group(_, Config) ->
+ Config.
+
+end_per_group(_Group, Config) ->
+ Config.
+
+init_per_testcase(_Case, Config) ->
+ Dog = test_server:timetrap(?default_timeout),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(_Case, Config) ->
+ Dog=?config(watchdog, Config),
+ test_server:timetrap_cancel(Dog),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+break(_Config) ->
+ test_server:break(""),
+ ok.
+
+tc_ok(_Config) ->
+ ok.
+
+tc_fail(_Config) ->
+ ct:fail("this test should fail").
+
+tc_skip(_Config) ->
+ {skip,"this test is skipped"}.
+
+tc_autoskip_require() ->
+ [{require,whatever}].
+tc_autoskip_require(Config) ->
+ ct:fail("this test should never be executed - it should be autoskipped").
diff --git a/lib/common_test/test/ct_system_error_SUITE.erl b/lib/common_test/test/ct_system_error_SUITE.erl
new file mode 100644
index 0000000000..f2d6ef4b1b
--- /dev/null
+++ b/lib/common_test/test/ct_system_error_SUITE.erl
@@ -0,0 +1,132 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File: ct_system_error_SUITE
+%%%
+%%% Description:
+%%%
+%%% Test that severe system errors (such as failure to write logs) are
+%%% noticed and handled.
+%%%-------------------------------------------------------------------
+-module(ct_system_error_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("common_test/include/ct_event.hrl").
+
+-define(eh, ct_test_support_eh).
+
+%%--------------------------------------------------------------------
+%% TEST SERVER CALLBACK FUNCTIONS
+%%--------------------------------------------------------------------
+
+%%--------------------------------------------------------------------
+%% Description: Since Common Test starts another Test Server
+%% instance, the tests need to be performed on a separate node (or
+%% there will be clashes with logging processes etc).
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config1 = ct_test_support:init_per_suite(Config),
+ Config1.
+
+end_per_suite(Config) ->
+ ct_test_support:end_per_suite(Config).
+
+init_per_testcase(TestCase, Config) ->
+ ct_test_support:init_per_testcase(TestCase, Config).
+
+end_per_testcase(TestCase, Config) ->
+ ct_test_support:end_per_testcase(TestCase, Config).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [
+ test_server_failing_logs
+ ].
+
+%%--------------------------------------------------------------------
+%% TEST CASES
+%%--------------------------------------------------------------------
+
+%%%-----------------------------------------------------------------
+%%%
+test_server_failing_logs(Config) ->
+ TC = test_server_failing_logs,
+ DataDir = ?config(data_dir, Config),
+ Suite = filename:join(DataDir, "a_SUITE"),
+ {Opts,ERPid} = setup([{suite,Suite},{label,TC}], Config),
+ crash_test_server(Config),
+ {error,{cannot_create_log_dir,__}} = ct_test_support:run(Opts, Config),
+ Events = ct_test_support:get_events(ERPid, Config),
+ ct_test_support:log_events(TC,
+ reformat(Events, ?eh),
+ ?config(priv_dir, Config),
+ Opts),
+
+ TestEvents = events_to_check(TC),
+ ok = ct_test_support:verify_events(TestEvents, Events, Config).
+
+crash_test_server(Config) ->
+ DataDir = ?config(data_dir, Config),
+ Root = proplists:get_value(logdir, ct_test_support:get_opts(Config)),
+ [$@|Host] = lists:dropwhile(fun(C) ->
+ C =/= $@
+ end, atom_to_list(node())),
+ Format = filename:join(Root,
+ "ct_run.ct@" ++ Host ++
+ ".~4..0w-~2..0w-~2..0w_"
+ "~2..0w.~2..0w.~2..0w"),
+ [C2,C1|_] = lists:reverse(filename:split(DataDir)),
+ LogDir = C1 ++ "." ++ C2 ++ ".a_SUITE.logs",
+ T = calendar:datetime_to_gregorian_seconds(calendar:local_time()),
+ [begin
+ {{Y,Mon,D},{H,Min,S}} =
+ calendar:gregorian_seconds_to_datetime(T+Offset),
+ Dir0 = io_lib:format(Format, [Y,Mon,D,H,Min,S]),
+ Dir = lists:flatten(Dir0),
+ file:make_dir(Dir),
+ File = filename:join(Dir, LogDir),
+ file:write_file(File, "anything goes\n")
+ end || Offset <- lists:seq(0, 20)],
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% HELP FUNCTIONS
+%%%-----------------------------------------------------------------
+
+setup(Test, Config) ->
+ Opts0 = ct_test_support:get_opts(Config),
+ Level = ?config(trace_level, Config),
+ EvHArgs = [{cbm,ct_test_support},{trace_level,Level}],
+ Opts = Opts0 ++ [{event_handler,{?eh,EvHArgs}}|Test],
+ ERPid = ct_test_support:start_event_receiver(Config),
+ {Opts,ERPid}.
+
+reformat(Events, EH) ->
+ ct_test_support:reformat(Events, EH).
+
+%%%-----------------------------------------------------------------
+%%% TEST EVENTS
+%%%-----------------------------------------------------------------
+
+events_to_check(_Test) ->
+ [{?eh,severe_error,{cannot_create_log_dir,{'_','_'}}}].
diff --git a/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl b/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl
new file mode 100644
index 0000000000..c6e3ddfd5d
--- /dev/null
+++ b/lib/common_test/test/ct_system_error_SUITE_data/a_SUITE.erl
@@ -0,0 +1,122 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(a_SUITE).
+
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+
+%%--------------------------------------------------------------------
+%% @spec suite() -> Info
+%% Info = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+suite() ->
+ [{timetrap,{seconds,10}}].
+
+%%--------------------------------------------------------------------
+%% @spec init_per_suite(Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_suite(Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_suite(Config0) -> void() | {save_config,Config1}
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_suite(_Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_group(GroupName, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_group(GroupName, Config0) ->
+%% void() | {save_config,Config1}
+%% GroupName = atom()
+%% Config0 = Config1 = [tuple()]
+%% @end
+%%--------------------------------------------------------------------
+end_per_group(_GroupName, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec init_per_testcase(TestCase, Config0) ->
+%% Config1 | {skip,Reason} | {skip_and_save,Reason,Config1}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% @spec end_per_testcase(TestCase, Config0) ->
+%% void() | {save_config,Config1} | {fail,Reason}
+%% TestCase = atom()
+%% Config0 = Config1 = [tuple()]
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+%%--------------------------------------------------------------------
+%% @spec groups() -> [Group]
+%% Group = {GroupName,Properties,GroupsAndTestCases}
+%% GroupName = atom()
+%% Properties = [parallel | sequence | Shuffle | {RepeatType,N}]
+%% GroupsAndTestCases = [Group | {group,GroupName} | TestCase]
+%% TestCase = atom()
+%% Shuffle = shuffle | {shuffle,{integer(),integer(),integer()}}
+%% RepeatType = repeat | repeat_until_all_ok | repeat_until_all_fail |
+%% repeat_until_any_ok | repeat_until_any_fail
+%% N = integer() | forever
+%% @end
+%%--------------------------------------------------------------------
+groups() ->
+ [].
+
+%%--------------------------------------------------------------------
+%% @spec all() -> GroupsAndTestCases | {skip,Reason}
+%% GroupsAndTestCases = [{group,GroupName} | TestCase]
+%% GroupName = atom()
+%% TestCase = atom()
+%% Reason = term()
+%% @end
+%%--------------------------------------------------------------------
+all() ->
+ [tc1].
+
+tc1(_C) ->
+ ok.
diff --git a/lib/common_test/test/ct_test_support.erl b/lib/common_test/test/ct_test_support.erl
index 80cca4a1cc..fc572aa82f 100644
--- a/lib/common_test/test/ct_test_support.erl
+++ b/lib/common_test/test/ct_test_support.erl
@@ -32,7 +32,7 @@
run/2, run/3, run/4, get_opts/1, wait_for_ct_stop/1]).
-export([handle_event/2, start_event_receiver/1, get_events/2,
- verify_events/3, reformat/2, log_events/4,
+ verify_events/3, verify_events/4, reformat/2, log_events/4,
join_abs_dirs/2]).
-export([ct_test_halt/1]).
@@ -117,8 +117,7 @@ end_per_suite(Config) ->
CTNode = proplists:get_value(ct_node, Config),
PrivDir = proplists:get_value(priv_dir, Config),
true = rpc:call(CTNode, code, del_path, [filename:join(PrivDir,"")]),
- cover:stop(CTNode),
- slave:stop(CTNode),
+ slave_stop(CTNode),
ok.
%%%-----------------------------------------------------------------
@@ -149,8 +148,7 @@ end_per_testcase(_TestCase, Config) ->
case wait_for_ct_stop(CTNode) of
%% Common test was not stopped to we restart node.
false ->
- cover:stop(CTNode),
- slave:stop(CTNode),
+ slave_stop(CTNode),
start_slave(Config,proplists:get_value(trace_level,Config)),
{fail, "Could not stop common_test"};
true ->
@@ -364,6 +362,14 @@ verify_events(TEvs, Evs, Config) ->
ok
end.
+verify_events(TEvs, Evs, Node, Config) ->
+ case catch verify_events1(TEvs, Evs, Node, Config) of
+ {'EXIT',Reason} ->
+ Reason;
+ _ ->
+ ok
+ end.
+
verify_events1([TestEv|_], [{TEH,#event{name=stop_logging,node=Node,data=_}}|_], Node, _)
when element(1,TestEv) == TEH, element(2,TestEv) =/= stop_logging ->
test_server:format("Failed to find ~p in the list of events!~n", [TestEv]),
@@ -612,8 +618,11 @@ locate({parallel,TEvs}, Node, Evs, Config) ->
fun({EH,#event{name=tc_auto_skip,
node=EvNode,
data={Mod,end_per_group,Reason}}}) when
- EH == TEH, EvNode == Node, Mod == M, Reason == R ->
- false;
+ EH == TEH, EvNode == Node, Mod == M ->
+ case match_data(R, Reason) of
+ match -> false;
+ _ -> true
+ end;
({EH,#event{name=stop_logging,
node=EvNode,data=_}}) when
EH == TEH, EvNode == Node ->
@@ -627,23 +636,12 @@ locate({parallel,TEvs}, Node, Evs, Config) ->
[_AutoSkip | RemEvs2] ->
{Done,RemEvs2,length(RemEvs2)}
end;
- %% match other event than test case
- (TEv={TEH,N,D}, Acc) when D == '_' ->
- case [E || E={EH,#event{name=Name,
- node=EvNode,
- data=_}} <- Evs1,
- EH == TEH, EvNode == Node, Name == N] of
- [] ->
- exit({unmatched,TEv});
- _ ->
- test_server:format("Found ~p!", [TEv]),
- Acc
- end;
(TEv={TEH,N,D}, Acc) ->
case [E || E={EH,#event{name=Name,
node=EvNode,
data=Data}} <- Evs1,
- EH == TEH, EvNode == Node, Name == N, Data == D] of
+ EH == TEH, EvNode == Node, Name == N,
+ match == match_data(D,Data)] of
[] ->
exit({unmatched,TEv});
_ ->
@@ -1002,33 +1000,39 @@ locate({TEH,Name,Data}, Node, [{TEH,#event{name=Name,
data = EvData,
node = Node}}|Evs],
Config) ->
- try match_data(Data, EvData) of
+ case match_data(Data, EvData) of
match ->
- {Config,Evs}
- catch _:_ ->
+ {Config,Evs};
+ _ ->
nomatch
end;
locate({_TEH,_Name,_Data}, _Node, [_|_Evs], _Config) ->
nomatch.
-match_data(D,D) ->
+match_data(Data, EvData) ->
+ try do_match_data(Data, EvData)
+ catch _:_ ->
+ nomatch
+ end.
+
+do_match_data(D,D) ->
match;
-match_data('_',_) ->
+do_match_data('_',_) ->
match;
-match_data(Fun,Data) when is_function(Fun) ->
+do_match_data(Fun,Data) when is_function(Fun) ->
Fun(Data);
-match_data('$proplist',Proplist) ->
- match_data(
+do_match_data('$proplist',Proplist) ->
+ do_match_data(
fun(List) ->
lists:foreach(fun({_,_}) -> ok end,List)
end,Proplist);
-match_data([H1|MatchT],[H2|ValT]) ->
- match_data(H1,H2),
- match_data(MatchT,ValT);
-match_data(Tuple1,Tuple2) when is_tuple(Tuple1),is_tuple(Tuple2) ->
- match_data(tuple_to_list(Tuple1),tuple_to_list(Tuple2));
-match_data([],[]) ->
+do_match_data([H1|MatchT],[H2|ValT]) ->
+ do_match_data(H1,H2),
+ do_match_data(MatchT,ValT);
+do_match_data(Tuple1,Tuple2) when is_tuple(Tuple1),is_tuple(Tuple2) ->
+ do_match_data(tuple_to_list(Tuple1),tuple_to_list(Tuple2));
+do_match_data([],[]) ->
match.
result_match({SkipOrFail,{ErrorInd,{Why,'_'}}},
@@ -1043,6 +1047,9 @@ result_match({failed,{timetrap_timeout,{'$approx',Num}}},
Value =< trunc(Num+0.02*Num) -> true;
true -> false
end;
+result_match({user_timetrap_error,{Why,'_'}},
+ {user_timetrap_error,{Why,_Stack}}) ->
+ true;
result_match(Result, Result) ->
true;
result_match(_, _) ->
@@ -1259,3 +1266,22 @@ rm_files([F | Fs]) ->
rm_files([]) ->
ok.
+%%%-----------------------------------------------------------------
+%%%
+slave_stop(Node) ->
+ Cover = test_server:is_cover(),
+ if Cover-> cover:flush(Node);
+ true -> ok
+ end,
+ erlang:monitor_node(Node, true),
+ slave:stop(Node),
+ receive
+ {nodedown, Node} ->
+ if Cover -> cover:stop(Node);
+ true -> ok
+ end
+ after 5000 ->
+ erlang:monitor_node(Node, false),
+ receive {nodedown, Node} -> ok after 0 -> ok end %flush
+ end,
+ ok.
diff --git a/lib/common_test/test/ct_testspec_1_SUITE.erl b/lib/common_test/test/ct_testspec_1_SUITE.erl
index b7e19f25dd..6a4a4acd80 100644
--- a/lib/common_test/test/ct_testspec_1_SUITE.erl
+++ b/lib/common_test/test/ct_testspec_1_SUITE.erl
@@ -58,7 +58,7 @@ end_per_testcase(TestCase, Config) ->
suite() -> [{ct_hooks,[ts_install_cth]}].
-all() ->
+all() ->
[all_suites, skip_all_suites, suite, skip_suite,
all_testcases, skip_all_testcases, testcase,
skip_testcase, all_groups, skip_all_groups, group,
@@ -67,23 +67,23 @@ all() ->
skip_group_testcase, topgroup, subgroup, skip_subgroup,
subgroup_all_testcases, skip_subgroup_all_testcases,
subgroup_testcase, skip_subgroup_testcase,
- sub_skipped_by_top, testcase_in_multiple_groups,
- order_of_tests_in_multiple_dirs_no_merge_tests,
- order_of_tests_in_multiple_suites_no_merge_tests,
- order_of_suites_in_multiple_dirs_no_merge_tests,
- order_of_groups_in_multiple_dirs_no_merge_tests,
- order_of_groups_in_multiple_suites_no_merge_tests,
- order_of_tests_in_multiple_dirs,
- order_of_tests_in_multiple_suites,
- order_of_suites_in_multiple_dirs,
- order_of_groups_in_multiple_dirs,
- order_of_groups_in_multiple_suites,
- order_of_tests_in_multiple_suites_with_skip_no_merge_tests,
- order_of_tests_in_multiple_suites_with_skip,
+ sub_skipped_by_top, testcase_many_groups,
+ order_of_tests_many_dirs_no_merge_tests,
+ order_of_tests_many_suites_no_merge_tests,
+ order_of_suites_many_dirs_no_merge_tests,
+ order_of_groups_many_dirs_no_merge_tests,
+ order_of_groups_many_suites_no_merge_tests,
+ order_of_tests_many_dirs,
+ order_of_tests_many_suites,
+ order_of_suites_many_dirs,
+ order_of_groups_many_dirs,
+ order_of_groups_many_suites,
+ order_of_tests_many_suites_with_skip_no_merge_tests,
+ order_of_tests_many_suites_with_skip,
all_plus_one_tc_no_merge_tests,
all_plus_one_tc].
-groups() ->
+groups() ->
[].
init_per_group(_GroupName, Config) ->
@@ -373,19 +373,19 @@ sub_skipped_by_top(Config) when is_list(Config) ->
%%%-----------------------------------------------------------------
%%%
-testcase_in_multiple_groups(Config) when is_list(Config) ->
+testcase_many_groups(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir = filename:join(DataDir, "groups_1"),
TestSpec = [{cases,TestDir,groups_12_SUITE,[testcase_1a,testcase_1b]},
{skip_cases,TestDir,groups_12_SUITE,[testcase_1b],"SKIPPED!"}],
- setup_and_execute(testcase_in_multiple_groups, TestSpec, Config).
+ setup_and_execute(testcase_many_groups, TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
+order_of_tests_many_dirs_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -395,13 +395,13 @@ order_of_tests_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
{cases,TestDir2,groups_22_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_dirs_no_merge_tests,
+ setup_and_execute(order_of_tests_many_dirs_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites_no_merge_tests(Config) when is_list(Config) ->
+order_of_tests_many_suites_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -410,13 +410,13 @@ order_of_tests_in_multiple_suites_no_merge_tests(Config) when is_list(Config) ->
{cases,TestDir1,groups_11_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_suites_no_merge_tests,
+ setup_and_execute(order_of_tests_many_suites_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_suites_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
+order_of_suites_many_dirs_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -426,13 +426,13 @@ order_of_suites_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
{suites,TestDir2,groups_22_SUITE},
{suites,TestDir1,groups_11_SUITE}],
- setup_and_execute(order_of_suites_in_multiple_dirs_no_merge_tests,
+ setup_and_execute(order_of_suites_many_dirs_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
+order_of_groups_many_dirs_no_merge_tests(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -442,13 +442,13 @@ order_of_groups_in_multiple_dirs_no_merge_tests(Config) when is_list(Config) ->
{groups,TestDir2,groups_22_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_dirs_no_merge_tests,
+ setup_and_execute(order_of_groups_many_dirs_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_suites_no_merge_tests(Config)
+order_of_groups_many_suites_no_merge_tests(Config)
when is_list(Config) ->
DataDir = ?config(data_dir, Config),
@@ -458,13 +458,13 @@ order_of_groups_in_multiple_suites_no_merge_tests(Config)
{groups,TestDir1,groups_11_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_suites_no_merge_tests,
+ setup_and_execute(order_of_groups_many_suites_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites_with_skip_no_merge_tests(Config)
+order_of_tests_many_suites_with_skip_no_merge_tests(Config)
when is_list(Config) ->
DataDir = ?config(data_dir, Config),
@@ -477,14 +477,14 @@ order_of_tests_in_multiple_suites_with_skip_no_merge_tests(Config)
{skip_cases,TestDir1,groups_12_SUITE,[testcase_1b],"Skip it"}],
setup_and_execute(
- order_of_tests_in_multiple_suites_with_skip_no_merge_tests,
+ order_of_tests_many_suites_with_skip_no_merge_tests,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_dirs(Config) when is_list(Config) ->
+order_of_tests_many_dirs(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -493,13 +493,13 @@ order_of_tests_in_multiple_dirs(Config) when is_list(Config) ->
{cases,TestDir2,groups_22_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_dirs,
+ setup_and_execute(order_of_tests_many_dirs,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites(Config) when is_list(Config) ->
+order_of_tests_many_suites(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -507,13 +507,13 @@ order_of_tests_in_multiple_suites(Config) when is_list(Config) ->
{cases,TestDir1,groups_11_SUITE,[testcase_1]},
{cases,TestDir1,groups_12_SUITE,[testcase_1b]}],
- setup_and_execute(order_of_tests_in_multiple_suites,
+ setup_and_execute(order_of_tests_many_suites,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_suites_in_multiple_dirs(Config) when is_list(Config) ->
+order_of_suites_many_dirs(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -522,13 +522,13 @@ order_of_suites_in_multiple_dirs(Config) when is_list(Config) ->
{suites,TestDir2,groups_22_SUITE},
{suites,TestDir1,groups_11_SUITE}],
- setup_and_execute(order_of_suites_in_multiple_dirs,
+ setup_and_execute(order_of_suites_many_dirs,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_dirs(Config) when is_list(Config) ->
+order_of_groups_many_dirs(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -537,13 +537,13 @@ order_of_groups_in_multiple_dirs(Config) when is_list(Config) ->
{groups,TestDir2,groups_22_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_dirs,
+ setup_and_execute(order_of_groups_many_dirs,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_groups_in_multiple_suites(Config) when is_list(Config) ->
+order_of_groups_many_suites(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -551,13 +551,13 @@ order_of_groups_in_multiple_suites(Config) when is_list(Config) ->
{groups,TestDir1,groups_11_SUITE,test_group_1a},
{groups,TestDir1,groups_12_SUITE,test_group_1b}],
- setup_and_execute(order_of_groups_in_multiple_suites,
+ setup_and_execute(order_of_groups_many_suites,
TestSpec, Config).
%%%-----------------------------------------------------------------
%%%
-order_of_tests_in_multiple_suites_with_skip(Config) when is_list(Config) ->
+order_of_tests_many_suites_with_skip(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
TestDir1 = filename:join(DataDir, "groups_1"),
@@ -567,7 +567,7 @@ order_of_tests_in_multiple_suites_with_skip(Config) when is_list(Config) ->
{cases,TestDir1,groups_11_SUITE,[testcase_2]},
{skip_cases,TestDir1,groups_12_SUITE,[testcase_1b],"Skip it!"}],
- setup_and_execute(order_of_tests_in_multiple_suites_with_skip,
+ setup_and_execute(order_of_tests_many_suites_with_skip,
TestSpec, Config).
%%%-----------------------------------------------------------------
@@ -1204,10 +1204,10 @@ test_events(sub_skipped_by_top) ->
{negative,{?eh,tc_start,'_'},{?eh,stop_logging,'_'}}
];
-test_events(testcase_in_multiple_groups) ->
+test_events(testcase_many_groups) ->
[];
-test_events(order_of_tests_in_multiple_dirs_no_merge_tests) ->
+test_events(order_of_tests_many_dirs_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done, {groups_12_SUITE,testcase_1a,
@@ -1219,7 +1219,7 @@ test_events(order_of_tests_in_multiple_dirs_no_merge_tests) ->
{failed,{error,{test_case_failed,no_group_data}}}}},
{?eh,stop_logging,[]}
];
-test_events(order_of_tests_in_multiple_suites_no_merge_tests) ->
+test_events(order_of_tests_many_suites_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
@@ -1229,7 +1229,7 @@ test_events(order_of_tests_in_multiple_suites_no_merge_tests) ->
{?eh,tc_done,{groups_12_SUITE,testcase_1b,'_'}},
{?eh,stop_logging,[]}
];
-test_events(order_of_suites_in_multiple_dirs_no_merge_tests) ->
+test_events(order_of_suites_many_dirs_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,init_per_suite}},
{?eh,tc_done,{groups_12_SUITE,init_per_suite,'_'}},
@@ -1244,7 +1244,7 @@ test_events(order_of_suites_in_multiple_dirs_no_merge_tests) ->
{?eh,tc_start,{groups_11_SUITE,end_per_suite}},
{?eh,tc_done,{groups_11_SUITE,end_per_suite,'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_dirs_no_merge_tests) ->
+test_events(order_of_groups_many_dirs_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1257,7 +1257,7 @@ test_events(order_of_groups_in_multiple_dirs_no_merge_tests) ->
{?eh,tc_done, {groups_12_SUITE,{end_per_group,test_group_1b,'_'},'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_suites_no_merge_tests) ->
+test_events(order_of_groups_many_suites_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1270,7 +1270,7 @@ test_events(order_of_groups_in_multiple_suites_no_merge_tests) ->
{?eh,tc_done, {groups_12_SUITE,{end_per_group,test_group_1b,'_'},'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_tests_in_multiple_suites_with_skip_no_merge_tests) ->
+test_events(order_of_tests_many_suites_with_skip_no_merge_tests) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
@@ -1282,7 +1282,7 @@ test_events(order_of_tests_in_multiple_suites_with_skip_no_merge_tests) ->
{?eh,stop_logging,[]}
];
-test_events(order_of_tests_in_multiple_dirs) ->
+test_events(order_of_tests_many_dirs) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,
@@ -1296,7 +1296,7 @@ test_events(order_of_tests_in_multiple_dirs) ->
{?eh,tc_done,{groups_22_SUITE,testcase_1,ok}},
{?eh,stop_logging,[]}
];
-test_events(order_of_tests_in_multiple_suites) ->
+test_events(order_of_tests_many_suites) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
@@ -1308,7 +1308,7 @@ test_events(order_of_tests_in_multiple_suites) ->
{?eh,tc_done,{groups_11_SUITE,testcase_1,ok}},
{?eh,stop_logging,[]}
];
-test_events(order_of_suites_in_multiple_dirs) ->
+test_events(order_of_suites_many_dirs) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,init_per_suite}},
{?eh,tc_done,{groups_12_SUITE,init_per_suite,'_'}},
@@ -1325,7 +1325,7 @@ test_events(order_of_suites_in_multiple_dirs) ->
{?eh,tc_start,{groups_22_SUITE,end_per_suite}},
{?eh,tc_done,{groups_22_SUITE,end_per_suite,'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_dirs) ->
+test_events(order_of_groups_many_dirs) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1338,7 +1338,7 @@ test_events(order_of_groups_in_multiple_dirs) ->
{?eh,tc_done, {groups_22_SUITE,{end_per_group,test_group_1a,'_'},'_'}},
{?eh,stop_logging,[]}];
-test_events(order_of_groups_in_multiple_suites) ->
+test_events(order_of_groups_many_suites) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start, {groups_12_SUITE,{init_per_group,test_group_1a,'_'}}},
@@ -1352,7 +1352,7 @@ test_events(order_of_groups_in_multiple_suites) ->
{?eh,stop_logging,[]}];
-test_events(order_of_tests_in_multiple_suites_with_skip) ->
+test_events(order_of_tests_many_suites_with_skip) ->
[{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,tc_start,{groups_12_SUITE,testcase_1a}},
{?eh,tc_done,{groups_12_SUITE,testcase_1a,'_'}},
diff --git a/lib/common_test/vsn.mk b/lib/common_test/vsn.mk
index 5c9fdfc47e..f9bb22867e 100644
--- a/lib/common_test/vsn.mk
+++ b/lib/common_test/vsn.mk
@@ -1 +1 @@
-COMMON_TEST_VSN = 1.6.2.1
+COMMON_TEST_VSN = 1.6.3