diff options
Diffstat (limited to 'lib/common_test')
-rw-r--r-- | lib/common_test/doc/src/common_test_app.xml | 11 | ||||
-rw-r--r-- | lib/common_test/doc/src/cover_chapter.xml | 87 | ||||
-rw-r--r-- | lib/common_test/doc/src/ct_hooks_chapter.xml | 43 | ||||
-rw-r--r-- | lib/common_test/doc/src/notes.xml | 50 | ||||
-rw-r--r-- | lib/common_test/doc/src/run_test_chapter.xml | 6 | ||||
-rw-r--r-- | lib/common_test/doc/src/write_test_chapter.xml | 52 | ||||
-rw-r--r-- | lib/common_test/src/ct_cover.erl | 32 | ||||
-rw-r--r-- | lib/common_test/src/ct_netconfc.erl | 6 | ||||
-rw-r--r-- | lib/common_test/src/ct_slave.erl | 28 | ||||
-rw-r--r-- | lib/common_test/src/cth_surefire.erl | 183 | ||||
-rw-r--r-- | lib/common_test/test/Makefile | 3 | ||||
-rw-r--r-- | lib/common_test/test/common_test.cover | 16 | ||||
-rw-r--r-- | lib/common_test/test/ct_cover_SUITE.erl | 53 | ||||
-rw-r--r-- | lib/common_test/test/ct_surefire_SUITE.erl | 351 | ||||
-rw-r--r-- | lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl | 92 | ||||
-rw-r--r-- | lib/common_test/test/ct_test_support.erl | 31 |
16 files changed, 921 insertions, 123 deletions
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml index b6d4a633cb..151159ad69 100644 --- a/lib/common_test/doc/src/common_test_app.xml +++ b/lib/common_test/doc/src/common_test_app.xml @@ -4,7 +4,7 @@ <erlref> <header> <copyright> - <year>2003</year><year>2012</year> + <year>2003</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -170,7 +170,9 @@ <v> UserData = term()</v> <v> Conns = [atom()]</v> <v> CSSFile = string()</v> - <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v> + <v> CTHs = [CTHModule |</v> + <v> {CTHModule, CTHInitArgs} |</v> + <v> {CTHModule, CTHInitArgs, CTHPriority}]</v> <v> CTHModule = atom()</v> <v> CTHInitArgs = term()</v> </type> @@ -297,8 +299,9 @@ <v> UserData = term()</v> <v> Conns = [atom()]</v> <v> CSSFile = string()</v> - <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | - {CTHModule, CTHInitArgs, CTHPriority}]</v> + <v> CTHs = [CTHModule |</v> + <v> {CTHModule, CTHInitArgs} |</v> + <v> {CTHModule, CTHInitArgs, CTHPriority}]</v> <v> CTHModule = atom()</v> <v> CTHInitArgs = term()</v> </type> diff --git a/lib/common_test/doc/src/cover_chapter.xml b/lib/common_test/doc/src/cover_chapter.xml index b2e64bfff0..4fa92d5583 100644 --- a/lib/common_test/doc/src/cover_chapter.xml +++ b/lib/common_test/doc/src/cover_chapter.xml @@ -108,8 +108,8 @@ specifications</seealso>).</p> </section> + <marker id="cover_stop"></marker> <section> - <marker id="cover_stop"></marker> <title>Stopping the cover tool when tests are completed</title> <p>By default the Cover tool is automatically stopped when the tests are completed. This causes the original (non cover @@ -175,6 +175,11 @@ %% Specific modules to exclude in cover. {excl_mods, Mods}. + + %% Cross cover compilation + %% Tag = atom(), an identifier for a test run + %% Mod = [atom()], modules to compile for accumulated analysis + {cross,[{Tag,Mods}]}. </pre> <p>The <c>incl_dirs_r</c> and <c>excl_dirs_r</c> terms tell Common @@ -190,6 +195,81 @@ specification file for Common Test).</p> </section> + <marker id="cross_cover"/> + <section> + <title>Cross cover analysis</title> + <p>The cross cover mechanism allows cover analysis of modules + across multiple tests. It is useful if some code, e.g. a library + module, is used by many different tests and the accumulated cover + result is desirable.</p> + + <p>This can of course also be achieved in a more customized way by + using the <c>export</c> parameter in the cover specification and + analysing the result off line, but the cross cover mechanism is a + build in solution which also provides the logging.</p> + + <p>The mechanism is easiest explained via an example:</p> + + <p>Let's say that there are two systems, <c>s1</c> and <c>s2</c>, + which are tested in separate test runs. System <c>s1</c> contains + a library module <c>m1</c> which is tested by the <c>s1</c> test + run and is included in <c>s1</c>'s cover specification:</p> + +<code type="none"> +s1.cover: + {incl_mods,[m1]}.</code> + + <p>When analysing code coverage, the result for <c>m1</c> can be + seen in the cover log in the <c>s1</c> test result.</p> + + <p>Now, let's imagine that since <c>m1</c> is a library module, it + is also used quite a bit by system <c>s2</c>. The <c>s2</c> test + run does not specifically test <c>m1</c>, but it might still be + interesting to see which parts of <c>m1</c> is actually covered by + the <c>s2</c> tests. To do this, <c>m1</c> could be included also + in <c>s2</c>'s cover specification:</p> + +<code type="none"> +s2.cover: + {incl_mods,[m1]}.</code> + + <p>This would give an entry for <c>m1</c> also in the cover log + for the <c>s2</c> test run. The problem is that this would only + reflect the coverage by <c>s2</c> tests, not the accumulated + result over <c>s1</c> and <c>s2</c>. And this is where the cross + cover mechanism comes in handy.</p> + + <p>If instead the cover specification for <c>s2</c> was like + this:</p> + +<code type="none"> +s2.cover: + {cross,[{s1,[m1]}]}.</code> + + <p>then <c>m1</c> would be cover compiled in the <c>s2</c> test + run, but not shown in the coverage log. Instead, if + <c>ct_cover:cross_cover_analyse/2</c> is called after both + <c>s1</c> and <c>s2</c> test runs are completed, the accumulated + result for <c>m1</c> would be available in the cross cover log for + the <c>s1</c> test run.</p> + + <p>The call to the analyse function must be like this:</p> + +<code type="none"> +ct_cover:cross_cover_analyse(Level, [{s1,S1LogDir},{s2,S2LogDir}]).</code> + + <p>where <c>S1LogDir</c> and <c>S2LogDir</c> are the directories + named <c><TestName>.logs</c> for each test respectively.</p> + + <p>Note the tags <c>s1</c> and <c>s2</c> which are used in the + cover specification file and in the call to + <c>ct_cover:cross_cover_analyse/2</c>. The point of these are only + to map the modules specified in the cover specification to the log + directory specified in the call to the analyse function. The name + of the tag has no meaning beyond this.</p> + + </section> + <section> <title>Logging</title> <p>To view the result of a code coverage test, follow the @@ -197,6 +277,11 @@ takes you to the code coverage overview page. If you have successfully performed a detailed coverage analysis, you find links to each individual module coverage page here.</p> + + <p>If cross cover analysis has been performed, and there are + accumulated coverage results for the current test, then the - + "Coverdata collected over all tests" link will take you to these + results.</p> </section> </chapter> diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml index 86237f5fc1..fe871eb516 100644 --- a/lib/common_test/doc/src/ct_hooks_chapter.xml +++ b/lib/common_test/doc/src/ct_hooks_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2011</year><year>2012</year> + <year>2011</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -439,14 +439,14 @@ terminate(State) -> <table> <row> - <cell><em>CTH Name</em></cell> - <cell><em>Is Built-in</em></cell> - <cell><em>Description</em></cell> + <cell align="left"><em>CTH Name</em></cell> + <cell align="left"><em>Is Built-in</em></cell> + <cell align="left"><em>Description</em></cell> </row> <row> - <cell>cth_log_redirect</cell> - <cell>yes</cell> - <cell>Captures all error_logger and SASL logging events and prints them + <cell align="left">cth_log_redirect</cell> + <cell align="left">yes</cell> + <cell align="left">Captures all error_logger and SASL logging events and prints them to the current test case log. If an event can not be associated with a testcase it will be printed in the common test framework log. This will happen for testcases which are run in parallel and events which occur @@ -455,14 +455,29 @@ terminate(State) -> using the normal SASL mechanisms. </cell> </row> <row> - <cell>cth_surefire</cell> - <cell>no</cell> - <cell>Captures all test results and outputs them as surefire XML into - a file. The file which is created is by default called junit_report.xml. - The name can be by setting the path option for this hook. e.g. + <cell align="left">cth_surefire</cell> + <cell align="left">no</cell> + <cell align="left"><p>Captures all test results and outputs them as surefire + XML into a file. The file which is created is by default + called junit_report.xml. The file name can be changed by + setting the <c>path</c> option for this hook, e.g.</p> + <code>-ct_hooks cth_surefire [{path,"/tmp/report.xml"}]</code> - Surefire XML can forinstance be used by Jenkins to display test - results.</cell> + + <p>If the <c>url_base</c> option is set, an additional + attribute named <c>url</c> will be added to each + <c>testsuite</c> and <c>testcase</c> XML element. The value will + be constructed from the <c>url_base</c> and a relative path + to the test suite or test case log respectively, e.g.</p> + + <code>-ct_hooks cth_surefire [{url_base, "http://myserver.com/"}]</code> + <p>will give a url attribute value similar to</p> + + <code>"http://myserver.com/[email protected]_11.19.39/ +x86_64-unknown-linux-gnu.my_test.logs/run.2012-12-12_11.19.39/suite.log.html"</code> + + <p>Surefire XML can for instance be used by Jenkins to display test + results.</p></cell> </row> </table> diff --git a/lib/common_test/doc/src/notes.xml b/lib/common_test/doc/src/notes.xml index 7e33b71de1..8c3b13951d 100644 --- a/lib/common_test/doc/src/notes.xml +++ b/lib/common_test/doc/src/notes.xml @@ -32,6 +32,56 @@ <file>notes.xml</file> </header> +<section><title>Common_Test 1.6.3.1</title> + + <section><title>Known Bugs and Problems</title> + <list> + <item> + <p> + The following corrections/changes are done in the + cth_surefire hook:</p> + <p> + <list> <item> Earlier there would always be a + 'properties' element under the 'testsuites' element. This + would exist even if there were no 'property' element + inside it. This has been changed so if there are no + 'property' elements to display, then there will not be a + 'properties' element either. </item> <item> The XML file + will now (unless other is specified) be stored in the top + log directory. Earlier, the default directory would be + the current working directory for the erlang node, which + would mostly, but not always, be the top log directory. + </item> <item> The 'hostname' attribute in the + 'testsuite' element would earlier never have the correct + value. This has been corrected. </item> <item> The + 'errors' attribute in the 'testsuite' element would + earlier display the number of failed testcases. This has + been changed and will now always have the value 0, while + the 'failures' attribute will show the number of failed + testcases. </item> <item> A new attribute 'skipped' is + added to the 'testsuite' element. This will display the + number of skipped testcases. These would earlier be + included in the number of failed test cases. </item> + <item> The total number of tests displayed by the 'tests' + attribute in the 'testsuite' element would earlier + include init/end_per_suite and init/end_per_group. This + is no longer the case. The 'tests' attribute will now + only count "real" test cases. </item> <item> Earlier, + auto skipped test cases would have no value in the 'log' + attribute. This is now corrected. </item> <item> A new + attributes 'log' is added to the 'testsuite' element. + </item> <item> A new option named 'url_base' is added for + this hook. If this option is used, a new attribute named + 'url' will be added to the 'testcase' and 'testsuite' + elements. </item> </list></p> + <p> + Own Id: OTP-10589</p> + </item> + </list> + </section> + +</section> + <section><title>Common_Test 1.6.3</title> <section><title>Fixed Bugs and Malfunctions</title> diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml index b804f134c6..d5f5d89e05 100644 --- a/lib/common_test/doc/src/run_test_chapter.xml +++ b/lib/common_test/doc/src/run_test_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2003</year><year>2012</year> + <year>2003</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -752,7 +752,9 @@ PrivDirOption = auto_per_run | auto_per_tc | manual_per_tc EventHandlers = atom() | [atom()] InitArgs = [term()] - CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}] + CTHModules = [CTHModule | + {CTHModule, CTHInitArgs} | + {CTHModule, CTHInitArgs, CTHPriority}] CTHModule = atom() CTHInitArgs = term() Dir = string() diff --git a/lib/common_test/doc/src/write_test_chapter.xml b/lib/common_test/doc/src/write_test_chapter.xml index 248d7de8b6..cc8d913994 100644 --- a/lib/common_test/doc/src/write_test_chapter.xml +++ b/lib/common_test/doc/src/write_test_chapter.xml @@ -4,7 +4,7 @@ <chapter> <header> <copyright> - <year>2003</year><year>2012</year> + <year>2003</year><year>2013</year> <holder>Ericsson AB. All Rights Reserved.</holder> </copyright> <legalnotice> @@ -982,38 +982,36 @@ <p>Example:</p> <pre> + Some printouts during test case execution: - Some printouts during test case execution: + io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]), + ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]), + ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]), + ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]), + ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]), + ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]), - io:format("1. Standard IO, importance = ~w~n", [?STD_IMPORTANCE]), - ct:log("2. Uncategorized, importance = ~w", [?STD_IMPORTANCE]), - ct:log(info, "3. Categorized info, importance = ~w", [?STD_IMPORTANCE]]), - ct:log(info, ?LOW_IMPORTANCE, "4. Categorized info, importance = ~w", [?LOW_IMPORTANCE]), - ct:log(error, "5. Categorized error, importance = ~w", [?HI_IMPORTANCE]), - ct:log(error, ?HI_IMPORTANCE, "6. Categorized error, importance = ~w", [?MAX_IMPORTANCE]), + If starting the test without specifying any verbosity levels: - If starting the test without specifying any verbosity levels: + $ ct_run ... - $ ct_run ... + the following gets printed: - the following gets printed: - - 1. Standard IO, importance = 50 - 2. Uncategorized, importance = 50 - 3. Categorized info, importance = 50 - 5. Categorized error, importance = 75 - 6. Categorized error, importance = 99 - - If starting the test with: - - $ ct_run -verbosity 1 and info 75 - - the following gets printed: + 1. Standard IO, importance = 50 + 2. Uncategorized, importance = 50 + 3. Categorized info, importance = 50 + 5. Categorized error, importance = 75 + 6. Categorized error, importance = 99 + + If starting the test with: + + $ ct_run -verbosity 1 and info 75 + + the following gets printed: - 3. Categorized info, importance = 50 - 4. Categorized info, importance = 25 - 6. Categorized error, importance = 99 - </pre> + 3. Categorized info, importance = 50 + 4. Categorized info, importance = 25 + 6. Categorized error, importance = 99</pre> <p>How categories can be mapped to CSS tags is documented in the <seealso marker="run_test_chapter#html_stylesheet">Running Tests</seealso> diff --git a/lib/common_test/src/ct_cover.erl b/lib/common_test/src/ct_cover.erl index d39f50ba00..ae671c750a 100644 --- a/lib/common_test/src/ct_cover.erl +++ b/lib/common_test/src/ct_cover.erl @@ -1,7 +1,7 @@ %% %% %CopyrightBegin% %% -%% Copyright Ericsson AB 2006-2009. All Rights Reserved. +%% Copyright Ericsson AB 2006-2012. All Rights Reserved. %% %% The contents of this file are subject to the Erlang Public License, %% Version 1.1, (the "License"); you may not use this file except in @@ -24,7 +24,7 @@ -module(ct_cover). --export([get_spec/1, add_nodes/1, remove_nodes/1]). +-export([get_spec/1, add_nodes/1, remove_nodes/1, cross_cover_analyse/2]). -include("ct_util.hrl"). @@ -100,6 +100,22 @@ remove_nodes(Nodes) -> %%%----------------------------------------------------------------- +%%% @spec cross_cover_analyse(Level,Tests) -> ok +%%% Level = overview | details +%%% Tests = [{Tag,Dir}] +%%% Tag = atom() +%%% Dir = string() +%%% +%%% @doc Accumulate cover results over multiple tests. +%%% See the chapter about <seealso +%%% marker="cover_chapter#cross_cover">cross cover +%%% analysis</seealso> in the users's guide. +%%% +cross_cover_analyse(Level,Tests) -> + test_server_ctrl:cross_cover_analyse(Level,Tests). + + +%%%----------------------------------------------------------------- %%% @hidden %% Read cover specification file and return the parsed info. @@ -249,9 +265,11 @@ get_app_info(App=#cover{app=Name}, [{excl_mods,Name,Mods1}|Terms]) -> Mods = App#cover.excl_mods, get_app_info(App#cover{excl_mods=Mods++Mods1},Terms); -get_app_info(App=#cover{app=Name}, [{cross_apps,Name,AppMods1}|Terms]) -> - AppMods = App#cover.cross, - get_app_info(App#cover{cross=AppMods++AppMods1},Terms); +get_app_info(App=#cover{app=none}, [{cross,Cross}|Terms]) -> + get_app_info(App, [{cross,none,Cross}|Terms]); +get_app_info(App=#cover{app=Name}, [{cross,Name,Cross1}|Terms]) -> + Cross = App#cover.cross, + get_app_info(App#cover{cross=Cross++Cross1},Terms); get_app_info(App=#cover{app=none}, [{src_dirs,Dirs}|Terms]) -> get_app_info(App, [{src_dirs,none,Dirs}|Terms]); @@ -354,10 +372,10 @@ remove_excludes_and_dups(CoverData=#cover{excl_mods=Excl,incl_mods=Incl}) -> files2mods(Info=#cover{excl_mods=ExclFs, incl_mods=InclFs, - cross=CrossFs}) -> + cross=Cross}) -> Info#cover{excl_mods=files2mods1(ExclFs), incl_mods=files2mods1(InclFs), - cross=files2mods1(CrossFs)}. + cross=[{Tag,files2mods1(Fs)} || {Tag,Fs} <- Cross]}. files2mods1([M|Fs]) when is_atom(M) -> [M|files2mods1(Fs)]; diff --git a/lib/common_test/src/ct_netconfc.erl b/lib/common_test/src/ct_netconfc.erl index 11c8235040..1ccbc86d8f 100644 --- a/lib/common_test/src/ct_netconfc.erl +++ b/lib/common_test/src/ct_netconfc.erl @@ -1073,7 +1073,8 @@ handle_msg({get_event_streams=Op,Streams,Timeout}, From, State) -> SimpleXml = encode_rpc_operation(get,[Filter]), do_send_rpc(Op, SimpleXml, Timeout, From, State). -handle_msg({ssh_cm, _CM, {data, _Ch, _Type, Data}}, State) -> +handle_msg({ssh_cm, CM, {data, Ch, _Type, Data}}, State) -> + ssh_connection:adjust_window(CM,Ch,size(Data)), handle_data(Data, State); handle_msg({ssh_cm, _CM, _SshCloseMsg}, State) -> %% _SshCloseMsg can probably be one of @@ -1805,7 +1806,8 @@ get_tag([]) -> %%% SSH stuff ssh_receive_data() -> receive - {ssh_cm, _CM, {data, _Ch, _Type, Data}} -> + {ssh_cm, CM, {data, Ch, _Type, Data}} -> + ssh_connection:adjust_window(CM,Ch,size(Data)), {ok, Data}; {ssh_cm, _CM, {Closed, _Ch}} = X when Closed == closed; Closed == eof -> {error,X}; diff --git a/lib/common_test/src/ct_slave.erl b/lib/common_test/src/ct_slave.erl index 58633b7de6..1fd8c04f8b 100644 --- a/lib/common_test/src/ct_slave.erl +++ b/lib/common_test/src/ct_slave.erl @@ -449,15 +449,29 @@ wait_for_node_alive(Node, N) -> % call init:stop on a remote node do_stop(ENode) -> - case test_server:is_cover() of - true -> - MainCoverNode = cover:get_main_node(), - rpc:call(MainCoverNode,cover,flush,[ENode]); - false -> - ok + {Cover,MainCoverNode} = + case test_server:is_cover() of + true -> + Main = cover:get_main_node(), + rpc:call(Main,cover,flush,[ENode]), + {true,Main}; + false -> + {false,undefined} end, spawn(ENode, init, stop, []), - wait_for_node_dead(ENode, 5). + case wait_for_node_dead(ENode, 5) of + {ok,ENode} -> + if Cover -> + %% To avoid that cover is started again if a node + %% with the same name is started later. + rpc:call(MainCoverNode,cover,stop,[ENode]); + true -> + ok + end, + {ok,ENode}; + Error -> + Error + end. % wait N seconds until node is disconnected wait_for_node_dead(Node, 0) -> diff --git a/lib/common_test/src/cth_surefire.erl b/lib/common_test/src/cth_surefire.erl index 76b0f0b5ea..e6eaad8d48 100644 --- a/lib/common_test/src/cth_surefire.erl +++ b/lib/common_test/src/cth_surefire.erl @@ -1,3 +1,22 @@ +%%-------------------------------------------------------------------- +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%%-------------------------------------------------------------------- + %%% @doc Common Test Framework functions handling test specifications. %%% %%% <p>This module creates a junit report of the test run if plugged in @@ -27,18 +46,28 @@ -export([terminate/1]). -record(state, { filepath, axis, properties, package, hostname, - curr_suite, curr_suite_ts, curr_group = [], curr_tc, - curr_log_dir, timer, tc_log, + curr_suite, curr_suite_ts, curr_group = [], + curr_log_dir, timer, tc_log, url_base, test_cases = [], test_suites = [] }). --record(testcase, { log, group, classname, name, time, failure, timestamp }). --record(testsuite, { errors, failures, hostname, name, tests, +-record(testcase, { log, url, group, classname, name, time, result, timestamp }). +-record(testsuite, { errors, failures, skipped, hostname, name, tests, time, timestamp, id, package, - properties, testcases }). + properties, testcases, log, url }). + +-define(default_report,"junit_report.xml"). +-define(suite_log,"suite.log.html"). + +%% Number of dirs from log root to testcase log file. +%% ct_run.<node>.<timestamp>/<test_name>/run.<timestamp>/<tc_log>.html +-define(log_depth,3). id(Opts) -> - filename:absname(proplists:get_value(path, Opts, "junit_report.xml")). + case proplists:get_value(path, Opts) of + undefined -> ?default_report; + Path -> filename:absname(Path) + end. init(Path, Opts) -> {ok, Host} = inet:gethostname(), @@ -47,10 +76,24 @@ init(Path, Opts) -> package = proplists:get_value(package,Opts), axis = proplists:get_value(axis,Opts,[]), properties = proplists:get_value(properties,Opts,[]), + url_base = proplists:get_value(url_base,Opts), timer = now() }. pre_init_per_suite(Suite,Config,#state{ test_cases = [] } = State) -> - {Config, init_tc(State#state{ curr_suite = Suite, curr_suite_ts = now() }, + TcLog = proplists:get_value(tc_logfile,Config), + CurrLogDir = filename:dirname(TcLog), + Path = + case State#state.filepath of + ?default_report -> + RootDir = get_test_root(TcLog), + filename:join(RootDir,?default_report); + P -> + P + end, + {Config, init_tc(State#state{ filepath = Path, + curr_suite = Suite, + curr_suite_ts = now(), + curr_log_dir = CurrLogDir}, Config) }; pre_init_per_suite(Suite,Config,State) -> %% Have to close the previous suite @@ -59,7 +102,8 @@ pre_init_per_suite(Suite,Config,State) -> post_init_per_suite(_Suite,Config, Result, State) -> {Result, end_tc(init_per_suite,Config,Result,State)}. -pre_end_per_suite(_Suite,Config,State) -> {Config, init_tc(State, Config)}. +pre_end_per_suite(_Suite,Config,State) -> + {Config, init_tc(State, Config)}. post_end_per_suite(_Suite,Config,Result,State) -> {Result, end_tc(end_per_suite,Config,Result,State)}. @@ -71,13 +115,15 @@ pre_init_per_group(Group,Config,State) -> post_init_per_group(_Group,Config,Result,State) -> {Result, end_tc(init_per_group,Config,Result,State)}. -pre_end_per_group(_Group,Config,State) -> {Config, init_tc(State, Config)}. +pre_end_per_group(_Group,Config,State) -> + {Config, init_tc(State, Config)}. post_end_per_group(_Group,Config,Result,State) -> NewState = end_tc(end_per_group, Config, Result, State), {Result, NewState#state{ curr_group = tl(NewState#state.curr_group)}}. -pre_init_per_testcase(_TC,Config,State) -> {Config, init_tc(State, Config)}. +pre_init_per_testcase(_TC,Config,State) -> + {Config, init_tc(State, Config)}. post_end_per_testcase(TC,Config,Result,State) -> {Result, end_tc(TC,Config, Result,State)}. @@ -88,11 +134,19 @@ on_tc_fail(_TC, Res, State) -> TCs = State#state.test_cases, TC = hd(TCs), NewTC = TC#testcase{ - failure = + result = {fail,lists:flatten(io_lib:format("~p",[Res]))} }, State#state{ test_cases = [NewTC | tl(TCs)]}. -on_tc_skip(Tc,{Type,_Reason} = Res, State) when Type == tc_auto_skip -> +on_tc_skip(Tc,{Type,_Reason} = Res, State0) when Type == tc_auto_skip -> + TcStr = atom_to_list(Tc), + State = + case State0#state.test_cases of + [#testcase{name=TcStr}|TCs] -> + State0#state{test_cases=TCs}; + _ -> + State0 + end, do_tc_skip(Res, end_tc(Tc,[],Res,init_tc(State,[]))); on_tc_skip(_Tc, _Res, State = #state{test_cases = []}) -> State; @@ -103,7 +157,7 @@ do_tc_skip(Res, State) -> TCs = State#state.test_cases, TC = hd(TCs), NewTC = TC#testcase{ - failure = + result = {skipped,lists:flatten(io_lib:format("~p",[Res]))} }, State#state{ test_cases = [NewTC | tl(TCs)]}. @@ -117,33 +171,52 @@ end_tc(Func, Config, Res, State) when is_atom(Func) -> end_tc(atom_to_list(Func), Config, Res, State); end_tc(Name, _Config, _Res, State = #state{ curr_suite = Suite, curr_group = Groups, - timer = TS, tc_log = Log } ) -> + curr_log_dir = CurrLogDir, + timer = TS, + tc_log = Log0, + url_base = UrlBase } ) -> + Log = + case Log0 of + "" -> + LowerSuiteName = string:to_lower(atom_to_list(Suite)), + filename:join(CurrLogDir,LowerSuiteName++"."++Name++".html"); + _ -> + Log0 + end, + Url = make_url(UrlBase,Log), ClassName = atom_to_list(Suite), PGroup = string:join([ atom_to_list(Group)|| Group <- lists:reverse(Groups)],"."), TimeTakes = io_lib:format("~f",[timer:now_diff(now(),TS) / 1000000]), State#state{ test_cases = [#testcase{ log = Log, + url = Url, timestamp = now_to_string(TS), classname = ClassName, group = PGroup, name = Name, time = TimeTakes, - failure = passed }| State#state.test_cases]}. + result = passed }| + State#state.test_cases], + tc_log = ""}. % so old tc_log is not set if next is on_tc_skip close_suite(#state{ test_cases = [] } = State) -> State; -close_suite(#state{ test_cases = TCs } = State) -> - Total = length(TCs), - Succ = length(lists:filter(fun(#testcase{ failure = F }) -> - F == passed - end,TCs)), - Fail = Total - Succ, +close_suite(#state{ test_cases = TCs, url_base = UrlBase } = State) -> + {Total,Fail,Skip} = count_tcs(TCs,0,0,0), TimeTaken = timer:now_diff(now(),State#state.curr_suite_ts) / 1000000, + SuiteLog = filename:join(State#state.curr_log_dir,?suite_log), + SuiteUrl = make_url(UrlBase,SuiteLog), Suite = #testsuite{ name = atom_to_list(State#state.curr_suite), package = State#state.package, + hostname = State#state.hostname, time = io_lib:format("~f",[TimeTaken]), timestamp = now_to_string(State#state.curr_suite_ts), - errors = Fail, tests = Total, - testcases = lists:reverse(TCs) }, + errors = 0, + failures = Fail, + skipped = Skip, + tests = Total, + testcases = lists:reverse(TCs), + log = SuiteLog, + url = SuiteUrl}, State#state{ test_cases = [], test_suites = [Suite | State#state.test_suites]}. @@ -159,14 +232,15 @@ terminate(State) -> -to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, timestamp = TS, failure = F}) -> +to_xml(#testcase{ group = Group, classname = CL, log = L, url = U, name = N, time = T, timestamp = TS, result = R}) -> ["<testcase ", - [["group=\"",Group,"\""]||Group /= ""]," " + [["group=\"",Group,"\" "]||Group /= ""], "name=\"",N,"\" " "time=\"",T,"\" " - "timestamp=\"",TS,"\" " + "timestamp=\"",TS,"\" ", + [["url=\"",U,"\" "]||U /= undefined], "log=\"",L,"\">", - case F of + case R of passed -> []; {skipped,Reason} -> @@ -176,22 +250,29 @@ to_xml(#testcase{ group = Group, classname = CL, log = L, name = N, time = T, ti ["<failure message=\"Test ",N," in ",CL," failed!\" type=\"crash\">", sanitize(Reason),"</failure>"] end,"</testcase>"]; -to_xml(#testsuite{ package = P, hostname = H, errors = E, time = Time, - timestamp = TS, tests = T, name = N, testcases = Cases }) -> +to_xml(#testsuite{ package = P, hostname = H, errors = E, failures = F, + skipped = S, time = Time, timestamp = TS, tests = T, name = N, + testcases = Cases, log = Log, url = Url }) -> ["<testsuite ", [["package=\"",P,"\" "]||P /= undefined], - [["hostname=\"",P,"\" "]||H /= undefined], - [["name=\"",N,"\" "]||N /= undefined], - [["time=\"",Time,"\" "]||Time /= undefined], - [["timestamp=\"",TS,"\" "]||TS /= undefined], + "hostname=\"",H,"\" " + "name=\"",N,"\" " + "time=\"",Time,"\" " + "timestamp=\"",TS,"\" " "errors=\"",integer_to_list(E),"\" " - "tests=\"",integer_to_list(T),"\">", + "failures=\"",integer_to_list(F),"\" " + "skipped=\"",integer_to_list(S),"\" " + "tests=\"",integer_to_list(T),"\" ", + [["url=\"",Url,"\" "]||Url /= undefined], + "log=\"",Log,"\">", [to_xml(Case) || Case <- Cases], "</testsuite>"]; to_xml(#state{ test_suites = TestSuites, axis = Axis, properties = Props }) -> ["<testsuites>",properties_to_xml(Axis,Props), [to_xml(TestSuite) || TestSuite <- TestSuites],"</testsuites>"]. +properties_to_xml([],[]) -> + []; properties_to_xml(Axis,Props) -> ["<properties>", [["<property name=\"",Name,"\" axis=\"yes\" value=\"",Value,"\" />"] || {Name,Value} <- Axis], @@ -217,3 +298,37 @@ sanitize([]) -> now_to_string(Now) -> {{YY,MM,DD},{HH,Mi,SS}} = calendar:now_to_local_time(Now), io_lib:format("~p-~2..0B-~2..0BT~2..0B:~2..0B:~2..0B",[YY,MM,DD,HH,Mi,SS]). + +make_url(undefined,_) -> + undefined; +make_url(_,[]) -> + undefined; +make_url(UrlBase0,Log) -> + UrlBase = string:strip(UrlBase0,right,$/), + RelativeLog = get_relative_log_url(Log), + string:join([UrlBase,RelativeLog],"/"). + +get_test_root(Log) -> + LogParts = filename:split(Log), + filename:join(lists:sublist(LogParts,1,length(LogParts)-?log_depth)). + +get_relative_log_url(Log) -> + LogParts = filename:split(Log), + Start = length(LogParts)-?log_depth, + Length = ?log_depth+1, + string:join(lists:sublist(LogParts,Start,Length),"/"). + +count_tcs([#testcase{name=ConfCase}|TCs],Ok,F,S) + when ConfCase=="init_per_suite"; + ConfCase=="end_per_suite"; + ConfCase=="init_per_group"; + ConfCase=="end_per_group" -> + count_tcs(TCs,Ok,F,S); +count_tcs([#testcase{result=passed}|TCs],Ok,F,S) -> + count_tcs(TCs,Ok+1,F,S); +count_tcs([#testcase{result={fail,_}}|TCs],Ok,F,S) -> + count_tcs(TCs,Ok,F+1,S); +count_tcs([#testcase{result={skipped,_}}|TCs],Ok,F,S) -> + count_tcs(TCs,Ok,F,S+1); +count_tcs([],Ok,F,S) -> + {Ok+F+S,F,S}. diff --git a/lib/common_test/test/Makefile b/lib/common_test/test/Makefile index df816f9a61..d469d03e04 100644 --- a/lib/common_test/test/Makefile +++ b/lib/common_test/test/Makefile @@ -56,7 +56,8 @@ MODULES= \ ct_snmp_SUITE \ ct_group_leader_SUITE \ ct_cover_SUITE \ - ct_groups_search_SUITE + ct_groups_search_SUITE \ + ct_surefire_SUITE ERL_FILES= $(MODULES:%=%.erl) diff --git a/lib/common_test/test/common_test.cover b/lib/common_test/test/common_test.cover index 66697854ea..3aa49623e7 100644 --- a/lib/common_test/test/common_test.cover +++ b/lib/common_test/test/common_test.cover @@ -1,10 +1,10 @@ %% -*- erlang -*- {incl_app,common_test,details}. -{cross_apps,common_test,[erl2html2, - test_server, - test_server_ctrl, - test_server_gl, - test_server_h, - test_server_io, - test_server_node, - test_server_sup]}. +{cross,common_test,[{test_server,[erl2html2, + test_server, + test_server_ctrl, + test_server_gl, + test_server_h, + test_server_io, + test_server_node, + test_server_sup]}]}. diff --git a/lib/common_test/test/ct_cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE.erl index bebfce70d0..cb49dc423f 100644 --- a/lib/common_test/test/ct_cover_SUITE.erl +++ b/lib/common_test/test/ct_cover_SUITE.erl @@ -77,7 +77,8 @@ all() -> slave_start_slave, cover_node_option, ct_cover_add_remove_nodes, - otp_9956 + otp_9956, + cross ]. %%-------------------------------------------------------------------- @@ -161,6 +162,43 @@ otp_9956(Config) -> check_calls(Events,{?suite,otp_9956,1},1), ok. +%% Test cross cover mechanism +cross(Config) -> + {ok,Events1} = run_test(cross1,Config), + check_calls(Events1,1), + + CoverFile2 = create_cover_file(cross1,[{cross,[{cross1,[?mod]}]}],Config), + {ok,Events2} = run_test(cross2,[{cover,CoverFile2}],Config), + check_calls(Events2,1), + + %% Get the log dirs for each test and run cross cover analyse + [D11,D12] = lists:sort(get_run_dirs(Events1)), + [D21,D22] = lists:sort(get_run_dirs(Events2)), + + ct_cover:cross_cover_analyse(details,[{cross1,D11},{cross2,D21}]), + ct_cover:cross_cover_analyse(details,[{cross1,D12},{cross2,D22}]), + + %% Get the cross cover logs and read for each test + [C11,C12,C21,C22] = + [filename:join(D,"cross_cover.html") || D <- [D11,D12,D21,D22]], + + {ok,CrossData} = file:read_file(C11), + {ok,CrossData} = file:read_file(C12), + + {ok,Def} = file:read_file(C21), + {ok,Def} = file:read_file(C22), + + %% A simple test: just check that the test module exists in the + %% log from cross1 test, and that it does not exist in the log + %% from cross2 test. + TestMod = list_to_binary(atom_to_list(?mod)), + {_,_} = binary:match(CrossData,TestMod), + nomatch = binary:match(Def,TestMod), + {_,_} = binary:match(Def, + <<"No cross cover modules exist for this application">>), + + ok. + %%%----------------------------------------------------------------- %%% HELP FUNCTIONS @@ -229,15 +267,18 @@ check_cover(Node) when is_atom(Node) -> false end. +%% Get the log dir "run.<timestamp>" for all (both!) tests +get_run_dirs(Events) -> + [filename:dirname(TCLog) || + {ct_test_support_eh, + {event,tc_logfile,_Node, + {{?suite,init_per_suite},TCLog}}} <- Events]. + %% Check that each coverlog includes N calls to ?mod:foo/0 check_calls(Events,N) -> check_calls(Events,{?mod,foo,0},N). check_calls(Events,MFA,N) -> - CoverLogs = - [filename:join(filename:dirname(TCLog),"all.coverdata") || - {ct_test_support_eh, - {event,tc_logfile,ct@falco, - {{?suite,init_per_suite},TCLog}}} <- Events], + CoverLogs = [filename:join(D,"all.coverdata") || D <- get_run_dirs(Events)], do_check_logs(CoverLogs,MFA,N). do_check_logs([CoverLog|CoverLogs],{Mod,_,_} = MFA,N) -> diff --git a/lib/common_test/test/ct_surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE.erl new file mode 100644 index 0000000000..69e98cef48 --- /dev/null +++ b/lib/common_test/test/ct_surefire_SUITE.erl @@ -0,0 +1,351 @@ +%% +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% + +%%%------------------------------------------------------------------- +%%% File: ct_surefire_SUITE +%%% +%%% Description: +%%% Test cth_surefire hook +%%% +%%%------------------------------------------------------------------- +-module(ct_surefire_SUITE). + +-compile(export_all). + +-include_lib("common_test/include/ct.hrl"). +-include_lib("common_test/include/ct_event.hrl"). + +-include_lib("xmerl/include/xmerl.hrl"). + +-define(eh, ct_test_support_eh). + +-define(url_base,"http://my.host.com/"). + +%%-------------------------------------------------------------------- +%% TEST SERVER CALLBACK FUNCTIONS +%%-------------------------------------------------------------------- + +%%-------------------------------------------------------------------- +%% Description: Since Common Test starts another Test Server +%% instance, the tests need to be performed on a separate node (or +%% there will be clashes with logging processes etc). +%%-------------------------------------------------------------------- +init_per_suite(Config) -> + Config1 = ct_test_support:init_per_suite(Config), + Config1. + +end_per_suite(Config) -> + ct_test_support:end_per_suite(Config). + +init_per_testcase(TestCase, Config) -> + ct_test_support:init_per_testcase(TestCase, Config). + +end_per_testcase(TestCase, Config) -> + ct_test_support:end_per_testcase(TestCase, Config). + +suite() -> [{ct_hooks,[ts_install_cth]}]. + +all() -> + [ + default, + absolute_path, + relative_path, + url, + logdir + ]. + +%%-------------------------------------------------------------------- +%% TEST CASES +%%-------------------------------------------------------------------- + +%%%----------------------------------------------------------------- +%%% +default(Config) when is_list(Config) -> + run(default,[cth_surefire],Config), + PrivDir = ?config(priv_dir,Config), + XmlRe = filename:join([PrivDir,"*","junit_report.xml"]), + check_xml(default,XmlRe). + +absolute_path(Config) when is_list(Config) -> + PrivDir = ?config(priv_dir,Config), + Path = filename:join(PrivDir,"abspath.xml"), + run(absolute_path,[{cth_surefire,[{path,Path}]}],Config), + check_xml(absolute_path,Path). + +relative_path(Config) when is_list(Config) -> + Path = "relpath.xml", + run(relative_path,[{cth_surefire,[{path,Path}]}],Config), + PrivDir = ?config(priv_dir,Config), + XmlRe = filename:join([PrivDir,"*",Path]), + check_xml(relative_path,XmlRe). + +url(Config) when is_list(Config) -> + Path = "url.xml", + run(url,[{cth_surefire,[{url_base,?url_base}, + {path,Path}]}],Config), + PrivDir = ?config(priv_dir,Config), + XmlRe = filename:join([PrivDir,"*",Path]), + check_xml(url,XmlRe). + +logdir(Config) when is_list(Config) -> + PrivDir = ?config(priv_dir,Config), + LogDir = filename:join(PrivDir,"specific_logdir"), + file:make_dir(LogDir), + Path = "logdir.xml", + run(logdir,[{cth_surefire,[{path,Path}]}],Config,[{logdir,LogDir}]), + PrivDir = ?config(priv_dir,Config), + XmlRe = filename:join([LogDir,"*",Path]), + check_xml(logdir,XmlRe). + +%%%----------------------------------------------------------------- +%%% HELP FUNCTIONS +%%%----------------------------------------------------------------- +run(Case,CTHs,Config) -> + run(Case,CTHs,Config,[]). +run(Case,CTHs,Config,ExtraOpts) -> + DataDir = ?config(data_dir, Config), + Suite = filename:join(DataDir, "surefire_SUITE"), + {Opts,ERPid} = setup([{suite,Suite},{ct_hooks,CTHs},{label,Case}|ExtraOpts], + Config), + ok = execute(Case, Opts, ERPid, Config). + +setup(Test, Config) -> + Opts0 = ct_test_support:get_opts(Config), + Opts1 = + case lists:keymember(logdir,1,Test) of + true -> lists:keydelete(logdir,1,Opts0); + false -> Opts0 + end, + Level = ?config(trace_level, Config), + EvHArgs = [{cbm,ct_test_support},{trace_level,Level}], + Opts = Opts1 ++ [{event_handler,{?eh,EvHArgs}}|Test], + ERPid = ct_test_support:start_event_receiver(Config), + {Opts,ERPid}. + +execute(Name, Opts, ERPid, Config) -> + ok = ct_test_support:run(Opts, Config), + Events = ct_test_support:get_events(ERPid, Config), + + ct_test_support:log_events(Name, + reformat(Events, ?eh), + ?config(priv_dir, Config), + Opts), + + TestEvents = events_to_check(Name), + ct_test_support:verify_events(TestEvents, Events, Config). + +reformat(Events, EH) -> + ct_test_support:reformat(Events, EH). + +%%%----------------------------------------------------------------- +%%% TEST EVENTS +%%%----------------------------------------------------------------- +events_to_check(Test) -> + %% 2 tests (ct:run_test + script_start) is default + events_to_check(Test, 2). + +events_to_check(_, 0) -> + []; +events_to_check(Test, N) -> + test_events(Test) ++ events_to_check(Test, N-1). + +test_events(_) -> + [{?eh,start_logging,'_'}, + {?eh,start_info,{1,1,9}}, + {?eh,tc_start,{surefire_SUITE,init_per_suite}}, + {?eh,tc_done,{surefire_SUITE,init_per_suite,ok}}, + {?eh,tc_start,{surefire_SUITE,tc_ok}}, + {?eh,tc_done,{surefire_SUITE,tc_ok,ok}}, + {?eh,test_stats,{1,0,{0,0}}}, + {?eh,tc_start,{surefire_SUITE,tc_fail}}, + {?eh,tc_done,{surefire_SUITE,tc_fail, + {failed,{error,{test_case_failed,"this test should fail"}}}}}, + {?eh,test_stats,{1,1,{0,0}}}, + {?eh,tc_start,{surefire_SUITE,tc_skip}}, + {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}}, + {?eh,test_stats,{1,1,{1,0}}}, + {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}}, + {?eh,tc_done,{surefire_SUITE,tc_autoskip_require, + {skipped,{require_failed,'_'}}}}, + {?eh,test_stats,{1,1,{1,1}}}, + [{?eh,tc_start,{surefire_SUITE,{init_per_group,g,[]}}}, + {?eh,tc_done,{surefire_SUITE,{init_per_group,g,[]},ok}}, + {?eh,tc_start,{surefire_SUITE,tc_ok}}, + {?eh,tc_done,{surefire_SUITE,tc_ok,ok}}, + {?eh,test_stats,{2,1,{1,1}}}, + {?eh,tc_start,{surefire_SUITE,tc_fail}}, + {?eh,tc_done,{surefire_SUITE,tc_fail, + {failed,{error,{test_case_failed,"this test should fail"}}}}}, + {?eh,test_stats,{2,2,{1,1}}}, + {?eh,tc_start,{surefire_SUITE,tc_skip}}, + {?eh,tc_done,{surefire_SUITE,tc_skip,{skipped,"this test is skipped"}}}, + {?eh,test_stats,{2,2,{2,1}}}, + {?eh,tc_start,{surefire_SUITE,tc_autoskip_require}}, + {?eh,tc_done,{surefire_SUITE,tc_autoskip_require, + {skipped,{require_failed,'_'}}}}, + {?eh,test_stats,{2,2,{2,2}}}, + {?eh,tc_start,{surefire_SUITE,{end_per_group,g,[]}}}, + {?eh,tc_done,{surefire_SUITE,{end_per_group,g,[]},ok}}], + [{?eh,tc_start,{surefire_SUITE,{init_per_group,g_fail,[]}}}, + {?eh,tc_done,{surefire_SUITE,{init_per_group,g_fail,[]}, + {failed,{error,all_cases_should_be_skipped}}}}, + {?eh,tc_auto_skip,{surefire_SUITE,tc_ok, + {failed, + {surefire_SUITE,init_per_group, + {'EXIT',all_cases_should_be_skipped}}}}}, + {?eh,test_stats,{2,2,{2,3}}}, + {?eh,tc_auto_skip,{surefire_SUITE,end_per_group, + {failed, + {surefire_SUITE,init_per_group, + {'EXIT',all_cases_should_be_skipped}}}}}], + {?eh,tc_start,{surefire_SUITE,end_per_suite}}, + {?eh,tc_done,{surefire_SUITE,end_per_suite,ok}}, + {?eh,stop_logging,[]}]. + + +%%%----------------------------------------------------------------- +%%% Check generated xml log files +check_xml(Case,XmlRe) -> + case filelib:wildcard(XmlRe) of + [] -> + ct:fail("No xml files found with regexp ~p~n", [XmlRe]); + [_] = Xmls when Case==absolute_path -> + do_check_xml(Case,Xmls); + [_,_] = Xmls -> + do_check_xml(Case,Xmls) + end. + +%% Allowed structure: +%% <testsuites> +%% <testsuite> +%% <properties> +%% <property/> +%% ... +%% </properties> +%% <testcase> +%% [<failure/> | <error/> | <skipped/> ] +%% </testcase> +%% ... +%% </testsuite> +%% ... +%% </testsuites> +do_check_xml(Case,[Xml|Xmls]) -> + ct:log("Checking <a href=~p>~s</a>~n",[Xml,Xml]), + {E,_} = xmerl_scan:file(Xml), + Expected = events_to_result(lists:flatten(test_events(Case))), + ParseResult = testsuites(Case,E), + ct:log("Expecting: ~p~n",[[Expected]]), + ct:log("Actual : ~p~n",[ParseResult]), + [Expected] = ParseResult, + do_check_xml(Case,Xmls); +do_check_xml(_,[]) -> + ok. + +%% Scanning the XML to get the same type of result as events_to_result/1 +testsuites(Case,#xmlElement{name=testsuites,content=TS}) -> + %% OTP-10589 - move properties element to <testsuite> + false = lists:keytake(properties,#xmlElement.name,TS), + testsuite(Case,TS). + +testsuite(Case,[#xmlElement{name=testsuite,content=TC,attributes=A}|TS]) -> + {ET,EF,ES} = events_to_numbers(lists:flatten(test_events(Case))), + {T,E,F,S} = get_numbers_from_attrs(A,false,false,false,false), + ct:log("Expecting total:~p, error:~p, failure:~p, skipped:~p~n",[ET,0,EF,ES]), + ct:log("Actual total:~p, error:~p, failure:~p, skipped:~p~n",[T,E,F,S]), + {ET,0,EF,ES} = {T,E,F,S}, + + %% properties should only be there if given a options to hook + false = lists:keytake(properties,#xmlElement.name,TC), + %% system-out and system-err is not used by common_test + false = lists:keytake('system-out',#xmlElement.name,TC), + false = lists:keytake('system-err',#xmlElement.name,TC), + R=testcase(Case,TC), + [R|testsuite(Case,TS)]; +testsuite(_Case,[]) -> + []. + +testcase(url=Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) -> + R = failed_or_skipped(C), + case R of + [s] -> + case lists:keyfind(url,#xmlAttribute.name,A) of + false -> ok; + #xmlAttribute{value=UrlAttr} -> + lists:keyfind(url,#xmlAttribute.name,A), + true = lists:prefix(?url_base,UrlAttr) + end; + _ -> + #xmlAttribute{value=UrlAttr} = + lists:keyfind(url,#xmlAttribute.name,A), + true = lists:prefix(?url_base,UrlAttr) + end, + [R|testcase(Case,TC)]; +testcase(Case,[#xmlElement{name=testcase,attributes=A,content=C}|TC]) -> + false = lists:keyfind(url,#xmlAttribute.name,A), + R = failed_or_skipped(C), + [R|testcase(Case,TC)]; +testcase(_Case,[]) -> + []. + +failed_or_skipped([#xmlElement{name=failure}|E]) -> + [f|failed_or_skipped(E)]; +failed_or_skipped([#xmlElement{name=error}|E]) -> + [e|failed_or_skipped(E)]; +failed_or_skipped([#xmlElement{name=skipped}|E]) -> + [s|failed_or_skipped(E)]; +failed_or_skipped([]) -> + []. + +%% Using the expected events to produce the expected result of the XML scanning. +%% The result is a list of test suites: +%% Testsuites = [Testsuite] +%% Testsuite = [Testcase] +%% Testcase = [] | [f] | [s], indicating ok, failed and skipped respectively +events_to_result([{?eh,tc_done,{_Suite,_Case,R}}|E]) -> + [result(R)|events_to_result(E)]; +events_to_result([{?eh,tc_auto_skip,_}|E]) -> + [[s]|events_to_result(E)]; +events_to_result([_|E]) -> + events_to_result(E); +events_to_result([]) -> + []. + +result(ok) ->[]; +result({skipped,_}) -> [s]; +result({failed,_}) -> [f]. + +%% Using the expected events' last test_stats element to produce the +%% expected number of totla, errors, failed and skipped testcases. +events_to_numbers(E) -> + RevE = lists:reverse(E), + {?eh,test_stats,{Ok,F,{US,AS}}} = lists:keyfind(test_stats,2,RevE), + {Ok+F+US+AS,F,US+AS}. + +get_numbers_from_attrs([#xmlAttribute{name=tests,value=X}|A],false,E,F,S) -> + get_numbers_from_attrs(A,list_to_integer(X),E,F,S); +get_numbers_from_attrs([#xmlAttribute{name=errors,value=X}|A],T,false,F,S) -> + get_numbers_from_attrs(A,T,list_to_integer(X),F,S); +get_numbers_from_attrs([#xmlAttribute{name=failures,value=X}|A],T,E,false,S) -> + get_numbers_from_attrs(A,T,E,list_to_integer(X),S); +get_numbers_from_attrs([#xmlAttribute{name=skipped,value=X}|A],T,E,F,false) -> + get_numbers_from_attrs(A,T,E,F,list_to_integer(X)); +get_numbers_from_attrs([_|A],T,E,F,S) -> + get_numbers_from_attrs(A,T,E,F,S); +get_numbers_from_attrs([],T,E,F,S) -> + {T,E,F,S}. diff --git a/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl new file mode 100644 index 0000000000..677aee46c5 --- /dev/null +++ b/lib/common_test/test/ct_surefire_SUITE_data/surefire_SUITE.erl @@ -0,0 +1,92 @@ +%%-------------------------------------------------------------------- +%% %CopyrightBegin% +%% +%% Copyright Ericsson AB 2012. All Rights Reserved. +%% +%% The contents of this file are subject to the Erlang Public License, +%% Version 1.1, (the "License"); you may not use this file except in +%% compliance with the License. You should have received a copy of the +%% Erlang Public License along with this software. If not, it can be +%% retrieved online at http://www.erlang.org/. +%% +%% Software distributed under the License is distributed on an "AS IS" +%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See +%% the License for the specific language governing rights and limitations +%% under the License. +%% +%% %CopyrightEnd% +%% +%%---------------------------------------------------------------------- +%% File: surefire_SUITE.erl +%% +%% Description: +%% This file contains the test cases for cth_surefire. +%% +%% @author Support +%% @doc Test of surefire support in common_test +%% @end +%%---------------------------------------------------------------------- +%%---------------------------------------------------------------------- +-module(surefire_SUITE). +-include_lib("common_test/include/ct.hrl"). + +-compile(export_all). + +%% Default timetrap timeout (set in init_per_testcase). +-define(default_timeout, ?t:minutes(1)). + +all() -> + testcases() ++ [{group,g},{group,g_fail}]. + +groups() -> + [{g,testcases()}, + {g_fail,[tc_ok]}]. + +testcases() -> + [tc_ok, + tc_fail, + tc_skip, + tc_autoskip_require]. + +init_per_suite(Config) -> + Config. + +end_per_suite(Config) -> + Config. + +init_per_group(g_fail, _Config) -> + exit(all_cases_should_be_skipped); +init_per_group(_, Config) -> + Config. + +end_per_group(_Group, Config) -> + Config. + +init_per_testcase(_Case, Config) -> + Dog = test_server:timetrap(?default_timeout), + [{watchdog, Dog}|Config]. + +end_per_testcase(_Case, Config) -> + Dog=?config(watchdog, Config), + test_server:timetrap_cancel(Dog), + ok. + +%%%----------------------------------------------------------------- +%%% Test cases +break(_Config) -> + test_server:break(""), + ok. + +tc_ok(_Config) -> + ok. + +tc_fail(_Config) -> + ct:fail("this test should fail"). + +tc_skip(_Config) -> + {skip,"this test is skipped"}. + +tc_autoskip_require() -> + [{require,whatever}]. +tc_autoskip_require(Config) -> + ct:fail("this test should never be executed - it should be autoskipped"). diff --git a/lib/common_test/test/ct_test_support.erl b/lib/common_test/test/ct_test_support.erl index e5e2e68fcb..fc572aa82f 100644 --- a/lib/common_test/test/ct_test_support.erl +++ b/lib/common_test/test/ct_test_support.erl @@ -117,11 +117,7 @@ end_per_suite(Config) -> CTNode = proplists:get_value(ct_node, Config), PrivDir = proplists:get_value(priv_dir, Config), true = rpc:call(CTNode, code, del_path, [filename:join(PrivDir,"")]), - case test_server:is_cover() of - true -> cover:flush(CTNode); - false -> ok - end, - slave:stop(CTNode), + slave_stop(CTNode), ok. %%%----------------------------------------------------------------- @@ -152,11 +148,7 @@ end_per_testcase(_TestCase, Config) -> case wait_for_ct_stop(CTNode) of %% Common test was not stopped to we restart node. false -> - case test_server:is_cover() of - true -> cover:flush(CTNode); - false -> ok - end, - slave:stop(CTNode), + slave_stop(CTNode), start_slave(Config,proplists:get_value(trace_level,Config)), {fail, "Could not stop common_test"}; true -> @@ -1274,3 +1266,22 @@ rm_files([F | Fs]) -> rm_files([]) -> ok. +%%%----------------------------------------------------------------- +%%% +slave_stop(Node) -> + Cover = test_server:is_cover(), + if Cover-> cover:flush(Node); + true -> ok + end, + erlang:monitor_node(Node, true), + slave:stop(Node), + receive + {nodedown, Node} -> + if Cover -> cover:stop(Node); + true -> ok + end + after 5000 -> + erlang:monitor_node(Node, false), + receive {nodedown, Node} -> ok after 0 -> ok end %flush + end, + ok. |