aboutsummaryrefslogtreecommitdiffstats
path: root/lib
diff options
context:
space:
mode:
Diffstat (limited to 'lib')
-rw-r--r--lib/appmon/src/Makefile4
-rw-r--r--lib/appmon/src/appmon.app.src4
-rw-r--r--lib/asn1/doc/src/asn1ct.xml4
-rw-r--r--lib/asn1/src/asn1ct.erl22
-rw-r--r--lib/asn1/src/asn1ct_check.erl72
-rw-r--r--lib/asn1/src/asn1ct_constructed_per.erl63
-rw-r--r--lib/asn1/src/asn1ct_gen_ber_bin_v2.erl19
-rw-r--r--lib/asn1/src/asn1ct_gen_per.erl164
-rw-r--r--lib/asn1/src/asn1ct_gen_per_rt2ct.erl189
-rw-r--r--lib/asn1/src/asn1ct_parser2.erl31
-rw-r--r--lib/asn1/src/asn1rt_uper_bin.erl15
-rw-r--r--lib/asn1/test/asn1_SUITE.erl57
-rw-r--r--lib/asn1/test/asn1_SUITE_data/ConstraintEquivalence.asn142
-rw-r--r--lib/asn1/test/asn1_SUITE_data/Extension-Addition-Group.asn21
-rw-r--r--lib/asn1/test/asn1_SUITE_data/PrimStrings.asn113
-rw-r--r--lib/asn1/test/asn1_SUITE_data/SeqExtension.asn128
-rw-r--r--lib/asn1/test/asn1_SUITE_data/extensionAdditionGroup.erl23
-rw-r--r--lib/asn1/test/asn1_SUITE_data/testobj.erl28
-rw-r--r--lib/asn1/test/testChoExtension.erl41
-rw-r--r--lib/asn1/test/testChoExternal.erl75
-rw-r--r--lib/asn1/test/testChoRecursive.erl51
-rw-r--r--lib/asn1/test/testCompactBitString.erl302
-rw-r--r--lib/asn1/test/testConstraints.erl191
-rw-r--r--lib/asn1/test/testDeepTConstr.erl26
-rw-r--r--lib/asn1/test/testEnumExt.erl55
-rw-r--r--lib/asn1/test/testMergeCompile.erl2
-rw-r--r--lib/asn1/test/testParameterizedInfObj.erl2
-rw-r--r--lib/asn1/test/testPrimStrings.erl5
-rw-r--r--lib/asn1/test/testSeqExtension.erl135
-rw-r--r--lib/asn1/test/testSetOptional.erl210
-rw-r--r--lib/asn1/test/test_partial_incomplete_decode.erl2
-rw-r--r--lib/asn1/test/test_selective_decode.erl2
-rw-r--r--lib/asn1/test/test_special_decode_performance.erl6
-rw-r--r--lib/common_test/doc/src/cover_chapter.xml87
-rw-r--r--lib/common_test/src/ct_cover.erl32
-rw-r--r--lib/common_test/test/common_test.cover16
-rw-r--r--lib/common_test/test/ct_cover_SUITE.erl53
-rw-r--r--lib/compiler/src/compile.erl6
-rw-r--r--lib/compiler/src/sys_pre_expand.erl66
-rw-r--r--lib/compiler/test/compilation_SUITE.erl3
-rw-r--r--lib/compiler/test/compilation_SUITE_data/bad_functional_value.erl28
-rw-r--r--lib/compiler/test/compile_SUITE.erl30
-rw-r--r--lib/crypto/c_src/crypto.c58
-rwxr-xr-x[-rw-r--r--]lib/crypto/doc/src/crypto.xml23
-rw-r--r--lib/crypto/src/crypto.erl102
-rw-r--r--lib/crypto/test/crypto_SUITE.erl294
-rw-r--r--lib/debugger/src/dbg_wx_filedialog_win.erl9
-rw-r--r--lib/debugger/src/int.erl25
-rw-r--r--lib/dialyzer/test/options1_SUITE_data/src/compiler/sys_pre_expand.erl56
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/mnesia2
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/src/asn1/asn1ct_gen.erl2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/port_info_test4
-rw-r--r--lib/edoc/src/edoc.erl6
-rw-r--r--lib/edoc/src/edoc_doclet.erl8
-rw-r--r--lib/edoc/src/edoc_extract.erl2
-rw-r--r--lib/edoc/src/edoc_lib.erl21
-rw-r--r--lib/edoc/src/edoc_parser.yrl5
-rw-r--r--lib/edoc/src/edoc_refs.erl19
-rw-r--r--lib/eldap/src/eldap.erl2
-rw-r--r--lib/erl_interface/aclocal.m426
-rw-r--r--lib/erl_interface/configure.in4
-rw-r--r--lib/eunit/include/eunit.hrl154
-rw-r--r--lib/eunit/src/eunit_autoexport.erl7
-rw-r--r--lib/kernel/doc/src/Makefile1
-rw-r--r--lib/kernel/doc/src/file.xml12
-rw-r--r--lib/kernel/src/Makefile1
-rw-r--r--lib/kernel/src/code.erl6
-rw-r--r--lib/kernel/src/code_server.erl9
-rw-r--r--lib/kernel/src/file.erl14
-rw-r--r--lib/kernel/src/file_io_server.erl4
-rw-r--r--lib/kernel/src/kernel.app.src1
-rw-r--r--lib/kernel/src/packages.erl158
-rw-r--r--lib/kernel/src/ram_file.erl7
-rw-r--r--lib/kernel/test/Makefile1
-rw-r--r--lib/kernel/test/file_SUITE.erl72
-rw-r--r--lib/kernel/test/heart_SUITE.erl27
-rw-r--r--lib/kernel/test/ignore_cores.erl158
-rw-r--r--lib/kernel/test/prim_file_SUITE.erl74
-rw-r--r--lib/megaco/aclocal.m41906
-rw-r--r--lib/megaco/configure.in5
-rw-r--r--lib/observer/src/observer_app_wx.erl7
-rw-r--r--lib/observer/src/observer_perf_wx.erl14
-rw-r--r--lib/observer/src/observer_pro_wx.erl2
-rw-r--r--lib/observer/src/observer_tv_table.erl2
-rw-r--r--lib/observer/src/observer_wx.erl100
-rw-r--r--lib/odbc/aclocal.m426
-rw-r--r--lib/odbc/configure.in5
-rw-r--r--lib/os_mon/src/os_mon.erl4
-rw-r--r--lib/public_key/doc/src/cert_records.xml2
-rw-r--r--lib/reltool/src/reltool_sys_win.erl104
-rw-r--r--lib/reltool/src/reltool_target.erl31
-rw-r--r--lib/runtime_tools/src/Makefile1
-rw-r--r--lib/runtime_tools/src/appmon_info.erl (renamed from lib/appmon/src/appmon_info.erl)0
-rw-r--r--lib/runtime_tools/src/runtime_tools.app.src2
-rw-r--r--lib/sasl/src/systools_make.erl40
-rw-r--r--lib/ssh/doc/src/ssh_protocol.xml5
-rw-r--r--lib/ssl/test/Makefile11
-rw-r--r--lib/ssl/test/ssl_basic_SUITE.erl2777
-rw-r--r--lib/ssl/test/ssl_certificate_verify_SUITE.erl982
-rw-r--r--lib/ssl/test/ssl_cipher_SUITE.erl122
-rw-r--r--lib/ssl/test/ssl_dist_SUITE.erl32
-rw-r--r--lib/ssl/test/ssl_handshake_SUITE.erl8
-rw-r--r--lib/ssl/test/ssl_npn_handshake_SUITE.erl30
-rw-r--r--lib/ssl/test/ssl_npn_hello_SUITE.erl92
-rw-r--r--lib/ssl/test/ssl_packet_SUITE.erl1417
-rw-r--r--lib/ssl/test/ssl_payload_SUITE.erl276
-rw-r--r--lib/ssl/test/ssl_session_cache_SUITE.erl132
-rw-r--r--lib/ssl/test/ssl_test_lib.erl165
-rw-r--r--lib/ssl/test/ssl_to_openssl_SUITE.erl640
-rw-r--r--lib/stdlib/src/c.erl2
-rw-r--r--lib/stdlib/src/erl_eval.erl45
-rw-r--r--lib/stdlib/src/erl_expand_records.erl7
-rw-r--r--lib/stdlib/src/erl_lint.erl225
-rw-r--r--lib/stdlib/src/erl_parse.yrl64
-rw-r--r--lib/stdlib/src/filename.erl2
-rw-r--r--lib/stdlib/src/otp_internal.erl41
-rw-r--r--lib/stdlib/src/qlc_pt.erl10
-rw-r--r--lib/stdlib/src/shell.erl61
-rw-r--r--lib/stdlib/test/erl_expand_records_SUITE.erl14
-rw-r--r--lib/stdlib/test/erl_lint_SUITE.erl4
-rw-r--r--lib/stdlib/test/erl_pp_SUITE.erl20
-rw-r--r--lib/stdlib/test/qlc_SUITE.erl15
-rw-r--r--lib/syntax_tools/src/erl_prettypr.erl24
-rw-r--r--lib/syntax_tools/src/erl_syntax.erl116
-rw-r--r--lib/syntax_tools/src/erl_syntax_lib.erl5
-rw-r--r--lib/test_server/doc/src/test_server_ctrl.xml93
-rw-r--r--lib/test_server/doc/src/ts.xml4
-rw-r--r--lib/test_server/src/Makefile3
-rw-r--r--lib/test_server/src/test_server.erl23
-rw-r--r--lib/test_server/src/test_server_ctrl.erl318
-rw-r--r--lib/test_server/src/test_server_sup.erl28
-rw-r--r--lib/test_server/src/ts.erl31
-rw-r--r--lib/test_server/test/test_server_SUITE.erl100
-rw-r--r--lib/test_server/test/test_server_SUITE_data/Makefile.src4
-rw-r--r--lib/test_server/test/test_server_SUITE_data/test_server_break_SUITE.erl10
-rw-r--r--lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE.erl58
-rw-r--r--lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE_data/cover_helper.erl4
-rw-r--r--lib/wx/.gitignore5
-rw-r--r--lib/wx/aclocal.m426
-rw-r--r--lib/wx/api_gen/gen_util.erl12
-rw-r--r--lib/wx/api_gen/gl_gen.erl25
-rw-r--r--lib/wx/api_gen/gl_gen_erl.erl22
-rw-r--r--lib/wx/api_gen/gl_scan_doc.erl14
-rw-r--r--lib/wx/api_gen/wx_extra/wxPrintout.erl5
-rw-r--r--lib/wx/api_gen/wx_gen.erl114
-rw-r--r--lib/wx/api_gen/wx_gen.hrl5
-rw-r--r--lib/wx/api_gen/wx_gen_cpp.erl55
-rw-r--r--lib/wx/api_gen/wx_gen_erl.erl128
-rw-r--r--lib/wx/api_gen/wxapi.conf144
-rw-r--r--lib/wx/c_src/Makefile.in5
-rw-r--r--lib/wx/c_src/gen/wxe_derived_dest.h12
-rw-r--r--lib/wx/c_src/gen/wxe_events.cpp425
-rw-r--r--lib/wx/c_src/gen/wxe_funcs.cpp2197
-rw-r--r--lib/wx/c_src/gen/wxe_macros.h299
-rw-r--r--lib/wx/c_src/wxe_impl.cpp36
-rw-r--r--lib/wx/c_src/wxe_ps_init.c5
-rwxr-xr-xlib/wx/configure.in68
-rw-r--r--lib/wx/examples/demo/demo.erl53
-rw-r--r--lib/wx/examples/demo/ex_aui.erl22
-rw-r--r--lib/wx/examples/demo/ex_button.erl10
-rw-r--r--lib/wx/examples/demo/ex_canvas.erl5
-rw-r--r--lib/wx/examples/demo/ex_canvas_paint.erl25
-rw-r--r--lib/wx/examples/demo/ex_choices.erl6
-rw-r--r--lib/wx/examples/demo/ex_cursor.erl4
-rw-r--r--lib/wx/examples/demo/ex_dialogs.erl4
-rw-r--r--lib/wx/examples/demo/ex_frame_utils.erl4
-rw-r--r--lib/wx/examples/demo/ex_gauge.erl4
-rw-r--r--lib/wx/examples/demo/ex_gl.erl61
-rw-r--r--lib/wx/examples/demo/ex_graphicsContext.erl42
-rw-r--r--lib/wx/examples/demo/ex_grid.erl4
-rw-r--r--lib/wx/examples/demo/ex_htmlWindow.erl4
-rw-r--r--lib/wx/examples/demo/ex_listCtrl.erl8
-rw-r--r--lib/wx/examples/demo/ex_notebook.erl4
-rw-r--r--lib/wx/examples/demo/ex_pickers.erl4
-rw-r--r--lib/wx/examples/demo/ex_popupMenu.erl4
-rw-r--r--lib/wx/examples/demo/ex_radioBox.erl4
-rw-r--r--lib/wx/examples/demo/ex_sashWindow.erl4
-rw-r--r--lib/wx/examples/demo/ex_sizers.erl4
-rw-r--r--lib/wx/examples/demo/ex_slider.erl4
-rw-r--r--lib/wx/examples/demo/ex_splitterWindow.erl4
-rw-r--r--lib/wx/examples/demo/ex_static.erl4
-rw-r--r--lib/wx/examples/demo/ex_textCtrl.erl24
-rw-r--r--lib/wx/examples/demo/ex_treeCtrl.erl4
-rw-r--r--lib/wx/examples/simple/menu.erl4
-rw-r--r--lib/wx/examples/simple/minimal.erl6
-rw-r--r--lib/wx/examples/sudoku/sudoku_board.erl46
-rw-r--r--lib/wx/examples/sudoku/sudoku_gui.erl25
-rw-r--r--lib/wx/include/wx.hrl215
-rw-r--r--lib/wx/src/gen/gl.erl285
-rw-r--r--lib/wx/src/gen/glu.erl82
-rw-r--r--lib/wx/src/gen/wxCalendarCtrl.erl2
-rw-r--r--lib/wx/src/gen/wxClientDC.erl2
-rw-r--r--lib/wx/src/gen/wxClipboard.erl3
-rw-r--r--lib/wx/src/gen/wxCursor.erl2
-rw-r--r--lib/wx/src/gen/wxDC.erl17
-rw-r--r--lib/wx/src/gen/wxGraphicsContext.erl11
-rw-r--r--lib/wx/src/gen/wxGraphicsPath.erl8
-rw-r--r--lib/wx/src/gen/wxGraphicsRenderer.erl2
-rw-r--r--lib/wx/src/gen/wxGridCellEditor.erl2
-rw-r--r--lib/wx/src/gen/wxIdleEvent.erl2
-rw-r--r--lib/wx/src/gen/wxImage.erl9
-rw-r--r--lib/wx/src/gen/wxMDIClientWindow.erl2
-rw-r--r--lib/wx/src/gen/wxMouseEvent.erl2
-rw-r--r--lib/wx/src/gen/wxPageSetupDialogData.erl9
-rw-r--r--lib/wx/src/gen/wxPaintDC.erl2
-rw-r--r--lib/wx/src/gen/wxPaintEvent.erl2
-rw-r--r--lib/wx/src/gen/wxPen.erl6
-rw-r--r--lib/wx/src/gen/wxPostScriptDC.erl2
-rw-r--r--lib/wx/src/gen/wxPrintData.erl6
-rw-r--r--lib/wx/src/gen/wxPrintout.erl5
-rw-r--r--lib/wx/src/gen/wxStyledTextCtrl.erl47
-rw-r--r--lib/wx/src/gen/wxSystemSettings.erl2
-rw-r--r--lib/wx/src/gen/wxWindowDC.erl2
-rw-r--r--lib/wx/src/gen/wxe_debug.hrl299
-rw-r--r--lib/wx/src/gen/wxe_funcs.hrl299
-rw-r--r--lib/wx/src/wxe_util.erl16
-rw-r--r--lib/wx/test/wx_basic_SUITE.erl6
-rw-r--r--lib/wx/test/wx_class_SUITE.erl17
-rw-r--r--lib/wx/test/wx_event_SUITE.erl79
-rw-r--r--lib/wx/test/wx_opengl_SUITE.erl40
-rw-r--r--lib/wx/test/wx_xtra_SUITE.erl32
-rw-r--r--lib/wx/wxwin-2.8.m4 (renamed from lib/wx/wxwin.m4)0
-rw-r--r--lib/wx/wxwin-2.9.m41060
223 files changed, 11210 insertions, 9240 deletions
diff --git a/lib/appmon/src/Makefile b/lib/appmon/src/Makefile
index 06e61b7cc8..9dc47ab84e 100644
--- a/lib/appmon/src/Makefile
+++ b/lib/appmon/src/Makefile
@@ -37,13 +37,15 @@ MODULES= \
appmon \
appmon_a \
appmon_dg \
- appmon_info \
appmon_place \
appmon_txt \
appmon_lb \
process_info \
appmon_web
+# appmon_info \ Moved to runtime tools where it belongs
+
+
HRL_FILES= appmon_dg.hrl
ERL_FILES= $(MODULES:%=%.erl)
diff --git a/lib/appmon/src/appmon.app.src b/lib/appmon/src/appmon.app.src
index 2e1aa3ef3b..aa6a08772e 100644
--- a/lib/appmon/src/appmon.app.src
+++ b/lib/appmon/src/appmon.app.src
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -18,7 +18,7 @@
{application, appmon,
[{description, "DEVTOOLS CXC 138 16"},
{vsn, "%VSN%"},
- {modules, [appmon, appmon_a, appmon_dg, appmon_info,
+ {modules, [appmon, appmon_a, appmon_dg, %% appmon_info, moved to runtime tools
appmon_lb, appmon_place, appmon_txt,process_info,appmon_web]},
{registered,[appmon, appmon_info, appmon_txt,webappmon_server,proc_info]},
{applications, [kernel, stdlib]}]}.
diff --git a/lib/asn1/doc/src/asn1ct.xml b/lib/asn1/doc/src/asn1ct.xml
index 9a9bb7ec1b..bb3c6a4f0f 100644
--- a/lib/asn1/doc/src/asn1ct.xml
+++ b/lib/asn1/doc/src/asn1ct.xml
@@ -120,9 +120,7 @@ File3.asn </pre>
<c>Options</c> is a list with options specific for the asn1
compiler and options that are applied to the Erlang compiler.
The latter are those that not is recognized as asn1 specific.
- For <em>preferred option use</em> see <seealso
- marker="asn1_ug#preferred option use">Preferred Option Use
- section in users guide</seealso>. Available options are:
+ Available options are:
</p>
<taglist>
<tag><c>ber | per | uper</c></tag>
diff --git a/lib/asn1/src/asn1ct.erl b/lib/asn1/src/asn1ct.erl
index 90882462ac..98877320a0 100644
--- a/lib/asn1/src/asn1ct.erl
+++ b/lib/asn1/src/asn1ct.erl
@@ -1288,35 +1288,35 @@ pretty2(Module,AbsFile) ->
{ok,F} = file:open(AbsFile,[write]),
M = asn1_db:dbget(Module,'MODULE'),
io:format(F,"%%%%%%%%%%%%%%%%%%% ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- io:format(F,"~s\n",[asn1ct_pretty_format:term(M#module.defid)]),
- io:format(F,"~s\n",[asn1ct_pretty_format:term(M#module.tagdefault)]),
- io:format(F,"~s\n",[asn1ct_pretty_format:term(M#module.exports)]),
- io:format(F,"~s\n",[asn1ct_pretty_format:term(M#module.imports)]),
- io:format(F,"~s\n\n",[asn1ct_pretty_format:term(M#module.extensiondefault)]),
+ io:format(F,"~s.\n",[asn1ct_pretty_format:term(M#module.defid)]),
+ io:format(F,"~s.\n",[asn1ct_pretty_format:term(M#module.tagdefault)]),
+ io:format(F,"~s.\n",[asn1ct_pretty_format:term(M#module.exports)]),
+ io:format(F,"~s.\n",[asn1ct_pretty_format:term(M#module.imports)]),
+ io:format(F,"~s.\n\n",[asn1ct_pretty_format:term(M#module.extensiondefault)]),
{Types,Values,ParameterizedTypes,Classes,Objects,ObjectSets} = M#module.typeorval,
io:format(F,"%%%%%%%%%%%%%%%%%%% TYPES in ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- lists:foreach(fun(T)-> io:format(F,"~s\n",
+ lists:foreach(fun(T)-> io:format(F,"~s.\n",
[asn1ct_pretty_format:term(asn1_db:dbget(Module,T))])
end,Types),
io:format(F,"%%%%%%%%%%%%%%%%%%% VALUES in ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- lists:foreach(fun(T)-> io:format(F,"~s\n",
+ lists:foreach(fun(T)-> io:format(F,"~s.\n",
[asn1ct_pretty_format:term(asn1_db:dbget(Module,T))])
end,Values),
io:format(F,"%%%%%%%%%%%%%%%%%%% Parameterized Types in ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- lists:foreach(fun(T)-> io:format(F,"~s\n",
+ lists:foreach(fun(T)-> io:format(F,"~s.\n",
[asn1ct_pretty_format:term(asn1_db:dbget(Module,T))])
end,ParameterizedTypes),
io:format(F,"%%%%%%%%%%%%%%%%%%% Classes in ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- lists:foreach(fun(T)-> io:format(F,"~s\n",
+ lists:foreach(fun(T)-> io:format(F,"~s.\n",
[asn1ct_pretty_format:term(asn1_db:dbget(Module,T))])
end,Classes),
io:format(F,"%%%%%%%%%%%%%%%%%%% Objects in ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- lists:foreach(fun(T)-> io:format(F,"~s\n",
+ lists:foreach(fun(T)-> io:format(F,"~s.\n",
[asn1ct_pretty_format:term(asn1_db:dbget(Module,T))])
end,Objects),
io:format(F,"%%%%%%%%%%%%%%%%%%% Object Sets in ~p %%%%%%%%%%%%%%%%%%%~n",[Module]),
- lists:foreach(fun(T)-> io:format(F,"~s\n",
+ lists:foreach(fun(T)-> io:format(F,"~s.\n",
[asn1ct_pretty_format:term(asn1_db:dbget(Module,T))])
end,ObjectSets).
start() ->
diff --git a/lib/asn1/src/asn1ct_check.erl b/lib/asn1/src/asn1ct_check.erl
index fe1b2e14a8..dd77085c39 100644
--- a/lib/asn1/src/asn1ct_check.erl
+++ b/lib/asn1/src/asn1ct_check.erl
@@ -4340,11 +4340,33 @@ permitted_alphabet_merge([C1|Rest],UorI,Acc) ->
%% there will be no extension if the last constraint is without extension.
%% The rootset of all constraints are considered in the "outermoust
%% intersection". See section 13.1.2 in Dubuisson.
-constraint_merge(_S,C=[H])when is_tuple(H) ->
+constraint_merge(St, Cs0) ->
+ Cs = constraint_merge_1(St, Cs0),
+ normalize_cs(Cs).
+
+normalize_cs([{'SingleValue',[V]}|Cs]) ->
+ [{'SingleValue',V}|normalize_cs(Cs)];
+normalize_cs([{'SingleValue',[_|_]=L0}|Cs]) ->
+ [H|T] = L = lists:usort(L0),
+ [case is_range(H, T) of
+ false -> {'SingleValue',L};
+ true -> {'ValueRange',{H,lists:last(T)}}
+ end|normalize_cs(Cs)];
+normalize_cs([{'ValueRange',{Sv,Sv}}|Cs]) ->
+ [{'SingleValue',Sv}|normalize_cs(Cs)];
+normalize_cs([{'ValueRange',{'MIN','MAX'}}|Cs]) ->
+ normalize_cs(Cs);
+normalize_cs(Other) -> Other.
+
+is_range(Prev, [H|T]) when Prev =:= H - 1 -> is_range(H, T);
+is_range(_, [_|_]) -> false;
+is_range(_, []) -> true.
+
+constraint_merge_1(_S, [H]=C) when is_tuple(H) ->
C;
-constraint_merge(_S,[]) ->
+constraint_merge_1(_S, []) ->
[];
-constraint_merge(S,C) ->
+constraint_merge_1(S, C) ->
%% skip all extension but the last extension
C1 = filter_extensions(C),
%% perform all internal level intersections, intersections first
@@ -4367,17 +4389,16 @@ constraint_merge(S,C) ->
%% get the least common size constraint
SZs = get_constraints(C3,'SizeConstraint'),
CombSZ = intersection_of_size(S,SZs),
- CminusSVs=ordsets:subtract(ordsets:from_list(C3),ordsets:from_list(SVs)),
- % CminusSVsVRs = ordsets:subtract(ordsets:from_list(CminusSVs),
-% ordsets:from_list(VRs)),
- RestC = ordsets:subtract(ordsets:from_list(CminusSVs),
- ordsets:from_list(SZs)),
+ RestC = ordsets:subtract(ordsets:from_list(C3),
+ ordsets:from_list(SZs ++ VRs ++ SVs)),
%% get the least common combined constraint. That is the union of each
- %% deep costraint and merge of single value and value range constraints
- NewCs = combine_constraints(S,CombSV,CombVR,CombSZ++RestC),
- [X||X <- lists:flatten(NewCs),
- X /= intersection,
- X /= union].
+ %% deep constraint and merge of single value and value range constraints.
+ %% FIXME: Removing 'intersection' from the flattened list essentially
+ %% means that intersections are converted to unions!
+ Cs = combine_constraints(S, CombSV, CombVR, CombSZ++RestC),
+ [X || X <- lists:flatten(Cs),
+ X =/= intersection,
+ X =/= union].
%% constraint_union(S,C) takes a list of constraints as input and
%% merge them to a union. Unions are performed when two
@@ -4407,16 +4428,16 @@ constraint_union(_S,C) ->
constraint_union1(S,[A={'ValueRange',_},union,B={'ValueRange',_}|Rest],Acc) ->
AunionB = constraint_union_vr([A,B]),
- constraint_union1(S,Rest,Acc ++ AunionB);
+ constraint_union1(S, AunionB++Rest, Acc);
constraint_union1(S,[A={'SingleValue',_},union,B={'SingleValue',_}|Rest],Acc) ->
AunionB = constraint_union_sv(S,[A,B]),
constraint_union1(S,Rest,Acc ++ AunionB);
constraint_union1(S,[A={'SingleValue',_},union,B={'ValueRange',_}|Rest],Acc) ->
AunionB = union_sv_vr(S,A,B),
- constraint_union1(S,Rest,Acc ++ AunionB);
+ constraint_union1(S, AunionB++Rest, Acc);
constraint_union1(S,[A={'ValueRange',_},union,B={'SingleValue',_}|Rest],Acc) ->
AunionB = union_sv_vr(S,B,A),
- constraint_union1(S,Rest,Acc ++ AunionB);
+ constraint_union1(S, AunionB++Rest, Acc);
constraint_union1(S,[union|Rest],Acc) -> %skip when unsupported constraints
constraint_union1(S,Rest,Acc);
constraint_union1(S,[A|Rest],Acc) ->
@@ -4449,15 +4470,8 @@ constraint_union_vr(VR) ->
({_,{A1,_B1}},{_,{A2,_B2}}) when is_integer(A1),is_integer(A2),A1<A2 -> true;
({_,{A,B1}},{_,{A,B2}}) when B1=<B2->true;
(_,_)->false end,
- % sort and remove duplicates
- SortedVR = lists:sort(Fun,VR),
- RemoveDup = fun([],_) ->[];
- ([H],_) -> [H];
- ([H,H|T],F) -> F([H|T],F);
- ([H|T],F) -> [H|F(T,F)]
- end,
-
- constraint_union_vr(RemoveDup(SortedVR,RemoveDup),[]).
+ SortedVR = lists:usort(Fun,VR),
+ constraint_union_vr(SortedVR, []).
constraint_union_vr([],Acc) ->
lists:reverse(Acc);
@@ -4467,8 +4481,8 @@ constraint_union_vr([{_,{Lb,Ub2}}|Rest],[{_,{Lb,_Ub1}}|Acc]) -> %Ub2 > Ub1
constraint_union_vr(Rest,[{'ValueRange',{Lb,Ub2}}|Acc]);
constraint_union_vr([{_,{_,Ub}}|Rest],A=[{_,{_,Ub}}|_Acc]) ->
constraint_union_vr(Rest,A);
-constraint_union_vr([{_,{Lb2,Ub2}}|Rest],[{_,{Lb1,Ub1}}|Acc]) when Lb2=<Ub1,
- Ub2>Ub1->
+constraint_union_vr([{_,{Lb2,Ub2}}|Rest], [{_,{Lb1,Ub1}}|Acc])
+ when Ub1 =< Lb2, Ub1 < Ub2 ->
constraint_union_vr(Rest,[{'ValueRange',{Lb1,Ub2}}|Acc]);
constraint_union_vr([{_,{_,Ub2}}|Rest],A=[{_,{_,Ub1}}|_Acc]) when Ub2=<Ub1->
constraint_union_vr(Rest,A);
@@ -4589,9 +4603,11 @@ constraint_intersection(_S,C) ->
constraint_intersection1(S,[A,intersection,B|Rest],Acc) ->
AisecB = c_intersect(S,A,B),
- constraint_intersection1(S,Rest,AisecB++Acc);
+ constraint_intersection1(S, AisecB++Rest, Acc);
constraint_intersection1(S,[A|Rest],Acc) ->
constraint_intersection1(S,Rest,[A|Acc]);
+constraint_intersection1(_, [], [C]) ->
+ C;
constraint_intersection1(_,[],Acc) ->
lists:reverse(Acc).
diff --git a/lib/asn1/src/asn1ct_constructed_per.erl b/lib/asn1/src/asn1ct_constructed_per.erl
index b29a7b3048..27070be966 100644
--- a/lib/asn1/src/asn1ct_constructed_per.erl
+++ b/lib/asn1/src/asn1ct_constructed_per.erl
@@ -108,7 +108,10 @@ gen_encode_constructed(Erule,Typename,D) when is_record(D,type) ->
emit([
{next,val}," = case [X || X <- [",Elements,
"],X =/= asn1_NOVALUE] of",nl,
- "[] -> ",{curr,val},";",nl,
+ "[] -> setelement(",
+ {asis,ExtActualGroupPos+1},",",
+ {curr,val},",",
+ "asn1_NOVALUE);",nl,
"_ -> setelement(",{asis,ExtActualGroupPos+1},",",
{curr,val},",",
"{extaddgroup,", Elements,"})",nl,
@@ -1099,10 +1102,11 @@ gen_dec_components_call(Erule,TopType,CL={Root1,ExtList,Root2},
{EmitExts,_} = gen_dec_comp_calls(NewExtList, Erule, TopType, OptTable,
DecInfObj, Ext, NumberOfOptionals,
Tpos, []),
+ NumExtsToSkip = ext_length(ExtList),
Finish =
fun(St) ->
emit([{next,bytes},"= ?RT_PER:skipextensions(",{curr,bytes},",",
- length(ExtList)+1,",Extensions)"]),
+ NumExtsToSkip+1,",Extensions)"]),
asn1ct_name:new(bytes),
St
end,
@@ -1361,7 +1365,7 @@ gen_dec_line_open_type(_, _, _) ->
fun() -> St end}
end}.
-gen_dec_line_special(_, {typefield,_}, _TopType, Comp,
+gen_dec_line_special(Erule, {typefield,_}, _TopType, Comp,
DecInfObj, Ext) ->
#'ComponentType'{name=Cname,typespec=Type,prop=Prop} = Comp,
fun({_BytesVar,PrevSt}) ->
@@ -1370,13 +1374,14 @@ gen_dec_line_special(_, {typefield,_}, _TopType, Comp,
{Name,RestFieldNames} =
(Type#type.def)#'ObjectClassFieldType'.fieldname,
- asn1ct_name:new(tmpterm),
asn1ct_name:new(reason),
- emit([indent(2),"{",{curr,tmpterm},", ",{next,bytes},
- "} = ?RT_PER:decode_open_type(",{curr,bytes},
- ", []),",nl]),
- emit([indent(2),"case (catch ObjFun(",
- {asis,Name},",",{curr,tmpterm},",telltype,",
+ Imm = asn1ct_imm:per_dec_open_type(is_aligned(Erule)),
+ BytesVar = asn1ct_gen:mk_var(asn1ct_name:curr(bytes)),
+ {TmpTerm,TempBuf} = asn1ct_imm:dec_slim_cg(Imm, BytesVar),
+ emit([com,nl,
+ {next,bytes}," = ",TempBuf,com,nl,
+ indent(2),"case (catch ObjFun(",
+ {asis,Name},",",TmpTerm,",telltype,",
{asis,RestFieldNames},")) of", nl]),
emit([indent(4),"{'EXIT',",{curr,reason},"} ->",nl]),
emit([indent(6),"exit({'Type not ",
@@ -1402,8 +1407,10 @@ gen_dec_line_special(_, {typefield,_}, _TopType, Comp,
end,
{Name,RestFieldNames} =
(Type#type.def)#'ObjectClassFieldType'.fieldname,
- emit(["?RT_PER:decode_open_type(",{curr,bytes},
- ", []),",nl]),
+ Imm = asn1ct_imm:per_dec_open_type(is_aligned(Erule)),
+ BytesVar = asn1ct_gen:mk_var(asn1ct_name:curr(bytes)),
+ asn1ct_imm:dec_code_gen(Imm, BytesVar),
+ emit([com,nl]),
if
Ext == noext andalso Prop == mandatory ->
emit([{curr,term}," =",nl," "]);
@@ -1429,8 +1436,9 @@ gen_dec_line_special(_, {typefield,_}, _TopType, Comp,
end,
{[],PrevSt};
_ ->
- emit(["?RT_PER:decode_open_type(",{curr,bytes},
- ", [])"]),
+ Imm = asn1ct_imm:per_dec_open_type(is_aligned(Erule)),
+ BytesVar = asn1ct_gen:mk_var(asn1ct_name:curr(bytes)),
+ asn1ct_imm:dec_code_gen(Imm, BytesVar),
RefedFieldName =
(Type#type.def)#'ObjectClassFieldType'.fieldname,
@@ -1440,10 +1448,12 @@ gen_dec_line_special(_, {typefield,_}, _TopType, Comp,
Prop}],PrevSt}
end
end;
-gen_dec_line_special(_, {objectfield,PrimFieldName1,PFNList}, _TopType,
+gen_dec_line_special(Erule, {objectfield,PrimFieldName1,PFNList}, _TopType,
Comp, _DecInfObj, _Ext) ->
fun({_BytesVar,PrevSt}) ->
- emit(["?RT_PER:decode_open_type(",{curr,bytes},", [])"]),
+ Imm = asn1ct_imm:per_dec_open_type(is_aligned(Erule)),
+ BytesVar = asn1ct_gen:mk_var(asn1ct_name:curr(bytes)),
+ asn1ct_imm:dec_code_gen(Imm, BytesVar),
#'ComponentType'{name=Cname,prop=Prop} = Comp,
SaveBytes = [{Cname,{PrimFieldName1,PFNList},
asn1ct_gen:mk_var(asn1ct_name:curr(term)),
@@ -1666,20 +1676,15 @@ gen_dec_choice1(Erule,TopType,CompList,{ext,ExtPos,ExtNum}) ->
length(CompList)-ExtNum,",Ext ),",nl}),
emit({"{Cname,{Val,NewBytes}} = case Choice + Ext*",ExtPos-1," of",nl}),
gen_dec_choice2(Erule,TopType,CompList,{ext,ExtPos,ExtNum}),
- case Erule of
- per ->
- emit([";",nl,"_ -> {asn1_ExtAlt,",nl,
- " fun() -> ",nl,
- " {XTerm,XBytes} = ?RT_PER:decode_open_type(",
- {curr,bytes},",[]),",nl,
- " {binary_to_list(XTerm),XBytes}",nl,
- " end()}"]);
- _ ->
- emit([";",nl,"_ -> {asn1_ExtAlt, ?RT_PER:decode_open_type(",
- {curr,bytes},",[])}"])
- end,
- emit({nl,"end,",nl}),
- emit({nl,"{{Cname,Val},NewBytes}"}).
+ Imm = asn1ct_imm:per_dec_open_type(is_aligned(Erule)),
+ BytesVar = asn1ct_gen:mk_var(asn1ct_name:curr(bytes)),
+ emit([";",nl,
+ "_ ->",nl]),
+ {TmpTerm,TmpBuf} = asn1ct_imm:dec_slim_cg(Imm, BytesVar),
+ emit([com,nl,
+ "{asn1_ExtAlt,{",TmpTerm,com,TmpBuf,"}}",nl,
+ "end,",nl,nl,
+ "{{Cname,Val},NewBytes}"]).
gen_dec_choice2(Erule,TopType,L,Ext) ->
diff --git a/lib/asn1/src/asn1ct_gen_ber_bin_v2.erl b/lib/asn1/src/asn1ct_gen_ber_bin_v2.erl
index 00c3dd98b2..664dfc2086 100644
--- a/lib/asn1/src/asn1ct_gen_ber_bin_v2.erl
+++ b/lib/asn1/src/asn1ct_gen_ber_bin_v2.erl
@@ -114,16 +114,6 @@ gen_encode(Erules,Typename,Type) when is_record(Type,type) ->
_ -> % embedded type with constructed name
true
end,
- case lists:member(InnerType,['SET','SEQUENCE']) of
- true ->
- true;
- _ ->
- emit([nl,"'enc_",asn1ct_gen:list2name(Typename),
- "'({'",asn1ct_gen:list2name(Typename),
- "',Val}, TagIn",ObjFun,") ->",nl]),
- emit([" 'enc_",asn1ct_gen:list2name(Typename),
- "'(Val, TagIn",ObjFun,");",nl,nl])
- end,
emit(["'enc_",asn1ct_gen:list2name(Typename),
"'(Val, TagIn",ObjFun,") ->",nl," "]),
asn1ct_gen:gen_encode_constructed(Erules,Typename,InnerType,Type);
@@ -157,15 +147,6 @@ gen_encode_user(Erules,D) when is_record(D,typedef) ->
"'(Val",") ->",nl]),
emit([" 'enc_",asn1ct_gen:list2name(Typename),
"'(Val, ", {asis,lists:reverse(Tag)},").",nl,nl]),
-
- case lists:member(InnerType,['SET','SEQUENCE']) of
- true ->
- true;
- _ ->
- emit({nl,"'enc_",asn1ct_gen:list2name(Typename),
- "'({'",asn1ct_gen:list2name(Typename),"',Val}, TagIn) ->",nl}),
- emit({" 'enc_",asn1ct_gen:list2name(Typename),"'(Val, TagIn);",nl,nl})
- end,
emit({"'enc_",asn1ct_gen:list2name(Typename),"'(Val, TagIn) ->",nl}),
CurrentMod = get(currmod),
case asn1ct_gen:type(InnerType) of
diff --git a/lib/asn1/src/asn1ct_gen_per.erl b/lib/asn1/src/asn1ct_gen_per.erl
index eb4cfdccc6..af19edb908 100644
--- a/lib/asn1/src/asn1ct_gen_per.erl
+++ b/lib/asn1/src/asn1ct_gen_per.erl
@@ -79,18 +79,6 @@ gen_encode(Erules,Typename,Type) when is_record(Type,type) ->
end,
case asn1ct_gen:type(InnerType) of
{constructed,bif} ->
- case InnerType of
- 'SET' ->
- true;
- 'SEQUENCE' ->
- true;
- _ ->
- emit({nl,"'enc_",asn1ct_gen:list2name(Typename),
- "'({'",asn1ct_gen:list2name(Typename),
- "',Val}",ObjFun,") ->",nl}),
- emit({"'enc_",asn1ct_gen:list2name(Typename),
- "'(Val",ObjFun,");",nl,nl})
- end,
emit({"'enc_",asn1ct_gen:list2name(Typename),"'(Val",ObjFun,
") ->",nl}),
asn1ct_gen:gen_encode_constructed(Erules,Typename,InnerType,Type);
@@ -943,7 +931,6 @@ gen_objset_dec(ObjSetName,_UniqueName,['EXTENSIONMARK'],_ClName,_ClFields,
_NthObj) ->
emit({"'getdec_",ObjSetName,"'(_, _) ->",nl}),
emit({indent(3),"fun(Attr1, Bytes, _,_) ->",nl}),
-%% emit({indent(6),"?RT_PER:decode_open_type(Bytes,[])",nl}),
emit({indent(6),"{Bytes,Attr1}",nl}),
emit({indent(3),"end.",nl,nl}),
ok;
@@ -959,76 +946,42 @@ emit_default_getdec(ObjSetName,UniqueName) ->
emit([indent(2), "fun(C,V,_,_) -> exit({{component,C},{value,V},{unique_name_and_value,",{asis,UniqueName},",ErrV}}) end"]).
-gen_inlined_dec_funs(Fields,[{typefield,Name,_}|Rest],
- ObjSetName,NthObj) ->
- CurrMod = get(currmod),
- InternalDefFunName = [NthObj,Name,ObjSetName],
- case lists:keysearch(Name,1,Fields) of
- {value,{_,Type}} when is_record(Type,type) ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- N=emit_inner_of_decfun(Type,InternalDefFunName),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj+N);
- {value,{_,Type}} when is_record(Type,typedef) ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- emit({indent(9),{asis,Name}," ->",nl}),
- N=emit_inner_of_decfun(Type,InternalDefFunName),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj+N);
- {value,{_,#'Externaltypereference'{module=CurrMod,type=T}}} ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- emit({indent(9),{asis,Name}," ->",nl}),
- emit([indent(12),"'dec_",T,"'(Val, telltype)"]),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj);
- {value,{_,#'Externaltypereference'{module=M,type=T}}} ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- emit({indent(9),{asis,Name}," ->",nl}),
- emit([indent(12),"'",M,"':'dec_",T,"'(Val, telltype)"]),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj);
- false ->
- emit([indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl,
- indent(9),{asis,Name}," ->{Val,Type}"]),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj)
- end;
-gen_inlined_dec_funs(Fields,[_|Rest],ObjSetName,NthObj) ->
- gen_inlined_dec_funs(Fields,Rest,ObjSetName,NthObj);
-gen_inlined_dec_funs(_,[],_,NthObj) ->
+gen_inlined_dec_funs(Fields, List, ObjSetName, NthObj0) ->
+ emit([indent(3),"fun(Type, Val, _, _) ->",nl,
+ indent(6),"case Type of",nl]),
+ NthObj = gen_inlined_dec_funs1(Fields, List, ObjSetName, "", NthObj0),
+ emit([nl,indent(6),"end",nl,
+ indent(3),"end"]),
NthObj.
-gen_inlined_dec_funs1(Fields,[{typefield,Name,_}|Rest],
- ObjSetName,NthObj) ->
+gen_inlined_dec_funs1(Fields, [{typefield,Name,_}|Rest],
+ ObjSetName, Sep0, NthObj) ->
CurrentMod = get(currmod),
InternalDefFunName = [NthObj,Name,ObjSetName],
- N=case lists:keysearch(Name,1,Fields) of
- {value,{_,Type}} when is_record(Type,type) ->
- emit({";",nl}),
- emit_inner_of_decfun(Type,InternalDefFunName);
- {value,{_,Type}} when is_record(Type,typedef) ->
- emit({";",nl,indent(9),{asis,Name}," ->",nl}),
- emit_inner_of_decfun(Type,InternalDefFunName);
- {value,{_,#'Externaltypereference'{module=CurrentMod,type=T}}} ->
- emit([";",nl,indent(9),{asis,Name}," ->",nl]),
- emit([indent(12),"'dec_",T,"'(Val,telltype)"]),
- 0;
- {value,{_,#'Externaltypereference'{module=M,type=T}}} ->
- emit([";",nl,indent(9),{asis,Name}," ->",nl]),
- emit([indent(12),"'",M,"'",":'dec_",T,"'(Val,telltype)"]),
- 0;
- false ->
- emit([";",nl,
- indent(9),{asis,Name}," ->{Val,Type}"]),
- 0
- end,
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj+N);
-gen_inlined_dec_funs1(Fields,[_|Rest],ObjSetName,NthObj)->
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj);
-gen_inlined_dec_funs1(_,[],_,NthObj) ->
- emit({nl,indent(6),"end",nl}),
- emit({indent(3),"end"}),
- NthObj.
+ emit(Sep0),
+ Sep = [";",nl],
+ N = case lists:keyfind(Name, 1, Fields) of
+ {_,#type{}=Type} ->
+ emit_inner_of_decfun(Type, InternalDefFunName);
+ {_,#typedef{}=Type} ->
+ emit([indent(9),{asis,Name}," ->",nl]),
+ emit_inner_of_decfun(Type, InternalDefFunName);
+ {_,#'Externaltypereference'{module=CurrentMod,type=T}} ->
+ emit([indent(9),{asis,Name}," ->",nl,
+ indent(12),"'dec_",T,"'(Val,telltype)"]),
+ 0;
+ {_,#'Externaltypereference'{module=M,type=T}} ->
+ emit([indent(9),{asis,Name}," ->",nl,
+ indent(12),"'",M,"':'dec_",T,"'(Val,telltype)"]),
+ 0;
+ false ->
+ emit([indent(9),{asis,Name}," -> {Val,Type}"]),
+ 0
+ end,
+ gen_inlined_dec_funs1(Fields, Rest, ObjSetName, Sep, NthObj+N);
+gen_inlined_dec_funs1(Fields, [_|Rest], ObjSetName, Sep, NthObj) ->
+ gen_inlined_dec_funs1(Fields, Rest, ObjSetName, Sep, NthObj);
+gen_inlined_dec_funs1(_, [], _, _, NthObj) -> NthObj.
emit_inner_of_decfun(#typedef{name={ExtName,Name},typespec=Type},
InternalDefFunName) ->
@@ -1147,6 +1100,10 @@ gen_dec_imm(Erule, #type{def=Name,constraint=C}) ->
end,
gen_dec_imm_1(Name, C, Aligned).
+gen_dec_imm_1('ASN1_OPEN_TYPE', Constraint, Aligned) ->
+ imm_decode_open_type(Constraint, Aligned);
+gen_dec_imm_1('ANY', _Constraint, Aligned) ->
+ imm_decode_open_type([], Aligned);
gen_dec_imm_1('BOOLEAN', _Constr, _Aligned) ->
asn1ct_imm:per_dec_boolean();
gen_dec_imm_1({'ENUMERATED',{Base,Ext}}, _Constr, Aligned) ->
@@ -1239,36 +1196,6 @@ gen_dec_prim_1(Erule,
",",{asis,Constraint},")"});
'UTF8String' ->
emit({"?RT_PER:decode_UTF8String(",BytesVar,")"});
- 'ANY' ->
- case Erule of
- per ->
- emit(["fun() -> {XTerm,YTermXBytes} = ?RT_PER:decode_open_type(",BytesVar,",",{asis,Constraint}, "), {binary_to_list(XTerm),XBytes} end ()"]);
- _ ->
- emit(["?RT_PER:decode_open_type(",BytesVar,",",
- {asis,Constraint}, ")"])
- end;
- 'ASN1_OPEN_TYPE' ->
- case Constraint of
- [#'Externaltypereference'{type=Tname}] ->
- emit(["fun(FBytes) ->",nl,
- " {XTerm,XBytes} = "]),
- emit(["?RT_PER:decode_open_type(FBytes,[]),",nl]),
- emit([" {YTerm,_} = dec_",Tname,"(XTerm,mandatory),",nl]),
- emit([" {YTerm,XBytes} end(",BytesVar,")"]);
- [#type{def=#'Externaltypereference'{type=Tname}}] ->
- emit(["fun(FBytes) ->",nl,
- " {XTerm,XBytes} = "]),
- emit(["?RT_PER:decode_open_type(FBytes,[]),",nl]),
- emit([" {YTerm,_} = dec_",Tname,"(XTerm,mandatory),",nl]),
- emit([" {YTerm,XBytes} end(",BytesVar,")"]);
- _ ->
- case Erule of
- per ->
- emit(["fun() -> {XTerm,XBytes} = ?RT_PER:decode_open_type(",BytesVar,", []), {binary_to_list(XTerm),XBytes} end()"]);
- _ ->
- emit(["?RT_PER:decode_open_type(",BytesVar,",[])"])
- end
- end;
#'ObjectClassFieldType'{} ->
case asn1ct_gen:get_inner(Typename) of
{fixedtypevaluefield,_,InnerType} ->
@@ -1334,3 +1261,22 @@ extaddgroup2sequence([C|T],ExtNum,Acc) ->
extaddgroup2sequence(T,ExtNum,[C|Acc]);
extaddgroup2sequence([],_,Acc) ->
lists:reverse(Acc).
+
+imm_decode_open_type([#'Externaltypereference'{type=Tname}], Aligned) ->
+ imm_dec_open_type_1(Tname, Aligned);
+imm_decode_open_type([#type{def=#'Externaltypereference'{type=Tname}}],
+ Aligned) ->
+ imm_dec_open_type_1(Tname, Aligned);
+imm_decode_open_type(_, Aligned) ->
+ asn1ct_imm:per_dec_open_type(Aligned).
+
+imm_dec_open_type_1(Type, Aligned) ->
+ D = fun(OpenType, Buf) ->
+ asn1ct_name:new(tmpval),
+ emit(["begin",nl,
+ "{",{curr,tmpval},",_} = ",
+ "dec_",Type,"(",OpenType,", mandatory),",nl,
+ "{",{curr,tmpval},com,Buf,"}",nl,
+ "end"])
+ end,
+ {call,D,asn1ct_imm:per_dec_open_type(Aligned)}.
diff --git a/lib/asn1/src/asn1ct_gen_per_rt2ct.erl b/lib/asn1/src/asn1ct_gen_per_rt2ct.erl
index ecd212c3e3..4f4563833f 100644
--- a/lib/asn1/src/asn1ct_gen_per_rt2ct.erl
+++ b/lib/asn1/src/asn1ct_gen_per_rt2ct.erl
@@ -69,18 +69,6 @@ gen_encode(Erules,Typename,Type) when is_record(Type,type) ->
end,
case asn1ct_gen:type(InnerType) of
{constructed,bif} ->
- case InnerType of
- 'SET' ->
- true;
- 'SEQUENCE' ->
- true;
- _ ->
- emit({nl,"'enc_",asn1ct_gen:list2name(Typename),
- "'({'",asn1ct_gen:list2name(Typename),
- "',Val}",ObjFun,") ->",nl}),
- emit({"'enc_",asn1ct_gen:list2name(Typename),
- "'(Val",ObjFun,");",nl,nl})
- end,
emit({"'enc_",asn1ct_gen:list2name(Typename),"'(Val",ObjFun,
") ->",nl}),
asn1ct_gen:gen_encode_constructed(Erules,Typename,InnerType,Type);
@@ -417,35 +405,46 @@ emit_enc_octet_string(_Erules,Constraint,Value) ->
asn1ct_name:new(tmpval),
emit({" begin",nl}),
emit({" [",{curr,tmpval},"] = ",Value,",",nl}),
- emit({" [10,8,",{curr,tmpval},"]",nl}),
+ emit([" [[10,8],",{curr,tmpval},"]",nl]),
emit(" end");
2 ->
asn1ct_name:new(tmpval),
- emit({" begin",nl}),
- emit({" [",{curr,tmpval},",",{next,tmpval},"] = ",
- Value,",",nl}),
- emit({" [[10,8,",{curr,tmpval},"],[10,8,",
- {next,tmpval},"]]",nl}),
- emit(" end"),
- asn1ct_name:new(tmpval);
- Sv when is_integer(Sv),Sv =< 256 ->
+ emit([" begin",nl,
+ " ",{curr,tmpval}," = ",Value,",",nl,
+ " case length(",{curr,tmpval},") of",nl,
+ " 2 ->",nl,
+ " [[45,16,2]|",{curr,tmpval},"];",nl,
+ " _ ->",nl,
+ " exit({error,{value_out_of_bounds,",
+ {curr,tmpval},"}})",nl,
+ " end",nl,
+ " end"]);
+ Sv when is_integer(Sv), Sv < 256 ->
asn1ct_name:new(tmpval),
- emit({" begin",nl}),
- emit({" case length(",Value,") of",nl}),
- emit([" ",{curr,tmpval}," when ",{curr,tmpval}," == ",Sv," ->"]),
- emit([" [2,20,",{curr,tmpval},",",Value,"];",nl]),
- emit({" _ -> exit({error,{value_out_of_bounds,",
- Value,"}})", nl," end",nl}),
- emit(" end");
+ asn1ct_name:new(tmplen),
+ emit([" begin",nl,
+ " ",{curr,tmpval}," = ",Value,",",nl,
+ " case length(",{curr,tmpval},") of",nl,
+ " ",Sv,"=",{curr,tmplen}," ->",nl,
+ " [20,",{curr,tmplen},"|",{curr,tmpval},"];",nl,
+ " _ ->",nl,
+ " exit({error,{value_out_of_bounds,",
+ {curr,tmpval},"}})",nl,
+ " end",nl,
+ " end"]);
Sv when is_integer(Sv),Sv =< 65535 ->
asn1ct_name:new(tmpval),
- emit({" begin",nl}),
- emit({" case length(",Value,") of",nl}),
- emit([" ",{curr,tmpval}," when ",{curr,tmpval}," == ",Sv," ->"]),
- emit([" [2,21,",{curr,tmpval},",",Value,"];",nl]),
- emit({" _ -> exit({error,{value_out_of_bounds,",
- Value,"}})",nl," end",nl}),
- emit(" end");
+ asn1ct_name:new(tmplen),
+ emit([" begin",nl,
+ " ",{curr,tmpval}," = ",Value,",",nl,
+ " case length(",{curr,tmpval},") of",nl,
+ " ",Sv,"=",{curr,tmplen}," ->",nl,
+ " [<<21,",{curr,tmplen},":16>>|",Value,"];",nl,
+ " _ ->",nl,
+ " exit({error,{value_out_of_bounds,",
+ {curr,tmpval},"}})",nl,
+ " end",nl,
+ " end"]);
C ->
emit({" ?RT_PER:encode_octet_string(",{asis,C},",false,",Value,")",nl})
end.
@@ -1292,7 +1291,6 @@ gen_objset_dec(ObjSetName,_,['EXTENSIONMARK'],_ClName,_ClFields,
_NthObj) ->
emit({"'getdec_",ObjSetName,"'(_, _) ->",nl}),
emit({indent(3),"fun(Attr1, Bytes, _, _) ->",nl}),
- %% emit({indent(6),"?RT_PER:decode_open_type(Bytes,[])",nl}),
emit({indent(6),"{Bytes,Attr1}",nl}),
emit({indent(3),"end.",nl,nl}),
ok;
@@ -1308,77 +1306,42 @@ emit_default_getdec(ObjSetName,UniqueName) ->
emit([indent(2), "fun(C,V,_,_) -> exit({{component,C},{value,V},{unique_name_and_value,",{asis,UniqueName},",ErrV}}) end"]).
-gen_inlined_dec_funs(Fields,[{typefield,Name,_}|Rest],
- ObjSetName,NthObj) ->
- CurrMod = get(currmod),
- InternalDefFunName = [NthObj,Name,ObjSetName],
- case lists:keysearch(Name,1,Fields) of
- {value,{_,Type}} when is_record(Type,type) ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- N=emit_inner_of_decfun(Type,InternalDefFunName),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj+N);
- {value,{_,Type}} when is_record(Type,typedef) ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- emit({indent(9),{asis,Name}," ->",nl}),
- N=emit_inner_of_decfun(Type,InternalDefFunName),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj+N);
- {value,{_,#'Externaltypereference'{module=CurrMod,type=T}}} ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- emit({indent(9),{asis,Name}," ->",nl}),
- emit([indent(12),"'dec_",T,"'(Val, telltype)"]),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj);
- {value,{_,#'Externaltypereference'{module=M,type=T}}} ->
- emit({indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl}),
- emit({indent(9),{asis,Name}," ->",nl}),
- emit([indent(12),"'",M,"':'dec_",T,"'(Val, telltype)"]),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj);
- false ->
- emit([indent(3),"fun(Type, Val, _, _) ->",nl,
- indent(6),"case Type of",nl,
- indent(9),{asis,Name}," -> {Val,Type}"]),
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj)
- end;
-gen_inlined_dec_funs(Fields,[_|Rest],ObjSetName,NthObj) ->
- gen_inlined_dec_funs(Fields,Rest,ObjSetName,NthObj);
-gen_inlined_dec_funs(_,[],_,NthObj) ->
+gen_inlined_dec_funs(Fields, List, ObjSetName, NthObj0) ->
+ emit([indent(3),"fun(Type, Val, _, _) ->",nl,
+ indent(6),"case Type of",nl]),
+ NthObj = gen_inlined_dec_funs1(Fields, List, ObjSetName, "", NthObj0),
+ emit([nl,indent(6),"end",nl,
+ indent(3),"end"]),
NthObj.
-gen_inlined_dec_funs1(Fields,[{typefield,Name,_}|Rest],
- ObjSetName,NthObj) ->
+gen_inlined_dec_funs1(Fields, [{typefield,Name,_}|Rest],
+ ObjSetName, Sep0, NthObj) ->
CurrentMod = get(currmod),
InternalDefFunName = [NthObj,Name,ObjSetName],
- N=
- case lists:keysearch(Name,1,Fields) of
- {value,{_,Type}} when is_record(Type,type) ->
- emit({";",nl}),
- emit_inner_of_decfun(Type,InternalDefFunName);
- {value,{_,Type}} when is_record(Type,typedef) ->
- emit({";",nl,indent(9),{asis,Name}," ->",nl}),
- emit_inner_of_decfun(Type,InternalDefFunName);
- {value,{_,#'Externaltypereference'{module=CurrentMod,type=T}}} ->
- emit([";",nl,indent(9),{asis,Name}," ->",nl]),
- emit([indent(12),"'dec_",T,"'(Val,telltype)"]),
- 0;
- {value,{_,#'Externaltypereference'{module=M,type=T}}} ->
- emit([";",nl,indent(9),{asis,Name}," ->",nl]),
- emit([indent(12),"'",M,"':'dec_",T,"'(Val,telltype)"]),
- 0;
- false ->
- emit([";",nl,
- indent(9),{asis,Name}," -> {Val,Type}"]),
- 0
- end,
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj+N);
-gen_inlined_dec_funs1(Fields,[_|Rest],ObjSetName,NthObj)->
- gen_inlined_dec_funs1(Fields,Rest,ObjSetName,NthObj);
-gen_inlined_dec_funs1(_,[],_,NthObj) ->
- emit({nl,indent(6),"end",nl}),
- emit({indent(3),"end"}),
- NthObj.
+ emit(Sep0),
+ Sep = [";",nl],
+ N = case lists:keyfind(Name, 1, Fields) of
+ {_,#type{}=Type} ->
+ emit_inner_of_decfun(Type, InternalDefFunName);
+ {_,#typedef{}=Type} ->
+ emit([indent(9),{asis,Name}," ->",nl]),
+ emit_inner_of_decfun(Type, InternalDefFunName);
+ {_,#'Externaltypereference'{module=CurrentMod,type=T}} ->
+ emit([indent(9),{asis,Name}," ->",nl,
+ indent(12),"'dec_",T,"'(Val,telltype)"]),
+ 0;
+ {_,#'Externaltypereference'{module=M,type=T}} ->
+ emit([indent(9),{asis,Name}," ->",nl,
+ indent(12),"'",M,"':'dec_",T,"'(Val,telltype)"]),
+ 0;
+ false ->
+ emit([indent(9),{asis,Name}," -> {Val,Type}"]),
+ 0
+ end,
+ gen_inlined_dec_funs1(Fields, Rest, ObjSetName, Sep, NthObj+N);
+gen_inlined_dec_funs1(Fields, [_|Rest], ObjSetName, Sep, NthObj) ->
+ gen_inlined_dec_funs1(Fields, Rest, ObjSetName, Sep, NthObj);
+gen_inlined_dec_funs1(_, [], _, _, NthObj) -> NthObj.
emit_inner_of_decfun(#typedef{name={ExtName,Name},typespec=Type},
InternalDefFunName) ->
@@ -1579,25 +1542,9 @@ gen_dec_prim(Erules,Att,BytesVar) ->
'UTF8String' ->
emit({"?RT_PER:decode_UTF8String(",BytesVar,")"});
'ANY' ->
- emit(["?RT_PER:decode_open_type(",BytesVar,",",
- {asis,Constraint}, ")"]);
+ asn1ct_gen_per:gen_dec_prim(Erules, Att, BytesVar);
'ASN1_OPEN_TYPE' ->
- case Constraint of
- [#'Externaltypereference'{type=Tname}] ->
- emit(["fun(FBytes) ->",nl,
- " {XTerm,XBytes} = "]),
- emit(["?RT_PER:decode_open_type(FBytes,[]),",nl]),
- emit([" {YTerm,_} = dec_",Tname,"(XTerm,mandatory),",nl]),
- emit([" {YTerm,XBytes} end(",BytesVar,")"]);
- [#type{def=#'Externaltypereference'{type=Tname}}] ->
- emit(["fun(FBytes) ->",nl,
- " {XTerm,XBytes} = "]),
- emit(["?RT_PER:decode_open_type(FBytes,[]),",nl]),
- emit([" {YTerm,_} = dec_",Tname,"(XTerm,mandatory),",nl]),
- emit([" {YTerm,XBytes} end(",BytesVar,")"]);
- _ ->
- emit(["?RT_PER:decode_open_type(",BytesVar,",[])"])
- end;
+ asn1ct_gen_per:gen_dec_prim(Erules, Att, BytesVar);
#'ObjectClassFieldType'{} ->
case asn1ct_gen:get_inner(Att#type.def) of
{fixedtypevaluefield,_,InnerType} ->
diff --git a/lib/asn1/src/asn1ct_parser2.erl b/lib/asn1/src/asn1ct_parser2.erl
index 7301f49085..9e1fcce2b1 100644
--- a/lib/asn1/src/asn1ct_parser2.erl
+++ b/lib/asn1/src/asn1ct_parser2.erl
@@ -924,19 +924,8 @@ parse_UnionsRec([{'|',_}|Rest]) ->
{V1,V2} ->
{[V1,union,V2],Rest3}
end;
-parse_UnionsRec([{'UNION',_}|Rest]) ->
- {InterSec,Rest2} = parse_Intersections(Rest),
- {URec,Rest3} = parse_UnionsRec(Rest2),
- case {InterSec,URec} of
- {V1,[]} ->
- {V1,Rest3};
- {{'SingleValue',V1},{'SingleValue',V2}} ->
- {{'SingleValue',ordsets:union(to_set(V1),to_set(V2))},Rest3};
- {V1,V2} when is_list(V2) ->
- {[V1] ++ [union|V2],Rest3};
- {V1,V2} ->
- {[V1,union,V2],Rest3}
- end;
+parse_UnionsRec([{'UNION',Info}|Rest]) ->
+ parse_UnionsRec([{'|',Info}|Rest]);
parse_UnionsRec(Tokens) ->
{[],Tokens}.
@@ -971,20 +960,8 @@ parse_IElemsRec([{'^',_}|Rest]) ->
{V1,V2} ->
{[V1,intersection,V2],Rest3}
end;
-parse_IElemsRec([{'INTERSECTION',_}|Rest]) ->
- {InterSec,Rest2} = parse_IntersectionElements(Rest),
- {IRec,Rest3} = parse_IElemsRec(Rest2),
- case {InterSec,IRec} of
- {{'SingleValue',V1},{'SingleValue',V2}} ->
- {{'SingleValue',
- ordsets:intersection(to_set(V1),to_set(V2))},Rest3};
- {V1,[]} ->
- {V1,Rest3};
- {V1,V2} when is_list(V2) ->
- {[V1] ++ [intersection|V2],Rest3};
- {V1,V2} ->
- {[V1,intersection,V2],Rest3}
- end;
+parse_IElemsRec([{'INTERSECTION',Info}|Rest]) ->
+ parse_IElemsRec([{'^',Info}|Rest]);
parse_IElemsRec(Tokens) ->
{[],Tokens}.
diff --git a/lib/asn1/src/asn1rt_uper_bin.erl b/lib/asn1/src/asn1rt_uper_bin.erl
index 9410c3ef90..fc65d80245 100644
--- a/lib/asn1/src/asn1rt_uper_bin.erl
+++ b/lib/asn1/src/asn1rt_uper_bin.erl
@@ -120,14 +120,15 @@ fixextensions(Pos,ExtPos,Val,Acc) ->
end,
fixextensions(Pos+1,ExtPos,Val,(Acc bsl 1)+Bit).
-skipextensions(Bytes,Nr,ExtensionBitPattern) ->
- case (catch element(Nr,ExtensionBitPattern)) of
- 1 ->
+skipextensions(Bytes,Nr,ExtensionBitstr) when is_bitstring(ExtensionBitstr) ->
+ Prev = Nr - 1,
+ case ExtensionBitstr of
+ <<_:Prev,1:1,_/bitstring>> ->
{_,Bytes2} = decode_open_type(Bytes,[]),
- skipextensions(Bytes2, Nr+1, ExtensionBitPattern);
- 0 ->
- skipextensions(Bytes, Nr+1, ExtensionBitPattern);
- {'EXIT',_} -> % badarg, no more extensions
+ skipextensions(Bytes2, Nr+1, ExtensionBitstr);
+ <<_:Prev,0:1,_/bitstring>> ->
+ skipextensions(Bytes, Nr+1, ExtensionBitstr);
+ _ ->
Bytes
end.
diff --git a/lib/asn1/test/asn1_SUITE.erl b/lib/asn1/test/asn1_SUITE.erl
index 38ec72c473..325293f35d 100644
--- a/lib/asn1/test/asn1_SUITE.erl
+++ b/lib/asn1/test/asn1_SUITE.erl
@@ -20,19 +20,10 @@
-module(asn1_SUITE).
--define(only_per(Func),
- if Rule =:= per -> Func;
- true -> ok
- end).
-define(only_ber(Func),
if Rule =:= ber -> Func;
true -> ok
end).
--define(only_uper(Func),
- case Rule of
- uper -> Func;
- _ -> ok
- end).
-compile(export_all).
@@ -62,7 +53,8 @@ groups() ->
[{compile, parallel([]),
[c_syntax,
c_string,
- c_implicit_before_choice]},
+ c_implicit_before_choice,
+ constraint_equivalence]},
{ber, parallel([]),
[ber_choiceinseq,
@@ -188,7 +180,6 @@ groups() ->
testDoubleEllipses,
test_x691,
ticket_6143,
- testExtensionAdditionGroup,
test_OTP_9688]},
{performance, [],
@@ -321,12 +312,12 @@ testCompactBitString(Config, Rule, Opts) ->
asn1_test_lib:compile("PrimStrings", Config,
[Rule, compact_bit_string|Opts]),
testCompactBitString:compact_bit_string(Rule),
- ?only_uper(testCompactBitString:bit_string_unnamed(Rule)),
- ?only_per(testCompactBitString:bit_string_unnamed(Rule)),
- ?only_per(testCompactBitString:ticket_7734(Rule)),
- ?only_per(asn1_test_lib:compile("Constraints", Config,
- [Rule, compact_bit_string|Opts])),
- ?only_per(testCompactBitString:otp_4869(Rule)).
+ testCompactBitString:bit_string_unnamed(Rule),
+ testCompactBitString:bit_string_unnamed(Rule),
+ testCompactBitString:ticket_7734(Rule),
+ asn1_test_lib:compile("Constraints", Config,
+ [Rule, compact_bit_string|Opts]),
+ testCompactBitString:otp_4869(Rule).
testPrimStrings(Config) -> test(Config, fun testPrimStrings/3).
testPrimStrings(Config, Rule, Opts) ->
@@ -439,7 +430,8 @@ testSeqExtension(Config) -> test(Config, fun testSeqExtension/3).
testSeqExtension(Config, Rule, Opts) ->
asn1_test_lib:compile_all(["External", "SeqExtension"], Config,
[Rule|Opts]),
- testSeqExtension:main(Rule).
+ DataDir = ?config(data_dir, Config),
+ testSeqExtension:main(DataDir, [Rule|Opts]).
testSeqExternal(Config) -> test(Config, fun testSeqExternal/3).
testSeqExternal(Config, Rule, Opts) ->
@@ -627,6 +619,34 @@ c_implicit_before_choice(Config, Rule, Opts) ->
{error, _R2} = asn1ct:compile(filename:join(DataDir, "CCSNARG3"),
[Rule, {outdir, CaseDir}|Opts]).
+constraint_equivalence(Config) ->
+ DataDir = ?config(data_dir, Config),
+ CaseDir = ?config(case_dir, Config),
+ Asn1Spec = "ConstraintEquivalence",
+ Asn1Src = filename:join(DataDir, Asn1Spec),
+ ok = asn1ct:compile(Asn1Src, [abs,{outdir,CaseDir}]),
+ AbsFile = filename:join(CaseDir, Asn1Spec++".abs"),
+ {ok,Terms} = file:consult(AbsFile),
+ Cs = [begin
+ 'INTEGER' = element(3, Type), %Assertion.
+ Constraints = element(4, Type),
+ Name1 = atom_to_list(Name0),
+ {Name,_} = lists:splitwith(fun(C) -> C =/= $X end, Name1),
+ {Name,Constraints}
+ end || {typedef,_,_,Name0,Type} <- Terms],
+ R = sofs:relation(Cs, [{name,constraint}]),
+ F0 = sofs:relation_to_family(R),
+ F = sofs:to_external(F0),
+ Diff = [E || {_,L}=E <- F, length(L) > 1],
+ case Diff of
+ [] ->
+ ok;
+ [_|_] ->
+ io:put_chars("Not equivalent:\n"),
+ [io:format("~s: ~p\n", [N,D]) || {N,D} <- Diff],
+ test_server:fail(length(Diff))
+ end.
+
parse(Config) ->
[asn1_test_lib:compile(M, Config, [abs]) || M <- test_modules()].
@@ -1063,6 +1083,7 @@ testExtensionAdditionGroup(Config, Rule, Opts) ->
[debug_info]),
extensionAdditionGroup:run([Rule|Opts]),
extensionAdditionGroup:run2([Rule|Opts]),
+ extensionAdditionGroup:run3(),
asn1_test_lib:compile("EUTRA-RRC-Definitions", Config, [Rule, {record_name_prefix, "RRC-"}|Opts]),
extensionAdditionGroup:run3([Rule|Opts]).
diff --git a/lib/asn1/test/asn1_SUITE_data/ConstraintEquivalence.asn1 b/lib/asn1/test/asn1_SUITE_data/ConstraintEquivalence.asn1
new file mode 100644
index 0000000000..6a97c1b38e
--- /dev/null
+++ b/lib/asn1/test/asn1_SUITE_data/ConstraintEquivalence.asn1
@@ -0,0 +1,42 @@
+ConstraintEquivalence DEFINITIONS AUTOMATIC TAGS ::=
+BEGIN
+ SingleValueX42 ::= INTEGER (42)
+ SingleValueX1 ::= INTEGER ((42) ^ (42))
+ SingleValueX2 ::= INTEGER ((42) INTERSECTION (42))
+ SingleValueX3 ::= INTEGER ((42) | (42))
+ SingleValueX4 ::= INTEGER ((42) UNION (42))
+ SingleValueX5 ::= INTEGER ((42) INTERSECTION (MIN..MAX))
+ SingleValueX6 ::= INTEGER ((42) INTERSECTION (40..49))
+ SingleValueX7 ::= INTEGER (42..42)
+
+ UnconstrainedX0 ::= INTEGER
+ UnconstrainedX1 ::= INTEGER (MIN..MAX)
+ UnconstrainedX2 ::= INTEGER (1|(MIN..MAX))
+ UnconstrainedX3 ::= INTEGER (1..10|(MIN..MAX))
+ UnconstrainedX4 ::= INTEGER ((MIN..MAX)|9|10)
+ UnconstrainedX5 ::= INTEGER ((MIN..MAX)|10..20)
+ UnconstrainedX6 ::= INTEGER ((MIN..MAX) UNION (10..20))
+
+ RangeX00 ::= INTEGER (5..10)
+ RangeX01 ::= INTEGER (4<..<11)
+ RangeX02 ::= INTEGER (5..<11)
+ RangeX03 ::= INTEGER (4<..10)
+ RangeX04 ::= INTEGER (5|6|7|8|9|10)
+ RangeX05 ::= INTEGER (10|9|8|7|6|5)
+ RangeX06 ::= INTEGER (5|6|7..10)
+
+ RangeX10 ::= INTEGER ((5..6) UNION (7..8) UNION (9|10))
+ RangeX11 ::= INTEGER ((5|6) UNION (7..8) UNION (9|10))
+ RangeX12 ::= INTEGER ((5|6) UNION (7|8) UNION (9|10))
+ RangeX13 ::= INTEGER ((5|6) UNION (7) UNION (8..10))
+ RangeX14 ::= INTEGER ((5|6) UNION (7) UNION (8..10))
+ RangeX15 ::= INTEGER ((5|6) UNION (7) UNION ((8..8)|(9..9)|(10)))
+ RangeX16 ::= INTEGER ((5|6) UNION (7) UNION (7<..<11))
+
+ RangeX20 ::= INTEGER (0..20) (5..10)
+ RangeX21 ::= INTEGER (0..10) (5..20)
+ RangeX22 ::= INTEGER (0..10) (5..20) (MIN..MAX)
+ RangeX23 ::= INTEGER ((0..10) INTERSECTION (5..20) ^ (MIN..MAX))
+ RangeX24 ::= INTEGER ((5|6|7|8|9|10) INTERSECTION (5..20) ^ (MIN..MAX))
+
+END
diff --git a/lib/asn1/test/asn1_SUITE_data/Extension-Addition-Group.asn b/lib/asn1/test/asn1_SUITE_data/Extension-Addition-Group.asn
index 55124f9449..b7cc74ab07 100644
--- a/lib/asn1/test/asn1_SUITE_data/Extension-Addition-Group.asn
+++ b/lib/asn1/test/asn1_SUITE_data/Extension-Addition-Group.asn
@@ -95,6 +95,27 @@ AS-Config ::= SEQUENCE {
]]
}
+SystemInformationBlockType2 ::= SEQUENCE {
+ timeAlignmentTimerCommon TimeAlignmentTimer,
+ ...,
+ lateNonCriticalExtension OCTET STRING OPTIONAL,
+ [[ ssac-BarringForMMTEL-Voice-r9 AC-BarringConfig OPTIONAL,
+ ssac-BarringForMMTEL-Video-r9 AC-BarringConfig OPTIONAL
+ ]],
+ [[ ac-BarringForCSFB-r10 AC-BarringConfig OPTIONAL
+ ]]
+}
+
+TimeAlignmentTimer ::= ENUMERATED {
+ sf500, sf750, sf1280, sf1920, sf2560, sf5120,
+ sf10240, infinity}
+AC-BarringConfig ::= SEQUENCE {
+ ac-BarringFactor ENUMERATED {
+ p00, p05, p10, p15, p20, p25, p30, p40,
+ p50, p60, p70, p75, p80, p85, p90, p95},
+ ac-BarringTime ENUMERATED {s4, s8, s16, s32, s64, s128, s256, s512},
+ ac-BarringForSpecialAC BIT STRING (SIZE(5))
+}
END
diff --git a/lib/asn1/test/asn1_SUITE_data/PrimStrings.asn1 b/lib/asn1/test/asn1_SUITE_data/PrimStrings.asn1
index 7cb47e9792..9b6b34a776 100644
--- a/lib/asn1/test/asn1_SUITE_data/PrimStrings.asn1
+++ b/lib/asn1/test/asn1_SUITE_data/PrimStrings.asn1
@@ -59,6 +59,19 @@ BS1024 ::= BIT STRING (SIZE (1024))
FixedOs65536 ::= OCTET STRING (SIZE (65536))
FixedOs65537 ::= OCTET STRING (SIZE (65537))
+ OsFixedStrings ::= SEQUENCE {
+ b1 BOOLEAN, -- Unalign
+ s0 OCTET STRING (SIZE (0)),
+ s1 OCTET STRING (SIZE (1)),
+ s2 OCTET STRING (SIZE (2)),
+ s3 OCTET STRING (SIZE (3)),
+ b2 BOOLEAN, -- Unalign
+ s255 OCTET STRING (SIZE (255)),
+ s256 OCTET STRING (SIZE (256)),
+ s257 OCTET STRING (SIZE (257)),
+ i INTEGER (0..1024)
+ }
+
OsAlignment ::= SEQUENCE {
b1 BOOLEAN,
s1 Os,
diff --git a/lib/asn1/test/asn1_SUITE_data/SeqExtension.asn1 b/lib/asn1/test/asn1_SUITE_data/SeqExtension.asn1
index bb0a7cca3a..5fda19303a 100644
--- a/lib/asn1/test/asn1_SUITE_data/SeqExtension.asn1
+++ b/lib/asn1/test/asn1_SUITE_data/SeqExtension.asn1
@@ -31,7 +31,35 @@ SeqExt4 ::= SEQUENCE
int INTEGER
}
+SeqExt5 ::= SEQUENCE
+{
+ ...,
+ [[ name OCTET STRING (SIZE (1..8)),
+ shoesize INTEGER ]]
+}
+
+SeqExt6 ::= SEQUENCE
+{
+ -- The spaces between the ellipsis and the comma will prevent them
+ -- from being removed.
+ ... ,
+ [[ i1 [100] INTEGER, i2 [101] INTEGER, i3 [102] INTEGER ]],
+ [[ i4 [104] INTEGER, i5 [105] INTEGER ]],
+ [[ i6 [106] INTEGER, i7 [107] INTEGER ]]
+}
+
SeqExt1X ::= XSeqExt1
SeqExt2X ::= XSeqExt2
+SuperSeq ::= SEQUENCE
+{
+ s1 SeqExt1,
+ s2 SeqExt2,
+ s3 SeqExt3,
+ s4 SeqExt4,
+ s5 SeqExt5,
+ s6 SeqExt6,
+ i INTEGER
+}
+
END
diff --git a/lib/asn1/test/asn1_SUITE_data/extensionAdditionGroup.erl b/lib/asn1/test/asn1_SUITE_data/extensionAdditionGroup.erl
index 5fcec23756..8148381d92 100644
--- a/lib/asn1/test/asn1_SUITE_data/extensionAdditionGroup.erl
+++ b/lib/asn1/test/asn1_SUITE_data/extensionAdditionGroup.erl
@@ -130,3 +130,26 @@ run3(Erule) ->
_ -> exit({expected,Val, got, Val2})
end.
+run3() ->
+ SI = #'SystemInformationBlockType2'{
+ timeAlignmentTimerCommon = sf500,
+ lateNonCriticalExtension = asn1_NOVALUE,
+ 'ssac-BarringForMMTEL-Voice-r9' = asn1_NOVALUE,
+ 'ssac-BarringForMMTEL-Video-r9' = asn1_NOVALUE,
+ 'ac-BarringForCSFB-r10' = asn1_NOVALUE},
+ Barring = #'AC-BarringConfig'{
+ 'ac-BarringFactor' = p00,
+ 'ac-BarringTime' = s4,
+ 'ac-BarringForSpecialAC' = [0,0,0,0,0]},
+ roundtrip(SI),
+ roundtrip(SI#'SystemInformationBlockType2'{
+ 'ssac-BarringForMMTEL-Voice-r9'=Barring}),
+ roundtrip(SI#'SystemInformationBlockType2'{
+ 'ssac-BarringForMMTEL-Video-r9'=Barring}),
+ roundtrip(SI#'SystemInformationBlockType2'{
+ 'ac-BarringForCSFB-r10'=Barring}).
+
+roundtrip(V) ->
+ Mod = 'Extension-Addition-Group',
+ {ok,E} = Mod:encode('SystemInformationBlockType2', V),
+ {ok,V} = Mod:decode('SystemInformationBlockType2', iolist_to_binary(E)).
diff --git a/lib/asn1/test/asn1_SUITE_data/testobj.erl b/lib/asn1/test/asn1_SUITE_data/testobj.erl
index 80942f7e38..d9f60ca8a3 100644
--- a/lib/asn1/test/asn1_SUITE_data/testobj.erl
+++ b/lib/asn1/test/asn1_SUITE_data/testobj.erl
@@ -883,7 +883,7 @@ initial_ue_ies() ->
cn_domain_indicator() ->
- {'CN-DomainIndicator', 'ps-domain'}.
+ 'ps-domain'.
init_lai() ->
#'ProtocolIE-Field'{
@@ -1279,11 +1279,11 @@ reset() ->
protocolIEs = reset_ies()
}.
reset_ies() ->
- {'Reset_protocolIEs', % this identifier is very unneccesary here
- [reset_cause(),
- cn_domain_ind(), % Se initial Ue
- init_global_rnc_id() % ---- " ----
- ]}.
+ [reset_cause(),
+ cn_domain_ind(), % Se initial Ue
+ init_global_rnc_id() % ---- " ----
+ ].
+
init_global_rnc_id() ->
#'ProtocolIE-Field'{
id = 86, % 86 = id-GlobalRNC-ID
@@ -1323,8 +1323,7 @@ reset_ack() ->
protocolIEs = reset_ack_ies()
}.
reset_ack_ies() ->
- {'ResetAcknowledge_protocolIEs', % very unneccesary
- [cn_domain_ind()]}. % Se initial Ue
+ [cn_domain_ind()]. % Se initial Ue
@@ -1336,13 +1335,12 @@ reset_res(IuSCId) ->
}.
reset_res_ies(IuSCId) ->
- {'ResetResource_protocolIEs', % very unneccesary
- [
- cn_domain_ind() % Se initial Ue
- ,reset_cause() % Se reset
- ,reset_res_list(IuSCId)
- ,init_global_rnc_id_reset_res() % ---- " ----
- ]}.
+ [
+ cn_domain_ind() % Se initial Ue
+ ,reset_cause() % Se reset
+ ,reset_res_list(IuSCId)
+ ,init_global_rnc_id_reset_res() % ---- " ----
+ ].
init_global_rnc_id_reset_res() ->
#'ProtocolIE-Field'{
diff --git a/lib/asn1/test/testChoExtension.erl b/lib/asn1/test/testChoExtension.erl
index b75cfb6831..067d4d2bf7 100644
--- a/lib/asn1/test/testChoExtension.erl
+++ b/lib/asn1/test/testChoExtension.erl
@@ -25,42 +25,27 @@
extension(_Rules) ->
-
- ?line {ok,Bytes1} = asn1_wrapper:encode('ChoExtension','ChoExt1',{'ChoExt1',{bool,true}}),
- ?line {ok,{bool,true}} =
- asn1_wrapper:decode('ChoExtension','ChoExt1',lists:flatten(Bytes1)),
-
- ?line {ok,Bytes2} = asn1_wrapper:encode('ChoExtension','ChoExt1',{'ChoExt1',{int,33}}),
- ?line {ok,{int,33}} =
- asn1_wrapper:decode('ChoExtension','ChoExt1',lists:flatten(Bytes2)),
+ roundtrip('ChoExt1', {bool,true}),
+ roundtrip('ChoExt1', {int,33}),
%% A trick to encode with another compatible CHOICE type to test reception
%% extension alternative
- ?line {ok,Bytes2x} = asn1_wrapper:encode('ChoExtension','ChoExt1x',{str,"abc"}),
- ?line {ok,Val2x} =
+ {ok,Bytes2x} = asn1_wrapper:encode('ChoExtension','ChoExt1x',{str,"abc"}),
+ {ok,Val2x} =
asn1_wrapper:decode('ChoExtension','ChoExt1',lists:flatten(Bytes2x)),
io:format("Choice extension alternative = ~p~n",[Val2x]),
- ?line {ok,Bytes3} = asn1_wrapper:encode('ChoExtension','ChoExt2',{'ChoExt2',{bool,true}}),
- ?line {ok,{bool,true}} =
- asn1_wrapper:decode('ChoExtension','ChoExt2',lists:flatten(Bytes3)),
-
- ?line {ok,Bytes4} = asn1_wrapper:encode('ChoExtension','ChoExt2',{'ChoExt2',{int,33}}),
- ?line {ok,{int,33}} =
- asn1_wrapper:decode('ChoExtension','ChoExt2',lists:flatten(Bytes4)),
+ roundtrip('ChoExt2', {bool,true}),
+ roundtrip('ChoExt2', {int,33}),
+ roundtrip('ChoExt3', {bool,true}),
+ roundtrip('ChoExt3', {int,33}),
+ roundtrip('ChoExt4', {str,"abc"}),
- ?line {ok,Bytes5} = asn1_wrapper:encode('ChoExtension','ChoExt3',{'ChoExt3',{bool,true}}),
- ?line {ok,{bool,true}} =
- asn1_wrapper:decode('ChoExtension','ChoExt3',lists:flatten(Bytes5)),
-
- ?line {ok,Bytes6} = asn1_wrapper:encode('ChoExtension','ChoExt3',{'ChoExt3',{int,33}}),
- ?line {ok,{int,33}} =
- asn1_wrapper:decode('ChoExtension','ChoExt3',lists:flatten(Bytes6)),
-
- Val7 = {str,"abc"},
- ?line {ok,Bytes7} = asn1_wrapper:encode('ChoExtension','ChoExt4',Val7),
- ?line {ok,Val7} = asn1_wrapper:decode('ChoExtension','ChoExt4',lists:flatten(Bytes7)),
+ ok.
+roundtrip(Type, Value) ->
+ {ok,Encoded} = 'ChoExtension':encode(Type, Value),
+ {ok,Value} = 'ChoExtension':decode(Type, Encoded),
ok.
diff --git a/lib/asn1/test/testChoExternal.erl b/lib/asn1/test/testChoExternal.erl
index b2d171f9c7..5fdee48add 100644
--- a/lib/asn1/test/testChoExternal.erl
+++ b/lib/asn1/test/testChoExternal.erl
@@ -38,62 +38,27 @@ compile(Config, Rules, Optimize) ->
external(_Rules) ->
+ roundtrip('ChoXCho', {boolCho,true}),
+ roundtrip('ChoXCho', {intCho,77}),
- ?line {ok,Bytes11} = asn1_wrapper:encode('ChoExternal','ChoXCho',{'ChoXCho',{boolCho,true}}),
- ?line {ok,{boolCho,true}} = asn1_wrapper:decode('ChoExternal','ChoXCho',lists:flatten(Bytes11)),
-
-
- ?line {ok,Bytes12} = asn1_wrapper:encode('ChoExternal','ChoXCho',{'ChoXCho',{intCho,77}}),
- ?line {ok,{intCho,77}} = asn1_wrapper:decode('ChoExternal','ChoXCho',lists:flatten(Bytes12)),
-
-
-
- ?line {ok,Bytes21} = asn1_wrapper:encode('ChoExternal','ChoXBool',{'ChoXBool',{xbool,true}}),
- ?line {ok,{xbool,true}} = asn1_wrapper:decode('ChoExternal','ChoXBool',lists:flatten(Bytes21)),
-
-
- ?line {ok,Bytes22} = asn1_wrapper:encode('ChoExternal','ChoXBool',{'ChoXBool',{xboolImp,true}}),
- ?line {ok,{xboolImp,true}} = asn1_wrapper:decode('ChoExternal','ChoXBool',lists:flatten(Bytes22)),
-
-
- ?line {ok,Bytes23} = asn1_wrapper:encode('ChoExternal','ChoXBool',{'ChoXBool',{xboolExp,true}}),
- ?line {ok,{xboolExp,true}} = asn1_wrapper:decode('ChoExternal','ChoXBool',lists:flatten(Bytes23)),
-
-
-
- ?line {ok,Bytes31} = asn1_wrapper:encode('ChoExternal','NT',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','NT',lists:flatten(Bytes31)),
-
- ?line {ok,Bytes32} = asn1_wrapper:encode('ChoExternal','Exp',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','Exp',lists:flatten(Bytes32)),
-
- ?line {ok,Bytes33} = asn1_wrapper:encode('ChoExternal','NTNT',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','NTNT',lists:flatten(Bytes33)),
-
- ?line {ok,Bytes34} = asn1_wrapper:encode('ChoExternal','NTExp',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','NTExp',lists:flatten(Bytes34)),
-
- ?line {ok,Bytes35} = asn1_wrapper:encode('ChoExternal','ExpNT',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','ExpNT',lists:flatten(Bytes35)),
-
- ?line {ok,Bytes36} = asn1_wrapper:encode('ChoExternal','ExpExp',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','ExpExp',lists:flatten(Bytes36)),
-
-
-
-
-
- ?line {ok,Bytes41} = asn1_wrapper:encode('ChoExternal','XNTNT',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','XNTNT',lists:flatten(Bytes41)),
-
- ?line {ok,Bytes42} = asn1_wrapper:encode('ChoExternal','XNTExp',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','XNTExp',lists:flatten(Bytes42)),
-
- ?line {ok,Bytes43} = asn1_wrapper:encode('ChoExternal','XExpNT',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','XExpNT',lists:flatten(Bytes43)),
-
- ?line {ok,Bytes44} = asn1_wrapper:encode('ChoExternal','XExpExp',{os,"kalle"}),
- ?line {ok,{os,"kalle"}} = asn1_wrapper:decode('ChoExternal','XExpExp',lists:flatten(Bytes44)),
+ roundtrip('ChoXBool', {xbool,true}),
+ roundtrip('ChoXBool', {xboolImp,true}),
+ roundtrip('ChoXBool', {xboolExp,true}),
+
+ roundtrip('NT', {os,"kalle"}),
+ roundtrip('Exp', {os,"kalle"}),
+ roundtrip('NTNT', {os,"kalle"}),
+ roundtrip('NTExp', {os,"kalle"}),
+ roundtrip('ExpNT', {os,"kalle"}),
+ roundtrip('ExpExp', {os,"kalle"}),
+ roundtrip('XNTNT', {os,"kalle"}),
+ roundtrip('XNTExp', {os,"kalle"}),
+ roundtrip('XExpNT', {os,"kalle"}),
+ roundtrip('XExpExp', {os,"kalle"}),
ok.
+roundtrip(Type, Value) ->
+ {ok,Encoded} = 'ChoExternal':encode(Type, Value),
+ {ok,Value} = 'ChoExternal':decode(Type, Encoded),
+ ok.
diff --git a/lib/asn1/test/testChoRecursive.erl b/lib/asn1/test/testChoRecursive.erl
index 22be26cbce..ee26d124a9 100644
--- a/lib/asn1/test/testChoRecursive.erl
+++ b/lib/asn1/test/testChoRecursive.erl
@@ -28,38 +28,21 @@
-record('ChoRec2_something',{a, b, c}).
recursive(_Rules) ->
-
- ?line {ok,Bytes11} = asn1_wrapper:encode('ChoRecursive','ChoRec',{'ChoRec',{something,
- #'ChoRec_something'{a = 77,
- b = "some octets here",
- c = {'ChoRec',{nothing,'NULL'}}}}}),
- ?line {ok,{something,{'ChoRec_something',77,"some octets here",{nothing,'NULL'}}}} =
- asn1_wrapper:decode('ChoRecursive','ChoRec',lists:flatten(Bytes11)),
-
-
- ?line {ok,Bytes12} = asn1_wrapper:encode('ChoRecursive','ChoRec',{'ChoRec',{nothing,'NULL'}}),
- ?line {ok,{nothing,'NULL'}} =
- asn1_wrapper:decode('ChoRecursive','ChoRec',lists:flatten(Bytes12)),
-
-
-
- ?line {ok,Bytes21} =
- asn1_wrapper:encode('ChoRecursive','ChoRec2',{'ChoRec2',
- {something,
- #'ChoRec2_something'{a = 77,
- b = "some octets here",
- c = {'ChoRec2',
- {nothing,'NULL'}}}}}),
- ?line {ok,{something,{'ChoRec2_something',77,"some octets here",{nothing,'NULL'}}}} =
- asn1_wrapper:decode('ChoRecursive','ChoRec2',lists:flatten(Bytes21)),
-
-
- ?line {ok,Bytes22} =
- asn1_wrapper:encode('ChoRecursive','ChoRec2',{'ChoRec2',{nothing,'NULL'}}),
- ?line {ok,{nothing,'NULL'}} =
- asn1_wrapper:decode('ChoRecursive','ChoRec2',lists:flatten(Bytes22)),
-
-
-
-
+ roundtrip('ChoRec',
+ {something,
+ #'ChoRec_something'{a = 77,
+ b = "some octets here",
+ c = {nothing,'NULL'}}}),
+ roundtrip('ChoRec', {nothing,'NULL'}),
+ roundtrip('ChoRec2',
+ {something,
+ #'ChoRec2_something'{a = 77,
+ b = "some octets here",
+ c = {nothing,'NULL'}}}),
+ roundtrip('ChoRec2', {nothing,'NULL'}),
+ ok.
+
+roundtrip(Type, Value) ->
+ {ok,Encoded} = 'ChoRecursive':encode(Type, Value),
+ {ok,Value} = 'ChoRecursive':decode(Type, Encoded),
ok.
diff --git a/lib/asn1/test/testCompactBitString.erl b/lib/asn1/test/testCompactBitString.erl
index db102a3bda..96d9f0fdcb 100644
--- a/lib/asn1/test/testCompactBitString.erl
+++ b/lib/asn1/test/testCompactBitString.erl
@@ -22,240 +22,132 @@
-export([compact_bit_string/1, bit_string_unnamed/1,otp_4869/1,
ticket_7734/1]).
--include_lib("test_server/include/test_server.hrl").
-
compact_bit_string(Rules) ->
%%==========================================================
%% Bs1 ::= BIT STRING
%%==========================================================
- ?line {ok,Bytes1} = asn1_wrapper:encode('PrimStrings','Bs1',0),
- ?line {ok,{0,<<>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes1)),
-
- ?line {ok,Bytes2} = asn1_wrapper:encode('PrimStrings','Bs1',4),
- ?line {ok,{5,<<32>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes2)),
-
- ?line {ok,Bytes3} = asn1_wrapper:encode('PrimStrings','Bs1',15),
- ?line {ok,{4,<<240>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes3)),
-
- ?line {ok,Bytes4} = asn1_wrapper:encode('PrimStrings','Bs1',255),
- ?line {ok,{0,<<255>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes4)),
-
- ?line {ok,Bytes5} = asn1_wrapper:encode('PrimStrings','Bs1',256),
- ?line {ok,{7,<<0,128>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes5)),
-
- ?line {ok,Bytes6} = asn1_wrapper:encode('PrimStrings','Bs1',257),
- ?line {ok,{7,<<128,128>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes6)),
-
- ?line {ok,Bytes7} = asn1_wrapper:encode('PrimStrings','Bs1',444),
- ?line {ok,{7,<<61,128>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes7)),
-
- ?line {ok,Bytes8} = asn1_wrapper:encode('PrimStrings','Bs1',
- 12345678901234567890),
- ?line {ok,_} = asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes8)),
-
-%% Removed due to beam cannot handle this big integers
-%% Bs1_1 = 123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890,
-%% ?line {ok,Bytes9} = asn1_wrapper:encode('PrimStrings','Bs1',Bs1_1),
-%% ?line {ok,_} = asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes9)),
-
-%% Bs1_2 = 12345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890123456789012345678901234567890,
-%% ?line {ok,Bytes10} = asn1_wrapper:encode('PrimStrings','Bs1',Bs1_2),
-%% ?line {ok,_} = asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes10)),
-
- ?line {ok,Bytes11} = asn1_wrapper:encode('PrimStrings','Bs1',
- [1,1,1,1,1,1,1,1]),
- ?line {ok,{0,<<255>>}} = asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes11)),
-
- ?line {ok,Bytes12} = asn1_wrapper:encode('PrimStrings',
- 'Bs1',
- [0,1,0,0,1,0]),
- ?line {ok,{2,<<72>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes12)),
-
- ?line {ok,Bytes13} =
- asn1_wrapper:encode('PrimStrings', 'Bs1',
- [1,0,0,0,0,0,0,0,0]),
- ?line {ok,{7,<<128,0>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes13)),
-
-
- ?line {ok,Bytes14} =
- asn1_wrapper:encode('PrimStrings','Bs1',
- [0,1,0,0,1,0,1,1,1,1,1,0,0,0,1,0,0,1,1]),
- ?line {ok,{5,<<75,226,96>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes14)),
-
-
- ?line case asn1_wrapper:erule(Rules) of
- ber ->
- ?line Bytes15 = [35,8,3,2,0,73,3,2,4,32],
- ?line {ok,{4,<<73,32>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes15)),
-
- ?line Bytes16 = [35,9,3,2,0,234,3,3,7,156,0],
- ?line {ok,{7,<<234,156,0>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes16)),
-
- ?line Bytes17 = [35,128,3,2,0,73,3,2,4,32,0,0],
- ?line {ok,{4,<<73,32>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes17)),
-
- ?line Bytes18 = [35,128,3,2,0,234,3,3,7,156,0,0,0],
- ?line {ok,{7,<<234,156,0>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',
- lists:flatten(Bytes18)),
- ok;
-
- per ->
- ok
- end,
+ roundtrip('Bs1', 0, {0,<<>>}),
+ roundtrip('Bs1', 4, {5,<<2#00100000>>}),
+ roundtrip('Bs1', 15, {4,<<2#11110000>>}),
+ roundtrip('Bs1', 255, {0,<<2#11111111>>}),
+ roundtrip('Bs1', 256, {7,<<16#00,16#80>>}),
+ roundtrip('Bs1', 257, {7,<<16#80,16#80>>}),
+ roundtrip('Bs1', 444, {7,<<16#3D,16#80>>}),
+ roundtrip('Bs1', 12345678901234567890,
+ {0,<<75,80,248,215,49,149,42,213>>}),
+
+ roundtrip('Bs1', [1,1,1,1,1,1,1,1], {0,<<255>>}),
+ roundtrip('Bs1', [0,1,0,0,1,0], {2,<<16#48>>}),
+ roundtrip('Bs1', [1,0,0,0,0,0,0,0,0], {7,<<16#80,0>>}),
+ roundtrip('Bs1', [0,1,0,0,1,0,1,1,1,1,1,0,0,0,1,0,0,1,1],
+ {5,<<75,226,96>>}),
- %% The following case to test OTP-4200
- ?line {ok,Bytes19} =
- asn1_wrapper:encode('PrimStrings','Bs1',{0,<<0,0,1,1>>}),
- ?line {ok,{0,<<0,0,1,1>>}} =
- asn1_wrapper:decode('PrimStrings','Bs1',lists:flatten(Bytes19)),
+ case Rules of
+ ber ->
+ {ok,{4,<<73,32>>}} =
+ 'PrimStrings':decode('Bs1', <<35,8,3,2,0,73,3,2,4,32>>),
+ {ok,{7,<<234,156,0>>}} =
+ 'PrimStrings':decode('Bs1', <<35,9,3,2,0,234,3,3,7,156,0>>),
+ {ok,{4,<<73,32>>}} =
+ 'PrimStrings':decode('Bs1', <<35,128,3,2,0,73,3,2,4,32,0,0>>),
+ {ok,{7,<<234,156,0>>}} =
+ 'PrimStrings':decode('Bs1',
+ <<35,128,3,2,0,234,3,3,7,156,0,0,0>>);
+ _ ->
+ ok
+ end,
+
+ %% Test OTP-4200
+ roundtrip('Bs1', {0,<<0,0,1,1>>}),
%%==========================================================
%% Bs2 ::= BIT STRING {su(0), mo(1), tu(2), we(3), th(4), fr(5), sa(6) } (SIZE (7))
%%==========================================================
-
- ?line {ok,Bytes21} = asn1_wrapper:encode('PrimStrings','Bs2',[mo,tu,fr]),
- ?line {ok,[mo,tu,fr]} = asn1_wrapper:decode('PrimStrings','Bs2',lists:flatten(Bytes21)),
-
- ?line {ok,Bytes22} = asn1_wrapper:encode('PrimStrings','Bs2',[0,1,1,0,0,1,0]),
- ?line {ok,[mo,tu,fr]} = asn1_wrapper:decode('PrimStrings','Bs2',lists:flatten(Bytes22)),
-
- % ?line case asn1_wrapper:erule(Rules) of
-% ber ->
-% ?line {ok,[mo,tu,fr,su,mo,th]} =
-% asn1_wrapper:decode('PrimStrings','Bs2',[35,8,3,2,1,100,3,2,2,200]),
-
-% ?line {ok,[mo,tu,fr,su,mo,th]} =
-% asn1_wrapper:decode('PrimStrings','Bs2',[35,128,3,2,1,100,3,2,2,200,0,0]),
-% ok;
-
-% per ->
-% ok
-% end,
-
-
+
+ roundtrip('Bs2', [mo,tu,fr]),
+ roundtrip('Bs2', [0,1,1,0,0,1,0], [mo,tu,fr]),
%%==========================================================
%% Bs3 ::= BIT STRING {su(0), mo(1), tu(2), we(3), th(4), fr(5), sa(6) } (SIZE (1..7))
%%==========================================================
- ?line {ok,Bytes31} = asn1_wrapper:encode('PrimStrings','Bs3',[mo,tu,fr]),
- ?line {ok,[mo,tu,fr]} = asn1_wrapper:decode('PrimStrings','Bs3',lists:flatten(Bytes31)),
-
- ?line {ok,Bytes32} = asn1_wrapper:encode('PrimStrings','Bs3',[0,1,1,0,0,1,0]),
- ?line {ok,[mo,tu,fr]} = asn1_wrapper:decode('PrimStrings','Bs3',lists:flatten(Bytes32)),
-
-
+ roundtrip('Bs3', [mo,tu,fr]),
+ roundtrip('Bs3', [0,1,1,0,0,1,0], [mo,tu,fr]),
%%==========================================================
%% BsPri ::= [PRIVATE 61] BIT STRING
%%==========================================================
-
- ?line {ok,Bytes41} = asn1_wrapper:encode('PrimStrings','BsPri',45),
- ?line {ok,{2,<<180>>}} =
- asn1_wrapper:decode('PrimStrings','BsPri',lists:flatten(Bytes41)),
-
- ?line {ok,Bytes42} = asn1_wrapper:encode('PrimStrings','BsPri',211),
- ?line {ok,{0,<<203>>}} =
- asn1_wrapper:decode('PrimStrings','BsPri',lists:flatten(Bytes42)),
-
- ?line case asn1_wrapper:erule(Rules) of
- ber ->
- ?line {ok,{5,<<75,226,96>>}} =
- asn1_wrapper:decode('PrimStrings','BsPri',
- [223,61,4,5,75,226,96]),
-
- ?line {ok,{5,<<75,226,96>>}} =
- asn1_wrapper:decode('PrimStrings','BsPri',
- [255,61,128,3,4,5,75,226,96,0,0]),
-
- ?line {ok,{5,<<75,226,96>>}} =
- asn1_wrapper:decode('PrimStrings','BsPri',
- [255,61,9,3,2,0,75,3,3,5,226,96]),
-
- ?line {ok,{5,<<75,226,96>>}} =
- asn1_wrapper:decode('PrimStrings','BsPri',
- [255,61,128,3,2,0,75,3,3,5,226,96,0,0]),
- ok;
-
- per ->
- ok
- end,
-
+
+ roundtrip('BsPri', 45, {2,<<180>>}),
+ roundtrip('BsPri', 211, {0,<<203>>}),
+
+ case Rules of
+ ber ->
+ {ok,{5,<<75,226,96>>}} =
+ 'PrimStrings':decode('BsPri',
+ <<223,61,4,5,75,226,96>>),
+
+ {ok,{5,<<75,226,96>>}} =
+ 'PrimStrings':decode('BsPri',
+ <<255,61,128,3,4,5,75,226,96,0,0>>),
+
+ {ok,{5,<<75,226,96>>}} =
+ 'PrimStrings':decode('BsPri',
+ <<255,61,9,3,2,0,75,3,3,5,226,96>>),
+
+ {ok,{5,<<75,226,96>>}} =
+ 'PrimStrings':decode('BsPri',
+ <<255,61,128,3,2,0,75,3,3,5,226,96,0,0>>),
+ ok;
+ _ ->
+ ok
+ end,
%%==========================================================
%% BsExpPri ::= [PRIVATE 61] EXPLICIT BIT STRING
%%==========================================================
-
- ?line {ok,Bytes51} = asn1_wrapper:encode('PrimStrings','BsExpPri',45),
- ?line {ok,{2,<<180>>}} =
- asn1_wrapper:decode('PrimStrings','BsExpPri',lists:flatten(Bytes51)),
-
- ?line {ok,Bytes52} = asn1_wrapper:encode('PrimStrings','BsExpPri',211),
- ?line {ok,{0,<<203>>}} =
- asn1_wrapper:decode('PrimStrings','BsExpPri',lists:flatten(Bytes52)),
-
- ?line case asn1_wrapper:erule(Rules) of
- ber ->
- ?line {ok,{5,<<75,226,96>>}} =
- asn1_wrapper:decode('PrimStrings','BsExpPri',[255,61,6,3,4,5,75,226,96]),
- ok;
-
- per ->
- ok
- end,
-
- ok.
-ticket_7734(per) ->
- ?line BS = {0,list_to_binary(lists:duplicate(128,0))},
- ?line {ok,BSEnc} = asn1_wrapper:encode('PrimStrings','BS1024',BS),
- ?line {ok,BS} = asn1_wrapper:decode('PrimStrings','BS1024',BSEnc).
+ roundtrip('BsExpPri', 45, {2,<<180>>}),
+ roundtrip('BsExpPri', 211, {0,<<203>>}),
-bit_string_unnamed(Rules) ->
- case asn1_wrapper:erule(Rules) of
+ case Rules of
ber ->
- ok;
- per ->
- ?line {ok,Bytes1} =
- asn1_wrapper:encode('PrimStrings','TransportLayerAddress',
- [0,1,1,0]),
- ?line {ok,{4,<<96>>}} =
- asn1_wrapper:decode('PrimStrings','TransportLayerAddress',
- lists:flatten(Bytes1))
- end.
+ {ok,{5,<<75,226,96>>}} =
+ 'PrimStrings':decode('BsExpPri', <<255,61,6,3,4,5,75,226,96>>);
+ _ ->
+ ok
+ end,
-otp_4869(per) ->
- ?line Val1={'IP',[0],{0,<<62,235,90,50,0,0,0,0,0,0,0,0,0,0,0,0>>},asn1_NOVALUE},
- ?line Val2 = {'IP',[0],[0,0,1,1,1,1,1,0,1,1,1,0,1,0,1,1,0,1,0,1,1,0,1,0,0,0,1,1,0,0,1,0] ++ lists:duplicate(128 - 32,0),asn1_NOVALUE},
+ ok.
+
+ticket_7734(_) ->
+ BS = {0,list_to_binary(lists:duplicate(128, 0))},
+ roundtrip('BS1024', BS).
- ?line {ok,Bytes1} = asn1_wrapper:encode('Constraints','IP',Val1),
- ?line {ok,Bytes1} = asn1_wrapper:encode('Constraints','IP',Val2);
+bit_string_unnamed(_Rules) ->
+ roundtrip('TransportLayerAddress', [0,1,1,0], {4,<<96>>}).
+
+otp_4869(per) ->
+ Val1 = {'IP',[0],{0,<<62,235,90,50,0,0,0,0,0,0,0,0,0,0,0,0>>},asn1_NOVALUE},
+ Val2 = {'IP',[0],[0,0,1,1,1,1,1,0,1,1,1,0,1,0,1,1,0,1,0,1,1,0,
+ 1,0,0,0,1,1,0,0,1,0] ++
+ lists:duplicate(128 - 32, 0),asn1_NOVALUE},
+ {ok,Encoded} = 'Constraints':encode('IP', Val1),
+ {ok,Encoded} = 'Constraints':encode('IP', Val2),
+ ok;
otp_4869(_) ->
ok.
+
+roundtrip(Type, Val) ->
+ roundtrip_1('PrimStrings', Type, Val, Val).
+
+roundtrip(Type, Val1, Val2) ->
+ roundtrip_1('PrimStrings', Type, Val1, Val2).
+
+roundtrip_1(Mod, Type, In, Out) ->
+ {ok,Encoded} = Mod:encode(Type, In),
+ {ok,Out} = Mod:decode(Type, Encoded),
+ ok.
diff --git a/lib/asn1/test/testConstraints.erl b/lib/asn1/test/testConstraints.erl
index 543c106e8a..c8d9008641 100644
--- a/lib/asn1/test/testConstraints.erl
+++ b/lib/asn1/test/testConstraints.erl
@@ -30,59 +30,20 @@ int_constraints(Rules) ->
%% SingleValue ::= INTEGER (1)
%%==========================================================
- ?line {ok,Bytes1} = asn1_wrapper:encode('Constraints','SingleValue',1),
- ?line {ok,1} = asn1_wrapper:decode('Constraints','SingleValue',
- lists:flatten(Bytes1)),
-
- ?line case asn1_wrapper:erule(Rules) of
- ber ->
- ?line {ok,Bytes2} =
- asn1_wrapper:encode('Constraints','SingleValue',0),
- ?line {error,{asn1,{integer_range,_,0}}} =
- asn1_wrapper:decode('Constraints','SingleValue',
- lists:flatten(Bytes2)),
- ?line {ok,Bytes3} =
- asn1_wrapper:encode('Constraints','SingleValue',1000),
- ?line {error,{asn1,{integer_range,_,1000}}} =
- asn1_wrapper:decode('Constraints','SingleValue',
- lists:flatten(Bytes3));
- per ->
- ?line {error,_Reason1} =
- asn1_wrapper:encode('Constraints','SingleValue',0),
- ?line {error,_Reason2} =
- asn1_wrapper:encode('Constraints','SingleValue',1000)
- end,
+ range_error(Rules, 'SingleValue', 0),
+ roundtrip('SingleValue', 1),
+ range_error(Rules, 'SingleValue', 2),
+ range_error(Rules, 'SingleValue', 1000),
%%==========================================================
%% SingleValue2 ::= INTEGER (1..20)
%%==========================================================
- ?line {ok,Bytes4} = asn1_wrapper:encode('Constraints','SingleValue2',1),
- ?line {ok,1} = asn1_wrapper:decode('Constraints','SingleValue2',
- lists:flatten(Bytes4)),
-
- ?line {ok,Bytes5} = asn1_wrapper:encode('Constraints','SingleValue2',20),
- ?line {ok,20} = asn1_wrapper:decode('Constraints','SingleValue2',
- lists:flatten(Bytes5)),
-
- ?line case asn1_wrapper:erule(Rules) of
- ber ->
- ?line {ok,Bytes6} =
- asn1_wrapper:encode('Constraints','SingleValue2',0),
- ?line {error,{asn1,{integer_range,{1,20},0}}} =
- asn1_wrapper:decode('Constraints','SingleValue2',
- lists:flatten(Bytes6)),
- ?line {ok,Bytes7} =
- asn1_wrapper:encode('Constraints','SingleValue2',21),
- ?line {error,{asn1,{integer_range,{1,20},21}}} =
- asn1_wrapper:decode('Constraints','SingleValue2',
- lists:flatten(Bytes7));
- per ->
- ?line {error,_Reason3} =
- asn1_wrapper:encode('Constraints','SingleValue',0),
- ?line {error,_Reason4} =
- asn1_wrapper:encode('Constraints','SingleValue',1000)
- end,
+ range_error(Rules, 'SingleValue2', 0),
+ roundtrip('SingleValue2', 1),
+ roundtrip('SingleValue2', 20),
+ range_error(Rules, 'SingleValue2', 21),
+ range_error(Rules, 'SingleValue2', 1000),
%%==========================================================
%% SingleValue3 ::= INTEGER (Predefined | 5 | 10)
@@ -90,136 +51,106 @@ int_constraints(Rules) ->
%% where one value is predefined.
%%==========================================================
- ?line {ok,BytesSV3} = asn1_wrapper:encode('Constraints','SingleValue3',1),
- ?line {ok,1} = asn1_wrapper:decode('Constraints','SingleValue3',
- lists:flatten(BytesSV3)),
- ?line {ok,BytesSV3_2} = asn1_wrapper:encode('Constraints','SingleValue3',5),
- ?line {ok,5} = asn1_wrapper:decode('Constraints','SingleValue3',
- lists:flatten(BytesSV3_2)),
- ?line {ok,BytesSV3_3} = asn1_wrapper:encode('Constraints','SingleValue3',10),
- ?line {ok,10} = asn1_wrapper:decode('Constraints','SingleValue3',
- lists:flatten(BytesSV3_3)),
+ roundtrip('SingleValue3', 1),
+ roundtrip('SingleValue3', 5),
+ roundtrip('SingleValue3', 10),
%%==========================================================
%% Range2to19 ::= INTEGER (1<..<20)
%%==========================================================
- ?line {ok,Bytes8} = asn1_wrapper:encode('Constraints','Range2to19',2),
- ?line {ok,2} = asn1_wrapper:decode('Constraints','Range2to19',lists:flatten(Bytes8)),
-
- ?line {ok,Bytes9} = asn1_wrapper:encode('Constraints','Range2to19',19),
- ?line {ok,19} = asn1_wrapper:decode('Constraints','Range2to19',lists:flatten(Bytes9)),
-
- ?line case asn1_wrapper:erule(Rules) of
- ber ->
- ?line {ok,Bytes10} =
- asn1_wrapper:encode('Constraints','Range2to19',1),
- ?line {error,{asn1,{integer_range,{2,19},1}}} =
- asn1_wrapper:decode('Constraints','Range2to19',
- lists:flatten(Bytes10)),
- ?line {ok,Bytes11} =
- asn1_wrapper:encode('Constraints','Range2to19',20),
- ?line {error,{asn1,{integer_range,{2,19},20}}} =
- asn1_wrapper:decode('Constraints','Range2to19',
- lists:flatten(Bytes11));
- per ->
- ?line {error,_Reason5} =
- asn1_wrapper:encode('Constraints','Range2to19',1),
- ?line {error,_Reason6} =
- asn1_wrapper:encode('Constraints','Range2to19',20)
- end,
+ range_error(Rules, 'Range2to19', 1),
+ roundtrip('Range2to19', 2),
+ roundtrip('Range2to19', 19),
+ range_error(Rules, 'Range2to19', 20),
%%==========================================================
%% Tests for Range above 16^4 up to maximum supported by asn1 assuming the
%% octet length field is encoded on max 8 bits
%%==========================================================
LastNumWithoutLengthEncoding = 65536,
- ?line {ok,BytesFoo} = asn1_wrapper:encode('Constraints','Range256to65536',
- LastNumWithoutLengthEncoding),
- ?line {ok,LastNumWithoutLengthEncoding} =
- asn1_wrapper:decode('Constraints','Range256to65536',lists:flatten(BytesFoo)),
+ roundtrip('Range256to65536', LastNumWithoutLengthEncoding),
FirstNumWithLengthEncoding = 65537,
- ?line {ok,BytesBar} = asn1_wrapper:encode('LargeConstraints','RangeMax',
- FirstNumWithLengthEncoding),
- ?line {ok,FirstNumWithLengthEncoding} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesBar)),
+ roundtrip('LargeConstraints', 'RangeMax', FirstNumWithLengthEncoding),
FirstNumOver16_6 = 16777217,
- ?line {ok, BytesBaz} =
- asn1_wrapper:encode('LargeConstraints','RangeMax', FirstNumOver16_6),
- ?line {ok, FirstNumOver16_6} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesBaz)),
+ roundtrip('LargeConstraints', 'RangeMax', FirstNumOver16_6),
FirstNumOver16_8 = 4294967297,
- ?line {ok, BytesQux} =
- asn1_wrapper:encode('LargeConstraints','RangeMax', FirstNumOver16_8),
- ?line {ok, FirstNumOver16_8} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesQux)),
+ roundtrip('LargeConstraints', 'RangeMax', FirstNumOver16_8),
FirstNumOver16_10 = 1099511627776,
- ?line {ok, BytesBur} =
- asn1_wrapper:encode('LargeConstraints','RangeMax', FirstNumOver16_10),
- ?line {ok, FirstNumOver16_10} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesBur)),
+ roundtrip('LargeConstraints', 'RangeMax', FirstNumOver16_10),
FirstNumOver16_10 = 1099511627776,
- ?line {ok, BytesBur} =
- asn1_wrapper:encode('LargeConstraints','RangeMax', FirstNumOver16_10),
- ?line {ok, FirstNumOver16_10} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesBur)),
+ roundtrip('LargeConstraints', 'RangeMax', FirstNumOver16_10),
HalfMax = 1 bsl (128*8),
- ?line {ok, BytesHalfMax} =
- asn1_wrapper:encode('LargeConstraints','RangeMax', HalfMax),
- ?line {ok, HalfMax} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesHalfMax)),
+ roundtrip('LargeConstraints', 'RangeMax', HalfMax),
Max = 1 bsl (255*8),
- ?line {ok, BytesMax} =
- asn1_wrapper:encode('LargeConstraints','RangeMax', Max),
- ?line {ok, Max} =
- asn1_wrapper:decode('LargeConstraints','RangeMax',lists:flatten(BytesMax)),
+ roundtrip('LargeConstraints', 'RangeMax', Max),
%% Random number within longlong range
LongLong = 12672809400538808320,
- ?line {ok, BytesLongLong} =
- asn1_wrapper:encode('Constraints','LongLong', LongLong),
- ?line {ok, LongLong} =
- asn1_wrapper:decode('Constraints','LongLong',lists:flatten(BytesLongLong)),
+ roundtrip('LongLong', LongLong),
%%==========================================================
%% Constraint Combinations (Duboisson p. 285)
%% I ::= INTEGER (0|15..269)
%%==========================================================
- ?line {ok,Bytes12} = asn1_wrapper:encode('Constraints','I',0),
- ?line {ok,0} = asn1_wrapper:decode('Constraints','I',Bytes12),
- ?line {ok,Bytes13} = asn1_wrapper:encode('Constraints','I',20),
- ?line {ok,20} = asn1_wrapper:decode('Constraints','I',Bytes13),
+ range_error(Rules, 'I', -1),
+ roundtrip('I', 0),
+ roundtrip('I', 15),
+ roundtrip('I', 20),
+ roundtrip('I', 269),
+ range_error(Rules, 'I', 270),
%%==========================================================
%% Constraint Combinations (Duboisson p. 285)
%% X1 ::= INTEGER (1..4|8|10|20)
%%==========================================================
- ?line {ok,Bytes14} = asn1_wrapper:encode('Constraints','X1',1),
- ?line {ok,1} = asn1_wrapper:decode('Constraints','X1',Bytes14),
- ?line {ok,Bytes15} = asn1_wrapper:encode('Constraints','X1',20),
- ?line {ok,20} = asn1_wrapper:decode('Constraints','X1',Bytes15),
+ range_error(Rules, 'X1', 0),
+ roundtrip('X1', 1),
+ roundtrip('X1', 4),
+ roundtrip('X1', 8),
+ roundtrip('X1', 10),
+ roundtrip('X1', 20),
+ range_error(Rules, 'X1', 21),
+
%%==========================================================
%% SIZE Constraint (Duboisson p. 268)
%% T ::= IA5String (SIZE (1|2, ..., SIZE (1|2|3)))
%% T2 ::= IA5String (SIZE (1|2, ..., 3))
%%==========================================================
- ?line {ok,Bytes16} = asn1_wrapper:encode('Constraints','T',"IA"),
- ?line {ok,"IA"} = asn1_wrapper:decode('Constraints','T',Bytes16),
- ?line {ok,Bytes17} = asn1_wrapper:encode('Constraints','T2',"IA"),
- ?line {ok,"IA"} = asn1_wrapper:decode('Constraints','T2',Bytes17).
-
+ roundtrip('T', "IA"),
+ roundtrip('T2', "IA").
refed_NNL_name(_Erule) ->
?line {ok,_} = asn1_wrapper:encode('Constraints','AnotherThing',fred),
?line {error,_Reason} =
asn1_wrapper:encode('Constraints','AnotherThing',fred3).
+
+roundtrip(Type, Value) ->
+ roundtrip('Constraints', Type, Value).
+
+roundtrip(Module, Type, Value) ->
+ {ok,Encoded} = Module:encode(Type, Value),
+ {ok,Value} = Module:decode(Type, Encoded),
+ ok.
+
+range_error(ber, Type, Value) ->
+ %% BER: Values outside the effective range should be rejected
+ %% on decode.
+ {ok,Encoded} = 'Constraints':encode(Type, Value),
+ {error,{asn1,{integer_range,_,_}}} = 'Constraints':decode(Type, Encoded),
+ ok;
+range_error(Per, Type, Value) when Per =:= per; Per =:= uper ->
+ %% (U)PER: Values outside the effective range should be rejected
+ %% on encode.
+ {error,_} = 'Constraints':encode(Type, Value),
+ ok.
diff --git a/lib/asn1/test/testDeepTConstr.erl b/lib/asn1/test/testDeepTConstr.erl
index aa3afbb58f..3df7bcbaa0 100644
--- a/lib/asn1/test/testDeepTConstr.erl
+++ b/lib/asn1/test/testDeepTConstr.erl
@@ -26,21 +26,19 @@
-include_lib("test_server/include/test_server.hrl").
main(_Erule) ->
- Val1 = {'FilterItem',
- {substrings,
- {'FilterItem_substrings',
- {2,6},
- [{initial,"SE"},
- {any,"DK"},
- {final,"N"}]}}},
+ Val1 = {substrings,
+ {'FilterItem_substrings',
+ {2,6},
+ [{initial,"SE"},
+ {any,"DK"},
+ {final,"N"}]}},
- Val2 = {'FilterItem',
- {substrings,
- {'FilterItem_substrings',
- {2,6},
- [{initial,"SE"},
- {any,"DK"},
- {final,"NO"}]}}},
+ Val2 = {substrings,
+ {'FilterItem_substrings',
+ {2,6},
+ [{initial,"SE"},
+ {any,"DK"},
+ {final,"NO"}]}},
?line {ok,Bytes1} =
asn1_wrapper:encode('TConstrChoice','FilterItem',Val1),
diff --git a/lib/asn1/test/testEnumExt.erl b/lib/asn1/test/testEnumExt.erl
index bb975a1d13..0811f20571 100644
--- a/lib/asn1/test/testEnumExt.erl
+++ b/lib/asn1/test/testEnumExt.erl
@@ -25,58 +25,41 @@
main(Rule) when Rule =:= per; Rule =:= uper ->
io:format("main(~p)~n",[Rule]),
- B32=[32],B64=[64],
+
%% ENUMERATED with extensionmark (value is in root set)
- ?line {ok,B32} = asn1_wrapper:encode('EnumExt','Ext',red),
- ?line {ok,red} = asn1_wrapper:decode('EnumExt','Ext',B32),
+ B32 = <<32>>,
+ B32 = roundtrip('Ext', red),
%% ENUMERATED with extensionmark (value is an extensionvalue)
- ?line {ok,Or} = asn1_wrapper:encode('EnumExt','Ext1',orange),
- ?line {ok,orange} = asn1_wrapper:decode('EnumExt','Ext1',Or),
+ Or = roundtrip('Ext1', orange),
%% unknown extensionvalue
- ?line {ok,{asn1_enum,0}} = asn1_wrapper:decode('EnumExt','Ext',Or),
-
+ {ok,{asn1_enum,0}} = asn1_wrapper:decode('EnumExt','Ext',Or),
%% ENUMERATED no extensionmark
- ?line {ok,B64} = asn1_wrapper:encode('EnumExt','Noext',red),
- ?line {ok,red} = asn1_wrapper:decode('EnumExt','Noext',B64),
+ B64 = <<64>>,
+ B64 = roundtrip('Noext', red),
ok;
main(ber) ->
io:format("main(ber)~n",[]),
%% ENUMERATED with extensionmark (value is in root set)
- ?line {ok,Bytes1} = asn1_wrapper:encode('EnumExt','Ext',red),
- ?line {ok,red} = asn1_wrapper:decode('EnumExt','Ext',lists:flatten(Bytes1)),
+ roundtrip('Ext', red),
%% value is an extensionvalue
- ?line {ok,Bytes1_1} = asn1_wrapper:encode('EnumExt','Ext1',orange),
- ?line {ok,{asn1_enum,7}} = asn1_wrapper:decode('EnumExt','Ext',lists:flatten(Bytes1_1)),
-%% ?line {ok,Bytes1_1} = asn1_wrapper:encode('EnumExt','Ext',{asn1_enum,7}),
+ {ok,Bytes1_1} = asn1_wrapper:encode('EnumExt','Ext1',orange),
+ {ok,{asn1_enum,7}} = asn1_wrapper:decode('EnumExt','Ext',lists:flatten(Bytes1_1)),
- %% ENUMERATED no extensionmark
- ?line {ok,Bytes2} = asn1_wrapper:encode('EnumExt','Noext',red),
- ?line {ok,red} = asn1_wrapper:decode('EnumExt','Noext',lists:flatten(Bytes2)),
+ %% ENUMERATED no extensionmark
+ roundtrip('Noext', red),
?line {error,{asn1,_}} = (catch asn1_wrapper:encode('EnumExt','Noext',orange)),
-%% ?line {error,{asn1,_}} = (catch asn1_wrapper:encode('EnumExt','Noext',{asn1_enum,7})),
- ok,
%% ENUMERATED with atom 'com'
- ?line {ok,Bytes3} = asn1_wrapper:encode('EnumExt','Globalstate',{'Globalstate',preop}),
- ?line {ok,preop} = asn1_wrapper:decode('EnumExt','Globalstate',
- lists:flatten(Bytes3)),
- ?line {ok,Bytes4} = asn1_wrapper:encode('EnumExt','Globalstate',{'Globalstate',com}),
- ?line {ok,com} = asn1_wrapper:decode('EnumExt','Globalstate',
- lists:flatten(Bytes4)).
-
-
-
-
-
-
-
-
-
-
-
+ roundtrip('Globalstate', preop),
+ roundtrip('Globalstate', com),
+ ok.
+roundtrip(Type, Value) ->
+ {ok,Encoded} = 'EnumExt':encode(Type, Value),
+ {ok,Value} = 'EnumExt':decode(Type, Encoded),
+ Encoded.
diff --git a/lib/asn1/test/testMergeCompile.erl b/lib/asn1/test/testMergeCompile.erl
index d63df28c31..8ef7ba3458 100644
--- a/lib/asn1/test/testMergeCompile.erl
+++ b/lib/asn1/test/testMergeCompile.erl
@@ -37,7 +37,7 @@ main(Erule) ->
%% test of RANAP.set.asn1
?line _PIEVal = [{'ProtocolIE-Field',4,ignore,{'Cause',{radioNetwork,{'CauseRadioNetwork','rab-pre-empted'}}}}],
- ?line PIEVal2 = [{'ProtocolIE-Field',4,ignore,{'Cause',{radioNetwork,'rab-pre-empted'}}}],
+ PIEVal2 = [{'ProtocolIE-Field',4,ignore,{radioNetwork,'rab-pre-empted'}}],
?line _PEVal = [{'ProtocolExtensionField',[0]}],
%% ?line EncVal = asn1rt_per_v1:encode_integer([],100),
?line EncVal =
diff --git a/lib/asn1/test/testParameterizedInfObj.erl b/lib/asn1/test/testParameterizedInfObj.erl
index 6f53595132..17108e285b 100644
--- a/lib/asn1/test/testParameterizedInfObj.erl
+++ b/lib/asn1/test/testParameterizedInfObj.erl
@@ -86,7 +86,7 @@ main(Erule) ->
ranap(_Erule) ->
- ?line PIEVal2 = [{'ProtocolIE-Field',4,ignore,{'Cause',{radioNetwork,'rab-pre-empted'}}}],
+ PIEVal2 = [{'ProtocolIE-Field',4,ignore,{radioNetwork,'rab-pre-empted'}}],
?line Val2 =
#'InitiatingMessage'{procedureCode=1,
criticality=ignore,
diff --git a/lib/asn1/test/testPrimStrings.erl b/lib/asn1/test/testPrimStrings.erl
index 9a640a2cb1..263d9e5ed2 100644
--- a/lib/asn1/test/testPrimStrings.erl
+++ b/lib/asn1/test/testPrimStrings.erl
@@ -372,6 +372,11 @@ octet_string(Rules) ->
end,
fragmented_octet_string(Rules),
+
+ S255 = lists:seq(1, 255),
+ FixedStrings = {'OsFixedStrings',true,"","1","12","345",true,
+ S255,[$a|S255],[$a,$b|S255],397},
+ roundtrip('OsFixedStrings', FixedStrings),
ok.
fragmented_octet_string(Erules) ->
diff --git a/lib/asn1/test/testSeqExtension.erl b/lib/asn1/test/testSeqExtension.erl
index 7c77ab87e9..1128d9a7c3 100644
--- a/lib/asn1/test/testSeqExtension.erl
+++ b/lib/asn1/test/testSeqExtension.erl
@@ -20,7 +20,7 @@
-module(testSeqExtension).
-include("External.hrl").
--export([main/1]).
+-export([main/2]).
-include_lib("test_server/include/test_server.hrl").
@@ -28,70 +28,73 @@
-record('SeqExt2',{bool, int}).
-record('SeqExt3',{bool, int}).
-record('SeqExt4',{bool, int}).
-
-
-main(_Rules) ->
-
- ?line {ok,Bytes11} =
- asn1_wrapper:encode('SeqExtension','SeqExt1',#'SeqExt1'{}),
- ?line {ok,{'SeqExt1'}} =
- asn1_wrapper:decode('SeqExtension','SeqExt1',lists:flatten(Bytes11)),
-
- ?line {ok,Bytes21} =
- asn1_wrapper:encode('SeqExtension','SeqExt2',#'SeqExt2'{bool = true,int = 99}),
- ?line {ok,{'SeqExt2',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt2',lists:flatten(Bytes21)),
-
- ?line {ok,Bytes22} =
- asn1_wrapper:encode('SeqExtension','SeqExt2',#'SeqExt2'{int = 99,bool = true}),
- ?line {ok,{'SeqExt2',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt2',lists:flatten(Bytes22)),
-
- ?line {ok,Bytes31} =
- asn1_wrapper:encode('SeqExtension','SeqExt3',#'SeqExt3'{bool = true,int = 99}),
- ?line {ok,{'SeqExt3',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt3',lists:flatten(Bytes31)),
-
- ?line {ok,Bytes32} =
- asn1_wrapper:encode('SeqExtension','SeqExt3',#'SeqExt3'{int = 99,bool = true}),
- ?line {ok,{'SeqExt3',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt3',lists:flatten(Bytes32)),
-
- ?line {ok,Bytes41} =
- asn1_wrapper:encode('SeqExtension','SeqExt4',#'SeqExt4'{bool = true,int = 99}),
- ?line {ok,{'SeqExt4',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt4',lists:flatten(Bytes41)),
-
- ?line {ok,Bytes42} =
- asn1_wrapper:encode('SeqExtension','SeqExt4',#'SeqExt4'{int = 99,bool = true}),
- ?line {ok,{'SeqExt4',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt4',lists:flatten(Bytes42)),
-
-
- % test of extension , not ready
-
- ?line {ok,BytesX11} =
- asn1_wrapper:encode('SeqExtension','SeqExt1',#'SeqExt1'{}),
- ?line {ok,{'SeqExt1'}} =
- asn1_wrapper:decode('SeqExtension','SeqExt1',lists:flatten(BytesX11)),
-
- ?line {ok,BytesX21} =
- asn1_wrapper:encode('SeqExtension','SeqExt2',#'SeqExt2'{bool = true,int = 99}),
- ?line {ok,{'SeqExt2',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt2',lists:flatten(BytesX21)),
-
- ?line {ok,BytesX22} =
- asn1_wrapper:encode('SeqExtension','SeqExt2',#'SeqExt2'{int = 99,bool = true}),
- ?line {ok,{'SeqExt2',true,99}} =
- asn1_wrapper:decode('SeqExtension','SeqExt2',lists:flatten(BytesX22)),
-
-
-
-
-
+-record('SeqExt5',{name, shoesize}).
+-record('SeqExt6',{i1,i2,i3,i4,i5,i6,i7}).
+-record('SuperSeq',{s1,s2,s3,s4,s5,s6,i}).
+
+main(DataDir, Opts) ->
+ roundtrip('SeqExt1', #'SeqExt1'{}),
+
+ roundtrip('SeqExt2', #'SeqExt2'{bool=true,int=99}),
+ roundtrip('SeqExt2', #'SeqExt2'{bool=false,int=42}),
+
+ roundtrip('SeqExt3', #'SeqExt3'{bool=true,int=-77777}),
+ roundtrip('SeqExt3', #'SeqExt3'{bool=false,int=-42000}),
+
+ roundtrip('SeqExt4', #'SeqExt4'{bool=true,int=12345}),
+ roundtrip('SeqExt4', #'SeqExt4'{bool=false,int=123456}),
+
+ roundtrip('SeqExt5', #'SeqExt5'{name="Arne",shoesize=47}),
+
+ %% Encode a value with this version of the specification.
+ BigInt = 128638468966,
+ SuperSeq = #'SuperSeq'{s1=#'SeqExt1'{},
+ s2=#'SeqExt2'{bool=true,int=2345},
+ s3=#'SeqExt3'{bool=false,int=17},
+ s4=#'SeqExt4'{bool=true,int=38739739},
+ s5=#'SeqExt5'{name="Arne",shoesize=47},
+ s6=#'SeqExt6'{i1=531,i2=601,i3=999,
+ i4=777,i5=11953,
+ i6=13553,i7=77777},
+ i=BigInt
+ },
+ {ok,SuperSeqEnc} = 'SeqExtension':encode('SuperSeq', SuperSeq),
+ {ok,SuperSeq} = 'SeqExtension':decode('SuperSeq', SuperSeqEnc),
+
+ %% Remove all extensions from the ASN.1 specification and compile it.
+ CaseDir = filename:dirname(code:which('SeqExtension')),
+ Asn1SrcBase = "SeqExtension.asn1",
+ Asn1SrcFile0 = filename:join(DataDir, Asn1SrcBase),
+ {ok,Src0} = file:read_file(Asn1SrcFile0),
+ %% Remove all declarations following "...," up to the end
+ %% of the SEQUENCE.
+ Src1 = re:replace(Src0, "[.][.][.],[^}]*", "...\n",
+ [global,{return,binary}]),
+ %% Remove the last double bracket group in the SEQUENCE.
+ Src = re:replace(Src1, ",\\s*\\[\\[.*?\\]\\]\\s*\\}", "\n}",
+ [global,{return,binary}]),
+ io:format("~s\n\n", [Src]),
+ Asn1SrcFile = filename:join(CaseDir, Asn1SrcBase),
+ ok = file:write_file(Asn1SrcFile, Src),
+ ok = asn1ct:compile(Asn1SrcFile,
+ [{i,DataDir},{outdir,CaseDir}|Opts]),
+
+ %% Decode the encoded sequence with the version of the spec
+ %% with no extensions following the extension marks
+ %% (except in SeqExt6). The integer 'i' at the end
+ %% of the sequence must still be the correct integer (otherwise
+ %% some extension has not been skipped correctly).
+ {ok,DecodedSuperSeq} = 'SeqExtension':decode('SuperSeq', SuperSeqEnc),
+ #'SuperSeq'{s1={'SeqExt1'},
+ s2=#'SeqExt2'{bool=true,int=2345},
+ s3={'SeqExt3'},
+ s4={'SeqExt4',true},
+ s5={'SeqExt5'},
+ s6={'SeqExt6',531,601,999,777,11953},
+ i=BigInt} = DecodedSuperSeq,
ok.
-
-
-
-
+roundtrip(Type, Value) ->
+ {ok,Encoded} = 'SeqExtension':encode(Type, Value),
+ {ok,Value} = 'SeqExtension':decode(Type, Encoded),
+ ok.
diff --git a/lib/asn1/test/testSetOptional.erl b/lib/asn1/test/testSetOptional.erl
index cef90bc843..bb43ff0a96 100644
--- a/lib/asn1/test/testSetOptional.erl
+++ b/lib/asn1/test/testSetOptional.erl
@@ -21,8 +21,7 @@
-include("External.hrl").
-export([main/1]).
--export([ticket_7533/1,decoder/4]).
--include_lib("test_server/include/test_server.hrl").
+-export([ticket_7533/1]).
-record('SetOpt1',{bool1 = asn1_NOVALUE, int1, set1 = asn1_NOVALUE}).
-record('SetOpt1Imp',{bool1 = asn1_NOVALUE, int1, set1 = asn1_NOVALUE}).
@@ -36,171 +35,64 @@
-record('SetIn',{boolIn, intIn}).
main(_Rules) ->
+ roundtrip('SetOpt1',
+ #'SetOpt1'{bool1=true,int1=15,
+ set1=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt1', #'SetOpt1'{int1=15}),
+
+ roundtrip('SetOpt2', #'SetOpt2'{bool2=true,int2=15,
+ set2=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt2', #'SetOpt2'{int2=15,bool2=true}),
+
+ roundtrip('SetOpt3', #'SetOpt3'{bool3=true,int3=15,
+ set3=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt3', #'SetOpt3'{int3=15}),
+
+ roundtrip('SetOpt1Imp',
+ #'SetOpt1Imp'{bool1=true,int1 = 15,
+ set1=#'SetIn'{boolIn = true,intIn = 66}}),
+ roundtrip('SetOpt1Imp', #'SetOpt1Imp'{int1=15}),
- ?line {ok,Bytes11} =
- asn1_wrapper:encode('SetOptional','SetOpt1',#'SetOpt1'{bool1 = true,
- int1 = 15,
- set1 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt1',true,15,{'SetIn',true,66}}} =
- asn1_wrapper:decode('SetOptional','SetOpt1',lists:flatten(Bytes11)),
-
-
- ?line {ok,Bytes12} = asn1_wrapper:encode('SetOptional','SetOpt1',#'SetOpt1'{int1 = 15}),
- ?line {ok,{'SetOpt1',asn1_NOVALUE,15,asn1_NOVALUE}} =
- asn1_wrapper:decode('SetOptional','SetOpt1',lists:flatten(Bytes12)),
-
-
- ?line {ok,Bytes21} =
- asn1_wrapper:encode('SetOptional','SetOpt2',#'SetOpt2'{bool2 = true,
- int2 = 15,
- set2 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt2',{'SetIn',true,66},true,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt2',lists:flatten(Bytes21)),
-
-
- ?line {ok,Bytes22} = asn1_wrapper:encode('SetOptional','SetOpt2',#'SetOpt2'{int2 = 15,
- bool2 = true}),
- ?line {ok,{'SetOpt2',asn1_NOVALUE,true,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt2',lists:flatten(Bytes22)),
-
-
-
- ?line {ok,Bytes31} =
- asn1_wrapper:encode('SetOptional','SetOpt3',#'SetOpt3'{bool3 = true,
- int3 = 15,
- set3 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt3',true,{'SetIn',true,66},15}} =
- asn1_wrapper:decode('SetOptional','SetOpt3',lists:flatten(Bytes31)),
-
-
- ?line {ok,Bytes32} = asn1_wrapper:encode('SetOptional','SetOpt3',#'SetOpt3'{int3 = 15}),
- ?line {ok,{'SetOpt3',asn1_NOVALUE,asn1_NOVALUE,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt3',lists:flatten(Bytes32)),
-
-
-
-
-
- ?line {ok,Bytes41} =
- asn1_wrapper:encode('SetOptional','SetOpt1Imp',#'SetOpt1Imp'{bool1 = true,
- int1 = 15,
- set1 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt1Imp',true,15,{'SetIn',true,66}}} =
- asn1_wrapper:decode('SetOptional','SetOpt1Imp',lists:flatten(Bytes41)),
-
-
- ?line {ok,Bytes42} = asn1_wrapper:encode('SetOptional','SetOpt1Imp',#'SetOpt1Imp'{int1 = 15}),
- ?line {ok,{'SetOpt1Imp',asn1_NOVALUE,15,asn1_NOVALUE}} =
- asn1_wrapper:decode('SetOptional','SetOpt1Imp',lists:flatten(Bytes42)),
-
-
- ?line {ok,Bytes51} =
- asn1_wrapper:encode('SetOptional','SetOpt2Imp',#'SetOpt2Imp'{bool2 = true,
- int2 = 15,
- set2 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt2Imp',{'SetIn',true,66},true,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt2Imp',lists:flatten(Bytes51)),
-
-
- ?line {ok,Bytes52} = asn1_wrapper:encode('SetOptional','SetOpt2Imp',#'SetOpt2Imp'{int2 = 15,
- bool2 = true}),
- ?line {ok,{'SetOpt2Imp',asn1_NOVALUE,true,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt2Imp',lists:flatten(Bytes52)),
-
-
-
- ?line {ok,Bytes61} =
- asn1_wrapper:encode('SetOptional','SetOpt3Imp',#'SetOpt3Imp'{bool3 = true,
- int3 = 15,
- set3 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt3Imp',true,{'SetIn',true,66},15}} =
- asn1_wrapper:decode('SetOptional','SetOpt3Imp',lists:flatten(Bytes61)),
-
-
- ?line {ok,Bytes62} = asn1_wrapper:encode('SetOptional','SetOpt3Imp',#'SetOpt3Imp'{int3 = 15}),
- ?line {ok,{'SetOpt3Imp',asn1_NOVALUE,asn1_NOVALUE,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt3Imp',lists:flatten(Bytes62)),
-
-
-
-
-
-
- ?line {ok,Bytes71} =
- asn1_wrapper:encode('SetOptional','SetOpt1Exp',#'SetOpt1Exp'{bool1 = true,
- int1 = 15,
- set1 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt1Exp',true,15,{'SetIn',true,66}}} =
- asn1_wrapper:decode('SetOptional','SetOpt1Exp',lists:flatten(Bytes71)),
-
-
- ?line {ok,Bytes72} = asn1_wrapper:encode('SetOptional','SetOpt1Exp',#'SetOpt1Exp'{int1 = 15}),
- ?line {ok,{'SetOpt1Exp',asn1_NOVALUE,15,asn1_NOVALUE}} =
- asn1_wrapper:decode('SetOptional','SetOpt1Exp',lists:flatten(Bytes72)),
-
-
- ?line {ok,Bytes81} =
- asn1_wrapper:encode('SetOptional','SetOpt2Exp',#'SetOpt2Exp'{bool2 = true,
- int2 = 15,
- set2 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt2Exp',{'SetIn',true,66},true,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt2Exp',lists:flatten(Bytes81)),
-
-
- ?line {ok,Bytes82} = asn1_wrapper:encode('SetOptional','SetOpt2Exp',#'SetOpt2Exp'{int2 = 15,
- bool2 = true}),
- ?line {ok,{'SetOpt2Exp',asn1_NOVALUE,true,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt2Exp',lists:flatten(Bytes82)),
-
-
-
- ?line {ok,Bytes91} =
- asn1_wrapper:encode('SetOptional','SetOpt3Exp',#'SetOpt3Exp'{bool3 = true,
- int3 = 15,
- set3 = #'SetIn'{boolIn = true,
- intIn = 66}}),
- ?line {ok,{'SetOpt3Exp',true,{'SetIn',true,66},15}} =
- asn1_wrapper:decode('SetOptional','SetOpt3Exp',lists:flatten(Bytes91)),
-
-
- ?line {ok,Bytes92} = asn1_wrapper:encode('SetOptional','SetOpt3Exp',#'SetOpt3Exp'{int3 = 15}),
- ?line {ok,{'SetOpt3Exp',asn1_NOVALUE,asn1_NOVALUE,15}} =
- asn1_wrapper:decode('SetOptional','SetOpt3Exp',lists:flatten(Bytes92)),
-
+
+ roundtrip('SetOpt2Imp',
+ #'SetOpt2Imp'{bool2=true,int2=15,
+ set2=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt2Imp',#'SetOpt2Imp'{int2=15,bool2=true}),
+
+ roundtrip('SetOpt3Imp',
+ #'SetOpt3Imp'{bool3=true,int3=15,
+ set3=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt3Imp', #'SetOpt3Imp'{int3=15}),
+
+ roundtrip('SetOpt1Exp',
+ #'SetOpt1Exp'{bool1=true,int1=15,
+ set1=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt1Exp', #'SetOpt1Exp'{int1=15}),
+
+ roundtrip('SetOpt2Exp',
+ #'SetOpt2Exp'{bool2=true,int2=15,
+ set2=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt2Exp', #'SetOpt2Exp'{int2=15,bool2=true}),
+ roundtrip('SetOpt3Exp',
+ #'SetOpt3Exp'{bool3=true,int3=15,
+ set3=#'SetIn'{boolIn=true,intIn=66}}),
+ roundtrip('SetOpt3Exp', #'SetOpt3Exp'{int3=15}),
ok.
ticket_7533(Ber) when Ber == ber ->
- Val = #'SetOpt1'{bool1 = true,int1=12,set1=#'SetIn'{boolIn=false,intIn=13}},
- ?line {ok,B} = asn1_wrapper:encode('SetOptional','SetOpt1',Val),
- ?line {ok,Val} = asn1_wrapper:decode('SetOptional','SetOpt1',B),
-
- CorruptVal = [49,14,1,1,255,2,1,12] ++ lists:duplicate(8,0),
- Pid = spawn(?MODULE,decoder,[self(),'SetOptional','SetOpt1',CorruptVal]),
- receive
- {ok,Pid,Result} ->
- io:format("Decode result: ~p~n",[Result]),
- ok
- after 10000 ->
- io:format("Decode timeout~n",[]),
- exit(Pid,normal)
- end;
+ Val = #'SetOpt1'{bool1=true,int1=12,set1=#'SetIn'{boolIn=false,intIn=13}},
+ roundtrip('SetOpt1', Val),
+ CorruptVal = <<49,14,1,1,255,2,1,12,0:8/unit:8>>,
+ {error,_} = 'SetOptional':decode('SetOpt1', CorruptVal),
+ ok;
ticket_7533(_) ->
ok.
-decoder(Parent,Module,Type,Val) ->
- io:format("Decoding~n",[]),
- ?line {ok,Res} = asn1_wrapper:decode(Module,Type,Val),
- io:format("Decode res: ~p~n",[Res]),
- Parent ! {ok,self(),Res}.
+roundtrip(Type, Value) ->
+ {ok,Encoded} = 'SetOptional':encode(Type, Value),
+ {ok,Value} = 'SetOptional':decode(Type, Encoded),
+ ok.
diff --git a/lib/asn1/test/test_partial_incomplete_decode.erl b/lib/asn1/test/test_partial_incomplete_decode.erl
index df56c27115..8ede06938d 100644
--- a/lib/asn1/test/test_partial_incomplete_decode.erl
+++ b/lib/asn1/test/test_partial_incomplete_decode.erl
@@ -188,7 +188,7 @@ decode_parts('S1_2',PartDecMsg) ->
msg('F') ->
- {'F',{fb,{'E',35,[{'D',3,true},{'D',4,false},{'D',5,true},{'D',6,true},{'D',7,false},{'D',8,true},{'D',9,true},{'D',10,false},{'D',11,true},{'D',12,true},{'D',13,false},{'D',14,true}],false,{da,[{'A',16,{'D',17,true}}]}}}};
+ {fb,{'E',35,[{'D',3,true},{'D',4,false},{'D',5,true},{'D',6,true},{'D',7,false},{'D',8,true},{'D',9,true},{'D',10,false},{'D',11,true},{'D',12,true},{'D',13,false},{'D',14,true}],false,{da,[{'A',16,{'D',17,true}}]}}};
msg('F3') ->
{fb,{'E',10,[{'D',11,true},{'D',12,false}],false,{dc,{'E_d_dc',13,true,{'E_d_dc_dcc',14,15}}}}};
diff --git a/lib/asn1/test/test_selective_decode.erl b/lib/asn1/test/test_selective_decode.erl
index bb348611da..ebe1296cf3 100644
--- a/lib/asn1/test/test_selective_decode.erl
+++ b/lib/asn1/test/test_selective_decode.erl
@@ -53,7 +53,7 @@ test() ->
msg('F') ->
- {'F',{fb,{'E',35,[{'D',3,true},{'D',4,false},{'D',5,true},{'D',6,true},{'D',7,false},{'D',8,true},{'D',9,true},{'D',10,false},{'D',11,true},{'D',12,true},{'D',13,false},{'D',14,true}],false,{da,[{'A',16,{'D',17,true}}]}}}};
+ {fb,{'E',35,[{'D',3,true},{'D',4,false},{'D',5,true},{'D',6,true},{'D',7,false},{'D',8,true},{'D',9,true},{'D',10,false},{'D',11,true},{'D',12,true},{'D',13,false},{'D',14,true}],false,{da,[{'A',16,{'D',17,true}}]}}};
msg('E') ->
{'E',10,[{'D',11,true},{'D',12,false}],false,{dc,{'E_d_dc',13,true,{'E_d_dc_dcc',14,15}}}};
diff --git a/lib/asn1/test/test_special_decode_performance.erl b/lib/asn1/test/test_special_decode_performance.erl
index dd56d29b28..7dfab1f25a 100644
--- a/lib/asn1/test/test_special_decode_performance.erl
+++ b/lib/asn1/test/test_special_decode_performance.erl
@@ -31,8 +31,8 @@ go(all) ->
{Time_S_c,Time_MGC_c}).
go(N,Mod) ->
- ?line Val = val(Mod),
- ?line {ok,B} = Mod:encode(element(1,Val),Val),
+ {Type,Val} = val(Mod),
+ {ok,B} = Mod:encode(Type, Val),
?line go(Mod,B,N).
go(Mod,Bin,N) ->
@@ -92,7 +92,7 @@ val('PartialDecSeq') ->
{'F',{fb,{'E',12,[{'D',13,true},{'D',14,false},{'D',15,true},{'D',16,false},{'D',13,true},{'D',14,false},{'D',15,true},{'D',16,false},{'D',13,true},{'D',14,false},{'D',15,true},{'D',16,false}],true,{da,[{'A',17,{'D',18,false}},{'A',19,{'D',20,true}},{'A',21,{'D',22,false}},{'A',17,{'D',18,false}},{'A',19,{'D',20,true}},{'A',21,{'D',22,false}},{'A',17,{'D',18,false}},{'A',19,{'D',20,true}},{'A',21,{'D',22,false}},{'A',17,{'D',18,false}},{'A',19,{'D',20,true}},{'A',21,{'D',22,false}},{'A',17,{'D',18,false}},{'A',19,{'D',20,true}},{'A',21,{'D',22,false}},{'A',17,{'D',18,false}},{'A',19,{'D',20,true}},{'A',21,{'D',22,false}}]}}}};
val('MEDIA-GATEWAY-CONTROL') ->
- {'MegacoMessage',asn1_NOVALUE,{'Message',1,{ip4Address,{'IP4Address',[125,125,125,111],55555}},{transactions,[{transactionReply,{'TransactionReply',50007,asn1_NOVALUE,{actionReplies,[{'ActionReply',0,asn1_NOVALUE,asn1_NOVALUE,[{auditValueReply,{auditResult,{'AuditResult',{'TerminationID',[],[255,255,255]},[{mediaDescriptor,{'MediaDescriptor',asn1_NOVALUE,{multiStream,[{'StreamDescriptor',1,{'StreamParms',{'LocalControlDescriptor',sendRecv,asn1_NOVALUE,asn1_NOVALUE,[{'PropertyParm',[0,11,0,7],[[52,48]],asn1_NOVALUE}]},{'LocalRemoteDescriptor',[[{'PropertyParm',[0,0,176,1],[[48]],asn1_NOVALUE},{'PropertyParm',[0,0,176,8],[[73,78,32,73,80,52,32,49,50,53,46,49,50,53,46,49,50,53,46,49,49,49]],asn1_NOVALUE},{'PropertyParm',[0,0,176,15],[[97,117,100,105,111,32,49,49,49,49,32,82,84,80,47,65,86,80,32,32,52]],asn1_NOVALUE},{'PropertyParm',[0,0,176,12],[[112,116,105,109,101,58,51,48]],asn1_NOVALUE}]]},{'LocalRemoteDescriptor',[[{'PropertyParm',[0,0,176,1],[[48]],asn1_NOVALUE},{'PropertyParm',[0,0,176,8],[[73,78,32,73,80,52,32,49,50,52,46,49,50,52,46,49,50,52,46,50,50,50]],asn1_NOVALUE},{'PropertyParm',[0,0,176,15],[[97,117,100,105,111,32,50,50,50,50,32,82,84,80,47,65,86,80,32,32,52]],asn1_NOVALUE},{'PropertyParm',[0,0,176,12],[[112,116,105,109,101,58,51,48]],asn1_NOVALUE}]]}}}]}}},{packagesDescriptor,[{'PackagesItem',[0,11],1},{'PackagesItem',[0,11],1}]},{statisticsDescriptor,[{'StatisticsParameter',[0,12,0,4],[[49,50,48,48]]},{'StatisticsParameter',[0,11,0,2],[[54,50,51,48,48]]},{'StatisticsParameter',[0,12,0,5],[[55,48,48]]},{'StatisticsParameter',[0,11,0,3],[[52,53,49,48,48]]},{'StatisticsParameter',[0,12,0,6],[[48,46,50]]},{'StatisticsParameter',[0,12,0,7],[[50,48]]},{'StatisticsParameter',[0,12,0,8],[[52,48]]}]}]}}}]}]}}}]}}}.
+ {'MegacoMessage',{'MegacoMessage',asn1_NOVALUE,{'Message',1,{ip4Address,{'IP4Address',[125,125,125,111],55555}},{transactions,[{transactionReply,{'TransactionReply',50007,asn1_NOVALUE,{actionReplies,[{'ActionReply',0,asn1_NOVALUE,asn1_NOVALUE,[{auditValueReply,{auditResult,{'AuditResult',{'TerminationID',[],[255,255,255]},[{mediaDescriptor,{'MediaDescriptor',asn1_NOVALUE,{multiStream,[{'StreamDescriptor',1,{'StreamParms',{'LocalControlDescriptor',sendRecv,asn1_NOVALUE,asn1_NOVALUE,[{'PropertyParm',[0,11,0,7],[[52,48]],asn1_NOVALUE}]},{'LocalRemoteDescriptor',[[{'PropertyParm',[0,0,176,1],[[48]],asn1_NOVALUE},{'PropertyParm',[0,0,176,8],[[73,78,32,73,80,52,32,49,50,53,46,49,50,53,46,49,50,53,46,49,49,49]],asn1_NOVALUE},{'PropertyParm',[0,0,176,15],[[97,117,100,105,111,32,49,49,49,49,32,82,84,80,47,65,86,80,32,32,52]],asn1_NOVALUE},{'PropertyParm',[0,0,176,12],[[112,116,105,109,101,58,51,48]],asn1_NOVALUE}]]},{'LocalRemoteDescriptor',[[{'PropertyParm',[0,0,176,1],[[48]],asn1_NOVALUE},{'PropertyParm',[0,0,176,8],[[73,78,32,73,80,52,32,49,50,52,46,49,50,52,46,49,50,52,46,50,50,50]],asn1_NOVALUE},{'PropertyParm',[0,0,176,15],[[97,117,100,105,111,32,50,50,50,50,32,82,84,80,47,65,86,80,32,32,52]],asn1_NOVALUE},{'PropertyParm',[0,0,176,12],[[112,116,105,109,101,58,51,48]],asn1_NOVALUE}]]}}}]}}},{packagesDescriptor,[{'PackagesItem',[0,11],1},{'PackagesItem',[0,11],1}]},{statisticsDescriptor,[{'StatisticsParameter',[0,12,0,4],[[49,50,48,48]]},{'StatisticsParameter',[0,11,0,2],[[54,50,51,48,48]]},{'StatisticsParameter',[0,12,0,5],[[55,48,48]]},{'StatisticsParameter',[0,11,0,3],[[52,53,49,48,48]]},{'StatisticsParameter',[0,12,0,6],[[48,46,50]]},{'StatisticsParameter',[0,12,0,7],[[50,48]]},{'StatisticsParameter',[0,12,0,8],[[52,48]]}]}]}}}]}]}}}]}}}}.
%% val('PartialDecSeq') ->
%% {'F',{fb,{'E',35,[{'D',3,true},{'D',4,false},{'D',5,true},{'D',6,true},{'D',7,false},{'D',8,true},{'D',9,true},{'D',10,false},{'D',11,true},{'D',12,true},{'D',13,false},{'D',14,true}],false,{dc,{'E_d_dc',15,true,{'E_d_dc_dcc',17,4711}}}}}}.
diff --git a/lib/common_test/doc/src/cover_chapter.xml b/lib/common_test/doc/src/cover_chapter.xml
index b2e64bfff0..4fa92d5583 100644
--- a/lib/common_test/doc/src/cover_chapter.xml
+++ b/lib/common_test/doc/src/cover_chapter.xml
@@ -108,8 +108,8 @@
specifications</seealso>).</p>
</section>
+ <marker id="cover_stop"></marker>
<section>
- <marker id="cover_stop"></marker>
<title>Stopping the cover tool when tests are completed</title>
<p>By default the Cover tool is automatically stopped when the
tests are completed. This causes the original (non cover
@@ -175,6 +175,11 @@
%% Specific modules to exclude in cover.
{excl_mods, Mods}.
+
+ %% Cross cover compilation
+ %% Tag = atom(), an identifier for a test run
+ %% Mod = [atom()], modules to compile for accumulated analysis
+ {cross,[{Tag,Mods}]}.
</pre>
<p>The <c>incl_dirs_r</c> and <c>excl_dirs_r</c> terms tell Common
@@ -190,6 +195,81 @@
specification file for Common Test).</p>
</section>
+ <marker id="cross_cover"/>
+ <section>
+ <title>Cross cover analysis</title>
+ <p>The cross cover mechanism allows cover analysis of modules
+ across multiple tests. It is useful if some code, e.g. a library
+ module, is used by many different tests and the accumulated cover
+ result is desirable.</p>
+
+ <p>This can of course also be achieved in a more customized way by
+ using the <c>export</c> parameter in the cover specification and
+ analysing the result off line, but the cross cover mechanism is a
+ build in solution which also provides the logging.</p>
+
+ <p>The mechanism is easiest explained via an example:</p>
+
+ <p>Let's say that there are two systems, <c>s1</c> and <c>s2</c>,
+ which are tested in separate test runs. System <c>s1</c> contains
+ a library module <c>m1</c> which is tested by the <c>s1</c> test
+ run and is included in <c>s1</c>'s cover specification:</p>
+
+<code type="none">
+s1.cover:
+ {incl_mods,[m1]}.</code>
+
+ <p>When analysing code coverage, the result for <c>m1</c> can be
+ seen in the cover log in the <c>s1</c> test result.</p>
+
+ <p>Now, let's imagine that since <c>m1</c> is a library module, it
+ is also used quite a bit by system <c>s2</c>. The <c>s2</c> test
+ run does not specifically test <c>m1</c>, but it might still be
+ interesting to see which parts of <c>m1</c> is actually covered by
+ the <c>s2</c> tests. To do this, <c>m1</c> could be included also
+ in <c>s2</c>'s cover specification:</p>
+
+<code type="none">
+s2.cover:
+ {incl_mods,[m1]}.</code>
+
+ <p>This would give an entry for <c>m1</c> also in the cover log
+ for the <c>s2</c> test run. The problem is that this would only
+ reflect the coverage by <c>s2</c> tests, not the accumulated
+ result over <c>s1</c> and <c>s2</c>. And this is where the cross
+ cover mechanism comes in handy.</p>
+
+ <p>If instead the cover specification for <c>s2</c> was like
+ this:</p>
+
+<code type="none">
+s2.cover:
+ {cross,[{s1,[m1]}]}.</code>
+
+ <p>then <c>m1</c> would be cover compiled in the <c>s2</c> test
+ run, but not shown in the coverage log. Instead, if
+ <c>ct_cover:cross_cover_analyse/2</c> is called after both
+ <c>s1</c> and <c>s2</c> test runs are completed, the accumulated
+ result for <c>m1</c> would be available in the cross cover log for
+ the <c>s1</c> test run.</p>
+
+ <p>The call to the analyse function must be like this:</p>
+
+<code type="none">
+ct_cover:cross_cover_analyse(Level, [{s1,S1LogDir},{s2,S2LogDir}]).</code>
+
+ <p>where <c>S1LogDir</c> and <c>S2LogDir</c> are the directories
+ named <c>&lt;TestName&gt;.logs</c> for each test respectively.</p>
+
+ <p>Note the tags <c>s1</c> and <c>s2</c> which are used in the
+ cover specification file and in the call to
+ <c>ct_cover:cross_cover_analyse/2</c>. The point of these are only
+ to map the modules specified in the cover specification to the log
+ directory specified in the call to the analyse function. The name
+ of the tag has no meaning beyond this.</p>
+
+ </section>
+
<section>
<title>Logging</title>
<p>To view the result of a code coverage test, follow the
@@ -197,6 +277,11 @@
takes you to the code coverage overview page. If you have
successfully performed a detailed coverage analysis, you
find links to each individual module coverage page here.</p>
+
+ <p>If cross cover analysis has been performed, and there are
+ accumulated coverage results for the current test, then the -
+ "Coverdata collected over all tests" link will take you to these
+ results.</p>
</section>
</chapter>
diff --git a/lib/common_test/src/ct_cover.erl b/lib/common_test/src/ct_cover.erl
index d39f50ba00..ae671c750a 100644
--- a/lib/common_test/src/ct_cover.erl
+++ b/lib/common_test/src/ct_cover.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -24,7 +24,7 @@
-module(ct_cover).
--export([get_spec/1, add_nodes/1, remove_nodes/1]).
+-export([get_spec/1, add_nodes/1, remove_nodes/1, cross_cover_analyse/2]).
-include("ct_util.hrl").
@@ -100,6 +100,22 @@ remove_nodes(Nodes) ->
%%%-----------------------------------------------------------------
+%%% @spec cross_cover_analyse(Level,Tests) -> ok
+%%% Level = overview | details
+%%% Tests = [{Tag,Dir}]
+%%% Tag = atom()
+%%% Dir = string()
+%%%
+%%% @doc Accumulate cover results over multiple tests.
+%%% See the chapter about <seealso
+%%% marker="cover_chapter#cross_cover">cross cover
+%%% analysis</seealso> in the users's guide.
+%%%
+cross_cover_analyse(Level,Tests) ->
+ test_server_ctrl:cross_cover_analyse(Level,Tests).
+
+
+%%%-----------------------------------------------------------------
%%% @hidden
%% Read cover specification file and return the parsed info.
@@ -249,9 +265,11 @@ get_app_info(App=#cover{app=Name}, [{excl_mods,Name,Mods1}|Terms]) ->
Mods = App#cover.excl_mods,
get_app_info(App#cover{excl_mods=Mods++Mods1},Terms);
-get_app_info(App=#cover{app=Name}, [{cross_apps,Name,AppMods1}|Terms]) ->
- AppMods = App#cover.cross,
- get_app_info(App#cover{cross=AppMods++AppMods1},Terms);
+get_app_info(App=#cover{app=none}, [{cross,Cross}|Terms]) ->
+ get_app_info(App, [{cross,none,Cross}|Terms]);
+get_app_info(App=#cover{app=Name}, [{cross,Name,Cross1}|Terms]) ->
+ Cross = App#cover.cross,
+ get_app_info(App#cover{cross=Cross++Cross1},Terms);
get_app_info(App=#cover{app=none}, [{src_dirs,Dirs}|Terms]) ->
get_app_info(App, [{src_dirs,none,Dirs}|Terms]);
@@ -354,10 +372,10 @@ remove_excludes_and_dups(CoverData=#cover{excl_mods=Excl,incl_mods=Incl}) ->
files2mods(Info=#cover{excl_mods=ExclFs,
incl_mods=InclFs,
- cross=CrossFs}) ->
+ cross=Cross}) ->
Info#cover{excl_mods=files2mods1(ExclFs),
incl_mods=files2mods1(InclFs),
- cross=files2mods1(CrossFs)}.
+ cross=[{Tag,files2mods1(Fs)} || {Tag,Fs} <- Cross]}.
files2mods1([M|Fs]) when is_atom(M) ->
[M|files2mods1(Fs)];
diff --git a/lib/common_test/test/common_test.cover b/lib/common_test/test/common_test.cover
index 66697854ea..3aa49623e7 100644
--- a/lib/common_test/test/common_test.cover
+++ b/lib/common_test/test/common_test.cover
@@ -1,10 +1,10 @@
%% -*- erlang -*-
{incl_app,common_test,details}.
-{cross_apps,common_test,[erl2html2,
- test_server,
- test_server_ctrl,
- test_server_gl,
- test_server_h,
- test_server_io,
- test_server_node,
- test_server_sup]}.
+{cross,common_test,[{test_server,[erl2html2,
+ test_server,
+ test_server_ctrl,
+ test_server_gl,
+ test_server_h,
+ test_server_io,
+ test_server_node,
+ test_server_sup]}]}.
diff --git a/lib/common_test/test/ct_cover_SUITE.erl b/lib/common_test/test/ct_cover_SUITE.erl
index bebfce70d0..cb49dc423f 100644
--- a/lib/common_test/test/ct_cover_SUITE.erl
+++ b/lib/common_test/test/ct_cover_SUITE.erl
@@ -77,7 +77,8 @@ all() ->
slave_start_slave,
cover_node_option,
ct_cover_add_remove_nodes,
- otp_9956
+ otp_9956,
+ cross
].
%%--------------------------------------------------------------------
@@ -161,6 +162,43 @@ otp_9956(Config) ->
check_calls(Events,{?suite,otp_9956,1},1),
ok.
+%% Test cross cover mechanism
+cross(Config) ->
+ {ok,Events1} = run_test(cross1,Config),
+ check_calls(Events1,1),
+
+ CoverFile2 = create_cover_file(cross1,[{cross,[{cross1,[?mod]}]}],Config),
+ {ok,Events2} = run_test(cross2,[{cover,CoverFile2}],Config),
+ check_calls(Events2,1),
+
+ %% Get the log dirs for each test and run cross cover analyse
+ [D11,D12] = lists:sort(get_run_dirs(Events1)),
+ [D21,D22] = lists:sort(get_run_dirs(Events2)),
+
+ ct_cover:cross_cover_analyse(details,[{cross1,D11},{cross2,D21}]),
+ ct_cover:cross_cover_analyse(details,[{cross1,D12},{cross2,D22}]),
+
+ %% Get the cross cover logs and read for each test
+ [C11,C12,C21,C22] =
+ [filename:join(D,"cross_cover.html") || D <- [D11,D12,D21,D22]],
+
+ {ok,CrossData} = file:read_file(C11),
+ {ok,CrossData} = file:read_file(C12),
+
+ {ok,Def} = file:read_file(C21),
+ {ok,Def} = file:read_file(C22),
+
+ %% A simple test: just check that the test module exists in the
+ %% log from cross1 test, and that it does not exist in the log
+ %% from cross2 test.
+ TestMod = list_to_binary(atom_to_list(?mod)),
+ {_,_} = binary:match(CrossData,TestMod),
+ nomatch = binary:match(Def,TestMod),
+ {_,_} = binary:match(Def,
+ <<"No cross cover modules exist for this application">>),
+
+ ok.
+
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
@@ -229,15 +267,18 @@ check_cover(Node) when is_atom(Node) ->
false
end.
+%% Get the log dir "run.<timestamp>" for all (both!) tests
+get_run_dirs(Events) ->
+ [filename:dirname(TCLog) ||
+ {ct_test_support_eh,
+ {event,tc_logfile,_Node,
+ {{?suite,init_per_suite},TCLog}}} <- Events].
+
%% Check that each coverlog includes N calls to ?mod:foo/0
check_calls(Events,N) ->
check_calls(Events,{?mod,foo,0},N).
check_calls(Events,MFA,N) ->
- CoverLogs =
- [filename:join(filename:dirname(TCLog),"all.coverdata") ||
- {ct_test_support_eh,
- {event,tc_logfile,ct@falco,
- {{?suite,init_per_suite},TCLog}}} <- Events],
+ CoverLogs = [filename:join(D,"all.coverdata") || D <- get_run_dirs(Events)],
do_check_logs(CoverLogs,MFA,N).
do_check_logs([CoverLog|CoverLogs],{Mod,_,_} = MFA,N) ->
diff --git a/lib/compiler/src/compile.erl b/lib/compiler/src/compile.erl
index a3120eb917..10e7f5e9ce 100644
--- a/lib/compiler/src/compile.erl
+++ b/lib/compiler/src/compile.erl
@@ -1342,16 +1342,12 @@ save_binary(#compile{code=none}=St) -> {ok,St};
save_binary(#compile{module=Mod,ofile=Outfile,
options=Opts}=St) ->
%% Test that the module name and output file name match.
- %% We must take care to not completely break a packaged module
- %% (even though packages still is as an experimental, unsupported
- %% feature) - so we will extract the last part of a packaged
- %% module name and compare only that.
case member(no_error_module_mismatch, Opts) of
true ->
save_binary_1(St);
false ->
Base = filename:rootname(filename:basename(Outfile)),
- case lists:last(packages:split(Mod)) of
+ case atom_to_list(Mod) of
Base ->
save_binary_1(St);
_ ->
diff --git a/lib/compiler/src/sys_pre_expand.erl b/lib/compiler/src/sys_pre_expand.erl
index e55fb2a037..a8c69c3cb1 100644
--- a/lib/compiler/src/sys_pre_expand.erl
+++ b/lib/compiler/src/sys_pre_expand.erl
@@ -35,10 +35,8 @@
-record(expand, {module=[], %Module name
parameters=undefined, %Module parameters
- package="", %Module package
exports=[], %Exports
imports=[], %Imports
- mod_imports, %Module Imports
compile=[], %Compile flags
attributes=[], %Attributes
callbacks=[], %Callbacks
@@ -67,12 +65,8 @@ module(Fs0, Opts0) ->
%% Set pre-defined exported functions.
PreExp = [{module_info,0},{module_info,1}],
- %% Set pre-defined module imports.
- PreModImp = [{erlang,erlang},{packages,packages}],
-
%% Build initial expand record.
St0 = #expand{exports=PreExp,
- mod_imports=dict:from_list(PreModImp),
compile=Opts,
defined=PreExp,
bitdefault = erl_bits:system_bitdefault(),
@@ -242,14 +236,12 @@ forms([], St) -> {[],St}.
%% Process an attribute, this just affects the state.
attribute(module, {Module, As}, _L, St) ->
- M = package_to_string(Module),
- St#expand{module=list_to_atom(M),
- package=packages:strip_last(M),
+ true = is_atom(Module),
+ St#expand{module=Module,
parameters=As};
attribute(module, Module, _L, St) ->
- M = package_to_string(Module),
- St#expand{module=list_to_atom(M),
- package=packages:strip_last(M)};
+ true = is_atom(Module),
+ St#expand{module=Module};
attribute(export, Es, _L, St) ->
St#expand{exports=union(from_list(Es), St#expand.exports)};
attribute(import, Is, _L, St) ->
@@ -312,8 +304,6 @@ pattern({tuple,Line,Ps}, St0) ->
%%pattern({struct,Line,Tag,Ps}, St0) ->
%% {TPs,TPsvs,St1} = pattern_list(Ps, St0),
%% {{tuple,Line,[{atom,Line,Tag}|TPs]},TPsvs,St1};
-pattern({record_field,_,_,_}=M, St) ->
- {expand_package(M, St),St}; % must be a package name
pattern({bin,Line,Es0}, St0) ->
{Es1,St1} = pattern_bin(Es0, St0),
{{bin,Line,Es1},St1};
@@ -404,8 +394,6 @@ expr({tuple,Line,Es0}, St0) ->
%%expr({struct,Line,Tag,Es0}, Vs, St0) ->
%% {Es1,Esvs,Esus,St1} = expr_list(Es0, Vs, St0),
%% {{tuple,Line,[{atom,Line,Tag}|Es1]},Esvs,Esus,St1};
-expr({record_field,_,_,_}=M, St) ->
- {expand_package(M, St),St}; % must be a package name
expr({bin,Line,Es0}, St0) ->
{Es1,St1} = expr_bin(Es0, St0),
{{bin,Line,Es1},St1};
@@ -448,12 +436,9 @@ expr({call,Line,{atom,La,N}=Atom,As0}, St0) ->
end
end
end;
-expr({call,Line,{record_field,_,_,_}=M,As0}, St0) ->
- expr({call,Line,expand_package(M, St0),As0}, St0);
-expr({call,Line,{remote,Lr,M,F},As0}, St0) ->
- M1 = expand_package(M, St0),
- {[M2,F1|As1],St1} = expr_list([M1,F|As0], St0),
- {{call,Line,{remote,Lr,M2,F1},As1},St1};
+expr({call,Line,{remote,Lr,M0,F},As0}, St0) ->
+ {[M1,F1|As1],St1} = expr_list([M0,F|As0], St0),
+ {{call,Line,{remote,Lr,M1,F1},As1},St1};
expr({call,Line,F,As0}, St0) ->
{[Fun1|As1],St1} = expr_list([F|As0], St0),
{{call,Line,Fun1,As1},St1};
@@ -666,32 +651,6 @@ string_to_conses(Line, Cs, Tail) ->
foldr(fun (C, T) -> {cons,Line,{char,Line,C},T} end, Tail, Cs).
-%% In syntax trees, module/package names are atoms or lists of atoms.
-
-package_to_string(A) when is_atom(A) -> atom_to_list(A);
-package_to_string(L) when is_list(L) -> packages:concat(L).
-
-expand_package({atom,L,A} = M, St) ->
- case dict:find(A, St#expand.mod_imports) of
- {ok, A1} ->
- {atom,L,A1};
- error ->
- case packages:is_segmented(A) of
- true ->
- M;
- false ->
- M1 = packages:concat(St#expand.package, A),
- {atom,L,list_to_atom(M1)}
- end
- end;
-expand_package(M, _St) ->
- case erl_parse:package_segments(M) of
- error ->
- M;
- M1 ->
- {atom,element(2,M),list_to_atom(package_to_string(M1))}
- end.
-
%% import(Line, Imports, State) ->
%% State'
%% imported(Name, Arity, State) ->
@@ -699,15 +658,10 @@ expand_package(M, _St) ->
%% Handle import declarations and test for imported functions. No need to
%% check when building imports as code is correct.
-import({Mod0,Fs}, St) ->
- Mod = list_to_atom(package_to_string(Mod0)),
+import({Mod,Fs}, St) ->
+ true = is_atom(Mod),
Mfs = from_list(Fs),
- St#expand{imports=add_imports(Mod, Mfs, St#expand.imports)};
-import(Mod0, St) ->
- Mod = package_to_string(Mod0),
- Key = list_to_atom(packages:last(Mod)),
- St#expand{mod_imports=dict:store(Key, list_to_atom(Mod),
- St#expand.mod_imports)}.
+ St#expand{imports=add_imports(Mod, Mfs, St#expand.imports)}.
add_imports(Mod, [F|Fs], Is) ->
add_imports(Mod, Fs, orddict:store(F, Mod, Is));
diff --git a/lib/compiler/test/compilation_SUITE.erl b/lib/compiler/test/compilation_SUITE.erl
index bec97b0199..f8f74e6f7a 100644
--- a/lib/compiler/test/compilation_SUITE.erl
+++ b/lib/compiler/test/compilation_SUITE.erl
@@ -44,7 +44,7 @@ groups() ->
{group,vsn},otp_2380,otp_2141,otp_2173,otp_4790,
const_list_256,bin_syntax_1,bin_syntax_2,
bin_syntax_3,bin_syntax_4,bin_syntax_5,bin_syntax_6,
- live_var,convopts,bad_functional_value,
+ live_var,convopts,
catch_in_catch,redundant_case,long_string,otp_5076,
complex_guard,otp_5092,otp_5151,otp_5235,otp_5244,
trycatch_4,opt_crash,otp_5404,otp_5436,otp_5481,
@@ -143,7 +143,6 @@ split({int, N}, <<N:16,B:N/binary,T/binary>>) ->
?comp(live_var).
?comp(trycatch_4).
-?comp(bad_functional_value).
?comp(catch_in_catch).
diff --git a/lib/compiler/test/compilation_SUITE_data/bad_functional_value.erl b/lib/compiler/test/compilation_SUITE_data/bad_functional_value.erl
deleted file mode 100644
index 126a573e83..0000000000
--- a/lib/compiler/test/compilation_SUITE_data/bad_functional_value.erl
+++ /dev/null
@@ -1,28 +0,0 @@
-%%
-%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2003-2009. All Rights Reserved.
-%%
-%% The contents of this file are subject to the Erlang Public License,
-%% Version 1.1, (the "License"); you may not use this file except in
-%% compliance with the License. You should have received a copy of the
-%% Erlang Public License along with this software. If not, it can be
-%% retrieved online at http://www.erlang.org/.
-%%
-%% Software distributed under the License is distributed on an "AS IS"
-%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-%% the License for the specific language governing rights and limitations
-%% under the License.
-%%
-%% %CopyrightEnd%
-%%
--module(bad_functional_value).
-
--export([?MODULE/0,a/0]).
-
-?MODULE() ->
- ok.
-
-a() ->
- .list_to_atom("ok").
-
diff --git a/lib/compiler/test/compile_SUITE.erl b/lib/compiler/test/compile_SUITE.erl
index 2cd75944f4..229e5a98a1 100644
--- a/lib/compiler/test/compile_SUITE.erl
+++ b/lib/compiler/test/compile_SUITE.erl
@@ -27,7 +27,7 @@
app_test/1,
file_1/1, forms_2/1, module_mismatch/1, big_file/1, outdir/1,
binary/1, makedep/1, cond_and_ifdef/1, listings/1, listings_big/1,
- other_output/1, package_forms/1, encrypted_abstr/1,
+ other_output/1, encrypted_abstr/1,
bad_record_use1/1, bad_record_use2/1, strict_record/1,
missing_testheap/1, cover/1, env/1, core/1, asm/1,
sys_pre_attributes/1]).
@@ -44,7 +44,7 @@ all() ->
test_lib:recompile(?MODULE),
[app_test, file_1, forms_2, module_mismatch, big_file, outdir,
binary, makedep, cond_and_ifdef, listings, listings_big,
- other_output, package_forms, encrypted_abstr,
+ other_output, encrypted_abstr,
{group, bad_record_use}, strict_record,
missing_testheap, cover, env, core, asm,
sys_pre_attributes].
@@ -410,32 +410,6 @@ other_output(Config) when is_list(Config) ->
?line test_server:timetrap_cancel(Dog),
ok.
-package_forms(Config) when is_list(Config) ->
- Fs = [{attribute,1,file,{"./p.erl",1}},
- {attribute,1,module,[p,p]},
- {attribute,3,compile,export_all},
- {attribute,1,file,
- {"/clearcase/otp/erts/lib/stdlib/include/qlc.hrl",1}},
- {attribute,6,file,{"./p.erl",6}},
- {function,7,q,0,
- [{clause,7,[],[],
- [{call,8,
- {remote,8,{atom,8,qlc},{atom,8,q}},
- [{tuple,-8,
- [{atom,-8,qlc_lc},
- {'fun',-8,
- {clauses,
- [{clause,-8,[],[],
- [{tuple,-8,
- [{atom,-8,simple_v1},
- {atom,-8,'X'},
- {'fun',-8,{clauses,[{clause,-8,[],[],[{nil,8}]}]}},
- {integer,-8,8}]}]}]}},
- {atom,-8,undefined}]}]}]}]},
- {eof,9}],
- {ok,'p.p',_} = compile:forms(Fs, ['S',report]),
- ok.
-
encrypted_abstr(Config) when is_list(Config) ->
?line Dog = test_server:timetrap(test_server:minutes(10)),
?line {Simple,Target} = files(Config, "encrypted_abstr"),
diff --git a/lib/crypto/c_src/crypto.c b/lib/crypto/c_src/crypto.c
index 72c9e5b8e8..e77e5fb8f0 100644
--- a/lib/crypto/c_src/crypto.c
+++ b/lib/crypto/c_src/crypto.c
@@ -44,6 +44,7 @@
#include <openssl/md5.h>
#include <openssl/md4.h>
#include <openssl/sha.h>
+#include <openssl/ripemd.h>
#include <openssl/bn.h>
#include <openssl/objects.h>
#include <openssl/rc4.h>
@@ -139,6 +140,10 @@ static ERL_NIF_TERM md5(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
static ERL_NIF_TERM md5_init(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
static ERL_NIF_TERM md5_update(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
static ERL_NIF_TERM md5_final(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
+static ERL_NIF_TERM ripemd160(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
+static ERL_NIF_TERM ripemd160_init(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
+static ERL_NIF_TERM ripemd160_update(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
+static ERL_NIF_TERM ripemd160_final(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
static ERL_NIF_TERM sha(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
static ERL_NIF_TERM sha_init(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
static ERL_NIF_TERM sha_update(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[]);
@@ -246,6 +251,10 @@ static ErlNifFunc nif_funcs[] = {
{"md5_init", 0, md5_init},
{"md5_update", 2, md5_update},
{"md5_final", 1, md5_final},
+ {"ripemd160", 1, ripemd160},
+ {"ripemd160_init", 0, ripemd160_init},
+ {"ripemd160_update", 2, ripemd160_update},
+ {"ripemd160_final", 1, ripemd160_final},
{"sha", 1, sha},
{"sha_init", 0, sha_init},
{"sha_update", 2, sha_update},
@@ -326,6 +335,8 @@ ERL_NIF_INIT(crypto,nif_funcs,load,NULL,upgrade,unload)
#define MD5_LEN_96 12
#define MD4_CTX_LEN (sizeof(MD4_CTX))
#define MD4_LEN 16
+#define RIPEMD160_CTX_LEN (sizeof(RIPEMD160_CTX))
+#define RIPEMD160_LEN 20
#define SHA_CTX_LEN (sizeof(SHA_CTX))
#define SHA_LEN 20
#define SHA_LEN_96 12
@@ -600,6 +611,53 @@ static ERL_NIF_TERM md5_final(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[
return ret;
}
+static ERL_NIF_TERM ripemd160(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
+{/* (Data) */
+ ErlNifBinary ibin;
+ ERL_NIF_TERM ret;
+
+ if (!enif_inspect_iolist_as_binary(env, argv[0], &ibin)) {
+ return enif_make_badarg(env);
+ }
+ RIPEMD160((unsigned char *) ibin.data, ibin.size,
+ enif_make_new_binary(env,RIPEMD160_LEN, &ret));
+ return ret;
+}
+static ERL_NIF_TERM ripemd160_init(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
+{/* () */
+ ERL_NIF_TERM ret;
+ RIPEMD160_Init((RIPEMD160_CTX *) enif_make_new_binary(env, RIPEMD160_CTX_LEN, &ret));
+ return ret;
+}
+static ERL_NIF_TERM ripemd160_update(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
+{/* (Context, Data) */
+ RIPEMD160_CTX* new_ctx;
+ ErlNifBinary ctx_bin, data_bin;
+ ERL_NIF_TERM ret;
+ if (!enif_inspect_binary(env, argv[0], &ctx_bin)
+ || ctx_bin.size != RIPEMD160_CTX_LEN
+ || !enif_inspect_iolist_as_binary(env, argv[1], &data_bin)) {
+ return enif_make_badarg(env);
+ }
+ new_ctx = (RIPEMD160_CTX*) enif_make_new_binary(env,RIPEMD160_CTX_LEN, &ret);
+ memcpy(new_ctx, ctx_bin.data, RIPEMD160_CTX_LEN);
+ RIPEMD160_Update(new_ctx, data_bin.data, data_bin.size);
+ return ret;
+}
+static ERL_NIF_TERM ripemd160_final(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
+{/* (Context) */
+ ErlNifBinary ctx_bin;
+ RIPEMD160_CTX ctx_clone;
+ ERL_NIF_TERM ret;
+ if (!enif_inspect_binary(env, argv[0], &ctx_bin) || ctx_bin.size != RIPEMD160_CTX_LEN) {
+ return enif_make_badarg(env);
+ }
+ memcpy(&ctx_clone, ctx_bin.data, RIPEMD160_CTX_LEN); /* writable */
+ RIPEMD160_Final(enif_make_new_binary(env, RIPEMD160_LEN, &ret), &ctx_clone);
+ return ret;
+}
+
+
static ERL_NIF_TERM sha(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{/* (Data) */
ErlNifBinary ibin;
diff --git a/lib/crypto/doc/src/crypto.xml b/lib/crypto/doc/src/crypto.xml
index 3e533158c8..14c77c873f 100644..100755
--- a/lib/crypto/doc/src/crypto.xml
+++ b/lib/crypto/doc/src/crypto.xml
@@ -265,7 +265,7 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
<name>hash(Type, Data) -> Digest</name>
<fsummary></fsummary>
<type>
- <v>Type = md4 | md5 | sha | sha224 | sha256 | sha384 | sha512</v>
+ <v>Type = md4 | md5 | ripemd160 | sha | sha224 | sha256 | sha384 | sha512</v>
<v>Data = iodata()</v>
<v>Digest = binary()</v>
</type>
@@ -279,7 +279,7 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
<name>hash_init(Type) -> Context</name>
<fsummary></fsummary>
<type>
- <v>Type = md4 | md5 | sha | sha224 | sha256 | sha384 | sha512</v>
+ <v>Type = md4 | md5 | ripemd160 | sha | sha224 | sha256 | sha384 | sha512</v>
</type>
<desc>
<p>Initializes the context for streaming hash operations. <c>Type</c> determines
@@ -343,10 +343,27 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
</desc>
</func>
<func>
+ <name>hmac(Type, Key, Data) -> Mac</name>
+ <name>hmac(Type, Key, Data, MacLength) -> Mac</name>
+ <fsummary></fsummary>
+ <type>
+ <v>Type = md5 | sha | sha224 | sha256 | sha384 | sha512</v>
+ <v>Key = iodata()</v>
+ <v>Data = iodata()</v>
+ <v>MacLength = integer()</v>
+ <v>Mac = binary()</v>
+ </type>
+ <desc>
+ <p>Computes a HMAC of type <c>Type</c> from <c>Data</c> using
+ <c>Key</c> as the authentication key.</p> <c>MacLength</c>
+ will limit the size of the resultant <c>Mac</c>.
+ </desc>
+ </func>
+ <func>
<name>hmac_init(Type, Key) -> Context</name>
<fsummary></fsummary>
<type>
- <v>Type = sha | md5 | ripemd160</v>
+ <v>Type = md5 | ripemd160 | sha | sha224 | sha256 | sha384 | sha512</v>
<v>Key = iolist() | binary()</v>
<v>Context = binary()</v>
</type>
diff --git a/lib/crypto/src/crypto.erl b/lib/crypto/src/crypto.erl
index 461558a79e..aa89f6cc61 100644
--- a/lib/crypto/src/crypto.erl
+++ b/lib/crypto/src/crypto.erl
@@ -35,7 +35,7 @@
-export([sha256_mac/2, sha256_mac/3]).
-export([sha384_mac/2, sha384_mac/3]).
-export([sha512_mac/2, sha512_mac/3]).
--export([hmac_init/2, hmac_update/2, hmac_final/1, hmac_final_n/2]).
+-export([hmac/3, hmac/4, hmac_init/2, hmac_update/2, hmac_final/1, hmac_final_n/2]).
-export([des_cbc_encrypt/3, des_cbc_decrypt/3, des_cbc_ivec/1]).
-export([des_ecb_encrypt/2, des_ecb_decrypt/2]).
-export([des_cfb_encrypt/3, des_cfb_decrypt/3, des_cfb_ivec/2]).
@@ -107,7 +107,7 @@
blowfish_ecb_encrypt, blowfish_ecb_decrypt, blowfish_ofb64_encrypt,
des_cbc_ivec, des_cfb_ivec, erlint, mpint,
hash, hash_init, hash_update, hash_final,
- hmac_init, hmac_update, hmac_final, hmac_final_n, info,
+ hmac, hmac_init, hmac_update, hmac_final, hmac_final_n, info,
rc2_cbc_encrypt, rc2_cbc_decrypt,
info_lib]).
@@ -197,43 +197,48 @@ version() -> ?CRYPTO_VSN.
%%
-spec hash(_, iodata()) -> binary().
-hash(md5, Data) -> md5(Data);
-hash(md4, Data) -> md4(Data);
-hash(sha, Data) -> sha(Data);
-hash(sha224, Data) -> sha224(Data);
-hash(sha256, Data) -> sha256(Data);
-hash(sha384, Data) -> sha384(Data);
-hash(sha512, Data) -> sha512(Data).
-
--spec hash_init('md5'|'md4'|'sha'|'sha224'|'sha256'|'sha384'|'sha512') -> any().
-
-hash_init(md5) -> {md5, md5_init()};
-hash_init(md4) -> {md4, md4_init()};
-hash_init(sha) -> {sha, sha_init()};
-hash_init(sha224) -> {sha224, sha224_init()};
-hash_init(sha256) -> {sha256, sha256_init()};
-hash_init(sha384) -> {sha384, sha384_init()};
-hash_init(sha512) -> {sha512, sha512_init()}.
+hash(md5, Data) -> md5(Data);
+hash(md4, Data) -> md4(Data);
+hash(sha, Data) -> sha(Data);
+hash(ripemd160, Data) -> ripemd160(Data);
+hash(sha224, Data) -> sha224(Data);
+hash(sha256, Data) -> sha256(Data);
+hash(sha384, Data) -> sha384(Data);
+hash(sha512, Data) -> sha512(Data).
+
+-spec hash_init('md5'|'md4'|'ripemd160'|
+ 'sha'|'sha224'|'sha256'|'sha384'|'sha512') -> any().
+
+hash_init(md5) -> {md5, md5_init()};
+hash_init(md4) -> {md4, md4_init()};
+hash_init(sha) -> {sha, sha_init()};
+hash_init(ripemd160) -> {ripemd160, ripemd160_init()};
+hash_init(sha224) -> {sha224, sha224_init()};
+hash_init(sha256) -> {sha256, sha256_init()};
+hash_init(sha384) -> {sha384, sha384_init()};
+hash_init(sha512) -> {sha512, sha512_init()}.
-spec hash_update(_, iodata()) -> any().
-hash_update({md5,Context}, Data) -> {md5, md5_update(Context,Data)};
-hash_update({md4,Context}, Data) -> {md4, md4_update(Context,Data)};
-hash_update({sha,Context}, Data) -> {sha, sha_update(Context,Data)};
-hash_update({sha224,Context}, Data) -> {sha224, sha224_update(Context,Data)};
-hash_update({sha256,Context}, Data) -> {sha256, sha256_update(Context,Data)};
-hash_update({sha384,Context}, Data) -> {sha384, sha384_update(Context,Data)};
-hash_update({sha512,Context}, Data) -> {sha512, sha512_update(Context,Data)}.
+hash_update({md5,Context}, Data) -> {md5, md5_update(Context,Data)};
+hash_update({md4,Context}, Data) -> {md4, md4_update(Context,Data)};
+hash_update({sha,Context}, Data) -> {sha, sha_update(Context,Data)};
+hash_update({ripemd160,Context}, Data) -> {ripemd160, ripemd160_update(Context,Data)};
+hash_update({sha224,Context}, Data) -> {sha224, sha224_update(Context,Data)};
+hash_update({sha256,Context}, Data) -> {sha256, sha256_update(Context,Data)};
+hash_update({sha384,Context}, Data) -> {sha384, sha384_update(Context,Data)};
+hash_update({sha512,Context}, Data) -> {sha512, sha512_update(Context,Data)}.
-spec hash_final(_) -> binary().
-hash_final({md5,Context}) -> md5_final(Context);
-hash_final({md4,Context}) -> md4_final(Context);
-hash_final({sha,Context}) -> sha_final(Context);
-hash_final({sha224,Context}) -> sha224_final(Context);
-hash_final({sha256,Context}) -> sha256_final(Context);
-hash_final({sha384,Context}) -> sha384_final(Context);
-hash_final({sha512,Context}) -> sha512_final(Context).
+hash_final({md5,Context}) -> md5_final(Context);
+hash_final({md4,Context}) -> md4_final(Context);
+hash_final({sha,Context}) -> sha_final(Context);
+hash_final({ripemd160,Context}) -> ripemd160_final(Context);
+hash_final({sha224,Context}) -> sha224_final(Context);
+hash_final({sha256,Context}) -> sha256_final(Context);
+hash_final({sha384,Context}) -> sha384_final(Context);
+hash_final({sha512,Context}) -> sha512_final(Context).
%%
%% MD5
@@ -263,6 +268,20 @@ md4_update(_Context, _Data) -> ?nif_stub.
md4_final(_Context) -> ?nif_stub.
%%
+%% RIPEMD160
+%%
+
+-spec ripemd160(iodata()) -> binary().
+-spec ripemd160_init() -> binary().
+-spec ripemd160_update(binary(), iodata()) -> binary().
+-spec ripemd160_final(binary()) -> binary().
+
+ripemd160(_Data) -> ?nif_stub.
+ripemd160_init() -> ?nif_stub.
+ripemd160_update(_Context, _Data) -> ?nif_stub.
+ripemd160_final(_Context) -> ?nif_stub.
+
+%%
%% SHA
%%
-spec sha(iodata()) -> binary().
@@ -418,11 +437,28 @@ sha512_final_nif(_Context) -> ?nif_stub.
%%
%% HMAC (multiple hash options)
%%
+
+-spec hmac(_, iodata(), iodata()) -> binary().
+-spec hmac(_, iodata(), iodata(), integer()) -> binary().
-spec hmac_init(atom(), iodata()) -> binary().
-spec hmac_update(binary(), iodata()) -> binary().
-spec hmac_final(binary()) -> binary().
-spec hmac_final_n(binary(), integer()) -> binary().
+hmac(md5, Key, Data) -> md5_mac(Key, Data);
+hmac(sha, Key, Data) -> sha_mac(Key, Data);
+hmac(sha224, Key, Data) -> sha224_mac(Key, Data);
+hmac(sha256, Key, Data) -> sha256_mac(Key, Data);
+hmac(sha384, Key, Data) -> sha384_mac(Key, Data);
+hmac(sha512, Key, Data) -> sha512_mac(Key, Data).
+
+hmac(md5, Key, Data, Size) -> md5_mac_n(Key, Data, Size);
+hmac(sha, Key, Data, Size) -> sha_mac(Key, Data, Size);
+hmac(sha224, Key, Data, Size) -> sha224_mac(Key, Data, Size);
+hmac(sha256, Key, Data, Size) -> sha256_mac(Key, Data, Size);
+hmac(sha384, Key, Data, Size) -> sha384_mac(Key, Data, Size);
+hmac(sha512, Key, Data, Size) -> sha512_mac(Key, Data, Size).
+
hmac_init(_Type, _Key) -> ?nif_stub.
hmac_update(_Context, _Data) -> ? nif_stub.
hmac_final(_Context) -> ? nif_stub.
diff --git a/lib/crypto/test/crypto_SUITE.erl b/lib/crypto/test/crypto_SUITE.erl
index 8965ab6b94..142f06677a 100644
--- a/lib/crypto/test/crypto_SUITE.erl
+++ b/lib/crypto/test/crypto_SUITE.erl
@@ -38,7 +38,10 @@
hmac_update_md5/1,
hmac_update_md5_io/1,
hmac_update_md5_n/1,
+ hmac_rfc2202/1,
hmac_rfc4231/1,
+ ripemd160/1,
+ ripemd160_update/1,
sha256/1,
sha256_update/1,
sha512/1,
@@ -86,11 +89,11 @@ groups() ->
[{info, [sequence],[info, {group, rest}]},
{rest, [],
[md5, md5_update, md4, md4_update, md5_mac,
- md5_mac_io, sha, sha_update,
+ md5_mac_io, ripemd160, ripemd160_update, sha, sha_update,
sha256, sha256_update, sha512, sha512_update,
hmac_update_sha, hmac_update_sha_n, hmac_update_sha256, hmac_update_sha512,
hmac_update_md5_n, hmac_update_md5_io, hmac_update_md5,
- hmac_rfc4231,
+ hmac_rfc2202, hmac_rfc4231,
des_cbc, aes_cfb, aes_cbc,
des_cfb, des_cfb_iter, des3_cbc, des3_cfb, rc2_cbc,
aes_cbc_iter, aes_ctr, aes_ctr_stream, des_cbc_iter, des_ecb,
@@ -418,8 +421,169 @@ hmac_update_md5(Config) when is_list(Config) ->
?line Exp2 = crypto:md5_mac(Key2, lists:flatten([Long1, Long2, Long3])),
?line m(Exp2, Mac2).
+hmac_rfc2202(doc) ->
+ ["Generate an HMAC using hmac, md5_mac, and sha_mac."
+ "Test vectors are taken from RFC-2202."];
+hmac_rfc2202(suite) ->
+ [];
+hmac_rfc2202(Config) when is_list(Config) ->
+ hmac_rfc2202_md5(),
+ hmac_rfc2202_sha().
+
+hmac_rfc2202_md5() ->
+ %% Test case 1
+ Case1Key = binary:copy(<<16#0b>>, 16),
+ Case1Data = <<"Hi There">>,
+ Case1Exp = hexstr2bin("9294727a3638bb1c13f48ef8158bfc9d"),
+
+ ?line Case1Mac_1 = crypto:md5_mac(Case1Key, Case1Data),
+ ?line Case1Mac_2 = crypto:hmac(md5, Case1Key, Case1Data),
+ ?line m(Case1Exp, Case1Mac_1),
+ ?line m(Case1Exp, Case1Mac_2),
+
+ %% Test case 2
+ Case2Key = <<"Jefe">>,
+ Case2Data = <<"what do ya want for nothing?">>,
+ Case2Exp = hexstr2bin("750c783e6ab0b503eaa86e310a5db738"),
+
+ ?line Case2Mac_1 = crypto:md5_mac(Case2Key, Case2Data),
+ ?line Case2Mac_2 = crypto:hmac(md5, Case2Key, Case2Data),
+ ?line m(Case2Exp, Case2Mac_1),
+ ?line m(Case2Exp, Case2Mac_2),
+
+ %% Test case 3
+ Case3Key = binary:copy(<<16#aa>>, 16),
+ Case3Data = binary:copy(<<16#dd>>, 50),
+ Case3Exp = hexstr2bin("56be34521d144c88dbb8c733f0e8b3f6"),
+
+ ?line Case3Mac_1 = crypto:md5_mac(Case3Key, Case3Data),
+ ?line Case3Mac_2 = crypto:hmac(md5, Case3Key, Case3Data),
+ ?line m(Case3Exp, Case3Mac_1),
+ ?line m(Case3Exp, Case3Mac_2),
+
+ %% Test case 4
+ Case4Key = list_to_binary(lists:seq(1, 16#19)),
+ Case4Data = binary:copy(<<16#cd>>, 50),
+ Case4Exp = hexstr2bin("697eaf0aca3a3aea3a75164746ffaa79"),
+
+ ?line Case4Mac_1 = crypto:md5_mac(Case4Key, Case4Data),
+ ?line Case4Mac_2 = crypto:hmac(md5, Case4Key, Case4Data),
+ ?line m(Case4Exp, Case4Mac_1),
+ ?line m(Case4Exp, Case4Mac_2),
+
+ %% Test case 5
+ Case5Key = binary:copy(<<16#0c>>, 16),
+ Case5Data = "Test With Truncation",
+ Case5Exp = hexstr2bin("56461ef2342edc00f9bab995690efd4c"),
+ Case5Exp96 = hexstr2bin("56461ef2342edc00f9bab995"),
+
+ ?line Case5Mac_1 = crypto:md5_mac(Case5Key, Case5Data),
+ ?line Case5Mac_2 = crypto:hmac(md5, Case5Key, Case5Data),
+ ?line Case5Mac96_1 = crypto:md5_mac_96(Case5Key, Case5Data),
+ ?line Case5Mac96_2 = crypto:hmac(md5, Case5Key, Case5Data, 12),
+ ?line m(Case5Exp, Case5Mac_1),
+ ?line m(Case5Exp, Case5Mac_2),
+ ?line m(Case5Exp96, Case5Mac96_1),
+ ?line m(Case5Exp96, Case5Mac96_2),
+
+ %% Test case 6
+ Case6Key = binary:copy(<<16#aa>>, 80),
+ Case6Data = <<"Test Using Larger Than Block-Size Key - Hash Key First">>,
+ Case6Exp = hexstr2bin("6b1ab7fe4bd7bf8f0b62e6ce61b9d0cd"),
+
+ ?line Case6Mac_1 = crypto:md5_mac(Case6Key, Case6Data),
+ ?line Case6Mac_2 = crypto:hmac(md5, Case6Key, Case6Data),
+ ?line m(Case6Exp, Case6Mac_1),
+ ?line m(Case6Exp, Case6Mac_2),
+
+ %% Test case 7
+ Case7Key = binary:copy(<<16#aa>>, 80),
+ Case7Data = <<"Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data">>,
+ Case7Exp = hexstr2bin("6f630fad67cda0ee1fb1f562db3aa53e"),
+
+ ?line Case7Mac_1 = crypto:md5_mac(Case7Key, Case7Data),
+ ?line Case7Mac_2 = crypto:hmac(md5, Case7Key, Case7Data),
+ ?line m(Case7Exp, Case7Mac_1),
+ ?line m(Case7Exp, Case7Mac_2).
+
+hmac_rfc2202_sha() ->
+ %% Test case 1
+ Case1Key = binary:copy(<<16#0b>>, 20),
+ Case1Data = <<"Hi There">>,
+ Case1Exp = hexstr2bin("b617318655057264e28bc0b6fb378c8ef146be00"),
+
+ ?line Case1Mac_1 = crypto:sha_mac(Case1Key, Case1Data),
+ ?line Case1Mac_2 = crypto:hmac(sha, Case1Key, Case1Data),
+ ?line m(Case1Exp, Case1Mac_1),
+ ?line m(Case1Exp, Case1Mac_2),
+
+ %% Test case 2
+ Case2Key = <<"Jefe">>,
+ Case2Data = <<"what do ya want for nothing?">>,
+ Case2Exp = hexstr2bin("effcdf6ae5eb2fa2d27416d5f184df9c259a7c79"),
+
+ ?line Case2Mac_1 = crypto:sha_mac(Case2Key, Case2Data),
+ ?line Case2Mac_2 = crypto:hmac(sha, Case2Key, Case2Data),
+ ?line m(Case2Exp, Case2Mac_1),
+ ?line m(Case2Exp, Case2Mac_2),
+
+ %% Test case 3
+ Case3Key = binary:copy(<<16#aa>>, 20),
+ Case3Data = binary:copy(<<16#dd>>, 50),
+ Case3Exp = hexstr2bin("125d7342b9ac11cd91a39af48aa17b4f63f175d3"),
+
+ ?line Case3Mac_1 = crypto:sha_mac(Case3Key, Case3Data),
+ ?line Case3Mac_2 = crypto:hmac(sha, Case3Key, Case3Data),
+ ?line m(Case3Exp, Case3Mac_1),
+ ?line m(Case3Exp, Case3Mac_2),
+
+ %% Test case 4
+ Case4Key = list_to_binary(lists:seq(1, 16#19)),
+ Case4Data = binary:copy(<<16#cd>>, 50),
+ Case4Exp = hexstr2bin("4c9007f4026250c6bc8414f9bf50c86c2d7235da"),
+
+ ?line Case4Mac_1 = crypto:sha_mac(Case4Key, Case4Data),
+ ?line Case4Mac_2 = crypto:hmac(sha, Case4Key, Case4Data),
+ ?line m(Case4Exp, Case4Mac_1),
+ ?line m(Case4Exp, Case4Mac_2),
+
+ %% Test case 5
+ Case5Key = binary:copy(<<16#0c>>, 20),
+ Case5Data = "Test With Truncation",
+ Case5Exp = hexstr2bin("4c1a03424b55e07fe7f27be1d58bb9324a9a5a04"),
+ Case5Exp96 = hexstr2bin("4c1a03424b55e07fe7f27be1"),
+
+ ?line Case5Mac_1 = crypto:sha_mac(Case5Key, Case5Data),
+ ?line Case5Mac_2 = crypto:hmac(sha, Case5Key, Case5Data),
+ ?line Case5Mac96_1 = crypto:sha_mac_96(Case5Key, Case5Data),
+ ?line Case5Mac96_2 = crypto:hmac(sha, Case5Key, Case5Data, 12),
+ ?line m(Case5Exp, Case5Mac_1),
+ ?line m(Case5Exp, Case5Mac_2),
+ ?line m(Case5Exp96, Case5Mac96_1),
+ ?line m(Case5Exp96, Case5Mac96_2),
+
+ %% Test case 6
+ Case6Key = binary:copy(<<16#aa>>, 80),
+ Case6Data = <<"Test Using Larger Than Block-Size Key - Hash Key First">>,
+ Case6Exp = hexstr2bin("aa4ae5e15272d00e95705637ce8a3b55ed402112"),
+
+ ?line Case6Mac_1 = crypto:sha_mac(Case6Key, Case6Data),
+ ?line Case6Mac_2 = crypto:hmac(sha, Case6Key, Case6Data),
+ ?line m(Case6Exp, Case6Mac_1),
+ ?line m(Case6Exp, Case6Mac_2),
+
+ %% Test case 7
+ Case7Key = binary:copy(<<16#aa>>, 80),
+ Case7Data = <<"Test Using Larger Than Block-Size Key and Larger Than One Block-Size Data">>,
+ Case7Exp = hexstr2bin("e8e99d0f45237d786d6bbaa7965c7808bbff1a91"),
+
+ ?line Case7Mac_1 = crypto:sha_mac(Case7Key, Case7Data),
+ ?line Case7Mac_2 = crypto:hmac(sha, Case7Key, Case7Data),
+ ?line m(Case7Exp, Case7Mac_1),
+ ?line m(Case7Exp, Case7Mac_2).
+
hmac_rfc4231(doc) ->
- ["Generate an HMAC using crypto:shaXXX_mac and hmac_init, hmac_update, and hmac_final. "
+ ["Generate an HMAC using crypto:shaXXX_mac, hmac, and hmac_init, hmac_update, and hmac_final. "
"Testvectors are take from RFC4231." ];
hmac_rfc4231(suite) ->
[];
@@ -446,29 +610,37 @@ hmac_rfc4231_do() ->
?line Case1Ctx224_2 = crypto:hmac_update(Case1Ctx224, Case1Data),
?line Case1Mac224_1 = crypto:hmac_final(Case1Ctx224_2),
?line Case1Mac224_2 = crypto:sha224_mac(Case1Key, Case1Data),
+ ?line Case1Mac224_3 = crypto:hmac(sha224, Case1Key, Case1Data),
?line m(Case1Exp224, Case1Mac224_1),
?line m(Case1Exp224, Case1Mac224_2),
+ ?line m(Case1Exp224, Case1Mac224_3),
?line Case1Ctx256 = crypto:hmac_init(sha256, Case1Key),
?line Case1Ctx256_2 = crypto:hmac_update(Case1Ctx256, Case1Data),
?line Case1Mac256_1 = crypto:hmac_final(Case1Ctx256_2),
?line Case1Mac256_2 = crypto:sha256_mac(Case1Key, Case1Data),
+ ?line Case1Mac256_3 = crypto:hmac(sha256, Case1Key, Case1Data),
?line m(Case1Exp256, Case1Mac256_1),
?line m(Case1Exp256, Case1Mac256_2),
+ ?line m(Case1Exp256, Case1Mac256_3),
?line Case1Ctx384 = crypto:hmac_init(sha384, Case1Key),
?line Case1Ctx384_2 = crypto:hmac_update(Case1Ctx384, Case1Data),
?line Case1Mac384_1 = crypto:hmac_final(Case1Ctx384_2),
?line Case1Mac384_2 = crypto:sha384_mac(Case1Key, Case1Data),
+ ?line Case1Mac384_3 = crypto:hmac(sha384, Case1Key, Case1Data),
?line m(Case1Exp384, Case1Mac384_1),
?line m(Case1Exp384, Case1Mac384_2),
+ ?line m(Case1Exp384, Case1Mac384_3),
?line Case1Ctx512 = crypto:hmac_init(sha512, Case1Key),
?line Case1Ctx512_2 = crypto:hmac_update(Case1Ctx512, Case1Data),
?line Case1Mac512_1 = crypto:hmac_final(Case1Ctx512_2),
?line Case1Mac512_2 = crypto:sha512_mac(Case1Key, Case1Data),
+ ?line Case1Mac512_3 = crypto:hmac(sha512, Case1Key, Case1Data),
?line m(Case1Exp512, Case1Mac512_1),
?line m(Case1Exp512, Case1Mac512_2),
+ ?line m(Case1Exp512, Case1Mac512_3),
%% Test Case 2
Case2Key = <<"Jefe">>,
@@ -489,29 +661,37 @@ hmac_rfc4231_do() ->
?line Case2Ctx224_2 = crypto:hmac_update(Case2Ctx224, Case2Data),
?line Case2Mac224_1 = crypto:hmac_final(Case2Ctx224_2),
?line Case2Mac224_2 = crypto:sha224_mac(Case2Key, Case2Data),
+ ?line Case2Mac224_3 = crypto:hmac(sha224, Case2Key, Case2Data),
?line m(Case2Exp224, Case2Mac224_1),
?line m(Case2Exp224, Case2Mac224_2),
+ ?line m(Case2Exp224, Case2Mac224_3),
?line Case2Ctx256 = crypto:hmac_init(sha256, Case2Key),
?line Case2Ctx256_2 = crypto:hmac_update(Case2Ctx256, Case2Data),
?line Case2Mac256_1 = crypto:hmac_final(Case2Ctx256_2),
?line Case2Mac256_2 = crypto:sha256_mac(Case2Key, Case2Data),
+ ?line Case2Mac256_3 = crypto:hmac(sha256, Case2Key, Case2Data),
?line m(Case2Exp256, Case2Mac256_1),
?line m(Case2Exp256, Case2Mac256_2),
+ ?line m(Case2Exp256, Case2Mac256_3),
?line Case2Ctx384 = crypto:hmac_init(sha384, Case2Key),
?line Case2Ctx384_2 = crypto:hmac_update(Case2Ctx384, Case2Data),
?line Case2Mac384_1 = crypto:hmac_final(Case2Ctx384_2),
?line Case2Mac384_2 = crypto:sha384_mac(Case2Key, Case2Data),
+ ?line Case2Mac384_3 = crypto:hmac(sha384, Case2Key, Case2Data),
?line m(Case2Exp384, Case2Mac384_1),
?line m(Case2Exp384, Case2Mac384_2),
+ ?line m(Case2Exp384, Case2Mac384_3),
?line Case2Ctx512 = crypto:hmac_init(sha512, Case2Key),
?line Case2Ctx512_2 = crypto:hmac_update(Case2Ctx512, Case2Data),
?line Case2Mac512_1 = crypto:hmac_final(Case2Ctx512_2),
?line Case2Mac512_2 = crypto:sha512_mac(Case2Key, Case2Data),
+ ?line Case2Mac512_3 = crypto:hmac(sha512, Case2Key, Case2Data),
?line m(Case2Exp512, Case2Mac512_1),
?line m(Case2Exp512, Case2Mac512_2),
+ ?line m(Case2Exp512, Case2Mac512_3),
%% Test Case 3
Case3Key = binary:copy(<<16#aa>>, 20),
@@ -532,29 +712,37 @@ hmac_rfc4231_do() ->
?line Case3Ctx224_2 = crypto:hmac_update(Case3Ctx224, Case3Data),
?line Case3Mac224_1 = crypto:hmac_final(Case3Ctx224_2),
?line Case3Mac224_2 = crypto:sha224_mac(Case3Key, Case3Data),
+ ?line Case3Mac224_3 = crypto:hmac(sha224, Case3Key, Case3Data),
?line m(Case3Exp224, Case3Mac224_1),
?line m(Case3Exp224, Case3Mac224_2),
+ ?line m(Case3Exp224, Case3Mac224_3),
?line Case3Ctx256 = crypto:hmac_init(sha256, Case3Key),
?line Case3Ctx256_2 = crypto:hmac_update(Case3Ctx256, Case3Data),
?line Case3Mac256_1 = crypto:hmac_final(Case3Ctx256_2),
?line Case3Mac256_2 = crypto:sha256_mac(Case3Key, Case3Data),
+ ?line Case3Mac256_3 = crypto:hmac(sha256, Case3Key, Case3Data),
?line m(Case3Exp256, Case3Mac256_1),
?line m(Case3Exp256, Case3Mac256_2),
+ ?line m(Case3Exp256, Case3Mac256_3),
?line Case3Ctx384 = crypto:hmac_init(sha384, Case3Key),
?line Case3Ctx384_2 = crypto:hmac_update(Case3Ctx384, Case3Data),
?line Case3Mac384_1 = crypto:hmac_final(Case3Ctx384_2),
?line Case3Mac384_2 = crypto:sha384_mac(Case3Key, Case3Data),
+ ?line Case3Mac384_3 = crypto:hmac(sha384, Case3Key, Case3Data),
?line m(Case3Exp384, Case3Mac384_1),
?line m(Case3Exp384, Case3Mac384_2),
+ ?line m(Case3Exp384, Case3Mac384_3),
?line Case3Ctx512 = crypto:hmac_init(sha512, Case3Key),
?line Case3Ctx512_2 = crypto:hmac_update(Case3Ctx512, Case3Data),
?line Case3Mac512_1 = crypto:hmac_final(Case3Ctx512_2),
?line Case3Mac512_2 = crypto:sha512_mac(Case3Key, Case3Data),
+ ?line Case3Mac512_3 = crypto:hmac(sha512, Case3Key, Case3Data),
?line m(Case3Exp512, Case3Mac512_1),
?line m(Case3Exp512, Case3Mac512_2),
+ ?line m(Case3Exp512, Case3Mac512_3),
%% Test Case 4
Case4Key = list_to_binary(lists:seq(1, 16#19)),
@@ -575,29 +763,81 @@ hmac_rfc4231_do() ->
?line Case4Ctx224_2 = crypto:hmac_update(Case4Ctx224, Case4Data),
?line Case4Mac224_1 = crypto:hmac_final(Case4Ctx224_2),
?line Case4Mac224_2 = crypto:sha224_mac(Case4Key, Case4Data),
+ ?line Case4Mac224_3 = crypto:hmac(sha224, Case4Key, Case4Data),
?line m(Case4Exp224, Case4Mac224_1),
?line m(Case4Exp224, Case4Mac224_2),
+ ?line m(Case4Exp224, Case4Mac224_3),
?line Case4Ctx256 = crypto:hmac_init(sha256, Case4Key),
?line Case4Ctx256_2 = crypto:hmac_update(Case4Ctx256, Case4Data),
?line Case4Mac256_1 = crypto:hmac_final(Case4Ctx256_2),
?line Case4Mac256_2 = crypto:sha256_mac(Case4Key, Case4Data),
+ ?line Case4Mac256_3 = crypto:hmac(sha256, Case4Key, Case4Data),
?line m(Case4Exp256, Case4Mac256_1),
?line m(Case4Exp256, Case4Mac256_2),
+ ?line m(Case4Exp256, Case4Mac256_3),
?line Case4Ctx384 = crypto:hmac_init(sha384, Case4Key),
?line Case4Ctx384_2 = crypto:hmac_update(Case4Ctx384, Case4Data),
?line Case4Mac384_1 = crypto:hmac_final(Case4Ctx384_2),
?line Case4Mac384_2 = crypto:sha384_mac(Case4Key, Case4Data),
+ ?line Case4Mac384_3 = crypto:hmac(sha384, Case4Key, Case4Data),
?line m(Case4Exp384, Case4Mac384_1),
?line m(Case4Exp384, Case4Mac384_2),
+ ?line m(Case4Exp384, Case4Mac384_3),
?line Case4Ctx512 = crypto:hmac_init(sha512, Case4Key),
?line Case4Ctx512_2 = crypto:hmac_update(Case4Ctx512, Case4Data),
?line Case4Mac512_1 = crypto:hmac_final(Case4Ctx512_2),
?line Case4Mac512_2 = crypto:sha512_mac(Case4Key, Case4Data),
+ ?line Case4Mac512_3 = crypto:hmac(sha512, Case4Key, Case4Data),
?line m(Case4Exp512, Case4Mac512_1),
?line m(Case4Exp512, Case4Mac512_2),
+ ?line m(Case4Exp512, Case4Mac512_3),
+
+ %% Test Case 5
+ Case5Key = binary:copy(<<16#0c>>, 20),
+ Case5Data = <<"Test With Truncation">>,
+ Case5Exp224 = hexstr2bin("0e2aea68a90c8d37c988bcdb9fca6fa8"),
+ Case5Exp256 = hexstr2bin("a3b6167473100ee06e0c796c2955552b"),
+ Case5Exp384 = hexstr2bin("3abf34c3503b2a23a46efc619baef897"),
+ Case5Exp512 = hexstr2bin("415fad6271580a531d4179bc891d87a6"),
+
+ ?line Case5Ctx224 = crypto:hmac_init(sha224, Case5Key),
+ ?line Case5Ctx224_2 = crypto:hmac_update(Case5Ctx224, Case5Data),
+ ?line Case5Mac224_1 = crypto:hmac_final_n(Case5Ctx224_2, 16),
+ ?line Case5Mac224_2 = crypto:sha224_mac(Case5Key, Case5Data, 16),
+ ?line Case5Mac224_3 = crypto:hmac(sha224, Case5Key, Case5Data, 16),
+ ?line m(Case5Exp224, Case5Mac224_1),
+ ?line m(Case5Exp224, Case5Mac224_2),
+ ?line m(Case5Exp224, Case5Mac224_3),
+
+ ?line Case5Ctx256 = crypto:hmac_init(sha256, Case5Key),
+ ?line Case5Ctx256_2 = crypto:hmac_update(Case5Ctx256, Case5Data),
+ ?line Case5Mac256_1 = crypto:hmac_final_n(Case5Ctx256_2, 16),
+ ?line Case5Mac256_2 = crypto:sha256_mac(Case5Key, Case5Data, 16),
+ ?line Case5Mac256_3 = crypto:hmac(sha256, Case5Key, Case5Data, 16),
+ ?line m(Case5Exp256, Case5Mac256_1),
+ ?line m(Case5Exp256, Case5Mac256_2),
+ ?line m(Case5Exp256, Case5Mac256_3),
+
+ ?line Case5Ctx384 = crypto:hmac_init(sha384, Case5Key),
+ ?line Case5Ctx384_2 = crypto:hmac_update(Case5Ctx384, Case5Data),
+ ?line Case5Mac384_1 = crypto:hmac_final_n(Case5Ctx384_2, 16),
+ ?line Case5Mac384_2 = crypto:sha384_mac(Case5Key, Case5Data, 16),
+ ?line Case5Mac384_3 = crypto:hmac(sha384, Case5Key, Case5Data, 16),
+ ?line m(Case5Exp384, Case5Mac384_1),
+ ?line m(Case5Exp384, Case5Mac384_2),
+ ?line m(Case5Exp384, Case5Mac384_3),
+
+ ?line Case5Ctx512 = crypto:hmac_init(sha512, Case5Key),
+ ?line Case5Ctx512_2 = crypto:hmac_update(Case5Ctx512, Case5Data),
+ ?line Case5Mac512_1 = crypto:hmac_final_n(Case5Ctx512_2, 16),
+ ?line Case5Mac512_2 = crypto:sha512_mac(Case5Key, Case5Data, 16),
+ ?line Case5Mac512_3 = crypto:hmac(sha512, Case5Key, Case5Data, 16),
+ ?line m(Case5Exp512, Case5Mac512_1),
+ ?line m(Case5Exp512, Case5Mac512_2),
+ ?line m(Case5Exp512, Case5Mac512_3),
%% Test Case 6
Case6Key = binary:copy(<<16#aa>>, 131),
@@ -618,29 +858,37 @@ hmac_rfc4231_do() ->
?line Case6Ctx224_2 = crypto:hmac_update(Case6Ctx224, Case6Data),
?line Case6Mac224_1 = crypto:hmac_final(Case6Ctx224_2),
?line Case6Mac224_2 = crypto:sha224_mac(Case6Key, Case6Data),
+ ?line Case6Mac224_3 = crypto:hmac(sha224, Case6Key, Case6Data),
?line m(Case6Exp224, Case6Mac224_1),
?line m(Case6Exp224, Case6Mac224_2),
+ ?line m(Case6Exp224, Case6Mac224_3),
?line Case6Ctx256 = crypto:hmac_init(sha256, Case6Key),
?line Case6Ctx256_2 = crypto:hmac_update(Case6Ctx256, Case6Data),
?line Case6Mac256_1 = crypto:hmac_final(Case6Ctx256_2),
?line Case6Mac256_2 = crypto:sha256_mac(Case6Key, Case6Data),
+ ?line Case6Mac256_3 = crypto:hmac(sha256, Case6Key, Case6Data),
?line m(Case6Exp256, Case6Mac256_1),
?line m(Case6Exp256, Case6Mac256_2),
+ ?line m(Case6Exp256, Case6Mac256_3),
?line Case6Ctx384 = crypto:hmac_init(sha384, Case6Key),
?line Case6Ctx384_2 = crypto:hmac_update(Case6Ctx384, Case6Data),
?line Case6Mac384_1 = crypto:hmac_final(Case6Ctx384_2),
?line Case6Mac384_2 = crypto:sha384_mac(Case6Key, Case6Data),
+ ?line Case6Mac384_3 = crypto:hmac(sha384, Case6Key, Case6Data),
?line m(Case6Exp384, Case6Mac384_1),
?line m(Case6Exp384, Case6Mac384_2),
+ ?line m(Case6Exp384, Case6Mac384_3),
?line Case6Ctx512 = crypto:hmac_init(sha512, Case6Key),
?line Case6Ctx512_2 = crypto:hmac_update(Case6Ctx512, Case6Data),
?line Case6Mac512_1 = crypto:hmac_final(Case6Ctx512_2),
?line Case6Mac512_2 = crypto:sha512_mac(Case6Key, Case6Data),
+ ?line Case6Mac512_3 = crypto:hmac(sha512, Case6Key, Case6Data),
?line m(Case6Exp512, Case6Mac512_1),
?line m(Case6Exp512, Case6Mac512_2),
+ ?line m(Case6Exp512, Case6Mac512_3),
%% Test Case 7
Case7Key = binary:copy(<<16#aa>>, 131),
@@ -663,29 +911,37 @@ hmac_rfc4231_do() ->
?line Case7Ctx224_2 = crypto:hmac_update(Case7Ctx224, Case7Data),
?line Case7Mac224_1 = crypto:hmac_final(Case7Ctx224_2),
?line Case7Mac224_2 = crypto:sha224_mac(Case7Key, Case7Data),
+ ?line Case7Mac224_3 = crypto:hmac(sha224, Case7Key, Case7Data),
?line m(Case7Exp224, Case7Mac224_1),
?line m(Case7Exp224, Case7Mac224_2),
+ ?line m(Case7Exp224, Case7Mac224_3),
?line Case7Ctx256 = crypto:hmac_init(sha256, Case7Key),
?line Case7Ctx256_2 = crypto:hmac_update(Case7Ctx256, Case7Data),
?line Case7Mac256_1 = crypto:hmac_final(Case7Ctx256_2),
?line Case7Mac256_2 = crypto:sha256_mac(Case7Key, Case7Data),
+ ?line Case7Mac256_3 = crypto:hmac(sha256, Case7Key, Case7Data),
?line m(Case7Exp256, Case7Mac256_1),
?line m(Case7Exp256, Case7Mac256_2),
+ ?line m(Case7Exp256, Case7Mac256_3),
?line Case7Ctx384 = crypto:hmac_init(sha384, Case7Key),
?line Case7Ctx384_2 = crypto:hmac_update(Case7Ctx384, Case7Data),
?line Case7Mac384_1 = crypto:hmac_final(Case7Ctx384_2),
?line Case7Mac384_2 = crypto:sha384_mac(Case7Key, Case7Data),
+ ?line Case7Mac384_3 = crypto:hmac(sha384, Case7Key, Case7Data),
?line m(Case7Exp384, Case7Mac384_1),
?line m(Case7Exp384, Case7Mac384_2),
+ ?line m(Case7Exp384, Case7Mac384_3),
?line Case7Ctx512 = crypto:hmac_init(sha512, Case7Key),
?line Case7Ctx512_2 = crypto:hmac_update(Case7Ctx512, Case7Data),
?line Case7Mac512_1 = crypto:hmac_final(Case7Ctx512_2),
?line Case7Mac512_2 = crypto:sha512_mac(Case7Key, Case7Data),
+ ?line Case7Mac512_3 = crypto:hmac(sha512, Case7Key, Case7Data),
?line m(Case7Exp512, Case7Mac512_1),
- ?line m(Case7Exp512, Case7Mac512_2).
+ ?line m(Case7Exp512, Case7Mac512_2),
+ ?line m(Case7Exp512, Case7Mac512_3).
hmac_update_md5_io(doc) ->
["Generate an MD5 HMAC using hmac_init, hmac_update, and hmac_final. "
@@ -719,7 +975,33 @@ hmac_update_md5_n(Config) when is_list(Config) ->
?line Mac = crypto:hmac_final_n(Ctx3, 12),
?line Exp = crypto:md5_mac_96(Key, lists:flatten([Data, Data2])),
?line m(Exp, Mac).
-
+%%
+%%
+ripemd160(doc) ->
+ ["Generate RIPEMD160 message digests and check the result."];
+ripemd160(suite) ->
+ [];
+ripemd160(Config) when is_list(Config) ->
+ ?line m(crypto:hash(ripemd160,"abc"),
+ hexstr2bin("8EB208F7E05D987A9B044A8E98C6B087F15A0BFC")),
+ ?line m(crypto:hash(ripemd160,"abcdbcdecdefdefgefghfghighijhijkijkljklmklm"
+ "nlmnomnopnopq"),
+ hexstr2bin("12A053384A9C0C88E405A06C27DCF49ADA62EB2B")).
+
+
+%%
+%%
+ripemd160_update(doc) ->
+ ["Generate RIPEMD160 message digests by using ripemd160_init,"
+ "ripemd160_update, and ripemd160_final and check the result."];
+ripemd160_update(suite) ->
+ [];
+ripemd160_update(Config) when is_list(Config) ->
+ ?line Ctx = crypto:hash_init(ripemd160),
+ ?line Ctx1 = crypto:hash_update(Ctx, "abcdbcdecdefdefgefghfghighi"),
+ ?line Ctx2 = crypto:hash_update(Ctx1, "jhijkijkljklmklmnlmnomnopnopq"),
+ ?line m(crypto:hash_final(Ctx2),
+ hexstr2bin("12A053384A9C0C88E405A06C27DCF49ADA62EB2B")).
%%
%%
@@ -1838,7 +2120,7 @@ worker_loop(N, Config) ->
aes_cfb, aes_cbc, des_cbc_iter, rand_uniform_test, strong_rand_test,
rsa_verify_test, exor_test, rc4_test, rc4_stream_test, mod_exp_test,
hmac_update_md5, hmac_update_sha, hmac_update_sha256, hmac_update_sha512,
- hmac_rfc4231,
+ hmac_rfc2202, hmac_rfc4231,
aes_ctr_stream },
F = element(random:uniform(size(Funcs)),Funcs),
diff --git a/lib/debugger/src/dbg_wx_filedialog_win.erl b/lib/debugger/src/dbg_wx_filedialog_win.erl
index f109652a70..c8ecb7b5d4 100644
--- a/lib/debugger/src/dbg_wx_filedialog_win.erl
+++ b/lib/debugger/src/dbg_wx_filedialog_win.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -381,7 +381,6 @@ show_completion(Wanted, State = #state{text=TC, win=Win, list=LC, completion=Com
Last = wxTextCtrl:getLastPosition(TC),
wxTextCtrl:setSelection(TC, Start, Last),
destroy_completion(Comp),
- wxWindow:setFocus(TC),
State#state{ptext=Path, completion=undefined};
Paths when Comp =:= undefined ->
{PosX,PosY} = wxListCtrl:getPosition(LC),
@@ -406,14 +405,16 @@ show_completion(Wanted, State = #state{text=TC, win=Win, list=LC, completion=Com
%% wxListBox:connect(LB, command_listbox_doubleclicked),
wxListBox:connect(LB, command_listbox_selected),
wxWindow:show(Temp),
+ %% setFocus does a select all on 2.9 sigh..
+ {Start, Last} = wxTextCtrl:getSelection(TC),
wxWindow:setFocus(TC),
+ wxTextCtrl:setSelection(TC, Start, Last),
State#state{completion = {Temp, LB}, ptext=Wanted};
Paths ->
{_Temp, LB} = Comp,
wxListBox:clear(LB),
Files = [filename:basename(File) || File <- Paths],
- wxListBox:insertItems(LB,Files,0),
- wxWindow:setFocus(TC),
+ Files /= [] andalso wxListBox:insertItems(LB,Files,0),
State#state{ptext=Wanted}
end.
diff --git a/lib/debugger/src/int.erl b/lib/debugger/src/int.erl
index b3a8a07f03..1c9f2eddd1 100644
--- a/lib/debugger/src/int.erl
+++ b/lib/debugger/src/int.erl
@@ -626,18 +626,18 @@ find_src(Beam) ->
find_beam(Mod, Src) ->
SrcDir = filename:dirname(Src),
- BeamFile = packages:last(Mod) ++ code:objfile_extension(),
+ BeamFile = atom_to_list(Mod) ++ code:objfile_extension(),
File = filename:join(SrcDir, BeamFile),
case is_file(File) of
true -> File;
- false -> find_beam_1(Mod, SrcDir)
+ false -> find_beam_1(Mod, BeamFile, SrcDir)
end.
-find_beam_1(Mod, SrcDir) ->
- RootDir = find_root_dir(SrcDir, packages:first(Mod)),
+find_beam_1(Mod, BeamFile, SrcDir) ->
+ RootDir = filename:dirname(SrcDir),
EbinDir = filename:join(RootDir, "ebin"),
CodePath = [EbinDir | code:get_path()],
- BeamFile = to_path(Mod) ++ code:objfile_extension(),
+ BeamFile = atom_to_list(Mod) ++ code:objfile_extension(),
lists:foldl(fun(_, Beam) when is_list(Beam) -> Beam;
(Dir, error) ->
File = filename:join(Dir, BeamFile),
@@ -649,14 +649,6 @@ find_beam_1(Mod, SrcDir) ->
error,
CodePath).
-to_path(X) ->
- filename:join(packages:split(X)).
-
-find_root_dir(Dir, [_|Ss]) ->
- find_root_dir(filename:dirname(Dir), Ss);
-find_root_dir(Dir, []) ->
- filename:dirname(Dir).
-
check_beam(BeamBin) when is_binary(BeamBin) ->
case beam_lib:chunks(BeamBin, [abstract_code,exports]) of
{ok,{_Mod,[{abstract_code,no_abstract_code}|_]}} ->
@@ -711,14 +703,11 @@ scan_module_name_2(_, _) ->
scan_module_name_3(Ts) ->
case erl_parse:parse_form(Ts) of
- {ok, {attribute,_,module,{M,_}}} -> module_atom(M);
- {ok, {attribute,_,module,M}} -> module_atom(M);
+ {ok, {attribute,_,module,{M,_}}} -> M;
+ {ok, {attribute,_,module,M}} -> M;
_ -> error
end.
-module_atom(A) when is_atom(A) -> A;
-module_atom(L) when is_list(L) -> list_to_atom(packages:concat(L)).
-
%%--Stop interpreting modules-----------------------------------------
del_mod(AbsMod, Dist) ->
diff --git a/lib/dialyzer/test/options1_SUITE_data/src/compiler/sys_pre_expand.erl b/lib/dialyzer/test/options1_SUITE_data/src/compiler/sys_pre_expand.erl
index 08bc6cb147..41b7cb248d 100644
--- a/lib/dialyzer/test/options1_SUITE_data/src/compiler/sys_pre_expand.erl
+++ b/lib/dialyzer/test/options1_SUITE_data/src/compiler/sys_pre_expand.erl
@@ -149,14 +149,12 @@ forms([], St) -> {[],St}.
%% Process an attribute, this just affects the state.
attribute(module, {Module, As}, St) ->
- M = package_to_string(Module),
- St#expand{module=list_to_atom(M),
- package = packages:strip_last(M),
+ true = is_atom(Module),
+ St#expand{module=Module,
parameters=As};
attribute(module, Module, St) ->
- M = package_to_string(Module),
- St#expand{module=list_to_atom(M),
- package = packages:strip_last(M)};
+ true = is_atom(Module),
+ St#expand{module=Module};
attribute(export, Es, St) ->
St#expand{exports=union(from_list(Es), St#expand.exports)};
attribute(import, Is, St) ->
@@ -226,8 +224,6 @@ pattern({tuple,Line,Ps}, St0) ->
%%pattern({struct,Line,Tag,Ps}, St0) ->
%% {TPs,TPsvs,St1} = pattern_list(Ps, St0),
%% {{tuple,Line,[{atom,Line,Tag}|TPs]},TPsvs,St1};
-pattern({record_field,_,_,_}=M, St) ->
- {expand_package(M, St), [], [], St}; % must be a package name
pattern({record_index,Line,Name,Field}, St) ->
{index_expr(Line, Field, Name, record_fields(Name, St)),[],[],St};
pattern({record,Line,Name,Pfs}, St0) ->
@@ -401,8 +397,6 @@ expr({tuple,Line,Es0}, Vs, St0) ->
%%expr({struct,Line,Tag,Es0}, Vs, St0) ->
%% {Es1,Esvs,Esus,St1} = expr_list(Es0, Vs, St0),
%% {{tuple,Line,[{atom,Line,Tag}|Es1]},Esvs,Esus,St1};
-expr({record_field,_,_,_}=M, _Vs, St) ->
- {expand_package(M, St), [], [], St}; % must be a package name
expr({record_index,Line,Name,F}, Vs, St) ->
I = index_expr(Line, F, Name, record_fields(Name, St)),
expr(I, Vs, St);
@@ -483,10 +477,7 @@ expr({call,Line,{atom,La,N},As0}, Vs, St0) ->
end
end
end;
-expr({call,Line,{record_field,_,_,_}=M,As0}, Vs, St0) ->
- expr({call,Line,expand_package(M, St0),As0}, Vs, St0);
-expr({call,Line,{remote,Lr,M,F},As0}, Vs, St0) ->
- M1 = expand_package(M, St0),
+expr({call,Line,{remote,Lr,M1,F},As0}, Vs, St0) ->
{[M2,F1|As1],Asvs,Asus,St1} = expr_list([M1,F|As0], Vs, St0),
{{call,Line,{remote,Lr,M2,F1},As1},Asvs,Asus,St1};
expr({call,Line,{tuple,_,[{atom,_,_}=M,{atom,_,_}=F]},As}, Vs, St) ->
@@ -922,32 +913,6 @@ string_to_conses(Line, Cs, Tail) ->
foldr(fun (C, T) -> {cons,Line,{char,Line,C},T} end, Tail, Cs).
-%% In syntax trees, module/package names are atoms or lists of atoms.
-
-package_to_string(A) when atom(A) -> atom_to_list(A);
-package_to_string(L) when list(L) -> packages:concat(L).
-
-expand_package({atom,L,A} = M, St) ->
- case dict:find(A, St#expand.mod_imports) of
- {ok, A1} ->
- {atom,L,A1};
- error ->
- case packages:is_segmented(A) of
- true ->
- M;
- false ->
- M1 = packages:concat(St#expand.package, A),
- {atom,L,list_to_atom(M1)}
- end
- end;
-expand_package(M, _St) ->
- case erl_parse:package_segments(M) of
- error ->
- M;
- M1 ->
- {atom,element(2,M),list_to_atom(package_to_string(M1))}
- end.
-
%% Create a case-switch on true/false, generating badarg for all other
%% values.
@@ -1005,15 +970,10 @@ new_in_all(Before, Region) ->
%% Handle import declarations and est for imported functions. No need to
%% check when building imports as code is correct.
-import({Mod0,Fs}, St) ->
- Mod = list_to_atom(package_to_string(Mod0)),
+import({Mod,Fs}, St) ->
+ true = is_atom(Mod),
Mfs = from_list(Fs),
- St#expand{imports=add_imports(Mod, Mfs, St#expand.imports)};
-import(Mod0, St) ->
- Mod = package_to_string(Mod0),
- Key = list_to_atom(packages:last(Mod)),
- St#expand{mod_imports=dict:store(Key, list_to_atom(Mod),
- St#expand.mod_imports)}.
+ St#expand{imports=add_imports(Mod, Mfs, St#expand.imports)}.
add_imports(Mod, [F|Fs], Is) ->
add_imports(Mod, Fs, orddict:store(F, Mod, Is));
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
index 17f2bd2ea8..1aac46f5b2 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
@@ -6,7 +6,7 @@ mnesia_bup.erl:111: The created fun has no local return
mnesia_bup.erl:574: Function fallback_receiver/2 has no local return
mnesia_bup.erl:967: Function uninstall_fallback_master/2 has no local return
mnesia_checkpoint.erl:1014: The variable Error can never match since previous clauses completely covered the type {'ok',#checkpoint_args{nodes::[any()],retainers::[any(),...]}}
-mnesia_checkpoint.erl:894: The call sys:handle_system_msg(Msg::any(),From::any(),'no_parent','mnesia_checkpoint',[],Cp::#checkpoint_args{}) breaks the contract (Msg,From,Parent,Module,Debug,Misc) -> Void when is_subtype(Msg,term()), is_subtype(From,{pid(),Tag::_}), is_subtype(Parent,pid()), is_subtype(Module,module()), is_subtype(Debug,[dbg_opt()]), is_subtype(Misc,term()), is_subtype(Void,term())
+mnesia_checkpoint.erl:894: The call sys:handle_system_msg(Msg::any(),From::any(),'no_parent','mnesia_checkpoint',[],Cp::#checkpoint_args{}) breaks the contract (Msg,From,Parent,Module,Debug,Misc) -> no_return() when is_subtype(Msg,term()), is_subtype(From,{pid(),Tag::_}), is_subtype(Parent,pid()), is_subtype(Module,module()), is_subtype(Debug,[dbg_opt()]), is_subtype(Misc,term())
mnesia_controller.erl:1666: The variable Tab can never match since previous clauses completely covered the type [any()]
mnesia_controller.erl:1679: The pattern {'stop', Reason, Reply, State2} can never match the type {'noreply',_} | {'reply',_,_} | {'stop','shutdown',#state{}}
mnesia_controller.erl:1685: The pattern {'noreply', State2, _Timeout} can never match the type {'reply',_,_}
diff --git a/lib/dialyzer/test/r9c_SUITE_data/src/asn1/asn1ct_gen.erl b/lib/dialyzer/test/r9c_SUITE_data/src/asn1/asn1ct_gen.erl
index 32d4a22645..5b33be9eff 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/src/asn1/asn1ct_gen.erl
+++ b/lib/dialyzer/test/r9c_SUITE_data/src/asn1/asn1ct_gen.erl
@@ -295,7 +295,7 @@ gen_part_decode_funcs([_H|T],N) ->
gen_part_decode_funcs([],N) ->
if
N > 0 ->
- .emit([".",nl]);
+ emit([".",nl]);
true ->
ok
end.
diff --git a/lib/dialyzer/test/small_SUITE_data/results/port_info_test b/lib/dialyzer/test/small_SUITE_data/results/port_info_test
index 863a3d61df..53d20a415b 100644
--- a/lib/dialyzer/test/small_SUITE_data/results/port_info_test
+++ b/lib/dialyzer/test/small_SUITE_data/results/port_info_test
@@ -1,7 +1,7 @@
port_info_test.erl:10: The pattern {'connected', 42} can never match the type 'undefined' | {'connected',pid()}
-port_info_test.erl:14: The pattern {'registered_name', "42"} can never match the type 'undefined' | {'registered_name',atom()}
+port_info_test.erl:14: The pattern {'registered_name', "42"} can never match the type 'undefined' | [] | {'registered_name',atom()}
port_info_test.erl:19: The pattern {'output', 42} can never match the type 'undefined' | {'connected',pid()}
port_info_test.erl:24: Guard test 'links' =:= Atom::'connected' can never succeed
-port_info_test.erl:28: The pattern {'gazonk', _} can never match the type 'undefined' | {'connected' | 'id' | 'input' | 'links' | 'name' | 'os_pid' | 'output' | 'registered_name',atom() | pid() | [pid() | char()] | integer()}
+port_info_test.erl:28: The pattern {'gazonk', _} can never match the type 'undefined' | [] | {'connected' | 'id' | 'input' | 'links' | 'locking' | 'memory' | 'monitors' | 'name' | 'os_pid' | 'output' | 'parallelism' | 'queue_size' | 'registered_name',atom() | pid() | [pid() | char() | {'process',pid()}] | non_neg_integer()}
port_info_test.erl:32: The pattern {'os_pid', "42"} can never match the type 'undefined' | {'os_pid','undefined' | non_neg_integer()}
diff --git a/lib/edoc/src/edoc.erl b/lib/edoc/src/edoc.erl
index 5a599e6e97..599036f380 100644
--- a/lib/edoc/src/edoc.erl
+++ b/lib/edoc/src/edoc.erl
@@ -456,14 +456,14 @@ expand_sources(Ss, Opts) ->
end,
expand_sources(Ss1, Suffix, sets:new(), [], []).
-expand_sources([{P, F, D} | Fs], Suffix, S, As, Ms) ->
- M = list_to_atom(packages:concat(P, filename:rootname(F, Suffix))),
+expand_sources([{'', F, D} | Fs], Suffix, S, As, Ms) ->
+ M = list_to_atom(filename:rootname(F, Suffix)),
case sets:is_element(M, S) of
true ->
expand_sources(Fs, Suffix, S, As, Ms);
false ->
S1 = sets:add_element(M, S),
- expand_sources(Fs, Suffix, S1, [{M, P, F, D} | As],
+ expand_sources(Fs, Suffix, S1, [{M, '', F, D} | As],
[M | Ms])
end;
expand_sources([], _Suffix, _S, As, Ms) ->
diff --git a/lib/edoc/src/edoc_doclet.erl b/lib/edoc/src/edoc_doclet.erl
index d6561e10fc..a0c1ae1c0f 100644
--- a/lib/edoc/src/edoc_doclet.erl
+++ b/lib/edoc/src/edoc_doclet.erl
@@ -192,7 +192,7 @@ source({M, P, Name, Path}, Dir, Suffix, Env, Set, Private, Hidden,
andalso ((not is_hidden(Doc)) orelse Hidden) of
true ->
Text = edoc:layout(Doc, Options),
- Name1 = packages:last(M) ++ Suffix,
+ Name1 = atom_to_list(M) ++ Suffix,
Encoding = [{encoding,encoding(Doc)}],
edoc_lib:write_file(Text, Dir, Name1, P, Encoding),
{sets:add_element(Module, Set), Error};
@@ -205,9 +205,9 @@ source({M, P, Name, Path}, Dir, Suffix, Env, Set, Private, Hidden,
end.
check_name(M, M0, P0, File) ->
- P = list_to_atom(packages:strip_last(M)),
- N = packages:last(M),
- N0 = packages:last(M0),
+ P = '',
+ N = M,
+ N0 = M0,
case N of
[$? | _] ->
%% A module name of the form '?...' is assumed to be caused
diff --git a/lib/edoc/src/edoc_extract.erl b/lib/edoc/src/edoc_extract.erl
index dcab816f54..67a95e80aa 100644
--- a/lib/edoc/src/edoc_extract.erl
+++ b/lib/edoc/src/edoc_extract.erl
@@ -121,7 +121,7 @@ source1(Tree, File0, Env, Opts, TypeDocs) ->
Module = get_module_info(Tree, File),
{Header, Footer, Entries} = collect(Forms, Module),
Name = Module#module.name,
- Package = list_to_atom(packages:strip_last(Name)),
+ Package = '',
Env1 = Env#env{module = Name,
package = Package,
root = edoc_refs:relative_package_path('', Package)},
diff --git a/lib/edoc/src/edoc_lib.erl b/lib/edoc/src/edoc_lib.erl
index 942715b8ee..3d193c4bfa 100644
--- a/lib/edoc/src/edoc_lib.erl
+++ b/lib/edoc/src/edoc_lib.erl
@@ -269,6 +269,10 @@ is_name_1(_) -> false.
to_atom(A) when is_atom(A) -> A;
to_atom(S) when is_list(S) -> list_to_atom(S).
+
+to_list(A) when is_atom(A) -> atom_to_list(A);
+to_list(S) when is_list(S) -> S.
+
%% @private
unique([X | Xs]) -> [X | unique(Xs, X)];
@@ -695,8 +699,7 @@ write_file(Text, Dir, Name, Package) ->
write_file(Text, Dir, Name, Package, [{encoding,latin1}]).
write_file(Text, Dir, Name, Package, Options) ->
- Dir1 = filename:join([Dir | packages:split(Package)]),
- File = filename:join(Dir1, Name),
+ File = filename:join([Dir, to_list(Package), Name]),
ok = filelib:ensure_dir(File),
case file:open(File, [write] ++ Options) of
{ok, FD} ->
@@ -836,7 +839,7 @@ find_sources(Path, Pkg, Rec, Ext, Opts) ->
lists:flatten(find_sources_1(Path, to_atom(Pkg), Rec, Ext, Skip)).
find_sources_1([P | Ps], Pkg, Rec, Ext, Skip) ->
- Dir = filename:join(P, filename:join(packages:split(Pkg))),
+ Dir = filename:join(P, atom_to_list(Pkg)),
Fs1 = find_sources_1(Ps, Pkg, Rec, Ext, Skip),
case filelib:is_dir(Dir) of
true ->
@@ -862,9 +865,9 @@ find_sources_2(Dir, Pkg, Rec, Ext, Skip) ->
[]
end.
-find_sources_3(Es, Dir, Pkg, Rec, Ext, Skip) ->
+find_sources_3(Es, Dir, '', Rec, Ext, Skip) ->
[find_sources_2(filename:join(Dir, E),
- to_atom(packages:concat(Pkg, E)), Rec, Ext, Skip)
+ to_atom(E), Rec, Ext, Skip)
|| E <- Es, is_package_dir(E, Dir)].
is_source_file(Name, Ext) ->
@@ -876,16 +879,16 @@ is_package_dir(Name, Dir) ->
andalso filelib:is_dir(filename:join(Dir, Name)).
%% @private
-find_file([P | Ps], Pkg, Name) ->
- Dir = filename:join(P, filename:join(packages:split(Pkg))),
- File = filename:join(Dir, Name),
+find_file([P | Ps], []=Pkg, Name) ->
+ Pkg = [],
+ File = filename:join(P, Name),
case filelib:is_file(File) of
true ->
File;
false ->
find_file(Ps, Pkg, Name)
end;
-find_file([], _Pkg, _Name) ->
+find_file([], [], _Name) ->
"".
%% @private
diff --git a/lib/edoc/src/edoc_parser.yrl b/lib/edoc/src/edoc_parser.yrl
index 9351217618..cf1a2d6b11 100644
--- a/lib/edoc/src/edoc_parser.yrl
+++ b/lib/edoc/src/edoc_parser.yrl
@@ -318,10 +318,7 @@ tok_val(T) -> element(3, T).
tok_line(T) -> element(2, T).
-qname([A]) ->
- A; % avoid unnecessary call to packages:concat/1.
-qname(List) ->
- list_to_atom(packages:concat(lists:reverse(List))).
+qname([A]) -> A.
union(Ts) ->
case Ts of
diff --git a/lib/edoc/src/edoc_refs.erl b/lib/edoc/src/edoc_refs.erl
index 1f578a3b83..ea439490ed 100644
--- a/lib/edoc/src/edoc_refs.erl
+++ b/lib/edoc/src/edoc_refs.erl
@@ -126,7 +126,7 @@ abs_uri({package, P}, Env) ->
module_ref(M, Env) ->
case (Env#env.modules)(M) of
"" ->
- File = packages:last(M) ++ Env#env.file_suffix,
+ File = atom_to_list(M) ++ Env#env.file_suffix,
Path = relative_module_path(M, Env#env.package),
join_uri(Path, escape_uri(File));
Base ->
@@ -134,8 +134,7 @@ module_ref(M, Env) ->
end.
module_absref(M, Env) ->
- join_segments(packages:split(M))
- ++ escape_uri(Env#env.file_suffix).
+ escape_uri(atom_to_list(M)) ++ escape_uri(Env#env.file_suffix).
package_ref(P, Env) ->
case (Env#env.packages)(P) of
@@ -147,7 +146,7 @@ package_ref(P, Env) ->
end.
package_absref(P, Env) ->
- join_uri(join_segments(packages:split(P)),
+ join_uri(escape_uri(atom_to_list(P)),
escape_uri(Env#env.package_summary)).
app_ref(A, Env) ->
@@ -179,14 +178,11 @@ join_segments([S | Ss]) ->
%% The empty string is returned if the To module has only one segment,
%% implying a local reference.
-relative_module_path(To, From) ->
- case first(packages:split(To)) of
- [] -> "";
- P -> relative_path(P, packages:split(From))
- end.
+relative_module_path(_To, _From) ->
+ "".
relative_package_path(To, From) ->
- relative_path(packages:split(To), packages:split(From)).
+ relative_path([atom_to_list(To)], [atom_to_list(From)]).
%% This takes two lists of path segments (From, To). Note that an empty
%% string will be returned if the paths are the same. Empty leading
@@ -210,6 +206,3 @@ relative_path_2([], []) ->
"";
relative_path_2([], Ts) ->
join_segments(Ts).
-
-first([H | T]) when T /= [] -> [H | first(T)];
-first(_) -> [].
diff --git a/lib/eldap/src/eldap.erl b/lib/eldap/src/eldap.erl
index b3249d4f56..5753cc4749 100644
--- a/lib/eldap/src/eldap.erl
+++ b/lib/eldap/src/eldap.erl
@@ -320,7 +320,7 @@ present(Attribute) when is_list(Attribute) ->
%%% will match entries containing: 'sn: Tornkvist'
%%%
substrings(Type, SubStr) when is_list(Type), is_list(SubStr) ->
- Ss = {'SubstringFilter_substrings',v_substr(SubStr)},
+ Ss = v_substr(SubStr),
{substrings,#'SubstringFilter'{type = Type,
substrings = Ss}}.
diff --git a/lib/erl_interface/aclocal.m4 b/lib/erl_interface/aclocal.m4
index 9578cd35c4..5d555a5123 100644
--- a/lib/erl_interface/aclocal.m4
+++ b/lib/erl_interface/aclocal.m4
@@ -1849,6 +1849,32 @@ case $erl_gethrvtime in
esac
])dnl
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_TRY_ENABLE_CFLAG
+dnl
+dnl
+dnl Tries a CFLAG and sees if it can be enabled without compiler errors
+dnl $1: textual cflag to add
+dnl $2: variable to store the modified CFLAG in
+dnl Usage example LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+dnl
+dnl
+AC_DEFUN([LM_TRY_ENABLE_CFLAG], [
+ AC_MSG_CHECKING([if we can add $1 to CFLAGS])
+ saved_CFLAGS=$CFLAGS;
+ CFLAGS="$1 $CFLAGS";
+ AC_TRY_COMPILE([],[return 0;],can_enable_flag=true,can_enable_flag=false)
+ CFLAGS=$saved_CFLAGS;
+ if test "X$can_enable_flag" = "Xtrue"; then
+ AC_MSG_RESULT([yes])
+ AS_VAR_SET($2, "$1 $CFLAGS")
+ else
+ AC_MSG_RESULT([no])
+ AS_VAR_SET($2, "$CFLAGS")
+ fi
+])
+
dnl ERL_TRY_LINK_JAVA(CLASSES, FUNCTION-BODY
dnl [ACTION_IF_FOUND [, ACTION-IF-NOT-FOUND]])
dnl Freely inspired by AC_TRY_LINK. (Maybe better to create a
diff --git a/lib/erl_interface/configure.in b/lib/erl_interface/configure.in
index 97f1cff345..d511f2e240 100644
--- a/lib/erl_interface/configure.in
+++ b/lib/erl_interface/configure.in
@@ -273,6 +273,8 @@ esac
AC_SUBST(WFLAGS)
if test "x$GCC" = xyes; then
+ # Treat certain GCC warnings as errors
+ LM_TRY_ENABLE_CFLAG([-Werror=return-type], [WERRORFLAGS])
WFLAGS="-Wall -Wstrict-prototypes -Wmissing-prototypes -Wmissing-declarations -Wnested-externs -Winline"
# check which GCC version
GCC_VERSION=`$CC -v 2>&1 | sed -n 's/gcc version //p'`
@@ -287,8 +289,10 @@ if test "x$GCC" = xyes; then
*)
WFLAGS="$WFLAGS -fno-strict-aliasing";;
esac
+ CFLAGS="$WERRORFLAGS $CFLAGS"
else
WFLAGS=""
+ WERRORFLAGS=""
fi
# ---------------------------------------------------------------------------
diff --git a/lib/eunit/include/eunit.hrl b/lib/eunit/include/eunit.hrl
index 7b460ee5e8..8ebdb6ba16 100644
--- a/lib/eunit/include/eunit.hrl
+++ b/lib/eunit/include/eunit.hrl
@@ -125,8 +125,8 @@
-ifndef(UNDER_EUNIT).
-define(UNDER_EUNIT,
(?MATCHES({current_function,{eunit_proc,_,_}},
- .erlang:process_info(.erlang:group_leader(),
- current_function)))).
+ erlang:process_info(erlang:group_leader(),
+ current_function)))).
-endif.
%% The plain assert macro should be defined to do nothing if this file
@@ -143,14 +143,14 @@
((fun () ->
case (BoolExpr) of
true -> ok;
- __V -> .erlang:error({assertion_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??BoolExpr)},
- {expected, true},
- {value, case __V of false -> __V;
- _ -> {not_a_boolean,__V}
- end}]})
+ __V -> erlang:error({assertion_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??BoolExpr)},
+ {expected, true},
+ {value, case __V of false -> __V;
+ _ -> {not_a_boolean,__V}
+ end}]})
end
end)())).
-endif.
@@ -171,12 +171,12 @@
((fun () ->
case (Expr) of
Guard -> ok;
- __V -> .erlang:error({assertMatch_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??Expr)},
- {pattern, (??Guard)},
- {value, __V}]})
+ __V -> erlang:error({assertMatch_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern, (??Guard)},
+ {value, __V}]})
end
end)())).
-endif.
@@ -190,12 +190,12 @@
((fun () ->
__V = (Expr),
case __V of
- Guard -> .erlang:error({assertNotMatch_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??Expr)},
- {pattern, (??Guard)},
- {value, __V}]});
+ Guard -> erlang:error({assertNotMatch_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern, (??Guard)},
+ {value, __V}]});
_ -> ok
end
end)())).
@@ -211,12 +211,12 @@
((fun (__X) ->
case (Expr) of
__X -> ok;
- __V -> .erlang:error({assertEqual_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??Expr)},
- {expected, __X},
- {value, __V}]})
+ __V -> erlang:error({assertEqual_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {expected, __X},
+ {value, __V}]})
end
end)(Expect))).
-endif.
@@ -229,11 +229,11 @@
-define(assertNotEqual(Unexpected, Expr),
((fun (__X) ->
case (Expr) of
- __X -> .erlang:error({assertNotEqual_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??Expr)},
- {value, __X}]});
+ __X -> erlang:error({assertNotEqual_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {value, __X}]});
_ -> ok
end
end)(Unexpected))).
@@ -249,7 +249,7 @@
-define(assertException(Class, Term, Expr),
((fun () ->
try (Expr) of
- __V -> .erlang:error({assertException_failed,
+ __V -> erlang:error({assertException_failed,
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
@@ -260,16 +260,16 @@
catch
Class:Term -> ok;
__C:__T ->
- .erlang:error({assertException_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??Expr)},
- {pattern,
- "{ "++(??Class)++" , "++(??Term)
- ++" , [...] }"},
- {unexpected_exception,
- {__C, __T,
- .erlang:get_stacktrace()}}]})
+ erlang:error({assertException_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern,
+ "{ "++(??Class)++" , "++(??Term)
+ ++" , [...] }"},
+ {unexpected_exception,
+ {__C, __T,
+ erlang:get_stacktrace()}}]})
end
end)())).
-endif.
@@ -300,17 +300,17 @@
Class ->
case __T of
Term ->
- .erlang:error({assertNotException_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {expression, (??Expr)},
- {pattern,
- "{ "++(??Class)++" , "
- ++(??Term)++" , [...] }"},
- {unexpected_exception,
- {__C, __T,
- .erlang:get_stacktrace()
- }}]});
+ erlang:error({assertNotException_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern,
+ "{ "++(??Class)++" , "
+ ++(??Term)++" , [...] }"},
+ {unexpected_exception,
+ {__C, __T,
+ erlang:get_stacktrace()
+ }}]});
_ -> ok
end;
_ -> ok
@@ -325,17 +325,17 @@
%% require EUnit to be present at runtime, or at least eunit_lib.)
%% these can be used for simply running commands in a controlled way
--define(_cmd_(Cmd), (.eunit_lib:command(Cmd))).
+-define(_cmd_(Cmd), (eunit_lib:command(Cmd))).
-define(cmdStatus(N, Cmd),
((fun () ->
case ?_cmd_(Cmd) of
{(N), __Out} -> __Out;
- {__N, _} -> .erlang:error({command_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {command, (Cmd)},
- {expected_status,(N)},
- {status,__N}]})
+ {__N, _} -> erlang:error({command_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {command, (Cmd)},
+ {expected_status,(N)},
+ {status,__N}]})
end
end)())).
-define(_cmdStatus(N, Cmd), ?_test(?cmdStatus(N, Cmd))).
@@ -351,12 +351,12 @@
((fun () ->
case ?_cmd_(Cmd) of
{(N), _} -> ok;
- {__N, _} -> .erlang:error({assertCmd_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {command, (Cmd)},
- {expected_status,(N)},
- {status,__N}]})
+ {__N, _} -> erlang:error({assertCmd_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {command, (Cmd)},
+ {expected_status,(N)},
+ {status,__N}]})
end
end)())).
-endif.
@@ -369,12 +369,12 @@
((fun () ->
case ?_cmd_(Cmd) of
{_, (T)} -> ok;
- {_, __T} -> .erlang:error({assertCmdOutput_failed,
- [{module, ?MODULE},
- {line, ?LINE},
- {command,(Cmd)},
- {expected_output,(T)},
- {output,__T}]})
+ {_, __T} -> erlang:error({assertCmdOutput_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {command,(Cmd)},
+ {expected_output,(T)},
+ {output,__T}]})
end
end)())).
-endif.
@@ -395,12 +395,12 @@
-else.
-define(debugMsg(S),
(begin
- .io:fwrite(user, <<"~s:~w:~w: ~s\n">>,
- [?FILE, ?LINE, self(), S]),
+ io:fwrite(user, <<"~s:~w:~w: ~s\n">>,
+ [?FILE, ?LINE, self(), S]),
ok
end)).
-define(debugHere, (?debugMsg("<-"))).
--define(debugFmt(S, As), (?debugMsg(.io_lib:format((S), (As))))).
+-define(debugFmt(S, As), (?debugMsg(io_lib:format((S), (As))))).
-define(debugVal(E),
((fun (__V) ->
?debugFmt(<<"~s = ~P">>, [(??E), __V, 15]),
diff --git a/lib/eunit/src/eunit_autoexport.erl b/lib/eunit/src/eunit_autoexport.erl
index 099bcb222e..36ae3b71d7 100644
--- a/lib/eunit/src/eunit_autoexport.erl
+++ b/lib/eunit/src/eunit_autoexport.erl
@@ -80,10 +80,9 @@ rewrite([F | Fs], As, Module, Test) ->
rewrite(Fs, [F | As], Module, Test);
rewrite([], As, Module, Test) ->
{if Test ->
- EUnit = {record_field,0,{atom,0,''},{atom,0,eunit}},
[{function,0,test,0,
[{clause,0,[],[],
- [{call,0,{remote,0,EUnit,{atom,0,test}},
+ [{call,0,{remote,0,{atom,0,eunit},{atom,0,test}},
[{atom,0,Module}]}]}]}
| As];
true ->
@@ -92,9 +91,7 @@ rewrite([], As, Module, Test) ->
Test}.
module_decl(Name, M, Fs, Exports) ->
- Module = if is_atom(Name) -> Name;
- true -> list_to_atom(packages:concat(Name))
- end,
+ Module = Name,
{Fs1, Test} = rewrite(Fs, [], Module, true),
Es = if Test -> [{test,0} | Exports];
true -> Exports
diff --git a/lib/kernel/doc/src/Makefile b/lib/kernel/doc/src/Makefile
index 5e04bff0c1..de3ca1e176 100644
--- a/lib/kernel/doc/src/Makefile
+++ b/lib/kernel/doc/src/Makefile
@@ -58,7 +58,6 @@ XML_REF3_FILES = application.xml \
net_adm.xml \
net_kernel.xml \
os.xml \
- packages.xml \
pg2.xml \
rpc.xml \
seq_trace.xml \
diff --git a/lib/kernel/doc/src/file.xml b/lib/kernel/doc/src/file.xml
index 536b98b5f5..e30ade1bd2 100644
--- a/lib/kernel/doc/src/file.xml
+++ b/lib/kernel/doc/src/file.xml
@@ -170,6 +170,18 @@
</desc>
</func>
<func>
+ <name name="allocate" arity="3"/>
+ <fsummary>Allocate file space</fsummary>
+ <desc>
+ <p><c>allocate/3</c> can be used to preallocate space for a file.</p>
+ <p>This function only succeeds in platforms that implement this
+ feature. When it succeeds, space is preallocated for the file but
+ the file size might not be updated. This behaviour depends on the
+ preallocation implementation. To guarantee the file size is updated
+ one must truncate the file to the new size.</p>
+ </desc>
+ </func>
+ <func>
<name name="change_group" arity="2"/>
<fsummary>Change group of a file</fsummary>
<desc>
diff --git a/lib/kernel/src/Makefile b/lib/kernel/src/Makefile
index c76ff9e2f0..60291bbce6 100644
--- a/lib/kernel/src/Makefile
+++ b/lib/kernel/src/Makefile
@@ -107,7 +107,6 @@ MODULES = \
net_adm \
net_kernel \
os \
- packages \
pg2 \
ram_file \
rpc \
diff --git a/lib/kernel/src/code.erl b/lib/kernel/src/code.erl
index c808ac7cb7..361f2bdf8a 100644
--- a/lib/kernel/src/code.erl
+++ b/lib/kernel/src/code.erl
@@ -359,7 +359,6 @@ load_code_server_prerequisites() ->
hipe_unified_loader,
lists,
os,
- packages,
unicode],
[M = M:module_info(module) || M <- Needed],
ok.
@@ -413,7 +412,7 @@ which(Module) when is_atom(Module) ->
end.
which2(Module) ->
- Base = to_path(Module),
+ Base = atom_to_list(Module),
File = filename:basename(Base) ++ objfile_extension(),
Path = get_path(),
which(File, filename:dirname(Base), Path).
@@ -547,9 +546,6 @@ has_ext(Ext, Extlen, File) ->
_ -> false
end.
-to_path(X) ->
- filename:join(packages:split(X)).
-
-spec load_native_code_for_all_loaded() -> ok.
load_native_code_for_all_loaded() ->
Architecture = erlang:system_info(hipe_architecture),
diff --git a/lib/kernel/src/code_server.erl b/lib/kernel/src/code_server.erl
index 00ad923466..b2d2c19f78 100644
--- a/lib/kernel/src/code_server.erl
+++ b/lib/kernel/src/code_server.erl
@@ -1229,7 +1229,7 @@ load_abs(File, Mod0, Caller, St) ->
end.
try_load_module(Mod, Dir, Caller, St) ->
- File = filename:append(Dir, to_path(Mod) ++
+ File = filename:append(Dir, to_list(Mod) ++
objfile_extension()),
case erl_prim_loader:get_file(File) of
error ->
@@ -1347,7 +1347,7 @@ load_file_1(Mod, Caller, #state{cache=Cache}=St0) ->
end.
mod_to_bin([Dir|Tail], Mod) ->
- File = filename:append(Dir, to_path(Mod) ++ objfile_extension()),
+ File = filename:append(Dir, to_list(Mod) ++ objfile_extension()),
case erl_prim_loader:get_file(File) of
error ->
mod_to_bin(Tail, Mod);
@@ -1356,7 +1356,7 @@ mod_to_bin([Dir|Tail], Mod) ->
end;
mod_to_bin([], Mod) ->
%% At last, try also erl_prim_loader's own method
- File = to_path(Mod) ++ objfile_extension(),
+ File = to_list(Mod) ++ objfile_extension(),
case erl_prim_loader:get_file(File) of
error ->
error; % No more alternatives !
@@ -1570,6 +1570,3 @@ to_list(X) when is_atom(X) -> atom_to_list(X).
to_atom(X) when is_atom(X) -> X;
to_atom(X) when is_list(X) -> list_to_atom(X).
-
-to_path(X) ->
- filename:join(packages:split(X)).
diff --git a/lib/kernel/src/file.erl b/lib/kernel/src/file.erl
index de3eaad5a1..16f2dde464 100644
--- a/lib/kernel/src/file.erl
+++ b/lib/kernel/src/file.erl
@@ -38,7 +38,7 @@
%% Specialized
-export([ipread_s32bu_p32bu/3]).
%% Generic file contents.
--export([open/2, close/1, advise/4,
+-export([open/2, close/1, advise/4, allocate/3,
read/2, write/2,
pread/2, pread/3, pwrite/2, pwrite/3,
read_line/1,
@@ -490,6 +490,18 @@ advise(#file_descriptor{module = Module} = Handle, Offset, Length, Advise) ->
advise(_, _, _, _) ->
{error, badarg}.
+-spec allocate(File, Offset, Length) ->
+ 'ok' | {'error', posix()} when
+ File :: io_device(),
+ Offset :: non_neg_integer(),
+ Length :: non_neg_integer().
+
+allocate(File, Offset, Length) when is_pid(File) ->
+ R = file_request(File, {allocate, Offset, Length}),
+ wait_file_reply(File, R);
+allocate(#file_descriptor{module = Module} = Handle, Offset, Length) ->
+ Module:allocate(Handle, Offset, Length).
+
-spec read(IoDevice, Number) -> {ok, Data} | eof | {error, Reason} when
IoDevice :: io_device() | atom(),
Number :: non_neg_integer(),
diff --git a/lib/kernel/src/file_io_server.erl b/lib/kernel/src/file_io_server.erl
index acaffe1e41..fad2ed7fb3 100644
--- a/lib/kernel/src/file_io_server.erl
+++ b/lib/kernel/src/file_io_server.erl
@@ -211,6 +211,10 @@ file_request({advise,Offset,Length,Advise},
Reply ->
{reply,Reply,State}
end;
+file_request({allocate, Offset, Length},
+ #state{handle = Handle} = State) ->
+ Reply = ?PRIM_FILE:allocate(Handle, Offset, Length),
+ {reply, Reply, State};
file_request({pread,At,Sz},
#state{handle=Handle,buf=Buf,read_mode=ReadMode}=State) ->
case position(Handle, At, Buf) of
diff --git a/lib/kernel/src/kernel.app.src b/lib/kernel/src/kernel.app.src
index 17ab84c177..9a20baf8d0 100644
--- a/lib/kernel/src/kernel.app.src
+++ b/lib/kernel/src/kernel.app.src
@@ -28,7 +28,6 @@
application_starter,
auth,
code,
- packages,
code_server,
dist_util,
erl_boot_server,
diff --git a/lib/kernel/src/packages.erl b/lib/kernel/src/packages.erl
deleted file mode 100644
index e0b1f36b85..0000000000
--- a/lib/kernel/src/packages.erl
+++ /dev/null
@@ -1,158 +0,0 @@
-%%
-%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2002-2009. All Rights Reserved.
-%%
-%% The contents of this file are subject to the Erlang Public License,
-%% Version 1.1, (the "License"); you may not use this file except in
-%% compliance with the License. You should have received a copy of the
-%% Erlang Public License along with this software. If not, it can be
-%% retrieved online at http://www.erlang.org/.
-%%
-%% Software distributed under the License is distributed on an "AS IS"
-%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-%% the License for the specific language governing rights and limitations
-%% under the License.
-%%
-%% %CopyrightEnd%
-%%
--module(packages).
-
--export([to_string/1, concat/1, concat/2, is_valid/1, is_segmented/1,
- split/1, last/1, first/1, strip_last/1, find_modules/1,
- find_modules/2]).
-
-%% A package name (or a package-qualified module name) may be an atom or
-%% a string (list of nonnegative integers) - not a deep list, and not a
-%% list containing atoms. A name may be empty, but may not contain two
-%% consecutive period (`.') characters or end with a period character.
-
--type package_name() :: atom() | string().
-
--spec to_string(package_name()) -> string().
-to_string(Name) when is_atom(Name) ->
- atom_to_list(Name);
-to_string(Name) ->
- Name.
-
-%% `concat' does not insert a leading period if the first segment is
-%% empty. However, the result may contain leading, consecutive or
-%% dangling period characters, if any of the segments after the first
-%% are empty. Use 'is_valid' to check the result if necessary.
-
--spec concat(package_name(), package_name()) -> string().
-concat(A, B) ->
- concat([A, B]).
-
--spec concat([package_name()]) -> string().
-concat([H | T]) when is_atom(H) ->
- concat([atom_to_list(H) | T]);
-concat(["" | T]) ->
- concat_1(T);
-concat(L) ->
- concat_1(L).
-
-concat_1([H | T]) when is_atom(H) ->
- concat_1([atom_to_list(H) | T]);
-concat_1([H]) ->
- H;
-concat_1([H | T]) ->
- H ++ "." ++ concat_1(T);
-concat_1([]) ->
- "";
-concat_1(Name) ->
- erlang:error({badarg, Name}).
-
--spec is_valid(package_name()) -> boolean().
-is_valid(Name) when is_atom(Name) ->
- is_valid_1(atom_to_list(Name));
-is_valid([$. | _]) ->
- false;
-is_valid(Name) ->
- is_valid_1(Name).
-
-is_valid_1([$.]) -> false;
-is_valid_1([$., $. | _]) -> false;
-is_valid_1([H | T]) when is_integer(H), H >= 0 ->
- is_valid_1(T);
-is_valid_1([]) -> true;
-is_valid_1(_) -> false.
-
--spec split(package_name()) -> [string()].
-split(Name) when is_atom(Name) ->
- split_1(atom_to_list(Name), []);
-split(Name) ->
- split_1(Name, []).
-
-split_1([$. | T], Cs) ->
- [lists:reverse(Cs) | split_1(T, [])];
-split_1([H | T], Cs) when is_integer(H), H >= 0 ->
- split_1(T, [H | Cs]);
-split_1([], Cs) ->
- [lists:reverse(Cs)];
-split_1(_, _) ->
- erlang:error(badarg).
-
-%% This is equivalent to testing if `split(Name)' yields a list of
-%% length larger than one (i.e., if the name can be split into two or
-%% more segments), but is cheaper.
-
--spec is_segmented(package_name()) -> boolean().
-is_segmented(Name) when is_atom(Name) ->
- is_segmented_1(atom_to_list(Name));
-is_segmented(Name) ->
- is_segmented_1(Name).
-
-is_segmented_1([$. | _]) -> true;
-is_segmented_1([H | T]) when is_integer(H), H >= 0 ->
- is_segmented_1(T);
-is_segmented_1([]) -> false;
-is_segmented_1(_) ->
- erlang:error(badarg).
-
--spec last(package_name()) -> string().
-last(Name) ->
- last_1(split(Name)).
-
-last_1([H]) -> H;
-last_1([_ | T]) -> last_1(T).
-
--spec first(package_name()) -> [string()].
-first(Name) ->
- first_1(split(Name)).
-
-first_1([H | T]) when T =/= [] -> [H | first_1(T)];
-first_1(_) -> [].
-
--spec strip_last(package_name()) -> string().
-strip_last(Name) ->
- concat(first(Name)).
-
-%% This finds all modules available for a given package, using the
-%% current code server search path. (There is no guarantee that the
-%% modules are loadable; only that the object files exist.)
-
--spec find_modules(package_name()) -> [string()].
-find_modules(P) ->
- find_modules(P, code:get_path()).
-
--spec find_modules(package_name(), [string()]) -> [string()].
-find_modules(P, Paths) ->
- P1 = filename:join(packages:split(P)),
- find_modules(P1, Paths, code:objfile_extension(), sets:new()).
-
-find_modules(P, [Path | Paths], Ext, S0) ->
- case file:list_dir(filename:join(Path, P)) of
- {ok, Fs} ->
- Fs1 = [F || F <- Fs, filename:extension(F) =:= Ext],
- S1 = lists:foldl(fun (F, S) ->
- F1 = filename:rootname(F, Ext),
- sets:add_element(F1, S)
- end,
- S0, Fs1),
- find_modules(P, Paths, Ext, S1);
- _ ->
- find_modules(P, Paths, Ext, S0)
- end;
-find_modules(_P, [], _Ext, S) ->
- sets:to_list(S).
diff --git a/lib/kernel/src/ram_file.erl b/lib/kernel/src/ram_file.erl
index 48ea871433..ca881ff8a4 100644
--- a/lib/kernel/src/ram_file.erl
+++ b/lib/kernel/src/ram_file.erl
@@ -29,6 +29,7 @@
%% Specialized file operations
-export([get_size/1, get_file/1, set_file/2, get_file_close/1]).
-export([compress/1, uncompress/1, uuencode/1, uudecode/1, advise/4]).
+-export([allocate/3]).
-export([open_mode/1]). %% used by ftp-file
@@ -72,6 +73,7 @@
-define(RAM_FILE_UUDECODE, 36).
-define(RAM_FILE_SIZE, 37).
-define(RAM_FILE_ADVISE, 38).
+-define(RAM_FILE_ALLOCATE, 39).
%% Open modes for RAM_FILE_OPEN
-define(RAM_FILE_MODE_READ, 1).
@@ -383,6 +385,11 @@ advise(#file_descriptor{module = ?MODULE, data = Port}, Offset,
advise(#file_descriptor{}, _Offset, _Length, _Advise) ->
{error, enotsup}.
+allocate(#file_descriptor{module = ?MODULE, data = Port}, Offset, Length) ->
+ call_port(Port, <<?RAM_FILE_ALLOCATE, Offset:64/signed, Length:64/signed>>);
+allocate(#file_descriptor{}, _Offset, _Length) ->
+ {error, enotsup}.
+
%%%-----------------------------------------------------------------
diff --git a/lib/kernel/test/Makefile b/lib/kernel/test/Makefile
index 8eca37029d..7fd3afe93c 100644
--- a/lib/kernel/test/Makefile
+++ b/lib/kernel/test/Makefile
@@ -73,6 +73,7 @@ MODULES= \
seq_trace_SUITE \
wrap_log_reader_SUITE \
cleanup \
+ ignore_cores \
zlib_SUITE \
loose_node \
sendfile_SUITE
diff --git a/lib/kernel/test/file_SUITE.erl b/lib/kernel/test/file_SUITE.erl
index 9c507fd437..914f0d6127 100644
--- a/lib/kernel/test/file_SUITE.erl
+++ b/lib/kernel/test/file_SUITE.erl
@@ -84,6 +84,8 @@
-export([advise/1]).
+-export([allocate/1]).
+
-export([standard_io/1,mini_server/1]).
%% Debug exports
@@ -116,7 +118,7 @@ groups() ->
{files, [],
[{group, open}, {group, pos}, {group, file_info},
{group, consult}, {group, eval}, {group, script},
- truncate, sync, datasync, advise]},
+ truncate, sync, datasync, advise, allocate]},
{open, [],
[open1, old_modes, new_modes, path_open, close, access,
read_write, pread_write, append, open_errors,
@@ -1617,6 +1619,74 @@ advise(Config) when is_list(Config) ->
?line test_server:timetrap_cancel(Dog),
ok.
+allocate(suite) -> [];
+allocate(doc) -> "Tests that ?FILE_MODULE:allocate/3 at least doesn't crash.";
+allocate(Config) when is_list(Config) ->
+ ?line Dog = test_server:timetrap(test_server:seconds(5)),
+ ?line PrivDir = ?config(priv_dir, Config),
+ ?line Allocate = filename:join(PrivDir,
+ atom_to_list(?MODULE)
+ ++"_allocate.fil"),
+
+ Line1 = "Hello\n",
+ Line2 = "World!\n",
+
+ ?line {ok, Fd} = ?FILE_MODULE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd, 1, iolist_size([Line1, Line2])),
+ ?line ok = io:format(Fd, "~s", [Line1]),
+ ?line ok = io:format(Fd, "~s", [Line2]),
+ ?line ok = ?FILE_MODULE:close(Fd),
+
+ ?line {ok, Fd2} = ?FILE_MODULE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd2, 1, iolist_size(Line1)),
+ ?line ok = io:format(Fd2, "~s", [Line1]),
+ ?line ok = io:format(Fd2, "~s", [Line2]),
+ ?line ok = ?FILE_MODULE:close(Fd2),
+
+ ?line {ok, Fd3} = ?FILE_MODULE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd3, 1, iolist_size(Line1) + 1),
+ ?line ok = io:format(Fd3, "~s", [Line1]),
+ ?line ok = io:format(Fd3, "~s", [Line2]),
+ ?line ok = ?FILE_MODULE:close(Fd3),
+
+ ?line {ok, Fd4} = ?FILE_MODULE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd4, 1, 4 * iolist_size([Line1, Line2])),
+ ?line ok = io:format(Fd4, "~s", [Line1]),
+ ?line ok = io:format(Fd4, "~s", [Line2]),
+ ?line ok = ?FILE_MODULE:close(Fd4),
+
+ ?line [] = flush(),
+ ?line test_server:timetrap_cancel(Dog),
+ ok.
+
+allocate_and_assert(Fd, Offset, Length) ->
+ % Just verify that calls to ?PRIM_FILE:allocate/3 don't crash or have
+ % any other negative side effect. We can't really asssert against a
+ % specific return value, because support for file space pre-allocation
+ % depends on the OS, OS version and underlying filesystem.
+ %
+ % The Linux kernel added support for fallocate() in version 2.6.23,
+ % which currently works only for the ext4, ocfs2, xfs and btrfs file
+ % systems. posix_fallocate() is available in glibc as of version
+ % 2.1.94, but it was buggy until glibc version 2.7.
+ %
+ % Mac OS X, as of version 10.3, supports the fcntl operation F_PREALLOCATE.
+ %
+ % Solaris supports posix_fallocate() but only for the UFS file system
+ % apparently (not supported for ZFS).
+ %
+ % FreeBSD 9.0 is the first FreeBSD release supporting posix_fallocate().
+ %
+ % For Windows there's apparently no way to pre-allocate file space, at
+ % least with same semantics as posix_fallocate(), fallocate() and
+ % fcntl F_PREALLOCATE.
+ Result = ?FILE_MODULE:allocate(Fd, Offset, Length),
+ case os:type() of
+ {win32, _} ->
+ ?line {error, enotsup} = Result;
+ _ ->
+ ?line _ = Result
+ end.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/kernel/test/heart_SUITE.erl b/lib/kernel/test/heart_SUITE.erl
index 2ec3b7c297..320b23bea1 100644
--- a/lib/kernel/test/heart_SUITE.erl
+++ b/lib/kernel/test/heart_SUITE.erl
@@ -83,10 +83,10 @@ init_per_suite(Config) when is_list(Config) ->
{win32, windows} ->
{skipped, "No use to run on Windows 95/98"};
_ ->
- Config
+ ignore_cores:init(Config)
end.
end_per_suite(Config) when is_list(Config) ->
- Config.
+ ignore_cores:fini(Config).
start_check(Type, Name) ->
@@ -188,8 +188,20 @@ reboot(Config) when is_list(Config) ->
%% Check that a node is up and running after a crash.
%% This test exhausts the atom table on the remote node.
%% ERL_CRASH_DUMP_SECONDS=0 will force beam not to dump an erl_crash.dump.
+%% May currently dump core in beam debug build due to lock-order violation
+%% This should be removed when a non-lockad information retriever is implemented
+%% for crash dumps
node_start_immediately_after_crash(suite) -> {req, [{time, 10}]};
node_start_immediately_after_crash(Config) when is_list(Config) ->
+ Config2 = ignore_cores:setup(?MODULE, node_start_immediately_after_crash, Config, true),
+ try
+ node_start_immediately_after_crash_test(Config2)
+ after
+ ignore_cores:restore(Config2)
+ end.
+
+
+node_start_immediately_after_crash_test(Config) when is_list(Config) ->
{ok, Node} = start_check(loose, heart_test_imm, [{"ERL_CRASH_DUMP_SECONDS", "0"}]),
ok = rpc:call(Node, heart, set_cmd,
@@ -228,8 +240,19 @@ node_start_immediately_after_crash(Config) when is_list(Config) ->
%% This test exhausts the atom table on the remote node.
%% ERL_CRASH_DUMP_SECONDS=10 will force beam
%% to only dump an erl_crash.dump for 10 seconds.
+%% May currently dump core in beam debug build due to lock-order violation
+%% This should be removed when a non-lockad information retriever is implemented
+%% for crash dumps
node_start_soon_after_crash(suite) -> {req, [{time, 10}]};
node_start_soon_after_crash(Config) when is_list(Config) ->
+ Config2 = ignore_cores:setup(?MODULE, node_start_soon_after_crash, Config, true),
+ try
+ node_start_soon_after_crash_test(Config2)
+ after
+ ignore_cores:restore(Config2)
+ end.
+
+node_start_soon_after_crash_test(Config) when is_list(Config) ->
{ok, Node} = start_check(loose, heart_test_soon, [{"ERL_CRASH_DUMP_SECONDS", "10"}]),
ok = rpc:call(Node, heart, set_cmd,
diff --git a/lib/kernel/test/ignore_cores.erl b/lib/kernel/test/ignore_cores.erl
new file mode 100644
index 0000000000..8b1ac0fe6c
--- /dev/null
+++ b/lib/kernel/test/ignore_cores.erl
@@ -0,0 +1,158 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%%-------------------------------------------------------------------
+%%% File : ignore_cores.erl
+%%% Author : Rickard Green <[email protected]>
+%%% Description :
+%%%
+%%% Created : 11 Feb 2008 by Rickard Green <[email protected]>
+%%%-------------------------------------------------------------------
+
+-module(ignore_cores).
+
+-include_lib("test_server/include/test_server.hrl").
+
+-export([init/1, fini/1, setup/3, setup/4, restore/1, dir/1]).
+
+-record(ignore_cores, {org_cwd,
+ org_path,
+ org_pwd_env,
+ ign_dir = false,
+ cores_dir = false}).
+
+%%
+%% Takes a testcase config
+%%
+
+init(Config) ->
+ {ok, OrgCWD} = file:get_cwd(),
+ [{ignore_cores,
+ #ignore_cores{org_cwd = OrgCWD,
+ org_path = code:get_path(),
+ org_pwd_env = os:getenv("PWD")}}
+ | lists:keydelete(ignore_cores, 1, Config)].
+
+fini(Config) ->
+ #ignore_cores{org_cwd = OrgCWD,
+ org_path = OrgPath,
+ org_pwd_env = OrgPWD} = ?config(ignore_cores, Config),
+ ok = file:set_cwd(OrgCWD),
+ true = code:set_path(OrgPath),
+ case OrgPWD of
+ false -> ok;
+ _ -> true = os:putenv("PWD", OrgPWD)
+ end,
+ lists:keydelete(ignore_cores, 1, Config).
+
+setup(Suite, Testcase, Config) ->
+ setup(Suite, Testcase, Config, false).
+
+setup(Suite, Testcase, Config, SetCwd) when is_atom(Suite),
+ is_atom(Testcase),
+ is_list(Config) ->
+ #ignore_cores{org_cwd = OrgCWD,
+ org_path = OrgPath,
+ org_pwd_env = OrgPWD} = ?config(ignore_cores, Config),
+ Path = lists:map(fun (".") -> OrgCWD; (Dir) -> Dir end, OrgPath),
+ true = code:set_path(Path),
+ PrivDir = ?config(priv_dir, Config),
+ IgnDir = filename:join([PrivDir,
+ atom_to_list(Suite)
+ ++ "_"
+ ++ atom_to_list(Testcase)
+ ++ "_wd"]),
+ ok = file:make_dir(IgnDir),
+ case SetCwd of
+ false ->
+ ok;
+ _ ->
+ ok = file:set_cwd(IgnDir),
+ OrgPWD = case os:getenv("PWD") of
+ false -> false;
+ PWD ->
+ os:putenv("PWD", IgnDir),
+ PWD
+ end
+ end,
+ ok = file:write_file(filename:join([IgnDir, "ignore_core_files"]), <<>>),
+ %% cores are dumped in /cores on MacOS X
+ CoresDir = case {?t:os_type(), filelib:is_dir("/cores")} of
+ {{unix,darwin}, true} ->
+ filelib:fold_files("/cores",
+ "^core.*$",
+ false,
+ fun (C,Cs) -> [C|Cs] end,
+ []);
+ _ ->
+ false
+ end,
+ lists:keyreplace(ignore_cores,
+ 1,
+ Config,
+ {ignore_cores,
+ #ignore_cores{org_cwd = OrgCWD,
+ org_path = OrgPath,
+ org_pwd_env = OrgPWD,
+ ign_dir = IgnDir,
+ cores_dir = CoresDir}}).
+
+restore(Config) ->
+ #ignore_cores{org_cwd = OrgCWD,
+ org_path = OrgPath,
+ org_pwd_env = OrgPWD,
+ ign_dir = IgnDir,
+ cores_dir = CoresDir} = ?config(ignore_cores, Config),
+ try
+ case CoresDir of
+ false ->
+ ok;
+ _ ->
+ %% Move cores dumped by these testcases in /cores
+ %% to cwd.
+ lists:foreach(fun (C) ->
+ case lists:member(C, CoresDir) of
+ true -> ok;
+ _ ->
+ Dst = filename:join(
+ [IgnDir,
+ filename:basename(C)]),
+ {ok, _} = file:copy(C, Dst),
+ file:delete(C)
+ end
+ end,
+ filelib:fold_files("/cores",
+ "^core.*$",
+ false,
+ fun (C,Cs) -> [C|Cs] end,
+ []))
+ end
+ after
+ catch file:set_cwd(OrgCWD),
+ catch code:set_path(OrgPath),
+ case OrgPWD of
+ false -> ok;
+ _ -> catch os:putenv("PWD", OrgPWD)
+ end
+ end.
+
+
+dir(Config) ->
+ #ignore_cores{ign_dir = Dir} = ?config(ignore_cores, Config),
+ Dir.
diff --git a/lib/kernel/test/prim_file_SUITE.erl b/lib/kernel/test/prim_file_SUITE.erl
index a56746bbc4..4e93a593b3 100644
--- a/lib/kernel/test/prim_file_SUITE.erl
+++ b/lib/kernel/test/prim_file_SUITE.erl
@@ -57,6 +57,8 @@
%% System probe functions that might be handy to check from the shell
-export([unix_free/1]).
+-export([allocate/1]).
+
-include_lib("test_server/include/test_server.hrl").
-include_lib("kernel/include/file.hrl").
@@ -87,7 +89,7 @@ groups() ->
cur_dir_1a, cur_dir_1b]},
{files, [],
[{group, open}, {group, pos}, {group, file_info},
- truncate, sync, datasync, advise, large_write]},
+ truncate, sync, datasync, advise, large_write, allocate]},
{open, [],
[open1, modes, close, access, read_write, pread_write,
append, exclusive]},
@@ -1359,6 +1361,76 @@ check_large_write(Dog, Fd, _, _, []) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+allocate(suite) -> [];
+allocate(doc) -> "Tests that ?PRIM_FILE:allocate/3 at least doesn't crash.";
+allocate(Config) when is_list(Config) ->
+ ?line Dog = test_server:timetrap(test_server:seconds(5)),
+ ?line PrivDir = ?config(priv_dir, Config),
+ ?line Allocate = filename:join(PrivDir,
+ atom_to_list(?MODULE)
+ ++"_allocate.fil"),
+
+ Line1 = "Hello\n",
+ Line2 = "World!\n",
+
+ ?line {ok, Fd} = ?PRIM_FILE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd, 1, iolist_size([Line1, Line2])),
+ ?line ok = ?PRIM_FILE:write(Fd, Line1),
+ ?line ok = ?PRIM_FILE:write(Fd, Line2),
+ ?line ok = ?PRIM_FILE:close(Fd),
+
+ ?line {ok, Fd2} = ?PRIM_FILE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd2, 1, iolist_size(Line1)),
+ ?line ok = ?PRIM_FILE:write(Fd2, Line1),
+ ?line ok = ?PRIM_FILE:write(Fd2, Line2),
+ ?line ok = ?PRIM_FILE:close(Fd2),
+
+ ?line {ok, Fd3} = ?PRIM_FILE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd3, 1, iolist_size(Line1) + 1),
+ ?line ok = ?PRIM_FILE:write(Fd3, Line1),
+ ?line ok = ?PRIM_FILE:write(Fd3, Line2),
+ ?line ok = ?PRIM_FILE:close(Fd3),
+
+ ?line {ok, Fd4} = ?PRIM_FILE:open(Allocate, [write, binary]),
+ allocate_and_assert(Fd4, 1, 4 * iolist_size([Line1, Line2])),
+ ?line ok = ?PRIM_FILE:write(Fd4, Line1),
+ ?line ok = ?PRIM_FILE:write(Fd4, Line2),
+ ?line ok = ?PRIM_FILE:close(Fd4),
+
+ ?line test_server:timetrap_cancel(Dog),
+ ok.
+
+allocate_and_assert(Fd, Offset, Length) ->
+ % Just verify that calls to ?PRIM_FILE:allocate/3 don't crash or have
+ % any other negative side effect. We can't really asssert against a
+ % specific return value, because support for file space pre-allocation
+ % depends on the OS, OS version and underlying filesystem.
+ %
+ % The Linux kernel added support for fallocate() in version 2.6.23,
+ % which currently works only for the ext4, ocfs2, xfs and btrfs file
+ % systems. posix_fallocate() is available in glibc as of version
+ % 2.1.94, but it was buggy until glibc version 2.7.
+ %
+ % Mac OS X, as of version 10.3, supports the fcntl operation F_PREALLOCATE.
+ %
+ % Solaris supports posix_fallocate() but only for the UFS file system
+ % apparently (not supported for ZFS).
+ %
+ % FreeBSD 9.0 is the first FreeBSD release supporting posix_fallocate().
+ %
+ % For Windows there's apparently no way to pre-allocate file space, at
+ % least with similar API/semantics as posix_fallocate(), fallocate() or
+ % fcntl F_PREALLOCATE.
+ Result = ?PRIM_FILE:allocate(Fd, Offset, Length),
+ case os:type() of
+ {win32, _} ->
+ ?line {error, enotsup} = Result;
+ _ ->
+ ?line _ = Result
+ end.
+
+%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
+
delete_a(suite) -> [];
delete_a(doc) -> [];
delete_a(Config) when is_list(Config) ->
diff --git a/lib/megaco/aclocal.m4 b/lib/megaco/aclocal.m4
new file mode 100644
index 0000000000..5d555a5123
--- /dev/null
+++ b/lib/megaco/aclocal.m4
@@ -0,0 +1,1906 @@
+dnl
+dnl %CopyrightBegin%
+dnl
+dnl Copyright Ericsson AB 1998-2012. All Rights Reserved.
+dnl
+dnl The contents of this file are subject to the Erlang Public License,
+dnl Version 1.1, (the "License"); you may not use this file except in
+dnl compliance with the License. You should have received a copy of the
+dnl Erlang Public License along with this software. If not, it can be
+dnl retrieved online at http://www.erlang.org/.
+dnl
+dnl Software distributed under the License is distributed on an "AS IS"
+dnl basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+dnl the License for the specific language governing rights and limitations
+dnl under the License.
+dnl
+dnl %CopyrightEnd%
+dnl
+
+dnl
+dnl aclocal.m4
+dnl
+dnl Local macros used in configure.in. The Local Macros which
+dnl could/should be part of autoconf are prefixed LM_, macros specific
+dnl to the Erlang system are prefixed ERL_.
+dnl
+
+AC_DEFUN(LM_PRECIOUS_VARS,
+[
+
+dnl ERL_TOP
+AC_ARG_VAR(ERL_TOP, [Erlang/OTP top source directory])
+
+dnl Tools
+AC_ARG_VAR(CC, [C compiler])
+AC_ARG_VAR(CFLAGS, [C compiler flags])
+AC_ARG_VAR(STATIC_CFLAGS, [C compiler static flags])
+AC_ARG_VAR(CFLAG_RUNTIME_LIBRARY_PATH, [runtime library path linker flag passed via C compiler])
+AC_ARG_VAR(CPP, [C/C++ preprocessor])
+AC_ARG_VAR(CPPFLAGS, [C/C++ preprocessor flags])
+AC_ARG_VAR(CXX, [C++ compiler])
+AC_ARG_VAR(CXXFLAGS, [C++ compiler flags])
+AC_ARG_VAR(LD, [linker (is often overridden by configure)])
+AC_ARG_VAR(LDFLAGS, [linker flags (can be risky to set since LD may be overriden by configure)])
+AC_ARG_VAR(LIBS, [libraries])
+AC_ARG_VAR(DED_LD, [linker for Dynamic Erlang Drivers (set all DED_LD* variables or none)])
+AC_ARG_VAR(DED_LDFLAGS, [linker flags for Dynamic Erlang Drivers (set all DED_LD* variables or none)])
+AC_ARG_VAR(DED_LD_FLAG_RUNTIME_LIBRARY_PATH, [runtime library path linker flag for Dynamic Erlang Drivers (set all DED_LD* variables or none)])
+AC_ARG_VAR(LFS_CFLAGS, [large file support C compiler flags (set all LFS_* variables or none)])
+AC_ARG_VAR(LFS_LDFLAGS, [large file support linker flags (set all LFS_* variables or none)])
+AC_ARG_VAR(LFS_LIBS, [large file support libraries (set all LFS_* variables or none)])
+AC_ARG_VAR(RANLIB, [ranlib])
+AC_ARG_VAR(AR, [ar])
+AC_ARG_VAR(GETCONF, [getconf])
+
+dnl Cross system root
+AC_ARG_VAR(erl_xcomp_sysroot, [Absolute cross system root path (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_isysroot, [Absolute cross system root include path (only used when cross compiling)])
+
+dnl Cross compilation variables
+AC_ARG_VAR(erl_xcomp_bigendian, [big endian system: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_double_middle_endian, [double-middle-endian system: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_linux_clock_gettime_correction, [clock_gettime() can be used for time correction: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_linux_nptl, [have Native POSIX Thread Library: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_linux_usable_sigusrx, [SIGUSR1 and SIGUSR2 can be used: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_linux_usable_sigaltstack, [have working sigaltstack(): yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_poll, [have working poll(): yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_kqueue, [have working kqueue(): yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_putenv_copy, [putenv() stores key-value copy: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_reliable_fpe, [have reliable floating point exceptions: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_getaddrinfo, [have working getaddrinfo() for both IPv4 and IPv6: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_gethrvtime_procfs_ioctl, [have working gethrvtime() which can be used with procfs ioctl(): yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_clock_gettime_cpu_time, [clock_gettime() can be used for retrieving process CPU time: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_after_morecore_hook, [__after_morecore_hook can track malloc()s core memory usage: yes|no (only used when cross compiling)])
+AC_ARG_VAR(erl_xcomp_dlsym_brk_wrappers, [dlsym(RTLD_NEXT, _) brk wrappers can track malloc()s core memory usage: yes|no (only used when cross compiling)])
+
+])
+
+AC_DEFUN(ERL_XCOMP_SYSROOT_INIT,
+[
+erl_xcomp_without_sysroot=no
+if test "$cross_compiling" = "yes"; then
+ test "$erl_xcomp_sysroot" != "" || erl_xcomp_without_sysroot=yes
+ test "$erl_xcomp_isysroot" != "" || erl_xcomp_isysroot="$erl_xcomp_sysroot"
+else
+ erl_xcomp_sysroot=
+ erl_xcomp_isysroot=
+fi
+])
+
+AC_DEFUN(LM_CHECK_GETCONF,
+[
+if test "$cross_compiling" != "yes"; then
+ AC_CHECK_PROG([GETCONF], [getconf], [getconf], [false])
+else
+ dnl First check if we got a `<HOST>-getconf' in $PATH
+ host_getconf="$host_alias-getconf"
+ AC_CHECK_PROG([GETCONF], [$host_getconf], [$host_getconf], [false])
+ if test "$GETCONF" = "false" && test "$erl_xcomp_sysroot" != ""; then
+ dnl We should perhaps give up if we have'nt found it by now, but at
+ dnl least in one Tilera MDE `getconf' under sysroot is a bourne
+ dnl shell script which we can use. We try to find `<HOST>-getconf'
+ dnl or `getconf' under sysconf, but only under sysconf since
+ dnl `getconf' in $PATH is almost guaranteed to be for the build
+ dnl machine.
+ GETCONF=
+ prfx="$erl_xcomp_sysroot"
+ AC_PATH_TOOL([GETCONF], [getconf], [false],
+ ["$prfx/usr/bin:$prfx/bin:$prfx/usr/local/bin"])
+ fi
+fi
+])
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_WINDOWS_ENVIRONMENT
+dnl
+dnl
+dnl Tries to determine thw windows build environment, i.e.
+dnl MIXED_CYGWIN_VC or MIXED_MSYS_VC
+dnl
+
+AC_DEFUN(LM_WINDOWS_ENVIRONMENT,
+[
+MIXED_CYGWIN=no
+MIXED_MSYS=no
+
+AC_MSG_CHECKING(for mixed cygwin or msys and native VC++ environment)
+if test "X$host" = "Xwin32" -a "x$GCC" != "xyes"; then
+ if test -x /usr/bin/cygpath; then
+ CFLAGS="-O2"
+ MIXED_CYGWIN=yes
+ AC_MSG_RESULT([Cygwin and VC])
+ MIXED_CYGWIN_VC=yes
+ CPPFLAGS="$CPPFLAGS -DERTS_MIXED_CYGWIN_VC"
+ elif test -x /usr/bin/msysinfo; then
+ CFLAGS="-O2"
+ MIXED_MSYS=yes
+ AC_MSG_RESULT([MSYS and VC])
+ MIXED_MSYS_VC=yes
+ CPPFLAGS="$CPPFLAGS -DERTS_MIXED_MSYS_VC"
+ else
+ AC_MSG_RESULT([undeterminable])
+ AC_MSG_ERROR(Seems to be mixed windows but not with cygwin, cannot handle this!)
+ fi
+else
+ AC_MSG_RESULT([no])
+ MIXED_CYGWIN_VC=no
+ MIXED_MSYS_VC=no
+fi
+AC_SUBST(MIXED_CYGWIN_VC)
+AC_SUBST(MIXED_MSYS_VC)
+
+MIXED_VC=no
+if test "x$MIXED_MSYS_VC" = "xyes" -o "x$MIXED_CYGWIN_VC" = "xyes" ; then
+ MIXED_VC=yes
+fi
+
+AC_SUBST(MIXED_VC)
+
+if test "x$MIXED_MSYS" != "xyes"; then
+ AC_MSG_CHECKING(for mixed cygwin and native MinGW environment)
+ if test "X$host" = "Xwin32" -a "x$GCC" = x"yes"; then
+ if test -x /usr/bin/cygpath; then
+ CFLAGS="-O2"
+ MIXED_CYGWIN=yes
+ AC_MSG_RESULT([yes])
+ MIXED_CYGWIN_MINGW=yes
+ CPPFLAGS="$CPPFLAGS -DERTS_MIXED_CYGWIN_MINGW"
+ else
+ AC_MSG_RESULT([undeterminable])
+ AC_MSG_ERROR(Seems to be mixed windows but not with cygwin, cannot handle this!)
+ fi
+ else
+ AC_MSG_RESULT([no])
+ MIXED_CYGWIN_MINGW=no
+ fi
+else
+ MIXED_CYGWIN_MINGW=no
+fi
+AC_SUBST(MIXED_CYGWIN_MINGW)
+
+AC_MSG_CHECKING(if we mix cygwin with any native compiler)
+if test "X$MIXED_CYGWIN" = "Xyes"; then
+ AC_MSG_RESULT([yes])
+else
+ AC_MSG_RESULT([no])
+fi
+
+AC_SUBST(MIXED_CYGWIN)
+
+AC_MSG_CHECKING(if we mix msys with another native compiler)
+if test "X$MIXED_MSYS" = "Xyes" ; then
+ AC_MSG_RESULT([yes])
+else
+ AC_MSG_RESULT([no])
+fi
+
+AC_SUBST(MIXED_MSYS)
+])
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_FIND_EMU_CC
+dnl
+dnl
+dnl Tries fairly hard to find a C compiler that can handle jump tables.
+dnl Defines the @EMU_CC@ variable for the makefiles and
+dnl inserts NO_JUMP_TABLE in the header if one cannot be found...
+dnl
+
+AC_DEFUN(LM_FIND_EMU_CC,
+ [AC_CACHE_CHECK(for a compiler that handles jumptables,
+ ac_cv_prog_emu_cc,
+ [
+AC_TRY_COMPILE([],[
+#if defined(__clang_major__) && __clang_major__ >= 3
+ /* clang 3.x or later is fine */
+#elif defined(__llvm__)
+#error "this version of llvm is unable to correctly compile beam_emu.c"
+#endif
+ __label__ lbl1;
+ __label__ lbl2;
+ int x = magic();
+ static void *jtab[2];
+
+ jtab[0] = &&lbl1;
+ jtab[1] = &&lbl2;
+ goto *jtab[x];
+lbl1:
+ return 1;
+lbl2:
+ return 2;
+],ac_cv_prog_emu_cc=$CC,ac_cv_prog_emu_cc=no)
+
+if test $ac_cv_prog_emu_cc = no; then
+ for ac_progname in emu_cc.sh gcc-4.2 gcc; do
+ IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS=":"
+ ac_dummy="$PATH"
+ for ac_dir in $ac_dummy; do
+ test -z "$ac_dir" && ac_dir=.
+ if test -f $ac_dir/$ac_progname; then
+ ac_cv_prog_emu_cc=$ac_dir/$ac_progname
+ break
+ fi
+ done
+ IFS="$ac_save_ifs"
+ if test $ac_cv_prog_emu_cc != no; then
+ break
+ fi
+ done
+fi
+
+if test $ac_cv_prog_emu_cc != no; then
+ save_CC=$CC
+ save_CFLAGS=$CFLAGS
+ save_CPPFLAGS=$CPPFLAGS
+ CC=$ac_cv_prog_emu_cc
+ CFLAGS=""
+ CPPFLAGS=""
+ AC_TRY_COMPILE([],[
+#if defined(__clang_major__) && __clang_major__ >= 3
+ /* clang 3.x or later is fine */
+#elif defined(__llvm__)
+#error "this version of llvm is unable to correctly compile beam_emu.c"
+#endif
+ __label__ lbl1;
+ __label__ lbl2;
+ int x = magic();
+ static void *jtab[2];
+
+ jtab[0] = &&lbl1;
+ jtab[1] = &&lbl2;
+ goto *jtab[x];
+ lbl1:
+ return 1;
+ lbl2:
+ return 2;
+ ],ac_cv_prog_emu_cc=$CC,ac_cv_prog_emu_cc=no)
+ CC=$save_CC
+ CFLAGS=$save_CFLAGS
+ CPPFLAGS=$save_CPPFLAGS
+fi
+])
+if test $ac_cv_prog_emu_cc = no; then
+ AC_DEFINE(NO_JUMP_TABLE,[],[Defined if no found C compiler can handle jump tables])
+ EMU_CC=$CC
+else
+ EMU_CC=$ac_cv_prog_emu_cc
+fi
+AC_SUBST(EMU_CC)
+])
+
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_PROG_INSTALL_DIR
+dnl
+dnl This macro may be used by any OTP application.
+dnl
+dnl Figure out how to create directories with parents.
+dnl (In my opinion INSTALL_DIR is a bad name, MKSUBDIRS or something is better)
+dnl
+dnl We prefer 'install -d', but use 'mkdir -p' if it exists.
+dnl If none of these methods works, we give up.
+dnl
+
+
+AC_DEFUN(LM_PROG_INSTALL_DIR,
+[AC_CACHE_CHECK(how to create a directory including parents,
+ac_cv_prog_mkdir_p,
+[
+temp_name_base=config.$$
+temp_name=$temp_name_base/x/y/z
+$INSTALL -d $temp_name >/dev/null 2>&1
+ac_cv_prog_mkdir_p=none
+if test -d $temp_name; then
+ ac_cv_prog_mkdir_p="$INSTALL -d"
+else
+ mkdir -p $temp_name >/dev/null 2>&1
+ if test -d $temp_name; then
+ ac_cv_prog_mkdir_p="mkdir -p"
+ fi
+fi
+rm -fr $temp_name_base
+])
+
+case "${ac_cv_prog_mkdir_p}" in
+ none) AC_MSG_ERROR(don't know how create directories with parents) ;;
+ *) INSTALL_DIR="$ac_cv_prog_mkdir_p" AC_SUBST(INSTALL_DIR) ;;
+esac
+])
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_PROG_PERL5
+dnl
+dnl Try to find perl version 5. If found set PERL to the absolute path
+dnl of the program, if not found set PERL to false.
+dnl
+dnl On some systems /usr/bin/perl is perl 4 and e.g.
+dnl /usr/local/bin/perl is perl 5. We try to handle this case by
+dnl putting a couple of
+dnl Tries to handle the case that there are two programs called perl
+dnl in the path and one of them is perl 5 and the other isn't.
+dnl
+AC_DEFUN(LM_PROG_PERL5,
+[AC_PATH_PROGS(PERL, perl5 perl, false,
+ /usr/local/bin:/opt/local/bin:/usr/local/gnu/bin:${PATH})
+changequote(, )dnl
+dnl[ That bracket is needed to balance the right bracket below
+if test "$PERL" = "false" || $PERL -e 'exit ($] >= 5)'; then
+changequote([, ])dnl
+ ac_cv_path_PERL=false
+ PERL=false
+dnl AC_MSG_WARN(perl version 5 not found)
+fi
+])dnl
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_DECL_SO_BSDCOMPAT
+dnl
+dnl Check if the system has the SO_BSDCOMPAT flag on sockets (linux)
+dnl
+AC_DEFUN(LM_DECL_SO_BSDCOMPAT,
+[AC_CACHE_CHECK([for SO_BSDCOMPAT declaration], ac_cv_decl_so_bsdcompat,
+AC_TRY_COMPILE([#include <sys/socket.h>], [int i = SO_BSDCOMPAT;],
+ ac_cv_decl_so_bsdcompat=yes,
+ ac_cv_decl_so_bsdcompat=no))
+
+case "${ac_cv_decl_so_bsdcompat}" in
+ "yes" ) AC_DEFINE(HAVE_SO_BSDCOMPAT,[],
+ [Define if you have SO_BSDCOMPAT flag on sockets]) ;;
+ * ) ;;
+esac
+])
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_DECL_INADDR_LOOPBACK
+dnl
+dnl Try to find declaration of INADDR_LOOPBACK, if nowhere provide a default
+dnl
+
+AC_DEFUN(LM_DECL_INADDR_LOOPBACK,
+[AC_CACHE_CHECK([for INADDR_LOOPBACK in netinet/in.h],
+ ac_cv_decl_inaddr_loopback,
+[AC_TRY_COMPILE([#include <sys/types.h>
+#include <netinet/in.h>], [int i = INADDR_LOOPBACK;],
+ac_cv_decl_inaddr_loopback=yes, ac_cv_decl_inaddr_loopback=no)
+])
+
+if test ${ac_cv_decl_inaddr_loopback} = no; then
+ AC_CACHE_CHECK([for INADDR_LOOPBACK in rpc/types.h],
+ ac_cv_decl_inaddr_loopback_rpc,
+ AC_TRY_COMPILE([#include <rpc/types.h>],
+ [int i = INADDR_LOOPBACK;],
+ ac_cv_decl_inaddr_loopback_rpc=yes,
+ ac_cv_decl_inaddr_loopback_rpc=no))
+
+ case "${ac_cv_decl_inaddr_loopback_rpc}" in
+ "yes" )
+ AC_DEFINE(DEF_INADDR_LOOPBACK_IN_RPC_TYPES_H,[],
+ [Define if you need to include rpc/types.h to get INADDR_LOOPBACK defined]) ;;
+ * )
+ AC_CACHE_CHECK([for INADDR_LOOPBACK in winsock2.h],
+ ac_cv_decl_inaddr_loopback_winsock2,
+ AC_TRY_COMPILE([#define WIN32_LEAN_AND_MEAN
+ #include <winsock2.h>],
+ [int i = INADDR_LOOPBACK;],
+ ac_cv_decl_inaddr_loopback_winsock2=yes,
+ ac_cv_decl_inaddr_loopback_winsock2=no))
+ case "${ac_cv_decl_inaddr_loopback_winsock2}" in
+ "yes" )
+ AC_DEFINE(DEF_INADDR_LOOPBACK_IN_WINSOCK2_H,[],
+ [Define if you need to include winsock2.h to get INADDR_LOOPBACK defined]) ;;
+ * )
+ # couldn't find it anywhere
+ AC_DEFINE(HAVE_NO_INADDR_LOOPBACK,[],
+ [Define if you don't have a definition of INADDR_LOOPBACK]) ;;
+ esac;;
+ esac
+fi
+])
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_STRUCT_SOCKADDR_SA_LEN
+dnl
+dnl Check if the sockaddr structure has the field sa_len
+dnl
+
+AC_DEFUN(LM_STRUCT_SOCKADDR_SA_LEN,
+[AC_CACHE_CHECK([whether struct sockaddr has sa_len field],
+ ac_cv_struct_sockaddr_sa_len,
+AC_TRY_COMPILE([#include <sys/types.h>
+#include <sys/socket.h>], [struct sockaddr s; s.sa_len = 10;],
+ ac_cv_struct_sockaddr_sa_len=yes, ac_cv_struct_sockaddr_sa_len=no))
+
+dnl FIXME convbreak
+case ${ac_cv_struct_sockaddr_sa_len} in
+ "no" ) AC_DEFINE(NO_SA_LEN,[1],[Define if you dont have salen]) ;;
+ *) ;;
+esac
+])
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_STRUCT_EXCEPTION
+dnl
+dnl Check to see whether the system supports the matherr function
+dnl and its associated type "struct exception".
+dnl
+
+AC_DEFUN(LM_STRUCT_EXCEPTION,
+[AC_CACHE_CHECK([for struct exception (and matherr function)],
+ ac_cv_struct_exception,
+AC_TRY_COMPILE([#include <math.h>],
+ [struct exception x; x.type = DOMAIN; x.type = SING;],
+ ac_cv_struct_exception=yes, ac_cv_struct_exception=no))
+
+case "${ac_cv_struct_exception}" in
+ "yes" ) AC_DEFINE(USE_MATHERR,[1],[Define if you have matherr() function and struct exception type]) ;;
+ * ) ;;
+esac
+])
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_SYS_IPV6
+dnl
+dnl Check for ipv6 support and what the in6_addr structure is called.
+dnl (early linux used in_addr6 insted of in6_addr)
+dnl
+
+AC_DEFUN(LM_SYS_IPV6,
+[AC_MSG_CHECKING(for IP version 6 support)
+AC_CACHE_VAL(ac_cv_sys_ipv6_support,
+[ok_so_far=yes
+ AC_TRY_COMPILE([#include <sys/types.h>
+#ifdef __WIN32__
+#include <winsock2.h>
+#include <ws2tcpip.h>
+#else
+#include <netinet/in.h>
+#endif],
+ [struct in6_addr a6; struct sockaddr_in6 s6;], ok_so_far=yes, ok_so_far=no)
+
+if test $ok_so_far = yes; then
+ ac_cv_sys_ipv6_support=yes
+else
+ AC_TRY_COMPILE([#include <sys/types.h>
+#ifdef __WIN32__
+#include <winsock2.h>
+#include <ws2tcpip.h>
+#else
+#include <netinet/in.h>
+#endif],
+ [struct in_addr6 a6; struct sockaddr_in6 s6;],
+ ac_cv_sys_ipv6_support=in_addr6, ac_cv_sys_ipv6_support=no)
+fi
+])dnl
+
+dnl
+dnl Have to use old style AC_DEFINE due to BC with old autoconf.
+dnl
+
+case ${ac_cv_sys_ipv6_support} in
+ yes)
+ AC_MSG_RESULT(yes)
+ AC_DEFINE(HAVE_IN6,[1],[Define if ipv6 is present])
+ ;;
+ in_addr6)
+ AC_MSG_RESULT([yes (but I am redefining in_addr6 to in6_addr)])
+ AC_DEFINE(HAVE_IN6,[1],[Define if ipv6 is present])
+ AC_DEFINE(HAVE_IN_ADDR6_STRUCT,[],[Early linux used in_addr6 instead of in6_addr, define if you have this])
+ ;;
+ *)
+ AC_MSG_RESULT(no)
+ ;;
+esac
+])
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_SYS_MULTICAST
+dnl
+dnl Check for multicast support. Only checks for multicast options in
+dnl setsockopt(), no check is performed that multicasting actually works.
+dnl If options are found defines HAVE_MULTICAST_SUPPORT
+dnl
+
+AC_DEFUN(LM_SYS_MULTICAST,
+[AC_CACHE_CHECK([for multicast support], ac_cv_sys_multicast_support,
+[AC_EGREP_CPP(yes,
+[#include <sys/types.h>
+#include <sys/socket.h>
+#include <netinet/in.h>
+#if defined(IP_MULTICAST_TTL) && defined(IP_MULTICAST_LOOP) && defined(IP_MULTICAST_IF) && defined(IP_ADD_MEMBERSHIP) && defined(IP_DROP_MEMBERSHIP)
+yes
+#endif
+], ac_cv_sys_multicast_support=yes, ac_cv_sys_multicast_support=no)])
+if test $ac_cv_sys_multicast_support = yes; then
+ AC_DEFINE(HAVE_MULTICAST_SUPPORT,[1],
+ [Define if setsockopt() accepts multicast options])
+fi
+])dnl
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_DECL_SYS_ERRLIST
+dnl
+dnl Define SYS_ERRLIST_DECLARED if the variable sys_errlist is declared
+dnl in a system header file, stdio.h or errno.h.
+dnl
+
+AC_DEFUN(LM_DECL_SYS_ERRLIST,
+[AC_CACHE_CHECK([for sys_errlist declaration in stdio.h or errno.h],
+ ac_cv_decl_sys_errlist,
+[AC_TRY_COMPILE([#include <stdio.h>
+#include <errno.h>], [char *msg = *(sys_errlist + 1);],
+ ac_cv_decl_sys_errlist=yes, ac_cv_decl_sys_errlist=no)])
+if test $ac_cv_decl_sys_errlist = yes; then
+ AC_DEFINE(SYS_ERRLIST_DECLARED,[],
+ [define if the variable sys_errlist is declared in a system header file])
+fi
+])
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_CHECK_FUNC_DECL( funname, declaration [, extra includes
+dnl [, action-if-found [, action-if-not-found]]] )
+dnl
+dnl Checks if the declaration "declaration" of "funname" conflicts
+dnl with the header files idea of how the function should be
+dnl declared. It is useful on systems which lack prototypes and you
+dnl need to provide your own (e.g. when you want to take the address
+dnl of a function). The 4'th argument is expanded if conflicting,
+dnl the 5'th argument otherwise
+dnl
+dnl
+
+AC_DEFUN(LM_CHECK_FUNC_DECL,
+[AC_MSG_CHECKING([for conflicting declaration of $1])
+AC_CACHE_VAL(ac_cv_func_decl_$1,
+[AC_TRY_COMPILE([#include <stdio.h>
+$3],[$2
+char *c = (char *)$1;
+], eval "ac_cv_func_decl_$1=no", eval "ac_cv_func_decl_$1=yes")])
+if eval "test \"`echo '$ac_cv_func_decl_'$1`\" = yes"; then
+ AC_MSG_RESULT(yes)
+ ifelse([$4], , :, [$4])
+else
+ AC_MSG_RESULT(no)
+ifelse([$5], , , [$5
+])dnl
+fi
+])
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl AC_DOUBLE_MIDDLE_ENDIAN
+dnl
+dnl Checks whether doubles are represented in "middle-endian" format.
+dnl Sets ac_cv_double_middle_endian={no,yes,unknown} accordingly,
+dnl as well as DOUBLE_MIDDLE_ENDIAN.
+dnl
+dnl
+
+AC_DEFUN([AC_C_DOUBLE_MIDDLE_ENDIAN],
+[AC_CACHE_CHECK(whether double word ordering is middle-endian, ac_cv_c_double_middle_endian,
+[# It does not; compile a test program.
+AC_RUN_IFELSE(
+[AC_LANG_SOURCE([[#include <stdlib.h>
+
+int
+main(void)
+{
+ int i = 0;
+ int zero = 0;
+ int bigendian;
+ int zero_index = 0;
+
+ union
+ {
+ long int l;
+ char c[sizeof (long int)];
+ } u;
+
+ /* we'll use the one with 32-bit words */
+ union
+ {
+ double d;
+ unsigned int c[2];
+ } vint;
+
+ union
+ {
+ double d;
+ unsigned long c[2];
+ } vlong;
+
+ union
+ {
+ double d;
+ unsigned short c[2];
+ } vshort;
+
+
+ /* Are we little or big endian? From Harbison&Steele. */
+ u.l = 1;
+ bigendian = (u.c[sizeof (long int) - 1] == 1);
+
+ zero_index = bigendian ? 1 : 0;
+
+ vint.d = 1.0;
+ vlong.d = 1.0;
+ vshort.d = 1.0;
+
+ if (sizeof(unsigned int) == 4)
+ {
+ if (vint.c[zero_index] != 0)
+ zero = 1;
+ }
+ else if (sizeof(unsigned long) == 4)
+ {
+ if (vlong.c[zero_index] != 0)
+ zero = 1;
+ }
+ else if (sizeof(unsigned short) == 4)
+ {
+ if (vshort.c[zero_index] != 0)
+ zero = 1;
+ }
+
+ exit (zero);
+}
+]])],
+ [ac_cv_c_double_middle_endian=no],
+ [ac_cv_c_double_middle_endian=yes],
+ [ac_cv_c_double_middle=unknown])])
+case $ac_cv_c_double_middle_endian in
+ yes)
+ m4_default([$1],
+ [AC_DEFINE([DOUBLE_MIDDLE_ENDIAN], 1,
+ [Define to 1 if your processor stores the words in a double in
+ middle-endian format (like some ARMs).])]) ;;
+ no)
+ $2 ;;
+ *)
+ m4_default([$3],
+ [AC_MSG_WARN([unknown double endianness
+presetting ac_cv_c_double_middle_endian=no (or yes) will help])]) ;;
+esac
+])# AC_C_DOUBLE_MIDDLE_ENDIAN
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_CHECK_THR_LIB
+dnl
+dnl This macro may be used by any OTP application.
+dnl
+dnl LM_CHECK_THR_LIB sets THR_LIBS, THR_DEFS, and THR_LIB_NAME. It also
+dnl checks for some pthread headers which will appear in DEFS or config.h.
+dnl
+
+AC_DEFUN(LM_CHECK_THR_LIB,
+[
+
+NEED_NPTL_PTHREAD_H=no
+
+dnl win32?
+AC_MSG_CHECKING([for native win32 threads])
+if test "X$host_os" = "Xwin32"; then
+ AC_MSG_RESULT(yes)
+ THR_DEFS="-DWIN32_THREADS"
+ THR_LIBS=
+ THR_LIB_NAME=win32_threads
+ THR_LIB_TYPE=win32_threads
+else
+ AC_MSG_RESULT(no)
+ THR_DEFS=
+ THR_LIBS=
+ THR_LIB_NAME=
+ THR_LIB_TYPE=posix_unknown
+
+dnl Try to find POSIX threads
+
+dnl The usual pthread lib...
+ AC_CHECK_LIB(pthread, pthread_create, THR_LIBS="-lpthread")
+
+dnl Very old versions of FreeBSD have pthreads in special c library, c_r...
+ if test "x$THR_LIBS" = "x"; then
+ AC_CHECK_LIB(c_r, pthread_create, THR_LIBS="-lc_r")
+ fi
+
+dnl QNX has pthreads in standard C library
+ if test "x$THR_LIBS" = "x"; then
+ AC_CHECK_FUNC(pthread_create, THR_LIBS="none_needed")
+ fi
+
+dnl On ofs1 the '-pthread' switch should be used
+ if test "x$THR_LIBS" = "x"; then
+ AC_MSG_CHECKING([if the '-pthread' switch can be used])
+ saved_cflags=$CFLAGS
+ CFLAGS="$CFLAGS -pthread"
+ AC_TRY_LINK([#include <pthread.h>],
+ pthread_create((void*)0,(void*)0,(void*)0,(void*)0);,
+ [THR_DEFS="-pthread"
+ THR_LIBS="-pthread"])
+ CFLAGS=$saved_cflags
+ if test "x$THR_LIBS" != "x"; then
+ AC_MSG_RESULT(yes)
+ else
+ AC_MSG_RESULT(no)
+ fi
+ fi
+
+ if test "x$THR_LIBS" != "x"; then
+ THR_DEFS="$THR_DEFS -D_THREAD_SAFE -D_REENTRANT -DPOSIX_THREADS"
+ THR_LIB_NAME=pthread
+ if test "x$THR_LIBS" = "xnone_needed"; then
+ THR_LIBS=
+ fi
+ case $host_os in
+ solaris*)
+ THR_DEFS="$THR_DEFS -D_POSIX_PTHREAD_SEMANTICS" ;;
+ linux*)
+ THR_DEFS="$THR_DEFS -D_POSIX_THREAD_SAFE_FUNCTIONS"
+
+ LM_CHECK_GETCONF
+ AC_MSG_CHECKING(for Native POSIX Thread Library)
+ libpthr_vsn=`$GETCONF GNU_LIBPTHREAD_VERSION 2>/dev/null`
+ if test $? -eq 0; then
+ case "$libpthr_vsn" in
+ *nptl*|*NPTL*) nptl=yes;;
+ *) nptl=no;;
+ esac
+ elif test "$cross_compiling" = "yes"; then
+ case "$erl_xcomp_linux_nptl" in
+ "") nptl=cross;;
+ yes|no) nptl=$erl_xcomp_linux_nptl;;
+ *) AC_MSG_ERROR([Bad erl_xcomp_linux_nptl value: $erl_xcomp_linux_nptl]);;
+ esac
+ else
+ nptl=no
+ fi
+ AC_MSG_RESULT($nptl)
+ if test $nptl = cross; then
+ nptl=yes
+ AC_MSG_WARN([result yes guessed because of cross compilation])
+ fi
+ if test $nptl = yes; then
+ THR_LIB_TYPE=posix_nptl
+ need_nptl_incldir=no
+ AC_CHECK_HEADER(nptl/pthread.h,
+ [need_nptl_incldir=yes
+ NEED_NPTL_PTHREAD_H=yes])
+ if test $need_nptl_incldir = yes; then
+ # Ahh...
+ nptl_path="$C_INCLUDE_PATH:$CPATH"
+ if test X$cross_compiling != Xyes; then
+ nptl_path="$nptl_path:/usr/local/include:/usr/include"
+ else
+ IROOT="$erl_xcomp_isysroot"
+ test "$IROOT" != "" || IROOT="$erl_xcomp_sysroot"
+ test "$IROOT" != "" || AC_MSG_ERROR([Don't know where to search for includes! Please set erl_xcomp_isysroot])
+ nptl_path="$nptl_path:$IROOT/usr/local/include:$IROOT/usr/include"
+ fi
+ nptl_ws_path=
+ save_ifs="$IFS"; IFS=":"
+ for dir in $nptl_path; do
+ if test "x$dir" != "x"; then
+ nptl_ws_path="$nptl_ws_path $dir"
+ fi
+ done
+ IFS=$save_ifs
+ nptl_incldir=
+ for dir in $nptl_ws_path; do
+ AC_CHECK_HEADER($dir/nptl/pthread.h,
+ nptl_incldir=$dir/nptl)
+ if test "x$nptl_incldir" != "x"; then
+ THR_DEFS="$THR_DEFS -isystem $nptl_incldir"
+ break
+ fi
+ done
+ if test "x$nptl_incldir" = "x"; then
+ AC_MSG_ERROR(Failed to locate nptl system include directory)
+ fi
+ fi
+ fi
+ ;;
+ *) ;;
+ esac
+
+ dnl We sometimes need THR_DEFS in order to find certain headers
+ dnl (at least for pthread.h on osf1).
+ saved_cppflags=$CPPFLAGS
+ CPPFLAGS="$CPPFLAGS $THR_DEFS"
+
+ dnl
+ dnl Check for headers
+ dnl
+
+ AC_CHECK_HEADER(pthread.h,
+ AC_DEFINE(HAVE_PTHREAD_H, 1, \
+[Define if you have the <pthread.h> header file.]))
+
+ dnl Some Linuxes have <pthread/mit/pthread.h> instead of <pthread.h>
+ AC_CHECK_HEADER(pthread/mit/pthread.h, \
+ AC_DEFINE(HAVE_MIT_PTHREAD_H, 1, \
+[Define if the pthread.h header file is in pthread/mit directory.]))
+
+ dnl restore CPPFLAGS
+ CPPFLAGS=$saved_cppflags
+
+ fi
+fi
+
+])
+
+AC_DEFUN(ERL_INTERNAL_LIBS,
+[
+
+ERTS_INTERNAL_X_LIBS=
+
+AC_CHECK_LIB(kstat, kstat_open,
+[AC_DEFINE(HAVE_KSTAT, 1, [Define if you have kstat])
+ERTS_INTERNAL_X_LIBS="$ERTS_INTERNAL_X_LIBS -lkstat"])
+
+AC_SUBST(ERTS_INTERNAL_X_LIBS)
+
+])
+
+AC_DEFUN(ETHR_CHK_SYNC_OP,
+[
+ AC_MSG_CHECKING([for $3-bit $1()])
+ case "$2" in
+ "1") sync_call="$1(&var);";;
+ "2") sync_call="$1(&var, ($4) 0);";;
+ "3") sync_call="$1(&var, ($4) 0, ($4) 0);";;
+ esac
+ have_sync_op=no
+ AC_TRY_LINK([],
+ [
+ $4 res;
+ volatile $4 var;
+ res = $sync_call
+ ],
+ [have_sync_op=yes])
+ test $have_sync_op = yes && $5
+ AC_MSG_RESULT([$have_sync_op])
+])
+
+AC_DEFUN(ETHR_CHK_INTERLOCKED,
+[
+ ilckd="$1"
+ AC_MSG_CHECKING([for ${ilckd}()])
+ case "$2" in
+ "1") ilckd_call="${ilckd}(var);";;
+ "2") ilckd_call="${ilckd}(var, ($3) 0);";;
+ "3") ilckd_call="${ilckd}(var, ($3) 0, ($3) 0);";;
+ "4") ilckd_call="${ilckd}(var, ($3) 0, ($3) 0, arr);";;
+ esac
+ have_interlocked_op=no
+ AC_TRY_LINK(
+ [
+ #define WIN32_LEAN_AND_MEAN
+ #include <windows.h>
+ #include <intrin.h>
+ ],
+ [
+ volatile $3 *var;
+ volatile $3 arr[2];
+
+ $ilckd_call
+ return 0;
+ ],
+ [have_interlocked_op=yes])
+ test $have_interlocked_op = yes && $4
+ AC_MSG_RESULT([$have_interlocked_op])
+])
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl ERL_FIND_ETHR_LIB
+dnl
+dnl NOTE! This macro may be changed at any time! Should *only* be used by
+dnl ERTS!
+dnl
+dnl Find a thread library to use. Sets ETHR_LIBS to libraries to link
+dnl with, ETHR_X_LIBS to extra libraries to link with (same as ETHR_LIBS
+dnl except that the ethread lib itself is not included), ETHR_DEFS to
+dnl defines to compile with, ETHR_THR_LIB_BASE to the name of the
+dnl thread library which the ethread library is based on, and ETHR_LIB_NAME
+dnl to the name of the library where the ethread implementation is located.
+dnl ERL_FIND_ETHR_LIB currently searches for 'pthreads', and
+dnl 'win32_threads'. If no thread library was found ETHR_LIBS, ETHR_X_LIBS,
+dnl ETHR_DEFS, ETHR_THR_LIB_BASE, and ETHR_LIB_NAME are all set to the
+dnl empty string.
+dnl
+
+AC_DEFUN(ERL_FIND_ETHR_LIB,
+[
+
+LM_CHECK_THR_LIB
+ERL_INTERNAL_LIBS
+
+ethr_have_native_atomics=no
+ethr_have_native_spinlock=no
+ETHR_THR_LIB_BASE="$THR_LIB_NAME"
+ETHR_THR_LIB_BASE_TYPE="$THR_LIB_TYPE"
+ETHR_DEFS="$THR_DEFS"
+ETHR_X_LIBS="$THR_LIBS $ERTS_INTERNAL_X_LIBS"
+ETHR_LIBS=
+ETHR_LIB_NAME=
+
+ethr_modified_default_stack_size=
+
+dnl Name of lib where ethread implementation is located
+ethr_lib_name=ethread
+
+case "$THR_LIB_NAME" in
+
+ win32_threads)
+ ETHR_THR_LIB_BASE_DIR=win
+ # * _WIN32_WINNT >= 0x0400 is needed for
+ # TryEnterCriticalSection
+ # * _WIN32_WINNT >= 0x0403 is needed for
+ # InitializeCriticalSectionAndSpinCount
+ # The ethread lib will refuse to build if _WIN32_WINNT < 0x0403.
+ #
+ # -D_WIN32_WINNT should have been defined in $CPPFLAGS; fetch it
+ # and save it in ETHR_DEFS.
+ found_win32_winnt=no
+ for cppflag in $CPPFLAGS; do
+ case $cppflag in
+ -DWINVER*)
+ ETHR_DEFS="$ETHR_DEFS $cppflag"
+ ;;
+ -D_WIN32_WINNT*)
+ ETHR_DEFS="$ETHR_DEFS $cppflag"
+ found_win32_winnt=yes
+ ;;
+ *)
+ ;;
+ esac
+ done
+ if test $found_win32_winnt = no; then
+ AC_MSG_ERROR([-D_WIN32_WINNT missing in CPPFLAGS])
+ fi
+
+ AC_DEFINE(ETHR_WIN32_THREADS, 1, [Define if you have win32 threads])
+
+ ETHR_CHK_INTERLOCKED([_InterlockedDecrement], [1], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDDECREMENT, 1, [Define if you have _InterlockedDecrement()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedDecrement_rel], [1], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDDECREMENT_REL, 1, [Define if you have _InterlockedDecrement_rel()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedIncrement], [1], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDINCREMENT, 1, [Define if you have _InterlockedIncrement()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedIncrement_acq], [1], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDINCREMENT_ACQ, 1, [Define if you have _InterlockedIncrement_acq()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedExchangeAdd], [2], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDEXCHANGEADD, 1, [Define if you have _InterlockedExchangeAdd()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedExchangeAdd_acq], [2], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDEXCHANGEADD_ACQ, 1, [Define if you have _InterlockedExchangeAdd_acq()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedAnd], [2], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDAND, 1, [Define if you have _InterlockedAnd()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedOr], [2], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDOR, 1, [Define if you have _InterlockedOr()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedExchange], [2], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDEXCHANGE, 1, [Define if you have _InterlockedExchange()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange], [3], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE, 1, [Define if you have _InterlockedCompareExchange()]))
+ test "$have_interlocked_op" = "yes" && ethr_have_native_atomics=yes
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange_acq], [3], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE_ACQ, 1, [Define if you have _InterlockedCompareExchange_acq()]))
+ test "$have_interlocked_op" = "yes" && ethr_have_native_atomics=yes
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange_rel], [3], [long], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE_REL, 1, [Define if you have _InterlockedCompareExchange_rel()]))
+ test "$have_interlocked_op" = "yes" && ethr_have_native_atomics=yes
+
+ ETHR_CHK_INTERLOCKED([_InterlockedDecrement64], [1], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDDECREMENT64, 1, [Define if you have _InterlockedDecrement64()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedDecrement64_rel], [1], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDDECREMENT64_REL, 1, [Define if you have _InterlockedDecrement64_rel()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedIncrement64], [1], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDINCREMENT64, 1, [Define if you have _InterlockedIncrement64()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedIncrement64_acq], [1], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDINCREMENT64_ACQ, 1, [Define if you have _InterlockedIncrement64_acq()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedExchangeAdd64], [2], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDEXCHANGEADD64, 1, [Define if you have _InterlockedExchangeAdd64()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedExchangeAdd64_acq], [2], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDEXCHANGEADD64_ACQ, 1, [Define if you have _InterlockedExchangeAdd64_acq()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedAnd64], [2], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDAND64, 1, [Define if you have _InterlockedAnd64()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedOr64], [2], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDOR64, 1, [Define if you have _InterlockedOr64()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedExchange64], [2], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDEXCHANGE64, 1, [Define if you have _InterlockedExchange64()]))
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange64], [3], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE64, 1, [Define if you have _InterlockedCompareExchange64()]))
+ test "$have_interlocked_op" = "yes" && ethr_have_native_atomics=yes
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange64_acq], [3], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE64_ACQ, 1, [Define if you have _InterlockedCompareExchange64_acq()]))
+ test "$have_interlocked_op" = "yes" && ethr_have_native_atomics=yes
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange64_rel], [3], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE64_REL, 1, [Define if you have _InterlockedCompareExchange64_rel()]))
+ test "$have_interlocked_op" = "yes" && ethr_have_native_atomics=yes
+
+ ETHR_CHK_INTERLOCKED([_InterlockedCompareExchange128], [4], [__int64], AC_DEFINE_UNQUOTED(ETHR_HAVE__INTERLOCKEDCOMPAREEXCHANGE128, 1, [Define if you have _InterlockedCompareExchange128()]))
+
+ test "$ethr_have_native_atomics" = "yes" && ethr_have_native_spinlock=yes
+ ;;
+
+ pthread)
+ ETHR_THR_LIB_BASE_DIR=pthread
+ AC_DEFINE(ETHR_PTHREADS, 1, [Define if you have pthreads])
+ case $host_os in
+ openbsd*)
+ # The default stack size is insufficient for our needs
+ # on OpenBSD. We increase it to 256 kilo words.
+ ethr_modified_default_stack_size=256;;
+ linux*)
+ ETHR_DEFS="$ETHR_DEFS -D_GNU_SOURCE"
+
+ if test X$cross_compiling = Xyes; then
+ case X$erl_xcomp_linux_usable_sigusrx in
+ X) usable_sigusrx=cross;;
+ Xyes|Xno) usable_sigusrx=$erl_xcomp_linux_usable_sigusrx;;
+ *) AC_MSG_ERROR([Bad erl_xcomp_linux_usable_sigusrx value: $erl_xcomp_linux_usable_sigusrx]);;
+ esac
+ case X$erl_xcomp_linux_usable_sigaltstack in
+ X) usable_sigaltstack=cross;;
+ Xyes|Xno) usable_sigaltstack=$erl_xcomp_linux_usable_sigaltstack;;
+ *) AC_MSG_ERROR([Bad erl_xcomp_linux_usable_sigaltstack value: $erl_xcomp_linux_usable_sigaltstack]);;
+ esac
+ else
+ # FIXME: Test for actual problems instead of kernel versions
+ linux_kernel_vsn_=`uname -r`
+ case $linux_kernel_vsn_ in
+ [[0-1]].*|2.[[0-1]]|2.[[0-1]].*)
+ usable_sigusrx=no
+ usable_sigaltstack=no;;
+ 2.[[2-3]]|2.[[2-3]].*)
+ usable_sigusrx=yes
+ usable_sigaltstack=no;;
+ *)
+ usable_sigusrx=yes
+ usable_sigaltstack=yes;;
+ esac
+ fi
+
+ AC_MSG_CHECKING(if SIGUSR1 and SIGUSR2 can be used)
+ AC_MSG_RESULT($usable_sigusrx)
+ if test $usable_sigusrx = cross; then
+ usable_sigusrx=yes
+ AC_MSG_WARN([result yes guessed because of cross compilation])
+ fi
+ if test $usable_sigusrx = no; then
+ ETHR_DEFS="$ETHR_DEFS -DETHR_UNUSABLE_SIGUSRX"
+ fi
+
+ AC_MSG_CHECKING(if sigaltstack can be used)
+ AC_MSG_RESULT($usable_sigaltstack)
+ if test $usable_sigaltstack = cross; then
+ usable_sigaltstack=yes
+ AC_MSG_WARN([result yes guessed because of cross compilation])
+ fi
+ if test $usable_sigaltstack = no; then
+ ETHR_DEFS="$ETHR_DEFS -DETHR_UNUSABLE_SIGALTSTACK"
+ fi
+ ;;
+ *) ;;
+ esac
+
+ dnl We sometimes need ETHR_DEFS in order to find certain headers
+ dnl (at least for pthread.h on osf1).
+ saved_cppflags="$CPPFLAGS"
+ CPPFLAGS="$CPPFLAGS $ETHR_DEFS"
+
+ dnl We need the thread library in order to find some functions
+ saved_libs="$LIBS"
+ LIBS="$LIBS $ETHR_X_LIBS"
+
+ dnl
+ dnl Check for headers
+ dnl
+
+ AC_CHECK_HEADER(pthread.h, \
+ AC_DEFINE(ETHR_HAVE_PTHREAD_H, 1, \
+[Define if you have the <pthread.h> header file.]))
+
+ dnl Some Linuxes have <pthread/mit/pthread.h> instead of <pthread.h>
+ AC_CHECK_HEADER(pthread/mit/pthread.h, \
+ AC_DEFINE(ETHR_HAVE_MIT_PTHREAD_H, 1, \
+[Define if the pthread.h header file is in pthread/mit directory.]))
+
+ if test $NEED_NPTL_PTHREAD_H = yes; then
+ AC_DEFINE(ETHR_NEED_NPTL_PTHREAD_H, 1, \
+[Define if you need the <nptl/pthread.h> header file.])
+ fi
+
+ AC_CHECK_HEADER(sched.h, \
+ AC_DEFINE(ETHR_HAVE_SCHED_H, 1, \
+[Define if you have the <sched.h> header file.]))
+
+ AC_CHECK_HEADER(sys/time.h, \
+ AC_DEFINE(ETHR_HAVE_SYS_TIME_H, 1, \
+[Define if you have the <sys/time.h> header file.]))
+
+ AC_TRY_COMPILE([#include <time.h>
+ #include <sys/time.h>],
+ [struct timeval *tv; return 0;],
+ AC_DEFINE(ETHR_TIME_WITH_SYS_TIME, 1, \
+[Define if you can safely include both <sys/time.h> and <time.h>.]))
+
+
+ dnl
+ dnl Check for functions
+ dnl
+
+ AC_CHECK_FUNC(pthread_spin_lock, \
+ [ethr_have_native_spinlock=yes \
+ AC_DEFINE(ETHR_HAVE_PTHREAD_SPIN_LOCK, 1, \
+[Define if you have the pthread_spin_lock function.])])
+
+ have_sched_yield=no
+ have_librt_sched_yield=no
+ AC_CHECK_FUNC(sched_yield, [have_sched_yield=yes])
+ if test $have_sched_yield = no; then
+ AC_CHECK_LIB(rt, sched_yield,
+ [have_librt_sched_yield=yes
+ ETHR_X_LIBS="$ETHR_X_LIBS -lrt"])
+ fi
+ if test $have_sched_yield = yes || test $have_librt_sched_yield = yes; then
+ AC_DEFINE(ETHR_HAVE_SCHED_YIELD, 1, [Define if you have the sched_yield() function.])
+ AC_MSG_CHECKING([whether sched_yield() returns an int])
+ sched_yield_ret_int=no
+ AC_TRY_COMPILE([
+ #ifdef ETHR_HAVE_SCHED_H
+ #include <sched.h>
+ #endif
+ ],
+ [int sched_yield();],
+ [sched_yield_ret_int=yes])
+ AC_MSG_RESULT([$sched_yield_ret_int])
+ if test $sched_yield_ret_int = yes; then
+ AC_DEFINE(ETHR_SCHED_YIELD_RET_INT, 1, [Define if sched_yield() returns an int.])
+ fi
+ fi
+
+ have_pthread_yield=no
+ AC_CHECK_FUNC(pthread_yield, [have_pthread_yield=yes])
+ if test $have_pthread_yield = yes; then
+ AC_DEFINE(ETHR_HAVE_PTHREAD_YIELD, 1, [Define if you have the pthread_yield() function.])
+ AC_MSG_CHECKING([whether pthread_yield() returns an int])
+ pthread_yield_ret_int=no
+ AC_TRY_COMPILE([
+ #if defined(ETHR_NEED_NPTL_PTHREAD_H)
+ #include <nptl/pthread.h>
+ #elif defined(ETHR_HAVE_MIT_PTHREAD_H)
+ #include <pthread/mit/pthread.h>
+ #elif defined(ETHR_HAVE_PTHREAD_H)
+ #include <pthread.h>
+ #endif
+ ],
+ [int pthread_yield();],
+ [pthread_yield_ret_int=yes])
+ AC_MSG_RESULT([$pthread_yield_ret_int])
+ if test $pthread_yield_ret_int = yes; then
+ AC_DEFINE(ETHR_PTHREAD_YIELD_RET_INT, 1, [Define if pthread_yield() returns an int.])
+ fi
+ fi
+
+ have_pthread_rwlock_init=no
+ AC_CHECK_FUNC(pthread_rwlock_init, [have_pthread_rwlock_init=yes])
+ if test $have_pthread_rwlock_init = yes; then
+
+ ethr_have_pthread_rwlockattr_setkind_np=no
+ AC_CHECK_FUNC(pthread_rwlockattr_setkind_np,
+ [ethr_have_pthread_rwlockattr_setkind_np=yes])
+
+ if test $ethr_have_pthread_rwlockattr_setkind_np = yes; then
+ AC_DEFINE(ETHR_HAVE_PTHREAD_RWLOCKATTR_SETKIND_NP, 1, \
+[Define if you have the pthread_rwlockattr_setkind_np() function.])
+
+ AC_MSG_CHECKING([for PTHREAD_RWLOCK_PREFER_WRITER_NONRECURSIVE_NP])
+ ethr_pthread_rwlock_writer_nonrecursive_initializer_np=no
+ AC_TRY_LINK([
+ #if defined(ETHR_NEED_NPTL_PTHREAD_H)
+ #include <nptl/pthread.h>
+ #elif defined(ETHR_HAVE_MIT_PTHREAD_H)
+ #include <pthread/mit/pthread.h>
+ #elif defined(ETHR_HAVE_PTHREAD_H)
+ #include <pthread.h>
+ #endif
+ ],
+ [
+ pthread_rwlockattr_t *attr;
+ return pthread_rwlockattr_setkind_np(attr,
+ PTHREAD_RWLOCK_PREFER_WRITER_NONRECURSIVE_NP);
+ ],
+ [ethr_pthread_rwlock_writer_nonrecursive_initializer_np=yes])
+ AC_MSG_RESULT([$ethr_pthread_rwlock_writer_nonrecursive_initializer_np])
+ if test $ethr_pthread_rwlock_writer_nonrecursive_initializer_np = yes; then
+ AC_DEFINE(ETHR_HAVE_PTHREAD_RWLOCK_PREFER_WRITER_NONRECURSIVE_NP, 1, \
+[Define if you have the PTHREAD_RWLOCK_PREFER_WRITER_NONRECURSIVE_NP rwlock attribute.])
+ fi
+ fi
+ fi
+
+ if test "$force_pthread_rwlocks" = "yes"; then
+
+ AC_DEFINE(ETHR_FORCE_PTHREAD_RWLOCK, 1, \
+[Define if you want to force usage of pthread rwlocks])
+
+ if test $have_pthread_rwlock_init = yes; then
+ AC_MSG_WARN([Forced usage of pthread rwlocks. Note that this implementation may suffer from starvation issues.])
+ else
+ AC_MSG_ERROR([User forced usage of pthread rwlock, but no such implementation was found])
+ fi
+ fi
+
+ AC_CHECK_FUNC(pthread_attr_setguardsize, \
+ AC_DEFINE(ETHR_HAVE_PTHREAD_ATTR_SETGUARDSIZE, 1, \
+[Define if you have the pthread_attr_setguardsize function.]))
+
+ linux_futex=no
+ AC_MSG_CHECKING([for Linux futexes])
+ AC_TRY_LINK([
+ #include <sys/syscall.h>
+ #include <unistd.h>
+ #include <linux/futex.h>
+ #include <sys/time.h>
+ ],
+ [
+ int i = 1;
+ syscall(__NR_futex, (void *) &i, FUTEX_WAKE, 1,
+ (void*)0,(void*)0, 0);
+ syscall(__NR_futex, (void *) &i, FUTEX_WAIT, 0,
+ (void*)0,(void*)0, 0);
+ return 0;
+ ],
+ linux_futex=yes)
+ AC_MSG_RESULT([$linux_futex])
+ test $linux_futex = yes && AC_DEFINE(ETHR_HAVE_LINUX_FUTEX, 1, [Define if you have a linux futex implementation.])
+
+ AC_CHECK_SIZEOF(int)
+ AC_CHECK_SIZEOF(long)
+ AC_CHECK_SIZEOF(long long)
+ AC_CHECK_SIZEOF(__int128_t)
+
+ if test "$ac_cv_sizeof_int" = "4"; then
+ int32="int"
+ elif test "$ac_cv_sizeof_long" = "4"; then
+ int32="long"
+ elif test "$ac_cv_sizeof_long_long" = "4"; then
+ int32="long long"
+ else
+ AC_MSG_ERROR([No 32-bit type found])
+ fi
+
+ if test "$ac_cv_sizeof_int" = "8"; then
+ int64="int"
+ elif test "$ac_cv_sizeof_long" = "8"; then
+ int64="long"
+ elif test "$ac_cv_sizeof_long_long" = "8"; then
+ int64="long long"
+ else
+ AC_MSG_ERROR([No 64-bit type found])
+ fi
+
+ int128=no
+ if test "$ac_cv_sizeof___int128_t" = "16"; then
+ int128="__int128_t"
+ fi
+
+ ETHR_CHK_SYNC_OP([__sync_val_compare_and_swap], [3], [32], [$int32], AC_DEFINE(ETHR_HAVE___SYNC_VAL_COMPARE_AND_SWAP32, 1, [Define if you have __sync_val_compare_and_swap() for 32-bit integers]))
+ test "$have_sync_op" = "yes" && ethr_have_native_atomics=yes
+ ETHR_CHK_SYNC_OP([__sync_add_and_fetch], [2], [32], [$int32], AC_DEFINE(ETHR_HAVE___SYNC_ADD_AND_FETCH32, 1, [Define if you have __sync_add_and_fetch() for 32-bit integers]))
+ ETHR_CHK_SYNC_OP([__sync_fetch_and_and], [2], [32], [$int32], AC_DEFINE(ETHR_HAVE___SYNC_FETCH_AND_AND32, 1, [Define if you have __sync_fetch_and_and() for 32-bit integers]))
+ ETHR_CHK_SYNC_OP([__sync_fetch_and_or], [2], [32], [$int32], AC_DEFINE(ETHR_HAVE___SYNC_FETCH_AND_OR32, 1, [Define if you have __sync_fetch_and_or() for 32-bit integers]))
+
+ ETHR_CHK_SYNC_OP([__sync_val_compare_and_swap], [3], [64], [$int64], AC_DEFINE(ETHR_HAVE___SYNC_VAL_COMPARE_AND_SWAP64, 1, [Define if you have __sync_val_compare_and_swap() for 64-bit integers]))
+ test "$have_sync_op" = "yes" && ethr_have_native_atomics=yes
+ ETHR_CHK_SYNC_OP([__sync_add_and_fetch], [2], [64], [$int64], AC_DEFINE(ETHR_HAVE___SYNC_ADD_AND_FETCH64, 1, [Define if you have __sync_add_and_fetch() for 64-bit integers]))
+ ETHR_CHK_SYNC_OP([__sync_fetch_and_and], [2], [64], [$int64], AC_DEFINE(ETHR_HAVE___SYNC_FETCH_AND_AND64, 1, [Define if you have __sync_fetch_and_and() for 64-bit integers]))
+ ETHR_CHK_SYNC_OP([__sync_fetch_and_or], [2], [64], [$int64], AC_DEFINE(ETHR_HAVE___SYNC_FETCH_AND_OR64, 1, [Define if you have __sync_fetch_and_or() for 64-bit integers]))
+
+ if test $int128 != no; then
+ ETHR_CHK_SYNC_OP([__sync_val_compare_and_swap], [3], [128], [$int128], AC_DEFINE(ETHR_HAVE___SYNC_VAL_COMPARE_AND_SWAP128, 1, [Define if you have __sync_val_compare_and_swap() for 128-bit integers]))
+ fi
+
+ AC_MSG_CHECKING([for a usable libatomic_ops implementation])
+ case "x$with_libatomic_ops" in
+ xno | xyes | x)
+ libatomic_ops_include=
+ ;;
+ *)
+ if test -d "${with_libatomic_ops}/include"; then
+ libatomic_ops_include="-I$with_libatomic_ops/include"
+ CPPFLAGS="$CPPFLAGS $libatomic_ops_include"
+ else
+ AC_MSG_ERROR([libatomic_ops include directory $with_libatomic_ops/include not found])
+ fi;;
+ esac
+ ethr_have_libatomic_ops=no
+ AC_TRY_LINK([#include "atomic_ops.h"],
+ [
+ volatile AO_t x;
+ AO_t y;
+ int z;
+
+ AO_nop_full();
+ AO_store(&x, (AO_t) 0);
+ z = AO_load(&x);
+ z = AO_compare_and_swap_full(&x, (AO_t) 0, (AO_t) 1);
+ ],
+ [ethr_have_native_atomics=yes
+ ethr_have_libatomic_ops=yes])
+ AC_MSG_RESULT([$ethr_have_libatomic_ops])
+ if test $ethr_have_libatomic_ops = yes; then
+ AC_CHECK_SIZEOF(AO_t, ,
+ [
+ #include <stdio.h>
+ #include "atomic_ops.h"
+ ])
+ AC_DEFINE_UNQUOTED(ETHR_SIZEOF_AO_T, $ac_cv_sizeof_AO_t, [Define to the size of AO_t if libatomic_ops is used])
+
+ AC_DEFINE(ETHR_HAVE_LIBATOMIC_OPS, 1, [Define if you have libatomic_ops atomic operations])
+ if test "x$with_libatomic_ops" != "xno" && test "x$with_libatomic_ops" != "x"; then
+ AC_DEFINE(ETHR_PREFER_LIBATOMIC_OPS_NATIVE_IMPLS, 1, [Define if you prefer libatomic_ops native ethread implementations])
+ fi
+ ETHR_DEFS="$ETHR_DEFS $libatomic_ops_include"
+ elif test "x$with_libatomic_ops" != "xno" && test "x$with_libatomic_ops" != "x"; then
+ AC_MSG_ERROR([No usable libatomic_ops implementation found])
+ fi
+
+ case "$host_cpu" in
+ sparc | sun4u | sparc64 | sun4v)
+ case "$with_sparc_memory_order" in
+ "TSO")
+ AC_DEFINE(ETHR_SPARC_TSO, 1, [Define if only run in Sparc TSO mode]);;
+ "PSO")
+ AC_DEFINE(ETHR_SPARC_PSO, 1, [Define if only run in Sparc PSO, or TSO mode]);;
+ "RMO"|"")
+ AC_DEFINE(ETHR_SPARC_RMO, 1, [Define if run in Sparc RMO, PSO, or TSO mode]);;
+ *)
+ AC_MSG_ERROR([Unsupported Sparc memory order: $with_sparc_memory_order]);;
+ esac
+ ethr_have_native_atomics=yes;;
+ i86pc | i*86 | x86_64 | amd64)
+ if test "$enable_x86_out_of_order" = "yes"; then
+ AC_DEFINE(ETHR_X86_OUT_OF_ORDER, 1, [Define if x86/x86_64 out of order instructions should be synchronized])
+ fi
+ ethr_have_native_atomics=yes;;
+ macppc | ppc | "Power Macintosh")
+ ethr_have_native_atomics=yes;;
+ tile)
+ ethr_have_native_atomics=yes;;
+ *)
+ ;;
+ esac
+
+ test ethr_have_native_atomics = "yes" && ethr_have_native_spinlock=yes
+
+ dnl Restore LIBS
+ LIBS=$saved_libs
+ dnl restore CPPFLAGS
+ CPPFLAGS=$saved_cppflags
+
+ ;;
+ *)
+ ;;
+esac
+
+AC_MSG_CHECKING([whether default stack size should be modified])
+if test "x$ethr_modified_default_stack_size" != "x"; then
+ AC_DEFINE_UNQUOTED(ETHR_MODIFIED_DEFAULT_STACK_SIZE, $ethr_modified_default_stack_size, [Define if you want to modify the default stack size])
+ AC_MSG_RESULT([yes; to $ethr_modified_default_stack_size kilo words])
+else
+ AC_MSG_RESULT([no])
+fi
+
+if test "x$ETHR_THR_LIB_BASE" != "x"; then
+ ETHR_DEFS="-DUSE_THREADS $ETHR_DEFS"
+ ETHR_LIBS="-l$ethr_lib_name -lerts_internal_r $ETHR_X_LIBS"
+ ETHR_LIB_NAME=$ethr_lib_name
+fi
+
+AC_CHECK_SIZEOF(void *)
+AC_DEFINE_UNQUOTED(ETHR_SIZEOF_PTR, $ac_cv_sizeof_void_p, [Define to the size of pointers])
+
+AC_CHECK_SIZEOF(int)
+AC_DEFINE_UNQUOTED(ETHR_SIZEOF_INT, $ac_cv_sizeof_int, [Define to the size of int])
+AC_CHECK_SIZEOF(long)
+AC_DEFINE_UNQUOTED(ETHR_SIZEOF_LONG, $ac_cv_sizeof_long, [Define to the size of long])
+AC_CHECK_SIZEOF(long long)
+AC_DEFINE_UNQUOTED(ETHR_SIZEOF_LONG_LONG, $ac_cv_sizeof_long_long, [Define to the size of long long])
+AC_CHECK_SIZEOF(__int64)
+AC_DEFINE_UNQUOTED(ETHR_SIZEOF___INT64, $ac_cv_sizeof___int64, [Define to the size of __int64])
+AC_CHECK_SIZEOF(__int128_t)
+AC_DEFINE_UNQUOTED(ETHR_SIZEOF___INT128_T, $ac_cv_sizeof___int128_t, [Define to the size of __int128_t])
+
+
+case X$erl_xcomp_bigendian in
+ X) ;;
+ Xyes|Xno) ac_cv_c_bigendian=$erl_xcomp_bigendian;;
+ *) AC_MSG_ERROR([Bad erl_xcomp_bigendian value: $erl_xcomp_bigendian]);;
+esac
+
+AC_C_BIGENDIAN
+
+if test "$ac_cv_c_bigendian" = "yes"; then
+ AC_DEFINE(ETHR_BIGENDIAN, 1, [Define if bigendian])
+fi
+
+case X$erl_xcomp_double_middle_endian in
+ X) ;;
+ Xyes|Xno|Xunknown) ac_cv_c_double_middle_endian=$erl_xcomp_double_middle_endian;;
+ *) AC_MSG_ERROR([Bad erl_xcomp_double_middle_endian value: $erl_xcomp_double_middle_endian]);;
+esac
+
+AC_C_DOUBLE_MIDDLE_ENDIAN
+
+AC_ARG_ENABLE(native-ethr-impls,
+ AS_HELP_STRING([--disable-native-ethr-impls],
+ [disable native ethread implementations]),
+[ case "$enableval" in
+ no) disable_native_ethr_impls=yes ;;
+ *) disable_native_ethr_impls=no ;;
+ esac ], disable_native_ethr_impls=no)
+
+AC_ARG_ENABLE(x86-out-of-order,
+ AS_HELP_STRING([--enable-x86-out-of-order],
+ [enable x86/x84_64 out of order support (default disabled)]))
+
+test "X$disable_native_ethr_impls" = "Xyes" &&
+ AC_DEFINE(ETHR_DISABLE_NATIVE_IMPLS, 1, [Define if you want to disable native ethread implementations])
+
+AC_ARG_ENABLE(prefer-gcc-native-ethr-impls,
+ AS_HELP_STRING([--enable-prefer-gcc-native-ethr-impls],
+ [prefer gcc native ethread implementations]),
+[ case "$enableval" in
+ yes) enable_prefer_gcc_native_ethr_impls=yes ;;
+ *) enable_prefer_gcc_native_ethr_impls=no ;;
+ esac ], enable_prefer_gcc_native_ethr_impls=no)
+
+test $enable_prefer_gcc_native_ethr_impls = yes &&
+ AC_DEFINE(ETHR_PREFER_GCC_NATIVE_IMPLS, 1, [Define if you prefer gcc native ethread implementations])
+
+AC_ARG_WITH(libatomic_ops,
+ AS_HELP_STRING([--with-libatomic_ops=PATH],
+ [specify and prefer usage of libatomic_ops in the ethread library]))
+
+AC_ARG_WITH(with_sparc_memory_order,
+ AS_HELP_STRING([--with-sparc-memory-order=TSO|PSO|RMO],
+ [specify sparc memory order (defaults to RMO)]))
+
+ETHR_X86_SSE2_ASM=no
+case "$GCC-$ac_cv_sizeof_void_p-$host_cpu" in
+ yes-4-i86pc | yes-4-i*86 | yes-4-x86_64 | yes-4-amd64)
+ AC_MSG_CHECKING([for gcc sse2 asm support])
+ save_CFLAGS="$CFLAGS"
+ CFLAGS="$CFLAGS -msse2"
+ gcc_sse2_asm=no
+ AC_TRY_COMPILE([],
+ [
+ long long x, *y;
+ __asm__ __volatile__("movq %1, %0\n\t" : "=x"(x) : "m"(*y) : "memory");
+ ],
+ [gcc_sse2_asm=yes])
+ CFLAGS="$save_CFLAGS"
+ AC_MSG_RESULT([$gcc_sse2_asm])
+ if test "$gcc_sse2_asm" = "yes"; then
+ AC_DEFINE(ETHR_GCC_HAVE_SSE2_ASM_SUPPORT, 1, [Define if you use a gcc that supports -msse2 and understand sse2 specific asm statements])
+ ETHR_X86_SSE2_ASM=yes
+ fi
+ ;;
+ *)
+ ;;
+esac
+
+case "$GCC-$host_cpu" in
+ yes-i86pc | yes-i*86 | yes-x86_64 | yes-amd64)
+ gcc_dw_cmpxchg_asm=no
+ AC_MSG_CHECKING([for gcc double word cmpxchg asm support])
+ AC_TRY_COMPILE([],
+ [
+ char xchgd;
+ long new[2], xchg[2], *p;
+ __asm__ __volatile__(
+#if ETHR_SIZEOF_PTR == 4 && defined(__PIC__) && __PIC__
+ "pushl %%ebx\n\t"
+ "movl %8, %%ebx\n\t"
+#endif
+#if ETHR_SIZEOF_PTR == 4
+ "lock; cmpxchg8b %0\n\t"
+#else
+ "lock; cmpxchg16b %0\n\t"
+#endif
+ "setz %3\n\t"
+#if ETHR_SIZEOF_PTR == 4 && defined(__PIC__) && __PIC__
+ "popl %%ebx\n\t"
+#endif
+ : "=m"(*p), "=d"(xchg[1]), "=a"(xchg[0]), "=c"(xchgd)
+ : "m"(*p), "1"(xchg[1]), "2"(xchg[0]), "3"(new[1]),
+#if ETHR_SIZEOF_PTR == 4 && defined(__PIC__) && __PIC__
+ "r"(new[0])
+#else
+ "b"(new[0])
+#endif
+ : "cc", "memory");
+
+ ],
+ [gcc_dw_cmpxchg_asm=yes])
+ if test $gcc_dw_cmpxchg_asm = no && test $ac_cv_sizeof_void_p = 4; then
+ AC_TRY_COMPILE([],
+ [
+ char xchgd;
+ long new[2], xchg[2], *p;
+#if !defined(__PIC__) || !__PIC__
+# error nope
+#endif
+ __asm__ __volatile__(
+ "pushl %%ebx\n\t"
+ "movl (%7), %%ebx\n\t"
+ "movl 4(%7), %%ecx\n\t"
+ "lock; cmpxchg8b %0\n\t"
+ "setz %3\n\t"
+ "popl %%ebx\n\t"
+ : "=m"(*p), "=d"(xchg[1]), "=a"(xchg[0]), "=c"(xchgd)
+ : "m"(*p), "1"(xchg[1]), "2"(xchg[0]), "3"(new)
+ : "cc", "memory");
+
+ ],
+ [gcc_dw_cmpxchg_asm=yes])
+ if test "$gcc_dw_cmpxchg_asm" = "yes"; then
+ AC_DEFINE(ETHR_CMPXCHG8B_REGISTER_SHORTAGE, 1, [Define if you get a register shortage with cmpxchg8b and position independent code])
+ fi
+ fi
+ AC_MSG_RESULT([$gcc_dw_cmpxchg_asm])
+ if test "$gcc_dw_cmpxchg_asm" = "yes"; then
+ AC_DEFINE(ETHR_GCC_HAVE_DW_CMPXCHG_ASM_SUPPORT, 1, [Define if you use a gcc that supports the double word cmpxchg instruction])
+ fi;;
+ *)
+ ;;
+esac
+
+AC_DEFINE(ETHR_HAVE_ETHREAD_DEFINES, 1, \
+[Define if you have all ethread defines])
+
+AC_SUBST(ETHR_X_LIBS)
+AC_SUBST(ETHR_LIBS)
+AC_SUBST(ETHR_LIB_NAME)
+AC_SUBST(ETHR_DEFS)
+AC_SUBST(ETHR_THR_LIB_BASE)
+AC_SUBST(ETHR_THR_LIB_BASE_DIR)
+AC_SUBST(ETHR_X86_SSE2_ASM)
+
+])
+
+
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl ERL_TIME_CORRECTION
+dnl
+dnl In the presence of a high resolution realtime timer Erlang can adapt
+dnl its view of time relative to this timer. On solaris such a timer is
+dnl available with the syscall gethrtime(). On other OS's a fallback
+dnl solution using times() is implemented. (However on e.g. FreeBSD times()
+dnl is implemented using gettimeofday so it doesn't make much sense to
+dnl use it there...) On second thought, it seems to be safer to do it the
+dnl other way around. I.e. only use times() on OS's where we know it will
+dnl work...
+dnl
+
+AC_DEFUN(ERL_TIME_CORRECTION,
+[if test x$ac_cv_func_gethrtime = x; then
+ AC_CHECK_FUNC(gethrtime)
+fi
+if test x$clock_gettime_correction = xunknown; then
+ AC_TRY_COMPILE([#include <time.h>],
+ [struct timespec ts;
+ long long result;
+ clock_gettime(CLOCK_MONOTONIC,&ts);
+ result = ((long long) ts.tv_sec) * 1000000000LL +
+ ((long long) ts.tv_nsec);],
+ clock_gettime_compiles=yes,
+ clock_gettime_compiles=no)
+else
+ clock_gettime_compiles=no
+fi
+
+
+AC_CACHE_CHECK([how to correct for time adjustments], erl_cv_time_correction,
+[
+case $clock_gettime_correction in
+ yes)
+ erl_cv_time_correction=clock_gettime;;
+ no|unknown)
+ case $ac_cv_func_gethrtime in
+ yes)
+ erl_cv_time_correction=hrtime ;;
+ no)
+ case $host_os in
+ linux*)
+ case $clock_gettime_correction in
+ unknown)
+ if test x$clock_gettime_compiles = xyes; then
+ if test X$cross_compiling != Xyes; then
+ linux_kernel_vsn_=`uname -r`
+ case $linux_kernel_vsn_ in
+ [[0-1]].*|2.[[0-5]]|2.[[0-5]].*)
+ erl_cv_time_correction=times ;;
+ *)
+ erl_cv_time_correction=clock_gettime;;
+ esac
+ else
+ case X$erl_xcomp_linux_clock_gettime_correction in
+ X)
+ erl_cv_time_correction=cross;;
+ Xyes|Xno)
+ if test $erl_xcomp_linux_clock_gettime_correction = yes; then
+ erl_cv_time_correction=clock_gettime
+ else
+ erl_cv_time_correction=times
+ fi;;
+ *)
+ AC_MSG_ERROR([Bad erl_xcomp_linux_clock_gettime_correction value: $erl_xcomp_linux_clock_gettime_correction]);;
+ esac
+ fi
+ else
+ erl_cv_time_correction=times
+ fi
+ ;;
+ *)
+ erl_cv_time_correction=times ;;
+ esac
+ ;;
+ *)
+ erl_cv_time_correction=none ;;
+ esac
+ ;;
+ esac
+ ;;
+esac
+])
+
+xrtlib=""
+case $erl_cv_time_correction in
+ times)
+ AC_DEFINE(CORRECT_USING_TIMES,[],
+ [Define if you do not have a high-res. timer & want to use times() instead])
+ ;;
+ clock_gettime|cross)
+ if test $erl_cv_time_correction = cross; then
+ erl_cv_time_correction=clock_gettime
+ AC_MSG_WARN([result clock_gettime guessed because of cross compilation])
+ fi
+ xrtlib="-lrt"
+ AC_DEFINE(GETHRTIME_WITH_CLOCK_GETTIME,[1],
+ [Define if you want to use clock_gettime to simulate gethrtime])
+ ;;
+esac
+dnl
+dnl Check if gethrvtime is working, and if to use procfs ioctl
+dnl or (yet to be written) write to the procfs ctl file.
+dnl
+
+AC_MSG_CHECKING([if gethrvtime works and how to use it])
+AC_TRY_RUN([
+/* gethrvtime procfs ioctl test */
+/* These need to be undef:ed to not break activation of
+ * micro level process accounting on /proc/self
+ */
+#ifdef _LARGEFILE_SOURCE
+# undef _LARGEFILE_SOURCE
+#endif
+#ifdef _FILE_OFFSET_BITS
+# undef _FILE_OFFSET_BITS
+#endif
+#include <stdlib.h>
+#include <unistd.h>
+#include <string.h>
+#include <stdio.h>
+#include <sys/time.h>
+#include <sys/types.h>
+#include <sys/stat.h>
+#include <sys/signal.h>
+#include <sys/fault.h>
+#include <sys/syscall.h>
+#include <sys/procfs.h>
+#include <fcntl.h>
+
+int main() {
+ long msacct = PR_MSACCT;
+ int fd;
+ long long start, stop;
+ int i;
+ pid_t pid = getpid();
+ char proc_self[30] = "/proc/";
+
+ sprintf(proc_self+strlen(proc_self), "%lu", (unsigned long) pid);
+ if ( (fd = open(proc_self, O_WRONLY)) == -1)
+ exit(1);
+ if (ioctl(fd, PIOCSET, &msacct) < 0)
+ exit(2);
+ if (close(fd) < 0)
+ exit(3);
+ start = gethrvtime();
+ for (i = 0; i < 100; i++)
+ stop = gethrvtime();
+ if (start == 0)
+ exit(4);
+ if (start == stop)
+ exit(5);
+ exit(0); return 0;
+}
+],
+erl_gethrvtime=procfs_ioctl,
+erl_gethrvtime=false,
+[
+case X$erl_xcomp_gethrvtime_procfs_ioctl in
+ X)
+ erl_gethrvtime=cross;;
+ Xyes|Xno)
+ if test $erl_xcomp_gethrvtime_procfs_ioctl = yes; then
+ erl_gethrvtime=procfs_ioctl
+ else
+ erl_gethrvtime=false
+ fi;;
+ *)
+ AC_MSG_ERROR([Bad erl_xcomp_gethrvtime_procfs_ioctl value: $erl_xcomp_gethrvtime_procfs_ioctl]);;
+esac
+])
+
+case $erl_gethrvtime in
+ procfs_ioctl)
+ AC_DEFINE(HAVE_GETHRVTIME_PROCFS_IOCTL,[1],
+ [define if gethrvtime() works and uses ioctl() to /proc/self])
+ AC_MSG_RESULT(uses ioctl to procfs)
+ ;;
+ *)
+ if test $erl_gethrvtime = cross; then
+ erl_gethrvtime=false
+ AC_MSG_RESULT(cross)
+ AC_MSG_WARN([result 'not working' guessed because of cross compilation])
+ else
+ AC_MSG_RESULT(not working)
+ fi
+
+ dnl
+ dnl Check if clock_gettime (linux) is working
+ dnl
+
+ AC_MSG_CHECKING([if clock_gettime can be used to get process CPU time])
+ save_libs=$LIBS
+ LIBS="-lrt"
+ AC_TRY_RUN([
+ #include <stdlib.h>
+ #include <unistd.h>
+ #include <string.h>
+ #include <stdio.h>
+ #include <time.h>
+ int main() {
+ long long start, stop;
+ int i;
+ struct timespec tp;
+
+ if (clock_gettime(CLOCK_PROCESS_CPUTIME_ID, &tp) < 0)
+ exit(1);
+ start = ((long long)tp.tv_sec * 1000000000LL) + (long long)tp.tv_nsec;
+ for (i = 0; i < 100; i++)
+ clock_gettime(CLOCK_PROCESS_CPUTIME_ID, &tp);
+ stop = ((long long)tp.tv_sec * 1000000000LL) + (long long)tp.tv_nsec;
+ if (start == 0)
+ exit(4);
+ if (start == stop)
+ exit(5);
+ exit(0); return 0;
+ }
+ ],
+ erl_clock_gettime=yes,
+ erl_clock_gettime=no,
+ [
+ case X$erl_xcomp_clock_gettime_cpu_time in
+ X) erl_clock_gettime=cross;;
+ Xyes|Xno) erl_clock_gettime=$erl_xcomp_clock_gettime_cpu_time;;
+ *) AC_MSG_ERROR([Bad erl_xcomp_clock_gettime_cpu_time value: $erl_xcomp_clock_gettime_cpu_time]);;
+ esac
+ ])
+ LIBS=$save_libs
+ case $host_os in
+ linux*)
+ AC_MSG_RESULT([no; not stable])
+ LIBRT=$xrtlib
+ ;;
+ *)
+ AC_MSG_RESULT($erl_clock_gettime)
+ case $erl_clock_gettime in
+ yes)
+ AC_DEFINE(HAVE_CLOCK_GETTIME,[],
+ [define if clock_gettime() works for getting process time])
+ LIBRT=-lrt
+ ;;
+ cross)
+ erl_clock_gettime=no
+ AC_MSG_WARN([result no guessed because of cross compilation])
+ LIBRT=$xrtlib
+ ;;
+ *)
+ LIBRT=$xrtlib
+ ;;
+ esac
+ ;;
+ esac
+ AC_SUBST(LIBRT)
+ ;;
+esac
+])dnl
+
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_TRY_ENABLE_CFLAG
+dnl
+dnl
+dnl Tries a CFLAG and sees if it can be enabled without compiler errors
+dnl $1: textual cflag to add
+dnl $2: variable to store the modified CFLAG in
+dnl Usage example LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+dnl
+dnl
+AC_DEFUN([LM_TRY_ENABLE_CFLAG], [
+ AC_MSG_CHECKING([if we can add $1 to CFLAGS])
+ saved_CFLAGS=$CFLAGS;
+ CFLAGS="$1 $CFLAGS";
+ AC_TRY_COMPILE([],[return 0;],can_enable_flag=true,can_enable_flag=false)
+ CFLAGS=$saved_CFLAGS;
+ if test "X$can_enable_flag" = "Xtrue"; then
+ AC_MSG_RESULT([yes])
+ AS_VAR_SET($2, "$1 $CFLAGS")
+ else
+ AC_MSG_RESULT([no])
+ AS_VAR_SET($2, "$CFLAGS")
+ fi
+])
+
+dnl ERL_TRY_LINK_JAVA(CLASSES, FUNCTION-BODY
+dnl [ACTION_IF_FOUND [, ACTION-IF-NOT-FOUND]])
+dnl Freely inspired by AC_TRY_LINK. (Maybe better to create a
+dnl AC_LANG_JAVA instead...)
+AC_DEFUN(ERL_TRY_LINK_JAVA,
+[java_link='$JAVAC conftest.java 1>&AC_FD_CC'
+changequote(, )dnl
+cat > conftest.java <<EOF
+$1
+class conftest { public static void main(String[] args) {
+ $2
+ ; return; }}
+EOF
+changequote([, ])dnl
+if AC_TRY_EVAL(java_link) && test -s conftest.class; then
+ ifelse([$3], , :, [rm -rf conftest*
+ $3])
+else
+ echo "configure: failed program was:" 1>&AC_FD_CC
+ cat conftest.java 1>&AC_FD_CC
+ echo "configure: PATH was $PATH" 1>&AC_FD_CC
+ifelse([$4], , , [ rm -rf conftest*
+ $4
+])dnl
+fi
+rm -f conftest*])
+#define UNSAFE_MASK 0xc0000000 /* Mask for bits that must be constant */
+
+
diff --git a/lib/megaco/configure.in b/lib/megaco/configure.in
index 722ccc3fb4..9c3858f562 100644
--- a/lib/megaco/configure.in
+++ b/lib/megaco/configure.in
@@ -273,6 +273,11 @@ if test "$PERL" = no_perl; then
AC_MSG_ERROR([Perl is required to build the flex scanner!])
fi
+if test "x$GCC" = xyes; then
+ # Treat certain GCC warnings as errors
+ LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+fi
+
AC_OUTPUT(examples/meas/Makefile:examples/meas/Makefile.in)
AC_OUTPUT(src/flex/$host/Makefile:src/flex/Makefile.in)
diff --git a/lib/observer/src/observer_app_wx.erl b/lib/observer/src/observer_app_wx.erl
index 380532e90c..72bafcc5e0 100644
--- a/lib/observer/src/observer_app_wx.erl
+++ b/lib/observer/src/observer_app_wx.erl
@@ -28,7 +28,7 @@
-include("observer_defs.hrl").
%% Import drawing wrappers
--import(observer_perf_wx, [haveGC/1,
+-import(observer_perf_wx, [haveGC/0,
setPen/2, setFont/3, setBrush/2,
strokeLine/5, strokeLines/2, drawRoundedRectangle/6,
drawText/4, getTextExtent/2]).
@@ -114,9 +114,10 @@ init([Notebook, Parent]) ->
_ -> ok
end,
- UseGC = haveGC(DrawingArea),
+ UseGC = haveGC(),
+ Version28 = ?wxMAJOR_VERSION =:= 2 andalso ?wxMINOR_VERSION =:= 8,
Font = case os:type() of
- {unix,_} when UseGC ->
+ {unix,_} when UseGC, Version28 ->
wxFont:new(12,?wxFONTFAMILY_DECORATIVE,?wxFONTSTYLE_NORMAL,?wxFONTWEIGHT_NORMAL);
_ ->
wxSystemSettings:getFont(?wxSYS_DEFAULT_GUI_FONT)
diff --git a/lib/observer/src/observer_perf_wx.erl b/lib/observer/src/observer_perf_wx.erl
index abf90ac612..54c98f3ba3 100644
--- a/lib/observer/src/observer_perf_wx.erl
+++ b/lib/observer/src/observer_perf_wx.erl
@@ -24,7 +24,7 @@
handle_event/2, handle_sync_event/3, handle_cast/2]).
%% Drawing wrappers for DC and GC areas
--export([haveGC/1,
+-export([haveGC/0,
setPen/2, setFont/3, setBrush/2,
strokeLine/5, strokeLines/2, drawRoundedRectangle/6,
drawText/4, getTextExtent/2]).
@@ -90,11 +90,12 @@ init([Notebook, Parent]) ->
_ -> ok
end,
- UseGC = haveGC(Panel),
+ UseGC = haveGC(),
+ Version28 = ?wxMAJOR_VERSION =:= 2 andalso ?wxMINOR_VERSION =:= 8,
{Font, SmallFont}
= case os:type() of
- {unix, _} when UseGC ->
- %% Def font is really small when using Graphics contexts for some reason
+ {unix, _} when UseGC, Version28 ->
+ %% Def font is really small when using Graphics contexts in 2.8
%% Hardcode it
F = wxFont:new(12,?wxFONTFAMILY_DECORATIVE,?wxFONTSTYLE_NORMAL,?wxFONTWEIGHT_BOLD),
SF = wxFont:new(10, ?wxFONTFAMILY_DECORATIVE, ?wxFONTSTYLE_NORMAL, ?wxFONTWEIGHT_NORMAL),
@@ -524,10 +525,9 @@ colors() ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% wxDC and ?wxGC wrappers
-haveGC(Win) ->
+haveGC() ->
try
- GC = ?wxGC:create(Win),
- ?wxGC:destroy(GC),
+ wxGraphicsRenderer:getDefaultRenderer(),
true
catch _:_ -> false
end.
diff --git a/lib/observer/src/observer_pro_wx.erl b/lib/observer/src/observer_pro_wx.erl
index ee67664539..9aaf648ea2 100644
--- a/lib/observer/src/observer_pro_wx.erl
+++ b/lib/observer/src/observer_pro_wx.erl
@@ -225,7 +225,7 @@ handle_info({holder_updated, Count}, State0=#state{grid=Grid}) ->
State = update_selection(State0),
wxListCtrl:setItemCount(Grid, Count),
- wxListCtrl:refreshItems(Grid, 0, Count-1),
+ Count > 0 andalso wxListCtrl:refreshItems(Grid, 0, Count-1),
{noreply, State};
diff --git a/lib/observer/src/observer_tv_table.erl b/lib/observer/src/observer_tv_table.erl
index c41f0f006a..5d1ab2e946 100644
--- a/lib/observer/src/observer_tv_table.erl
+++ b/lib/observer/src/observer_tv_table.erl
@@ -403,7 +403,7 @@ handle_info({new_cols, New}, State = #state{grid=Grid, columns=Cols0}) ->
{noreply, State#state{columns=Cols}};
handle_info({refresh, Min, Max}, State = #state{grid=Grid}) ->
- wxListCtrl:refreshItems(Grid, Min, Max),
+ Max > 0 andalso wxListCtrl:refreshItems(Grid, Min, Max),
{noreply, State};
handle_info(refresh_interval, State = #state{pid=Pid}) ->
diff --git a/lib/observer/src/observer_wx.erl b/lib/observer/src/observer_wx.erl
index e433bea8c2..47740581f0 100644
--- a/lib/observer/src/observer_wx.erl
+++ b/lib/observer/src/observer_wx.erl
@@ -465,41 +465,36 @@ create_connect_dialog(ping, #state{frame = Frame, prev_node=Prev}) ->
cancel
end;
create_connect_dialog(connect, #state{frame = Frame}) ->
- Dialog = wxDialog:new(Frame, ?wxID_ANY, "Distribute node "),
+ Dialog = wxDialog:new(Frame, ?wxID_ANY, "Distribute node",
+ [{style, ?wxDEFAULT_FRAME_STYLE bor ?wxRESIZE_BORDER}]),
VSizer = wxBoxSizer:new(?wxVERTICAL),
- RadioBoxSizer = wxBoxSizer:new(?wxHORIZONTAL),
Choices = ["Short name", "Long name"],
- RadioBox = wxRadioBox:new(Dialog, 1, "",
- ?wxDefaultPosition,
- ?wxDefaultSize,
- Choices,
- [{majorDim, 2},
- {style, ?wxHORIZONTAL}]),
+ RadioBox = wxRadioBox:new(Dialog, 1, "", ?wxDefaultPosition, ?wxDefaultSize,
+ Choices, [{majorDim, 2}, {style, ?wxHORIZONTAL}]),
NameText = wxStaticText:new(Dialog, ?wxID_ANY, "Node name: "),
- NameCtrl = wxTextCtrl:new(Dialog, ?wxID_ANY, [{size, {200, 25}}]),
+ NameCtrl = wxTextCtrl:new(Dialog, ?wxID_ANY, [{size, {300,-1}}]),
wxTextCtrl:setValue(NameCtrl, "observer"),
CookieText = wxStaticText:new(Dialog, ?wxID_ANY, "Secret cookie: "),
- CookieCtrl = wxTextCtrl:new(Dialog, ?wxID_ANY,
- [{size, {200, 25}}, {style, ?wxTE_PASSWORD}]),
+ CookieCtrl = wxTextCtrl:new(Dialog, ?wxID_ANY,[{style, ?wxTE_PASSWORD}]),
- BtnSizer = wxDialog:createStdDialogButtonSizer(Dialog, ?wxID_DEFAULT),
- Flags = [{flag, ?wxEXPAND bor ?wxALL}, {border, 5}],
- wxSizer:add(RadioBoxSizer, RadioBox, Flags),
-
- wxSizer:add(VSizer, RadioBoxSizer, Flags),
+ BtnSizer = wxDialog:createButtonSizer(Dialog, ?wxOK bor ?wxCANCEL),
+ Dir = ?wxLEFT bor ?wxRIGHT bor ?wxDOWN,
+ Flags = [{flag, ?wxEXPAND bor Dir bor ?wxALIGN_CENTER_VERTICAL}, {border, 5}],
+ wxSizer:add(VSizer, RadioBox, Flags),
wxSizer:addSpacer(VSizer, 10),
- wxSizer:add(VSizer, NameText),
+ wxSizer:add(VSizer, NameText, [{flag, ?wxLEFT}, {border, 5}]),
wxSizer:add(VSizer, NameCtrl, Flags),
wxSizer:addSpacer(VSizer, 10),
- wxSizer:add(VSizer, CookieText),
+ wxSizer:add(VSizer, CookieText, [{flag, ?wxLEFT}, {border, 5}]),
wxSizer:add(VSizer, CookieCtrl, Flags),
wxSizer:addSpacer(VSizer, 10),
- wxSizer:add(VSizer, BtnSizer, [{flag, ?wxALIGN_LEFT}]),
+ wxSizer:add(VSizer, BtnSizer, [{proportion, 1}, {flag, ?wxEXPAND bor ?wxALL},{border, 5}]),
- wxWindow:setSizer(Dialog, VSizer),
+ wxWindow:setSizerAndFit(Dialog, VSizer),
+ wxSizer:setSizeHints(VSizer, Dialog),
CookiePath = filename:join(os:getenv("HOME"), ".erlang.cookie"),
DefaultCookie = case filelib:is_file(CookiePath) of
true ->
@@ -548,28 +543,36 @@ clean_menus(Menus, MenuBar) ->
remove_menu_items(Menus, MenuBar).
remove_menu_items([{MenuStr = "File", Menus}|Rest], MenuBar) ->
- MenuId = wxMenuBar:findMenu(MenuBar, MenuStr),
- Menu = wxMenuBar:getMenu(MenuBar, MenuId),
- Items = [wxMenu:findItem(Menu, Tag) || #create_menu{text=Tag} <- Menus],
- [wxMenu:delete(Menu, MItem) || MItem <- Items],
- case os:type() =:= {unix, darwin} of
- true ->
- wxMenuBar:remove(MenuBar, MenuId),
- wxMenu:destroy(Menu);
- false ->
- ignore
- end,
- remove_menu_items(Rest, MenuBar);
+ case wxMenuBar:findMenu(MenuBar, MenuStr) of
+ ?wxNOT_FOUND ->
+ remove_menu_items(Rest, MenuBar);
+ MenuId ->
+ Menu = wxMenuBar:getMenu(MenuBar, MenuId),
+ Items = [wxMenu:findItem(Menu, Tag) || #create_menu{text=Tag} <- Menus],
+ [wxMenu:delete(Menu, MItem) || MItem <- Items],
+ case os:type() =:= {unix, darwin} of
+ true ->
+ wxMenuBar:remove(MenuBar, MenuId),
+ wxMenu:destroy(Menu);
+ false ->
+ ignore
+ end,
+ remove_menu_items(Rest, MenuBar)
+ end;
remove_menu_items([{"Nodes", _}|_], _MB) ->
ok;
remove_menu_items([{Tag, _Menus}|Rest], MenuBar) ->
- MenuId = wxMenuBar:findMenu(MenuBar, Tag),
- Menu = wxMenuBar:getMenu(MenuBar, MenuId),
- wxMenuBar:remove(MenuBar, MenuId),
- Items = wxMenu:getMenuItems(Menu),
- [wxMenu:'Destroy'(Menu, Item) || Item <- Items],
- wxMenu:destroy(Menu),
- remove_menu_items(Rest, MenuBar);
+ case wxMenuBar:findMenu(MenuBar, Tag) of
+ ?wxNOT_FOUND ->
+ remove_menu_items(Rest, MenuBar);
+ MenuId ->
+ Menu = wxMenuBar:getMenu(MenuBar, MenuId),
+ wxMenuBar:remove(MenuBar, MenuId),
+ Items = wxMenu:getMenuItems(Menu),
+ [wxMenu:'Destroy'(Menu, Item) || Item <- Items],
+ wxMenu:destroy(Menu),
+ remove_menu_items(Rest, MenuBar)
+ end;
remove_menu_items([], _MB) ->
ok.
@@ -597,15 +600,22 @@ epmd_nodes(Names) ->
update_node_list(State = #state{menubar=MenuBar}) ->
{Nodes, NodesMenuItems} = get_nodes(),
- NodeMenuId = wxMenuBar:findMenu(MenuBar, "Nodes"),
- NodeMenu = wxMenuBar:getMenu(MenuBar, NodeMenuId),
- wx:foreach(fun(Item) -> wxMenu:'Destroy'(NodeMenu, Item) end,
- wxMenu:getMenuItems(NodeMenu)),
-
+ NodeMenu = case wxMenuBar:findMenu(MenuBar, "Nodes") of
+ ?wxNOT_FOUND ->
+ Menu = wxMenu:new(),
+ wxMenuBar:append(MenuBar, Menu, "Nodes"),
+ Menu;
+ NodeMenuId ->
+ Menu = wxMenuBar:getMenu(MenuBar, NodeMenuId),
+ wx:foreach(fun(Item) -> wxMenu:'Destroy'(Menu, Item) end,
+ wxMenu:getMenuItems(Menu)),
+ Menu
+ end,
+
Index = wx:foldl(fun(Record, Index) ->
observer_lib:create_menu_item(Record, NodeMenu, Index)
end, 0, NodesMenuItems),
-
+
Dist = case erlang:is_alive() of
true -> #create_menu{id = ?ID_PING, text = "Connect node"};
false -> #create_menu{id = ?ID_CONNECT, text = "Enable distribution"}
diff --git a/lib/odbc/aclocal.m4 b/lib/odbc/aclocal.m4
index 9578cd35c4..5d555a5123 100644
--- a/lib/odbc/aclocal.m4
+++ b/lib/odbc/aclocal.m4
@@ -1849,6 +1849,32 @@ case $erl_gethrvtime in
esac
])dnl
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_TRY_ENABLE_CFLAG
+dnl
+dnl
+dnl Tries a CFLAG and sees if it can be enabled without compiler errors
+dnl $1: textual cflag to add
+dnl $2: variable to store the modified CFLAG in
+dnl Usage example LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+dnl
+dnl
+AC_DEFUN([LM_TRY_ENABLE_CFLAG], [
+ AC_MSG_CHECKING([if we can add $1 to CFLAGS])
+ saved_CFLAGS=$CFLAGS;
+ CFLAGS="$1 $CFLAGS";
+ AC_TRY_COMPILE([],[return 0;],can_enable_flag=true,can_enable_flag=false)
+ CFLAGS=$saved_CFLAGS;
+ if test "X$can_enable_flag" = "Xtrue"; then
+ AC_MSG_RESULT([yes])
+ AS_VAR_SET($2, "$1 $CFLAGS")
+ else
+ AC_MSG_RESULT([no])
+ AS_VAR_SET($2, "$CFLAGS")
+ fi
+])
+
dnl ERL_TRY_LINK_JAVA(CLASSES, FUNCTION-BODY
dnl [ACTION_IF_FOUND [, ACTION-IF-NOT-FOUND]])
dnl Freely inspired by AC_TRY_LINK. (Maybe better to create a
diff --git a/lib/odbc/configure.in b/lib/odbc/configure.in
index bec65c71bf..e6ba9f57f5 100644
--- a/lib/odbc/configure.in
+++ b/lib/odbc/configure.in
@@ -212,4 +212,9 @@ AC_SUBST(ODBC_INCLUDE)
fi dnl "$with_odbc" != "no"
+if test "x$GCC" = xyes; then
+ # Treat certain GCC warnings as errors
+ LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+fi
+
AC_OUTPUT(c_src/$host/Makefile:c_src/Makefile.in)
diff --git a/lib/os_mon/src/os_mon.erl b/lib/os_mon/src/os_mon.erl
index df1eccb064..19acae9f0e 100644
--- a/lib/os_mon/src/os_mon.erl
+++ b/lib/os_mon/src/os_mon.erl
@@ -176,9 +176,7 @@ services({unix, sunos}) ->
services({unix, _}) -> % Other unix.
[cpu_sup, disksup, memsup];
services({win32, _}) ->
- [disksup, memsup, os_sup, sysinfo];
-services(_) ->
- [].
+ [disksup, memsup, os_sup, sysinfo].
server_name(cpu_sup) -> cpu_sup;
server_name(disksup) -> disksup;
diff --git a/lib/public_key/doc/src/cert_records.xml b/lib/public_key/doc/src/cert_records.xml
index 94c7c46350..b1d2a05200 100644
--- a/lib/public_key/doc/src/cert_records.xml
+++ b/lib/public_key/doc/src/cert_records.xml
@@ -137,7 +137,7 @@
issuer, % {rdnSequence, [#AttributeTypeAndValue'{}]}
validity, % #'Validity'{}
subject, % {rdnSequence, [#AttributeTypeAndValue'{}]}
- subjectPublicKeyInfo, % #'SubjectPublicKeyInfo'{}
+ subjectPublicKeyInfo, % #'OTPSubjectPublicKeyInfo'{}
issuerUniqueID, % binary() | asn1_novalue
subjectUniqueID, % binary() | asn1_novalue
extensions % [#'Extension'{}]
diff --git a/lib/reltool/src/reltool_sys_win.erl b/lib/reltool/src/reltool_sys_win.erl
index 0c0b295db1..8e182d02ed 100644
--- a/lib/reltool/src/reltool_sys_win.erl
+++ b/lib/reltool/src/reltool_sys_win.erl
@@ -49,7 +49,6 @@
rel_book,
lib_tree,
status_bar,
- popup_menu,
source,
whitelist,
blacklist,
@@ -136,6 +135,7 @@ init(Options) ->
do_init(Options)
catch
error:Reason ->
+ io:format("~p: ~p~n",[Reason, erlang:get_stacktrace()]),
exit({Reason, erlang:get_stacktrace()})
end.
@@ -403,8 +403,6 @@ create_menubar(Frame) ->
wxEvtHandler:connect(Frame,
command_menu_selected,
[{userData, main_window}]),
- wxEvtHandler:connect(File, menu_close),
- wxEvtHandler:connect(Help, menu_close),
MenuBar.
create_app_page(#state{book = Book} = S) ->
@@ -780,15 +778,12 @@ root_popup(S, Root, Tree, Item) ->
wxMenu:appendSeparator(PopupMenu),
wxMenu:append(PopupMenu, 1, "Edit"),
Choices = [edit],
- wxEvtHandler:connect(PopupMenu, command_menu_selected),
- wxEvtHandler:connect(PopupMenu, menu_close),
+ Popup = #root_popup{dir = Root, choices = Choices,
+ tree = Tree, item = Item},
+ wxEvtHandler:connect(PopupMenu, command_menu_selected, [{userData, {popup, Popup}}]),
wxWindow:popupMenu(S#state.frame, PopupMenu),
- Popup = #root_popup{dir = Root,
- choices = Choices,
- tree = Tree,
- item = Item},
- S#state{popup_menu = Popup}.
+ S.
lib_popup(S, Lib, Tree, Item) ->
PopupMenu = wxMenu:new(),
@@ -804,12 +799,10 @@ lib_popup(S, Lib, Tree, Item) ->
wxMenu:append(PopupMenu, 3, "Delete"),
[add, edit, delete]
end,
- wxEvtHandler:connect(PopupMenu, command_menu_selected),
- wxEvtHandler:connect(PopupMenu, menu_close),
- wxWindow:popupMenu(S#state.frame, PopupMenu),
-
Popup = #lib_popup{dir = Lib, choices = Choices, tree = Tree, item = Item},
- S#state{popup_menu = Popup}.
+ wxEvtHandler:connect(PopupMenu, command_menu_selected, [{userData, {popup, Popup}}]),
+ wxWindow:popupMenu(S#state.frame, PopupMenu),
+ S.
escript_popup(S, File, Tree, Item) ->
PopupMenu = wxMenu:new(),
@@ -825,15 +818,11 @@ escript_popup(S, File, Tree, Item) ->
wxMenu:append(PopupMenu, 3, "Delete"),
[add, edit, delete]
end,
- wxEvtHandler:connect(PopupMenu, command_menu_selected),
- wxEvtHandler:connect(PopupMenu, menu_close),
+ Popup = #escript_popup{file = File, choices = Choices,
+ tree = Tree, item = Item},
+ wxEvtHandler:connect(PopupMenu, command_menu_selected, [{userData, {popup, Popup}}]),
wxWindow:popupMenu(S#state.frame, PopupMenu),
-
- Popup = #escript_popup{file = File,
- choices = Choices,
- tree = Tree,
- item = Item},
- S#state{popup_menu = Popup}.
+ S.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
@@ -903,11 +892,13 @@ handle_event(S, #wx{id = Id, obj= ObjRef, userData = UserData, event = Event} =
wxMessageDialog:showModal(MD),
wxMessageDialog:destroy(MD),
S;
- #wxMenu{type = menu_close} ->
- S#state{popup_menu = undefined};
- #wxCommand{type = command_menu_selected = Type, cmdString = Str}
- when S#state.popup_menu =/= undefined ->
- handle_popup_event(S, Type, Id, ObjRef, UserData, Str);
+ #wxCommand{type = command_menu_selected = Type, cmdString = Str} ->
+ case UserData of
+ {popup, Popup} ->
+ handle_popup_event(S, Type, Id, ObjRef, Popup, Str);
+ true ->
+ S
+ end;
#wxMouse{type = enter_window} ->
%% The following is commented out because it raises the
%% main system window on top of popup windows.
@@ -1028,11 +1019,9 @@ warning_popup_position(#state{frame=MF,warning_list=WL},{WFW,WFH}) ->
{X,Y}.
handle_popup_event(S, _Type, 0, _ObjRef, _UserData, _Str) ->
- S#state{popup_menu = undefined};
-handle_popup_event(#state{popup_menu = #root_popup{dir = OldDir,
- choices = Choices},
- sys = Sys} = S,
- _Type, Pos, _ObjRef, _UserData, _Str) ->
+ S;
+handle_popup_event(#state{sys = Sys} = S, _Type, Pos, _ObjRef,
+ #root_popup{dir = OldDir, choices = Choices}, _Str) ->
case lists:nth(Pos, Choices) of
edit ->
Style = ?wxFD_OPEN bor ?wxFD_FILE_MUST_EXIST,
@@ -1042,18 +1031,16 @@ handle_popup_event(#state{popup_menu = #root_popup{dir = OldDir,
Style) of
{ok, NewDir} when NewDir =:= OldDir ->
%% Same dir.Ignore.
- S#state{popup_menu = undefined};
+ S;
{ok, NewDir} ->
Sys2 = Sys#sys{root_dir = NewDir},
- do_set_sys(S#state{popup_menu = undefined, sys = Sys2});
+ do_set_sys(S#state{sys = Sys2});
cancel ->
- S#state{popup_menu = undefined}
+ S
end
end;
-handle_popup_event(#state{popup_menu = #lib_popup{dir = OldDir,
- choices = Choices},
- sys = Sys} = S,
- _Type, Pos, _ObjRef, _UserData, _Str) ->
+handle_popup_event(#state{sys = Sys} = S, _Type, Pos, _ObjRef,
+ #lib_popup{dir = OldDir, choices = Choices}, _Str) ->
case lists:nth(Pos, Choices) of
add ->
{ok, Cwd} = file:get_cwd(),
@@ -1063,15 +1050,14 @@ handle_popup_event(#state{popup_menu = #lib_popup{dir = OldDir,
case lists:member(NewDir, Sys#sys.lib_dirs) of
true ->
%% Ignore duplicate. Keep old.
- S#state{popup_menu = undefined};
+ S;
false ->
LibDirs = Sys#sys.lib_dirs ++ [NewDir],
Sys2 = Sys#sys{lib_dirs = LibDirs},
- do_set_sys(S#state{popup_menu = undefined,
- sys = Sys2})
+ do_set_sys(S#state{sys = Sys2})
end;
cancel ->
- S#state{popup_menu = undefined}
+ S
end;
edit ->
Style = ?wxFD_OPEN bor ?wxFD_FILE_MUST_EXIST,
@@ -1083,28 +1069,25 @@ handle_popup_event(#state{popup_menu = #lib_popup{dir = OldDir,
case lists:member(NewDir, Sys#sys.lib_dirs) of
true ->
%% Ignore duplicate. Keep old.
- S#state{popup_menu = undefined};
+ S;
false ->
Pred = fun(E) -> E =/= OldDir end,
{Before, [_| After]} =
lists:splitwith(Pred, Sys#sys.lib_dirs),
LibDirs2 = Before ++ [NewDir | After],
Sys2 = Sys#sys{lib_dirs = LibDirs2},
- do_set_sys(S#state{popup_menu = undefined,
- sys = Sys2})
+ do_set_sys(S#state{sys = Sys2})
end;
cancel ->
- S#state{popup_menu = undefined}
+ S
end;
delete ->
LibDirs = Sys#sys.lib_dirs -- [OldDir],
Sys2 = Sys#sys{lib_dirs = LibDirs},
- do_set_sys(S#state{popup_menu = undefined, sys = Sys2})
+ do_set_sys(S#state{sys = Sys2})
end;
-handle_popup_event(#state{popup_menu = #escript_popup{file = OldFile,
- choices = Choices},
- sys = Sys} = S,
- _Type, Pos, _ObjRef, _UserData, _Str) ->
+handle_popup_event(#state{sys = Sys} = S, _Type, Pos, _ObjRef,
+ #escript_popup{file = OldFile, choices = Choices}, _Str) ->
case lists:nth(Pos, Choices) of
add ->
OldFile2 =
@@ -1124,14 +1107,14 @@ handle_popup_event(#state{popup_menu = #escript_popup{file = OldFile,
case lists:member(NewFile, Sys#sys.escripts) of
true ->
%% Ignore duplicate. Keep old.
- S#state{popup_menu = undefined};
+ S;
false ->
Escripts = Sys#sys.escripts ++ [NewFile],
Sys2 = Sys#sys{escripts = Escripts},
- do_set_sys(S#state{popup_menu = undefined, sys = Sys2})
+ do_set_sys(S#state{sys = Sys2})
end;
cancel ->
- S#state{popup_menu = undefined}
+ S
end;
edit ->
Style = ?wxFD_OPEN bor ?wxFD_FILE_MUST_EXIST,
@@ -1143,23 +1126,22 @@ handle_popup_event(#state{popup_menu = #escript_popup{file = OldFile,
case lists:member(NewFile, Sys#sys.escripts) of
true ->
%% Ignore duplicate. Keep old.
- S#state{popup_menu = undefined};
+ S;
false ->
Pred = fun(E) -> E =/= OldFile end,
{Before, [_| After]} =
lists:splitwith(Pred, Sys#sys.escripts),
Escripts2 = Before ++ [NewFile | After],
Sys2 = Sys#sys{escripts = Escripts2},
- do_set_sys(S#state{popup_menu = undefined,
- sys = Sys2})
+ do_set_sys(S#state{sys = Sys2})
end;
cancel ->
- S#state{popup_menu = undefined}
+ S
end;
delete ->
Escripts = Sys#sys.escripts -- [OldFile],
Sys2 = Sys#sys{escripts = Escripts},
- do_set_sys(S#state{popup_menu = undefined, sys = Sys2})
+ do_set_sys(S#state{sys = Sys2})
end.
handle_system_event(#state{sys = Sys} = S,
diff --git a/lib/reltool/src/reltool_target.erl b/lib/reltool/src/reltool_target.erl
index 6cb7ba0163..1f4ce7226a 100644
--- a/lib/reltool/src/reltool_target.erl
+++ b/lib/reltool/src/reltool_target.erl
@@ -482,33 +482,12 @@ do_gen_script(#rel{name = RelName, vsn = RelVsn},
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
-load_app_mods(#app{mods = Mods} = App, Mand, PathFlag, Variables) ->
+load_app_mods(#app{mods = Mods0} = App, Mand, PathFlag, Variables) ->
Path = cr_path(App, PathFlag, Variables),
- PartNames =
- lists:sort([{packages:split(M),M} ||
- #mod{name = M, is_included=true} <- Mods,
- not lists:member(M, Mand)]),
- SplitMods =
- lists:foldl(
- fun({Parts,M}, [{Last, Acc}|Rest]) ->
- [_|Tail] = lists:reverse(Parts),
- case lists:reverse(Tail) of
- Subs when Subs == Last ->
- [{Last,[M|Acc]}|Rest];
- Subs ->
- [{Subs, [M]}|[{Last,Acc}|Rest]]
- end
- end,
- [{[],
- []}],
- PartNames),
- lists:foldl(
- fun({Subs,Ms}, Cmds) ->
- [{path, [filename:join([Path | Subs])]},
- {primLoad, lists:sort(Ms)} | Cmds]
- end,
- [],
- SplitMods).
+ Mods = [M || #mod{name = M, is_included=true} <- Mods0,
+ not lists:member(M, Mand)],
+ [{path, [filename:join([Path])]},
+ {primLoad, lists:sort(Mods)}].
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% sort_used_and_incl_apps(Apps, OrderedApps) -> Apps
diff --git a/lib/runtime_tools/src/Makefile b/lib/runtime_tools/src/Makefile
index d6750f3a88..4ca37ab0bf 100644
--- a/lib/runtime_tools/src/Makefile
+++ b/lib/runtime_tools/src/Makefile
@@ -35,6 +35,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/runtime_tools-$(VSN)
# ----------------------------------------------------
MODULES= \
+ appmon_info \
erts_alloc_config \
runtime_tools \
runtime_tools_sup \
diff --git a/lib/appmon/src/appmon_info.erl b/lib/runtime_tools/src/appmon_info.erl
index 332140f69d..332140f69d 100644
--- a/lib/appmon/src/appmon_info.erl
+++ b/lib/runtime_tools/src/appmon_info.erl
diff --git a/lib/runtime_tools/src/runtime_tools.app.src b/lib/runtime_tools/src/runtime_tools.app.src
index 60be9ed7c9..602048dc21 100644
--- a/lib/runtime_tools/src/runtime_tools.app.src
+++ b/lib/runtime_tools/src/runtime_tools.app.src
@@ -19,7 +19,7 @@
{application, runtime_tools,
[{description, "RUNTIME_TOOLS"},
{vsn, "%VSN%"},
- {modules, [dbg,observer_backend,percept_profile,
+ {modules, [appmon_info, dbg,observer_backend,percept_profile,
runtime_tools,runtime_tools_sup,erts_alloc_config,
ttb_autostart,dyntrace]},
{registered, [runtime_tools_sup]},
diff --git a/lib/sasl/src/systools_make.erl b/lib/sasl/src/systools_make.erl
index 29c4a0d168..9b2e2c809b 100644
--- a/lib/sasl/src/systools_make.erl
+++ b/lib/sasl/src/systools_make.erl
@@ -1067,11 +1067,10 @@ check_mod(Mod,App,Dir,Ext,IncPath) ->
end.
mod_to_filename(Dir, Mod, Ext) ->
- Parts = packages:split(Mod),
- filename:join([Dir | Parts]) ++ Ext.
+ filename:join(Dir, atom_to_list(Mod) ++ Ext).
check_module(Mod, Dir, ObjModTime, IncPath) ->
- {SrcDirs,_IncDirs}= smart_guess(Mod, Dir,IncPath),
+ {SrcDirs,_IncDirs}= smart_guess(Dir,IncPath),
case locate_src(Mod,SrcDirs) of
{ok,_FDir,_File,LastModTime} ->
if
@@ -1085,7 +1084,7 @@ check_module(Mod, Dir, ObjModTime, IncPath) ->
end.
locate_src(Mod,[Dir|Dirs]) ->
- File = filename:join(Dir, mod_to_fname(Mod) ++ ".erl"),
+ File = mod_to_filename(Dir, Mod, ".erl"),
case file:read_file_info(File) of
{ok,FileInfo} ->
LastModTime = FileInfo#file_info.mtime,
@@ -1096,9 +1095,6 @@ locate_src(Mod,[Dir|Dirs]) ->
locate_src(_,[]) ->
false.
-mod_to_fname(Mod) ->
- hd(lists:reverse(packages:split(Mod))).
-
%%______________________________________________________________________
%% smart_guess(Mod, Dir,IncludePath) -> {[Dirs],[IncDirs]}
@@ -1106,17 +1102,12 @@ mod_to_fname(Mod) ->
%% src-dir should be one of .../src or .../src/e_src
%% If dir does not contain .../ebin set dir to the same directory.
-smart_guess(Mod, Dir,IncPath) ->
+smart_guess(Dir,IncPath) ->
case reverse(filename:split(Dir)) of
["ebin"|D] ->
- Subdirs = case packages:split(Mod) of
- [_] -> [];
- [_|_] = Parts ->
- lists:reverse(tl(lists:reverse(Parts)))
- end,
D1 = reverse(D),
- Dirs = [filename:join(D1 ++ ["src" | Subdirs]),
- filename:join(D1 ++ ["src", "e_src" | Subdirs])],
+ Dirs = [filename:join(D1 ++ ["src"]),
+ filename:join(D1 ++ ["src", "e_src"])],
{Dirs,Dirs ++ IncPath};
_ ->
{[Dir],[Dir] ++ IncPath}
@@ -1423,23 +1414,8 @@ load_appl_mods([], _, _, _) ->
[{progress, modules_loaded}].
load_commands(Mods, Path) ->
- SplitMods = lists:foldl(
- fun({Parts,M}, [{Last, Acc}|Rest]) ->
- [_|Tail] = lists:reverse(Parts),
- case lists:reverse(Tail) of
- Subs when Subs == Last ->
- [{Last,[M|Acc]}|Rest];
- Subs ->
- [{Subs, [M]}|[{Last,Acc}|Rest]]
- end
- end, [{[],[]}],
- lists:sort([{packages:split(M),M} || M <- Mods])),
- lists:foldl(
- fun({Subs,Ms}, Cmds) ->
- [{path, [filename:join([Path | Subs])]},
- {primLoad,lists:sort(Ms)} | Cmds]
- end, [], SplitMods).
-
+ [{path, [filename:join([Path])]},
+ {primLoad,lists:sort(Mods)}].
%%______________________________________________________________________
%% Pack an application to an application term.
diff --git a/lib/ssh/doc/src/ssh_protocol.xml b/lib/ssh/doc/src/ssh_protocol.xml
index 6a253c43eb..28f42f5707 100644
--- a/lib/ssh/doc/src/ssh_protocol.xml
+++ b/lib/ssh/doc/src/ssh_protocol.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>2012</year>
+ <year>2013</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -110,8 +110,7 @@
read-eval-print loop. It is also possible, but much more work,
to provide your own CLI (Command Line Interface) implementation.
</item>
- <item><em>Exec</em> - one-time remote execution (like
- SCP). See <seealso
+ <item><em>Exec</em> - one-time remote execution of commands. See <seealso
marker="ssh_connection#exec-4">ssh_connection:exec/4</seealso></item>
</list>
</section>
diff --git a/lib/ssl/test/Makefile b/lib/ssl/test/Makefile
index d36dcb588b..847907cde8 100644
--- a/lib/ssl/test/Makefile
+++ b/lib/ssl/test/Makefile
@@ -37,15 +37,16 @@ VSN=$(GS_VSN)
MODULES = \
ssl_test_lib \
ssl_basic_SUITE \
- ssl_handshake_SUITE \
- ssl_packet_SUITE \
ssl_cipher_SUITE \
- ssl_payload_SUITE \
- ssl_to_openssl_SUITE \
- ssl_session_cache_SUITE \
+ ssl_certificate_verify_SUITE\
ssl_dist_SUITE \
+ ssl_handshake_SUITE \
ssl_npn_hello_SUITE \
ssl_npn_handshake_SUITE \
+ ssl_packet_SUITE \
+ ssl_payload_SUITE \
+ ssl_session_cache_SUITE \
+ ssl_to_openssl_SUITE \
make_certs\
erl_make_certs
diff --git a/lib/ssl/test/ssl_basic_SUITE.erl b/lib/ssl/test/ssl_basic_SUITE.erl
index faed91e559..5ba71f9218 100644
--- a/lib/ssl/test/ssl_basic_SUITE.erl
+++ b/lib/ssl/test/ssl_basic_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2007-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2007-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -41,127 +41,10 @@
-define(RENEGOTIATION_DISABLE_TIME, 12000).
-define(CLEAN_SESSION_DB, 60000).
-%% Test server callback functions
%%--------------------------------------------------------------------
-%% Function: init_per_suite(Config) -> Config
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Initialization before the whole suite
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%%--------------------------------------------------------------------
-init_per_suite(Config0) ->
- Dog = ssl_test_lib:timetrap(?LONG_TIMEOUT *2),
- catch crypto:stop(),
- try crypto:start() of
- ok ->
- application:start(public_key),
-
- %% make rsa certs using oppenssl
- Result =
- (catch make_certs:all(?config(data_dir, Config0),
- ?config(priv_dir, Config0))),
- test_server:format("Make certs ~p~n", [Result]),
-
- Config1 = ssl_test_lib:make_dsa_cert(Config0),
- Config = ssl_test_lib:cert_options(Config1),
- [{watchdog, Dog} | Config]
- catch _:_ ->
- {skip, "Crypto did not start"}
- end.
-%%--------------------------------------------------------------------
-%% Function: end_per_suite(Config) -> _
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after the whole suite
-%%--------------------------------------------------------------------
-end_per_suite(_Config) ->
- ssl:stop(),
- application:stop(crypto).
-
-%%--------------------------------------------------------------------
-%% Function: init_per_testcase(TestCase, Config) -> Config
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%%
-%% Description: Initialization before each test case
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%% Description: Initialization before each test case
-%%--------------------------------------------------------------------
-init_per_testcase(no_authority_key_identifier, Config) ->
- %% Clear cach so that root cert will not
- %% be found.
- ssl:clear_pem_cache(),
- Config;
-
-init_per_testcase(protocol_versions, Config) ->
- ssl:stop(),
- application:load(ssl),
- %% For backwards compatibility sslv2 should be filtered out.
- application:set_env(ssl, protocol_version, [sslv2, sslv3, tlsv1]),
- ssl:start(),
- Config;
-
-init_per_testcase(reuse_session_expired, Config0) ->
- Config = lists:keydelete(watchdog, 1, Config0),
- ssl:stop(),
- application:load(ssl),
- application:set_env(ssl, session_lifetime, ?EXPIRE),
- application:set_env(ssl, session_delay_cleanup_time, 500),
- ssl:start(),
- Config;
-
-init_per_testcase(empty_protocol_versions, Config) ->
- ssl:stop(),
- application:load(ssl),
- application:set_env(ssl, protocol_version, []),
- ssl:start(),
- Config;
-
-%% init_per_testcase(different_ca_peer_sign, Config0) ->
-%% ssl_test_lib:make_mix_cert(Config0);
-
-init_per_testcase(_TestCase, Config0) ->
- test_server:format("TLS/SSL version ~p~n ", [ssl_record:supported_protocol_versions()]),
- Config = lists:keydelete(watchdog, 1, Config0),
- Dog = test_server:timetrap(?TIMEOUT),
- [{watchdog, Dog} | Config].
-
-%%--------------------------------------------------------------------
-%% Function: end_per_testcase(TestCase, Config) -> _
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after each test case
+%% Common Test interface functions -----------------------------------
%%--------------------------------------------------------------------
-end_per_testcase(reuse_session_expired, Config) ->
- application:unset_env(ssl, session_lifetime),
- application:unset_env(ssl, session_delay_cleanup_time),
- end_per_testcase(default_action, Config);
-end_per_testcase(_TestCase, Config) ->
- Dog = ?config(watchdog, Config),
- case Dog of
- undefined ->
- ok;
- _ ->
- test_server:timetrap_cancel(Dog)
- end.
-
-%%--------------------------------------------------------------------
-%% Function: all(Clause) -> TestCases
-%% Clause - atom() - suite | doc
-%% TestCases - [Case]
-%% Case - atom()
-%% Name of a test case.
-%% Description: Returns a list of all test cases in this test suite
-%%--------------------------------------------------------------------
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
@@ -183,7 +66,6 @@ groups() ->
{'tlsv1', [], all_versions_groups() ++ rizzo_tests()},
{'sslv3', [], all_versions_groups() ++ rizzo_tests()},
{api,[], api_tests()},
- {certificate_verify, [], certificate_verify_tests()},
{session, [], session_tests()},
{renegotiate, [], renegotiate_tests()},
{ciphers, [], cipher_tests()},
@@ -192,29 +74,10 @@ groups() ->
all_versions_groups ()->
[{group, api},
- {group, certificate_verify},
{group, renegotiate},
{group, ciphers},
{group, error_handling_tests}].
-init_per_group(GroupName, Config) ->
- case ssl_test_lib:is_tls_version(GroupName) of
- true ->
- case ssl_test_lib:sufficient_crypto_support(GroupName) of
- true ->
- ssl_test_lib:init_tls_version(GroupName),
- Config;
- false ->
- {skip, "Missing crypto support"}
- end;
- _ ->
- ssl:start(),
- Config
- end.
-
-
-end_per_group(_GroupName, Config) ->
- Config.
basic_tests() ->
[app,
@@ -242,7 +105,8 @@ options_tests() ->
protocol_versions,
empty_protocol_versions,
ipv6,
- reuseaddr].
+ reuseaddr,
+ tcp_reuseaddr].
api_tests() ->
[connection_info,
@@ -264,38 +128,6 @@ api_tests() ->
ssl_recv_timeout
].
-certificate_verify_tests() ->
- [server_verify_peer_passive,
- server_verify_peer_active,
- server_verify_peer_active_once,
- server_verify_none_passive,
- server_verify_none_active,
- server_verify_none_active_once,
- server_verify_no_cacerts,
- server_require_peer_cert_ok,
- server_require_peer_cert_fail,
- server_verify_client_once_passive,
- server_verify_client_once_active,
- server_verify_client_once_active_once,
- new_server_wants_peer_cert,
- client_verify_none_passive,
- client_verify_none_active,
- client_verify_none_active_once,
- extended_key_usage_verify_peer,
- extended_key_usage_verify_none,
- invalid_signature_client,
- invalid_signature_server,
- cert_expired,
- client_with_cert_cipher_suites_handshake,
- verify_fun_always_run_client,
- verify_fun_always_run_server,
- unknown_server_ca_fail,
- unknown_server_ca_accept_verify_none,
- unknown_server_ca_accept_verify_peer,
- unknown_server_ca_accept_backwardscompatibility,
- no_authority_key_identifier
- ].
-
session_tests() ->
[reuse_session,
reuse_session_expired,
@@ -335,19 +167,109 @@ rizzo_tests() ->
[rizzo,
no_rizzo_rc4].
-%% Test cases starts here.
%%--------------------------------------------------------------------
-app(doc) ->
- "Test that the ssl app file is ok";
-app(suite) ->
- [];
+init_per_suite(Config0) ->
+ Dog = ct:timetrap(?LONG_TIMEOUT *2),
+ catch crypto:stop(),
+ try crypto:start() of
+ ok ->
+ application:start(public_key),
+
+ %% make rsa certs using oppenssl
+ Result =
+ (catch make_certs:all(?config(data_dir, Config0),
+ ?config(priv_dir, Config0))),
+ ct:print("Make certs ~p~n", [Result]),
+
+ Config1 = ssl_test_lib:make_dsa_cert(Config0),
+ Config = ssl_test_lib:cert_options(Config1),
+ [{watchdog, Dog} | Config]
+ catch _:_ ->
+ {skip, "Crypto did not start"}
+ end.
+
+end_per_suite(_Config) ->
+ ssl:stop(),
+ application:stop(crypto).
+
+%%--------------------------------------------------------------------
+init_per_group(GroupName, Config) ->
+ case ssl_test_lib:is_tls_version(GroupName) of
+ true ->
+ case ssl_test_lib:sufficient_crypto_support(GroupName) of
+ true ->
+ ssl_test_lib:init_tls_version(GroupName),
+ Config;
+ false ->
+ {skip, "Missing crypto support"}
+ end;
+ _ ->
+ ssl:start(),
+ Config
+ end.
+
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+init_per_testcase(no_authority_key_identifier, Config) ->
+ %% Clear cach so that root cert will not
+ %% be found.
+ ssl:clear_pem_cache(),
+ Config;
+
+init_per_testcase(protocol_versions, Config) ->
+ ssl:stop(),
+ application:load(ssl),
+ %% For backwards compatibility sslv2 should be filtered out.
+ application:set_env(ssl, protocol_version, [sslv2, sslv3, tlsv1]),
+ ssl:start(),
+ Config;
+
+init_per_testcase(reuse_session_expired, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ ssl:stop(),
+ application:load(ssl),
+ application:set_env(ssl, session_lifetime, ?EXPIRE),
+ application:set_env(ssl, session_delay_cleanup_time, 500),
+ ssl:start(),
+ Config;
+
+init_per_testcase(empty_protocol_versions, Config) ->
+ ssl:stop(),
+ application:load(ssl),
+ application:set_env(ssl, protocol_version, []),
+ ssl:start(),
+ Config;
+
+%% init_per_testcase(different_ca_peer_sign, Config0) ->
+%% ssl_test_lib:make_mix_cert(Config0);
+
+init_per_testcase(_TestCase, Config0) ->
+ ct:print("TLS/SSL version ~p~n ", [ssl_record:supported_protocol_versions()]),
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = ct:timetrap(?TIMEOUT),
+ [{watchdog, Dog} | Config].
+
+end_per_testcase(reuse_session_expired, Config) ->
+ application:unset_env(ssl, session_lifetime),
+ application:unset_env(ssl, session_delay_cleanup_time),
+ end_per_testcase(default_action, Config);
+
+end_per_testcase(_TestCase, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
+app() ->
+ [{doc, "Test that the ssl app file is ok"}].
app(Config) when is_list(Config) ->
- ok = test_server:app_test(ssl).
+ ok = ?t:app_test(ssl).
%%--------------------------------------------------------------------
-alerts(doc) ->
- "Test ssl_alert:alert_txt/1";
-alerts(suite) ->
- [];
+alerts() ->
+ [{doc, "Test ssl_alert:alert_txt/1"}].
alerts(Config) when is_list(Config) ->
Descriptions = [?CLOSE_NOTIFY, ?UNEXPECTED_MESSAGE, ?BAD_RECORD_MAC,
?DECRYPTION_FAILED, ?RECORD_OVERFLOW, ?DECOMPRESSION_FAILURE,
@@ -364,14 +286,12 @@ alerts(Config) when is_list(Config) ->
Txt when is_list(Txt) ->
ok;
Other ->
- test_server:fail({unexpected, Other})
+ ct:fail({unexpected, Other})
end
end, Alerts).
%%--------------------------------------------------------------------
-connection_info(doc) ->
- ["Test the API function ssl:connection_info/1"];
-connection_info(suite) ->
- [];
+connection_info() ->
+ [{doc,"Test the API function ssl:connection_info/1"}].
connection_info(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -390,7 +310,7 @@ connection_info(Config) when is_list(Config) ->
[{ciphers,[{rsa,rc4_128,sha,no_export}]} |
ClientOpts]}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
Version =
@@ -403,58 +323,23 @@ connection_info(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-connection_info_result(Socket) ->
- ssl:connection_info(Socket).
-
%%--------------------------------------------------------------------
-
-protocol_versions(doc) ->
- ["Test to set a list of protocol versions in app environment."];
-
-protocol_versions(suite) ->
- [];
+protocol_versions() ->
+ [{doc,"Test to set a list of protocol versions in app environment."}].
protocol_versions(Config) when is_list(Config) ->
basic_test(Config).
-
-empty_protocol_versions(doc) ->
- ["Test to set an empty list of protocol versions in app environment."];
-
-empty_protocol_versions(suite) ->
- [];
+%%--------------------------------------------------------------------
+empty_protocol_versions() ->
+ [{doc,"Test to set an empty list of protocol versions in app environment."}].
empty_protocol_versions(Config) when is_list(Config) ->
basic_test(Config).
-
-basic_test(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, ClientOpts}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-controlling_process(doc) ->
- ["Test API function controlling_process/2"];
-
-controlling_process(suite) ->
- [];
+controlling_process() ->
+ [{doc,"Test API function controlling_process/2"}].
controlling_process(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -478,7 +363,7 @@ controlling_process(Config) when is_list(Config) ->
ClientMsg]}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
receive
@@ -497,46 +382,15 @@ controlling_process(Config) when is_list(Config) ->
ok
end;
Unexpected ->
- test_server:fail(Unexpected)
+ ct:fail(Unexpected)
end,
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-controlling_process_result(Socket, Pid, Msg) ->
- ok = ssl:controlling_process(Socket, Pid),
- %% Make sure other side has evaluated controlling_process
- %% before message is sent
- test_server:sleep(?SLEEP),
- ssl:send(Socket, Msg),
- no_result_msg.
-
-receive_s_rizzo_duong_beast() ->
- receive
- {ssl, _, "erver hello"} ->
- receive
- {ssl, _, "C"} ->
- receive
- {ssl, _, "lient hello"} ->
- ok
- end
- end
- end.
-receive_c_rizzo_duong_beast() ->
- receive
- {ssl, _, "lient hello"} ->
- receive
- {ssl, _, "S"} ->
- receive
- {ssl, _, "erver hello"} ->
- ok
- end
- end
- end.
%%--------------------------------------------------------------------
-controller_dies(doc) ->
- ["Test that the socket is closed after controlling process dies"];
-controller_dies(suite) -> [];
+controller_dies() ->
+ [{doc,"Test that the socket is closed after controlling process dies"}].
controller_dies(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -559,8 +413,8 @@ controller_dies(Config) when is_list(Config) ->
ClientMsg]}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n", [self(), Client, Server]),
- test_server:sleep(?SLEEP), %% so that they are connected
+ ct:print("Testcase ~p, Client ~p Server ~p ~n", [self(), Client, Server]),
+ ct:sleep(?SLEEP), %% so that they are connected
process_flag(trap_exit, true),
@@ -577,7 +431,7 @@ controller_dies(Config) when is_list(Config) ->
%% Make sure server finishes and verification
%% and is in coonection state before
%% killing client
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Pid ! {self(), connected, Socket},
receive die_nice -> normal end
end,
@@ -597,13 +451,13 @@ controller_dies(Config) when is_list(Config) ->
Client3 ! die_nice
end,
- test_server:format("Wating on exit ~p~n",[Client3]),
+ ct:print("Wating on exit ~p~n",[Client3]),
receive {'EXIT', Client3, normal} -> ok end,
receive %% Client3 is dead but that doesn't matter, socket should not be closed.
Unexpected ->
- test_server:format("Unexpected ~p~n",[Unexpected]),
- test_server:fail({line, ?LINE-1})
+ ct:print("Unexpected ~p~n",[Unexpected]),
+ ct:fail({line, ?LINE-1})
after 1000 ->
ok
end,
@@ -619,39 +473,17 @@ controller_dies(Config) when is_list(Config) ->
controller_dies_result, [self(),
ClientMsg]}},
{options, [{reuseaddr,true}|ClientOpts]}]),
- test_server:sleep(?SLEEP), %% so that they are connected
+ ct:sleep(?SLEEP), %% so that they are connected
exit(Server, killed),
get_close(Server, ?LINE),
process_flag(trap_exit, false),
ssl_test_lib:close(LastClient).
-controller_dies_result(_Socket, _Pid, _Msg) ->
- receive Result -> Result end.
-
-get_close(Pid, Where) ->
- receive
- {'EXIT', Pid, _Reason} ->
- receive
- {_, {ssl_closed, Socket}} ->
- test_server:format("Socket closed ~p~n",[Socket]);
- Unexpected ->
- test_server:format("Unexpected ~p~n",[Unexpected]),
- test_server:fail({line, ?LINE-1})
- after 5000 ->
- test_server:fail({timeout, {line, ?LINE, Where}})
- end;
- Unexpected ->
- test_server:format("Unexpected ~p~n",[Unexpected]),
- test_server:fail({line, ?LINE-1})
- after 5000 ->
- test_server:fail({timeout, {line, ?LINE, Where}})
- end.
-
%%--------------------------------------------------------------------
-client_closes_socket(doc) ->
- ["Test what happens when client closes socket before handshake is compleated"];
-client_closes_socket(suite) -> [];
+client_closes_socket() ->
+ [{doc,"Test what happens when client closes socket before handshake is compleated"}].
+
client_closes_socket(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
@@ -668,7 +500,7 @@ client_closes_socket(Config) when is_list(Config) ->
[Hostname, Port, TcpOpts]),
%% Make sure that ssl_accept is called before
%% client process ends and closes socket.
- test_server:sleep(?SLEEP)
+ ct:sleep(?SLEEP)
end,
_Client = spawn_link(Connect),
@@ -676,11 +508,8 @@ client_closes_socket(Config) when is_list(Config) ->
ssl_test_lib:check_result(Server, {error,closed}).
%%--------------------------------------------------------------------
-connect_dist(doc) ->
- ["Test a simple connect as is used by distribution"];
-
-connect_dist(suite) ->
- [];
+connect_dist() ->
+ [{doc,"Test a simple connect as is used by distribution"}].
connect_dist(Config) when is_list(Config) ->
ClientOpts0 = ?config(client_kc_opts, Config),
@@ -706,22 +535,9 @@ connect_dist(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-connect_dist_s(S) ->
- Msg = term_to_binary({erlang,term}),
- ok = ssl:send(S, Msg).
-
-connect_dist_c(S) ->
- Test = binary_to_list(term_to_binary({erlang,term})),
- {ok, Test} = ssl:recv(S, 0, 10000),
- ok.
-
-
%%--------------------------------------------------------------------
-peername(doc) ->
- ["Test API function peername/1"];
-
-peername(suite) ->
- [];
+peername() ->
+ [{doc,"Test API function peername/1"}].
peername(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -744,7 +560,7 @@ peername(Config) when is_list(Config) ->
ServerMsg = {ok, {ClientIp, ClientPort}},
ClientMsg = {ok, {ServerIp, Port}},
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ServerMsg, Client, ClientMsg),
@@ -752,14 +568,9 @@ peername(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-peername_result(S) ->
- ssl:peername(S).
-
%%--------------------------------------------------------------------
-peercert(doc) ->
- [""];
-peercert(suite) ->
- [];
+peercert() ->
+ [{doc,"Test API function peercert/1"}].
peercert(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -782,7 +593,7 @@ peercert(Config) when is_list(Config) ->
ServerMsg = {error, no_peercert},
ClientMsg = {ok, BinCert},
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ServerMsg, Client, ClientMsg),
@@ -794,10 +605,8 @@ peercert_result(Socket) ->
ssl:peercert(Socket).
%%--------------------------------------------------------------------
-peercert_with_client_cert(doc) ->
- [""];
-peercert_with_client_cert(suite) ->
- [];
+peercert_with_client_cert() ->
+ [{doc,"Test API function peercert/1"}].
peercert_with_client_cert(Config) when is_list(Config) ->
ClientOpts = ?config(client_dsa_opts, Config),
ServerOpts = ?config(server_dsa_verify_opts, Config),
@@ -822,7 +631,7 @@ peercert_with_client_cert(Config) when is_list(Config) ->
ServerMsg = {ok, ClientBinCert},
ClientMsg = {ok, ServerBinCert},
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ServerMsg, Client, ClientMsg),
@@ -831,12 +640,8 @@ peercert_with_client_cert(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-sockname(doc) ->
- ["Test API function sockname/1"];
-
-sockname(suite) ->
- [];
-
+sockname() ->
+ [{doc,"Test API function sockname/1"}].
sockname(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -858,7 +663,7 @@ sockname(Config) when is_list(Config) ->
ServerMsg = {ok, {ServerIp, Port}},
ClientMsg = {ok, {ClientIp, ClientPort}},
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ServerMsg, Client, ClientMsg),
@@ -870,11 +675,8 @@ sockname_result(S) ->
ssl:sockname(S).
%%--------------------------------------------------------------------
-cipher_suites(doc) ->
- ["Test API function cipher_suites/0"];
-
-cipher_suites(suite) ->
- [];
+cipher_suites() ->
+ [{doc,"Test API function cipher_suites/0"}].
cipher_suites(Config) when is_list(Config) ->
MandatoryCipherSuite = {rsa,'3des_ede_cbc',sha},
@@ -884,11 +686,8 @@ cipher_suites(Config) when is_list(Config) ->
[_|_] =ssl:cipher_suites(openssl).
%%--------------------------------------------------------------------
-socket_options(doc) ->
- ["Test API function getopts/2 and setopts/2"];
-
-socket_options(suite) ->
- [];
+socket_options() ->
+ [{doc,"Test API function getopts/2 and setopts/2"}].
socket_options(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -937,16 +736,13 @@ socket_options_result(Socket, Options, DefaultValues, NewOptions, NewValues) ->
ssl:setopts(Socket, [{nodelay, true}]),
{ok,[{nodelay, true}]} = ssl:getopts(Socket, [nodelay]),
{ok, All} = ssl:getopts(Socket, []),
- test_server:format("All opts ~p~n", [All]),
+ ct:print("All opts ~p~n", [All]),
ok.
%%--------------------------------------------------------------------
-invalid_inet_get_option(doc) ->
- ["Test handling of invalid inet options in getopts"];
-
-invalid_inet_get_option(suite) ->
- [];
+invalid_inet_get_option() ->
+ [{doc,"Test handling of invalid inet options in getopts"}].
invalid_inet_get_option(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -963,24 +759,16 @@ invalid_inet_get_option(Config) when is_list(Config) ->
{mfa, {ssl_test_lib, no_result, []}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-
-get_invalid_inet_option(Socket) ->
- {error, {eoptions, {inet_option, foo, _}}} = ssl:getopts(Socket, [foo]),
- ok.
-
%%--------------------------------------------------------------------
-invalid_inet_get_option_not_list(doc) ->
- ["Test handling of invalid type in getopts"];
-
-invalid_inet_get_option_not_list(suite) ->
- [];
+invalid_inet_get_option_not_list() ->
+ [{doc,"Test handling of invalid type in getopts"}].
invalid_inet_get_option_not_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -997,7 +785,7 @@ invalid_inet_get_option_not_list(Config) when is_list(Config) ->
{mfa, {ssl_test_lib, no_result, []}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok),
@@ -1011,11 +799,8 @@ get_invalid_inet_option_not_list(Socket) ->
ok.
%%--------------------------------------------------------------------
-invalid_inet_get_option_improper_list(doc) ->
- ["Test handling of invalid type in getopts"];
-
-invalid_inet_get_option_improper_list(suite) ->
- [];
+invalid_inet_get_option_improper_list() ->
+ [{doc,"Test handling of invalid type in getopts"}].
invalid_inet_get_option_improper_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1032,7 +817,7 @@ invalid_inet_get_option_improper_list(Config) when is_list(Config) ->
{mfa, {ssl_test_lib, no_result, []}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok),
@@ -1045,11 +830,8 @@ get_invalid_inet_option_improper_list(Socket) ->
ok.
%%--------------------------------------------------------------------
-invalid_inet_set_option(doc) ->
- ["Test handling of invalid inet options in setopts"];
-
-invalid_inet_set_option(suite) ->
- [];
+invalid_inet_set_option() ->
+ [{doc,"Test handling of invalid inet options in setopts"}].
invalid_inet_set_option(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1066,7 +848,7 @@ invalid_inet_set_option(Config) when is_list(Config) ->
{mfa, {ssl_test_lib, no_result, []}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok),
@@ -1080,11 +862,8 @@ set_invalid_inet_option(Socket) ->
{error, {eoptions, {inet_opt, {mode, foo}}}} = ssl:setopts(Socket, [{mode, foo}]),
ok.
%%--------------------------------------------------------------------
-invalid_inet_set_option_not_list(doc) ->
- ["Test handling of invalid type in setopts"];
-
-invalid_inet_set_option_not_list(suite) ->
- [];
+invalid_inet_set_option_not_list() ->
+ [{doc,"Test handling of invalid type in setopts"}].
invalid_inet_set_option_not_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1101,7 +880,7 @@ invalid_inet_set_option_not_list(Config) when is_list(Config) ->
{mfa, {ssl_test_lib, no_result, []}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok),
@@ -1115,11 +894,8 @@ set_invalid_inet_option_not_list(Socket) ->
ok.
%%--------------------------------------------------------------------
-invalid_inet_set_option_improper_list(doc) ->
- ["Test handling of invalid tye in setopts"];
-
-invalid_inet_set_option_improper_list(suite) ->
- [];
+invalid_inet_set_option_improper_list() ->
+ [{doc,"Test handling of invalid tye in setopts"}].
invalid_inet_set_option_improper_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1136,7 +912,7 @@ invalid_inet_set_option_improper_list(Config) when is_list(Config) ->
{mfa, {ssl_test_lib, no_result, []}},
{options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok),
@@ -1149,11 +925,8 @@ set_invalid_inet_option_improper_list(Socket) ->
ok.
%%--------------------------------------------------------------------
-misc_ssl_options(doc) ->
- ["Test what happens when we give valid options"];
-
-misc_ssl_options(suite) ->
- [];
+misc_ssl_options() ->
+ [{doc,"Test what happens when we give valid options"}].
misc_ssl_options(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1171,17 +944,17 @@ misc_ssl_options(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options, TestOpts ++ ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
Client =
ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options, TestOpts ++ ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok, Client, ok),
@@ -1189,23 +962,16 @@ misc_ssl_options(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-versions(doc) ->
- ["Test API function versions/0"];
-
-versions(suite) ->
- [];
+versions() ->
+ [{doc,"Test API function versions/0"}].
versions(Config) when is_list(Config) ->
[_|_] = Versions = ssl:versions(),
- test_server:format("~p~n", [Versions]).
+ ct:print("~p~n", [Versions]).
%%--------------------------------------------------------------------
-send_recv(doc) ->
- [""];
-
-send_recv(suite) ->
- [];
-
+send_recv() ->
+ [{doc,""}].
send_recv(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1213,17 +979,17 @@ send_recv(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
Client =
ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ClientOpts]}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok, Client, ok),
@@ -1232,12 +998,8 @@ send_recv(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-send_close(doc) ->
- [""];
-
-send_close(suite) ->
- [];
-
+send_close() ->
+ [{doc,""}].
send_close(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1245,7 +1007,7 @@ send_close(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
{ok, TcpS} = rpc:call(ClientNode, gen_tcp, connect,
@@ -1253,7 +1015,7 @@ send_close(Config) when is_list(Config) ->
{ok, SslS} = rpc:call(ClientNode, ssl, connect,
[TcpS,[{active, false}|ClientOpts]]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), self(), Server]),
ok = ssl:send(SslS, "Hello world"),
{ok,<<"Hello world">>} = ssl:recv(SslS, 11),
@@ -1261,11 +1023,8 @@ send_close(Config) when is_list(Config) ->
{error, _} = ssl:send(SslS, "Hello world").
%%--------------------------------------------------------------------
-close_transport_accept(doc) ->
- ["Tests closing ssl socket when waiting on ssl:transport_accept/1"];
-
-close_transport_accept(suite) ->
- [];
+close_transport_accept() ->
+ [{doc,"Tests closing ssl socket when waiting on ssl:transport_accept/1"}].
close_transport_accept(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
@@ -1275,7 +1034,7 @@ close_transport_accept(Config) when is_list(Config) ->
Opts = [{active, false} | ServerOpts],
{ok, ListenSocket} = rpc:call(ServerNode, ssl, listen, [Port, Opts]),
spawn_link(fun() ->
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
rpc:call(ServerNode, ssl, close, [ListenSocket])
end),
case rpc:call(ServerNode, ssl, transport_accept, [ListenSocket]) of
@@ -1286,11 +1045,8 @@ close_transport_accept(Config) when is_list(Config) ->
end.
%%--------------------------------------------------------------------
-dh_params(doc) ->
- ["Test to specify DH-params file in server."];
-
-dh_params(suite) ->
- [];
+dh_params() ->
+ [{doc,"Test to specify DH-params file in server."}].
dh_params(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1302,13 +1058,13 @@ dh_params(Config) when is_list(Config) ->
Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options, [{dhfile, DHParamFile} | ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options,
[{ciphers,[{dhe_rsa,aes_256_cbc,sha,ignore}]} |
ClientOpts]}]),
@@ -1319,11 +1075,8 @@ dh_params(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-upgrade(doc) ->
- ["Test that you can upgrade an tcp connection to an ssl connection"];
-
-upgrade(suite) ->
- [];
+upgrade() ->
+ [{doc,"Test that you can upgrade an tcp connection to an ssl connection"}].
upgrade(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1347,7 +1100,7 @@ upgrade(Config) when is_list(Config) ->
{tcp_options, TcpOpts},
{ssl_options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok, Client, ok),
@@ -1371,11 +1124,8 @@ upgrade_result(Socket) ->
end.
%%--------------------------------------------------------------------
-upgrade_with_timeout(doc) ->
- ["Test ssl_accept/3"];
-
-upgrade_with_timeout(suite) ->
- [];
+upgrade_with_timeout() ->
+ [{doc,"Test ssl_accept/3"}].
upgrade_with_timeout(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1400,7 +1150,7 @@ upgrade_with_timeout(Config) when is_list(Config) ->
{tcp_options, TcpOpts},
{ssl_options, ClientOpts}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok, Client, ok),
@@ -1409,11 +1159,8 @@ upgrade_with_timeout(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-tcp_connect(doc) ->
- ["Test what happens when a tcp tries to connect, i,e. a bad (ssl) packet is sent first"];
-
-tcp_connect(suite) ->
- [];
+tcp_connect() ->
+ [{doc,"Test what happens when a tcp tries to connect, i,e. a bad (ssl) packet is sent first"}].
tcp_connect(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
@@ -1429,22 +1176,19 @@ tcp_connect(Config) when is_list(Config) ->
Port = ssl_test_lib:inet_port(Server),
{ok, Socket} = gen_tcp:connect(Hostname, Port, [binary, {packet, 0}]),
- test_server:format("Testcase ~p connected to Server ~p ~n", [self(), Server]),
+ ct:print("Testcase ~p connected to Server ~p ~n", [self(), Server]),
gen_tcp:send(Socket, "<SOME GARBLED NON SSL MESSAGE>"),
receive
{tcp_closed, Socket} ->
receive
{Server, {error, Error}} ->
- test_server:format("Error ~p", [Error])
+ ct:print("Error ~p", [Error])
end
end.
-
-tcp_connect_big(doc) ->
- ["Test what happens when a tcp tries to connect, i,e. a bad big (ssl) packet is sent first"];
-
-tcp_connect_big(suite) ->
- [];
+%%--------------------------------------------------------------------
+tcp_connect_big() ->
+ [{doc,"Test what happens when a tcp tries to connect, i,e. a bad big (ssl) packet is sent first"}].
tcp_connect_big(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
@@ -1460,7 +1204,7 @@ tcp_connect_big(Config) when is_list(Config) ->
Port = ssl_test_lib:inet_port(Server),
{ok, Socket} = gen_tcp:connect(Hostname, Port, [binary, {packet, 0}]),
- test_server:format("Testcase ~p connected to Server ~p ~n", [self(), Server]),
+ ct:print("Testcase ~p connected to Server ~p ~n", [self(), Server]),
Rand = crypto:rand_bytes(?MAX_CIPHER_TEXT_LENGTH+1),
gen_tcp:send(Socket, <<?BYTE(0),
@@ -1470,24 +1214,16 @@ tcp_connect_big(Config) when is_list(Config) ->
{tcp_closed, Socket} ->
receive
{Server, {error, timeout}} ->
- test_server:fail("hangs");
+ ct:fail("hangs");
{Server, {error, Error}} ->
- test_server:format("Error ~p", [Error])
+ ct:print("Error ~p", [Error])
end
end.
-dummy(_Socket) ->
- %% Should not happen as the ssl connection will not be established
- %% due to fatal handshake failiure
- exit(kill).
-
%%--------------------------------------------------------------------
ipv6() ->
- [{require, ipv6_hosts}].
-ipv6(doc) ->
- ["Test ipv6."];
-ipv6(suite) ->
- [];
+ [{require, ipv6_hosts},
+ {doc,"Test ipv6."}].
ipv6(Config) when is_list(Config) ->
{ok, Hostname0} = inet:gethostname(),
@@ -1499,18 +1235,18 @@ ipv6(Config) when is_list(Config) ->
ssl_test_lib:run_where(Config, ipv6),
Server = ssl_test_lib:start_server([{node, ServerNode},
{port, 0}, {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options,
[inet6, {active, false} | ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
Client = ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options,
[inet6, {active, false} | ClientOpts]}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok, Client, ok),
@@ -1523,12 +1259,8 @@ ipv6(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-ekeyfile(doc) ->
- ["Test what happens with an invalid key file"];
-
-ekeyfile(suite) ->
- [];
-
+ekeyfile() ->
+ [{doc,"Test what happens with an invalid key file"}].
ekeyfile(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
BadOpts = ?config(server_bad_key, Config),
@@ -1551,11 +1283,8 @@ ekeyfile(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-ecertfile(doc) ->
- ["Test what happens with an invalid cert file"];
-
-ecertfile(suite) ->
- [];
+ecertfile() ->
+ [{doc,"Test what happens with an invalid cert file"}].
ecertfile(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1580,11 +1309,8 @@ ecertfile(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-ecacertfile(doc) ->
- ["Test what happens with an invalid cacert file"];
-
-ecacertfile(suite) ->
- [];
+ecacertfile() ->
+ [{doc,"Test what happens with an invalid cacert file"}].
ecacertfile(Config) when is_list(Config) ->
ClientOpts = [{reuseaddr, true}|?config(client_opts, Config)],
@@ -1632,12 +1358,9 @@ ecacertfile(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-eoptions(doc) ->
- ["Test what happens when we give invalid options"];
+eoptions() ->
+ [{doc,"Test what happens when we give invalid options"}].
-eoptions(suite) ->
- [];
-
eoptions(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1694,12 +1417,8 @@ eoptions(Config) when is_list(Config) ->
ok.
%%--------------------------------------------------------------------
-shutdown(doc) ->
- [""];
-
-shutdown(suite) ->
- [];
-
+shutdown() ->
+ [{doc,"Test API function ssl:shutdown/2"}].
shutdown(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1724,25 +1443,9 @@ shutdown(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-shutdown_result(Socket, server) ->
- ssl:send(Socket, "Hej"),
- ssl:shutdown(Socket, write),
- {ok, "Hej hopp"} = ssl:recv(Socket, 8),
- ok;
-
-shutdown_result(Socket, client) ->
- {ok, "Hej"} = ssl:recv(Socket, 3),
- ssl:send(Socket, "Hej hopp"),
- ssl:shutdown(Socket, write),
- ok.
-
%%--------------------------------------------------------------------
-shutdown_write(doc) ->
- [""];
-
-shutdown_write(suite) ->
- [];
-
+shutdown_write() ->
+ [{doc,"Test API function ssl:shutdown/2 with option write."}].
shutdown_write(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1759,20 +1462,10 @@ shutdown_write(Config) when is_list(Config) ->
{options, [{active, false} | ClientOpts]}]),
ssl_test_lib:check_result(Server, ok, Client, {error, closed}).
-
-shutdown_write_result(Socket, server) ->
- test_server:sleep(?SLEEP),
- ssl:shutdown(Socket, write);
-shutdown_write_result(Socket, client) ->
- ssl:recv(Socket, 0).
%%--------------------------------------------------------------------
-shutdown_both(doc) ->
- [""];
-
-shutdown_both(suite) ->
- [];
-
+shutdown_both() ->
+ [{doc,"Test API function ssl:shutdown/2 with option both."}].
shutdown_both(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1790,19 +1483,9 @@ shutdown_both(Config) when is_list(Config) ->
ssl_test_lib:check_result(Server, ok, Client, {error, closed}).
-shutdown_both_result(Socket, server) ->
- test_server:sleep(?SLEEP),
- ssl:shutdown(Socket, read_write);
-shutdown_both_result(Socket, client) ->
- ssl:recv(Socket, 0).
-
%%--------------------------------------------------------------------
-shutdown_error(doc) ->
- [""];
-
-shutdown_error(suite) ->
- [];
-
+shutdown_error() ->
+ [{doc,"Test ssl:shutdown/2 error handling"}].
shutdown_error(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
Port = ssl_test_lib:inet_port(node()),
@@ -1812,141 +1495,60 @@ shutdown_error(Config) when is_list(Config) ->
{error, closed} = ssl:shutdown(Listen, read_write).
%%-------------------------------------------------------------------
-ciphers_rsa_signed_certs(doc) ->
- ["Test all rsa ssl cipher suites in highest support ssl/tls version"];
+ciphers_rsa_signed_certs() ->
+ [{doc,"Test all rsa ssl cipher suites in highest support ssl/tls version"}].
-ciphers_rsa_signed_certs(suite) ->
- [];
-
ciphers_rsa_signed_certs(Config) when is_list(Config) ->
Version =
ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
Ciphers = ssl_test_lib:rsa_suites(),
- test_server:format("~p erlang cipher suites ~p~n", [Version, Ciphers]),
+ ct:print("~p erlang cipher suites ~p~n", [Version, Ciphers]),
run_suites(Ciphers, Version, Config, rsa).
-
-ciphers_rsa_signed_certs_openssl_names(doc) ->
- ["Test all rsa ssl cipher suites in highest support ssl/tls version"];
+%%-------------------------------------------------------------------
+ciphers_rsa_signed_certs_openssl_names() ->
+ [{doc,"Test all rsa ssl cipher suites in highest support ssl/tls version"}].
-ciphers_rsa_signed_certs_openssl_names(suite) ->
- [];
-
ciphers_rsa_signed_certs_openssl_names(Config) when is_list(Config) ->
Version =
ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
Ciphers = ssl_test_lib:openssl_rsa_suites(),
- test_server:format("tls1 openssl cipher suites ~p~n", [Ciphers]),
+ ct:print("tls1 openssl cipher suites ~p~n", [Ciphers]),
run_suites(Ciphers, Version, Config, rsa).
-
-ciphers_dsa_signed_certs(doc) ->
- ["Test all dsa ssl cipher suites in highest support ssl/tls version"];
+%%-------------------------------------------------------------------
+ciphers_dsa_signed_certs() ->
+ [{doc,"Test all dsa ssl cipher suites in highest support ssl/tls version"}].
-ciphers_dsa_signed_certs(suite) ->
- [];
-
ciphers_dsa_signed_certs(Config) when is_list(Config) ->
Version =
ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
Ciphers = ssl_test_lib:dsa_suites(),
- test_server:format("~p erlang cipher suites ~p~n", [Version, Ciphers]),
+ ct:print("~p erlang cipher suites ~p~n", [Version, Ciphers]),
run_suites(Ciphers, Version, Config, dsa).
-
-ciphers_dsa_signed_certs_openssl_names(doc) ->
- ["Test all dsa ssl cipher suites in highest support ssl/tls version"];
+%%-------------------------------------------------------------------
+ciphers_dsa_signed_certs_openssl_names() ->
+ [{doc,"Test all dsa ssl cipher suites in highest support ssl/tls version"}].
-ciphers_dsa_signed_certs_openssl_names(suite) ->
- [];
-
ciphers_dsa_signed_certs_openssl_names(Config) when is_list(Config) ->
Version =
ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
Ciphers = ssl_test_lib:openssl_dsa_suites(),
- test_server:format("tls1 openssl cipher suites ~p~n", [Ciphers]),
+ ct:print("tls1 openssl cipher suites ~p~n", [Ciphers]),
run_suites(Ciphers, Version, Config, dsa).
-
-anonymous_cipher_suites(doc)->
- ["Test the anonymous ciphersuites"];
-anonymous_cipher_suites(suite) ->
- [];
+%%-------------------------------------------------------------------
+anonymous_cipher_suites()->
+ [{doc,"Test the anonymous ciphersuites"}].
anonymous_cipher_suites(Config) when is_list(Config) ->
Version = ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
Ciphers = ssl_test_lib:anonymous_suites(),
run_suites(Ciphers, Version, Config, anonymous).
-run_suites(Ciphers, Version, Config, Type) ->
- {ClientOpts, ServerOpts} =
- case Type of
- rsa ->
- {?config(client_opts, Config),
- ?config(server_opts, Config)};
- dsa ->
- {?config(client_opts, Config),
- ?config(server_dsa_opts, Config)};
- anonymous ->
- %% No certs in opts!
- {?config(client_opts, Config),
- ?config(server_anon, Config)}
- end,
-
- Result = lists:map(fun(Cipher) ->
- cipher(Cipher, Version, Config, ClientOpts, ServerOpts) end,
- Ciphers),
- case lists:flatten(Result) of
- [] ->
- ok;
- Error ->
- test_server:format("Cipher suite errors: ~p~n", [Error]),
- test_server:fail(cipher_suite_failed_see_test_case_log)
- end.
-
-erlang_cipher_suite(Suite) when is_list(Suite)->
- ssl:suite_definition(ssl_cipher:openssl_suite(Suite));
-erlang_cipher_suite(Suite) ->
- Suite.
-
-cipher(CipherSuite, Version, Config, ClientOpts, ServerOpts) ->
- %% process_flag(trap_exit, true),
- test_server:format("Testing CipherSuite ~p~n", [CipherSuite]),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- ErlangCipherSuite = erlang_cipher_suite(CipherSuite),
-
- ConnectionInfo = {ok, {Version, ErlangCipherSuite}},
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {ssl_test_lib, cipher_result, [ConnectionInfo]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib, cipher_result, [ConnectionInfo]}},
- {options,
- [{ciphers,[CipherSuite]} |
- ClientOpts]}]),
-
- Result = ssl_test_lib:wait_for_result(Server, ok, Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client),
-
- case Result of
- ok ->
- [];
- Error ->
- [{ErlangCipherSuite, Error}]
- end.
-
%%--------------------------------------------------------------------
-default_reject_anonymous(doc)->
- ["Test that by default anonymous cipher suites are rejected "];
-default_reject_anonymous(suite) ->
- [];
+default_reject_anonymous()->
+ [{doc,"Test that by default anonymous cipher suites are rejected "}].
default_reject_anonymous(Config) when is_list(Config) ->
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
ClientOpts = ?config(client_opts, Config),
@@ -1969,12 +1571,8 @@ default_reject_anonymous(Config) when is_list(Config) ->
Client, {error, "insufficient security"}).
%%--------------------------------------------------------------------
-reuse_session(doc) ->
- ["Test reuse of sessions (short handshake)"];
-
-reuse_session(suite) ->
- [];
-
+reuse_session() ->
+ [{doc,"Test reuse of sessions (short handshake)"}].
reuse_session(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2000,7 +1598,7 @@ reuse_session(Config) when is_list(Config) ->
Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
@@ -2011,9 +1609,9 @@ reuse_session(Config) when is_list(Config) ->
{Client1, SessionInfo} ->
ok;
{Client1, Other} ->
- test_server:format("Expected: ~p, Unexpected: ~p~n",
+ ct:print("Expected: ~p, Unexpected: ~p~n",
[SessionInfo, Other]),
- test_server:fail(session_not_reused)
+ ct:fail(session_not_reused)
end,
Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
@@ -2026,7 +1624,7 @@ reuse_session(Config) when is_list(Config) ->
| ClientOpts]}]),
receive
{Client2, SessionInfo} ->
- test_server:fail(
+ ct:fail(
session_reused_when_session_reuse_disabled_by_client);
{Client2, _} ->
ok
@@ -2056,7 +1654,7 @@ reuse_session(Config) when is_list(Config) ->
Server1 ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Client4 =
ssl_test_lib:start_client([{node, ClientNode},
@@ -2066,10 +1664,10 @@ reuse_session(Config) when is_list(Config) ->
receive
{Client4, SessionInfo1} ->
- test_server:fail(
+ ct:fail(
session_reused_when_session_reuse_disabled_by_server);
{Client4, _Other} ->
- test_server:format("OTHER: ~p ~n", [_Other]),
+ ct:print("OTHER: ~p ~n", [_Other]),
ok
end,
@@ -2081,12 +1679,8 @@ reuse_session(Config) when is_list(Config) ->
ssl_test_lib:close(Client4).
%%--------------------------------------------------------------------
-reuse_session_expired(doc) ->
- ["Test sessions is not reused when it has expired"];
-
-reuse_session_expired(suite) ->
- [];
-
+reuse_session_expired() ->
+ [{doc,"Test sessions is not reused when it has expired"}].
reuse_session_expired(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2112,7 +1706,7 @@ reuse_session_expired(Config) when is_list(Config) ->
Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
@@ -2123,15 +1717,15 @@ reuse_session_expired(Config) when is_list(Config) ->
{Client1, SessionInfo} ->
ok;
{Client1, Other} ->
- test_server:format("Expected: ~p, Unexpected: ~p~n",
+ ct:print("Expected: ~p, Unexpected: ~p~n",
[SessionInfo, Other]),
- test_server:fail(session_not_reused)
+ ct:fail(session_not_reused)
end,
Server ! listen,
%% Make sure session is unregistered due to expiration
- test_server:sleep((?EXPIRE+1)),
+ ct:sleep((?EXPIRE+1)),
[{session_id, Id} |_] = SessionInfo,
make_sure_expired(Hostname, Port, Id),
@@ -2143,7 +1737,7 @@ reuse_session_expired(Config) when is_list(Config) ->
{from, self()}, {options, ClientOpts}]),
receive
{Client2, SessionInfo} ->
- test_server:fail(session_reused_when_session_expired);
+ ct:fail(session_reused_when_session_expired);
{Client2, _} ->
ok
end,
@@ -2165,17 +1759,13 @@ make_sure_expired(Host, Port, Id) ->
#session{is_resumable = false} ->
ok;
_ ->
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
make_sure_expired(Host, Port, Id)
end.
%%--------------------------------------------------------------------
-server_does_not_want_to_reuse_session(doc) ->
- ["Test reuse of sessions (short handshake)"];
-
-server_does_not_want_to_reuse_session(suite) ->
- [];
-
+server_does_not_want_to_reuse_session() ->
+ [{doc,"Test reuse of sessions (short handshake)"}].
server_does_not_want_to_reuse_session(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2204,7 +1794,7 @@ server_does_not_want_to_reuse_session(Config) when is_list(Config) ->
Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
ssl_test_lib:close(Client0),
Client1 =
@@ -2214,7 +1804,7 @@ server_does_not_want_to_reuse_session(Config) when is_list(Config) ->
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
- test_server:fail(session_reused_when_server_does_not_want_to);
+ ct:fail(session_reused_when_server_does_not_want_to);
{Client1, _Other} ->
ok
end,
@@ -2223,512 +1813,55 @@ server_does_not_want_to_reuse_session(Config) when is_list(Config) ->
ssl_test_lib:close(Client1).
%%--------------------------------------------------------------------
-
-server_verify_peer_passive(doc) ->
- ["Test server option verify_peer"];
-
-server_verify_peer_passive(suite) ->
- [];
-
-server_verify_peer_passive(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false}, {verify, verify_peer}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-
-server_verify_peer_active(doc) ->
- ["Test server option verify_peer"];
-
-server_verify_peer_active(suite) ->
- [];
-
-server_verify_peer_active(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{active, true}, {verify, verify_peer}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{active, true} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-server_verify_peer_active_once(doc) ->
- ["Test server option verify_peer"];
-
-server_verify_peer_active_once(suite) ->
- [];
-
-server_verify_peer_active_once(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once}, {verify, verify_peer}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-
-server_verify_none_passive(doc) ->
- ["Test server option verify_none"];
-
-server_verify_none_passive(suite) ->
- [];
-
-server_verify_none_passive(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false}, {verify, verify_none}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-
-server_verify_none_active(doc) ->
- ["Test server option verify_none"];
-
-server_verify_none_active(suite) ->
- [];
-
-server_verify_none_active(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{active, true}, {verify, verify_none} |
- ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{active, true} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-server_verify_none_active_once(doc) ->
- ["Test server option verify_none"];
-
-server_verify_none_active_once(suite) ->
- [];
-
-server_verify_none_active_once(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once}, {verify, verify_none}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-
-server_verify_client_once_passive(doc) ->
- ["Test server option verify_client_once"];
-
-server_verify_client_once_passive(suite) ->
- [];
-
-server_verify_client_once_passive(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false}, {verify, verify_peer},
- {verify_client_once, true}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client0 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client0, ok),
- Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
- ssl_test_lib:close(Client0),
- Client1 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, result_ok, []}},
- {options, [{active, false} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Client1, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client1).
-
-%%--------------------------------------------------------------------
-
-server_verify_client_once_active(doc) ->
- ["Test server option verify_client_once"];
-
-server_verify_client_once_active(suite) ->
- [];
-
-server_verify_client_once_active(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{active, true}, {verify, verify_peer},
- {verify_client_once, true}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client0 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{active, true} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client0, ok),
- Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
- ssl_test_lib:close(Client0),
- Client1 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, result_ok, []}},
- {options, [{active, true} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Client1, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client1).
-
-%%--------------------------------------------------------------------
-
-server_verify_client_once_active_once(doc) ->
- ["Test server option verify_client_once"];
-
-server_verify_client_once_active_once(suite) ->
- [];
-
-server_verify_client_once_active_once(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once}, {verify, verify_peer},
- {verify_client_once, true}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client0 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client0, ok),
- Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
- ssl_test_lib:close(Client0),
- Client1 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, result_ok, []}},
- {options, [{active, once} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Client1, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client1).
-
-%%--------------------------------------------------------------------
-
-server_verify_no_cacerts(doc) ->
- ["Test server must have cacerts if it wants to verify client"];
-
-server_verify_no_cacerts(suite) ->
- [];
-server_verify_no_cacerts(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- {_, ServerNode, _} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {options, [{verify, verify_peer}
- | ServerOpts]}]),
-
- ssl_test_lib:check_result(Server, {error, {eoptions, {cacertfile, ""}}}).
-
-%%--------------------------------------------------------------------
-
-server_require_peer_cert_ok(doc) ->
- ["Test server option fail_if_no_peer_cert when peer sends cert"];
-
-server_require_peer_cert_ok(suite) ->
- [];
-
-server_require_peer_cert_ok(Config) when is_list(Config) ->
- ServerOpts = [{verify, verify_peer}, {fail_if_no_peer_cert, true}
- | ?config(server_verification_opts, Config)],
- ClientOpts = ?config(client_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false} | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-
-server_require_peer_cert_fail(doc) ->
- ["Test server option fail_if_no_peer_cert when peer doesn't send cert"];
-
-server_require_peer_cert_fail(suite) ->
- [];
-
-server_require_peer_cert_fail(Config) when is_list(Config) ->
- ServerOpts = [{verify, verify_peer}, {fail_if_no_peer_cert, true}
- | ?config(server_verification_opts, Config)],
- BadClientOpts = ?config(client_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {options, [{active, false} | ServerOpts]}]),
-
- Port = ssl_test_lib:inet_port(Server),
-
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {options, [{active, false} | BadClientOpts]}]),
-
- ssl_test_lib:check_result(Server, {error, esslaccept},
- Client, {error, esslconnect}).
-
-%%--------------------------------------------------------------------
-
-client_verify_none_passive(doc) ->
- ["Test client option verify_none"];
-
-client_verify_none_passive(suite) ->
- [];
-
-client_verify_none_passive(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
-
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
- {options, [{active, false},
- {verify, verify_none}
- | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-
-client_verify_none_active(doc) ->
- ["Test client option verify_none"];
-
-client_verify_none_active(suite) ->
- [];
-
-client_verify_none_active(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, [{active, true}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, [{active, true},
- {verify, verify_none}
- | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-client_verify_none_active_once(doc) ->
- ["Test client option verify_none"];
-
-client_verify_none_active_once(suite) ->
- [];
-
-client_verify_none_active_once(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active_once, []}},
- {options, [{active, once} | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
-
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active_once,
- []}},
- {options, [{active, once},
- {verify, verify_none}
- | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-client_renegotiate(doc) ->
- ["Test ssl:renegotiate/1 on client."];
-
-client_renegotiate(suite) ->
- [];
-
+client_renegotiate() ->
+ [{doc,"Test ssl:renegotiate/1 on client."}].
client_renegotiate(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
+
Data = "From erlang to erlang",
- Server =
- ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ Server =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
{mfa, {?MODULE, erlang_ssl_receive, [Data]}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
-
+
Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
+ {from, self()},
+ {mfa, {?MODULE,
renegotiate, [Data]}},
{options, [{reuse_sessions, false} | ClientOpts]}]),
- ssl_test_lib:check_result(Client, ok, Server, ok),
+ ssl_test_lib:check_result(Client, ok, Server, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-server_renegotiate(doc) ->
- ["Test ssl:renegotiate/1 on server."];
-
-server_renegotiate(suite) ->
- [];
-
+server_renegotiate() ->
+ [{doc,"Test ssl:renegotiate/1 on server."}].
server_renegotiate(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
+
Data = "From erlang to erlang",
Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE,
+ {mfa, {?MODULE,
renegotiate, [Data]}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
-
+
Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
- {from, self()},
+ {from, self()},
{mfa, {?MODULE, erlang_ssl_receive, [Data]}},
{options, [{reuse_sessions, false} | ClientOpts]}]),
@@ -2737,805 +1870,133 @@ server_renegotiate(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-client_renegotiate_reused_session(doc) ->
- ["Test ssl:renegotiate/1 on client when the ssl session will be reused."];
-
-client_renegotiate_reused_session(suite) ->
- [];
-
+client_renegotiate_reused_session() ->
+ [{doc,"Test ssl:renegotiate/1 on client when the ssl session will be reused."}].
client_renegotiate_reused_session(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
+
Data = "From erlang to erlang",
- Server =
- ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ Server =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
{mfa, {?MODULE, erlang_ssl_receive, [Data]}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
-
+
Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
+ {from, self()},
+ {mfa, {?MODULE,
renegotiate_reuse_session, [Data]}},
{options, [{reuse_sessions, true} | ClientOpts]}]),
- ssl_test_lib:check_result(Client, ok, Server, ok),
+ ssl_test_lib:check_result(Client, ok, Server, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-server_renegotiate_reused_session(doc) ->
- ["Test ssl:renegotiate/1 on server when the ssl session will be reused."];
-
-server_renegotiate_reused_session(suite) ->
- [];
-
+server_renegotiate_reused_session() ->
+ [{doc,"Test ssl:renegotiate/1 on server when the ssl session will be reused."}].
server_renegotiate_reused_session(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
Data = "From erlang to erlang",
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE,
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE,
renegotiate_reuse_session, [Data]}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
- {from, self()},
+ {from, self()},
{mfa, {?MODULE, erlang_ssl_receive, [Data]}},
{options, [{reuse_sessions, true} | ClientOpts]}]),
-
+
ssl_test_lib:check_result(Server, ok, Client, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-client_no_wrap_sequence_number(doc) ->
- ["Test that erlang client will renegotiate session when",
+client_no_wrap_sequence_number() ->
+ [{doc,"Test that erlang client will renegotiate session when",
"max sequence number celing is about to be reached. Although"
- "in the testcase we use the test option renegotiate_at"
- " to lower treashold substantially."];
-
-client_no_wrap_sequence_number(suite) ->
- [];
+ "in the testcase we use the test option renegotiate_at"
+ " to lower treashold substantially."}].
client_no_wrap_sequence_number(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
+
ErlData = "From erlang to erlang",
N = 10,
- Server =
- ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ Server =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
{mfa, {ssl_test_lib, no_result, []}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
-
+
Version = ssl_record:highest_protocol_version(ssl_record:supported_protocol_versions()),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib,
+ {from, self()},
+ {mfa, {ssl_test_lib,
trigger_renegotiate, [[ErlData, treashold(N, Version)]]}},
{options, [{reuse_sessions, false},
{renegotiate_at, N} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
+
+ ssl_test_lib:check_result(Client, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
- %% First two clauses handles 1/n-1 splitting countermeasure Rizzo/Duong-Beast
-treashold(N, {3,0}) ->
- (N div 2) + 1;
-treashold(N, {3,1}) ->
- (N div 2) + 1;
-treashold(N, _) ->
- N + 1.
-
%%--------------------------------------------------------------------
-server_no_wrap_sequence_number(doc) ->
- ["Test that erlang server will renegotiate session when",
+server_no_wrap_sequence_number() ->
+ [{doc, "Test that erlang server will renegotiate session when",
"max sequence number celing is about to be reached. Although"
- "in the testcase we use the test option renegotiate_at"
- " to lower treashold substantially."];
-
-server_no_wrap_sequence_number(suite) ->
- [];
+ "in the testcase we use the test option renegotiate_at"
+ " to lower treashold substantially."}].
server_no_wrap_sequence_number(Config) when is_list(Config) ->
- ServerOpts = ?config(server_opts, Config),
- ClientOpts = ?config(client_opts, Config),
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Data = "From erlang to erlang",
- N = 10,
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {ssl_test_lib,
- trigger_renegotiate, [[Data, N+2]]}},
- {options, [{renegotiate_at, N} | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
-
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib, no_result, []}},
- {options, [{reuse_sessions, false} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-%%--------------------------------------------------------------------
-extended_key_usage_verify_peer(doc) ->
- ["Test cert that has a critical extended_key_usage extension in verify_peer mode"];
-
-extended_key_usage_verify_peer(suite) ->
- [];
-
-extended_key_usage_verify_peer(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- PrivDir = ?config(priv_dir, Config),
-
- KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
- [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
- Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
-
- ServerCertFile = proplists:get_value(certfile, ServerOpts),
- NewServerCertFile = filename:join(PrivDir, "server/new_cert.pem"),
- [{'Certificate', ServerDerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
- ServerOTPCert = public_key:pkix_decode_cert(ServerDerCert, otp),
- ServerExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-serverAuth']},
- ServerOTPTbsCert = ServerOTPCert#'OTPCertificate'.tbsCertificate,
- ServerExtensions = ServerOTPTbsCert#'OTPTBSCertificate'.extensions,
- NewServerOTPTbsCert = ServerOTPTbsCert#'OTPTBSCertificate'{extensions =
- [ServerExtKeyUsageExt |
- ServerExtensions]},
- NewServerDerCert = public_key:pkix_sign(NewServerOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
- NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
-
- ClientCertFile = proplists:get_value(certfile, ClientOpts),
- NewClientCertFile = filename:join(PrivDir, "client/new_cert.pem"),
- [{'Certificate', ClientDerCert, _}] = ssl_test_lib:pem_to_der(ClientCertFile),
- ClientOTPCert = public_key:pkix_decode_cert(ClientDerCert, otp),
- ClientExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-clientAuth']},
- ClientOTPTbsCert = ClientOTPCert#'OTPCertificate'.tbsCertificate,
- ClientExtensions = ClientOTPTbsCert#'OTPTBSCertificate'.extensions,
- NewClientOTPTbsCert = ClientOTPTbsCert#'OTPTBSCertificate'{extensions =
- [ClientExtKeyUsageExt |
- ClientExtensions]},
- NewClientDerCert = public_key:pkix_sign(NewClientOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewClientCertFile, [{'Certificate', NewClientDerCert, not_encrypted}]),
- NewClientOpts = [{certfile, NewClientCertFile} | proplists:delete(certfile, ClientOpts)],
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{verify, verify_peer} | NewServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{verify, verify_peer} | NewClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-extended_key_usage_verify_none(doc) ->
- ["Test cert that has a critical extended_key_usage extension in verify_none mode"];
-
-extended_key_usage_verify_none(suite) ->
- [];
-
-extended_key_usage_verify_none(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- PrivDir = ?config(priv_dir, Config),
-
- KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
- [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
- Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
-
- ServerCertFile = proplists:get_value(certfile, ServerOpts),
- NewServerCertFile = filename:join(PrivDir, "server/new_cert.pem"),
- [{'Certificate', ServerDerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
- ServerOTPCert = public_key:pkix_decode_cert(ServerDerCert, otp),
- ServerExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-serverAuth']},
- ServerOTPTbsCert = ServerOTPCert#'OTPCertificate'.tbsCertificate,
- ServerExtensions = ServerOTPTbsCert#'OTPTBSCertificate'.extensions,
- NewServerOTPTbsCert = ServerOTPTbsCert#'OTPTBSCertificate'{extensions =
- [ServerExtKeyUsageExt |
- ServerExtensions]},
- NewServerDerCert = public_key:pkix_sign(NewServerOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
- NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
-
- ClientCertFile = proplists:get_value(certfile, ClientOpts),
- NewClientCertFile = filename:join(PrivDir, "client/new_cert.pem"),
- [{'Certificate', ClientDerCert, _}] = ssl_test_lib:pem_to_der(ClientCertFile),
- ClientOTPCert = public_key:pkix_decode_cert(ClientDerCert, otp),
- ClientExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-clientAuth']},
- ClientOTPTbsCert = ClientOTPCert#'OTPCertificate'.tbsCertificate,
- ClientExtensions = ClientOTPTbsCert#'OTPTBSCertificate'.extensions,
- NewClientOTPTbsCert = ClientOTPTbsCert#'OTPTBSCertificate'{extensions =
- [ClientExtKeyUsageExt |
- ClientExtensions]},
- NewClientDerCert = public_key:pkix_sign(NewClientOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewClientCertFile, [{'Certificate', NewClientDerCert, not_encrypted}]),
- NewClientOpts = [{certfile, NewClientCertFile} | proplists:delete(certfile, ClientOpts)],
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{verify, verify_none} | NewServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{verify, verify_none} | NewClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-no_authority_key_identifier(doc) ->
- ["Test cert that does not have authorityKeyIdentifier extension"
- " but are present in trusted certs db."];
-
-no_authority_key_identifier(suite) ->
- [];
-no_authority_key_identifier(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
ServerOpts = ?config(server_opts, Config),
- PrivDir = ?config(priv_dir, Config),
-
- KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
- [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
- Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
-
- CertFile = proplists:get_value(certfile, ServerOpts),
- NewCertFile = filename:join(PrivDir, "server/new_cert.pem"),
- [{'Certificate', DerCert, _}] = ssl_test_lib:pem_to_der(CertFile),
- OTPCert = public_key:pkix_decode_cert(DerCert, otp),
- OTPTbsCert = OTPCert#'OTPCertificate'.tbsCertificate,
- Extensions = OTPTbsCert#'OTPTBSCertificate'.extensions,
- NewExtensions = delete_authority_key_extension(Extensions, []),
- NewOTPTbsCert = OTPTbsCert#'OTPTBSCertificate'{extensions = NewExtensions},
-
- test_server:format("Extensions ~p~n, NewExtensions: ~p~n", [Extensions, NewExtensions]),
-
- NewDerCert = public_key:pkix_sign(NewOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewCertFile, [{'Certificate', NewDerCert, not_encrypted}]),
- NewServerOpts = [{certfile, NewCertFile} | proplists:delete(certfile, ServerOpts)],
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, NewServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
- {options, [{verify, verify_peer} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-delete_authority_key_extension([], Acc) ->
- lists:reverse(Acc);
-delete_authority_key_extension([#'Extension'{extnID = ?'id-ce-authorityKeyIdentifier'} | Rest],
- Acc) ->
- delete_authority_key_extension(Rest, Acc);
-delete_authority_key_extension([Head | Rest], Acc) ->
- delete_authority_key_extension(Rest, [Head | Acc]).
-
-%%--------------------------------------------------------------------
-
-invalid_signature_server(doc) ->
- ["Test server with invalid signature"];
-
-invalid_signature_server(suite) ->
- [];
-
-invalid_signature_server(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- PrivDir = ?config(priv_dir, Config),
-
- KeyFile = filename:join(PrivDir, "server/key.pem"),
- [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
- Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
-
- ServerCertFile = proplists:get_value(certfile, ServerOpts),
- NewServerCertFile = filename:join(PrivDir, "server/invalid_cert.pem"),
- [{'Certificate', ServerDerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
- ServerOTPCert = public_key:pkix_decode_cert(ServerDerCert, otp),
- ServerOTPTbsCert = ServerOTPCert#'OTPCertificate'.tbsCertificate,
- NewServerDerCert = public_key:pkix_sign(ServerOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
- NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {options, NewServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {options, [{verify, verify_peer} | ClientOpts]}]),
-
- tcp_delivery_workaround(Server, {error, "bad certificate"},
- Client, {error,"bad certificate"}).
-
-%%--------------------------------------------------------------------
-
-invalid_signature_client(doc) ->
- ["Test server with invalid signature"];
-
-invalid_signature_client(suite) ->
- [];
-
-invalid_signature_client(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- PrivDir = ?config(priv_dir, Config),
-
- KeyFile = filename:join(PrivDir, "client/key.pem"),
- [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
- Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
-
- ClientCertFile = proplists:get_value(certfile, ClientOpts),
- NewClientCertFile = filename:join(PrivDir, "client/invalid_cert.pem"),
- [{'Certificate', ClientDerCert, _}] = ssl_test_lib:pem_to_der(ClientCertFile),
- ClientOTPCert = public_key:pkix_decode_cert(ClientDerCert, otp),
- ClientOTPTbsCert = ClientOTPCert#'OTPCertificate'.tbsCertificate,
- NewClientDerCert = public_key:pkix_sign(ClientOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewClientCertFile, [{'Certificate', NewClientDerCert, not_encrypted}]),
- NewClientOpts = [{certfile, NewClientCertFile} | proplists:delete(certfile, ClientOpts)],
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {options, [{verify, verify_peer} | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {options, NewClientOpts}]),
-
- tcp_delivery_workaround(Server, {error, "bad certificate"},
- Client, {error,"bad certificate"}).
-
-tcp_delivery_workaround(Server, ServerMsg, Client, ClientMsg) ->
- receive
- {Server, ServerMsg} ->
- client_msg(Client, ClientMsg);
- {Client, ClientMsg} ->
- server_msg(Server, ServerMsg);
- {Client, {error,closed}} ->
- server_msg(Server, ServerMsg);
- {Server, {error,closed}} ->
- client_msg(Client, ClientMsg);
- {Client, {error, esslconnect}} ->
- server_msg(Server, ServerMsg);
- {Server, {error, esslaccept}} ->
- client_msg(Client, ClientMsg)
- end.
-
-client_msg(Client, ClientMsg) ->
- receive
- {Client, ClientMsg} ->
- ok;
- {Client, {error,closed}} ->
- test_server:format("client got close"),
- ok;
- {Client, {error, esslconnect}} ->
- test_server:format("client got econnaborted"),
- ok;
- Unexpected ->
- test_server:fail(Unexpected)
- end.
-
-server_msg(Server, ServerMsg) ->
- receive
- {Server, ServerMsg} ->
- ok;
- {Server, {error,closed}} ->
- test_server:format("server got close"),
- ok;
- {Server, {error, esslaccept}} ->
- test_server:format("server got econnaborted"),
- ok;
- Unexpected ->
- test_server:fail(Unexpected)
- end.
-
-%%--------------------------------------------------------------------
-cert_expired(doc) ->
- ["Test server with invalid signature"];
-
-cert_expired(suite) ->
- [];
-
-cert_expired(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- PrivDir = ?config(priv_dir, Config),
-
- KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
- [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
- Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
-
- ServerCertFile = proplists:get_value(certfile, ServerOpts),
- NewServerCertFile = filename:join(PrivDir, "server/expired_cert.pem"),
- [{'Certificate', DerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
- OTPCert = public_key:pkix_decode_cert(DerCert, otp),
- OTPTbsCert = OTPCert#'OTPCertificate'.tbsCertificate,
-
- {Year, Month, Day} = date(),
- {Hours, Min, Sec} = time(),
- NotBeforeStr = lists:flatten(io_lib:format("~p~s~s~s~s~sZ",[Year-2,
- two_digits_str(Month),
- two_digits_str(Day),
- two_digits_str(Hours),
- two_digits_str(Min),
- two_digits_str(Sec)])),
- NotAfterStr = lists:flatten(io_lib:format("~p~s~s~s~s~sZ",[Year-1,
- two_digits_str(Month),
- two_digits_str(Day),
- two_digits_str(Hours),
- two_digits_str(Min),
- two_digits_str(Sec)])),
- NewValidity = {'Validity', {generalTime, NotBeforeStr}, {generalTime, NotAfterStr}},
-
- test_server:format("Validity: ~p ~n NewValidity: ~p ~n",
- [OTPTbsCert#'OTPTBSCertificate'.validity, NewValidity]),
-
- NewOTPTbsCert = OTPTbsCert#'OTPTBSCertificate'{validity = NewValidity},
- NewServerDerCert = public_key:pkix_sign(NewOTPTbsCert, Key),
- ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
- NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
-
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {options, NewServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {options, [{verify, verify_peer} | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, {error, "certificate expired"},
- Client, {error, "certificate expired"}).
-
-two_digits_str(N) when N < 10 ->
- lists:flatten(io_lib:format("0~p", [N]));
-two_digits_str(N) ->
- lists:flatten(io_lib:format("~p", [N])).
-
-%%--------------------------------------------------------------------
-
-client_with_cert_cipher_suites_handshake(doc) ->
- ["Test that client with a certificate without keyEncipherment usage "
- " extension can connect to a server with restricted cipher suites "];
-
-client_with_cert_cipher_suites_handshake(suite) ->
- [];
-
-client_with_cert_cipher_suites_handshake(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts_digital_signature_only, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, [{active, true},
- {ciphers, ssl_test_lib:rsa_non_signed_suites()}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, [{active, true}
- | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
-%%--------------------------------------------------------------------
-verify_fun_always_run_client(doc) ->
- ["Verify that user verify_fun is always run (for valid and valid_peer not only unknown_extension)"];
-verify_fun_always_run_client(suite) ->
- [];
-verify_fun_always_run_client(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {ssl_test_lib,
- no_result, []}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
-
- %% If user verify fun is called correctly we fail the connection.
- %% otherwise we can not tell this case apart form where we miss
- %% to call users verify fun
- FunAndState = {fun(_,{extension, _}, UserState) ->
- {unknown, UserState};
- (_, valid, [ChainLen]) ->
- {valid, [ChainLen + 1]};
- (_, valid_peer, [2]) ->
- {fail, "verify_fun_was_always_run"};
- (_, valid_peer, UserState) ->
- {valid, UserState}
- end, [0]},
-
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib,
- no_result, []}},
- {options,
- [{verify, verify_peer},
- {verify_fun, FunAndState}
- | ClientOpts]}]),
- %% Server error may be esslaccept or closed depending on timing
- %% this is not a bug it is a circumstance of how tcp works!
- receive
- {Server, ServerError} ->
- test_server:format("Server Error ~p~n", [ServerError])
- end,
-
- ssl_test_lib:check_result(Client, {error, esslconnect}).
-
-%%--------------------------------------------------------------------
-verify_fun_always_run_server(doc) ->
- ["Verify that user verify_fun is always run (for valid and valid_peer not only unknown_extension)"];
-verify_fun_always_run_server(suite) ->
- [];
-verify_fun_always_run_server(Config) when is_list(Config) ->
- ClientOpts = ?config(client_verification_opts, Config),
- ServerOpts = ?config(server_verification_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- %% If user verify fun is called correctly we fail the connection.
- %% otherwise we can not tell this case apart form where we miss
- %% to call users verify fun
- FunAndState = {fun(_,{extension, _}, UserState) ->
- {unknown, UserState};
- (_, valid, [ChainLen]) ->
- {valid, [ChainLen + 1]};
- (_, valid_peer, [2]) ->
- {fail, "verify_fun_was_always_run"};
- (_, valid_peer, UserState) ->
- {valid, UserState}
- end, [0]},
-
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {ssl_test_lib,
- no_result, []}},
- {options,
- [{verify, verify_peer},
- {verify_fun, FunAndState} |
- ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
-
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib,
- no_result, []}},
- {options,
- [{verify, verify_peer}
- | ClientOpts]}]),
-
- %% Client error may be esslconnect or closed depending on timing
- %% this is not a bug it is a circumstance of how tcp works!
- receive
- {Client, ClientError} ->
- test_server:format("Client Error ~p~n", [ClientError])
- end,
-
- ssl_test_lib:check_result(Server, {error, esslaccept}).
-
-%%--------------------------------------------------------------------
-unknown_server_ca_fail(doc) ->
- ["Test that the client fails if the ca is unknown in verify_peer mode"];
-unknown_server_ca_fail(suite) ->
- [];
-unknown_server_ca_fail(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {ssl_test_lib,
- no_result, []}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
-
- FunAndState = {fun(_,{bad_cert, unknown_ca} = Reason, _) ->
- {fail, Reason};
- (_,{extension, _}, UserState) ->
- {unknown, UserState};
- (_, valid, UserState) ->
- {valid, [test_to_update_user_state | UserState]};
- (_, valid_peer, UserState) ->
- {valid, UserState}
- end, []},
-
- Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib,
- no_result, []}},
- {options,
- [{verify, verify_peer},
- {verify_fun, FunAndState}
- | ClientOpts]}]),
-
- ssl_test_lib:check_result(Server, {error,"unknown ca"},
- Client, {error, "unknown ca"}).
-
-%%--------------------------------------------------------------------
-unknown_server_ca_accept_verify_none(doc) ->
- ["Test that the client succeds if the ca is unknown in verify_none mode"];
-unknown_server_ca_accept_verify_none(suite) ->
- [];
-unknown_server_ca_accept_verify_none(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options,
- [{verify, verify_none}| ClientOpts]}]),
+ ClientOpts = ?config(client_opts, Config),
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-%%--------------------------------------------------------------------
-unknown_server_ca_accept_verify_peer(doc) ->
- ["Test that the client succeds if the ca is unknown in verify_peer mode"
- " with a verify_fun that accepts the unknown ca error"];
-unknown_server_ca_accept_verify_peer(suite) ->
- [];
-unknown_server_ca_accept_verify_peer(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
-
- FunAndState = {fun(_,{bad_cert, unknown_ca}, UserState) ->
- {valid, UserState};
- (_,{bad_cert, _} = Reason, _) ->
- {fail, Reason};
- (_,{extension, _}, UserState) ->
- {unknown, UserState};
- (_, valid, UserState) ->
- {valid, UserState};
- (_, valid_peer, UserState) ->
- {valid, UserState}
- end, []},
-
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options,
- [{verify, verify_peer},
- {verify_fun, FunAndState}| ClientOpts]}]),
- ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ Data = "From erlang to erlang",
+ N = 10,
-%%--------------------------------------------------------------------
-unknown_server_ca_accept_backwardscompatibility(doc) ->
- ["Test that old style verify_funs will work"];
-unknown_server_ca_accept_backwardscompatibility(suite) ->
- [];
-unknown_server_ca_accept_backwardscompatibility(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
-
- AcceptBadCa = fun({bad_cert,unknown_ca}, Acc) -> Acc;
- (Other, Acc) -> [Other | Acc]
- end,
- VerifyFun =
- fun(ErrorList) ->
- case lists:foldl(AcceptBadCa, [], ErrorList) of
- [] -> true;
- [_|_] -> false
- end
- end,
+ {mfa, {ssl_test_lib,
+ trigger_renegotiate, [[Data, N+2]]}},
+ {options, [{renegotiate_at, N} | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE,
- send_recv_result_active, []}},
- {options,
- [{verify, verify_peer},
- {verify_fun, VerifyFun}| ClientOpts]}]),
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, [{reuse_sessions, false} | ClientOpts]}]),
- ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:check_result(Server, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-der_input(doc) ->
- ["Test to input certs and key as der"];
-
-der_input(suite) ->
- [];
+der_input() ->
+ [{doc,"Test to input certs and key as der"}].
der_input(Config) when is_list(Config) ->
DataDir = ?config(data_dir, Config),
@@ -3556,19 +2017,19 @@ der_input(Config) when is_list(Config) ->
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ClientOpts]}]),
ssl_test_lib:check_result(Server, ok, Client, ok),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-
+%%--------------------------------------------------------------------
der_input_opts(Opts) ->
Certfile = proplists:get_value(certfile, Opts),
CaCertsfile = proplists:get_value(cacertfile, Opts),
@@ -3585,12 +2046,9 @@ der_input_opts(Opts) ->
{Cert, {Asn1Type, Key}, CaCerts, DHParams}.
%%--------------------------------------------------------------------
-%% different_ca_peer_sign(doc) ->
+%% different_ca_peer_sign() ->
%% ["Check that a CA can have a different signature algorithm than the peer cert."];
-%% different_ca_peer_sign(suite) ->
-%% [];
-
%% different_ca_peer_sign(Config) when is_list(Config) ->
%% ClientOpts = ?config(client_mix_opts, Config),
%% ServerOpts = ?config(server_mix_verify_opts, Config),
@@ -3598,7 +2056,7 @@ der_input_opts(Opts) ->
%% {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
%% Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
%% {from, self()},
-%% {mfa, {?MODULE, send_recv_result_active_once, []}},
+%% {mfa, {ssl_test_lib, send_recv_result_active_once, []}},
%% {options, [{active, once},
%% {verify, verify_peer} | ServerOpts]}]),
%% Port = ssl_test_lib:inet_port(Server),
@@ -3606,7 +2064,7 @@ der_input_opts(Opts) ->
%% Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
%% {host, Hostname},
%% {from, self()},
-%% {mfa, {?MODULE,
+%% {mfa, {ssl_test_lib,
%% send_recv_result_active_once,
%% []}},
%% {options, [{active, once},
@@ -3619,12 +2077,8 @@ der_input_opts(Opts) ->
%%--------------------------------------------------------------------
-no_reuses_session_server_restart_new_cert(doc) ->
- ["Check that a session is not reused if the server is restarted with a new cert."];
-
-no_reuses_session_server_restart_new_cert(suite) ->
- [];
-
+no_reuses_session_server_restart_new_cert() ->
+ [{doc,"Check that a session is not reused if the server is restarted with a new cert."}].
no_reuses_session_server_restart_new_cert(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -3650,7 +2104,7 @@ no_reuses_session_server_restart_new_cert(Config) when is_list(Config) ->
end,
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Monitor = erlang:monitor(process, Server),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client0),
@@ -3672,7 +2126,7 @@ no_reuses_session_server_restart_new_cert(Config) when is_list(Config) ->
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
- test_server:fail(session_reused_when_server_has_new_cert);
+ ct:fail(session_reused_when_server_has_new_cert);
{Client1, _Other} ->
ok
end,
@@ -3680,12 +2134,9 @@ no_reuses_session_server_restart_new_cert(Config) when is_list(Config) ->
ssl_test_lib:close(Client1).
%%--------------------------------------------------------------------
-no_reuses_session_server_restart_new_cert_file(doc) ->
- ["Check that a session is not reused if a server is restarted with a new "
- "cert contained in a file with the same name as the old cert."];
-
-no_reuses_session_server_restart_new_cert_file(suite) ->
- [];
+no_reuses_session_server_restart_new_cert_file() ->
+ [{doc,"Check that a session is not reused if a server is restarted with a new "
+ "cert contained in a file with the same name as the old cert."}].
no_reuses_session_server_restart_new_cert_file(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -3715,7 +2166,7 @@ no_reuses_session_server_restart_new_cert_file(Config) when is_list(Config) ->
%% Make sure session is registered and we get
%% new file time stamp when calling new_config!
- test_server:sleep(?SLEEP* 2),
+ ct:sleep(?SLEEP* 2),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client0),
@@ -3735,7 +2186,7 @@ no_reuses_session_server_restart_new_cert_file(Config) when is_list(Config) ->
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
- test_server:fail(session_reused_when_server_has_new_cert);
+ ct:fail(session_reused_when_server_has_new_cert);
{Client1, _Other} ->
ok
end,
@@ -3743,11 +2194,8 @@ no_reuses_session_server_restart_new_cert_file(Config) when is_list(Config) ->
ssl_test_lib:close(Client1).
%%--------------------------------------------------------------------
-reuseaddr(doc) ->
- [""];
-
-reuseaddr(suite) ->
- [];
+reuseaddr() ->
+ [{doc,"Test reuseaddr option"}].
reuseaddr(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -3765,24 +2213,19 @@ reuseaddr(Config) when is_list(Config) ->
{from, self()},
{mfa, {ssl_test_lib, no_result, []}},
{options, [{active, false} | ClientOpts]}]),
- Monitor = erlang:monitor(process, Server),
ssl_test_lib:close(Server),
ssl_test_lib:close(Client),
- receive
- {'DOWN', Monitor, _, _, _} ->
- ok
- end,
Server1 =
ssl_test_lib:start_server([{node, ServerNode}, {port, Port},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ServerOpts]}]),
Client1 =
ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ClientOpts]}]),
ssl_test_lib:check_result(Server1, ok, Client1, ok),
@@ -3790,14 +2233,51 @@ reuseaddr(Config) when is_list(Config) ->
ssl_test_lib:close(Client1).
%%--------------------------------------------------------------------
+tcp_reuseaddr() ->
+ [{doc, "Reference test case."}].
+tcp_reuseaddr(Config) when is_list(Config) ->
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {transport, gen_tcp},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, [{active, false}, {reuseaddr, true}]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client =
+ ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {transport, gen_tcp},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, [{active, false}]}]),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client),
+
+ Server1 =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, Port},
+ {from, self()},
+ {transport, gen_tcp},
+ {mfa, {?MODULE, tcp_send_recv_result, []}},
+ {options, [{active, false}, {reuseaddr, true}]}]),
+ Client1 =
+ ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {transport, gen_tcp},
+ {mfa, {?MODULE, tcp_send_recv_result, []}},
+ {options, [{active, false}]}]),
+
+ ssl_test_lib:check_result(Server1, ok, Client1, ok),
+ ssl_test_lib:close(Server1),
+ ssl_test_lib:close(Client1).
-hibernate(doc) ->
- ["Check that an SSL connection that is started with option "
- "{hibernate_after, 1000} indeed hibernates after 1000ms of "
- "inactivity"];
+%%--------------------------------------------------------------------
-hibernate(suite) ->
- [];
+hibernate() ->
+ [{doc,"Check that an SSL connection that is started with option "
+ "{hibernate_after, 1000} indeed hibernates after 1000ms of "
+ "inactivity"}].
hibernate(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -3807,14 +2287,14 @@ hibernate(Config) ->
Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
{Client, #sslsocket{pid=Pid}} = ssl_test_lib:start_client([return_socket,
{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options, [{hibernate_after, 1000}|ClientOpts]}]),
{current_function, _} =
process_info(Pid, current_function),
@@ -3828,11 +2308,8 @@ hibernate(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-listen_socket(doc) ->
- ["Check error handling and inet compliance when calling API functions with listen sockets."];
-
-listen_socket(suite) ->
- [];
+listen_socket() ->
+ [{doc,"Check error handling and inet compliance when calling API functions with listen sockets."}].
listen_socket(Config) ->
ServerOpts = ?config(server_opts, Config),
@@ -3856,10 +2333,9 @@ listen_socket(Config) ->
ok = ssl:close(ListenSocket).
%%--------------------------------------------------------------------
-ssl_accept_timeout(doc) ->
- ["Test ssl:ssl_accept timeout"];
-ssl_accept_timeout(suite) ->
- [];
+ssl_accept_timeout() ->
+ [{doc,"Test ssl:ssl_accept timeout"}].
+
ssl_accept_timeout(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -3883,10 +2359,9 @@ ssl_accept_timeout(Config) ->
end.
%%--------------------------------------------------------------------
-ssl_recv_timeout(doc) ->
- ["Test ssl:ssl_accept timeout"];
-ssl_recv_timeout(suite) ->
- [];
+ssl_recv_timeout() ->
+ [{doc,"Test ssl:ssl_accept timeout"}].
+
ssl_recv_timeout(Config) ->
ServerOpts = ?config(server_opts, Config),
ClientOpts = ?config(client_opts, Config),
@@ -3912,11 +2387,8 @@ ssl_recv_timeout(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-
-connect_twice(doc) ->
- [""];
-connect_twice(suite) ->
- [];
+connect_twice() ->
+ [{doc,""}].
connect_twice(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -3926,7 +2398,7 @@ connect_twice(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{keepalive, true},{active, false}
| ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
@@ -3934,7 +2406,7 @@ connect_twice(Config) when is_list(Config) ->
ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{keepalive, true},{active, false}
| ClientOpts]}]),
Server ! listen,
@@ -3944,11 +2416,11 @@ connect_twice(Config) when is_list(Config) ->
{node, ClientNode}, {port, Port},
{host, Hostname},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{keepalive, true},{active, false}
| ClientOpts]}]),
- test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ ct:print("Testcase ~p, Client ~p Server ~p ~n",
[self(), Client, Server]),
ssl_test_lib:check_result(Server, ok, Client, ok),
@@ -3959,13 +2431,9 @@ connect_twice(Config) when is_list(Config) ->
ssl_test_lib:close(Client1).
%%--------------------------------------------------------------------
-renegotiate_dos_mitigate_active(doc) ->
- ["Mitigate DOS computational attack by not allowing client to renegotiate many times in a row",
- "immediately after each other"];
-
-renegotiate_dos_mitigate_active(suite) ->
- [];
-
+renegotiate_dos_mitigate_active() ->
+ [{doc, "Mitigate DOS computational attack by not allowing client to renegotiate many times in a row",
+ "immediately after each other"}].
renegotiate_dos_mitigate_active(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
ClientOpts = ?config(client_opts, Config),
@@ -3975,7 +2443,7 @@ renegotiate_dos_mitigate_active(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result_active, []}},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
{options, [ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
@@ -3991,13 +2459,9 @@ renegotiate_dos_mitigate_active(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-renegotiate_dos_mitigate_passive(doc) ->
- ["Mitigate DOS computational attack by not allowing client to renegotiate many times in a row",
- "immediately after each other"];
-
-renegotiate_dos_mitigate_passive(suite) ->
- [];
-
+renegotiate_dos_mitigate_passive() ->
+ [{doc, "Mitigate DOS computational attack by not allowing client to renegotiate many times in a row",
+ "immediately after each other"}].
renegotiate_dos_mitigate_passive(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
ClientOpts = ?config(client_opts, Config),
@@ -4007,7 +2471,7 @@ renegotiate_dos_mitigate_passive(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, send_recv_result, []}},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
{options, [{active, false} | ServerOpts]}]),
Port = ssl_test_lib:inet_port(Server),
@@ -4023,8 +2487,8 @@ renegotiate_dos_mitigate_passive(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-tcp_error_propagation_in_active_mode(doc) ->
- ["Test that process recives {ssl_error, Socket, closed} when tcp error ocurres"];
+tcp_error_propagation_in_active_mode() ->
+ [{doc,"Test that process recives {ssl_error, Socket, closed} when tcp error ocurres"}].
tcp_error_propagation_in_active_mode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -4053,11 +2517,9 @@ tcp_error_propagation_in_active_mode(Config) when is_list(Config) ->
ssl_test_lib:check_result(Client, {ssl_closed, SslSocket}).
-
%%--------------------------------------------------------------------
-
-recv_error_handling(doc) ->
- ["Special case of call error handling"];
+recv_error_handling() ->
+ [{doc,"Special case of call error handling"}].
recv_error_handling(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -4077,11 +2539,11 @@ recv_error_handling(Config) when is_list(Config) ->
ssl:close(SslSocket),
ssl_test_lib:check_result(Server, ok).
-
%%--------------------------------------------------------------------
-rizzo(doc) -> ["Test that there is a 1/n-1-split for non RC4 in 'TLS < 1.1' as it is
- vunrable to Rizzo/Dungon attack"];
+rizzo() ->
+ [{doc, "Test that there is a 1/n-1-split for non RC4 in 'TLS < 1.1' as it is
+ vunrable to Rizzo/Dungon attack"}].
rizzo(Config) when is_list(Config) ->
Ciphers = [X || X ={_,Y,_} <- ssl:cipher_suites(), Y =/= rc4_128],
@@ -4090,8 +2552,8 @@ rizzo(Config) when is_list(Config) ->
run_send_recv_rizzo(Ciphers, Config, Version,
{?MODULE, send_recv_result_active_rizzo, []}).
%%--------------------------------------------------------------------
-no_rizzo_rc4(doc) ->
- ["Test that there is no 1/n-1-split for RC4 as it is not vunrable to Rizzo/Dungon attack"];
+no_rizzo_rc4() ->
+ [{doc,"Test that there is no 1/n-1-split for RC4 as it is not vunrable to Rizzo/Dungon attack"}].
no_rizzo_rc4(Config) when is_list(Config) ->
Ciphers = [X || X ={_,Y,_} <- ssl:cipher_suites(),Y == rc4_128],
@@ -4101,59 +2563,9 @@ no_rizzo_rc4(Config) when is_list(Config) ->
{?MODULE, send_recv_result_active_no_rizzo, []}).
%%--------------------------------------------------------------------
-run_send_recv_rizzo(Ciphers, Config, Version, Mfa) ->
- Result = lists:map(fun(Cipher) ->
- rizzo_test(Cipher, Config, Version, Mfa) end,
- Ciphers),
- case lists:flatten(Result) of
- [] ->
- ok;
- Error ->
- test_server:format("Cipher suite errors: ~p~n", [Error]),
- test_server:fail(cipher_suite_failed_see_test_case_log)
- end.
-
-rizzo_test(Cipher, Config, Version, Mfa) ->
- {ClientOpts, ServerOpts} = client_server_opts(Cipher, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
- Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
- {from, self()},
- {mfa, Mfa},
- {options, [{active, true}, {ciphers, [Cipher]},
- {versions, [Version]}
- | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, Mfa},
- {options, [{active, true} | ClientOpts]}]),
-
- Result = ssl_test_lib:check_result(Server, ok, Client, ok),
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client),
- case Result of
- ok ->
- [];
- Error ->
- [{Cipher, Error}]
- end.
-
-client_server_opts({KeyAlgo,_,_}, Config) when KeyAlgo == rsa orelse KeyAlgo == dhe_rsa ->
- {?config(client_opts, Config),
- ?config(server_opts, Config)};
-client_server_opts({KeyAlgo,_,_}, Config) when KeyAlgo == dss orelse KeyAlgo == dhe_dss ->
- {?config(client_dsa_opts, Config),
- ?config(server_dsa_opts, Config)}.
-
-
-%%--------------------------------------------------------------------
-
-new_server_wants_peer_cert(doc) ->
- ["Test that server configured to do client certification does"
- " not reuse session without a client certificate."];
-new_server_wants_peer_cert(suite) ->
- [];
+new_server_wants_peer_cert() ->
+ [{doc, "Test that server configured to do client certification does"
+ " not reuse session without a client certificate."}].
new_server_wants_peer_cert(Config) when is_list(Config) ->
ServerOpts = ?config(server_opts, Config),
VServerOpts = [{verify, verify_peer}, {fail_if_no_peer_cert, true}
@@ -4206,14 +2618,50 @@ new_server_wants_peer_cert(Config) when is_list(Config) ->
ssl_test_lib:close(Client),
ssl_test_lib:close(Client1).
+%%--------------------------------------------------------------------
+session_cache_process_list() ->
+ [{doc,"Test reuse of sessions (short handshake)"}].
+session_cache_process_list(Config) when is_list(Config) ->
+ session_cache_process(list,Config).
+%%--------------------------------------------------------------------
+session_cache_process_mnesia() ->
+ [{doc,"Test reuse of sessions (short handshake)"}].
+session_cache_process_mnesia(Config) when is_list(Config) ->
+ session_cache_process(mnesia,Config).
%%--------------------------------------------------------------------
-%%% Internal functions
+%% Internal functions ------------------------------------------------
%%--------------------------------------------------------------------
send_recv_result(Socket) ->
ssl:send(Socket, "Hello world"),
{ok,"Hello world"} = ssl:recv(Socket, 11),
ok.
+tcp_send_recv_result(Socket) ->
+ gen_tcp:send(Socket, "Hello world"),
+ {ok,"Hello world"} = gen_tcp:recv(Socket, 11),
+ ok.
+
+basic_test(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
+ {options, ClientOpts}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
send_recv_result_timeout_client(Socket) ->
{error, timeout} = ssl:recv(Socket, 11, 500),
@@ -4241,17 +2689,6 @@ recv_close(Socket) ->
ok
end.
-send_recv_result_active(Socket) ->
- ssl:send(Socket, "Hello world"),
- receive
- {ssl, Socket, "H"} ->
- receive
- {ssl, Socket, "ello world"} ->
- ok
- end;
- {ssl, Socket, "Hello world"} ->
- ok
- end.
send_recv_result_active_rizzo(Socket) ->
ssl:send(Socket, "Hello world"),
@@ -4270,26 +2707,13 @@ send_recv_result_active_no_rizzo(Socket) ->
ok
end.
-send_recv_result_active_once(Socket) ->
- ssl:send(Socket, "Hello world"),
- receive
- {ssl, Socket, "H"} ->
- ssl:setopts(Socket, [{active, once}]),
- receive
- {ssl, Socket, "ello world"} ->
- ok
- end;
- {ssl, Socket, "Hello world"} ->
- ok
- end.
-
result_ok(_Socket) ->
ok.
renegotiate(Socket, Data) ->
- test_server:format("Renegotiating ~n", []),
+ ct:print("Renegotiating ~n", []),
Result = ssl:renegotiate(Socket),
- test_server:format("Result ~p~n", [Result]),
+ ct:print("Result ~p~n", [Result]),
ssl:send(Socket, Data),
case Result of
ok ->
@@ -4300,7 +2724,7 @@ renegotiate(Socket, Data) ->
renegotiate_reuse_session(Socket, Data) ->
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
renegotiate(Socket, Data).
renegotiate_immediately(Socket) ->
@@ -4316,9 +2740,9 @@ renegotiate_immediately(Socket) ->
end,
ok = ssl:renegotiate(Socket),
{error, renegotiation_rejected} = ssl:renegotiate(Socket),
- test_server:sleep(?RENEGOTIATION_DISABLE_TIME +1),
+ ct:sleep(?RENEGOTIATION_DISABLE_TIME +1),
ok = ssl:renegotiate(Socket),
- test_server:format("Renegotiated again"),
+ ct:print("Renegotiated again"),
ssl:send(Socket, "Hello world"),
ok.
@@ -4337,27 +2761,11 @@ new_config(PrivDir, ServerOpts0) ->
ServerOpts = proplists:delete(keyfile, ServerOpts2),
{ok, PEM} = file:read_file(NewCaCertFile),
- test_server:format("CA file content: ~p~n", [public_key:pem_decode(PEM)]),
+ ct:print("CA file content: ~p~n", [public_key:pem_decode(PEM)]),
[{cacertfile, NewCaCertFile}, {certfile, NewCertFile},
{keyfile, NewKeyFile} | ServerOpts].
-session_cache_process_list(doc) ->
- ["Test reuse of sessions (short handshake)"];
-
-session_cache_process_list(suite) ->
- [];
-session_cache_process_list(Config) when is_list(Config) ->
- session_cache_process(list,Config).
-
-session_cache_process_mnesia(doc) ->
- ["Test reuse of sessions (short handshake)"];
-
-session_cache_process_mnesia(suite) ->
- [];
-session_cache_process_mnesia(Config) when is_list(Config) ->
- session_cache_process(mnesia,Config).
-
session_cache_process(_Type,Config) when is_list(Config) ->
reuse_session(Config).
@@ -4499,9 +2907,9 @@ erlang_ssl_receive(Socket, Data) ->
io:format("Received ~p~n",[Byte]),
erlang_ssl_receive(Socket, tl(Data));
Other ->
- test_server:fail({unexpected_message, Other})
+ ct:fail({unexpected_message, Other})
after ?SLEEP * 3 ->
- test_server:fail({did_not_get, Data})
+ ct:fail({did_not_get, Data})
end.
receive_msg(_) ->
@@ -4509,3 +2917,222 @@ receive_msg(_) ->
Msg ->
Msg
end.
+
+controlling_process_result(Socket, Pid, Msg) ->
+ ok = ssl:controlling_process(Socket, Pid),
+ %% Make sure other side has evaluated controlling_process
+ %% before message is sent
+ ct:sleep(?SLEEP),
+ ssl:send(Socket, Msg),
+ no_result_msg.
+
+receive_s_rizzo_duong_beast() ->
+ receive
+ {ssl, _, "erver hello"} ->
+ receive
+ {ssl, _, "C"} ->
+ receive
+ {ssl, _, "lient hello"} ->
+ ok
+ end
+ end
+ end.
+receive_c_rizzo_duong_beast() ->
+ receive
+ {ssl, _, "lient hello"} ->
+ receive
+ {ssl, _, "S"} ->
+ receive
+ {ssl, _, "erver hello"} ->
+ ok
+ end
+ end
+ end.
+
+controller_dies_result(_Socket, _Pid, _Msg) ->
+ receive Result -> Result end.
+
+get_close(Pid, Where) ->
+ receive
+ {'EXIT', Pid, _Reason} ->
+ receive
+ {_, {ssl_closed, Socket}} ->
+ ct:print("Socket closed ~p~n",[Socket]);
+ Unexpected ->
+ ct:print("Unexpected ~p~n",[Unexpected]),
+ ct:fail({line, ?LINE-1})
+ after 5000 ->
+ ct:fail({timeout, {line, ?LINE, Where}})
+ end;
+ Unexpected ->
+ ct:print("Unexpected ~p~n",[Unexpected]),
+ ct:fail({line, ?LINE-1})
+ after 5000 ->
+ ct:fail({timeout, {line, ?LINE, Where}})
+ end.
+
+run_send_recv_rizzo(Ciphers, Config, Version, Mfa) ->
+ Result = lists:map(fun(Cipher) ->
+ rizzo_test(Cipher, Config, Version, Mfa) end,
+ Ciphers),
+ case lists:flatten(Result) of
+ [] ->
+ ok;
+ Error ->
+ ct:print("Cipher suite errors: ~p~n", [Error]),
+ ct:fail(cipher_suite_failed_see_test_case_log)
+ end.
+
+rizzo_test(Cipher, Config, Version, Mfa) ->
+ {ClientOpts, ServerOpts} = client_server_opts(Cipher, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, Mfa},
+ {options, [{active, true}, {ciphers, [Cipher]},
+ {versions, [Version]}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, Mfa},
+ {options, [{active, true} | ClientOpts]}]),
+
+ Result = ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client),
+ case Result of
+ ok ->
+ [];
+ Error ->
+ [{Cipher, Error}]
+ end.
+
+client_server_opts({KeyAlgo,_,_}, Config) when KeyAlgo == rsa orelse KeyAlgo == dhe_rsa ->
+ {?config(client_opts, Config),
+ ?config(server_opts, Config)};
+client_server_opts({KeyAlgo,_,_}, Config) when KeyAlgo == dss orelse KeyAlgo == dhe_dss ->
+ {?config(client_dsa_opts, Config),
+ ?config(server_dsa_opts, Config)}.
+
+run_suites(Ciphers, Version, Config, Type) ->
+ {ClientOpts, ServerOpts} =
+ case Type of
+ rsa ->
+ {?config(client_opts, Config),
+ ?config(server_opts, Config)};
+ dsa ->
+ {?config(client_opts, Config),
+ ?config(server_dsa_opts, Config)};
+ anonymous ->
+ %% No certs in opts!
+ {?config(client_opts, Config),
+ ?config(server_anon, Config)}
+ end,
+
+ Result = lists:map(fun(Cipher) ->
+ cipher(Cipher, Version, Config, ClientOpts, ServerOpts) end,
+ Ciphers),
+ case lists:flatten(Result) of
+ [] ->
+ ok;
+ Error ->
+ ct:print("Cipher suite errors: ~p~n", [Error]),
+ ct:fail(cipher_suite_failed_see_test_case_log)
+ end.
+
+erlang_cipher_suite(Suite) when is_list(Suite)->
+ ssl:suite_definition(ssl_cipher:openssl_suite(Suite));
+erlang_cipher_suite(Suite) ->
+ Suite.
+
+cipher(CipherSuite, Version, Config, ClientOpts, ServerOpts) ->
+ %% process_flag(trap_exit, true),
+ ct:print("Testing CipherSuite ~p~n", [CipherSuite]),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ ErlangCipherSuite = erlang_cipher_suite(CipherSuite),
+
+ ConnectionInfo = {ok, {Version, ErlangCipherSuite}},
+
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, cipher_result, [ConnectionInfo]}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, cipher_result, [ConnectionInfo]}},
+ {options,
+ [{ciphers,[CipherSuite]} |
+ ClientOpts]}]),
+
+ Result = ssl_test_lib:wait_for_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client),
+
+ case Result of
+ ok ->
+ [];
+ Error ->
+ [{ErlangCipherSuite, Error}]
+ end.
+
+connection_info_result(Socket) ->
+ ssl:connection_info(Socket).
+
+connect_dist_s(S) ->
+ Msg = term_to_binary({erlang,term}),
+ ok = ssl:send(S, Msg).
+
+connect_dist_c(S) ->
+ Test = binary_to_list(term_to_binary({erlang,term})),
+ {ok, Test} = ssl:recv(S, 0, 10000),
+ ok.
+
+ %% First two clauses handles 1/n-1 splitting countermeasure Rizzo/Duong-Beast
+treashold(N, {3,0}) ->
+ (N div 2) + 1;
+treashold(N, {3,1}) ->
+ (N div 2) + 1;
+treashold(N, _) ->
+ N + 1.
+
+get_invalid_inet_option(Socket) ->
+ {error, {eoptions, {inet_option, foo, _}}} = ssl:getopts(Socket, [foo]),
+ ok.
+
+shutdown_result(Socket, server) ->
+ ssl:send(Socket, "Hej"),
+ ssl:shutdown(Socket, write),
+ {ok, "Hej hopp"} = ssl:recv(Socket, 8),
+ ok;
+
+shutdown_result(Socket, client) ->
+ {ok, "Hej"} = ssl:recv(Socket, 3),
+ ssl:send(Socket, "Hej hopp"),
+ ssl:shutdown(Socket, write),
+ ok.
+
+shutdown_write_result(Socket, server) ->
+ ct:sleep(?SLEEP),
+ ssl:shutdown(Socket, write);
+shutdown_write_result(Socket, client) ->
+ ssl:recv(Socket, 0).
+
+dummy(_Socket) ->
+ %% Should not happen as the ssl connection will not be established
+ %% due to fatal handshake failiure
+ exit(kill).
+
+shutdown_both_result(Socket, server) ->
+ ct:sleep(?SLEEP),
+ ssl:shutdown(Socket, read_write);
+shutdown_both_result(Socket, client) ->
+ ssl:recv(Socket, 0).
+
+peername_result(S) ->
+ ssl:peername(S).
diff --git a/lib/ssl/test/ssl_certificate_verify_SUITE.erl b/lib/ssl/test/ssl_certificate_verify_SUITE.erl
new file mode 100644
index 0000000000..9677d98c1b
--- /dev/null
+++ b/lib/ssl/test/ssl_certificate_verify_SUITE.erl
@@ -0,0 +1,982 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.2
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%
+-module(ssl_certificate_verify_SUITE).
+
+%% Note: This directive should only be used in test suites.
+-compile(export_all).
+
+-include_lib("common_test/include/ct.hrl").
+-include_lib("public_key/include/public_key.hrl").
+
+-include("ssl_internal.hrl").
+-include("ssl_alert.hrl").
+-include("ssl_internal.hrl").
+-include("ssl_record.hrl").
+-include("ssl_handshake.hrl").
+
+-define(LONG_TIMEOUT, 600000).
+
+%%--------------------------------------------------------------------
+%% Common Test interface functions -----------------------------------
+%%--------------------------------------------------------------------
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [{group, active},
+ {group, passive},
+ {group, active_once},
+ {group, error_handling}].
+
+
+groups() ->
+ [{active, [], tests()},
+ {active_once, [], tests()},
+ {passive, [], tests()},
+ {error_handling, [],error_handling_tests()}].
+
+tests() ->
+ [server_verify_peer,
+ server_verify_none,
+ server_require_peer_cert_ok,
+ server_require_peer_cert_fail,
+ verify_fun_always_run_client,
+ verify_fun_always_run_server,
+ cert_expired,
+ invalid_signature_client,
+ invalid_signature_server,
+ extended_key_usage_verify_peer,
+ extended_key_usage_verify_none].
+
+error_handling_tests()->
+ [client_with_cert_cipher_suites_handshake,
+ server_verify_no_cacerts,
+ unknown_server_ca_fail,
+ unknown_server_ca_accept_verify_none,
+ unknown_server_ca_accept_verify_peer,
+ unknown_server_ca_accept_backwardscompatibility,
+ no_authority_key_identifier].
+
+init_per_suite(Config0) ->
+ Dog = ct:timetrap(?LONG_TIMEOUT *2),
+ catch crypto:stop(),
+ try crypto:start() of
+ ok ->
+ application:start(public_key),
+ application:start(ssl),
+ %% make rsa certs using oppenssl
+ Result =
+ (catch make_certs:all(?config(data_dir, Config0),
+ ?config(priv_dir, Config0))),
+ ct:print("Make certs ~p~n", [Result]),
+
+ Config1 = ssl_test_lib:make_dsa_cert(Config0),
+ Config = ssl_test_lib:cert_options(Config1),
+ [{watchdog, Dog} | Config]
+ catch _:_ ->
+ {skip, "Crypto did not start"}
+ end.
+
+end_per_suite(_Config) ->
+ ssl:stop(),
+ application:stop(crypto).
+
+init_per_group(active, Config) ->
+ [{active, true}, {receive_function, send_recv_result_active} | Config];
+init_per_group(active_once, Config) ->
+ [{active, once}, {receive_function, send_recv_result_active_once} | Config];
+init_per_group(passive, Config) ->
+ [{active, false}, {receive_function, send_recv_result} | Config];
+init_per_group(_, Config) ->
+ Config.
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
+
+server_verify_peer() ->
+ [{doc,"Test server option verify_peer"}].
+server_verify_peer(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ Active = ?config(active, Config),
+ ReceiveFunction = ?config(receive_function, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{active, Active}, {verify, verify_peer}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{active, Active} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+server_verify_none() ->
+ [{doc,"Test server option verify_none"}].
+
+server_verify_none(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ Active = ?config(active, Config),
+ ReceiveFunction = ?config(receive_function, Config),
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{active, Active}, {verify, verify_none}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{active, Active} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+
+server_verify_client_once() ->
+ [{doc,"Test server option verify_client_once"}].
+
+server_verify_client_once(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ Active = ?config(active, Config),
+ ReceiveFunction = ?config(receive_function, Config),
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{active, Active}, {verify, verify_peer},
+ {verify_client_once, true}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client0 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{active, Active} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client0, ok),
+ Server ! {listen, {mfa, {ssl_test_lib, no_result, []}}},
+ ssl_test_lib:close(Client0),
+ Client1 = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, result_ok, []}},
+ {options, [{active, Active} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Client1, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client1).
+
+%%--------------------------------------------------------------------
+
+server_require_peer_cert_ok() ->
+ [{doc,"Test server option fail_if_no_peer_cert when peer sends cert"}].
+
+server_require_peer_cert_ok(Config) when is_list(Config) ->
+ ServerOpts = [{verify, verify_peer}, {fail_if_no_peer_cert, true}
+ | ?config(server_verification_opts, Config)],
+ ClientOpts = ?config(client_verification_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,send_recv_result, []}},
+ {options, [{active, false} | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
+ {options, [{active, false} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+
+server_require_peer_cert_fail() ->
+ [{doc,"Test server option fail_if_no_peer_cert when peer doesn't send cert"}].
+
+server_require_peer_cert_fail(Config) when is_list(Config) ->
+ ServerOpts = [{verify, verify_peer}, {fail_if_no_peer_cert, true}
+ | ?config(server_verification_opts, Config)],
+ BadClientOpts = ?config(client_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {options, [{active, false} | ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {options, [{active, false} | BadClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, {error, esslaccept},
+ Client, {error, esslconnect}).
+
+
+%%--------------------------------------------------------------------
+verify_fun_always_run_client() ->
+ [{doc,"Verify that user verify_fun is always run (for valid and valid_peer not only unknown_extension)"}].
+
+verify_fun_always_run_client(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ no_result, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ %% If user verify fun is called correctly we fail the connection.
+ %% otherwise we can not tell this case apart form where we miss
+ %% to call users verify fun
+ FunAndState = {fun(_,{extension, _}, UserState) ->
+ {unknown, UserState};
+ (_, valid, [ChainLen]) ->
+ {valid, [ChainLen + 1]};
+ (_, valid_peer, [2]) ->
+ {fail, "verify_fun_was_always_run"};
+ (_, valid_peer, UserState) ->
+ {valid, UserState}
+ end, [0]},
+
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ no_result, []}},
+ {options,
+ [{verify, verify_peer},
+ {verify_fun, FunAndState}
+ | ClientOpts]}]),
+ %% Server error may be esslaccept or closed depending on timing
+ %% this is not a bug it is a circumstance of how tcp works!
+ receive
+ {Server, ServerError} ->
+ ct:print("Server Error ~p~n", [ServerError])
+ end,
+
+ ssl_test_lib:check_result(Client, {error, esslconnect}).
+
+%%--------------------------------------------------------------------
+verify_fun_always_run_server() ->
+ [{doc,"Verify that user verify_fun is always run (for valid and valid_peer not only unknown_extension)"}].
+verify_fun_always_run_server(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ %% If user verify fun is called correctly we fail the connection.
+ %% otherwise we can not tell this case apart form where we miss
+ %% to call users verify fun
+ FunAndState = {fun(_,{extension, _}, UserState) ->
+ {unknown, UserState};
+ (_, valid, [ChainLen]) ->
+ {valid, [ChainLen + 1]};
+ (_, valid_peer, [2]) ->
+ {fail, "verify_fun_was_always_run"};
+ (_, valid_peer, UserState) ->
+ {valid, UserState}
+ end, [0]},
+
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ no_result, []}},
+ {options,
+ [{verify, verify_peer},
+ {verify_fun, FunAndState} |
+ ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ no_result, []}},
+ {options,
+ [{verify, verify_peer}
+ | ClientOpts]}]),
+
+ %% Client error may be esslconnect or closed depending on timing
+ %% this is not a bug it is a circumstance of how tcp works!
+ receive
+ {Client, ClientError} ->
+ ct:print("Client Error ~p~n", [ClientError])
+ end,
+
+ ssl_test_lib:check_result(Server, {error, esslaccept}).
+
+%%--------------------------------------------------------------------
+
+client_verify_none_passive() ->
+ [{doc,"Test client option verify_none"}].
+
+client_verify_none_passive(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
+ {options, [{active, false}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result, []}},
+ {options, [{active, false},
+ {verify, verify_none}
+ | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+%%--------------------------------------------------------------------
+cert_expired() ->
+ [{doc,"Test server with invalid signature"}].
+
+cert_expired(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ PrivDir = ?config(priv_dir, Config),
+
+ KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
+ [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
+ Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
+
+ ServerCertFile = proplists:get_value(certfile, ServerOpts),
+ NewServerCertFile = filename:join(PrivDir, "server/expired_cert.pem"),
+ [{'Certificate', DerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
+ OTPCert = public_key:pkix_decode_cert(DerCert, otp),
+ OTPTbsCert = OTPCert#'OTPCertificate'.tbsCertificate,
+
+ {Year, Month, Day} = date(),
+ {Hours, Min, Sec} = time(),
+ NotBeforeStr = lists:flatten(io_lib:format("~p~s~s~s~s~sZ",[Year-2,
+ two_digits_str(Month),
+ two_digits_str(Day),
+ two_digits_str(Hours),
+ two_digits_str(Min),
+ two_digits_str(Sec)])),
+ NotAfterStr = lists:flatten(io_lib:format("~p~s~s~s~s~sZ",[Year-1,
+ two_digits_str(Month),
+ two_digits_str(Day),
+ two_digits_str(Hours),
+ two_digits_str(Min),
+ two_digits_str(Sec)])),
+ NewValidity = {'Validity', {generalTime, NotBeforeStr}, {generalTime, NotAfterStr}},
+
+ ct:print("Validity: ~p ~n NewValidity: ~p ~n",
+ [OTPTbsCert#'OTPTBSCertificate'.validity, NewValidity]),
+
+ NewOTPTbsCert = OTPTbsCert#'OTPTBSCertificate'{validity = NewValidity},
+ NewServerDerCert = public_key:pkix_sign(NewOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
+ NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {options, NewServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {options, [{verify, verify_peer} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, {error, "certificate expired"},
+ Client, {error, "certificate expired"}).
+
+two_digits_str(N) when N < 10 ->
+ lists:flatten(io_lib:format("0~p", [N]));
+two_digits_str(N) ->
+ lists:flatten(io_lib:format("~p", [N])).
+
+%%--------------------------------------------------------------------
+
+client_verify_none_active() ->
+ [{doc,"Test client option verify_none"}].
+
+client_verify_none_active(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, [{active, true}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, [{active, true},
+ {verify, verify_none}
+ | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+client_verify_none_active_once() ->
+ [{doc,"Test client option verify_none"}].
+
+client_verify_none_active_once(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
+ {options, [{active, once} | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active_once,
+ []}},
+ {options, [{active, once},
+ {verify, verify_none}
+ | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+extended_key_usage_verify_peer() ->
+ [{doc,"Test cert that has a critical extended_key_usage extension in verify_peer mode"}].
+
+extended_key_usage_verify_peer(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ PrivDir = ?config(priv_dir, Config),
+ Active = ?config(active, Config),
+ ReceiveFunction = ?config(receive_function, Config),
+
+ KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
+ [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
+ Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
+
+ ServerCertFile = proplists:get_value(certfile, ServerOpts),
+ NewServerCertFile = filename:join(PrivDir, "server/new_cert.pem"),
+ [{'Certificate', ServerDerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
+ ServerOTPCert = public_key:pkix_decode_cert(ServerDerCert, otp),
+ ServerExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-serverAuth']},
+ ServerOTPTbsCert = ServerOTPCert#'OTPCertificate'.tbsCertificate,
+ ServerExtensions = ServerOTPTbsCert#'OTPTBSCertificate'.extensions,
+ NewServerOTPTbsCert = ServerOTPTbsCert#'OTPTBSCertificate'{extensions =
+ [ServerExtKeyUsageExt |
+ ServerExtensions]},
+ NewServerDerCert = public_key:pkix_sign(NewServerOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
+ NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
+
+ ClientCertFile = proplists:get_value(certfile, ClientOpts),
+ NewClientCertFile = filename:join(PrivDir, "client/new_cert.pem"),
+ [{'Certificate', ClientDerCert, _}] = ssl_test_lib:pem_to_der(ClientCertFile),
+ ClientOTPCert = public_key:pkix_decode_cert(ClientDerCert, otp),
+ ClientExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-clientAuth']},
+ ClientOTPTbsCert = ClientOTPCert#'OTPCertificate'.tbsCertificate,
+ ClientExtensions = ClientOTPTbsCert#'OTPTBSCertificate'.extensions,
+ NewClientOTPTbsCert = ClientOTPTbsCert#'OTPTBSCertificate'{extensions =
+ [ClientExtKeyUsageExt |
+ ClientExtensions]},
+ NewClientDerCert = public_key:pkix_sign(NewClientOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewClientCertFile, [{'Certificate', NewClientDerCert, not_encrypted}]),
+ NewClientOpts = [{certfile, NewClientCertFile} | proplists:delete(certfile, ClientOpts)],
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{verify, verify_peer}, {active, Active} | NewServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{verify, verify_peer}, {active, Active} |
+ NewClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+extended_key_usage_verify_none() ->
+ [{doc,"Test cert that has a critical extended_key_usage extension in verify_none mode"}].
+
+extended_key_usage_verify_none(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ PrivDir = ?config(priv_dir, Config),
+ Active = ?config(active, Config),
+ ReceiveFunction = ?config(receive_function, Config),
+
+ KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
+ [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
+ Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
+
+ ServerCertFile = proplists:get_value(certfile, ServerOpts),
+ NewServerCertFile = filename:join(PrivDir, "server/new_cert.pem"),
+ [{'Certificate', ServerDerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
+ ServerOTPCert = public_key:pkix_decode_cert(ServerDerCert, otp),
+ ServerExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-serverAuth']},
+ ServerOTPTbsCert = ServerOTPCert#'OTPCertificate'.tbsCertificate,
+ ServerExtensions = ServerOTPTbsCert#'OTPTBSCertificate'.extensions,
+ NewServerOTPTbsCert = ServerOTPTbsCert#'OTPTBSCertificate'{extensions =
+ [ServerExtKeyUsageExt |
+ ServerExtensions]},
+ NewServerDerCert = public_key:pkix_sign(NewServerOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
+ NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
+
+ ClientCertFile = proplists:get_value(certfile, ClientOpts),
+ NewClientCertFile = filename:join(PrivDir, "client/new_cert.pem"),
+ [{'Certificate', ClientDerCert, _}] = ssl_test_lib:pem_to_der(ClientCertFile),
+ ClientOTPCert = public_key:pkix_decode_cert(ClientDerCert, otp),
+ ClientExtKeyUsageExt = {'Extension', ?'id-ce-extKeyUsage', true, [?'id-kp-clientAuth']},
+ ClientOTPTbsCert = ClientOTPCert#'OTPCertificate'.tbsCertificate,
+ ClientExtensions = ClientOTPTbsCert#'OTPTBSCertificate'.extensions,
+ NewClientOTPTbsCert = ClientOTPTbsCert#'OTPTBSCertificate'{extensions =
+ [ClientExtKeyUsageExt |
+ ClientExtensions]},
+ NewClientDerCert = public_key:pkix_sign(NewClientOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewClientCertFile, [{'Certificate', NewClientDerCert, not_encrypted}]),
+ NewClientOpts = [{certfile, NewClientCertFile} | proplists:delete(certfile, ClientOpts)],
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{verify, verify_none}, {active, Active} | NewServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, ReceiveFunction, []}},
+ {options, [{verify, verify_none}, {active, Active} | NewClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+no_authority_key_identifier() ->
+ [{doc, "Test cert that does not have authorityKeyIdentifier extension"
+ " but are present in trusted certs db."}].
+
+no_authority_key_identifier(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ PrivDir = ?config(priv_dir, Config),
+
+ KeyFile = filename:join(PrivDir, "otpCA/private/key.pem"),
+ [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
+ Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
+
+ CertFile = proplists:get_value(certfile, ServerOpts),
+ NewCertFile = filename:join(PrivDir, "server/new_cert.pem"),
+ [{'Certificate', DerCert, _}] = ssl_test_lib:pem_to_der(CertFile),
+ OTPCert = public_key:pkix_decode_cert(DerCert, otp),
+ OTPTbsCert = OTPCert#'OTPCertificate'.tbsCertificate,
+ Extensions = OTPTbsCert#'OTPTBSCertificate'.extensions,
+ NewExtensions = delete_authority_key_extension(Extensions, []),
+ NewOTPTbsCert = OTPTbsCert#'OTPTBSCertificate'{extensions = NewExtensions},
+
+ ct:print("Extensions ~p~n, NewExtensions: ~p~n", [Extensions, NewExtensions]),
+
+ NewDerCert = public_key:pkix_sign(NewOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewCertFile, [{'Certificate', NewDerCert, not_encrypted}]),
+ NewServerOpts = [{certfile, NewCertFile} | proplists:delete(certfile, ServerOpts)],
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
+ {options, NewServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, send_recv_result_active, []}},
+ {options, [{verify, verify_peer} | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+delete_authority_key_extension([], Acc) ->
+ lists:reverse(Acc);
+delete_authority_key_extension([#'Extension'{extnID = ?'id-ce-authorityKeyIdentifier'} | Rest],
+ Acc) ->
+ delete_authority_key_extension(Rest, Acc);
+delete_authority_key_extension([Head | Rest], Acc) ->
+ delete_authority_key_extension(Rest, [Head | Acc]).
+
+%%--------------------------------------------------------------------
+
+invalid_signature_server() ->
+ [{doc,"Test server with invalid signature"}].
+
+invalid_signature_server(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ PrivDir = ?config(priv_dir, Config),
+
+ KeyFile = filename:join(PrivDir, "server/key.pem"),
+ [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
+ Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
+
+ ServerCertFile = proplists:get_value(certfile, ServerOpts),
+ NewServerCertFile = filename:join(PrivDir, "server/invalid_cert.pem"),
+ [{'Certificate', ServerDerCert, _}] = ssl_test_lib:pem_to_der(ServerCertFile),
+ ServerOTPCert = public_key:pkix_decode_cert(ServerDerCert, otp),
+ ServerOTPTbsCert = ServerOTPCert#'OTPCertificate'.tbsCertificate,
+ NewServerDerCert = public_key:pkix_sign(ServerOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewServerCertFile, [{'Certificate', NewServerDerCert, not_encrypted}]),
+ NewServerOpts = [{certfile, NewServerCertFile} | proplists:delete(certfile, ServerOpts)],
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {options, NewServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {options, [{verify, verify_peer} | ClientOpts]}]),
+
+ tcp_delivery_workaround(Server, {error, "bad certificate"},
+ Client, {error,"bad certificate"}).
+
+%%--------------------------------------------------------------------
+
+invalid_signature_client() ->
+ [{doc,"Test server with invalid signature"}].
+
+invalid_signature_client(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ PrivDir = ?config(priv_dir, Config),
+
+ KeyFile = filename:join(PrivDir, "client/key.pem"),
+ [KeyEntry] = ssl_test_lib:pem_to_der(KeyFile),
+ Key = ssl_test_lib:public_key(public_key:pem_entry_decode(KeyEntry)),
+
+ ClientCertFile = proplists:get_value(certfile, ClientOpts),
+ NewClientCertFile = filename:join(PrivDir, "client/invalid_cert.pem"),
+ [{'Certificate', ClientDerCert, _}] = ssl_test_lib:pem_to_der(ClientCertFile),
+ ClientOTPCert = public_key:pkix_decode_cert(ClientDerCert, otp),
+ ClientOTPTbsCert = ClientOTPCert#'OTPCertificate'.tbsCertificate,
+ NewClientDerCert = public_key:pkix_sign(ClientOTPTbsCert, Key),
+ ssl_test_lib:der_to_pem(NewClientCertFile, [{'Certificate', NewClientDerCert, not_encrypted}]),
+ NewClientOpts = [{certfile, NewClientCertFile} | proplists:delete(certfile, ClientOpts)],
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {options, [{verify, verify_peer} | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {options, NewClientOpts}]),
+
+ tcp_delivery_workaround(Server, {error, "bad certificate"},
+ Client, {error,"bad certificate"}).
+
+
+%%--------------------------------------------------------------------
+
+client_with_cert_cipher_suites_handshake() ->
+ [{doc, "Test that client with a certificate without keyEncipherment usage "
+ " extension can connect to a server with restricted cipher suites "}].
+client_with_cert_cipher_suites_handshake(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_verification_opts_digital_signature_only, Config),
+ ServerOpts = ?config(server_verification_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, [{active, true},
+ {ciphers, ssl_test_lib:rsa_non_signed_suites()}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, [{active, true}
+ | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+
+server_verify_no_cacerts() ->
+ [{doc,"Test server must have cacerts if it wants to verify client"}].
+server_verify_no_cacerts(Config) when is_list(Config) ->
+ ServerOpts = ?config(server_opts, Config),
+ {_, ServerNode, _} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {options, [{verify, verify_peer}
+ | ServerOpts]}]),
+
+ ssl_test_lib:check_result(Server, {error, {eoptions, {cacertfile, ""}}}).
+
+
+%%--------------------------------------------------------------------
+unknown_server_ca_fail() ->
+ [{doc,"Test that the client fails if the ca is unknown in verify_peer mode"}].
+unknown_server_ca_fail(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server_error([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ no_result, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ FunAndState = {fun(_,{bad_cert, unknown_ca} = Reason, _) ->
+ {fail, Reason};
+ (_,{extension, _}, UserState) ->
+ {unknown, UserState};
+ (_, valid, UserState) ->
+ {valid, [test_to_update_user_state | UserState]};
+ (_, valid_peer, UserState) ->
+ {valid, UserState}
+ end, []},
+
+ Client = ssl_test_lib:start_client_error([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ no_result, []}},
+ {options,
+ [{verify, verify_peer},
+ {verify_fun, FunAndState}
+ | ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, {error,"unknown ca"},
+ Client, {error, "unknown ca"}).
+
+%%--------------------------------------------------------------------
+unknown_server_ca_accept_verify_none() ->
+ [{doc,"Test that the client succeds if the ca is unknown in verify_none mode"}].
+unknown_server_ca_accept_verify_none(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options,
+ [{verify, verify_none}| ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+%%--------------------------------------------------------------------
+unknown_server_ca_accept_verify_peer() ->
+ [{doc, "Test that the client succeds if the ca is unknown in verify_peer mode"
+ " with a verify_fun that accepts the unknown ca error"}].
+unknown_server_ca_accept_verify_peer(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ FunAndState = {fun(_,{bad_cert, unknown_ca}, UserState) ->
+ {valid, UserState};
+ (_,{bad_cert, _} = Reason, _) ->
+ {fail, Reason};
+ (_,{extension, _}, UserState) ->
+ {unknown, UserState};
+ (_, valid, UserState) ->
+ {valid, UserState};
+ (_, valid_peer, UserState) ->
+ {valid, UserState}
+ end, []},
+
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options,
+ [{verify, verify_peer},
+ {verify_fun, FunAndState}| ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+unknown_server_ca_accept_backwardscompatibility() ->
+ [{doc,"Test that old style verify_funs will work"}].
+unknown_server_ca_accept_backwardscompatibility(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ AcceptBadCa = fun({bad_cert,unknown_ca}, Acc) -> Acc;
+ (Other, Acc) -> [Other | Acc]
+ end,
+ VerifyFun =
+ fun(ErrorList) ->
+ case lists:foldl(AcceptBadCa, [], ErrorList) of
+ [] -> true;
+ [_|_] -> false
+ end
+ end,
+
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib,
+ send_recv_result_active, []}},
+ {options,
+ [{verify, verify_peer},
+ {verify_fun, VerifyFun}| ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+%%--------------------------------------------------------------------
+%% Internal functions ------------------------------------------------
+%%--------------------------------------------------------------------
+
+tcp_delivery_workaround(Server, ServerMsg, Client, ClientMsg) ->
+ receive
+ {Server, ServerMsg} ->
+ client_msg(Client, ClientMsg);
+ {Client, ClientMsg} ->
+ server_msg(Server, ServerMsg);
+ {Client, {error,closed}} ->
+ server_msg(Server, ServerMsg);
+ {Server, {error,closed}} ->
+ client_msg(Client, ClientMsg);
+ {Client, {error, esslconnect}} ->
+ server_msg(Server, ServerMsg);
+ {Server, {error, esslaccept}} ->
+ client_msg(Client, ClientMsg)
+ end.
+
+client_msg(Client, ClientMsg) ->
+ receive
+ {Client, ClientMsg} ->
+ ok;
+ {Client, {error,closed}} ->
+ ct:print("client got close"),
+ ok;
+ {Client, {error, esslconnect}} ->
+ ct:print("client got econnaborted"),
+ ok;
+ Unexpected ->
+ ct:fail(Unexpected)
+ end.
+server_msg(Server, ServerMsg) ->
+ receive
+ {Server, ServerMsg} ->
+ ok;
+ {Server, {error,closed}} ->
+ ct:print("server got close"),
+ ok;
+ {Server, {error, esslaccept}} ->
+ ct:print("server got econnaborted"),
+ ok;
+ Unexpected ->
+ ct:fail(Unexpected)
+ end.
diff --git a/lib/ssl/test/ssl_cipher_SUITE.erl b/lib/ssl/test/ssl_cipher_SUITE.erl
index ea1d9dc90c..9869812e6e 100644
--- a/lib/ssl/test/ssl_cipher_SUITE.erl
+++ b/lib/ssl/test/ssl_cipher_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -31,16 +31,18 @@
-define(TIMEOUT, 600000).
-%% Test server callback functions
%%--------------------------------------------------------------------
-%% Function: init_per_suite(Config) -> Config
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Initialization before the whole suite
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
+%% Common Test interface functions -----------------------------------
%%--------------------------------------------------------------------
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [aes_decipher_good, aes_decipher_good_tls11, aes_decipher_fail, aes_decipher_fail_tls11].
+
+groups() ->
+ [].
+
init_per_suite(Config) ->
try crypto:start() of
ok ->
@@ -48,81 +50,30 @@ init_per_suite(Config) ->
catch _:_ ->
{skip, "Crypto did not start"}
end.
-%%--------------------------------------------------------------------
-%% Function: end_per_suite(Config) -> _
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after the whole suite
-%%--------------------------------------------------------------------
+
end_per_suite(_Config) ->
ssl:stop(),
application:stop(crypto).
-%%--------------------------------------------------------------------
-%% Function: init_per_testcase(TestCase, Config) -> Config
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%%
-%% Description: Initialization before each test case
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%% Description: Initialization before each test case
-%%--------------------------------------------------------------------
-init_per_testcase(_TestCase, Config0) ->
- Config = lists:keydelete(watchdog, 1, Config0),
- Dog = ssl_test_lib:timetrap(?TIMEOUT),
- [{watchdog, Dog} | Config].
-
-%%--------------------------------------------------------------------
-%% Function: end_per_testcase(TestCase, Config) -> _
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after each test case
-%%--------------------------------------------------------------------
-end_per_testcase(_TestCase, Config) ->
- Dog = ?config(watchdog, Config),
- case Dog of
- undefined ->
- ok;
- _ ->
- test_server:timetrap_cancel(Dog)
- end.
-
-%%--------------------------------------------------------------------
-%% Function: all(Clause) -> TestCases
-%% Clause - atom() - suite | doc
-%% TestCases - [Case]
-%% Case - atom()
-%% Name of a test case.
-%% Description: Returns a list of all test cases in this test suite
-%%--------------------------------------------------------------------
-suite() -> [{ct_hooks,[ts_install_cth]}].
-
-all() ->
- [aes_decipher_good, aes_decipher_good_tls11, aes_decipher_fail, aes_decipher_fail_tls11].
-
-groups() ->
- [].
-
init_per_group(_GroupName, Config) ->
Config.
end_per_group(_GroupName, Config) ->
Config.
+init_per_testcase(_TestCase, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = ct:timetrap(?TIMEOUT),
+ [{watchdog, Dog} | Config].
-%% Test cases starts here.
-%%--------------------------------------------------------------------
-aes_decipher_good(doc) ->
- ["Decipher a known cryptotext."];
+end_per_testcase(_TestCase, Config) ->
+ Config.
-aes_decipher_good(suite) ->
- [];
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
+aes_decipher_good() ->
+ [{doc,"Decipher a known cryptotext."}].
aes_decipher_good(Config) when is_list(Config) ->
HashSz = 32,
@@ -142,11 +93,8 @@ aes_decipher_good(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-aes_decipher_good_tls11(doc) ->
- ["Decipher a known TLS 1.1 cryptotext."];
-
-aes_decipher_good_tls11(suite) ->
- [];
+aes_decipher_good_tls11() ->
+ [{doc,"Decipher a known TLS 1.1 cryptotext."}].
%% the fragment is actuall a TLS 1.1 record, with
%% Version = TLS 1.1, we get the correct NextIV in #cipher_state
@@ -169,11 +117,8 @@ aes_decipher_good_tls11(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-aes_decipher_fail(doc) ->
- ["Decipher a known cryptotext."];
-
-aes_decipher_fail(suite) ->
- [];
+aes_decipher_fail() ->
+ [{doc,"Decipher a known cryptotext."}].
%% same as above, last byte of key replaced
aes_decipher_fail(Config) when is_list(Config) ->
@@ -196,11 +141,8 @@ aes_decipher_fail(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-aes_decipher_fail_tls11(doc) ->
- ["Decipher a known TLS 1.1 cryptotext."];
-
-aes_decipher_fail_tls11(suite) ->
- [];
+aes_decipher_fail_tls11() ->
+ [{doc,"Decipher a known TLS 1.1 cryptotext."}].
%% same as above, last byte of key replaced
%% stricter padding checks in TLS 1.1 mean we get an alert instead
@@ -213,9 +155,11 @@ aes_decipher_fail_tls11(Config) when is_list(Config) ->
198,181,81,19,98,162,213,228,74,224,253,168,156,59,195,122,
108,101,107,242,20,15,169,150,163,107,101,94,93,104,241,165>>,
Version = {3,2},
- #alert{level = ?FATAL, description = ?BAD_RECORD_MAC} = ssl_cipher:decipher(?AES, HashSz, CipherState, Fragment, Version),
+ #alert{level = ?FATAL, description = ?BAD_RECORD_MAC} =
+ ssl_cipher:decipher(?AES, HashSz, CipherState, Fragment, Version),
Version1 = {3,3},
- #alert{level = ?FATAL, description = ?BAD_RECORD_MAC} = ssl_cipher:decipher(?AES, HashSz, CipherState, Fragment, Version1),
+ #alert{level = ?FATAL, description = ?BAD_RECORD_MAC} =
+ ssl_cipher:decipher(?AES, HashSz, CipherState, Fragment, Version1),
ok.
%%--------------------------------------------------------------------
diff --git a/lib/ssl/test/ssl_dist_SUITE.erl b/lib/ssl/test/ssl_dist_SUITE.erl
index 818f7f1897..7bfd678f4b 100644
--- a/lib/ssl/test/ssl_dist_SUITE.erl
+++ b/lib/ssl/test/ssl_dist_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2007-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2007-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -19,7 +19,7 @@
-module(ssl_dist_SUITE).
--include_lib("test_server/include/test_server.hrl").
+-include_lib("common_test/include/ct.hrl").
%% Note: This directive should only be used in test suites.
-compile(export_all).
@@ -35,7 +35,10 @@
nodename}
).
-%% Test server callback functions
+%%--------------------------------------------------------------------
+%% Common Test interface functions -----------------------------------
+%%--------------------------------------------------------------------
+
suite() ->
[{ct_hooks,[ts_install_cth]}].
@@ -54,6 +57,7 @@ end_per_group(_GroupName, Config) ->
init_per_suite(Config0) ->
try crypto:start() of
ok ->
+ %% Currently no ct function avilable for is_cover!
case test_server:is_cover() of
false ->
Config = add_ssl_opts_config(Config0),
@@ -98,11 +102,13 @@ common_end(_, Config) ->
Dog = ?config(watchdog, Config),
?t:timetrap_cancel(Dog),
ok.
+
%%--------------------------------------------------------------------
-%% Test cases starts here.
+%% Test Cases --------------------------------------------------------
%%--------------------------------------------------------------------
-basic(doc) ->
- ["Test that two nodes can connect via ssl distribution"];
+
+basic() ->
+ [{doc,"Test that two nodes can connect via ssl distribution"}].
basic(Config) when is_list(Config) ->
NH1 = start_ssl_node(Config),
Node1 = NH1#node_handle.nodename,
@@ -162,8 +168,8 @@ basic(Config) when is_list(Config) ->
success(Config).
%%--------------------------------------------------------------------
-payload(doc) ->
- ["Test that send a lot of data between the ssl distributed noes"];
+payload() ->
+ [{doc,"Test that send a lot of data between the ssl distributed noes"}].
payload(Config) when is_list(Config) ->
NH1 = start_ssl_node(Config),
Node1 = NH1#node_handle.nodename,
@@ -204,8 +210,8 @@ payload(Config) when is_list(Config) ->
stop_ssl_node(NH2),
success(Config).
%%--------------------------------------------------------------------
-plain_options(doc) ->
- ["Test specifying additional options"];
+plain_options() ->
+ [{doc,"Test specifying additional options"}].
plain_options(Config) when is_list(Config) ->
DistOpts = "-ssl_dist_opt server_secure_renegotiate true "
"client_secure_renegotiate true "
@@ -228,8 +234,8 @@ plain_options(Config) when is_list(Config) ->
stop_ssl_node(NH2),
success(Config).
%%--------------------------------------------------------------------
-plain_verify_options(doc) ->
- ["Test specifying additional options"];
+plain_verify_options() ->
+ [{doc,"Test specifying additional options"}].
plain_verify_options(Config) when is_list(Config) ->
DistOpts = "-ssl_dist_opt server_secure_renegotiate true "
"client_secure_renegotiate true "
@@ -251,7 +257,7 @@ plain_verify_options(Config) when is_list(Config) ->
success(Config).
%%--------------------------------------------------------------------
-%%% Internal functions
+%%% Internal functions -----------------------------------------------
%%--------------------------------------------------------------------
%% ssl_node side api
diff --git a/lib/ssl/test/ssl_handshake_SUITE.erl b/lib/ssl/test/ssl_handshake_SUITE.erl
index 363a0be594..aff0e0fbbc 100644
--- a/lib/ssl/test/ssl_handshake_SUITE.erl
+++ b/lib/ssl/test/ssl_handshake_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -27,6 +27,9 @@
-include("ssl_internal.hrl").
-include("ssl_handshake.hrl").
+%%--------------------------------------------------------------------
+%% Common Test interface functions -----------------------------------
+%%--------------------------------------------------------------------
suite() -> [{ct_hooks,[ts_install_cth]}].
all() -> [
@@ -34,6 +37,9 @@ all() -> [
decode_single_hello_extension_correctly,
decode_unknown_hello_extension_correctly].
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
decode_hello_handshake(_Config) ->
HelloPacket = <<16#02, 16#00, 16#00,
16#44, 16#03, 16#03, 16#4e, 16#7f, 16#c1, 16#03, 16#35,
diff --git a/lib/ssl/test/ssl_npn_handshake_SUITE.erl b/lib/ssl/test/ssl_npn_handshake_SUITE.erl
index 8597aa6740..4e848095a5 100644
--- a/lib/ssl/test/ssl_npn_handshake_SUITE.erl
+++ b/lib/ssl/test/ssl_npn_handshake_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -24,6 +24,10 @@
-compile(export_all).
-include_lib("common_test/include/ct.hrl").
+%%--------------------------------------------------------------------
+%% Common Test interface functions -----------------------------------
+%%--------------------------------------------------------------------
+
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
@@ -68,7 +72,7 @@ init_per_suite(Config) ->
Result =
(catch make_certs:all(?config(data_dir, Config),
?config(priv_dir, Config))),
- test_server:format("Make certs ~p~n", [Result]),
+ ct:print("Make certs ~p~n", [Result]),
ssl_test_lib:cert_options(Config)
catch _:_ ->
{skip, "Crypto did not start"}
@@ -94,12 +98,11 @@ init_per_group(GroupName, Config) ->
Config
end.
-
end_per_group(_GroupName, Config) ->
Config.
-
-%% Test cases starts here.
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
%%--------------------------------------------------------------------
validate_empty_protocols_are_not_allowed(Config) when is_list(Config) ->
@@ -229,9 +232,8 @@ npn_not_supported_server(Config) when is_list(Config)->
{error, {eoptions, {not_supported_in_sslv3, AdvProtocols}}} = ssl:listen(0, ServerOpts).
%%--------------------------------------------------------------------
-%%% Internal functions
+%% Internal functions ------------------------------------------------
%%--------------------------------------------------------------------
-
run_npn_handshake(Config, ClientExtraOpts, ServerExtraOpts, ExpectedProtocol) ->
Data = "hello world",
@@ -257,13 +259,13 @@ run_npn_handshake(Config, ClientExtraOpts, ServerExtraOpts, ExpectedProtocol) ->
assert_npn(Socket, Protocol) ->
- test_server:format("Negotiated Protocol ~p, Expecting: ~p ~n",
+ ct:print("Negotiated Protocol ~p, Expecting: ~p ~n",
[ssl:negotiated_next_protocol(Socket), Protocol]),
Protocol = ssl:negotiated_next_protocol(Socket).
assert_npn_and_renegotiate_and_send_data(Socket, Protocol, Data) ->
assert_npn(Socket, Protocol),
- test_server:format("Renegotiating ~n", []),
+ ct:print("Renegotiating ~n", []),
ok = ssl:renegotiate(Socket),
ssl:send(Socket, Data),
assert_npn(Socket, Protocol),
@@ -278,7 +280,7 @@ ssl_receive_and_assert_npn(Socket, Protocol, Data) ->
ssl_receive(Socket, Data).
ssl_send(Socket, Data) ->
- test_server:format("Connection info: ~p~n",
+ ct:print("Connection info: ~p~n",
[ssl:connection_info(Socket)]),
ssl:send(Socket, Data).
@@ -286,11 +288,11 @@ ssl_receive(Socket, Data) ->
ssl_receive(Socket, Data, []).
ssl_receive(Socket, Data, Buffer) ->
- test_server:format("Connection info: ~p~n",
+ ct:print("Connection info: ~p~n",
[ssl:connection_info(Socket)]),
receive
{ssl, Socket, MoreData} ->
- test_server:format("Received ~p~n",[MoreData]),
+ ct:print("Received ~p~n",[MoreData]),
NewBuffer = Buffer ++ MoreData,
case NewBuffer of
Data ->
@@ -300,9 +302,9 @@ ssl_receive(Socket, Data, Buffer) ->
ssl_receive(Socket, Data, NewBuffer)
end;
Other ->
- test_server:fail({unexpected_message, Other})
+ ct:fail({unexpected_message, Other})
after 4000 ->
- test_server:fail({did_not_get, Data})
+ ct:fail({did_not_get, Data})
end.
diff --git a/lib/ssl/test/ssl_npn_hello_SUITE.erl b/lib/ssl/test/ssl_npn_hello_SUITE.erl
index 5102c74e87..72768bcb55 100644
--- a/lib/ssl/test/ssl_npn_hello_SUITE.erl
+++ b/lib/ssl/test/ssl_npn_hello_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -27,6 +27,10 @@
-include("ssl_record.hrl").
-include_lib("common_test/include/ct.hrl").
+%%--------------------------------------------------------------------
+%% Common Test interface functions -----------------------------------
+%%--------------------------------------------------------------------
+
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
@@ -37,44 +41,26 @@ all() ->
create_server_hello_with_advertised_protocols_test,
create_server_hello_with_no_advertised_protocols_test].
-
-create_client_handshake(Npn) ->
- ssl_handshake:encode_handshake(#client_hello{
- client_version = {1, 2},
- random = <<1:256>>,
- session_id = <<>>,
- cipher_suites = "",
- compression_methods = "",
- next_protocol_negotiation = Npn,
- renegotiation_info = #renegotiation_info{}
- }, vsn).
-
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
encode_and_decode_client_hello_test(_Config) ->
HandShakeData = create_client_handshake(undefined),
Version = ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
- {[{DecodedHandshakeMessage, _Raw}], _} = ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
+ {[{DecodedHandshakeMessage, _Raw}], _} =
+ ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
NextProtocolNegotiation = DecodedHandshakeMessage#client_hello.next_protocol_negotiation,
NextProtocolNegotiation = undefined.
-
+%%--------------------------------------------------------------------
encode_and_decode_npn_client_hello_test(_Config) ->
HandShakeData = create_client_handshake(#next_protocol_negotiation{extension_data = <<>>}),
Version = ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
- {[{DecodedHandshakeMessage, _Raw}], _} = ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
+ {[{DecodedHandshakeMessage, _Raw}], _} =
+ ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
NextProtocolNegotiation = DecodedHandshakeMessage#client_hello.next_protocol_negotiation,
NextProtocolNegotiation = #next_protocol_negotiation{extension_data = <<>>}.
-
-create_server_handshake(Npn) ->
- ssl_handshake:encode_handshake(#server_hello{
- server_version = {1, 2},
- random = <<1:256>>,
- session_id = <<>>,
- cipher_suite = <<1,2>>,
- compression_method = 1,
- next_protocol_negotiation = Npn,
- renegotiation_info = #renegotiation_info{}
- }, vsn).
-
+%%--------------------------------------------------------------------
encode_and_decode_server_hello_test(_Config) ->
HandShakeData = create_server_handshake(undefined),
Version = ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
@@ -82,15 +68,51 @@ encode_and_decode_server_hello_test(_Config) ->
ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
NextProtocolNegotiation = DecodedHandshakeMessage#server_hello.next_protocol_negotiation,
NextProtocolNegotiation = undefined.
-
+%%--------------------------------------------------------------------
encode_and_decode_npn_server_hello_test(_Config) ->
HandShakeData = create_server_handshake(#next_protocol_negotiation{extension_data = <<6, "spdy/2">>}),
Version = ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
- {[{DecodedHandshakeMessage, _Raw}], _} = ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
+ {[{DecodedHandshakeMessage, _Raw}], _} =
+ ssl_handshake:get_tls_handshake(Version, list_to_binary(HandShakeData), <<>>),
NextProtocolNegotiation = DecodedHandshakeMessage#server_hello.next_protocol_negotiation,
ct:print("~p ~n", [NextProtocolNegotiation]),
NextProtocolNegotiation = #next_protocol_negotiation{extension_data = <<6, "spdy/2">>}.
+%%--------------------------------------------------------------------
+create_server_hello_with_no_advertised_protocols_test(_Config) ->
+ Hello = ssl_handshake:server_hello(<<>>, {3, 0}, create_connection_states(), false, undefined),
+ undefined = Hello#server_hello.next_protocol_negotiation.
+%%--------------------------------------------------------------------
+create_server_hello_with_advertised_protocols_test(_Config) ->
+ Hello = ssl_handshake:server_hello(<<>>, {3, 0}, create_connection_states(),
+ false, [<<"spdy/1">>, <<"http/1.0">>, <<"http/1.1">>]),
+ #next_protocol_negotiation{extension_data = <<6, "spdy/1", 8, "http/1.0", 8, "http/1.1">>} =
+ Hello#server_hello.next_protocol_negotiation.
+%%--------------------------------------------------------------------
+%% Internal functions ------------------------------------------------
+%%--------------------------------------------------------------------
+create_client_handshake(Npn) ->
+ ssl_handshake:encode_handshake(#client_hello{
+ client_version = {1, 2},
+ random = <<1:256>>,
+ session_id = <<>>,
+ cipher_suites = "",
+ compression_methods = "",
+ next_protocol_negotiation = Npn,
+ renegotiation_info = #renegotiation_info{}
+ }, vsn).
+
+create_server_handshake(Npn) ->
+ ssl_handshake:encode_handshake(#server_hello{
+ server_version = {1, 2},
+ random = <<1:256>>,
+ session_id = <<>>,
+ cipher_suite = <<1,2>>,
+ compression_method = 1,
+ next_protocol_negotiation = Npn,
+ renegotiation_info = #renegotiation_info{}
+ }, vsn).
+
create_connection_states() ->
#connection_states{
pending_read = #connection_state{
@@ -105,13 +127,3 @@ create_connection_states() ->
secure_renegotiation = false
}
}.
-
-create_server_hello_with_no_advertised_protocols_test(_Config) ->
- Hello = ssl_handshake:server_hello(<<>>, {3, 0}, create_connection_states(), false, undefined),
- undefined = Hello#server_hello.next_protocol_negotiation.
-
-create_server_hello_with_advertised_protocols_test(_Config) ->
- Hello = ssl_handshake:server_hello(<<>>, {3, 0}, create_connection_states(),
- false, [<<"spdy/1">>, <<"http/1.0">>, <<"http/1.1">>]),
- #next_protocol_negotiation{extension_data = <<6, "spdy/1", 8, "http/1.0", 8, "http/1.1">>} =
- Hello#server_hello.next_protocol_negotiation.
diff --git a/lib/ssl/test/ssl_packet_SUITE.erl b/lib/ssl/test/ssl_packet_SUITE.erl
index 8ce80cb725..158c40e372 100644
--- a/lib/ssl/test/ssl_packet_SUITE.erl
+++ b/lib/ssl/test/ssl_packet_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -41,84 +41,10 @@
-define(MANY, 1000).
-define(SOME, 50).
-
-%% Test server callback functions
%%--------------------------------------------------------------------
-%% Function: init_per_suite(Config) -> Config
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Initialization before the whole suite
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
+%% Common Test interface functions -----------------------------------
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- catch crypto:stop(),
- try crypto:start() of
- ok ->
- application:start(public_key),
- ssl:start(),
- Result =
- (catch make_certs:all(?config(data_dir, Config),
- ?config(priv_dir, Config))),
- test_server:format("Make certs ~p~n", [Result]),
- ssl_test_lib:cert_options(Config)
- catch _:_ ->
- {skip, "Crypto did not start"}
- end.
-%%--------------------------------------------------------------------
-%% Function: end_per_suite(Config) -> _
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after the whole suite
-%%--------------------------------------------------------------------
-end_per_suite(_Config) ->
- ssl:stop(),
- application:stop(crypto).
-%%--------------------------------------------------------------------
-%% Function: init_per_testcase(TestCase, Config) -> Config
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%%
-%% Description: Initialization before each test case
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%% Description: Initialization before each test case
-%%--------------------------------------------------------------------
-init_per_testcase(_TestCase, Config0) ->
- Config = lists:keydelete(watchdog, 1, Config0),
- Dog = ssl_test_lib:timetrap(?TIMEOUT),
- [{watchdog, Dog} | Config].
-
-%%--------------------------------------------------------------------
-%% Function: end_per_testcase(TestCase, Config) -> _
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after each test case
-%%--------------------------------------------------------------------
-end_per_testcase(_TestCase, Config) ->
- Dog = ?config(watchdog, Config),
- case Dog of
- undefined ->
- ok;
- _ ->
- test_server:timetrap_cancel(Dog)
- end.
-
-%%--------------------------------------------------------------------
-%% Function: all(Clause) -> TestCases
-%% Clause - atom() - suite | doc
-%% TestCases - [Case]
-%% Case - atom()
-%% Name of a test case.
-%% Description: Returns a list of all test cases in this test suite
-%%--------------------------------------------------------------------
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
@@ -129,12 +55,6 @@ all() ->
{group, 'sslv3'}
].
-groups() ->
- [{'tlsv1.2', [], packet_tests()},
- {'tlsv1.1', [], packet_tests()},
- {'tlsv1', [], packet_tests()},
- {'sslv3', [], packet_tests()}].
-
packet_tests() ->
active_packet_tests() ++ active_once_packet_tests() ++ passive_packet_tests() ++
[packet_send_to_large,
@@ -208,6 +128,24 @@ active_packet_tests() ->
header_decode_two_bytes_one_sent_active
].
+init_per_suite(Config) ->
+ catch crypto:stop(),
+ try crypto:start() of
+ ok ->
+ application:start(public_key),
+ ssl:start(),
+ Result =
+ (catch make_certs:all(?config(data_dir, Config),
+ ?config(priv_dir, Config))),
+ ct:print("Make certs ~p~n", [Result]),
+ ssl_test_lib:cert_options(Config)
+ catch _:_ ->
+ {skip, "Crypto did not start"}
+ end.
+
+end_per_suite(_Config) ->
+ ssl:stop(),
+ application:stop(crypto).
init_per_group(GroupName, Config) ->
case ssl_test_lib:is_tls_version(GroupName) of
@@ -228,1032 +166,262 @@ init_per_group(GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
+init_per_testcase(_TestCase, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = ct:timetrap(?TIMEOUT),
+ [{watchdog, Dog} | Config].
-%% Test cases starts here.
-%%--------------------------------------------------------------------
-packet_raw_passive_many_small(doc) ->
- ["Test packet option {packet, raw} in passive mode."];
-
-packet_raw_passive_many_small(suite) ->
- [];
-packet_raw_passive_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Data = "Packet option is {packet, raw}",
+end_per_testcase(_TestCase, Config) ->
+ Config.
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?MANY]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_raw, [Data, ?MANY]}},
- {options,
- [{active, false},
- {packet, raw} |
- ClientOpts]}]),
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
- ssl_test_lib:check_result(Client, ok),
+packet_raw_passive_many_small() ->
+ [{doc,"Test packet option {packet, raw} in passive mode."}].
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+packet_raw_passive_many_small(Config) when is_list(Config) ->
+ Data = "Packet option is {packet, raw}",
+ packet(Config, Data, send, passive_recv_packet, ?MANY, raw, false).
%%--------------------------------------------------------------------
-packet_raw_passive_some_big(doc) ->
- ["Test packet option {packet, raw} in passive mode."];
-
-packet_raw_passive_some_big(suite) ->
- [];
-
-packet_raw_passive_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_raw_passive_some_big() ->
+ [{doc,"Test packet option {packet, raw} in passive mode."}].
+packet_raw_passive_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?SOME]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_raw, [Data, ?SOME]}},
- {options,
- [{active, false},
- {packet, raw} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send, passive_recv_packet, ?SOME, raw, false).
%%--------------------------------------------------------------------
-packet_0_passive_many_small(doc) ->
- ["Test packet option {packet, 0} in passive mode."];
-
-packet_0_passive_many_small(suite) ->
- [];
-
-packet_0_passive_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_0_passive_many_small() ->
+ [{doc,"Test packet option {packet, 0} in passive mode."}].
+packet_0_passive_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 0}, equivalent to packet raw.",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?MANY]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_raw, [Data, ?MANY]}},
- {options, [{active, false},
- {packet, 0} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?MANY, 0, false).
%%--------------------------------------------------------------------
-packet_0_passive_some_big(doc) ->
- ["Test packet option {packet, 0} in passive mode."];
-
-packet_0_passive_some_big(suite) ->
- [];
-
-packet_0_passive_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_0_passive_some_big() ->
+ [{doc,"Test packet option {packet, 0} in passive mode."}].
+packet_0_passive_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?SOME]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_raw, [Data, ?SOME]}},
- {options, [{active, false},
- {packet, 0} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?SOME, 0, false).
%%--------------------------------------------------------------------
-packet_1_passive_many_small(doc) ->
- ["Test packet option {packet, 1} in passive mode."];
-
-packet_1_passive_many_small(suite) ->
- [];
-
-packet_1_passive_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_1_passive_many_small() ->
+ [{doc,"Test packet option {packet, 1} in passive mode."}].
+packet_1_passive_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 1}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 1}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_recv_packet,
- [Data, ?MANY]}},
- {options, [{active, false},
- {packet, 1} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?MANY, 1, false).
%%--------------------------------------------------------------------
-packet_1_passive_some_big(doc) ->
- ["Test packet option {packet, 1} in passive mode."];
-
-packet_1_passive_some_big(suite) ->
- [];
-
-packet_1_passive_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_1_passive_some_big() ->
+ [{doc,"Test packet option {packet, 1} in passive mode."}].
+packet_1_passive_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(255, "1")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 1}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_recv_packet,
- [Data, ?SOME]}},
- {options, [{active, false},
- {packet, 1} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?SOME, 1, false).
%%--------------------------------------------------------------------
-packet_2_passive_many_small(doc) ->
- ["Test packet option {packet, 2} in passive mode"];
-
-packet_2_passive_many_small(suite) ->
- [];
-
-packet_2_passive_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_2_passive_many_small() ->
+ [{doc,"Test packet option {packet, 2} in passive mode"}].
+packet_2_passive_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 2}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 2}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_recv_packet,
- [Data, ?MANY]}},
- {options, [{active, false},
- {packet, 2} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?MANY, 2, false).
%%--------------------------------------------------------------------
-packet_2_passive_some_big(doc) ->
- ["Test packet option {packet, 2} in passive mode"];
-
-packet_2_passive_some_big(suite) ->
- [];
-
-packet_2_passive_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_2_passive_some_big() ->
+ [{doc,"Test packet option {packet, 2} in passive mode"}].
+packet_2_passive_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 2}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_recv_packet,
- [Data, ?SOME]}},
- {options, [{active, false},
- {packet, 2} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?SOME, 2, false).
%%--------------------------------------------------------------------
-packet_4_passive_many_small(doc) ->
- ["Test packet option {packet, 4} in passive mode"];
-
-packet_4_passive_many_small(suite) ->
- [];
-
-packet_4_passive_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_4_passive_many_small() ->
+ [{doc,"Test packet option {packet, 4} in passive mode"}].
+packet_4_passive_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 4}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa,
- {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 4}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_recv_packet,
- [Data, ?MANY]}},
- {options, [{active, false},
- {packet, 4} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send, passive_recv_packet, ?MANY, 4, false).
%%--------------------------------------------------------------------
-packet_4_passive_some_big(doc) ->
- ["Test packet option {packet, 4} in passive mode"];
-
-packet_4_passive_some_big(suite) ->
- [];
-
-packet_4_passive_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_4_passive_some_big() ->
+ [{doc,"Test packet option {packet, 4} in passive mode"}].
+packet_4_passive_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 4}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, passive_recv_packet,
- [Data, ?SOME]}},
- {options, [{active, false},
- {packet, 4} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send, passive_recv_packet, ?SOME, 4, false).
%%--------------------------------------------------------------------
-packet_raw_active_once_many_small(doc) ->
- ["Test packet option {packet, raw} in active once mode."];
-
-packet_raw_active_once_many_small(suite) ->
- [];
-
-packet_raw_active_once_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_raw_active_once_many_small() ->
+ [{doc,"Test packet option {packet, raw} in active once mode."}].
+packet_raw_active_once_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, raw}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?MANY]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, active_once_raw,
- [Data, ?MANY]}},
- {options, [{active, once},
- {packet, raw} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?MANY, raw, once).
%%--------------------------------------------------------------------
-packet_raw_active_once_some_big(doc) ->
- ["Test packet option {packet, raw} in active once mode."];
-
-packet_raw_active_once_some_big(suite) ->
- [];
-
-packet_raw_active_once_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_raw_active_once_some_big() ->
+ [{doc,"Test packet option {packet, raw} in active once mode."}].
+packet_raw_active_once_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?SOME]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, active_once_raw,
- [Data, ?SOME]}},
- {options, [{active, once},
- {packet, raw} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?SOME, raw, once).
%%--------------------------------------------------------------------
-packet_0_active_once_many_small(doc) ->
- ["Test packet option {packet, 0} in active once mode."];
-
-packet_0_active_once_many_small(suite) ->
- [];
-
-packet_0_active_once_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_0_active_once_many_small() ->
+ [{doc,"Test packet option {packet, 0} in active once mode."}].
+packet_0_active_once_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 0}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?MANY]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE, active_once_raw,
- [Data, ?MANY]}},
- {options, [{active, once},
- {packet, 0} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send_raw, active_once_raw, ?MANY, 0, once).
%%--------------------------------------------------------------------
-packet_0_active_once_some_big(doc) ->
- ["Test packet option {packet, 0} in active once mode."];
-
-packet_0_active_once_some_big(suite) ->
- [];
-
-packet_0_active_once_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_0_active_once_some_big() ->
+ [{doc,"Test packet option {packet, 0} in active once mode."}].
+packet_0_active_once_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,
- [Data, ?SOME]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE, active_once_raw,
- [Data, ?SOME]}},
- {options, [{active, once},
- {packet, 0} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?SOME, 0, once).
%%--------------------------------------------------------------------
-packet_1_active_once_many_small(doc) ->
- ["Test packet option {packet, 1} in active once mode."];
-
-packet_1_active_once_many_small(suite) ->
- [];
-
-packet_1_active_once_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_1_active_once_many_small() ->
+ [{doc,"Test packet option {packet, 1} in active once mode."}].
+packet_1_active_once_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 1}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 1}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_once_packet,
- [Data, ?MANY]}},
- {options, [{active, once},
- {packet, 1} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?MANY, 1, once).
%%--------------------------------------------------------------------
-packet_1_active_once_some_big(doc) ->
- ["Test packet option {packet, 1} in active once mode."];
-
-packet_1_active_once_some_big(suite) ->
- [];
-
-packet_1_active_once_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_1_active_once_some_big() ->
+ [{doc,"Test packet option {packet, 1} in active once mode."}].
+packet_1_active_once_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(255, "1")),
+ packet(Config, Data, send_raw, active_once_raw, ?SOME, 1, once).
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 1}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_once_packet,
- [Data, ?SOME]}},
- {options, [{active, once},
- {packet, 1} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_2_active_once_many_small(doc) ->
- ["Test packet option {packet, 2} in active once mode"];
-
-packet_2_active_once_many_small(suite) ->
- [];
-
-packet_2_active_once_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_2_active_once_many_small() ->
+ [{doc,"Test packet option {packet, 2} in active once mode"}].
+packet_2_active_once_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 2}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 2}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_once_packet,
- [Data, ?MANY]}},
- {options, [{active, once},
- {packet, 2} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send_raw, active_once_raw, ?MANY, 2, once).
%%--------------------------------------------------------------------
-packet_2_active_once_some_big(doc) ->
- ["Test packet option {packet, 2} in active once mode"];
-
-packet_2_active_once_some_big(suite) ->
- [];
-
-packet_2_active_once_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_2_active_once_some_big() ->
+ [{doc,"Test packet option {packet, 2} in active once mode"}].
+packet_2_active_once_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 2}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_once_packet,
- [Data, ?SOME]}},
- {options, [{active, once},
- {packet, 2} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?SOME, 2, once).
%%--------------------------------------------------------------------
-packet_4_active_once_many_small(doc) ->
- ["Test packet option {packet, 4} in active once mode"];
-
-packet_4_active_once_many_small(suite) ->
- [];
-
-packet_4_active_once_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_4_active_once_many_small() ->
+ [{doc,"Test packet option {packet, 4} in active once mode"}].
+packet_4_active_once_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 4}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 4}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_once_packet,
- [Data, ?MANY]}},
- {options, [{active, once},
- {packet, 4} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?MANY, 4, once).
%%--------------------------------------------------------------------
-packet_4_active_once_some_big(doc) ->
- ["Test packet option {packet, 4} in active once mode"];
-
-packet_4_active_once_some_big(suite) ->
- [];
-
-packet_4_active_once_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_4_active_once_some_big() ->
+ [{doc,"Test packet option {packet, 4} in active once mode"}].
+packet_4_active_once_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 4}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_once_packet,
- [Data, ?SOME]}},
- {options, [{active, once},
- {packet, 4} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_once_raw, ?SOME, 4, once).
%%--------------------------------------------------------------------
-packet_raw_active_many_small(doc) ->
- ["Test packet option {packet, raw} in active mode."];
-
-packet_raw_active_many_small(suite) ->
- [];
+packet_raw_active_many_small() ->
+ [{doc,"Test packet option {packet, raw} in active mode."}].
packet_raw_active_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
Data = "Packet option is {packet, raw}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?MANY]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, active_raw,
- [Data, ?MANY]}},
- {options, [{active, true},
- {packet, raw} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send_raw, active_raw, ?MANY, raw, active).
%%--------------------------------------------------------------------
-packet_raw_active_some_big(doc) ->
- ["Test packet option {packet, raw} in active mode."];
-
-packet_raw_active_some_big(suite) ->
- [];
+packet_raw_active_some_big() ->
+ [{doc,"Test packet option {packet, raw} in active mode."}].
packet_raw_active_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?SOME]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {?MODULE, active_raw, [Data, ?SOME]}},
- {options, [{active, true},
- {packet, raw} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_raw, ?SOME, raw, active).
%%--------------------------------------------------------------------
-packet_0_active_many_small(doc) ->
- ["Test packet option {packet, 0} in active mode."];
-
-packet_0_active_many_small(suite) ->
- [];
-
-packet_0_active_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_0_active_many_small() ->
+ [{doc,"Test packet option {packet, 0} in active mode."}].
+packet_0_active_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 0}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?MANY]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE, active_raw,
- [Data, ?MANY]}},
- {options, [{active, true},
- {packet, 0} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_raw, ?MANY, 0, active).
%%--------------------------------------------------------------------
-packet_0_active_some_big(doc) ->
- ["Test packet option {packet, 0} in active mode."];
-
-packet_0_active_some_big(suite) ->
- [];
-
-packet_0_active_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_0_active_some_big() ->
+ [{doc,"Test packet option {packet, 0} in active mode."}].
+packet_0_active_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send_raw ,[Data, ?SOME]}},
- {options, ServerOpts}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE, active_raw,
- [Data, ?SOME]}},
- {options, [{active, true},
- {packet, 0} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send_raw, active_raw, ?SOME, 0, active).
%%--------------------------------------------------------------------
-packet_1_active_many_small(doc) ->
- ["Test packet option {packet, 1} in active mode."];
-
-packet_1_active_many_small(suite) ->
- [];
-
-packet_1_active_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_1_active_many_small() ->
+ [{doc,"Test packet option {packet, 1} in active mode."}].
+packet_1_active_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 1}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 1}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_packet, [Data, ?MANY]}},
- {options, [{active, true},
- {packet, 1} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_raw, ?MANY, 1, active).
%%--------------------------------------------------------------------
-packet_1_active_some_big(doc) ->
- ["Test packet option {packet, 1} in active mode."];
-
-packet_1_active_some_big(suite) ->
- [];
-
-packet_1_active_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_1_active_some_big() ->
+ [{doc,"Test packet option {packet, 1} in active mode."}].
+packet_1_active_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(255, "1")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 1}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_packet, [Data, ?SOME]}},
- {options, [{active, true},
- {packet, 1} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_raw, ?SOME, 1, active).
%%--------------------------------------------------------------------
-packet_2_active_many_small(doc) ->
- ["Test packet option {packet, 2} in active mode"];
-
-packet_2_active_many_small(suite) ->
- [];
-
-packet_2_active_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_2_active_many_small() ->
+ [{doc,"Test packet option {packet, 2} in active mode"}].
+packet_2_active_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 2}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 2}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_packet, [Data, ?MANY]}},
- {options, [{active, true},
- {packet, 2} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_raw, ?MANY, 2, active).
%%--------------------------------------------------------------------
-packet_2_active_some_big(doc) ->
- ["Test packet option {packet, 2} in active mode"];
-
-packet_2_active_some_big(suite) ->
- [];
-
-packet_2_active_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_2_active_some_big() ->
+ [{doc,"Test packet option {packet, 2} in active mode"}].
+packet_2_active_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 2}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_packet, [Data, ?SOME]}},
- {options, [{active, true},
- {packet, 2} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
+ packet(Config, Data, send_raw, active_raw, ?SOME, 2, active).
%%--------------------------------------------------------------------
-packet_4_active_many_small(doc) ->
- ["Test packet option {packet, 4} in active mode"];
-
-packet_4_active_many_small(suite) ->
- [];
-
-packet_4_active_many_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_4_active_many_small() ->
+ [{doc,"Test packet option {packet, 4} in active mode"}].
+packet_4_active_many_small(Config) when is_list(Config) ->
Data = "Packet option is {packet, 4}",
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?MANY]}},
- {options, [{packet, 4}|ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_packet, [Data, ?MANY]}},
- {options, [{active, true},
- {packet, 4} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send_raw, active_raw, ?MANY, 4, active).
%%--------------------------------------------------------------------
-packet_4_active_some_big(doc) ->
- ["Test packet option {packet, 4} in active mode"];
-
-packet_4_active_some_big(suite) ->
- [];
-
-packet_4_active_some_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
- ServerOpts = ?config(server_opts, Config),
- {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+packet_4_active_some_big() ->
+ [{doc,"Test packet option {packet, 4} in active mode"}].
+packet_4_active_some_big(Config) when is_list(Config) ->
Data = lists:append(lists:duplicate(100, "1234567890")),
-
- Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
- {from, self()},
- {mfa, {?MODULE, send, [Data, ?SOME]}},
- {options, [{packet, 4} | ServerOpts]}]),
- Port = ssl_test_lib:inet_port(Server),
- Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa,
- {?MODULE,
- active_packet, [Data, ?SOME]}},
- {options, [{active, true},
- {packet, 4} |
- ClientOpts]}]),
-
- ssl_test_lib:check_result(Client, ok),
-
- ssl_test_lib:close(Server),
- ssl_test_lib:close(Client).
-
+ packet(Config, Data, send_raw, active_raw, ?SOME, 4, active).
%%--------------------------------------------------------------------
-packet_send_to_large(doc) ->
- ["Test setting the packet option {packet, 2} on the send side"];
-
-packet_send_to_large(suite) -> [];
+packet_send_to_large() ->
+ [{doc,"Test setting the packet option {packet, 2} on the send side"}].
packet_send_to_large(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1279,16 +447,9 @@ packet_send_to_large(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
-
-
-
-
%%--------------------------------------------------------------------
-packet_wait_active(doc) ->
- ["Test waiting when complete packages have not arrived"];
-
-packet_wait_active(suite) ->
- [];
+packet_wait_active() ->
+ [{doc,"Test waiting when complete packages have not arrived"}].
packet_wait_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1320,11 +481,8 @@ packet_wait_active(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-packet_wait_passive(doc) ->
- ["Test waiting when complete packages have not arrived"];
-
-packet_wait_passive(suite) ->
- [];
+packet_wait_passive() ->
+ [{doc,"Test waiting when complete packages have not arrived"}].
packet_wait_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1353,10 +511,8 @@ packet_wait_passive(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_baddata_active(doc) ->
- ["Test that if a bad packet arrives error msg is sent and socket is closed"];
-packet_baddata_active(suite) ->
- [];
+packet_baddata_active() ->
+ [{doc,"Test that if a bad packet arrives error msg is sent and socket is closed"}].
packet_baddata_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1381,18 +537,15 @@ packet_baddata_active(Config) when is_list(Config) ->
{Client, {other, {ssl_error, _Socket,
{invalid_packet, _}},{error,closed},1}} -> ok;
Unexpected ->
- test_server:fail({unexpected, Unexpected})
+ ct:fail({unexpected, Unexpected})
end,
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_baddata_passive(doc) ->
- ["Test that if a bad packet arrives error msg is sent and socket is closed"];
-
-packet_baddata_passive(suite) ->
- [];
+packet_baddata_passive() ->
+ [{doc,"Test that if a bad packet arrives error msg is sent and socket is closed"}].
packet_baddata_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1418,19 +571,16 @@ packet_baddata_passive(Config) when is_list(Config) ->
receive
{Client, {other, {error, {invalid_packet, _}},{error,closed}, 1}} -> ok;
Unexpected ->
- test_server:fail({unexpected, Unexpected})
+ ct:fail({unexpected, Unexpected})
end,
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_size_active(doc) ->
- ["Test that if a packet of size larger than
- packet_size arrives error msg is sent and socket is closed"];
-
-packet_size_active(suite) ->
- [];
+packet_size_active() ->
+ [{doc,"Test that if a packet of size larger than
+ packet_size arrives error msg is sent and socket is closed"}].
packet_size_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1455,17 +605,16 @@ packet_size_active(Config) when is_list(Config) ->
{Client, {other, {ssl_error, _Socket,
{invalid_packet, _}},{error,closed},1}} -> ok;
Unexpected ->
- test_server:fail({unexpected, Unexpected})
+ ct:fail({unexpected, Unexpected})
end,
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_size_passive(doc) ->
- ["Test that if a packet of size larger
- than packet_size arrives error msg is sent and socket is closed"];
-packet_size_passive(suite) -> [];
+packet_size_passive() ->
+ [{doc, "Test that if a packet of size larger
+ than packet_size arrives error msg is sent and socket is closed"}].
packet_size_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1490,17 +639,15 @@ packet_size_passive(Config) when is_list(Config) ->
receive
{Client, {other, {error, {invalid_packet, _}},{error,closed},1}} -> ok;
Unexpected ->
- test_server:fail({unexpected, Unexpected})
+ ct:fail({unexpected, Unexpected})
end,
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_cdr_decode(doc) ->
- ["Test setting the packet option {packet, cdr}, {mode, binary}"];
-packet_cdr_decode(suite) ->
- [];
+packet_cdr_decode() ->
+ [{doc,"Test setting the packet option {packet, cdr}, {mode, binary}"}].
packet_cdr_decode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1532,10 +679,8 @@ packet_cdr_decode(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_cdr_decode_list(doc) ->
- ["Test setting the packet option {packet, cdr} {mode, list}"];
-packet_cdr_decode_list(suite) ->
- [];
+packet_cdr_decode_list() ->
+ [{doc,"Test setting the packet option {packet, cdr} {mode, list}"}].
packet_cdr_decode_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1567,11 +712,9 @@ packet_cdr_decode_list(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_http_decode(doc) ->
- ["Test setting the packet option {packet, http} {mode, binary} "
- "(Body will be binary http strings are lists)"];
-packet_http_decode(suite) ->
- [];
+packet_http_decode() ->
+ [{doc, "Test setting the packet option {packet, http} {mode, binary} "
+ "(Body will be binary http strings are lists)"}].
packet_http_decode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -1652,11 +795,9 @@ client_http_decode(Socket, HttpRequest) ->
ok.
%%--------------------------------------------------------------------
-packet_http_decode_list(doc) ->
- ["Test setting the packet option {packet, http}, {mode, list}"
- "(Body will be list too)"];
-packet_http_decode_list(suite) ->
- [];
+packet_http_decode_list() ->
+ [{doc, "Test setting the packet option {packet, http}, {mode, list}"
+ "(Body will be list too)"}].
packet_http_decode_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1712,11 +853,8 @@ client_http_decode_list(Socket, HttpRequest) ->
ok.
%%--------------------------------------------------------------------
-packet_http_bin_decode_multi(doc) ->
- ["Test setting the packet option {packet, http_bin} with multiple requests"];
-packet_http_bin_decode_multi(suite) ->
- [];
-
+packet_http_bin_decode_multi() ->
+ [{doc,"Test setting the packet option {packet, http_bin} with multiple requests"}].
packet_http_bin_decode_multi(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1803,11 +941,10 @@ client_http_bin_decode(_, _, _) ->
ok.
%%--------------------------------------------------------------------
-packet_http_error_passive(doc) ->
- ["Test setting the packet option {packet, http}, {active, false}"
- " with a incorrect http header." ];
-packet_http_error_passive(suite) ->
- [];
+packet_http_error_passive() ->
+ [{doc,"Test setting the packet option {packet, http}, {active, false}"
+ " with a incorrect http header."}].
+
packet_http_error_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1865,10 +1002,9 @@ server_http_decode_error(Socket, HttpResponse) ->
ok = ssl:send(Socket, HttpResponse),
ok.
%%--------------------------------------------------------------------
-packet_httph_active(doc) ->
- ["Test setting the packet option {packet, httph}"];
-packet_httph_active(suite) ->
- [];
+packet_httph_active() ->
+ [{doc,"Test setting the packet option {packet, httph}"}].
+
packet_httph_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1922,10 +1058,8 @@ client_http_decode_trailer_active(Socket) ->
ok.
%%--------------------------------------------------------------------
-packet_httph_bin_active(doc) ->
- ["Test setting the packet option {packet, httph_bin}"];
-packet_httph_bin_active(suite) ->
- [];
+packet_httph_bin_active() ->
+ [{doc,"Test setting the packet option {packet, httph_bin}"}].
packet_httph_bin_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -1973,10 +1107,9 @@ client_http_decode_trailer_bin_active(Socket) ->
end,
ok.
%%--------------------------------------------------------------------
-packet_httph_active_once(doc) ->
- ["Test setting the packet option {packet, httph}"];
-packet_httph_active_once(suite) ->
- [];
+packet_httph_active_once() ->
+ [{doc,"Test setting the packet option {packet, httph}"}].
+
packet_httph_active_once(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2027,10 +1160,9 @@ client_http_decode_trailer_active_once(Socket) ->
end,
ok.
%%--------------------------------------------------------------------
-packet_httph_bin_active_once(doc) ->
- ["Test setting the packet option {packet, httph_bin}"];
-packet_httph_bin_active_once(suite) ->
- [];
+packet_httph_bin_active_once() ->
+ [{doc,"Test setting the packet option {packet, httph_bin}"}].
+
packet_httph_bin_active_once(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2082,10 +1214,9 @@ client_http_decode_trailer_bin_active_once(Socket) ->
%%--------------------------------------------------------------------
-packet_httph_passive(doc) ->
- ["Test setting the packet option {packet, httph}"];
-packet_httph_passive(suite) ->
- [];
+packet_httph_passive() ->
+ [{doc,"Test setting the packet option {packet, httph}"}].
+
packet_httph_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2123,10 +1254,9 @@ client_http_decode_trailer_passive(Socket) ->
ok.
%%--------------------------------------------------------------------
-packet_httph_bin_passive(doc) ->
- ["Test setting the packet option {packet, httph_bin}"];
-packet_httph_bin_passive(suite) ->
- [];
+packet_httph_bin_passive() ->
+ [{doc,"Test setting the packet option {packet, httph_bin}"}].
+
packet_httph_bin_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2164,10 +1294,9 @@ client_http_decode_trailer_bin_passive(Socket) ->
ok.
%%--------------------------------------------------------------------
-packet_line_decode(doc) ->
- ["Test setting the packet option {packet, line}, {mode, binary}"];
-packet_line_decode(suite) ->
- [];
+packet_line_decode() ->
+ [{doc,"Test setting the packet option {packet, line}, {mode, binary}"}].
+
packet_line_decode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2201,10 +1330,9 @@ packet_line_decode(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-packet_line_decode_list(doc) ->
- ["Test setting the packet option {packet, line}, {mode, list}"];
-packet_line_decode_list(suite) ->
- [];
+packet_line_decode_list() ->
+ [{doc,"Test setting the packet option {packet, line}, {mode, list}"}].
+
packet_line_decode_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2240,10 +1368,9 @@ packet_line_decode_list(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-packet_asn1_decode(doc) ->
- ["Test setting the packet option {packet, asn1}"];
-packet_asn1_decode(suite) ->
- [];
+packet_asn1_decode() ->
+ [{doc,"Test setting the packet option {packet, asn1}"}].
+
packet_asn1_decode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2276,10 +1403,9 @@ packet_asn1_decode(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_asn1_decode_list(doc) ->
- ["Test setting the packet option {packet, asn1}"];
-packet_asn1_decode_list(suite) ->
- [];
+packet_asn1_decode_list() ->
+ [{doc,"Test setting the packet option {packet, asn1}"}].
+
packet_asn1_decode_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2314,10 +1440,9 @@ packet_asn1_decode_list(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_tpkt_decode(doc) ->
- ["Test setting the packet option {packet, tpkt}"];
-packet_tpkt_decode(suite) ->
- [];
+packet_tpkt_decode() ->
+ [{doc,"Test setting the packet option {packet, tpkt}"}].
+
packet_tpkt_decode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2347,10 +1472,9 @@ packet_tpkt_decode(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_tpkt_decode_list(doc) ->
- ["Test setting the packet option {packet, tpkt}"];
-packet_tpkt_decode_list(suite) ->
- [];
+packet_tpkt_decode_list() ->
+ [{doc,"Test setting the packet option {packet, tpkt}"}].
+
packet_tpkt_decode_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2381,10 +1505,9 @@ packet_tpkt_decode_list(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-%% packet_fcgi_decode(doc) ->
-%% ["Test setting the packet option {packet, fcgi}"];
-%% packet_fcgi_decode(suite) ->
-%% [];
+%% packet_fcgi_decode() ->
+%% [{doc,"Test setting the packet option {packet, fcgi}"}].
+
%% packet_fcgi_decode(Config) when is_list(Config) ->
%% ClientOpts = ?config(client_opts, Config),
%% ServerOpts = ?config(server_opts, Config),
@@ -2416,10 +1539,8 @@ packet_tpkt_decode_list(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-packet_sunrm_decode(doc) ->
- ["Test setting the packet option {packet, sunrm}"];
-packet_sunrm_decode(suite) ->
- [];
+packet_sunrm_decode() ->
+ [{doc,"Test setting the packet option {packet, sunrm}"}].
packet_sunrm_decode(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2449,10 +1570,9 @@ packet_sunrm_decode(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-packet_sunrm_decode_list(doc) ->
- ["Test setting the packet option {packet, sunrm}"];
-packet_sunrm_decode_list(suite) ->
- [];
+packet_sunrm_decode_list() ->
+ [{doc,"Test setting the packet option {packet, sunrm}"}].
+
packet_sunrm_decode_list(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2482,10 +1602,9 @@ packet_sunrm_decode_list(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-header_decode_one_byte_active(doc) ->
- ["Test setting the packet option {header, 1}"];
-header_decode_one_byte_active(suite) ->
- [];
+header_decode_one_byte_active() ->
+ [{doc,"Test setting the packet option {header, 1}"}].
+
header_decode_one_byte_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2516,10 +1635,9 @@ header_decode_one_byte_active(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_two_bytes_active(doc) ->
- ["Test setting the packet option {header, 2}"];
-header_decode_two_bytes_active(suite) ->
- [];
+header_decode_two_bytes_active() ->
+ [{doc,"Test setting the packet option {header, 2}"}].
+
header_decode_two_bytes_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2551,10 +1669,9 @@ header_decode_two_bytes_active(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_two_bytes_two_sent_active(doc) ->
- ["Test setting the packet option {header, 2} and sending two byte"];
-header_decode_two_bytes_two_sent_active(suite) ->
- [];
+header_decode_two_bytes_two_sent_active() ->
+ [{doc,"Test setting the packet option {header, 2} and sending two byte"}].
+
header_decode_two_bytes_two_sent_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2586,10 +1703,9 @@ header_decode_two_bytes_two_sent_active(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_two_bytes_one_sent_active(doc) ->
- ["Test setting the packet option {header, 2} and sending one byte"];
-header_decode_two_bytes_one_sent_active(suite) ->
- [];
+header_decode_two_bytes_one_sent_active() ->
+ [{doc,"Test setting the packet option {header, 2} and sending one byte"}].
+
header_decode_two_bytes_one_sent_active(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2620,10 +1736,9 @@ header_decode_two_bytes_one_sent_active(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_one_byte_passive(doc) ->
- ["Test setting the packet option {header, 1}"];
-header_decode_one_byte_passive(suite) ->
- [];
+header_decode_one_byte_passive() ->
+ [{doc,"Test setting the packet option {header, 1}"}].
+
header_decode_one_byte_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2654,10 +1769,9 @@ header_decode_one_byte_passive(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_two_bytes_passive(doc) ->
- ["Test setting the packet option {header, 2}"];
-header_decode_two_bytes_passive(suite) ->
- [];
+header_decode_two_bytes_passive() ->
+ [{doc,"Test setting the packet option {header, 2}"}].
+
header_decode_two_bytes_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2689,10 +1803,9 @@ header_decode_two_bytes_passive(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_two_bytes_two_sent_passive(doc) ->
- ["Test setting the packet option {header, 2} and sending two byte"];
-header_decode_two_bytes_two_sent_passive(suite) ->
- [];
+header_decode_two_bytes_two_sent_passive() ->
+ [{doc,"Test setting the packet option {header, 2} and sending two byte"}].
+
header_decode_two_bytes_two_sent_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2724,10 +1837,9 @@ header_decode_two_bytes_two_sent_passive(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-header_decode_two_bytes_one_sent_passive(doc) ->
- ["Test setting the packet option {header, 2} and sending one byte"];
-header_decode_two_bytes_one_sent_passive(suite) ->
- [];
+header_decode_two_bytes_one_sent_passive() ->
+ [{doc,"Test setting the packet option {header, 2} and sending one byte"}].
+
header_decode_two_bytes_one_sent_passive(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
@@ -2757,7 +1869,30 @@ header_decode_two_bytes_one_sent_passive(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-%% Internal functions
+%% Internal functions ------------------------------------------------
+%%--------------------------------------------------------------------
+packet(Config, Data, Send, Recv, Quantity, Packet, Active) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, Send ,[Data, Quantity]}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, Recv, [Data, Quantity]}},
+ {options, [{active, Active},
+ {packet, Packet} |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
send_raw(Socket,_, 0) ->
ssl:send(Socket, <<>>),
@@ -2928,7 +2063,7 @@ client_packet_decode(Socket, [Head | Tail] = Packet) ->
client_packet_decode(Socket, [Head], Tail, Packet).
client_packet_decode(Socket, P1, P2, Packet) ->
- test_server:format("Packet: ~p ~n", [Packet]),
+ ct:print("Packet: ~p ~n", [Packet]),
ok = ssl:send(Socket, P1),
ok = ssl:send(Socket, P2),
receive
diff --git a/lib/ssl/test/ssl_payload_SUITE.erl b/lib/ssl/test/ssl_payload_SUITE.erl
index c97f97e70b..77ad546420 100644
--- a/lib/ssl/test/ssl_payload_SUITE.erl
+++ b/lib/ssl/test/ssl_payload_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -26,79 +26,8 @@
-define(TIMEOUT, 600000).
-%% Test server callback functions
%%--------------------------------------------------------------------
-%% Function: init_per_suite(Config) -> Config
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Initialization before the whole suite
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- catch crypto:stop(),
- try crypto:start() of
- ok ->
- application:start(public_key),
- ssl:start(),
- make_certs:all(?config(data_dir, Config), ?config(priv_dir, Config)),
- ssl_test_lib:cert_options(Config)
- catch _:_ ->
- {skip, "Crypto did not start"}
- end.
-%%--------------------------------------------------------------------
-%% Function: end_per_suite(Config) -> _
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after the whole suite
-%%--------------------------------------------------------------------
-end_per_suite(_Config) ->
- ssl:stop(),
- application:stop(crypto).
-
-%%--------------------------------------------------------------------
-%% Function: init_per_testcase(TestCase, Config) -> Config
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%%
-%% Description: Initialization before each test case
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%% Description: Initialization before each test case
-%%--------------------------------------------------------------------
-init_per_testcase(_TestCase, Config0) ->
- Config = lists:keydelete(watchdog, 1, Config0),
- Dog = ssl_test_lib:timetrap(?TIMEOUT),
- [{watchdog, Dog} | Config].
-
-%%--------------------------------------------------------------------
-%% Function: end_per_testcase(TestCase, Config) -> _
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after each test case
-%%--------------------------------------------------------------------
-end_per_testcase(_TestCase, Config) ->
- Dog = ?config(watchdog, Config),
- case Dog of
- undefined ->
- ok;
- _ ->
- test_server:timetrap_cancel(Dog)
- end.
-
-%%--------------------------------------------------------------------
-%% Function: all(Clause) -> TestCases
-%% Clause - atom() - suite | doc
-%% TestCases - [Case]
-%% Case - atom()
-%% Name of a test case.
-%% Description: Returns a list of all test cases in this test suite
+%% Common Test interface functions -----------------------------------
%%--------------------------------------------------------------------
suite() -> [{ct_hooks,[ts_install_cth]}].
@@ -138,6 +67,21 @@ payload_tests() ->
client_echos_active_once_huge,
client_echos_active_huge].
+init_per_suite(Config) ->
+ catch crypto:stop(),
+ try crypto:start() of
+ ok ->
+ application:start(public_key),
+ ssl:start(),
+ make_certs:all(?config(data_dir, Config), ?config(priv_dir, Config)),
+ ssl_test_lib:cert_options(Config)
+ catch _:_ ->
+ {skip, "Crypto did not start"}
+ end.
+
+end_per_suite(_Config) ->
+ ssl:stop(),
+ application:stop(crypto).
init_per_group(GroupName, Config) ->
case ssl_test_lib:is_tls_version(GroupName) of
@@ -157,15 +101,20 @@ init_per_group(GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
+init_per_testcase(_TestCase, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = ct:timetrap(?TIMEOUT),
+ [{watchdog, Dog} | Config].
-%% Test cases starts here.
+end_per_testcase(_TestCase, Config) ->
+ Config.
+%%--------------------------------------------------------------------
+%% Test Cases --------------------------------------------------------
%%--------------------------------------------------------------------
-server_echos_passive_small(doc) ->
- ["Client sends 1000 bytes in passive mode to server, that receives them, "
- "sends them back, and closes."];
-server_echos_passive_small(suite) ->
- [];
+server_echos_passive_small() ->
+ [{doc, "Client sends 1000 bytes in passive mode to server, that receives them, "
+ "sends them back, and closes."}].
server_echos_passive_small(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -179,12 +128,9 @@ server_echos_passive_small(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-server_echos_active_once_small(doc) ->
- ["Client sends 1000 bytes in active once mode to server, that receives "
- " them, sends them back, and closes."];
-
-server_echos_active_once_small(suite) ->
- [];
+server_echos_active_once_small() ->
+ [{doc, "Client sends 1000 bytes in active once mode to server, that receives "
+ " them, sends them back, and closes."}].
server_echos_active_once_small(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -198,12 +144,9 @@ server_echos_active_once_small(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-server_echos_active_small(doc) ->
- ["Client sends 1000 bytes in active mode to server, that receives them, "
- "sends them back, and closes."];
-
-server_echos_active_small(suite) ->
- [];
+server_echos_active_small() ->
+ [{doc, "Client sends 1000 bytes in active mode to server, that receives them, "
+ "sends them back, and closes."}].
server_echos_active_small(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -216,12 +159,9 @@ server_echos_active_small(Config) when is_list(Config) ->
ClientNode, ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_passive_small(doc) ->
- ["Server sends 1000 bytes in passive mode to client, that receives them, "
- "sends them back, and closes."];
-
-client_echos_passive_small(suite) ->
- [];
+client_echos_passive_small() ->
+ [{doc, "Server sends 1000 bytes in passive mode to client, that receives them, "
+ "sends them back, and closes."}].
client_echos_passive_small(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -234,12 +174,9 @@ client_echos_passive_small(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_active_once_small(doc) ->
+client_echos_active_once_small() ->
["Server sends 1000 bytes in active once mode to client, that receives "
- "them, sends them back, and closes."];
-
-client_echos_active_once_small(suite) ->
- [];
+ "them, sends them back, and closes."].
client_echos_active_once_small(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -252,15 +189,12 @@ client_echos_active_once_small(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_active_small(doc) ->
- ["Server sends 1000 bytes in active mode to client, that receives them, "
- "sends them back, and closes."];
-
-client_echos_active_small(suite) ->
- [];
+client_echos_active_small() ->
+ [{doc, "Server sends 1000 bytes in active mode to client, that receives them, "
+ "sends them back, and closes."}].
client_echos_active_small(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
@@ -271,12 +205,9 @@ client_echos_active_small(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-server_echos_passive_big(doc) ->
- ["Client sends 50000 bytes to server in passive mode, that receives them, "
- "sends them back, and closes."];
-
-server_echos_passive_big(suite) ->
- [];
+server_echos_passive_big() ->
+ [{doc, "Client sends 50000 bytes to server in passive mode, that receives them, "
+ "sends them back, and closes."}].
server_echos_passive_big(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -290,15 +221,12 @@ server_echos_passive_big(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-server_echos_active_once_big(doc) ->
- ["Client sends 50000 bytes to server in active once mode, that receives "
- "them, sends them back, and closes."];
-
-server_echos_active_once_big(suite) ->
- [];
+server_echos_active_once_big() ->
+ [{doc,"Client sends 50000 bytes to server in active once mode, that receives "
+ "them, sends them back, and closes."}].
server_echos_active_once_big(Config) when is_list(Config) ->
- ClientOpts = ?config(client_opts, Config),
+ ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
@@ -309,12 +237,9 @@ server_echos_active_once_big(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-server_echos_active_big(doc) ->
- ["Client sends 50000 bytes to server in active once mode, that receives "
- " them, sends them back, and closes."];
-
-server_echos_active_big(suite) ->
- [];
+server_echos_active_big() ->
+ [{doc, "Client sends 50000 bytes to server in active once mode, that receives "
+ " them, sends them back, and closes."}].
server_echos_active_big(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -327,12 +252,9 @@ server_echos_active_big(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_passive_big(doc) ->
- ["Server sends 50000 bytes to client in passive mode, that receives them, "
- "sends them back, and closes."];
-
-client_echos_passive_big(suite) ->
- [];
+client_echos_passive_big() ->
+ [{doc, "Server sends 50000 bytes to client in passive mode, that receives them, "
+ "sends them back, and closes."}].
client_echos_passive_big(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -345,12 +267,9 @@ client_echos_passive_big(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_active_once_big(doc) ->
- ["Server sends 50000 bytes to client in active once mode, that receives"
- " them, sends them back, and closes."];
-
-client_echos_active_once_big(suite) ->
- [];
+client_echos_active_once_big() ->
+ [{doc, "Server sends 50000 bytes to client in active once mode, that receives"
+ " them, sends them back, and closes."}].
client_echos_active_once_big(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -363,12 +282,9 @@ client_echos_active_once_big(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_active_big(doc) ->
- ["Server sends 50000 bytes to client in active mode, that receives them, "
- "sends them back, and closes."];
-
-client_echos_active_big(suite) ->
- [];
+client_echos_active_big() ->
+ [{doc, "Server sends 50000 bytes to client in active mode, that receives them, "
+ "sends them back, and closes."}].
client_echos_active_big(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -381,12 +297,9 @@ client_echos_active_big(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-server_echos_passive_huge(doc) ->
- ["Client sends 500000 bytes to server in passive mode, that receives "
- " them, sends them back, and closes."];
-
-server_echos_passive_huge(suite) ->
- [];
+server_echos_passive_huge() ->
+ [{doc, "Client sends 500000 bytes to server in passive mode, that receives "
+ " them, sends them back, and closes."}].
server_echos_passive_huge(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -399,12 +312,9 @@ server_echos_passive_huge(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-server_echos_active_once_huge(doc) ->
- ["Client sends 500000 bytes to server in active once mode, that receives "
- "them, sends them back, and closes."];
-
-server_echos_active_once_huge(suite) ->
- [];
+server_echos_active_once_huge() ->
+ [{doc, "Client sends 500000 bytes to server in active once mode, that receives "
+ "them, sends them back, and closes."}].
server_echos_active_once_huge(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -417,12 +327,9 @@ server_echos_active_once_huge(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-server_echos_active_huge(doc) ->
- ["Client sends 500000 bytes to server in active mode, that receives them, "
- "sends them back, and closes."];
-
-server_echos_active_huge(suite) ->
- [];
+server_echos_active_huge() ->
+ [{doc, "Client sends 500000 bytes to server in active mode, that receives them, "
+ "sends them back, and closes."}].
server_echos_active_huge(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -435,12 +342,9 @@ server_echos_active_huge(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_passive_huge(doc) ->
- ["Server sends 500000 bytes to client in passive mode, that receives "
- "them, sends them back, and closes."];
-
-client_echos_passive_huge(suite) ->
- [];
+client_echos_passive_huge() ->
+ [{doc, "Server sends 500000 bytes to client in passive mode, that receives "
+ "them, sends them back, and closes."}].
client_echos_passive_huge(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -452,12 +356,9 @@ client_echos_passive_huge(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_active_once_huge(doc) ->
- ["Server sends 500000 bytes to client in active once mode, that receives "
- "them, sends them back, and closes."];
-
-client_echos_active_once_huge(suite) ->
- [];
+client_echos_active_once_huge() ->
+ [{doc, "Server sends 500000 bytes to client in active once mode, that receives "
+ "them, sends them back, and closes."}].
client_echos_active_once_huge(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -469,12 +370,9 @@ client_echos_active_once_huge(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
-client_echos_active_huge(doc) ->
- ["Server sends 500000 bytes to client in active mode, that receives them, "
- "sends them back, and closes."];
-
-client_echos_active_huge(suite) ->
- [];
+client_echos_active_huge() ->
+ [{doc, "Server sends 500000 bytes to client in active mode, that receives them, "
+ "sends them back, and closes."}].
client_echos_active_huge(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
@@ -486,6 +384,8 @@ client_echos_active_huge(Config) when is_list(Config) ->
ServerNode, Hostname).
%%--------------------------------------------------------------------
+%% Internal functions ------------------------------------------------
+%%--------------------------------------------------------------------
server_echos_passive(Data, Length, ClientOpts, ServerOpts,
ClientNode, ServerNode, Hostname) ->
@@ -656,33 +556,33 @@ send(Socket, Data, Size, Repeate,F) ->
sender(Socket, Data, Size) ->
ok = send(Socket, Data, Size, 100, fun() -> do_recv(Socket, Data, Size, <<>>, false) end),
- test_server:format("Sender recv: ~p~n", [ssl:getopts(Socket, [active])]),
+ ct:print("Sender recv: ~p~n", [ssl:getopts(Socket, [active])]),
ok.
sender_once(Socket, Data, Size) ->
send(Socket, Data, Size, 100,
fun() -> do_active_once(Socket, Data, Size, <<>>, false) end),
- test_server:format("Sender active once: ~p~n",
+ ct:print("Sender active once: ~p~n",
[ssl:getopts(Socket, [active])]),
ok.
sender_active(Socket, Data, Size) ->
F = fun() -> do_active(Socket, Data, Size, <<>>, false) end,
send(Socket, Data, Size, 100, F),
- test_server:format("Sender active: ~p~n", [ssl:getopts(Socket, [active])]),
+ ct:print("Sender active: ~p~n", [ssl:getopts(Socket, [active])]),
ok.
echoer(Socket, Data, Size) ->
- test_server:format("Echoer recv: ~p~n", [ssl:getopts(Socket, [active])]),
+ ct:print("Echoer recv: ~p~n", [ssl:getopts(Socket, [active])]),
echo(fun() -> do_recv(Socket, Data, Size, <<>>, true) end, 100).
echoer_once(Socket, Data, Size) ->
- test_server:format("Echoer active once: ~p ~n",
+ ct:print("Echoer active once: ~p ~n",
[ssl:getopts(Socket, [active])]),
echo(fun() -> do_active_once(Socket, Data, Size, <<>>, true) end, 100).
echoer_active(Socket, Data, Size) ->
- test_server:format("Echoer active: ~p~n", [ssl:getopts(Socket, [active])]),
+ ct:print("Echoer active: ~p~n", [ssl:getopts(Socket, [active])]),
echo(fun() -> do_active(Socket, Data, Size, <<>>, true) end, 100).
echo(_Fun, 0) -> ok;
diff --git a/lib/ssl/test/ssl_session_cache_SUITE.erl b/lib/ssl/test/ssl_session_cache_SUITE.erl
index 1d71efd40c..fd9a0a594c 100644
--- a/lib/ssl/test/ssl_session_cache_SUITE.erl
+++ b/lib/ssl/test/ssl_session_cache_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2010-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2010-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -37,18 +37,22 @@
-export([init/1, terminate/1, lookup/2, update/3,
delete/2, foldl/3, select_session/2]).
-%% Test server callback functions
%%--------------------------------------------------------------------
-%% Function: init_per_suite(Config) -> Config
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Initialization before the whole suite
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
+%% Common Test interface functions -----------------------------------
%%--------------------------------------------------------------------
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [session_cleanup,
+ session_cache_process_list,
+ session_cache_process_mnesia].
+
+groups() ->
+ [].
+
init_per_suite(Config0) ->
- Dog = ssl_test_lib:timetrap(?LONG_TIMEOUT *2),
+ Dog = ct:timetrap(?LONG_TIMEOUT *2),
catch crypto:stop(),
try crypto:start() of
ok ->
@@ -59,7 +63,7 @@ init_per_suite(Config0) ->
Result =
(catch make_certs:all(?config(data_dir, Config0),
?config(priv_dir, Config0))),
- test_server:format("Make certs ~p~n", [Result]),
+ ct:print("Make certs ~p~n", [Result]),
Config1 = ssl_test_lib:make_dsa_cert(Config0),
Config = ssl_test_lib:cert_options(Config1),
@@ -68,29 +72,16 @@ init_per_suite(Config0) ->
{skip, "Crypto did not start"}
end.
-%%--------------------------------------------------------------------
-%% Function: end_per_suite(Config) -> _
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after the whole suite
-%%--------------------------------------------------------------------
end_per_suite(_Config) ->
ssl:stop(),
application:stop(crypto).
-%%--------------------------------------------------------------------
-%% Function: init_per_testcase(TestCase, Config) -> Config
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%%
-%% Description: Initialization before each test case
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%% Description: Initialization before each test case
-%%--------------------------------------------------------------------
+init_per_group(_GroupName, Config) ->
+ Config.
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
init_per_testcase(session_cache_process_list, Config) ->
init_customized_session_cache(list, Config);
@@ -100,7 +91,7 @@ init_per_testcase(session_cache_process_mnesia, Config) ->
init_per_testcase(session_cleanup, Config0) ->
Config = lists:keydelete(watchdog, 1, Config0),
- Dog = test_server:timetrap(?TIMEOUT),
+ Dog = ct:timetrap(?TIMEOUT),
ssl:stop(),
application:load(ssl),
application:set_env(ssl, session_lifetime, 5),
@@ -110,12 +101,12 @@ init_per_testcase(session_cleanup, Config0) ->
init_per_testcase(_TestCase, Config0) ->
Config = lists:keydelete(watchdog, 1, Config0),
- Dog = test_server:timetrap(?TIMEOUT),
+ Dog = ct:timetrap(?TIMEOUT),
[{watchdog, Dog} | Config].
init_customized_session_cache(Type, Config0) ->
Config = lists:keydelete(watchdog, 1, Config0),
- Dog = test_server:timetrap(?TIMEOUT),
+ Dog = ct:timetrap(?TIMEOUT),
ssl:stop(),
application:load(ssl),
application:set_env(ssl, session_cb, ?MODULE),
@@ -123,14 +114,6 @@ init_customized_session_cache(Type, Config0) ->
ssl:start(),
[{watchdog, Dog} | Config].
-%%--------------------------------------------------------------------
-%% Function: end_per_testcase(TestCase, Config) -> _
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after each test case
-%%--------------------------------------------------------------------
end_per_testcase(session_cache_process_list, Config) ->
application:unset_env(ssl, session_cb),
end_per_testcase(default_action, Config);
@@ -146,43 +129,14 @@ end_per_testcase(session_cleanup, Config) ->
application:unset_env(ssl, session_lifetime),
end_per_testcase(default_action, Config);
end_per_testcase(_TestCase, Config) ->
- Dog = ?config(watchdog, Config),
- case Dog of
- undefined ->
- ok;
- _ ->
- test_server:timetrap_cancel(Dog)
- end.
-
-%%--------------------------------------------------------------------
-%% Function: all(Clause) -> TestCases
-%% Clause - atom() - suite | doc
-%% TestCases - [Case]
-%% Case - atom()
-%% Name of a test case.
-%% Description: Returns a list of all test cases in this test suite
-%%--------------------------------------------------------------------
-suite() -> [{ct_hooks,[ts_install_cth]}].
-
-all() ->
- [session_cleanup,
- session_cache_process_list,
- session_cache_process_mnesia].
-
-groups() ->
- [].
-
-init_per_group(_GroupName, Config) ->
Config.
-end_per_group(_GroupName, Config) ->
- Config.
%%--------------------------------------------------------------------
-session_cleanup(doc) ->
- ["Test that sessions are cleand up eventually, so that the session table "
- "does not grow and grow ..."];
-session_cleanup(suite) ->
- [];
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
+session_cleanup() ->
+ [{doc, "Test that sessions are cleand up eventually, so that the session table "
+ "does not grow and grow ..."}].
session_cleanup(Config)when is_list(Config) ->
process_flag(trap_exit, true),
ClientOpts = ?config(client_opts, Config),
@@ -207,7 +161,7 @@ session_cleanup(Config)when is_list(Config) ->
end,
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
{status, _, _, StatusInfo} = sys:get_status(whereis(ssl_manager)),
[_, _,_, _, Prop] = StatusInfo,
@@ -224,14 +178,14 @@ session_cleanup(Config)when is_list(Config) ->
%% Make sure session has expired and been cleaned up
check_timer(SessionTimer),
- test_server:sleep(?DELAY *2), %% Delay time + some extra time
+ ct:sleep(?DELAY *2), %% Delay time + some extra time
{ServerDelayTimer, ClientDelayTimer} = get_delay_timers(),
check_timer(ServerDelayTimer),
check_timer(ClientDelayTimer),
- test_server:sleep(?SLEEP), %% Make sure clean has had time to run
+ ct:sleep(?SLEEP), %% Make sure clean has had time to run
undefined = ssl_session_cache:lookup(Cache, {{Hostname, Port}, Id}),
undefined = ssl_session_cache:lookup(Cache, {Port, Id}),
@@ -248,7 +202,7 @@ check_timer(Timer) ->
{status, _, _, _} = sys:get_status(whereis(ssl_manager)),
ok;
Int ->
- test_server:sleep(Int),
+ ct:sleep(Int),
check_timer(Timer)
end.
@@ -258,31 +212,25 @@ get_delay_timers() ->
State = ssl_test_lib:state(Prop),
case element(7, State) of
{undefined, undefined} ->
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
get_delay_timers();
{undefined, _} ->
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
get_delay_timers();
{_, undefined} ->
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
get_delay_timers();
DelayTimers ->
DelayTimers
end.
%%--------------------------------------------------------------------
-session_cache_process_list(doc) ->
- ["Test reuse of sessions (short handshake)"];
-
-session_cache_process_list(suite) ->
- [];
+session_cache_process_list() ->
+ [{doc,"Test reuse of sessions (short handshake)"}].
session_cache_process_list(Config) when is_list(Config) ->
session_cache_process(list,Config).
%%--------------------------------------------------------------------
-session_cache_process_mnesia(doc) ->
- ["Test reuse of sessions (short handshake)"];
-
-session_cache_process_mnesia(suite) ->
- [];
+session_cache_process_mnesia() ->
+ [{doc,"Test reuse of sessions (short handshake)"}].
session_cache_process_mnesia(Config) when is_list(Config) ->
session_cache_process(mnesia,Config).
diff --git a/lib/ssl/test/ssl_test_lib.erl b/lib/ssl/test/ssl_test_lib.erl
index f1f5b9ae0a..76b302b1cb 100644
--- a/lib/ssl/test/ssl_test_lib.erl
+++ b/lib/ssl/test/ssl_test_lib.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -20,8 +20,7 @@
%%
-module(ssl_test_lib).
--include("test_server.hrl").
--include("test_server_line.hrl").
+-include_lib("common_test/include/ct.hrl").
-include_lib("public_key/include/public_key.hrl").
%% Note: This directive should only be used in test suites.
@@ -29,12 +28,6 @@
-record(sslsocket, { fd = nil, pid = nil}).
-timetrap(Time) ->
- Mul = try
- test_server:timetrap_scale_factor()
- catch _:_ -> 1 end,
- test_server:timetrap(1000+Time*Mul).
-
%% For now always run locally
run_where(_) ->
ClientNode = node(),
@@ -65,8 +58,9 @@ run_server(Opts) ->
Port = proplists:get_value(port, Opts),
Options = proplists:get_value(options, Opts),
Pid = proplists:get_value(from, Opts),
- test_server:format("ssl:listen(~p, ~p)~n", [Port, Options]),
- {ok, ListenSocket} = rpc:call(Node, ssl, listen, [Port, Options]),
+ Transport = proplists:get_value(transport, Opts, ssl),
+ ct:print("ssl:listen(~p, ~p)~n", [Port, Options]),
+ {ok, ListenSocket} = rpc:call(Node, Transport, listen, [Port, Options]),
Pid ! {listen, up},
send_selected_port(Pid, Port, ListenSocket),
run_server(ListenSocket, Opts).
@@ -81,14 +75,15 @@ do_run_server(_, {error, timeout} = Result, Opts) ->
do_run_server(ListenSocket, AcceptSocket, Opts) ->
Node = proplists:get_value(node, Opts),
Pid = proplists:get_value(from, Opts),
+ Transport = proplists:get_value(transport, Opts, ssl),
{Module, Function, Args} = proplists:get_value(mfa, Opts),
- test_server:format("Server: apply(~p,~p,~p)~n",
+ ct:print("Server: apply(~p,~p,~p)~n",
[Module, Function, [AcceptSocket | Args]]),
case rpc:call(Node, Module, Function, [AcceptSocket | Args]) of
no_result_msg ->
ok;
Msg ->
- test_server:format("Server Msg: ~p ~n", [Msg]),
+ ct:print("Server Msg: ~p ~n", [Msg]),
Pid ! {self(), Msg}
end,
receive
@@ -97,15 +92,16 @@ do_run_server(ListenSocket, AcceptSocket, Opts) ->
{listen, MFA} ->
run_server(ListenSocket, [MFA | proplists:delete(mfa, Opts)]);
close ->
- test_server:format("Server closing ~p ~n", [self()]),
- Result = rpc:call(Node, ssl, close, [AcceptSocket], 500),
- test_server:format("Result ~p ~n", [Result]);
+ ct:print("Server closing ~p ~n", [self()]),
+ Result = rpc:call(Node, Transport, close, [AcceptSocket], 500),
+ Result1 = rpc:call(Node, Transport, close, [ListenSocket], 500),
+ ct:print("Result ~p : ~p ~n", [Result, Result1]);
{ssl_closed, _} ->
ok
end.
%%% To enable to test with s_client -reconnect
-connect(ListenSocket, Opts) ->
+connect(#sslsocket{} = ListenSocket, Opts) ->
Node = proplists:get_value(node, Opts),
ReconnectTimes = proplists:get_value(reconnect_times, Opts, 0),
Timeout = proplists:get_value(timeout, Opts, infinity),
@@ -116,15 +112,21 @@ connect(ListenSocket, Opts) ->
_ ->
remove_close_msg(ReconnectTimes),
AcceptSocket
- end.
-
+ end;
+connect(ListenSocket, Opts) ->
+ Node = proplists:get_value(node, Opts),
+ ct:print("gen_tcp:accept(~p)~n", [ListenSocket]),
+ {ok, AcceptSocket} = rpc:call(Node, gen_tcp, accept,
+ [ListenSocket]),
+ AcceptSocket.
+
connect(_, _, 0, AcceptSocket, _) ->
AcceptSocket;
connect(ListenSocket, Node, N, _, Timeout) ->
- test_server:format("ssl:transport_accept(~p)~n", [ListenSocket]),
+ ct:print("ssl:transport_accept(~p)~n", [ListenSocket]),
{ok, AcceptSocket} = rpc:call(Node, ssl, transport_accept,
[ListenSocket]),
- test_server:format("ssl:ssl_accept(~p, ~p)~n", [AcceptSocket, Timeout]),
+ ct:print("ssl:ssl_accept(~p, ~p)~n", [AcceptSocket, Timeout]),
case rpc:call(Node, ssl, ssl_accept, [AcceptSocket, Timeout]) of
ok ->
@@ -157,45 +159,48 @@ run_client(Opts) ->
Host = proplists:get_value(host, Opts),
Port = proplists:get_value(port, Opts),
Pid = proplists:get_value(from, Opts),
+ Transport = proplists:get_value(transport, Opts, ssl),
Options = proplists:get_value(options, Opts),
- test_server:format("ssl:connect(~p, ~p, ~p)~n", [Host, Port, Options]),
- case rpc:call(Node, ssl, connect, [Host, Port, Options]) of
+ ct:print("ssl:connect(~p, ~p, ~p)~n", [Host, Port, Options]),
+ case rpc:call(Node, Transport, connect, [Host, Port, Options]) of
{ok, Socket} ->
Pid ! { connected, Socket },
- test_server:format("Client: connected~n", []),
+ ct:print("Client: connected~n", []),
%% In special cases we want to know the client port, it will
%% be indicated by sending {port, 0} in options list!
send_selected_port(Pid, proplists:get_value(port, Options), Socket),
{Module, Function, Args} = proplists:get_value(mfa, Opts),
- test_server:format("Client: apply(~p,~p,~p)~n",
+ ct:print("Client: apply(~p,~p,~p)~n",
[Module, Function, [Socket | Args]]),
case rpc:call(Node, Module, Function, [Socket | Args]) of
no_result_msg ->
ok;
Msg ->
- test_server:format("Client Msg: ~p ~n", [Msg]),
+ ct:print("Client Msg: ~p ~n", [Msg]),
Pid ! {self(), Msg}
end,
receive
close ->
- test_server:format("Client closing~n", []),
- rpc:call(Node, ssl, close, [Socket]);
+ ct:print("Client closing~n", []),
+ rpc:call(Node, Transport, close, [Socket]);
{ssl_closed, Socket} ->
+ ok;
+ {gen_tcp, closed} ->
ok
end;
{error, Reason} ->
- test_server:format("Client: connection failed: ~p ~n", [Reason]),
+ ct:print("Client: connection failed: ~p ~n", [Reason]),
Pid ! {self(), {error, Reason}}
end.
close(Pid) ->
- test_server:format("Close ~p ~n", [Pid]),
+ ct:print("Close ~p ~n", [Pid]),
Monitor = erlang:monitor(process, Pid),
Pid ! close,
receive
{'DOWN', Monitor, process, Pid, Reason} ->
erlang:demonitor(Monitor),
- test_server:format("Pid: ~p down due to:~p ~n", [Pid, Reason])
+ ct:print("Pid: ~p down due to:~p ~n", [Pid, Reason])
end.
check_result(Server, ServerMsg, Client, ClientMsg) ->
@@ -207,7 +212,7 @@ check_result(Server, ServerMsg, Client, ClientMsg) ->
Unexpected ->
Reason = {{expected, {Client, ClientMsg}},
{got, Unexpected}},
- test_server:fail(Reason)
+ ct:fail(Reason)
end;
{Client, ClientMsg} ->
receive
@@ -216,7 +221,7 @@ check_result(Server, ServerMsg, Client, ClientMsg) ->
Unexpected ->
Reason = {{expected, {Server, ClientMsg}},
{got, Unexpected}},
- test_server:fail(Reason)
+ ct:fail(Reason)
end;
{Port, {data,Debug}} when is_port(Port) ->
io:format("openssl ~s~n",[Debug]),
@@ -225,7 +230,7 @@ check_result(Server, ServerMsg, Client, ClientMsg) ->
Unexpected ->
Reason = {{expected, {Client, ClientMsg}},
{expected, {Server, ServerMsg}}, {got, Unexpected}},
- test_server:fail(Reason)
+ ct:fail(Reason)
end.
check_result(Pid, Msg) ->
@@ -238,7 +243,7 @@ check_result(Pid, Msg) ->
Unexpected ->
Reason = {{expected, {Pid, Msg}},
{got, Unexpected}},
- test_server:fail(Reason)
+ ct:fail(Reason)
end.
wait_for_result(Server, ServerMsg, Client, ClientMsg) ->
@@ -405,33 +410,33 @@ run_upgrade_server(Opts) ->
SslOptions = proplists:get_value(ssl_options, Opts),
Pid = proplists:get_value(from, Opts),
- test_server:format("gen_tcp:listen(~p, ~p)~n", [Port, TcpOptions]),
+ ct:print("gen_tcp:listen(~p, ~p)~n", [Port, TcpOptions]),
{ok, ListenSocket} = rpc:call(Node, gen_tcp, listen, [Port, TcpOptions]),
Pid ! {listen, up},
send_selected_port(Pid, Port, ListenSocket),
- test_server:format("gen_tcp:accept(~p)~n", [ListenSocket]),
+ ct:print("gen_tcp:accept(~p)~n", [ListenSocket]),
{ok, AcceptSocket} = rpc:call(Node, gen_tcp, accept, [ListenSocket]),
try
{ok, SslAcceptSocket} = case TimeOut of
infinity ->
- test_server:format("ssl:ssl_accept(~p, ~p)~n",
+ ct:print("ssl:ssl_accept(~p, ~p)~n",
[AcceptSocket, SslOptions]),
rpc:call(Node, ssl, ssl_accept,
[AcceptSocket, SslOptions]);
_ ->
- test_server:format("ssl:ssl_accept(~p, ~p, ~p)~n",
+ ct:print("ssl:ssl_accept(~p, ~p, ~p)~n",
[AcceptSocket, SslOptions, TimeOut]),
rpc:call(Node, ssl, ssl_accept,
[AcceptSocket, SslOptions, TimeOut])
end,
{Module, Function, Args} = proplists:get_value(mfa, Opts),
Msg = rpc:call(Node, Module, Function, [SslAcceptSocket | Args]),
- test_server:format("Upgrade Server Msg: ~p ~n", [Msg]),
+ ct:print("Upgrade Server Msg: ~p ~n", [Msg]),
Pid ! {self(), Msg},
receive
close ->
- test_server:format("Upgrade Server closing~n", []),
+ ct:print("Upgrade Server closing~n", []),
rpc:call(Node, ssl, close, [SslAcceptSocket])
end
catch error:{badmatch, Error} ->
@@ -449,24 +454,24 @@ run_upgrade_client(Opts) ->
TcpOptions = proplists:get_value(tcp_options, Opts),
SslOptions = proplists:get_value(ssl_options, Opts),
- test_server:format("gen_tcp:connect(~p, ~p, ~p)~n",
+ ct:print("gen_tcp:connect(~p, ~p, ~p)~n",
[Host, Port, TcpOptions]),
{ok, Socket} = rpc:call(Node, gen_tcp, connect, [Host, Port, TcpOptions]),
send_selected_port(Pid, Port, Socket),
- test_server:format("ssl:connect(~p, ~p)~n", [Socket, SslOptions]),
+ ct:print("ssl:connect(~p, ~p)~n", [Socket, SslOptions]),
{ok, SslSocket} = rpc:call(Node, ssl, connect, [Socket, SslOptions]),
{Module, Function, Args} = proplists:get_value(mfa, Opts),
- test_server:format("apply(~p, ~p, ~p)~n",
+ ct:print("apply(~p, ~p, ~p)~n",
[Module, Function, [SslSocket | Args]]),
Msg = rpc:call(Node, Module, Function, [SslSocket | Args]),
- test_server:format("Upgrade Client Msg: ~p ~n", [Msg]),
+ ct:print("Upgrade Client Msg: ~p ~n", [Msg]),
Pid ! {self(), Msg},
receive
close ->
- test_server:format("Upgrade Client closing~n", []),
+ ct:print("Upgrade Client closing~n", []),
rpc:call(Node, ssl, close, [SslSocket])
end.
@@ -485,20 +490,20 @@ run_upgrade_server_error(Opts) ->
SslOptions = proplists:get_value(ssl_options, Opts),
Pid = proplists:get_value(from, Opts),
- test_server:format("gen_tcp:listen(~p, ~p)~n", [Port, TcpOptions]),
+ ct:print("gen_tcp:listen(~p, ~p)~n", [Port, TcpOptions]),
{ok, ListenSocket} = rpc:call(Node, gen_tcp, listen, [Port, TcpOptions]),
Pid ! {listen, up},
send_selected_port(Pid, Port, ListenSocket),
- test_server:format("gen_tcp:accept(~p)~n", [ListenSocket]),
+ ct:print("gen_tcp:accept(~p)~n", [ListenSocket]),
{ok, AcceptSocket} = rpc:call(Node, gen_tcp, accept, [ListenSocket]),
Error = case TimeOut of
infinity ->
- test_server:format("ssl:ssl_accept(~p, ~p)~n",
+ ct:print("ssl:ssl_accept(~p, ~p)~n",
[AcceptSocket, SslOptions]),
rpc:call(Node, ssl, ssl_accept,
[AcceptSocket, SslOptions]);
_ ->
- test_server:format("ssl:ssl_accept(~p, ~p, ~p)~n",
+ ct:print("ssl:ssl_accept(~p, ~p, ~p)~n",
[AcceptSocket, SslOptions, TimeOut]),
rpc:call(Node, ssl, ssl_accept,
[AcceptSocket, SslOptions, TimeOut])
@@ -517,22 +522,31 @@ run_server_error(Opts) ->
Port = proplists:get_value(port, Opts),
Options = proplists:get_value(options, Opts),
Pid = proplists:get_value(from, Opts),
- test_server:format("ssl:listen(~p, ~p)~n", [Port, Options]),
- case rpc:call(Node, ssl, listen, [Port, Options]) of
- {ok, ListenSocket} ->
+ Transport = proplists:get_value(transport, Opts, ssl),
+ ct:print("ssl:listen(~p, ~p)~n", [Port, Options]),
+ case rpc:call(Node, Transport, listen, [Port, Options]) of
+ {ok, #sslsocket{} = ListenSocket} ->
%% To make sure error_client will
%% get {error, closed} and not {error, connection_refused}
Pid ! {listen, up},
send_selected_port(Pid, Port, ListenSocket),
- test_server:format("ssl:transport_accept(~p)~n", [ListenSocket]),
- case rpc:call(Node, ssl, transport_accept, [ListenSocket]) of
+ ct:print("ssl:transport_accept(~p)~n", [ListenSocket]),
+ case rpc:call(Node, Transport, transport_accept, [ListenSocket]) of
{error, _} = Error ->
Pid ! {self(), Error};
{ok, AcceptSocket} ->
- test_server:format("ssl:ssl_accept(~p)~n", [AcceptSocket]),
+ ct:print("ssl:ssl_accept(~p)~n", [AcceptSocket]),
Error = rpc:call(Node, ssl, ssl_accept, [AcceptSocket]),
Pid ! {self(), Error}
end;
+ {ok, ListenSocket} ->
+ Pid ! {listen, up},
+ send_selected_port(Pid, Port, ListenSocket),
+ ct:print("~p:accept(~p)~n", [Transport, ListenSocket]),
+ case rpc:call(Node, Transport, accept, [ListenSocket]) of
+ {error, _} = Error ->
+ Pid ! {self(), Error}
+ end;
Error ->
%% Not really true but as this is an error test
%% this is what we want.
@@ -548,9 +562,10 @@ run_client_error(Opts) ->
Host = proplists:get_value(host, Opts),
Port = proplists:get_value(port, Opts),
Pid = proplists:get_value(from, Opts),
+ Transport = proplists:get_value(transport, Opts, ssl),
Options = proplists:get_value(options, Opts),
- test_server:format("ssl:connect(~p, ~p, ~p)~n", [Host, Port, Options]),
- Error = rpc:call(Node, ssl, connect, [Host, Port, Options]),
+ ct:print("ssl:connect(~p, ~p, ~p)~n", [Host, Port, Options]),
+ Error = rpc:call(Node, Transport, connect, [Host, Port, Options]),
Pid ! {self(), Error}.
inet_port(Pid) when is_pid(Pid)->
@@ -577,7 +592,7 @@ trigger_renegotiate(Socket, [ErlData, N]) ->
trigger_renegotiate(Socket, ErlData, N, Id).
trigger_renegotiate(Socket, _, 0, Id) ->
- test_server:sleep(1000),
+ ct:sleep(1000),
case ssl:session_info(Socket) of
[{session_id, Id} | _ ] ->
fail_session_not_renegotiated;
@@ -670,7 +685,7 @@ der_to_pem(File, Entries) ->
cipher_result(Socket, Result) ->
Result = ssl:connection_info(Socket),
- test_server:format("Successfull connect: ~p~n", [Result]),
+ ct:print("Successfull connect: ~p~n", [Result]),
%% Importante to send two packets here
%% to properly test "cipher state" handling
ssl:send(Socket, "Hello\n"),
@@ -751,3 +766,33 @@ sufficient_crypto_support('tlsv1.2') ->
end;
sufficient_crypto_support(_) ->
true.
+
+send_recv_result_active(Socket) ->
+ ssl:send(Socket, "Hello world"),
+ receive
+ {ssl, Socket, "H"} ->
+ receive
+ {ssl, Socket, "ello world"} ->
+ ok
+ end;
+ {ssl, Socket, "Hello world"} ->
+ ok
+ end.
+
+send_recv_result(Socket) ->
+ ssl:send(Socket, "Hello world"),
+ {ok,"Hello world"} = ssl:recv(Socket, 11),
+ ok.
+
+send_recv_result_active_once(Socket) ->
+ ssl:send(Socket, "Hello world"),
+ receive
+ {ssl, Socket, "H"} ->
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket, "ello world"} ->
+ ok
+ end;
+ {ssl, Socket, "Hello world"} ->
+ ok
+ end.
diff --git a/lib/ssl/test/ssl_to_openssl_SUITE.erl b/lib/ssl/test/ssl_to_openssl_SUITE.erl
index 107220c335..d5e7d515fd 100644
--- a/lib/ssl/test/ssl_to_openssl_SUITE.erl
+++ b/lib/ssl/test/ssl_to_openssl_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -16,7 +16,6 @@
%%
%% %CopyrightEnd%
%%
-
%%
-module(ssl_to_openssl_SUITE).
@@ -34,131 +33,10 @@
-define(OPENSSL_GARBAGE, "P\n").
-define(EXPIRE, 10).
-%% Test server callback functions
%%--------------------------------------------------------------------
-%% Function: init_per_suite(Config) -> Config
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Initialization before the whole suite
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
+%% Common Test interface functions -----------------------------------
%%--------------------------------------------------------------------
-init_per_suite(Config0) ->
- Dog = ssl_test_lib:timetrap(?LONG_TIMEOUT *2),
- case os:find_executable("openssl") of
- false ->
- {skip, "Openssl not found"};
- _ ->
- catch crypto:stop(),
- try crypto:start() of
- ok ->
- application:start(public_key),
- ssl:start(),
- Result =
- (catch make_certs:all(?config(data_dir, Config0),
- ?config(priv_dir, Config0))),
- test_server:format("Make certs ~p~n", [Result]),
- Config1 = ssl_test_lib:make_dsa_cert(Config0),
- Config = ssl_test_lib:cert_options(Config1),
- [{watchdog, Dog} | Config]
- catch _:_ ->
- {skip, "Crypto did not start"}
- end
- end.
-%%--------------------------------------------------------------------
-%% Function: end_per_suite(Config) -> _
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after the whole suite
-%%--------------------------------------------------------------------
-end_per_suite(_Config) ->
- ssl:stop(),
- application:stop(crypto).
-
-%%--------------------------------------------------------------------
-%% Function: init_per_testcase(TestCase, Config) -> Config
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%%
-%% Description: Initialization before each test case
-%%
-%% Note: This function is free to add any key/value pairs to the Config
-%% variable, but should NOT alter/remove any existing entries.
-%% Description: Initialization before each test case
-%%--------------------------------------------------------------------
-init_per_testcase(expired_session, Config0) ->
- Config = lists:keydelete(watchdog, 1, Config0),
- Dog = ssl_test_lib:timetrap(?EXPIRE * 1000 * 5),
- ssl:stop(),
- application:load(ssl),
- application:set_env(ssl, session_lifetime, ?EXPIRE),
- ssl:start(),
- [{watchdog, Dog} | Config];
-
-init_per_testcase(TestCase, Config0) ->
- Config = lists:keydelete(watchdog, 1, Config0),
- Dog = ssl_test_lib:timetrap(?TIMEOUT),
- special_init(TestCase, [{watchdog, Dog} | Config]).
-
-special_init(TestCase, Config)
- when TestCase == erlang_client_openssl_server_renegotiate;
- TestCase == erlang_client_openssl_server_nowrap_seqnum;
- TestCase == erlang_server_openssl_client_nowrap_seqnum
- ->
- check_sane_openssl_renegotaite(Config);
-
-special_init(ssl2_erlang_server_openssl_client, Config) ->
- check_sane_openssl_sslv2(Config);
-
-special_init(TestCase, Config)
- when TestCase == erlang_client_openssl_server_npn;
- TestCase == erlang_server_openssl_client_npn;
- TestCase == erlang_server_openssl_client_npn_renegotiate;
- TestCase == erlang_client_openssl_server_npn_renegotiate;
- TestCase == erlang_server_openssl_client_npn_only_server;
- TestCase == erlang_server_openssl_client_npn_only_client;
- TestCase == erlang_client_openssl_server_npn_only_client;
- TestCase == erlang_client_openssl_server_npn_only_server ->
- check_openssl_npn_support(Config);
-
-special_init(_, Config) ->
- Config.
-
-%%--------------------------------------------------------------------
-%% Function: end_per_testcase(TestCase, Config) -> _
-%% Case - atom()
-%% Name of the test case that is about to be run.
-%% Config - [tuple()]
-%% A list of key/value pairs, holding the test case configuration.
-%% Description: Cleanup after each test case
-%%--------------------------------------------------------------------
-end_per_testcase(reuse_session_expired, Config) ->
- application:unset_env(ssl, session_lifetime),
- end_per_testcase(default_action, Config);
-
-end_per_testcase(default_action, Config) ->
- Dog = ?config(watchdog, Config),
- case Dog of
- undefined ->
- ok;
- _ ->
- test_server:timetrap_cancel(Dog)
- end;
-end_per_testcase(_, Config) ->
- end_per_testcase(default_action, Config).
-
-%%--------------------------------------------------------------------
-%% Function: all(Clause) -> TestCases
-%% Clause - atom() - suite | doc
-%% TestCases - [Case]
-%% Case - atom()
-%% Name of a test case.
-%% Description: Returns a list of all test cases in this test suite
-%%--------------------------------------------------------------------
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
@@ -211,6 +89,34 @@ npn_tests() ->
erlang_client_openssl_server_npn_only_client,
erlang_client_openssl_server_npn_only_server].
+
+init_per_suite(Config0) ->
+ Dog = ct:timetrap(?LONG_TIMEOUT *2),
+ case os:find_executable("openssl") of
+ false ->
+ {skip, "Openssl not found"};
+ _ ->
+ catch crypto:stop(),
+ try crypto:start() of
+ ok ->
+ application:start(public_key),
+ ssl:start(),
+ Result =
+ (catch make_certs:all(?config(data_dir, Config0),
+ ?config(priv_dir, Config0))),
+ ct:print("Make certs ~p~n", [Result]),
+ Config1 = ssl_test_lib:make_dsa_cert(Config0),
+ Config = ssl_test_lib:cert_options(Config1),
+ [{watchdog, Dog} | Config]
+ catch _:_ ->
+ {skip, "Crypto did not start"}
+ end
+ end.
+
+end_per_suite(_Config) ->
+ ssl:stop(),
+ application:stop(crypto).
+
init_per_group(GroupName, Config) ->
case ssl_test_lib:is_tls_version(GroupName) of
true ->
@@ -229,13 +135,55 @@ init_per_group(GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
+init_per_testcase(expired_session, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = ct:timetrap(?EXPIRE * 1000 * 5),
+ ssl:stop(),
+ application:load(ssl),
+ application:set_env(ssl, session_lifetime, ?EXPIRE),
+ ssl:start(),
+ [{watchdog, Dog} | Config];
+
+init_per_testcase(TestCase, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = ct:timetrap(?TIMEOUT),
+ special_init(TestCase, [{watchdog, Dog} | Config]).
+
+special_init(TestCase, Config)
+ when TestCase == erlang_client_openssl_server_renegotiate;
+ TestCase == erlang_client_openssl_server_nowrap_seqnum;
+ TestCase == erlang_server_openssl_client_nowrap_seqnum
+ ->
+ check_sane_openssl_renegotaite(Config);
+
+special_init(ssl2_erlang_server_openssl_client, Config) ->
+ check_sane_openssl_sslv2(Config);
+
+special_init(TestCase, Config)
+ when TestCase == erlang_client_openssl_server_npn;
+ TestCase == erlang_server_openssl_client_npn;
+ TestCase == erlang_server_openssl_client_npn_renegotiate;
+ TestCase == erlang_client_openssl_server_npn_renegotiate;
+ TestCase == erlang_server_openssl_client_npn_only_server;
+ TestCase == erlang_server_openssl_client_npn_only_client;
+ TestCase == erlang_client_openssl_server_npn_only_client;
+ TestCase == erlang_client_openssl_server_npn_only_server ->
+ check_openssl_npn_support(Config);
+
+special_init(_, Config) ->
+ Config.
+
+end_per_testcase(reuse_session_expired, Config) ->
+ application:unset_env(ssl, session_lifetime),
+ Config;
+end_per_testcase(_, Config) ->
+ Config.
-%% Test cases starts here.
%%--------------------------------------------------------------------
-basic_erlang_client_openssl_server(doc) ->
- ["Test erlang client with openssl server"];
-basic_erlang_client_openssl_server(suite) ->
- [];
+%% Test Cases --------------------------------------------------------
+%%--------------------------------------------------------------------
+basic_erlang_client_openssl_server() ->
+ [{doc,"Test erlang client with openssl server"}].
basic_erlang_client_openssl_server(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -252,7 +200,7 @@ basic_erlang_client_openssl_server(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile,
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -271,14 +219,11 @@ basic_erlang_client_openssl_server(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
close_port(OpensslPort),
ssl_test_lib:close(Client),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-basic_erlang_server_openssl_client(doc) ->
- ["Test erlang server with openssl client"];
-basic_erlang_server_openssl_client(suite) ->
- [];
+basic_erlang_server_openssl_client() ->
+ [{doc,"Test erlang server with openssl client"}].
basic_erlang_server_openssl_client(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -296,7 +241,7 @@ basic_erlang_server_openssl_client(Config) when is_list(Config) ->
Cmd = "openssl s_client -port " ++ integer_to_list(Port) ++
" -host localhost",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
port_command(OpenSslPort, Data),
@@ -309,10 +254,8 @@ basic_erlang_server_openssl_client(Config) when is_list(Config) ->
process_flag(trap_exit, false),
ok.
%%--------------------------------------------------------------------
-erlang_client_openssl_server(doc) ->
- ["Test erlang client with openssl server"];
-erlang_client_openssl_server(suite) ->
- [];
+erlang_client_openssl_server() ->
+ [{doc,"Test erlang client with openssl server"}].
erlang_client_openssl_server(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -329,7 +272,7 @@ erlang_client_openssl_server(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile,
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -348,15 +291,11 @@ erlang_client_openssl_server(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
close_port(OpensslPort),
ssl_test_lib:close(Client),
- process_flag(trap_exit, false),
- ok.
-
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_server_openssl_client(doc) ->
- ["Test erlang server with openssl client"];
-erlang_server_openssl_client(suite) ->
- [];
+erlang_server_openssl_client() ->
+ [{doc,"Test erlang server with openssl client"}].
erlang_server_openssl_client(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -375,7 +314,7 @@ erlang_server_openssl_client(Config) when is_list(Config) ->
Cmd = "openssl s_client -port " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -host localhost",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
port_command(OpenSslPort, Data),
@@ -385,15 +324,12 @@ erlang_server_openssl_client(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
ssl_test_lib:close(Server),
close_port(OpenSslPort),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_client_openssl_server_dsa_cert(doc) ->
- ["Test erlang server with openssl client"];
-erlang_client_openssl_server_dsa_cert(suite) ->
- [];
+erlang_client_openssl_server_dsa_cert() ->
+ [{doc,"Test erlang server with openssl client"}].
erlang_client_openssl_server_dsa_cert(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ClientOpts = ?config(client_dsa_opts, Config),
@@ -413,7 +349,7 @@ erlang_client_openssl_server_dsa_cert(Config) when is_list(Config) ->
" -cert " ++ CertFile ++ " -CAfile " ++ CaCertFile
++ " -key " ++ KeyFile ++ " -Verify 2 -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -436,10 +372,8 @@ erlang_client_openssl_server_dsa_cert(Config) when is_list(Config) ->
process_flag(trap_exit, false),
ok.
%%--------------------------------------------------------------------
-erlang_server_openssl_client_dsa_cert(doc) ->
- ["Test erlang server with openssl client"];
-erlang_server_openssl_client_dsa_cert(suite) ->
- [];
+erlang_server_openssl_client_dsa_cert() ->
+ [{doc,"Test erlang server with openssl client"}].
erlang_server_openssl_client_dsa_cert(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ClientOpts = ?config(client_dsa_opts, Config),
@@ -462,7 +396,7 @@ erlang_server_openssl_client_dsa_cert(Config) when is_list(Config) ->
" -host localhost " ++ " -cert " ++ CertFile ++ " -CAfile " ++ CaCertFile
++ " -key " ++ KeyFile ++ " -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
port_command(OpenSslPort, Data),
@@ -472,16 +406,13 @@ erlang_server_openssl_client_dsa_cert(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
ssl_test_lib:close(Server),
close_port(OpenSslPort),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_server_openssl_client_reuse_session(doc) ->
- ["Test erlang server with openssl client that reconnects with the"
- "same session id, to test reusing of sessions."];
-erlang_server_openssl_client_reuse_session(suite) ->
- [];
+erlang_server_openssl_client_reuse_session() ->
+ [{doc, "Test erlang server with openssl client that reconnects with the"
+ "same session id, to test reusing of sessions."}].
erlang_server_openssl_client_reuse_session(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -500,7 +431,7 @@ erlang_server_openssl_client_reuse_session(Config) when is_list(Config) ->
Cmd = "openssl s_client -port " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -host localhost -reconnect",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -516,10 +447,8 @@ erlang_server_openssl_client_reuse_session(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-erlang_client_openssl_server_renegotiate(doc) ->
- ["Test erlang client when openssl server issuses a renegotiate"];
-erlang_client_openssl_server_renegotiate(suite) ->
- [];
+erlang_client_openssl_server_renegotiate() ->
+ [{doc,"Test erlang client when openssl server issuses a renegotiate"}].
erlang_client_openssl_server_renegotiate(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -538,7 +467,7 @@ erlang_client_openssl_server_renegotiate(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile ++ " -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -552,7 +481,7 @@ erlang_client_openssl_server_renegotiate(Config) when is_list(Config) ->
{options, ClientOpts}]),
port_command(OpensslPort, ?OPENSSL_RENEGOTIATE),
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
port_command(OpensslPort, OpenSslData),
ssl_test_lib:check_result(Client, ok),
@@ -565,13 +494,11 @@ erlang_client_openssl_server_renegotiate(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-erlang_client_openssl_server_nowrap_seqnum(doc) ->
- ["Test that erlang client will renegotiate session when",
+erlang_client_openssl_server_nowrap_seqnum() ->
+ [{doc, "Test that erlang client will renegotiate session when",
"max sequence number celing is about to be reached. Although"
"in the testcase we use the test option renegotiate_at"
- " to lower treashold substantially."];
-erlang_client_openssl_server_nowrap_seqnum(suite) ->
- [];
+ " to lower treashold substantially."}].
erlang_client_openssl_server_nowrap_seqnum(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -589,7 +516,7 @@ erlang_client_openssl_server_nowrap_seqnum(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile ++ " -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -608,17 +535,13 @@ erlang_client_openssl_server_nowrap_seqnum(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
close_port(OpensslPort),
ssl_test_lib:close(Client),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_server_openssl_client_nowrap_seqnum(doc) ->
- ["Test that erlang client will renegotiate session when",
+erlang_server_openssl_client_nowrap_seqnum() ->
+ [{doc, "Test that erlang client will renegotiate session when",
"max sequence number celing is about to be reached. Although"
"in the testcase we use the test option renegotiate_at"
- " to lower treashold substantially."];
-
-erlang_server_openssl_client_nowrap_seqnum(suite) ->
- [];
+ " to lower treashold substantially."}].
erlang_server_openssl_client_nowrap_seqnum(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -639,7 +562,7 @@ erlang_server_openssl_client_nowrap_seqnum(Config) when is_list(Config) ->
Cmd = "openssl s_client -port " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -host localhost -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -650,16 +573,14 @@ erlang_server_openssl_client_nowrap_seqnum(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
ssl_test_lib:close(Server),
close_port(OpenSslPort),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
+
%%--------------------------------------------------------------------
-erlang_client_openssl_server_no_server_ca_cert(doc) ->
- ["Test erlang client when openssl server sends a cert chain not"
+erlang_client_openssl_server_no_server_ca_cert() ->
+ [{doc, "Test erlang client when openssl server sends a cert chain not"
"including the ca cert. Explicitly test this even if it is"
- "implicitly tested eleswhere."];
-erlang_client_openssl_server_no_server_ca_cert(suite) ->
- [];
+ "implicitly tested eleswhere."}].
erlang_client_openssl_server_no_server_ca_cert(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -676,7 +597,7 @@ erlang_client_openssl_server_no_server_ca_cert(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile ++ " -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -696,14 +617,11 @@ erlang_client_openssl_server_no_server_ca_cert(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
close_port(OpensslPort),
ssl_test_lib:close(Client),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_client_openssl_server_client_cert(doc) ->
- ["Test erlang client with openssl server when client sends cert"];
-erlang_client_openssl_server_client_cert(suite) ->
- [];
+erlang_client_openssl_server_client_cert() ->
+ [{doc,"Test erlang client with openssl server when client sends cert"}].
erlang_client_openssl_server_client_cert(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_verification_opts, Config),
@@ -722,7 +640,7 @@ erlang_client_openssl_server_client_cert(Config) when is_list(Config) ->
" -cert " ++ CertFile ++ " -CAfile " ++ CaCertFile
++ " -key " ++ KeyFile ++ " -Verify 2",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -741,15 +659,12 @@ erlang_client_openssl_server_client_cert(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
close_port(OpensslPort),
ssl_test_lib:close(Client),
- process_flag(trap_exit, false),
- ok.
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_server_openssl_client_client_cert(doc) ->
- ["Test erlang server with openssl client when client sends cert"];
-erlang_server_openssl_client_client_cert(suite) ->
- [];
+erlang_server_openssl_client_client_cert() ->
+ [{doc,"Test erlang server with openssl client when client sends cert"}].
erlang_server_openssl_client_client_cert(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_verification_opts, Config),
@@ -776,7 +691,7 @@ erlang_server_openssl_client_client_cert(Config) when is_list(Config) ->
++ " -key " ++ KeyFile ++ " -port " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -host localhost",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
port_command(OpenSslPort, Data),
@@ -786,16 +701,12 @@ erlang_server_openssl_client_client_cert(Config) when is_list(Config) ->
%% Clean close down! Server needs to be closed first !!
close_port(OpenSslPort),
ssl_test_lib:close(Server),
- process_flag(trap_exit, false),
- ok.
-
+ process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_server_erlang_client_client_cert(doc) ->
- ["Test erlang server with erlang client when client sends cert"];
-erlang_server_erlang_client_client_cert(suite) ->
- [];
+erlang_server_erlang_client_client_cert() ->
+ [{doc,"Test erlang server with erlang client when client sends cert"}].
erlang_server_erlang_client_client_cert(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_verification_opts, Config),
@@ -828,30 +739,22 @@ erlang_server_erlang_client_client_cert(Config) when is_list(Config) ->
ssl_test_lib:close(Server),
ssl_test_lib:close(Client),
- process_flag(trap_exit, false),
- ok.
-%%--------------------------------------------------------------------
+ process_flag(trap_exit, false).
-ciphers_rsa_signed_certs(doc) ->
- ["Test cipher suites that uses rsa certs"];
-
-ciphers_rsa_signed_certs(suite) ->
- [];
+%%--------------------------------------------------------------------
+ciphers_rsa_signed_certs() ->
+ [{doc,"Test cipher suites that uses rsa certs"}].
ciphers_rsa_signed_certs(Config) when is_list(Config) ->
Version =
ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
Ciphers = ssl_test_lib:rsa_suites(),
run_suites(Ciphers, Version, Config, rsa).
+%%--------------------------------------------------------------------
-
-ciphers_dsa_signed_certs(doc) ->
- ["Test cipher suites that uses dsa certs"];
-
-ciphers_dsa_signed_certs(suite) ->
- [];
-
+ciphers_dsa_signed_certs() ->
+ [{doc,"Test cipher suites that uses dsa certs"}].
ciphers_dsa_signed_certs(Config) when is_list(Config) ->
Version =
ssl_record:protocol_version(ssl_record:highest_protocol_version([])),
@@ -859,90 +762,9 @@ ciphers_dsa_signed_certs(Config) when is_list(Config) ->
Ciphers = ssl_test_lib:dsa_suites(),
run_suites(Ciphers, Version, Config, dsa).
-run_suites(Ciphers, Version, Config, Type) ->
- {ClientOpts, ServerOpts} =
- case Type of
- rsa ->
- {?config(client_opts, Config),
- ?config(server_opts, Config)};
- dsa ->
- {?config(client_opts, Config),
- ?config(server_dsa_opts, Config)}
- end,
-
- Result = lists:map(fun(Cipher) ->
- cipher(Cipher, Version, Config, ClientOpts, ServerOpts) end,
- Ciphers),
- case lists:flatten(Result) of
- [] ->
- ok;
- Error ->
- test_server:format("Cipher suite errors: ~p~n", [Error]),
- test_server:fail(cipher_suite_failed_see_test_case_log)
- end.
-
-cipher(CipherSuite, Version, Config, ClientOpts, ServerOpts) ->
- process_flag(trap_exit, true),
- test_server:format("Testing CipherSuite ~p~n", [CipherSuite]),
- {ClientNode, _ServerNode, Hostname} = ssl_test_lib:run_where(Config),
-
- Port = ssl_test_lib:inet_port(node()),
- CertFile = proplists:get_value(certfile, ServerOpts),
- KeyFile = proplists:get_value(keyfile, ServerOpts),
-
- Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
- " -cert " ++ CertFile ++ " -key " ++ KeyFile ++ "",
-
- test_server:format("openssl cmd: ~p~n", [Cmd]),
-
- OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
-
- wait_for_openssl_server(),
-
- ConnectionInfo = {ok, {Version, CipherSuite}},
-
- Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
- {host, Hostname},
- {from, self()},
- {mfa, {ssl_test_lib, cipher_result, [ConnectionInfo]}},
- {options,
- [{ciphers,[CipherSuite]} |
- ClientOpts]}]),
-
- port_command(OpenSslPort, "Hello\n"),
-
- receive
- {Port, {data, _}} when is_port(Port) ->
- ok
- after 500 ->
- test_server:format("Time out on openssl port, check that"
- " the messages Hello and world are received"
- " during close of port" , []),
- ok
- end,
-
- port_command(OpenSslPort, " world\n"),
-
- Result = ssl_test_lib:wait_for_result(Client, ok),
-
- %% Clean close down! Server needs to be closed first !!
- close_port(OpenSslPort),
- ssl_test_lib:close(Client),
-
- Return = case Result of
- ok ->
- [];
- Error ->
- [{CipherSuite, Error}]
- end,
- process_flag(trap_exit, false),
- Return.
-
%%--------------------------------------------------------------------
-erlang_client_bad_openssl_server(doc) ->
- [""];
-erlang_client_bad_openssl_server(suite) ->
- [];
+erlang_client_bad_openssl_server() ->
+ [{doc,"Test what happens if openssl server sends garbage to erlang ssl client"}].
erlang_client_bad_openssl_server(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_verification_opts, Config),
@@ -957,7 +779,7 @@ erlang_client_bad_openssl_server(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile ++ "",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -973,7 +795,7 @@ erlang_client_bad_openssl_server(Config) when is_list(Config) ->
%% Send garbage
port_command(OpensslPort, ?OPENSSL_GARBAGE),
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Client0 ! server_sent_garbage,
@@ -997,13 +819,9 @@ erlang_client_bad_openssl_server(Config) when is_list(Config) ->
%%--------------------------------------------------------------------
-expired_session(doc) ->
- ["Test our ssl client handling of expired sessions. Will make"
- "better code coverage of the ssl_manager module"];
-
-expired_session(suite) ->
- [];
-
+expired_session() ->
+ [{doc, "Test our ssl client handling of expired sessions. Will make"
+ "better code coverage of the ssl_manager module"}].
expired_session(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ClientOpts = ?config(client_opts, Config),
@@ -1017,7 +835,7 @@ expired_session(Config) when is_list(Config) ->
Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile ++ "",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -1032,7 +850,7 @@ expired_session(Config) when is_list(Config) ->
ssl_test_lib:close(Client0),
%% Make sure session is registered
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
@@ -1042,7 +860,7 @@ expired_session(Config) when is_list(Config) ->
ssl_test_lib:close(Client1),
%% Make sure session is unregistered due to expiration
- test_server:sleep((?EXPIRE+1) * 1000),
+ ct:sleep((?EXPIRE+1) * 1000),
Client2 =
ssl_test_lib:start_client([{node, ClientNode},
@@ -1056,10 +874,9 @@ expired_session(Config) when is_list(Config) ->
process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-ssl2_erlang_server_openssl_client(doc) ->
- ["Test that ssl v2 clients are rejected"];
-ssl2_erlang_server_openssl_client(suite) ->
- [];
+ssl2_erlang_server_openssl_client() ->
+ [{doc,"Test that ssl v2 clients are rejected"}].
+
ssl2_erlang_server_openssl_client(Config) when is_list(Config) ->
process_flag(trap_exit, true),
ServerOpts = ?config(server_opts, Config),
@@ -1076,7 +893,7 @@ ssl2_erlang_server_openssl_client(Config) when is_list(Config) ->
Cmd = "openssl s_client -port " ++ integer_to_list(Port) ++
" -host localhost -ssl2 -msg",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
port_command(OpenSslPort, Data),
@@ -1089,10 +906,9 @@ ssl2_erlang_server_openssl_client(Config) when is_list(Config) ->
process_flag(trap_exit, false).
%%--------------------------------------------------------------------
-erlang_client_openssl_server_npn(doc) ->
- ["Test erlang client with openssl server doing npn negotiation"];
-erlang_client_openssl_server_npn(suite) ->
- [];
+erlang_client_openssl_server_npn() ->
+ [{doc,"Test erlang client with openssl server doing npn negotiation"}].
+
erlang_client_openssl_server_npn(Config) when is_list(Config) ->
Data = "From openssl to erlang",
start_erlang_client_and_openssl_server_for_npn_negotiation(Config, Data, fun(Client, OpensslPort) ->
@@ -1100,33 +916,25 @@ erlang_client_openssl_server_npn(Config) when is_list(Config) ->
ssl_test_lib:check_result(Client, ok)
end),
-
ok.
-
%%--------------------------------------------------------------------
-erlang_client_openssl_server_npn_renegotiate(doc) ->
- ["Test erlang client with openssl server doing npn negotiation and renegotiate"];
-erlang_client_openssl_server_npn_renegotiate(suite) ->
- [];
+erlang_client_openssl_server_npn_renegotiate() ->
+ [{doc,"Test erlang client with openssl server doing npn negotiation and renegotiate"}].
+
erlang_client_openssl_server_npn_renegotiate(Config) when is_list(Config) ->
Data = "From openssl to erlang",
start_erlang_client_and_openssl_server_for_npn_negotiation(Config, Data, fun(Client, OpensslPort) ->
port_command(OpensslPort, ?OPENSSL_RENEGOTIATE),
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
port_command(OpensslPort, Data),
ssl_test_lib:check_result(Client, ok)
end),
ok.
-
-
%%--------------------------------------------------------------------------
+erlang_server_openssl_client_npn() ->
+ [{doc,"Test erlang server with openssl client and npn negotiation"}].
-
-erlang_server_openssl_client_npn(doc) ->
- ["Test erlang server with openssl client and npn negotiation"];
-erlang_server_openssl_client_npn(suite) ->
- [];
erlang_server_openssl_client_npn(Config) when is_list(Config) ->
Data = "From openssl to erlang",
@@ -1137,25 +945,23 @@ erlang_server_openssl_client_npn(Config) when is_list(Config) ->
ok.
%%--------------------------------------------------------------------------
+erlang_server_openssl_client_npn_renegotiate() ->
+ [{doc,"Test erlang server with openssl client and npn negotiation with renegotiation"}].
-erlang_server_openssl_client_npn_renegotiate(doc) ->
- ["Test erlang server with openssl client and npn negotiation with renegotiation"];
-erlang_server_openssl_client_npn_renegotiate(suite) ->
- [];
erlang_server_openssl_client_npn_renegotiate(Config) when is_list(Config) ->
Data = "From openssl to erlang",
start_erlang_server_and_openssl_client_for_npn_negotiation(Config, Data, fun(Server, OpensslPort) ->
port_command(OpensslPort, ?OPENSSL_RENEGOTIATE),
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
port_command(OpensslPort, Data),
ssl_test_lib:check_result(Server, ok)
end),
ok.
%%--------------------------------------------------------------------------
-
erlang_client_openssl_server_npn_only_server(Config) when is_list(Config) ->
Data = "From openssl to erlang",
- start_erlang_client_and_openssl_server_with_opts(Config, [], "-nextprotoneg spdy/2", Data, fun(Server, OpensslPort) ->
+ start_erlang_client_and_openssl_server_with_opts(Config, [],
+ "-nextprotoneg spdy/2", Data, fun(Server, OpensslPort) ->
port_command(OpensslPort, Data),
ssl_test_lib:check_result(Server, ok)
end),
@@ -1165,7 +971,10 @@ erlang_client_openssl_server_npn_only_server(Config) when is_list(Config) ->
erlang_client_openssl_server_npn_only_client(Config) when is_list(Config) ->
Data = "From openssl to erlang",
- start_erlang_client_and_openssl_server_with_opts(Config, [{client_preferred_next_protocols, {client, [<<"spdy/2">>], <<"http/1.1">>}}], "", Data, fun(Server, OpensslPort) ->
+ start_erlang_client_and_openssl_server_with_opts(Config,
+ [{client_preferred_next_protocols,
+ {client, [<<"spdy/2">>], <<"http/1.1">>}}], "",
+ Data, fun(Server, OpensslPort) ->
port_command(OpensslPort, Data),
ssl_test_lib:check_result(Server, ok)
end),
@@ -1174,7 +983,8 @@ erlang_client_openssl_server_npn_only_client(Config) when is_list(Config) ->
%%--------------------------------------------------------------------------
erlang_server_openssl_client_npn_only_server(Config) when is_list(Config) ->
Data = "From openssl to erlang",
- start_erlang_server_and_openssl_client_with_opts(Config, [{next_protocols_advertised, [<<"spdy/2">>]}], "", Data, fun(Server, OpensslPort) ->
+ start_erlang_server_and_openssl_client_with_opts(Config, [{next_protocols_advertised, [<<"spdy/2">>]}], "",
+ Data, fun(Server, OpensslPort) ->
port_command(OpensslPort, Data),
ssl_test_lib:check_result(Server, ok)
end),
@@ -1182,13 +992,94 @@ erlang_server_openssl_client_npn_only_server(Config) when is_list(Config) ->
erlang_server_openssl_client_npn_only_client(Config) when is_list(Config) ->
Data = "From openssl to erlang",
- start_erlang_server_and_openssl_client_with_opts(Config, [], "-nextprotoneg spdy/2", Data, fun(Server, OpensslPort) ->
+ start_erlang_server_and_openssl_client_with_opts(Config, [], "-nextprotoneg spdy/2",
+ Data, fun(Server, OpensslPort) ->
port_command(OpensslPort, Data),
ssl_test_lib:check_result(Server, ok)
end),
ok.
-%%--------------------------------------------------------------------------
+%%--------------------------------------------------------------------
+%% Internal functions ------------------------------------------------
+%%--------------------------------------------------------------------
+run_suites(Ciphers, Version, Config, Type) ->
+ {ClientOpts, ServerOpts} =
+ case Type of
+ rsa ->
+ {?config(client_opts, Config),
+ ?config(server_opts, Config)};
+ dsa ->
+ {?config(client_opts, Config),
+ ?config(server_dsa_opts, Config)}
+ end,
+
+ Result = lists:map(fun(Cipher) ->
+ cipher(Cipher, Version, Config, ClientOpts, ServerOpts) end,
+ Ciphers),
+ case lists:flatten(Result) of
+ [] ->
+ ok;
+ Error ->
+ ct:print("Cipher suite errors: ~p~n", [Error]),
+ ct:fail(cipher_suite_failed_see_test_case_log)
+ end.
+
+cipher(CipherSuite, Version, Config, ClientOpts, ServerOpts) ->
+ process_flag(trap_exit, true),
+ ct:print("Testing CipherSuite ~p~n", [CipherSuite]),
+ {ClientNode, _ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Port = ssl_test_lib:inet_port(node()),
+ CertFile = proplists:get_value(certfile, ServerOpts),
+ KeyFile = proplists:get_value(keyfile, ServerOpts),
+
+ Cmd = "openssl s_server -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
+ " -cert " ++ CertFile ++ " -key " ++ KeyFile ++ "",
+
+ ct:print("openssl cmd: ~p~n", [Cmd]),
+
+ OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
+
+ wait_for_openssl_server(),
+
+ ConnectionInfo = {ok, {Version, CipherSuite}},
+
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, cipher_result, [ConnectionInfo]}},
+ {options,
+ [{ciphers,[CipherSuite]} |
+ ClientOpts]}]),
+
+ port_command(OpenSslPort, "Hello\n"),
+
+ receive
+ {Port, {data, _}} when is_port(Port) ->
+ ok
+ after 500 ->
+ ct:print("Time out on openssl port, check that"
+ " the messages Hello and world are received"
+ " during close of port" , []),
+ ok
+ end,
+
+ port_command(OpenSslPort, " world\n"),
+
+ Result = ssl_test_lib:wait_for_result(Client, ok),
+
+ %% Clean close down! Server needs to be closed first !!
+ close_port(OpenSslPort),
+ ssl_test_lib:close(Client),
+
+ Return = case Result of
+ ok ->
+ [];
+ Error ->
+ [{CipherSuite, Error}]
+ end,
+ process_flag(trap_exit, false),
+ Return.
start_erlang_client_and_openssl_server_with_opts(Config, ErlangClientOpts, OpensslServerOpts, Data, Callback) ->
process_flag(trap_exit, true),
@@ -1209,7 +1100,7 @@ start_erlang_client_and_openssl_server_with_opts(Config, ErlangClientOpts, Opens
integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile,
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -1248,7 +1139,7 @@ start_erlang_client_and_openssl_server_for_npn_negotiation(Config, Data, Callbac
Cmd = "openssl s_server -msg -nextprotoneg http/1.1,spdy/2 -accept " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -cert " ++ CertFile ++ " -key " ++ KeyFile,
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpensslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -1286,7 +1177,7 @@ start_erlang_server_and_openssl_client_for_npn_negotiation(Config, Data, Callbac
Cmd = "openssl s_client -nextprotoneg http/1.0,spdy/2 -msg -port " ++ integer_to_list(Port) ++ version_flag(Version) ++
" -host localhost",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -1297,6 +1188,7 @@ start_erlang_server_and_openssl_client_for_npn_negotiation(Config, Data, Callbac
close_port(OpenSslPort),
process_flag(trap_exit, false).
+
start_erlang_server_and_openssl_client_with_opts(Config, ErlangServerOpts, OpenSSLClientOpts, Data, Callback) ->
process_flag(trap_exit, true),
ServerOpts0 = ?config(server_opts, Config),
@@ -1314,7 +1206,7 @@ start_erlang_server_and_openssl_client_with_opts(Config, ErlangServerOpts, OpenS
Cmd = "openssl s_client " ++ OpenSSLClientOpts ++ " -msg -port " ++ integer_to_list(Port) ++
" -host localhost",
- test_server:format("openssl cmd: ~p~n", [Cmd]),
+ ct:print("openssl cmd: ~p~n", [Cmd]),
OpenSslPort = open_port({spawn, Cmd}, [stderr_to_stdout]),
@@ -1333,7 +1225,7 @@ erlang_ssl_receive_and_assert_npn(Socket, Protocol, Data) ->
ok.
erlang_ssl_receive(Socket, Data) ->
- test_server:format("Connection info: ~p~n",
+ ct:print("Connection info: ~p~n",
[ssl:connection_info(Socket)]),
receive
{ssl, Socket, Data} ->
@@ -1347,15 +1239,15 @@ erlang_ssl_receive(Socket, Data) ->
io:format("openssl ~s~n",[Debug]),
erlang_ssl_receive(Socket,Data);
Other ->
- test_server:fail({unexpected_message, Other})
+ ct:fail({unexpected_message, Other})
after 4000 ->
- test_server:fail({did_not_get, Data})
+ ct:fail({did_not_get, Data})
end.
connection_info(Socket, Version) ->
case ssl:connection_info(Socket) of
{ok, {Version, _} = Info} ->
- test_server:format("Connection info: ~p~n", [Info]),
+ ct:print("Connection info: ~p~n", [Info]),
ok;
{ok, {OtherVersion, _}} ->
{wrong_version, OtherVersion}
@@ -1366,7 +1258,7 @@ connection_info_result(Socket) ->
delayed_send(Socket, [ErlData, OpenSslData]) ->
- test_server:sleep(?SLEEP),
+ ct:sleep(?SLEEP),
ssl:send(Socket, ErlData),
erlang_ssl_receive(Socket, OpenSslData).
@@ -1418,7 +1310,7 @@ wait_for_openssl_server() ->
%% it will be in accept. Parsing
%% output is too error prone. (Even
%% more so than sleep!)
- test_server:sleep(?SLEEP)
+ ct:sleep(?SLEEP)
end.
version_flag(tlsv1) ->
diff --git a/lib/stdlib/src/c.erl b/lib/stdlib/src/c.erl
index a920921a5e..4c1c0f904b 100644
--- a/lib/stdlib/src/c.erl
+++ b/lib/stdlib/src/c.erl
@@ -116,7 +116,7 @@ machine_load(Mod, File, Opts) ->
File2 = filename:join(Dir, filename:basename(File, ".erl")),
case compile:output_generated(Opts) of
true ->
- Base = packages:last(Mod),
+ Base = atom_to_list(Mod),
case filename:basename(File, ".erl") of
Base ->
code:purge(Mod),
diff --git a/lib/stdlib/src/erl_eval.erl b/lib/stdlib/src/erl_eval.erl
index 95ba6b1096..8471ae6b64 100644
--- a/lib/stdlib/src/erl_eval.erl
+++ b/lib/stdlib/src/erl_eval.erl
@@ -227,13 +227,6 @@ expr({bc,_,E,Qs}, Bs, Lf, Ef, RBs) ->
expr({tuple,_,Es}, Bs0, Lf, Ef, RBs) ->
{Vs,Bs} = expr_list(Es, Bs0, Lf, Ef),
ret_expr(list_to_tuple(Vs), Bs, RBs);
-expr({record_field,_,_,_}=Mod, Bs, _Lf, _Ef, RBs) ->
- case expand_module_name(Mod, Bs) of
- {atom,_,A} ->
- ret_expr(A, Bs, RBs); %% This is the "x.y" syntax
- _ ->
- erlang:raise(error, {badexpr, '.'}, stacktrace())
- end;
expr({record_field,_,_,Name,_}, _Bs, _Lf, _Ef, _RBs) ->
erlang:raise(error, {undef_record,Name}, stacktrace());
expr({record_index,_,Name,_}, _Bs, _Lf, _Ef, _RBs) ->
@@ -332,8 +325,7 @@ expr({call,L1,{remote,L2,{record_field,_,{atom,_,''},{atom,_,qlc}=Mod},
Bs, Lf, Ef, RBs) when length(As0) =< 1 ->
expr({call,L1,{remote,L2,Mod,Func},As}, Bs, Lf, Ef, RBs);
expr({call,_,{remote,_,Mod,Func},As0}, Bs0, Lf, Ef, RBs) ->
- Mod1 = expand_module_name(Mod, Bs0),
- {value,M,Bs1} = expr(Mod1, Bs0, Lf, Ef, none),
+ {value,M,Bs1} = expr(Mod, Bs0, Lf, Ef, none),
{value,F,Bs2} = expr(Func, Bs0, Lf, Ef, none),
{As,Bs3} = expr_list(As0, merge_bindings(Bs1, Bs2), Lf, Ef),
%% M could be a parameterized module (not an atom).
@@ -1210,41 +1202,6 @@ ret_expr(_Old, New) ->
line(Expr) -> element(2, Expr).
-%% In syntax trees, module/package names are atoms or lists of atoms.
-
-expand_module_name({atom,L,A} = M, Bs) ->
- case binding({module,A}, Bs) of
- {value, A1} ->
- {atom,L,A1};
- unbound ->
- case packages:is_segmented(A) of
- true ->
- M;
- false ->
-%%% P = case binding({module,'$package'}, Bs) of
-%%% {value, P1} -> P1;
-%%% unbound -> ""
-%%% end,
-%%% A1 = list_to_atom(packages:concat(P, A)),
-%%% {atom,L,list_to_atom(A1)}
- {atom,L,A}
- end
- end;
-expand_module_name(M, _) ->
- case erl_parse:package_segments(M) of
- error ->
- M;
- M1 ->
- L = element(2,M),
- Mod = packages:concat(M1),
- case packages:is_valid(Mod) of
- true ->
- {atom,L,list_to_atom(Mod)};
- false ->
- erlang:raise(error, {bad_module_name, Mod}, stacktrace())
- end
- end.
-
%% {?MODULE,expr,3} is still the stacktrace, despite the
%% fact that expr() now takes two, three or four arguments...
stacktrace() -> [{?MODULE,expr,3}].
diff --git a/lib/stdlib/src/erl_expand_records.erl b/lib/stdlib/src/erl_expand_records.erl
index 85defacc43..d05f630d8e 100644
--- a/lib/stdlib/src/erl_expand_records.erl
+++ b/lib/stdlib/src/erl_expand_records.erl
@@ -135,8 +135,6 @@ pattern({tuple,Line,Ps}, St0) ->
%%pattern({struct,Line,Tag,Ps}, St0) ->
%% {TPs,TPsvs,St1} = pattern_list(Ps, St0),
%% {{struct,Line,Tag,TPs},TPsvs,St1};
-pattern({record_field,_,_,_}=M, St) ->
- {M,St}; % must be a package name
pattern({record_index,Line,Name,Field}, St) ->
{index_expr(Line, Field, Name, record_fields(Name, St)),St};
pattern({record,Line,Name,Pfs}, St0) ->
@@ -306,8 +304,6 @@ expr({tuple,Line,Es0}, St0) ->
%%expr({struct,Line,Tag,Es0}, Vs, St0) ->
%% {Es1,Esvs,Esus,St1} = expr_list(Es0, Vs, St0),
%% {{struct,Line,Tag,Es1},Esvs,Esus,St1};
-expr({record_field,_,_,_}=M, St) ->
- {M,St}; % must be a package name
expr({record_index,Line,Name,F}, St) ->
I = index_expr(Line, F, Name, record_fields(Name, St)),
expr(I, St);
@@ -375,9 +371,6 @@ expr({call,Line,{atom,_La,N}=Atom,As0}, St0) ->
end
end
end;
-expr({call,Line,{record_field,_,_,_}=M,As0}, St0) ->
- {As,St1} = expr_list(As0, St0),
- {{call,Line,M,As},St1};
expr({call,Line,{remote,Lr,M,F},As0}, St0) ->
{[M1,F1 | As1],St1} = expr_list([M,F | As0], St0),
{{call,Line,{remote,Lr,M1,F1},As1},St1};
diff --git a/lib/stdlib/src/erl_lint.erl b/lib/stdlib/src/erl_lint.erl
index 0a442d950f..d24e2fff44 100644
--- a/lib/stdlib/src/erl_lint.erl
+++ b/lib/stdlib/src/erl_lint.erl
@@ -94,12 +94,10 @@ value_option(Flag, Default, On, OnVal, Off, OffVal, Opts) ->
%% the other function collections contain {Function, Arity}.
-record(lint, {state=start :: 'start' | 'attribute' | 'function',
module=[], %Module
- package="", %Module package
extends=[], %Extends
behaviour=[], %Behaviour
exports=gb_sets:empty() :: gb_set(), %Exports
imports=[], %Imports
- mod_imports=dict:new() :: dict(), %Module Imports
compile=[], %Compile flags
records=dict:new() :: dict(), %Record definitions
locals=gb_sets:empty() :: gb_set(), %All defined functions (prescanned)
@@ -539,7 +537,6 @@ start(File, Opts) ->
end,
#lint{state = start,
exports = gb_sets:from_list([{module_info,0},{module_info,1}]),
- mod_imports = dict:from_list([{erlang,erlang}]),
compile = Opts,
%% Internal pseudo-functions must appear as defined/reached.
defined = gb_sets:from_list(pseudolocals()),
@@ -681,8 +678,8 @@ form(Form, #lint{state=State}=St) ->
%% start_state(Form, State) -> State'
-start_state({attribute,L,module,{M,Ps}}, St) ->
- St1 = set_module(M, L, St),
+start_state({attribute,_,module,{M,Ps}}, St0) ->
+ St1 = St0#lint{module=M},
Arity = length(Ps),
Ps1 = if is_atom(St1#lint.extends) ->
['BASE', 'THIS' | Ps];
@@ -693,23 +690,13 @@ start_state({attribute,L,module,{M,Ps}}, St) ->
St2 = add_instance(Arity, St1),
St3 = ensure_new(Arity, St2),
St3#lint{state=attribute, extends=[], global_vt=Vt};
-start_state({attribute,L,module,M}, St) ->
- St1 = set_module(M, L, St),
+start_state({attribute,_,module,M}, St0) ->
+ St1 = St0#lint{module=M},
St1#lint{state=attribute, extends=[]};
start_state(Form, St) ->
St1 = add_error(element(2, Form), undefined_module, St),
attribute_state(Form, St1#lint{state=attribute, extends=[]}).
-set_module(M, L, St) ->
- M1 = package_to_string(M),
- case packages:is_valid(M1) of
- true ->
- St#lint{module=list_to_atom(M1),
- package=packages:strip_last(M1)};
- false ->
- add_error(L, {bad_module_name, M1}, St)
- end.
-
ensure_new(Arity, St) ->
case St#lint.new of
true ->
@@ -1007,9 +994,9 @@ check_imports(Forms, St0) ->
true ->
Usage = St0#lint.usage,
Unused = ordsets:subtract(St0#lint.imports, Usage#usage.imported),
- Imports = [{{FA,list_to_atom(package_to_string(Mod))},L}
- || {attribute,L,import,{Mod,Fs}} <- Forms,
- FA <- lists:usort(Fs)],
+ Imports = [{{FA,Mod},L} ||
+ {attribute,L,import,{Mod,Fs}} <- Forms,
+ FA <- lists:usort(Fs)],
Bad = [{FM,L} || FM <- Unused, {FM2,L} <- Imports, FM =:= FM2],
func_line_warning(unused_import, Bad, St0)
end.
@@ -1222,73 +1209,46 @@ export_type(Line, ETs, #lint{usage = Usage, exp_types = ETs0} = St0) ->
-spec import(line(), import(), lint_state()) -> lint_state().
import(Line, {Mod,Fs}, St) ->
- Mod1 = package_to_string(Mod),
- case packages:is_valid(Mod1) of
- true ->
- Mfs = ordsets:from_list(Fs),
- case check_imports(Line, Mfs, St#lint.imports) of
- [] ->
- St#lint{imports=add_imports(list_to_atom(Mod1), Mfs,
- St#lint.imports)};
- Efs ->
- {Err, St1} =
- foldl(fun ({bif,{F,A},_}, {Err,St0}) ->
- %% BifClash - import directive
- Warn = is_warn_enabled(bif_clash, St0)
- and (not bif_clash_specifically_disabled(St0,{F,A})),
- AutoImpSup = is_autoimport_suppressed(St0#lint.no_auto,{F,A}),
- OldBif = erl_internal:old_bif(F,A),
- {Err,if
- Warn and (not AutoImpSup) and OldBif ->
- add_error
- (Line,
- {redefine_old_bif_import, {F,A}},
- St0);
- Warn and (not AutoImpSup) ->
- add_warning
- (Line,
- {redefine_bif_import, {F,A}},
- St0);
- true ->
- St0
- end};
- (Ef, {_Err,St0}) ->
- {true,add_error(Line,
- {redefine_import,Ef},
- St0)}
- end,
- {false,St}, Efs),
- if
- not Err ->
- St1#lint{imports=
- add_imports(list_to_atom(Mod1), Mfs,
+ Mfs = ordsets:from_list(Fs),
+ case check_imports(Line, Mfs, St#lint.imports) of
+ [] ->
+ St#lint{imports=add_imports(Mod, Mfs,
+ St#lint.imports)};
+ Efs ->
+ {Err, St1} =
+ foldl(fun ({bif,{F,A},_}, {Err,St0}) ->
+ %% BifClash - import directive
+ Warn = is_warn_enabled(bif_clash, St0) andalso
+ (not bif_clash_specifically_disabled(St0,{F,A})),
+ AutoImpSup = is_autoimport_suppressed(St0#lint.no_auto,{F,A}),
+ OldBif = erl_internal:old_bif(F,A),
+ {Err,if
+ Warn and (not AutoImpSup) and OldBif ->
+ add_error
+ (Line,
+ {redefine_old_bif_import, {F,A}},
+ St0);
+ Warn and (not AutoImpSup) ->
+ add_warning
+ (Line,
+ {redefine_bif_import, {F,A}},
+ St0);
+ true ->
+ St0
+ end};
+ (Ef, {_Err,St0}) ->
+ {true,add_error(Line,
+ {redefine_import,Ef},
+ St0)}
+ end,
+ {false,St}, Efs),
+ if
+ not Err ->
+ St1#lint{imports=add_imports(Mod, Mfs,
St#lint.imports)};
- true ->
- St1
- end
- end;
- false ->
- add_error(Line, {bad_module_name, Mod1}, St)
- end;
-import(Line, Mod, St) ->
- Mod1 = package_to_string(Mod),
- case packages:is_valid(Mod1) of
- true ->
- Key = list_to_atom(packages:last(Mod1)),
- Imps = St#lint.mod_imports,
-%%% case dict:is_key(Key, Imps) of
-%%% true ->
-%%% M = packages:last(Mod1),
-%%% P = packages:strip_last(Mod1),
-%%% add_error(Line, {redefine_mod_import, M, P}, St);
-%%% false ->
-%%% St#lint{mod_imports =
-%%% dict:store(Key, list_to_atom(Mod1), Imps)}
-%%% end;
- St#lint{mod_imports = dict:store(Key, list_to_atom(Mod1),
- Imps)};
- false ->
- add_error(Line, {bad_module_name, Mod1}, St)
+ true ->
+ St1
+ end
end.
check_imports(_Line, Fs, Is) ->
@@ -1463,13 +1423,6 @@ pattern({record_index,Line,Name,Field}, _Vt, _Old, _Bvt, St) ->
pattern_field(Field, Name, Dfs, St1)
end),
{Vt1,[],St1};
-pattern({record_field,Line,_,_}=M, _Vt, _Old, _Bvt, St0) ->
- case expand_package(M, St0) of
- {error, St1} ->
- {[],[],add_error(Line, illegal_expr, St1)};
- {_, St1} ->
- {[],[],St1}
- end;
pattern({record,Line,Name,Pfs}, Vt, Old, Bvt, St) ->
case dict:find(Name, St#lint.records) of
{ok,{_Line,Fields}} ->
@@ -1851,13 +1804,6 @@ gexpr({tuple,_Line,Es}, Vt, St) ->
gexpr({record_index,Line,Name,Field}, _Vt, St) ->
check_record(Line, Name, St,
fun (Dfs, St1) -> record_field(Field, Name, Dfs, St1) end );
-gexpr({record_field,Line,_,_}=M, _Vt, St0) ->
- case expand_package(M, St0) of
- {error, St1} ->
- {[],add_error(Line, illegal_expr, St1)};
- {_, St1} ->
- {[], St1}
- end;
gexpr({record_field,Line,Rec,Name,Field}, Vt, St0) ->
{Rvt,St1} = gexpr(Rec, Vt, St0),
{Fvt,St2} = check_record(Line, Name, St1,
@@ -1996,8 +1942,6 @@ is_gexpr({tuple,_L,Es}, RDs) -> is_gexpr_list(Es, RDs);
%% is_gexpr_list(Es, RDs);
is_gexpr({record_index,_L,_Name,Field}, RDs) ->
is_gexpr(Field, RDs);
-is_gexpr({record_field,_L,_,_}=M, _RDs) ->
- erl_parse:package_segments(M) =/= error;
is_gexpr({record_field,_L,Rec,_Name,Field}, RDs) ->
is_gexpr_list([Rec,Field], RDs);
is_gexpr({record,L,Name,Inits}, RDs) ->
@@ -2086,13 +2030,6 @@ expr({record,Line,Name,Inits}, Vt, St) ->
fun (Dfs, St1) ->
init_fields(Inits, Line, Name, Dfs, Vt, St1)
end);
-expr({record_field,Line,_,_}=M, _Vt, St0) ->
- case expand_package(M, St0) of
- {error, St1} ->
- {[],add_error(Line, illegal_expr, St1)};
- {_, St1} ->
- {[], St1}
- end;
expr({record_field,Line,Rec,Name,Field}, Vt, St0) ->
{Rvt,St1} = record_expr(Line, Rec, Vt, St0),
{Fvt,St2} = check_record(Line, Name, St1,
@@ -2163,20 +2100,14 @@ expr({call,Line,{remote,_Lr,{atom,_Lm,erlang},{atom,Lf,is_record}},[E,A]},
expr({call,Line,{atom,Lf,is_record},[E,A]}, Vt, St0);
expr({call,L,{tuple,Lt,[{atom,Lm,erlang},{atom,Lf,is_record}]},As}, Vt, St) ->
expr({call,L,{remote,Lt,{atom,Lm,erlang},{atom,Lf,is_record}},As}, Vt, St);
+expr({call,Line,{remote,_Lr,{atom,_Lm,M},{atom,Lf,F}},As}, Vt, St0) ->
+ St1 = keyword_warning(Lf, F, St0),
+ St2 = check_remote_function(Line, M, F, As, St1),
+ expr_list(As, Vt, St2);
expr({call,Line,{remote,_Lr,M,F},As}, Vt, St0) ->
- case expand_package(M, St0) of
- {error, _} ->
- expr_list([M,F|As], Vt, St0);
- {{atom,_La,M1}, St1} ->
- case F of
- {atom,Lf,F1} ->
- St2 = keyword_warning(Lf, F1, St1),
- St3 = check_remote_function(Line, M1, F1, As, St2),
- expr_list(As, Vt, St3);
- _ ->
- expr_list([F|As], Vt, St1)
- end
- end;
+ St1 = keyword_warning(Line, M, St0),
+ St2 = keyword_warning(Line, F, St1),
+ expr_list([M,F|As], Vt, St2);
expr({call,Line,{atom,La,F},As}, Vt, St0) ->
St1 = keyword_warning(La, F, St0),
{Asvt,St2} = expr_list(As, Vt, St1),
@@ -2232,13 +2163,6 @@ expr({call,Line,{atom,La,F},As}, Vt, St0) ->
end
end}
end;
-expr({call,Line,{record_field,_,_,_}=F,As}, Vt, St0) ->
- case expand_package(F, St0) of
- {error, _} ->
- expr_list([F|As], Vt, St0);
- {A, St1} ->
- expr({call,Line,A,As}, Vt, St1)
- end;
expr({call,Line,F,As}, Vt, St0) ->
St = warn_invalid_call(Line,F,St0),
expr_list([F|As], Vt, St); %They see the same variables
@@ -3658,49 +3582,6 @@ control_type($n, Need) -> Need;
control_type($i, Need) -> [term|Need];
control_type(_C, _Need) -> error.
-%% In syntax trees, module/package names are atoms or lists of atoms.
-
-package_to_string(A) when is_atom(A) -> atom_to_list(A);
-package_to_string(L) when is_list(L) -> packages:concat(L).
-
-expand_package({atom,L,A} = M, St0) ->
- St1 = keyword_warning(L, A, St0),
- case dict:find(A, St1#lint.mod_imports) of
- {ok, A1} ->
- {{atom,L,A1}, St1};
- error ->
- Name = atom_to_list(A),
- case packages:is_valid(Name) of
- true ->
- case packages:is_segmented(Name) of
- true ->
- {M, St1};
- false ->
- M1 = packages:concat(St1#lint.package,
- Name),
- {{atom,L,list_to_atom(M1)}, St1}
- end;
- false ->
- St2 = add_error(L, {bad_module_name, Name}, St1),
- {error, St2}
- end
- end;
-expand_package(M, St0) ->
- L = element(2, M),
- case erl_parse:package_segments(M) of
- error ->
- {error, St0};
- M1 ->
- Name = package_to_string(M1),
- case packages:is_valid(Name) of
- true ->
- {{atom,L,list_to_atom(Name)}, St0};
- false ->
- St1 = add_error(L, {bad_module_name, Name}, St0),
- {error, St1}
- end
- end.
-
%% Prebuild set of local functions (to override auto-import)
local_functions(Forms) ->
diff --git a/lib/stdlib/src/erl_parse.yrl b/lib/stdlib/src/erl_parse.yrl
index 27a2ba80eb..002abc11e8 100644
--- a/lib/stdlib/src/erl_parse.yrl
+++ b/lib/stdlib/src/erl_parse.yrl
@@ -26,7 +26,7 @@ attribute attr_val
function function_clauses function_clause
clause_args clause_guard clause_body
expr expr_100 expr_150 expr_160 expr_200 expr_300 expr_400 expr_500
-expr_600 expr_700 expr_800 expr_900
+expr_600 expr_700 expr_800
expr_max
list tail
list_comprehension lc_expr lc_exprs
@@ -253,15 +253,9 @@ expr_700 -> function_call : '$1'.
expr_700 -> record_expr : '$1'.
expr_700 -> expr_800 : '$1'.
-expr_800 -> expr_900 ':' expr_max :
+expr_800 -> expr_max ':' expr_max :
{remote,?line('$2'),'$1','$3'}.
-expr_800 -> expr_900 : '$1'.
-
-expr_900 -> '.' atom :
- {record_field,?line('$1'),{atom,?line('$1'),''},'$2'}.
-expr_900 -> expr_900 '.' atom :
- {record_field,?line('$2'),'$1','$3'}.
-expr_900 -> expr_max : '$1'.
+expr_800 -> expr_max : '$1'.
expr_max -> var : '$1'.
expr_max -> atomic : '$1'.
@@ -510,7 +504,7 @@ Erlang code.
-export([parse_form/1,parse_exprs/1,parse_term/1]).
-export([normalise/1,abstract/1,tokens/1,tokens/2]).
--export([abstract/2, package_segments/1]).
+-export([abstract/2]).
-export([inop_prec/1,preop_prec/1,func_prec/0,max_prec/0]).
-export([set_line/2,get_attribute/2,get_attributes/1]).
@@ -679,20 +673,6 @@ build_attribute({atom,La,module}, Val) ->
{attribute,La,module,Module};
[{atom,_Lm,Module},ExpList] ->
{attribute,La,module,{Module,var_list(ExpList)}};
- [Name] ->
- case package_segments(Name) of
- error ->
- error_bad_decl(La, module);
- Module ->
- {attribute,La,module,Module}
- end;
- [Name,ExpList] ->
- case package_segments(Name) of
- error ->
- error_bad_decl(La, module);
- Module ->
- {attribute,La,module,{Module,var_list(ExpList)}}
- end;
_Other ->
error_bad_decl(La, module)
end;
@@ -704,22 +684,8 @@ build_attribute({atom,La,export}, Val) ->
end;
build_attribute({atom,La,import}, Val) ->
case Val of
- [Name] ->
- case package_segments(Name) of
- error ->
- error_bad_decl(La, import);
- Module ->
- {attribute,La,import,Module}
- end;
[{atom,_Lm,Mod},ImpList] ->
{attribute,La,import,{Mod,farity_list(ImpList)}};
- [Name, ImpList] ->
- case package_segments(Name) of
- error ->
- error_bad_decl(La, import);
- Module ->
- {attribute,La,import,{Module,farity_list(ImpList)}}
- end;
_Other -> error_bad_decl(La, import)
end;
build_attribute({atom,La,record}, Val) ->
@@ -820,18 +786,6 @@ term(Expr) ->
catch _:_R -> ret_err(?line(Expr), "bad attribute")
end.
-package_segments(Name) ->
- package_segments(Name, [], []).
-
-package_segments({record_field, _, F1, F2}, Fs, As) ->
- package_segments(F1, [F2 | Fs], As);
-package_segments({atom, _, A}, [F | Fs], As) ->
- package_segments(F, Fs, [A | As]);
-package_segments({atom, _, A}, [], As) ->
- lists:reverse([A | As]);
-package_segments(_, _, _) ->
- error.
-
%% build_function([Clause]) -> {function,Line,Name,Arity,[Clause]}
build_function(Cs) ->
@@ -900,12 +854,6 @@ normalise({cons,_,Head,Tail}) ->
[normalise(Head)|normalise(Tail)];
normalise({tuple,_,Args}) ->
list_to_tuple(normalise_list(Args));
-%% Atom dot-notation, as in 'foo.bar.baz'
-normalise({record_field,_,_,_}=A) ->
- case package_segments(A) of
- error -> erlang:error({badarg, A});
- As -> list_to_atom(packages:concat(As))
- end;
%% Special case for unary +/-.
normalise({op,_,'+',{char,_,I}}) -> I;
normalise({op,_,'+',{integer,_,I}}) -> I;
@@ -1083,9 +1031,9 @@ preop_prec('#') -> {700,800}.
func_prec() -> {800,700}.
--spec max_prec() -> 1000.
+-spec max_prec() -> 900.
-max_prec() -> 1000.
+max_prec() -> 900.
%%% [Experimental]. The parser just copies the attributes of the
%%% scanner tokens to the abstract format. This design decision has
diff --git a/lib/stdlib/src/filename.erl b/lib/stdlib/src/filename.erl
index 59d6de5d10..0c50eb34e6 100644
--- a/lib/stdlib/src/filename.erl
+++ b/lib/stdlib/src/filename.erl
@@ -878,7 +878,7 @@ filter_options(_Base, [], Result) ->
%% Gets the source file given path of object code and module name.
get_source_file(Obj, Mod, Rules) ->
- source_by_rules(dirname(Obj), packages:last(Mod), Rules).
+ source_by_rules(dirname(Obj), atom_to_list(Mod), Rules).
source_by_rules(Dir, Base, [{From, To}|Rest]) ->
case try_rule(Dir, Base, From, To) of
diff --git a/lib/stdlib/src/otp_internal.erl b/lib/stdlib/src/otp_internal.erl
index 400380a36d..9257953071 100644
--- a/lib/stdlib/src/otp_internal.erl
+++ b/lib/stdlib/src/otp_internal.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1999-2012. All Rights Reserved.
+%% Copyright Ericsson AB 1999-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -359,6 +359,45 @@ obsolete_1(ssh, sign_data, 2) ->
"and public_key:sign/3 instead"};
obsolete_1(ssh, verify_data, 3) ->
{deprecated,"deprecated (will be removed in R16A); use public_key:ssh_decode/1, and public_key:verify/4 instead"};
+
+%% Added in R16
+obsolete_1(wxCalendarCtrl, enableYearChange, _) -> %% wx bug documented?
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxDC, computeScaleAndOrigin, 1) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxClientDC, new, 0) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxPaintDC, new, 0) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxWindowDC, new, 0) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxGraphicsContext, createLinearGradientBrush, 7) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxGraphicsContext, createRadialGradientBrush, 8) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxGraphicsRenderer, createLinearGradientBrush, 7) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxGraphicsRenderer, createRadialGradientBrush, 8) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxGridCellEditor, endEdit, 4) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxGridCellEditor, paintBackground, 3) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxIdleEvent, canSend, 1) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxMDIClientWindow, new, 1) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxMDIClientWindow, new, 2) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxPostScriptDC, getResolution, 0) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxPostScriptDC, setResolution, 1) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxCursor, new, 3) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+obsolete_1(wxCursor, new, 4) ->
+ {deprecated,"deprecated function not available in wxWidgets-2.9 and later"};
+
obsolete_1(_, _, _) ->
no.
diff --git a/lib/stdlib/src/qlc_pt.erl b/lib/stdlib/src/qlc_pt.erl
index ad25fd559c..d441f38e44 100644
--- a/lib/stdlib/src/qlc_pt.erl
+++ b/lib/stdlib/src/qlc_pt.erl
@@ -31,9 +31,6 @@
%% Also in qlc.erl.
-define(QLC_Q(L1, L2, L3, L4, LC, Os),
{call,L1,{remote,L2,{atom,L3,?APIMOD},{atom,L4,?Q}},[LC | Os]}).
--define(QLC_QQ(L1, L2, L3, L4, L5, L6, LC, Os), % packages...
- {call,L1,{remote,L2,{record_field,L3,{atom,L4,''},
- {atom,L5,?APIMOD}},{atom,L6,?Q}},[LC | Os]}).
-define(IMP_Q(L1, L2, LC, Os), {call,L,{atom,L2,?Q},[LC | Os]}).
%% Also in qlc.erl.
@@ -2475,13 +2472,6 @@ qlcmf(?QLC_Q(L1, L2, L3, L4, LC0, Os0), F, Imp, A0, No0) when length(Os0) < 2 ->
NL = make_lcid(L1, No),
{T, A} = F(NL, LC, A2),
{?QLC_Q(L1, L2, L3, L4, T, Os), A, No + 1};
-qlcmf(?QLC_QQ(L1, L2, L3, L4, L5, L6, LC0, Os0),
- F, Imp, A0, No0) when length(Os0) < 2 ->
- {Os, A1, No1} = qlcmf(Os0, F, Imp, A0, No0),
- {LC, A2, No} = qlcmf(LC0, F, Imp, A1, No1), % nested...
- NL = make_lcid(L1, No),
- {T, A} = F(NL, LC, A2),
- {?QLC_QQ(L1, L2, L3, L4, L5, L6, T, Os), A, No + 1};
qlcmf(?IMP_Q(L1, L2, LC0, Os0), F, Imp=true, A0, No0) when length(Os0) < 2 ->
{Os, A1, No1} = qlcmf(Os0, F, Imp, A0, No0),
{LC, A2, No} = qlcmf(LC0, F, Imp, A1, No1), % nested...
diff --git a/lib/stdlib/src/shell.erl b/lib/stdlib/src/shell.erl
index 688492d724..5c929d2f51 100644
--- a/lib/stdlib/src/shell.erl
+++ b/lib/stdlib/src/shell.erl
@@ -139,16 +139,6 @@ stop_restricted() ->
application:unset_env(stdlib, restricted_shell),
exit(restricted_shell_stopped).
-default_packages() ->
- [].
-%%% ['erl','erl.lang'].
-
-default_modules() ->
- [].
-%%% [{pdict, 'erl.lang.proc.pdict'},
-%%% {keylist, 'erl.lang.list.keylist'},
-%%% {debug, 'erl.system.debug'}].
-
-spec server(boolean(), boolean()) -> 'terminated'.
server(NoCtrlG, StartSync) ->
@@ -183,15 +173,7 @@ server(StartSync) ->
end
end,
%% Our spawner has fixed the process groups.
- Bs0 = erl_eval:new_bindings(),
- Bs = lists:foldl(fun ({K, V}, D) ->
- erl_eval:add_binding({module,K}, V, D)
- end,
- lists:foldl(fun (P, D) ->
- import_all(P, D)
- end,
- Bs0, default_packages()),
- default_modules()),
+ Bs = erl_eval:new_bindings(),
%% Use an Ets table for record definitions. It takes too long to
%% send a huge term to and from the evaluator. Ets makes it
@@ -1032,38 +1014,6 @@ local_func(which, [{atom,_,M}], Bs, _Shell, _RT, _Lf, _Ef) ->
end;
local_func(which, [_Other], _Bs, _Shell, _RT, _Lf, _Ef) ->
erlang:raise(error, function_clause, [{shell,which,1}]);
-local_func(import, [M], Bs, _Shell, _RT, _Lf, _Ef) ->
- case erl_parse:package_segments(M) of
- error -> erlang:raise(error, function_clause, [{shell,import,1}]);
- M1 ->
- Mod = packages:concat(M1),
- case packages:is_valid(Mod) of
- true ->
- Key = list_to_atom(packages:last(Mod)),
- Mod1 = list_to_atom(Mod),
- {value,ok,erl_eval:add_binding({module,Key}, Mod1, Bs)};
- false ->
- exit({{bad_module_name, Mod}, [{shell,import,1}]})
- end
- end;
-local_func(import_all, [P], Bs0, _Shell, _RT, _Lf, _Ef) ->
- case erl_parse:package_segments(P) of
- error -> erlang:raise(error, function_clause, [{shell,import_all,1}]);
- P1 ->
- Name = packages:concat(P1),
- case packages:is_valid(Name) of
- true ->
- Bs1 = import_all(Name, Bs0),
- {value,ok,Bs1};
- false ->
- exit({{bad_package_name, Name},
- [{shell,import_all,1}]})
- end
- end;
-local_func(use, [M], Bs, Shell, RT, Lf, Ef) ->
- local_func(import, [M], Bs, Shell, RT, Lf, Ef);
-local_func(use_all, [M], Bs, Shell, RT, Lf, Ef) ->
- local_func(import_all, [M], Bs, Shell, RT, Lf, Ef);
local_func(history, [{integer,_,N}], Bs, _Shell, _RT, _Lf, _Ef) ->
{value,history(N),Bs};
local_func(history, [_Other], _Bs, _Shell, _RT, _Lf, _Ef) ->
@@ -1343,15 +1293,6 @@ record_attrs(Forms) ->
%%% End of reading record information from file(s)
-import_all(P, Bs0) ->
- Ms = packages:find_modules(P),
- lists:foldl(fun (M, Bs) ->
- Key = list_to_atom(M),
- M1 = list_to_atom(packages:concat(P, M)),
- erl_eval:add_binding({module,Key}, M1, Bs)
- end,
- Bs0, Ms).
-
shell_req(Shell, Req) ->
Shell ! {shell_req,self(),Req},
receive
diff --git a/lib/stdlib/test/erl_expand_records_SUITE.erl b/lib/stdlib/test/erl_expand_records_SUITE.erl
index e248934e10..e51c05a22c 100644
--- a/lib/stdlib/test/erl_expand_records_SUITE.erl
+++ b/lib/stdlib/test/erl_expand_records_SUITE.erl
@@ -107,8 +107,7 @@ attributes(doc) ->
attributes(suite) -> [];
attributes(Config) when is_list(Config) ->
Ts = [
- <<"-import(erl_expand_records_SUITE).
- -import(lists, [append/2, reverse/1]).
+ <<"-import(lists, [append/2, reverse/1]).
-record(r, {a,b}).
@@ -158,12 +157,12 @@ expr(Config) when is_list(Config) ->
2 = fun(X) -> X end(One + One),
3 = fun exprec_test:f/1(3),
4 = exprec_test:f(4),
- 5 = ''.f(5),
+ 5 = f(5),
L = receive
{a,message,L0} ->
L0
end,
- case catch a.b.c:foo(bar) of
+ case catch a:foo(bar) of
{'EXIT', _} -> ok
end,
_ = receive %Suppress warning.
@@ -263,8 +262,7 @@ pattern(doc) ->
pattern(suite) -> [];
pattern(Config) when is_list(Config) ->
Ts = [
- <<"-import(erl_expand_records_SUITE).
- -import(lists, [append/2, reverse/1]).
+ <<"-import(lists, [append/2, reverse/1]).
-record(r, {a,b}).
@@ -292,10 +290,10 @@ pattern(Config) when is_list(Config) ->
21 = t(#r{a = #r{}}),
22 = t(2),
23 = t(#r{a = #r{}, b = b}),
- 24 = t(a.b.c),
+ 24 = t(abc),
ok.
- t(a.b.c) ->
+ t(abc) ->
24;
t($a) ->
2;
diff --git a/lib/stdlib/test/erl_lint_SUITE.erl b/lib/stdlib/test/erl_lint_SUITE.erl
index 90a37f6441..774229fca9 100644
--- a/lib/stdlib/test/erl_lint_SUITE.erl
+++ b/lib/stdlib/test/erl_lint_SUITE.erl
@@ -1732,7 +1732,7 @@ otp_5362(Config) when is_list(Config) ->
{otp_5362_2,
<<"-export([inline/0]).
- -import(lists.foo, [a/1,b/1]). % b/1 is not used
+ -import(lists, [a/1,b/1]). % b/1 is not used
-compile([{inline,{inl,7}}]). % undefined
-compile([{inline,[{inl,17}]}]). % undefined
@@ -1764,7 +1764,7 @@ otp_5362(Config) when is_list(Config) ->
{6,erl_lint,{bad_inline,{inl,17}}},
{11,erl_lint,{undefined_function,{fipp,0}}},
{22,erl_lint,{bad_nowarn_unused_function,{and_not_used,2}}}],
- [{3,erl_lint,{unused_import,{{b,1},'lists.foo'}}},
+ [{3,erl_lint,{unused_import,{{b,1},lists}}},
{9,erl_lint,{unused_function,{foop,0}}},
{19,erl_lint,{unused_function,{not_used,0}}},
{23,erl_lint,{unused_function,{and_not_used,1}}}]}},
diff --git a/lib/stdlib/test/erl_pp_SUITE.erl b/lib/stdlib/test/erl_pp_SUITE.erl
index 07303174f1..db416b03b0 100644
--- a/lib/stdlib/test/erl_pp_SUITE.erl
+++ b/lib/stdlib/test/erl_pp_SUITE.erl
@@ -40,7 +40,7 @@
init_per_testcase/2, end_per_testcase/2]).
-export([ func/1, call/1, recs/1, try_catch/1, if_then/1,
- receive_after/1, bits/1, head_tail/1, package/1,
+ receive_after/1, bits/1, head_tail/1,
cond1/1, block/1, case1/1, ops/1, messages/1,
old_mnemosyne_syntax/1,
import_export/1, misc_attrs/1,
@@ -75,7 +75,7 @@ all() ->
groups() ->
[{expr, [],
[func, call, recs, try_catch, if_then, receive_after,
- bits, head_tail, package, cond1, block, case1, ops,
+ bits, head_tail, cond1, block, case1, ops,
messages, old_mnemosyne_syntax]},
{attributes, [], [misc_attrs, import_export]},
{tickets, [],
@@ -439,9 +439,6 @@ bits(Config) when is_list(Config) ->
?line ok = pp_expr(<<"<<{a,b}/binary>>">>),
?line ok = pp_expr(<<"<<{foo:bar(),b}/binary>>">>),
?line ok = pp_expr(<<"<<(foo:bar()):(foo:bar())/binary>>">>),
- ?line ok = pp_expr(<<"<<(foo.bar)/binary>>">>),
- ?line ok = pp_expr(<<"<<(foo.bar):all/binary>>">>),
- ?line ok = pp_expr(<<"<<(foo.bar):(foo.bar)/binary>>">>),
ok.
head_tail(suite) ->
@@ -463,17 +460,6 @@ head_tail(Config) when is_list(Config) ->
?line compile(Config, Ts),
ok.
-package(suite) ->
- [];
-package(Config) when is_list(Config) ->
- Ts = [{package_1,
- <<"t() -> a.b:foo().">>},
- {package_2,
- <<"t() -> .lists:sort([]).">>}
- ],
- ?line compile(Config, Ts),
- ok.
-
cond1(suite) ->
[];
cond1(Config) when is_list(Config) ->
@@ -615,13 +601,11 @@ misc_attrs(suite) ->
[];
misc_attrs(Config) when is_list(Config) ->
?line ok = pp_forms(<<"-module(m). ">>),
- ?line ok = pp_forms(<<"-module(m.p, [A,B]). ">>),
?line ok = pp_forms(<<"-module(m, [Aafjlksfjdlsjflsdfjlsdjflkdsfjlk,"
"Blsjfdlslfjsdf]). ">>),
?line ok = pp_forms(<<"-export([]). ">>),
?line ok = pp_forms(<<"-export([foo/2, bar/0]). ">>),
?line ok = pp_forms(<<"-export([bar/0]). ">>),
- ?line ok = pp_forms(<<"-import(.lists). ">>),
?line ok = pp_forms(<<"-import(lists, []). ">>),
?line ok = pp_forms(<<"-import(lists, [map/2]). ">>),
?line ok = pp_forms(<<"-import(lists, [map/2, foreach/2]). ">>),
diff --git a/lib/stdlib/test/qlc_SUITE.erl b/lib/stdlib/test/qlc_SUITE.erl
index e3090e4a47..cac8309bd9 100644
--- a/lib/stdlib/test/qlc_SUITE.erl
+++ b/lib/stdlib/test/qlc_SUITE.erl
@@ -6062,21 +6062,6 @@ otp_6673(Config) when is_list(Config) ->
],
?line run(Config, Ts_RT),
- %% Ulf Wiger provided a patch that makes QLC work with packages:
- Dir = filename:join(?privdir, "p"),
- ?line ok = filelib:ensure_dir(filename:join(Dir, ".")),
- File = filename:join(Dir, "p.erl"),
- ?line ok = file:write_file(File,
- <<"-module(p.p).\n"
- "-export([q/0]).\n"
- "-include_lib(\"stdlib/include/qlc.hrl\").\n"
- "q() ->\n"
- " .qlc:q([X || X <- [1,2]]).">>),
- ?line {ok, 'p.p'} = compile:file(File, [{outdir,Dir}]),
- ?line code:purge('p.p'),
- ?line {module, 'p.p'} = code:load_abs(filename:rootname(File), 'p.p'),
- ?line [1,2] = qlc:e(p.p:q()),
-
ok.
otp_6964(doc) ->
diff --git a/lib/syntax_tools/src/erl_prettypr.erl b/lib/syntax_tools/src/erl_prettypr.erl
index 577dd21a77..1a55a5e71c 100644
--- a/lib/syntax_tools/src/erl_prettypr.erl
+++ b/lib/syntax_tools/src/erl_prettypr.erl
@@ -645,10 +645,6 @@ lay_2(Node, Ctxt) ->
set_prec(Ctxt, PrecR)),
beside(D1, beside(text(":"), D2));
- qualified_name ->
- Ss = erl_syntax:qualified_name_segments(Node),
- lay_qualified_name(Ss, Ctxt);
-
%%
%% The rest is in alphabetical order
%%
@@ -972,26 +968,6 @@ maybe_parentheses(D, Prec, Ctxt) ->
D
end.
-lay_qualified_name([S | Ss1] = Ss, Ctxt) ->
- case erl_syntax:type(S) of
- atom ->
- case erl_syntax:atom_value(S) of
- '' ->
- beside(text("."),
- lay_qualified_name_1(Ss1, Ctxt));
- _ ->
- lay_qualified_name_1(Ss, Ctxt)
- end;
- _ ->
- lay_qualified_name_1(Ss, Ctxt)
- end.
-
-lay_qualified_name_1([S], Ctxt) ->
- lay(S, Ctxt);
-lay_qualified_name_1([S | Ss], Ctxt) ->
- beside(lay(S, Ctxt), beside(text("."),
- lay_qualified_name_1(Ss, Ctxt))).
-
lay_string(S, Ctxt) ->
%% S includes leading/trailing double-quote characters. The segment
%% width is 2/3 of the ribbon width - this seems to work well.
diff --git a/lib/syntax_tools/src/erl_syntax.erl b/lib/syntax_tools/src/erl_syntax.erl
index 93b9dc54dd..f7420030c3 100644
--- a/lib/syntax_tools/src/erl_syntax.erl
+++ b/lib/syntax_tools/src/erl_syntax.erl
@@ -235,8 +235,6 @@
prefix_expr/2,
prefix_expr_argument/1,
prefix_expr_operator/1,
- qualified_name/1,
- qualified_name_segments/1,
query_expr/1,
query_expr_body/1,
receive_expr/1,
@@ -451,7 +449,6 @@
%% <td>parentheses</td>
%% <td>prefix_expr</td>
%% </tr><tr>
-%% <td>qualified_name</td>
%% <td>query_expr</td>
%% <td>receive_expr</td>
%% <td>record_access</td>
@@ -516,7 +513,6 @@
%% @see operator/1
%% @see parentheses/1
%% @see prefix_expr/2
-%% @see qualified_name/1
%% @see query_expr/1
%% @see receive_expr/3
%% @see record_access/3
@@ -586,11 +582,7 @@ type(Node) ->
{record, _, _, _, _} -> record_expr;
{record, _, _, _} -> record_expr;
{record_field, _, _, _, _} -> record_access;
- {record_field, _, _, _} ->
- case is_qualified_name(Node) of
- true -> qualified_name;
- false -> record_access
- end;
+ {record_field, _, _, _} -> record_access;
{record_index, _, _, _} -> record_index_expr;
{remote, _, _, _} -> module_qualifier;
{rule, _, _, _, _} -> rule;
@@ -3047,9 +3039,6 @@ revert_module_name(A) ->
case type(A) of
atom ->
{ok, concrete(A)};
- qualified_name ->
- Ss = qualified_name_segments(A),
- {ok, [concrete(S) || S <- Ss]};
_ ->
error
end.
@@ -3095,11 +3084,7 @@ attribute_arguments(Node) ->
M0 ->
{M0, none}
end,
- M2 = if is_list(M1) ->
- qualified_name([atom(A) || A <- M1]);
- true ->
- atom(M1)
- end,
+ M2 = atom(M1),
M = set_pos(M2, Pos),
if Vs == none -> [M];
true -> [M, set_pos(list(Vs), Pos)]
@@ -3109,20 +3094,11 @@ attribute_arguments(Node) ->
list(unfold_function_names(Data, Pos)),
Pos)];
import ->
- case Data of
- {Module, Imports} ->
- [if is_list(Module) ->
- qualified_name([atom(A)
- || A <- Module]);
- true ->
- set_pos(atom(Module), Pos)
- end,
- set_pos(
- list(unfold_function_names(Imports, Pos)),
- Pos)];
- _ ->
- [qualified_name([atom(A) || A <- Data])]
- end;
+ {Module, Imports} = Data,
+ [set_pos(atom(Module), Pos),
+ set_pos(
+ list(unfold_function_names(Imports, Pos)),
+ Pos)];
file ->
{File, Line} = Data,
[set_pos(string(File), Pos),
@@ -3254,53 +3230,6 @@ module_qualifier_body(Node) ->
%% =====================================================================
-%% @doc Creates an abstract qualified name. The result represents
-%% "<code><em>S1</em>.<em>S2</em>. ... .<em>Sn</em></code>", if
-%% `Segments' is `[S1, S2, ..., Sn]'.
-%%
-%% @see qualified_name_segments/1
-
-%% type(Node) = qualified_name
-%% data(Node) = [syntaxTree()]
-%%
-%% `erl_parse' representation:
-%%
-%% {record_field, Pos, Node, Node}
-%%
-%% Node = {atom, Pos, Value} | {record_field, Pos, Node, Node}
-%%
-%% Note that if not all leaf subnodes are (abstract) atoms, then Node
-%% represents a Mnemosyne query record field access ('record_access');
-%% see type/1 for details.
-
--spec qualified_name([syntaxTree()]) -> syntaxTree().
-
-qualified_name(Segments) ->
- tree(qualified_name, Segments).
-
-revert_qualified_name(Node) ->
- Pos = get_pos(Node),
- fold_qualified_name(qualified_name_segments(Node), Pos).
-
-
-%% =====================================================================
-%% @doc Returns the list of name segments of a
-%% `qualified_name' node.
-%%
-%% @see qualified_name/1
-
--spec qualified_name_segments(syntaxTree()) -> [syntaxTree()].
-
-qualified_name_segments(Node) ->
- case unwrap(Node) of
- {record_field, _, _, _} = Node1 ->
- unfold_qualified_name(Node1);
- Node1 ->
- data(Node1)
- end.
-
-
-%% =====================================================================
%% @doc Creates an abstract function definition. If `Clauses'
%% is `[C1, ..., Cn]', the result represents
%% "<code><em>Name</em> <em>C1</em>; ...; <em>Name</em>
@@ -6112,8 +6041,6 @@ revert_root(Node) ->
revert_parentheses(Node);
prefix_expr ->
revert_prefix_expr(Node);
- qualified_name ->
- revert_qualified_name(Node);
query_expr ->
revert_query_expr(Node);
receive_expr ->
@@ -6356,8 +6283,6 @@ subtrees(T) ->
prefix_expr ->
[[prefix_expr_operator(T)],
[prefix_expr_argument(T)]];
- qualified_name ->
- [qualified_name_segments(T)];
query_expr ->
[[query_expr_body(T)]];
receive_expr ->
@@ -6488,7 +6413,6 @@ make_tree(match_expr, [[P], [E]]) -> match_expr(P, E);
make_tree(module_qualifier, [[M], [N]]) -> module_qualifier(M, N);
make_tree(parentheses, [[E]]) -> parentheses(E);
make_tree(prefix_expr, [[F], [A]]) -> prefix_expr(F, A);
-make_tree(qualified_name, [S]) -> qualified_name(S);
make_tree(query_expr, [[B]]) -> query_expr(B);
make_tree(receive_expr, [C]) -> receive_expr(C);
make_tree(receive_expr, [C, [E], A]) -> receive_expr(C, E, A);
@@ -6832,32 +6756,6 @@ fold_variable_names(Vs) ->
unfold_variable_names(Vs, Pos) ->
[set_pos(variable(V), Pos) || V <- Vs].
-%% Support functions for qualified names ("foo.bar.baz",
-%% "erl.lang.lists", etc.). The representation overlaps with the weird
-%% "Mnesia query record access" operators. The '.' operator is left
-%% associative, so folding should nest on the left.
-
-is_qualified_name({record_field, _, L, R}) ->
- is_qualified_name(L) andalso is_qualified_name(R);
-is_qualified_name({atom, _, _}) -> true;
-is_qualified_name(_) -> false.
-
-unfold_qualified_name(Node) ->
- lists:reverse(unfold_qualified_name(Node, [])).
-
-unfold_qualified_name({record_field, _, L, R}, Ss) ->
- unfold_qualified_name(R, unfold_qualified_name(L, Ss));
-unfold_qualified_name(S, Ss) -> [S | Ss].
-
-fold_qualified_name([S | Ss], Pos) ->
- fold_qualified_name(Ss, Pos, {atom, Pos, atom_value(S)}).
-
-fold_qualified_name([S | Ss], Pos, Ack) ->
- fold_qualified_name(Ss, Pos, {record_field, Pos, Ack,
- {atom, Pos, atom_value(S)}});
-fold_qualified_name([], _Pos, Ack) ->
- Ack.
-
%% Support functions for transforming lists of record field definitions.
%%
%% There is no unique representation for field definitions in the
diff --git a/lib/syntax_tools/src/erl_syntax_lib.erl b/lib/syntax_tools/src/erl_syntax_lib.erl
index 36cd35f15d..2c94ac776d 100644
--- a/lib/syntax_tools/src/erl_syntax_lib.erl
+++ b/lib/syntax_tools/src/erl_syntax_lib.erl
@@ -2223,11 +2223,6 @@ module_name_to_atom(M) ->
case erl_syntax:type(M) of
atom ->
erl_syntax:atom_value(M);
- qualified_name ->
- list_to_atom(packages:concat(
- [erl_syntax:atom_value(A)
- || A <- erl_syntax:qualified_name_segments(M)])
- );
_ ->
throw(syntax_error)
end.
diff --git a/lib/test_server/doc/src/test_server_ctrl.xml b/lib/test_server/doc/src/test_server_ctrl.xml
index 41bc0bcc75..af96f1fe7e 100644
--- a/lib/test_server/doc/src/test_server_ctrl.xml
+++ b/lib/test_server/doc/src/test_server_ctrl.xml
@@ -427,11 +427,21 @@ Optional, if not given the test server controller node
<p>A <c>CoverFile</c> can have the following entries:</p>
<code type="none">
{exclude, all | ExcludeModuleList}.
-{include, IncludeModuleList}. </code>
+{include, IncludeModuleList}.
+{cross, CrossCoverInfo}.</code>
<p>Note that each line must end with a full
stop. <c>ExcludeModuleList</c> and <c>IncludeModuleList</c>
are lists of atoms, where each atom is a module name.
</p>
+
+ <p><c>CrossCoverInfo</c> is used when collecting cover data
+ over multiple tests. Modules listed here are compiled, but
+ they will not be analysed when the test is finished. See
+ <seealso
+ marker="#cross_cover_analyse-2">cross_cover_analyse/2</seealso>
+ for more information about the cross cover mechanism and the
+ format of <c>CrossCoverInfo</c>.
+ </p>
<p>If both an <c>Application</c> and a <c>CoverFile</c> is
given, all modules in the application are cover compiled,
except for the modules listed in <c>ExcludeModuleList</c>. The
@@ -467,30 +477,71 @@ Optional, if not given the test server controller node
</desc>
</func>
<func>
- <name>cross_cover_analyse(Level) -> ok</name>
- <fsummary>Analyse cover data collected from all tests</fsummary>
+ <name>cross_cover_analyse(Level, Tests) -> ok</name>
+ <fsummary>Analyse cover data collected from multiple tests</fsummary>
<type>
<v>Level = details | overview</v>
+ <v>Tests = [{Tag,LogDir}]</v>
+ <v>Tag = atom()</v>
+ <d>Test identifier.</d>
+ <v>LogDir = string()</v>
+ <d>Log directory for the test identified by <c>Tag</c>. This
+ can either be the <c>run.&lt;timestamp&gt;</c> directory or
+ the parent directory of this (in which case the latest
+ <c>run.&lt;timestamp&gt;</c> directory is chosen.</d>
</type>
<desc>
- <p>Analyse cover data collected from all tests. The modules
- analysed are the ones listed in the cross cover file
- <c>cross.cover</c> in the current directory of the test
- server.</p>
- <p>The modules listed in the <c>cross.cover</c> file are
- modules that are heavily used by other applications than the
- one they belong to. This function should be run after all
- tests are completed, and the result will be stored in a file
- called cross_cover.html in the run.&lt;timestamp&gt;
- directory of the application the modules belong to.
- </p>
- <p>The <c>cross.cover</c> file contains elements like this:</p>
- <pre>
-{App,Modules}. </pre>
- <p>where <c>App</c> can be an application name or the atom
- <c>all</c>. The application (or all applications) will cover
- compile the listed <c>Modules</c>.
- </p>
+ <p>Analyse cover data collected from multiple tests. The modules
+ analysed are the ones listed in <c>cross</c> statements in
+ the cover files. These are modules that are heavily used by
+ other tests than the one where they belong or are explicitly
+ tested. They should then be listed as cross modules in the
+ cover file for the test where they are used but do not
+ belong. Se example below.</p>
+ <p>This function should be run after all tests are completed,
+ and the result will be stored in a file called
+ <c>cross_cover.html</c> in the <c>run.&lt;timestamp&gt;</c>
+ directory of the test the modules belong to.</p>
+ <p>Note that the function can be executed on any node, and it
+ does not require <c>test_server_ctrl</c> to be started first.</p>
+ <p>The <c>cross</c> statement in the cover file must be like this:</p>
+ <code type="none">
+{cross,[{Tag,Modules}]}.</code>
+ <p>where <c>Tag</c> is the same as <c>Tag</c> in the
+ <c>Tests</c> parameter to this function and <c>Modules</c> is a
+ list of module names (atoms).</p>
+ <p><em>Example:</em></p>
+ <p>If the module <c>m1</c> belongs to system <c>s1</c> but is
+ heavily used also in the tests for another system <c>s2</c>,
+ then the cover files for the two systems' tests could be like
+ this:</p>
+<code type="none">
+s1.cover:
+ {include,[m1]}.
+
+s2.cover:
+ {include,[....]}. % modules belonging to system s2
+ {cross,[{s1,[m1]}]}.</code>
+ <p>When the tests for both <c>s1</c> and <c>s2</c> are completed, run</p>
+<code type="none">
+test_server_ctrl:cross_cover_analyse(Level,[{s1,S1LogDir},{s2,S2LogDir}])
+</code>
+
+ <p>and the accumulated cover data for <c>m1</c> will be written to
+ <c>S1LogDir/[run.&lt;timestamp&gt;/]cross_cover.html</c>.</p>
+ <p>Note that the <c>m1</c> module will also be presented in the
+ normal coverage log for <c>s1</c> (due to the include statement in
+ <c>s1.cover</c>), but that only includes the coverage achieved by the
+ <c>s1</c> test itself.</p>
+ <p>The Tag in the <c>cross</c> statement in the cover file has
+ no other purpose than mapping the list of modules
+ (<c>[m1]</c> in the example above) to the correct log
+ directory where it should be included in the
+ <c>cross_cover.html</c> file (<c>S1LogDir</c> in the example
+ above). I.e. the value of <c>Tag</c> has no meaning, it
+ could be <c>foo</c> as well as <c>s1</c> above, as long as
+ the same <c>Tag</c> is used in the cover file and in the
+ call to this function.</p>
</desc>
</func>
<func>
diff --git a/lib/test_server/doc/src/ts.xml b/lib/test_server/doc/src/ts.xml
index 4a2c536e96..82ba3a5017 100644
--- a/lib/test_server/doc/src/ts.xml
+++ b/lib/test_server/doc/src/ts.xml
@@ -5,7 +5,7 @@
<header>
<copyright>
<year>2007</year>
- <year>2011</year>
+ <year>2012</year>
<holder>Ericsson AB, All Rights Reserved</holder>
</copyright>
<legalnotice>
@@ -450,7 +450,7 @@ This option is mandatory for remote targets
<desc>
<p>Analyse cover data collected from all tests.
</p>
- <p>See test_server_ctrl:cross_cover_analyse/1
+ <p>See test_server_ctrl:cross_cover_analyse/2
</p>
</desc>
</func>
diff --git a/lib/test_server/src/Makefile b/lib/test_server/src/Makefile
index 20e7a5942c..3261936472 100644
--- a/lib/test_server/src/Makefile
+++ b/lib/test_server/src/Makefile
@@ -69,7 +69,6 @@ INTERNAL_HRL_FILES = test_server_internal.hrl
TS_HRL_FILES= ts.hrl
C_FILES =
AUTOCONF_FILES = configure.in conf_vars.in
-COVER_FILES = cross.cover
PROGRAMS = configure config.sub config.guess install-sh
CONFIG = ts.config ts.unix.config ts.win32.config
@@ -137,7 +136,7 @@ release_tests_spec: opt
$(INSTALL_DATA) $(ERL_FILES) $(TS_ERL_FILES) \
$(HRL_FILES) $(INTERNAL_HRL_FILES) $(TS_HRL_FILES) \
$(TS_TARGET_FILES) \
- $(AUTOCONF_FILES) $(C_FILES) $(COVER_FILES) $(CONFIG) \
+ $(AUTOCONF_FILES) $(C_FILES) $(CONFIG) \
"$(RELEASE_PATH)/test_server"
$(INSTALL_SCRIPT) $(PROGRAMS) "$(RELEASE_PATH)/test_server"
diff --git a/lib/test_server/src/test_server.erl b/lib/test_server/src/test_server.erl
index 9f06ac450b..37cd8fac99 100644
--- a/lib/test_server/src/test_server.erl
+++ b/lib/test_server/src/test_server.erl
@@ -60,8 +60,6 @@
-include("test_server_internal.hrl").
-include_lib("kernel/include/file.hrl").
--define(pl2a(M), test_server_sup:package_atom(M)).
-
init_target_info() ->
[$.|Emu] = code:objfile_extension(),
{_, OTPRel} = init:script_id(),
@@ -97,7 +95,8 @@ init_purify() ->
%% is found, else {error,application_not_found}.
cover_compile({none,_Exclude,Include,Cross}) ->
- CompileMods = Include++Cross,
+ CrossMods = lists:flatmap(fun({_,M}) -> M end,Cross),
+ CompileMods = Include++CrossMods,
case length(CompileMods) of
0 ->
io:fwrite("WARNING: No modules to cover compile!\n\n",[]),
@@ -111,7 +110,8 @@ cover_compile({none,_Exclude,Include,Cross}) ->
{ok,Include}
end;
cover_compile({App,all,Include,Cross}) ->
- CompileMods = Include++Cross,
+ CrossMods = lists:flatmap(fun({_,M}) -> M end,Cross),
+ CompileMods = Include++CrossMods,
case length(CompileMods) of
0 ->
io:fwrite("WARNING: No modules to cover compile!\n\n",[]),
@@ -129,9 +129,10 @@ cover_compile({App,all,Include,Cross}) ->
{ok,Include}
end;
cover_compile({App,Exclude,Include,Cross}) ->
+ CrossMods = lists:flatmap(fun({_,M}) -> M end,Cross),
case code:lib_dir(App) of
{error,bad_name} ->
- case Include++Cross of
+ case Include++CrossMods of
[] ->
io:format("\nWARNING: Can't find lib_dir for \'~w\'\n"
"Not cover compiling!\n\n",[App]),
@@ -152,7 +153,7 @@ cover_compile({App,Exclude,Include,Cross}) ->
WC = filename:join(EbinDir,"*.beam"),
AllMods = module_names(filelib:wildcard(WC)),
AnalyseMods = (AllMods ++ Include) -- Exclude,
- CompileMods = AnalyseMods ++ Cross,
+ CompileMods = AnalyseMods ++ CrossMods,
case length(CompileMods) of
0 ->
io:fwrite("WARNING: No modules to cover compile!\n\n",[]),
@@ -918,7 +919,7 @@ run_test_case_eval(Mod, Func, Args0, Name, Ref, RunInit,
put(test_server_logopts, LogOpts),
Where = [{Mod,Func}],
put(test_server_loc, Where),
- FWInitResult = test_server_sup:framework_call(init_tc,[?pl2a(Mod),Func,Args0],
+ FWInitResult = test_server_sup:framework_call(init_tc,[Mod,Func,Args0],
{ok,Args0}),
set_tc_state(running),
{{Time,Value},Loc,Opts} =
@@ -1052,7 +1053,7 @@ do_end_tc_call(Mod, Func, Res, Return) ->
Ref = make_ref(),
if FwMod == "ct_framework" ; FwMod == "undefined"; FwMod == false ->
case test_server_sup:framework_call(
- end_tc, [?pl2a(Mod),Func,Res, Return], ok) of
+ end_tc, [Mod,Func,Res, Return], ok) of
{fail,FWReason} ->
{failed,FWReason};
ok ->
@@ -1067,7 +1068,7 @@ do_end_tc_call(Mod, Func, Res, Return) ->
end;
true ->
case test_server_sup:framework_call(FwMod, end_tc,
- [?pl2a(Mod),Func,Res], Ref) of
+ [Mod,Func,Res], Ref) of
{fail,FWReason} ->
{failed,FWReason};
_Else ->
@@ -1301,11 +1302,11 @@ get_loc(Pid) ->
fw_error_notify(Mod, Func, Args, Error) ->
test_server_sup:framework_call(error_notification,
- [?pl2a(Mod),Func,[Args],
+ [Mod,Func,[Args],
{Error,unknown}]).
fw_error_notify(Mod, Func, Args, Error, Loc) ->
test_server_sup:framework_call(error_notification,
- [?pl2a(Mod),Func,[Args],
+ [Mod,Func,[Args],
{Error,Loc}]).
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/test_server/src/test_server_ctrl.erl b/lib/test_server/src/test_server_ctrl.erl
index bc08c12089..c5c57426b4 100644
--- a/lib/test_server/src/test_server_ctrl.erl
+++ b/lib/test_server/src/test_server_ctrl.erl
@@ -53,8 +53,7 @@
-export([reject_io_reqs/1, get_levels/0, set_levels/3]).
-export([multiply_timetraps/1, scale_timetraps/1, get_timetrap_parameters/0]).
-export([create_priv_dir/1]).
--export([cover/2, cover/3, cover/8,
- cross_cover_analyse/2, cross_cover_analyse/3, trc/1, stop_trace/0]).
+-export([cover/2, cover/3, cover/8, cross_cover_analyse/2, trc/1, stop_trace/0]).
-export([testcase_callback/1]).
-export([set_random_seed/1]).
-export([kill_slavenodes/0]).
@@ -88,17 +87,18 @@
-define(data_dir_suffix, "_data/").
-define(suitelog_name, "suite.log").
-define(coverlog_name, "cover.html").
+-define(raw_coverlog_name, "cover.log").
-define(cross_coverlog_name, "cross_cover.html").
+-define(raw_cross_coverlog_name, "cross_cover.log").
+-define(cross_cover_info, "cross_cover.info").
-define(cover_total, "total_cover.log").
-define(unexpected_io_log, "unexpected_io.log").
-define(last_file, "last_name").
-define(last_link, "last_link").
-define(last_test, "last_test").
-define(html_ext, ".html").
--define(cross_cover_file, "cross.cover").
-define(now, erlang:now()).
--define(pl2a(M), test_server_sup:package_atom(M)).
-define(void_fun, fun() -> ok end).
-define(mod_result(X), if X == skip -> skipped;
X == auto_skip -> skipped;
@@ -409,7 +409,9 @@ cover(CoverFile, Analyse) ->
cover(App, CoverFile, Analyse) ->
controller_call({cover,{App,CoverFile},Analyse,true}).
cover(App, CoverFile, Exclude, Include, Cross, Export, Analyse, Stop) ->
- controller_call({cover,{App,{CoverFile,Exclude,Include,Cross,Export}},Analyse,Stop}).
+ controller_call({cover,
+ {App,{CoverFile,Exclude,Include,Cross,Export}},
+ Analyse,Stop}).
testcase_callback(ModFunc) ->
controller_call({testcase_callback,ModFunc}).
@@ -2277,7 +2279,7 @@ run_test_cases_loop([{auto_skip_case,{Type,Ref,Case,Comment},SkipMode}|Cases],
set_io_buffering(undefined),
{Mod,Func} = skip_case(auto, Ref, 0, Case, Comment, false, SkipMode),
test_server_sup:framework_call(report, [tc_auto_skip,
- {?pl2a(Mod),Func,Comment}]),
+ {Mod,Func,Comment}]),
run_test_cases_loop(Cases, Config, TimetrapData, ParentMode,
delete_status(Ref, Status));
_ ->
@@ -2286,7 +2288,7 @@ run_test_cases_loop([{auto_skip_case,{Type,Ref,Case,Comment},SkipMode}|Cases],
wait_for_cases(Ref),
{Mod,Func} = skip_case(auto, Ref, 0, Case, Comment, true, SkipMode),
test_server_sup:framework_call(report, [tc_auto_skip,
- {?pl2a(Mod),Func,Comment}]),
+ {Mod,Func,Comment}]),
case CurrIOHandler of
{Ref,_} ->
%% current_io_handler was set by start conf of this
@@ -2303,7 +2305,7 @@ run_test_cases_loop([{auto_skip_case,{Type,Ref,Case,Comment},SkipMode}|Cases],
%% this is a skipped end conf for a non-parallel group that's not
%% nested under a parallel group
{Mod,Func} = skip_case(auto, Ref, 0, Case, Comment, false, SkipMode),
- test_server_sup:framework_call(report, [tc_auto_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_auto_skip,{Mod,Func,Comment}]),
%% Check if this group is auto skipped because of error in the init conf.
%% If so, check if the parent group is a sequence, and if it is, skip
@@ -2334,7 +2336,7 @@ run_test_cases_loop([{auto_skip_case,{Type,Ref,Case,Comment},SkipMode}|Cases],
%% this is a skipped end conf for a non-parallel group nested under
%% a parallel group (io buffering is active)
{Mod,Func} = skip_case(auto, Ref, 0, Case, Comment, true, SkipMode),
- test_server_sup:framework_call(report, [tc_auto_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_auto_skip,{Mod,Func,Comment}]),
case CurrIOHandler of
{Ref,_} ->
%% current_io_handler was set by start conf of this
@@ -2350,7 +2352,7 @@ run_test_cases_loop([{auto_skip_case,{Type,Ref,Case,Comment},SkipMode}|Cases],
%% this is a skipped start conf for a group which is not nested
%% under a parallel group
{Mod,Func} = skip_case(auto, Ref, 0, Case, Comment, false, SkipMode),
- test_server_sup:framework_call(report, [tc_auto_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_auto_skip,{Mod,Func,Comment}]),
run_test_cases_loop(Cases, Config, TimetrapData, [conf(Ref,[])|Mode], Status);
{_,Ref0} when is_reference(Ref0) ->
%% this is a skipped start conf for a group nested under a parallel group
@@ -2361,7 +2363,7 @@ run_test_cases_loop([{auto_skip_case,{Type,Ref,Case,Comment},SkipMode}|Cases],
ok
end,
{Mod,Func} = skip_case(auto, Ref, 0, Case, Comment, true, SkipMode),
- test_server_sup:framework_call(report, [tc_auto_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_auto_skip,{Mod,Func,Comment}]),
run_test_cases_loop(Cases, Config, TimetrapData, [conf(Ref,[])|Mode], Status)
end;
@@ -2369,7 +2371,7 @@ run_test_cases_loop([{auto_skip_case,{Case,Comment},SkipMode}|Cases],
Config, TimetrapData, Mode, Status) ->
{Mod,Func} = skip_case(auto, undefined, get(test_server_case_num)+1,
Case, Comment, is_io_buffered(), SkipMode),
- test_server_sup:framework_call(report, [tc_auto_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_auto_skip,{Mod,Func,Comment}]),
run_test_cases_loop(Cases, Config, TimetrapData, Mode,
update_status(skipped, Mod, Func, Status));
@@ -2385,7 +2387,7 @@ run_test_cases_loop([{skip_case,{conf,Ref,Case,Comment}}|Cases0],
%% skipped start conf
{skip_cases_upto(Ref, Cases0, Comment, conf, Mode),Config}
end,
- test_server_sup:framework_call(report, [tc_user_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_user_skip,{Mod,Func,Comment}]),
run_test_cases_loop(Cases, Config1, TimetrapData, Mode,
update_status(skipped, Mod, Func, Status));
@@ -2393,7 +2395,7 @@ run_test_cases_loop([{skip_case,{Case,Comment}}|Cases],
Config, TimetrapData, Mode, Status) ->
{Mod,Func} = skip_case(user, undefined, get(test_server_case_num)+1,
Case, Comment, is_io_buffered()),
- test_server_sup:framework_call(report, [tc_user_skip,{?pl2a(Mod),Func,Comment}]),
+ test_server_sup:framework_call(report, [tc_user_skip,{Mod,Func,Comment}]),
run_test_cases_loop(Cases, Config, TimetrapData, Mode,
update_status(skipped, Mod, Func, Status));
@@ -3571,7 +3573,7 @@ run_test_case1(Ref, Num, Mod, Func, Args, RunInit,
end,
test_server_sup:framework_call(report,
- [tc_start,{{?pl2a(Mod),Func},MinorName}]),
+ [tc_start,{{Mod,Func},MinorName}]),
print_props((RunInit==skip_init), get_props(Mode)),
GroupName = case get_name(Mode) of
@@ -3756,7 +3758,7 @@ progress(skip, CaseNum, Mod, Func, Loc, Reason, Time,
print(major, "=result skipped", []),
print(1, "*** SKIPPED *** ~s",
[get_info_str(Func, CaseNum, get(test_server_cases))]),
- test_server_sup:framework_call(report, [tc_done,{?pl2a(Mod),Func,
+ test_server_sup:framework_call(report, [tc_done,{Mod,Func,
{skipped,Reason1}}]),
ReasonStr = reason_to_string(Reason1),
ReasonStr1 = lists:flatten([string:strip(S,left) ||
@@ -3787,7 +3789,7 @@ progress(failed, CaseNum, Mod, Func, Loc, timetrap_timeout, T,
print(1, "*** FAILED *** ~s",
[get_info_str(Func, CaseNum, get(test_server_cases))]),
test_server_sup:framework_call(report,
- [tc_done,{?pl2a(Mod),Func,
+ [tc_done,{Mod,Func,
{failed,timetrap_timeout}}]),
FormatLastLoc = test_server_sup:format_loc(get_last_loc(Loc)),
ErrorReason = io_lib:format("{timetrap_timeout,~s}", [FormatLastLoc]),
@@ -3813,7 +3815,7 @@ progress(failed, CaseNum, Mod, Func, Loc, {testcase_aborted,Reason}, _T,
print(1, "*** FAILED *** ~s",
[get_info_str(Func, CaseNum, get(test_server_cases))]),
test_server_sup:framework_call(report,
- [tc_done,{?pl2a(Mod),Func,
+ [tc_done,{Mod,Func,
{failed,testcase_aborted}}]),
FormatLastLoc = test_server_sup:format_loc(get_last_loc(Loc)),
ErrorReason = io_lib:format("{testcase_aborted,~s}", [FormatLastLoc]),
@@ -3838,7 +3840,7 @@ progress(failed, CaseNum, Mod, Func, unknown, Reason, Time,
print(major, "=result failed: ~p, ~p", [Reason,unknown]),
print(1, "*** FAILED *** ~s",
[get_info_str(Func, CaseNum, get(test_server_cases))]),
- test_server_sup:framework_call(report, [tc_done,{?pl2a(Mod),Func,
+ test_server_sup:framework_call(report, [tc_done,{Mod,Func,
{failed,Reason}}]),
TimeStr = io_lib:format(if is_float(Time) -> "~.3fs";
true -> "~w"
@@ -3874,7 +3876,7 @@ progress(failed, CaseNum, Mod, Func, Loc, Reason, Time,
print(major, "=result failed: ~p, ~p", [Reason,Loc]),
print(1, "*** FAILED *** ~s",
[get_info_str(Func, CaseNum, get(test_server_cases))]),
- test_server_sup:framework_call(report, [tc_done,{?pl2a(Mod),Func,
+ test_server_sup:framework_call(report, [tc_done,{Mod,Func,
{failed,Reason}}]),
TimeStr = io_lib:format(if is_float(Time) -> "~.3fs";
true -> "~w"
@@ -3899,7 +3901,7 @@ progress(failed, CaseNum, Mod, Func, Loc, Reason, Time,
progress(ok, _CaseNum, Mod, Func, _Loc, RetVal, Time,
Comment0, {St0,St1}) ->
print(minor, "successfully completed test case", []),
- test_server_sup:framework_call(report, [tc_done,{?pl2a(Mod),Func,ok}]),
+ test_server_sup:framework_call(report, [tc_done,{Mod,Func,ok}]),
Comment =
case RetVal of
{comment,RetComment} ->
@@ -4546,7 +4548,7 @@ collect_case_invoke(Mod, Case, MFA, St) ->
end;
_ ->
Suite = test_server_sup:framework_call(get_suite,
- [?pl2a(Mod),Case],
+ [Mod,Case],
[]),
collect_subcases(Mod, Case, MFA, St, Suite)
end.
@@ -4898,33 +4900,52 @@ pinfo(P) ->
%% - it does not belong to the application, but is listed in the
%% {include,List} part of the App.cover file
%% - it does not belong to the application, but is listed in the
-%% cross.cover file (in the test_server application) under 'all'
-%% or under the tested application.
-%%
-%% The modules listed in the cross.cover file are modules that are
-%% hevily used by other applications than the one they belong
-%% to. After all tests are completed, these modules can be analysed
-%% with coverage data from all tests - see cross_cover_analyse/1. The
-%% result is stored in a file called cross_cover.html in the
-%% run.<timestamp> directory of the application the modules belong
-%% to.
-%%
-%% For example, the lists module is listed in cross.cover to be
-%% included in all tests. lists belongs to the stdlib
-%% application. cross_cover_analyse/1 will create a file named
-%% cross_cover.html under the newest stdlib.logs/run.xxx directory,
-%% where the coverage result for the lists module from all tests is
-%% presented.
-%%
-%% The lists module is also presented in the normal coverage log
-%% for stdlib, but that only includes the coverage achieved by
-%% the stdlib tests themselves.
-%%
-%% The Cross cover file cross.cover contains elements like this:
-%% {App,Modules}.
-%% where App can be an application name or the atom all. The
-%% application (or all applications) shall cover compile the listed
-%% Modules.
+%% {cross,[{Tag,List}]} part of the App.cover file
+%%
+%% The modules listed in the 'cross' part of the cover file are
+%% modules that are heavily used by other tests than the one where
+%% they are explicitly tested. They should then be listed as 'cross'
+%% in the cover file for the test where they are used but do not
+%% belong.
+%%
+%% After all tests are completed, the these modules can be analysed
+%% with coverage data from all tests where they are compiled - see
+%% cross_cover_analyse/2. The result is stored in a file called
+%% cross_cover.html in the run.<timestamp> directory of the
+%% test the modules belong to.
+%%
+%% Example:
+%% If the module m1 belongs to system s1 but is heavily used also in
+%% the tests for another system s2, then the cover files for the two
+%% systems could be like this:
+%%
+%% s1.cover:
+%% {include,[m1]}.
+%%
+%% s2.cover:
+%% {include,[....]}. % modules belonging to system s2
+%% {cross,[{s1,[m1]}]}.
+%%
+%% When the tests for both s1 and s2 are completed, run
+%% cross_cover_analyse(Level,[{s1,S1LogDir},{s2,S2LogDir}]), and
+%% the accumulated cover data for m1 will be written to
+%% S1LogDir/[run.<timestamp>/]cross_cover.html
+%%
+%% S1LogDir and S2LogDir are either the run.<timestamp> directories
+%% for the two tests, or the parent directory of these, in which case
+%% the latest run.<timestamp> directory will be chosen.
+%%
+%% Note that the m1 module will also be presented in the normal
+%% coverage log for s1 (due to the include statement in s1.cover), but
+%% that only includes the coverage achieved by the s1 test itself.
+%%
+%% The Tag in the 'cross' statement in the cover file has no other
+%% purpose than mapping the list of modules ([m1] in the example
+%% above) to the correct log directory where it should be included in
+%% the cross_cover.html file (S1LogDir in the example above).
+%% I.e. the value of the Tag has no meaning, it could be foo as well
+%% as s1 above, as long as the same Tag is used in the cover file and
+%% in the call to cross_cover_analyse/2.
%% Cover compilation
@@ -4933,8 +4954,7 @@ cover_compile({App,{_File,Exclude,Include,Cross,_Export}}) ->
cover_compile1({App,Exclude,Include,Cross});
cover_compile({App,CoverFile}) ->
- Cross = get_cross_modules(App),
- {Exclude,Include} = read_cover_file(CoverFile),
+ {Exclude,Include,Cross} = read_cover_file(CoverFile),
cover_compile1({App,Exclude,Include,Cross}).
cover_compile1(What) ->
@@ -4945,41 +4965,57 @@ cover_compile1(What) ->
%% (Exclude), and a list of modules that are not members of the
%% application but shall be compiled (Include).
read_cover_file(none) ->
- {[],[]};
+ {[],[],[]};
read_cover_file(CoverFile) ->
case file:consult(CoverFile) of
{ok,List} ->
- case check_cover_file(List, [], []) of
- {ok,Exclude,Include} -> {Exclude,Include};
+ case check_cover_file(List, [], [], []) of
+ {ok,Exclude,Include,Cross} -> {Exclude,Include,Cross};
error ->
io:fwrite("Faulty format of CoverFile ~p\n", [CoverFile]),
- {[],[]}
+ {[],[],[]}
end;
{error,Reason} ->
io:fwrite("Can't read CoverFile ~p\nReason: ~p\n",
[CoverFile,Reason]),
- {[],[]}
+ {[],[],[]}
end.
-check_cover_file([{exclude,all}|Rest], _, Include) ->
- check_cover_file(Rest, all, Include);
-check_cover_file([{exclude,Exclude}|Rest], _, Include) ->
+check_cover_file([{exclude,all}|Rest], _, Include, Cross) ->
+ check_cover_file(Rest, all, Include, Cross);
+check_cover_file([{exclude,Exclude}|Rest], _, Include, Cross) ->
case lists:all(fun(M) -> is_atom(M) end, Exclude) of
true ->
- check_cover_file(Rest, Exclude, Include);
+ check_cover_file(Rest, Exclude, Include, Cross);
false ->
error
end;
-check_cover_file([{include,Include}|Rest], Exclude, _) ->
+check_cover_file([{include,Include}|Rest], Exclude, _, Cross) ->
case lists:all(fun(M) -> is_atom(M) end, Include) of
true ->
- check_cover_file(Rest, Exclude, Include);
+ check_cover_file(Rest, Exclude, Include, Cross);
false ->
error
end;
-check_cover_file([], Exclude, Include) ->
- {ok,Exclude,Include}.
+check_cover_file([{cross,Cross}|Rest], Exclude, Include, _) ->
+ case check_cross(Cross) of
+ true ->
+ check_cover_file(Rest, Exclude, Include, Cross);
+ false ->
+ error
+ end;
+check_cover_file([], Exclude, Include, Cross) ->
+ {ok,Exclude,Include,Cross}.
+check_cross([{Tag,Modules}|Rest]) ->
+ case lists:all(fun(M) -> is_atom(M) end, [Tag|Modules]) of
+ true ->
+ check_cross(Rest);
+ false ->
+ false
+ end;
+check_cross([]) ->
+ true.
%% Cover analysis, per application
@@ -5000,16 +5036,17 @@ cover_analyse({App,CoverInfo}, Analyse, AnalyseMods, Stop, TestDir) ->
"<p><a href=\"~s\">Coverdata collected over all tests</a></p>",
[?cross_coverlog_name]),
- {CoverFile,_Included,Excluded} =
+ {CoverFile,_Included,Excluded,Cross} =
case CoverInfo of
- {File,Excl,Incl,_Cross,Export} ->
+ {File,Excl,Incl,Cr,Export} ->
cover:export(Export),
- {File,Incl,Excl};
+ {File,Incl,Excl,Cr};
File ->
- {Excl,Incl} = read_cover_file(File),
- {File,Incl,Excl}
+ {Excl,Incl,Cr} = read_cover_file(File),
+ {File,Incl,Excl,Cr}
end,
io:fwrite(CoverLog, "<p>CoverFile: <code>~p</code>\n", [CoverFile]),
+ write_cross_cover_info(TestDir,Cross),
case length(cover:imported_modules()) of
Imps when Imps > 0 ->
@@ -5022,6 +5059,8 @@ cover_analyse({App,CoverInfo}, Analyse, AnalyseMods, Stop, TestDir) ->
io:fwrite(CoverLog, "<p>Excluded module(s): <code>~p</code>\n", [Excluded]),
Coverage = cover_analyse(Analyse, AnalyseMods, Stop),
+ file:write_file(filename:join(TestDir,?raw_coverlog_name),
+ term_to_binary(Coverage)),
case lists:filter(fun({_M,{_,_,_}}) -> false;
(_) -> true
@@ -5043,20 +5082,20 @@ cover_analyse(Analyse, AnalyseMods, Stop) ->
test_server:cover_analyse({Analyse,TestDir}, AnalyseMods, Stop).
-%% Cover analysis, cross application
+%% Cover analysis - accumulated over multiple tests
%% This can be executed on any node after all tests are finished.
-%% Apps = [{App,Dir}]
-%% App = atom(), application name
-%% Dir = string(), the log directory for App, normally where
-%% run.<timestamp> is found.
-%% Modules = [atom()], modules that have been cover compiled during tests
-%% of other apps than the one they belong to.
-cross_cover_analyse(Analyse, Apps) ->
- cross_cover_analyse(Analyse, Apps, get_cross_modules()).
-cross_cover_analyse(Analyse, Apps, Modules) ->
- Apps1 = get_latest_run_dirs(Apps),
- Apps2 = add_cross_modules(Modules,Apps1),
- CoverdataFiles = get_coverdata_files(Apps2),
+%% Analyse = overview | details
+%% TagDirs = [{Tag,Dir}]
+%% Tag = atom(), identifier
+%% Dir = string(), the log directory for Tag, it can be a
+%% run.<timestamp> directory or the parent directory of
+%% such (in which case the latest run.<timestamp> directory
+%% is used)
+cross_cover_analyse(Analyse, TagDirs0) ->
+ TagDirs = get_latest_run_dirs(TagDirs0),
+ TagMods = get_all_cross_info(TagDirs,[]),
+ TagDirMods = add_cross_modules(TagMods,TagDirs),
+ CoverdataFiles = get_coverdata_files(TagDirMods),
lists:foreach(fun(CDF) -> cover:import(CDF) end, CoverdataFiles),
io:fwrite("Cover analysing...\n", []),
DetailsFun =
@@ -5066,39 +5105,52 @@ cross_cover_analyse(Analyse, Apps, Modules) ->
OutFile = filename:join(Dir,
atom_to_list(M) ++
".CROSS_COVER.html"),
- cover:analyse_to_file(M, OutFile, [html]),
- {file,OutFile}
+ case cover:analyse_to_file(M, OutFile, [html]) of
+ {ok,_} ->
+ {file,OutFile};
+ Error ->
+ Error
+ end
end;
_ ->
fun(_,_) -> undefined end
end,
- Coverage = analyse_apps(Apps2, DetailsFun, []),
+ Coverage = analyse_tests(TagDirMods, DetailsFun, []),
cover:stop(),
- write_cross_cover_logs(Coverage,Apps2).
+ write_cross_cover_logs(Coverage,TagDirMods).
-%% For each application from which there are cross cover analysed
+write_cross_cover_info(_Dir,[]) ->
+ ok;
+write_cross_cover_info(Dir,Cross) ->
+ {ok,Fd} = file:open(filename:join(Dir,?cross_cover_info),[write]),
+ lists:foreach(fun(C) -> io:format(Fd,"~p.~n",[C]) end, Cross),
+ file:close(Fd).
+
+%% For each test from which there are cross cover analysed
%% modules, write a cross cover log (cross_cover.html).
-write_cross_cover_logs([{App,Coverage}|T],Apps) ->
- case lists:keyfind(App,1,Apps) of
+write_cross_cover_logs([{Tag,Coverage}|T],TagDirMods) ->
+ case lists:keyfind(Tag,1,TagDirMods) of
{_,Dir,Mods} when Mods=/=[] ->
+ file:write_file(filename:join(Dir,?raw_cross_coverlog_name),
+ term_to_binary(Coverage)),
CoverLogName = filename:join(Dir,?cross_coverlog_name),
{ok,CoverLog} = file:open(CoverLogName, [write]),
write_coverlog_header(CoverLog),
io:fwrite(CoverLog,
"<h1>Coverage results for \'~w\' from all tests</h1>\n",
- [App]),
+ [Tag]),
write_cover_result_table(CoverLog, Coverage),
io:fwrite("Written file ~p\n", [CoverLogName]);
_ ->
ok
end,
- write_cross_cover_logs(T,Apps);
+ write_cross_cover_logs(T,TagDirMods);
write_cross_cover_logs([],_) ->
io:fwrite("done\n", []).
%% Get the latest run.<timestamp> directories
-get_latest_run_dirs([{App,Dir}|Apps]) ->
- [{App,get_latest_run_dir(Dir)} | get_latest_run_dirs(Apps)];
+get_latest_run_dirs([{Tag,Dir}|Rest]) ->
+ [{Tag,get_latest_run_dir(Dir)} | get_latest_run_dirs(Rest)];
get_latest_run_dirs([]) ->
[].
@@ -5117,44 +5169,47 @@ get_latest_dir([_|T],Latest) ->
get_latest_dir([],Latest) ->
Latest.
-%% Associate the cross cover modules with their applications.
-add_cross_modules(Mods,Apps)->
- do_add_cross_modules(Mods,[{App,Dir,[]} || {App,Dir} <- Apps]).
-do_add_cross_modules([Mod|Mods],Apps)->
- App = get_app(Mod),
- NewApps =
- case lists:keytake(App,1,Apps) of
- {value,{App,Dir,AppMods},Rest} ->
- [{App,Dir,lists:umerge([Mod],AppMods)}|Rest];
+get_all_cross_info([{_Tag,Dir}|Rest],Acc) ->
+ case file:consult(filename:join(Dir,?cross_cover_info)) of
+ {ok,TagMods} ->
+ get_all_cross_info(Rest,TagMods++Acc);
+ _ ->
+ get_all_cross_info(Rest,Acc)
+ end;
+get_all_cross_info([],Acc) ->
+ Acc.
+
+%% Associate the cross cover modules with their log directories
+add_cross_modules(TagMods,TagDirs)->
+ do_add_cross_modules(TagMods,[{Tag,Dir,[]} || {Tag,Dir} <- TagDirs]).
+do_add_cross_modules([{Tag,Mods1}|TagMods],TagDirMods)->
+ NewTagDirMods =
+ case lists:keytake(Tag,1,TagDirMods) of
+ {value,{Tag,Dir,Mods},Rest} ->
+ [{Tag,Dir,lists:umerge(lists:sort(Mods1),Mods)}|Rest];
false ->
- Apps
+ TagDirMods
end,
- do_add_cross_modules(Mods,NewApps);
-do_add_cross_modules([],Apps) ->
- %% Just to get the modules in the same order as app-only cover log
- [{App,Dir,lists:reverse(Mods)} || {App,Dir,Mods} <- Apps].
-
-get_app(Module) ->
- Beam = code:which(Module),
- AppDir = filename:basename(filename:dirname(filename:dirname(Beam))),
- [AppStr|_] = string:tokens(AppDir,"-"),
- list_to_atom(AppStr).
+ do_add_cross_modules(TagMods,NewTagDirMods);
+do_add_cross_modules([],TagDirMods) ->
+ %% Just to get the modules in the same order as in the normal cover log
+ [{Tag,Dir,lists:reverse(Mods)} || {Tag,Dir,Mods} <- TagDirMods].
%% Find all exported coverdata files.
-get_coverdata_files(Apps) ->
+get_coverdata_files(TagDirMods) ->
lists:flatmap(
- fun({_,LatestAppDir,_}) ->
- filelib:wildcard(filename:join(LatestAppDir,"all.coverdata"))
+ fun({_,LatestDir,_}) ->
+ filelib:wildcard(filename:join(LatestDir,"all.coverdata"))
end,
- Apps).
+ TagDirMods).
-%% For each application, analyse all modules
+%% For each test, analyse all modules
%% Used for cross cover analysis.
-analyse_apps([{App,LastTest,Modules}|T], DetailsFun, Acc) ->
+analyse_tests([{Tag,LastTest,Modules}|T], DetailsFun, Acc) ->
Cov = analyse_modules(LastTest, Modules, DetailsFun, []),
- analyse_apps(T, DetailsFun, [{App,Cov}|Acc]);
-analyse_apps([], _DetailsFun, Acc) ->
+ analyse_tests(T, DetailsFun, [{Tag,Cov}|Acc]);
+analyse_tests([], _DetailsFun, Acc) ->
Acc.
%% Analyse each module
@@ -5167,27 +5222,6 @@ analyse_modules(_Dir, [], _DetailsFun, Acc) ->
Acc.
-%% Read the cross cover file (cross.cover)
-get_cross_modules() ->
- get_cross_modules(all).
-get_cross_modules(App) ->
- case file:consult(?cross_cover_file) of
- {ok,List} ->
- get_cross_modules(App, List, []);
- _X ->
- []
- end.
-
-get_cross_modules(App, [{_To,Modules}|T], Acc) when App==all->
- get_cross_modules(App, T, Acc ++ Modules);
-get_cross_modules(App, [{To,Modules}|T], Acc) when To==App; To==all->
- get_cross_modules(App, T, Acc ++ Modules);
-get_cross_modules(App, [_H|T], Acc) ->
- get_cross_modules(App, T, Acc);
-get_cross_modules(_App, [], Acc) ->
- Acc.
-
-
%% Support functions for writing the cover logs (both cross and normal)
write_coverlog_header(CoverLog) ->
case catch
diff --git a/lib/test_server/src/test_server_sup.erl b/lib/test_server/src/test_server_sup.erl
index c7553cccb5..a6d426887e 100644
--- a/lib/test_server/src/test_server_sup.erl
+++ b/lib/test_server/src/test_server_sup.erl
@@ -28,7 +28,7 @@
get_username/0, get_os_family/0,
hostatom/0, hostatom/1, hoststr/0, hoststr/1,
framework_call/2,framework_call/3,framework_call/4,
- format_loc/1, package_str/1, package_atom/1,
+ format_loc/1,
call_trace/1]).
-include("test_server_internal.hrl").
-define(crash_dump_tar,"crash_dumps.tar.gz").
@@ -553,7 +553,7 @@ format_loc([{Mod,Func,Line}|Rest]) ->
format_loc([{Mod,LineOrFunc}]) ->
format_loc({Mod,LineOrFunc});
format_loc({Mod,Func}) when is_atom(Func) ->
- io_lib:format("{~s,~w}",[package_str(Mod),Func]);
+ io_lib:format("{~w,~w}",[Mod,Func]);
format_loc(Loc) ->
io_lib:format("~p",[Loc]).
@@ -562,15 +562,15 @@ format_loc1([{Mod,Func,Line}]) ->
format_loc1([{Mod,Func,Line}|Rest]) ->
[" ",format_loc1({Mod,Func,Line}),",\n"|format_loc1(Rest)];
format_loc1({Mod,Func,Line}) ->
- ModStr = package_str(Mod),
+ ModStr = atom_to_list(Mod),
case {lists:member(no_src, get(test_server_logopts)),
lists:reverse(ModStr)} of
{false,[$E,$T,$I,$U,$S,$_|_]} ->
- io_lib:format("{~s,~w,<a href=\"~s~s#~w\">~w</a>}",
- [ModStr,Func,downcase(ModStr),?src_listing_ext,
+ io_lib:format("{~w,~w,<a href=\"~s~s#~w\">~w</a>}",
+ [Mod,Func,downcase(ModStr),?src_listing_ext,
Line,Line]);
_ ->
- io_lib:format("{~s,~w,~w}",[ModStr,Func,Line])
+ io_lib:format("{~w,~w,~w}",[Mod,Func,Line])
end.
downcase(S) -> downcase(S, []).
@@ -581,22 +581,6 @@ downcase([C|Rest], Result) ->
downcase([], Result) ->
lists:reverse(Result).
-package_str(Mod) when is_atom(Mod) ->
- atom_to_list(Mod);
-package_str(Mod) when is_list(Mod), is_atom(hd(Mod)) ->
- %% convert [s1,s2] -> "s1.s2"
- [_|M] = lists:flatten(["."++atom_to_list(S) || S <- Mod]),
- M;
-package_str(Mod) when is_list(Mod) ->
- Mod.
-
-package_atom(Mod) when is_atom(Mod) ->
- Mod;
-package_atom(Mod) when is_list(Mod), is_atom(hd(Mod)) ->
- list_to_atom(package_str(Mod));
-package_atom(Mod) when is_list(Mod) ->
- list_to_atom(Mod).
-
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% call_trace(TraceSpecFile) -> ok
%%
diff --git a/lib/test_server/src/ts.erl b/lib/test_server/src/ts.erl
index 115e783070..cfd7161dbd 100644
--- a/lib/test_server/src/ts.erl
+++ b/lib/test_server/src/ts.erl
@@ -160,8 +160,8 @@ help(installed) ->
" the given run options\n",
" ts:cross_cover_analyse(Level)\n"
" - Used after ts:run with option cover or \n"
- " cover_details. Analyses modules specified in\n"
- " cross.cover.\n"
+ " cover_details. Analyses modules specified with\n"
+ " a 'cross' statement in the cover spec file.\n"
" Level can be 'overview' or 'details'.\n",
" ts:compile_testcases()~n"
" ts:compile_testcases(Apps)~n"
@@ -528,8 +528,7 @@ cross_cover_analyse([Level]) ->
cross_cover_analyse(Level);
cross_cover_analyse(Level) ->
Apps = get_last_app_tests(),
- Modules = get_cross_modules(Apps,[]),
- test_server_ctrl:cross_cover_analyse(Level,Apps,Modules).
+ test_server_ctrl:cross_cover_analyse(Level,Apps).
get_last_app_tests() ->
AllTests = filelib:wildcard(filename:join(["*","*_test.logs"])),
@@ -558,30 +557,6 @@ get_last_app_tests([Dir|Dirs],RE,Acc) ->
get_last_app_tests([],_,Acc) ->
Acc.
-get_cross_modules([{App,_}|Apps],Acc) ->
- Mods = cross_modules(App),
- get_cross_modules(Apps,lists:umerge(Mods,Acc));
-get_cross_modules([],Acc) ->
- Acc.
-
-cross_modules(App) ->
- case default_coverfile(App) of
- none ->
- [];
- File ->
- case catch file:consult(File) of
- {ok,CoverSpec} ->
- case lists:keyfind(cross_apps,1,CoverSpec) of
- false ->
- [];
- {cross_apps,App,Modules} ->
- lists:usort(Modules)
- end;
- _ ->
- []
- end
- end.
-
%%% Implementation.
check_and_run(Fun) ->
diff --git a/lib/test_server/test/test_server_SUITE.erl b/lib/test_server/test/test_server_SUITE.erl
index 95a3423fef..fb82a87fd0 100644
--- a/lib/test_server/test/test_server_SUITE.erl
+++ b/lib/test_server/test/test_server_SUITE.erl
@@ -80,7 +80,7 @@ all() ->
[test_server_SUITE, test_server_parallel01_SUITE,
test_server_conf02_SUITE, test_server_conf01_SUITE,
test_server_skip_SUITE, test_server_shuffle01_SUITE,
- test_server_break_SUITE].
+ test_server_break_SUITE, test_server_cover_SUITE].
%%--------------------------------------------------------------------
@@ -93,37 +93,95 @@ test_server_SUITE(Config) ->
% rpc:call(Node,dbg, tracer,[]),
% rpc:call(Node,dbg, p,[all,c]),
% rpc:call(Node,dbg, tpl,[test_server_ctrl,x]),
- run_test_server_tests("test_server_SUITE", 38, 1, 30,
- 19, 9, 1, 11, 2, 25, Config).
+ run_test_server_tests("test_server_SUITE",
+ [{test_server_SUITE,skip_case7,"SKIPPED!"}],
+ 38, 1, 30, 19, 9, 1, 11, 2, 25, Config).
test_server_parallel01_SUITE(Config) ->
- run_test_server_tests("test_server_parallel01_SUITE", 37, 0, 19,
- 19, 0, 0, 0, 0, 37, Config).
+ run_test_server_tests("test_server_parallel01_SUITE", [],
+ 37, 0, 19, 19, 0, 0, 0, 0, 37, Config).
test_server_shuffle01_SUITE(Config) ->
- run_test_server_tests("test_server_shuffle01_SUITE", 130, 0, 0,
- 76, 0, 0, 0, 0, 130, Config).
+ run_test_server_tests("test_server_shuffle01_SUITE", [],
+ 130, 0, 0, 76, 0, 0, 0, 0, 130, Config).
test_server_skip_SUITE(Config) ->
- run_test_server_tests("test_server_skip_SUITE", 3, 0, 1,
- 0, 0, 1, 3, 0, 0, Config).
+ run_test_server_tests("test_server_skip_SUITE", [],
+ 3, 0, 1, 0, 0, 1, 3, 0, 0, Config).
test_server_conf01_SUITE(Config) ->
- run_test_server_tests("test_server_conf01_SUITE", 24, 0, 12,
- 12, 0, 0, 0, 0, 24, Config).
+ run_test_server_tests("test_server_conf01_SUITE", [],
+ 24, 0, 12, 12, 0, 0, 0, 0, 24, Config).
test_server_conf02_SUITE(Config) ->
- run_test_server_tests("test_server_conf02_SUITE", 26, 0, 12,
- 12, 0, 0, 0, 0, 26, Config).
+ run_test_server_tests("test_server_conf02_SUITE", [],
+ 26, 0, 12, 12, 0, 0, 0, 0, 26, Config).
test_server_break_SUITE(Config) ->
- D = run_test_server_tests("test_server_break_SUITE", 8, 2, 6,
- 4, 0, 0, 0, 2, 6, Config),
- D.
+ run_test_server_tests("test_server_break_SUITE", [],
+ 8, 2, 6, 4, 0, 0, 0, 2, 6, Config).
-run_test_server_tests(SuiteName, NCases, NFail, NExpected, NSucc,
+test_server_cover_SUITE(Config) ->
+ case test_server:is_cover() of
+ true ->
+ {skip, "Cover already running"};
+ false ->
+ PrivDir = ?config(priv_dir,Config),
+
+ %% Test suite has two test cases
+ %% tc1 calls cover_helper:foo/0
+ %% tc2 calls cover_helper:bar/0
+ %% Each function in cover_helper is one line.
+ %%
+ %% First test run skips tc2, so only cover_helper:foo/0 is executed.
+ %% Cover file specifies to include cover_helper in this test run.
+ CoverFile1 = filename:join(PrivDir,"t1.cover"),
+ CoverSpec1 = {include,[cover_helper]},
+ file:write_file(CoverFile1,io_lib:format("~p.~n",[CoverSpec1])),
+ run_test_server_tests("test_server_cover_SUITE",
+ [{test_server_cover_SUITE,tc2,"SKIPPED!"}],
+ 4, 0, 2, 1, 1, 0, 1, 0, 3,
+ CoverFile1, Config),
+
+ %% Next test run skips tc1, so only cover_helper:bar/0 is executed.
+ %% Cover file specifies cross compilation of cover_helper
+ CoverFile2 = filename:join(PrivDir,"t2.cover"),
+ CoverSpec2 = {cross,[{t1,[cover_helper]}]},
+ file:write_file(CoverFile2,io_lib:format("~p.~n",[CoverSpec2])),
+ run_test_server_tests("test_server_cover_SUITE",
+ [{test_server_cover_SUITE,tc1,"SKIPPED!"}],
+ 4, 0, 2, 1, 1, 0, 1, 0, 3, CoverFile2, Config),
+
+ %% Cross cover analyse
+ WorkDir = ?config(work_dir,Config),
+ WC = filename:join([WorkDir,"test_server_cover_SUITE.logs","run.*"]),
+ [D2,D1|_] = lists:reverse(lists:sort(filelib:wildcard(WC))),
+ TagDirs = [{t1,D1},{t2,D2}],
+ test_server_ctrl:cross_cover_analyse(details,TagDirs),
+
+ %% Check that cover log shows only what is really included
+ %% in the test and cross cover log show the accumulated
+ %% result.
+ {ok,Cover1} = file:read_file(filename:join(D1,"cover.log")),
+ [{cover_helper,{1,1,_}}] = binary_to_term(Cover1),
+ {ok,Cover2} = file:read_file(filename:join(D2,"cover.log")),
+ [] = binary_to_term(Cover2),
+ {ok,Cross} = file:read_file(filename:join(D1,"cross_cover.log")),
+ [{cover_helper,{2,0,_}}] = binary_to_term(Cross),
+ ok
+ end.
+
+
+run_test_server_tests(SuiteName, Skip, NCases, NFail, NExpected, NSucc,
NUsrSkip, NAutoSkip,
NActualSkip, NActualFail, NActualSucc, Config) ->
+ run_test_server_tests(SuiteName, Skip, NCases, NFail, NExpected, NSucc,
+ NUsrSkip, NAutoSkip,
+ NActualSkip, NActualFail, NActualSucc, false, Config).
+
+run_test_server_tests(SuiteName, Skip, NCases, NFail, NExpected, NSucc,
+ NUsrSkip, NAutoSkip,
+ NActualSkip, NActualFail, NActualSucc, Cover, Config) ->
WorkDir = proplists:get_value(work_dir, Config),
ct:log("<a href=\"file://~s\">Test case log files</a>\n",
@@ -131,11 +189,17 @@ run_test_server_tests(SuiteName, NCases, NFail, NExpected, NSucc,
Node = proplists:get_value(node, Config),
{ok,_Pid} = rpc:call(Node,test_server_ctrl, start, []),
+ case Cover of
+ false ->
+ ok;
+ _ ->
+ rpc:call(Node,test_server_ctrl,cover,[Cover,details])
+ end,
rpc:call(Node,
test_server_ctrl,add_dir_with_skip,
[SuiteName,
[proplists:get_value(data_dir,Config)],SuiteName,
- [{test_server_SUITE,skip_case7,"SKIPPED!"}]]),
+ Skip]),
until(fun() ->
rpc:call(Node,test_server_ctrl,jobs,[]) =:= []
diff --git a/lib/test_server/test/test_server_SUITE_data/Makefile.src b/lib/test_server/test/test_server_SUITE_data/Makefile.src
index ec8ddd78b0..c770627f04 100644
--- a/lib/test_server/test/test_server_SUITE_data/Makefile.src
+++ b/lib/test_server/test/test_server_SUITE_data/Makefile.src
@@ -5,4 +5,6 @@ all:
erlc test_server_shuffle01_SUITE.erl
erlc test_server_conf02_SUITE.erl
erlc test_server_skip_SUITE.erl
- erlc test_server_break_SUITE.erl \ No newline at end of file
+ erlc test_server_break_SUITE.erl
+ erlc test_server_cover_SUITE.erl
+ erlc +debug_info test_server_cover_SUITE_data/cover_helper.erl \ No newline at end of file
diff --git a/lib/test_server/test/test_server_SUITE_data/test_server_break_SUITE.erl b/lib/test_server/test/test_server_SUITE_data/test_server_break_SUITE.erl
index 70e30a3334..d9f009679a 100644
--- a/lib/test_server/test/test_server_SUITE_data/test_server_break_SUITE.erl
+++ b/lib/test_server/test/test_server_SUITE_data/test_server_break_SUITE.erl
@@ -41,7 +41,7 @@ init_per_suite(Config) ->
spawn(fun break_and_continue_sup/0),
Config.
-end_per_suite(Config) ->
+end_per_suite(_Config) ->
ok.
init_per_testcase(Case,Config) when Case==break_in_init_tc ->
@@ -90,19 +90,19 @@ break_in_end_tc_after_fail(Config) when is_list(Config) ->
break_in_end_tc_after_abort(Config) when is_list(Config) ->
?t:adjusted_sleep(2000). % will cause a timetrap timeout
-%%%-----------------------------------------------------------------
-%%% Internal functions
-
%% This test case checks that all breaks in previous test cases was
%% also continued, and that the break lasted as long as expected.
%% The reason for this is that some of the breaks above are in
%% end_per_testcase, and failures there will only produce a warning,
%% not an error - so this is to catch the error for real.
-check_all_breaks(Config) ->
+check_all_breaks(Config) when is_list(Config) ->
break_and_continue_sup ! {done,self()},
receive {Breaks,Continued} ->
check_all_breaks(Breaks,Continued)
end.
+%%%-----------------------------------------------------------------
+%%% Internal functions
+
check_all_breaks([{From,Case,T,Start}|Breaks],[{From,End}|Continued]) ->
Diff = timer:now_diff(End,Start),
diff --git a/lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE.erl b/lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE.erl
new file mode 100644
index 0000000000..b1ae70a302
--- /dev/null
+++ b/lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE.erl
@@ -0,0 +1,58 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2012. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(test_server_cover_SUITE).
+
+-export([all/1, init_per_suite/1, end_per_suite/1]).
+-export([init_per_testcase/2, end_per_testcase/2]).
+-export([tc1/1, tc2/1]).
+
+-include_lib("test_server/include/test_server.hrl").
+
+all(suite) ->
+ [tc1,tc2].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_testcase(_Case,Config) ->
+ Dog = ?t:timetrap({minutes,10}),
+ [{watchdog, Dog}|Config].
+
+end_per_testcase(_Case,Config) ->
+ Dog=?config(watchdog, Config),
+ ?t:timetrap_cancel(Dog),
+ ok.
+
+
+%%%-----------------------------------------------------------------
+%%% Test cases
+tc1(Config) when is_list(Config) ->
+ cover_helper:foo(),
+ ok.
+
+tc2(Config) when is_list(Config) ->
+ cover_helper:bar(),
+ ok.
+
+%%%-----------------------------------------------------------------
+%%% Internal functions
+
diff --git a/lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE_data/cover_helper.erl b/lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE_data/cover_helper.erl
new file mode 100644
index 0000000000..6c74eb4e8a
--- /dev/null
+++ b/lib/test_server/test/test_server_SUITE_data/test_server_cover_SUITE_data/cover_helper.erl
@@ -0,0 +1,4 @@
+-module(cover_helper).
+-compile(export_all).
+foo() -> ok.
+bar() -> ok.
diff --git a/lib/wx/.gitignore b/lib/wx/.gitignore
index 0fa427bfe5..960c76a779 100644
--- a/lib/wx/.gitignore
+++ b/lib/wx/.gitignore
@@ -1,4 +1,5 @@
test_log_*
wx_test_case_info
-api_gen/gl_man?
-doc/html/* \ No newline at end of file
+doc/html/*
+%% Don't delete links to man src when git clean -dfX
+%% api_gen/gl_man?
diff --git a/lib/wx/aclocal.m4 b/lib/wx/aclocal.m4
index 9578cd35c4..5d555a5123 100644
--- a/lib/wx/aclocal.m4
+++ b/lib/wx/aclocal.m4
@@ -1849,6 +1849,32 @@ case $erl_gethrvtime in
esac
])dnl
+dnl ----------------------------------------------------------------------
+dnl
+dnl LM_TRY_ENABLE_CFLAG
+dnl
+dnl
+dnl Tries a CFLAG and sees if it can be enabled without compiler errors
+dnl $1: textual cflag to add
+dnl $2: variable to store the modified CFLAG in
+dnl Usage example LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+dnl
+dnl
+AC_DEFUN([LM_TRY_ENABLE_CFLAG], [
+ AC_MSG_CHECKING([if we can add $1 to CFLAGS])
+ saved_CFLAGS=$CFLAGS;
+ CFLAGS="$1 $CFLAGS";
+ AC_TRY_COMPILE([],[return 0;],can_enable_flag=true,can_enable_flag=false)
+ CFLAGS=$saved_CFLAGS;
+ if test "X$can_enable_flag" = "Xtrue"; then
+ AC_MSG_RESULT([yes])
+ AS_VAR_SET($2, "$1 $CFLAGS")
+ else
+ AC_MSG_RESULT([no])
+ AS_VAR_SET($2, "$CFLAGS")
+ fi
+])
+
dnl ERL_TRY_LINK_JAVA(CLASSES, FUNCTION-BODY
dnl [ACTION_IF_FOUND [, ACTION-IF-NOT-FOUND]])
dnl Freely inspired by AC_TRY_LINK. (Maybe better to create a
diff --git a/lib/wx/api_gen/gen_util.erl b/lib/wx/api_gen/gen_util.erl
index 4638d4c7ea..2ba1c6e16f 100644
--- a/lib/wx/api_gen/gen_util.erl
+++ b/lib/wx/api_gen/gen_util.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -49,8 +49,10 @@ get_taylor_made(Str, Name) ->
[dotall, {capture, all_but_first, list}]).
open_write(File) ->
+ open_write(File, []).
+open_write(File, Opts) ->
%% io:format("Generating ~s~n",[File]),
- {ok, Fd} = file:open(File++".temp", [write]),
+ {ok, Fd} = file:open(File++".temp", [write|Opts]),
put(current_file, {Fd,File}).
@@ -187,6 +189,8 @@ replace_and_remove([$| | R], Acc) ->
replace_and_remove(R, ["|"|Acc]);
replace_and_remove([$* | R], Acc) ->
replace_and_remove(R, ["*"|Acc]);
+replace_and_remove([$+ | R], Acc) ->
+ replace_and_remove(R, ["+"|Acc]);
replace_and_remove([$& | R], Acc) ->
replace_and_remove(R, [$&|Acc]);
replace_and_remove([$<,$< | R], Acc) ->
@@ -221,7 +225,7 @@ erl_copyright() ->
w("%%~n",[]),
w("%% %CopyrightBegin%~n",[]),
w("%%~n",[]),
- w("%% Copyright Ericsson AB ~p-2012. All Rights Reserved.~n",
+ w("%% Copyright Ericsson AB ~p-2013. All Rights Reserved.~n",
[StartYear]),
w("%%~n",[]),
w("%% The contents of this file are subject to the Erlang Public License,~n",[]),
@@ -241,7 +245,7 @@ c_copyright() ->
w("/*~n",[]),
w(" * %CopyrightBegin%~n",[]),
w(" *~n",[]),
- w(" * Copyright Ericsson AB 2008-2012. All Rights Reserved.~n",[]),
+ w(" * Copyright Ericsson AB 2008-2013. All Rights Reserved.~n",[]),
w(" *~n",[]),
w(" * The contents of this file are subject to the Erlang Public License,~n",[]),
w(" * Version 1.1, (the \"License\"); you may not use this file except in~n",[]),
diff --git a/lib/wx/api_gen/gl_gen.erl b/lib/wx/api_gen/gl_gen.erl
index 331ba32ba4..ea967c958f 100644
--- a/lib/wx/api_gen/gl_gen.erl
+++ b/lib/wx/api_gen/gl_gen.erl
@@ -185,11 +185,11 @@ parse_define([#xmlElement{name=name,content=[#xmlText{value="WINGDIAPI"++_}]}|_]
throw(skip);
parse_define([#xmlElement{name=name,content=[#xmlText{value=Name}]}|R], Def, Os) ->
parse_define(R, Def#def{name=Name}, Os);
-parse_define([#xmlElement{name=initializer,content=[#xmlText{value=V}]}|_],Def,_Os) ->
- Val0 = string:strip(V),
- try
+parse_define([#xmlElement{name=initializer,content=Contents}|_R],Def,_Os) ->
+ Val0 = extract_def2(Contents),
+ try
case Val0 of
- "0x" ++ Val1 ->
+ "0x" ++ Val1 ->
_ = http_util:hexlist_to_integer(Val1),
Def#def{val=Val1, type=hex};
_ ->
@@ -207,6 +207,23 @@ parse_define([_|R], D, Opts) ->
parse_define([], D, _Opts) ->
D.
+extract_def2([#xmlText{value=Val}|R]) ->
+ strip_comment(string:strip(Val)) ++ extract_def2(R);
+extract_def2([#xmlElement{content=Cs}|R]) ->
+ extract_def2(Cs) ++ extract_def2(R);
+extract_def2([]) -> [].
+
+strip_comment("/*" ++ Rest) ->
+ strip_comment_until_end(Rest);
+strip_comment("//" ++ _) -> [];
+strip_comment([H|R]) -> [H | strip_comment(R)];
+strip_comment([]) -> [].
+
+strip_comment_until_end("*/" ++ Rest) ->
+ strip_comment(Rest);
+strip_comment_until_end([_|R]) ->
+ strip_comment_until_end(R).
+
parse_func(Xml, Opts) ->
{Func,_} = foldl(fun(X,Acc) -> parse_func(X,Acc,Opts) end, {#func{},1}, Xml),
put(current_func, Func#func.name),
diff --git a/lib/wx/api_gen/gl_gen_erl.erl b/lib/wx/api_gen/gl_gen_erl.erl
index 25f89e4ad4..446521098e 100644
--- a/lib/wx/api_gen/gl_gen_erl.erl
+++ b/lib/wx/api_gen/gl_gen_erl.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -31,7 +31,7 @@
-import(lists, [foldl/3,foldr/3,reverse/1, keysearch/3, map/2, filter/2, max/1]).
-import(gen_util, [lowercase/1, lowercase_all/1, uppercase/1, uppercase_all/1,
- open_write/1, close/0, erl_copyright/0, w/2,
+ open_write/1, open_write/2, close/0, erl_copyright/0, w/2,
args/3, args/4, strip_name/2]).
gl_defines(Defs) ->
@@ -90,7 +90,8 @@ types() ->
].
gl_api(Fs) ->
- open_write("../src/gen/gl.erl"),
+ open_write("../src/gen/gl.erl", [{encoding,utf8}]),
+ w("%% -*- coding: utf-8 -*-~n~n", []),
erl_copyright(),
w("~n%% OPENGL API~n~n", []),
w("%% This file is generated DO NOT EDIT~n~n", []),
@@ -148,7 +149,8 @@ gl_api(Fs) ->
ok.
glu_api(Fs) ->
- open_write("../src/gen/glu.erl"),
+ open_write("../src/gen/glu.erl", [{encoding,utf8}]),
+ w("%% -*- coding: utf-8 -*-~n~n", []),
erl_copyright(),
w("~n%% OPENGL UTILITY API~n~n", []),
w("%% This file is generated DO NOT EDIT~n~n", []),
@@ -330,7 +332,7 @@ format_doc([{constant, Const}|Rest], Count) ->
w("`?~s'", [Const]),
format_doc(Rest, Count-length(Const)-8);
format_doc([{emphasis, Const}|Rest], Count) ->
- w("`~s'", [Const]),
+ w("`~ts'", [Const]),
format_doc(Rest, Count-length(Const)-7);
format_doc([{function, Func}|Rest], Count) ->
case Func of
@@ -377,7 +379,7 @@ format_doc([{fenced, Open, Close, Eq}|Rest], Count) ->
format_doc(Rest, Count);
format_doc([{code, Code}|Rest], Count) ->
- w("``~s''", [Code]),
+ w("``~ts''", [Code]),
format_doc(Rest, Count-length(Code)-7);
format_doc([para|Rest], _Count) ->
@@ -387,10 +389,10 @@ format_doc([break|Rest], _Count) ->
w("<br />~n%% ", []),
format_doc(Rest, ?LINE_LEN);
format_doc([{purpose, Purpose}, para | Doc], _Count) ->
- w("%% @doc ~s~n%%~n%% ", [uppercase(Purpose)]),
+ w("%% @doc ~ts~n%%~n%% ", [uppercase(Purpose)]),
format_doc(Doc, ?LINE_LEN);
format_doc([{purpose, Purpose} | Doc], _Count) ->
- w("%% @doc ~s~n%%~n%% ", [Purpose]),
+ w("%% @doc ~ts~n%%~n%% ", [Purpose]),
format_doc(Doc, ?LINE_LEN);
format_doc([listentry|Rest], _Count) ->
w("~n%%~n%% ", []),
@@ -398,11 +400,11 @@ format_doc([listentry|Rest], _Count) ->
format_doc([Str|Rest], Count) ->
case length(Str) of
Len when Len < Count ->
- w("~s", [Str]),
+ w("~ts", [Str]),
format_doc(Rest, Count-Len);
_ ->
{Str1, Str2} = split(Str, Count, []),
- w("~s~n%% ", [Str1]),
+ w("~ts~n%% ", [Str1]),
format_doc([Str2|Rest], ?LINE_LEN)
end;
format_doc([], _) -> ok.
diff --git a/lib/wx/api_gen/gl_scan_doc.erl b/lib/wx/api_gen/gl_scan_doc.erl
index fc7b7cf275..80b4826a30 100644
--- a/lib/wx/api_gen/gl_scan_doc.erl
+++ b/lib/wx/api_gen/gl_scan_doc.erl
@@ -2,7 +2,7 @@
%%--------------------------------------------------------------------
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2012. All Rights Reserved.
+%% Copyright Ericsson AB 2012-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -56,8 +56,10 @@ gen_output({characters, String0}, #state{gen_output=true, type=Type, str=Str} =
mi -> case hd(Str) of
"/" -> String;
"*" -> String;
+ [215] -> String;
"+" -> String;
"-" -> String;
+ "=" -> String;
{fenced,_,_} -> String;
_ ->
[$ |String]
@@ -268,7 +270,9 @@ fix_str([$<|Str]) ->
fix_str([$>|Str]) ->
[$&,$g,$t,$;|fix_str(Str)];
fix_str("&times;"++Str) ->
- [$*|fix_str(Str)];
+ [215|fix_str(Str)];
+%% fix_str([215|Str]) ->
+%% [$*|fix_str(Str)];
fix_str("&Prime;"++Str) ->
[$"|fix_str(Str)];
fix_str("&CenterDot;"++Str) ->
@@ -277,10 +281,12 @@ fix_str("&af;"++Str) ->
fix_str(Str);
fix_str("&it;"++Str) ->
[$ |fix_str(Str)];
+fix_str("&nbsp;"++Str) ->
+ [$ |fix_str(Str)];
fix_str([$&|Str]) ->
[$&,$a,$m,$p,$; |fix_str(Str)];
-fix_str([C|Str]) when C > 255 ->
- fix_str(Str);
+%% fix_str([C|Str]) when C > 255 ->
+%% fix_str(Str);
fix_str([C|Str]) ->
[C|fix_str(Str)];
fix_str([]) -> [].
diff --git a/lib/wx/api_gen/wx_extra/wxPrintout.erl b/lib/wx/api_gen/wx_extra/wxPrintout.erl
index be8f2e2fa5..1dfd86ec62 100644
--- a/lib/wx/api_gen/wx_extra/wxPrintout.erl
+++ b/lib/wx/api_gen/wx_extra/wxPrintout.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -40,7 +40,8 @@ new(Title, OnPrintPage) ->
%% <pre>OnBeginDocument(This,StartPage,EndPage) -> boolean() </pre>
%% <pre>OnEndDocument(This) -> term() </pre>
%% <pre>HasPage(This,Page)} -> boolean() </pre>
-%% <pre>GetPageInfo(This) -> {MinPage:.integer(), MaxPage::integer(), PageFrom::integer(), PageTo::integer()} </pre>
+%% <pre>GetPageInfo(This) -> {MinPage::integer(), MaxPage::integer(),
+%% PageFrom::integer(), PageTo::integer()} </pre>
%% The <b>This</b> argument is the wxPrintout object reference to this object
%% <br /> NOTE: The callbacks may not call other processes.
new(Title, OnPrintPage, Opts) when is_list(Title), is_function(OnPrintPage), is_list(Opts) ->
diff --git a/lib/wx/api_gen/wx_gen.erl b/lib/wx/api_gen/wx_gen.erl
index 7f85151d03..2eb9d9d33d 100644
--- a/lib/wx/api_gen/wx_gen.erl
+++ b/lib/wx/api_gen/wx_gen.erl
@@ -103,7 +103,12 @@ mangle_info({class,CN,P,O,FL}) ->
Event = get_value(event,O, false),
Acc = get_value(acc, O, []),
{Fs,Fopts} = foldr(fun(FWO={F,FO},{Fl,Fopt}) when is_list(FO) ->
- {[F|Fl],[FWO|Fopt]};
+ Opt = case F of
+ {Name, ArgLen} when is_integer(ArgLen) ->
+ {Name, FO};
+ _ -> FWO
+ end,
+ {[F|Fl],[Opt|Fopt]};
(F,{Fl,Fopt}) ->
{[F|Fl], Fopt}
end, {[],[]}, FL),
@@ -421,22 +426,30 @@ select_member(Several, #class{name=Class,file=Orig}, Defs0, Opts) ->
parse_member(Data,MType,Virtual,Opts = #hs{fopt=Fopts}) ->
Parse = fun(Con,A) -> parse_member2(Con,Opts,A) end,
- Method = #method{name=MName,params=PS0} =
+ Method = #method{name=MName,params=PS0} =
foldl(Parse, #method{method_type=MType, virtual=Virtual}, Data),
%% Skip motif name's if it's last and optional
PS2 = case PS0 of %% Backward order..
- [#param{name="name",def=Def,type=#type{name="wxString"}}|PS1]
- when Def =/= none ->
+ [#param{name="name",def=Def,type=#type{name="wxString"}}|PS1]
+ when Def =/= none ->
PS1;
_ ->
PS0
end,
Sz = length(PS2),
- PS = map(fun(P=#param{name=PName}) ->
+ PS = map(fun(P=#param{name=PName}) ->
patch_param(MName,{Sz,PName},P,Fopts)
end, PS2),
- Alias = find_erl_alias_name(MName,PS,Fopts),
- Method#method{params=PS, alias=Alias}.
+ Alias = find_erl_alias_name(MName,PS,Fopts),
+ FOpts = case gb_trees:lookup(MName, Fopts) of
+ {value, FuncO} when is_list(FuncO) ->
+ case lists:keyfind({func,Sz}, 1, FuncO) of
+ false -> FuncO;
+ {_, FuncNO} -> FuncNO
+ end;
+ _ -> []
+ end,
+ Method#method{params=PS, alias=Alias, opts=FOpts}.
find_erl_alias_name(MName,Ps,Fopts) ->
case gb_trees:lookup(MName, Fopts) of
@@ -527,7 +540,7 @@ add_param2(P=#param{name=Name},#hs{fopt=FOpt},M0=#method{name=MName,params=Ps})
M0#method{params=[Patched|Ps]}
end.
-patch_param(Method, Name, P, Opt) ->
+patch_param(Method, Name, P, Opt) ->
case gb_trees:lookup(Method,Opt) of
none -> P;
{value,NoArg} when is_integer(NoArg) -> P;
@@ -560,11 +573,14 @@ handle_param_opt(both, P) -> P#param{in=both};
handle_param_opt({def,Def},P) -> P#param{def=Def};
handle_param_opt({type,Type}, P=#param{type=T}) -> P#param{type=T#type{name=Type}};
handle_param_opt({single,Opt}, P=#param{type=T}) -> P#param{type=T#type{single=Opt}};
+handle_param_opt({base,Enum={enum,Type}}, P=#param{type=T}) -> P#param{type=T#type{base=Enum, name=Type}};
handle_param_opt({base,Opt}, P=#param{type=T}) -> P#param{type=T#type{base=Opt}};
handle_param_opt({c_only,Opt},P) -> P#param{where=c, alt=Opt};
-handle_param_opt({ref, pointer}, P=#param{type=T}) ->
+handle_param_opt({ref, pointer}, P=#param{type=T}) ->
P#param{type=T#type{by_val=false,ref={pointer, 1}}};
-handle_param_opt({mod,Mods}, P=#param{type=T=#type{mod=Mods0}}) ->
+handle_param_opt({by_val, true}, P=#param{type=T}) ->
+ P#param{type=T#type{by_val=true}};
+handle_param_opt({mod,Mods}, P=#param{type=T=#type{mod=Mods0}}) ->
P#param{type=T#type{mod=Mods++Mods0}}.
get_opt(Opt, Method, Sz, Opts) ->
@@ -654,6 +670,12 @@ extract_type_info(#xmlElement{name=ref,attributes=As,content=[#xmlText{value=V}]
{value, #xmlAttribute{value = Kind}} = keysearch(kindref,#xmlAttribute.name,As),
{reverse(foldl(fun extract_type_info2/2, [], string:tokens(V, " "))) ++ Acc,
{Kind,Refid}};
+extract_type_info(#xmlElement{name=ref,attributes=As,content=[#xmlText{value=V}]},
+ {Acc,_}) ->
+ {value, #xmlAttribute{value = Refid}} = keysearch(refid,#xmlAttribute.name,As),
+ {value, #xmlAttribute{value = Kind}} = keysearch(kindref,#xmlAttribute.name,As),
+ {reverse(foldl(fun extract_type_info2/2, [], string:tokens(V, " "))) ++ Acc,
+ {Kind,Refid}};
extract_type_info(What,Acc) ->
?error({parse_error,What,Acc}).
@@ -704,11 +726,9 @@ parse_type2([N="wxTextPos"|R],Info,Opts,T) -> %%long
parse_type2(R,Info,Opts,T#type{name=N,base=int});
parse_type2([N="wxPrintQuality"|R],Info,Opts,T) ->
parse_type2(R,Info,Opts,T#type{name=N,base=int});
-parse_type2([N="wxPaperSize"|R],Info,Opts,T) ->
- parse_type2(R,Info,Opts,T#type{name=N,base=int});
parse_type2(["wxDataFormat"|_R],_Info,_Opts,T) ->
%% Hack Hack
- T#type{name="wxDataFormatId",base=int};
+ T#type{name="wxDataFormatId",base={enum,"wxDataFormatId"}};
parse_type2([N="wxArrayInt"|R],Info,Opts,T) ->
parse_type2(R,Info,Opts,T#type{name=N,base=int,single=array});
parse_type2([N="wxArrayDouble"|R],Info,Opts,T) ->
@@ -1251,7 +1271,7 @@ parse_enums([File|Files], Parsed) ->
case gb_sets:is_member(File,Parsed) of
false ->
FileName = filename:join(["wx_xml",File ++ "_8h.xml"]),
-%% io:format("Parse Enums in ~s ~n", [FileName]),
+ %%io:format("Parse Enums in ~s ~n", [FileName]),
case xmerl_scan:file(FileName, [{space, normalize}]) of
{error, enoent} ->
parse_enums(Files, gb_sets:add(File,Parsed));
@@ -1318,41 +1338,37 @@ extract_enum2([], N, _Id, Acc) ->
extract_enum3([#xmlElement{name=name,content=[#xmlText{value=Name}]}|R], Id, Acc) ->
case lists:keymember(Name, 1, Acc) of
- true -> %% Doxygen double includes some defs.
+ true -> %% Doxygen double includes some defs.
{Acc,Id};
false ->
case Id of
- This = {Str,Num} ->
+ This = {Str,Num} ->
extract_enum3(R, {Str, Num+1}, [{Name,This}|Acc]);
Val ->
extract_enum3(R, Val+1, [{Name,Val}|Acc])
end
end;
-extract_enum3([#xmlElement{name=initializer,
- content=Cs=[#xmlText{}|_]}|_],_Id,[{Name,_}|Acc]) ->
-
- String = lists:append([string:strip(C#xmlText.value) || C <- Cs]),
-
+extract_enum3([#xmlElement{name=initializer,content=Cs}|_],_Id,[{Name,_}|Acc]) ->
+ String = extract_def2(Cs),
Val0 = gen_util:tokens(String,"<& "),
-
- try
+ try
case Val0 of
- ["0x" ++ Val1] ->
+ ["0x" ++ Val1] ->
Val = http_util:hexlist_to_integer(Val1),
{[{Name, Val}|Acc], Val+1};
- [Single] ->
- Val = list_to_integer(Single),
- {[{Name, Val}|Acc], Val+1};
["1", "<<", Shift] ->
Val = 1 bsl list_to_integer(Shift),
{[{Name, Val}|Acc], Val+1};
- [_Str, "+", _What] ->
- Val = lists:append(Val0),
- {[{Name, {Val, 0}}|Acc], {Val,1}};
- _What ->
- %% io:format("~p Name ~p ~p~n",[?LINE, Name, Val0]),
- throw(below)
+ [Str, "+", What] ->
+ Val = list_to_integer(What),
+ {[{Name, {Str, Val}}|Acc], {Str,Val+1}};
+ [Single] ->
+ Val = list_to_integer(Single),
+ {[{Name, Val}|Acc], Val+1};
+ _ ->
+ %% io:format("~p Name ~p ~p ~p~n",[?LINE, Name, Val0, String]),
+ throw(below)
end
catch _:_ ->
{[{Name,{String,0}}|Acc], {String,1}}
@@ -1372,7 +1388,7 @@ extract_defs(Defs, File) ->
end.
extract_defs2(#xmlElement{name=memberdef,content=C},{Acc,Skip}) ->
- try
+ try
Res = {Name,_} = extract_def(C,undefined,Skip),
case gb_sets:is_member(Name,Skip) orelse lists:keymember(Name, 1, Acc) of
true -> {Acc,Skip};
@@ -1380,30 +1396,31 @@ extract_defs2(#xmlElement{name=memberdef,content=C},{Acc,Skip}) ->
end
catch throw:SkipName -> {Acc, gb_sets:add(SkipName,Skip)}
end.
-
+
extract_def([#xmlElement{name=name,content=[#xmlText{value=Name}]}|R], _N, Skip) ->
case Name of
"wxUSE" ++ _ ->
throw(Name);
"wx" ++ _ ->
extract_def(R, Name, Skip);
- _ ->
+ _ ->
throw(Name)
end;
extract_def([#xmlElement{name=param}|_],Name,_) ->
throw(Name);
-extract_def([#xmlElement{name=initializer,content=[#xmlText{value=Val0}]}|_],N,Skip) ->
+extract_def([#xmlElement{name=initializer,content=Cs}|_R],N,Skip) ->
+ Val0 = extract_def2(Cs),
case Val0 of
"0x" ++ Val1 -> {N, http_util:hexlist_to_integer(Val1)};
_ ->
try
Val = list_to_integer(Val0),
{N, Val}
- catch _:_ ->
+ catch _:_ ->
case def_is_ok(Val0, Skip) of
false ->
throw(N);
- NVal when is_integer(NVal) ->
+ NVal when is_integer(NVal) ->
{N, NVal};
NVal ->
{N, {NVal,0}}
@@ -1414,7 +1431,24 @@ extract_def([_|R],N,Skip) ->
extract_def(R,N,Skip);
extract_def(_,N,_) ->
throw(N).
-
+
+extract_def2([#xmlText{value=Val}|R]) ->
+ strip_comment(string:strip(Val)) ++ extract_def2(R);
+extract_def2([#xmlElement{content=Cs}|R]) ->
+ extract_def2(Cs) ++ extract_def2(R);
+extract_def2([]) -> [].
+
+strip_comment("/*" ++ Rest) ->
+ strip_comment_until_end(Rest);
+strip_comment("//" ++ _) -> [];
+strip_comment([H|R]) -> [H | strip_comment(R)];
+strip_comment([]) -> [].
+
+strip_comment_until_end("*/" ++ Rest) ->
+ strip_comment(Rest);
+strip_comment_until_end([_|R]) ->
+ strip_comment_until_end(R).
+
def_is_ok(Name, Skip) ->
Toks = gen_util:tokens(Name,"()| \\:"),
R = def_is_ok(Toks, Skip, []),
diff --git a/lib/wx/api_gen/wx_gen.hrl b/lib/wx/api_gen/wx_gen.hrl
index 426e3adfae..89577b9707 100644
--- a/lib/wx/api_gen/wx_gen.hrl
+++ b/lib/wx/api_gen/wx_gen.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -44,7 +44,8 @@
doc, % Extra documentation
virtual, % Is virtual?
pre_hook = [], % Pre hook before call in c-code
- post_hook = [] % Post hook after call in c-code
+ post_hook = [], % Post hook after call in c-code
+ opts = [] % Options
}
).
diff --git a/lib/wx/api_gen/wx_gen_cpp.erl b/lib/wx/api_gen/wx_gen_cpp.erl
index 2209e4a53b..293c97507e 100644
--- a/lib/wx/api_gen/wx_gen_cpp.erl
+++ b/lib/wx/api_gen/wx_gen_cpp.erl
@@ -118,12 +118,18 @@ gen_constructors(#class{name=Class, methods=Ms0}) ->
gen_constructor(_Class, #method{where=merged_c}) -> ok;
gen_constructor(_Class, #method{where=erl_no_opt}) -> ok;
-gen_constructor(Class, _M=#method{params=Ps}) ->
+gen_constructor(Class, _M=#method{params=Ps, opts=FOpts}) ->
Gen1 = fun(#param{name=N, type=T}) -> gen_type(T,1) ++ N end,
Gen2 = fun(#param{name=N, type=T}) -> gen_type(T,2) ++ N end,
CallA = fun(#param{name=N}) -> N end,
HaveMergedType = fun(#param{type={merged,_,_,_,_,_,_}}) -> true; (_) -> false end,
?WTC("gen_constructor"),
+ Endif = case lists:keysearch(deprecated, 1, FOpts) of
+ {value, {deprecated, IfDef}} ->
+ w("#if ~s~n", [IfDef]),
+ true;
+ _ -> false
+ end,
case lists:any(HaveMergedType, Ps) of
false ->
w(" E~s(~s) : ~s(~s) {};~n",
@@ -133,7 +139,9 @@ gen_constructor(Class, _M=#method{params=Ps}) ->
[Class,args(Gen1,",",Ps),Class,args(CallA,",",Ps)]),
w(" E~s(~s) : ~s(~s) {};~n",
[Class,args(Gen2,",",Ps),Class,args(CallA,",",Ps)])
- end.
+ end,
+ Endif andalso w("#endif~n", []),
+ ok.
gen_type(#type{name=Type, ref={pointer,1}, mod=Mod},_) ->
mods(Mod) ++ to_string(Type) ++ " * ";
@@ -162,6 +170,14 @@ gen_funcs(Defs) ->
w("#include \"wxe_macros.h\"~n"),
w("#include \"wxe_derived_dest.h\"~n~n"),
+ w("#if !wxCHECK_VERSION(2,9,0)~n", []),
+ [w("#define ~p int~n", [Enum]) ||
+ Enum <- [wxPenJoin, wxPenCap, wxImageResizeQuality, %%wxBitmapType,
+ wxPolygonFillMode, wxMappingMode, wxRasterOperationMode,
+ wxFloodFillStyle
+ ]],
+ w("#endif~n",[]),
+
w("void WxeApp::wxe_dispatch(wxeCommand& Ecmd)~n{~n"),
w(" char * bp = Ecmd.buffer;~n"),
w(" wxeMemEnv *memenv = getMemEnv(Ecmd.port);~n"),
@@ -292,10 +308,16 @@ gen_method(CName, M=#method{name=N,params=[Ps],method_type=destructor,id=MethodI
ignore
end,
M;
-gen_method(CName, M=#method{name=N,params=Ps0,type=T,method_type=MT,id=MethodId}) ->
+gen_method(CName, M=#method{name=N,params=Ps0,type=T,method_type=MT,id=MethodId, opts=FOpts}) ->
put(current_func, N),
put(bin_count,-1),
?WTC("gen_method"),
+ Endif = case lists:keysearch(deprecated, 1, FOpts) of
+ {value, {deprecated, IfDef}} ->
+ w("#if ~s~n", [IfDef]),
+ true;
+ _ -> false
+ end,
w("case ~s: { // ~s::~s~n", [wx_gen_erl:get_unique_name(MethodId),CName,N]),
Ps1 = declare_variables(void, Ps0),
{Ps2,Align} = decode_arguments(Ps1),
@@ -314,6 +336,7 @@ gen_method(CName, M=#method{name=N,params=Ps0,type=T,method_type=MT,id=MethodId
free_args(),
build_return_vals(T,Ps3),
w(" break;~n}~n", []),
+ Endif andalso w("#endif~n", []),
erase(current_func),
M.
@@ -746,7 +769,7 @@ return_res1(#type{name=Type,ref={pointer,_}, base={term,_}}) ->
{Type ++ " * Result = (" ++ Type ++ "*)", ""};
return_res1(#type{name=Type,ref={pointer,_}}) ->
{Type ++ " * Result = (" ++ Type ++ "*)", ""};
-return_res1(#type{name=Type,single=true,ref=reference}) ->
+return_res1(#type{name=Type,single=true,by_val=false,ref=reference}) ->
{Type ++ " * Result = &", ""};
return_res1(#type{name=Type,single=true,by_val=true})
when is_atom(Type) ->
@@ -758,7 +781,7 @@ return_res1(#type{name=Type,base={class,_},single=list,ref=reference}) ->
return_res1(#type{name=Type,base={comp,_,_},single=array,by_val=true}) ->
{Type ++ " Result = ", ""};
return_res1(#type{name=Type,single=true,by_val=true, base={class, _}}) ->
- %% Memory leak !!!!!! XXXX BUGBUG FIXME or doument!!
+ %% Temporary memory leak !!!!!!
case Type of
"wxImage" -> ok;
"wxFont" -> ok;
@@ -769,7 +792,6 @@ return_res1(#type{name=Type,single=true,by_val=true, base={class, _}}) ->
io:format("~s::~s Building return value of temp ~s~n",
[get(current_class),get(current_func),Type])
end,
- %% #class{id=Id} = get({class,Type}),
{Type ++ " * Result = new " ++ Type ++ "(", "); newPtr((void *) Result,"
++ "3, memenv);"};
return_res1(#type{base={enum,_Type},single=true,by_val=true}) ->
@@ -794,15 +816,14 @@ call_arg(#param{where=c, alt={length,Alt}}) when is_list(Alt) ->
call_arg(#param{where=c, alt={size,Id}}) when is_integer(Id) ->
%% It's a binary
"Ecmd.bin["++ integer_to_list(Id) ++ "]->size";
-call_arg(#param{name=N,def=Def,type=#type{name=Type,by_val=true,single=true,base=Base}})
+call_arg(#param{name=N,def=Def,type=#type{by_val=true,single=true,base=Base}})
when Base =:= int; Base =:= long; Base =:= float; Base =:= double; Base =:= bool ->
case Def of
- none -> "(" ++ to_string(Type) ++ ") *" ++ N;
+ none -> "*" ++ N;
_ -> N
end;
-
-call_arg(#param{name=N,type=#type{base={enum,Type}, by_val=true,single=true}}) ->
- "(" ++ enum_type(Type) ++") " ++ N;
+call_arg(#param{name=N,type=#type{base={enum,_Type}, by_val=true,single=true}}) ->
+ N;
call_arg(#param{name=N,type=#type{base={class,_},by_val=true,single=true}}) -> "*" ++ N;
call_arg(#param{name=N,type=#type{base={class,_},ref=reference,single=true}}) -> "*" ++ N;
call_arg(#param{name=N,type=#type{base=eventType}}) ->
@@ -823,8 +844,8 @@ call_arg(#param{name=N,type={merged,_,#type{base={class,_},single=true,
ref=Ref},_,_,_,_}})
when ByVal =:= true; Ref =:= reference ->
"*" ++ N;
-call_arg(#param{def=Def, type=void}) when Def =/= none -> Def;
-call_arg(#param{def=Def, type=voidp}) when Def =/= none -> Def;
+call_arg(#param{def=Def, type=void}) when Def =/= none -> Def;
+call_arg(#param{def=Def, type=voidp}) when Def =/= none -> "(void **) " ++ Def;
call_arg(#param{name=N,type=#type{base={ref,_},by_val=true,single=true}}) -> N;
call_arg(#param{name=N,type={merged,_,_,_,_,_,_}}) -> N.
@@ -932,10 +953,18 @@ build_ret(Name,_,#type{base={enum,_Type},single=true}) ->
w(" rt.addInt(~s);~n",[Name]);
build_ret(Name,_,#type{base={comp,_,{record, _}},single=true}) ->
w(" rt.add(~s);~n", [Name]);
+build_ret(Name,{ret,_},#type{base={comp,_,_},single=true, by_val=true}) ->
+ w(" rt.add(~s);~n",[Name]);
build_ret(Name,{ret,_},#type{base={comp,_,_},single=true, ref=reference}) ->
w(" rt.add((*~s));~n",[Name]);
build_ret(Name,_,#type{base={comp,_,_},single=true}) ->
w(" rt.add(~s);~n",[Name]);
+build_ret(Name = "ev->m_scanCode",_,#type{base=bool,single=true,by_val=true}) ->
+ %% Hardcoded workaround for 2.9 and later
+ w("#if !wxCHECK_VERSION(2,9,0)~n", []),
+ w(" rt.addBool(~s);~n",[Name]),
+ w("#else~n rt.addBool(false);~n",[]),
+ w("#endif~n",[]);
build_ret(Name,_,#type{base=bool,single=true,by_val=true}) ->
w(" rt.addBool(~s);~n",[Name]);
build_ret(Name,{arg, both},#type{base=int,single=true,mod=M}) ->
diff --git a/lib/wx/api_gen/wx_gen_erl.erl b/lib/wx/api_gen/wx_gen_erl.erl
index a8f23575f3..a999a869e6 100644
--- a/lib/wx/api_gen/wx_gen_erl.erl
+++ b/lib/wx/api_gen/wx_gen_erl.erl
@@ -70,8 +70,7 @@ gen_class1(C=#class{name=Name,parent="static",methods=Ms,options=_Opts}) ->
Exp = fun(M) -> gen_export(C,M) end,
ExportList = lists:usort(lists:append(lists:map(Exp,reverse(Ms)))),
- w("-export([~s]).~n~n", [args(fun(EF) -> EF end, ",", ExportList, 60)]),
-
+ w("-export([~s]).~n~n", [args(fun({EF,_}) -> EF end, ",", ExportList, 60)]),
Gen = fun(M) -> gen_method(Name,M) end,
NewMs = lists:map(Gen,reverse(Ms)),
@@ -134,7 +133,7 @@ gen_class1(C=#class{name=Name,parent=Parent,methods=Ms,options=Opts}) ->
w("-include(\"wxe.hrl\").~n",[]),
Exp = fun(M) -> gen_export(C,M) end,
ExportList = lists:usort(lists:append(lists:map(Exp,reverse(Ms)))),
- w("-export([~s]).~n~n", [args(fun(EF) -> EF end, ",", ExportList, 60)]),
+ w("-export([~s]).~n~n", [args(fun({EF,_}) -> EF end, ",", ExportList, 60)]),
w("%% inherited exports~n",[]),
Done0 = ["Destroy", "New", "Create", "destroy", "new", "create"],
Done = gb_sets:from_list(Done0 ++ [M|| #method{name=M} <- lists:append(Ms)]),
@@ -143,6 +142,10 @@ gen_class1(C=#class{name=Name,parent=Parent,methods=Ms,options=Opts}) ->
lists:usort(["parent_class/1"|InExported]),
60)]),
w("-export_type([~s/0]).~n", [Name]),
+ case lists:filter(fun({_F,Depr}) -> Depr end, ExportList) of
+ [] -> ok;
+ Depr -> w("-deprecated([~s]).~n~n", [args(fun({EF,_}) -> EF end, ",", Depr, 60)])
+ end,
w("%% @hidden~n", []),
parents_check(Parents),
w("-type ~s() :: wx:wx_object().~n", [Name]),
@@ -218,33 +221,40 @@ gen_export(#class{name=Class,abstract=Abs},Ms0) ->
case Res of
[] -> [];
[M=#method{where=taylormade}|_] ->
- [taylormade_export(Class, M)];
+ [deprecated(M, taylormade_export(Class, M))];
Ms ->
- GetF = fun(#method{method_type=constructor,where=W,params=Ps}) ->
+ GetF = fun(M=#method{method_type=constructor,where=W,params=Ps}) ->
{Args,Opts} = split_optional(Ps),
OptLen = case Opts of
[] -> 0;
_ when W =:= erl_no_opt -> 0;
_ -> 1
end,
- "new/" ++ integer_to_list(length(Args)+OptLen);
- (#method{method_type=destructor}) ->
+ deprecated(M, "new" ++ "/" ++ integer_to_list(length(Args)+OptLen));
+ (M=#method{method_type=destructor}) ->
case Abs of
true -> [];
- _ -> "destroy/1"
+ _ -> deprecated(M, "destroy/1")
end;
- (#method{name=N,alias=A,where=W, params=Ps}) ->
+ (M=#method{name=N,alias=A,where=W, params=Ps}) ->
{Args,Opts} = split_optional(Ps),
OptLen = case Opts of
[] -> 0;
_ when W =:= erl_no_opt -> 0;
_ -> 1
end,
- erl_func_name(N,A) ++ "/" ++ integer_to_list(length(Args) + OptLen)
+ deprecated(M, erl_func_name(N,A) ++ "/" ++ integer_to_list(length(Args) + OptLen))
end,
lists:map(GetF, Ms)
end.
+deprecated(#method{opts=FOpts}, FA) ->
+ case lists:keysearch(deprecated, 1, FOpts) of
+ {value, {deprecated, _}} ->
+ {FA,true};
+ _ ->
+ {FA,false}
+ end.
gen_method(Class,Ms0) ->
RemoveC = fun(#method{where=merged_c}) -> false;(_Other) -> true end,
@@ -832,15 +842,20 @@ doc_enum(_,Ps) ->
[doc_enum_type(Type,Name) || #param{name=Name, type=#type{base={enum,Type}}} <- Ps].
doc_enum_type(Type, Name) ->
- {Enum0, #enum{vals=Vals}} = wx_gen:get_enum(Type),
- Enum = case Enum0 of {_, E} -> E; E -> E end,
- Consts = get(consts),
- Format = fun({N,_What}) ->
- #const{name=N} = gb_trees:get(N, Consts),
- "?" ++ enum_name(N)
- end,
- Vs = args(Format, " | ", Vals),
- {uppercase(Enum),Name, Vs}.
+ try
+ {Enum0, #enum{vals=Vals}} = wx_gen:get_enum(Type),
+ Enum = case Enum0 of {_, E} -> E; E -> E end,
+ Consts = get(consts),
+ Format = fun({N,_What}) ->
+ #const{name=N} = gb_trees:get(N, Consts),
+ "?" ++ enum_name(N)
+ end,
+ Vs = args(Format, " | ", Vals),
+ {uppercase(Enum),Name, Vs}
+ catch _:_ ->
+ io:format("Warning missing enum type ~p~n", [Type]),
+ {uppercase(Type),Name,"integer"}
+ end.
doc_enum_desc([]) -> ok;
doc_enum_desc([{_Enum,Name,Vs}|R]) ->
@@ -1014,11 +1029,23 @@ align(64, 1, Str) -> {"0:32," ++ Str,0};
align(Sz, W, Str) -> align(Sz, W rem 2, Str).
enum_name(Name) ->
+ case enum_split(Name) of
+ {undefined, _} -> Name;
+ {_C, ErlName} -> ErlName
+ end.
+
+enum_split(Name) ->
case string:tokens(Name, ":") of
- [Name] -> Name;
- [C,N] -> C ++ "_" ++ N
+ [Name] -> {undefined, Name};
+ [C,N] -> {C, enum_name(C,N)}
end.
+enum_name(undefined, Name) -> Name;
+enum_name(Enum, Name) -> Enum ++ "_" ++ Name.
+
+enum_name_c(undefined, Name) -> Name;
+enum_name_c(Enum, Name) -> Enum ++ "::" ++ Name.
+
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
gen_enums_ints() ->
@@ -1058,6 +1085,14 @@ build_enum_ints(#enum{from=From, vals=Vals},Done) ->
w("% From class ~s::~s~n",[Class, Name])
end,
+ Consts = get(consts),
+ Ignore = fun(Name) ->
+ case gb_trees:lookup(Name, Consts) of
+ {value, Const} -> Const;
+ none -> true
+ end
+ end,
+
Format = fun(#const{name="wxEVT_" ++ _}) ->
ignore; %% Ignore event macros they are not valid in our event model
(#const{name=Name,val=Value,is_const=true}) when is_number(Value) ->
@@ -1065,44 +1100,57 @@ build_enum_ints(#enum{from=From, vals=Vals},Done) ->
(#const{name=Name,val=Value,is_const=false}) when is_number(Value) ->
w("-define(~s, wxe_util:get_const(~s)).~n", [enum_name(Name),enum_name(Name)]);
(#const{name=Name,val={Str,0}}) ->
+ {EnumClass, EnumName} = enum_split(Name),
case string:tokens(Str, " |()") of
[Token] ->
- w("-define(~s, ~s).~n", [enum_name(Name),const_value(Token)]);
+ w("-define(~s, ~s).~n", [EnumName,const_value(Token, EnumClass, Ignore)]);
Tokens ->
- Def = args(fun(T) -> const_value(T) end, " bor ", Tokens),
- w("-define(~s, (~s)).~n", [enum_name(Name),Def])
+ Def = args(fun(T) -> const_value(T, EnumClass, Ignore) end, " bor ", Tokens),
+ w("-define(~s, (~s)).~n", [EnumName, Def])
end;
(#const{name=Name,val={Str,N}}) ->
+ {EnumClass, EnumName} = enum_split(Name),
case string:tokens(Str, " |()") of
[Token] ->
- w("-define(~s, (?~s+~p)).~n", [enum_name(Name),Token,N])
+ w("-define(~s, (~s+~p)).~n", [EnumName,const_value(Token, EnumClass, Ignore),N])
end
end,
- Consts = get(consts),
+
Write = fun({Name,_What}, Skip) ->
- case gb_sets:is_member(Name,Skip) of
- true ->
- Skip;
- false ->
- case gb_trees:lookup(Name, Consts) of
- {value, Const} ->
- Format(Const),
- gb_sets:add(Name,Skip);
- none -> Skip
- end
+ case gb_sets:is_member(Name,Skip) orelse Ignore(Name) of
+ true -> Skip;
+ Const ->
+ try Format(Const)
+ catch {unknown_value, _Error} ->
+ %% io:format("Const ~s uses unknown define ~p ignoring~n", [Name, _Error]),
+ ok
+ end,
+ gb_sets:add(Name,Skip)
end
end,
lists:foldl(Write, Done, Vals).
-const_value(V) when is_integer(V) -> integer_to_list(V);
-const_value(V = "16#" ++ IntList) ->
+const_value(V,_,_) when is_integer(V) -> integer_to_list(V);
+const_value(V = "16#" ++ IntList,_,_) ->
_ = http_util:hexlist_to_integer(IntList), %% ASSERT
V;
-const_value(V0) ->
+const_value(V0, EnumClass, Ignore) ->
try
_ = list_to_integer(V0),
V0
- catch _:_ -> [$?|V0]
+ catch _:_ ->
+ EEnum = enum_name(EnumClass, V0),
+ CEnum = enum_name_c(EnumClass, V0),
+ case Ignore(CEnum) of
+ true when CEnum == V0 ->
+ throw({unknown_value, EEnum});
+ true ->
+ case Ignore(V0) of
+ true -> throw({unknown_value, EEnum});
+ _ -> [$?|V0]
+ end;
+ _ -> [$?|EEnum]
+ end
end.
gen_event_recs() ->
diff --git a/lib/wx/api_gen/wxapi.conf b/lib/wx/api_gen/wxapi.conf
index 1f6225ce60..94142ff6ba 100644
--- a/lib/wx/api_gen/wxapi.conf
+++ b/lib/wx/api_gen/wxapi.conf
@@ -148,7 +148,8 @@
{class, wxTopLevelWindowGTK, wxWindow,
[{alias, [{wxTopLevelWindowGTK, wxTopLevelWindow}]}],
- ['GetIcon','GetIcons','GetTitle','IsActive','Iconize',
+ [{'GetIcon', [{return, {by_val, true}}]},
+ 'GetIcons','GetTitle','IsActive','Iconize',
'IsFullScreen','IsIconized','IsMaximized','Maximize',
'RequestUserAttention','SetIcon','SetIcons',
'CenterOnScreen', 'CentreOnScreen',
@@ -279,8 +280,11 @@
{class, wxGridCellEditor, root, [],
['Create',
'IsCreated', 'SetSize', 'Show',
- 'PaintBackground', 'BeginEdit', 'EndEdit', 'Reset', 'StartingKey',
- 'StartingClick', 'HandleReturn'
+ {'PaintBackground', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ 'BeginEdit',
+ {'EndEdit', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ 'Reset', 'StartingKey',
+ 'StartingClick', 'HandleReturn'
%'Destroy','Clone','~wxGridCellEditor',
]}.
@@ -319,17 +323,25 @@
{class, wxDC, object,
[{skip, [{'DrawEllipse',5},{'DrawRectangle',5},
{'DrawRoundedRectangle',6},{'SetClippingRegion',5}]}],
- [{'Blit',7},'CalcBoundingBox','Clear','ComputeScaleAndOrigin',{'CrossHair',1},
+ [{{'Blit',7},[{"rop", [{base, {enum, "wxRasterOperationMode"}}]}]},
+ 'CalcBoundingBox','Clear',
+ {'ComputeScaleAndOrigin',[{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ {'CrossHair',1},
'DestroyClippingRegion','DeviceToLogicalX','DeviceToLogicalXRel',
'DeviceToLogicalY','DeviceToLogicalYRel',{'DrawArc',3},{'DrawBitmap',3},
{'DrawCheckMark',1},{'DrawCircle',2},'DrawEllipse',{'DrawEllipticArc',4},
{'DrawIcon',2},{'DrawLabel',4},{'DrawLine',2},
{'DrawLines', [{"n",{c_only,{length,"points"}}}]},
- {'DrawPolygon', [{"n",{c_only,{length,"points"}}}]}, %'DrawPolyPolygon',
+ {'DrawPolygon', [{"n",{c_only,{length,"points"}}},
+ {"fillStyle", [{base, {enum, "wxPolygonFillMode"}}]}
+ ]},
+ %%'DrawPolyPolygon',
{'DrawPoint',1},'DrawRectangle',
{'DrawRotatedText',3}, 'DrawRoundedRectangle',%'DrawSpline',
{'DrawText',2},
- 'EndDoc','EndPage',{'FloodFill',3},'GetBackground','GetBackgroundMode',
+ 'EndDoc','EndPage',
+ {{'FloodFill',3},[{"style", [{base, {enum, "wxFloodFillStyle"}}]}]},
+ 'GetBackground','GetBackgroundMode',
'GetBrush','GetCharHeight','GetCharWidth',{'GetClippingBox',[{"rect", skip_member}]},
'GetFont','GetLayoutDirection','GetLogicalFunction','GetMapMode','GetMultiLineTextExtent',
{'GetPartialTextExtents', [{"widths", out}]},
@@ -340,21 +352,33 @@
'LogicalToDeviceX','LogicalToDeviceXRel','LogicalToDeviceY','LogicalToDeviceYRel',
'MaxX','MaxY','MinX','MinY','IsOk','ResetBoundingBox','SetAxisOrientation',
'SetBackground','SetBackgroundMode','SetBrush','SetClippingRegion','SetDeviceOrigin',
- 'SetFont','SetLayoutDirection','SetLogicalFunction','SetMapMode', 'SetPalette',
+ 'SetFont','SetLayoutDirection',
+ {'SetLogicalFunction', [{"function", [{base, {enum, "wxRasterOperationMode"}}]}]},
+ {'SetMapMode', [{"mode", [{base, {enum, "wxMappingMode"}}]}]},
+ 'SetPalette',
'SetPen','SetTextBackground','SetTextForeground','SetUserScale','StartDoc','StartPage']}.
{class,wxMirrorDC, wxDC, [], ['wxMirrorDC', '~wxMirrorDC']}.
{class,wxScreenDC, wxDC, [], ['wxScreenDC', '~wxScreenDC']}.
-{class,wxPostScriptDC,wxDC,[],['wxPostScriptDC','~wxPostScriptDC','SetResolution','GetResolution']}.
-{class,wxWindowDC, wxDC, [], ['wxWindowDC', '~wxWindowDC']}.
-{class,wxClientDC,wxWindowDC,[],['wxClientDC', '~wxClientDC']}.
-{class,wxPaintDC, wxWindowDC, [], ['wxPaintDC', '~wxPaintDC']}.
+{class,wxPostScriptDC,wxDC,[],
+ ['wxPostScriptDC','~wxPostScriptDC',
+ {'SetResolution', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ {'GetResolution', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]}]}.
+{class,wxWindowDC, wxDC, [],
+ [{'wxWindowDC', [{{func, 0}, [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]}]},
+ '~wxWindowDC']}.
+{class,wxClientDC,wxWindowDC,[],
+ [{'wxClientDC', [{{func, 0}, [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]}]},
+ '~wxClientDC']}.
+{class,wxPaintDC, wxWindowDC, [],
+ [{'wxPaintDC', [{{func, 0}, [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]}]},
+ '~wxPaintDC']}.
%%{class,wxPrinterDC, wxDC, [], ['wxPrinterDC','GetPaperRect']}. Not in GTK
{class,wxMemoryDC, wxDC, [], ['wxMemoryDC', '~wxMemoryDC','SelectObject','SelectObjectAsSource']}.
{class,wxBufferedDC,wxMemoryDC,[],['wxBufferedDC','~wxBufferedDC','Init']}.
{class,wxBufferedPaintDC,wxBufferedDC,[],['wxBufferedPaintDC', '~wxBufferedPaintDC']}.
%% Only a typedef!
-%%{class,wxAutoBufferedPaintDC,wxBufferedPaintDC,[],['wxAutoBufferedPaintDC']}.
+%%{class,wxAutoBufferedPaintDC,wxBufferedPaintDC,[],['wxAutoBufferedPaintDC']}.
{class, wxGraphicsObject, object, [{ifdef, wxUSE_GRAPHICS_CONTEXT}],
['~wxGraphicsObject', 'GetRenderer','IsNull']}.
@@ -362,13 +386,17 @@
[{ifdef, wxUSE_GRAPHICS_CONTEXT}, {skip, [{'StrokeLines',4}]}],
['~wxGraphicsContext',
'Create', %%CreateFromNative CreateFromNativeWindow
- 'CreatePen','CreateBrush','CreateRadialGradientBrush',
- 'CreateLinearGradientBrush','CreateFont','CreateMatrix',
+ 'CreatePen','CreateBrush',
+ {'CreateRadialGradientBrush', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ {'CreateLinearGradientBrush', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ 'CreateFont','CreateMatrix',
'CreatePath','Clip','ResetClip',
'DrawBitmap','DrawEllipse','DrawIcon',
- {'DrawLines', [{"n",{c_only,{length,"points"}}}, {"points", {single,array}}]},
- 'DrawPath',
- 'DrawRectangle','DrawRoundedRectangle','DrawText','FillPath',
+ {'DrawLines', [{"n",{c_only,{length,"points"}}}, {"points", {single,array}},
+ {"fillStyle", [{base, {enum, "wxPolygonFillMode"}}]}]},
+ {'DrawPath',[{"fillStyle", [{base, {enum, "wxPolygonFillMode"}}]}]},
+ 'DrawRectangle','DrawRoundedRectangle','DrawText',
+ {'FillPath',[{"fillStyle", [{base, {enum, "wxPolygonFillMode"}}]}]},
'StrokePath', %% 'GetNativeContext',
{'GetPartialTextExtents', [{"widths", out}]},
'GetTextExtent','Rotate','Scale','Translate',
@@ -383,15 +411,18 @@
{class, wxGraphicsPath, wxGraphicsObject, [{ifdef, wxUSE_GRAPHICS_CONTEXT}],
['MoveToPoint','AddArc','AddArcToPoint','AddCircle','AddCurveToPoint',
'AddEllipse','AddLineToPoint','AddPath','AddQuadCurveToPoint',
- 'AddRectangle','AddRoundedRectangle','CloseSubpath','Contains',
- 'GetBox','GetCurrentPoint','Transform'
+ 'AddRectangle','AddRoundedRectangle','CloseSubpath',
+ {'Contains', [{"fillStyle", [{base, {enum, "wxPolygonFillMode"}}]}]},
+ 'GetBox','GetCurrentPoint','Transform'
%'GetNativePath','UnGetNativePath'
]}.
{class, wxGraphicsRenderer, object, [{ifdef, wxUSE_GRAPHICS_CONTEXT}],
['GetDefaultRenderer','CreateContext',
%%'CreateContextFromNativeContext', 'CreateContextFromNativeWindow',
'CreatePen','CreateBrush',
- 'CreateLinearGradientBrush','CreateRadialGradientBrush','CreateFont',
+ {'CreateLinearGradientBrush', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ {'CreateRadialGradientBrush', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ 'CreateFont',
'CreateMatrix','CreatePath']}.
{class, wxGraphicsPen, wxGraphicsObject,[{ifdef, wxUSE_GRAPHICS_CONTEXT}], []}.
@@ -501,10 +532,12 @@
'CopyFromBitmap','~wxIcon']}.
{class, wxIconBundle, root, [],
- ['wxIconBundle','~wxIconBundle','AddIcon','GetIcon']}.
+ ['wxIconBundle','~wxIconBundle','AddIcon',
+ {'GetIcon', [{return, {by_val, true}}]}]}.
{class, wxCursor, wxBitmap,[],
- [{'wxCursor',[{"bits",[in,{base,binary},{single,true}]},
+ [{'wxCursor',[{{func, 5}, [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ {"bits",[in,{base,binary},{single,true}]},
{"maskBits",nowhere},{"fg",nowhere},{"bg",nowhere}]},
'~wxCursor','Ok']}.
@@ -549,16 +582,22 @@
{'GetAlpha',[{{0,return},{base,{binary,"(This->GetWidth()*This->GetHeight())"}}}]},
'GetBlue',
{'GetData', [{return,{base,{binary,"(This->GetWidth()*This->GetHeight()*3)"}}}]},
- 'GetGreen', 'GetImageCount', %'GetHandlers',
+ 'GetGreen',
+ {'GetImageCount', [{"type", [{base, {enum, "wxBitmapType"}}]}]},
+ %%'GetHandlers',
'GetHeight','GetMaskBlue','GetMaskGreen',
'GetMaskRed','GetOrFindMaskColour','GetPalette',
'GetRed','GetSubImage', 'GetWidth',%%':HSVValue', 'HSVtoRGB',
'HasAlpha','HasMask','GetOption','GetOptionInt','HasOption',
'InitAlpha','InitStandardHandlers',%'InsertHandler',
'IsTransparent', 'LoadFile','Ok',%%RGBValue 'RGBtoHSV',
- 'RemoveHandler','Mirror','Replace','Rescale','Resize',
+ 'RemoveHandler','Mirror','Replace',
+ {'Rescale', [{"quality", [{base, {enum, "wxImageResizeQuality"}}]}]},
+ 'Resize',
'Rotate', 'RotateHue',
- 'Rotate90','SaveFile','Scale','Size',
+ 'Rotate90','SaveFile',
+ {'Scale', [{"quality", [{base, {enum, "wxImageResizeQuality"}}]}]},
+ 'Size',
{'SetAlpha', [{{2,"alpha"},[in,{base,binary}, {def, none}]},
{{2,pre_hook},
[{c, "if(!static_data) {"
@@ -576,15 +615,20 @@
'SetRGB']}.
{class, wxBrush, object, [],
- ['wxBrush','~wxBrush','GetColour','GetStipple','GetStyle',
+ ['wxBrush','~wxBrush',
+ {'GetColour', [{return, {by_val, true}}]},
+ 'GetStipple','GetStyle',
'IsHatch','IsOk','SetColour','SetStipple','SetStyle']}.
{class, wxPen, object, [],
- ['wxPen','~wxPen','GetCap','GetColour',
+ ['wxPen','~wxPen','GetCap',
+ {'GetColour', [{return, {by_val, true}}]},
%%'GetDashes', %'GetStipple',
- 'GetJoin', 'GetStyle','GetWidth','IsOk','SetCap','SetColour',
+ 'GetJoin', 'GetStyle','GetWidth','IsOk',
+ {'SetCap', [{"capStyle", [{base, {enum, "wxPenCap"}}]}]},
+ 'SetColour',
%%'SetDashes', %'SetStipple',
- 'SetJoin', 'SetStyle','SetWidth']}.
+ {'SetJoin', [{"joinStyle", [{base, {enum, "wxPenJoin"}}]}]}, 'SetStyle','SetWidth']}.
{enum, wxRegionContain, "wx"}.
@@ -683,8 +727,11 @@
['wxButton','~wxButton','Create',%'GetLabel',
'GetDefaultSize', 'SetDefault','SetLabel']}.
{class, wxBitmapButton, wxButton, [],
- ['wxBitmapButton','~wxBitmapButton','Create','GetBitmapDisabled',
- 'GetBitmapFocus','GetBitmapLabel','GetBitmapSelected',
+ ['wxBitmapButton','~wxBitmapButton','Create',
+ {'GetBitmapDisabled', [{return, {by_val, true}}]},
+ {'GetBitmapFocus', [{return, {by_val, true}}]},
+ {'GetBitmapLabel', [{return, {by_val, true}}]},
+ {'GetBitmapSelected', [{return, {by_val, true}}]},
'SetBitmapDisabled','SetBitmapFocus','SetBitmapLabel','SetBitmapSelected']}.
{class, wxToggleButton, wxControl, [],
['wxToggleButton','~wxToggleButton','Create','GetValue','SetValue']}.
@@ -693,8 +740,10 @@
{class, wxDateTime, root, [ignore], []}. %% Only for ifdefs and enums
{class, wxCalendarCtrl, wxControl, [],
- ['wxCalendarCtrl','Create','~wxCalendarCtrl','SetDate','GetDate',
- 'EnableYearChange','EnableMonthChange','EnableHolidayDisplay',
+ ['wxCalendarCtrl','Create','~wxCalendarCtrl','SetDate',
+ {'GetDate', [{return, {by_val, true}}]},
+ {'EnableYearChange', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]}, %% Temp bug in wx I assume
+ 'EnableMonthChange','EnableHolidayDisplay',
'SetHeaderColours','GetHeaderColourFg','GetHeaderColourBg',
'SetHighlightColours','GetHighlightColourFg','GetHighlightColourBg',
'SetHolidayColours','GetHolidayColourFg','GetHolidayColourBg',
@@ -816,8 +865,9 @@
{enum, wxTextAttrAlignment, "wxTEXT_ALIGNMENT_"}.
{class, wxTextAttr, root, [],
- ['wxTextAttr','GetAlignment','GetBackgroundColour','GetFont','GetLeftIndent',
- 'GetLeftSubIndent','GetRightIndent','GetTabs','GetTextColour',
+ ['wxTextAttr','GetAlignment','GetBackgroundColour',
+ {'GetFont', [{return, {by_val, true}}]},
+ 'GetLeftIndent','GetLeftSubIndent','GetRightIndent','GetTabs','GetTextColour',
'HasBackgroundColour','HasFont','HasTextColour','GetFlags','IsDefault',
'SetAlignment','SetBackgroundColour','SetFlags','SetFont','SetLeftIndent',
'SetRightIndent','SetTabs','SetTextColour']}.
@@ -1233,7 +1283,8 @@
{class, wxMDIParentFrame, wxFrame, [],
[
- 'wxMDIParentFrame', '~wxMDIParentFrame', 'ActivateNext', 'ActivatePrevious',
+ 'wxMDIParentFrame',
+ '~wxMDIParentFrame', 'ActivateNext', 'ActivatePrevious',
'ArrangeIcons', 'Cascade', 'Create',
%%'GetClientSize', 'GetToolBar', 'SetToolBar', defined in parent
'GetActiveChild', 'GetClientWindow',
@@ -1244,8 +1295,9 @@
{class, wxMDIChildFrame, wxFrame, [],
['wxMDIChildFrame','~wxMDIChildFrame','Activate','Create','Maximize','Restore']}.
-{class, wxMDIClientWindow, wxWindow, [],
- ['wxMDIClientWindow','~wxMDIClientWindow','CreateClient']}.
+{class, wxMDIClientWindow, wxWindow, [],
+ [{'wxMDIClientWindow', [{{func, 2}, [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]}]},
+ '~wxMDIClientWindow','CreateClient']}.
{class, wxLayoutAlgorithm, object, [],
['wxLayoutAlgorithm', '~wxLayoutAlgorithm',
@@ -1310,12 +1362,7 @@
[wxEVT_LEFT_DOWN,wxEVT_LEFT_UP,wxEVT_MIDDLE_DOWN,wxEVT_MIDDLE_UP,
wxEVT_RIGHT_DOWN,wxEVT_RIGHT_UP,wxEVT_MOTION,wxEVT_ENTER_WINDOW,
wxEVT_LEAVE_WINDOW,wxEVT_LEFT_DCLICK,wxEVT_MIDDLE_DCLICK,
- wxEVT_RIGHT_DCLICK,wxEVT_MOUSEWHEEL,
- wxEVT_NC_LEFT_DOWN,wxEVT_NC_LEFT_UP,
- wxEVT_NC_MIDDLE_DOWN,wxEVT_NC_MIDDLE_UP,wxEVT_NC_RIGHT_DOWN,
- wxEVT_NC_RIGHT_UP,wxEVT_NC_MOTION,wxEVT_NC_ENTER_WINDOW,
- wxEVT_NC_LEAVE_WINDOW,wxEVT_NC_LEFT_DCLICK,wxEVT_NC_MIDDLE_DCLICK,
- wxEVT_NC_RIGHT_DCLICK]}],
+ wxEVT_RIGHT_DCLICK,wxEVT_MOUSEWHEEL]}],
['AltDown','Button','ButtonDClick','ButtonDown','ButtonUp','CmdDown','ControlDown',
'Dragging', 'Entering', 'GetButton', 'GetPosition', 'GetLogicalPosition',
'GetLinesPerAction', 'GetWheelRotation', 'GetWheelDelta', 'GetX', 'GetY',
@@ -1345,8 +1392,8 @@
['GetSize']}.
{class, wxMoveEvent, wxEvent, [{event,[wxEVT_MOVE]}],
['GetPosition']}.
-{class, wxPaintEvent, wxEvent, [{event,[wxEVT_PAINT,wxEVT_PAINT_ICON]}],[]}.
-{class, wxNcPaintEvent, wxEvent, [{event,[wxEVT_NC_PAINT]}],[]}.
+{class, wxPaintEvent, wxEvent, [{event,[wxEVT_PAINT]}],[]}.
+%%{class, wxNcPaintEvent, wxEvent, [{event,[wxEVT_NC_PAINT]}],[]}.
{class, wxEraseEvent, wxEvent,
[{acc, [{m_dc, "GetDC()"}]},
{event, [wxEVT_ERASE_BACKGROUND]}],
@@ -1415,7 +1462,8 @@
['GetPosition','SetPosition']}.
{enum, wxIdleMode, "wxIDLE_"}.
{class, wxIdleEvent, wxEvent, [{event,[wxEVT_IDLE]}],
- ['CanSend','GetMode','RequestMore','MoreRequested','SetMode']}.
+ [{'CanSend', [{deprecated, "!wxCHECK_VERSION(2,9,0)"}]},
+ 'GetMode','RequestMore','MoreRequested','SetMode']}.
{class, wxGridEvent, wxNotifyEvent,
[{acc, [{m_row, "GetRow()"}, {m_col, "GetCol()"}, {m_x, "GetPosition().x"},{m_y, "GetPosition().y"},
{m_selecting, "Selecting()"},{m_control,"ControlDown()"},
@@ -1634,7 +1682,7 @@
'StyleSetFont', 'StyleSetFontAttr', 'StyleSetCharacterSet', 'StyleSetFontEncoding',
'CmdKeyExecute',
'SetMargins', {'GetSelection', [{"startPos", [out]}, {"endPos",[out]}]},
- 'PointFromPosition', 'ScrollToLine', 'ScrollToColumn', 'SendMsg',
+ 'PointFromPosition', 'ScrollToLine', 'ScrollToColumn', %% 'SendMsg',
'SetVScrollBar', 'SetHScrollBar', 'GetLastKeydownProcessed', 'SetLastKeydownProcessed',
'SaveFile', 'LoadFile', 'DoDragOver', 'DoDropText', 'GetUseAntiAliasing',
{'AddTextRaw', [{"text", [in, {base, binary}]}]},
diff --git a/lib/wx/c_src/Makefile.in b/lib/wx/c_src/Makefile.in
index 1497ac4d16..1d17076d23 100644
--- a/lib/wx/c_src/Makefile.in
+++ b/lib/wx/c_src/Makefile.in
@@ -71,8 +71,7 @@ WX_OBJECTS = $(GENERAL_O) $(GENERATED_O) $(RC_FILE)
OBJECTS = $(WX_OBJECTS) $(GL_OBJECTS)
-TARGET_APIS = wxe_driver erl_gl
-TARGET_DIR = ../priv
+TARGET_DIR = ../priv/$(SYS_TYPE)
# -O2 -funroll-loops -ffast-math -fomit-frame-pointer
@@ -121,7 +120,7 @@ debug:
clean:
rm -f $(OBJECTS)
- rm -f ../priv/$(TARGET_DIR)/$(TARGET_API)$(SO_EXT)
+ rm -f $(TARGET_DIR)/*$(SO_EXT)
rm -f *~ erl_crash.dump
complete_clean:
diff --git a/lib/wx/c_src/gen/wxe_derived_dest.h b/lib/wx/c_src/gen/wxe_derived_dest.h
index 6b7a5378cb..5fdce27d4b 100644
--- a/lib/wx/c_src/gen/wxe_derived_dest.h
+++ b/lib/wx/c_src/gen/wxe_derived_dest.h
@@ -94,19 +94,25 @@ class EwxPostScriptDC : public wxPostScriptDC {
class EwxWindowDC : public wxWindowDC {
public: ~EwxWindowDC() {((WxeApp *)wxTheApp)->clearPtr(this);};
EwxWindowDC(wxWindow * win) : wxWindowDC(win) {};
+#if !wxCHECK_VERSION(2,9,0)
EwxWindowDC() : wxWindowDC() {};
+#endif
};
class EwxClientDC : public wxClientDC {
public: ~EwxClientDC() {((WxeApp *)wxTheApp)->clearPtr(this);};
EwxClientDC(wxWindow * win) : wxClientDC(win) {};
+#if !wxCHECK_VERSION(2,9,0)
EwxClientDC() : wxClientDC() {};
+#endif
};
class EwxPaintDC : public wxPaintDC {
public: ~EwxPaintDC() {((WxeApp *)wxTheApp)->clearPtr(this);};
EwxPaintDC(wxWindow * win) : wxPaintDC(win) {};
+#if !wxCHECK_VERSION(2,9,0)
EwxPaintDC() : wxPaintDC() {};
+#endif
};
class EwxMemoryDC : public wxMemoryDC {
@@ -182,7 +188,9 @@ class EwxIcon : public wxIcon {
class EwxCursor : public wxCursor {
public: ~EwxCursor() {((WxeApp *)wxTheApp)->clearPtr(this);};
+#if !wxCHECK_VERSION(2,9,0)
EwxCursor(const char * bits,int width,int height,int hotSpotX,int hotSpotY) : wxCursor(bits,width,height,hotSpotX,hotSpotY) {};
+#endif
EwxCursor(int cursorId) : wxCursor(cursorId) {};
EwxCursor(const wxImage& image) : wxCursor(image) {};
EwxCursor() : wxCursor() {};
@@ -286,7 +294,7 @@ class EwxStdDialogButtonSizer : public wxStdDialogButtonSizer {
class EwxFont : public wxFont {
public: ~EwxFont() {((WxeApp *)wxTheApp)->clearPtr(this);};
- EwxFont(int size,int family,int style,int weight,bool underlined,const wxString& face,wxFontEncoding encoding) : wxFont(size,family,style,weight,underlined,face,encoding) {};
+ EwxFont(int size,wxFontFamily family,wxFontStyle style,int weight,bool underlined,const wxString& face,wxFontEncoding encoding) : wxFont(size,family,style,weight,underlined,face,encoding) {};
EwxFont(const wxString& fontname) : wxFont(fontname) {};
EwxFont() : wxFont() {};
};
@@ -712,7 +720,9 @@ class EwxMDIChildFrame : public wxMDIChildFrame {
class EwxMDIClientWindow : public wxMDIClientWindow {
public: ~EwxMDIClientWindow() {((WxeApp *)wxTheApp)->clearPtr(this);};
+#if !wxCHECK_VERSION(2,9,0)
EwxMDIClientWindow(wxMDIParentFrame * parent,long style) : wxMDIClientWindow(parent,style) {};
+#endif
EwxMDIClientWindow() : wxMDIClientWindow() {};
};
diff --git a/lib/wx/c_src/gen/wxe_events.cpp b/lib/wx/c_src/gen/wxe_events.cpp
index 0afb02150a..7a3233a410 100644
--- a/lib/wx/c_src/gen/wxe_events.cpp
+++ b/lib/wx/c_src/gen/wxe_events.cpp
@@ -107,18 +107,6 @@ void initEventTable()
{wxEVT_MIDDLE_DCLICK, 167, "middle_dclick"},
{wxEVT_RIGHT_DCLICK, 167, "right_dclick"},
{wxEVT_MOUSEWHEEL, 167, "mousewheel"},
- {wxEVT_NC_LEFT_DOWN, 167, "nc_left_down"},
- {wxEVT_NC_LEFT_UP, 167, "nc_left_up"},
- {wxEVT_NC_MIDDLE_DOWN, 167, "nc_middle_down"},
- {wxEVT_NC_MIDDLE_UP, 167, "nc_middle_up"},
- {wxEVT_NC_RIGHT_DOWN, 167, "nc_right_down"},
- {wxEVT_NC_RIGHT_UP, 167, "nc_right_up"},
- {wxEVT_NC_MOTION, 167, "nc_motion"},
- {wxEVT_NC_ENTER_WINDOW, 167, "nc_enter_window"},
- {wxEVT_NC_LEAVE_WINDOW, 167, "nc_leave_window"},
- {wxEVT_NC_LEFT_DCLICK, 167, "nc_left_dclick"},
- {wxEVT_NC_MIDDLE_DCLICK, 167, "nc_middle_dclick"},
- {wxEVT_NC_RIGHT_DCLICK, 167, "nc_right_dclick"},
{wxEVT_SET_CURSOR, 168, "set_cursor"},
{wxEVT_CHAR, 169, "char"},
{wxEVT_CHAR_HOOK, 169, "char_hook"},
@@ -127,187 +115,185 @@ void initEventTable()
{wxEVT_SIZE, 170, "size"},
{wxEVT_MOVE, 171, "move"},
{wxEVT_PAINT, 172, "paint"},
- {wxEVT_PAINT_ICON, 172, "paint_icon"},
- {wxEVT_NC_PAINT, 173, "nc_paint"},
- {wxEVT_ERASE_BACKGROUND, 174, "erase_background"},
- {wxEVT_SET_FOCUS, 175, "set_focus"},
- {wxEVT_KILL_FOCUS, 175, "kill_focus"},
- {wxEVT_CHILD_FOCUS, 176, "child_focus"},
- {wxEVT_MENU_OPEN, 177, "menu_open"},
- {wxEVT_MENU_CLOSE, 177, "menu_close"},
- {wxEVT_MENU_HIGHLIGHT, 177, "menu_highlight"},
- {wxEVT_CLOSE_WINDOW, 178, "close_window"},
- {wxEVT_END_SESSION, 178, "end_session"},
- {wxEVT_QUERY_END_SESSION, 178, "query_end_session"},
- {wxEVT_SHOW, 179, "show"},
- {wxEVT_ICONIZE, 180, "iconize"},
- {wxEVT_MAXIMIZE, 181, "maximize"},
- {wxEVT_JOY_BUTTON_DOWN, 182, "joy_button_down"},
- {wxEVT_JOY_BUTTON_UP, 182, "joy_button_up"},
- {wxEVT_JOY_MOVE, 182, "joy_move"},
- {wxEVT_JOY_ZMOVE, 182, "joy_zmove"},
- {wxEVT_UPDATE_UI, 183, "update_ui"},
- {wxEVT_SYS_COLOUR_CHANGED, 184, "sys_colour_changed"},
- {wxEVT_MOUSE_CAPTURE_CHANGED, 185, "mouse_capture_changed"},
- {wxEVT_DISPLAY_CHANGED, 186, "display_changed"},
- {wxEVT_PALETTE_CHANGED, 187, "palette_changed"},
- {wxEVT_QUERY_NEW_PALETTE, 188, "query_new_palette"},
- {wxEVT_NAVIGATION_KEY, 189, "navigation_key"},
- {wxEVT_CREATE, 190, "create"},
- {wxEVT_DESTROY, 191, "destroy"},
- {wxEVT_HELP, 192, "help"},
- {wxEVT_DETAILED_HELP, 192, "detailed_help"},
- {wxEVT_CONTEXT_MENU, 193, "context_menu"},
- {wxEVT_IDLE, 194, "idle"},
- {wxEVT_GRID_CELL_LEFT_CLICK, 195, "grid_cell_left_click"},
- {wxEVT_GRID_CELL_RIGHT_CLICK, 195, "grid_cell_right_click"},
- {wxEVT_GRID_CELL_LEFT_DCLICK, 195, "grid_cell_left_dclick"},
- {wxEVT_GRID_CELL_RIGHT_DCLICK, 195, "grid_cell_right_dclick"},
- {wxEVT_GRID_LABEL_LEFT_CLICK, 195, "grid_label_left_click"},
- {wxEVT_GRID_LABEL_RIGHT_CLICK, 195, "grid_label_right_click"},
- {wxEVT_GRID_LABEL_LEFT_DCLICK, 195, "grid_label_left_dclick"},
- {wxEVT_GRID_LABEL_RIGHT_DCLICK, 195, "grid_label_right_dclick"},
- {wxEVT_GRID_ROW_SIZE, 195, "grid_row_size"},
- {wxEVT_GRID_COL_SIZE, 195, "grid_col_size"},
- {wxEVT_GRID_RANGE_SELECT, 195, "grid_range_select"},
- {wxEVT_GRID_CELL_CHANGE, 195, "grid_cell_change"},
- {wxEVT_GRID_SELECT_CELL, 195, "grid_select_cell"},
- {wxEVT_GRID_EDITOR_SHOWN, 195, "grid_editor_shown"},
- {wxEVT_GRID_EDITOR_HIDDEN, 195, "grid_editor_hidden"},
- {wxEVT_GRID_EDITOR_CREATED, 195, "grid_editor_created"},
- {wxEVT_GRID_CELL_BEGIN_DRAG, 195, "grid_cell_begin_drag"},
- {wxEVT_SASH_DRAGGED, 197, "sash_dragged"},
- {wxEVT_COMMAND_LIST_BEGIN_DRAG, 198, "command_list_begin_drag"},
- {wxEVT_COMMAND_LIST_BEGIN_RDRAG, 198, "command_list_begin_rdrag"},
- {wxEVT_COMMAND_LIST_BEGIN_LABEL_EDIT, 198, "command_list_begin_label_edit"},
- {wxEVT_COMMAND_LIST_END_LABEL_EDIT, 198, "command_list_end_label_edit"},
- {wxEVT_COMMAND_LIST_DELETE_ITEM, 198, "command_list_delete_item"},
- {wxEVT_COMMAND_LIST_DELETE_ALL_ITEMS, 198, "command_list_delete_all_items"},
- {wxEVT_COMMAND_LIST_KEY_DOWN, 198, "command_list_key_down"},
- {wxEVT_COMMAND_LIST_INSERT_ITEM, 198, "command_list_insert_item"},
- {wxEVT_COMMAND_LIST_COL_CLICK, 198, "command_list_col_click"},
- {wxEVT_COMMAND_LIST_COL_RIGHT_CLICK, 198, "command_list_col_right_click"},
- {wxEVT_COMMAND_LIST_COL_BEGIN_DRAG, 198, "command_list_col_begin_drag"},
- {wxEVT_COMMAND_LIST_COL_DRAGGING, 198, "command_list_col_dragging"},
- {wxEVT_COMMAND_LIST_COL_END_DRAG, 198, "command_list_col_end_drag"},
- {wxEVT_COMMAND_LIST_ITEM_SELECTED, 198, "command_list_item_selected"},
- {wxEVT_COMMAND_LIST_ITEM_DESELECTED, 198, "command_list_item_deselected"},
- {wxEVT_COMMAND_LIST_ITEM_RIGHT_CLICK, 198, "command_list_item_right_click"},
- {wxEVT_COMMAND_LIST_ITEM_MIDDLE_CLICK, 198, "command_list_item_middle_click"},
- {wxEVT_COMMAND_LIST_ITEM_ACTIVATED, 198, "command_list_item_activated"},
- {wxEVT_COMMAND_LIST_ITEM_FOCUSED, 198, "command_list_item_focused"},
- {wxEVT_COMMAND_LIST_CACHE_HINT, 198, "command_list_cache_hint"},
- {wxEVT_DATE_CHANGED, 199, "date_changed"},
- {wxEVT_CALENDAR_SEL_CHANGED, 200, "calendar_sel_changed"},
- {wxEVT_CALENDAR_DAY_CHANGED, 200, "calendar_day_changed"},
- {wxEVT_CALENDAR_MONTH_CHANGED, 200, "calendar_month_changed"},
- {wxEVT_CALENDAR_YEAR_CHANGED, 200, "calendar_year_changed"},
- {wxEVT_CALENDAR_DOUBLECLICKED, 200, "calendar_doubleclicked"},
- {wxEVT_CALENDAR_WEEKDAY_CLICKED, 200, "calendar_weekday_clicked"},
- {wxEVT_COMMAND_FILEPICKER_CHANGED, 201, "command_filepicker_changed"},
- {wxEVT_COMMAND_DIRPICKER_CHANGED, 201, "command_dirpicker_changed"},
- {wxEVT_COMMAND_COLOURPICKER_CHANGED, 202, "command_colourpicker_changed"},
- {wxEVT_COMMAND_FONTPICKER_CHANGED, 203, "command_fontpicker_changed"},
- {wxEVT_STC_CHANGE, 204, "stc_change"},
- {wxEVT_STC_STYLENEEDED, 204, "stc_styleneeded"},
- {wxEVT_STC_CHARADDED, 204, "stc_charadded"},
- {wxEVT_STC_SAVEPOINTREACHED, 204, "stc_savepointreached"},
- {wxEVT_STC_SAVEPOINTLEFT, 204, "stc_savepointleft"},
- {wxEVT_STC_ROMODIFYATTEMPT, 204, "stc_romodifyattempt"},
- {wxEVT_STC_KEY, 204, "stc_key"},
- {wxEVT_STC_DOUBLECLICK, 204, "stc_doubleclick"},
- {wxEVT_STC_UPDATEUI, 204, "stc_updateui"},
- {wxEVT_STC_MODIFIED, 204, "stc_modified"},
- {wxEVT_STC_MACRORECORD, 204, "stc_macrorecord"},
- {wxEVT_STC_MARGINCLICK, 204, "stc_marginclick"},
- {wxEVT_STC_NEEDSHOWN, 204, "stc_needshown"},
- {wxEVT_STC_PAINTED, 204, "stc_painted"},
- {wxEVT_STC_USERLISTSELECTION, 204, "stc_userlistselection"},
- {wxEVT_STC_URIDROPPED, 204, "stc_uridropped"},
- {wxEVT_STC_DWELLSTART, 204, "stc_dwellstart"},
- {wxEVT_STC_DWELLEND, 204, "stc_dwellend"},
- {wxEVT_STC_START_DRAG, 204, "stc_start_drag"},
- {wxEVT_STC_DRAG_OVER, 204, "stc_drag_over"},
- {wxEVT_STC_DO_DROP, 204, "stc_do_drop"},
- {wxEVT_STC_ZOOM, 204, "stc_zoom"},
- {wxEVT_STC_HOTSPOT_CLICK, 204, "stc_hotspot_click"},
- {wxEVT_STC_HOTSPOT_DCLICK, 204, "stc_hotspot_dclick"},
- {wxEVT_STC_CALLTIP_CLICK, 204, "stc_calltip_click"},
- {wxEVT_STC_AUTOCOMP_SELECTION, 204, "stc_autocomp_selection"},
- {wxEVT_COMMAND_TREE_BEGIN_DRAG, 209, "command_tree_begin_drag"},
- {wxEVT_COMMAND_TREE_BEGIN_RDRAG, 209, "command_tree_begin_rdrag"},
- {wxEVT_COMMAND_TREE_BEGIN_LABEL_EDIT, 209, "command_tree_begin_label_edit"},
- {wxEVT_COMMAND_TREE_END_LABEL_EDIT, 209, "command_tree_end_label_edit"},
- {wxEVT_COMMAND_TREE_DELETE_ITEM, 209, "command_tree_delete_item"},
- {wxEVT_COMMAND_TREE_GET_INFO, 209, "command_tree_get_info"},
- {wxEVT_COMMAND_TREE_SET_INFO, 209, "command_tree_set_info"},
- {wxEVT_COMMAND_TREE_ITEM_EXPANDED, 209, "command_tree_item_expanded"},
- {wxEVT_COMMAND_TREE_ITEM_EXPANDING, 209, "command_tree_item_expanding"},
- {wxEVT_COMMAND_TREE_ITEM_COLLAPSED, 209, "command_tree_item_collapsed"},
- {wxEVT_COMMAND_TREE_ITEM_COLLAPSING, 209, "command_tree_item_collapsing"},
- {wxEVT_COMMAND_TREE_SEL_CHANGED, 209, "command_tree_sel_changed"},
- {wxEVT_COMMAND_TREE_SEL_CHANGING, 209, "command_tree_sel_changing"},
- {wxEVT_COMMAND_TREE_KEY_DOWN, 209, "command_tree_key_down"},
- {wxEVT_COMMAND_TREE_ITEM_ACTIVATED, 209, "command_tree_item_activated"},
- {wxEVT_COMMAND_TREE_ITEM_RIGHT_CLICK, 209, "command_tree_item_right_click"},
- {wxEVT_COMMAND_TREE_ITEM_MIDDLE_CLICK, 209, "command_tree_item_middle_click"},
- {wxEVT_COMMAND_TREE_END_DRAG, 209, "command_tree_end_drag"},
- {wxEVT_COMMAND_TREE_STATE_IMAGE_CLICK, 209, "command_tree_state_image_click"},
- {wxEVT_COMMAND_TREE_ITEM_GETTOOLTIP, 209, "command_tree_item_gettooltip"},
- {wxEVT_COMMAND_TREE_ITEM_MENU, 209, "command_tree_item_menu"},
- {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGED, 210, "command_notebook_page_changed"},
- {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGING, 210, "command_notebook_page_changing"},
- {wxEVT_COMMAND_SPINCTRL_UPDATED, 216, "command_spinctrl_updated"},
+ {wxEVT_ERASE_BACKGROUND, 173, "erase_background"},
+ {wxEVT_SET_FOCUS, 174, "set_focus"},
+ {wxEVT_KILL_FOCUS, 174, "kill_focus"},
+ {wxEVT_CHILD_FOCUS, 175, "child_focus"},
+ {wxEVT_MENU_OPEN, 176, "menu_open"},
+ {wxEVT_MENU_CLOSE, 176, "menu_close"},
+ {wxEVT_MENU_HIGHLIGHT, 176, "menu_highlight"},
+ {wxEVT_CLOSE_WINDOW, 177, "close_window"},
+ {wxEVT_END_SESSION, 177, "end_session"},
+ {wxEVT_QUERY_END_SESSION, 177, "query_end_session"},
+ {wxEVT_SHOW, 178, "show"},
+ {wxEVT_ICONIZE, 179, "iconize"},
+ {wxEVT_MAXIMIZE, 180, "maximize"},
+ {wxEVT_JOY_BUTTON_DOWN, 181, "joy_button_down"},
+ {wxEVT_JOY_BUTTON_UP, 181, "joy_button_up"},
+ {wxEVT_JOY_MOVE, 181, "joy_move"},
+ {wxEVT_JOY_ZMOVE, 181, "joy_zmove"},
+ {wxEVT_UPDATE_UI, 182, "update_ui"},
+ {wxEVT_SYS_COLOUR_CHANGED, 183, "sys_colour_changed"},
+ {wxEVT_MOUSE_CAPTURE_CHANGED, 184, "mouse_capture_changed"},
+ {wxEVT_DISPLAY_CHANGED, 185, "display_changed"},
+ {wxEVT_PALETTE_CHANGED, 186, "palette_changed"},
+ {wxEVT_QUERY_NEW_PALETTE, 187, "query_new_palette"},
+ {wxEVT_NAVIGATION_KEY, 188, "navigation_key"},
+ {wxEVT_CREATE, 189, "create"},
+ {wxEVT_DESTROY, 190, "destroy"},
+ {wxEVT_HELP, 191, "help"},
+ {wxEVT_DETAILED_HELP, 191, "detailed_help"},
+ {wxEVT_CONTEXT_MENU, 192, "context_menu"},
+ {wxEVT_IDLE, 193, "idle"},
+ {wxEVT_GRID_CELL_LEFT_CLICK, 194, "grid_cell_left_click"},
+ {wxEVT_GRID_CELL_RIGHT_CLICK, 194, "grid_cell_right_click"},
+ {wxEVT_GRID_CELL_LEFT_DCLICK, 194, "grid_cell_left_dclick"},
+ {wxEVT_GRID_CELL_RIGHT_DCLICK, 194, "grid_cell_right_dclick"},
+ {wxEVT_GRID_LABEL_LEFT_CLICK, 194, "grid_label_left_click"},
+ {wxEVT_GRID_LABEL_RIGHT_CLICK, 194, "grid_label_right_click"},
+ {wxEVT_GRID_LABEL_LEFT_DCLICK, 194, "grid_label_left_dclick"},
+ {wxEVT_GRID_LABEL_RIGHT_DCLICK, 194, "grid_label_right_dclick"},
+ {wxEVT_GRID_ROW_SIZE, 194, "grid_row_size"},
+ {wxEVT_GRID_COL_SIZE, 194, "grid_col_size"},
+ {wxEVT_GRID_RANGE_SELECT, 194, "grid_range_select"},
+ {wxEVT_GRID_CELL_CHANGE, 194, "grid_cell_change"},
+ {wxEVT_GRID_SELECT_CELL, 194, "grid_select_cell"},
+ {wxEVT_GRID_EDITOR_SHOWN, 194, "grid_editor_shown"},
+ {wxEVT_GRID_EDITOR_HIDDEN, 194, "grid_editor_hidden"},
+ {wxEVT_GRID_EDITOR_CREATED, 194, "grid_editor_created"},
+ {wxEVT_GRID_CELL_BEGIN_DRAG, 194, "grid_cell_begin_drag"},
+ {wxEVT_SASH_DRAGGED, 196, "sash_dragged"},
+ {wxEVT_COMMAND_LIST_BEGIN_DRAG, 197, "command_list_begin_drag"},
+ {wxEVT_COMMAND_LIST_BEGIN_RDRAG, 197, "command_list_begin_rdrag"},
+ {wxEVT_COMMAND_LIST_BEGIN_LABEL_EDIT, 197, "command_list_begin_label_edit"},
+ {wxEVT_COMMAND_LIST_END_LABEL_EDIT, 197, "command_list_end_label_edit"},
+ {wxEVT_COMMAND_LIST_DELETE_ITEM, 197, "command_list_delete_item"},
+ {wxEVT_COMMAND_LIST_DELETE_ALL_ITEMS, 197, "command_list_delete_all_items"},
+ {wxEVT_COMMAND_LIST_KEY_DOWN, 197, "command_list_key_down"},
+ {wxEVT_COMMAND_LIST_INSERT_ITEM, 197, "command_list_insert_item"},
+ {wxEVT_COMMAND_LIST_COL_CLICK, 197, "command_list_col_click"},
+ {wxEVT_COMMAND_LIST_COL_RIGHT_CLICK, 197, "command_list_col_right_click"},
+ {wxEVT_COMMAND_LIST_COL_BEGIN_DRAG, 197, "command_list_col_begin_drag"},
+ {wxEVT_COMMAND_LIST_COL_DRAGGING, 197, "command_list_col_dragging"},
+ {wxEVT_COMMAND_LIST_COL_END_DRAG, 197, "command_list_col_end_drag"},
+ {wxEVT_COMMAND_LIST_ITEM_SELECTED, 197, "command_list_item_selected"},
+ {wxEVT_COMMAND_LIST_ITEM_DESELECTED, 197, "command_list_item_deselected"},
+ {wxEVT_COMMAND_LIST_ITEM_RIGHT_CLICK, 197, "command_list_item_right_click"},
+ {wxEVT_COMMAND_LIST_ITEM_MIDDLE_CLICK, 197, "command_list_item_middle_click"},
+ {wxEVT_COMMAND_LIST_ITEM_ACTIVATED, 197, "command_list_item_activated"},
+ {wxEVT_COMMAND_LIST_ITEM_FOCUSED, 197, "command_list_item_focused"},
+ {wxEVT_COMMAND_LIST_CACHE_HINT, 197, "command_list_cache_hint"},
+ {wxEVT_DATE_CHANGED, 198, "date_changed"},
+ {wxEVT_CALENDAR_SEL_CHANGED, 199, "calendar_sel_changed"},
+ {wxEVT_CALENDAR_DAY_CHANGED, 199, "calendar_day_changed"},
+ {wxEVT_CALENDAR_MONTH_CHANGED, 199, "calendar_month_changed"},
+ {wxEVT_CALENDAR_YEAR_CHANGED, 199, "calendar_year_changed"},
+ {wxEVT_CALENDAR_DOUBLECLICKED, 199, "calendar_doubleclicked"},
+ {wxEVT_CALENDAR_WEEKDAY_CLICKED, 199, "calendar_weekday_clicked"},
+ {wxEVT_COMMAND_FILEPICKER_CHANGED, 200, "command_filepicker_changed"},
+ {wxEVT_COMMAND_DIRPICKER_CHANGED, 200, "command_dirpicker_changed"},
+ {wxEVT_COMMAND_COLOURPICKER_CHANGED, 201, "command_colourpicker_changed"},
+ {wxEVT_COMMAND_FONTPICKER_CHANGED, 202, "command_fontpicker_changed"},
+ {wxEVT_STC_CHANGE, 203, "stc_change"},
+ {wxEVT_STC_STYLENEEDED, 203, "stc_styleneeded"},
+ {wxEVT_STC_CHARADDED, 203, "stc_charadded"},
+ {wxEVT_STC_SAVEPOINTREACHED, 203, "stc_savepointreached"},
+ {wxEVT_STC_SAVEPOINTLEFT, 203, "stc_savepointleft"},
+ {wxEVT_STC_ROMODIFYATTEMPT, 203, "stc_romodifyattempt"},
+ {wxEVT_STC_KEY, 203, "stc_key"},
+ {wxEVT_STC_DOUBLECLICK, 203, "stc_doubleclick"},
+ {wxEVT_STC_UPDATEUI, 203, "stc_updateui"},
+ {wxEVT_STC_MODIFIED, 203, "stc_modified"},
+ {wxEVT_STC_MACRORECORD, 203, "stc_macrorecord"},
+ {wxEVT_STC_MARGINCLICK, 203, "stc_marginclick"},
+ {wxEVT_STC_NEEDSHOWN, 203, "stc_needshown"},
+ {wxEVT_STC_PAINTED, 203, "stc_painted"},
+ {wxEVT_STC_USERLISTSELECTION, 203, "stc_userlistselection"},
+ {wxEVT_STC_URIDROPPED, 203, "stc_uridropped"},
+ {wxEVT_STC_DWELLSTART, 203, "stc_dwellstart"},
+ {wxEVT_STC_DWELLEND, 203, "stc_dwellend"},
+ {wxEVT_STC_START_DRAG, 203, "stc_start_drag"},
+ {wxEVT_STC_DRAG_OVER, 203, "stc_drag_over"},
+ {wxEVT_STC_DO_DROP, 203, "stc_do_drop"},
+ {wxEVT_STC_ZOOM, 203, "stc_zoom"},
+ {wxEVT_STC_HOTSPOT_CLICK, 203, "stc_hotspot_click"},
+ {wxEVT_STC_HOTSPOT_DCLICK, 203, "stc_hotspot_dclick"},
+ {wxEVT_STC_CALLTIP_CLICK, 203, "stc_calltip_click"},
+ {wxEVT_STC_AUTOCOMP_SELECTION, 203, "stc_autocomp_selection"},
+ {wxEVT_COMMAND_TREE_BEGIN_DRAG, 208, "command_tree_begin_drag"},
+ {wxEVT_COMMAND_TREE_BEGIN_RDRAG, 208, "command_tree_begin_rdrag"},
+ {wxEVT_COMMAND_TREE_BEGIN_LABEL_EDIT, 208, "command_tree_begin_label_edit"},
+ {wxEVT_COMMAND_TREE_END_LABEL_EDIT, 208, "command_tree_end_label_edit"},
+ {wxEVT_COMMAND_TREE_DELETE_ITEM, 208, "command_tree_delete_item"},
+ {wxEVT_COMMAND_TREE_GET_INFO, 208, "command_tree_get_info"},
+ {wxEVT_COMMAND_TREE_SET_INFO, 208, "command_tree_set_info"},
+ {wxEVT_COMMAND_TREE_ITEM_EXPANDED, 208, "command_tree_item_expanded"},
+ {wxEVT_COMMAND_TREE_ITEM_EXPANDING, 208, "command_tree_item_expanding"},
+ {wxEVT_COMMAND_TREE_ITEM_COLLAPSED, 208, "command_tree_item_collapsed"},
+ {wxEVT_COMMAND_TREE_ITEM_COLLAPSING, 208, "command_tree_item_collapsing"},
+ {wxEVT_COMMAND_TREE_SEL_CHANGED, 208, "command_tree_sel_changed"},
+ {wxEVT_COMMAND_TREE_SEL_CHANGING, 208, "command_tree_sel_changing"},
+ {wxEVT_COMMAND_TREE_KEY_DOWN, 208, "command_tree_key_down"},
+ {wxEVT_COMMAND_TREE_ITEM_ACTIVATED, 208, "command_tree_item_activated"},
+ {wxEVT_COMMAND_TREE_ITEM_RIGHT_CLICK, 208, "command_tree_item_right_click"},
+ {wxEVT_COMMAND_TREE_ITEM_MIDDLE_CLICK, 208, "command_tree_item_middle_click"},
+ {wxEVT_COMMAND_TREE_END_DRAG, 208, "command_tree_end_drag"},
+ {wxEVT_COMMAND_TREE_STATE_IMAGE_CLICK, 208, "command_tree_state_image_click"},
+ {wxEVT_COMMAND_TREE_ITEM_GETTOOLTIP, 208, "command_tree_item_gettooltip"},
+ {wxEVT_COMMAND_TREE_ITEM_MENU, 208, "command_tree_item_menu"},
+ {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGED, 209, "command_notebook_page_changed"},
+ {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGING, 209, "command_notebook_page_changing"},
+ {wxEVT_COMMAND_SPINCTRL_UPDATED, 215, "command_spinctrl_updated"},
{wxEVT_SCROLL_LINEUP + wxEVT_USER_FIRST, 165, "spin_up"},
{wxEVT_SCROLL_LINEDOWN + wxEVT_USER_FIRST, 165, "spin_down"},
{wxEVT_SCROLL_THUMBTRACK + wxEVT_USER_FIRST, 165, "spin"},
- {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGED, 218, "command_splitter_sash_pos_changed"},
- {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGING, 218, "command_splitter_sash_pos_changing"},
- {wxEVT_COMMAND_SPLITTER_DOUBLECLICKED, 218, "command_splitter_doubleclicked"},
- {wxEVT_COMMAND_SPLITTER_UNSPLIT, 218, "command_splitter_unsplit"},
- {wxEVT_COMMAND_HTML_LINK_CLICKED, 220, "command_html_link_clicked"},
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSE, 223, "command_auinotebook_page_close"},
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGED, 223, "command_auinotebook_page_changed"},
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGING, 223, "command_auinotebook_page_changing"},
- {wxEVT_COMMAND_AUINOTEBOOK_BUTTON, 223, "command_auinotebook_button"},
- {wxEVT_COMMAND_AUINOTEBOOK_BEGIN_DRAG, 223, "command_auinotebook_begin_drag"},
- {wxEVT_COMMAND_AUINOTEBOOK_END_DRAG, 223, "command_auinotebook_end_drag"},
- {wxEVT_COMMAND_AUINOTEBOOK_DRAG_MOTION, 223, "command_auinotebook_drag_motion"},
- {wxEVT_COMMAND_AUINOTEBOOK_ALLOW_DND, 223, "command_auinotebook_allow_dnd"},
+ {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGED, 217, "command_splitter_sash_pos_changed"},
+ {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGING, 217, "command_splitter_sash_pos_changing"},
+ {wxEVT_COMMAND_SPLITTER_DOUBLECLICKED, 217, "command_splitter_doubleclicked"},
+ {wxEVT_COMMAND_SPLITTER_UNSPLIT, 217, "command_splitter_unsplit"},
+ {wxEVT_COMMAND_HTML_LINK_CLICKED, 219, "command_html_link_clicked"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSE, 222, "command_auinotebook_page_close"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGED, 222, "command_auinotebook_page_changed"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGING, 222, "command_auinotebook_page_changing"},
+ {wxEVT_COMMAND_AUINOTEBOOK_BUTTON, 222, "command_auinotebook_button"},
+ {wxEVT_COMMAND_AUINOTEBOOK_BEGIN_DRAG, 222, "command_auinotebook_begin_drag"},
+ {wxEVT_COMMAND_AUINOTEBOOK_END_DRAG, 222, "command_auinotebook_end_drag"},
+ {wxEVT_COMMAND_AUINOTEBOOK_DRAG_MOTION, 222, "command_auinotebook_drag_motion"},
+ {wxEVT_COMMAND_AUINOTEBOOK_ALLOW_DND, 222, "command_auinotebook_allow_dnd"},
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_DOWN, 223, "command_auinotebook_tab_middle_down"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_DOWN, 222, "command_auinotebook_tab_middle_down"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_UP, 223, "command_auinotebook_tab_middle_up"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_UP, 222, "command_auinotebook_tab_middle_up"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_DOWN, 223, "command_auinotebook_tab_right_down"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_DOWN, 222, "command_auinotebook_tab_right_down"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_UP, 223, "command_auinotebook_tab_right_up"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_UP, 222, "command_auinotebook_tab_right_up"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSED, 223, "command_auinotebook_page_closed"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSED, 222, "command_auinotebook_page_closed"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_DRAG_DONE, 223, "command_auinotebook_drag_done"},
+ {wxEVT_COMMAND_AUINOTEBOOK_DRAG_DONE, 222, "command_auinotebook_drag_done"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_BG_DCLICK, 223, "command_auinotebook_bg_dclick"},
+ {wxEVT_COMMAND_AUINOTEBOOK_BG_DCLICK, 222, "command_auinotebook_bg_dclick"},
#endif
- {wxEVT_AUI_PANE_BUTTON, 224, "aui_pane_button"},
- {wxEVT_AUI_PANE_CLOSE, 224, "aui_pane_close"},
- {wxEVT_AUI_PANE_MAXIMIZE, 224, "aui_pane_maximize"},
- {wxEVT_AUI_PANE_RESTORE, 224, "aui_pane_restore"},
- {wxEVT_AUI_RENDER, 224, "aui_render"},
- {wxEVT_AUI_FIND_MANAGER, 224, "aui_find_manager"},
- {wxEVT_TASKBAR_MOVE, 227, "taskbar_move"},
- {wxEVT_TASKBAR_LEFT_DOWN, 227, "taskbar_left_down"},
- {wxEVT_TASKBAR_LEFT_UP, 227, "taskbar_left_up"},
- {wxEVT_TASKBAR_RIGHT_DOWN, 227, "taskbar_right_down"},
- {wxEVT_TASKBAR_RIGHT_UP, 227, "taskbar_right_up"},
- {wxEVT_TASKBAR_LEFT_DCLICK, 227, "taskbar_left_dclick"},
- {wxEVT_TASKBAR_RIGHT_DCLICK, 227, "taskbar_right_dclick"},
+ {wxEVT_AUI_PANE_BUTTON, 223, "aui_pane_button"},
+ {wxEVT_AUI_PANE_CLOSE, 223, "aui_pane_close"},
+ {wxEVT_AUI_PANE_MAXIMIZE, 223, "aui_pane_maximize"},
+ {wxEVT_AUI_PANE_RESTORE, 223, "aui_pane_restore"},
+ {wxEVT_AUI_RENDER, 223, "aui_render"},
+ {wxEVT_AUI_FIND_MANAGER, 223, "aui_find_manager"},
+ {wxEVT_TASKBAR_MOVE, 226, "taskbar_move"},
+ {wxEVT_TASKBAR_LEFT_DOWN, 226, "taskbar_left_down"},
+ {wxEVT_TASKBAR_LEFT_UP, 226, "taskbar_left_up"},
+ {wxEVT_TASKBAR_RIGHT_DOWN, 226, "taskbar_right_down"},
+ {wxEVT_TASKBAR_RIGHT_UP, 226, "taskbar_right_up"},
+ {wxEVT_TASKBAR_LEFT_DCLICK, 226, "taskbar_left_dclick"},
+ {wxEVT_TASKBAR_RIGHT_DCLICK, 226, "taskbar_right_dclick"},
{-1, 0, }
};
for(int i=0; event_types[i].ev_type != -1; i++) {
@@ -437,7 +423,11 @@ case 169: {// wxKeyEvent
rt.addBool(ev->m_shiftDown);
rt.addBool(ev->m_altDown);
rt.addBool(ev->m_metaDown);
+#if !wxCHECK_VERSION(2,9,0)
rt.addBool(ev->m_scanCode);
+#else
+ rt.addBool(false);
+#endif
rt.addInt(ev->m_uniChar);
rt.addUint(ev->m_rawCode);
rt.addUint(ev->m_rawFlags);
@@ -468,14 +458,7 @@ case 172: {// wxPaintEvent
rt.addTupleCount(2);
break;
}
-case 173: {// wxNcPaintEvent
- evClass = (char*)"wxNcPaintEvent";
- rt.addAtom((char*)"wxNcPaint");
- rt.addAtom(Etype->eName);
- rt.addTupleCount(2);
- break;
-}
-case 174: {// wxEraseEvent
+case 173: {// wxEraseEvent
wxEraseEvent * ev = (wxEraseEvent *) event;
wxDC * GetDC = ev->GetDC();
evClass = (char*)"wxEraseEvent";
@@ -485,105 +468,105 @@ case 174: {// wxEraseEvent
rt.addTupleCount(3);
break;
}
-case 175: {// wxFocusEvent
+case 174: {// wxFocusEvent
evClass = (char*)"wxFocusEvent";
rt.addAtom((char*)"wxFocus");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 176: {// wxChildFocusEvent
+case 175: {// wxChildFocusEvent
evClass = (char*)"wxChildFocusEvent";
rt.addAtom((char*)"wxChildFocus");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 177: {// wxMenuEvent
+case 176: {// wxMenuEvent
evClass = (char*)"wxMenuEvent";
rt.addAtom((char*)"wxMenu");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 178: {// wxCloseEvent
+case 177: {// wxCloseEvent
evClass = (char*)"wxCloseEvent";
rt.addAtom((char*)"wxClose");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 179: {// wxShowEvent
+case 178: {// wxShowEvent
evClass = (char*)"wxShowEvent";
rt.addAtom((char*)"wxShow");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 180: {// wxIconizeEvent
+case 179: {// wxIconizeEvent
evClass = (char*)"wxIconizeEvent";
rt.addAtom((char*)"wxIconize");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 181: {// wxMaximizeEvent
+case 180: {// wxMaximizeEvent
evClass = (char*)"wxMaximizeEvent";
rt.addAtom((char*)"wxMaximize");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 182: {// wxJoystickEvent
+case 181: {// wxJoystickEvent
evClass = (char*)"wxJoystickEvent";
rt.addAtom((char*)"wxJoystick");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 183: {// wxUpdateUIEvent
+case 182: {// wxUpdateUIEvent
evClass = (char*)"wxUpdateUIEvent";
rt.addAtom((char*)"wxUpdateUI");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 184: {// wxSysColourChangedEvent
+case 183: {// wxSysColourChangedEvent
evClass = (char*)"wxSysColourChangedEvent";
rt.addAtom((char*)"wxSysColourChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 185: {// wxMouseCaptureChangedEvent
+case 184: {// wxMouseCaptureChangedEvent
evClass = (char*)"wxMouseCaptureChangedEvent";
rt.addAtom((char*)"wxMouseCaptureChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 186: {// wxDisplayChangedEvent
+case 185: {// wxDisplayChangedEvent
evClass = (char*)"wxDisplayChangedEvent";
rt.addAtom((char*)"wxDisplayChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 187: {// wxPaletteChangedEvent
+case 186: {// wxPaletteChangedEvent
evClass = (char*)"wxPaletteChangedEvent";
rt.addAtom((char*)"wxPaletteChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 188: {// wxQueryNewPaletteEvent
+case 187: {// wxQueryNewPaletteEvent
evClass = (char*)"wxQueryNewPaletteEvent";
rt.addAtom((char*)"wxQueryNewPalette");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 189: {// wxNavigationKeyEvent
+case 188: {// wxNavigationKeyEvent
wxNavigationKeyEvent * ev = (wxNavigationKeyEvent *) event;
evClass = (char*)"wxNavigationKeyEvent";
rt.addAtom((char*)"wxNavigationKey");
@@ -593,42 +576,42 @@ case 189: {// wxNavigationKeyEvent
rt.addTupleCount(4);
break;
}
-case 190: {// wxWindowCreateEvent
+case 189: {// wxWindowCreateEvent
evClass = (char*)"wxWindowCreateEvent";
rt.addAtom((char*)"wxWindowCreate");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 191: {// wxWindowDestroyEvent
+case 190: {// wxWindowDestroyEvent
evClass = (char*)"wxWindowDestroyEvent";
rt.addAtom((char*)"wxWindowDestroy");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 192: {// wxHelpEvent
+case 191: {// wxHelpEvent
evClass = (char*)"wxHelpEvent";
rt.addAtom((char*)"wxHelp");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 193: {// wxContextMenuEvent
+case 192: {// wxContextMenuEvent
evClass = (char*)"wxContextMenuEvent";
rt.addAtom((char*)"wxContextMenu");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 194: {// wxIdleEvent
+case 193: {// wxIdleEvent
evClass = (char*)"wxIdleEvent";
rt.addAtom((char*)"wxIdle");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 195: {// wxGridEvent
+case 194: {// wxGridEvent
wxGridEvent * ev = (wxGridEvent *) event;
evClass = (char*)"wxGridEvent";
rt.addAtom((char*)"wxGrid");
@@ -645,7 +628,7 @@ case 195: {// wxGridEvent
rt.addTupleCount(11);
break;
}
-case 197: {// wxSashEvent
+case 196: {// wxSashEvent
wxSashEvent * ev = (wxSashEvent *) event;
evClass = (char*)"wxSashEvent";
rt.addAtom((char*)"wxSash");
@@ -656,7 +639,7 @@ case 197: {// wxSashEvent
rt.addTupleCount(5);
break;
}
-case 198: {// wxListEvent
+case 197: {// wxListEvent
wxListEvent * ev = (wxListEvent *) event;
evClass = (char*)"wxListEvent";
rt.addAtom((char*)"wxList");
@@ -669,7 +652,7 @@ case 198: {// wxListEvent
rt.addTupleCount(7);
break;
}
-case 199: {// wxDateEvent
+case 198: {// wxDateEvent
wxDateEvent * ev = (wxDateEvent *) event;
evClass = (char*)"wxDateEvent";
rt.addAtom((char*)"wxDate");
@@ -678,14 +661,14 @@ case 199: {// wxDateEvent
rt.addTupleCount(3);
break;
}
-case 200: {// wxCalendarEvent
+case 199: {// wxCalendarEvent
evClass = (char*)"wxCalendarEvent";
rt.addAtom((char*)"wxCalendar");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 201: {// wxFileDirPickerEvent
+case 200: {// wxFileDirPickerEvent
wxFileDirPickerEvent * ev = (wxFileDirPickerEvent *) event;
evClass = (char*)"wxFileDirPickerEvent";
rt.addAtom((char*)"wxFileDirPicker");
@@ -694,7 +677,7 @@ case 201: {// wxFileDirPickerEvent
rt.addTupleCount(3);
break;
}
-case 202: {// wxColourPickerEvent
+case 201: {// wxColourPickerEvent
wxColourPickerEvent * ev = (wxColourPickerEvent *) event;
evClass = (char*)"wxColourPickerEvent";
rt.addAtom((char*)"wxColourPicker");
@@ -703,7 +686,7 @@ case 202: {// wxColourPickerEvent
rt.addTupleCount(3);
break;
}
-case 203: {// wxFontPickerEvent
+case 202: {// wxFontPickerEvent
wxFontPickerEvent * ev = (wxFontPickerEvent *) event;
wxFont * GetFont = new wxFont(ev->GetFont());
app->newPtr((void *) GetFont,3, memenv);
@@ -714,7 +697,7 @@ case 203: {// wxFontPickerEvent
rt.addTupleCount(3);
break;
}
-case 204: {// wxStyledTextEvent
+case 203: {// wxStyledTextEvent
wxStyledTextEvent * ev = (wxStyledTextEvent *) event;
evClass = (char*)"wxStyledTextEvent";
rt.addAtom((char*)"wxStyledText");
@@ -742,7 +725,7 @@ case 204: {// wxStyledTextEvent
rt.addTupleCount(22);
break;
}
-case 209: {// wxTreeEvent
+case 208: {// wxTreeEvent
wxTreeEvent * ev = (wxTreeEvent *) event;
evClass = (char*)"wxTreeEvent";
rt.addAtom((char*)"wxTree");
@@ -753,14 +736,14 @@ case 209: {// wxTreeEvent
rt.addTupleCount(5);
break;
}
-case 210: {// wxNotebookEvent
+case 209: {// wxNotebookEvent
evClass = (char*)"wxNotebookEvent";
rt.addAtom((char*)"wxNotebook");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 216: {// wxSpinEvent
+case 215: {// wxSpinEvent
wxSpinEvent * ev = (wxSpinEvent *) event;
evClass = (char*)"wxSpinEvent";
rt.addAtom((char*)"wxSpin");
@@ -769,14 +752,14 @@ case 216: {// wxSpinEvent
rt.addTupleCount(3);
break;
}
-case 218: {// wxSplitterEvent
+case 217: {// wxSplitterEvent
evClass = (char*)"wxSplitterEvent";
rt.addAtom((char*)"wxSplitter");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 220: {// wxHtmlLinkEvent
+case 219: {// wxHtmlLinkEvent
wxHtmlLinkEvent * ev = (wxHtmlLinkEvent *) event;
evClass = (char*)"wxHtmlLinkEvent";
rt.addAtom((char*)"wxHtmlLink");
@@ -785,7 +768,7 @@ case 220: {// wxHtmlLinkEvent
rt.addTupleCount(3);
break;
}
-case 223: {// wxAuiNotebookEvent
+case 222: {// wxAuiNotebookEvent
wxAuiNotebookEvent * ev = (wxAuiNotebookEvent *) event;
wxAuiNotebook * GetDragSource = ev->GetDragSource();
evClass = (char*)"wxAuiNotebookEvent";
@@ -797,7 +780,7 @@ case 223: {// wxAuiNotebookEvent
rt.addTupleCount(5);
break;
}
-case 224: {// wxAuiManagerEvent
+case 223: {// wxAuiManagerEvent
wxAuiManagerEvent * ev = (wxAuiManagerEvent *) event;
wxAuiManager * GetManager = ev->GetManager();
wxAuiPaneInfo * GetPane = ev->GetPane();
@@ -814,7 +797,7 @@ case 224: {// wxAuiManagerEvent
rt.addTupleCount(8);
break;
}
-case 227: {// wxTaskBarIconEvent
+case 226: {// wxTaskBarIconEvent
evClass = (char*)"wxTaskBarIconEvent";
rt.addAtom((char*)"wxTaskBarIcon");
rt.addAtom(Etype->eName);
diff --git a/lib/wx/c_src/gen/wxe_funcs.cpp b/lib/wx/c_src/gen/wxe_funcs.cpp
index 15012011ed..5fbe8a2a9e 100644
--- a/lib/wx/c_src/gen/wxe_funcs.cpp
+++ b/lib/wx/c_src/gen/wxe_funcs.cpp
@@ -27,6 +27,15 @@
#include "wxe_macros.h"
#include "wxe_derived_dest.h"
+#if !wxCHECK_VERSION(2,9,0)
+#define wxPenJoin int
+#define wxPenCap int
+#define wxImageResizeQuality int
+#define wxPolygonFillMode int
+#define wxMappingMode int
+#define wxRasterOperationMode int
+#define wxFloodFillStyle int
+#endif
void WxeApp::wxe_dispatch(wxeCommand& Ecmd)
{
char * bp = Ecmd.buffer;
@@ -149,7 +158,7 @@ case wxWindow_new_3: { // wxWindow::wxWindow
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxWindow * Result = new EwxWindow(parent,(wxWindowID) *id,pos,size,style);
+ wxWindow * Result = new EwxWindow(parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
@@ -326,7 +335,7 @@ case wxWindow_FindWindow_1_0: { // wxWindow::FindWindow
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * winid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->FindWindow((long) *winid);
+ wxWindow * Result = (wxWindow*)This->FindWindow(*winid);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -349,7 +358,7 @@ case wxWindow_FindWindowById: { // wxWindow::FindWindowById
parent = (wxWindow *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxWindow * Result = (wxWindow*)wxWindow::FindWindowById((long) *winid,parent);
+ wxWindow * Result = (wxWindow*)wxWindow::FindWindowById(*winid,parent);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -615,7 +624,7 @@ case wxWindow_GetScrollPos: { // wxWindow::GetScrollPos
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * orient = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetScrollPos((int) *orient);
+ int Result = This->GetScrollPos(*orient);
rt.addInt(Result);
break;
}
@@ -623,7 +632,7 @@ case wxWindow_GetScrollRange: { // wxWindow::GetScrollRange
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * orient = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetScrollRange((int) *orient);
+ int Result = This->GetScrollRange(*orient);
rt.addInt(Result);
break;
}
@@ -631,7 +640,7 @@ case wxWindow_GetScrollThumb: { // wxWindow::GetScrollThumb
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * orient = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetScrollThumb((int) *orient);
+ int Result = This->GetScrollThumb(*orient);
rt.addInt(Result);
break;
}
@@ -719,7 +728,7 @@ case wxWindow_HasScrollbar: { // wxWindow::HasScrollbar
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * orient = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->HasScrollbar((int) *orient);
+ bool Result = This->HasScrollbar(*orient);
rt.addBool(Result);
break;
}
@@ -767,7 +776,7 @@ case wxWindow_IsExposed_2: { // wxWindow::IsExposed
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsExposed((int) *x,(int) *y);
+ bool Result = This->IsExposed(*x,*y);
rt.addBool(Result);
break;
}
@@ -778,7 +787,7 @@ case wxWindow_IsExposed_4: { // wxWindow::IsExposed
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsExposed((int) *x,(int) *y,(int) *w,(int) *h);
+ bool Result = This->IsExposed(*x,*y,*w,*h);
rt.addBool(Result);
break;
}
@@ -877,7 +886,7 @@ case wxWindow_Move_3: { // wxWindow::Move
} break;
}};
if(!This) throw wxe_badarg(0);
- This->Move((int) *x,(int) *y,flags);
+ This->Move(*x,*y,flags);
break;
}
case wxWindow_Move_2: { // wxWindow::Move
@@ -975,7 +984,7 @@ case wxWindow_PopupMenu_3: { // wxWindow::PopupMenu
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->PopupMenu(menu,(int) *x,(int) *y);
+ bool Result = This->PopupMenu(menu,*x,*y);
rt.addBool(Result);
break;
}
@@ -1071,7 +1080,7 @@ case wxWindow_ScrollLines: { // wxWindow::ScrollLines
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * lines = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->ScrollLines((int) *lines);
+ bool Result = This->ScrollLines(*lines);
rt.addBool(Result);
break;
}
@@ -1079,7 +1088,7 @@ case wxWindow_ScrollPages: { // wxWindow::ScrollPages
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * pages = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->ScrollPages((int) *pages);
+ bool Result = This->ScrollPages(*pages);
rt.addBool(Result);
break;
}
@@ -1100,7 +1109,7 @@ case wxWindow_ScrollWindow: { // wxWindow::ScrollWindow
} break;
}};
if(!This) throw wxe_badarg(0);
- This->ScrollWindow((int) *dx,(int) *dy,rect);
+ This->ScrollWindow(*dx,*dy,rect);
break;
}
case wxWindow_SetAcceleratorTable: { // wxWindow::SetAcceleratorTable
@@ -1114,7 +1123,7 @@ case wxWindow_SetAutoLayout: { // wxWindow::SetAutoLayout
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
bool * autoLayout = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAutoLayout((bool) *autoLayout);
+ This->SetAutoLayout(*autoLayout);
break;
}
case wxWindow_SetBackgroundColour: { // wxWindow::SetBackgroundColour
@@ -1133,7 +1142,7 @@ case wxWindow_SetBackgroundStyle: { // wxWindow::SetBackgroundStyle
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
wxBackgroundStyle style = *(wxBackgroundStyle *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetBackgroundStyle((wxBackgroundStyle) style);
+ bool Result = This->SetBackgroundStyle(style);
rt.addBool(Result);
break;
}
@@ -1149,7 +1158,7 @@ case wxWindow_SetClientSize_2: { // wxWindow::SetClientSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetClientSize((int) *width,(int) *height);
+ This->SetClientSize(*width,*height);
break;
}
case wxWindow_SetClientSize_1_0: { // wxWindow::SetClientSize
@@ -1245,7 +1254,7 @@ case wxWindow_SetExtraStyle: { // wxWindow::SetExtraStyle
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * exStyle = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetExtraStyle((long) *exStyle);
+ This->SetExtraStyle(*exStyle);
break;
}
case wxWindow_SetFocus: { // wxWindow::SetFocus
@@ -1293,7 +1302,7 @@ case wxWindow_SetId: { // wxWindow::SetId
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * winid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetId((wxWindowID) *winid);
+ This->SetId(*winid);
break;
}
case wxWindow_SetLabel: { // wxWindow::SetLabel
@@ -1335,7 +1344,7 @@ case wxWindow_SetScrollbar: { // wxWindow::SetScrollbar
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetScrollbar((int) *orient,(int) *pos,(int) *thumbVisible,(int) *range,refresh);
+ This->SetScrollbar(*orient,*pos,*thumbVisible,*range,refresh);
break;
}
case wxWindow_SetScrollPos: { // wxWindow::SetScrollPos
@@ -1350,7 +1359,7 @@ case wxWindow_SetScrollPos: { // wxWindow::SetScrollPos
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetScrollPos((int) *orient,(int) *pos,refresh);
+ This->SetScrollPos(*orient,*pos,refresh);
break;
}
case wxWindow_SetSize_5: { // wxWindow::SetSize
@@ -1367,7 +1376,7 @@ case wxWindow_SetSize_5: { // wxWindow::SetSize
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetSize((int) *x,(int) *y,(int) *width,(int) *height,sizeFlags);
+ This->SetSize(*x,*y,*width,*height,sizeFlags);
break;
}
case wxWindow_SetSize_2_0: { // wxWindow::SetSize
@@ -1375,7 +1384,7 @@ case wxWindow_SetSize_2_0: { // wxWindow::SetSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSize((int) *width,(int) *height);
+ This->SetSize(*width,*height);
break;
}
case wxWindow_SetSize_1: { // wxWindow::SetSize
@@ -1429,7 +1438,7 @@ case wxWindow_SetSizeHints_3: { // wxWindow::SetSizeHints
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetSizeHints((int) *minW,(int) *minH,maxW,maxH,incW,incH);
+ This->SetSizeHints(*minW,*minH,maxW,maxH,incW,incH);
break;
}
case wxWindow_SetSizeHints_2: { // wxWindow::SetSizeHints
@@ -1488,7 +1497,7 @@ case wxWindow_SetThemeEnabled: { // wxWindow::SetThemeEnabled
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
bool * enableTheme = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetThemeEnabled((bool) *enableTheme);
+ This->SetThemeEnabled(*enableTheme);
break;
}
case wxWindow_SetToolTip_1_0: { // wxWindow::SetToolTip
@@ -1521,7 +1530,7 @@ case wxWindow_SetVirtualSize_2: { // wxWindow::SetVirtualSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetVirtualSize((int) *x,(int) *y);
+ This->SetVirtualSize(*x,*y);
break;
}
case wxWindow_SetVirtualSizeHints_3: { // wxWindow::SetVirtualSizeHints
@@ -1540,7 +1549,7 @@ case wxWindow_SetVirtualSizeHints_3: { // wxWindow::SetVirtualSizeHints
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetVirtualSizeHints((int) *minW,(int) *minH,maxW,maxH);
+ This->SetVirtualSizeHints(*minW,*minH,maxW,maxH);
break;
}
case wxWindow_SetVirtualSizeHints_2: { // wxWindow::SetVirtualSizeHints
@@ -1566,21 +1575,21 @@ case wxWindow_SetWindowStyle: { // wxWindow::SetWindowStyle
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWindowStyle((long) *style);
+ This->SetWindowStyle(*style);
break;
}
case wxWindow_SetWindowStyleFlag: { // wxWindow::SetWindowStyleFlag
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWindowStyleFlag((long) *style);
+ This->SetWindowStyleFlag(*style);
break;
}
case wxWindow_SetWindowVariant: { // wxWindow::SetWindowVariant
wxWindow *This = (wxWindow *) getPtr(bp,memenv); bp += 4;
wxWindowVariant variant = *(wxWindowVariant *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetWindowVariant((wxWindowVariant) variant);
+ This->SetWindowVariant(variant);
break;
}
case wxWindow_ShouldInheritColours: { // wxWindow::ShouldInheritColours
@@ -1655,13 +1664,13 @@ case wxWindow_WarpPointer: { // wxWindow::WarpPointer
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->WarpPointer((int) *x,(int) *y);
+ This->WarpPointer(*x,*y);
break;
}
case wxTopLevelWindow_GetIcon: { // wxTopLevelWindow::GetIcon
wxTopLevelWindow *This = (wxTopLevelWindow *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxIcon * Result = &This->GetIcon();
+ const wxIcon * Result = new wxIcon(This->GetIcon()); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxIcon");
break;
}
@@ -1813,7 +1822,7 @@ case wxTopLevelWindow_ShowFullScreen: { // wxTopLevelWindow::ShowFullScreen
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->ShowFullScreen((bool) *show,style);
+ bool Result = This->ShowFullScreen(*show,style);
rt.addBool(Result);
break;
}
@@ -1843,7 +1852,7 @@ case wxFrame_new_4: { // wxFrame::wxFrame
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxFrame * Result = new EwxFrame(parent,(wxWindowID) *id,title,pos,size,style);
+ wxFrame * Result = new EwxFrame(parent,*id,title,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFrame");
break;
@@ -1882,7 +1891,7 @@ case wxFrame_Create: { // wxFrame::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,title,pos,size,style);
+ bool Result = This->Create(parent,*id,title,pos,size,style);
rt.addBool(Result);
break;
}
@@ -1965,7 +1974,7 @@ case wxFrame_ProcessCommand: { // wxFrame::ProcessCommand
wxFrame *This = (wxFrame *) getPtr(bp,memenv); bp += 4;
int * winid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->ProcessCommand((int) *winid);
+ bool Result = This->ProcessCommand(*winid);
rt.addBool(Result);
break;
}
@@ -1993,7 +2002,7 @@ case wxFrame_SetStatusBarPane: { // wxFrame::SetStatusBarPane
wxFrame *This = (wxFrame *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStatusBarPane((int) *n);
+ This->SetStatusBarPane(*n);
break;
}
case wxFrame_SetStatusText: { // wxFrame::SetStatusText
@@ -2058,7 +2067,7 @@ case wxMiniFrame_new_4: { // wxMiniFrame::wxMiniFrame
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxMiniFrame * Result = new EwxMiniFrame(parent,(wxWindowID) *id,title,pos,size,style);
+ wxMiniFrame * Result = new EwxMiniFrame(parent,*id,title,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMiniFrame");
break;
@@ -2091,7 +2100,7 @@ case wxMiniFrame_Create: { // wxMiniFrame::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,title,pos,size,style);
+ bool Result = This->Create(parent,*id,title,pos,size,style);
rt.addBool(Result);
break;
}
@@ -2128,7 +2137,7 @@ case wxSplashScreen_new_6: { // wxSplashScreen::wxSplashScreen
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxSplashScreen * Result = new EwxSplashScreen(*bitmap,(long) *splashStyle,(int) *milliseconds,parent,(wxWindowID) *id,pos,size,style);
+ wxSplashScreen * Result = new EwxSplashScreen(*bitmap,*splashStyle,*milliseconds,parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxSplashScreen");
break;
@@ -2166,7 +2175,7 @@ case wxPanel_new_6: { // wxPanel::wxPanel
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxPanel * Result = new EwxPanel(parent,(int) *x,(int) *y,(int) *width,(int) *height,style);
+ wxPanel * Result = new EwxPanel(parent,*x,*y,*width,*height,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxPanel");
break;
@@ -2254,7 +2263,7 @@ case wxScrolledWindow_CalcScrolledPosition_4: { // wxScrolledWindow::CalcScrolle
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CalcScrolledPosition((int) *x,(int) *y,&xx,&yy);
+ This->CalcScrolledPosition(*x,*y,&xx,&yy);
rt.addInt(xx);
rt.addInt(yy);
rt.addTupleCount(2);
@@ -2277,7 +2286,7 @@ case wxScrolledWindow_CalcUnscrolledPosition_4: { // wxScrolledWindow::CalcUnscr
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CalcUnscrolledPosition((int) *x,(int) *y,&xx,&yy);
+ This->CalcUnscrolledPosition(*x,*y,&xx,&yy);
rt.addInt(xx);
rt.addInt(yy);
rt.addTupleCount(2);
@@ -2298,7 +2307,7 @@ case wxScrolledWindow_EnableScrolling: { // wxScrolledWindow::EnableScrolling
bool * x_scrolling = (bool *) bp; bp += 4;
bool * y_scrolling = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableScrolling((bool) *x_scrolling,(bool) *y_scrolling);
+ This->EnableScrolling(*x_scrolling,*y_scrolling);
break;
}
case wxScrolledWindow_GetScrollPixelsPerUnit: { // wxScrolledWindow::GetScrollPixelsPerUnit
@@ -2342,7 +2351,7 @@ case wxScrolledWindow_Scroll: { // wxScrolledWindow::Scroll
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Scroll((int) *x,(int) *y);
+ This->Scroll(*x,*y);
break;
}
case wxScrolledWindow_SetScrollbars: { // wxScrolledWindow::SetScrollbars
@@ -2367,7 +2376,7 @@ case wxScrolledWindow_SetScrollbars: { // wxScrolledWindow::SetScrollbars
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetScrollbars((int) *pixelsPerUnitX,(int) *pixelsPerUnitY,(int) *noUnitsX,(int) *noUnitsY,xPos,yPos,noRefresh);
+ This->SetScrollbars(*pixelsPerUnitX,*pixelsPerUnitY,*noUnitsX,*noUnitsY,xPos,yPos,noRefresh);
break;
}
case wxScrolledWindow_SetScrollRate: { // wxScrolledWindow::SetScrollRate
@@ -2375,7 +2384,7 @@ case wxScrolledWindow_SetScrollRate: { // wxScrolledWindow::SetScrollRate
int * xstep = (int *) bp; bp += 4;
int * ystep = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetScrollRate((int) *xstep,(int) *ystep);
+ This->SetScrollRate(*xstep,*ystep);
break;
}
case wxScrolledWindow_SetTargetWindow: { // wxScrolledWindow::SetTargetWindow
@@ -2427,7 +2436,7 @@ case wxSashWindow_GetSashVisible: { // wxSashWindow::GetSashVisible
wxSashWindow *This = (wxSashWindow *) getPtr(bp,memenv); bp += 4;
wxSashEdgePosition edge = *(wxSashEdgePosition *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetSashVisible((wxSashEdgePosition) edge);
+ bool Result = This->GetSashVisible(edge);
rt.addBool(Result);
break;
}
@@ -2463,28 +2472,28 @@ case wxSashWindow_SetMaximumSizeX: { // wxSashWindow::SetMaximumSizeX
wxSashWindow *This = (wxSashWindow *) getPtr(bp,memenv); bp += 4;
int * max = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMaximumSizeX((int) *max);
+ This->SetMaximumSizeX(*max);
break;
}
case wxSashWindow_SetMaximumSizeY: { // wxSashWindow::SetMaximumSizeY
wxSashWindow *This = (wxSashWindow *) getPtr(bp,memenv); bp += 4;
int * max = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMaximumSizeY((int) *max);
+ This->SetMaximumSizeY(*max);
break;
}
case wxSashWindow_SetMinimumSizeX: { // wxSashWindow::SetMinimumSizeX
wxSashWindow *This = (wxSashWindow *) getPtr(bp,memenv); bp += 4;
int * min = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinimumSizeX((int) *min);
+ This->SetMinimumSizeX(*min);
break;
}
case wxSashWindow_SetMinimumSizeY: { // wxSashWindow::SetMinimumSizeY
wxSashWindow *This = (wxSashWindow *) getPtr(bp,memenv); bp += 4;
int * min = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinimumSizeY((int) *min);
+ This->SetMinimumSizeY(*min);
break;
}
case wxSashWindow_SetSashVisible: { // wxSashWindow::SetSashVisible
@@ -2492,7 +2501,7 @@ case wxSashWindow_SetSashVisible: { // wxSashWindow::SetSashVisible
wxSashEdgePosition edge = *(wxSashEdgePosition *) bp; bp += 4;;
bool * sash = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSashVisible((wxSashEdgePosition) edge,(bool) *sash);
+ This->SetSashVisible(edge,*sash);
break;
}
case wxSashLayoutWindow_new_0: { // wxSashLayoutWindow::wxSashLayoutWindow
@@ -2583,7 +2592,7 @@ case wxSashLayoutWindow_SetAlignment: { // wxSashLayoutWindow::SetAlignment
wxSashLayoutWindow *This = (wxSashLayoutWindow *) getPtr(bp,memenv); bp += 4;
wxLayoutAlignment align = *(wxLayoutAlignment *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetAlignment((wxLayoutAlignment) align);
+ This->SetAlignment(align);
break;
}
case wxSashLayoutWindow_SetDefaultSize: { // wxSashLayoutWindow::SetDefaultSize
@@ -2599,7 +2608,7 @@ case wxSashLayoutWindow_SetOrientation: { // wxSashLayoutWindow::SetOrientation
wxSashLayoutWindow *This = (wxSashLayoutWindow *) getPtr(bp,memenv); bp += 4;
wxLayoutOrientation orient = *(wxLayoutOrientation *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetOrientation((wxLayoutOrientation) orient);
+ This->SetOrientation(orient);
break;
}
case wxGrid_new_0: { // wxGrid::wxGrid
@@ -2631,7 +2640,7 @@ case wxGrid_new_3: { // wxGrid::wxGrid
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxGrid * Result = new EwxGrid(parent,(wxWindowID) *id,pos,size,style);
+ wxGrid * Result = new EwxGrid(parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxGrid");
break;
@@ -2655,7 +2664,7 @@ case wxGrid_new_4: { // wxGrid::wxGrid
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxGrid * Result = new EwxGrid(parent,(int) *x,(int) *y,w,h,style);
+ wxGrid * Result = new EwxGrid(parent,*x,*y,w,h,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxGrid");
break;
@@ -2712,7 +2721,7 @@ case wxGrid_AutoSizeColumn: { // wxGrid::AutoSizeColumn
} break;
}};
if(!This) throw wxe_badarg(0);
- This->AutoSizeColumn((int) *col,setAsMin);
+ This->AutoSizeColumn(*col,setAsMin);
break;
}
case wxGrid_AutoSizeColumns: { // wxGrid::AutoSizeColumns
@@ -2738,7 +2747,7 @@ case wxGrid_AutoSizeRow: { // wxGrid::AutoSizeRow
} break;
}};
if(!This) throw wxe_badarg(0);
- This->AutoSizeRow((int) *row,setAsMin);
+ This->AutoSizeRow(*row,setAsMin);
break;
}
case wxGrid_AutoSizeRows: { // wxGrid::AutoSizeRows
@@ -2806,7 +2815,7 @@ case wxGrid_CellToRect_2: { // wxGrid::CellToRect
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxRect Result = This->CellToRect((int) *row,(int) *col);
+ wxRect Result = This->CellToRect(*row,*col);
rt.add(Result);
break;
}
@@ -2844,7 +2853,7 @@ selmode = *(wxGrid::wxGridSelectionModes *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->CreateGrid((int) *numRows,(int) *numCols,(wxGrid::wxGridSelectionModes) selmode);
+ bool Result = This->CreateGrid(*numRows,*numCols,selmode);
rt.addBool(Result);
break;
}
@@ -2972,7 +2981,7 @@ case wxGrid_EnableEditing: { // wxGrid::EnableEditing
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * edit = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableEditing((bool) *edit);
+ This->EnableEditing(*edit);
break;
}
case wxGrid_EnableGridLines: { // wxGrid::EnableGridLines
@@ -3020,7 +3029,7 @@ case wxGrid_GetCellAlignment: { // wxGrid::GetCellAlignment
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->GetCellAlignment((int) *row,(int) *col,&horiz,&vert);
+ This->GetCellAlignment(*row,*col,&horiz,&vert);
rt.addInt(horiz);
rt.addInt(vert);
rt.addTupleCount(2);
@@ -3031,7 +3040,7 @@ case wxGrid_GetCellBackgroundColour: { // wxGrid::GetCellBackgroundColour
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour Result = This->GetCellBackgroundColour((int) *row,(int) *col);
+ wxColour Result = This->GetCellBackgroundColour(*row,*col);
rt.add(Result);
break;
}
@@ -3040,7 +3049,7 @@ case wxGrid_GetCellEditor: { // wxGrid::GetCellEditor
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellEditor * Result = (wxGridCellEditor*)This->GetCellEditor((int) *row,(int) *col);
+ wxGridCellEditor * Result = (wxGridCellEditor*)This->GetCellEditor(*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellEditor");
break;
}
@@ -3049,7 +3058,7 @@ case wxGrid_GetCellFont: { // wxGrid::GetCellFont
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxFont * Result = new wxFont(This->GetCellFont((int) *row,(int) *col)); newPtr((void *) Result,3, memenv);;
+ wxFont * Result = new wxFont(This->GetCellFont(*row,*col)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxFont");
break;
}
@@ -3058,7 +3067,7 @@ case wxGrid_GetCellRenderer: { // wxGrid::GetCellRenderer
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellRenderer * Result = (wxGridCellRenderer*)This->GetCellRenderer((int) *row,(int) *col);
+ wxGridCellRenderer * Result = (wxGridCellRenderer*)This->GetCellRenderer(*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellRenderer");
break;
}
@@ -3067,7 +3076,7 @@ case wxGrid_GetCellTextColour: { // wxGrid::GetCellTextColour
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour Result = This->GetCellTextColour((int) *row,(int) *col);
+ wxColour Result = This->GetCellTextColour(*row,*col);
rt.add(Result);
break;
}
@@ -3076,7 +3085,7 @@ case wxGrid_GetCellValue_2: { // wxGrid::GetCellValue
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetCellValue((int) *row,(int) *col);
+ wxString Result = This->GetCellValue(*row,*col);
rt.add(Result);
break;
}
@@ -3112,7 +3121,7 @@ case wxGrid_GetColLabelValue: { // wxGrid::GetColLabelValue
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetColLabelValue((int) *col);
+ wxString Result = This->GetColLabelValue(*col);
rt.add(Result);
break;
}
@@ -3181,7 +3190,7 @@ case wxGrid_GetDefaultEditorForCell_2: { // wxGrid::GetDefaultEditorForCell
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellEditor * Result = (wxGridCellEditor*)This->GetDefaultEditorForCell((int) *row,(int) *col);
+ wxGridCellEditor * Result = (wxGridCellEditor*)This->GetDefaultEditorForCell(*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellEditor");
break;
}
@@ -3217,7 +3226,7 @@ case wxGrid_GetDefaultRendererForCell: { // wxGrid::GetDefaultRendererForCell
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellRenderer * Result = (wxGridCellRenderer*)This->GetDefaultRendererForCell((int) *row,(int) *col);
+ wxGridCellRenderer * Result = (wxGridCellRenderer*)This->GetDefaultRendererForCell(*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellRenderer");
break;
}
@@ -3313,7 +3322,7 @@ case wxGrid_GetOrCreateCellAttr: { // wxGrid::GetOrCreateCellAttr
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellAttr * Result = (wxGridCellAttr*)This->GetOrCreateCellAttr((int) *row,(int) *col);
+ wxGridCellAttr * Result = (wxGridCellAttr*)This->GetOrCreateCellAttr(*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellAttr");
break;
}
@@ -3346,7 +3355,7 @@ case wxGrid_GetRowLabelValue: { // wxGrid::GetRowLabelValue
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * row = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetRowLabelValue((int) *row);
+ wxString Result = This->GetRowLabelValue(*row);
rt.add(Result);
break;
}
@@ -3354,7 +3363,7 @@ case wxGrid_GetRowSize: { // wxGrid::GetRowSize
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * row = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetRowSize((int) *row);
+ int Result = This->GetRowSize(*row);
rt.addInt(Result);
break;
}
@@ -3541,7 +3550,7 @@ case wxGrid_IsInSelection_2: { // wxGrid::IsInSelection
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsInSelection((int) *row,(int) *col);
+ bool Result = This->IsInSelection(*row,*col);
rt.addBool(Result);
break;
}
@@ -3560,7 +3569,7 @@ case wxGrid_IsReadOnly: { // wxGrid::IsReadOnly
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsReadOnly((int) *row,(int) *col);
+ bool Result = This->IsReadOnly(*row,*col);
rt.addBool(Result);
break;
}
@@ -3583,7 +3592,7 @@ case wxGrid_IsVisible_3: { // wxGrid::IsVisible
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->IsVisible((int) *row,(int) *col,wholeCellVisible);
+ bool Result = This->IsVisible(*row,*col,wholeCellVisible);
rt.addBool(Result);
break;
}
@@ -3609,7 +3618,7 @@ case wxGrid_MakeCellVisible_2: { // wxGrid::MakeCellVisible
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->MakeCellVisible((int) *row,(int) *col);
+ This->MakeCellVisible(*row,*col);
break;
}
case wxGrid_MakeCellVisible_1: { // wxGrid::MakeCellVisible
@@ -3625,7 +3634,7 @@ case wxGrid_MoveCursorDown: { // wxGrid::MoveCursorDown
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorDown((bool) *expandSelection);
+ bool Result = This->MoveCursorDown(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3633,7 +3642,7 @@ case wxGrid_MoveCursorLeft: { // wxGrid::MoveCursorLeft
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorLeft((bool) *expandSelection);
+ bool Result = This->MoveCursorLeft(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3641,7 +3650,7 @@ case wxGrid_MoveCursorRight: { // wxGrid::MoveCursorRight
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorRight((bool) *expandSelection);
+ bool Result = This->MoveCursorRight(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3649,7 +3658,7 @@ case wxGrid_MoveCursorUp: { // wxGrid::MoveCursorUp
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorUp((bool) *expandSelection);
+ bool Result = This->MoveCursorUp(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3657,7 +3666,7 @@ case wxGrid_MoveCursorDownBlock: { // wxGrid::MoveCursorDownBlock
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorDownBlock((bool) *expandSelection);
+ bool Result = This->MoveCursorDownBlock(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3665,7 +3674,7 @@ case wxGrid_MoveCursorLeftBlock: { // wxGrid::MoveCursorLeftBlock
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorLeftBlock((bool) *expandSelection);
+ bool Result = This->MoveCursorLeftBlock(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3673,7 +3682,7 @@ case wxGrid_MoveCursorRightBlock: { // wxGrid::MoveCursorRightBlock
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorRightBlock((bool) *expandSelection);
+ bool Result = This->MoveCursorRightBlock(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3681,7 +3690,7 @@ case wxGrid_MoveCursorUpBlock: { // wxGrid::MoveCursorUpBlock
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
bool * expandSelection = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->MoveCursorUpBlock((bool) *expandSelection);
+ bool Result = This->MoveCursorUpBlock(*expandSelection);
rt.addBool(Result);
break;
}
@@ -3736,7 +3745,7 @@ case wxGrid_SelectBlock_5: { // wxGrid::SelectBlock
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SelectBlock((int) *topRow,(int) *leftCol,(int) *bottomRow,(int) *rightCol,addToSelected);
+ This->SelectBlock(*topRow,*leftCol,*bottomRow,*rightCol,addToSelected);
break;
}
case wxGrid_SelectBlock_3: { // wxGrid::SelectBlock
@@ -3768,7 +3777,7 @@ case wxGrid_SelectCol: { // wxGrid::SelectCol
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SelectCol((int) *col,addToSelected);
+ This->SelectCol(*col,addToSelected);
break;
}
case wxGrid_SelectRow: { // wxGrid::SelectRow
@@ -3781,7 +3790,7 @@ case wxGrid_SelectRow: { // wxGrid::SelectRow
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SelectRow((int) *row,addToSelected);
+ This->SelectRow(*row,addToSelected);
break;
}
case wxGrid_SetCellAlignment_4: { // wxGrid::SetCellAlignment
@@ -3791,7 +3800,7 @@ case wxGrid_SetCellAlignment_4: { // wxGrid::SetCellAlignment
int * horiz = (int *) bp; bp += 4;
int * vert = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellAlignment((int) *row,(int) *col,(int) *horiz,(int) *vert);
+ This->SetCellAlignment(*row,*col,*horiz,*vert);
break;
}
case wxGrid_SetCellAlignment_3: { // wxGrid::SetCellAlignment
@@ -3800,14 +3809,14 @@ case wxGrid_SetCellAlignment_3: { // wxGrid::SetCellAlignment
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellAlignment((int) *align,(int) *row,(int) *col);
+ This->SetCellAlignment(*align,*row,*col);
break;
}
case wxGrid_SetCellAlignment_1: { // wxGrid::SetCellAlignment
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * align = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellAlignment((int) *align);
+ This->SetCellAlignment(*align);
break;
}
case wxGrid_SetCellBackgroundColour_3_0: { // wxGrid::SetCellBackgroundColour
@@ -3820,7 +3829,7 @@ case wxGrid_SetCellBackgroundColour_3_0: { // wxGrid::SetCellBackgroundColour
int * valA = (int *) bp; bp += 4;
wxColour val = wxColour(*valR,*valG,*valB,*valA);
if(!This) throw wxe_badarg(0);
- This->SetCellBackgroundColour((int) *row,(int) *col,val);
+ This->SetCellBackgroundColour(*row,*col,val);
break;
}
case wxGrid_SetCellBackgroundColour_1: { // wxGrid::SetCellBackgroundColour
@@ -3844,7 +3853,7 @@ case wxGrid_SetCellBackgroundColour_3_1: { // wxGrid::SetCellBackgroundColour
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellBackgroundColour(colour,(int) *row,(int) *col);
+ This->SetCellBackgroundColour(colour,*row,*col);
break;
}
case wxGrid_SetCellEditor: { // wxGrid::SetCellEditor
@@ -3853,7 +3862,7 @@ case wxGrid_SetCellEditor: { // wxGrid::SetCellEditor
int * col = (int *) bp; bp += 4;
wxGridCellEditor *editor = (wxGridCellEditor *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellEditor((int) *row,(int) *col,editor);
+ This->SetCellEditor(*row,*col,editor);
break;
}
case wxGrid_SetCellFont: { // wxGrid::SetCellFont
@@ -3862,7 +3871,7 @@ case wxGrid_SetCellFont: { // wxGrid::SetCellFont
int * col = (int *) bp; bp += 4;
wxFont *val = (wxFont *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellFont((int) *row,(int) *col,*val);
+ This->SetCellFont(*row,*col,*val);
break;
}
case wxGrid_SetCellRenderer: { // wxGrid::SetCellRenderer
@@ -3871,7 +3880,7 @@ case wxGrid_SetCellRenderer: { // wxGrid::SetCellRenderer
int * col = (int *) bp; bp += 4;
wxGridCellRenderer *renderer = (wxGridCellRenderer *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellRenderer((int) *row,(int) *col,renderer);
+ This->SetCellRenderer(*row,*col,renderer);
break;
}
case wxGrid_SetCellTextColour_3_0: { // wxGrid::SetCellTextColour
@@ -3884,7 +3893,7 @@ case wxGrid_SetCellTextColour_3_0: { // wxGrid::SetCellTextColour
int * valA = (int *) bp; bp += 4;
wxColour val = wxColour(*valR,*valG,*valB,*valA);
if(!This) throw wxe_badarg(0);
- This->SetCellTextColour((int) *row,(int) *col,val);
+ This->SetCellTextColour(*row,*col,val);
break;
}
case wxGrid_SetCellTextColour_3_1: { // wxGrid::SetCellTextColour
@@ -3897,7 +3906,7 @@ case wxGrid_SetCellTextColour_3_1: { // wxGrid::SetCellTextColour
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellTextColour(val,(int) *row,(int) *col);
+ This->SetCellTextColour(val,*row,*col);
break;
}
case wxGrid_SetCellTextColour_1: { // wxGrid::SetCellTextColour
@@ -3919,7 +3928,7 @@ case wxGrid_SetCellValue_3_0: { // wxGrid::SetCellValue
wxString s = wxString(bp, wxConvUTF8);
bp += *sLen+((8-((0+ *sLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetCellValue((int) *row,(int) *col,s);
+ This->SetCellValue(*row,*col,s);
break;
}
case wxGrid_SetCellValue_2: { // wxGrid::SetCellValue
@@ -3942,7 +3951,7 @@ case wxGrid_SetCellValue_3_1: { // wxGrid::SetCellValue
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCellValue(val,(int) *row,(int) *col);
+ This->SetCellValue(val,*row,*col);
break;
}
case wxGrid_SetColAttr: { // wxGrid::SetColAttr
@@ -3950,21 +3959,21 @@ case wxGrid_SetColAttr: { // wxGrid::SetColAttr
int * col = (int *) bp; bp += 4;
wxGridCellAttr *attr = (wxGridCellAttr *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColAttr((int) *col,attr);
+ This->SetColAttr(*col,attr);
break;
}
case wxGrid_SetColFormatBool: { // wxGrid::SetColFormatBool
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColFormatBool((int) *col);
+ This->SetColFormatBool(*col);
break;
}
case wxGrid_SetColFormatNumber: { // wxGrid::SetColFormatNumber
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColFormatNumber((int) *col);
+ This->SetColFormatNumber(*col);
break;
}
case wxGrid_SetColFormatFloat: { // wxGrid::SetColFormatFloat
@@ -3981,7 +3990,7 @@ case wxGrid_SetColFormatFloat: { // wxGrid::SetColFormatFloat
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetColFormatFloat((int) *col,width,precision);
+ This->SetColFormatFloat(*col,width,precision);
break;
}
case wxGrid_SetColFormatCustom: { // wxGrid::SetColFormatCustom
@@ -3991,7 +4000,7 @@ case wxGrid_SetColFormatCustom: { // wxGrid::SetColFormatCustom
wxString typeName = wxString(bp, wxConvUTF8);
bp += *typeNameLen+((8-((4+ *typeNameLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetColFormatCustom((int) *col,typeName);
+ This->SetColFormatCustom(*col,typeName);
break;
}
case wxGrid_SetColLabelAlignment: { // wxGrid::SetColLabelAlignment
@@ -3999,14 +4008,14 @@ case wxGrid_SetColLabelAlignment: { // wxGrid::SetColLabelAlignment
int * horiz = (int *) bp; bp += 4;
int * vert = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColLabelAlignment((int) *horiz,(int) *vert);
+ This->SetColLabelAlignment(*horiz,*vert);
break;
}
case wxGrid_SetColLabelSize: { // wxGrid::SetColLabelSize
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColLabelSize((int) *height);
+ This->SetColLabelSize(*height);
break;
}
case wxGrid_SetColLabelValue: { // wxGrid::SetColLabelValue
@@ -4016,7 +4025,7 @@ case wxGrid_SetColLabelValue: { // wxGrid::SetColLabelValue
wxString val = wxString(bp, wxConvUTF8);
bp += *valLen+((8-((4+ *valLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetColLabelValue((int) *col,val);
+ This->SetColLabelValue(*col,val);
break;
}
case wxGrid_SetColMinimalWidth: { // wxGrid::SetColMinimalWidth
@@ -4024,14 +4033,14 @@ case wxGrid_SetColMinimalWidth: { // wxGrid::SetColMinimalWidth
int * col = (int *) bp; bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColMinimalWidth((int) *col,(int) *width);
+ This->SetColMinimalWidth(*col,*width);
break;
}
case wxGrid_SetColMinimalAcceptableWidth: { // wxGrid::SetColMinimalAcceptableWidth
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColMinimalAcceptableWidth((int) *width);
+ This->SetColMinimalAcceptableWidth(*width);
break;
}
case wxGrid_SetColSize: { // wxGrid::SetColSize
@@ -4039,7 +4048,7 @@ case wxGrid_SetColSize: { // wxGrid::SetColSize
int * col = (int *) bp; bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColSize((int) *col,(int) *width);
+ This->SetColSize(*col,*width);
break;
}
case wxGrid_SetDefaultCellAlignment: { // wxGrid::SetDefaultCellAlignment
@@ -4047,7 +4056,7 @@ case wxGrid_SetDefaultCellAlignment: { // wxGrid::SetDefaultCellAlignment
int * horiz = (int *) bp; bp += 4;
int * vert = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDefaultCellAlignment((int) *horiz,(int) *vert);
+ This->SetDefaultCellAlignment(*horiz,*vert);
break;
}
case wxGrid_SetDefaultCellBackgroundColour: { // wxGrid::SetDefaultCellBackgroundColour
@@ -4103,7 +4112,7 @@ case wxGrid_SetDefaultColSize: { // wxGrid::SetDefaultColSize
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetDefaultColSize((int) *width,resizeExistingCols);
+ This->SetDefaultColSize(*width,resizeExistingCols);
break;
}
case wxGrid_SetDefaultRowSize: { // wxGrid::SetDefaultRowSize
@@ -4116,7 +4125,7 @@ case wxGrid_SetDefaultRowSize: { // wxGrid::SetDefaultRowSize
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetDefaultRowSize((int) *height,resizeExistingRows);
+ This->SetDefaultRowSize(*height,resizeExistingRows);
break;
}
case wxGrid_SetGridCursor: { // wxGrid::SetGridCursor
@@ -4124,7 +4133,7 @@ case wxGrid_SetGridCursor: { // wxGrid::SetGridCursor
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetGridCursor((int) *row,(int) *col);
+ This->SetGridCursor(*row,*col);
break;
}
case wxGrid_SetGridLineColour: { // wxGrid::SetGridLineColour
@@ -4172,7 +4181,7 @@ case wxGrid_SetMargins: { // wxGrid::SetMargins
int * extraWidth = (int *) bp; bp += 4;
int * extraHeight = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMargins((int) *extraWidth,(int) *extraHeight);
+ This->SetMargins(*extraWidth,*extraHeight);
break;
}
case wxGrid_SetReadOnly: { // wxGrid::SetReadOnly
@@ -4187,7 +4196,7 @@ case wxGrid_SetReadOnly: { // wxGrid::SetReadOnly
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetReadOnly((int) *row,(int) *col,isReadOnly);
+ This->SetReadOnly(*row,*col,isReadOnly);
break;
}
case wxGrid_SetRowAttr: { // wxGrid::SetRowAttr
@@ -4195,7 +4204,7 @@ case wxGrid_SetRowAttr: { // wxGrid::SetRowAttr
int * row = (int *) bp; bp += 4;
wxGridCellAttr *attr = (wxGridCellAttr *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRowAttr((int) *row,attr);
+ This->SetRowAttr(*row,attr);
break;
}
case wxGrid_SetRowLabelAlignment: { // wxGrid::SetRowLabelAlignment
@@ -4203,14 +4212,14 @@ case wxGrid_SetRowLabelAlignment: { // wxGrid::SetRowLabelAlignment
int * horiz = (int *) bp; bp += 4;
int * vert = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRowLabelAlignment((int) *horiz,(int) *vert);
+ This->SetRowLabelAlignment(*horiz,*vert);
break;
}
case wxGrid_SetRowLabelSize: { // wxGrid::SetRowLabelSize
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRowLabelSize((int) *width);
+ This->SetRowLabelSize(*width);
break;
}
case wxGrid_SetRowLabelValue: { // wxGrid::SetRowLabelValue
@@ -4220,7 +4229,7 @@ case wxGrid_SetRowLabelValue: { // wxGrid::SetRowLabelValue
wxString val = wxString(bp, wxConvUTF8);
bp += *valLen+((8-((4+ *valLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetRowLabelValue((int) *row,val);
+ This->SetRowLabelValue(*row,val);
break;
}
case wxGrid_SetRowMinimalHeight: { // wxGrid::SetRowMinimalHeight
@@ -4228,14 +4237,14 @@ case wxGrid_SetRowMinimalHeight: { // wxGrid::SetRowMinimalHeight
int * row = (int *) bp; bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRowMinimalHeight((int) *row,(int) *width);
+ This->SetRowMinimalHeight(*row,*width);
break;
}
case wxGrid_SetRowMinimalAcceptableHeight: { // wxGrid::SetRowMinimalAcceptableHeight
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRowMinimalAcceptableHeight((int) *width);
+ This->SetRowMinimalAcceptableHeight(*width);
break;
}
case wxGrid_SetRowSize: { // wxGrid::SetRowSize
@@ -4243,21 +4252,21 @@ case wxGrid_SetRowSize: { // wxGrid::SetRowSize
int * row = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRowSize((int) *row,(int) *height);
+ This->SetRowSize(*row,*height);
break;
}
case wxGrid_SetScrollLineX: { // wxGrid::SetScrollLineX
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * x = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetScrollLineX((int) *x);
+ This->SetScrollLineX(*x);
break;
}
case wxGrid_SetScrollLineY: { // wxGrid::SetScrollLineY
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetScrollLineY((int) *y);
+ This->SetScrollLineY(*y);
break;
}
case wxGrid_SetSelectionBackground: { // wxGrid::SetSelectionBackground
@@ -4286,7 +4295,7 @@ case wxGrid_SetSelectionMode: { // wxGrid::SetSelectionMode
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
wxGrid::wxGridSelectionModes selmode = *(wxGrid::wxGridSelectionModes *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetSelectionMode((wxGrid::wxGridSelectionModes) selmode);
+ This->SetSelectionMode(selmode);
break;
}
case wxGrid_ShowCellEditControl: { // wxGrid::ShowCellEditControl
@@ -4305,7 +4314,7 @@ case wxGrid_XToCol: { // wxGrid::XToCol
} break;
}};
if(!This) throw wxe_badarg(0);
- int Result = This->XToCol((int) *x,clipToMinMax);
+ int Result = This->XToCol(*x,clipToMinMax);
rt.addInt(Result);
break;
}
@@ -4313,7 +4322,7 @@ case wxGrid_XToEdgeOfCol: { // wxGrid::XToEdgeOfCol
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * x = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->XToEdgeOfCol((int) *x);
+ int Result = This->XToEdgeOfCol(*x);
rt.addInt(Result);
break;
}
@@ -4321,7 +4330,7 @@ case wxGrid_YToEdgeOfRow: { // wxGrid::YToEdgeOfRow
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->YToEdgeOfRow((int) *y);
+ int Result = This->YToEdgeOfRow(*y);
rt.addInt(Result);
break;
}
@@ -4329,7 +4338,7 @@ case wxGrid_YToRow: { // wxGrid::YToRow
wxGrid *This = (wxGrid *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->YToRow((int) *y);
+ int Result = This->YToRow(*y);
rt.addInt(Result);
break;
}
@@ -4347,7 +4356,7 @@ case wxGridCellRenderer_Draw: { // wxGridCellRenderer::Draw
int * col = (int *) bp; bp += 4;
bool * isSelected = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Draw(*grid,*attr,*dc,rect,(int) *row,(int) *col,(bool) *isSelected);
+ This->Draw(*grid,*attr,*dc,rect,*row,*col,*isSelected);
break;
}
case wxGridCellRenderer_GetBestSize: { // wxGridCellRenderer::GetBestSize
@@ -4358,7 +4367,7 @@ case wxGridCellRenderer_GetBestSize: { // wxGridCellRenderer::GetBestSize
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSize Result = This->GetBestSize(*grid,*attr,*dc,(int) *row,(int) *col);
+ wxSize Result = This->GetBestSize(*grid,*attr,*dc,*row,*col);
rt.add(Result);
break;
}
@@ -4368,7 +4377,7 @@ case wxGridCellEditor_Create: { // wxGridCellEditor::Create
int * id = (int *) bp; bp += 4;
wxEvtHandler *evtHandler = (wxEvtHandler *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->Create(parent,(wxWindowID) *id,evtHandler);
+ This->Create(parent,*id,evtHandler);
break;
}
case wxGridCellEditor_IsCreated: { // wxGridCellEditor::IsCreated
@@ -4399,9 +4408,10 @@ attr = (wxGridCellAttr *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- This->Show((bool) *show,attr);
+ This->Show(*show,attr);
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxGridCellEditor_PaintBackground: { // wxGridCellEditor::PaintBackground
wxGridCellEditor *This = (wxGridCellEditor *) getPtr(bp,memenv); bp += 4;
int * rectCellX = (int *) bp; bp += 4;
@@ -4414,25 +4424,28 @@ case wxGridCellEditor_PaintBackground: { // wxGridCellEditor::PaintBackground
This->PaintBackground(rectCell,attr);
break;
}
+#endif
case wxGridCellEditor_BeginEdit: { // wxGridCellEditor::BeginEdit
wxGridCellEditor *This = (wxGridCellEditor *) getPtr(bp,memenv); bp += 4;
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
wxGrid *grid = (wxGrid *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->BeginEdit((int) *row,(int) *col,grid);
+ This->BeginEdit(*row,*col,grid);
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxGridCellEditor_EndEdit: { // wxGridCellEditor::EndEdit
wxGridCellEditor *This = (wxGridCellEditor *) getPtr(bp,memenv); bp += 4;
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
wxGrid *grid = (wxGrid *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->EndEdit((int) *row,(int) *col,grid);
+ bool Result = This->EndEdit(*row,*col,grid);
rt.addBool(Result);
break;
}
+#endif
case wxGridCellEditor_Reset: { // wxGridCellEditor::Reset
wxGridCellEditor *This = (wxGridCellEditor *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
@@ -4552,14 +4565,14 @@ case wxGridCellFloatRenderer_SetPrecision: { // wxGridCellFloatRenderer::SetPrec
wxGridCellFloatRenderer *This = (wxGridCellFloatRenderer *) getPtr(bp,memenv); bp += 4;
int * precision = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPrecision((int) *precision);
+ This->SetPrecision(*precision);
break;
}
case wxGridCellFloatRenderer_SetWidth: { // wxGridCellFloatRenderer::SetWidth
wxGridCellFloatRenderer *This = (wxGridCellFloatRenderer *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWidth((int) *width);
+ This->SetWidth(*width);
break;
}
case wxGridCellFloatRenderer_destroy: { // wxGridCellFloatRenderer::destroy
@@ -4753,7 +4766,7 @@ case wxGridCellAttr_SetAlignment: { // wxGridCellAttr::SetAlignment
int * hAlign = (int *) bp; bp += 4;
int * vAlign = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAlignment((int) *hAlign,(int) *vAlign);
+ This->SetAlignment(*hAlign,*vAlign);
break;
}
case wxGridCellAttr_SetReadOnly: { // wxGridCellAttr::SetReadOnly
@@ -4863,7 +4876,7 @@ case wxGridCellAttr_GetRenderer: { // wxGridCellAttr::GetRenderer
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellRenderer * Result = (wxGridCellRenderer*)This->GetRenderer(grid,(int) *row,(int) *col);
+ wxGridCellRenderer * Result = (wxGridCellRenderer*)This->GetRenderer(grid,*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellRenderer");
break;
}
@@ -4873,7 +4886,7 @@ case wxGridCellAttr_GetEditor: { // wxGridCellAttr::GetEditor
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGridCellEditor * Result = (wxGridCellEditor*)This->GetEditor(grid,(int) *row,(int) *col);
+ wxGridCellEditor * Result = (wxGridCellEditor*)This->GetEditor(grid,*row,*col);
rt.addRef(getRef((void *)Result,memenv), "wxGridCellEditor");
break;
}
@@ -4892,7 +4905,7 @@ case wxGridCellAttr_SetDefAttr: { // wxGridCellAttr::SetDefAttr
break;
}
case wxDC_Blit: { // wxDC::Blit
- int rop=wxCOPY;
+ wxRasterOperationMode rop=wxCOPY;
bool useMask=false;
wxPoint srcPtMask= wxDefaultPosition;
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
@@ -4908,7 +4921,7 @@ case wxDC_Blit: { // wxDC::Blit
wxPoint srcPt = wxPoint(*srcPtX,*srcPtY);
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- rop = (int)*(int *) bp; bp += 4;
+rop = *(wxRasterOperationMode *) bp; bp += 4;;
} break;
case 2: {bp += 4;
useMask = *(bool *) bp; bp += 4;
@@ -4930,7 +4943,7 @@ case wxDC_CalcBoundingBox: { // wxDC::CalcBoundingBox
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CalcBoundingBox((wxCoord) *x,(wxCoord) *y);
+ This->CalcBoundingBox(*x,*y);
break;
}
case wxDC_Clear: { // wxDC::Clear
@@ -4939,12 +4952,14 @@ case wxDC_Clear: { // wxDC::Clear
This->Clear();
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxDC_ComputeScaleAndOrigin: { // wxDC::ComputeScaleAndOrigin
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
This->ComputeScaleAndOrigin();
break;
}
+#endif
case wxDC_CrossHair: { // wxDC::CrossHair
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * ptX = (int *) bp; bp += 4;
@@ -4964,7 +4979,7 @@ case wxDC_DeviceToLogicalX: { // wxDC::DeviceToLogicalX
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * x = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->DeviceToLogicalX((wxCoord) *x);
+ wxCoord Result = This->DeviceToLogicalX(*x);
rt.addInt(Result);
break;
}
@@ -4972,7 +4987,7 @@ case wxDC_DeviceToLogicalXRel: { // wxDC::DeviceToLogicalXRel
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * x = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->DeviceToLogicalXRel((wxCoord) *x);
+ wxCoord Result = This->DeviceToLogicalXRel(*x);
rt.addInt(Result);
break;
}
@@ -4980,7 +4995,7 @@ case wxDC_DeviceToLogicalY: { // wxDC::DeviceToLogicalY
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->DeviceToLogicalY((wxCoord) *y);
+ wxCoord Result = This->DeviceToLogicalY(*y);
rt.addInt(Result);
break;
}
@@ -4988,7 +5003,7 @@ case wxDC_DeviceToLogicalYRel: { // wxDC::DeviceToLogicalYRel
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->DeviceToLogicalYRel((wxCoord) *y);
+ wxCoord Result = This->DeviceToLogicalYRel(*y);
rt.addInt(Result);
break;
}
@@ -5041,7 +5056,7 @@ case wxDC_DrawCircle: { // wxDC::DrawCircle
wxPoint pt = wxPoint(*ptX,*ptY);
int * radius = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->DrawCircle(pt,(wxCoord) *radius);
+ This->DrawCircle(pt,*radius);
break;
}
case wxDC_DrawEllipse_2: { // wxDC::DrawEllipse
@@ -5079,7 +5094,7 @@ case wxDC_DrawEllipticArc: { // wxDC::DrawEllipticArc
double * sa = (double *) bp; bp += 8;
double * ea = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawEllipticArc(pt,sz,(double) *sa,(double) *ea);
+ This->DrawEllipticArc(pt,sz,*sa,*ea);
break;
}
case wxDC_DrawIcon: { // wxDC::DrawIcon
@@ -5155,7 +5170,7 @@ case wxDC_DrawLines: { // wxDC::DrawLines
case wxDC_DrawPolygon: { // wxDC::DrawPolygon
wxCoord xoffset=0;
wxCoord yoffset=0;
- int fillStyle=wxODDEVEN_RULE;
+ wxPolygonFillMode fillStyle=wxODDEVEN_RULE;
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * pointsLen = (int *) bp; bp += 4;
wxPoint *points;
@@ -5172,7 +5187,7 @@ case wxDC_DrawPolygon: { // wxDC::DrawPolygon
yoffset = (wxCoord)*(int *) bp; bp += 4;
} break;
case 3: {bp += 4;
- fillStyle = (int)*(int *) bp; bp += 4;
+fillStyle = *(wxPolygonFillMode *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
@@ -5222,7 +5237,7 @@ case wxDC_DrawRotatedText: { // wxDC::DrawRotatedText
wxPoint pt = wxPoint(*ptX,*ptY);
double * angle = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawRotatedText(text,pt,(double) *angle);
+ This->DrawRotatedText(text,pt,*angle);
break;
}
case wxDC_DrawRoundedRectangle_3: { // wxDC::DrawRoundedRectangle
@@ -5236,7 +5251,7 @@ case wxDC_DrawRoundedRectangle_3: { // wxDC::DrawRoundedRectangle
bp += 4; /* Align */
double * radius = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawRoundedRectangle(pt,sz,(double) *radius);
+ This->DrawRoundedRectangle(pt,sz,*radius);
break;
}
case wxDC_DrawRoundedRectangle_2: { // wxDC::DrawRoundedRectangle
@@ -5249,7 +5264,7 @@ case wxDC_DrawRoundedRectangle_2: { // wxDC::DrawRoundedRectangle
bp += 4; /* Align */
double * radius = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawRoundedRectangle(r,(double) *radius);
+ This->DrawRoundedRectangle(r,*radius);
break;
}
case wxDC_DrawText: { // wxDC::DrawText
@@ -5277,7 +5292,7 @@ case wxDC_EndPage: { // wxDC::EndPage
break;
}
case wxDC_FloodFill: { // wxDC::FloodFill
- int style=wxFLOOD_SURFACE;
+ wxFloodFillStyle style=wxFLOOD_SURFACE;
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * ptX = (int *) bp; bp += 4;
int * ptY = (int *) bp; bp += 4;
@@ -5290,7 +5305,7 @@ case wxDC_FloodFill: { // wxDC::FloodFill
bp += 4; /* Align */
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- style = (int)*(int *) bp; bp += 4;
+style = *(wxFloodFillStyle *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
@@ -5591,14 +5606,14 @@ nDirection = *(wxDirection *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- This->GradientFillLinear(rect,initialColour,destColour,(wxDirection) nDirection);
+ This->GradientFillLinear(rect,initialColour,destColour,nDirection);
break;
}
case wxDC_LogicalToDeviceX: { // wxDC::LogicalToDeviceX
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * x = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->LogicalToDeviceX((wxCoord) *x);
+ wxCoord Result = This->LogicalToDeviceX(*x);
rt.addInt(Result);
break;
}
@@ -5606,7 +5621,7 @@ case wxDC_LogicalToDeviceXRel: { // wxDC::LogicalToDeviceXRel
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * x = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->LogicalToDeviceXRel((wxCoord) *x);
+ wxCoord Result = This->LogicalToDeviceXRel(*x);
rt.addInt(Result);
break;
}
@@ -5614,7 +5629,7 @@ case wxDC_LogicalToDeviceY: { // wxDC::LogicalToDeviceY
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->LogicalToDeviceY((wxCoord) *y);
+ wxCoord Result = This->LogicalToDeviceY(*y);
rt.addInt(Result);
break;
}
@@ -5622,7 +5637,7 @@ case wxDC_LogicalToDeviceYRel: { // wxDC::LogicalToDeviceYRel
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCoord Result = This->LogicalToDeviceYRel((wxCoord) *y);
+ wxCoord Result = This->LogicalToDeviceYRel(*y);
rt.addInt(Result);
break;
}
@@ -5672,7 +5687,7 @@ case wxDC_SetAxisOrientation: { // wxDC::SetAxisOrientation
bool * xLeftRight = (bool *) bp; bp += 4;
bool * yBottomUp = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAxisOrientation((bool) *xLeftRight,(bool) *yBottomUp);
+ This->SetAxisOrientation(*xLeftRight,*yBottomUp);
break;
}
case wxDC_SetBackground: { // wxDC::SetBackground
@@ -5686,7 +5701,7 @@ case wxDC_SetBackgroundMode: { // wxDC::SetBackgroundMode
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetBackgroundMode((int) *mode);
+ This->SetBackgroundMode(*mode);
break;
}
case wxDC_SetBrush: { // wxDC::SetBrush
@@ -5731,7 +5746,7 @@ case wxDC_SetDeviceOrigin: { // wxDC::SetDeviceOrigin
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDeviceOrigin((wxCoord) *x,(wxCoord) *y);
+ This->SetDeviceOrigin(*x,*y);
break;
}
case wxDC_SetFont: { // wxDC::SetFont
@@ -5745,21 +5760,21 @@ case wxDC_SetLayoutDirection: { // wxDC::SetLayoutDirection
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
wxLayoutDirection dir = *(wxLayoutDirection *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetLayoutDirection((wxLayoutDirection) dir);
+ This->SetLayoutDirection(dir);
break;
}
case wxDC_SetLogicalFunction: { // wxDC::SetLogicalFunction
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
- int * function = (int *) bp; bp += 4;
+ wxRasterOperationMode function = *(wxRasterOperationMode *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetLogicalFunction((int) *function);
+ This->SetLogicalFunction(function);
break;
}
case wxDC_SetMapMode: { // wxDC::SetMapMode
wxDC *This = (wxDC *) getPtr(bp,memenv); bp += 4;
- int * mode = (int *) bp; bp += 4;
+ wxMappingMode mode = *(wxMappingMode *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetMapMode((int) *mode);
+ This->SetMapMode(mode);
break;
}
case wxDC_SetPalette: { // wxDC::SetPalette
@@ -5804,7 +5819,7 @@ case wxDC_SetUserScale: { // wxDC::SetUserScale
double * x = (double *) bp; bp += 8;
double * y = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->SetUserScale((double) *x,(double) *y);
+ This->SetUserScale(*x,*y);
break;
}
case wxDC_StartDoc: { // wxDC::StartDoc
@@ -5826,7 +5841,7 @@ case wxDC_StartPage: { // wxDC::StartPage
case wxMirrorDC_new: { // wxMirrorDC::wxMirrorDC
wxDC *dc = (wxDC *) getPtr(bp,memenv); bp += 4;
bool * mirror = (bool *) bp; bp += 4;
- wxMirrorDC * Result = new EwxMirrorDC(*dc,(bool) *mirror);
+ wxMirrorDC * Result = new EwxMirrorDC(*dc,*mirror);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMirrorDC");
break;
@@ -5850,22 +5865,28 @@ case wxPostScriptDC_new_1: { // wxPostScriptDC::wxPostScriptDC
rt.addRef(getRef((void *)Result,memenv), "wxPostScriptDC");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxPostScriptDC_SetResolution: { // wxPostScriptDC::SetResolution
int * ppi = (int *) bp; bp += 4;
- wxPostScriptDC::SetResolution((int) *ppi);
+ wxPostScriptDC::SetResolution(*ppi);
break;
}
+#endif
+#if !wxCHECK_VERSION(2,9,0)
case wxPostScriptDC_GetResolution: { // wxPostScriptDC::GetResolution
int Result = wxPostScriptDC::GetResolution();
rt.addInt(Result);
break;
}
+#endif
+#if !wxCHECK_VERSION(2,9,0)
case wxWindowDC_new_0: { // wxWindowDC::wxWindowDC
wxWindowDC * Result = new EwxWindowDC();
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxWindowDC");
break;
}
+#endif
case wxWindowDC_new_1: { // wxWindowDC::wxWindowDC
wxWindow *win = (wxWindow *) getPtr(bp,memenv); bp += 4;
wxWindowDC * Result = new EwxWindowDC(win);
@@ -5873,12 +5894,14 @@ case wxWindowDC_new_1: { // wxWindowDC::wxWindowDC
rt.addRef(getRef((void *)Result,memenv), "wxWindowDC");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxClientDC_new_0: { // wxClientDC::wxClientDC
wxClientDC * Result = new EwxClientDC();
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxClientDC");
break;
}
+#endif
case wxClientDC_new_1: { // wxClientDC::wxClientDC
wxWindow *win = (wxWindow *) getPtr(bp,memenv); bp += 4;
wxClientDC * Result = new EwxClientDC(win);
@@ -5886,12 +5909,14 @@ case wxClientDC_new_1: { // wxClientDC::wxClientDC
rt.addRef(getRef((void *)Result,memenv), "wxClientDC");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxPaintDC_new_0: { // wxPaintDC::wxPaintDC
wxPaintDC * Result = new EwxPaintDC();
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxPaintDC");
break;
}
+#endif
case wxPaintDC_new_1: { // wxPaintDC::wxPaintDC
wxWindow *win = (wxWindow *) getPtr(bp,memenv); bp += 4;
wxPaintDC * Result = new EwxPaintDC(win);
@@ -6085,6 +6110,7 @@ case wxGraphicsContext_CreateBrush: { // wxGraphicsContext::CreateBrush
rt.addRef(getRef((void *)Result,memenv), "wxGraphicsBrush");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxGraphicsContext_CreateRadialGradientBrush: { // wxGraphicsContext::CreateRadialGradientBrush
wxGraphicsContext *This = (wxGraphicsContext *) getPtr(bp,memenv); bp += 4;
bp += 4; /* Align */
@@ -6104,10 +6130,12 @@ case wxGraphicsContext_CreateRadialGradientBrush: { // wxGraphicsContext::Create
int * cColorA = (int *) bp; bp += 4;
wxColour cColor = wxColour(*cColorR,*cColorG,*cColorB,*cColorA);
if(!This) throw wxe_badarg(0);
- wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateRadialGradientBrush((wxDouble) *xo,(wxDouble) *yo,(wxDouble) *xc,(wxDouble) *yc,(wxDouble) *radius,oColor,cColor)); newPtr((void *) Result,3, memenv);;
+ wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateRadialGradientBrush(*xo,*yo,*xc,*yc,*radius,oColor,cColor)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxGraphicsBrush");
break;
}
+#endif
+#if !wxCHECK_VERSION(2,9,0)
case wxGraphicsContext_CreateLinearGradientBrush: { // wxGraphicsContext::CreateLinearGradientBrush
wxGraphicsContext *This = (wxGraphicsContext *) getPtr(bp,memenv); bp += 4;
bp += 4; /* Align */
@@ -6126,10 +6154,11 @@ case wxGraphicsContext_CreateLinearGradientBrush: { // wxGraphicsContext::Create
int * c2A = (int *) bp; bp += 4;
wxColour c2 = wxColour(*c2R,*c2G,*c2B,*c2A);
if(!This) throw wxe_badarg(0);
- wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateLinearGradientBrush((wxDouble) *x1,(wxDouble) *y1,(wxDouble) *x2,(wxDouble) *y2,c1,c2)); newPtr((void *) Result,3, memenv);;
+ wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateLinearGradientBrush(*x1,*y1,*x2,*y2,c1,c2)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxGraphicsBrush");
break;
}
+#endif
case wxGraphicsContext_CreateFont: { // wxGraphicsContext::CreateFont
wxColour col= *wxBLACK;
wxGraphicsContext *This = (wxGraphicsContext *) getPtr(bp,memenv); bp += 4;
@@ -6211,7 +6240,7 @@ case wxGraphicsContext_Clip_4: { // wxGraphicsContext::Clip
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Clip((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->Clip(*x,*y,*w,*h);
break;
}
case wxGraphicsContext_ResetClip: { // wxGraphicsContext::ResetClip
@@ -6228,7 +6257,7 @@ case wxGraphicsContext_DrawBitmap: { // wxGraphicsContext::DrawBitmap
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawBitmap(*bmp,(wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->DrawBitmap(*bmp,*x,*y,*w,*h);
break;
}
case wxGraphicsContext_DrawEllipse: { // wxGraphicsContext::DrawEllipse
@@ -6239,7 +6268,7 @@ case wxGraphicsContext_DrawEllipse: { // wxGraphicsContext::DrawEllipse
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawEllipse((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->DrawEllipse(*x,*y,*w,*h);
break;
}
case wxGraphicsContext_DrawIcon: { // wxGraphicsContext::DrawIcon
@@ -6250,11 +6279,11 @@ case wxGraphicsContext_DrawIcon: { // wxGraphicsContext::DrawIcon
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawIcon(*icon,(wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->DrawIcon(*icon,*x,*y,*w,*h);
break;
}
case wxGraphicsContext_DrawLines: { // wxGraphicsContext::DrawLines
- int fillStyle=wxODDEVEN_RULE;
+ wxPolygonFillMode fillStyle=wxODDEVEN_RULE;
wxGraphicsContext *This = (wxGraphicsContext *) getPtr(bp,memenv); bp += 4;
int * pointsLen = (int *) bp; bp += 4;
wxPoint2DDouble *points;
@@ -6265,7 +6294,7 @@ case wxGraphicsContext_DrawLines: { // wxGraphicsContext::DrawLines
points[i] = wxPoint2DDouble(x,y);}
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- fillStyle = (int)*(int *) bp; bp += 4;
+fillStyle = *(wxPolygonFillMode *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
@@ -6274,12 +6303,12 @@ case wxGraphicsContext_DrawLines: { // wxGraphicsContext::DrawLines
break;
}
case wxGraphicsContext_DrawPath: { // wxGraphicsContext::DrawPath
- int fillStyle=wxODDEVEN_RULE;
+ wxPolygonFillMode fillStyle=wxODDEVEN_RULE;
wxGraphicsContext *This = (wxGraphicsContext *) getPtr(bp,memenv); bp += 4;
wxGraphicsPath *path = (wxGraphicsPath *) getPtr(bp,memenv); bp += 4;
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- fillStyle = (int)*(int *) bp; bp += 4;
+fillStyle = *(wxPolygonFillMode *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
@@ -6294,7 +6323,7 @@ case wxGraphicsContext_DrawRectangle: { // wxGraphicsContext::DrawRectangle
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawRectangle((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->DrawRectangle(*x,*y,*w,*h);
break;
}
case wxGraphicsContext_DrawRoundedRectangle: { // wxGraphicsContext::DrawRoundedRectangle
@@ -6306,7 +6335,7 @@ case wxGraphicsContext_DrawRoundedRectangle: { // wxGraphicsContext::DrawRounded
wxDouble * h = (wxDouble *) bp; bp += 8;
wxDouble * radius = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawRoundedRectangle((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h,(wxDouble) *radius);
+ This->DrawRoundedRectangle(*x,*y,*w,*h,*radius);
break;
}
case wxGraphicsContext_DrawText_3: { // wxGraphicsContext::DrawText
@@ -6317,7 +6346,7 @@ case wxGraphicsContext_DrawText_3: { // wxGraphicsContext::DrawText
wxDouble * x = (wxDouble *) bp; bp += 8;
wxDouble * y = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawText(str,(wxDouble) *x,(wxDouble) *y);
+ This->DrawText(str,*x,*y);
break;
}
case wxGraphicsContext_DrawText_4_0: { // wxGraphicsContext::DrawText
@@ -6329,7 +6358,7 @@ case wxGraphicsContext_DrawText_4_0: { // wxGraphicsContext::DrawText
wxDouble * y = (wxDouble *) bp; bp += 8;
wxDouble * angle = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->DrawText(str,(wxDouble) *x,(wxDouble) *y,(wxDouble) *angle);
+ This->DrawText(str,*x,*y,*angle);
break;
}
case wxGraphicsContext_DrawText_4_1: { // wxGraphicsContext::DrawText
@@ -6341,7 +6370,7 @@ case wxGraphicsContext_DrawText_4_1: { // wxGraphicsContext::DrawText
wxDouble * y = (wxDouble *) bp; bp += 8;
wxGraphicsBrush *backgroundBrush = (wxGraphicsBrush *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->DrawText(str,(wxDouble) *x,(wxDouble) *y,*backgroundBrush);
+ This->DrawText(str,*x,*y,*backgroundBrush);
break;
}
case wxGraphicsContext_DrawText_5: { // wxGraphicsContext::DrawText
@@ -6354,16 +6383,16 @@ case wxGraphicsContext_DrawText_5: { // wxGraphicsContext::DrawText
wxDouble * angle = (wxDouble *) bp; bp += 8;
wxGraphicsBrush *backgroundBrush = (wxGraphicsBrush *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->DrawText(str,(wxDouble) *x,(wxDouble) *y,(wxDouble) *angle,*backgroundBrush);
+ This->DrawText(str,*x,*y,*angle,*backgroundBrush);
break;
}
case wxGraphicsContext_FillPath: { // wxGraphicsContext::FillPath
- int fillStyle=wxODDEVEN_RULE;
+ wxPolygonFillMode fillStyle=wxODDEVEN_RULE;
wxGraphicsContext *This = (wxGraphicsContext *) getPtr(bp,memenv); bp += 4;
wxGraphicsPath *path = (wxGraphicsPath *) getPtr(bp,memenv); bp += 4;
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- fillStyle = (int)*(int *) bp; bp += 4;
+fillStyle = *(wxPolygonFillMode *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
@@ -6411,7 +6440,7 @@ case wxGraphicsContext_Rotate: { // wxGraphicsContext::Rotate
bp += 4; /* Align */
wxDouble * angle = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Rotate((wxDouble) *angle);
+ This->Rotate(*angle);
break;
}
case wxGraphicsContext_Scale: { // wxGraphicsContext::Scale
@@ -6420,7 +6449,7 @@ case wxGraphicsContext_Scale: { // wxGraphicsContext::Scale
wxDouble * xScale = (wxDouble *) bp; bp += 8;
wxDouble * yScale = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Scale((wxDouble) *xScale,(wxDouble) *yScale);
+ This->Scale(*xScale,*yScale);
break;
}
case wxGraphicsContext_Translate: { // wxGraphicsContext::Translate
@@ -6429,7 +6458,7 @@ case wxGraphicsContext_Translate: { // wxGraphicsContext::Translate
wxDouble * dx = (wxDouble *) bp; bp += 8;
wxDouble * dy = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Translate((wxDouble) *dx,(wxDouble) *dy);
+ This->Translate(*dx,*dy);
break;
}
case wxGraphicsContext_GetTransform: { // wxGraphicsContext::GetTransform
@@ -6508,7 +6537,7 @@ case wxGraphicsContext_StrokeLine: { // wxGraphicsContext::StrokeLine
wxDouble * x2 = (wxDouble *) bp; bp += 8;
wxDouble * y2 = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->StrokeLine((wxDouble) *x1,(wxDouble) *y1,(wxDouble) *x2,(wxDouble) *y2);
+ This->StrokeLine(*x1,*y1,*x2,*y2);
break;
}
case wxGraphicsContext_StrokeLines: { // wxGraphicsContext::StrokeLines
@@ -6579,7 +6608,7 @@ case wxGraphicsMatrix_Rotate: { // wxGraphicsMatrix::Rotate
bp += 4; /* Align */
wxDouble * angle = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Rotate((wxDouble) *angle);
+ This->Rotate(*angle);
break;
}
case wxGraphicsMatrix_Scale: { // wxGraphicsMatrix::Scale
@@ -6588,7 +6617,7 @@ case wxGraphicsMatrix_Scale: { // wxGraphicsMatrix::Scale
wxDouble * xScale = (wxDouble *) bp; bp += 8;
wxDouble * yScale = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Scale((wxDouble) *xScale,(wxDouble) *yScale);
+ This->Scale(*xScale,*yScale);
break;
}
case wxGraphicsMatrix_Translate: { // wxGraphicsMatrix::Translate
@@ -6597,7 +6626,7 @@ case wxGraphicsMatrix_Translate: { // wxGraphicsMatrix::Translate
wxDouble * dx = (wxDouble *) bp; bp += 8;
wxDouble * dy = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->Translate((wxDouble) *dx,(wxDouble) *dy);
+ This->Translate(*dx,*dy);
break;
}
case wxGraphicsMatrix_Set: { // wxGraphicsMatrix::Set
@@ -6669,7 +6698,7 @@ case wxGraphicsPath_MoveToPoint_2: { // wxGraphicsPath::MoveToPoint
wxDouble * x = (wxDouble *) bp; bp += 8;
wxDouble * y = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->MoveToPoint((wxDouble) *x,(wxDouble) *y);
+ This->MoveToPoint(*x,*y);
break;
}
case wxGraphicsPath_MoveToPoint_1: { // wxGraphicsPath::MoveToPoint
@@ -6692,7 +6721,7 @@ case wxGraphicsPath_AddArc_6: { // wxGraphicsPath::AddArc
wxDouble * endAngle = (wxDouble *) bp; bp += 8;
bool * clockwise = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AddArc((wxDouble) *x,(wxDouble) *y,(wxDouble) *r,(wxDouble) *startAngle,(wxDouble) *endAngle,(bool) *clockwise);
+ This->AddArc(*x,*y,*r,*startAngle,*endAngle,*clockwise);
break;
}
case wxGraphicsPath_AddArc_5: { // wxGraphicsPath::AddArc
@@ -6706,7 +6735,7 @@ case wxGraphicsPath_AddArc_5: { // wxGraphicsPath::AddArc
wxDouble * endAngle = (wxDouble *) bp; bp += 8;
bool * clockwise = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AddArc(c,(wxDouble) *r,(wxDouble) *startAngle,(wxDouble) *endAngle,(bool) *clockwise);
+ This->AddArc(c,*r,*startAngle,*endAngle,*clockwise);
break;
}
case wxGraphicsPath_AddArcToPoint: { // wxGraphicsPath::AddArcToPoint
@@ -6718,7 +6747,7 @@ case wxGraphicsPath_AddArcToPoint: { // wxGraphicsPath::AddArcToPoint
wxDouble * y2 = (wxDouble *) bp; bp += 8;
wxDouble * r = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddArcToPoint((wxDouble) *x1,(wxDouble) *y1,(wxDouble) *x2,(wxDouble) *y2,(wxDouble) *r);
+ This->AddArcToPoint(*x1,*y1,*x2,*y2,*r);
break;
}
case wxGraphicsPath_AddCircle: { // wxGraphicsPath::AddCircle
@@ -6728,7 +6757,7 @@ case wxGraphicsPath_AddCircle: { // wxGraphicsPath::AddCircle
wxDouble * y = (wxDouble *) bp; bp += 8;
wxDouble * r = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddCircle((wxDouble) *x,(wxDouble) *y,(wxDouble) *r);
+ This->AddCircle(*x,*y,*r);
break;
}
case wxGraphicsPath_AddCurveToPoint_6: { // wxGraphicsPath::AddCurveToPoint
@@ -6741,7 +6770,7 @@ case wxGraphicsPath_AddCurveToPoint_6: { // wxGraphicsPath::AddCurveToPoint
wxDouble * x = (wxDouble *) bp; bp += 8;
wxDouble * y = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddCurveToPoint((wxDouble) *cx1,(wxDouble) *cy1,(wxDouble) *cx2,(wxDouble) *cy2,(wxDouble) *x,(wxDouble) *y);
+ This->AddCurveToPoint(*cx1,*cy1,*cx2,*cy2,*x,*y);
break;
}
case wxGraphicsPath_AddCurveToPoint_3: { // wxGraphicsPath::AddCurveToPoint
@@ -6768,7 +6797,7 @@ case wxGraphicsPath_AddEllipse: { // wxGraphicsPath::AddEllipse
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddEllipse((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->AddEllipse(*x,*y,*w,*h);
break;
}
case wxGraphicsPath_AddLineToPoint_2: { // wxGraphicsPath::AddLineToPoint
@@ -6777,7 +6806,7 @@ case wxGraphicsPath_AddLineToPoint_2: { // wxGraphicsPath::AddLineToPoint
wxDouble * x = (wxDouble *) bp; bp += 8;
wxDouble * y = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddLineToPoint((wxDouble) *x,(wxDouble) *y);
+ This->AddLineToPoint(*x,*y);
break;
}
case wxGraphicsPath_AddLineToPoint_1: { // wxGraphicsPath::AddLineToPoint
@@ -6805,7 +6834,7 @@ case wxGraphicsPath_AddQuadCurveToPoint: { // wxGraphicsPath::AddQuadCurveToPoin
wxDouble * x = (wxDouble *) bp; bp += 8;
wxDouble * y = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddQuadCurveToPoint((wxDouble) *cx,(wxDouble) *cy,(wxDouble) *x,(wxDouble) *y);
+ This->AddQuadCurveToPoint(*cx,*cy,*x,*y);
break;
}
case wxGraphicsPath_AddRectangle: { // wxGraphicsPath::AddRectangle
@@ -6816,7 +6845,7 @@ case wxGraphicsPath_AddRectangle: { // wxGraphicsPath::AddRectangle
wxDouble * w = (wxDouble *) bp; bp += 8;
wxDouble * h = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddRectangle((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h);
+ This->AddRectangle(*x,*y,*w,*h);
break;
}
case wxGraphicsPath_AddRoundedRectangle: { // wxGraphicsPath::AddRoundedRectangle
@@ -6828,7 +6857,7 @@ case wxGraphicsPath_AddRoundedRectangle: { // wxGraphicsPath::AddRoundedRectangl
wxDouble * h = (wxDouble *) bp; bp += 8;
wxDouble * radius = (wxDouble *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->AddRoundedRectangle((wxDouble) *x,(wxDouble) *y,(wxDouble) *w,(wxDouble) *h,(wxDouble) *radius);
+ This->AddRoundedRectangle(*x,*y,*w,*h,*radius);
break;
}
case wxGraphicsPath_CloseSubpath: { // wxGraphicsPath::CloseSubpath
@@ -6838,23 +6867,23 @@ case wxGraphicsPath_CloseSubpath: { // wxGraphicsPath::CloseSubpath
break;
}
case wxGraphicsPath_Contains_3: { // wxGraphicsPath::Contains
- int fillStyle=wxODDEVEN_RULE;
+ wxPolygonFillMode fillStyle=wxODDEVEN_RULE;
wxGraphicsPath *This = (wxGraphicsPath *) getPtr(bp,memenv); bp += 4;
bp += 4; /* Align */
wxDouble * x = (wxDouble *) bp; bp += 8;
wxDouble * y = (wxDouble *) bp; bp += 8;
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- fillStyle = (int)*(int *) bp; bp += 4;
+fillStyle = *(wxPolygonFillMode *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Contains((wxDouble) *x,(wxDouble) *y,fillStyle);
+ bool Result = This->Contains(*x,*y,fillStyle);
rt.addBool(Result);
break;
}
case wxGraphicsPath_Contains_2: { // wxGraphicsPath::Contains
- int fillStyle=wxODDEVEN_RULE;
+ wxPolygonFillMode fillStyle=wxODDEVEN_RULE;
wxGraphicsPath *This = (wxGraphicsPath *) getPtr(bp,memenv); bp += 4;
bp += 4; /* Align */
wxDouble * cX = (wxDouble *) bp; bp += 8;
@@ -6862,7 +6891,7 @@ case wxGraphicsPath_Contains_2: { // wxGraphicsPath::Contains
wxPoint2DDouble c = wxPoint2DDouble(*cX,*cY);
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- fillStyle = (int)*(int *) bp; bp += 4;
+fillStyle = *(wxPolygonFillMode *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
@@ -6930,6 +6959,7 @@ case wxGraphicsRenderer_CreateBrush: { // wxGraphicsRenderer::CreateBrush
rt.addRef(getRef((void *)Result,memenv), "wxGraphicsBrush");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxGraphicsRenderer_CreateLinearGradientBrush: { // wxGraphicsRenderer::CreateLinearGradientBrush
wxGraphicsRenderer *This = (wxGraphicsRenderer *) getPtr(bp,memenv); bp += 4;
bp += 4; /* Align */
@@ -6948,10 +6978,12 @@ case wxGraphicsRenderer_CreateLinearGradientBrush: { // wxGraphicsRenderer::Crea
int * c2A = (int *) bp; bp += 4;
wxColour c2 = wxColour(*c2R,*c2G,*c2B,*c2A);
if(!This) throw wxe_badarg(0);
- wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateLinearGradientBrush((wxDouble) *x1,(wxDouble) *y1,(wxDouble) *x2,(wxDouble) *y2,c1,c2)); newPtr((void *) Result,3, memenv);;
+ wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateLinearGradientBrush(*x1,*y1,*x2,*y2,c1,c2)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxGraphicsBrush");
break;
}
+#endif
+#if !wxCHECK_VERSION(2,9,0)
case wxGraphicsRenderer_CreateRadialGradientBrush: { // wxGraphicsRenderer::CreateRadialGradientBrush
wxGraphicsRenderer *This = (wxGraphicsRenderer *) getPtr(bp,memenv); bp += 4;
bp += 4; /* Align */
@@ -6971,10 +7003,11 @@ case wxGraphicsRenderer_CreateRadialGradientBrush: { // wxGraphicsRenderer::Crea
int * cColorA = (int *) bp; bp += 4;
wxColour cColor = wxColour(*cColorR,*cColorG,*cColorB,*cColorA);
if(!This) throw wxe_badarg(0);
- wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateRadialGradientBrush((wxDouble) *xo,(wxDouble) *yo,(wxDouble) *xc,(wxDouble) *yc,(wxDouble) *radius,oColor,cColor)); newPtr((void *) Result,3, memenv);;
+ wxGraphicsBrush * Result = new wxGraphicsBrush(This->CreateRadialGradientBrush(*xo,*yo,*xc,*yc,*radius,oColor,cColor)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxGraphicsBrush");
break;
}
+#endif
case wxGraphicsRenderer_CreateFont: { // wxGraphicsRenderer::CreateFont
wxColour col= *wxBLACK;
wxGraphicsRenderer *This = (wxGraphicsRenderer *) getPtr(bp,memenv); bp += 4;
@@ -7050,7 +7083,7 @@ case wxGraphicsRenderer_CreatePath: { // wxGraphicsRenderer::CreatePath
#endif // wxUSE_GRAPHICS_CONTEXT
case wxMenuBar_new_1: { // wxMenuBar::wxMenuBar
int * style = (int *) bp; bp += 4;
- wxMenuBar * Result = new EwxMenuBar((long) *style);
+ wxMenuBar * Result = new EwxMenuBar(*style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMenuBar");
break;
@@ -7077,7 +7110,7 @@ case wxMenuBar_Check: { // wxMenuBar::Check
int * itemid = (int *) bp; bp += 4;
bool * check = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Check((int) *itemid,(bool) *check);
+ This->Check(*itemid,*check);
break;
}
case wxMenuBar_Enable_2: { // wxMenuBar::Enable
@@ -7085,7 +7118,7 @@ case wxMenuBar_Enable_2: { // wxMenuBar::Enable
int * itemid = (int *) bp; bp += 4;
bool * enable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Enable((int) *itemid,(bool) *enable);
+ This->Enable(*itemid,*enable);
break;
}
case wxMenuBar_Enable_1: { // wxMenuBar::Enable
@@ -7107,7 +7140,7 @@ case wxMenuBar_EnableTop: { // wxMenuBar::EnableTop
int * pos = (int *) bp; bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableTop((size_t) *pos,(bool) *flag);
+ This->EnableTop(*pos,*flag);
break;
}
case wxMenuBar_FindMenu: { // wxMenuBar::FindMenu
@@ -7138,7 +7171,7 @@ case wxMenuBar_FindItem: { // wxMenuBar::FindItem
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * id = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->FindItem((int) *id,menu);
+ wxMenuItem * Result = (wxMenuItem*)This->FindItem(*id,menu);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7146,7 +7179,7 @@ case wxMenuBar_GetHelpString: { // wxMenuBar::GetHelpString
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetHelpString((int) *itemid);
+ wxString Result = This->GetHelpString(*itemid);
rt.add(Result);
break;
}
@@ -7154,7 +7187,7 @@ case wxMenuBar_GetLabel_1: { // wxMenuBar::GetLabel
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetLabel((int) *itemid);
+ wxString Result = This->GetLabel(*itemid);
rt.add(Result);
break;
}
@@ -7169,7 +7202,7 @@ case wxMenuBar_GetLabelTop: { // wxMenuBar::GetLabelTop
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetLabelTop((size_t) *pos);
+ wxString Result = This->GetLabelTop(*pos);
rt.add(Result);
break;
}
@@ -7177,7 +7210,7 @@ case wxMenuBar_GetMenu: { // wxMenuBar::GetMenu
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenu * Result = (wxMenu*)This->GetMenu((size_t) *pos);
+ wxMenu * Result = (wxMenu*)This->GetMenu(*pos);
rt.addRef(getRef((void *)Result,memenv), "wxMenu");
break;
}
@@ -7196,7 +7229,7 @@ case wxMenuBar_Insert: { // wxMenuBar::Insert
wxString title = wxString(bp, wxConvUTF8);
bp += *titleLen+((8-((0+ *titleLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->Insert((size_t) *pos,menu,title);
+ bool Result = This->Insert(*pos,menu,title);
rt.addBool(Result);
break;
}
@@ -7204,7 +7237,7 @@ case wxMenuBar_IsChecked: { // wxMenuBar::IsChecked
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsChecked((int) *itemid);
+ bool Result = This->IsChecked(*itemid);
rt.addBool(Result);
break;
}
@@ -7212,7 +7245,7 @@ case wxMenuBar_IsEnabled_1: { // wxMenuBar::IsEnabled
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsEnabled((int) *itemid);
+ bool Result = This->IsEnabled(*itemid);
rt.addBool(Result);
break;
}
@@ -7227,7 +7260,7 @@ case wxMenuBar_Remove: { // wxMenuBar::Remove
wxMenuBar *This = (wxMenuBar *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenu * Result = (wxMenu*)This->Remove((size_t) *pos);
+ wxMenu * Result = (wxMenu*)This->Remove(*pos);
rt.addRef(getRef((void *)Result,memenv), "wxMenu");
break;
}
@@ -7239,7 +7272,7 @@ case wxMenuBar_Replace: { // wxMenuBar::Replace
wxString title = wxString(bp, wxConvUTF8);
bp += *titleLen+((8-((0+ *titleLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- wxMenu * Result = (wxMenu*)This->Replace((size_t) *pos,menu,title);
+ wxMenu * Result = (wxMenu*)This->Replace(*pos,menu,title);
rt.addRef(getRef((void *)Result,memenv), "wxMenu");
break;
}
@@ -7250,7 +7283,7 @@ case wxMenuBar_SetHelpString: { // wxMenuBar::SetHelpString
wxString helpString = wxString(bp, wxConvUTF8);
bp += *helpStringLen+((8-((4+ *helpStringLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetHelpString((int) *itemid,helpString);
+ This->SetHelpString(*itemid,helpString);
break;
}
case wxMenuBar_SetLabel_2: { // wxMenuBar::SetLabel
@@ -7260,7 +7293,7 @@ case wxMenuBar_SetLabel_2: { // wxMenuBar::SetLabel
wxString label = wxString(bp, wxConvUTF8);
bp += *labelLen+((8-((4+ *labelLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetLabel((int) *itemid,label);
+ This->SetLabel(*itemid,label);
break;
}
case wxMenuBar_SetLabel_1: { // wxMenuBar::SetLabel
@@ -7279,7 +7312,7 @@ case wxMenuBar_SetLabelTop: { // wxMenuBar::SetLabelTop
wxString label = wxString(bp, wxConvUTF8);
bp += *labelLen+((8-((4+ *labelLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetLabelTop((size_t) *pos,label);
+ This->SetLabelTop(*pos,label);
break;
}
case wxControl_GetLabel: { // wxControl::GetLabel
@@ -7345,7 +7378,7 @@ case wxControlWithItems_Delete: { // wxControlWithItems::Delete
wxControlWithItems *This = (wxControlWithItems *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Delete((int) *n);
+ This->Delete(*n);
break;
}
case wxControlWithItems_FindString: { // wxControlWithItems::FindString
@@ -7368,7 +7401,7 @@ case wxControlWithItems_getClientData: { // wxControlWithItems::GetClientObject
wxControlWithItems *This = (wxControlWithItems *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxeErlTerm * Result = (wxeErlTerm*)This->GetClientObject((int) *n);
+ wxeErlTerm * Result = (wxeErlTerm*)This->GetClientObject(*n);
rt.addExt2Term(Result);
break;
}
@@ -7377,7 +7410,7 @@ case wxControlWithItems_setClientData: { // wxControlWithItems::SetClientObject
unsigned int * n = (unsigned int *) bp; bp += 4;
wxeErlTerm * clientData = new wxeErlTerm(Ecmd.bin[0]);
if(!This) throw wxe_badarg(0);
- This->SetClientObject((int) *n,clientData);
+ This->SetClientObject(*n,clientData);
break;
}
case wxControlWithItems_GetCount: { // wxControlWithItems::GetCount
@@ -7398,7 +7431,7 @@ case wxControlWithItems_GetString: { // wxControlWithItems::GetString
wxControlWithItems *This = (wxControlWithItems *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetString((int) *n);
+ wxString Result = This->GetString(*n);
rt.add(Result);
break;
}
@@ -7416,7 +7449,7 @@ case wxControlWithItems_Insert_2: { // wxControlWithItems::Insert
bp += *itemLen+((8-((0+ *itemLen) & 7)) & 7);
unsigned int * pos = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->Insert(item,(int) *pos);
+ int Result = This->Insert(item,*pos);
rt.addInt(Result);
break;
}
@@ -7428,7 +7461,7 @@ case wxControlWithItems_Insert_3: { // wxControlWithItems::Insert
unsigned int * pos = (unsigned int *) bp; bp += 4;
wxeErlTerm * clientData = new wxeErlTerm(Ecmd.bin[0]);
if(!This) throw wxe_badarg(0);
- int Result = This->Insert(item,(int) *pos,clientData);
+ int Result = This->Insert(item,*pos,clientData);
rt.addInt(Result);
break;
}
@@ -7443,14 +7476,14 @@ case wxControlWithItems_Select: { // wxControlWithItems::Select
wxControlWithItems *This = (wxControlWithItems *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Select((int) *n);
+ This->Select(*n);
break;
}
case wxControlWithItems_SetSelection: { // wxControlWithItems::SetSelection
wxControlWithItems *This = (wxControlWithItems *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *n);
+ This->SetSelection(*n);
break;
}
case wxControlWithItems_SetString: { // wxControlWithItems::SetString
@@ -7460,7 +7493,7 @@ case wxControlWithItems_SetString: { // wxControlWithItems::SetString
wxString s = wxString(bp, wxConvUTF8);
bp += *sLen+((8-((4+ *sLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetString((int) *n,s);
+ This->SetString(*n,s);
break;
}
case wxControlWithItems_SetStringSelection: { // wxControlWithItems::SetStringSelection
@@ -7519,7 +7552,7 @@ kind = *(wxItemKind *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Append((int) *itemid,text,help,(wxItemKind) kind);
+ wxMenuItem * Result = (wxMenuItem*)This->Append(*itemid,text,help,kind);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7542,7 +7575,7 @@ case wxMenu_Append_4_0: { // wxMenu::Append
bp += *helpLen+((8-((4+ *helpLen) & 7)) & 7);
bool * isCheckable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Append((int) *itemid,text,help,(bool) *isCheckable);
+ This->Append(*itemid,text,help,*isCheckable);
break;
}
case wxMenu_Append_4_1: { // wxMenu::Append
@@ -7562,7 +7595,7 @@ case wxMenu_Append_4_1: { // wxMenu::Append
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Append((int) *itemid,text,submenu,help);
+ wxMenuItem * Result = (wxMenuItem*)This->Append(*itemid,text,submenu,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7581,7 +7614,7 @@ case wxMenu_AppendCheckItem: { // wxMenu::AppendCheckItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->AppendCheckItem((int) *itemid,text,help);
+ wxMenuItem * Result = (wxMenuItem*)This->AppendCheckItem(*itemid,text,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7600,7 +7633,7 @@ case wxMenu_AppendRadioItem: { // wxMenu::AppendRadioItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->AppendRadioItem((int) *itemid,text,help);
+ wxMenuItem * Result = (wxMenuItem*)This->AppendRadioItem(*itemid,text,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7622,14 +7655,14 @@ case wxMenu_Check: { // wxMenu::Check
int * itemid = (int *) bp; bp += 4;
bool * check = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Check((int) *itemid,(bool) *check);
+ This->Check(*itemid,*check);
break;
}
case wxMenu_Delete_1_0: { // wxMenu::Delete
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Delete((int) *itemid);
+ bool Result = This->Delete(*itemid);
rt.addBool(Result);
break;
}
@@ -7645,7 +7678,7 @@ case wxMenu_Destroy_1_0: { // wxMenu::Destroy
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Destroy((int) *itemid);
+ bool Result = This->Destroy(*itemid);
rt.addBool(Result);
break;
}
@@ -7662,7 +7695,7 @@ case wxMenu_Enable: { // wxMenu::Enable
int * itemid = (int *) bp; bp += 4;
bool * enable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Enable((int) *itemid,(bool) *enable);
+ This->Enable(*itemid,*enable);
break;
}
case wxMenu_FindItem_1: { // wxMenu::FindItem
@@ -7680,7 +7713,7 @@ case wxMenu_FindItem_2: { // wxMenu::FindItem
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->FindItem((int) *itemid,menu);
+ wxMenuItem * Result = (wxMenuItem*)This->FindItem(*itemid,menu);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7688,7 +7721,7 @@ case wxMenu_FindItemByPosition: { // wxMenu::FindItemByPosition
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * position = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->FindItemByPosition((size_t) *position);
+ wxMenuItem * Result = (wxMenuItem*)This->FindItemByPosition(*position);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7696,7 +7729,7 @@ case wxMenu_GetHelpString: { // wxMenu::GetHelpString
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetHelpString((int) *itemid);
+ wxString Result = This->GetHelpString(*itemid);
rt.add(Result);
break;
}
@@ -7704,7 +7737,7 @@ case wxMenu_GetLabel: { // wxMenu::GetLabel
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetLabel((int) *itemid);
+ wxString Result = This->GetLabel(*itemid);
rt.add(Result);
break;
}
@@ -7738,7 +7771,7 @@ case wxMenu_Insert_2: { // wxMenu::Insert
int * pos = (int *) bp; bp += 4;
wxMenuItem *item = (wxMenuItem *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Insert((size_t) *pos,item);
+ wxMenuItem * Result = (wxMenuItem*)This->Insert(*pos,item);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7766,7 +7799,7 @@ kind = *(wxItemKind *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Insert((size_t) *pos,(int) *itemid,text,help,(wxItemKind) kind);
+ wxMenuItem * Result = (wxMenuItem*)This->Insert(*pos,*itemid,text,help,kind);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7788,7 +7821,7 @@ case wxMenu_Insert_5_1: { // wxMenu::Insert
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Insert((size_t) *pos,(int) *itemid,text,submenu,help);
+ wxMenuItem * Result = (wxMenuItem*)This->Insert(*pos,*itemid,text,submenu,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7804,7 +7837,7 @@ case wxMenu_Insert_5_0: { // wxMenu::Insert
bp += *helpLen+((8-((4+ *helpLen) & 7)) & 7);
bool * isCheckable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Insert((size_t) *pos,(int) *itemid,text,help,(bool) *isCheckable);
+ This->Insert(*pos,*itemid,text,help,*isCheckable);
break;
}
case wxMenu_InsertCheckItem: { // wxMenu::InsertCheckItem
@@ -7823,7 +7856,7 @@ case wxMenu_InsertCheckItem: { // wxMenu::InsertCheckItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->InsertCheckItem((size_t) *pos,(int) *itemid,text,help);
+ wxMenuItem * Result = (wxMenuItem*)This->InsertCheckItem(*pos,*itemid,text,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7843,7 +7876,7 @@ case wxMenu_InsertRadioItem: { // wxMenu::InsertRadioItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->InsertRadioItem((size_t) *pos,(int) *itemid,text,help);
+ wxMenuItem * Result = (wxMenuItem*)This->InsertRadioItem(*pos,*itemid,text,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7851,7 +7884,7 @@ case wxMenu_InsertSeparator: { // wxMenu::InsertSeparator
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->InsertSeparator((size_t) *pos);
+ wxMenuItem * Result = (wxMenuItem*)This->InsertSeparator(*pos);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7859,7 +7892,7 @@ case wxMenu_IsChecked: { // wxMenu::IsChecked
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsChecked((int) *itemid);
+ bool Result = This->IsChecked(*itemid);
rt.addBool(Result);
break;
}
@@ -7867,7 +7900,7 @@ case wxMenu_IsEnabled: { // wxMenu::IsEnabled
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsEnabled((int) *itemid);
+ bool Result = This->IsEnabled(*itemid);
rt.addBool(Result);
break;
}
@@ -7901,7 +7934,7 @@ kind = *(wxItemKind *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Prepend((int) *itemid,text,help,(wxItemKind) kind);
+ wxMenuItem * Result = (wxMenuItem*)This->Prepend(*itemid,text,help,kind);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7922,7 +7955,7 @@ case wxMenu_Prepend_4_1: { // wxMenu::Prepend
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Prepend((int) *itemid,text,submenu,help);
+ wxMenuItem * Result = (wxMenuItem*)This->Prepend(*itemid,text,submenu,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7937,7 +7970,7 @@ case wxMenu_Prepend_4_0: { // wxMenu::Prepend
bp += *helpLen+((8-((4+ *helpLen) & 7)) & 7);
bool * isCheckable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Prepend((int) *itemid,text,help,(bool) *isCheckable);
+ This->Prepend(*itemid,text,help,*isCheckable);
break;
}
case wxMenu_PrependCheckItem: { // wxMenu::PrependCheckItem
@@ -7955,7 +7988,7 @@ case wxMenu_PrependCheckItem: { // wxMenu::PrependCheckItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->PrependCheckItem((int) *itemid,text,help);
+ wxMenuItem * Result = (wxMenuItem*)This->PrependCheckItem(*itemid,text,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7974,7 +8007,7 @@ case wxMenu_PrependRadioItem: { // wxMenu::PrependRadioItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->PrependRadioItem((int) *itemid,text,help);
+ wxMenuItem * Result = (wxMenuItem*)This->PrependRadioItem(*itemid,text,help);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -7989,7 +8022,7 @@ case wxMenu_Remove_1_0: { // wxMenu::Remove
wxMenu *This = (wxMenu *) getPtr(bp,memenv); bp += 4;
int * itemid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMenuItem * Result = (wxMenuItem*)This->Remove((int) *itemid);
+ wxMenuItem * Result = (wxMenuItem*)This->Remove(*itemid);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
}
@@ -8008,7 +8041,7 @@ case wxMenu_SetHelpString: { // wxMenu::SetHelpString
wxString helpString = wxString(bp, wxConvUTF8);
bp += *helpStringLen+((8-((4+ *helpStringLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetHelpString((int) *itemid,helpString);
+ This->SetHelpString(*itemid,helpString);
break;
}
case wxMenu_SetLabel: { // wxMenu::SetLabel
@@ -8018,7 +8051,7 @@ case wxMenu_SetLabel: { // wxMenu::SetLabel
wxString label = wxString(bp, wxConvUTF8);
bp += *labelLen+((8-((4+ *labelLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetLabel((int) *itemid,label);
+ This->SetLabel(*itemid,label);
break;
}
case wxMenu_SetTitle: { // wxMenu::SetTitle
@@ -8061,7 +8094,7 @@ kind = *(wxItemKind *) bp; bp += 4;;
subMenu = (wxMenu *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxMenuItem * Result = new EwxMenuItem(parentMenu,id,text,help,(wxItemKind) kind,subMenu);
+ wxMenuItem * Result = new EwxMenuItem(parentMenu,id,text,help,kind,subMenu);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMenuItem");
break;
@@ -8276,7 +8309,7 @@ data = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool((int) *toolid,label,*bitmap,*bmpDisabled,(wxItemKind) kind,shortHelp,longHelp,data);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool(*toolid,label,*bitmap,*bmpDisabled,kind,shortHelp,longHelp,data);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8301,7 +8334,7 @@ kind = *(wxItemKind *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool((int) *toolid,label,*bitmap,shortHelp,(wxItemKind) kind);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool(*toolid,label,*bitmap,shortHelp,kind);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8341,7 +8374,7 @@ clientData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool((int) *toolid,*bitmap,*bmpDisabled,toggle,clientData,shortHelpString,longHelpString);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool(*toolid,*bitmap,*bmpDisabled,toggle,clientData,shortHelpString,longHelpString);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8365,7 +8398,7 @@ case wxToolBar_AddTool_3: { // wxToolBar::AddTool
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool((int) *toolid,*bitmap,shortHelpString,longHelpString);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool(*toolid,*bitmap,shortHelpString,longHelpString);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8399,7 +8432,7 @@ clientData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool((int) *toolid,*bitmap,*bmpDisabled,(bool) *toggle,(wxCoord) *xPos,yPos,clientData,shortHelp,longHelp);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddTool(*toolid,*bitmap,*bmpDisabled,*toggle,*xPos,yPos,clientData,shortHelp,longHelp);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8434,7 +8467,7 @@ data = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddCheckTool((int) *toolid,label,*bitmap,*bmpDisabled,shortHelp,longHelp,data);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddCheckTool(*toolid,label,*bitmap,*bmpDisabled,shortHelp,longHelp,data);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8469,7 +8502,7 @@ data = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddRadioTool((int) *toolid,label,*bitmap,*bmpDisabled,shortHelp,longHelp,data);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->AddRadioTool(*toolid,label,*bitmap,*bmpDisabled,shortHelp,longHelp,data);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8477,7 +8510,7 @@ case wxToolBar_DeleteTool: { // wxToolBar::DeleteTool
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeleteTool((int) *toolid);
+ bool Result = This->DeleteTool(*toolid);
rt.addBool(Result);
break;
}
@@ -8485,7 +8518,7 @@ case wxToolBar_DeleteToolByPos: { // wxToolBar::DeleteToolByPos
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeleteToolByPos((size_t) *pos);
+ bool Result = This->DeleteToolByPos(*pos);
rt.addBool(Result);
break;
}
@@ -8494,14 +8527,14 @@ case wxToolBar_EnableTool: { // wxToolBar::EnableTool
int * toolid = (int *) bp; bp += 4;
bool * enable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableTool((int) *toolid,(bool) *enable);
+ This->EnableTool(*toolid,*enable);
break;
}
case wxToolBar_FindById: { // wxToolBar::FindById
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->FindById((int) *toolid);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->FindById(*toolid);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8509,7 +8542,7 @@ case wxToolBar_FindControl: { // wxToolBar::FindControl
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxControl * Result = (wxControl*)This->FindControl((int) *toolid);
+ wxControl * Result = (wxControl*)This->FindControl(*toolid);
rt.addRef(getRef((void *)Result,memenv), "wxControl");
break;
}
@@ -8518,7 +8551,7 @@ case wxToolBar_FindToolForPosition: { // wxToolBar::FindToolForPosition
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->FindToolForPosition((wxCoord) *x,(wxCoord) *y);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->FindToolForPosition(*x,*y);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8547,7 +8580,7 @@ case wxToolBar_GetToolEnabled: { // wxToolBar::GetToolEnabled
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetToolEnabled((int) *toolid);
+ bool Result = This->GetToolEnabled(*toolid);
rt.addBool(Result);
break;
}
@@ -8555,7 +8588,7 @@ case wxToolBar_GetToolLongHelp: { // wxToolBar::GetToolLongHelp
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetToolLongHelp((int) *toolid);
+ wxString Result = This->GetToolLongHelp(*toolid);
rt.add(Result);
break;
}
@@ -8570,7 +8603,7 @@ case wxToolBar_GetToolPos: { // wxToolBar::GetToolPos
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * id = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetToolPos((int) *id);
+ int Result = This->GetToolPos(*id);
rt.addInt(Result);
break;
}
@@ -8585,7 +8618,7 @@ case wxToolBar_GetToolShortHelp: { // wxToolBar::GetToolShortHelp
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetToolShortHelp((int) *toolid);
+ wxString Result = This->GetToolShortHelp(*toolid);
rt.add(Result);
break;
}
@@ -8593,7 +8626,7 @@ case wxToolBar_GetToolState: { // wxToolBar::GetToolState
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetToolState((int) *toolid);
+ bool Result = This->GetToolState(*toolid);
rt.addBool(Result);
break;
}
@@ -8602,7 +8635,7 @@ case wxToolBar_InsertControl: { // wxToolBar::InsertControl
int * pos = (int *) bp; bp += 4;
wxControl *control = (wxControl *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertControl((size_t) *pos,control);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertControl(*pos,control);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8610,7 +8643,7 @@ case wxToolBar_InsertSeparator: { // wxToolBar::InsertSeparator
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertSeparator((size_t) *pos);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertSeparator(*pos);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8650,7 +8683,7 @@ clientData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertTool((size_t) *pos,(int) *toolid,label,*bitmap,*bmpDisabled,(wxItemKind) kind,shortHelp,longHelp,clientData);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertTool(*pos,*toolid,label,*bitmap,*bmpDisabled,kind,shortHelp,longHelp,clientData);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8659,7 +8692,7 @@ case wxToolBar_InsertTool_2: { // wxToolBar::InsertTool
int * pos = (int *) bp; bp += 4;
wxToolBarToolBase *tool = (wxToolBarToolBase *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertTool((size_t) *pos,tool);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertTool(*pos,tool);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8695,7 +8728,7 @@ clientData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertTool((size_t) *pos,(int) *toolid,*bitmap,*bmpDisabled,toggle,clientData,shortHelp,longHelp);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->InsertTool(*pos,*toolid,*bitmap,*bmpDisabled,toggle,clientData,shortHelp,longHelp);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8710,7 +8743,7 @@ case wxToolBar_RemoveTool: { // wxToolBar::RemoveTool
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * toolid = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolBarToolBase * Result = (wxToolBarToolBase*)This->RemoveTool((int) *toolid);
+ wxToolBarToolBase * Result = (wxToolBarToolBase*)This->RemoveTool(*toolid);
rt.addRef(getRef((void *)Result,memenv), "wx");
break;
}
@@ -8719,7 +8752,7 @@ case wxToolBar_SetMargins: { // wxToolBar::SetMargins
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMargins((int) *x,(int) *y);
+ This->SetMargins(*x,*y);
break;
}
case wxToolBar_SetToolBitmapSize: { // wxToolBar::SetToolBitmapSize
@@ -8738,14 +8771,14 @@ case wxToolBar_SetToolLongHelp: { // wxToolBar::SetToolLongHelp
wxString helpString = wxString(bp, wxConvUTF8);
bp += *helpStringLen+((8-((4+ *helpStringLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetToolLongHelp((int) *toolid,helpString);
+ This->SetToolLongHelp(*toolid,helpString);
break;
}
case wxToolBar_SetToolPacking: { // wxToolBar::SetToolPacking
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * packing = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetToolPacking((int) *packing);
+ This->SetToolPacking(*packing);
break;
}
case wxToolBar_SetToolShortHelp: { // wxToolBar::SetToolShortHelp
@@ -8755,14 +8788,14 @@ case wxToolBar_SetToolShortHelp: { // wxToolBar::SetToolShortHelp
wxString helpString = wxString(bp, wxConvUTF8);
bp += *helpStringLen+((8-((4+ *helpStringLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetToolShortHelp((int) *id,helpString);
+ This->SetToolShortHelp(*id,helpString);
break;
}
case wxToolBar_SetToolSeparation: { // wxToolBar::SetToolSeparation
wxToolBar *This = (wxToolBar *) getPtr(bp,memenv); bp += 4;
int * separation = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetToolSeparation((int) *separation);
+ This->SetToolSeparation(*separation);
break;
}
case wxToolBar_ToggleTool: { // wxToolBar::ToggleTool
@@ -8770,7 +8803,7 @@ case wxToolBar_ToggleTool: { // wxToolBar::ToggleTool
int * toolid = (int *) bp; bp += 4;
bool * toggle = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ToggleTool((int) *toolid,(bool) *toggle);
+ This->ToggleTool(*toolid,*toggle);
break;
}
case wxStatusBar_new_0: { // wxStatusBar::wxStatusBar
@@ -8824,7 +8857,7 @@ case wxStatusBar_GetFieldRect: { // wxStatusBar::GetFieldRect
int * rectH = (int *) bp; bp += 4;
wxRect rect = wxRect(*rectX,*rectY,*rectW,*rectH);
if(!This) throw wxe_badarg(0);
- bool Result = This->GetFieldRect((int) *i,rect);
+ bool Result = This->GetFieldRect(*i,rect);
rt.addBool(Result);
break;
}
@@ -8889,14 +8922,14 @@ case wxStatusBar_SetFieldsCount: { // wxStatusBar::SetFieldsCount
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetFieldsCount((int) *number,widths);
+ This->SetFieldsCount(*number,widths);
break;
}
case wxStatusBar_SetMinHeight: { // wxStatusBar::SetMinHeight
wxStatusBar *This = (wxStatusBar *) getPtr(bp,memenv); bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinHeight((int) *height);
+ This->SetMinHeight(*height);
break;
}
case wxStatusBar_SetStatusText: { // wxStatusBar::SetStatusText
@@ -8945,7 +8978,7 @@ case wxBitmap_new_3: { // wxBitmap::wxBitmap
depth = (int)*(int *) bp; bp += 4;
} break;
}};
- wxBitmap * Result = new EwxBitmap((int) *width,(int) *height,depth);
+ wxBitmap * Result = new EwxBitmap(*width,*height,depth);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
@@ -8960,7 +8993,7 @@ case wxBitmap_new_4: { // wxBitmap::wxBitmap
depth = (int)*(int *) bp; bp += 4;
} break;
}};
- wxBitmap * Result = new EwxBitmap(bits,(int) *width,(int) *height,depth);
+ wxBitmap * Result = new EwxBitmap(bits,*width,*height,depth);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
@@ -8975,7 +9008,7 @@ case wxBitmap_new_2_0: { // wxBitmap::wxBitmap
type = *(wxBitmapType *) bp; bp += 4;;
} break;
}};
- wxBitmap * Result = new EwxBitmap(filename,(wxBitmapType) type);
+ wxBitmap * Result = new EwxBitmap(filename,type);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
@@ -9021,7 +9054,7 @@ case wxBitmap_Create: { // wxBitmap::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create((int) *width,(int) *height,depth);
+ bool Result = This->Create(*width,*height,depth);
rt.addBool(Result);
break;
}
@@ -9084,7 +9117,7 @@ type = *(wxBitmapType *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->LoadFile(name,(wxBitmapType) type);
+ bool Result = This->LoadFile(name,type);
rt.addBool(Result);
break;
}
@@ -9109,7 +9142,7 @@ palette = (wxPalette *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->SaveFile(name,(wxBitmapType) type,palette);
+ bool Result = This->SaveFile(name,type,palette);
rt.addBool(Result);
break;
}
@@ -9117,14 +9150,14 @@ case wxBitmap_SetDepth: { // wxBitmap::SetDepth
wxBitmap *This = (wxBitmap *) getPtr(bp,memenv); bp += 4;
int * depth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDepth((int) *depth);
+ This->SetDepth(*depth);
break;
}
case wxBitmap_SetHeight: { // wxBitmap::SetHeight
wxBitmap *This = (wxBitmap *) getPtr(bp,memenv); bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHeight((int) *height);
+ This->SetHeight(*height);
break;
}
case wxBitmap_SetMask: { // wxBitmap::SetMask
@@ -9145,7 +9178,7 @@ case wxBitmap_SetWidth: { // wxBitmap::SetWidth
wxBitmap *This = (wxBitmap *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWidth((int) *width);
+ This->SetWidth(*width);
break;
}
case wxIcon_new_0: { // wxIcon::wxIcon
@@ -9172,7 +9205,7 @@ type = *(wxBitmapType *) bp; bp += 4;;
desiredHeight = (int)*(int *) bp; bp += 4;
} break;
}};
- wxIcon * Result = new EwxIcon(filename,(wxBitmapType) type,desiredWidth,desiredHeight);
+ wxIcon * Result = new EwxIcon(filename,type,desiredWidth,desiredHeight);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxIcon");
break;
@@ -9202,7 +9235,7 @@ case wxIconBundle_new_2: { // wxIconBundle::wxIconBundle
wxString file = wxString(bp, wxConvUTF8);
bp += *fileLen+((8-((4+ *fileLen) & 7)) & 7);
int * type = (int *) bp; bp += 4;
- wxIconBundle * Result = new wxIconBundle(file,(long) *type);
+ wxIconBundle * Result = new wxIconBundle(file,*type);
newPtr((void *) Result, 61, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxIconBundle");
break;
@@ -9234,7 +9267,7 @@ case wxIconBundle_AddIcon_2: { // wxIconBundle::AddIcon
bp += *fileLen+((8-((0+ *fileLen) & 7)) & 7);
int * type = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AddIcon(file,(long) *type);
+ This->AddIcon(file,*type);
break;
}
case wxIconBundle_AddIcon_1: { // wxIconBundle::AddIcon
@@ -9250,7 +9283,7 @@ case wxIconBundle_GetIcon_1_1: { // wxIconBundle::GetIcon
int * sizeH = (int *) bp; bp += 4;
wxSize size = wxSize(*sizeW,*sizeH);
if(!This) throw wxe_badarg(0);
- const wxIcon * Result = &This->GetIcon(size);
+ const wxIcon * Result = new wxIcon(This->GetIcon(size)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxIcon");
break;
}
@@ -9264,7 +9297,7 @@ case wxIconBundle_GetIcon_1_0: { // wxIconBundle::GetIcon
} break;
}};
if(!This) throw wxe_badarg(0);
- const wxIcon * Result = &This->GetIcon(size);
+ const wxIcon * Result = new wxIcon(This->GetIcon(size)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxIcon");
break;
}
@@ -9276,7 +9309,7 @@ case wxCursor_new_0: { // wxCursor::wxCursor
}
case wxCursor_new_1_0: { // wxCursor::wxCursor
int * cursorId = (int *) bp; bp += 4;
- wxCursor * Result = new EwxCursor((int) *cursorId);
+ wxCursor * Result = new EwxCursor(*cursorId);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCursor");
break;
@@ -9288,6 +9321,7 @@ case wxCursor_new_1_1: { // wxCursor::wxCursor
rt.addRef(getRef((void *)Result,memenv), "wxCursor");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxCursor_new_4: { // wxCursor::wxCursor
int hotSpotX=-1;
int hotSpotY=-1;
@@ -9302,11 +9336,12 @@ case wxCursor_new_4: { // wxCursor::wxCursor
hotSpotY = (int)*(int *) bp; bp += 4;
} break;
}};
- wxCursor * Result = new EwxCursor(bits,(int) *width,(int) *height,hotSpotX,hotSpotY);
+ wxCursor * Result = new EwxCursor(bits,*width,*height,hotSpotX,hotSpotY);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCursor");
break;
}
+#endif
case wxCursor_Ok: { // wxCursor::Ok
wxCursor *This = (wxCursor *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
@@ -9335,7 +9370,7 @@ case wxMask_new_2_1: { // wxMask::wxMask
case wxMask_new_2_0: { // wxMask::wxMask
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
int * paletteIndex = (int *) bp; bp += 4;
- wxMask * Result = new EwxMask(*bitmap,(int) *paletteIndex);
+ wxMask * Result = new EwxMask(*bitmap,*paletteIndex);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMask");
break;
@@ -9365,7 +9400,7 @@ case wxMask_Create_2_0: { // wxMask::Create
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
int * paletteIndex = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(*bitmap,(int) *paletteIndex);
+ bool Result = This->Create(*bitmap,*paletteIndex);
rt.addBool(Result);
break;
}
@@ -9392,7 +9427,7 @@ case wxImage_new_3_0: { // wxImage::wxImage
clear = *(bool *) bp; bp += 4;
} break;
}};
- wxImage * Result = new EwxImage((int) *width,(int) *height,clear);
+ wxImage * Result = new EwxImage(*width,*height,clear);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
@@ -9408,7 +9443,7 @@ case wxImage_new_4: { // wxImage::wxImage
} break;
}};
if(!static_data) {data = (unsigned char *) malloc(Ecmd.bin[0]->size);memcpy(data,Ecmd.bin[0]->base,Ecmd.bin[0]->size);};
- wxImage * Result = new EwxImage((int) *width,(int) *height,data,static_data);
+ wxImage * Result = new EwxImage(*width,*height,data,static_data);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
@@ -9425,7 +9460,7 @@ case wxImage_new_5: { // wxImage::wxImage
} break;
}};
if(!static_data) { data = (unsigned char *) malloc(Ecmd.bin[0]->size); alpha = (unsigned char *) malloc(Ecmd.bin[1]->size); memcpy(data,Ecmd.bin[0]->base,Ecmd.bin[0]->size); memcpy(alpha,Ecmd.bin[1]->base,Ecmd.bin[1]->size);};
- wxImage * Result = new EwxImage((int) *width,(int) *height,data,alpha,static_data);
+ wxImage * Result = new EwxImage(*width,*height,data,alpha,static_data);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
@@ -9471,7 +9506,7 @@ case wxImage_Blur: { // wxImage::Blur
wxImage *This = (wxImage *) getPtr(bp,memenv); bp += 4;
int * radius = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxImage * Result = new wxImage(This->Blur((int) *radius)); newPtr((void *) Result,3, memenv);;
+ wxImage * Result = new wxImage(This->Blur(*radius)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -9479,7 +9514,7 @@ case wxImage_BlurHorizontal: { // wxImage::BlurHorizontal
wxImage *This = (wxImage *) getPtr(bp,memenv); bp += 4;
int * radius = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxImage * Result = new wxImage(This->BlurHorizontal((int) *radius)); newPtr((void *) Result,3, memenv);;
+ wxImage * Result = new wxImage(This->BlurHorizontal(*radius)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -9487,7 +9522,7 @@ case wxImage_BlurVertical: { // wxImage::BlurVertical
wxImage *This = (wxImage *) getPtr(bp,memenv); bp += 4;
int * radius = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxImage * Result = new wxImage(This->BlurVertical((int) *radius)); newPtr((void *) Result,3, memenv);;
+ wxImage * Result = new wxImage(This->BlurVertical(*radius)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -9536,7 +9571,7 @@ case wxImage_ConvertToMono: { // wxImage::ConvertToMono
unsigned int * g = (unsigned int *) bp; bp += 4;
unsigned int * b = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxImage * Result = new wxImage(This->ConvertToMono((char) *r,(char) *g,(char) *b)); newPtr((void *) Result,3, memenv);;
+ wxImage * Result = new wxImage(This->ConvertToMono(*r,*g,*b)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -9559,7 +9594,7 @@ case wxImage_Create_3: { // wxImage::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create((int) *width,(int) *height,clear);
+ bool Result = This->Create(*width,*height,clear);
rt.addBool(Result);
break;
}
@@ -9577,7 +9612,7 @@ case wxImage_Create_4: { // wxImage::Create
}};
if(!static_data) {data = (unsigned char *) malloc(Ecmd.bin[0]->size);memcpy(data,Ecmd.bin[0]->base,Ecmd.bin[0]->size);};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create((int) *width,(int) *height,data,static_data);
+ bool Result = This->Create(*width,*height,data,static_data);
rt.addBool(Result);
break;
}
@@ -9596,7 +9631,7 @@ case wxImage_Create_5: { // wxImage::Create
}};
if(!static_data) { data = (unsigned char *) malloc(Ecmd.bin[0]->size); alpha = (unsigned char *) malloc(Ecmd.bin[1]->size); memcpy(data,Ecmd.bin[0]->base,Ecmd.bin[0]->size); memcpy(alpha,Ecmd.bin[1]->base,Ecmd.bin[1]->size);};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create((int) *width,(int) *height,data,alpha,static_data);
+ bool Result = This->Create(*width,*height,data,alpha,static_data);
rt.addBool(Result);
break;
}
@@ -9645,7 +9680,7 @@ case wxImage_GetAlpha_2: { // wxImage::GetAlpha
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- char Result = This->GetAlpha((int) *x,(int) *y);
+ char Result = This->GetAlpha(*x,*y);
rt.addUint(Result);
break;
}
@@ -9663,7 +9698,7 @@ case wxImage_GetBlue: { // wxImage::GetBlue
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- char Result = This->GetBlue((int) *x,(int) *y);
+ char Result = This->GetBlue(*x,*y);
rt.addUint(Result);
break;
}
@@ -9681,18 +9716,18 @@ case wxImage_GetGreen: { // wxImage::GetGreen
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- char Result = This->GetGreen((int) *x,(int) *y);
+ char Result = This->GetGreen(*x,*y);
rt.addUint(Result);
break;
}
case wxImage_GetImageCount: { // wxImage::GetImageCount
- long type=wxBITMAP_TYPE_ANY;
+ wxBitmapType type=wxBITMAP_TYPE_ANY;
int * nameLen = (int *) bp; bp += 4;
wxString name = wxString(bp, wxConvUTF8);
bp += *nameLen+((8-((4+ *nameLen) & 7)) & 7);
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- type = (long)*(int *) bp; bp += 4;
+type = *(wxBitmapType *) bp; bp += 4;;
} break;
}};
int Result = wxImage::GetImageCount(name,type);
@@ -9753,7 +9788,7 @@ case wxImage_GetRed: { // wxImage::GetRed
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- char Result = This->GetRed((int) *x,(int) *y);
+ char Result = This->GetRed(*x,*y);
rt.addUint(Result);
break;
}
@@ -9842,7 +9877,7 @@ case wxImage_IsTransparent: { // wxImage::IsTransparent
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->IsTransparent((int) *x,(int) *y,threshold);
+ bool Result = This->IsTransparent(*x,*y,threshold);
rt.addBool(Result);
break;
}
@@ -9923,22 +9958,22 @@ case wxImage_Replace: { // wxImage::Replace
unsigned int * g2 = (unsigned int *) bp; bp += 4;
unsigned int * b2 = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Replace((char) *r1,(char) *g1,(char) *b1,(char) *r2,(char) *g2,(char) *b2);
+ This->Replace(*r1,*g1,*b1,*r2,*g2,*b2);
break;
}
case wxImage_Rescale: { // wxImage::Rescale
- int quality=wxIMAGE_QUALITY_NORMAL;
+ wxImageResizeQuality quality=wxIMAGE_QUALITY_NORMAL;
wxImage *This = (wxImage *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
bp += 4; /* Align */
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- quality = (int)*(int *) bp; bp += 4;
+quality = *(wxImageResizeQuality *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxImage * Result = &This->Rescale((int) *width,(int) *height,quality);
+ wxImage * Result = &This->Rescale(*width,*height,quality);
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -9991,7 +10026,7 @@ case wxImage_Rotate: { // wxImage::Rotate
} break;
}};
if(!This) throw wxe_badarg(0);
- wxImage * Result = new wxImage(This->Rotate((double) *angle,centre_of_rotation,interpolating,offset_after_rotation)); newPtr((void *) Result,3, memenv);;
+ wxImage * Result = new wxImage(This->Rotate(*angle,centre_of_rotation,interpolating,offset_after_rotation)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -10000,7 +10035,7 @@ case wxImage_RotateHue: { // wxImage::RotateHue
bp += 4; /* Align */
double * angle = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->RotateHue((double) *angle);
+ This->RotateHue(*angle);
break;
}
case wxImage_Rotate90: { // wxImage::Rotate90
@@ -10034,7 +10069,7 @@ case wxImage_SaveFile_2_0: { // wxImage::SaveFile
bp += *nameLen+((8-((0+ *nameLen) & 7)) & 7);
int * type = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SaveFile(name,(int) *type);
+ bool Result = This->SaveFile(name,*type);
rt.addBool(Result);
break;
}
@@ -10052,18 +10087,18 @@ case wxImage_SaveFile_2_1: { // wxImage::SaveFile
break;
}
case wxImage_Scale: { // wxImage::Scale
- int quality=wxIMAGE_QUALITY_NORMAL;
+ wxImageResizeQuality quality=wxIMAGE_QUALITY_NORMAL;
wxImage *This = (wxImage *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
bp += 4; /* Align */
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
- quality = (int)*(int *) bp; bp += 4;
+quality = *(wxImageResizeQuality *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxImage * Result = new wxImage(This->Scale((int) *width,(int) *height,quality)); newPtr((void *) Result,3, memenv);;
+ wxImage * Result = new wxImage(This->Scale(*width,*height,quality)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxImage");
break;
}
@@ -10101,7 +10136,7 @@ case wxImage_SetAlpha_3: { // wxImage::SetAlpha
int * y = (int *) bp; bp += 4;
unsigned int * alpha = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAlpha((int) *x,(int) *y,(char) *alpha);
+ This->SetAlpha(*x,*y,*alpha);
break;
}
case wxImage_SetAlpha_2: { // wxImage::SetAlpha
@@ -10148,7 +10183,7 @@ case wxImage_SetData_4: { // wxImage::SetData
}};
if(!static_data) {data = (unsigned char *) malloc(Ecmd.bin[0]->size);memcpy(data,Ecmd.bin[0]->base,Ecmd.bin[0]->size);};
if(!This) throw wxe_badarg(0);
- This->SetData(data,(int) *new_width,(int) *new_height,static_data);
+ This->SetData(data,*new_width,*new_height,static_data);
break;
}
case wxImage_SetMask: { // wxImage::SetMask
@@ -10170,7 +10205,7 @@ case wxImage_SetMaskColour: { // wxImage::SetMaskColour
unsigned int * g = (unsigned int *) bp; bp += 4;
unsigned int * b = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMaskColour((char) *r,(char) *g,(char) *b);
+ This->SetMaskColour(*r,*g,*b);
break;
}
case wxImage_SetMaskFromImage: { // wxImage::SetMaskFromImage
@@ -10180,7 +10215,7 @@ case wxImage_SetMaskFromImage: { // wxImage::SetMaskFromImage
unsigned int * mg = (unsigned int *) bp; bp += 4;
unsigned int * mb = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetMaskFromImage(*mask,(char) *mr,(char) *mg,(char) *mb);
+ bool Result = This->SetMaskFromImage(*mask,*mr,*mg,*mb);
rt.addBool(Result);
break;
}
@@ -10203,7 +10238,7 @@ case wxImage_SetOption_2_0: { // wxImage::SetOption
bp += *nameLen+((8-((0+ *nameLen) & 7)) & 7);
int * value = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetOption(name,(int) *value);
+ This->SetOption(name,*value);
break;
}
case wxImage_SetPalette: { // wxImage::SetPalette
@@ -10221,7 +10256,7 @@ case wxImage_SetRGB_5: { // wxImage::SetRGB
unsigned int * g = (unsigned int *) bp; bp += 4;
unsigned int * b = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRGB((int) *x,(int) *y,(char) *r,(char) *g,(char) *b);
+ This->SetRGB(*x,*y,*r,*g,*b);
break;
}
case wxImage_SetRGB_4: { // wxImage::SetRGB
@@ -10235,7 +10270,7 @@ case wxImage_SetRGB_4: { // wxImage::SetRGB
unsigned int * g = (unsigned int *) bp; bp += 4;
unsigned int * b = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRGB(rect,(char) *r,(char) *g,(char) *b);
+ This->SetRGB(rect,*r,*g,*b);
break;
}
case wxBrush_new_0: { // wxBrush::wxBrush
@@ -10271,8 +10306,8 @@ case wxBrush_new_1: { // wxBrush::wxBrush
case wxBrush_GetColour: { // wxBrush::GetColour
wxBrush *This = (wxBrush *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour * Result = &This->GetColour();
- rt.add((*Result));
+ wxColour Result = This->GetColour();
+ rt.add(Result);
break;
}
case wxBrush_GetStipple: { // wxBrush::GetStipple
@@ -10320,7 +10355,7 @@ case wxBrush_SetColour_3: { // wxBrush::SetColour
unsigned int * g = (unsigned int *) bp; bp += 4;
unsigned int * b = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColour((char) *r,(char) *g,(char) *b);
+ This->SetColour(*r,*g,*b);
break;
}
case wxBrush_SetStipple: { // wxBrush::SetStipple
@@ -10334,7 +10369,7 @@ case wxBrush_SetStyle: { // wxBrush::SetStyle
wxBrush *This = (wxBrush *) getPtr(bp,memenv); bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStyle((int) *style);
+ This->SetStyle(*style);
break;
}
case wxPen_new_0: { // wxPen::wxPen
@@ -10374,8 +10409,8 @@ case wxPen_GetCap: { // wxPen::GetCap
case wxPen_GetColour: { // wxPen::GetColour
wxPen *This = (wxPen *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour * Result = &This->GetColour();
- rt.add((*Result));
+ wxColour Result = This->GetColour();
+ rt.add(Result);
break;
}
case wxPen_GetJoin: { // wxPen::GetJoin
@@ -10408,9 +10443,9 @@ case wxPen_IsOk: { // wxPen::IsOk
}
case wxPen_SetCap: { // wxPen::SetCap
wxPen *This = (wxPen *) getPtr(bp,memenv); bp += 4;
- int * capStyle = (int *) bp; bp += 4;
+ wxPenCap capStyle = *(wxPenCap *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetCap((int) *capStyle);
+ This->SetCap(capStyle);
break;
}
case wxPen_SetColour_1: { // wxPen::SetColour
@@ -10430,28 +10465,28 @@ case wxPen_SetColour_3: { // wxPen::SetColour
unsigned int * green = (unsigned int *) bp; bp += 4;
unsigned int * blue = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColour((char) *red,(char) *green,(char) *blue);
+ This->SetColour(*red,*green,*blue);
break;
}
case wxPen_SetJoin: { // wxPen::SetJoin
wxPen *This = (wxPen *) getPtr(bp,memenv); bp += 4;
- int * joinStyle = (int *) bp; bp += 4;
+ wxPenJoin joinStyle = *(wxPenJoin *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetJoin((int) *joinStyle);
+ This->SetJoin(joinStyle);
break;
}
case wxPen_SetStyle: { // wxPen::SetStyle
wxPen *This = (wxPen *) getPtr(bp,memenv); bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStyle((int) *style);
+ This->SetStyle(*style);
break;
}
case wxPen_SetWidth: { // wxPen::SetWidth
wxPen *This = (wxPen *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWidth((int) *width);
+ This->SetWidth(*width);
break;
}
case wxRegion_new_0: { // wxRegion::wxRegion
@@ -10465,7 +10500,7 @@ case wxRegion_new_4: { // wxRegion::wxRegion
int * y = (int *) bp; bp += 4;
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
- wxRegion * Result = new EwxRegion((wxCoord) *x,(wxCoord) *y,(wxCoord) *w,(wxCoord) *h);
+ wxRegion * Result = new EwxRegion(*x,*y,*w,*h);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxRegion");
break;
@@ -10511,7 +10546,7 @@ case wxRegion_Contains_2: { // wxRegion::Contains
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->Contains((wxCoord) *x,(wxCoord) *y);
+ int Result = This->Contains(*x,*y);
rt.addInt(Result);
break;
}
@@ -10532,7 +10567,7 @@ case wxRegion_Contains_4: { // wxRegion::Contains
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->Contains((wxCoord) *x,(wxCoord) *y,(wxCoord) *w,(wxCoord) *h);
+ int Result = This->Contains(*x,*y,*w,*h);
rt.addInt(Result);
break;
}
@@ -10569,7 +10604,7 @@ case wxRegion_Intersect_4: { // wxRegion::Intersect
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Intersect((wxCoord) *x,(wxCoord) *y,(wxCoord) *w,(wxCoord) *h);
+ bool Result = This->Intersect(*x,*y,*w,*h);
rt.addBool(Result);
break;
}
@@ -10607,7 +10642,7 @@ case wxRegion_Subtract_4: { // wxRegion::Subtract
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Subtract((wxCoord) *x,(wxCoord) *y,(wxCoord) *w,(wxCoord) *h);
+ bool Result = This->Subtract(*x,*y,*w,*h);
rt.addBool(Result);
break;
}
@@ -10636,7 +10671,7 @@ case wxRegion_Offset_2: { // wxRegion::Offset
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Offset((wxCoord) *x,(wxCoord) *y);
+ bool Result = This->Offset(*x,*y);
rt.addBool(Result);
break;
}
@@ -10657,7 +10692,7 @@ case wxRegion_Union_4: { // wxRegion::Union
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Union((wxCoord) *x,(wxCoord) *y,(wxCoord) *w,(wxCoord) *h);
+ bool Result = This->Union(*x,*y,*w,*h);
rt.addBool(Result);
break;
}
@@ -10715,7 +10750,7 @@ case wxRegion_Xor_4: { // wxRegion::Xor
int * w = (int *) bp; bp += 4;
int * h = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Xor((wxCoord) *x,(wxCoord) *y,(wxCoord) *w,(wxCoord) *h);
+ bool Result = This->Xor(*x,*y,*w,*h);
rt.addBool(Result);
break;
}
@@ -10751,7 +10786,7 @@ case wxAcceleratorTable_new_2: { // wxAcceleratorTable::wxAcceleratorTable
wxAcceleratorEntry *entries;
entries = (wxAcceleratorEntry *) driver_alloc(sizeof(wxAcceleratorEntry) * *entriesLen); for(int i=0; i < *entriesLen; i++) { entries[i] = * (wxAcceleratorEntry *) getPtr(bp,memenv); bp += 4;}
bp += ((0+ *entriesLen)%2 )*4;
- wxAcceleratorTable * Result = new EwxAcceleratorTable((int) *n,entries);
+ wxAcceleratorTable * Result = new EwxAcceleratorTable(*n,entries);
newPtr((void *) Result, 1, memenv);
driver_free(entries);
rt.addRef(getRef((void *)Result,memenv), "wxAcceleratorTable");
@@ -10828,7 +10863,7 @@ item = (wxMenuItem *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- This->Set((int) *flags,(int) *keyCode,(int) *cmd,item);
+ This->Set(*flags,*keyCode,*cmd,item);
break;
}
case wxAcceleratorEntry_destroy: { // wxAcceleratorEntry::destroy
@@ -10841,7 +10876,7 @@ case wxCaret_new_3: { // wxCaret::wxCaret
wxWindow *window = (wxWindow *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
- wxCaret * Result = new EwxCaret(window,(int) *width,(int) *height);
+ wxCaret * Result = new EwxCaret(window,*width,*height);
newPtr((void *) Result, 70, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCaret");
break;
@@ -10868,7 +10903,7 @@ case wxCaret_Create_3: { // wxCaret::Create
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(window,(int) *width,(int) *height);
+ bool Result = This->Create(window,*width,*height);
rt.addBool(Result);
break;
}
@@ -10934,7 +10969,7 @@ case wxCaret_Move_2: { // wxCaret::Move
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Move((int) *x,(int) *y);
+ This->Move(*x,*y);
break;
}
case wxCaret_Move_1: { // wxCaret::Move
@@ -10948,7 +10983,7 @@ case wxCaret_Move_1: { // wxCaret::Move
}
case wxCaret_SetBlinkTime: { // wxCaret::SetBlinkTime
int * milliseconds = (int *) bp; bp += 4;
- wxCaret::SetBlinkTime((int) *milliseconds);
+ wxCaret::SetBlinkTime(*milliseconds);
break;
}
case wxCaret_SetSize_2: { // wxCaret::SetSize
@@ -10956,7 +10991,7 @@ case wxCaret_SetSize_2: { // wxCaret::SetSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSize((int) *width,(int) *height);
+ This->SetSize(*width,*height);
break;
}
case wxCaret_SetSize_1: { // wxCaret::SetSize
@@ -11057,7 +11092,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Add((int) *width,(int) *height,proportion,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Add(*width,*height,proportion,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11083,7 +11118,7 @@ case wxSizer_AddSpacer: { // wxSizer::AddSpacer
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * size = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->AddSpacer((int) *size);
+ wxSizerItem * Result = (wxSizerItem*)This->AddSpacer(*size);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11141,7 +11176,7 @@ case wxSizer_Detach_1_0: { // wxSizer::Detach
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Detach((int) *index);
+ bool Result = This->Detach(*index);
rt.addBool(Result);
break;
}
@@ -11203,7 +11238,7 @@ case wxSizer_GetItem_1: { // wxSizer::GetItem
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->GetItem((size_t) *index);
+ wxSizerItem * Result = (wxSizerItem*)This->GetItem(*index);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11260,7 +11295,7 @@ case wxSizer_Hide_1: { // wxSizer::Hide
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Hide((size_t) *index);
+ bool Result = This->Hide(*index);
rt.addBool(Result);
break;
}
@@ -11288,7 +11323,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Insert((size_t) *index,window,proportion,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Insert(*index,window,proportion,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11316,7 +11351,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Insert((size_t) *index,sizer,proportion,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Insert(*index,sizer,proportion,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11344,7 +11379,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Insert((size_t) *index,(int) *width,(int) *height,proportion,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Insert(*index,*width,*height,proportion,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11354,7 +11389,7 @@ case wxSizer_Insert_3_3: { // wxSizer::Insert
wxWindow * window = (wxWindow *) getPtr(bp,memenv); bp += 4;
wxSizerFlags *flags = (wxSizerFlags *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Insert((size_t) *index,window,*flags);
+ wxSizerItem * Result = (wxSizerItem*)This->Insert(*index,window,*flags);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11364,7 +11399,7 @@ case wxSizer_Insert_3_2: { // wxSizer::Insert
wxSizer *sizer = (wxSizer *) getPtr(bp,memenv); bp += 4;
wxSizerFlags *flags = (wxSizerFlags *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Insert((size_t) *index,sizer,*flags);
+ wxSizerItem * Result = (wxSizerItem*)This->Insert(*index,sizer,*flags);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11373,7 +11408,7 @@ case wxSizer_Insert_2: { // wxSizer::Insert
int * index = (int *) bp; bp += 4;
wxSizerItem *item = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Insert((size_t) *index,item);
+ wxSizerItem * Result = (wxSizerItem*)This->Insert(*index,item);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11382,7 +11417,7 @@ case wxSizer_InsertSpacer: { // wxSizer::InsertSpacer
int * index = (int *) bp; bp += 4;
int * size = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->InsertSpacer((size_t) *index,(int) *size);
+ wxSizerItem * Result = (wxSizerItem*)This->InsertSpacer(*index,*size);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11396,7 +11431,7 @@ case wxSizer_InsertStretchSpacer: { // wxSizer::InsertStretchSpacer
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->InsertStretchSpacer((size_t) *index,prop);
+ wxSizerItem * Result = (wxSizerItem*)This->InsertStretchSpacer(*index,prop);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11420,7 +11455,7 @@ case wxSizer_IsShown_1_0: { // wxSizer::IsShown
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsShown((size_t) *index);
+ bool Result = This->IsShown(*index);
rt.addBool(Result);
break;
}
@@ -11506,7 +11541,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Prepend((int) *width,(int) *height,proportion,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Prepend(*width,*height,proportion,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11540,7 +11575,7 @@ case wxSizer_PrependSpacer: { // wxSizer::PrependSpacer
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * size = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->PrependSpacer((int) *size);
+ wxSizerItem * Result = (wxSizerItem*)This->PrependSpacer(*size);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -11576,7 +11611,7 @@ case wxSizer_Remove_1_0: { // wxSizer::Remove
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Remove((int) *index);
+ bool Result = This->Remove(*index);
rt.addBool(Result);
break;
}
@@ -11617,7 +11652,7 @@ case wxSizer_Replace_2: { // wxSizer::Replace
int * index = (int *) bp; bp += 4;
wxSizerItem *newitem = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Replace((size_t) *index,newitem);
+ bool Result = This->Replace(*index,newitem);
rt.addBool(Result);
break;
}
@@ -11628,7 +11663,7 @@ case wxSizer_SetDimension: { // wxSizer::SetDimension
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDimension((int) *x,(int) *y,(int) *width,(int) *height);
+ This->SetDimension(*x,*y,*width,*height);
break;
}
case wxSizer_SetMinSize_2: { // wxSizer::SetMinSize
@@ -11636,7 +11671,7 @@ case wxSizer_SetMinSize_2: { // wxSizer::SetMinSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinSize((int) *width,(int) *height);
+ This->SetMinSize(*width,*height);
break;
}
case wxSizer_SetMinSize_1: { // wxSizer::SetMinSize
@@ -11654,7 +11689,7 @@ case wxSizer_SetItemMinSize_3_2: { // wxSizer::SetItemMinSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemMinSize(window,(int) *width,(int) *height);
+ bool Result = This->SetItemMinSize(window,*width,*height);
rt.addBool(Result);
break;
}
@@ -11675,7 +11710,7 @@ case wxSizer_SetItemMinSize_3_1: { // wxSizer::SetItemMinSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemMinSize(sizer,(int) *width,(int) *height);
+ bool Result = This->SetItemMinSize(sizer,*width,*height);
rt.addBool(Result);
break;
}
@@ -11696,7 +11731,7 @@ case wxSizer_SetItemMinSize_3_0: { // wxSizer::SetItemMinSize
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemMinSize((size_t) *index,(int) *width,(int) *height);
+ bool Result = This->SetItemMinSize(*index,*width,*height);
rt.addBool(Result);
break;
}
@@ -11707,7 +11742,7 @@ case wxSizer_SetItemMinSize_2_0: { // wxSizer::SetItemMinSize
int * sizeH = (int *) bp; bp += 4;
wxSize size = wxSize(*sizeW,*sizeH);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemMinSize((size_t) *index,size);
+ bool Result = This->SetItemMinSize(*index,size);
rt.addBool(Result);
break;
}
@@ -11771,7 +11806,7 @@ case wxSizer_Show_2_0: { // wxSizer::Show
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Show((size_t) *index,show);
+ bool Result = This->Show(*index,show);
rt.addBool(Result);
break;
}
@@ -11779,7 +11814,7 @@ case wxSizer_Show_1: { // wxSizer::Show
wxSizer *This = (wxSizer *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Show((bool) *show);
+ This->Show(*show);
break;
}
case wxSizerFlags_new: { // wxSizerFlags::wxSizerFlags
@@ -11798,7 +11833,7 @@ case wxSizerFlags_Align: { // wxSizerFlags::Align
wxSizerFlags *This = (wxSizerFlags *) getPtr(bp,memenv); bp += 4;
int * alignment = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerFlags * Result = &This->Align((int) *alignment);
+ wxSizerFlags * Result = &This->Align(*alignment);
rt.addRef(getRef((void *)Result,memenv), "wxSizerFlags");
break;
}
@@ -11807,7 +11842,7 @@ case wxSizerFlags_Border_2: { // wxSizerFlags::Border
int * direction = (int *) bp; bp += 4;
int * borderInPixels = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerFlags * Result = &This->Border((int) *direction,(int) *borderInPixels);
+ wxSizerFlags * Result = &This->Border(*direction,*borderInPixels);
rt.addRef(getRef((void *)Result,memenv), "wxSizerFlags");
break;
}
@@ -11857,7 +11892,7 @@ case wxSizerFlags_Proportion: { // wxSizerFlags::Proportion
wxSizerFlags *This = (wxSizerFlags *) getPtr(bp,memenv); bp += 4;
int * proportion = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizerFlags * Result = &This->Proportion((int) *proportion);
+ wxSizerFlags * Result = &This->Proportion(*proportion);
rt.addRef(getRef((void *)Result,memenv), "wxSizerFlags");
break;
}
@@ -11880,7 +11915,7 @@ case wxSizerItem_new_5_1: { // wxSizerItem::wxSizerItem
int * flag = (int *) bp; bp += 4;
int * border = (int *) bp; bp += 4;
wxObject *userData = (wxObject *) getPtr(bp,memenv); bp += 4;
- wxSizerItem * Result = new EwxSizerItem(window,(int) *proportion,(int) *flag,(int) *border,userData);
+ wxSizerItem * Result = new EwxSizerItem(window,*proportion,*flag,*border,userData);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
@@ -11899,7 +11934,7 @@ case wxSizerItem_new_5_0: { // wxSizerItem::wxSizerItem
int * flag = (int *) bp; bp += 4;
int * border = (int *) bp; bp += 4;
wxObject *userData = (wxObject *) getPtr(bp,memenv); bp += 4;
- wxSizerItem * Result = new EwxSizerItem(sizer,(int) *proportion,(int) *flag,(int) *border,userData);
+ wxSizerItem * Result = new EwxSizerItem(sizer,*proportion,*flag,*border,userData);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
@@ -11919,7 +11954,7 @@ case wxSizerItem_new_6: { // wxSizerItem::wxSizerItem
int * flag = (int *) bp; bp += 4;
int * border = (int *) bp; bp += 4;
wxObject *userData = (wxObject *) getPtr(bp,memenv); bp += 4;
- wxSizerItem * Result = new EwxSizerItem((int) *width,(int) *height,(int) *proportion,(int) *flag,(int) *border,userData);
+ wxSizerItem * Result = new EwxSizerItem(*width,*height,*proportion,*flag,*border,userData);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
@@ -11928,7 +11963,7 @@ case wxSizerItem_new_3: { // wxSizerItem::wxSizerItem
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
wxSizerFlags *flags = (wxSizerFlags *) getPtr(bp,memenv); bp += 4;
- wxSizerItem * Result = new EwxSizerItem((int) *width,(int) *height,*flags);
+ wxSizerItem * Result = new EwxSizerItem(*width,*height,*flags);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
@@ -12074,7 +12109,7 @@ case wxSizerItem_SetBorder: { // wxSizerItem::SetBorder
wxSizerItem *This = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
int * border = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetBorder((int) *border);
+ This->SetBorder(*border);
break;
}
case wxSizerItem_SetDimension: { // wxSizerItem::SetDimension
@@ -12093,7 +12128,7 @@ case wxSizerItem_SetFlag: { // wxSizerItem::SetFlag
wxSizerItem *This = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
int * flag = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFlag((int) *flag);
+ This->SetFlag(*flag);
break;
}
case wxSizerItem_SetInitSize: { // wxSizerItem::SetInitSize
@@ -12101,7 +12136,7 @@ case wxSizerItem_SetInitSize: { // wxSizerItem::SetInitSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetInitSize((int) *x,(int) *y);
+ This->SetInitSize(*x,*y);
break;
}
case wxSizerItem_SetMinSize_1: { // wxSizerItem::SetMinSize
@@ -12118,14 +12153,14 @@ case wxSizerItem_SetMinSize_2: { // wxSizerItem::SetMinSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinSize((int) *x,(int) *y);
+ This->SetMinSize(*x,*y);
break;
}
case wxSizerItem_SetProportion: { // wxSizerItem::SetProportion
wxSizerItem *This = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
int * proportion = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetProportion((int) *proportion);
+ This->SetProportion(*proportion);
break;
}
case wxSizerItem_SetRatio_2: { // wxSizerItem::SetRatio
@@ -12133,7 +12168,7 @@ case wxSizerItem_SetRatio_2: { // wxSizerItem::SetRatio
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRatio((int) *width,(int) *height);
+ This->SetRatio(*width,*height);
break;
}
case wxSizerItem_SetRatio_1_1: { // wxSizerItem::SetRatio
@@ -12149,7 +12184,7 @@ case wxSizerItem_SetRatio_1_0: { // wxSizerItem::SetRatio
wxSizerItem *This = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
float * ratio = (float *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRatio((float) *ratio);
+ This->SetRatio(*ratio);
break;
}
case wxSizerItem_SetSizer: { // wxSizerItem::SetSizer
@@ -12173,7 +12208,7 @@ case wxSizerItem_SetSpacer_2: { // wxSizerItem::SetSpacer
int * width = (int *) bp; bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSpacer((int) *width,(int) *height);
+ This->SetSpacer(*width,*height);
break;
}
case wxSizerItem_SetWindow: { // wxSizerItem::SetWindow
@@ -12187,12 +12222,12 @@ case wxSizerItem_Show: { // wxSizerItem::Show
wxSizerItem *This = (wxSizerItem *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Show((bool) *show);
+ This->Show(*show);
break;
}
case wxBoxSizer_new: { // wxBoxSizer::wxBoxSizer
int * orient = (int *) bp; bp += 4;
- wxBoxSizer * Result = new EwxBoxSizer((int) *orient);
+ wxBoxSizer * Result = new EwxBoxSizer(*orient);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBoxSizer");
break;
@@ -12207,7 +12242,7 @@ case wxBoxSizer_GetOrientation: { // wxBoxSizer::GetOrientation
case wxStaticBoxSizer_new_2: { // wxStaticBoxSizer::wxStaticBoxSizer
wxStaticBox *box = (wxStaticBox *) getPtr(bp,memenv); bp += 4;
int * orient = (int *) bp; bp += 4;
- wxStaticBoxSizer * Result = new EwxStaticBoxSizer(box,(int) *orient);
+ wxStaticBoxSizer * Result = new EwxStaticBoxSizer(box,*orient);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxStaticBoxSizer");
break;
@@ -12223,7 +12258,7 @@ case wxStaticBoxSizer_new_3: { // wxStaticBoxSizer::wxStaticBoxSizer
bp += *labelLen+((8-((0+ *labelLen) & 7)) & 7);
} break;
}};
- wxStaticBoxSizer * Result = new EwxStaticBoxSizer((int) *orient,win,label);
+ wxStaticBoxSizer * Result = new EwxStaticBoxSizer(*orient,win,label);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxStaticBoxSizer");
break;
@@ -12240,7 +12275,7 @@ case wxGridSizer_new_4: { // wxGridSizer::wxGridSizer
int * cols = (int *) bp; bp += 4;
int * vgap = (int *) bp; bp += 4;
int * hgap = (int *) bp; bp += 4;
- wxGridSizer * Result = new EwxGridSizer((int) *rows,(int) *cols,(int) *vgap,(int) *hgap);
+ wxGridSizer * Result = new EwxGridSizer(*rows,*cols,*vgap,*hgap);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxGridSizer");
break;
@@ -12258,7 +12293,7 @@ case wxGridSizer_new_2: { // wxGridSizer::wxGridSizer
hgap = (int)*(int *) bp; bp += 4;
} break;
}};
- wxGridSizer * Result = new EwxGridSizer((int) *cols,vgap,hgap);
+ wxGridSizer * Result = new EwxGridSizer(*cols,vgap,hgap);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxGridSizer");
break;
@@ -12295,28 +12330,28 @@ case wxGridSizer_SetCols: { // wxGridSizer::SetCols
wxGridSizer *This = (wxGridSizer *) getPtr(bp,memenv); bp += 4;
int * cols = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCols((int) *cols);
+ This->SetCols(*cols);
break;
}
case wxGridSizer_SetHGap: { // wxGridSizer::SetHGap
wxGridSizer *This = (wxGridSizer *) getPtr(bp,memenv); bp += 4;
int * gap = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHGap((int) *gap);
+ This->SetHGap(*gap);
break;
}
case wxGridSizer_SetRows: { // wxGridSizer::SetRows
wxGridSizer *This = (wxGridSizer *) getPtr(bp,memenv); bp += 4;
int * rows = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRows((int) *rows);
+ This->SetRows(*rows);
break;
}
case wxGridSizer_SetVGap: { // wxGridSizer::SetVGap
wxGridSizer *This = (wxGridSizer *) getPtr(bp,memenv); bp += 4;
int * gap = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetVGap((int) *gap);
+ This->SetVGap(*gap);
break;
}
case wxFlexGridSizer_new_4: { // wxFlexGridSizer::wxFlexGridSizer
@@ -12324,7 +12359,7 @@ case wxFlexGridSizer_new_4: { // wxFlexGridSizer::wxFlexGridSizer
int * cols = (int *) bp; bp += 4;
int * vgap = (int *) bp; bp += 4;
int * hgap = (int *) bp; bp += 4;
- wxFlexGridSizer * Result = new EwxFlexGridSizer((int) *rows,(int) *cols,(int) *vgap,(int) *hgap);
+ wxFlexGridSizer * Result = new EwxFlexGridSizer(*rows,*cols,*vgap,*hgap);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFlexGridSizer");
break;
@@ -12342,7 +12377,7 @@ case wxFlexGridSizer_new_2: { // wxFlexGridSizer::wxFlexGridSizer
hgap = (int)*(int *) bp; bp += 4;
} break;
}};
- wxFlexGridSizer * Result = new EwxFlexGridSizer((int) *cols,vgap,hgap);
+ wxFlexGridSizer * Result = new EwxFlexGridSizer(*cols,vgap,hgap);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFlexGridSizer");
break;
@@ -12357,7 +12392,7 @@ case wxFlexGridSizer_AddGrowableCol: { // wxFlexGridSizer::AddGrowableCol
} break;
}};
if(!This) throw wxe_badarg(0);
- This->AddGrowableCol((size_t) *idx,proportion);
+ This->AddGrowableCol(*idx,proportion);
break;
}
case wxFlexGridSizer_AddGrowableRow: { // wxFlexGridSizer::AddGrowableRow
@@ -12370,7 +12405,7 @@ case wxFlexGridSizer_AddGrowableRow: { // wxFlexGridSizer::AddGrowableRow
} break;
}};
if(!This) throw wxe_badarg(0);
- This->AddGrowableRow((size_t) *idx,proportion);
+ This->AddGrowableRow(*idx,proportion);
break;
}
case wxFlexGridSizer_GetFlexibleDirection: { // wxFlexGridSizer::GetFlexibleDirection
@@ -12391,28 +12426,28 @@ case wxFlexGridSizer_RemoveGrowableCol: { // wxFlexGridSizer::RemoveGrowableCol
wxFlexGridSizer *This = (wxFlexGridSizer *) getPtr(bp,memenv); bp += 4;
int * idx = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->RemoveGrowableCol((size_t) *idx);
+ This->RemoveGrowableCol(*idx);
break;
}
case wxFlexGridSizer_RemoveGrowableRow: { // wxFlexGridSizer::RemoveGrowableRow
wxFlexGridSizer *This = (wxFlexGridSizer *) getPtr(bp,memenv); bp += 4;
int * idx = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->RemoveGrowableRow((size_t) *idx);
+ This->RemoveGrowableRow(*idx);
break;
}
case wxFlexGridSizer_SetFlexibleDirection: { // wxFlexGridSizer::SetFlexibleDirection
wxFlexGridSizer *This = (wxFlexGridSizer *) getPtr(bp,memenv); bp += 4;
int * direction = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFlexibleDirection((int) *direction);
+ This->SetFlexibleDirection(*direction);
break;
}
case wxFlexGridSizer_SetNonFlexibleGrowMode: { // wxFlexGridSizer::SetNonFlexibleGrowMode
wxFlexGridSizer *This = (wxFlexGridSizer *) getPtr(bp,memenv); bp += 4;
wxFlexSizerGrowMode mode = *(wxFlexSizerGrowMode *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetNonFlexibleGrowMode((wxFlexSizerGrowMode) mode);
+ This->SetNonFlexibleGrowMode(mode);
break;
}
case wxGridBagSizer_new: { // wxGridBagSizer::wxGridBagSizer
@@ -12525,7 +12560,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Add((int) *width,(int) *height,pos,span,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Add(*width,*height,pos,span,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -12613,7 +12648,7 @@ userData = (wxObject *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- wxSizerItem * Result = (wxSizerItem*)This->Add((int) *width,(int) *height,proportion,flag,border,userData);
+ wxSizerItem * Result = (wxSizerItem*)This->Add(*width,*height,proportion,flag,border,userData);
rt.addRef(getRef((void *)Result,memenv), "wxSizerItem");
break;
}
@@ -12715,7 +12750,7 @@ case wxGridBagSizer_GetCellSize: { // wxGridBagSizer::GetCellSize
int * row = (int *) bp; bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSize Result = This->GetCellSize((int) *row,(int) *col);
+ wxSize Result = This->GetCellSize(*row,*col);
rt.add(Result);
break;
}
@@ -12746,7 +12781,7 @@ case wxGridBagSizer_GetItemPosition_1_0: { // wxGridBagSizer::GetItemPosition
wxGridBagSizer *This = (wxGridBagSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGBPosition Result = This->GetItemPosition((size_t) *index);
+ wxGBPosition Result = This->GetItemPosition(*index);
rt.add(Result);
break;
}
@@ -12770,7 +12805,7 @@ case wxGridBagSizer_GetItemSpan_1_0: { // wxGridBagSizer::GetItemSpan
wxGridBagSizer *This = (wxGridBagSizer *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxGBSpan Result = This->GetItemSpan((size_t) *index);
+ wxGBSpan Result = This->GetItemSpan(*index);
rt.add(Result);
break;
}
@@ -12812,7 +12847,7 @@ case wxGridBagSizer_SetItemPosition_2_0: { // wxGridBagSizer::SetItemPosition
int * posC = (int *) bp; bp += 4;
wxGBPosition pos = wxGBPosition(*posR,*posC);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemPosition((size_t) *index,pos);
+ bool Result = This->SetItemPosition(*index,pos);
rt.addBool(Result);
break;
}
@@ -12845,7 +12880,7 @@ case wxGridBagSizer_SetItemSpan_2_0: { // wxGridBagSizer::SetItemSpan
int * spanCS = (int *) bp; bp += 4;
wxGBSpan span = wxGBSpan(*spanRS,*spanCS);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemSpan((size_t) *index,span);
+ bool Result = This->SetItemSpan(*index,span);
rt.addBool(Result);
break;
}
@@ -12925,7 +12960,7 @@ case wxFont_new_5: { // wxFont::wxFont
encoding = *(wxFontEncoding *) bp; bp += 4;;
} break;
}};
- wxFont * Result = new EwxFont((int) *size,(wxFontFamily) family,(wxFontStyle) style,(int) *weight,underlined,face,(wxFontEncoding) encoding);
+ wxFont * Result = new EwxFont(*size,family,style,*weight,underlined,face,encoding);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFont");
break;
@@ -13007,7 +13042,7 @@ case wxFont_Ok: { // wxFont::Ok
}
case wxFont_SetDefaultEncoding: { // wxFont::SetDefaultEncoding
wxFontEncoding encoding = *(wxFontEncoding *) bp; bp += 4;;
- wxFont::SetDefaultEncoding((wxFontEncoding) encoding);
+ wxFont::SetDefaultEncoding(encoding);
break;
}
case wxFont_SetFaceName: { // wxFont::SetFaceName
@@ -13024,45 +13059,45 @@ case wxFont_SetFamily: { // wxFont::SetFamily
wxFont *This = (wxFont *) getPtr(bp,memenv); bp += 4;
wxFontFamily family = *(wxFontFamily *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetFamily((wxFontFamily) family);
+ This->SetFamily(family);
break;
}
case wxFont_SetPointSize: { // wxFont::SetPointSize
wxFont *This = (wxFont *) getPtr(bp,memenv); bp += 4;
int * pointSize = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPointSize((int) *pointSize);
+ This->SetPointSize(*pointSize);
break;
}
case wxFont_SetStyle: { // wxFont::SetStyle
wxFont *This = (wxFont *) getPtr(bp,memenv); bp += 4;
wxFontStyle style = *(wxFontStyle *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetStyle((wxFontStyle) style);
+ This->SetStyle(style);
break;
}
case wxFont_SetUnderlined: { // wxFont::SetUnderlined
wxFont *This = (wxFont *) getPtr(bp,memenv); bp += 4;
bool * underlined = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetUnderlined((bool) *underlined);
+ This->SetUnderlined(*underlined);
break;
}
case wxFont_SetWeight: { // wxFont::SetWeight
wxFont *This = (wxFont *) getPtr(bp,memenv); bp += 4;
int * weight = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWeight((int) *weight);
+ This->SetWeight(*weight);
break;
}
case wxToolTip_Enable: { // wxToolTip::Enable
bool * flag = (bool *) bp; bp += 4;
- wxToolTip::Enable((bool) *flag);
+ wxToolTip::Enable(*flag);
break;
}
case wxToolTip_SetDelay: { // wxToolTip::SetDelay
int * msecs = (int *) bp; bp += 4;
- wxToolTip::SetDelay((long) *msecs);
+ wxToolTip::SetDelay(*msecs);
break;
}
case wxToolTip_new: { // wxToolTip::wxToolTip
@@ -13130,7 +13165,7 @@ case wxButton_new_3: { // wxButton::wxButton
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxButton * Result = new EwxButton(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ wxButton * Result = new EwxButton(parent,*id,label,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxButton");
break;
@@ -13177,7 +13212,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,label,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -13230,7 +13265,7 @@ case wxBitmapButton_new_4: { // wxBitmapButton::wxBitmapButton
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxBitmapButton * Result = new EwxBitmapButton(parent,(wxWindowID) *id,*bitmap,pos,size,style,*validator);
+ wxBitmapButton * Result = new EwxBitmapButton(parent,*id,*bitmap,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmapButton");
break;
@@ -13271,35 +13306,35 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,*bitmap,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,*bitmap,pos,size,style,*validator);
rt.addBool(Result);
break;
}
case wxBitmapButton_GetBitmapDisabled: { // wxBitmapButton::GetBitmapDisabled
wxBitmapButton *This = (wxBitmapButton *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxBitmap * Result = &This->GetBitmapDisabled();
+ const wxBitmap * Result = new wxBitmap(This->GetBitmapDisabled()); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
}
case wxBitmapButton_GetBitmapFocus: { // wxBitmapButton::GetBitmapFocus
wxBitmapButton *This = (wxBitmapButton *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxBitmap * Result = &This->GetBitmapFocus();
+ const wxBitmap * Result = new wxBitmap(This->GetBitmapFocus()); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
}
case wxBitmapButton_GetBitmapLabel: { // wxBitmapButton::GetBitmapLabel
wxBitmapButton *This = (wxBitmapButton *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxBitmap * Result = &This->GetBitmapLabel();
+ const wxBitmap * Result = new wxBitmap(This->GetBitmapLabel()); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
}
case wxBitmapButton_GetBitmapSelected: { // wxBitmapButton::GetBitmapSelected
wxBitmapButton *This = (wxBitmapButton *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxBitmap * Result = &This->GetBitmapSelected();
+ const wxBitmap * Result = new wxBitmap(This->GetBitmapSelected()); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
}
@@ -13367,7 +13402,7 @@ case wxToggleButton_new_4: { // wxToggleButton::wxToggleButton
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxToggleButton * Result = new EwxToggleButton(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ wxToggleButton * Result = new EwxToggleButton(parent,*id,label,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxToggleButton");
break;
@@ -13404,7 +13439,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,label,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -13419,7 +13454,7 @@ case wxToggleButton_SetValue: { // wxToggleButton::SetValue
wxToggleButton *This = (wxToggleButton *) getPtr(bp,memenv); bp += 4;
bool * state = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((bool) *state);
+ This->SetValue(*state);
break;
}
case wxCalendarCtrl_new_0: { // wxCalendarCtrl::wxCalendarCtrl
@@ -13462,7 +13497,7 @@ case wxCalendarCtrl_new_3: { // wxCalendarCtrl::wxCalendarCtrl
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxCalendarCtrl * Result = new EwxCalendarCtrl(parent,(wxWindowID) *id,date,pos,size,style);
+ wxCalendarCtrl * Result = new EwxCalendarCtrl(parent,*id,date,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCalendarCtrl");
break;
@@ -13504,7 +13539,7 @@ case wxCalendarCtrl_Create: { // wxCalendarCtrl::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,date,pos,size,style);
+ bool Result = This->Create(parent,*id,date,pos,size,style);
rt.addBool(Result);
break;
}
@@ -13525,10 +13560,11 @@ case wxCalendarCtrl_SetDate: { // wxCalendarCtrl::SetDate
case wxCalendarCtrl_GetDate: { // wxCalendarCtrl::GetDate
wxCalendarCtrl *This = (wxCalendarCtrl *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxDateTime * Result = &This->GetDate();
- rt.add((*Result));
+ const wxDateTime Result = This->GetDate();
+ rt.add(Result);
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxCalendarCtrl_EnableYearChange: { // wxCalendarCtrl::EnableYearChange
bool enable=true;
wxCalendarCtrl *This = (wxCalendarCtrl *) getPtr(bp,memenv); bp += 4;
@@ -13542,6 +13578,7 @@ case wxCalendarCtrl_EnableYearChange: { // wxCalendarCtrl::EnableYearChange
This->EnableYearChange(enable);
break;
}
+#endif
case wxCalendarCtrl_EnableMonthChange: { // wxCalendarCtrl::EnableMonthChange
bool enable=true;
wxCalendarCtrl *This = (wxCalendarCtrl *) getPtr(bp,memenv); bp += 4;
@@ -13662,7 +13699,7 @@ case wxCalendarCtrl_GetAttr: { // wxCalendarCtrl::GetAttr
wxCalendarCtrl *This = (wxCalendarCtrl *) getPtr(bp,memenv); bp += 4;
int * day = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxCalendarDateAttr * Result = (wxCalendarDateAttr*)This->GetAttr((size_t) *day);
+ wxCalendarDateAttr * Result = (wxCalendarDateAttr*)This->GetAttr(*day);
rt.addRef(getRef((void *)Result,memenv), "wxCalendarDateAttr");
break;
}
@@ -13671,21 +13708,21 @@ case wxCalendarCtrl_SetAttr: { // wxCalendarCtrl::SetAttr
int * day = (int *) bp; bp += 4;
wxCalendarDateAttr *attr = (wxCalendarDateAttr *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAttr((size_t) *day,attr);
+ This->SetAttr(*day,attr);
break;
}
case wxCalendarCtrl_SetHoliday: { // wxCalendarCtrl::SetHoliday
wxCalendarCtrl *This = (wxCalendarCtrl *) getPtr(bp,memenv); bp += 4;
int * day = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHoliday((size_t) *day);
+ This->SetHoliday(*day);
break;
}
case wxCalendarCtrl_ResetAttr: { // wxCalendarCtrl::ResetAttr
wxCalendarCtrl *This = (wxCalendarCtrl *) getPtr(bp,memenv); bp += 4;
int * day = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ResetAttr((size_t) *day);
+ This->ResetAttr(*day);
break;
}
case wxCalendarCtrl_HitTest: { // wxCalendarCtrl::HitTest
@@ -13743,7 +13780,7 @@ font = (wxFont *) getPtr(bp,memenv); bp += 4;
border = *(wxCalendarDateBorder *) bp; bp += 4;;
} break;
}};
- wxCalendarDateAttr * Result = new wxCalendarDateAttr(colText,colBack,colBorder,*font,(wxCalendarDateBorder) border);
+ wxCalendarDateAttr * Result = new wxCalendarDateAttr(colText,colBack,colBorder,*font,border);
newPtr((void *) Result, 88, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCalendarDateAttr");
break;
@@ -13762,7 +13799,7 @@ case wxCalendarDateAttr_new_2_0: { // wxCalendarDateAttr::wxCalendarDateAttr
bp += 4; /* Align */
} break;
}};
- wxCalendarDateAttr * Result = new wxCalendarDateAttr((wxCalendarDateBorder) border,colBorder);
+ wxCalendarDateAttr * Result = new wxCalendarDateAttr(border,colBorder);
newPtr((void *) Result, 88, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCalendarDateAttr");
break;
@@ -13811,14 +13848,14 @@ case wxCalendarDateAttr_SetBorder: { // wxCalendarDateAttr::SetBorder
wxCalendarDateAttr *This = (wxCalendarDateAttr *) getPtr(bp,memenv); bp += 4;
wxCalendarDateBorder border = *(wxCalendarDateBorder *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetBorder((wxCalendarDateBorder) border);
+ This->SetBorder(border);
break;
}
case wxCalendarDateAttr_SetHoliday: { // wxCalendarDateAttr::SetHoliday
wxCalendarDateAttr *This = (wxCalendarDateAttr *) getPtr(bp,memenv); bp += 4;
bool * holiday = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHoliday((bool) *holiday);
+ This->SetHoliday(*holiday);
break;
}
case wxCalendarDateAttr_HasTextColour: { // wxCalendarDateAttr::HasTextColour
@@ -13934,7 +13971,7 @@ case wxCheckBox_new_4: { // wxCheckBox::wxCheckBox
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxCheckBox * Result = new EwxCheckBox(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ wxCheckBox * Result = new EwxCheckBox(parent,*id,label,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCheckBox");
break;
@@ -13977,7 +14014,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,label,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -14020,14 +14057,14 @@ case wxCheckBox_SetValue: { // wxCheckBox::SetValue
wxCheckBox *This = (wxCheckBox *) getPtr(bp,memenv); bp += 4;
bool * state = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((bool) *state);
+ This->SetValue(*state);
break;
}
case wxCheckBox_Set3StateValue: { // wxCheckBox::Set3StateValue
wxCheckBox *This = (wxCheckBox *) getPtr(bp,memenv); bp += 4;
wxCheckBoxState state = *(wxCheckBoxState *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->Set3StateValue((wxCheckBoxState) state);
+ This->Set3StateValue(state);
break;
}
case wxCheckListBox_new_0: { // wxCheckListBox::wxCheckListBox
@@ -14075,7 +14112,7 @@ case wxCheckListBox_new_3: { // wxCheckListBox::wxCheckListBox
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxCheckListBox * Result = new EwxCheckListBox(parent,(wxWindowID) *id,pos,size,choices,style,*validator);
+ wxCheckListBox * Result = new EwxCheckListBox(parent,*id,pos,size,choices,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxCheckListBox");
break;
@@ -14090,14 +14127,14 @@ case wxCheckListBox_Check: { // wxCheckListBox::Check
} break;
}};
if(!This) throw wxe_badarg(0);
- This->Check((int) *index,check);
+ This->Check(*index,check);
break;
}
case wxCheckListBox_IsChecked: { // wxCheckListBox::IsChecked
wxCheckListBox *This = (wxCheckListBox *) getPtr(bp,memenv); bp += 4;
unsigned int * index = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsChecked((int) *index);
+ bool Result = This->IsChecked(*index);
rt.addBool(Result);
break;
}
@@ -14140,7 +14177,7 @@ case wxChoice_new_3: { // wxChoice::wxChoice
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxChoice * Result = new EwxChoice(parent,(wxWindowID) *id,pos,size,choices,style,*validator);
+ wxChoice * Result = new EwxChoice(parent,*id,pos,size,choices,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxChoice");
break;
@@ -14182,7 +14219,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,choices,style,*validator);
+ bool Result = This->Create(parent,*id,pos,size,choices,style,*validator);
rt.addBool(Result);
break;
}
@@ -14190,7 +14227,7 @@ case wxChoice_Delete: { // wxChoice::Delete
wxChoice *This = (wxChoice *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Delete((int) *n);
+ This->Delete(*n);
break;
}
case wxChoice_GetColumns: { // wxChoice::GetColumns
@@ -14264,7 +14301,7 @@ case wxComboBox_new_3: { // wxComboBox::wxComboBox
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxComboBox * Result = new EwxComboBox(parent,(wxWindowID) *id,value,pos,size,choices,style,*validator);
+ wxComboBox * Result = new EwxComboBox(parent,*id,value,pos,size,choices,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxComboBox");
break;
@@ -14303,7 +14340,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,value,pos,size,choices,style,*validator);
+ bool Result = This->Create(parent,*id,value,pos,size,choices,style,*validator);
rt.addBool(Result);
break;
}
@@ -14395,7 +14432,7 @@ case wxComboBox_Replace: { // wxComboBox::Replace
wxString value = wxString(bp, wxConvUTF8);
bp += *valueLen+((8-((0+ *valueLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->Replace((long) *from,(long) *to,value);
+ This->Replace(*from,*to,value);
break;
}
case wxComboBox_Remove: { // wxComboBox::Remove
@@ -14403,14 +14440,14 @@ case wxComboBox_Remove: { // wxComboBox::Remove
int * from = (int *) bp; bp += 4;
int * to = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Remove((long) *from,(long) *to);
+ This->Remove(*from,*to);
break;
}
case wxComboBox_SetInsertionPoint: { // wxComboBox::SetInsertionPoint
wxComboBox *This = (wxComboBox *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetInsertionPoint((long) *pos);
+ This->SetInsertionPoint(*pos);
break;
}
case wxComboBox_SetInsertionPointEnd: { // wxComboBox::SetInsertionPointEnd
@@ -14423,7 +14460,7 @@ case wxComboBox_SetSelection_1: { // wxComboBox::SetSelection
wxComboBox *This = (wxComboBox *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *n);
+ This->SetSelection(*n);
break;
}
case wxComboBox_SetSelection_2: { // wxComboBox::SetSelection
@@ -14431,7 +14468,7 @@ case wxComboBox_SetSelection_2: { // wxComboBox::SetSelection
int * from = (int *) bp; bp += 4;
int * to = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((long) *from,(long) *to);
+ This->SetSelection(*from,*to);
break;
}
case wxComboBox_SetValue: { // wxComboBox::SetValue
@@ -14484,7 +14521,7 @@ case wxGauge_new_4: { // wxGauge::wxGauge
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxGauge * Result = new EwxGauge(parent,(wxWindowID) *id,(int) *range,pos,size,style,*validator);
+ wxGauge * Result = new EwxGauge(parent,*id,*range,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxGauge");
break;
@@ -14519,7 +14556,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,(int) *range,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,*range,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -14562,28 +14599,28 @@ case wxGauge_SetBezelFace: { // wxGauge::SetBezelFace
wxGauge *This = (wxGauge *) getPtr(bp,memenv); bp += 4;
int * w = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetBezelFace((int) *w);
+ This->SetBezelFace(*w);
break;
}
case wxGauge_SetRange: { // wxGauge::SetRange
wxGauge *This = (wxGauge *) getPtr(bp,memenv); bp += 4;
int * r = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRange((int) *r);
+ This->SetRange(*r);
break;
}
case wxGauge_SetShadowWidth: { // wxGauge::SetShadowWidth
wxGauge *This = (wxGauge *) getPtr(bp,memenv); bp += 4;
int * w = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetShadowWidth((int) *w);
+ This->SetShadowWidth(*w);
break;
}
case wxGauge_SetValue: { // wxGauge::SetValue
wxGauge *This = (wxGauge *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((int) *pos);
+ This->SetValue(*pos);
break;
}
case wxGauge_Pulse: { // wxGauge::Pulse
@@ -14793,7 +14830,7 @@ case wxGenericDirCtrl_SetFilterIndex: { // wxGenericDirCtrl::SetFilterIndex
wxGenericDirCtrl *This = (wxGenericDirCtrl *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFilterIndex((int) *n);
+ This->SetFilterIndex(*n);
break;
}
case wxGenericDirCtrl_SetPath: { // wxGenericDirCtrl::SetPath
@@ -14831,7 +14868,7 @@ case wxStaticBox_new_4: { // wxStaticBox::wxStaticBox
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxStaticBox * Result = new EwxStaticBox(parent,(wxWindowID) *id,label,pos,size,style);
+ wxStaticBox * Result = new EwxStaticBox(parent,*id,label,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxStaticBox");
break;
@@ -14870,7 +14907,7 @@ case wxStaticBox_Create: { // wxStaticBox::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,label,pos,size,style);
+ bool Result = This->Create(parent,*id,label,pos,size,style);
rt.addBool(Result);
break;
}
@@ -14995,7 +15032,7 @@ case wxListBox_new_3: { // wxListBox::wxListBox
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxListBox * Result = new EwxListBox(parent,(wxWindowID) *id,pos,size,choices,style,*validator);
+ wxListBox * Result = new EwxListBox(parent,*id,pos,size,choices,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxListBox");
break;
@@ -15037,7 +15074,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,choices,style,*validator);
+ bool Result = This->Create(parent,*id,pos,size,choices,style,*validator);
rt.addBool(Result);
break;
}
@@ -15045,7 +15082,7 @@ case wxListBox_Deselect: { // wxListBox::Deselect
wxListBox *This = (wxListBox *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Deselect((int) *n);
+ This->Deselect(*n);
break;
}
case wxListBox_GetSelections: { // wxListBox::GetSelections
@@ -15072,14 +15109,14 @@ case wxListBox_InsertItems: { // wxListBox::InsertItems
bp += (8-((0+ itemsASz) & 7 )) & 7;
unsigned int * pos = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->InsertItems(items,(int) *pos);
+ This->InsertItems(items,*pos);
break;
}
case wxListBox_IsSelected: { // wxListBox::IsSelected
wxListBox *This = (wxListBox *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsSelected((int) *n);
+ bool Result = This->IsSelected(*n);
rt.addBool(Result);
break;
}
@@ -15096,7 +15133,7 @@ case wxListBox_Set: { // wxListBox::Set
}
bp += (8-((0+ itemsASz) & 7 )) & 7;
if(!This) throw wxe_badarg(0);
- This->Set(items,NULL);
+ This->Set(items,(void **) NULL);
break;
}
case wxListBox_HitTest: { // wxListBox::HitTest
@@ -15113,7 +15150,7 @@ case wxListBox_SetFirstItem_1_0: { // wxListBox::SetFirstItem
wxListBox *This = (wxListBox *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFirstItem((int) *n);
+ This->SetFirstItem(*n);
break;
}
case wxListBox_SetFirstItem_1_1: { // wxListBox::SetFirstItem
@@ -15203,7 +15240,7 @@ case wxListCtrl_AssignImageList: { // wxListCtrl::AssignImageList
wxImageList *imageList = (wxImageList *) getPtr(bp,memenv); bp += 4;
int * which = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AssignImageList(imageList,(int) *which);
+ This->AssignImageList(imageList,*which);
break;
}
case wxListCtrl_ClearAll: { // wxListCtrl::ClearAll
@@ -15277,7 +15314,7 @@ case wxListCtrl_DeleteColumn: { // wxListCtrl::DeleteColumn
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeleteColumn((int) *col);
+ bool Result = This->DeleteColumn(*col);
rt.addBool(Result);
break;
}
@@ -15285,7 +15322,7 @@ case wxListCtrl_DeleteItem: { // wxListCtrl::DeleteItem
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeleteItem((long) *item);
+ bool Result = This->DeleteItem(*item);
rt.addBool(Result);
break;
}
@@ -15293,7 +15330,7 @@ case wxListCtrl_EditLabel: { // wxListCtrl::EditLabel
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxTextCtrl * Result = (wxTextCtrl*)This->EditLabel((long) *item);
+ wxTextCtrl * Result = (wxTextCtrl*)This->EditLabel(*item);
rt.addRef(getRef((void *)Result,memenv), "wxTextCtrl");
break;
}
@@ -15301,7 +15338,7 @@ case wxListCtrl_EnsureVisible: { // wxListCtrl::EnsureVisible
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->EnsureVisible((long) *item);
+ bool Result = This->EnsureVisible(*item);
rt.addBool(Result);
break;
}
@@ -15318,7 +15355,7 @@ case wxListCtrl_FindItem_3_0: { // wxListCtrl::FindItem
} break;
}};
if(!This) throw wxe_badarg(0);
- long Result = This->FindItem((long) *start,str,partial);
+ long Result = This->FindItem(*start,str,partial);
rt.addInt(Result);
break;
}
@@ -15330,7 +15367,7 @@ case wxListCtrl_FindItem_3_1: { // wxListCtrl::FindItem
wxPoint pt = wxPoint(*ptX,*ptY);
int * direction = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- long Result = This->FindItem((long) *start,pt,(int) *direction);
+ long Result = This->FindItem(*start,pt,*direction);
rt.addInt(Result);
break;
}
@@ -15339,7 +15376,7 @@ case wxListCtrl_GetColumn: { // wxListCtrl::GetColumn
int * col = (int *) bp; bp += 4;
wxListItem *item = (wxListItem *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetColumn((int) *col,*item);
+ bool Result = This->GetColumn(*col,*item);
rt.addBool(Result);
break;
}
@@ -15354,7 +15391,7 @@ case wxListCtrl_GetColumnWidth: { // wxListCtrl::GetColumnWidth
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetColumnWidth((int) *col);
+ int Result = This->GetColumnWidth(*col);
rt.addInt(Result);
break;
}
@@ -15376,7 +15413,7 @@ case wxListCtrl_GetImageList: { // wxListCtrl::GetImageList
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * which = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxImageList * Result = (wxImageList*)This->GetImageList((int) *which);
+ wxImageList * Result = (wxImageList*)This->GetImageList(*which);
rt.addRef(getRef((void *)Result,memenv), "wxImageList");
break;
}
@@ -15392,7 +15429,7 @@ case wxListCtrl_GetItemBackgroundColour: { // wxListCtrl::GetItemBackgroundColou
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour Result = This->GetItemBackgroundColour((long) *item);
+ wxColour Result = This->GetItemBackgroundColour(*item);
rt.add(Result);
break;
}
@@ -15407,7 +15444,7 @@ case wxListCtrl_GetItemData: { // wxListCtrl::GetItemData
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxUIntPtr Result = This->GetItemData((long) *item);
+ wxUIntPtr Result = This->GetItemData(*item);
rt.addInt(Result);
break;
}
@@ -15415,7 +15452,7 @@ case wxListCtrl_GetItemFont: { // wxListCtrl::GetItemFont
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxFont * Result = new wxFont(This->GetItemFont((long) *item)); newPtr((void *) Result,3, memenv);;
+ wxFont * Result = new wxFont(This->GetItemFont(*item)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxFont");
break;
}
@@ -15424,7 +15461,7 @@ case wxListCtrl_GetItemPosition: { // wxListCtrl::GetItemPosition
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetItemPosition((long) *item,pos);
+ bool Result = This->GetItemPosition(*item,pos);
rt.addBool(Result);
rt.add(pos);
rt.addTupleCount(2);
@@ -15441,7 +15478,7 @@ case wxListCtrl_GetItemRect: { // wxListCtrl::GetItemRect
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->GetItemRect((long) *item,rect,code);
+ bool Result = This->GetItemRect(*item,rect,code);
rt.addBool(Result);
rt.add(rect);
rt.addTupleCount(2);
@@ -15459,7 +15496,7 @@ case wxListCtrl_GetItemState: { // wxListCtrl::GetItemState
int * item = (int *) bp; bp += 4;
int * stateMask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetItemState((long) *item,(long) *stateMask);
+ int Result = This->GetItemState(*item,*stateMask);
rt.addInt(Result);
break;
}
@@ -15467,7 +15504,7 @@ case wxListCtrl_GetItemText: { // wxListCtrl::GetItemText
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetItemText((long) *item);
+ wxString Result = This->GetItemText(*item);
rt.add(Result);
break;
}
@@ -15475,7 +15512,7 @@ case wxListCtrl_GetItemTextColour: { // wxListCtrl::GetItemTextColour
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour Result = This->GetItemTextColour((long) *item);
+ wxColour Result = This->GetItemTextColour(*item);
rt.add(Result);
break;
}
@@ -15493,7 +15530,7 @@ case wxListCtrl_GetNextItem: { // wxListCtrl::GetNextItem
} break;
}};
if(!This) throw wxe_badarg(0);
- long Result = This->GetNextItem((long) *item,geometry,state);
+ long Result = This->GetNextItem(*item,geometry,state);
rt.addInt(Result);
break;
}
@@ -15541,7 +15578,7 @@ case wxListCtrl_InsertColumn_2: { // wxListCtrl::InsertColumn
int * col = (int *) bp; bp += 4;
wxListItem *info = (wxListItem *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- long Result = This->InsertColumn((long) *col,*info);
+ long Result = This->InsertColumn(*col,*info);
rt.addInt(Result);
break;
}
@@ -15562,7 +15599,7 @@ case wxListCtrl_InsertColumn_3: { // wxListCtrl::InsertColumn
} break;
}};
if(!This) throw wxe_badarg(0);
- long Result = This->InsertColumn((long) *col,heading,format,width);
+ long Result = This->InsertColumn(*col,heading,format,width);
rt.addInt(Result);
break;
}
@@ -15581,7 +15618,7 @@ case wxListCtrl_InsertItem_2_1: { // wxListCtrl::InsertItem
wxString label = wxString(bp, wxConvUTF8);
bp += *labelLen+((8-((4+ *labelLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- long Result = This->InsertItem((long) *index,label);
+ long Result = This->InsertItem(*index,label);
rt.addInt(Result);
break;
}
@@ -15590,7 +15627,7 @@ case wxListCtrl_InsertItem_2_0: { // wxListCtrl::InsertItem
int * index = (int *) bp; bp += 4;
int * imageIndex = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- long Result = This->InsertItem((long) *index,(int) *imageIndex);
+ long Result = This->InsertItem(*index,*imageIndex);
rt.addInt(Result);
break;
}
@@ -15602,7 +15639,7 @@ case wxListCtrl_InsertItem_3: { // wxListCtrl::InsertItem
bp += *labelLen+((8-((4+ *labelLen) & 7)) & 7);
int * imageIndex = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- long Result = This->InsertItem((long) *index,label,(int) *imageIndex);
+ long Result = This->InsertItem(*index,label,*imageIndex);
rt.addInt(Result);
break;
}
@@ -15610,7 +15647,7 @@ case wxListCtrl_RefreshItem: { // wxListCtrl::RefreshItem
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->RefreshItem((long) *item);
+ This->RefreshItem(*item);
break;
}
case wxListCtrl_RefreshItems: { // wxListCtrl::RefreshItems
@@ -15618,7 +15655,7 @@ case wxListCtrl_RefreshItems: { // wxListCtrl::RefreshItems
int * itemFrom = (int *) bp; bp += 4;
int * itemTo = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->RefreshItems((long) *itemFrom,(long) *itemTo);
+ This->RefreshItems(*itemFrom,*itemTo);
break;
}
case wxListCtrl_ScrollList: { // wxListCtrl::ScrollList
@@ -15626,7 +15663,7 @@ case wxListCtrl_ScrollList: { // wxListCtrl::ScrollList
int * dx = (int *) bp; bp += 4;
int * dy = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->ScrollList((int) *dx,(int) *dy);
+ bool Result = This->ScrollList(*dx,*dy);
rt.addBool(Result);
break;
}
@@ -15647,7 +15684,7 @@ case wxListCtrl_SetColumn: { // wxListCtrl::SetColumn
int * col = (int *) bp; bp += 4;
wxListItem *item = (wxListItem *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetColumn((int) *col,*item);
+ bool Result = This->SetColumn(*col,*item);
rt.addBool(Result);
break;
}
@@ -15656,7 +15693,7 @@ case wxListCtrl_SetColumnWidth: { // wxListCtrl::SetColumnWidth
int * col = (int *) bp; bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetColumnWidth((int) *col,(int) *width);
+ bool Result = This->SetColumnWidth(*col,*width);
rt.addBool(Result);
break;
}
@@ -15665,7 +15702,7 @@ case wxListCtrl_SetImageList: { // wxListCtrl::SetImageList
wxImageList *imageList = (wxImageList *) getPtr(bp,memenv); bp += 4;
int * which = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetImageList(imageList,(int) *which);
+ This->SetImageList(imageList,*which);
break;
}
case wxListCtrl_SetItem_1: { // wxListCtrl::SetItem
@@ -15690,7 +15727,7 @@ case wxListCtrl_SetItem_4: { // wxListCtrl::SetItem
} break;
}};
if(!This) throw wxe_badarg(0);
- long Result = This->SetItem((long) *index,(int) *col,label,imageId);
+ long Result = This->SetItem(*index,*col,label,imageId);
rt.addInt(Result);
break;
}
@@ -15703,14 +15740,14 @@ case wxListCtrl_SetItemBackgroundColour: { // wxListCtrl::SetItemBackgroundColou
int * colA = (int *) bp; bp += 4;
wxColour col = wxColour(*colR,*colG,*colB,*colA);
if(!This) throw wxe_badarg(0);
- This->SetItemBackgroundColour((long) *item,col);
+ This->SetItemBackgroundColour(*item,col);
break;
}
case wxListCtrl_SetItemCount: { // wxListCtrl::SetItemCount
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * count = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetItemCount((long) *count);
+ This->SetItemCount(*count);
break;
}
case wxListCtrl_SetItemData: { // wxListCtrl::SetItemData
@@ -15718,7 +15755,7 @@ case wxListCtrl_SetItemData: { // wxListCtrl::SetItemData
int * item = (int *) bp; bp += 4;
int * data = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemData((long) *item,(long) *data);
+ bool Result = This->SetItemData(*item,*data);
rt.addBool(Result);
break;
}
@@ -15727,7 +15764,7 @@ case wxListCtrl_SetItemFont: { // wxListCtrl::SetItemFont
int * item = (int *) bp; bp += 4;
wxFont *f = (wxFont *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetItemFont((long) *item,*f);
+ This->SetItemFont(*item,*f);
break;
}
case wxListCtrl_SetItemImage: { // wxListCtrl::SetItemImage
@@ -15742,7 +15779,7 @@ case wxListCtrl_SetItemImage: { // wxListCtrl::SetItemImage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemImage((long) *item,(int) *image,selImage);
+ bool Result = This->SetItemImage(*item,*image,selImage);
rt.addBool(Result);
break;
}
@@ -15752,7 +15789,7 @@ case wxListCtrl_SetItemColumnImage: { // wxListCtrl::SetItemColumnImage
int * column = (int *) bp; bp += 4;
int * image = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemColumnImage((long) *item,(long) *column,(int) *image);
+ bool Result = This->SetItemColumnImage(*item,*column,*image);
rt.addBool(Result);
break;
}
@@ -15763,7 +15800,7 @@ case wxListCtrl_SetItemPosition: { // wxListCtrl::SetItemPosition
int * posY = (int *) bp; bp += 4;
wxPoint pos = wxPoint(*posX,*posY);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemPosition((long) *item,pos);
+ bool Result = This->SetItemPosition(*item,pos);
rt.addBool(Result);
break;
}
@@ -15773,7 +15810,7 @@ case wxListCtrl_SetItemState: { // wxListCtrl::SetItemState
int * state = (int *) bp; bp += 4;
int * stateMask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetItemState((long) *item,(long) *state,(long) *stateMask);
+ bool Result = This->SetItemState(*item,*state,*stateMask);
rt.addBool(Result);
break;
}
@@ -15784,7 +15821,7 @@ case wxListCtrl_SetItemText: { // wxListCtrl::SetItemText
wxString str = wxString(bp, wxConvUTF8);
bp += *strLen+((8-((4+ *strLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetItemText((long) *item,str);
+ This->SetItemText(*item,str);
break;
}
case wxListCtrl_SetItemTextColour: { // wxListCtrl::SetItemTextColour
@@ -15796,7 +15833,7 @@ case wxListCtrl_SetItemTextColour: { // wxListCtrl::SetItemTextColour
int * colA = (int *) bp; bp += 4;
wxColour col = wxColour(*colR,*colG,*colB,*colA);
if(!This) throw wxe_badarg(0);
- This->SetItemTextColour((long) *item,col);
+ This->SetItemTextColour(*item,col);
break;
}
case wxListCtrl_SetSingleStyle: { // wxListCtrl::SetSingleStyle
@@ -15809,7 +15846,7 @@ case wxListCtrl_SetSingleStyle: { // wxListCtrl::SetSingleStyle
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetSingleStyle((long) *style,add);
+ This->SetSingleStyle(*style,add);
break;
}
case wxListCtrl_SetTextColour: { // wxListCtrl::SetTextColour
@@ -15827,7 +15864,7 @@ case wxListCtrl_SetWindowStyleFlag: { // wxListCtrl::SetWindowStyleFlag
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWindowStyleFlag((long) *style);
+ This->SetWindowStyleFlag(*style);
break;
}
@@ -15857,14 +15894,14 @@ case wxListView_ClearColumnImage: { // wxListView::ClearColumnImage
wxListView *This = (wxListView *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ClearColumnImage((int) *col);
+ This->ClearColumnImage(*col);
break;
}
case wxListView_Focus: { // wxListView::Focus
wxListView *This = (wxListView *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Focus((long) *index);
+ This->Focus(*index);
break;
}
case wxListView_GetFirstSelected: { // wxListView::GetFirstSelected
@@ -15885,7 +15922,7 @@ case wxListView_GetNextSelected: { // wxListView::GetNextSelected
wxListView *This = (wxListView *) getPtr(bp,memenv); bp += 4;
int * item = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- long Result = This->GetNextSelected((long) *item);
+ long Result = This->GetNextSelected(*item);
rt.addInt(Result);
break;
}
@@ -15893,7 +15930,7 @@ case wxListView_IsSelected: { // wxListView::IsSelected
wxListView *This = (wxListView *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsSelected((long) *index);
+ bool Result = This->IsSelected(*index);
rt.addBool(Result);
break;
}
@@ -15907,7 +15944,7 @@ case wxListView_Select: { // wxListView::Select
} break;
}};
if(!This) throw wxe_badarg(0);
- This->Select((long) *n,on);
+ This->Select(*n,on);
break;
}
case wxListView_SetColumnImage: { // wxListView::SetColumnImage
@@ -15915,7 +15952,7 @@ case wxListView_SetColumnImage: { // wxListView::SetColumnImage
int * col = (int *) bp; bp += 4;
int * image = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColumnImage((int) *col,(int) *image);
+ This->SetColumnImage(*col,*image);
break;
}
case wxListItem_new_0: { // wxListItem::wxListItem
@@ -16018,7 +16055,7 @@ case wxListItem_SetAlign: { // wxListItem::SetAlign
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
wxListColumnFormat align = *(wxListColumnFormat *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetAlign((wxListColumnFormat) align);
+ This->SetAlign(align);
break;
}
case wxListItem_SetBackgroundColour: { // wxListItem::SetBackgroundColour
@@ -16036,7 +16073,7 @@ case wxListItem_SetColumn: { // wxListItem::SetColumn
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * col = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColumn((int) *col);
+ This->SetColumn(*col);
break;
}
case wxListItem_SetFont: { // wxListItem::SetFont
@@ -16050,35 +16087,35 @@ case wxListItem_SetId: { // wxListItem::SetId
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * id = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetId((long) *id);
+ This->SetId(*id);
break;
}
case wxListItem_SetImage: { // wxListItem::SetImage
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * image = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetImage((int) *image);
+ This->SetImage(*image);
break;
}
case wxListItem_SetMask: { // wxListItem::SetMask
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * mask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMask((long) *mask);
+ This->SetMask(*mask);
break;
}
case wxListItem_SetState: { // wxListItem::SetState
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * state = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetState((long) *state);
+ This->SetState(*state);
break;
}
case wxListItem_SetStateMask: { // wxListItem::SetStateMask
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * stateMask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStateMask((long) *stateMask);
+ This->SetStateMask(*stateMask);
break;
}
case wxListItem_SetText: { // wxListItem::SetText
@@ -16105,7 +16142,7 @@ case wxListItem_SetWidth: { // wxListItem::SetWidth
wxListItem *This = (wxListItem *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWidth((int) *width);
+ This->SetWidth(*width);
break;
}
case wxListItemAttr_new_0: { // wxListItemAttr::wxListItemAttr
@@ -16227,7 +16264,7 @@ case wxImageList_new_3: { // wxImageList::wxImageList
initialCount = (int)*(int *) bp; bp += 4;
} break;
}};
- wxImageList * Result = new EwxImageList((int) *width,(int) *height,mask,initialCount);
+ wxImageList * Result = new EwxImageList(*width,*height,mask,initialCount);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxImageList");
break;
@@ -16278,7 +16315,7 @@ case wxImageList_Create: { // wxImageList::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create((int) *width,(int) *height,mask,initialCount);
+ bool Result = This->Create(*width,*height,mask,initialCount);
rt.addBool(Result);
break;
}
@@ -16300,7 +16337,7 @@ case wxImageList_Draw: { // wxImageList::Draw
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Draw((int) *index,*dc,(int) *x,(int) *y,flags,solidBackground);
+ bool Result = This->Draw(*index,*dc,*x,*y,flags,solidBackground);
rt.addBool(Result);
break;
}
@@ -16308,7 +16345,7 @@ case wxImageList_GetBitmap: { // wxImageList::GetBitmap
wxImageList *This = (wxImageList *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxBitmap * Result = new wxBitmap(This->GetBitmap((int) *index)); newPtr((void *) Result,3, memenv);;
+ wxBitmap * Result = new wxBitmap(This->GetBitmap(*index)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
}
@@ -16316,7 +16353,7 @@ case wxImageList_GetIcon: { // wxImageList::GetIcon
wxImageList *This = (wxImageList *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxIcon * Result = new wxIcon(This->GetIcon((int) *index)); newPtr((void *) Result,3, memenv);;
+ wxIcon * Result = new wxIcon(This->GetIcon(*index)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxIcon");
break;
}
@@ -16333,7 +16370,7 @@ case wxImageList_GetSize: { // wxImageList::GetSize
wxImageList *This = (wxImageList *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetSize((int) *index,width,height);
+ bool Result = This->GetSize(*index,width,height);
rt.addBool(Result);
rt.addInt(width);
rt.addInt(height);
@@ -16344,7 +16381,7 @@ case wxImageList_Remove: { // wxImageList::Remove
wxImageList *This = (wxImageList *) getPtr(bp,memenv); bp += 4;
int * index = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Remove((int) *index);
+ bool Result = This->Remove(*index);
rt.addBool(Result);
break;
}
@@ -16360,7 +16397,7 @@ case wxImageList_Replace_2: { // wxImageList::Replace
int * index = (int *) bp; bp += 4;
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Replace((int) *index,*bitmap);
+ bool Result = This->Replace(*index,*bitmap);
rt.addBool(Result);
break;
}
@@ -16370,7 +16407,7 @@ case wxImageList_Replace_3: { // wxImageList::Replace
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
wxBitmap *mask = (wxBitmap *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Replace((int) *index,*bitmap,*mask);
+ bool Result = This->Replace(*index,*bitmap,*mask);
rt.addBool(Result);
break;
}
@@ -16405,7 +16442,7 @@ font = (wxFont *) getPtr(bp,memenv); bp += 4;
alignment = *(wxTextAttrAlignment *) bp; bp += 4;;
} break;
}};
- wxTextAttr * Result = new wxTextAttr(colText,colBack,*font,(wxTextAttrAlignment) alignment);
+ wxTextAttr * Result = new wxTextAttr(colText,colBack,*font,alignment);
newPtr((void *) Result, 103, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTextAttr");
break;
@@ -16427,7 +16464,7 @@ case wxTextAttr_GetBackgroundColour: { // wxTextAttr::GetBackgroundColour
case wxTextAttr_GetFont: { // wxTextAttr::GetFont
wxTextAttr *This = (wxTextAttr *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- const wxFont * Result = &This->GetFont();
+ const wxFont * Result = new wxFont(This->GetFont()); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxFont");
break;
}
@@ -16505,7 +16542,7 @@ case wxTextAttr_SetAlignment: { // wxTextAttr::SetAlignment
wxTextAttr *This = (wxTextAttr *) getPtr(bp,memenv); bp += 4;
wxTextAttrAlignment alignment = *(wxTextAttrAlignment *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetAlignment((wxTextAttrAlignment) alignment);
+ This->SetAlignment(alignment);
break;
}
case wxTextAttr_SetBackgroundColour: { // wxTextAttr::SetBackgroundColour
@@ -16523,7 +16560,7 @@ case wxTextAttr_SetFlags: { // wxTextAttr::SetFlags
wxTextAttr *This = (wxTextAttr *) getPtr(bp,memenv); bp += 4;
int * flags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFlags((long) *flags);
+ This->SetFlags(*flags);
break;
}
case wxTextAttr_SetFont: { // wxTextAttr::SetFont
@@ -16549,14 +16586,14 @@ case wxTextAttr_SetLeftIndent: { // wxTextAttr::SetLeftIndent
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetLeftIndent((int) *indent,subIndent);
+ This->SetLeftIndent(*indent,subIndent);
break;
}
case wxTextAttr_SetRightIndent: { // wxTextAttr::SetRightIndent
wxTextAttr *This = (wxTextAttr *) getPtr(bp,memenv); bp += 4;
int * indent = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRightIndent((int) *indent);
+ This->SetRightIndent(*indent);
break;
}
case wxTextAttr_SetTabs: { // wxTextAttr::SetTabs
@@ -16619,7 +16656,7 @@ case wxTextCtrl_new_3: { // wxTextCtrl::wxTextCtrl
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxTextCtrl * Result = new EwxTextCtrl(parent,(wxWindowID) *id,value,pos,size,style,*validator);
+ wxTextCtrl * Result = new EwxTextCtrl(parent,*id,value,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTextCtrl");
break;
@@ -16722,7 +16759,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,value,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,value,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -16771,7 +16808,7 @@ case wxTextCtrl_GetLineLength: { // wxTextCtrl::GetLineLength
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
int * lineNo = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetLineLength((long) *lineNo);
+ int Result = This->GetLineLength(*lineNo);
rt.addInt(Result);
break;
}
@@ -16779,7 +16816,7 @@ case wxTextCtrl_GetLineText: { // wxTextCtrl::GetLineText
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
int * lineNo = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetLineText((long) *lineNo);
+ wxString Result = This->GetLineText(*lineNo);
rt.add(Result);
break;
}
@@ -16795,7 +16832,7 @@ case wxTextCtrl_GetRange: { // wxTextCtrl::GetRange
int * from = (int *) bp; bp += 4;
int * to = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetRange((long) *from,(long) *to);
+ wxString Result = This->GetRange(*from,*to);
rt.add(Result);
break;
}
@@ -16822,7 +16859,7 @@ case wxTextCtrl_GetStyle: { // wxTextCtrl::GetStyle
int * position = (int *) bp; bp += 4;
wxTextAttr *style = (wxTextAttr *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetStyle((long) *position,*style);
+ bool Result = This->GetStyle(*position,*style);
rt.addBool(Result);
break;
}
@@ -16895,7 +16932,7 @@ case wxTextCtrl_PositionToXY: { // wxTextCtrl::PositionToXY
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->PositionToXY((long) *pos,&x,&y);
+ bool Result = This->PositionToXY(*pos,&x,&y);
rt.addBool(Result);
rt.addInt(x);
rt.addInt(y);
@@ -16913,7 +16950,7 @@ case wxTextCtrl_Remove: { // wxTextCtrl::Remove
int * from = (int *) bp; bp += 4;
int * to = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Remove((long) *from,(long) *to);
+ This->Remove(*from,*to);
break;
}
case wxTextCtrl_Replace: { // wxTextCtrl::Replace
@@ -16924,7 +16961,7 @@ case wxTextCtrl_Replace: { // wxTextCtrl::Replace
wxString value = wxString(bp, wxConvUTF8);
bp += *valueLen+((8-((0+ *valueLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->Replace((long) *from,(long) *to,value);
+ This->Replace(*from,*to,value);
break;
}
case wxTextCtrl_SaveFile: { // wxTextCtrl::SaveFile
@@ -16959,14 +16996,14 @@ case wxTextCtrl_SetEditable: { // wxTextCtrl::SetEditable
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * editable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetEditable((bool) *editable);
+ This->SetEditable(*editable);
break;
}
case wxTextCtrl_SetInsertionPoint: { // wxTextCtrl::SetInsertionPoint
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetInsertionPoint((long) *pos);
+ This->SetInsertionPoint(*pos);
break;
}
case wxTextCtrl_SetInsertionPointEnd: { // wxTextCtrl::SetInsertionPointEnd
@@ -16979,7 +17016,7 @@ case wxTextCtrl_SetMaxLength: { // wxTextCtrl::SetMaxLength
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
unsigned int * len = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMaxLength((long) *len);
+ This->SetMaxLength(*len);
break;
}
case wxTextCtrl_SetSelection: { // wxTextCtrl::SetSelection
@@ -16987,7 +17024,7 @@ case wxTextCtrl_SetSelection: { // wxTextCtrl::SetSelection
int * from = (int *) bp; bp += 4;
int * to = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((long) *from,(long) *to);
+ This->SetSelection(*from,*to);
break;
}
case wxTextCtrl_SetStyle: { // wxTextCtrl::SetStyle
@@ -16996,7 +17033,7 @@ case wxTextCtrl_SetStyle: { // wxTextCtrl::SetStyle
int * end = (int *) bp; bp += 4;
wxTextAttr *style = (wxTextAttr *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetStyle((long) *start,(long) *end,*style);
+ bool Result = This->SetStyle(*start,*end,*style);
rt.addBool(Result);
break;
}
@@ -17013,7 +17050,7 @@ case wxTextCtrl_ShowPosition: { // wxTextCtrl::ShowPosition
wxTextCtrl *This = (wxTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ShowPosition((long) *pos);
+ This->ShowPosition(*pos);
break;
}
case wxTextCtrl_Undo: { // wxTextCtrl::Undo
@@ -17036,7 +17073,7 @@ case wxTextCtrl_XYToPosition: { // wxTextCtrl::XYToPosition
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- long Result = This->XYToPosition((long) *x,(long) *y);
+ long Result = This->XYToPosition(*x,*y);
rt.addInt(Result);
break;
}
@@ -17069,7 +17106,7 @@ case wxNotebook_new_3: { // wxNotebook::wxNotebook
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxNotebook * Result = new EwxNotebook(parent,(wxWindowID) *winid,pos,size,style);
+ wxNotebook * Result = new EwxNotebook(parent,*winid,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxNotebook");
break;
@@ -17141,7 +17178,7 @@ case wxNotebook_Create: { // wxNotebook::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,style);
+ bool Result = This->Create(parent,*id,pos,size,style);
rt.addBool(Result);
break;
}
@@ -17156,7 +17193,7 @@ case wxNotebook_DeletePage: { // wxNotebook::DeletePage
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * nPage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeletePage((size_t) *nPage);
+ bool Result = This->DeletePage(*nPage);
rt.addBool(Result);
break;
}
@@ -17164,7 +17201,7 @@ case wxNotebook_RemovePage: { // wxNotebook::RemovePage
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * nPage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RemovePage((size_t) *nPage);
+ bool Result = This->RemovePage(*nPage);
rt.addBool(Result);
break;
}
@@ -17186,7 +17223,7 @@ case wxNotebook_GetPage: { // wxNotebook::GetPage
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->GetPage((size_t) *n);
+ wxWindow * Result = (wxWindow*)This->GetPage(*n);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -17201,7 +17238,7 @@ case wxNotebook_GetPageImage: { // wxNotebook::GetPageImage
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * nPage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetPageImage((size_t) *nPage);
+ int Result = This->GetPageImage(*nPage);
rt.addInt(Result);
break;
}
@@ -17209,7 +17246,7 @@ case wxNotebook_GetPageText: { // wxNotebook::GetPageText
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * nPage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetPageText((size_t) *nPage);
+ wxString Result = This->GetPageText(*nPage);
rt.add(Result);
break;
}
@@ -17265,7 +17302,7 @@ case wxNotebook_InsertPage: { // wxNotebook::InsertPage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertPage((size_t) *position,win,strText,bSelect,imageId);
+ bool Result = This->InsertPage(*position,win,strText,bSelect,imageId);
rt.addBool(Result);
break;
}
@@ -17299,7 +17336,7 @@ case wxNotebook_SetPageImage: { // wxNotebook::SetPageImage
int * nPage = (int *) bp; bp += 4;
int * nImage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageImage((size_t) *nPage,(int) *nImage);
+ bool Result = This->SetPageImage(*nPage,*nImage);
rt.addBool(Result);
break;
}
@@ -17310,7 +17347,7 @@ case wxNotebook_SetPageText: { // wxNotebook::SetPageText
wxString strText = wxString(bp, wxConvUTF8);
bp += *strTextLen+((8-((4+ *strTextLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageText((size_t) *nPage,strText);
+ bool Result = This->SetPageText(*nPage,strText);
rt.addBool(Result);
break;
}
@@ -17318,7 +17355,7 @@ case wxNotebook_SetSelection: { // wxNotebook::SetSelection
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * nPage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->SetSelection((size_t) *nPage);
+ int Result = This->SetSelection(*nPage);
rt.addInt(Result);
break;
}
@@ -17326,7 +17363,7 @@ case wxNotebook_ChangeSelection: { // wxNotebook::ChangeSelection
wxNotebook *This = (wxNotebook *) getPtr(bp,memenv); bp += 4;
int * nPage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->ChangeSelection((size_t) *nPage);
+ int Result = This->ChangeSelection(*nPage);
rt.addInt(Result);
break;
}
@@ -17359,7 +17396,7 @@ case wxChoicebook_new_3: { // wxChoicebook::wxChoicebook
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxChoicebook * Result = new EwxChoicebook(parent,(wxWindowID) *id,pos,size,style);
+ wxChoicebook * Result = new EwxChoicebook(parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxChoicebook");
break;
@@ -17431,7 +17468,7 @@ case wxChoicebook_Create: { // wxChoicebook::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,style);
+ bool Result = This->Create(parent,*id,pos,size,style);
rt.addBool(Result);
break;
}
@@ -17446,7 +17483,7 @@ case wxChoicebook_DeletePage: { // wxChoicebook::DeletePage
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeletePage((size_t) *n);
+ bool Result = This->DeletePage(*n);
rt.addBool(Result);
break;
}
@@ -17454,7 +17491,7 @@ case wxChoicebook_RemovePage: { // wxChoicebook::RemovePage
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RemovePage((size_t) *n);
+ bool Result = This->RemovePage(*n);
rt.addBool(Result);
break;
}
@@ -17476,7 +17513,7 @@ case wxChoicebook_GetPage: { // wxChoicebook::GetPage
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->GetPage((size_t) *n);
+ wxWindow * Result = (wxWindow*)This->GetPage(*n);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -17491,7 +17528,7 @@ case wxChoicebook_GetPageImage: { // wxChoicebook::GetPageImage
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetPageImage((size_t) *n);
+ int Result = This->GetPageImage(*n);
rt.addInt(Result);
break;
}
@@ -17499,7 +17536,7 @@ case wxChoicebook_GetPageText: { // wxChoicebook::GetPageText
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetPageText((size_t) *n);
+ wxString Result = This->GetPageText(*n);
rt.add(Result);
break;
}
@@ -17541,7 +17578,7 @@ case wxChoicebook_InsertPage: { // wxChoicebook::InsertPage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertPage((size_t) *n,page,text,bSelect,imageId);
+ bool Result = This->InsertPage(*n,page,text,bSelect,imageId);
rt.addBool(Result);
break;
}
@@ -17566,7 +17603,7 @@ case wxChoicebook_SetPageImage: { // wxChoicebook::SetPageImage
int * n = (int *) bp; bp += 4;
int * imageId = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageImage((size_t) *n,(int) *imageId);
+ bool Result = This->SetPageImage(*n,*imageId);
rt.addBool(Result);
break;
}
@@ -17577,7 +17614,7 @@ case wxChoicebook_SetPageText: { // wxChoicebook::SetPageText
wxString strText = wxString(bp, wxConvUTF8);
bp += *strTextLen+((8-((4+ *strTextLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageText((size_t) *n,strText);
+ bool Result = This->SetPageText(*n,strText);
rt.addBool(Result);
break;
}
@@ -17585,7 +17622,7 @@ case wxChoicebook_SetSelection: { // wxChoicebook::SetSelection
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->SetSelection((size_t) *n);
+ int Result = This->SetSelection(*n);
rt.addInt(Result);
break;
}
@@ -17593,7 +17630,7 @@ case wxChoicebook_ChangeSelection: { // wxChoicebook::ChangeSelection
wxChoicebook *This = (wxChoicebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->ChangeSelection((size_t) *n);
+ int Result = This->ChangeSelection(*n);
rt.addInt(Result);
break;
}
@@ -17626,7 +17663,7 @@ case wxToolbook_new_3: { // wxToolbook::wxToolbook
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxToolbook * Result = new EwxToolbook(parent,(wxWindowID) *id,pos,size,style);
+ wxToolbook * Result = new EwxToolbook(parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxToolbook");
break;
@@ -17698,7 +17735,7 @@ case wxToolbook_Create: { // wxToolbook::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,style);
+ bool Result = This->Create(parent,*id,pos,size,style);
rt.addBool(Result);
break;
}
@@ -17713,7 +17750,7 @@ case wxToolbook_DeletePage: { // wxToolbook::DeletePage
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeletePage((size_t) *n);
+ bool Result = This->DeletePage(*n);
rt.addBool(Result);
break;
}
@@ -17721,7 +17758,7 @@ case wxToolbook_RemovePage: { // wxToolbook::RemovePage
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RemovePage((size_t) *n);
+ bool Result = This->RemovePage(*n);
rt.addBool(Result);
break;
}
@@ -17743,7 +17780,7 @@ case wxToolbook_GetPage: { // wxToolbook::GetPage
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->GetPage((size_t) *n);
+ wxWindow * Result = (wxWindow*)This->GetPage(*n);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -17758,7 +17795,7 @@ case wxToolbook_GetPageImage: { // wxToolbook::GetPageImage
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetPageImage((size_t) *n);
+ int Result = This->GetPageImage(*n);
rt.addInt(Result);
break;
}
@@ -17766,7 +17803,7 @@ case wxToolbook_GetPageText: { // wxToolbook::GetPageText
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetPageText((size_t) *n);
+ wxString Result = This->GetPageText(*n);
rt.add(Result);
break;
}
@@ -17808,7 +17845,7 @@ case wxToolbook_InsertPage: { // wxToolbook::InsertPage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertPage((size_t) *n,page,text,bSelect,imageId);
+ bool Result = This->InsertPage(*n,page,text,bSelect,imageId);
rt.addBool(Result);
break;
}
@@ -17833,7 +17870,7 @@ case wxToolbook_SetPageImage: { // wxToolbook::SetPageImage
int * n = (int *) bp; bp += 4;
int * imageId = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageImage((size_t) *n,(int) *imageId);
+ bool Result = This->SetPageImage(*n,*imageId);
rt.addBool(Result);
break;
}
@@ -17844,7 +17881,7 @@ case wxToolbook_SetPageText: { // wxToolbook::SetPageText
wxString strText = wxString(bp, wxConvUTF8);
bp += *strTextLen+((8-((4+ *strTextLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageText((size_t) *n,strText);
+ bool Result = This->SetPageText(*n,strText);
rt.addBool(Result);
break;
}
@@ -17852,7 +17889,7 @@ case wxToolbook_SetSelection: { // wxToolbook::SetSelection
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->SetSelection((size_t) *n);
+ int Result = This->SetSelection(*n);
rt.addInt(Result);
break;
}
@@ -17860,7 +17897,7 @@ case wxToolbook_ChangeSelection: { // wxToolbook::ChangeSelection
wxToolbook *This = (wxToolbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->ChangeSelection((size_t) *n);
+ int Result = This->ChangeSelection(*n);
rt.addInt(Result);
break;
}
@@ -17893,7 +17930,7 @@ case wxListbook_new_3: { // wxListbook::wxListbook
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxListbook * Result = new EwxListbook(parent,(wxWindowID) *id,pos,size,style);
+ wxListbook * Result = new EwxListbook(parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxListbook");
break;
@@ -17965,7 +18002,7 @@ case wxListbook_Create: { // wxListbook::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,style);
+ bool Result = This->Create(parent,*id,pos,size,style);
rt.addBool(Result);
break;
}
@@ -17980,7 +18017,7 @@ case wxListbook_DeletePage: { // wxListbook::DeletePage
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeletePage((size_t) *n);
+ bool Result = This->DeletePage(*n);
rt.addBool(Result);
break;
}
@@ -17988,7 +18025,7 @@ case wxListbook_RemovePage: { // wxListbook::RemovePage
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RemovePage((size_t) *n);
+ bool Result = This->RemovePage(*n);
rt.addBool(Result);
break;
}
@@ -18010,7 +18047,7 @@ case wxListbook_GetPage: { // wxListbook::GetPage
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->GetPage((size_t) *n);
+ wxWindow * Result = (wxWindow*)This->GetPage(*n);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -18025,7 +18062,7 @@ case wxListbook_GetPageImage: { // wxListbook::GetPageImage
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetPageImage((size_t) *n);
+ int Result = This->GetPageImage(*n);
rt.addInt(Result);
break;
}
@@ -18033,7 +18070,7 @@ case wxListbook_GetPageText: { // wxListbook::GetPageText
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetPageText((size_t) *n);
+ wxString Result = This->GetPageText(*n);
rt.add(Result);
break;
}
@@ -18075,7 +18112,7 @@ case wxListbook_InsertPage: { // wxListbook::InsertPage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertPage((size_t) *n,page,text,bSelect,imageId);
+ bool Result = This->InsertPage(*n,page,text,bSelect,imageId);
rt.addBool(Result);
break;
}
@@ -18100,7 +18137,7 @@ case wxListbook_SetPageImage: { // wxListbook::SetPageImage
int * n = (int *) bp; bp += 4;
int * imageId = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageImage((size_t) *n,(int) *imageId);
+ bool Result = This->SetPageImage(*n,*imageId);
rt.addBool(Result);
break;
}
@@ -18111,7 +18148,7 @@ case wxListbook_SetPageText: { // wxListbook::SetPageText
wxString strText = wxString(bp, wxConvUTF8);
bp += *strTextLen+((8-((4+ *strTextLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageText((size_t) *n,strText);
+ bool Result = This->SetPageText(*n,strText);
rt.addBool(Result);
break;
}
@@ -18119,7 +18156,7 @@ case wxListbook_SetSelection: { // wxListbook::SetSelection
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->SetSelection((size_t) *n);
+ int Result = This->SetSelection(*n);
rt.addInt(Result);
break;
}
@@ -18127,7 +18164,7 @@ case wxListbook_ChangeSelection: { // wxListbook::ChangeSelection
wxListbook *This = (wxListbook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->ChangeSelection((size_t) *n);
+ int Result = This->ChangeSelection(*n);
rt.addInt(Result);
break;
}
@@ -18160,7 +18197,7 @@ case wxTreebook_new_3: { // wxTreebook::wxTreebook
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxTreebook * Result = new EwxTreebook(parent,(wxWindowID) *id,pos,size,style);
+ wxTreebook * Result = new EwxTreebook(parent,*id,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTreebook");
break;
@@ -18232,7 +18269,7 @@ case wxTreebook_Create: { // wxTreebook::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,style);
+ bool Result = This->Create(parent,*id,pos,size,style);
rt.addBool(Result);
break;
}
@@ -18247,7 +18284,7 @@ case wxTreebook_DeletePage: { // wxTreebook::DeletePage
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeletePage((size_t) *pos);
+ bool Result = This->DeletePage(*pos);
rt.addBool(Result);
break;
}
@@ -18255,7 +18292,7 @@ case wxTreebook_RemovePage: { // wxTreebook::RemovePage
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RemovePage((size_t) *n);
+ bool Result = This->RemovePage(*n);
rt.addBool(Result);
break;
}
@@ -18277,7 +18314,7 @@ case wxTreebook_GetPage: { // wxTreebook::GetPage
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->GetPage((size_t) *n);
+ wxWindow * Result = (wxWindow*)This->GetPage(*n);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -18292,7 +18329,7 @@ case wxTreebook_GetPageImage: { // wxTreebook::GetPageImage
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetPageImage((size_t) *n);
+ int Result = This->GetPageImage(*n);
rt.addInt(Result);
break;
}
@@ -18300,7 +18337,7 @@ case wxTreebook_GetPageText: { // wxTreebook::GetPageText
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetPageText((size_t) *n);
+ wxString Result = This->GetPageText(*n);
rt.add(Result);
break;
}
@@ -18321,7 +18358,7 @@ case wxTreebook_ExpandNode: { // wxTreebook::ExpandNode
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->ExpandNode((size_t) *pos,expand);
+ bool Result = This->ExpandNode(*pos,expand);
rt.addBool(Result);
break;
}
@@ -18329,7 +18366,7 @@ case wxTreebook_IsNodeExpanded: { // wxTreebook::IsNodeExpanded
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsNodeExpanded((size_t) *pos);
+ bool Result = This->IsNodeExpanded(*pos);
rt.addBool(Result);
break;
}
@@ -18364,7 +18401,7 @@ case wxTreebook_InsertPage: { // wxTreebook::InsertPage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertPage((size_t) *pos,page,text,bSelect,imageId);
+ bool Result = This->InsertPage(*pos,page,text,bSelect,imageId);
rt.addBool(Result);
break;
}
@@ -18386,7 +18423,7 @@ case wxTreebook_InsertSubPage: { // wxTreebook::InsertSubPage
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertSubPage((size_t) *pos,page,text,bSelect,imageId);
+ bool Result = This->InsertSubPage(*pos,page,text,bSelect,imageId);
rt.addBool(Result);
break;
}
@@ -18411,7 +18448,7 @@ case wxTreebook_SetPageImage: { // wxTreebook::SetPageImage
int * n = (int *) bp; bp += 4;
int * imageId = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageImage((size_t) *n,(int) *imageId);
+ bool Result = This->SetPageImage(*n,*imageId);
rt.addBool(Result);
break;
}
@@ -18422,7 +18459,7 @@ case wxTreebook_SetPageText: { // wxTreebook::SetPageText
wxString strText = wxString(bp, wxConvUTF8);
bp += *strTextLen+((8-((4+ *strTextLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageText((size_t) *n,strText);
+ bool Result = This->SetPageText(*n,strText);
rt.addBool(Result);
break;
}
@@ -18430,7 +18467,7 @@ case wxTreebook_SetSelection: { // wxTreebook::SetSelection
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->SetSelection((size_t) *n);
+ int Result = This->SetSelection(*n);
rt.addInt(Result);
break;
}
@@ -18438,7 +18475,7 @@ case wxTreebook_ChangeSelection: { // wxTreebook::ChangeSelection
wxTreebook *This = (wxTreebook *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->ChangeSelection((size_t) *n);
+ int Result = This->ChangeSelection(*n);
rt.addInt(Result);
break;
}
@@ -18790,7 +18827,7 @@ which = *(wxTreeItemIcon *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- int Result = This->GetItemImage(item,(wxTreeItemIcon) which);
+ int Result = This->GetItemImage(item,which);
rt.addInt(Result);
break;
}
@@ -18933,7 +18970,7 @@ case wxTreeCtrl_InsertItem: { // wxTreeCtrl::InsertItem
} break;
}};
if(!This) throw wxe_badarg(0);
- wxTreeItemId Result = This->InsertItem(parent,(size_t) *pos,text,image,selImage,data);
+ wxTreeItemId Result = This->InsertItem(parent,*pos,text,image,selImage,data);
rt.add((wxUIntPtr *) Result.m_pItem);
break;
}
@@ -19043,7 +19080,7 @@ case wxTreeCtrl_SetIndent: { // wxTreeCtrl::SetIndent
wxTreeCtrl *This = (wxTreeCtrl *) getPtr(bp,memenv); bp += 4;
unsigned int * indent = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetIndent((int) *indent);
+ This->SetIndent(*indent);
break;
}
case wxTreeCtrl_SetImageList: { // wxTreeCtrl::SetImageList
@@ -19132,7 +19169,7 @@ case wxTreeCtrl_SetItemImage_2: { // wxTreeCtrl::SetItemImage
wxTreeItemId item = wxTreeItemId((void *) *(wxUint64 *) bp); bp += 8;
int * image = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetItemImage(item,(int) *image);
+ This->SetItemImage(item,*image);
break;
}
case wxTreeCtrl_SetItemImage_3: { // wxTreeCtrl::SetItemImage
@@ -19148,7 +19185,7 @@ which = *(wxTreeItemIcon *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetItemImage(item,(int) *image,(wxTreeItemIcon) which);
+ This->SetItemImage(item,*image,which);
break;
}
case wxTreeCtrl_SetItemText: { // wxTreeCtrl::SetItemText
@@ -19186,7 +19223,7 @@ case wxTreeCtrl_SetWindowStyle: { // wxTreeCtrl::SetWindowStyle
wxTreeCtrl *This = (wxTreeCtrl *) getPtr(bp,memenv); bp += 4;
const int * styles = (const int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWindowStyle((long) *styles);
+ This->SetWindowStyle(*styles);
break;
}
case wxTreeCtrl_SortChildren: { // wxTreeCtrl::SortChildren
@@ -19266,7 +19303,7 @@ case wxScrollBar_new_3: { // wxScrollBar::wxScrollBar
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxScrollBar * Result = new EwxScrollBar(parent,(wxWindowID) *id,pos,size,style,*validator);
+ wxScrollBar * Result = new EwxScrollBar(parent,*id,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxScrollBar");
break;
@@ -19301,7 +19338,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -19337,7 +19374,7 @@ case wxScrollBar_SetThumbPosition: { // wxScrollBar::SetThumbPosition
wxScrollBar *This = (wxScrollBar *) getPtr(bp,memenv); bp += 4;
int * viewStart = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetThumbPosition((int) *viewStart);
+ This->SetThumbPosition(*viewStart);
break;
}
case wxScrollBar_SetScrollbar: { // wxScrollBar::SetScrollbar
@@ -19354,7 +19391,7 @@ case wxScrollBar_SetScrollbar: { // wxScrollBar::SetScrollbar
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetScrollbar((int) *position,(int) *thumbSize,(int) *range,(int) *pageSize,refresh);
+ This->SetScrollbar(*position,*thumbSize,*range,*pageSize,refresh);
break;
}
case wxSpinButton_new_2: { // wxSpinButton::wxSpinButton
@@ -19453,14 +19490,14 @@ case wxSpinButton_SetRange: { // wxSpinButton::SetRange
int * minVal = (int *) bp; bp += 4;
int * maxVal = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRange((int) *minVal,(int) *maxVal);
+ This->SetRange(*minVal,*maxVal);
break;
}
case wxSpinButton_SetValue: { // wxSpinButton::SetValue
wxSpinButton *This = (wxSpinButton *) getPtr(bp,memenv); bp += 4;
int * value = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((int) *value);
+ This->SetValue(*value);
break;
}
case wxSpinCtrl_new_0: { // wxSpinCtrl::wxSpinCtrl
@@ -19582,7 +19619,7 @@ case wxSpinCtrl_SetValue_1_0: { // wxSpinCtrl::SetValue
wxSpinCtrl *This = (wxSpinCtrl *) getPtr(bp,memenv); bp += 4;
int * value = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((int) *value);
+ This->SetValue(*value);
break;
}
case wxSpinCtrl_GetValue: { // wxSpinCtrl::GetValue
@@ -19597,7 +19634,7 @@ case wxSpinCtrl_SetRange: { // wxSpinCtrl::SetRange
int * minVal = (int *) bp; bp += 4;
int * maxVal = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRange((int) *minVal,(int) *maxVal);
+ This->SetRange(*minVal,*maxVal);
break;
}
case wxSpinCtrl_SetSelection: { // wxSpinCtrl::SetSelection
@@ -19605,7 +19642,7 @@ case wxSpinCtrl_SetSelection: { // wxSpinCtrl::SetSelection
int * from = (int *) bp; bp += 4;
int * to = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((long) *from,(long) *to);
+ This->SetSelection(*from,*to);
break;
}
case wxSpinCtrl_GetMin: { // wxSpinCtrl::GetMin
@@ -19654,7 +19691,7 @@ case wxStaticText_new_4: { // wxStaticText::wxStaticText
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxStaticText * Result = new EwxStaticText(parent,(wxWindowID) *id,label,pos,size,style);
+ wxStaticText * Result = new EwxStaticText(parent,*id,label,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxStaticText");
break;
@@ -19687,7 +19724,7 @@ case wxStaticText_Create: { // wxStaticText::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,label,pos,size,style);
+ bool Result = This->Create(parent,*id,label,pos,size,style);
rt.addBool(Result);
break;
}
@@ -19711,7 +19748,7 @@ case wxStaticText_Wrap: { // wxStaticText::Wrap
wxStaticText *This = (wxStaticText *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Wrap((int) *width);
+ This->Wrap(*width);
break;
}
case wxStaticBitmap_new_0: { // wxStaticBitmap::wxStaticBitmap
@@ -19745,7 +19782,7 @@ case wxStaticBitmap_new_4: { // wxStaticBitmap::wxStaticBitmap
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxStaticBitmap * Result = new EwxStaticBitmap(parent,(wxWindowID) *id,*label,pos,size,style);
+ wxStaticBitmap * Result = new EwxStaticBitmap(parent,*id,*label,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxStaticBitmap");
break;
@@ -19776,7 +19813,7 @@ case wxStaticBitmap_Create: { // wxStaticBitmap::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,*label,pos,size,style);
+ bool Result = This->Create(parent,*id,*label,pos,size,style);
rt.addBool(Result);
break;
}
@@ -19830,7 +19867,7 @@ case wxRadioBox_new: { // wxRadioBox::wxRadioBox
val = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxRadioBox * Result = new EwxRadioBox(parent,(wxWindowID) *id,title,pos,size,choices,majorDim,style,*val);
+ wxRadioBox * Result = new EwxRadioBox(parent,*id,title,pos,size,choices,majorDim,style,*val);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxRadioBox");
break;
@@ -19873,7 +19910,7 @@ val = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,title,pos,size,choices,majorDim,style,*val);
+ bool Result = This->Create(parent,*id,title,pos,size,choices,majorDim,style,*val);
rt.addBool(Result);
break;
}
@@ -19887,7 +19924,7 @@ case wxRadioBox_Enable_2: { // wxRadioBox::Enable
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Enable((int) *n,enable);
+ bool Result = This->Enable(*n,enable);
rt.addBool(Result);
break;
}
@@ -19916,7 +19953,7 @@ case wxRadioBox_GetString: { // wxRadioBox::GetString
wxRadioBox *This = (wxRadioBox *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetString((int) *n);
+ wxString Result = This->GetString(*n);
rt.add(Result);
break;
}
@@ -19924,7 +19961,7 @@ case wxRadioBox_SetSelection: { // wxRadioBox::SetSelection
wxRadioBox *This = (wxRadioBox *) getPtr(bp,memenv); bp += 4;
int * n = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *n);
+ This->SetSelection(*n);
break;
}
case wxRadioBox_Show_2: { // wxRadioBox::Show
@@ -19937,7 +19974,7 @@ case wxRadioBox_Show_2: { // wxRadioBox::Show
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Show((int) *n,show);
+ bool Result = This->Show(*n,show);
rt.addBool(Result);
break;
}
@@ -19966,7 +20003,7 @@ case wxRadioBox_GetItemHelpText: { // wxRadioBox::GetItemHelpText
wxRadioBox *This = (wxRadioBox *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetItemHelpText((int) *n);
+ wxString Result = This->GetItemHelpText(*n);
rt.add(Result);
break;
}
@@ -19974,7 +20011,7 @@ case wxRadioBox_GetItemToolTip: { // wxRadioBox::GetItemToolTip
wxRadioBox *This = (wxRadioBox *) getPtr(bp,memenv); bp += 4;
unsigned int * item = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxToolTip * Result = (wxToolTip*)This->GetItemToolTip((int) *item);
+ wxToolTip * Result = (wxToolTip*)This->GetItemToolTip(*item);
rt.addRef(getRef((void *)Result,memenv), "wxToolTip");
break;
}
@@ -19999,7 +20036,7 @@ case wxRadioBox_IsItemEnabled: { // wxRadioBox::IsItemEnabled
wxRadioBox *This = (wxRadioBox *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsItemEnabled((int) *n);
+ bool Result = This->IsItemEnabled(*n);
rt.addBool(Result);
break;
}
@@ -20007,7 +20044,7 @@ case wxRadioBox_IsItemShown: { // wxRadioBox::IsItemShown
wxRadioBox *This = (wxRadioBox *) getPtr(bp,memenv); bp += 4;
unsigned int * n = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsItemShown((int) *n);
+ bool Result = This->IsItemShown(*n);
rt.addBool(Result);
break;
}
@@ -20018,7 +20055,7 @@ case wxRadioBox_SetItemHelpText: { // wxRadioBox::SetItemHelpText
wxString helpText = wxString(bp, wxConvUTF8);
bp += *helpTextLen+((8-((4+ *helpTextLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetItemHelpText((int) *n,helpText);
+ This->SetItemHelpText(*n,helpText);
break;
}
case wxRadioBox_SetItemToolTip: { // wxRadioBox::SetItemToolTip
@@ -20028,7 +20065,7 @@ case wxRadioBox_SetItemToolTip: { // wxRadioBox::SetItemToolTip
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetItemToolTip((int) *item,text);
+ This->SetItemToolTip(*item,text);
break;
}
case wxRadioButton_new_0: { // wxRadioButton::wxRadioButton
@@ -20067,7 +20104,7 @@ case wxRadioButton_new_4: { // wxRadioButton::wxRadioButton
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxRadioButton * Result = new EwxRadioButton(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ wxRadioButton * Result = new EwxRadioButton(parent,*id,label,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxRadioButton");
break;
@@ -20104,7 +20141,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,label,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,label,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -20119,7 +20156,7 @@ case wxRadioButton_SetValue: { // wxRadioButton::SetValue
wxRadioButton *This = (wxRadioButton *) getPtr(bp,memenv); bp += 4;
bool * val = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((bool) *val);
+ This->SetValue(*val);
break;
}
case wxSlider_new_6: { // wxSlider::wxSlider
@@ -20153,7 +20190,7 @@ case wxSlider_new_6: { // wxSlider::wxSlider
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxSlider * Result = new EwxSlider(parent,(wxWindowID) *id,(int) *value,(int) *minValue,(int) *maxValue,pos,size,style,*validator);
+ wxSlider * Result = new EwxSlider(parent,*id,*value,*minValue,*maxValue,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxSlider");
break;
@@ -20196,7 +20233,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,(int) *value,(int) *minValue,(int) *maxValue,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,*value,*minValue,*maxValue,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -20246,14 +20283,14 @@ case wxSlider_SetLineSize: { // wxSlider::SetLineSize
wxSlider *This = (wxSlider *) getPtr(bp,memenv); bp += 4;
int * lineSize = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLineSize((int) *lineSize);
+ This->SetLineSize(*lineSize);
break;
}
case wxSlider_SetPageSize: { // wxSlider::SetPageSize
wxSlider *This = (wxSlider *) getPtr(bp,memenv); bp += 4;
int * pageSize = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPageSize((int) *pageSize);
+ This->SetPageSize(*pageSize);
break;
}
case wxSlider_SetRange: { // wxSlider::SetRange
@@ -20261,21 +20298,21 @@ case wxSlider_SetRange: { // wxSlider::SetRange
int * minValue = (int *) bp; bp += 4;
int * maxValue = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRange((int) *minValue,(int) *maxValue);
+ This->SetRange(*minValue,*maxValue);
break;
}
case wxSlider_SetThumbLength: { // wxSlider::SetThumbLength
wxSlider *This = (wxSlider *) getPtr(bp,memenv); bp += 4;
int * lenPixels = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetThumbLength((int) *lenPixels);
+ This->SetThumbLength(*lenPixels);
break;
}
case wxSlider_SetValue: { // wxSlider::SetValue
wxSlider *This = (wxSlider *) getPtr(bp,memenv); bp += 4;
int * value = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetValue((int) *value);
+ This->SetValue(*value);
break;
}
case wxDialog_new_4: { // wxDialog::wxDialog
@@ -20304,7 +20341,7 @@ case wxDialog_new_4: { // wxDialog::wxDialog
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxDialog * Result = new EwxDialog(parent,(wxWindowID) *id,title,pos,size,style);
+ wxDialog * Result = new EwxDialog(parent,*id,title,pos,size,style);
newPtr((void *) Result, 2, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxDialog");
break;
@@ -20343,7 +20380,7 @@ case wxDialog_Create: { // wxDialog::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,title,pos,size,style);
+ bool Result = This->Create(parent,*id,title,pos,size,style);
rt.addBool(Result);
break;
}
@@ -20351,7 +20388,7 @@ case wxDialog_CreateButtonSizer: { // wxDialog::CreateButtonSizer
wxDialog *This = (wxDialog *) getPtr(bp,memenv); bp += 4;
int * flags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxSizer * Result = (wxSizer*)This->CreateButtonSizer((long) *flags);
+ wxSizer * Result = (wxSizer*)This->CreateButtonSizer(*flags);
rt.addRef(getRef((void *)Result,memenv), "wxSizer");
break;
}
@@ -20359,7 +20396,7 @@ case wxDialog_CreateStdDialogButtonSizer: { // wxDialog::CreateStdDialogButtonSi
wxDialog *This = (wxDialog *) getPtr(bp,memenv); bp += 4;
int * flags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxStdDialogButtonSizer * Result = (wxStdDialogButtonSizer*)This->CreateStdDialogButtonSizer((long) *flags);
+ wxStdDialogButtonSizer * Result = (wxStdDialogButtonSizer*)This->CreateStdDialogButtonSizer(*flags);
rt.addRef(getRef((void *)Result,memenv), "wxStdDialogButtonSizer");
break;
}
@@ -20367,7 +20404,7 @@ case wxDialog_EndModal: { // wxDialog::EndModal
wxDialog *This = (wxDialog *) getPtr(bp,memenv); bp += 4;
int * retCode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EndModal((int) *retCode);
+ This->EndModal(*retCode);
break;
}
case wxDialog_GetAffirmativeId: { // wxDialog::GetAffirmativeId
@@ -20395,14 +20432,14 @@ case wxDialog_SetAffirmativeId: { // wxDialog::SetAffirmativeId
wxDialog *This = (wxDialog *) getPtr(bp,memenv); bp += 4;
int * affirmativeId = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAffirmativeId((int) *affirmativeId);
+ This->SetAffirmativeId(*affirmativeId);
break;
}
case wxDialog_SetReturnCode: { // wxDialog::SetReturnCode
wxDialog *This = (wxDialog *) getPtr(bp,memenv); bp += 4;
int * returnCode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetReturnCode((int) *returnCode);
+ This->SetReturnCode(*returnCode);
break;
}
case wxDialog_Show: { // wxDialog::Show
@@ -20498,7 +20535,7 @@ case wxColourData_GetCustomColour: { // wxColourData::GetCustomColour
wxColourData *This = (wxColourData *) getPtr(bp,memenv); bp += 4;
int * i = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour Result = This->GetCustomColour((int) *i);
+ wxColour Result = This->GetCustomColour(*i);
rt.add(Result);
break;
}
@@ -20506,7 +20543,7 @@ case wxColourData_SetChooseFull: { // wxColourData::SetChooseFull
wxColourData *This = (wxColourData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetChooseFull((bool) *flag);
+ This->SetChooseFull(*flag);
break;
}
case wxColourData_SetColour: { // wxColourData::SetColour
@@ -20529,7 +20566,7 @@ case wxColourData_SetCustomColour: { // wxColourData::SetCustomColour
int * colourA = (int *) bp; bp += 4;
wxColour colour = wxColour(*colourR,*colourG,*colourB,*colourA);
if(!This) throw wxe_badarg(0);
- This->SetCustomColour((int) *i,colour);
+ This->SetCustomColour(*i,colour);
break;
}
case wxPalette_new_0: { // wxPalette::wxPalette
@@ -20570,7 +20607,7 @@ case wxPalette_GetPixel: { // wxPalette::GetPixel
unsigned int * green = (unsigned int *) bp; bp += 4;
unsigned int * blue = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetPixel((char) *red,(char) *green,(char) *blue);
+ int Result = This->GetPixel(*red,*green,*blue);
rt.addInt(Result);
break;
}
@@ -20581,7 +20618,7 @@ case wxPalette_GetRGB: { // wxPalette::GetRGB
wxPalette *This = (wxPalette *) getPtr(bp,memenv); bp += 4;
int * pixel = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetRGB((int) *pixel,&red,&green,&blue);
+ bool Result = This->GetRGB(*pixel,&red,&green,&blue);
rt.addBool(Result);
rt.addUint(red);
rt.addUint(green);
@@ -20800,7 +20837,7 @@ case wxFileDialog_SetFilterIndex: { // wxFileDialog::SetFilterIndex
wxFileDialog *This = (wxFileDialog *) getPtr(bp,memenv); bp += 4;
int * filterIndex = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFilterIndex((int) *filterIndex);
+ This->SetFilterIndex(*filterIndex);
break;
}
case wxFileDialog_SetMessage: { // wxFileDialog::SetMessage
@@ -20834,7 +20871,7 @@ case wxPickerBase_SetInternalMargin: { // wxPickerBase::SetInternalMargin
wxPickerBase *This = (wxPickerBase *) getPtr(bp,memenv); bp += 4;
int * newmargin = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetInternalMargin((int) *newmargin);
+ This->SetInternalMargin(*newmargin);
break;
}
case wxPickerBase_GetInternalMargin: { // wxPickerBase::GetInternalMargin
@@ -20848,14 +20885,14 @@ case wxPickerBase_SetTextCtrlProportion: { // wxPickerBase::SetTextCtrlProportio
wxPickerBase *This = (wxPickerBase *) getPtr(bp,memenv); bp += 4;
int * prop = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTextCtrlProportion((int) *prop);
+ This->SetTextCtrlProportion(*prop);
break;
}
case wxPickerBase_SetPickerCtrlProportion: { // wxPickerBase::SetPickerCtrlProportion
wxPickerBase *This = (wxPickerBase *) getPtr(bp,memenv); bp += 4;
int * prop = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPickerCtrlProportion((int) *prop);
+ This->SetPickerCtrlProportion(*prop);
break;
}
case wxPickerBase_GetTextCtrlProportion: { // wxPickerBase::GetTextCtrlProportion
@@ -20977,7 +21014,7 @@ case wxFilePickerCtrl_new_3: { // wxFilePickerCtrl::wxFilePickerCtrl
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxFilePickerCtrl * Result = new EwxFilePickerCtrl(parent,(wxWindowID) *id,path,message,wildcard,pos,size,style,*validator);
+ wxFilePickerCtrl * Result = new EwxFilePickerCtrl(parent,*id,path,message,wildcard,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFilePickerCtrl");
break;
@@ -21030,7 +21067,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,path,message,wildcard,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,path,message,wildcard,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -21095,7 +21132,7 @@ case wxDirPickerCtrl_new_3: { // wxDirPickerCtrl::wxDirPickerCtrl
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxDirPickerCtrl * Result = new EwxDirPickerCtrl(parent,(wxWindowID) *id,path,message,pos,size,style,*validator);
+ wxDirPickerCtrl * Result = new EwxDirPickerCtrl(parent,*id,path,message,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxDirPickerCtrl");
break;
@@ -21142,7 +21179,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,path,message,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,path,message,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -21204,7 +21241,7 @@ case wxColourPickerCtrl_new_3: { // wxColourPickerCtrl::wxColourPickerCtrl
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxColourPickerCtrl * Result = new EwxColourPickerCtrl(parent,(wxWindowID) *id,col,pos,size,style,*validator);
+ wxColourPickerCtrl * Result = new EwxColourPickerCtrl(parent,*id,col,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxColourPickerCtrl");
break;
@@ -21248,7 +21285,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,col,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,col,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -21324,7 +21361,7 @@ case wxDatePickerCtrl_new_3: { // wxDatePickerCtrl::wxDatePickerCtrl
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxDatePickerCtrl * Result = new EwxDatePickerCtrl(parent,(wxWindowID) *id,date,pos,size,style,*validator);
+ wxDatePickerCtrl * Result = new EwxDatePickerCtrl(parent,*id,date,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxDatePickerCtrl");
break;
@@ -21427,7 +21464,7 @@ initial = (wxFont *) getPtr(bp,memenv); bp += 4;
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
- wxFontPickerCtrl * Result = new EwxFontPickerCtrl(parent,(wxWindowID) *id,*initial,pos,size,style,*validator);
+ wxFontPickerCtrl * Result = new EwxFontPickerCtrl(parent,*id,*initial,pos,size,style,*validator);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFontPickerCtrl");
break;
@@ -21466,7 +21503,7 @@ validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,*initial,pos,size,style,*validator);
+ bool Result = This->Create(parent,*id,*initial,pos,size,style,*validator);
rt.addBool(Result);
break;
}
@@ -21495,7 +21532,7 @@ case wxFontPickerCtrl_SetMaxPointSize: { // wxFontPickerCtrl::SetMaxPointSize
wxFontPickerCtrl *This = (wxFontPickerCtrl *) getPtr(bp,memenv); bp += 4;
unsigned int * max = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMaxPointSize((int) *max);
+ This->SetMaxPointSize(*max);
break;
}
case wxFindReplaceDialog_new_0: { // wxFindReplaceDialog::wxFindReplaceDialog
@@ -21554,7 +21591,7 @@ case wxFindReplaceData_new_0: { // wxFindReplaceData::wxFindReplaceData
}
case wxFindReplaceData_new_1: { // wxFindReplaceData::wxFindReplaceData
unsigned int * flags = (unsigned int *) bp; bp += 4;
- wxFindReplaceData * Result = new EwxFindReplaceData((int) *flags);
+ wxFindReplaceData * Result = new EwxFindReplaceData(*flags);
newPtr((void *) Result, 1, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFindReplaceData");
break;
@@ -21584,7 +21621,7 @@ case wxFindReplaceData_SetFlags: { // wxFindReplaceData::SetFlags
wxFindReplaceData *This = (wxFindReplaceData *) getPtr(bp,memenv); bp += 4;
unsigned int * flags = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFlags((int) *flags);
+ This->SetFlags(*flags);
break;
}
case wxFindReplaceData_SetFindString: { // wxFindReplaceData::SetFindString
@@ -21725,7 +21762,7 @@ case wxSingleChoiceDialog_SetSelection: { // wxSingleChoiceDialog::SetSelection
wxSingleChoiceDialog *This = (wxSingleChoiceDialog *) getPtr(bp,memenv); bp += 4;
int * sel = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *sel);
+ This->SetSelection(*sel);
break;
}
case wxTextEntryDialog_new: { // wxTextEntryDialog::wxTextEntryDialog
@@ -21831,7 +21868,7 @@ case wxFontData_EnableEffects: { // wxFontData::EnableEffects
wxFontData *This = (wxFontData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableEffects((bool) *flag);
+ This->EnableEffects(*flag);
break;
}
case wxFontData_GetAllowSymbols: { // wxFontData::GetAllowSymbols
@@ -21880,7 +21917,7 @@ case wxFontData_SetAllowSymbols: { // wxFontData::SetAllowSymbols
wxFontData *This = (wxFontData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAllowSymbols((bool) *flag);
+ This->SetAllowSymbols(*flag);
break;
}
case wxFontData_SetChosenFont: { // wxFontData::SetChosenFont
@@ -21913,14 +21950,14 @@ case wxFontData_SetRange: { // wxFontData::SetRange
int * minRange = (int *) bp; bp += 4;
int * maxRange = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRange((int) *minRange,(int) *maxRange);
+ This->SetRange(*minRange,*maxRange);
break;
}
case wxFontData_SetShowHelp: { // wxFontData::SetShowHelp
wxFontData *This = (wxFontData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetShowHelp((bool) *flag);
+ This->SetShowHelp(*flag);
break;
}
case wxFontDialog_new_0: { // wxFontDialog::wxFontDialog
@@ -21997,7 +22034,7 @@ case wxProgressDialog_Update_2: { // wxProgressDialog::Update
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Update((int) *value,newmsg);
+ bool Result = This->Update(*value,newmsg);
rt.addBool(Result);
break;
}
@@ -22088,35 +22125,35 @@ case wxPageSetupDialogData_EnableHelp: { // wxPageSetupDialogData::EnableHelp
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableHelp((bool) *flag);
+ This->EnableHelp(*flag);
break;
}
case wxPageSetupDialogData_EnableMargins: { // wxPageSetupDialogData::EnableMargins
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableMargins((bool) *flag);
+ This->EnableMargins(*flag);
break;
}
case wxPageSetupDialogData_EnableOrientation: { // wxPageSetupDialogData::EnableOrientation
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableOrientation((bool) *flag);
+ This->EnableOrientation(*flag);
break;
}
case wxPageSetupDialogData_EnablePaper: { // wxPageSetupDialogData::EnablePaper
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnablePaper((bool) *flag);
+ This->EnablePaper(*flag);
break;
}
case wxPageSetupDialogData_EnablePrinter: { // wxPageSetupDialogData::EnablePrinter
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnablePrinter((bool) *flag);
+ This->EnablePrinter(*flag);
break;
}
case wxPageSetupDialogData_GetDefaultMinMargins: { // wxPageSetupDialogData::GetDefaultMinMargins
@@ -22199,7 +22236,7 @@ case wxPageSetupDialogData_GetMinMarginBottomRight: { // wxPageSetupDialogData::
case wxPageSetupDialogData_GetPaperId: { // wxPageSetupDialogData::GetPaperId
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxPaperSize Result = This->GetPaperId();
+ int Result = This->GetPaperId();
rt.addInt(Result);
break;
}
@@ -22228,14 +22265,14 @@ case wxPageSetupDialogData_SetDefaultInfo: { // wxPageSetupDialogData::SetDefaul
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDefaultInfo((bool) *flag);
+ This->SetDefaultInfo(*flag);
break;
}
case wxPageSetupDialogData_SetDefaultMinMargins: { // wxPageSetupDialogData::SetDefaultMinMargins
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDefaultMinMargins((bool) *flag);
+ This->SetDefaultMinMargins(*flag);
break;
}
case wxPageSetupDialogData_SetMarginTopLeft: { // wxPageSetupDialogData::SetMarginTopLeft
@@ -22276,9 +22313,9 @@ case wxPageSetupDialogData_SetMinMarginBottomRight: { // wxPageSetupDialogData::
}
case wxPageSetupDialogData_SetPaperId: { // wxPageSetupDialogData::SetPaperId
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
- int * id = (int *) bp; bp += 4;
+ wxPaperSize id = *(wxPaperSize *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetPaperId((wxPaperSize) *id);
+ This->SetPaperId(id);
break;
}
case wxPageSetupDialogData_SetPaperSize_1_1: { // wxPageSetupDialogData::SetPaperSize
@@ -22292,9 +22329,9 @@ case wxPageSetupDialogData_SetPaperSize_1_1: { // wxPageSetupDialogData::SetPape
}
case wxPageSetupDialogData_SetPaperSize_1_0: { // wxPageSetupDialogData::SetPaperSize
wxPageSetupDialogData *This = (wxPageSetupDialogData *) getPtr(bp,memenv); bp += 4;
- int * id = (int *) bp; bp += 4;
+ wxPaperSize id = *(wxPaperSize *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetPaperSize((wxPaperSize) *id);
+ This->SetPaperSize(id);
break;
}
case wxPageSetupDialogData_SetPrintData: { // wxPageSetupDialogData::SetPrintData
@@ -22364,28 +22401,28 @@ case wxPrintDialogData_EnableHelp: { // wxPrintDialogData::EnableHelp
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableHelp((bool) *flag);
+ This->EnableHelp(*flag);
break;
}
case wxPrintDialogData_EnablePageNumbers: { // wxPrintDialogData::EnablePageNumbers
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnablePageNumbers((bool) *flag);
+ This->EnablePageNumbers(*flag);
break;
}
case wxPrintDialogData_EnablePrintToFile: { // wxPrintDialogData::EnablePrintToFile
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnablePrintToFile((bool) *flag);
+ This->EnablePrintToFile(*flag);
break;
}
case wxPrintDialogData_EnableSelection: { // wxPrintDialogData::EnableSelection
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnableSelection((bool) *flag);
+ This->EnableSelection(*flag);
break;
}
case wxPrintDialogData_GetAllPages: { // wxPrintDialogData::GetAllPages
@@ -22469,35 +22506,35 @@ case wxPrintDialogData_SetCollate: { // wxPrintDialogData::SetCollate
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCollate((bool) *flag);
+ This->SetCollate(*flag);
break;
}
case wxPrintDialogData_SetFromPage: { // wxPrintDialogData::SetFromPage
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
int * v = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFromPage((int) *v);
+ This->SetFromPage(*v);
break;
}
case wxPrintDialogData_SetMaxPage: { // wxPrintDialogData::SetMaxPage
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
int * v = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMaxPage((int) *v);
+ This->SetMaxPage(*v);
break;
}
case wxPrintDialogData_SetMinPage: { // wxPrintDialogData::SetMinPage
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
int * v = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinPage((int) *v);
+ This->SetMinPage(*v);
break;
}
case wxPrintDialogData_SetNoCopies: { // wxPrintDialogData::SetNoCopies
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
int * v = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetNoCopies((int) *v);
+ This->SetNoCopies(*v);
break;
}
case wxPrintDialogData_SetPrintData: { // wxPrintDialogData::SetPrintData
@@ -22511,21 +22548,21 @@ case wxPrintDialogData_SetPrintToFile: { // wxPrintDialogData::SetPrintToFile
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPrintToFile((bool) *flag);
+ This->SetPrintToFile(*flag);
break;
}
case wxPrintDialogData_SetSelection: { // wxPrintDialogData::SetSelection
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((bool) *flag);
+ This->SetSelection(*flag);
break;
}
case wxPrintDialogData_SetToPage: { // wxPrintDialogData::SetToPage
wxPrintDialogData *This = (wxPrintDialogData *) getPtr(bp,memenv); bp += 4;
int * v = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetToPage((int) *v);
+ This->SetToPage(*v);
break;
}
case wxPrintData_new_0: { // wxPrintData::wxPrintData
@@ -22586,7 +22623,7 @@ case wxPrintData_GetOrientation: { // wxPrintData::GetOrientation
case wxPrintData_GetPaperId: { // wxPrintData::GetPaperId
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- wxPaperSize Result = This->GetPaperId();
+ int Result = This->GetPaperId();
rt.addInt(Result);
break;
}
@@ -22615,49 +22652,49 @@ case wxPrintData_SetBin: { // wxPrintData::SetBin
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
wxPrintBin bin = *(wxPrintBin *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetBin((wxPrintBin) bin);
+ This->SetBin(bin);
break;
}
case wxPrintData_SetCollate: { // wxPrintData::SetCollate
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
bool * flag = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCollate((bool) *flag);
+ This->SetCollate(*flag);
break;
}
case wxPrintData_SetColour: { // wxPrintData::SetColour
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
bool * colour = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetColour((bool) *colour);
+ This->SetColour(*colour);
break;
}
case wxPrintData_SetDuplex: { // wxPrintData::SetDuplex
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
wxDuplexMode duplex = *(wxDuplexMode *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetDuplex((wxDuplexMode) duplex);
+ This->SetDuplex(duplex);
break;
}
case wxPrintData_SetNoCopies: { // wxPrintData::SetNoCopies
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
int * v = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetNoCopies((int) *v);
+ This->SetNoCopies(*v);
break;
}
case wxPrintData_SetOrientation: { // wxPrintData::SetOrientation
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
int * orient = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetOrientation((int) *orient);
+ This->SetOrientation(*orient);
break;
}
case wxPrintData_SetPaperId: { // wxPrintData::SetPaperId
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
- int * sizeId = (int *) bp; bp += 4;
+ wxPaperSize sizeId = *(wxPaperSize *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetPaperId((wxPaperSize) *sizeId);
+ This->SetPaperId(sizeId);
break;
}
case wxPrintData_SetPrinterName: { // wxPrintData::SetPrinterName
@@ -22673,7 +22710,7 @@ case wxPrintData_SetQuality: { // wxPrintData::SetQuality
wxPrintData *This = (wxPrintData *) getPtr(bp,memenv); bp += 4;
int * quality = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetQuality((wxPrintQuality) *quality);
+ This->SetQuality(*quality);
break;
}
case wxPrintPreview_new_2: { // wxPrintPreview::wxPrintPreview
@@ -22772,7 +22809,7 @@ case wxPrintPreview_Print: { // wxPrintPreview::Print
wxPrintPreview *This = (wxPrintPreview *) getPtr(bp,memenv); bp += 4;
bool * interactive = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Print((bool) *interactive);
+ bool Result = This->Print(*interactive);
rt.addBool(Result);
break;
}
@@ -22780,7 +22817,7 @@ case wxPrintPreview_RenderPage: { // wxPrintPreview::RenderPage
wxPrintPreview *This = (wxPrintPreview *) getPtr(bp,memenv); bp += 4;
int * pageNum = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RenderPage((int) *pageNum);
+ bool Result = This->RenderPage(*pageNum);
rt.addBool(Result);
break;
}
@@ -22795,7 +22832,7 @@ case wxPrintPreview_SetCurrentPage: { // wxPrintPreview::SetCurrentPage
wxPrintPreview *This = (wxPrintPreview *) getPtr(bp,memenv); bp += 4;
int * pageNum = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetCurrentPage((int) *pageNum);
+ bool Result = This->SetCurrentPage(*pageNum);
rt.addBool(Result);
break;
}
@@ -22817,7 +22854,7 @@ case wxPrintPreview_SetZoom: { // wxPrintPreview::SetZoom
wxPrintPreview *This = (wxPrintPreview *) getPtr(bp,memenv); bp += 4;
int * percent = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetZoom((int) *percent);
+ This->SetZoom(*percent);
break;
}
case wxPreviewFrame_new: { // wxPreviewFrame::wxPreviewFrame
@@ -22904,7 +22941,7 @@ case wxPreviewControlBar_new: { // wxPreviewControlBar::wxPreviewControlBar
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxPreviewControlBar * Result = new EwxPreviewControlBar(preview,(long) *buttons,parent,pos,size,style);
+ wxPreviewControlBar * Result = new EwxPreviewControlBar(preview,*buttons,parent,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxPreviewControlBar");
break;
@@ -22933,7 +22970,7 @@ case wxPreviewControlBar_SetZoomControl: { // wxPreviewControlBar::SetZoomContro
wxPreviewControlBar *This = (wxPreviewControlBar *) getPtr(bp,memenv); bp += 4;
int * zoom = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetZoomControl((int) *zoom);
+ This->SetZoomControl(*zoom);
break;
}
case wxPrinter_new: { // wxPrinter::wxPrinter
@@ -23089,7 +23126,7 @@ case wxXmlResource_CompareVersion: { // wxXmlResource::CompareVersion
int * release = (int *) bp; bp += 4;
int * revision = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->CompareVersion((int) *major,(int) *minor,(int) *release,(int) *revision);
+ int Result = This->CompareVersion(*major,*minor,*release,*revision);
rt.addInt(Result);
break;
}
@@ -23283,7 +23320,7 @@ case wxXmlResource_SetFlags: { // wxXmlResource::SetFlags
wxXmlResource *This = (wxXmlResource *) getPtr(bp,memenv); bp += 4;
int * flags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFlags((int) *flags);
+ This->SetFlags(*flags);
break;
}
case wxXmlResource_Unload: { // wxXmlResource::Unload
@@ -23811,14 +23848,14 @@ case wxAuiManager_SetDockSizeConstraint: { // wxAuiManager::SetDockSizeConstrain
double * width_pct = (double *) bp; bp += 8;
double * height_pct = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->SetDockSizeConstraint((double) *width_pct,(double) *height_pct);
+ This->SetDockSizeConstraint(*width_pct,*height_pct);
break;
}
case wxAuiManager_SetFlags: { // wxAuiManager::SetFlags
wxAuiManager *This = (wxAuiManager *) getPtr(bp,memenv); bp += 4;
unsigned int * flags = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFlags((int) *flags);
+ This->SetFlags(*flags);
break;
}
case wxAuiManager_SetManagedWindow: { // wxAuiManager::SetManagedWindow
@@ -23887,7 +23924,7 @@ case wxAuiPaneInfo_BestSize_2: { // wxAuiPaneInfo::BestSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->BestSize((int) *x,(int) *y);
+ wxAuiPaneInfo * Result = &This->BestSize(*x,*y);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -23989,7 +24026,7 @@ case wxAuiPaneInfo_Direction: { // wxAuiPaneInfo::Direction
wxAuiPaneInfo *This = (wxAuiPaneInfo *) getPtr(bp,memenv); bp += 4;
int * direction = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->Direction((int) *direction);
+ wxAuiPaneInfo * Result = &This->Direction(*direction);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24057,7 +24094,7 @@ case wxAuiPaneInfo_FloatingPosition_2: { // wxAuiPaneInfo::FloatingPosition
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->FloatingPosition((int) *x,(int) *y);
+ wxAuiPaneInfo * Result = &This->FloatingPosition(*x,*y);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24076,7 +24113,7 @@ case wxAuiPaneInfo_FloatingSize_2: { // wxAuiPaneInfo::FloatingSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->FloatingSize((int) *x,(int) *y);
+ wxAuiPaneInfo * Result = &This->FloatingSize(*x,*y);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24133,7 +24170,7 @@ case wxAuiPaneInfo_HasFlag: { // wxAuiPaneInfo::HasFlag
wxAuiPaneInfo *This = (wxAuiPaneInfo *) getPtr(bp,memenv); bp += 4;
unsigned int * flag = (unsigned int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->HasFlag((int) *flag);
+ bool Result = This->HasFlag(*flag);
rt.addBool(Result);
break;
}
@@ -24274,7 +24311,7 @@ case wxAuiPaneInfo_Layer: { // wxAuiPaneInfo::Layer
wxAuiPaneInfo *This = (wxAuiPaneInfo *) getPtr(bp,memenv); bp += 4;
int * layer = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->Layer((int) *layer);
+ wxAuiPaneInfo * Result = &This->Layer(*layer);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24314,7 +24351,7 @@ case wxAuiPaneInfo_MaxSize_2: { // wxAuiPaneInfo::MaxSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->MaxSize((int) *x,(int) *y);
+ wxAuiPaneInfo * Result = &This->MaxSize(*x,*y);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24347,7 +24384,7 @@ case wxAuiPaneInfo_MinSize_2: { // wxAuiPaneInfo::MinSize
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->MinSize((int) *x,(int) *y);
+ wxAuiPaneInfo * Result = &This->MinSize(*x,*y);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24421,7 +24458,7 @@ case wxAuiPaneInfo_Position: { // wxAuiPaneInfo::Position
wxAuiPaneInfo *This = (wxAuiPaneInfo *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->Position((int) *pos);
+ wxAuiPaneInfo * Result = &This->Position(*pos);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24464,7 +24501,7 @@ case wxAuiPaneInfo_Row: { // wxAuiPaneInfo::Row
wxAuiPaneInfo *This = (wxAuiPaneInfo *) getPtr(bp,memenv); bp += 4;
int * row = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->Row((int) *row);
+ wxAuiPaneInfo * Result = &This->Row(*row);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24480,7 +24517,7 @@ case wxAuiPaneInfo_SetFlag: { // wxAuiPaneInfo::SetFlag
unsigned int * flag = (unsigned int *) bp; bp += 4;
bool * option_state = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxAuiPaneInfo * Result = &This->SetFlag((int) *flag,(bool) *option_state);
+ wxAuiPaneInfo * Result = &This->SetFlag(*flag,*option_state);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -24631,7 +24668,7 @@ case wxAuiNotebook_DeletePage: { // wxAuiNotebook::DeletePage
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * page = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->DeletePage((size_t) *page);
+ bool Result = This->DeletePage(*page);
rt.addBool(Result);
break;
}
@@ -24646,7 +24683,7 @@ case wxAuiNotebook_GetPage: { // wxAuiNotebook::GetPage
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * page_idx = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxWindow * Result = (wxWindow*)This->GetPage((size_t) *page_idx);
+ wxWindow * Result = (wxWindow*)This->GetPage(*page_idx);
rt.addRef(getRef((void *)Result,memenv), "wxWindow");
break;
}
@@ -24654,7 +24691,7 @@ case wxAuiNotebook_GetPageBitmap: { // wxAuiNotebook::GetPageBitmap
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * page_idx = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxBitmap * Result = new wxBitmap(This->GetPageBitmap((size_t) *page_idx)); newPtr((void *) Result,3, memenv);;
+ wxBitmap * Result = new wxBitmap(This->GetPageBitmap(*page_idx)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxBitmap");
break;
}
@@ -24677,7 +24714,7 @@ case wxAuiNotebook_GetPageText: { // wxAuiNotebook::GetPageText
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * page_idx = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetPageText((size_t) *page_idx);
+ wxString Result = This->GetPageText(*page_idx);
rt.add(Result);
break;
}
@@ -24706,7 +24743,7 @@ bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->InsertPage((size_t) *page_idx,page,caption,select,*bitmap);
+ bool Result = This->InsertPage(*page_idx,page,caption,select,*bitmap);
rt.addBool(Result);
break;
}
@@ -24714,7 +24751,7 @@ case wxAuiNotebook_RemovePage: { // wxAuiNotebook::RemovePage
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * page = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->RemovePage((size_t) *page);
+ bool Result = This->RemovePage(*page);
rt.addBool(Result);
break;
}
@@ -24738,7 +24775,7 @@ case wxAuiNotebook_SetPageBitmap: { // wxAuiNotebook::SetPageBitmap
int * page = (int *) bp; bp += 4;
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageBitmap((size_t) *page,*bitmap);
+ bool Result = This->SetPageBitmap(*page,*bitmap);
rt.addBool(Result);
break;
}
@@ -24749,7 +24786,7 @@ case wxAuiNotebook_SetPageText: { // wxAuiNotebook::SetPageText
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->SetPageText((size_t) *page,text);
+ bool Result = This->SetPageText(*page,text);
rt.addBool(Result);
break;
}
@@ -24757,7 +24794,7 @@ case wxAuiNotebook_SetSelection: { // wxAuiNotebook::SetSelection
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * new_page = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- size_t Result = This->SetSelection((size_t) *new_page);
+ size_t Result = This->SetSelection(*new_page);
rt.addInt(Result);
break;
}
@@ -24765,7 +24802,7 @@ case wxAuiNotebook_SetTabCtrlHeight: { // wxAuiNotebook::SetTabCtrlHeight
wxAuiNotebook *This = (wxAuiNotebook *) getPtr(bp,memenv); bp += 4;
int * height = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTabCtrlHeight((int) *height);
+ This->SetTabCtrlHeight(*height);
break;
}
case wxAuiNotebook_SetUniformBitmapSize: { // wxAuiNotebook::SetUniformBitmapSize
@@ -24814,7 +24851,7 @@ case wxMDIParentFrame_new_4: { // wxMDIParentFrame::wxMDIParentFrame
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxMDIParentFrame * Result = new EwxMDIParentFrame(parent,(wxWindowID) *id,title,pos,size,style);
+ wxMDIParentFrame * Result = new EwxMDIParentFrame(parent,*id,title,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMDIParentFrame");
break;
@@ -24871,7 +24908,7 @@ case wxMDIParentFrame_Create: { // wxMDIParentFrame::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,title,pos,size,style);
+ bool Result = This->Create(parent,*id,title,pos,size,style);
rt.addBool(Result);
break;
}
@@ -24899,7 +24936,7 @@ orient = *(wxOrientation *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- This->Tile((wxOrientation) orient);
+ This->Tile(orient);
break;
}
case wxMDIChildFrame_new_0: { // wxMDIChildFrame::wxMDIChildFrame
@@ -24934,7 +24971,7 @@ case wxMDIChildFrame_new_4: { // wxMDIChildFrame::wxMDIChildFrame
style = (long)*(int *) bp; bp += 4;
} break;
}};
- wxMDIChildFrame * Result = new EwxMDIChildFrame(parent,(wxWindowID) *id,title,pos,size,style);
+ wxMDIChildFrame * Result = new EwxMDIChildFrame(parent,*id,title,pos,size,style);
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxMDIChildFrame");
break;
@@ -24973,7 +25010,7 @@ case wxMDIChildFrame_Create: { // wxMDIChildFrame::Create
} break;
}};
if(!This) throw wxe_badarg(0);
- bool Result = This->Create(parent,(wxWindowID) *id,title,pos,size,style);
+ bool Result = This->Create(parent,*id,title,pos,size,style);
rt.addBool(Result);
break;
}
@@ -25002,6 +25039,7 @@ case wxMDIClientWindow_new_0: { // wxMDIClientWindow::wxMDIClientWindow
rt.addRef(getRef((void *)Result,memenv), "wxMDIClientWindow");
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxMDIClientWindow_new_2: { // wxMDIClientWindow::wxMDIClientWindow
long style=0;
wxMDIParentFrame *parent = (wxMDIParentFrame *) getPtr(bp,memenv); bp += 4;
@@ -25016,6 +25054,7 @@ case wxMDIClientWindow_new_2: { // wxMDIClientWindow::wxMDIClientWindow
rt.addRef(getRef((void *)Result,memenv), "wxMDIClientWindow");
break;
}
+#endif
case wxMDIClientWindow_CreateClient: { // wxMDIClientWindow::CreateClient
long style=wxVSCROLL|wxHSCROLL;
wxMDIClientWindow *This = (wxMDIClientWindow *) getPtr(bp,memenv); bp += 4;
@@ -25115,7 +25154,7 @@ case wxEvent_ResumePropagation: { // wxEvent::ResumePropagation
wxEvent *This = (wxEvent *) getPtr(bp,memenv); bp += 4;
int * propagationLevel = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ResumePropagation((int) *propagationLevel);
+ This->ResumePropagation(*propagationLevel);
break;
}
case wxEvent_ShouldPropagate: { // wxEvent::ShouldPropagate
@@ -25198,7 +25237,7 @@ case wxCommandEvent_SetInt: { // wxCommandEvent::SetInt
wxCommandEvent *This = (wxCommandEvent *) getPtr(bp,memenv); bp += 4;
int * i = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetInt((int) *i);
+ This->SetInt(*i);
break;
}
case wxCommandEvent_SetString: { // wxCommandEvent::SetString
@@ -25249,7 +25288,7 @@ case wxMouseEvent_Button: { // wxMouseEvent::Button
wxMouseEvent *This = (wxMouseEvent *) getPtr(bp,memenv); bp += 4;
int * but = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->Button((int) *but);
+ bool Result = This->Button(*but);
rt.addBool(Result);
break;
}
@@ -25713,14 +25752,14 @@ case wxCloseEvent_SetCanVeto: { // wxCloseEvent::SetCanVeto
wxCloseEvent *This = (wxCloseEvent *) getPtr(bp,memenv); bp += 4;
bool * canVeto = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCanVeto((bool) *canVeto);
+ This->SetCanVeto(*canVeto);
break;
}
case wxCloseEvent_SetLoggingOff: { // wxCloseEvent::SetLoggingOff
wxCloseEvent *This = (wxCloseEvent *) getPtr(bp,memenv); bp += 4;
bool * logOff = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLoggingOff((bool) *logOff);
+ This->SetLoggingOff(*logOff);
break;
}
case wxCloseEvent_Veto: { // wxCloseEvent::Veto
@@ -25740,7 +25779,7 @@ case wxShowEvent_SetShow: { // wxShowEvent::SetShow
wxShowEvent *This = (wxShowEvent *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetShow((bool) *show);
+ This->SetShow(*show);
break;
}
case wxShowEvent_GetShow: { // wxShowEvent::GetShow
@@ -25865,21 +25904,21 @@ case wxUpdateUIEvent_Check: { // wxUpdateUIEvent::Check
wxUpdateUIEvent *This = (wxUpdateUIEvent *) getPtr(bp,memenv); bp += 4;
bool * check = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Check((bool) *check);
+ This->Check(*check);
break;
}
case wxUpdateUIEvent_Enable: { // wxUpdateUIEvent::Enable
wxUpdateUIEvent *This = (wxUpdateUIEvent *) getPtr(bp,memenv); bp += 4;
bool * enable = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Enable((bool) *enable);
+ This->Enable(*enable);
break;
}
case wxUpdateUIEvent_Show: { // wxUpdateUIEvent::Show
wxUpdateUIEvent *This = (wxUpdateUIEvent *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Show((bool) *show);
+ This->Show(*show);
break;
}
case wxUpdateUIEvent_GetChecked: { // wxUpdateUIEvent::GetChecked
@@ -25954,7 +25993,7 @@ case wxUpdateUIEvent_ResetUpdateTime: { // wxUpdateUIEvent::ResetUpdateTime
}
case wxUpdateUIEvent_SetMode: { // wxUpdateUIEvent::SetMode
wxUpdateUIMode mode = *(wxUpdateUIMode *) bp; bp += 4;;
- wxUpdateUIEvent::SetMode((wxUpdateUIMode) mode);
+ wxUpdateUIEvent::SetMode(mode);
break;
}
case wxUpdateUIEvent_SetText: { // wxUpdateUIEvent::SetText
@@ -25968,7 +26007,7 @@ case wxUpdateUIEvent_SetText: { // wxUpdateUIEvent::SetText
}
case wxUpdateUIEvent_SetUpdateInterval: { // wxUpdateUIEvent::SetUpdateInterval
int * updateInterval = (int *) bp; bp += 4;
- wxUpdateUIEvent::SetUpdateInterval((long) *updateInterval);
+ wxUpdateUIEvent::SetUpdateInterval(*updateInterval);
break;
}
case wxMouseCaptureChangedEvent_GetCapturedWindow: { // wxMouseCaptureChangedEvent::GetCapturedWindow
@@ -25996,7 +26035,7 @@ case wxQueryNewPaletteEvent_SetPaletteRealized: { // wxQueryNewPaletteEvent::Set
wxQueryNewPaletteEvent *This = (wxQueryNewPaletteEvent *) getPtr(bp,memenv); bp += 4;
bool * realized = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPaletteRealized((bool) *realized);
+ This->SetPaletteRealized(*realized);
break;
}
case wxQueryNewPaletteEvent_GetPaletteRealized: { // wxQueryNewPaletteEvent::GetPaletteRealized
@@ -26017,7 +26056,7 @@ case wxNavigationKeyEvent_SetDirection: { // wxNavigationKeyEvent::SetDirection
wxNavigationKeyEvent *This = (wxNavigationKeyEvent *) getPtr(bp,memenv); bp += 4;
bool * bForward = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetDirection((bool) *bForward);
+ This->SetDirection(*bForward);
break;
}
case wxNavigationKeyEvent_IsWindowChange: { // wxNavigationKeyEvent::IsWindowChange
@@ -26031,7 +26070,7 @@ case wxNavigationKeyEvent_SetWindowChange: { // wxNavigationKeyEvent::SetWindowC
wxNavigationKeyEvent *This = (wxNavigationKeyEvent *) getPtr(bp,memenv); bp += 4;
bool * bIs = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWindowChange((bool) *bIs);
+ This->SetWindowChange(*bIs);
break;
}
case wxNavigationKeyEvent_IsFromTab: { // wxNavigationKeyEvent::IsFromTab
@@ -26045,7 +26084,7 @@ case wxNavigationKeyEvent_SetFromTab: { // wxNavigationKeyEvent::SetFromTab
wxNavigationKeyEvent *This = (wxNavigationKeyEvent *) getPtr(bp,memenv); bp += 4;
bool * bIs = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFromTab((bool) *bIs);
+ This->SetFromTab(*bIs);
break;
}
case wxNavigationKeyEvent_GetCurrentFocus: { // wxNavigationKeyEvent::GetCurrentFocus
@@ -26080,7 +26119,7 @@ case wxHelpEvent_SetOrigin: { // wxHelpEvent::SetOrigin
wxHelpEvent *This = (wxHelpEvent *) getPtr(bp,memenv); bp += 4;
wxHelpEvent::Origin origin = *(wxHelpEvent::Origin *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->SetOrigin((wxHelpEvent::Origin) origin);
+ This->SetOrigin(origin);
break;
}
case wxHelpEvent_SetPosition: { // wxHelpEvent::SetPosition
@@ -26108,12 +26147,14 @@ case wxContextMenuEvent_SetPosition: { // wxContextMenuEvent::SetPosition
This->SetPosition(pos);
break;
}
+#if !wxCHECK_VERSION(2,9,0)
case wxIdleEvent_CanSend: { // wxIdleEvent::CanSend
wxWindow *win = (wxWindow *) getPtr(bp,memenv); bp += 4;
bool Result = wxIdleEvent::CanSend(win);
rt.addBool(Result);
break;
}
+#endif
case wxIdleEvent_GetMode: { // wxIdleEvent::GetMode
int Result = wxIdleEvent::GetMode();
rt.addInt(Result);
@@ -26141,7 +26182,7 @@ case wxIdleEvent_MoreRequested: { // wxIdleEvent::MoreRequested
}
case wxIdleEvent_SetMode: { // wxIdleEvent::SetMode
wxIdleMode mode = *(wxIdleMode *) bp; bp += 4;;
- wxIdleEvent::SetMode((wxIdleMode) mode);
+ wxIdleEvent::SetMode(mode);
break;
}
case wxGridEvent_AltDown: { // wxGridEvent::AltDown
@@ -26529,7 +26570,7 @@ case wxStyledTextEvent_GetAlt: { // wxStyledTextEvent::GetAlt
}
case utils_wxGetKeyState: { // utils::wxGetKeyState
wxKeyCode key = *(wxKeyCode *) bp; bp += 4;;
- bool Result = ::wxGetKeyState((wxKeyCode) key);
+ bool Result = ::wxGetKeyState(key);
rt.addBool(Result);
break;
}
@@ -26549,7 +26590,7 @@ case utils_wxGetMouseState: { // utils::wxGetMouseState
}
case utils_wxSetDetectableAutoRepeat: { // utils::wxSetDetectableAutoRepeat
bool * flag = (bool *) bp; bp += 4;
- bool Result = ::wxSetDetectableAutoRepeat((bool) *flag);
+ bool Result = ::wxSetDetectableAutoRepeat(*flag);
rt.addBool(Result);
break;
}
@@ -26606,7 +26647,7 @@ case utils_wxIsBusy: { // utils::wxIsBusy
}
case utils_wxShutdown: { // utils::wxShutdown
wxShutdownFlags wFlags = *(wxShutdownFlags *) bp; bp += 4;;
- bool Result = ::wxShutdown((wxShutdownFlags) wFlags);
+ bool Result = ::wxShutdown(wFlags);
rt.addBool(Result);
break;
}
@@ -26659,7 +26700,7 @@ case utils_wxNewId: { // utils::wxNewId
}
case utils_wxRegisterId: { // utils::wxRegisterId
int * id = (int *) bp; bp += 4;
- ::wxRegisterId((long) *id);
+ ::wxRegisterId(*id);
break;
}
case utils_wxGetCurrentId: { // utils::wxGetCurrentId
@@ -26862,7 +26903,7 @@ case wxPrintout_SetLogicalOrigin: { // wxPrintout::SetLogicalOrigin
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLogicalOrigin((wxCoord) *x,(wxCoord) *y);
+ This->SetLogicalOrigin(*x,*y);
break;
}
case wxPrintout_OffsetLogicalOrigin: { // wxPrintout::OffsetLogicalOrigin
@@ -26870,7 +26911,7 @@ case wxPrintout_OffsetLogicalOrigin: { // wxPrintout::OffsetLogicalOrigin
int * xoff = (int *) bp; bp += 4;
int * yoff = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->OffsetLogicalOrigin((wxCoord) *xoff,(wxCoord) *yoff);
+ This->OffsetLogicalOrigin(*xoff,*yoff);
break;
}
case wxStyledTextCtrl_new_2: { // wxStyledTextCtrl::wxStyledTextCtrl
@@ -26966,7 +27007,7 @@ case wxStyledTextCtrl_InsertText: { // wxStyledTextCtrl::InsertText
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->InsertText((int) *pos,text);
+ This->InsertText(*pos,text);
break;
}
case wxStyledTextCtrl_ClearAll: { // wxStyledTextCtrl::ClearAll
@@ -26992,7 +27033,7 @@ case wxStyledTextCtrl_GetCharAt: { // wxStyledTextCtrl::GetCharAt
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetCharAt((int) *pos);
+ int Result = This->GetCharAt(*pos);
rt.addInt(Result);
break;
}
@@ -27014,7 +27055,7 @@ case wxStyledTextCtrl_GetStyleAt: { // wxStyledTextCtrl::GetStyleAt
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetStyleAt((int) *pos);
+ int Result = This->GetStyleAt(*pos);
rt.addInt(Result);
break;
}
@@ -27028,7 +27069,7 @@ case wxStyledTextCtrl_SetUndoCollection: { // wxStyledTextCtrl::SetUndoCollectio
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * collectUndo = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetUndoCollection((bool) *collectUndo);
+ This->SetUndoCollection(*collectUndo);
break;
}
case wxStyledTextCtrl_SelectAll: { // wxStyledTextCtrl::SelectAll
@@ -27048,7 +27089,7 @@ case wxStyledTextCtrl_GetStyledText: { // wxStyledTextCtrl::GetStyledText
int * startPos = (int *) bp; bp += 4;
int * endPos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxMemoryBuffer * Result = new wxMemoryBuffer(This->GetStyledText((int) *startPos,(int) *endPos)); newPtr((void *) Result,3, memenv);;
+ wxMemoryBuffer * Result = new wxMemoryBuffer(This->GetStyledText(*startPos,*endPos)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxMemoryBuffer");
break;
}
@@ -27063,7 +27104,7 @@ case wxStyledTextCtrl_MarkerLineFromHandle: { // wxStyledTextCtrl::MarkerLineFro
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * handle = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->MarkerLineFromHandle((int) *handle);
+ int Result = This->MarkerLineFromHandle(*handle);
rt.addInt(Result);
break;
}
@@ -27071,7 +27112,7 @@ case wxStyledTextCtrl_MarkerDeleteHandle: { // wxStyledTextCtrl::MarkerDeleteHan
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * handle = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->MarkerDeleteHandle((int) *handle);
+ This->MarkerDeleteHandle(*handle);
break;
}
case wxStyledTextCtrl_GetUndoCollection: { // wxStyledTextCtrl::GetUndoCollection
@@ -27092,7 +27133,7 @@ case wxStyledTextCtrl_SetViewWhiteSpace: { // wxStyledTextCtrl::SetViewWhiteSpac
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * viewWS = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetViewWhiteSpace((int) *viewWS);
+ This->SetViewWhiteSpace(*viewWS);
break;
}
case wxStyledTextCtrl_PositionFromPoint: { // wxStyledTextCtrl::PositionFromPoint
@@ -27110,7 +27151,7 @@ case wxStyledTextCtrl_PositionFromPointClose: { // wxStyledTextCtrl::PositionFro
int * x = (int *) bp; bp += 4;
int * y = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->PositionFromPointClose((int) *x,(int) *y);
+ int Result = This->PositionFromPointClose(*x,*y);
rt.addInt(Result);
break;
}
@@ -27118,21 +27159,21 @@ case wxStyledTextCtrl_GotoLine: { // wxStyledTextCtrl::GotoLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->GotoLine((int) *line);
+ This->GotoLine(*line);
break;
}
case wxStyledTextCtrl_GotoPos: { // wxStyledTextCtrl::GotoPos
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->GotoPos((int) *pos);
+ This->GotoPos(*pos);
break;
}
case wxStyledTextCtrl_SetAnchor: { // wxStyledTextCtrl::SetAnchor
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * posAnchor = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetAnchor((int) *posAnchor);
+ This->SetAnchor(*posAnchor);
break;
}
case wxStyledTextCtrl_GetCurLine: { // wxStyledTextCtrl::GetCurLine
@@ -27156,7 +27197,7 @@ case wxStyledTextCtrl_ConvertEOLs: { // wxStyledTextCtrl::ConvertEOLs
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * eolMode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ConvertEOLs((int) *eolMode);
+ This->ConvertEOLs(*eolMode);
break;
}
case wxStyledTextCtrl_GetEOLMode: { // wxStyledTextCtrl::GetEOLMode
@@ -27170,7 +27211,7 @@ case wxStyledTextCtrl_SetEOLMode: { // wxStyledTextCtrl::SetEOLMode
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * eolMode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetEOLMode((int) *eolMode);
+ This->SetEOLMode(*eolMode);
break;
}
case wxStyledTextCtrl_StartStyling: { // wxStyledTextCtrl::StartStyling
@@ -27178,7 +27219,7 @@ case wxStyledTextCtrl_StartStyling: { // wxStyledTextCtrl::StartStyling
int * pos = (int *) bp; bp += 4;
int * mask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StartStyling((int) *pos,(int) *mask);
+ This->StartStyling(*pos,*mask);
break;
}
case wxStyledTextCtrl_SetStyling: { // wxStyledTextCtrl::SetStyling
@@ -27186,7 +27227,7 @@ case wxStyledTextCtrl_SetStyling: { // wxStyledTextCtrl::SetStyling
int * length = (int *) bp; bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStyling((int) *length,(int) *style);
+ This->SetStyling(*length,*style);
break;
}
case wxStyledTextCtrl_GetBufferedDraw: { // wxStyledTextCtrl::GetBufferedDraw
@@ -27200,14 +27241,14 @@ case wxStyledTextCtrl_SetBufferedDraw: { // wxStyledTextCtrl::SetBufferedDraw
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * buffered = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetBufferedDraw((bool) *buffered);
+ This->SetBufferedDraw(*buffered);
break;
}
case wxStyledTextCtrl_SetTabWidth: { // wxStyledTextCtrl::SetTabWidth
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * tabWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTabWidth((int) *tabWidth);
+ This->SetTabWidth(*tabWidth);
break;
}
case wxStyledTextCtrl_GetTabWidth: { // wxStyledTextCtrl::GetTabWidth
@@ -27221,7 +27262,7 @@ case wxStyledTextCtrl_SetCodePage: { // wxStyledTextCtrl::SetCodePage
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * codePage = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCodePage((int) *codePage);
+ This->SetCodePage(*codePage);
break;
}
case wxStyledTextCtrl_MarkerDefine: { // wxStyledTextCtrl::MarkerDefine
@@ -27250,7 +27291,7 @@ case wxStyledTextCtrl_MarkerDefine: { // wxStyledTextCtrl::MarkerDefine
} break;
}};
if(!This) throw wxe_badarg(0);
- This->MarkerDefine((int) *markerNumber,(int) *markerSymbol,foreground,background);
+ This->MarkerDefine(*markerNumber,*markerSymbol,foreground,background);
break;
}
case wxStyledTextCtrl_MarkerSetForeground: { // wxStyledTextCtrl::MarkerSetForeground
@@ -27262,7 +27303,7 @@ case wxStyledTextCtrl_MarkerSetForeground: { // wxStyledTextCtrl::MarkerSetForeg
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->MarkerSetForeground((int) *markerNumber,fore);
+ This->MarkerSetForeground(*markerNumber,fore);
break;
}
case wxStyledTextCtrl_MarkerSetBackground: { // wxStyledTextCtrl::MarkerSetBackground
@@ -27274,7 +27315,7 @@ case wxStyledTextCtrl_MarkerSetBackground: { // wxStyledTextCtrl::MarkerSetBackg
int * backA = (int *) bp; bp += 4;
wxColour back = wxColour(*backR,*backG,*backB,*backA);
if(!This) throw wxe_badarg(0);
- This->MarkerSetBackground((int) *markerNumber,back);
+ This->MarkerSetBackground(*markerNumber,back);
break;
}
case wxStyledTextCtrl_MarkerAdd: { // wxStyledTextCtrl::MarkerAdd
@@ -27282,7 +27323,7 @@ case wxStyledTextCtrl_MarkerAdd: { // wxStyledTextCtrl::MarkerAdd
int * line = (int *) bp; bp += 4;
int * markerNumber = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->MarkerAdd((int) *line,(int) *markerNumber);
+ int Result = This->MarkerAdd(*line,*markerNumber);
rt.addInt(Result);
break;
}
@@ -27291,21 +27332,21 @@ case wxStyledTextCtrl_MarkerDelete: { // wxStyledTextCtrl::MarkerDelete
int * line = (int *) bp; bp += 4;
int * markerNumber = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->MarkerDelete((int) *line,(int) *markerNumber);
+ This->MarkerDelete(*line,*markerNumber);
break;
}
case wxStyledTextCtrl_MarkerDeleteAll: { // wxStyledTextCtrl::MarkerDeleteAll
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * markerNumber = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->MarkerDeleteAll((int) *markerNumber);
+ This->MarkerDeleteAll(*markerNumber);
break;
}
case wxStyledTextCtrl_MarkerGet: { // wxStyledTextCtrl::MarkerGet
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->MarkerGet((int) *line);
+ int Result = This->MarkerGet(*line);
rt.addInt(Result);
break;
}
@@ -27314,7 +27355,7 @@ case wxStyledTextCtrl_MarkerNext: { // wxStyledTextCtrl::MarkerNext
int * lineStart = (int *) bp; bp += 4;
int * markerMask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->MarkerNext((int) *lineStart,(int) *markerMask);
+ int Result = This->MarkerNext(*lineStart,*markerMask);
rt.addInt(Result);
break;
}
@@ -27323,7 +27364,7 @@ case wxStyledTextCtrl_MarkerPrevious: { // wxStyledTextCtrl::MarkerPrevious
int * lineStart = (int *) bp; bp += 4;
int * markerMask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->MarkerPrevious((int) *lineStart,(int) *markerMask);
+ int Result = This->MarkerPrevious(*lineStart,*markerMask);
rt.addInt(Result);
break;
}
@@ -27332,7 +27373,7 @@ case wxStyledTextCtrl_MarkerDefineBitmap: { // wxStyledTextCtrl::MarkerDefineBit
int * markerNumber = (int *) bp; bp += 4;
wxBitmap *bmp = (wxBitmap *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->MarkerDefineBitmap((int) *markerNumber,*bmp);
+ This->MarkerDefineBitmap(*markerNumber,*bmp);
break;
}
case wxStyledTextCtrl_MarkerAddSet: { // wxStyledTextCtrl::MarkerAddSet
@@ -27340,7 +27381,7 @@ case wxStyledTextCtrl_MarkerAddSet: { // wxStyledTextCtrl::MarkerAddSet
int * line = (int *) bp; bp += 4;
int * set = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->MarkerAddSet((int) *line,(int) *set);
+ This->MarkerAddSet(*line,*set);
break;
}
case wxStyledTextCtrl_MarkerSetAlpha: { // wxStyledTextCtrl::MarkerSetAlpha
@@ -27348,7 +27389,7 @@ case wxStyledTextCtrl_MarkerSetAlpha: { // wxStyledTextCtrl::MarkerSetAlpha
int * markerNumber = (int *) bp; bp += 4;
int * alpha = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->MarkerSetAlpha((int) *markerNumber,(int) *alpha);
+ This->MarkerSetAlpha(*markerNumber,*alpha);
break;
}
case wxStyledTextCtrl_SetMarginType: { // wxStyledTextCtrl::SetMarginType
@@ -27356,14 +27397,14 @@ case wxStyledTextCtrl_SetMarginType: { // wxStyledTextCtrl::SetMarginType
int * margin = (int *) bp; bp += 4;
int * marginType = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMarginType((int) *margin,(int) *marginType);
+ This->SetMarginType(*margin,*marginType);
break;
}
case wxStyledTextCtrl_GetMarginType: { // wxStyledTextCtrl::GetMarginType
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * margin = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetMarginType((int) *margin);
+ int Result = This->GetMarginType(*margin);
rt.addInt(Result);
break;
}
@@ -27372,14 +27413,14 @@ case wxStyledTextCtrl_SetMarginWidth: { // wxStyledTextCtrl::SetMarginWidth
int * margin = (int *) bp; bp += 4;
int * pixelWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMarginWidth((int) *margin,(int) *pixelWidth);
+ This->SetMarginWidth(*margin,*pixelWidth);
break;
}
case wxStyledTextCtrl_GetMarginWidth: { // wxStyledTextCtrl::GetMarginWidth
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * margin = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetMarginWidth((int) *margin);
+ int Result = This->GetMarginWidth(*margin);
rt.addInt(Result);
break;
}
@@ -27388,14 +27429,14 @@ case wxStyledTextCtrl_SetMarginMask: { // wxStyledTextCtrl::SetMarginMask
int * margin = (int *) bp; bp += 4;
int * mask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMarginMask((int) *margin,(int) *mask);
+ This->SetMarginMask(*margin,*mask);
break;
}
case wxStyledTextCtrl_GetMarginMask: { // wxStyledTextCtrl::GetMarginMask
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * margin = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetMarginMask((int) *margin);
+ int Result = This->GetMarginMask(*margin);
rt.addInt(Result);
break;
}
@@ -27404,14 +27445,14 @@ case wxStyledTextCtrl_SetMarginSensitive: { // wxStyledTextCtrl::SetMarginSensit
int * margin = (int *) bp; bp += 4;
bool * sensitive = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMarginSensitive((int) *margin,(bool) *sensitive);
+ This->SetMarginSensitive(*margin,*sensitive);
break;
}
case wxStyledTextCtrl_GetMarginSensitive: { // wxStyledTextCtrl::GetMarginSensitive
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * margin = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetMarginSensitive((int) *margin);
+ bool Result = This->GetMarginSensitive(*margin);
rt.addBool(Result);
break;
}
@@ -27430,7 +27471,7 @@ case wxStyledTextCtrl_StyleSetForeground: { // wxStyledTextCtrl::StyleSetForegro
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->StyleSetForeground((int) *style,fore);
+ This->StyleSetForeground(*style,fore);
break;
}
case wxStyledTextCtrl_StyleSetBackground: { // wxStyledTextCtrl::StyleSetBackground
@@ -27442,7 +27483,7 @@ case wxStyledTextCtrl_StyleSetBackground: { // wxStyledTextCtrl::StyleSetBackgro
int * backA = (int *) bp; bp += 4;
wxColour back = wxColour(*backR,*backG,*backB,*backA);
if(!This) throw wxe_badarg(0);
- This->StyleSetBackground((int) *style,back);
+ This->StyleSetBackground(*style,back);
break;
}
case wxStyledTextCtrl_StyleSetBold: { // wxStyledTextCtrl::StyleSetBold
@@ -27450,7 +27491,7 @@ case wxStyledTextCtrl_StyleSetBold: { // wxStyledTextCtrl::StyleSetBold
int * style = (int *) bp; bp += 4;
bool * bold = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetBold((int) *style,(bool) *bold);
+ This->StyleSetBold(*style,*bold);
break;
}
case wxStyledTextCtrl_StyleSetItalic: { // wxStyledTextCtrl::StyleSetItalic
@@ -27458,7 +27499,7 @@ case wxStyledTextCtrl_StyleSetItalic: { // wxStyledTextCtrl::StyleSetItalic
int * style = (int *) bp; bp += 4;
bool * italic = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetItalic((int) *style,(bool) *italic);
+ This->StyleSetItalic(*style,*italic);
break;
}
case wxStyledTextCtrl_StyleSetSize: { // wxStyledTextCtrl::StyleSetSize
@@ -27466,7 +27507,7 @@ case wxStyledTextCtrl_StyleSetSize: { // wxStyledTextCtrl::StyleSetSize
int * style = (int *) bp; bp += 4;
int * sizePoints = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetSize((int) *style,(int) *sizePoints);
+ This->StyleSetSize(*style,*sizePoints);
break;
}
case wxStyledTextCtrl_StyleSetFaceName: { // wxStyledTextCtrl::StyleSetFaceName
@@ -27476,7 +27517,7 @@ case wxStyledTextCtrl_StyleSetFaceName: { // wxStyledTextCtrl::StyleSetFaceName
wxString fontName = wxString(bp, wxConvUTF8);
bp += *fontNameLen+((8-((4+ *fontNameLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->StyleSetFaceName((int) *style,fontName);
+ This->StyleSetFaceName(*style,fontName);
break;
}
case wxStyledTextCtrl_StyleSetEOLFilled: { // wxStyledTextCtrl::StyleSetEOLFilled
@@ -27484,7 +27525,7 @@ case wxStyledTextCtrl_StyleSetEOLFilled: { // wxStyledTextCtrl::StyleSetEOLFille
int * style = (int *) bp; bp += 4;
bool * filled = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetEOLFilled((int) *style,(bool) *filled);
+ This->StyleSetEOLFilled(*style,*filled);
break;
}
case wxStyledTextCtrl_StyleResetDefault: { // wxStyledTextCtrl::StyleResetDefault
@@ -27498,7 +27539,7 @@ case wxStyledTextCtrl_StyleSetUnderline: { // wxStyledTextCtrl::StyleSetUnderlin
int * style = (int *) bp; bp += 4;
bool * underline = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetUnderline((int) *style,(bool) *underline);
+ This->StyleSetUnderline(*style,*underline);
break;
}
case wxStyledTextCtrl_StyleSetCase: { // wxStyledTextCtrl::StyleSetCase
@@ -27506,7 +27547,7 @@ case wxStyledTextCtrl_StyleSetCase: { // wxStyledTextCtrl::StyleSetCase
int * style = (int *) bp; bp += 4;
int * caseForce = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetCase((int) *style,(int) *caseForce);
+ This->StyleSetCase(*style,*caseForce);
break;
}
case wxStyledTextCtrl_StyleSetHotSpot: { // wxStyledTextCtrl::StyleSetHotSpot
@@ -27514,7 +27555,7 @@ case wxStyledTextCtrl_StyleSetHotSpot: { // wxStyledTextCtrl::StyleSetHotSpot
int * style = (int *) bp; bp += 4;
bool * hotspot = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetHotSpot((int) *style,(bool) *hotspot);
+ This->StyleSetHotSpot(*style,*hotspot);
break;
}
case wxStyledTextCtrl_SetSelForeground: { // wxStyledTextCtrl::SetSelForeground
@@ -27526,7 +27567,7 @@ case wxStyledTextCtrl_SetSelForeground: { // wxStyledTextCtrl::SetSelForeground
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->SetSelForeground((bool) *useSetting,fore);
+ This->SetSelForeground(*useSetting,fore);
break;
}
case wxStyledTextCtrl_SetSelBackground: { // wxStyledTextCtrl::SetSelBackground
@@ -27538,7 +27579,7 @@ case wxStyledTextCtrl_SetSelBackground: { // wxStyledTextCtrl::SetSelBackground
int * backA = (int *) bp; bp += 4;
wxColour back = wxColour(*backR,*backG,*backB,*backA);
if(!This) throw wxe_badarg(0);
- This->SetSelBackground((bool) *useSetting,back);
+ This->SetSelBackground(*useSetting,back);
break;
}
case wxStyledTextCtrl_GetSelAlpha: { // wxStyledTextCtrl::GetSelAlpha
@@ -27552,7 +27593,7 @@ case wxStyledTextCtrl_SetSelAlpha: { // wxStyledTextCtrl::SetSelAlpha
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * alpha = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelAlpha((int) *alpha);
+ This->SetSelAlpha(*alpha);
break;
}
case wxStyledTextCtrl_SetCaretForeground: { // wxStyledTextCtrl::SetCaretForeground
@@ -27572,7 +27613,7 @@ case wxStyledTextCtrl_CmdKeyAssign: { // wxStyledTextCtrl::CmdKeyAssign
int * modifiers = (int *) bp; bp += 4;
int * cmd = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CmdKeyAssign((int) *key,(int) *modifiers,(int) *cmd);
+ This->CmdKeyAssign(*key,*modifiers,*cmd);
break;
}
case wxStyledTextCtrl_CmdKeyClear: { // wxStyledTextCtrl::CmdKeyClear
@@ -27580,7 +27621,7 @@ case wxStyledTextCtrl_CmdKeyClear: { // wxStyledTextCtrl::CmdKeyClear
int * key = (int *) bp; bp += 4;
int * modifiers = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CmdKeyClear((int) *key,(int) *modifiers);
+ This->CmdKeyClear(*key,*modifiers);
break;
}
case wxStyledTextCtrl_CmdKeyClearAll: { // wxStyledTextCtrl::CmdKeyClearAll
@@ -27594,7 +27635,7 @@ case wxStyledTextCtrl_SetStyleBytes: { // wxStyledTextCtrl::SetStyleBytes
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * length = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStyleBytes((int) *length,&styleBytes);
+ This->SetStyleBytes(*length,&styleBytes);
rt.addInt(styleBytes);
break;
}
@@ -27603,7 +27644,7 @@ case wxStyledTextCtrl_StyleSetVisible: { // wxStyledTextCtrl::StyleSetVisible
int * style = (int *) bp; bp += 4;
bool * visible = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetVisible((int) *style,(bool) *visible);
+ This->StyleSetVisible(*style,*visible);
break;
}
case wxStyledTextCtrl_GetCaretPeriod: { // wxStyledTextCtrl::GetCaretPeriod
@@ -27617,7 +27658,7 @@ case wxStyledTextCtrl_SetCaretPeriod: { // wxStyledTextCtrl::SetCaretPeriod
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * periodMilliseconds = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCaretPeriod((int) *periodMilliseconds);
+ This->SetCaretPeriod(*periodMilliseconds);
break;
}
case wxStyledTextCtrl_SetWordChars: { // wxStyledTextCtrl::SetWordChars
@@ -27646,14 +27687,14 @@ case wxStyledTextCtrl_IndicatorSetStyle: { // wxStyledTextCtrl::IndicatorSetStyl
int * indic = (int *) bp; bp += 4;
int * style = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->IndicatorSetStyle((int) *indic,(int) *style);
+ This->IndicatorSetStyle(*indic,*style);
break;
}
case wxStyledTextCtrl_IndicatorGetStyle: { // wxStyledTextCtrl::IndicatorGetStyle
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * indic = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->IndicatorGetStyle((int) *indic);
+ int Result = This->IndicatorGetStyle(*indic);
rt.addInt(Result);
break;
}
@@ -27666,14 +27707,14 @@ case wxStyledTextCtrl_IndicatorSetForeground: { // wxStyledTextCtrl::IndicatorSe
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->IndicatorSetForeground((int) *indic,fore);
+ This->IndicatorSetForeground(*indic,fore);
break;
}
case wxStyledTextCtrl_IndicatorGetForeground: { // wxStyledTextCtrl::IndicatorGetForeground
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * indic = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxColour Result = This->IndicatorGetForeground((int) *indic);
+ wxColour Result = This->IndicatorGetForeground(*indic);
rt.add(Result);
break;
}
@@ -27686,7 +27727,7 @@ case wxStyledTextCtrl_SetWhitespaceForeground: { // wxStyledTextCtrl::SetWhitesp
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->SetWhitespaceForeground((bool) *useSetting,fore);
+ This->SetWhitespaceForeground(*useSetting,fore);
break;
}
case wxStyledTextCtrl_SetWhitespaceBackground: { // wxStyledTextCtrl::SetWhitespaceBackground
@@ -27698,7 +27739,7 @@ case wxStyledTextCtrl_SetWhitespaceBackground: { // wxStyledTextCtrl::SetWhitesp
int * backA = (int *) bp; bp += 4;
wxColour back = wxColour(*backR,*backG,*backB,*backA);
if(!This) throw wxe_badarg(0);
- This->SetWhitespaceBackground((bool) *useSetting,back);
+ This->SetWhitespaceBackground(*useSetting,back);
break;
}
case wxStyledTextCtrl_GetStyleBits: { // wxStyledTextCtrl::GetStyleBits
@@ -27713,14 +27754,14 @@ case wxStyledTextCtrl_SetLineState: { // wxStyledTextCtrl::SetLineState
int * line = (int *) bp; bp += 4;
int * state = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLineState((int) *line,(int) *state);
+ This->SetLineState(*line,*state);
break;
}
case wxStyledTextCtrl_GetLineState: { // wxStyledTextCtrl::GetLineState
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetLineState((int) *line);
+ int Result = This->GetLineState(*line);
rt.addInt(Result);
break;
}
@@ -27742,7 +27783,7 @@ case wxStyledTextCtrl_SetCaretLineVisible: { // wxStyledTextCtrl::SetCaretLineVi
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCaretLineVisible((bool) *show);
+ This->SetCaretLineVisible(*show);
break;
}
case wxStyledTextCtrl_GetCaretLineBackground: { // wxStyledTextCtrl::GetCaretLineBackground
@@ -27770,7 +27811,7 @@ case wxStyledTextCtrl_AutoCompShow: { // wxStyledTextCtrl::AutoCompShow
wxString itemList = wxString(bp, wxConvUTF8);
bp += *itemListLen+((8-((4+ *itemListLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->AutoCompShow((int) *lenEntered,itemList);
+ This->AutoCompShow(*lenEntered,itemList);
break;
}
case wxStyledTextCtrl_AutoCompCancel: { // wxStyledTextCtrl::AutoCompCancel
@@ -27812,7 +27853,7 @@ case wxStyledTextCtrl_AutoCompSetSeparator: { // wxStyledTextCtrl::AutoCompSetSe
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * separatorCharacter = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetSeparator((int) *separatorCharacter);
+ This->AutoCompSetSeparator(*separatorCharacter);
break;
}
case wxStyledTextCtrl_AutoCompGetSeparator: { // wxStyledTextCtrl::AutoCompGetSeparator
@@ -27835,7 +27876,7 @@ case wxStyledTextCtrl_AutoCompSetCancelAtStart: { // wxStyledTextCtrl::AutoCompS
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * cancel = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetCancelAtStart((bool) *cancel);
+ This->AutoCompSetCancelAtStart(*cancel);
break;
}
case wxStyledTextCtrl_AutoCompGetCancelAtStart: { // wxStyledTextCtrl::AutoCompGetCancelAtStart
@@ -27858,7 +27899,7 @@ case wxStyledTextCtrl_AutoCompSetChooseSingle: { // wxStyledTextCtrl::AutoCompSe
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * chooseSingle = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetChooseSingle((bool) *chooseSingle);
+ This->AutoCompSetChooseSingle(*chooseSingle);
break;
}
case wxStyledTextCtrl_AutoCompGetChooseSingle: { // wxStyledTextCtrl::AutoCompGetChooseSingle
@@ -27872,7 +27913,7 @@ case wxStyledTextCtrl_AutoCompSetIgnoreCase: { // wxStyledTextCtrl::AutoCompSetI
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * ignoreCase = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetIgnoreCase((bool) *ignoreCase);
+ This->AutoCompSetIgnoreCase(*ignoreCase);
break;
}
case wxStyledTextCtrl_AutoCompGetIgnoreCase: { // wxStyledTextCtrl::AutoCompGetIgnoreCase
@@ -27889,14 +27930,14 @@ case wxStyledTextCtrl_UserListShow: { // wxStyledTextCtrl::UserListShow
wxString itemList = wxString(bp, wxConvUTF8);
bp += *itemListLen+((8-((4+ *itemListLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->UserListShow((int) *listType,itemList);
+ This->UserListShow(*listType,itemList);
break;
}
case wxStyledTextCtrl_AutoCompSetAutoHide: { // wxStyledTextCtrl::AutoCompSetAutoHide
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * autoHide = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetAutoHide((bool) *autoHide);
+ This->AutoCompSetAutoHide(*autoHide);
break;
}
case wxStyledTextCtrl_AutoCompGetAutoHide: { // wxStyledTextCtrl::AutoCompGetAutoHide
@@ -27910,7 +27951,7 @@ case wxStyledTextCtrl_AutoCompSetDropRestOfWord: { // wxStyledTextCtrl::AutoComp
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * dropRestOfWord = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetDropRestOfWord((bool) *dropRestOfWord);
+ This->AutoCompSetDropRestOfWord(*dropRestOfWord);
break;
}
case wxStyledTextCtrl_AutoCompGetDropRestOfWord: { // wxStyledTextCtrl::AutoCompGetDropRestOfWord
@@ -27925,7 +27966,7 @@ case wxStyledTextCtrl_RegisterImage: { // wxStyledTextCtrl::RegisterImage
int * type = (int *) bp; bp += 4;
wxBitmap *bmp = (wxBitmap *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->RegisterImage((int) *type,*bmp);
+ This->RegisterImage(*type,*bmp);
break;
}
case wxStyledTextCtrl_ClearRegisteredImages: { // wxStyledTextCtrl::ClearRegisteredImages
@@ -27945,14 +27986,14 @@ case wxStyledTextCtrl_AutoCompSetTypeSeparator: { // wxStyledTextCtrl::AutoCompS
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * separatorCharacter = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetTypeSeparator((int) *separatorCharacter);
+ This->AutoCompSetTypeSeparator(*separatorCharacter);
break;
}
case wxStyledTextCtrl_AutoCompSetMaxWidth: { // wxStyledTextCtrl::AutoCompSetMaxWidth
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * characterCount = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetMaxWidth((int) *characterCount);
+ This->AutoCompSetMaxWidth(*characterCount);
break;
}
case wxStyledTextCtrl_AutoCompGetMaxWidth: { // wxStyledTextCtrl::AutoCompGetMaxWidth
@@ -27966,7 +28007,7 @@ case wxStyledTextCtrl_AutoCompSetMaxHeight: { // wxStyledTextCtrl::AutoCompSetMa
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * rowCount = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->AutoCompSetMaxHeight((int) *rowCount);
+ This->AutoCompSetMaxHeight(*rowCount);
break;
}
case wxStyledTextCtrl_AutoCompGetMaxHeight: { // wxStyledTextCtrl::AutoCompGetMaxHeight
@@ -27980,7 +28021,7 @@ case wxStyledTextCtrl_SetIndent: { // wxStyledTextCtrl::SetIndent
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * indentSize = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetIndent((int) *indentSize);
+ This->SetIndent(*indentSize);
break;
}
case wxStyledTextCtrl_GetIndent: { // wxStyledTextCtrl::GetIndent
@@ -27994,7 +28035,7 @@ case wxStyledTextCtrl_SetUseTabs: { // wxStyledTextCtrl::SetUseTabs
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * useTabs = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetUseTabs((bool) *useTabs);
+ This->SetUseTabs(*useTabs);
break;
}
case wxStyledTextCtrl_GetUseTabs: { // wxStyledTextCtrl::GetUseTabs
@@ -28009,14 +28050,14 @@ case wxStyledTextCtrl_SetLineIndentation: { // wxStyledTextCtrl::SetLineIndentat
int * line = (int *) bp; bp += 4;
int * indentSize = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLineIndentation((int) *line,(int) *indentSize);
+ This->SetLineIndentation(*line,*indentSize);
break;
}
case wxStyledTextCtrl_GetLineIndentation: { // wxStyledTextCtrl::GetLineIndentation
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetLineIndentation((int) *line);
+ int Result = This->GetLineIndentation(*line);
rt.addInt(Result);
break;
}
@@ -28024,7 +28065,7 @@ case wxStyledTextCtrl_GetLineIndentPosition: { // wxStyledTextCtrl::GetLineInden
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetLineIndentPosition((int) *line);
+ int Result = This->GetLineIndentPosition(*line);
rt.addInt(Result);
break;
}
@@ -28032,7 +28073,7 @@ case wxStyledTextCtrl_GetColumn: { // wxStyledTextCtrl::GetColumn
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetColumn((int) *pos);
+ int Result = This->GetColumn(*pos);
rt.addInt(Result);
break;
}
@@ -28040,7 +28081,7 @@ case wxStyledTextCtrl_SetUseHorizontalScrollBar: { // wxStyledTextCtrl::SetUseHo
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetUseHorizontalScrollBar((bool) *show);
+ This->SetUseHorizontalScrollBar(*show);
break;
}
case wxStyledTextCtrl_GetUseHorizontalScrollBar: { // wxStyledTextCtrl::GetUseHorizontalScrollBar
@@ -28054,7 +28095,7 @@ case wxStyledTextCtrl_SetIndentationGuides: { // wxStyledTextCtrl::SetIndentatio
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetIndentationGuides((bool) *show);
+ This->SetIndentationGuides(*show);
break;
}
case wxStyledTextCtrl_GetIndentationGuides: { // wxStyledTextCtrl::GetIndentationGuides
@@ -28068,7 +28109,7 @@ case wxStyledTextCtrl_SetHighlightGuide: { // wxStyledTextCtrl::SetHighlightGuid
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * column = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHighlightGuide((int) *column);
+ This->SetHighlightGuide(*column);
break;
}
case wxStyledTextCtrl_GetHighlightGuide: { // wxStyledTextCtrl::GetHighlightGuide
@@ -28082,7 +28123,7 @@ case wxStyledTextCtrl_GetLineEndPosition: { // wxStyledTextCtrl::GetLineEndPosit
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetLineEndPosition((int) *line);
+ int Result = This->GetLineEndPosition(*line);
rt.addInt(Result);
break;
}
@@ -28111,14 +28152,14 @@ case wxStyledTextCtrl_SetCurrentPos: { // wxStyledTextCtrl::SetCurrentPos
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCurrentPos((int) *pos);
+ This->SetCurrentPos(*pos);
break;
}
case wxStyledTextCtrl_SetSelectionStart: { // wxStyledTextCtrl::SetSelectionStart
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelectionStart((int) *pos);
+ This->SetSelectionStart(*pos);
break;
}
case wxStyledTextCtrl_GetSelectionStart: { // wxStyledTextCtrl::GetSelectionStart
@@ -28132,7 +28173,7 @@ case wxStyledTextCtrl_SetSelectionEnd: { // wxStyledTextCtrl::SetSelectionEnd
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelectionEnd((int) *pos);
+ This->SetSelectionEnd(*pos);
break;
}
case wxStyledTextCtrl_GetSelectionEnd: { // wxStyledTextCtrl::GetSelectionEnd
@@ -28146,7 +28187,7 @@ case wxStyledTextCtrl_SetPrintMagnification: { // wxStyledTextCtrl::SetPrintMagn
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * magnification = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPrintMagnification((int) *magnification);
+ This->SetPrintMagnification(*magnification);
break;
}
case wxStyledTextCtrl_GetPrintMagnification: { // wxStyledTextCtrl::GetPrintMagnification
@@ -28160,7 +28201,7 @@ case wxStyledTextCtrl_SetPrintColourMode: { // wxStyledTextCtrl::SetPrintColourM
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPrintColourMode((int) *mode);
+ This->SetPrintColourMode(*mode);
break;
}
case wxStyledTextCtrl_GetPrintColourMode: { // wxStyledTextCtrl::GetPrintColourMode
@@ -28184,7 +28225,7 @@ case wxStyledTextCtrl_FindText: { // wxStyledTextCtrl::FindText
} break;
}};
if(!This) throw wxe_badarg(0);
- int Result = This->FindText((int) *minPos,(int) *maxPos,text,flags);
+ int Result = This->FindText(*minPos,*maxPos,text,flags);
rt.addInt(Result);
break;
}
@@ -28206,7 +28247,7 @@ case wxStyledTextCtrl_FormatRange: { // wxStyledTextCtrl::FormatRange
int * pageRectH = (int *) bp; bp += 4;
wxRect pageRect = wxRect(*pageRectX,*pageRectY,*pageRectW,*pageRectH);
if(!This) throw wxe_badarg(0);
- int Result = This->FormatRange((bool) *doDraw,(int) *startPos,(int) *endPos,draw,target,renderRect,pageRect);
+ int Result = This->FormatRange(*doDraw,*startPos,*endPos,draw,target,renderRect,pageRect);
rt.addInt(Result);
break;
}
@@ -28221,7 +28262,7 @@ case wxStyledTextCtrl_GetLine: { // wxStyledTextCtrl::GetLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetLine((int) *line);
+ wxString Result = This->GetLine(*line);
rt.add(Result);
break;
}
@@ -28236,7 +28277,7 @@ case wxStyledTextCtrl_SetMarginLeft: { // wxStyledTextCtrl::SetMarginLeft
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pixelWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMarginLeft((int) *pixelWidth);
+ This->SetMarginLeft(*pixelWidth);
break;
}
case wxStyledTextCtrl_GetMarginLeft: { // wxStyledTextCtrl::GetMarginLeft
@@ -28250,7 +28291,7 @@ case wxStyledTextCtrl_SetMarginRight: { // wxStyledTextCtrl::SetMarginRight
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pixelWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMarginRight((int) *pixelWidth);
+ This->SetMarginRight(*pixelWidth);
break;
}
case wxStyledTextCtrl_GetMarginRight: { // wxStyledTextCtrl::GetMarginRight
@@ -28272,7 +28313,7 @@ case wxStyledTextCtrl_SetSelection: { // wxStyledTextCtrl::SetSelection
int * start = (int *) bp; bp += 4;
int * end = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *start,(int) *end);
+ This->SetSelection(*start,*end);
break;
}
case wxStyledTextCtrl_GetSelectedText: { // wxStyledTextCtrl::GetSelectedText
@@ -28287,7 +28328,7 @@ case wxStyledTextCtrl_GetTextRange: { // wxStyledTextCtrl::GetTextRange
int * startPos = (int *) bp; bp += 4;
int * endPos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxString Result = This->GetTextRange((int) *startPos,(int) *endPos);
+ wxString Result = This->GetTextRange(*startPos,*endPos);
rt.add(Result);
break;
}
@@ -28295,14 +28336,14 @@ case wxStyledTextCtrl_HideSelection: { // wxStyledTextCtrl::HideSelection
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * normal = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->HideSelection((bool) *normal);
+ This->HideSelection(*normal);
break;
}
case wxStyledTextCtrl_LineFromPosition: { // wxStyledTextCtrl::LineFromPosition
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->LineFromPosition((int) *pos);
+ int Result = This->LineFromPosition(*pos);
rt.addInt(Result);
break;
}
@@ -28310,7 +28351,7 @@ case wxStyledTextCtrl_PositionFromLine: { // wxStyledTextCtrl::PositionFromLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->PositionFromLine((int) *line);
+ int Result = This->PositionFromLine(*line);
rt.addInt(Result);
break;
}
@@ -28319,7 +28360,7 @@ case wxStyledTextCtrl_LineScroll: { // wxStyledTextCtrl::LineScroll
int * columns = (int *) bp; bp += 4;
int * lines = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->LineScroll((int) *columns,(int) *lines);
+ This->LineScroll(*columns,*lines);
break;
}
case wxStyledTextCtrl_EnsureCaretVisible: { // wxStyledTextCtrl::EnsureCaretVisible
@@ -28341,7 +28382,7 @@ case wxStyledTextCtrl_SetReadOnly: { // wxStyledTextCtrl::SetReadOnly
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * readOnly = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetReadOnly((bool) *readOnly);
+ This->SetReadOnly(*readOnly);
break;
}
case wxStyledTextCtrl_CanPaste: { // wxStyledTextCtrl::CanPaste
@@ -28428,7 +28469,7 @@ case wxStyledTextCtrl_SetCaretWidth: { // wxStyledTextCtrl::SetCaretWidth
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pixelWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCaretWidth((int) *pixelWidth);
+ This->SetCaretWidth(*pixelWidth);
break;
}
case wxStyledTextCtrl_GetCaretWidth: { // wxStyledTextCtrl::GetCaretWidth
@@ -28442,7 +28483,7 @@ case wxStyledTextCtrl_SetTargetStart: { // wxStyledTextCtrl::SetTargetStart
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTargetStart((int) *pos);
+ This->SetTargetStart(*pos);
break;
}
case wxStyledTextCtrl_GetTargetStart: { // wxStyledTextCtrl::GetTargetStart
@@ -28456,7 +28497,7 @@ case wxStyledTextCtrl_SetTargetEnd: { // wxStyledTextCtrl::SetTargetEnd
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTargetEnd((int) *pos);
+ This->SetTargetEnd(*pos);
break;
}
case wxStyledTextCtrl_GetTargetEnd: { // wxStyledTextCtrl::GetTargetEnd
@@ -28490,7 +28531,7 @@ case wxStyledTextCtrl_SetSearchFlags: { // wxStyledTextCtrl::SetSearchFlags
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * flags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSearchFlags((int) *flags);
+ This->SetSearchFlags(*flags);
break;
}
case wxStyledTextCtrl_GetSearchFlags: { // wxStyledTextCtrl::GetSearchFlags
@@ -28507,7 +28548,7 @@ case wxStyledTextCtrl_CallTipShow: { // wxStyledTextCtrl::CallTipShow
wxString definition = wxString(bp, wxConvUTF8);
bp += *definitionLen+((8-((4+ *definitionLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->CallTipShow((int) *pos,definition);
+ This->CallTipShow(*pos,definition);
break;
}
case wxStyledTextCtrl_CallTipCancel: { // wxStyledTextCtrl::CallTipCancel
@@ -28535,7 +28576,7 @@ case wxStyledTextCtrl_CallTipSetHighlight: { // wxStyledTextCtrl::CallTipSetHigh
int * start = (int *) bp; bp += 4;
int * end = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CallTipSetHighlight((int) *start,(int) *end);
+ This->CallTipSetHighlight(*start,*end);
break;
}
case wxStyledTextCtrl_CallTipSetBackground: { // wxStyledTextCtrl::CallTipSetBackground
@@ -28575,14 +28616,14 @@ case wxStyledTextCtrl_CallTipUseStyle: { // wxStyledTextCtrl::CallTipUseStyle
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * tabSize = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CallTipUseStyle((int) *tabSize);
+ This->CallTipUseStyle(*tabSize);
break;
}
case wxStyledTextCtrl_VisibleFromDocLine: { // wxStyledTextCtrl::VisibleFromDocLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->VisibleFromDocLine((int) *line);
+ int Result = This->VisibleFromDocLine(*line);
rt.addInt(Result);
break;
}
@@ -28590,7 +28631,7 @@ case wxStyledTextCtrl_DocLineFromVisible: { // wxStyledTextCtrl::DocLineFromVisi
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * lineDisplay = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->DocLineFromVisible((int) *lineDisplay);
+ int Result = This->DocLineFromVisible(*lineDisplay);
rt.addInt(Result);
break;
}
@@ -28598,7 +28639,7 @@ case wxStyledTextCtrl_WrapCount: { // wxStyledTextCtrl::WrapCount
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->WrapCount((int) *line);
+ int Result = This->WrapCount(*line);
rt.addInt(Result);
break;
}
@@ -28607,14 +28648,14 @@ case wxStyledTextCtrl_SetFoldLevel: { // wxStyledTextCtrl::SetFoldLevel
int * line = (int *) bp; bp += 4;
int * level = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFoldLevel((int) *line,(int) *level);
+ This->SetFoldLevel(*line,*level);
break;
}
case wxStyledTextCtrl_GetFoldLevel: { // wxStyledTextCtrl::GetFoldLevel
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetFoldLevel((int) *line);
+ int Result = This->GetFoldLevel(*line);
rt.addInt(Result);
break;
}
@@ -28623,7 +28664,7 @@ case wxStyledTextCtrl_GetLastChild: { // wxStyledTextCtrl::GetLastChild
int * line = (int *) bp; bp += 4;
int * level = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetLastChild((int) *line,(int) *level);
+ int Result = This->GetLastChild(*line,*level);
rt.addInt(Result);
break;
}
@@ -28631,7 +28672,7 @@ case wxStyledTextCtrl_GetFoldParent: { // wxStyledTextCtrl::GetFoldParent
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->GetFoldParent((int) *line);
+ int Result = This->GetFoldParent(*line);
rt.addInt(Result);
break;
}
@@ -28640,7 +28681,7 @@ case wxStyledTextCtrl_ShowLines: { // wxStyledTextCtrl::ShowLines
int * lineStart = (int *) bp; bp += 4;
int * lineEnd = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ShowLines((int) *lineStart,(int) *lineEnd);
+ This->ShowLines(*lineStart,*lineEnd);
break;
}
case wxStyledTextCtrl_HideLines: { // wxStyledTextCtrl::HideLines
@@ -28648,14 +28689,14 @@ case wxStyledTextCtrl_HideLines: { // wxStyledTextCtrl::HideLines
int * lineStart = (int *) bp; bp += 4;
int * lineEnd = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->HideLines((int) *lineStart,(int) *lineEnd);
+ This->HideLines(*lineStart,*lineEnd);
break;
}
case wxStyledTextCtrl_GetLineVisible: { // wxStyledTextCtrl::GetLineVisible
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetLineVisible((int) *line);
+ bool Result = This->GetLineVisible(*line);
rt.addBool(Result);
break;
}
@@ -28664,14 +28705,14 @@ case wxStyledTextCtrl_SetFoldExpanded: { // wxStyledTextCtrl::SetFoldExpanded
int * line = (int *) bp; bp += 4;
bool * expanded = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFoldExpanded((int) *line,(bool) *expanded);
+ This->SetFoldExpanded(*line,*expanded);
break;
}
case wxStyledTextCtrl_GetFoldExpanded: { // wxStyledTextCtrl::GetFoldExpanded
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- bool Result = This->GetFoldExpanded((int) *line);
+ bool Result = This->GetFoldExpanded(*line);
rt.addBool(Result);
break;
}
@@ -28679,35 +28720,35 @@ case wxStyledTextCtrl_ToggleFold: { // wxStyledTextCtrl::ToggleFold
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ToggleFold((int) *line);
+ This->ToggleFold(*line);
break;
}
case wxStyledTextCtrl_EnsureVisible: { // wxStyledTextCtrl::EnsureVisible
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnsureVisible((int) *line);
+ This->EnsureVisible(*line);
break;
}
case wxStyledTextCtrl_SetFoldFlags: { // wxStyledTextCtrl::SetFoldFlags
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * flags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetFoldFlags((int) *flags);
+ This->SetFoldFlags(*flags);
break;
}
case wxStyledTextCtrl_EnsureVisibleEnforcePolicy: { // wxStyledTextCtrl::EnsureVisibleEnforcePolicy
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->EnsureVisibleEnforcePolicy((int) *line);
+ This->EnsureVisibleEnforcePolicy(*line);
break;
}
case wxStyledTextCtrl_SetTabIndents: { // wxStyledTextCtrl::SetTabIndents
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * tabIndents = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTabIndents((bool) *tabIndents);
+ This->SetTabIndents(*tabIndents);
break;
}
case wxStyledTextCtrl_GetTabIndents: { // wxStyledTextCtrl::GetTabIndents
@@ -28721,7 +28762,7 @@ case wxStyledTextCtrl_SetBackSpaceUnIndents: { // wxStyledTextCtrl::SetBackSpace
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * bsUnIndents = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetBackSpaceUnIndents((bool) *bsUnIndents);
+ This->SetBackSpaceUnIndents(*bsUnIndents);
break;
}
case wxStyledTextCtrl_GetBackSpaceUnIndents: { // wxStyledTextCtrl::GetBackSpaceUnIndents
@@ -28735,7 +28776,7 @@ case wxStyledTextCtrl_SetMouseDwellTime: { // wxStyledTextCtrl::SetMouseDwellTim
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * periodMilliseconds = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMouseDwellTime((int) *periodMilliseconds);
+ This->SetMouseDwellTime(*periodMilliseconds);
break;
}
case wxStyledTextCtrl_GetMouseDwellTime: { // wxStyledTextCtrl::GetMouseDwellTime
@@ -28750,7 +28791,7 @@ case wxStyledTextCtrl_WordStartPosition: { // wxStyledTextCtrl::WordStartPositio
int * pos = (int *) bp; bp += 4;
bool * onlyWordCharacters = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->WordStartPosition((int) *pos,(bool) *onlyWordCharacters);
+ int Result = This->WordStartPosition(*pos,*onlyWordCharacters);
rt.addInt(Result);
break;
}
@@ -28759,7 +28800,7 @@ case wxStyledTextCtrl_WordEndPosition: { // wxStyledTextCtrl::WordEndPosition
int * pos = (int *) bp; bp += 4;
bool * onlyWordCharacters = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->WordEndPosition((int) *pos,(bool) *onlyWordCharacters);
+ int Result = This->WordEndPosition(*pos,*onlyWordCharacters);
rt.addInt(Result);
break;
}
@@ -28767,7 +28808,7 @@ case wxStyledTextCtrl_SetWrapMode: { // wxStyledTextCtrl::SetWrapMode
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWrapMode((int) *mode);
+ This->SetWrapMode(*mode);
break;
}
case wxStyledTextCtrl_GetWrapMode: { // wxStyledTextCtrl::GetWrapMode
@@ -28781,7 +28822,7 @@ case wxStyledTextCtrl_SetWrapVisualFlags: { // wxStyledTextCtrl::SetWrapVisualFl
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * wrapVisualFlags = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWrapVisualFlags((int) *wrapVisualFlags);
+ This->SetWrapVisualFlags(*wrapVisualFlags);
break;
}
case wxStyledTextCtrl_GetWrapVisualFlags: { // wxStyledTextCtrl::GetWrapVisualFlags
@@ -28795,7 +28836,7 @@ case wxStyledTextCtrl_SetWrapVisualFlagsLocation: { // wxStyledTextCtrl::SetWrap
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * wrapVisualFlagsLocation = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWrapVisualFlagsLocation((int) *wrapVisualFlagsLocation);
+ This->SetWrapVisualFlagsLocation(*wrapVisualFlagsLocation);
break;
}
case wxStyledTextCtrl_GetWrapVisualFlagsLocation: { // wxStyledTextCtrl::GetWrapVisualFlagsLocation
@@ -28809,7 +28850,7 @@ case wxStyledTextCtrl_SetWrapStartIndent: { // wxStyledTextCtrl::SetWrapStartInd
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * indent = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetWrapStartIndent((int) *indent);
+ This->SetWrapStartIndent(*indent);
break;
}
case wxStyledTextCtrl_GetWrapStartIndent: { // wxStyledTextCtrl::GetWrapStartIndent
@@ -28823,7 +28864,7 @@ case wxStyledTextCtrl_SetLayoutCache: { // wxStyledTextCtrl::SetLayoutCache
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLayoutCache((int) *mode);
+ This->SetLayoutCache(*mode);
break;
}
case wxStyledTextCtrl_GetLayoutCache: { // wxStyledTextCtrl::GetLayoutCache
@@ -28837,7 +28878,7 @@ case wxStyledTextCtrl_SetScrollWidth: { // wxStyledTextCtrl::SetScrollWidth
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pixelWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetScrollWidth((int) *pixelWidth);
+ This->SetScrollWidth(*pixelWidth);
break;
}
case wxStyledTextCtrl_GetScrollWidth: { // wxStyledTextCtrl::GetScrollWidth
@@ -28854,7 +28895,7 @@ case wxStyledTextCtrl_TextWidth: { // wxStyledTextCtrl::TextWidth
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- int Result = This->TextWidth((int) *style,text);
+ int Result = This->TextWidth(*style,text);
rt.addInt(Result);
break;
}
@@ -28869,7 +28910,7 @@ case wxStyledTextCtrl_TextHeight: { // wxStyledTextCtrl::TextHeight
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->TextHeight((int) *line);
+ int Result = This->TextHeight(*line);
rt.addInt(Result);
break;
}
@@ -28877,7 +28918,7 @@ case wxStyledTextCtrl_SetUseVerticalScrollBar: { // wxStyledTextCtrl::SetUseVert
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * show = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetUseVerticalScrollBar((bool) *show);
+ This->SetUseVerticalScrollBar(*show);
break;
}
case wxStyledTextCtrl_GetUseVerticalScrollBar: { // wxStyledTextCtrl::GetUseVerticalScrollBar
@@ -28907,7 +28948,7 @@ case wxStyledTextCtrl_SetTwoPhaseDraw: { // wxStyledTextCtrl::SetTwoPhaseDraw
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * twoPhase = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetTwoPhaseDraw((bool) *twoPhase);
+ This->SetTwoPhaseDraw(*twoPhase);
break;
}
case wxStyledTextCtrl_TargetFromSelection: { // wxStyledTextCtrl::TargetFromSelection
@@ -28926,7 +28967,7 @@ case wxStyledTextCtrl_LinesSplit: { // wxStyledTextCtrl::LinesSplit
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pixelWidth = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->LinesSplit((int) *pixelWidth);
+ This->LinesSplit(*pixelWidth);
break;
}
case wxStyledTextCtrl_SetFoldMarginColour: { // wxStyledTextCtrl::SetFoldMarginColour
@@ -28938,7 +28979,7 @@ case wxStyledTextCtrl_SetFoldMarginColour: { // wxStyledTextCtrl::SetFoldMarginC
int * backA = (int *) bp; bp += 4;
wxColour back = wxColour(*backR,*backG,*backB,*backA);
if(!This) throw wxe_badarg(0);
- This->SetFoldMarginColour((bool) *useSetting,back);
+ This->SetFoldMarginColour(*useSetting,back);
break;
}
case wxStyledTextCtrl_SetFoldMarginHiColour: { // wxStyledTextCtrl::SetFoldMarginHiColour
@@ -28950,7 +28991,7 @@ case wxStyledTextCtrl_SetFoldMarginHiColour: { // wxStyledTextCtrl::SetFoldMargi
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->SetFoldMarginHiColour((bool) *useSetting,fore);
+ This->SetFoldMarginHiColour(*useSetting,fore);
break;
}
case wxStyledTextCtrl_LineDown: { // wxStyledTextCtrl::LineDown
@@ -29299,7 +29340,7 @@ case wxStyledTextCtrl_LineLength: { // wxStyledTextCtrl::LineLength
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->LineLength((int) *line);
+ int Result = This->LineLength(*line);
rt.addInt(Result);
break;
}
@@ -29308,21 +29349,21 @@ case wxStyledTextCtrl_BraceHighlight: { // wxStyledTextCtrl::BraceHighlight
int * pos1 = (int *) bp; bp += 4;
int * pos2 = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->BraceHighlight((int) *pos1,(int) *pos2);
+ This->BraceHighlight(*pos1,*pos2);
break;
}
case wxStyledTextCtrl_BraceBadLight: { // wxStyledTextCtrl::BraceBadLight
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->BraceBadLight((int) *pos);
+ This->BraceBadLight(*pos);
break;
}
case wxStyledTextCtrl_BraceMatch: { // wxStyledTextCtrl::BraceMatch
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->BraceMatch((int) *pos);
+ int Result = This->BraceMatch(*pos);
rt.addInt(Result);
break;
}
@@ -29337,14 +29378,14 @@ case wxStyledTextCtrl_SetViewEOL: { // wxStyledTextCtrl::SetViewEOL
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * visible = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetViewEOL((bool) *visible);
+ This->SetViewEOL(*visible);
break;
}
case wxStyledTextCtrl_SetModEventMask: { // wxStyledTextCtrl::SetModEventMask
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * mask = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetModEventMask((int) *mask);
+ This->SetModEventMask(*mask);
break;
}
case wxStyledTextCtrl_GetEdgeColumn: { // wxStyledTextCtrl::GetEdgeColumn
@@ -29358,14 +29399,14 @@ case wxStyledTextCtrl_SetEdgeColumn: { // wxStyledTextCtrl::SetEdgeColumn
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * column = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetEdgeColumn((int) *column);
+ This->SetEdgeColumn(*column);
break;
}
case wxStyledTextCtrl_SetEdgeMode: { // wxStyledTextCtrl::SetEdgeMode
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetEdgeMode((int) *mode);
+ This->SetEdgeMode(*mode);
break;
}
case wxStyledTextCtrl_GetEdgeMode: { // wxStyledTextCtrl::GetEdgeMode
@@ -29406,7 +29447,7 @@ case wxStyledTextCtrl_SearchNext: { // wxStyledTextCtrl::SearchNext
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- int Result = This->SearchNext((int) *flags,text);
+ int Result = This->SearchNext(*flags,text);
rt.addInt(Result);
break;
}
@@ -29417,7 +29458,7 @@ case wxStyledTextCtrl_SearchPrev: { // wxStyledTextCtrl::SearchPrev
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- int Result = This->SearchPrev((int) *flags,text);
+ int Result = This->SearchPrev(*flags,text);
rt.addInt(Result);
break;
}
@@ -29432,7 +29473,7 @@ case wxStyledTextCtrl_UsePopUp: { // wxStyledTextCtrl::UsePopUp
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * allowPopUp = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->UsePopUp((bool) *allowPopUp);
+ This->UsePopUp(*allowPopUp);
break;
}
case wxStyledTextCtrl_SelectionIsRectangle: { // wxStyledTextCtrl::SelectionIsRectangle
@@ -29446,7 +29487,7 @@ case wxStyledTextCtrl_SetZoom: { // wxStyledTextCtrl::SetZoom
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * zoom = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetZoom((int) *zoom);
+ This->SetZoom(*zoom);
break;
}
case wxStyledTextCtrl_GetZoom: { // wxStyledTextCtrl::GetZoom
@@ -29467,7 +29508,7 @@ case wxStyledTextCtrl_SetSTCFocus: { // wxStyledTextCtrl::SetSTCFocus
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * focus = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSTCFocus((bool) *focus);
+ This->SetSTCFocus(*focus);
break;
}
case wxStyledTextCtrl_GetSTCFocus: { // wxStyledTextCtrl::GetSTCFocus
@@ -29481,7 +29522,7 @@ case wxStyledTextCtrl_SetStatus: { // wxStyledTextCtrl::SetStatus
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * statusCode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetStatus((int) *statusCode);
+ This->SetStatus(*statusCode);
break;
}
case wxStyledTextCtrl_GetStatus: { // wxStyledTextCtrl::GetStatus
@@ -29495,7 +29536,7 @@ case wxStyledTextCtrl_SetMouseDownCaptures: { // wxStyledTextCtrl::SetMouseDownC
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * captures = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMouseDownCaptures((bool) *captures);
+ This->SetMouseDownCaptures(*captures);
break;
}
case wxStyledTextCtrl_GetMouseDownCaptures: { // wxStyledTextCtrl::GetMouseDownCaptures
@@ -29509,7 +29550,7 @@ case wxStyledTextCtrl_SetSTCCursor: { // wxStyledTextCtrl::SetSTCCursor
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * cursorType = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSTCCursor((int) *cursorType);
+ This->SetSTCCursor(*cursorType);
break;
}
case wxStyledTextCtrl_GetSTCCursor: { // wxStyledTextCtrl::GetSTCCursor
@@ -29523,7 +29564,7 @@ case wxStyledTextCtrl_SetControlCharSymbol: { // wxStyledTextCtrl::SetControlCha
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * symbol = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetControlCharSymbol((int) *symbol);
+ This->SetControlCharSymbol(*symbol);
break;
}
case wxStyledTextCtrl_GetControlCharSymbol: { // wxStyledTextCtrl::GetControlCharSymbol
@@ -29562,7 +29603,7 @@ case wxStyledTextCtrl_SetVisiblePolicy: { // wxStyledTextCtrl::SetVisiblePolicy
int * visiblePolicy = (int *) bp; bp += 4;
int * visibleSlop = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetVisiblePolicy((int) *visiblePolicy,(int) *visibleSlop);
+ This->SetVisiblePolicy(*visiblePolicy,*visibleSlop);
break;
}
case wxStyledTextCtrl_DelLineLeft: { // wxStyledTextCtrl::DelLineLeft
@@ -29595,7 +29636,7 @@ case wxStyledTextCtrl_SetXCaretPolicy: { // wxStyledTextCtrl::SetXCaretPolicy
int * caretPolicy = (int *) bp; bp += 4;
int * caretSlop = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetXCaretPolicy((int) *caretPolicy,(int) *caretSlop);
+ This->SetXCaretPolicy(*caretPolicy,*caretSlop);
break;
}
case wxStyledTextCtrl_SetYCaretPolicy: { // wxStyledTextCtrl::SetYCaretPolicy
@@ -29603,7 +29644,7 @@ case wxStyledTextCtrl_SetYCaretPolicy: { // wxStyledTextCtrl::SetYCaretPolicy
int * caretPolicy = (int *) bp; bp += 4;
int * caretSlop = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetYCaretPolicy((int) *caretPolicy,(int) *caretSlop);
+ This->SetYCaretPolicy(*caretPolicy,*caretSlop);
break;
}
case wxStyledTextCtrl_GetPrintWrapMode: { // wxStyledTextCtrl::GetPrintWrapMode
@@ -29622,7 +29663,7 @@ case wxStyledTextCtrl_SetHotspotActiveForeground: { // wxStyledTextCtrl::SetHots
int * foreA = (int *) bp; bp += 4;
wxColour fore = wxColour(*foreR,*foreG,*foreB,*foreA);
if(!This) throw wxe_badarg(0);
- This->SetHotspotActiveForeground((bool) *useSetting,fore);
+ This->SetHotspotActiveForeground(*useSetting,fore);
break;
}
case wxStyledTextCtrl_SetHotspotActiveBackground: { // wxStyledTextCtrl::SetHotspotActiveBackground
@@ -29634,21 +29675,21 @@ case wxStyledTextCtrl_SetHotspotActiveBackground: { // wxStyledTextCtrl::SetHots
int * backA = (int *) bp; bp += 4;
wxColour back = wxColour(*backR,*backG,*backB,*backA);
if(!This) throw wxe_badarg(0);
- This->SetHotspotActiveBackground((bool) *useSetting,back);
+ This->SetHotspotActiveBackground(*useSetting,back);
break;
}
case wxStyledTextCtrl_SetHotspotActiveUnderline: { // wxStyledTextCtrl::SetHotspotActiveUnderline
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * underline = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHotspotActiveUnderline((bool) *underline);
+ This->SetHotspotActiveUnderline(*underline);
break;
}
case wxStyledTextCtrl_SetHotspotSingleLine: { // wxStyledTextCtrl::SetHotspotSingleLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * singleLine = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetHotspotSingleLine((bool) *singleLine);
+ This->SetHotspotSingleLine(*singleLine);
break;
}
case wxStyledTextCtrl_ParaDownExtend: { // wxStyledTextCtrl::ParaDownExtend
@@ -29673,7 +29714,7 @@ case wxStyledTextCtrl_PositionBefore: { // wxStyledTextCtrl::PositionBefore
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->PositionBefore((int) *pos);
+ int Result = This->PositionBefore(*pos);
rt.addInt(Result);
break;
}
@@ -29681,7 +29722,7 @@ case wxStyledTextCtrl_PositionAfter: { // wxStyledTextCtrl::PositionAfter
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->PositionAfter((int) *pos);
+ int Result = This->PositionAfter(*pos);
rt.addInt(Result);
break;
}
@@ -29690,7 +29731,7 @@ case wxStyledTextCtrl_CopyRange: { // wxStyledTextCtrl::CopyRange
int * start = (int *) bp; bp += 4;
int * end = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CopyRange((int) *start,(int) *end);
+ This->CopyRange(*start,*end);
break;
}
case wxStyledTextCtrl_CopyText: { // wxStyledTextCtrl::CopyText
@@ -29700,14 +29741,14 @@ case wxStyledTextCtrl_CopyText: { // wxStyledTextCtrl::CopyText
wxString text = wxString(bp, wxConvUTF8);
bp += *textLen+((8-((4+ *textLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->CopyText((int) *length,text);
+ This->CopyText(*length,text);
break;
}
case wxStyledTextCtrl_SetSelectionMode: { // wxStyledTextCtrl::SetSelectionMode
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelectionMode((int) *mode);
+ This->SetSelectionMode(*mode);
break;
}
case wxStyledTextCtrl_GetSelectionMode: { // wxStyledTextCtrl::GetSelectionMode
@@ -29845,7 +29886,7 @@ case wxStyledTextCtrl_Allocate: { // wxStyledTextCtrl::Allocate
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * bytes = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Allocate((int) *bytes);
+ This->Allocate(*bytes);
break;
}
case wxStyledTextCtrl_FindColumn: { // wxStyledTextCtrl::FindColumn
@@ -29853,7 +29894,7 @@ case wxStyledTextCtrl_FindColumn: { // wxStyledTextCtrl::FindColumn
int * line = (int *) bp; bp += 4;
int * column = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- int Result = This->FindColumn((int) *line,(int) *column);
+ int Result = This->FindColumn(*line,*column);
rt.addInt(Result);
break;
}
@@ -29868,7 +29909,7 @@ case wxStyledTextCtrl_SetCaretSticky: { // wxStyledTextCtrl::SetCaretSticky
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * useCaretStickyBehaviour = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCaretSticky((bool) *useCaretStickyBehaviour);
+ This->SetCaretSticky(*useCaretStickyBehaviour);
break;
}
case wxStyledTextCtrl_ToggleCaretSticky: { // wxStyledTextCtrl::ToggleCaretSticky
@@ -29881,7 +29922,7 @@ case wxStyledTextCtrl_SetPasteConvertEndings: { // wxStyledTextCtrl::SetPasteCon
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * convert = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPasteConvertEndings((bool) *convert);
+ This->SetPasteConvertEndings(*convert);
break;
}
case wxStyledTextCtrl_GetPasteConvertEndings: { // wxStyledTextCtrl::GetPasteConvertEndings
@@ -29901,7 +29942,7 @@ case wxStyledTextCtrl_SetCaretLineBackAlpha: { // wxStyledTextCtrl::SetCaretLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * alpha = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCaretLineBackAlpha((int) *alpha);
+ This->SetCaretLineBackAlpha(*alpha);
break;
}
case wxStyledTextCtrl_GetCaretLineBackAlpha: { // wxStyledTextCtrl::GetCaretLineBackAlpha
@@ -29927,7 +29968,7 @@ case wxStyledTextCtrl_SetLexer: { // wxStyledTextCtrl::SetLexer
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * lexer = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLexer((int) *lexer);
+ This->SetLexer(*lexer);
break;
}
case wxStyledTextCtrl_GetLexer: { // wxStyledTextCtrl::GetLexer
@@ -29942,7 +29983,7 @@ case wxStyledTextCtrl_Colourise: { // wxStyledTextCtrl::Colourise
int * start = (int *) bp; bp += 4;
int * end = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->Colourise((int) *start,(int) *end);
+ This->Colourise(*start,*end);
break;
}
case wxStyledTextCtrl_SetProperty: { // wxStyledTextCtrl::SetProperty
@@ -29964,7 +30005,7 @@ case wxStyledTextCtrl_SetKeyWords: { // wxStyledTextCtrl::SetKeyWords
wxString keyWords = wxString(bp, wxConvUTF8);
bp += *keyWordsLen+((8-((4+ *keyWordsLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->SetKeyWords((int) *keywordSet,keyWords);
+ This->SetKeyWords(*keywordSet,keyWords);
break;
}
case wxStyledTextCtrl_SetLexerLanguage: { // wxStyledTextCtrl::SetLexerLanguage
@@ -30007,7 +30048,7 @@ case wxStyledTextCtrl_StyleSetSpec: { // wxStyledTextCtrl::StyleSetSpec
wxString spec = wxString(bp, wxConvUTF8);
bp += *specLen+((8-((4+ *specLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- This->StyleSetSpec((int) *styleNum,spec);
+ This->StyleSetSpec(*styleNum,spec);
break;
}
case wxStyledTextCtrl_StyleSetFont: { // wxStyledTextCtrl::StyleSetFont
@@ -30015,7 +30056,7 @@ case wxStyledTextCtrl_StyleSetFont: { // wxStyledTextCtrl::StyleSetFont
int * styleNum = (int *) bp; bp += 4;
wxFont *font = (wxFont *) getPtr(bp,memenv); bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetFont((int) *styleNum,*font);
+ This->StyleSetFont(*styleNum,*font);
break;
}
case wxStyledTextCtrl_StyleSetFontAttr: { // wxStyledTextCtrl::StyleSetFontAttr
@@ -30036,7 +30077,7 @@ encoding = *(wxFontEncoding *) bp; bp += 4;;
} break;
}};
if(!This) throw wxe_badarg(0);
- This->StyleSetFontAttr((int) *styleNum,(int) *size,faceName,(bool) *bold,(bool) *italic,(bool) *underline,(wxFontEncoding) encoding);
+ This->StyleSetFontAttr(*styleNum,*size,faceName,*bold,*italic,*underline,encoding);
break;
}
case wxStyledTextCtrl_StyleSetCharacterSet: { // wxStyledTextCtrl::StyleSetCharacterSet
@@ -30044,7 +30085,7 @@ case wxStyledTextCtrl_StyleSetCharacterSet: { // wxStyledTextCtrl::StyleSetChara
int * style = (int *) bp; bp += 4;
int * characterSet = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->StyleSetCharacterSet((int) *style,(int) *characterSet);
+ This->StyleSetCharacterSet(*style,*characterSet);
break;
}
case wxStyledTextCtrl_StyleSetFontEncoding: { // wxStyledTextCtrl::StyleSetFontEncoding
@@ -30052,14 +30093,14 @@ case wxStyledTextCtrl_StyleSetFontEncoding: { // wxStyledTextCtrl::StyleSetFontE
int * style = (int *) bp; bp += 4;
wxFontEncoding encoding = *(wxFontEncoding *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- This->StyleSetFontEncoding((int) *style,(wxFontEncoding) encoding);
+ This->StyleSetFontEncoding(*style,encoding);
break;
}
case wxStyledTextCtrl_CmdKeyExecute: { // wxStyledTextCtrl::CmdKeyExecute
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * cmd = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->CmdKeyExecute((int) *cmd);
+ This->CmdKeyExecute(*cmd);
break;
}
case wxStyledTextCtrl_SetMargins: { // wxStyledTextCtrl::SetMargins
@@ -30067,7 +30108,7 @@ case wxStyledTextCtrl_SetMargins: { // wxStyledTextCtrl::SetMargins
int * left = (int *) bp; bp += 4;
int * right = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMargins((int) *left,(int) *right);
+ This->SetMargins(*left,*right);
break;
}
case wxStyledTextCtrl_GetSelection: { // wxStyledTextCtrl::GetSelection
@@ -30085,7 +30126,7 @@ case wxStyledTextCtrl_PointFromPosition: { // wxStyledTextCtrl::PointFromPositio
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- wxPoint Result = This->PointFromPosition((int) *pos);
+ wxPoint Result = This->PointFromPosition(*pos);
rt.add(Result);
break;
}
@@ -30093,32 +30134,14 @@ case wxStyledTextCtrl_ScrollToLine: { // wxStyledTextCtrl::ScrollToLine
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ScrollToLine((int) *line);
+ This->ScrollToLine(*line);
break;
}
case wxStyledTextCtrl_ScrollToColumn: { // wxStyledTextCtrl::ScrollToColumn
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * column = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->ScrollToColumn((int) *column);
- break;
-}
-case wxStyledTextCtrl_SendMsg: { // wxStyledTextCtrl::SendMsg
- long wp=0;
- long lp=0;
- wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
- int * msg = (int *) bp; bp += 4;
- while( * (int*) bp) { switch (* (int*) bp) {
- case 1: {bp += 4;
- wp = (long)*(int *) bp; bp += 4;
- } break;
- case 2: {bp += 4;
- lp = (long)*(int *) bp; bp += 4;
- } break;
- }};
- if(!This) throw wxe_badarg(0);
- long Result = This->SendMsg((int) *msg,wp,lp);
- rt.addInt(Result);
+ This->ScrollToColumn(*column);
break;
}
case wxStyledTextCtrl_SetVScrollBar: { // wxStyledTextCtrl::SetVScrollBar
@@ -30146,7 +30169,7 @@ case wxStyledTextCtrl_SetLastKeydownProcessed: { // wxStyledTextCtrl::SetLastKey
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
bool * val = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetLastKeydownProcessed((bool) *val);
+ This->SetLastKeydownProcessed(*val);
break;
}
case wxStyledTextCtrl_SaveFile: { // wxStyledTextCtrl::SaveFile
@@ -30175,7 +30198,7 @@ case wxStyledTextCtrl_DoDragOver: { // wxStyledTextCtrl::DoDragOver
int * y = (int *) bp; bp += 4;
wxDragResult def = *(wxDragResult *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- int Result = This->DoDragOver((wxCoord) *x,(wxCoord) *y,(wxDragResult) def);
+ int Result = This->DoDragOver(*x,*y,def);
rt.addInt(Result);
break;
}
@@ -30187,7 +30210,7 @@ case wxStyledTextCtrl_DoDropText: { // wxStyledTextCtrl::DoDropText
wxString data = wxString(bp, wxConvUTF8);
bp += *dataLen+((8-((0+ *dataLen) & 7)) & 7);
if(!This) throw wxe_badarg(0);
- bool Result = This->DoDropText((long) *x,(long) *y,data);
+ bool Result = This->DoDropText(*x,*y,data);
rt.addBool(Result);
break;
}
@@ -30210,7 +30233,7 @@ case wxStyledTextCtrl_InsertTextRaw: { // wxStyledTextCtrl::InsertTextRaw
int * pos = (int *) bp; bp += 4;
const char * text = (const char*) Ecmd.bin[0]->base;
if(!This) throw wxe_badarg(0);
- This->InsertTextRaw((int) *pos,text);
+ This->InsertTextRaw(*pos,text);
break;
}
case wxStyledTextCtrl_GetCurLineRaw: { // wxStyledTextCtrl::GetCurLineRaw
@@ -30229,7 +30252,7 @@ case wxStyledTextCtrl_GetLineRaw: { // wxStyledTextCtrl::GetLineRaw
wxStyledTextCtrl *This = (wxStyledTextCtrl *) getPtr(bp,memenv); bp += 4;
int * line = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- char * Result = This->GetLineRaw((int) *line).data();
+ char * Result = This->GetLineRaw(*line).data();
if(Result) {
rt.addBinary(Result, strlen(Result));
} else {rt.addAtom("null");};
@@ -30249,7 +30272,7 @@ case wxStyledTextCtrl_GetTextRangeRaw: { // wxStyledTextCtrl::GetTextRangeRaw
int * startPos = (int *) bp; bp += 4;
int * endPos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- char * Result = This->GetTextRangeRaw((int) *startPos,(int) *endPos).data();
+ char * Result = This->GetTextRangeRaw(*startPos,*endPos).data();
if(Result) {
rt.addBinary(Result, strlen(Result));
} else {rt.addAtom("null");};
@@ -30400,19 +30423,19 @@ case wxNotebookEvent_SetOldSelection: { // wxNotebookEvent::SetOldSelection
wxNotebookEvent *This = (wxNotebookEvent *) getPtr(bp,memenv); bp += 4;
int * nOldSel = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetOldSelection((int) *nOldSel);
+ This->SetOldSelection(*nOldSel);
break;
}
case wxNotebookEvent_SetSelection: { // wxNotebookEvent::SetSelection
wxNotebookEvent *This = (wxNotebookEvent *) getPtr(bp,memenv); bp += 4;
int * nSel = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *nSel);
+ This->SetSelection(*nSel);
break;
}
case wxFileDataObject_new: { // wxFileDataObject::wxFileDataObject
wxFileDataObject * Result = new wxFileDataObject();
- newPtr((void *) Result, 212, memenv);
+ newPtr((void *) Result, 211, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFileDataObject");
break;
}
@@ -30448,7 +30471,7 @@ case wxTextDataObject_new: { // wxTextDataObject::wxTextDataObject
} break;
}};
wxTextDataObject * Result = new wxTextDataObject(text);
- newPtr((void *) Result, 213, memenv);
+ newPtr((void *) Result, 212, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTextDataObject");
break;
}
@@ -30484,7 +30507,7 @@ case wxTextDataObject_destroy: { // wxTextDataObject::destroy
case wxBitmapDataObject_new_1_1: { // wxBitmapDataObject::wxBitmapDataObject
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
wxBitmapDataObject * Result = new wxBitmapDataObject(*bitmap);
- newPtr((void *) Result, 214, memenv);
+ newPtr((void *) Result, 213, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmapDataObject");
break;
}
@@ -30496,7 +30519,7 @@ bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
} break;
}};
wxBitmapDataObject * Result = new wxBitmapDataObject(*bitmap);
- newPtr((void *) Result, 214, memenv);
+ newPtr((void *) Result, 213, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmapDataObject");
break;
}
@@ -30598,9 +30621,9 @@ case wxClipboard_UsePrimarySelection: { // wxClipboard::UsePrimarySelection
}
case wxClipboard_IsSupported: { // wxClipboard::IsSupported
wxClipboard *This = (wxClipboard *) getPtr(bp,memenv); bp += 4;
- const int * format = (const int *) bp; bp += 4;
+ wxDataFormatId format = *(wxDataFormatId *) bp; bp += 4;;
if(!This) throw wxe_badarg(0);
- bool Result = This->IsSupported((wxDataFormatId) *format);
+ bool Result = This->IsSupported(format);
rt.addBool(Result);
break;
}
@@ -30620,7 +30643,7 @@ case wxSpinEvent_SetPosition: { // wxSpinEvent::SetPosition
wxSpinEvent *This = (wxSpinEvent *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetPosition((int) *pos);
+ This->SetPosition(*pos);
break;
}
case wxSplitterWindow_new_0: { // wxSplitterWindow::wxSplitterWindow
@@ -30763,7 +30786,7 @@ case wxSplitterWindow_SetSashGravity: { // wxSplitterWindow::SetSashGravity
bp += 4; /* Align */
double * gravity = (double *) bp; bp += 8;
if(!This) throw wxe_badarg(0);
- This->SetSashGravity((double) *gravity);
+ This->SetSashGravity(*gravity);
break;
}
case wxSplitterWindow_SetSashPosition: { // wxSplitterWindow::SetSashPosition
@@ -30776,28 +30799,28 @@ case wxSplitterWindow_SetSashPosition: { // wxSplitterWindow::SetSashPosition
} break;
}};
if(!This) throw wxe_badarg(0);
- This->SetSashPosition((int) *position,redraw);
+ This->SetSashPosition(*position,redraw);
break;
}
case wxSplitterWindow_SetSashSize: { // wxSplitterWindow::SetSashSize
wxSplitterWindow *This = (wxSplitterWindow *) getPtr(bp,memenv); bp += 4;
int * width = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSashSize((int) *width);
+ This->SetSashSize(*width);
break;
}
case wxSplitterWindow_SetMinimumPaneSize: { // wxSplitterWindow::SetMinimumPaneSize
wxSplitterWindow *This = (wxSplitterWindow *) getPtr(bp,memenv); bp += 4;
int * min = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetMinimumPaneSize((int) *min);
+ This->SetMinimumPaneSize(*min);
break;
}
case wxSplitterWindow_SetSplitMode: { // wxSplitterWindow::SetSplitMode
wxSplitterWindow *This = (wxSplitterWindow *) getPtr(bp,memenv); bp += 4;
int * mode = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSplitMode((int) *mode);
+ This->SetSplitMode(*mode);
break;
}
case wxSplitterWindow_SplitHorizontally: { // wxSplitterWindow::SplitHorizontally
@@ -30884,7 +30907,7 @@ case wxSplitterEvent_SetSashPosition: { // wxSplitterEvent::SetSashPosition
wxSplitterEvent *This = (wxSplitterEvent *) getPtr(bp,memenv); bp += 4;
int * pos = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSashPosition((int) *pos);
+ This->SetSashPosition(*pos);
break;
}
case wxHtmlWindow_new_0: { // wxHtmlWindow::wxHtmlWindow
@@ -31053,7 +31076,7 @@ case wxHtmlWindow_SetBorders: { // wxHtmlWindow::SetBorders
wxHtmlWindow *This = (wxHtmlWindow *) getPtr(bp,memenv); bp += 4;
int * b = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetBorders((int) *b);
+ This->SetBorders(*b);
break;
}
case wxHtmlWindow_SetFonts: { // wxHtmlWindow::SetFonts
@@ -31098,7 +31121,7 @@ case wxHtmlWindow_SetRelatedStatusBar: { // wxHtmlWindow::SetRelatedStatusBar
wxHtmlWindow *This = (wxHtmlWindow *) getPtr(bp,memenv); bp += 4;
int * bar = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetRelatedStatusBar((int) *bar);
+ This->SetRelatedStatusBar(*bar);
break;
}
case wxHtmlWindow_ToText: { // wxHtmlWindow::ToText
@@ -31117,13 +31140,13 @@ case wxHtmlLinkEvent_GetLinkInfo: { // wxHtmlLinkEvent::GetLinkInfo
}
case wxSystemSettings_GetColour: { // wxSystemSettings::GetColour
wxSystemColour index = *(wxSystemColour *) bp; bp += 4;;
- wxColour Result = wxSystemSettings::GetColour((wxSystemColour) index);
+ wxColour Result = wxSystemSettings::GetColour(index);
rt.add(Result);
break;
}
case wxSystemSettings_GetFont: { // wxSystemSettings::GetFont
wxSystemFont index = *(wxSystemFont *) bp; bp += 4;;
- wxFont * Result = new wxFont(wxSystemSettings::GetFont((wxSystemFont) index)); newPtr((void *) Result,3, memenv);;
+ wxFont * Result = new wxFont(wxSystemSettings::GetFont(index)); newPtr((void *) Result,3, memenv);;
rt.addRef(getRef((void *)Result,memenv), "wxFont");
break;
}
@@ -31136,7 +31159,7 @@ case wxSystemSettings_GetMetric: { // wxSystemSettings::GetMetric
win = (wxWindow *) getPtr(bp,memenv); bp += 4;
} break;
}};
- int Result = wxSystemSettings::GetMetric((wxSystemMetric) index,win);
+ int Result = wxSystemSettings::GetMetric(index,win);
rt.addInt(Result);
break;
}
@@ -31192,14 +31215,14 @@ case wxSystemOptions_SetOption_2_0: { // wxSystemOptions::SetOption
wxString name = wxString(bp, wxConvUTF8);
bp += *nameLen+((8-((4+ *nameLen) & 7)) & 7);
int * value = (int *) bp; bp += 4;
- wxSystemOptions::SetOption(name,(int) *value);
+ wxSystemOptions::SetOption(name,*value);
break;
}
case wxAuiNotebookEvent_SetSelection: { // wxAuiNotebookEvent::SetSelection
wxAuiNotebookEvent *This = (wxAuiNotebookEvent *) getPtr(bp,memenv); bp += 4;
int * s = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetSelection((int) *s);
+ This->SetSelection(*s);
break;
}
case wxAuiNotebookEvent_GetSelection: { // wxAuiNotebookEvent::GetSelection
@@ -31213,7 +31236,7 @@ case wxAuiNotebookEvent_SetOldSelection: { // wxAuiNotebookEvent::SetOldSelectio
wxAuiNotebookEvent *This = (wxAuiNotebookEvent *) getPtr(bp,memenv); bp += 4;
int * s = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetOldSelection((int) *s);
+ This->SetOldSelection(*s);
break;
}
case wxAuiNotebookEvent_GetOldSelection: { // wxAuiNotebookEvent::GetOldSelection
@@ -31269,7 +31292,7 @@ case wxAuiManagerEvent_SetButton: { // wxAuiManagerEvent::SetButton
wxAuiManagerEvent *This = (wxAuiManagerEvent *) getPtr(bp,memenv); bp += 4;
int * b = (int *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetButton((int) *b);
+ This->SetButton(*b);
break;
}
case wxAuiManagerEvent_GetButton: { // wxAuiManagerEvent::GetButton
@@ -31317,7 +31340,7 @@ case wxAuiManagerEvent_SetCanVeto: { // wxAuiManagerEvent::SetCanVeto
wxAuiManagerEvent *This = (wxAuiManagerEvent *) getPtr(bp,memenv); bp += 4;
bool * can_veto = (bool *) bp; bp += 4;
if(!This) throw wxe_badarg(0);
- This->SetCanVeto((bool) *can_veto);
+ This->SetCanVeto(*can_veto);
break;
}
case wxAuiManagerEvent_CanVeto: { // wxAuiManagerEvent::CanVeto
@@ -31329,7 +31352,7 @@ case wxAuiManagerEvent_CanVeto: { // wxAuiManagerEvent::CanVeto
}
case wxLogNull_new: { // wxLogNull::wxLogNull
wxLogNull * Result = new wxLogNull();
- newPtr((void *) Result, 225, memenv);
+ newPtr((void *) Result, 224, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxLogNull");
break;
}
@@ -31416,10 +31439,10 @@ void WxeApp::delete_object(void *ptr, wxeRefData *refd) {
case 101: delete (wxListItemAttr *) ptr; break;
case 103: delete (wxTextAttr *) ptr; break;
case 155: delete (wxAuiPaneInfo *) ptr; break;
- case 212: /* delete (wxFileDataObject *) ptr;These objects must be deleted by owner object */ break;
- case 213: /* delete (wxTextDataObject *) ptr;These objects must be deleted by owner object */ break;
- case 214: /* delete (wxBitmapDataObject *) ptr;These objects must be deleted by owner object */ break;
- case 225: delete (wxLogNull *) ptr; break;
+ case 211: /* delete (wxFileDataObject *) ptr;These objects must be deleted by owner object */ break;
+ case 212: /* delete (wxTextDataObject *) ptr;These objects must be deleted by owner object */ break;
+ case 213: /* delete (wxBitmapDataObject *) ptr;These objects must be deleted by owner object */ break;
+ case 224: delete (wxLogNull *) ptr; break;
default: delete (wxObject *) ptr;
}}
diff --git a/lib/wx/c_src/gen/wxe_macros.h b/lib/wx/c_src/gen/wxe_macros.h
index b24becae06..4b87c2340e 100644
--- a/lib/wx/c_src/gen/wxe_macros.h
+++ b/lib/wx/c_src/gen/wxe_macros.h
@@ -3201,155 +3201,154 @@
#define wxStyledTextCtrl_PointFromPosition 3370
#define wxStyledTextCtrl_ScrollToLine 3371
#define wxStyledTextCtrl_ScrollToColumn 3372
-#define wxStyledTextCtrl_SendMsg 3373
-#define wxStyledTextCtrl_SetVScrollBar 3374
-#define wxStyledTextCtrl_SetHScrollBar 3375
-#define wxStyledTextCtrl_GetLastKeydownProcessed 3376
-#define wxStyledTextCtrl_SetLastKeydownProcessed 3377
-#define wxStyledTextCtrl_SaveFile 3378
-#define wxStyledTextCtrl_LoadFile 3379
-#define wxStyledTextCtrl_DoDragOver 3380
-#define wxStyledTextCtrl_DoDropText 3381
-#define wxStyledTextCtrl_GetUseAntiAliasing 3382
-#define wxStyledTextCtrl_AddTextRaw 3383
-#define wxStyledTextCtrl_InsertTextRaw 3384
-#define wxStyledTextCtrl_GetCurLineRaw 3385
-#define wxStyledTextCtrl_GetLineRaw 3386
-#define wxStyledTextCtrl_GetSelectedTextRaw 3387
-#define wxStyledTextCtrl_GetTextRangeRaw 3388
-#define wxStyledTextCtrl_SetTextRaw 3389
-#define wxStyledTextCtrl_GetTextRaw 3390
-#define wxStyledTextCtrl_AppendTextRaw 3391
-#define wxArtProvider_GetBitmap 3392
-#define wxArtProvider_GetIcon 3393
-#define wxTreeEvent_GetKeyCode 3394
-#define wxTreeEvent_GetItem 3395
-#define wxTreeEvent_GetKeyEvent 3396
-#define wxTreeEvent_GetLabel 3397
-#define wxTreeEvent_GetOldItem 3398
-#define wxTreeEvent_GetPoint 3399
-#define wxTreeEvent_IsEditCancelled 3400
-#define wxTreeEvent_SetToolTip 3401
-#define wxNotebookEvent_GetOldSelection 3402
-#define wxNotebookEvent_GetSelection 3403
-#define wxNotebookEvent_SetOldSelection 3404
-#define wxNotebookEvent_SetSelection 3405
-#define wxFileDataObject_new 3406
-#define wxFileDataObject_AddFile 3407
-#define wxFileDataObject_GetFilenames 3408
-#define wxFileDataObject_destroy 3409
-#define wxTextDataObject_new 3410
-#define wxTextDataObject_GetTextLength 3411
-#define wxTextDataObject_GetText 3412
-#define wxTextDataObject_SetText 3413
-#define wxTextDataObject_destroy 3414
-#define wxBitmapDataObject_new_1_1 3415
-#define wxBitmapDataObject_new_1_0 3416
-#define wxBitmapDataObject_GetBitmap 3417
-#define wxBitmapDataObject_SetBitmap 3418
-#define wxBitmapDataObject_destroy 3419
-#define wxClipboard_new 3421
-#define wxClipboard_destruct 3422
-#define wxClipboard_AddData 3423
-#define wxClipboard_Clear 3424
-#define wxClipboard_Close 3425
-#define wxClipboard_Flush 3426
-#define wxClipboard_GetData 3427
-#define wxClipboard_IsOpened 3428
-#define wxClipboard_Open 3429
-#define wxClipboard_SetData 3430
-#define wxClipboard_UsePrimarySelection 3432
-#define wxClipboard_IsSupported 3433
-#define wxClipboard_Get 3434
-#define wxSpinEvent_GetPosition 3435
-#define wxSpinEvent_SetPosition 3436
-#define wxSplitterWindow_new_0 3437
-#define wxSplitterWindow_new_2 3438
-#define wxSplitterWindow_destruct 3439
-#define wxSplitterWindow_Create 3440
-#define wxSplitterWindow_GetMinimumPaneSize 3441
-#define wxSplitterWindow_GetSashGravity 3442
-#define wxSplitterWindow_GetSashPosition 3443
-#define wxSplitterWindow_GetSplitMode 3444
-#define wxSplitterWindow_GetWindow1 3445
-#define wxSplitterWindow_GetWindow2 3446
-#define wxSplitterWindow_Initialize 3447
-#define wxSplitterWindow_IsSplit 3448
-#define wxSplitterWindow_ReplaceWindow 3449
-#define wxSplitterWindow_SetSashGravity 3450
-#define wxSplitterWindow_SetSashPosition 3451
-#define wxSplitterWindow_SetSashSize 3452
-#define wxSplitterWindow_SetMinimumPaneSize 3453
-#define wxSplitterWindow_SetSplitMode 3454
-#define wxSplitterWindow_SplitHorizontally 3455
-#define wxSplitterWindow_SplitVertically 3456
-#define wxSplitterWindow_Unsplit 3457
-#define wxSplitterWindow_UpdateSize 3458
-#define wxSplitterEvent_GetSashPosition 3459
-#define wxSplitterEvent_GetX 3460
-#define wxSplitterEvent_GetY 3461
-#define wxSplitterEvent_GetWindowBeingRemoved 3462
-#define wxSplitterEvent_SetSashPosition 3463
-#define wxHtmlWindow_new_0 3464
-#define wxHtmlWindow_new_2 3465
-#define wxHtmlWindow_AppendToPage 3466
-#define wxHtmlWindow_GetOpenedAnchor 3467
-#define wxHtmlWindow_GetOpenedPage 3468
-#define wxHtmlWindow_GetOpenedPageTitle 3469
-#define wxHtmlWindow_GetRelatedFrame 3470
-#define wxHtmlWindow_HistoryBack 3471
-#define wxHtmlWindow_HistoryCanBack 3472
-#define wxHtmlWindow_HistoryCanForward 3473
-#define wxHtmlWindow_HistoryClear 3474
-#define wxHtmlWindow_HistoryForward 3475
-#define wxHtmlWindow_LoadFile 3476
-#define wxHtmlWindow_LoadPage 3477
-#define wxHtmlWindow_SelectAll 3478
-#define wxHtmlWindow_SelectionToText 3479
-#define wxHtmlWindow_SelectLine 3480
-#define wxHtmlWindow_SelectWord 3481
-#define wxHtmlWindow_SetBorders 3482
-#define wxHtmlWindow_SetFonts 3483
-#define wxHtmlWindow_SetPage 3484
-#define wxHtmlWindow_SetRelatedFrame 3485
-#define wxHtmlWindow_SetRelatedStatusBar 3486
-#define wxHtmlWindow_ToText 3487
-#define wxHtmlWindow_destroy 3488
-#define wxHtmlLinkEvent_GetLinkInfo 3489
-#define wxSystemSettings_GetColour 3490
-#define wxSystemSettings_GetFont 3491
-#define wxSystemSettings_GetMetric 3492
-#define wxSystemSettings_GetScreenType 3493
-#define wxSystemOptions_GetOption 3494
-#define wxSystemOptions_GetOptionInt 3495
-#define wxSystemOptions_HasOption 3496
-#define wxSystemOptions_IsFalse 3497
-#define wxSystemOptions_SetOption_2_1 3498
-#define wxSystemOptions_SetOption_2_0 3499
-#define wxAuiNotebookEvent_SetSelection 3500
-#define wxAuiNotebookEvent_GetSelection 3501
-#define wxAuiNotebookEvent_SetOldSelection 3502
-#define wxAuiNotebookEvent_GetOldSelection 3503
-#define wxAuiNotebookEvent_SetDragSource 3504
-#define wxAuiNotebookEvent_GetDragSource 3505
-#define wxAuiManagerEvent_SetManager 3506
-#define wxAuiManagerEvent_GetManager 3507
-#define wxAuiManagerEvent_SetPane 3508
-#define wxAuiManagerEvent_GetPane 3509
-#define wxAuiManagerEvent_SetButton 3510
-#define wxAuiManagerEvent_GetButton 3511
-#define wxAuiManagerEvent_SetDC 3512
-#define wxAuiManagerEvent_GetDC 3513
-#define wxAuiManagerEvent_Veto 3514
-#define wxAuiManagerEvent_GetVeto 3515
-#define wxAuiManagerEvent_SetCanVeto 3516
-#define wxAuiManagerEvent_CanVeto 3517
-#define wxLogNull_new 3518
-#define wxLogNull_destroy 3519
-#define wxTaskBarIcon_new 3520
-#define wxTaskBarIcon_destruct 3521
-#define wxTaskBarIcon_PopupMenu 3522
-#define wxTaskBarIcon_RemoveIcon 3523
-#define wxTaskBarIcon_SetIcon 3524
+#define wxStyledTextCtrl_SetVScrollBar 3373
+#define wxStyledTextCtrl_SetHScrollBar 3374
+#define wxStyledTextCtrl_GetLastKeydownProcessed 3375
+#define wxStyledTextCtrl_SetLastKeydownProcessed 3376
+#define wxStyledTextCtrl_SaveFile 3377
+#define wxStyledTextCtrl_LoadFile 3378
+#define wxStyledTextCtrl_DoDragOver 3379
+#define wxStyledTextCtrl_DoDropText 3380
+#define wxStyledTextCtrl_GetUseAntiAliasing 3381
+#define wxStyledTextCtrl_AddTextRaw 3382
+#define wxStyledTextCtrl_InsertTextRaw 3383
+#define wxStyledTextCtrl_GetCurLineRaw 3384
+#define wxStyledTextCtrl_GetLineRaw 3385
+#define wxStyledTextCtrl_GetSelectedTextRaw 3386
+#define wxStyledTextCtrl_GetTextRangeRaw 3387
+#define wxStyledTextCtrl_SetTextRaw 3388
+#define wxStyledTextCtrl_GetTextRaw 3389
+#define wxStyledTextCtrl_AppendTextRaw 3390
+#define wxArtProvider_GetBitmap 3391
+#define wxArtProvider_GetIcon 3392
+#define wxTreeEvent_GetKeyCode 3393
+#define wxTreeEvent_GetItem 3394
+#define wxTreeEvent_GetKeyEvent 3395
+#define wxTreeEvent_GetLabel 3396
+#define wxTreeEvent_GetOldItem 3397
+#define wxTreeEvent_GetPoint 3398
+#define wxTreeEvent_IsEditCancelled 3399
+#define wxTreeEvent_SetToolTip 3400
+#define wxNotebookEvent_GetOldSelection 3401
+#define wxNotebookEvent_GetSelection 3402
+#define wxNotebookEvent_SetOldSelection 3403
+#define wxNotebookEvent_SetSelection 3404
+#define wxFileDataObject_new 3405
+#define wxFileDataObject_AddFile 3406
+#define wxFileDataObject_GetFilenames 3407
+#define wxFileDataObject_destroy 3408
+#define wxTextDataObject_new 3409
+#define wxTextDataObject_GetTextLength 3410
+#define wxTextDataObject_GetText 3411
+#define wxTextDataObject_SetText 3412
+#define wxTextDataObject_destroy 3413
+#define wxBitmapDataObject_new_1_1 3414
+#define wxBitmapDataObject_new_1_0 3415
+#define wxBitmapDataObject_GetBitmap 3416
+#define wxBitmapDataObject_SetBitmap 3417
+#define wxBitmapDataObject_destroy 3418
+#define wxClipboard_new 3420
+#define wxClipboard_destruct 3421
+#define wxClipboard_AddData 3422
+#define wxClipboard_Clear 3423
+#define wxClipboard_Close 3424
+#define wxClipboard_Flush 3425
+#define wxClipboard_GetData 3426
+#define wxClipboard_IsOpened 3427
+#define wxClipboard_Open 3428
+#define wxClipboard_SetData 3429
+#define wxClipboard_UsePrimarySelection 3431
+#define wxClipboard_IsSupported 3432
+#define wxClipboard_Get 3433
+#define wxSpinEvent_GetPosition 3434
+#define wxSpinEvent_SetPosition 3435
+#define wxSplitterWindow_new_0 3436
+#define wxSplitterWindow_new_2 3437
+#define wxSplitterWindow_destruct 3438
+#define wxSplitterWindow_Create 3439
+#define wxSplitterWindow_GetMinimumPaneSize 3440
+#define wxSplitterWindow_GetSashGravity 3441
+#define wxSplitterWindow_GetSashPosition 3442
+#define wxSplitterWindow_GetSplitMode 3443
+#define wxSplitterWindow_GetWindow1 3444
+#define wxSplitterWindow_GetWindow2 3445
+#define wxSplitterWindow_Initialize 3446
+#define wxSplitterWindow_IsSplit 3447
+#define wxSplitterWindow_ReplaceWindow 3448
+#define wxSplitterWindow_SetSashGravity 3449
+#define wxSplitterWindow_SetSashPosition 3450
+#define wxSplitterWindow_SetSashSize 3451
+#define wxSplitterWindow_SetMinimumPaneSize 3452
+#define wxSplitterWindow_SetSplitMode 3453
+#define wxSplitterWindow_SplitHorizontally 3454
+#define wxSplitterWindow_SplitVertically 3455
+#define wxSplitterWindow_Unsplit 3456
+#define wxSplitterWindow_UpdateSize 3457
+#define wxSplitterEvent_GetSashPosition 3458
+#define wxSplitterEvent_GetX 3459
+#define wxSplitterEvent_GetY 3460
+#define wxSplitterEvent_GetWindowBeingRemoved 3461
+#define wxSplitterEvent_SetSashPosition 3462
+#define wxHtmlWindow_new_0 3463
+#define wxHtmlWindow_new_2 3464
+#define wxHtmlWindow_AppendToPage 3465
+#define wxHtmlWindow_GetOpenedAnchor 3466
+#define wxHtmlWindow_GetOpenedPage 3467
+#define wxHtmlWindow_GetOpenedPageTitle 3468
+#define wxHtmlWindow_GetRelatedFrame 3469
+#define wxHtmlWindow_HistoryBack 3470
+#define wxHtmlWindow_HistoryCanBack 3471
+#define wxHtmlWindow_HistoryCanForward 3472
+#define wxHtmlWindow_HistoryClear 3473
+#define wxHtmlWindow_HistoryForward 3474
+#define wxHtmlWindow_LoadFile 3475
+#define wxHtmlWindow_LoadPage 3476
+#define wxHtmlWindow_SelectAll 3477
+#define wxHtmlWindow_SelectionToText 3478
+#define wxHtmlWindow_SelectLine 3479
+#define wxHtmlWindow_SelectWord 3480
+#define wxHtmlWindow_SetBorders 3481
+#define wxHtmlWindow_SetFonts 3482
+#define wxHtmlWindow_SetPage 3483
+#define wxHtmlWindow_SetRelatedFrame 3484
+#define wxHtmlWindow_SetRelatedStatusBar 3485
+#define wxHtmlWindow_ToText 3486
+#define wxHtmlWindow_destroy 3487
+#define wxHtmlLinkEvent_GetLinkInfo 3488
+#define wxSystemSettings_GetColour 3489
+#define wxSystemSettings_GetFont 3490
+#define wxSystemSettings_GetMetric 3491
+#define wxSystemSettings_GetScreenType 3492
+#define wxSystemOptions_GetOption 3493
+#define wxSystemOptions_GetOptionInt 3494
+#define wxSystemOptions_HasOption 3495
+#define wxSystemOptions_IsFalse 3496
+#define wxSystemOptions_SetOption_2_1 3497
+#define wxSystemOptions_SetOption_2_0 3498
+#define wxAuiNotebookEvent_SetSelection 3499
+#define wxAuiNotebookEvent_GetSelection 3500
+#define wxAuiNotebookEvent_SetOldSelection 3501
+#define wxAuiNotebookEvent_GetOldSelection 3502
+#define wxAuiNotebookEvent_SetDragSource 3503
+#define wxAuiNotebookEvent_GetDragSource 3504
+#define wxAuiManagerEvent_SetManager 3505
+#define wxAuiManagerEvent_GetManager 3506
+#define wxAuiManagerEvent_SetPane 3507
+#define wxAuiManagerEvent_GetPane 3508
+#define wxAuiManagerEvent_SetButton 3509
+#define wxAuiManagerEvent_GetButton 3510
+#define wxAuiManagerEvent_SetDC 3511
+#define wxAuiManagerEvent_GetDC 3512
+#define wxAuiManagerEvent_Veto 3513
+#define wxAuiManagerEvent_GetVeto 3514
+#define wxAuiManagerEvent_SetCanVeto 3515
+#define wxAuiManagerEvent_CanVeto 3516
+#define wxLogNull_new 3517
+#define wxLogNull_destroy 3518
+#define wxTaskBarIcon_new 3519
+#define wxTaskBarIcon_destruct 3520
+#define wxTaskBarIcon_PopupMenu 3521
+#define wxTaskBarIcon_RemoveIcon 3522
+#define wxTaskBarIcon_SetIcon 3523
diff --git a/lib/wx/c_src/wxe_impl.cpp b/lib/wx/c_src/wxe_impl.cpp
index 69fcd4e362..527fabc315 100644
--- a/lib/wx/c_src/wxe_impl.cpp
+++ b/lib/wx/c_src/wxe_impl.cpp
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2011. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2012. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
@@ -30,6 +30,11 @@
// Ok ugly but needed for wxBufferedDC crash workaround
#define private public
#include <wx/dcbuffer.h>
+
+#if defined(__WXMSW__)
+ #include <wx/msw/private.h> // for wxSetInstance
+#endif
+
#undef private
#include "wxe_impl.h"
@@ -222,6 +227,11 @@ void *wxe_main_loop(void *vpdl)
// This should be done in emulator but it's not in yet.
#ifndef _WIN32
erts_thread_disable_fpe();
+#else
+ // Setup that wxWidgets should look for cursors and icons in
+ // this dll and not in werl.exe (which is the default)
+ HMODULE WXEHandle = GetModuleHandle(_T("wxe_driver"));
+ wxSetInstance((HINSTANCE) WXEHandle);
#endif
result = wxEntry(argc, argv);
@@ -248,20 +258,30 @@ wxFrame * dummy_window;
void create_dummy_window() {
dummy_window = new wxFrame(NULL,-1, wxT("wx driver"),
- wxDefaultPosition, wxSize(5,5),
+ wxPoint(0,0), wxSize(5,5),
wxFRAME_NO_TASKBAR);
+
+ wxMenuBar * menubar = new wxMenuBar();
+ dummy_window->SetMenuBar(menubar);
+ // wx-2.9 Don't delete the app menubar correctly
dummy_window->Connect(wxID_ANY, wxEVT_CLOSE_WINDOW,
(wxObjectEventFunction) (wxEventFunction) &WxeApp::dummy_close);
+ dummy_window->Connect(wxID_ANY, wxEVT_COMMAND_MENU_SELECTED,
+ (wxObjectEventFunction) (wxEventFunction) &WxeApp::dummy_close);
+ dummy_window->Show(true);
+ // dummy_window->Show(false);
}
// wxMac really wants a top level window which command-q quits if there are no
// windows open, and this will kill the thread, so restart the dummy_window each
// time a we receive a close.
void WxeApp::dummy_close(wxEvent& Ev) {
- // fprintf(stderr, "Tried to close dummy window\r\n"); fflush(stderr);
- create_dummy_window();
+ if(Ev.GetEventType() == wxEVT_CLOSE_WINDOW) {
+ create_dummy_window();
+ }
}
+
// Init wx-widgets thread
bool WxeApp::OnInit()
{
@@ -272,7 +292,7 @@ bool WxeApp::OnInit()
wxe_batch_cb_saved = new wxList;
cb_buff = NULL;
- wxIdleEvent::SetMode(wxIDLE_PROCESS_SPECIFIED);
+ // wxIdleEvent::SetMode(wxIDLE_PROCESS_SPECIFIED); Hmm printpreview doesn't work in 2.9 with this
this->Connect(wxID_ANY, wxEVT_IDLE,
(wxObjectEventFunction) (wxEventFunction) &WxeApp::idle);
@@ -290,7 +310,11 @@ bool WxeApp::OnInit()
/* Create a dummy window so wxWidgets don't automagicly quits the main loop
after the last window */
+#ifdef __DARWIN__
create_dummy_window();
+#else
+ SetExitOnFrameDelete(false);
+#endif
init_nonconsts(global_me, init_caller);
erl_drv_mutex_lock(wxe_status_m);
@@ -301,7 +325,9 @@ bool WxeApp::OnInit()
}
void WxeApp::shutdown(wxeMetaCommand& Ecmd) {
+#ifdef __DARWIN__
delete dummy_window;
+#endif
ExitMainLoop();
}
diff --git a/lib/wx/c_src/wxe_ps_init.c b/lib/wx/c_src/wxe_ps_init.c
index a85f751024..025ea90f8b 100644
--- a/lib/wx/c_src/wxe_ps_init.c
+++ b/lib/wx/c_src/wxe_ps_init.c
@@ -25,12 +25,17 @@
#include <Cocoa/Cocoa.h>
#include <objc/objc-runtime.h>
+extern OSErr CPSSetProcessName (ProcessSerialNumber *psn, char *processname);
+
void * wxe_ps_init()
{
ProcessSerialNumber psn;
NSAutoreleasePool *pool;
// Enable GUI
GetCurrentProcess(&psn);
+ char *app_title = getenv("WX_APP_TITLE");
+ // Undocumented function (but no documented way of doing this exists)
+ CPSSetProcessName(&psn, app_title?app_title:"Erlang");
TransformProcessType(&psn, kProcessTransformToForegroundApplication);
SetFrontProcess(&psn);
// Enable Cocoa calls from Carbon app
diff --git a/lib/wx/configure.in b/lib/wx/configure.in
index 7b35fed672..c45d2285af 100755
--- a/lib/wx/configure.in
+++ b/lib/wx/configure.in
@@ -80,20 +80,20 @@ fi
## Otherwise skip building wxErlang
AC_CHECK_SIZEOF(void *)
-case $ac_cv_sizeof_void_p-$host_os in
- 8-darwin*)
- if test X"$WX_BUILDING_INSIDE_ERLSRC" != X"true" ; then
- AC_MSG_ERROR([Can not use 64bits wxWidgets on Darwin])
- else
- echo "Can not combine 64bits erlang with wxWidgets on MacOSX, wx will not be useable" > ./CONF_INFO
- WXERL_CAN_BUILD_DRIVER=false
- AC_MSG_WARN([Can not combine 64bits erlang with wxWidgets on MacOSX, wx will not be useable])
- fi
- WXERL_CAN_BUILD_DRIVER=false
- ;;
- *)
- ;;
-esac
+# case $ac_cv_sizeof_void_p-$host_os in
+# 8-darwin*)
+# if test X"$WX_BUILDING_INSIDE_ERLSRC" != X"true" ; then
+# AC_MSG_ERROR([Can not use 64bits wxWidgets on Darwin])
+# else
+# echo "Can not combine 64bits erlang with wxWidgets on MacOSX, wx will not be useable" > ./CONF_INFO
+# WXERL_CAN_BUILD_DRIVER=false
+# AC_MSG_WARN([Can not combine 64bits erlang with wxWidgets on MacOSX, wx will not be useable])
+# fi
+# WXERL_CAN_BUILD_DRIVER=false
+# ;;
+# *)
+# ;;
+# esac
PTHR_CFLAGS="-D_THREAD_SAFE -D_REENTRANT"
@@ -155,7 +155,7 @@ case $host_os in
OBJC_CFLAGS="-ObjC"
fi
fi
- CFLAGS=$saved_CFLAGS
+ CFLAGS="$saved_CFLAGS -Wno-deprecated-declarations"
CPPFLAGS="$CPPFLAGS -D_MACOSX $PTHR_CFLAGS"
;;
mingw32)
@@ -169,6 +169,7 @@ case $host_os in
CPPFLAGS="$CPPFLAGS -D_WIN32_WINNT=0x0500"
;;
*)
+ CFLAGS="$CFLAGS -Wno-deprecated-declarations"
CPPFLAGS="$CPPFLAGS -D_GNU_SOURCE $PTHR_CFLAGS"
;;
esac
@@ -252,6 +253,18 @@ else
AC_CHECK_HEADERS([gl/gl.h],[],[],[#include <windows.h>])
fi
+if test X"$host_os" != X"win32" ; then
+ AC_CHECK_HEADERS([GL/glu.h], [],
+ [AC_CHECK_HEADERS([OpenGL/glu.h])])
+ if test X"$ac_cv_header_GL_glu_h" != Xyes &&
+ test X"$ac_cv_header_OpenGL_glu_h" != Xyes
+ then
+ AC_MSG_WARN([No GLU headers found, wx will NOT be usable])
+ fi
+else
+ AC_CHECK_HEADERS([gl/glu.h],[],[],[#include <windows.h>])
+fi
+
AC_SUBST(GL_LIBS)
CXXFLAGS="$CFLAGS $CPPFLAGS"
@@ -308,7 +321,15 @@ if test "$cross_compiling" = "yes"; then
echo "Cross compilation of the wx driver is not supported yet, wx will NOT be usable" > ./CONF_INFO
WXERL_CAN_BUILD_DRIVER=false
elif test X"$MIXED_CYGWIN_VC" == X"no" -a X"$MIXED_MSYS_VC" == X"no"; then
- m4_include(wxwin.m4)
+ WX_VERSION=`wx-config --version`
+ case $WX_VERSION in
+ 2.8.*)
+ m4_include(wxwin-2.8.m4)
+ ;;
+ *)
+ m4_include(wxwin-2.9.m4)
+ ;;
+ esac
AM_OPTIONS_WXCONFIG
reqwx=2.8.4
@@ -395,12 +416,12 @@ else
else
CWXWIN_PROG=`cygpath -d "$PROGRAMFILES" | cygpath -f - 2>/dev/null`
fi
- CWXWIN3=$CWXWIN_PROG/wxWidgets-2.8
- CWXWIN4=$CWXWIN_PROG/wxMSW-2.8
- CWX_DOCUMENTED="/opt/local/pgm/wxMSW-2.8.* /opt/local/pgm/wxWidgets-2.8.*"
+ CWXWIN3=$CWXWIN_PROG/wxWidgets-2.*.*
+ CWXWIN4=$CWXWIN_PROG/wxMSW-2.*.*
+ CWX_DOCUMENTED="/opt/local/pgm/wxMSW-2.*.* /opt/local/pgm/wxWidgets-2.*.*"
case $ac_cv_sizeof_void_p in
8)
- CWX_DOCUMENTED="/opt/local64/pgm/wxMSW-2.8.* /opt/local64/pgm/wxWidgets-2.8.* $CWX_DOCUMENTED"
+ CWX_DOCUMENTED="/opt/local64/pgm/wxMSW-2.*.* /opt/local64/pgm/wxWidgets-2.*.* $CWX_DOCUMENTED"
;;
*)
true
@@ -442,6 +463,7 @@ else
fi
fi
done
+
if test -z "$WX_LIBS_STATIC"; then
AC_MSG_RESULT([failed])
if test X"$WX_BUILDING_INSIDE_ERLSRC" != X"true" ; then
@@ -621,6 +643,12 @@ fi dnl - if test "$WXERL_CAN_BUILD_DRIVER" != "false"
AC_SUBST(WXERL_CAN_BUILD_DRIVER)
+if test "x$GCC" = xyes; then
+ # Treat certain GCC warnings as errors
+ LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CFLAGS])
+ LM_TRY_ENABLE_CFLAG([-Werror=return-type], [CXXFLAGS])
+fi
+
#############################################################################
dnl
diff --git a/lib/wx/examples/demo/demo.erl b/lib/wx/examples/demo/demo.erl
index 61e71af021..2f560096f5 100644
--- a/lib/wx/examples/demo/demo.erl
+++ b/lib/wx/examples/demo/demo.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -32,6 +32,21 @@
-record(state, {win, demo, example, selector, log, code}).
+%% For wx-2.9 usage
+-ifndef(wxSTC_ERLANG_COMMENT_FUNCTION).
+-define(wxSTC_ERLANG_COMMENT_FUNCTION, 14).
+-define(wxSTC_ERLANG_COMMENT_MODULE, 15).
+-define(wxSTC_ERLANG_COMMENT_DOC, 16).
+-define(wxSTC_ERLANG_COMMENT_DOC_MACRO, 17).
+-define(wxSTC_ERLANG_ATOM_QUOTED, 18).
+-define(wxSTC_ERLANG_MACRO_QUOTED, 19).
+-define(wxSTC_ERLANG_RECORD_QUOTED, 20).
+-define(wxSTC_ERLANG_NODE_NAME_QUOTED, 21).
+-define(wxSTC_ERLANG_BIFS, 22).
+-define(wxSTC_ERLANG_MODULES, 23).
+-define(wxSTC_ERLANG_MODULES_ATT, 24).
+-endif.
+
start() ->
start([]).
@@ -78,6 +93,7 @@ init(Options) ->
wxFrame:setMenuBar(Frame,MB),
wxFrame:connect(Frame, command_menu_selected),
+ wxFrame:connect(Frame, close_window),
_SB = wxFrame:createStatusBar(Frame,[]),
@@ -179,6 +195,8 @@ create_subwindow(Parent, BoxLabel, Funs) ->
%% Handled as in normal gen_server callbacks
handle_info({'EXIT',_, wx_deleted}, State) ->
{noreply,State};
+handle_info({'EXIT',_, shutdown}, State) ->
+ {noreply,State};
handle_info({'EXIT',_, normal}, State) ->
{noreply,State};
handle_info(Msg, State) ->
@@ -197,13 +215,13 @@ handle_cast(Msg, State) ->
handle_event(#wx{event=#wxCommand{type=command_listbox_selected, cmdString=Ex}},
State = #state{demo={_,DemoSz}, example=Example, code=Code}) ->
case Ex of
- [] ->
+ [] ->
{noreply, State};
_ ->
wxSizer:detach(DemoSz, Example),
- wxWindow:destroy(Example),
+ wx_object:call(Example, shutdown),
unload_code(Code),
- NewExample = load_example(Ex, State),
+ NewExample = load_example(Ex, State),
wxSizer:add(DemoSz, NewExample, [{proportion,1}, {flag, ?wxEXPAND}]),
wxSizer:layout(DemoSz),
{noreply, State#state{example=NewExample}}
@@ -247,9 +265,9 @@ handle_event(#wx{id = Id,
?wxICON_INFORMATION bor
?wxSTAY_ON_TOP},
{caption, "About"}])),
- {noreply, State};
+ {noreply, State};
?wxID_EXIT ->
- wx_object:get_pid(State#state.example) ! stop,
+ wx_object:call(State#state.example, shutdown),
{stop, normal, State};
_ ->
{noreply, State}
@@ -265,9 +283,9 @@ handle_event(Ev,State) ->
code_change(_, _, State) ->
{stop, not_yet_implemented, State}.
-terminate(_Reason, State) ->
- wx_object:get_pid(State#state.example) ! stop,
- timer:sleep(200), %% Give the example process some time to cleanup.
+terminate(_Reason, State = #state{win=Frame}) ->
+ catch wx_object:call(State#state.example, shutdown),
+ wxFrame:destroy(Frame),
wx:destroy().
%%%%%%%%%%%%%%%%% Internals %%%%%%%%%%
@@ -275,8 +293,6 @@ terminate(_Reason, State) ->
load_example(Ex, #state{demo={DemoPanel,DemoSz}, log=EvCtrl, code=Code}) ->
ModStr = "ex_" ++ Ex,
Mod = list_to_atom(ModStr),
-%% WxDir = code:lib_dir(wx),
-%% ModFile = filename:join([WxDir, "examples","demo", ModStr ++ ".erl"]),
ModFile = ModStr ++ ".erl",
load_code(Code, file:read_file(ModFile)),
find(Code),
@@ -312,7 +328,20 @@ code_area(Parent) ->
{?wxSTC_ERLANG_MACRO, {40,144,170}},
{?wxSTC_ERLANG_RECORD, {40,100,20}},
{?wxSTC_ERLANG_SEPARATOR,{0,0,0}},
- {?wxSTC_ERLANG_NODE_NAME,{0,0,0}}],
+ {?wxSTC_ERLANG_NODE_NAME,{0,0,0}},
+ %% Optional 2.9 stuff
+ {?wxSTC_ERLANG_COMMENT_FUNCTION, {160,53,35}},
+ {?wxSTC_ERLANG_COMMENT_MODULE, {160,53,35}},
+ {?wxSTC_ERLANG_COMMENT_DOC, {160,53,35}},
+ {?wxSTC_ERLANG_COMMENT_DOC_MACRO, {160,53,35}},
+ {?wxSTC_ERLANG_ATOM_QUOTED, {0,0,0}},
+ {?wxSTC_ERLANG_MACRO_QUOTED, {40,144,170}},
+ {?wxSTC_ERLANG_RECORD_QUOTED, {40,100,20}},
+ {?wxSTC_ERLANG_NODE_NAME_QUOTED, {0,0,0}},
+ {?wxSTC_ERLANG_BIFS, {130,40,172}},
+ {?wxSTC_ERLANG_MODULES, {64,102,244}},
+ {?wxSTC_ERLANG_MODULES_ATT, {64,102,244}}
+ ],
SetStyle = fun({Style, Color}) ->
?stc:styleSetFont(Ed, Style, FixedFont),
?stc:styleSetForeground(Ed, Style, Color)
diff --git a/lib/wx/examples/demo/ex_aui.erl b/lib/wx/examples/demo/ex_aui.erl
index 50f077638d..70372caad8 100644
--- a/lib/wx/examples/demo/ex_aui.erl
+++ b/lib/wx/examples/demo/ex_aui.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -32,7 +32,8 @@
-record(state,
{
parent,
- config
+ config,
+ aui
}).
start(Config) ->
@@ -47,12 +48,10 @@ init(Config) ->
do_init(Config) ->
Parent = proplists:get_value(parent, Config),
Panel = wxPanel:new(Parent, []),
-
%% Setup sizers
MainSizer = wxBoxSizer:new(?wxVERTICAL),
- Manager = wxAuiManager:new([{managed_wnd, Panel}
- ]),
+ Manager = wxAuiManager:new([{managed_wnd, Panel}]),
Pane = ?pi:new(),
?pi:closeButton(Pane),
@@ -79,8 +78,8 @@ do_init(Config) ->
wxAuiManager:connect(Manager, aui_pane_button, [{skip,true}]),
wxAuiManager:connect(Manager, aui_pane_maximize, [{skip,true}]),
wxAuiManager:update(Manager),
-
- {Panel, #state{parent=Panel, config=Config}}.
+ process_flag(trap_exit, true),
+ {Panel, #state{parent=Panel, config=Config, aui=Manager}}.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% Callbacks handled as normal gen_server callbacks
@@ -88,6 +87,12 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel, aui=Manager}) ->
+ wxAuiManager:unInit(Manager),
+ wxAuiManager:destroy(Manager),
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
@@ -134,11 +139,10 @@ handle_event(Ev = #wx{}, State) ->
io:format("~p\n", [Ev]),
{noreply, State}.
-
code_change(_, _, State) ->
{stop, ignore, State}.
-terminate(_Reason, _State) ->
+terminate(_Reason, _) ->
ok.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/wx/examples/demo/ex_button.erl b/lib/wx/examples/demo/ex_button.erl
index 0dd0363933..41bf34e572 100644
--- a/lib/wx/examples/demo/ex_button.erl
+++ b/lib/wx/examples/demo/ex_button.erl
@@ -25,7 +25,8 @@
-include_lib("wx/include/wx.hrl").
-behaviour(wx_object).
--export([start/1, init/1, terminate/2, code_change/3,
+-export([start/1, init/1,
+ terminate/2, code_change/3,
handle_info/2, handle_call/3, handle_cast/2, handle_event/2]).
-record(state,
@@ -120,6 +121,7 @@ do_init(Config) ->
wxWindow:connect(Panel, command_button_clicked),
wxWindow:setSizer(Panel, Sz),
wxSizer:layout(Sz),
+ wxWindow:refresh(Panel),
wxScrolledWindow:setScrollRate(Panel, 5, 5),
{Panel, #state{parent=Panel, config=Config}}.
@@ -149,6 +151,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p~n",[Msg]),
{noreply,State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p~n",[Msg]),
{reply,ok,State}.
@@ -160,7 +166,7 @@ handle_cast(Msg, State) ->
code_change(_, _, State) ->
{stop, ignore, State}.
-terminate(_Reason, _State) ->
+terminate(_Reason, _) ->
ok.
%%%%% a copy from wxwidgets samples.
diff --git a/lib/wx/examples/demo/ex_canvas.erl b/lib/wx/examples/demo/ex_canvas.erl
index 1ec4760f40..1f1d260276 100644
--- a/lib/wx/examples/demo/ex_canvas.erl
+++ b/lib/wx/examples/demo/ex_canvas.erl
@@ -140,6 +140,9 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
@@ -151,7 +154,7 @@ handle_cast(Msg, State) ->
code_change(_, _, State) ->
{stop, ignore, State}.
-terminate(_Reason, _State) ->
+terminate(_Reason, _) ->
ok.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/wx/examples/demo/ex_canvas_paint.erl b/lib/wx/examples/demo/ex_canvas_paint.erl
index 9bc083766a..6873724655 100644
--- a/lib/wx/examples/demo/ex_canvas_paint.erl
+++ b/lib/wx/examples/demo/ex_canvas_paint.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -207,6 +207,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
@@ -218,7 +222,7 @@ handle_cast(Msg, State) ->
code_change(_, _, State) ->
{stop, ignore, State}.
-terminate(_Reason, _State) ->
+terminate(_Reason, _) ->
ok.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
@@ -239,14 +243,17 @@ draw(Canvas, Bitmap, Fun) ->
wxMemoryDC:destroy(MemoryDC).
redraw(DC, Bitmap) ->
- MemoryDC = wxMemoryDC:new(Bitmap),
+ try
+ MemoryDC = wxMemoryDC:new(Bitmap),
- wxDC:blit(DC, {0,0},
- {wxBitmap:getWidth(Bitmap), wxBitmap:getHeight(Bitmap)},
- MemoryDC, {0,0}),
-
- wxMemoryDC:destroy(MemoryDC).
+ wxDC:blit(DC, {0,0},
+ {wxBitmap:getWidth(Bitmap), wxBitmap:getHeight(Bitmap)},
+ MemoryDC, {0,0}),
+ wxMemoryDC:destroy(MemoryDC)
+ catch error:{{badarg,_},_} -> %% Bitmap have been deleted
+ ok
+ end.
-getPageInfo(_This) ->
+getPageInfo(_This) ->
{1,1,1,1}.
diff --git a/lib/wx/examples/demo/ex_choices.erl b/lib/wx/examples/demo/ex_choices.erl
index 2e456ae249..b4418293c1 100644
--- a/lib/wx/examples/demo/ex_choices.erl
+++ b/lib/wx/examples/demo/ex_choices.erl
@@ -143,6 +143,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n",[Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply, {error,nyi}, State}.
@@ -154,7 +158,7 @@ handle_cast(Msg, State) ->
code_change(_, _, State) ->
{stop, ignore, State}.
-terminate(_Reason, _State) ->
+terminate(_Reason, _) ->
ok.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/wx/examples/demo/ex_cursor.erl b/lib/wx/examples/demo/ex_cursor.erl
index c1a558541b..2f1eaaf7c7 100644
--- a/lib/wx/examples/demo/ex_cursor.erl
+++ b/lib/wx/examples/demo/ex_cursor.erl
@@ -131,6 +131,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_dialogs.erl b/lib/wx/examples/demo/ex_dialogs.erl
index b39344f8b1..5c47b51271 100644
--- a/lib/wx/examples/demo/ex_dialogs.erl
+++ b/lib/wx/examples/demo/ex_dialogs.erl
@@ -149,6 +149,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_frame_utils.erl b/lib/wx/examples/demo/ex_frame_utils.erl
index a90642b355..4a59bb3a68 100644
--- a/lib/wx/examples/demo/ex_frame_utils.erl
+++ b/lib/wx/examples/demo/ex_frame_utils.erl
@@ -98,6 +98,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_gauge.erl b/lib/wx/examples/demo/ex_gauge.erl
index ffc667ff05..c53dfb807b 100644
--- a/lib/wx/examples/demo/ex_gauge.erl
+++ b/lib/wx/examples/demo/ex_gauge.erl
@@ -114,6 +114,10 @@ handle_info(pulse, State=#state{undeterminate_gauge = Gauge=#gauge{obj = Obj}})
Timer = erlang:send_after(300, self(), pulse),
{noreply, State#state{undeterminate_gauge = Gauge#gauge{timer = Timer}}}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply,ok, State}.
diff --git a/lib/wx/examples/demo/ex_gl.erl b/lib/wx/examples/demo/ex_gl.erl
index 72dad2cf9d..6bb2d12dff 100644
--- a/lib/wx/examples/demo/ex_gl.erl
+++ b/lib/wx/examples/demo/ex_gl.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -20,7 +20,8 @@
-behaviour(wx_object).
--export([init/1, code_change/3, handle_info/2, handle_event/2,
+-export([init/1, code_change/3, handle_info/2,
+ handle_sync_event/3, handle_event/2,
handle_call/3, handle_cast/2, terminate/2,
start/1]).
@@ -34,6 +35,7 @@
config,
gl,
canvas,
+ image,
timer,
time
}).
@@ -58,7 +60,7 @@ do_init(Config) ->
%% Setup sizer
Sizer = wxStaticBoxSizer:new(?wxHORIZONTAL, Panel, [{label, "wxGLCanvas"}]),
- Opts = [{size, {300,300}}, {style, ?wxSUNKEN_BORDER}],
+ Opts = [{style, ?wxFULL_REPAINT_ON_RESIZE}],
GLAttrib = [{attribList, [?WX_GL_RGBA,
?WX_GL_DOUBLEBUFFER,
?WX_GL_MIN_RED,8,
@@ -67,34 +69,48 @@ do_init(Config) ->
?WX_GL_DEPTH_SIZE,24,0]}],
Canvas = wxGLCanvas:new(Panel,Opts ++ GLAttrib),
wxGLCanvas:connect(Canvas, size),
+ wxGLCanvas:connect(Canvas, paint, [callback]),
- wxGLCanvas:setCurrent(Canvas),
Image = wxImage:scale(wxImage:new("image.jpg"), 128,128),
- GL = setup_gl(Canvas,Image),
- Timer = timer:send_interval(20, self(), update),
%% Add to sizers
wxSizer:add(Sizer, Canvas, [{flag, ?wxEXPAND},{proportion, 1}]),
wxWindow:setSizer(Panel,Sizer),
wxSizer:layout(Sizer),
+ Timer = timer:send_interval(20, self(), update),
{Panel, #state{parent = Panel, config = Config,
- canvas = Canvas,
- gl = GL, timer = Timer}}.
+ canvas = Canvas, image=Image,
+ timer = Timer}}.
%% Event handling
-handle_event(#wx{event = #wxSize{size = {W,H}}}, State) ->
- case W =:= 0 orelse H =:= 0 of
- true -> skip;
- _ ->
+handle_sync_event(_PaintEvent, _, #state{canvas=Canvas}) ->
+ %% Sync events are called from a temporary process,
+ %% we need to setup the gl canvas on cocoa for some reason
+ %% We do not really have to do anything, the timer event will refresh the painting
+ wxGLCanvas:setCurrent(Canvas),
+ DC= wxPaintDC:new(Canvas),
+ wxPaintDC:destroy(DC),
+ ok.
+
+handle_event(#wx{event = #wxSize{size = {W,H}}}, State = #state{gl=GL}) ->
+ if
+ GL =:= undefined ->
+ #state{canvas=Canvas, image=Image} = State,
+ wxGLCanvas:setCurrent(Canvas),
+ {noreply, State#state{gl=setup_gl(Canvas,Image)}};
+ W =:= 0, H =:= 0 -> {noreply, State};
+ true ->
gl:viewport(0,0,W,H),
gl:matrixMode(?GL_PROJECTION),
gl:loadIdentity(),
gl:ortho( -2.0, 2.0, -2.0*H/W, 2.0*H/W, -20.0, 20.0),
gl:matrixMode(?GL_MODELVIEW),
- gl:loadIdentity()
- end,
- {noreply, State}.
+ gl:loadIdentity(),
+ {noreply, State}
+ end.
+handle_info(update, State=#state{gl=undefined}) ->
+ {noreply, State};
handle_info(update, State) ->
S1 = update_rotation(State),
GL = S1#state.gl,
@@ -113,7 +129,13 @@ handle_info(stop, State) ->
timer:cancel(State#state.timer),
catch wxGLCanvas:destroy(State#state.canvas),
{stop, normal, State}.
-
+
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ catch wxGLCanvas:destroy(State#state.canvas),
+ timer:cancel(State#state.timer),
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
io:format("Got Call ~p~n",[Msg]),
{reply,ok,State}.
@@ -125,11 +147,8 @@ handle_cast(Msg, State) ->
code_change(_, _, State) ->
{stop, not_yet_implemented, State}.
-terminate(_Reason, State) ->
- catch wxGLCanvas:destroy(State#state.canvas),
- timer:cancel(State#state.timer),
- timer:sleep(300).
-
+terminate(_Reason, _State) ->
+ ok.
-define(VS, {{-0.5, -0.5, -0.5}, %1
diff --git a/lib/wx/examples/demo/ex_graphicsContext.erl b/lib/wx/examples/demo/ex_graphicsContext.erl
index c356500d99..59bfe7ff64 100644
--- a/lib/wx/examples/demo/ex_graphicsContext.erl
+++ b/lib/wx/examples/demo/ex_graphicsContext.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -25,8 +25,8 @@
%% wx_object callbacks
-export([init/1, terminate/2, code_change/3,
- handle_info/2, handle_call/3,
-handle_cast/2, handle_event/2, handle_sync_event/3]).
+ handle_info/2, handle_call/3,handle_cast/2,
+ handle_event/2, handle_sync_event/3]).
-include_lib("wx/include/wx.hrl").
@@ -57,11 +57,9 @@ do_init(Config) ->
[{label, "wxGrapicsContext"}]),
Win = wxPanel:new(Panel, []),
- Pen = wxPen:new(),
- Brush = wxBrush:new(?wxBLACK),
- Font = wxFont:new(),
- wxFont:setWeight(Font, ?wxBOLD),
-
+ Pen = ?wxBLACK_PEN,
+ Brush = wxBrush:new({30, 175, 23, 127}),
+ Font = ?wxITALIC_FONT,
wxPanel:connect(Win, paint, [callback]),
%% Add to sizers
@@ -94,6 +92,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
@@ -112,36 +114,26 @@ terminate(_Reason, _State) ->
%% Local functions
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
-draw(Win, Pen0, _Brush0, Font0) ->
+draw(Win, Pen, Brush, Font) ->
try
Canvas = wxGraphicsContext:create(Win),
- Pen = wxGraphicsContext:createPen(Canvas, Pen0),
wxGraphicsContext:setPen(Canvas, Pen),
- Brush = wxGraphicsContext:createLinearGradientBrush(Canvas, 0.0,0.0, 30.0,30.0,
- {200,50,50,50},
- {200,50,50,200}),
wxGraphicsContext:setBrush(Canvas, Brush),
- Font = wxGraphicsContext:createFont(Canvas, Font0),
- wxGraphicsContext:setFont(Canvas, Font),
+ wxGraphicsContext:setFont(Canvas, Font, {0, 0, 50}),
wxGraphicsContext:drawRoundedRectangle(Canvas, 35.0,35.0, 100.0, 50.0, 10.0),
- wxGraphicsContext:drawText(Canvas, "Welcome", 60.0, 55.0),
+ wxGraphicsContext:drawText(Canvas, "This text should be antialised", 60.0, 55.0),
Path = wxGraphicsContext:createPath(Canvas),
wxGraphicsPath:addCircle(Path, 0.0, 0.0, 40.0),
wxGraphicsPath:closeSubpath(Path),
- wxGraphicsContext:translate(Canvas, 100.0, 100.0),
-
- Brush2 = wxGraphicsContext:createLinearGradientBrush(Canvas, 0.0,0.0, 30.0,30.0,
- {50,200,50,50},
- {50,50,200,50}),
- wxGraphicsContext:setBrush(Canvas, Brush2),
+ wxGraphicsContext:translate(Canvas, 100.0, 250.0),
- F = fun(_) ->
+ F = fun(N) ->
wxGraphicsContext:scale(Canvas, 1.1, 1.1),
- wxGraphicsContext:translate(Canvas, 3.0,3.0),
+ wxGraphicsContext:translate(Canvas, 15.0,-1.0*N),
wxGraphicsContext:drawPath(Canvas, Path)
end,
- wx:foreach(F, lists:seq(1,5)),
+ wx:foreach(F, lists:seq(1,10)),
ok
catch _:{not_supported, _} ->
Err = "wxGraphicsContext not available in this build of wxwidgets",
diff --git a/lib/wx/examples/demo/ex_grid.erl b/lib/wx/examples/demo/ex_grid.erl
index d1a9952ab2..e284836d5b 100644
--- a/lib/wx/examples/demo/ex_grid.erl
+++ b/lib/wx/examples/demo/ex_grid.erl
@@ -78,6 +78,10 @@ handle_event(#wx{event = #wxGrid{type = grid_cell_change,
handle_info(_Msg, State) ->
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(_Msg, _From, State) ->
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_htmlWindow.erl b/lib/wx/examples/demo/ex_htmlWindow.erl
index 564c790e48..af3d4c71f5 100644
--- a/lib/wx/examples/demo/ex_htmlWindow.erl
+++ b/lib/wx/examples/demo/ex_htmlWindow.erl
@@ -77,6 +77,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_listCtrl.erl b/lib/wx/examples/demo/ex_listCtrl.erl
index 13096dfa52..2c62ac9d5f 100644
--- a/lib/wx/examples/demo/ex_listCtrl.erl
+++ b/lib/wx/examples/demo/ex_listCtrl.erl
@@ -58,8 +58,8 @@ do_init(Config) ->
IL = wxImageList:new(16,16),
wxImageList:add(IL, wxArtProvider:getBitmap("wxART_COPY", [{size, {16,16}}])),
wxImageList:add(IL, wxArtProvider:getBitmap("wxART_MISSING_IMAGE", [{size, {16,16}}])),
- wxImageList:add(IL, wxArtProvider:getBitmap("wxART_TICK_MARK", [{size, {16,16}}])),
- wxImageList:add(IL, wxArtProvider:getBitmap("wxART_CROSS_MARK", [{size, {16,16}}])),
+ wxImageList:add(IL, wxArtProvider:getBitmap("wxART_QUESTION", [{size, {16,16}}])),
+ wxImageList:add(IL, wxArtProvider:getBitmap("wxART_WARNING", [{size, {16,16}}])),
wxListCtrl:assignImageList(ListCtrl2, IL, ?wxIMAGE_LIST_SMALL),
Fun =
fun(Item) ->
@@ -143,6 +143,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n",[Msg]),
{noreply,State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply,ok,State}.
diff --git a/lib/wx/examples/demo/ex_notebook.erl b/lib/wx/examples/demo/ex_notebook.erl
index fc38fdae08..5edcc65082 100644
--- a/lib/wx/examples/demo/ex_notebook.erl
+++ b/lib/wx/examples/demo/ex_notebook.erl
@@ -129,6 +129,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n",[Msg]),
{noreply,State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply,ok,State}.
diff --git a/lib/wx/examples/demo/ex_pickers.erl b/lib/wx/examples/demo/ex_pickers.erl
index 8013a5ba32..54f8c7a8e5 100644
--- a/lib/wx/examples/demo/ex_pickers.erl
+++ b/lib/wx/examples/demo/ex_pickers.erl
@@ -120,6 +120,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_popupMenu.erl b/lib/wx/examples/demo/ex_popupMenu.erl
index d6778c5dc5..f48b00963d 100644
--- a/lib/wx/examples/demo/ex_popupMenu.erl
+++ b/lib/wx/examples/demo/ex_popupMenu.erl
@@ -86,6 +86,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_radioBox.erl b/lib/wx/examples/demo/ex_radioBox.erl
index ab7685f41f..17a11d1054 100644
--- a/lib/wx/examples/demo/ex_radioBox.erl
+++ b/lib/wx/examples/demo/ex_radioBox.erl
@@ -103,6 +103,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n",[Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply, {error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_sashWindow.erl b/lib/wx/examples/demo/ex_sashWindow.erl
index d8a8958f28..9eb3b9b27e 100644
--- a/lib/wx/examples/demo/ex_sashWindow.erl
+++ b/lib/wx/examples/demo/ex_sashWindow.erl
@@ -112,6 +112,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_sizers.erl b/lib/wx/examples/demo/ex_sizers.erl
index 7b9e8eb37f..ecd539cd62 100644
--- a/lib/wx/examples/demo/ex_sizers.erl
+++ b/lib/wx/examples/demo/ex_sizers.erl
@@ -97,6 +97,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_slider.erl b/lib/wx/examples/demo/ex_slider.erl
index 612543ff26..4979e8b4f4 100644
--- a/lib/wx/examples/demo/ex_slider.erl
+++ b/lib/wx/examples/demo/ex_slider.erl
@@ -97,6 +97,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n",[Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply, {error, nyi},State}.
diff --git a/lib/wx/examples/demo/ex_splitterWindow.erl b/lib/wx/examples/demo/ex_splitterWindow.erl
index 4f25b73293..ac2fbe0113 100644
--- a/lib/wx/examples/demo/ex_splitterWindow.erl
+++ b/lib/wx/examples/demo/ex_splitterWindow.erl
@@ -86,6 +86,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_static.erl b/lib/wx/examples/demo/ex_static.erl
index 013bd5ac35..8cf477b55a 100644
--- a/lib/wx/examples/demo/ex_static.erl
+++ b/lib/wx/examples/demo/ex_static.erl
@@ -101,6 +101,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_textCtrl.erl b/lib/wx/examples/demo/ex_textCtrl.erl
index d82884f30b..57088ad878 100644
--- a/lib/wx/examples/demo/ex_textCtrl.erl
+++ b/lib/wx/examples/demo/ex_textCtrl.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -51,27 +51,23 @@ do_init(Config) ->
Sizer3 = wxStaticBoxSizer:new(?wxVERTICAL, Panel,
[{label, "wxTextCtrl multiline"}]),
- TextCtrl = wxTextCtrl:new(Panel, 1, [{value, "This is a single line wxTextCtrl"},
+ TextCtrl = wxTextCtrl:new(Panel, 1, [{value, "This is a single line wxTextCtrl"},
{style, ?wxDEFAULT}]),
TextCtrl2 = wxTextCtrl:new(Panel, 2, [{value, "password"},
- {style, ?wxDEFAULT bor
- ?wxTE_PASSWORD}]),
- TextCtrl3 = wxTextCtrl:new(Panel, 3, [{value, "This is a\n"
- "multiline\n"
- "wxTextCtrl"},
- {style, ?wxDEFAULT bor
- ?wxTE_MULTILINE}]),
+ {style, ?wxDEFAULT bor ?wxTE_PASSWORD}]),
+ TextCtrl3 = wxTextCtrl:new(Panel, 3, [{value, "This is a\nmultiline\nwxTextCtrl"},
+ {style, ?wxDEFAULT bor ?wxTE_MULTILINE}]),
%% Add to sizers
- wxSizer:add(Sizer, TextCtrl, [{flag, ?wxEXPAND}]),
+ wxSizer:add(Sizer, TextCtrl, [{flag, ?wxEXPAND}]),
wxSizer:add(Sizer2, TextCtrl2, []),
- wxSizer:add(Sizer3, TextCtrl3, [{flag, ?wxEXPAND}]),
+ wxSizer:add(Sizer3, TextCtrl3, [{flag, ?wxEXPAND}, {proportion, 1}]),
wxSizer:add(MainSizer, Sizer, [{flag, ?wxEXPAND}]),
wxSizer:addSpacer(MainSizer, 10),
wxSizer:add(MainSizer, Sizer2, [{flag, ?wxEXPAND}]),
wxSizer:addSpacer(MainSizer, 10),
- wxSizer:add(MainSizer, Sizer3, [{flag, ?wxEXPAND}]),
+ wxSizer:add(MainSizer, Sizer3, [{flag, ?wxEXPAND}, {proportion, 1}]),
wxPanel:setSizer(Panel, MainSizer),
{Panel, #state{parent=Panel, config=Config}}.
@@ -88,6 +84,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n",[Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config,"Got Call ~p\n",[Msg]),
{reply, {error,nyi}, State}.
diff --git a/lib/wx/examples/demo/ex_treeCtrl.erl b/lib/wx/examples/demo/ex_treeCtrl.erl
index 611904500a..7698ab1f00 100644
--- a/lib/wx/examples/demo/ex_treeCtrl.erl
+++ b/lib/wx/examples/demo/ex_treeCtrl.erl
@@ -105,6 +105,10 @@ handle_info(Msg, State) ->
demo:format(State#state.config, "Got Info ~p\n", [Msg]),
{noreply, State}.
+handle_call(shutdown, _From, State=#state{parent=Panel}) ->
+ wxPanel:destroy(Panel),
+ {stop, normal, ok, State};
+
handle_call(Msg, _From, State) ->
demo:format(State#state.config, "Got Call ~p\n", [Msg]),
{reply,{error, nyi}, State}.
diff --git a/lib/wx/examples/simple/menu.erl b/lib/wx/examples/simple/menu.erl
index 0025a0b027..9e6b28b46b 100644
--- a/lib/wx/examples/simple/menu.erl
+++ b/lib/wx/examples/simple/menu.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -105,7 +105,7 @@ create_frame(Wx) ->
Frame = wxFrame:new(Wx, -1, "wxErlang menu sample", [{size, {600,400}}]),
Path = filename:dirname(code:which(?MODULE)),
- wxFrame:setIcon(Frame, wxIcon:new(filename:join(Path,"sample.xpm"))),
+ wxFrame:setIcon(Frame, wxIcon:new(filename:join(Path,"sample.xpm"), [{type, ?wxBITMAP_TYPE_XPM}])),
wxFrame:createStatusBar(Frame,[]),
wxFrame:connect(Frame, close_window),
diff --git a/lib/wx/examples/simple/minimal.erl b/lib/wx/examples/simple/minimal.erl
index bdff66e217..4782745dfc 100644
--- a/lib/wx/examples/simple/minimal.erl
+++ b/lib/wx/examples/simple/minimal.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -41,8 +41,8 @@ start() ->
create_window(Wx) ->
Frame = wxFrame:new(Wx, -1, "Minimal wxErlang App", [{size, {600,400}}]),
- Path = filename:dirname(code:which(?MODULE)),
- wxFrame:setIcon(Frame, wxIcon:new(filename:join(Path,"sample.xpm"))),
+ Path = filename:dirname(code:which(?MODULE)),
+ wxFrame:setIcon(Frame, wxIcon:new(filename:join(Path,"sample.xpm"), [{type, ?wxBITMAP_TYPE_XPM}])),
wxFrame:createStatusBar(Frame,[]),
wxFrame:connect(Frame, close_window),
diff --git a/lib/wx/examples/sudoku/sudoku_board.erl b/lib/wx/examples/sudoku/sudoku_board.erl
index 4b26ff97da..ed9c62b7c8 100644
--- a/lib/wx/examples/sudoku/sudoku_board.erl
+++ b/lib/wx/examples/sudoku/sudoku_board.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -27,7 +27,7 @@
-export([new/1, setup_board/2, clear_board/1, left/1,
get_board_data/1,set_board_data/2,
set_butt/3, butt_correct/3,
- draw/3,
+ get_state/1, redraw/3,
%% Callbacks
init/1, handle_sync_event/3,
handle_event/2, handle_info/2, handle_call/3, handle_cast/2,
@@ -69,9 +69,8 @@ get_board_data(Board) ->
set_board_data(Board, List) ->
wx_object:call(Board, {set_board_data, List}).
-
-draw(Board, DC, Size) ->
- wx_object:call(Board, {draw, DC, Size}).
+get_state(Board) ->
+ wx_object:call(Board, get_state).
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
@@ -85,26 +84,29 @@ init([ParentObj, ParentPid]) ->
wxWindow:connect(Win, erase_background, []),
wxWindow:connect(Win, key_up, [{skip, true}]),
wxWindow:connect(Win, left_down, [{skip, true}]),
- wxWindow:connect(Win, enter_window, [{skip, true}]),
+ wxWindow:connect(Win, enter_window, [{skip, true}]),
%% Init pens and fonts
Pen = wxPen:new({0,0,0}, [{width, 3}]),
Fs0 = [{Sz,wxFont:new(Sz, ?wxSWISS, ?wxNORMAL, ?wxNORMAL,[])} ||
Sz <- [8,9,10,11,12,13,14,16,18,20,22,24,26,28,30,34,38,42,44,46]],
- TestDC = wxClientDC:new(Win),
+ TestDC = wxMemoryDC:new(),
+ Bitmap = wxBitmap:new(256,256),
+ wxMemoryDC:selectObject(TestDC, Bitmap),
+ true = wxDC:isOk(TestDC),
CW = fun({Sz,Font},Acc) ->
case wxFont:ok(Font) of
- true ->
+ true ->
wxDC:setFont(TestDC, Font),
- CH = wxDC:getCharHeight(TestDC),
+ CH = wxDC:getCharHeight(TestDC),
[{CH,Sz,Font} | Acc];
false ->
Acc
end
end,
Fs = lists:foldl(CW, [], Fs0),
- wxClientDC:destroy(TestDC),
- {Win, #state{win=Win, board=[], pen=Pen, fonts=Fs, parent=ParentPid}}.
+ wxMemoryDC:destroy(TestDC),
+ {Win, #state{win=Win, board=[], pen=Pen, fonts=Fs,parent=ParentPid}}.
handle_sync_event(#wx{event=#wxPaint{}}, _Obj, State = #state{win=Win}) ->
%% io:format("EPaint~n",[]),
@@ -119,22 +121,17 @@ handle_sync_event(#wx{event=#wxPaint{}}, _Obj, State = #state{win=Win}) ->
handle_event(#wx{event=#wxMouse{type=enter_window}}, State = #state{win=Win}) ->
wxWindow:setFocus(Win), %% Get keyboard focus
{noreply,State};
-handle_event(#wx{event=#wxKey{keyCode=KeyC, x=X,y=Y}},
+handle_event(#wx{event=#wxKey{keyCode=KeyC}},
S = #state{parent=Pid, win=Win}) ->
Val = if KeyC > 47, KeyC < 58 -> KeyC - $0;
KeyC > 325, KeyC < 336 -> KeyC - 326; %% NUM LOCK
true -> 0
end,
- case get_butt(X,Y,S) of
- error -> %% Mac don't get correct coordinates.
- Global = wx_misc:getMousePosition(),
- {CX,CY} = wxWindow:screenToClient(Win, Global),
- case get_butt(CX,CY,S) of
- error -> ignore;
- Id -> Pid ! {set_val,Id,Val}
- end;
- Id ->
- Pid ! {set_val,Id,Val}
+ Global = wx_misc:getMousePosition(),
+ {CX,CY} = wxWindow:screenToClient(Win, Global),
+ case get_butt(CX,CY,S) of
+ error -> ignore;
+ Id -> Pid ! {set_val,Id,Val}
end,
{noreply, S};
handle_event(#wx{event=#wxMouse{type=left_down,x=X,y=Y}},
@@ -205,9 +202,8 @@ handle_call({set_board_data, B},_From, S0) ->
handle_call(left,_From, S = #state{board=B}) ->
Res = 81 - length([ok || #sq{correct=C} <- B, C /= false]),
{reply, Res, S};
-handle_call({draw, DC, Size},_From, S) ->
- redraw(DC,Size,S),
- {reply, ok, S}.
+handle_call(get_state, _From, S) ->
+ {reply, {ok,S}, S}.
handle_cast(Msg, State) ->
io:format("Got cast ~p~n",[Msg]),
diff --git a/lib/wx/examples/sudoku/sudoku_gui.erl b/lib/wx/examples/sudoku/sudoku_gui.erl
index 3d0c95ffa7..5f3f1a2621 100644
--- a/lib/wx/examples/sudoku/sudoku_gui.erl
+++ b/lib/wx/examples/sudoku/sudoku_gui.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -307,19 +307,19 @@ dialog(?PRINT_PAGE_SETUP, S = #gs{frame=Frame, print_psdd=PsDD0, print_d=PD0}) -
wxPageSetupDialogData:destroy(PsDD0),
wxPrintData:destroy(PD0),
S#gs{print_psdd=PsDD, print_d=PD};
-dialog(?PRINT_PRE, S = #gs{frame=Frame, print_d=PD}) ->
+dialog(?PRINT_PRE, S = #gs{frame=Frame, print_d=PD, board=Board}) ->
+ {ok, BoardS} = sudoku_board:get_state(Board),
PDD = wxPrintDialogData:new(PD),
- Printout1 = wxPrintout:new("Print", fun(This,Page) -> printout(This,Page,S) end,
+ Printout1 = wxPrintout:new("Print 1", fun(This,Page) -> printout(This,Page,BoardS, S) end,
[{getPageInfo, fun getPageInfo/1}]),
- Printout2 = wxPrintout:new("Print", fun(This,Page) -> printout(This,Page,S) end,
+ Printout2 = wxPrintout:new("Print 2", fun(This,Page) -> printout(This,Page,BoardS, S) end,
[{getPageInfo, fun getPageInfo/1}]),
- Preview = wxPrintPreview:new(Printout1, [{printoutForPrinting,Printout2},{data,PDD}]),
+ Preview = wxPrintPreview:new(Printout1, [{printoutForPrinting,Printout2},{data,PDD}]),
case wxPrintPreview:isOk(Preview) of
true ->
PF = wxPreviewFrame:new(Preview, Frame, [{title, "Print Preview"}]),
wxPreviewFrame:centre(PF, [{dir, ?wxBOTH}]),
wxPreviewFrame:initialize(PF),
- wxPreviewFrame:centre(PF),
wxPreviewFrame:show(PF);
false ->
io:format("Could not create preview window.\n"
@@ -327,10 +327,11 @@ dialog(?PRINT_PRE, S = #gs{frame=Frame, print_d=PD}) ->
wxPrintPreview:destroy(Preview)
end,
S;
-dialog(?PRINT, S = #gs{frame=Frame, print_d=PD}) ->
+dialog(?PRINT, S = #gs{frame=Frame, print_d=PD, board=Board}) ->
+ {ok, BoardS} = sudoku_board:get_state(Board),
PDD = wxPrintDialogData:new(PD),
Printer = wxPrinter:new([{data,PDD}]),
- Printout = wxPrintout:new("Print", fun(This,Page) -> printout(This,Page,S) end,
+ Printout = wxPrintout:new("Print", fun(This,Page) -> printout(This,Page,BoardS,S) end,
[{getPageInfo, fun getPageInfo/1}]),
case wxPrinter:print(Printer, Frame, Printout, [{prompt,true}]) of
@@ -374,16 +375,14 @@ init_printer(S) ->
getPageInfo(_This) ->
{1,1,1,1}.
-printout(This, _Page, #gs{board=Board, print_psdd=PsDD}) ->
+printout(This, _Page, Board, #gs{print_psdd=PsDD}) ->
MX = MY = 500,
wxPrintout:fitThisSizeToPageMargins(This, {MX,MY}, PsDD),
-
+
_DBG = {_X,_Y,W,H} = wxPrintout:getLogicalPageMarginsRect(This, PsDD),
wxPrintout:offsetLogicalOrigin(This,(W-MX) div 2, (H-MY) div 2),
-%% io:format("~p ->{~p,~p} ~n", [_DBG, (W-MX) div 2, (H-MY) div 2]),
-
DC = wxPrintout:getDC(This),
- sudoku_board:draw(Board, DC, {500,500}),
+ sudoku_board:redraw(DC, {500,500}, Board),
true.
set_val(Id, Val, Board, G) ->
diff --git a/lib/wx/include/wx.hrl b/lib/wx/include/wx.hrl
index 62979908a6..a48c756dea 100644
--- a/lib/wx/include/wx.hrl
+++ b/lib/wx/include/wx.hrl
@@ -131,7 +131,7 @@
-type wxScrollWin() :: #wxScrollWin{}. %% Callback event: {@link wxScrollWinEvent}
-record(wxPaint, {type :: wxPaintEventType()}). %% Callback event: {@link wxPaintEvent}
--type wxPaintEventType() :: paint | paint_icon.
+-type wxPaintEventType() :: paint.
-type wxPaint() :: #wxPaint{}. %% Callback event: {@link wxPaintEvent}
-record(wxChildFocus, {type :: wxChildFocusEventType()}). %% Callback event: {@link wxChildFocusEvent}
@@ -252,7 +252,7 @@
wheelRotation :: integer(),
wheelDelta :: integer(),
linesPerAction :: integer()}).
--type wxMouseEventType() :: left_down | left_up | middle_down | middle_up | right_down | right_up | motion | enter_window | leave_window | left_dclick | middle_dclick | right_dclick | mousewheel | nc_left_down | nc_left_up | nc_middle_down | nc_middle_up | nc_right_down | nc_right_up | nc_motion | nc_enter_window | nc_leave_window | nc_left_dclick | nc_middle_dclick | nc_right_dclick.
+-type wxMouseEventType() :: left_down | left_up | middle_down | middle_up | right_down | right_up | motion | enter_window | leave_window | left_dclick | middle_dclick | right_dclick | mousewheel.
-type wxMouse() :: #wxMouse{}. %% Callback event: {@link wxMouseEvent}
-record(wxWindowCreate, {type :: wxWindowCreateEventType()}). %% Callback event: {@link wxWindowCreateEvent}
@@ -292,10 +292,6 @@
-type wxIdleEventType() :: idle.
-type wxIdle() :: #wxIdle{}. %% Callback event: {@link wxIdleEvent}
--record(wxNcPaint, {type :: wxNcPaintEventType()}). %% Callback event: {@link wxNcPaintEvent}
--type wxNcPaintEventType() :: nc_paint.
--type wxNcPaint() :: #wxNcPaint{}. %% Callback event: {@link wxNcPaintEvent}
-
-record(wxColourPicker,{type :: wxColourPickerEventType(), %% Callback event: {@link wxColourPickerEvent}
colour :: wx:wx_colour()}).
-type wxColourPickerEventType() :: command_colourpicker_changed.
@@ -312,8 +308,8 @@
-type wxTreeEventType() :: command_tree_begin_drag | command_tree_begin_rdrag | command_tree_begin_label_edit | command_tree_end_label_edit | command_tree_delete_item | command_tree_get_info | command_tree_set_info | command_tree_item_expanded | command_tree_item_expanding | command_tree_item_collapsed | command_tree_item_collapsing | command_tree_sel_changed | command_tree_sel_changing | command_tree_key_down | command_tree_item_activated | command_tree_item_right_click | command_tree_item_middle_click | command_tree_end_drag | command_tree_state_image_click | command_tree_item_gettooltip | command_tree_item_menu.
-type wxTree() :: #wxTree{}. %% Callback event: {@link wxTreeEvent}
--type event() :: wxAuiManager() | wxAuiNotebook() | wxCalendar() | wxChildFocus() | wxClose() | wxColourPicker() | wxCommand() | wxContextMenu() | wxDate() | wxDisplayChanged() | wxErase() | wxFileDirPicker() | wxFocus() | wxFontPicker() | wxGrid() | wxHelp() | wxHtmlLink() | wxIconize() | wxIdle() | wxJoystick() | wxKey() | wxList() | wxMaximize() | wxMenu() | wxMouse() | wxMouseCaptureChanged() | wxMove() | wxNavigationKey() | wxNcPaint() | wxNotebook() | wxPaint() | wxPaletteChanged() | wxQueryNewPalette() | wxSash() | wxScroll() | wxScrollWin() | wxSetCursor() | wxShow() | wxSize() | wxSpin() | wxSplitter() | wxStyledText() | wxSysColourChanged() | wxTaskBarIcon() | wxTree() | wxUpdateUI() | wxWindowCreate() | wxWindowDestroy().
--type wxEventType() :: wxAuiManagerEventType() | wxAuiNotebookEventType() | wxCalendarEventType() | wxChildFocusEventType() | wxCloseEventType() | wxColourPickerEventType() | wxCommandEventType() | wxContextMenuEventType() | wxDateEventType() | wxDisplayChangedEventType() | wxEraseEventType() | wxFileDirPickerEventType() | wxFocusEventType() | wxFontPickerEventType() | wxGridEventType() | wxHelpEventType() | wxHtmlLinkEventType() | wxIconizeEventType() | wxIdleEventType() | wxJoystickEventType() | wxKeyEventType() | wxListEventType() | wxMaximizeEventType() | wxMenuEventType() | wxMouseCaptureChangedEventType() | wxMouseEventType() | wxMoveEventType() | wxNavigationKeyEventType() | wxNcPaintEventType() | wxNotebookEventType() | wxPaintEventType() | wxPaletteChangedEventType() | wxQueryNewPaletteEventType() | wxSashEventType() | wxScrollEventType() | wxScrollWinEventType() | wxSetCursorEventType() | wxShowEventType() | wxSizeEventType() | wxSpinEventType() | wxSplitterEventType() | wxStyledTextEventType() | wxSysColourChangedEventType() | wxTaskBarIconEventType() | wxTreeEventType() | wxUpdateUIEventType() | wxWindowCreateEventType() | wxWindowDestroyEventType().
+-type event() :: wxAuiManager() | wxAuiNotebook() | wxCalendar() | wxChildFocus() | wxClose() | wxColourPicker() | wxCommand() | wxContextMenu() | wxDate() | wxDisplayChanged() | wxErase() | wxFileDirPicker() | wxFocus() | wxFontPicker() | wxGrid() | wxHelp() | wxHtmlLink() | wxIconize() | wxIdle() | wxJoystick() | wxKey() | wxList() | wxMaximize() | wxMenu() | wxMouse() | wxMouseCaptureChanged() | wxMove() | wxNavigationKey() | wxNotebook() | wxPaint() | wxPaletteChanged() | wxQueryNewPalette() | wxSash() | wxScroll() | wxScrollWin() | wxSetCursor() | wxShow() | wxSize() | wxSpin() | wxSplitter() | wxStyledText() | wxSysColourChanged() | wxTaskBarIcon() | wxTree() | wxUpdateUI() | wxWindowCreate() | wxWindowDestroy().
+-type wxEventType() :: wxAuiManagerEventType() | wxAuiNotebookEventType() | wxCalendarEventType() | wxChildFocusEventType() | wxCloseEventType() | wxColourPickerEventType() | wxCommandEventType() | wxContextMenuEventType() | wxDateEventType() | wxDisplayChangedEventType() | wxEraseEventType() | wxFileDirPickerEventType() | wxFocusEventType() | wxFontPickerEventType() | wxGridEventType() | wxHelpEventType() | wxHtmlLinkEventType() | wxIconizeEventType() | wxIdleEventType() | wxJoystickEventType() | wxKeyEventType() | wxListEventType() | wxMaximizeEventType() | wxMenuEventType() | wxMouseCaptureChangedEventType() | wxMouseEventType() | wxMoveEventType() | wxNavigationKeyEventType() | wxNotebookEventType() | wxPaintEventType() | wxPaletteChangedEventType() | wxQueryNewPaletteEventType() | wxSashEventType() | wxScrollEventType() | wxScrollWinEventType() | wxSetCursorEventType() | wxShowEventType() | wxSizeEventType() | wxSpinEventType() | wxSplitterEventType() | wxStyledTextEventType() | wxSysColourChangedEventType() | wxTaskBarIconEventType() | wxTreeEventType() | wxUpdateUIEventType() | wxWindowCreateEventType() | wxWindowDestroyEventType().
%% Hardcoded Records
-record(wxMouseState, {x :: integer(), y :: integer(),
@@ -420,78 +416,78 @@
-define(wxDateTime_Country_Unknown, 0).
-define(wxDateTime_Country_Default, 1).
-define(wxDateTime_Country_WesternEurope_Start, 2).
--define(wxDateTime_Country_EEC, ?Country_WesternEurope_Start).
--define(wxDateTime_France, (?Country_WesternEurope_Start+1)).
--define(wxDateTime_Germany, (?Country_WesternEurope_Start+2)).
--define(wxDateTime_UK, (?Country_WesternEurope_Start+3)).
--define(wxDateTime_Country_WesternEurope_End, ?UK).
--define(wxDateTime_Russia, (?UK+1)).
--define(wxDateTime_USA, (?UK+2)).
+-define(wxDateTime_Country_EEC, ?wxDateTime_Country_WesternEurope_Start).
+-define(wxDateTime_France, (?wxDateTime_Country_WesternEurope_Start+1)).
+-define(wxDateTime_Germany, (?wxDateTime_Country_WesternEurope_Start+2)).
+-define(wxDateTime_UK, (?wxDateTime_Country_WesternEurope_Start+3)).
+-define(wxDateTime_Country_WesternEurope_End, ?wxDateTime_UK).
+-define(wxDateTime_Russia, (?wxDateTime_UK+1)).
+-define(wxDateTime_USA, (?wxDateTime_UK+2)).
% From class wxDateTime::GregorianAdoption
-define(wxDateTime_Gr_Unknown, 0).
-define(wxDateTime_Gr_Standard, 1).
-define(wxDateTime_Gr_Alaska, 2).
-define(wxDateTime_Gr_Albania, 3).
--define(wxDateTime_Gr_Austria, ?Gr_Unknown).
--define(wxDateTime_Gr_Austria_Brixen, (?Gr_Unknown+1)).
--define(wxDateTime_Gr_Austria_Salzburg, ?Gr_Austria_Brixen).
--define(wxDateTime_Gr_Austria_Tyrol, ?Gr_Austria_Brixen).
--define(wxDateTime_Gr_Austria_Carinthia, (?Gr_Austria_Brixen+1)).
--define(wxDateTime_Gr_Austria_Styria, ?Gr_Austria_Carinthia).
--define(wxDateTime_Gr_Belgium, (?Gr_Austria_Carinthia+1)).
--define(wxDateTime_Gr_Bulgaria, ?Gr_Unknown).
--define(wxDateTime_Gr_Bulgaria_1, (?Gr_Unknown+1)).
--define(wxDateTime_Gr_Bulgaria_2, (?Gr_Unknown+2)).
--define(wxDateTime_Gr_Bulgaria_3, (?Gr_Unknown+3)).
--define(wxDateTime_Gr_Canada, ?Gr_Unknown).
--define(wxDateTime_Gr_China, ?Gr_Unknown).
--define(wxDateTime_Gr_China_1, (?Gr_Unknown+1)).
--define(wxDateTime_Gr_China_2, (?Gr_Unknown+2)).
--define(wxDateTime_Gr_Czechoslovakia, (?Gr_Unknown+3)).
--define(wxDateTime_Gr_Denmark, (?Gr_Unknown+4)).
--define(wxDateTime_Gr_Egypt, (?Gr_Unknown+5)).
--define(wxDateTime_Gr_Estonia, (?Gr_Unknown+6)).
--define(wxDateTime_Gr_Finland, (?Gr_Unknown+7)).
--define(wxDateTime_Gr_France, (?Gr_Unknown+8)).
--define(wxDateTime_Gr_France_Alsace, (?Gr_Unknown+9)).
--define(wxDateTime_Gr_France_Lorraine, (?Gr_Unknown+10)).
--define(wxDateTime_Gr_France_Strasbourg, (?Gr_Unknown+11)).
--define(wxDateTime_Gr_Germany, ?Gr_Unknown).
--define(wxDateTime_Gr_Germany_Catholic, (?Gr_Unknown+1)).
--define(wxDateTime_Gr_Germany_Prussia, (?Gr_Unknown+2)).
--define(wxDateTime_Gr_Germany_Protestant, (?Gr_Unknown+3)).
--define(wxDateTime_Gr_GreatBritain, (?Gr_Unknown+4)).
--define(wxDateTime_Gr_Greece, (?Gr_Unknown+5)).
--define(wxDateTime_Gr_Hungary, (?Gr_Unknown+6)).
--define(wxDateTime_Gr_Ireland, ?Gr_GreatBritain).
--define(wxDateTime_Gr_Italy, ?Gr_Standard).
--define(wxDateTime_Gr_Japan, ?Gr_Unknown).
--define(wxDateTime_Gr_Japan_1, (?Gr_Unknown+1)).
--define(wxDateTime_Gr_Japan_2, (?Gr_Unknown+2)).
--define(wxDateTime_Gr_Japan_3, (?Gr_Unknown+3)).
--define(wxDateTime_Gr_Latvia, (?Gr_Unknown+4)).
--define(wxDateTime_Gr_Lithuania, (?Gr_Unknown+5)).
--define(wxDateTime_Gr_Luxemburg, (?Gr_Unknown+6)).
--define(wxDateTime_Gr_Netherlands, ?Gr_Belgium).
--define(wxDateTime_Gr_Netherlands_Groningen, (?Gr_Belgium+1)).
--define(wxDateTime_Gr_Netherlands_Gelderland, (?Gr_Belgium+2)).
--define(wxDateTime_Gr_Netherlands_Utrecht, (?Gr_Belgium+3)).
--define(wxDateTime_Gr_Netherlands_Friesland, (?Gr_Belgium+4)).
--define(wxDateTime_Gr_Norway, ?Gr_Denmark).
--define(wxDateTime_Gr_Poland, ?Gr_Standard).
--define(wxDateTime_Gr_Portugal, ?Gr_Standard).
--define(wxDateTime_Gr_Romania, (?Gr_Standard+1)).
--define(wxDateTime_Gr_Russia, (?Gr_Standard+2)).
--define(wxDateTime_Gr_Scotland, ?Gr_GreatBritain).
--define(wxDateTime_Gr_Spain, ?Gr_Standard).
--define(wxDateTime_Gr_Sweden, ?Gr_Finland).
--define(wxDateTime_Gr_Switzerland, ?Gr_Unknown).
--define(wxDateTime_Gr_Switzerland_Catholic, (?Gr_Unknown+1)).
--define(wxDateTime_Gr_Switzerland_Protestant, (?Gr_Unknown+2)).
--define(wxDateTime_Gr_Turkey, (?Gr_Unknown+3)).
--define(wxDateTime_Gr_USA, ?Gr_GreatBritain).
--define(wxDateTime_Gr_Wales, ?Gr_GreatBritain).
--define(wxDateTime_Gr_Yugoslavia, (?Gr_GreatBritain+1)).
+-define(wxDateTime_Gr_Austria, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_Austria_Brixen, (?wxDateTime_Gr_Unknown+1)).
+-define(wxDateTime_Gr_Austria_Salzburg, ?wxDateTime_Gr_Austria_Brixen).
+-define(wxDateTime_Gr_Austria_Tyrol, ?wxDateTime_Gr_Austria_Brixen).
+-define(wxDateTime_Gr_Austria_Carinthia, (?wxDateTime_Gr_Austria_Brixen+1)).
+-define(wxDateTime_Gr_Austria_Styria, ?wxDateTime_Gr_Austria_Carinthia).
+-define(wxDateTime_Gr_Belgium, (?wxDateTime_Gr_Austria_Carinthia+1)).
+-define(wxDateTime_Gr_Bulgaria, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_Bulgaria_1, (?wxDateTime_Gr_Unknown+1)).
+-define(wxDateTime_Gr_Bulgaria_2, (?wxDateTime_Gr_Unknown+2)).
+-define(wxDateTime_Gr_Bulgaria_3, (?wxDateTime_Gr_Unknown+3)).
+-define(wxDateTime_Gr_Canada, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_China, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_China_1, (?wxDateTime_Gr_Unknown+1)).
+-define(wxDateTime_Gr_China_2, (?wxDateTime_Gr_Unknown+2)).
+-define(wxDateTime_Gr_Czechoslovakia, (?wxDateTime_Gr_Unknown+3)).
+-define(wxDateTime_Gr_Denmark, (?wxDateTime_Gr_Unknown+4)).
+-define(wxDateTime_Gr_Egypt, (?wxDateTime_Gr_Unknown+5)).
+-define(wxDateTime_Gr_Estonia, (?wxDateTime_Gr_Unknown+6)).
+-define(wxDateTime_Gr_Finland, (?wxDateTime_Gr_Unknown+7)).
+-define(wxDateTime_Gr_France, (?wxDateTime_Gr_Unknown+8)).
+-define(wxDateTime_Gr_France_Alsace, (?wxDateTime_Gr_Unknown+9)).
+-define(wxDateTime_Gr_France_Lorraine, (?wxDateTime_Gr_Unknown+10)).
+-define(wxDateTime_Gr_France_Strasbourg, (?wxDateTime_Gr_Unknown+11)).
+-define(wxDateTime_Gr_Germany, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_Germany_Catholic, (?wxDateTime_Gr_Unknown+1)).
+-define(wxDateTime_Gr_Germany_Prussia, (?wxDateTime_Gr_Unknown+2)).
+-define(wxDateTime_Gr_Germany_Protestant, (?wxDateTime_Gr_Unknown+3)).
+-define(wxDateTime_Gr_GreatBritain, (?wxDateTime_Gr_Unknown+4)).
+-define(wxDateTime_Gr_Greece, (?wxDateTime_Gr_Unknown+5)).
+-define(wxDateTime_Gr_Hungary, (?wxDateTime_Gr_Unknown+6)).
+-define(wxDateTime_Gr_Ireland, ?wxDateTime_Gr_GreatBritain).
+-define(wxDateTime_Gr_Italy, ?wxDateTime_Gr_Standard).
+-define(wxDateTime_Gr_Japan, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_Japan_1, (?wxDateTime_Gr_Unknown+1)).
+-define(wxDateTime_Gr_Japan_2, (?wxDateTime_Gr_Unknown+2)).
+-define(wxDateTime_Gr_Japan_3, (?wxDateTime_Gr_Unknown+3)).
+-define(wxDateTime_Gr_Latvia, (?wxDateTime_Gr_Unknown+4)).
+-define(wxDateTime_Gr_Lithuania, (?wxDateTime_Gr_Unknown+5)).
+-define(wxDateTime_Gr_Luxemburg, (?wxDateTime_Gr_Unknown+6)).
+-define(wxDateTime_Gr_Netherlands, ?wxDateTime_Gr_Belgium).
+-define(wxDateTime_Gr_Netherlands_Groningen, (?wxDateTime_Gr_Belgium+1)).
+-define(wxDateTime_Gr_Netherlands_Gelderland, (?wxDateTime_Gr_Belgium+2)).
+-define(wxDateTime_Gr_Netherlands_Utrecht, (?wxDateTime_Gr_Belgium+3)).
+-define(wxDateTime_Gr_Netherlands_Friesland, (?wxDateTime_Gr_Belgium+4)).
+-define(wxDateTime_Gr_Norway, ?wxDateTime_Gr_Denmark).
+-define(wxDateTime_Gr_Poland, ?wxDateTime_Gr_Standard).
+-define(wxDateTime_Gr_Portugal, ?wxDateTime_Gr_Standard).
+-define(wxDateTime_Gr_Romania, (?wxDateTime_Gr_Standard+1)).
+-define(wxDateTime_Gr_Russia, (?wxDateTime_Gr_Standard+2)).
+-define(wxDateTime_Gr_Scotland, ?wxDateTime_Gr_GreatBritain).
+-define(wxDateTime_Gr_Spain, ?wxDateTime_Gr_Standard).
+-define(wxDateTime_Gr_Sweden, ?wxDateTime_Gr_Finland).
+-define(wxDateTime_Gr_Switzerland, ?wxDateTime_Gr_Unknown).
+-define(wxDateTime_Gr_Switzerland_Catholic, (?wxDateTime_Gr_Unknown+1)).
+-define(wxDateTime_Gr_Switzerland_Protestant, (?wxDateTime_Gr_Unknown+2)).
+-define(wxDateTime_Gr_Turkey, (?wxDateTime_Gr_Unknown+3)).
+-define(wxDateTime_Gr_USA, ?wxDateTime_Gr_GreatBritain).
+-define(wxDateTime_Gr_Wales, ?wxDateTime_Gr_GreatBritain).
+-define(wxDateTime_Gr_Yugoslavia, (?wxDateTime_Gr_GreatBritain+1)).
% From class wxDateTime::Month
-define(wxDateTime_Jan, 0).
-define(wxDateTime_Feb, 1).
@@ -537,34 +533,34 @@
-define(wxDateTime_GMT11, 24).
-define(wxDateTime_GMT12, 25).
-define(wxDateTime_GMT13, 26).
--define(wxDateTime_WET, ?GMT0).
--define(wxDateTime_WEST, ?GMT1).
--define(wxDateTime_CET, ?GMT1).
--define(wxDateTime_CEST, ?GMT2).
--define(wxDateTime_EET, ?GMT2).
--define(wxDateTime_EEST, ?GMT3).
--define(wxDateTime_MSK, ?GMT3).
--define(wxDateTime_MSD, ?GMT4).
--define(wxDateTime_AST, ?GMT_4).
--define(wxDateTime_ADT, ?GMT_3).
--define(wxDateTime_EST, ?GMT_5).
--define(wxDateTime_EDT, ?GMT_4).
--define(wxDateTime_CST, ?GMT_6).
--define(wxDateTime_CDT, ?GMT_5).
--define(wxDateTime_MST, ?GMT_7).
--define(wxDateTime_MDT, ?GMT_6).
--define(wxDateTime_PST, ?GMT_8).
--define(wxDateTime_PDT, ?GMT_7).
--define(wxDateTime_HST, ?GMT_10).
--define(wxDateTime_AKST, ?GMT_9).
--define(wxDateTime_AKDT, ?GMT_8).
--define(wxDateTime_A_WST, ?GMT8).
--define(wxDateTime_A_CST, ?GMT13+1).
--define(wxDateTime_A_EST, ?GMT10).
--define(wxDateTime_A_ESST, ?GMT11).
--define(wxDateTime_NZST, ?GMT12).
--define(wxDateTime_NZDT, ?GMT13).
--define(wxDateTime_UTC, ?GMT0).
+-define(wxDateTime_WET, ?wxDateTime_GMT0).
+-define(wxDateTime_WEST, ?wxDateTime_GMT1).
+-define(wxDateTime_CET, ?wxDateTime_GMT1).
+-define(wxDateTime_CEST, ?wxDateTime_GMT2).
+-define(wxDateTime_EET, ?wxDateTime_GMT2).
+-define(wxDateTime_EEST, ?wxDateTime_GMT3).
+-define(wxDateTime_MSK, ?wxDateTime_GMT3).
+-define(wxDateTime_MSD, ?wxDateTime_GMT4).
+-define(wxDateTime_AST, ?wxDateTime_GMT_4).
+-define(wxDateTime_ADT, ?wxDateTime_GMT_3).
+-define(wxDateTime_EST, ?wxDateTime_GMT_5).
+-define(wxDateTime_EDT, ?wxDateTime_GMT_4).
+-define(wxDateTime_CST, ?wxDateTime_GMT_6).
+-define(wxDateTime_CDT, ?wxDateTime_GMT_5).
+-define(wxDateTime_MST, ?wxDateTime_GMT_7).
+-define(wxDateTime_MDT, ?wxDateTime_GMT_6).
+-define(wxDateTime_PST, ?wxDateTime_GMT_8).
+-define(wxDateTime_PDT, ?wxDateTime_GMT_7).
+-define(wxDateTime_HST, ?wxDateTime_GMT_10).
+-define(wxDateTime_AKST, ?wxDateTime_GMT_9).
+-define(wxDateTime_AKDT, ?wxDateTime_GMT_8).
+-define(wxDateTime_A_WST, ?wxDateTime_GMT8).
+-define(wxDateTime_A_CST, (?wxDateTime_GMT13+1)).
+-define(wxDateTime_A_EST, ?wxDateTime_GMT10).
+-define(wxDateTime_A_ESST, ?wxDateTime_GMT11).
+-define(wxDateTime_NZST, ?wxDateTime_GMT12).
+-define(wxDateTime_NZDT, ?wxDateTime_GMT13).
+-define(wxDateTime_UTC, ?wxDateTime_GMT0).
% From class wxDateTime::WeekDay
-define(wxDateTime_Sun, 0).
-define(wxDateTime_Mon, 1).
@@ -579,7 +575,6 @@
-define(wxDateTime_Monday_First, 1).
-define(wxDateTime_Sunday_First, 2).
% From class wxDateTime::Year
--define(wxDateTime_Inv_Year, ?SHRT_MIN).
% From class wxDialog
-define(wxDialog_ButtonSizerFlags, (?wxOK bor ?wxCANCEL bor ?wxYES bor ?wxNO bor ?wxHELP bor ?wxNO_DEFAULT)).
% From class wxGrid
@@ -760,6 +755,7 @@
-define(wxCLRP_DEFAULT_STYLE, 0).
-define(wxCLRP_USE_TEXTCTRL, ?wxPB_USE_TEXTCTRL).
-define(wxCLRP_SHOW_LABEL, 8).
+% From "cmndata.h"
% From "cmndata.h": wxPrintBin
-define(wxPRINTBIN_DEFAULT, 0).
-define(wxPRINTBIN_ONLYONE, 1).
@@ -782,6 +778,8 @@
-define(wxC2S_NAME, 1).
% From "confbase.h"
-define(wxCONFIG_CASE_SENSITIVE, 0).
+% From "cpp.h"
+-define(wxEMPTY_PARAMETER_VALUE, ()).
% From "datectrl.h"
-define(wxDP_DEFAULT, 0).
-define(wxDP_SPIN, 1).
@@ -789,7 +787,6 @@
-define(wxDP_SHOWCENTURY, 4).
-define(wxDP_ALLOWNONE, 8).
% From "datetime.h"
--define(wxInvalidDateTime, ?wxDefaultDateTime).
% From "dcbuffer.h"
-define(wxBUFFER_CLIENT_AREA, 2).
-define(wxBUFFER_VIRTUAL_AREA, 1).
@@ -1560,13 +1557,13 @@
% From "event.h"
% From "event.h": Propagation_state
-define(wxEVENT_PROPAGATE_NONE, 0).
--define(wxEVENT_PROPAGATE_MAX, ?INT_MAX).
% From "event.h": wxIdleMode
-define(wxIDLE_PROCESS_ALL, 0).
-define(wxIDLE_PROCESS_SPECIFIED, 1).
% From "event.h": wxUpdateUIMode
-define(wxUPDATE_UI_PROCESS_ALL, 0).
-define(wxUPDATE_UI_PROCESS_SPECIFIED, 1).
+% From "fdrepdlg.h"
% From "fdrepdlg.h": wxFindReplaceDialogStyles
-define(wxFR_REPLACEDIALOG, 1).
-define(wxFR_NOUPDOWN, 2).
@@ -1810,7 +1807,6 @@
-define(wxGA_VERTICAL, ?wxVERTICAL).
-define(wxGA_HORIZONTAL, ?wxHORIZONTAL).
% From "gdicmn.h"
--define(wxGetDisplayDepth, ?wxDisplayDepth).
% From "gdicmn.h": wxBitmapType
-define(wxBITMAP_TYPE_INVALID, 0).
-define(wxBITMAP_TYPE_BMP, 1).
@@ -2091,7 +2087,6 @@
-define(wxLB_TOP, ?wxBK_TOP).
-define(wxLB_DEFAULT, ?wxBK_DEFAULT).
% From "log.h"
--define(wxTRACE_OleCalls, ?wxEmptyString).
-define(wxTraceRefCount, 8).
-define(wxTraceResAlloc, 4).
-define(wxTraceMessages, 2).
@@ -2195,7 +2190,8 @@
-define(wxSYS_COLOUR_MENUHILIGHT, (?wxSYS_COLOUR_BTNHIGHLIGHT+9)).
-define(wxSYS_COLOUR_MENUBAR, (?wxSYS_COLOUR_BTNHIGHLIGHT+10)).
-define(wxSYS_COLOUR_LISTBOXTEXT, (?wxSYS_COLOUR_BTNHIGHLIGHT+11)).
--define(wxSYS_COLOUR_MAX, (?wxSYS_COLOUR_BTNHIGHLIGHT+12)).
+-define(wxSYS_COLOUR_LISTBOXHIGHLIGHTTEXT, (?wxSYS_COLOUR_BTNHIGHLIGHT+12)).
+-define(wxSYS_COLOUR_MAX, (?wxSYS_COLOUR_BTNHIGHLIGHT+13)).
% From "settings.h": wxSystemFeature
-define(wxSYS_CAN_DRAW_FRAME_DECORATIONS, 1).
-define(wxSYS_CAN_ICONIZE_FRAME, 2).
@@ -3797,6 +3793,7 @@
-define(wxRELEASE_NUMBER, wxe_util:get_const(wxRELEASE_NUMBER)).
-define(wxMINOR_VERSION, wxe_util:get_const(wxMINOR_VERSION)).
-define(wxMAJOR_VERSION, wxe_util:get_const(wxMAJOR_VERSION)).
+% From "window.h"
% From "window.h": wxWindowVariant
-define(wxWINDOW_VARIANT_NORMAL, 0).
-define(wxWINDOW_VARIANT_SMALL, 1).
diff --git a/lib/wx/src/gen/gl.erl b/lib/wx/src/gen/gl.erl
index ff381683ee..8a8158c35e 100644
--- a/lib/wx/src/gen/gl.erl
+++ b/lib/wx/src/gen/gl.erl
@@ -1,7 +1,9 @@
+%% -*- coding: utf-8 -*-
+
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -460,7 +462,7 @@ alphaFunc(Func,Ref) ->
%% as (R s0 G s0 B s0 A s0), (R s1 G s1 B s1 A s1) and (R d G d B d A d), respectively. The color specified by {@link gl:blendColor/4} is referred to
%% as (R c G c B c A c). They are understood to have integer values between 0 and (k R k G k B k A), where
%%
-%% k c= 2(m c)-1
+%% k c=2(m c)-1
%%
%% and (m R m G m B m A) is the number of red, green, blue, and alpha bitplanes.
%%
@@ -489,12 +491,12 @@ alphaFunc(Func,Ref) ->
%%
%% In the table,
%%
-%% i= min(A s k A-A d) k/A
+%% i=min(A s k A-A d) k/A
%%
%% To determine the blended RGBA values of a pixel, the system uses the following equations:
%%
%%
-%% R d= min(k R R s s R+R d d R) G d= min(k G G s s G+G d d G) B d= min(k B B s s B+B d d B) A d= min(k A A s s A+A d d A)
+%% R d=min(k R R s s R+R d d R) G d=min(k G G s s G+G d d G) B d=min(k B B s s B+B d d B) A d=min(k A A s s A+A d d A)
%%
%% Despite the apparent precision of the above equations, blending arithmetic is not exactly
%% specified, because blending operates with imprecise integer color values. However, a blend
@@ -503,7 +505,7 @@ alphaFunc(Func,Ref) ->
%% , `Dfactor' is `?GL_ONE_MINUS_SRC_ALPHA', and A s is equal to k A, the equations
%% reduce to simple replacement:
%%
-%% R d= R s G d= G s B d= B s A d= A s
+%% R d=R s G d=G s B d=B s A d=A s
%%
%%
%%
@@ -643,7 +645,7 @@ lineWidth(Width) ->
%% is 0, otherwise these fragments are sent to the frame buffer. Bit zero of `Pattern'
%% is the least significant bit.
%%
-%% Antialiased lines are treated as a sequence of 1*width rectangles for purposes of stippling.
+%% Antialiased lines are treated as a sequence of 1×width rectangles for purposes of stippling.
%% Whether rectangle s is rasterized or not depends on the fragment rule described for
%% aliased lines, counting rectangles rather than groups of fragments.
%%
@@ -690,7 +692,7 @@ polygonMode(Face,Mode) ->
%% When `?GL_POLYGON_OFFSET_FILL', `?GL_POLYGON_OFFSET_LINE', or `?GL_POLYGON_OFFSET_POINT'
%% is enabled, each fragment's `depth' value will be offset after it is interpolated
%% from the `depth' values of the appropriate vertices. The value of the offset is
-%% factor*DZ+r*units, where DZ is a measurement of the change in depth relative to the
+%% factor×DZ+r×units, where DZ is a measurement of the change in depth relative to the
%% screen area of the polygon, and r is the smallest value that is guaranteed to produce
%% a resolvable offset for a given implementation. The offset is added before the depth test
%% is performed and before the value is written into the depth buffer.
@@ -709,10 +711,10 @@ polygonOffset(Factor,Units) ->
%% fragments produced by rasterization, creating a pattern. Stippling is independent of polygon
%% antialiasing.
%%
-%% `Pattern' is a pointer to a 32*32 stipple pattern that is stored in memory just
+%% `Pattern' is a pointer to a 32×32 stipple pattern that is stored in memory just
%% like the pixel data supplied to a {@link gl:drawPixels/5} call with height and `width'
%% both equal to 32, a pixel format of `?GL_COLOR_INDEX', and data type of `?GL_BITMAP'
-%% . That is, the stipple pattern is represented as a 32*32 array of 1-bit color indices
+%% . That is, the stipple pattern is represented as a 32×32 array of 1-bit color indices
%% packed in unsigned bytes. {@link gl:pixelStoref/2} parameters like `?GL_UNPACK_SWAP_BYTES'
%% and `?GL_UNPACK_LSB_FIRST' affect the assembling of the bits into a stipple pattern.
%% Pixel transfer operations (shift, offset, pixel map) are not applied to the stipple image,
@@ -737,10 +739,10 @@ polygonStipple(Mask) ->
%% @doc Return the polygon stipple pattern
%%
-%% ``gl:getPolygonStipple'' returns to `Pattern' a 32*32 polygon stipple pattern.
+%% ``gl:getPolygonStipple'' returns to `Pattern' a 32×32 polygon stipple pattern.
%% The pattern is packed into memory as if {@link gl:readPixels/7} with both `height'
%% and `width' of 32, `type' of `?GL_BITMAP', and `format' of `?GL_COLOR_INDEX'
-%% were called, and the stipple pattern were stored in an internal 32*32 color index buffer.
+%% were called, and the stipple pattern were stored in an internal 32×32 color index buffer.
%% Unlike {@link gl:readPixels/7} , however, pixel transfer operations (shift, offset, pixel
%% map) are not applied to the returned stipple image.
%%
@@ -2635,7 +2637,7 @@ loadIdentity() ->
%% and `M' points to an array of 16 single- or double-precision floating-point values
%% m={m[0] m[1] ... m[15]}, then the modelview transformation M(v) does the following:
%%
-%% M(v)=(m[0] m[4] m[8] m[12] m[1] m[5] m[9] m[13] m[2] m[6] m[10] m[14] m[3] m[7] m[11] m[15])*(v[0] v[1] v[2] v[3])
+%% M(v)=(m[0] m[4] m[8] m[12] m[1] m[5] m[9] m[13] m[2] m[6] m[10] m[14] m[3] m[7] m[11] m[15])×(v[0] v[1] v[2] v[3])
%%
%% Projection and texture transformations are similarly defined.
%%
@@ -2687,7 +2689,7 @@ multMatrixf({M1,M2,M3,M4,M5,M6,M7,M8,M9,M10,M11,M12}) ->
%% (x 2(1-c)+c x y(1-c)-z s x z(1-c)+y s 0 y x(1-c)+z s y 2(1-c)+c y z(1-c)-x s 0 x z(1-c)-y s y z(1-c)+x s z 2(1-c)+c 0 0 0 0
%% 1)
%%
-%% Where c= cos(angle), s= sin(angle), and ||(x y z)||= 1 (if not, the GL will normalize this vector).
+%% Where c=cos(angle), s=sin(angle), and ||(x y z)||=1 (if not, the GL will normalize this vector).
%%
%% If the matrix mode is either `?GL_MODELVIEW' or `?GL_PROJECTION', all objects
%% drawn after ``gl:rotate'' is called are rotated. Use {@link gl:pushMatrix/0} and {@link gl:pushMatrix/0}
@@ -3814,7 +3816,7 @@ rasterPos4sv({X,Y,Z,W}) -> rasterPos4s(X,Y,Z,W).
%% ``gl:rect'' supports efficient specification of rectangles as two corner points. Each
%% rectangle command takes four arguments, organized either as two consecutive pairs of (x y)
%% coordinates or as two pointers to arrays, each containing an (x y) pair. The resulting rectangle
-%% is defined in the z= 0 plane.
+%% is defined in the z=0 plane.
%%
%% ``gl:rect''( `X1' , `Y1' , `X2' , `Y2' ) is exactly equivalent to the
%% following sequence: glBegin(`?GL_POLYGON'); glVertex2( `X1' , `Y1' ); glVertex2(
@@ -4684,9 +4686,9 @@ pixelZoom(Xfactor,Yfactor) ->
%% is the number of pixels in a row (`?GL_PACK_ROW_LENGTH' if it is greater than 0,
%% the width argument to the pixel routine otherwise), a is the value of `?GL_PACK_ALIGNMENT'
%% , and s is the size, in bytes, of a single component (if a&lt; s, then it is as if a=
-%% s). In the case of 1-bit values, the location of the next row is obtained by skipping
+%% s). In the case of 1-bit values, the location of the next row is obtained by skipping
%%
-%% k= 8 a |(n l)/(8 a)|
+%% k=8 a |(n l)/(8 a)|
%%
%% components or indices.
%%
@@ -4708,7 +4710,7 @@ pixelZoom(Xfactor,Yfactor) ->
%% a pixel image (`?GL_PACK_IMAGE_HEIGHT' if it is greater than 0, the height argument
%% to the {@link gl:texImage3D/10} routine otherwise), a is the value of `?GL_PACK_ALIGNMENT'
%% , and s is the size, in bytes, of a single component (if a&lt; s, then it is as if
-%% a= s).
+%% a=s).
%%
%% The word `component' in this description refers to the nonindex values red, green,
%% blue, alpha, and depth. Storage format `?GL_RGB', for example, has three components
@@ -4758,9 +4760,9 @@ pixelZoom(Xfactor,Yfactor) ->
%% is the number of pixels in a row (`?GL_UNPACK_ROW_LENGTH' if it is greater than 0,
%% the width argument to the pixel routine otherwise), a is the value of `?GL_UNPACK_ALIGNMENT'
%% , and s is the size, in bytes, of a single component (if a&lt; s, then it is as if a=
-%% s). In the case of 1-bit values, the location of the next row is obtained by skipping
+%% s). In the case of 1-bit values, the location of the next row is obtained by skipping
%%
-%% k= 8 a |(n l)/(8 a)|
+%% k=8 a |(n l)/(8 a)|
%%
%% components or indices.
%%
@@ -4781,8 +4783,8 @@ pixelZoom(Xfactor,Yfactor) ->
%% the width argument to {@link gl:texImage3D/10} otherwise), h is the number of rows in
%% an image (`?GL_UNPACK_IMAGE_HEIGHT' if it is greater than 0, the height argument
%% to {@link gl:texImage3D/10} otherwise), a is the value of `?GL_UNPACK_ALIGNMENT',
-%% and s is the size, in bytes, of a single component (if a&lt; s, then it is as if a=
-%% s).
+%% and s is the size, in bytes, of a single component (if a&lt; s, then it is as if a=s).
+%%
%%
%% The word `component' in this description refers to the nonindex values red, green,
%% blue, alpha, and depth. Storage format `?GL_RGB', for example, has three components
@@ -5327,7 +5329,7 @@ readPixels(X,Y,Width,Height,Format,Type,Pixels) ->
%% or `?GL_STENCIL_INDEX'. Each unsigned byte is treated as eight 1-bit pixels, with
%% bit ordering determined by `?GL_UNPACK_LSB_FIRST' (see {@link gl:pixelStoref/2} ).
%%
-%% width*height pixels are read from memory, starting at location `Data' . By default,
+%% width×height pixels are read from memory, starting at location `Data' . By default,
%% these pixels are taken from adjacent memory locations, except that after all `Width'
%% pixels are read, the read pointer is advanced to the next four-byte boundary. The four-byte
%% row alignment is specified by {@link gl:pixelStoref/2} with argument `?GL_UNPACK_ALIGNMENT'
@@ -5340,7 +5342,7 @@ readPixels(X,Y,Width,Height,Format,Type,Pixels) ->
%% (see {@link gl:bindBuffer/2} ) while a block of pixels is specified, `Data' is treated
%% as a byte offset into the buffer object's data store.
%%
-%% The width*height pixels that are read from memory are each operated on in the same
+%% The width×height pixels that are read from memory are each operated on in the same
%% way, based on the values of several parameters specified by {@link gl:pixelTransferf/2}
%% and {@link gl:pixelMapfv/3} . The details of these operations, as well as the target buffer
%% into which the pixels are drawn, are specific to the format of the pixels, as specified
@@ -5366,10 +5368,10 @@ readPixels(X,Y,Width,Height,Format,Type,Pixels) ->
%%
%% The GL then converts the resulting indices or RGBA colors to fragments by attaching the
%% current raster position `z' coordinate and texture coordinates to each pixel, then
-%% assigning x and y window coordinates to the nth fragment such that x n= x r+n%
-%% width
+%% assigning x and y window coordinates to the nth fragment such that x n=x r+n% width
+%%
%%
-%% y n= y r+|n/width|
+%% y n=y r+|n/width|
%%
%% where (x r y r) is the current raster position. These pixel fragments are then treated just like
%% the fragments generated by rasterizing points, lines, or polygons. Texture mapping, fog,
@@ -5391,9 +5393,9 @@ readPixels(X,Y,Width,Height,Format,Type,Pixels) ->
%% the number of bits in the stencil buffer. The resulting stencil indices are then written
%% to the stencil buffer such that the nth index is written to location
%%
-%% x n= x r+n% width
+%% x n=x r+n% width
%%
-%% y n= y r+|n/width|
+%% y n=y r+|n/width|
%%
%% where (x r y r) is the current raster position. Only the pixel ownership test, the scissor test,
%% and the stencil writemask affect these write operations.
@@ -5411,9 +5413,9 @@ readPixels(X,Y,Width,Height,Format,Type,Pixels) ->
%% raster position color or color index and texture coordinates to each pixel, then assigning
%% x and y window coordinates to the nth fragment such that
%%
-%% x n= x r+n% width
+%% x n=x r+n% width
%%
-%% y n= y r+|n/width|
+%% y n=y r+|n/width|
%%
%% where (x r y r) is the current raster position. These pixel fragments are then treated just like
%% the fragments generated by rasterizing points, lines, or polygons. Texture mapping, fog,
@@ -5442,9 +5444,9 @@ readPixels(X,Y,Width,Height,Format,Type,Pixels) ->
%% raster position `z' coordinate and texture coordinates to each pixel, then assigning
%% x and y window coordinates to the nth fragment such that
%%
-%% x n= x r+n% width
+%% x n=x r+n% width
%%
-%% y n= y r+|n/width|
+%% y n=y r+|n/width|
%%
%% where (x r y r) is the current raster position. These pixel fragments are then treated just like
%% the fragments generated by rasterizing points, lines, or polygons. Texture mapping, fog,
@@ -5810,7 +5812,7 @@ clearStencil(S) ->
%%
%% If the texture generation function is `?GL_OBJECT_LINEAR', the function
%%
-%% g= p 1*x o+p 2*y o+p 3*z o+p 4*w o
+%% g=p 1×x o+p 2×y o+p 3×z o+p 4×w o
%%
%% is used, where g is the value computed for the coordinate named in `Coord' , p 1,
%% p 2, p 3, and p 4 are the four values supplied in `Params' , and x o, y o, z o,
@@ -5823,7 +5825,7 @@ clearStencil(S) ->
%%
%% If the texture generation function is `?GL_EYE_LINEAR', the function
%%
-%% g=(p 1)"*x e+(p 2)"*y e+(p 3)"*z e+(p 4)"*w e
+%% g=(p 1)"×x e+(p 2)"×y e+(p 3)"×z e+(p 4)"×w e
%%
%% is used, where
%%
@@ -5847,14 +5849,14 @@ clearStencil(S) ->
%%
%% f=(f x f y f z) T be the reflection vector such that
%%
-%% f= u-2 n" (n") T u
+%% f=u-2 n" (n") T u
%%
-%% Finally, let m= 2 ((f x) 2+(f y) 2+(f z+1) 2). Then the values assigned to the s and t texture coordinates
+%% Finally, let m=2 ((f x) 2+(f y) 2+(f z+1) 2). Then the values assigned to the s and t texture coordinates
%% are
%%
-%% s= f x/m+1/2
+%% s=f x/m+1/2
%%
-%% t= f y/m+1/2
+%% t=f y/m+1/2
%%
%% To enable or disable a texture-coordinate generation function, call {@link gl:enable/1}
%% or {@link gl:enable/1} with one of the symbolic texture-coordinate names (`?GL_TEXTURE_GEN_S'
@@ -6002,7 +6004,7 @@ texEnvi(Target,Pname,Param) ->
%% `?GL_BLEND' Function </td><td>`?GL_ADD' Function </td></tr></tbody><tbody><tr><td>
%% `?GL_ALPHA'</td><td> C v=</td><td> C p</td><td> C p</td><td> undefined </td><td> C p</td>
%% <td> C p</td></tr><tr><td></td><td> A v=</td><td> A s</td><td> A p A s</td><td></td><td>
-%% A v= A p A s</td><td> A p A s</td></tr><tr><td>`?GL_LUMINANCE'</td><td> C v=</td><td>
+%% A v=A p A s</td><td> A p A s</td></tr><tr><td>`?GL_LUMINANCE'</td><td> C v=</td><td>
%% C s</td><td> C p C s</td><td> undefined </td><td> C p (1-C s)+C c C s</td><td> C p+C s</td></tr>
%% <tr><td> (or 1) </td><td> A v=</td><td> A p</td><td> A p</td><td></td><td> A p</td><td> A
%% p</td></tr><tr><td>`?GL_LUMINANCE_ALPHA'</td><td> C v=</td><td> C s</td><td> C p C
@@ -6034,11 +6036,11 @@ texEnvi(Target,Pname,Param) ->
%%
%% <table><tbody><tr><td>`?GL_COMBINE_RGB'</td><td>` Texture Function '</td></tr></tbody>
%% <tbody><tr><td>`?GL_REPLACE'</td><td> Arg0</td></tr><tr><td>`?GL_MODULATE'</td><td>
-%% Arg0*Arg1</td></tr><tr><td>`?GL_ADD'</td><td> Arg0+Arg1</td></tr><tr><td>`?GL_ADD_SIGNED'
-%% </td><td> Arg0+Arg1-0.5</td></tr><tr><td>`?GL_INTERPOLATE'</td><td> Arg0*Arg2+Arg1*(1-
+%% Arg0×Arg1</td></tr><tr><td>`?GL_ADD'</td><td> Arg0+Arg1</td></tr><tr><td>`?GL_ADD_SIGNED'
+%% </td><td> Arg0+Arg1-0.5</td></tr><tr><td>`?GL_INTERPOLATE'</td><td> Arg0×Arg2+Arg1×(1-
%% Arg2)</td>
%% </tr><tr><td>`?GL_SUBTRACT'</td><td> Arg0-Arg1</td></tr><tr><td>`?GL_DOT3_RGB'
-%% or `?GL_DOT3_RGBA'</td><td> 4*((((Arg0 r)-0.5)*((Arg1 r)-0.5))+(((Arg0 g)-0.5)*((Arg1 g)-0.5))+(((Arg0 b)-0.5)*((Arg1 b)-0.5)))</td></tr></tbody></table>
+%% or `?GL_DOT3_RGBA'</td><td> 4×((((Arg0 r)-0.5)×((Arg1 r)-0.5))+(((Arg0 g)-0.5)×((Arg1 g)-0.5))+(((Arg0 b)-0.5)×((Arg1 b)-0.5)))</td></tr></tbody></table>
%%
%% The scalar results for `?GL_DOT3_RGB' and `?GL_DOT3_RGBA' are placed into each
%% of the 3 (RGB) or 4 (RGBA) components on output.
@@ -6049,8 +6051,8 @@ texEnvi(Target,Pname,Param) ->
%%
%% <table><tbody><tr><td>`?GL_COMBINE_ALPHA'</td><td>` Texture Function '</td></tr>
%% </tbody><tbody><tr><td>`?GL_REPLACE'</td><td> Arg0</td></tr><tr><td>`?GL_MODULATE'
-%% </td><td> Arg0*Arg1</td></tr><tr><td>`?GL_ADD'</td><td> Arg0+Arg1</td></tr><tr><td>`?GL_ADD_SIGNED'
-%% </td><td> Arg0+Arg1-0.5</td></tr><tr><td>`?GL_INTERPOLATE'</td><td> Arg0*Arg2+Arg1*(1-
+%% </td><td> Arg0×Arg1</td></tr><tr><td>`?GL_ADD'</td><td> Arg0+Arg1</td></tr><tr><td>`?GL_ADD_SIGNED'
+%% </td><td> Arg0+Arg1-0.5</td></tr><tr><td>`?GL_INTERPOLATE'</td><td> Arg0×Arg2+Arg1×(1-
%% Arg2)</td>
%% </tr><tr><td>`?GL_SUBTRACT'</td><td> Arg0-Arg1</td></tr></tbody></table>
%%
@@ -6245,19 +6247,18 @@ getTexEnviv(Target,Pname) ->
%% If the values for `?GL_TEXTURE_BORDER_COLOR' are specified with ``gl:texParameterIiv''
%% or ``gl:texParameterIuiv'', the values are stored unmodified with an internal data
%% type of integer. If specified with ``gl:texParameteriv'', they are converted to floating
-%% point with the following equation: f= 2 c+1 2 b-/1. If specified with ``gl:texParameterfv''
+%% point with the following equation: f=2 c+1 2 b-/1. If specified with ``gl:texParameterfv''
%% , they are stored unmodified as floating-point values.
%%
%% `?GL_TEXTURE_COMPARE_FUNC': Specifies the comparison operator used when `?GL_TEXTURE_COMPARE_MODE'
%% is set to `?GL_COMPARE_REF_TO_TEXTURE'. Permissible values are: <table><tbody><tr><td>
%% ` Texture Comparison Function '</td><td>` Computed result '</td></tr></tbody><tbody>
-%% <tr><td>`?GL_LEQUAL'</td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&lt;=(D t) r&gt;(D t))</td></tr><tr><td>`?GL_GEQUAL'</td><td>
-%% result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&gt;=(D t) r&lt;(D t))</td></tr><tr><td>`?GL_LESS'</td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&lt;
-%% (D t) r&gt;=(D t))</td></tr><tr><td>`?GL_GREATER'
-%% </td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&gt;(D t) r&lt;=(D t))</td></tr><tr><td>`?GL_EQUAL'</td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp;
-%% r=(D t) r&amp;ne;(D t))</td></tr><tr><td>`?GL_NOTEQUAL'
-%% </td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&amp;ne;(D t) r=(D t))</td></tr><tr><td>`?GL_ALWAYS'</td><td> result= 1.0</td></tr><tr><td>
-%% `?GL_NEVER'</td><td> result= 0.0</td></tr></tbody></table> where r is the current
+%% <tr><td>`?GL_LEQUAL'</td><td> result={1.0 0.0 r&lt;=(D t) r&gt;(D t))</td></tr><tr><td>`?GL_GEQUAL'</td><td>
+%% result={1.0 0.0 r&gt;=(D t) r&lt;(D t))</td></tr><tr><td>`?GL_LESS'</td><td> result={1.0 0.0 r&lt;(D t) r&gt;=(D t))</td></tr><tr><td>`?GL_GREATER'
+%% </td><td> result={1.0 0.0 r&gt;(D t) r&lt;=(D t))</td></tr><tr><td>`?GL_EQUAL'</td><td> result={1.0 0.0 r=(D t) r&amp;ne;
+%% (D t))</td></tr><tr><td>`?GL_NOTEQUAL'
+%% </td><td> result={1.0 0.0 r&amp;ne;(D t) r=(D t))</td></tr><tr><td>`?GL_ALWAYS'</td><td> result=1.0</td></tr><tr><td>
+%% `?GL_NEVER'</td><td> result=0.0</td></tr></tbody></table> where r is the current
%% interpolated texture coordinate, and D t is the depth texture value sampled from the
%% currently bound depth texture. result is assigned to the the red channel.
%%
@@ -6286,14 +6287,14 @@ getTexEnviv(Target,Pname) ->
%% The other four use mipmaps.
%%
%% A mipmap is an ordered set of arrays representing the same image at progressively lower
-%% resolutions. If the texture has dimensions 2 n*2 m, there are max(n m)+1 mipmaps. The first
-%% mipmap is the original texture, with dimensions 2 n*2 m. Each subsequent mipmap has
-%% dimensions 2(k-1)*2(l-1), where 2 k*2 l are the dimensions of the previous mipmap, until either
-%% k= 0 or l= 0. At that point, subsequent mipmaps have dimension 1*2(l-1) or 2(k-1)*1 until
-%% the final mipmap, which has dimension 1*1. To define the mipmaps, call {@link gl:texImage1D/8}
+%% resolutions. If the texture has dimensions 2 n×2 m, there are max(n m)+1 mipmaps. The first
+%% mipmap is the original texture, with dimensions 2 n×2 m. Each subsequent mipmap has
+%% dimensions 2(k-1)×2(l-1), where 2 k×2 l are the dimensions of the previous mipmap, until either
+%% k=0 or l=0. At that point, subsequent mipmaps have dimension 1×2(l-1) or 2(k-1)×1 until
+%% the final mipmap, which has dimension 1×1. To define the mipmaps, call {@link gl:texImage1D/8}
%% , {@link gl:texImage2D/9} , {@link gl:texImage3D/10} , {@link gl:copyTexImage1D/7} , or {@link gl:copyTexImage2D/8}
%% with the `level' argument indicating the order of the mipmaps. Level 0 is the original
-%% texture; level max(n m) is the final 1*1 mipmap.
+%% texture; level max(n m) is the final 1×1 mipmap.
%%
%% `Params' supplies a function for minifying the texture as one of the following:
%%
@@ -7255,7 +7256,7 @@ map2f(Target,U1,U2,Ustride,Uorder,V1,V2,Vstride,Vorder,Points) ->
%% `Query' can assume the following values:
%%
%% `?GL_COEFF': `V' returns the control points for the evaluator function. One-dimensional
-%% evaluators return order control points, and two-dimensional evaluators return uorder*vorder
+%% evaluators return order control points, and two-dimensional evaluators return uorder×vorder
%% control points. Each control point consists of one, two, three, or four integer, single-precision
%% floating-point, or double-precision floating-point values, depending on the type of the
%% evaluator. The GL returns two-dimensional control points in row-major order, incrementing
@@ -7330,9 +7331,9 @@ getMapiv(Target,Query,V) ->
%% `?GL_AUTO_NORMAL', ``gl:evalCoord2'' generates surface normals analytically, regardless
%% of the contents or enabling of the `?GL_MAP2_NORMAL' map. Let
%%
-%% m=((&amp;PartialD; p)/(&amp;PartialD; u))*((&amp;PartialD; p)/(&amp;PartialD; v))
+%% m=((&amp;PartialD; p)/(&amp;PartialD; u))×((&amp;PartialD; p)/(&amp;PartialD; v))
%%
-%% Then the generated normal n is n= m/(||m||)
+%% Then the generated normal n is n=m/(||m||)
%%
%% If automatic normal generation is disabled, the corresponding normal map `?GL_MAP2_NORMAL'
%% , if enabled, is used to produce a normal. If neither automatic normal generation nor
@@ -7393,17 +7394,17 @@ evalCoord2fv({U,V}) -> evalCoord2f(U,V).
%% 0 maps exactly to `U1' , and integer grid coordinate `Un' maps exactly to `U2'
%% . All other integer grid coordinates i are mapped so that
%%
-%% u= i(u2-u1)/un+u1
+%% u=i(u2-u1)/un+u1
%%
%% ``gl:mapGrid2'' specifies two such linear mappings. One maps integer grid coordinate
-%% i= 0 exactly to `U1' , and integer grid coordinate i= un exactly to `U2' . The
-%% other maps integer grid coordinate j= 0 exactly to `V1' , and integer grid coordinate
-%% j= vn exactly to `V2' . Other integer grid coordinates i and j are mapped such
+%% i=0 exactly to `U1' , and integer grid coordinate i=un exactly to `U2' . The
+%% other maps integer grid coordinate j=0 exactly to `V1' , and integer grid coordinate
+%% j=vn exactly to `V2' . Other integer grid coordinates i and j are mapped such
%% that
%%
-%% u= i(u2-u1)/un+u1
+%% u=i(u2-u1)/un+u1
%%
-%% v= j(v2-v1)/vn+v1
+%% v=j(v2-v1)/vn+v1
%%
%% The mappings specified by ``gl:mapGrid'' are used identically by {@link gl:evalMesh1/3}
%% and {@link gl:evalPoint1/1} .
@@ -7440,7 +7441,7 @@ mapGrid2f(Un,U1,U2,Vn,V1,V2) ->
%% 1 ); where &amp;Delta; u=(u 2-u 1)/n
%%
%% and n, u 1, and u 2 are the arguments to the most recent {@link gl:mapGrid1d/3} command.
-%% The one absolute numeric requirement is that if i= n, then the value computed from i.&amp;Delta;
+%% The one absolute numeric requirement is that if i=n, then the value computed from i.&amp;Delta;
%% u+u 1 is exactly u 2.
%%
%% In the two-dimensional case, ``gl:evalPoint2'', let
@@ -7452,8 +7453,8 @@ mapGrid2f(Un,U1,U2,Vn,V1,V2) ->
%% where n, u 1, u 2, m, v 1, and v 2 are the arguments to the most recent {@link gl:mapGrid1d/3}
%% command. Then the ``gl:evalPoint2'' command is equivalent to calling glEvalCoord2( i.
%% &amp;Delta; u+u 1, j.&amp;Delta; v+v 1 ); The only absolute numeric requirements are
-%% that if i= n, then the value computed from i.&amp;Delta; u+u 1 is exactly u 2, and
-%% if j= m, then the value computed from j.&amp;Delta; v+v 1 is exactly v 2.
+%% that if i=n, then the value computed from i.&amp;Delta; u+u 1 is exactly u 2, and
+%% if j=m, then the value computed from j.&amp;Delta; v+v 1 is exactly v 2.
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/glEvalPoint.xml">external</a> documentation.
-spec evalPoint1(I) -> ok when I :: integer().
@@ -7486,8 +7487,8 @@ evalPoint2(I,J) ->
%% `type' is `?GL_POINTS' if `Mode' is `?GL_POINT', or `?GL_LINES'
%% if `Mode' is `?GL_LINE'.
%%
-%% The one absolute numeric requirement is that if i= n, then the value computed from i.
-%% &amp;Delta; u+u 1 is exactly u 2.
+%% The one absolute numeric requirement is that if i=n, then the value computed from i.&amp;Delta;
+%% u+u 1 is exactly u 2.
%%
%% In the two-dimensional case, ``gl:evalMesh2'', let .cp &amp;Delta; u=(u 2-u 1)/n
%%
@@ -7516,8 +7517,8 @@ evalPoint2(I,J) ->
%% ; i &lt;= `I2' ; i += 1 ) glEvalCoord2( i.&amp;Delta; u+u 1, j.&amp;Delta; v+v 1
%% ); glEnd();
%%
-%% In all three cases, the only absolute numeric requirements are that if i= n, then the
-%% value computed from i.&amp;Delta; u+u 1 is exactly u 2, and if j= m, then the value
+%% In all three cases, the only absolute numeric requirements are that if i=n, then the
+%% value computed from i.&amp;Delta; u+u 1 is exactly u 2, and if j=m, then the value
%% computed from j.&amp;Delta; v+v 1 is exactly v 2.
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/glEvalMesh.xml">external</a> documentation.
@@ -7578,21 +7579,21 @@ evalMesh2(Mode,I1,I2,J1,J2) ->
%% (in the case that `?GL_FOG_COORD_SRC' is `?GL_FOG_COORD'). The equation for `?GL_LINEAR'
%% fog is f=(end-c)/(end-start)
%%
-%% The equation for `?GL_EXP' fog is f= e(-(density. c))
+%% The equation for `?GL_EXP' fog is f=e(-(density. c))
%%
-%% The equation for `?GL_EXP2' fog is f= e(-(density. c)) 2
+%% The equation for `?GL_EXP2' fog is f=e(-(density. c)) 2
%%
%% Regardless of the fog mode, f is clamped to the range [0 1] after it is computed. Then,
%% if the GL is in RGBA color mode, the fragment's red, green, and blue colors, represented
%% by C r, are replaced by
%%
-%% (C r)"= f*C r+(1-f)*C f
+%% (C r)"=f×C r+(1-f)×C f
%%
%% Fog does not affect a fragment's alpha component.
%%
%% In color index mode, the fragment's color index i r is replaced by
%%
-%% (i r)"= i r+(1-f)*i f
+%% (i r)"=i r+(1-f)×i f
%%
%%
%%
@@ -7664,44 +7665,45 @@ fogiv(Pname,Params) ->
%% is fed back as some number of floating-point values, as determined by `Type' . Colors
%% are fed back as four values in RGBA mode and one value in color index mode.
%%
-%% feedbackList feedbackItem feedbackList | feedbackItem
+%% feedbackList ← feedbackItem feedbackList | feedbackItem
%%
-%% feedbackItem point | lineSegment | polygon | bitmap | pixelRectangle | passThru
+%% feedbackItem ← point | lineSegment | polygon | bitmap | pixelRectangle | passThru
%%
-%% point `?GL_POINT_TOKEN' vertex
+%% point ←`?GL_POINT_TOKEN' vertex
%%
-%% lineSegment `?GL_LINE_TOKEN' vertex vertex | `?GL_LINE_RESET_TOKEN' vertex
+%% lineSegment ←`?GL_LINE_TOKEN' vertex vertex | `?GL_LINE_RESET_TOKEN' vertex
%% vertex
%%
-%% polygon `?GL_POLYGON_TOKEN' n polySpec
+%% polygon ←`?GL_POLYGON_TOKEN' n polySpec
%%
-%% polySpec polySpec vertex | vertex vertex vertex
+%% polySpec ← polySpec vertex | vertex vertex vertex
%%
-%% bitmap `?GL_BITMAP_TOKEN' vertex
+%% bitmap ←`?GL_BITMAP_TOKEN' vertex
%%
-%% pixelRectangle `?GL_DRAW_PIXEL_TOKEN' vertex | `?GL_COPY_PIXEL_TOKEN' vertex
+%% pixelRectangle ←`?GL_DRAW_PIXEL_TOKEN' vertex | `?GL_COPY_PIXEL_TOKEN' vertex
+%%
%%
-%% passThru `?GL_PASS_THROUGH_TOKEN' value
+%% passThru ←`?GL_PASS_THROUGH_TOKEN' value
%%
-%% vertex 2d | 3d | 3dColor | 3dColorTexture | 4dColorTexture
+%% vertex ← 2d | 3d | 3dColor | 3dColorTexture | 4dColorTexture
%%
-%% 2d value value
+%% 2d ← value value
%%
-%% 3d value value value
+%% 3d ← value value value
%%
-%% 3dColor value value value color
+%% 3dColor ← value value value color
%%
-%% 3dColorTexture value value value color tex
+%% 3dColorTexture ← value value value color tex
%%
-%% 4dColorTexture value value value value color tex
+%% 4dColorTexture ← value value value value color tex
%%
-%% color rgba | index
+%% color ← rgba | index
%%
-%% rgba value value value value
+%% rgba ← value value value value
%%
-%% index value
+%% index ← value
%%
-%% tex value value value value
+%% tex ← value value value value
%%
%% `value' is a floating-point number, and `n' is a floating-point integer giving
%% the number of vertices in the polygon. `?GL_POINT_TOKEN', `?GL_LINE_TOKEN', `?GL_LINE_RESET_TOKEN'
@@ -7886,13 +7888,13 @@ blendColor(Red,Green,Blue,Alpha) ->
%% blend factors are denoted (s R s G s B s A) and (d R d G d B d A), respectively. For these equations all color components
%% are understood to have values in the range [0 1]. <table><tbody><tr><td>` Mode '</td><td>
%% ` RGB Components '</td><td>` Alpha Component '</td></tr></tbody><tbody><tr><td>`?GL_FUNC_ADD'
-%% </td><td> Rr= R s s R+R d d R Gr= G s s G+G d d G Br= B s s B+B d d B</td><td> Ar=
-%% A s s A+A d d A</td></tr><tr><td>`?GL_FUNC_SUBTRACT'</td><td> Rr= R s s R-R d d
-%% R Gr= G s s G-G d d G Br= B s s B-B d d B</td><td> Ar= A s s A-A d d A</td></tr><tr>
-%% <td>`?GL_FUNC_REVERSE_SUBTRACT'</td><td> Rr= R d d R-R s s R Gr= G d d G-G s s G
-%% Br= B d d B-B s s B</td><td> Ar= A d d A-A s s A</td></tr><tr><td>`?GL_MIN'</td><td>
-%% Rr= min(R s R d) Gr= min(G s G d) Br= min(B s B d)</td><td> Ar= min(A s A d)</td></tr><tr><td>`?GL_MAX'</td><td> Rr=
-%% max(R s R d) Gr= max(G s G d) Br= max(B s B d)</td><td> Ar= max(A s A d)</td></tr></tbody></table>
+%% </td><td> Rr=R s s R+R d d R Gr=G s s G+G d d G Br=B s s B+B d d B</td><td> Ar=A s
+%% s A+A d d A</td></tr><tr><td>`?GL_FUNC_SUBTRACT'</td><td> Rr=R s s R-R d d R Gr=G
+%% s s G-G d d G Br=B s s B-B d d B</td><td> Ar=A s s A-A d d A</td></tr><tr><td>`?GL_FUNC_REVERSE_SUBTRACT'
+%% </td><td> Rr=R d d R-R s s R Gr=G d d G-G s s G Br=B d d B-B s s B</td><td> Ar=A d
+%% d A-A s s A</td></tr><tr><td>`?GL_MIN'</td><td> Rr=min(R s R d) Gr=min(G s G d) Br=min(B s B d)</td><td> Ar=min
+%% (A s A d)</td></tr><tr><td>`?GL_MAX'</td><td> Rr=max(R s R d) Gr=max(G s G d) Br=max(B s B d)</td><td> Ar=max(A s A d)</td></tr></tbody>
+%% </table>
%%
%% The results of these equations are clamped to the range [0 1].
%%
@@ -9062,7 +9064,7 @@ sampleCoverage(Value,Invert) ->
%%
%% `ImageSize' must be equal to:
%%
-%% b s*|width b/w|*|height b/h|*|depth b/d|
+%% b s×|width b/w|×|height b/h|×|depth b/d|
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/glCompressedTexImage3D.xml">external</a> documentation.
-spec compressedTexImage3D(Target, Level, Internalformat, Width, Height, Depth, Border, ImageSize, Data) -> ok when Target :: enum(),Level :: integer(),Internalformat :: enum(),Width :: integer(),Height :: integer(),Depth :: integer(),Border :: integer(),ImageSize :: integer(),Data :: offset()|mem().
@@ -9124,7 +9126,7 @@ compressedTexImage3D(Target,Level,Internalformat,Width,Height,Depth,Border,Image
%%
%% `ImageSize' must be equal to:
%%
-%% b s*|width b/w|*|height b/h|
+%% b s×|width b/w|×|height b/h|
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/glCompressedTexImage2D.xml">external</a> documentation.
-spec compressedTexImage2D(Target, Level, Internalformat, Width, Height, Border, ImageSize, Data) -> ok when Target :: enum(),Level :: integer(),Internalformat :: enum(),Width :: integer(),Height :: integer(),Border :: integer(),ImageSize :: integer(),Data :: offset()|mem().
@@ -9181,7 +9183,7 @@ compressedTexImage2D(Target,Level,Internalformat,Width,Height,Border,ImageSize,D
%%
%% `ImageSize' must be equal to:
%%
-%% b s*|width b/w|
+%% b s×|width b/w|
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/glCompressedTexImage1D.xml">external</a> documentation.
-spec compressedTexImage1D(Target, Level, Internalformat, Width, Border, ImageSize, Data) -> ok when Target :: enum(),Level :: integer(),Internalformat :: enum(),Width :: integer(),Border :: integer(),ImageSize :: integer(),Data :: offset()|mem().
@@ -9502,7 +9504,7 @@ multiTexCoord4sv(Target,{S,T,R,Q}) -> multiTexCoord4s(Target,S,T,R,Q).
%% and `M' points to an array of 16 single- or double-precision floating-point values
%% m={m[0] m[1] ... m[15]}, then the modelview transformation M(v) does the following:
%%
-%% M(v)=(m[0] m[1] m[2] m[3] m[4] m[5] m[6] m[7] m[8] m[9] m[10] m[11] m[12] m[13] m[14] m[15])*(v[0] v[1] v[2] v[3])
+%% M(v)=(m[0] m[1] m[2] m[3] m[4] m[5] m[6] m[7] m[8] m[9] m[10] m[11] m[12] m[13] m[14] m[15])×(v[0] v[1] v[2] v[3])
%%
%% Projection and texture transformations are similarly defined.
%%
@@ -9569,7 +9571,7 @@ multTransposeMatrixd({M1,M2,M3,M4,M5,M6,M7,M8,M9,M10,M11,M12}) ->
%% is referred to as (R c G c B c A c). They are understood to have integer values between 0 and (k R k G k B
%% k A), where
%%
-%% k c= 2(m c)-1
+%% k c=2(m c)-1
%%
%% and (m R m G m B m A) is the number of red, green, blue, and alpha bitplanes.
%%
@@ -9601,12 +9603,12 @@ multTransposeMatrixd({M1,M2,M3,M4,M5,M6,M7,M8,M9,M10,M11,M12}) ->
%%
%% In the table,
%%
-%% i= min(A s 1-(A d))
+%% i=min(A s 1-(A d))
%%
%% To determine the blended RGBA values of a pixel, the system uses the following equations:
%%
%%
-%% R d= min(k R R s s R+R d d R) G d= min(k G G s s G+G d d G) B d= min(k B B s s B+B d d B) A d= min(k A A s s A+A d d A)
+%% R d=min(k R R s s R+R d d R) G d=min(k G G s s G+G d d G) B d=min(k B B s s B+B d d B) A d=min(k A A s s A+A d d A)
%%
%% Despite the apparent precision of the above equations, blending arithmetic is not exactly
%% specified, because blending operates with imprecise integer color values. However, a blend
@@ -9615,7 +9617,7 @@ multTransposeMatrixd({M1,M2,M3,M4,M5,M6,M7,M8,M9,M10,M11,M12}) ->
%% , `DstRGB' is `?GL_ONE_MINUS_SRC_ALPHA', and A s is equal to k A, the equations
%% reduce to simple replacement:
%%
-%% R d= R s G d= G s B d= B s A d= A s
+%% R d=R s G d=G s B d=B s A d=A s
%%
%%
%%
@@ -9899,7 +9901,7 @@ secondaryColorPointer(Size,Type,Stride,Pointer) ->
%% current modelview and projection matrices, nor by the viewport-to-window transform. The
%% z coordinate of the current raster position is updated in the following manner:
%%
-%% z={n f(n+z*(f-n)) if z&lt;= 0 if z&gt;= 1(otherwise))
+%% z={n f(n+z×(f-n)) if z&lt;= 0 if z&gt;= 1(otherwise))
%%
%% where n is `?GL_DEPTH_RANGE''s near value, and f is `?GL_DEPTH_RANGE''s
%% far value. See {@link gl:depthRange/2} .
@@ -10397,13 +10399,13 @@ getBufferParameteriv(Target,Pname) ->
%% blend factors are denoted (s R s G s B s A) and (d R d G d B d A), respectively. For these equations all color components
%% are understood to have values in the range [0 1]. <table><tbody><tr><td>` Mode '</td><td>
%% ` RGB Components '</td><td>` Alpha Component '</td></tr></tbody><tbody><tr><td>`?GL_FUNC_ADD'
-%% </td><td> Rr= R s s R+R d d R Gr= G s s G+G d d G Br= B s s B+B d d B</td><td> Ar=
-%% A s s A+A d d A</td></tr><tr><td>`?GL_FUNC_SUBTRACT'</td><td> Rr= R s s R-R d d
-%% R Gr= G s s G-G d d G Br= B s s B-B d d B</td><td> Ar= A s s A-A d d A</td></tr><tr>
-%% <td>`?GL_FUNC_REVERSE_SUBTRACT'</td><td> Rr= R d d R-R s s R Gr= G d d G-G s s G
-%% Br= B d d B-B s s B</td><td> Ar= A d d A-A s s A</td></tr><tr><td>`?GL_MIN'</td><td>
-%% Rr= min(R s R d) Gr= min(G s G d) Br= min(B s B d)</td><td> Ar= min(A s A d)</td></tr><tr><td>`?GL_MAX'</td><td> Rr=
-%% max(R s R d) Gr= max(G s G d) Br= max(B s B d)</td><td> Ar= max(A s A d)</td></tr></tbody></table>
+%% </td><td> Rr=R s s R+R d d R Gr=G s s G+G d d G Br=B s s B+B d d B</td><td> Ar=A s
+%% s A+A d d A</td></tr><tr><td>`?GL_FUNC_SUBTRACT'</td><td> Rr=R s s R-R d d R Gr=G
+%% s s G-G d d G Br=B s s B-B d d B</td><td> Ar=A s s A-A d d A</td></tr><tr><td>`?GL_FUNC_REVERSE_SUBTRACT'
+%% </td><td> Rr=R d d R-R s s R Gr=G d d G-G s s G Br=B d d B-B s s B</td><td> Ar=A d
+%% d A-A s s A</td></tr><tr><td>`?GL_MIN'</td><td> Rr=min(R s R d) Gr=min(G s G d) Br=min(B s B d)</td><td> Ar=min
+%% (A s A d)</td></tr><tr><td>`?GL_MAX'</td><td> Rr=max(R s R d) Gr=max(G s G d) Br=max(B s B d)</td><td> Ar=max(A s A d)</td></tr></tbody>
+%% </table>
%%
%% The results of these equations are clamped to the range [0 1].
%%
@@ -11626,11 +11628,11 @@ useProgram(Program) ->
%%
%% The commands ``gl:uniformMatrix{2|3|4|2x3|3x2|2x4|4x2|3x4|4x3}fv'' are used to modify
%% a matrix or an array of matrices. The numbers in the command name are interpreted as the
-%% dimensionality of the matrix. The number `2' indicates a 2 � 2 matrix (i.e., 4 values),
-%% the number `3' indicates a 3 � 3 matrix (i.e., 9 values), and the number `4'
-%% indicates a 4 � 4 matrix (i.e., 16 values). Non-square matrix dimensionality is explicit,
+%% dimensionality of the matrix. The number `2' indicates a 2 × 2 matrix (i.e., 4 values),
+%% the number `3' indicates a 3 × 3 matrix (i.e., 9 values), and the number `4'
+%% indicates a 4 × 4 matrix (i.e., 16 values). Non-square matrix dimensionality is explicit,
%% with the first number representing the number of columns and the second number representing
-%% the number of rows. For example, `2x4' indicates a 2 � 4 matrix with 2 columns and
+%% the number of rows. For example, `2x4' indicates a 2 × 4 matrix with 2 columns and
%% 4 rows (i.e., 8 values). If `Transpose' is `?GL_FALSE', each matrix is assumed
%% to be supplied in column major order. If `Transpose' is `?GL_TRUE', each matrix
%% is assumed to be supplied in row major order. The `Count' argument indicates the
@@ -12753,7 +12755,7 @@ drawElementsInstanced(Mode,Count,Type,Indices,Primcount) ->
%%
%% When a buffer object is attached to a buffer texture, the buffer object's data store
%% is taken as the texture's texel array. The number of texels in the buffer texture's texel
-%% array is given by buffer_size components� sizeof( base_type/)
+%% array is given by buffer_size components×sizeof( base_type/)
%%
%% where `buffer_size' is the size of the buffer object, in basic machine units and
%% components and base type are the element count and base data type for elements, as specified
@@ -14576,14 +14578,14 @@ bindSampler(Unit,Sampler) ->
%% to compute the texture value. The other four use mipmaps.
%%
%% A mipmap is an ordered set of arrays representing the same image at progressively lower
-%% resolutions. If the texture has dimensions 2 n*2 m, there are max(n m)+1 mipmaps. The first
-%% mipmap is the original texture, with dimensions 2 n*2 m. Each subsequent mipmap has
-%% dimensions 2(k-1)*2(l-1), where 2 k*2 l are the dimensions of the previous mipmap, until either
-%% k= 0 or l= 0. At that point, subsequent mipmaps have dimension 1*2(l-1) or 2(k-1)*1 until
-%% the final mipmap, which has dimension 1*1. To define the mipmaps, call {@link gl:texImage1D/8}
+%% resolutions. If the texture has dimensions 2 n×2 m, there are max(n m)+1 mipmaps. The first
+%% mipmap is the original texture, with dimensions 2 n×2 m. Each subsequent mipmap has
+%% dimensions 2(k-1)×2(l-1), where 2 k×2 l are the dimensions of the previous mipmap, until either
+%% k=0 or l=0. At that point, subsequent mipmaps have dimension 1×2(l-1) or 2(k-1)×1 until
+%% the final mipmap, which has dimension 1×1. To define the mipmaps, call {@link gl:texImage1D/8}
%% , {@link gl:texImage2D/9} , {@link gl:texImage3D/10} , {@link gl:copyTexImage1D/7} , or {@link gl:copyTexImage2D/8}
%% with the `level' argument indicating the order of the mipmaps. Level 0 is the original
-%% texture; level max(n m) is the final 1*1 mipmap.
+%% texture; level max(n m) is the final 1×1 mipmap.
%%
%% `Params' supplies a function for minifying the texture as one of the following:
%%
@@ -14695,13 +14697,12 @@ bindSampler(Unit,Sampler) ->
%% `?GL_TEXTURE_COMPARE_FUNC': Specifies the comparison operator used when `?GL_TEXTURE_COMPARE_MODE'
%% is set to `?GL_COMPARE_REF_TO_TEXTURE'. Permissible values are: <table><tbody><tr><td>
%% ` Texture Comparison Function '</td><td>` Computed result '</td></tr></tbody><tbody>
-%% <tr><td>`?GL_LEQUAL'</td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&lt;=(D t) r&gt;(D t))</td></tr><tr><td>`?GL_GEQUAL'</td><td>
-%% result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&gt;=(D t) r&lt;(D t))</td></tr><tr><td>`?GL_LESS'</td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&lt;
-%% (D t) r&gt;=(D t))</td></tr><tr><td>`?GL_GREATER'
-%% </td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&gt;(D t) r&lt;=(D t))</td></tr><tr><td>`?GL_EQUAL'</td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp;
-%% r=(D t) r&amp;ne;(D t))</td></tr><tr><td>`?GL_NOTEQUAL'
-%% </td><td> result={1.0 0.0 &amp;nbsp;&amp;nbsp; r&amp;ne;(D t) r=(D t))</td></tr><tr><td>`?GL_ALWAYS'</td><td> result= 1.0</td></tr><tr><td>
-%% `?GL_NEVER'</td><td> result= 0.0</td></tr></tbody></table> where r is the current
+%% <tr><td>`?GL_LEQUAL'</td><td> result={1.0 0.0 r&lt;=(D t) r&gt;(D t))</td></tr><tr><td>`?GL_GEQUAL'</td><td>
+%% result={1.0 0.0 r&gt;=(D t) r&lt;(D t))</td></tr><tr><td>`?GL_LESS'</td><td> result={1.0 0.0 r&lt;(D t) r&gt;=(D t))</td></tr><tr><td>`?GL_GREATER'
+%% </td><td> result={1.0 0.0 r&gt;(D t) r&lt;=(D t))</td></tr><tr><td>`?GL_EQUAL'</td><td> result={1.0 0.0 r=(D t) r&amp;ne;
+%% (D t))</td></tr><tr><td>`?GL_NOTEQUAL'
+%% </td><td> result={1.0 0.0 r&amp;ne;(D t) r=(D t))</td></tr><tr><td>`?GL_ALWAYS'</td><td> result=1.0</td></tr><tr><td>
+%% `?GL_NEVER'</td><td> result=0.0</td></tr></tbody></table> where r is the current
%% interpolated texture coordinate, and D t is the texture value sampled from the currently
%% bound texture. result is assigned to R t.
%%
@@ -15774,11 +15775,11 @@ getProgramPipelineiv(Pipeline,Pname) ->
%%
%% The commands ``gl:programUniformMatrix{2|3|4|2x3|3x2|2x4|4x2|3x4|4x3}fv'' are used
%% to modify a matrix or an array of matrices. The numbers in the command name are interpreted
-%% as the dimensionality of the matrix. The number `2' indicates a 2 � 2 matrix (i.e.,
-%% 4 values), the number `3' indicates a 3 � 3 matrix (i.e., 9 values), and the number `4'
-%% indicates a 4 � 4 matrix (i.e., 16 values). Non-square matrix dimensionality is explicit,
+%% as the dimensionality of the matrix. The number `2' indicates a 2 × 2 matrix (i.e.,
+%% 4 values), the number `3' indicates a 3 × 3 matrix (i.e., 9 values), and the number `4'
+%% indicates a 4 × 4 matrix (i.e., 16 values). Non-square matrix dimensionality is explicit,
%% with the first number representing the number of columns and the second number representing
-%% the number of rows. For example, `2x4' indicates a 2 � 4 matrix with 2 columns and
+%% the number of rows. For example, `2x4' indicates a 2 × 4 matrix with 2 columns and
%% 4 rows (i.e., 8 values). If `Transpose' is `?GL_FALSE', each matrix is assumed
%% to be supplied in column major order. If `Transpose' is `?GL_TRUE', each matrix
%% is assumed to be supplied in row major order. The `Count' argument indicates the
diff --git a/lib/wx/src/gen/glu.erl b/lib/wx/src/gen/glu.erl
index 2c82c9792f..dc64c3c3a7 100644
--- a/lib/wx/src/gen/glu.erl
+++ b/lib/wx/src/gen/glu.erl
@@ -1,7 +1,9 @@
+%% -*- coding: utf-8 -*-
+
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -91,19 +93,19 @@ tesselate({Nx,Ny,Nz}, Vs) ->
%% ).
%%
%% A series of mipmap levels from `Base' to `Max' is built by decimating `Data'
-%% in half until size 1*1 is reached. At each level, each texel in the halved mipmap
+%% in half until size 1×1 is reached. At each level, each texel in the halved mipmap
%% level is an average of the corresponding two texels in the larger mipmap level. {@link gl:texImage1D/8}
%% is called to load these mipmap levels from `Base' to `Max' . If `Max' is
%% larger than the highest mipmap level for the texture of the specified size, then a GLU
%% error code is returned (see {@link glu:errorString/1} ) and nothing is loaded.
%%
%% For example, if `Level' is 2 and `Width' is 16, the following levels are possible:
-%% 16*1, 8*1, 4*1, 2*1, 1*1. These correspond to levels 2 through 6 respectively.
-%% If `Base' is 3 and `Max' is 5, then only mipmap levels 8*1, 4*1 and 2*1
+%% 16×1, 8×1, 4×1, 2×1, 1×1. These correspond to levels 2 through 6 respectively.
+%% If `Base' is 3 and `Max' is 5, then only mipmap levels 8×1, 4×1 and 2×1
%% are loaded. However, if `Max' is 7, then an error is returned and nothing is loaded
%% since `Max' is larger than the highest mipmap level which is, in this case, 6.
%%
-%% The highest mipmap level can be derived from the formula log 2(width*2 level).
+%% The highest mipmap level can be derived from the formula log 2(width×2 level).
%%
%% See the {@link gl:texImage1D/8} reference page for a description of the acceptable values
%% for `Type' parameter. See the {@link gl:drawPixels/5} reference page for a description
@@ -134,13 +136,13 @@ build1DMipmapLevels(Target,InternalFormat,Width,Format,Type,Level,Base,Max,Data)
%% can fit the requested texture. If not, `Width' is continually halved until it fits.
%%
%% Next, a series of mipmap levels is built by decimating a copy of `Data' in half
-%% until size 1*1 is reached. At each level, each texel in the halved mipmap level is an
+%% until size 1×1 is reached. At each level, each texel in the halved mipmap level is an
%% average of the corresponding two texels in the larger mipmap level.
%%
%% {@link gl:texImage1D/8} is called to load each of these mipmap levels. Level 0 is a copy
%% of `Data' . The highest level is (log 2)(width). For example, if `Width' is 64 and the implementation
-%% can store a texture of this size, the following mipmap levels are built: 64*1, 32*1,
-%% 16*1, 8*1, 4*1, 2*1, and 1*1. These correspond to levels 0 through 6, respectively.
+%% can store a texture of this size, the following mipmap levels are built: 64×1, 32×1,
+%% 16×1, 8×1, 4×1, 2×1, and 1×1. These correspond to levels 0 through 6, respectively.
%%
%%
%% See the {@link gl:texImage1D/8} reference page for a description of the acceptable values
@@ -163,22 +165,22 @@ build1DMipmaps(Target,InternalFormat,Width,Format,Type,Data) ->
%% ).
%%
%% A series of mipmap levels from `Base' to `Max' is built by decimating `Data'
-%% in half along both dimensions until size 1*1 is reached. At each level, each texel
+%% in half along both dimensions until size 1×1 is reached. At each level, each texel
%% in the halved mipmap level is an average of the corresponding four texels in the larger
%% mipmap level. (In the case of rectangular images, the decimation will ultimately reach
-%% an N*1 or 1*N configuration. Here, two texels are averaged instead.) {@link gl:texImage2D/9}
+%% an N×1 or 1×N configuration. Here, two texels are averaged instead.) {@link gl:texImage2D/9}
%% is called to load these mipmap levels from `Base' to `Max' . If `Max' is
%% larger than the highest mipmap level for the texture of the specified size, then a GLU
%% error code is returned (see {@link glu:errorString/1} ) and nothing is loaded.
%%
%% For example, if `Level' is 2 and `Width' is 16 and `Height' is 8, the
-%% following levels are possible: 16*8, 8*4, 4*2, 2*1, 1*1. These correspond to
+%% following levels are possible: 16×8, 8×4, 4×2, 2×1, 1×1. These correspond to
%% levels 2 through 6 respectively. If `Base' is 3 and `Max' is 5, then only mipmap
-%% levels 8*4, 4*2, and 2*1 are loaded. However, if `Max' is 7, then an error is
+%% levels 8×4, 4×2, and 2×1 are loaded. However, if `Max' is 7, then an error is
%% returned and nothing is loaded since `Max' is larger than the highest mipmap level
%% which is, in this case, 6.
%%
-%% The highest mipmap level can be derived from the formula log 2(max(width height)*2 level).
+%% The highest mipmap level can be derived from the formula log 2(max(width height)×2 level).
%%
%% See the {@link gl:texImage1D/8} reference page for a description of the acceptable values
%% for `Format' parameter. See the {@link gl:drawPixels/5} reference page for a description
@@ -214,15 +216,15 @@ build2DMipmapLevels(Target,InternalFormat,Width,Height,Format,Type,Level,Base,Ma
%% .)
%%
%% Next, a series of mipmap levels is built by decimating a copy of `Data' in half
-%% along both dimensions until size 1*1 is reached. At each level, each texel in the halved
+%% along both dimensions until size 1×1 is reached. At each level, each texel in the halved
%% mipmap level is an average of the corresponding four texels in the larger mipmap level.
-%% (In the case of rectangular images, the decimation will ultimately reach an N*1 or 1*N
+%% (In the case of rectangular images, the decimation will ultimately reach an N×1 or 1×N
%% configuration. Here, two texels are averaged instead.)
%%
%% {@link gl:texImage2D/9} is called to load each of these mipmap levels. Level 0 is a copy
%% of `Data' . The highest level is (log 2)(max(width height)). For example, if `Width' is 64 and `Height'
%% is 16 and the implementation can store a texture of this size, the following mipmap levels
-%% are built: 64*16, 32*8, 16*4, 8*2, 4*1, 2*1, and 1*1 These correspond to
+%% are built: 64×16, 32×8, 16×4, 8×2, 4×1, 2×1, and 1×1 These correspond to
%% levels 0 through 6, respectively.
%%
%% See the {@link gl:texImage1D/8} reference page for a description of the acceptable values
@@ -245,7 +247,7 @@ build2DMipmaps(Target,InternalFormat,Width,Height,Format,Type,Data) ->
%% ).
%%
%% A series of mipmap levels from `Base' to `Max' is built by decimating `Data'
-%% in half along both dimensions until size 1*1*1 is reached. At each level, each texel
+%% in half along both dimensions until size 1×1×1 is reached. At each level, each texel
%% in the halved mipmap level is an average of the corresponding eight texels in the larger
%% mipmap level. (If exactly one of the dimensions is 1, four texels are averaged. If exactly
%% two of the dimensions are 1, two texels are averaged.) {@link gl:texImage3D/10} is called
@@ -254,13 +256,13 @@ build2DMipmaps(Target,InternalFormat,Width,Height,Format,Type,Data) ->
%% is returned (see {@link glu:errorString/1} ) and nothing is loaded.
%%
%% For example, if `Level' is 2 and `Width' is 16, `Height' is 8 and `Depth'
-%% is 4, the following levels are possible: 16*8*4, 8*4*2, 4*2*1, 2*1*1, 1*1*1.
+%% is 4, the following levels are possible: 16×8×4, 8×4×2, 4×2×1, 2×1×1, 1×1×1.
%% These correspond to levels 2 through 6 respectively. If `Base' is 3 and `Max'
-%% is 5, then only mipmap levels 8*4*2, 4*2*1, and 2*1*1 are loaded. However, if `Max'
+%% is 5, then only mipmap levels 8×4×2, 4×2×1, and 2×1×1 are loaded. However, if `Max'
%% is 7, then an error is returned and nothing is loaded, since `Max' is larger than
%% the highest mipmap level which is, in this case, 6.
%%
-%% The highest mipmap level can be derived from the formula log 2(max(width height depth)*2 level).
+%% The highest mipmap level can be derived from the formula log 2(max(width height depth)×2 level).
%%
%% See the {@link gl:texImage1D/8} reference page for a description of the acceptable values
%% for `Format' parameter. See the {@link gl:drawPixels/5} reference page for a description
@@ -295,7 +297,7 @@ build3DMipmapLevels(Target,InternalFormat,Width,Height,Depth,Format,Type,Level,B
%% it fits.
%%
%% Next, a series of mipmap levels is built by decimating a copy of `Data' in half
-%% along all three dimensions until size 1*1*1 is reached. At each level, each texel in
+%% along all three dimensions until size 1×1×1 is reached. At each level, each texel in
%% the halved mipmap level is an average of the corresponding eight texels in the larger
%% mipmap level. (If exactly one of the dimensions is 1, four texels are averaged. If exactly
%% two of the dimensions are 1, two texels are averaged.)
@@ -303,8 +305,8 @@ build3DMipmapLevels(Target,InternalFormat,Width,Height,Depth,Format,Type,Level,B
%% {@link gl:texImage3D/10} is called to load each of these mipmap levels. Level 0 is a copy
%% of `Data' . The highest level is (log 2)(max(width height depth)). For example, if `Width' is 64, `Height'
%% is 16, and `Depth' is 32, and the implementation can store a texture of this size,
-%% the following mipmap levels are built: 64*16*32, 32*8*16, 16*4*8, 8*2*4, 4*1*2,
-%% 2*1*1, and 1*1*1. These correspond to levels 0 through 6, respectively.
+%% the following mipmap levels are built: 64×16×32, 32×8×16, 16×4×8, 8×2×4, 4×1×2,
+%% 2×1×1, and 1×1×1. These correspond to levels 0 through 6, respectively.
%%
%% See the {@link gl:texImage1D/8} reference page for a description of the acceptable values
%% for `Format' parameter. See the {@link gl:drawPixels/5} reference page for a description
@@ -334,7 +336,7 @@ checkExtension(ExtName,ExtString) ->
%% @doc Draw a cylinder
%%
%% ``glu:cylinder'' draws a cylinder oriented along the `z' axis. The base of the
-%% cylinder is placed at `z' = 0 and the top at z= height. Like a sphere, a cylinder
+%% cylinder is placed at `z' = 0 and the top at z=height. Like a sphere, a cylinder
%% is subdivided around the `z' axis into slices and along the `z' axis into stacks.
%%
%%
@@ -380,7 +382,7 @@ deleteQuadric(Quad) ->
%% the -`z' axis.
%%
%% If texturing has been turned on (with {@link glu:quadricTexture/2} ), texture coordinates
-%% are generated linearly such that where r= outer, the value at (`r', 0, 0) is (1,
+%% are generated linearly such that where r=outer, the value at (`r', 0, 0) is (1,
%% 0.5), at (0, `r', 0) it is (0.5, 1), at (-`r', 0, 0) it is (0, 0.5), and at
%% (0, -`r', 0) it is (0.5, 0).
%%
@@ -451,11 +453,11 @@ getString(Name) ->
%%
%% Let `UP' be the vector (upX upY upZ).
%%
-%% Then normalize as follows: f= F/(||F||)
+%% Then normalize as follows: f=F/(||F||)
%%
-%% UP"= UP/(||UP||)
+%% UP"=UP/(||UP||)
%%
-%% Finally, let s= f*UP", and u= s*f.
+%% Finally, let s=f×UP", and u=s×f.
%%
%% M is then constructed as follows: M=(s[0] s[1] s[2] 0 u[0] u[1] u[2] 0-f[0]-f[1]-f[2] 0 0 0 0 1)
%%
@@ -481,7 +483,7 @@ newQuadric() ->
%% @doc Define a 2D orthographic projection matrix
%%
%% ``glu:ortho2D'' sets up a two-dimensional orthographic viewing region. This is equivalent
-%% to calling {@link gl:ortho/6} with near= -1 and far= 1.
+%% to calling {@link gl:ortho/6} with near=-1 and far=1.
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/gluOrtho2D.xml">external</a> documentation.
-spec ortho2D(Left, Right, Bottom, Top) -> ok when Left :: float(),Right :: float(),Bottom :: float(),Top :: float().
@@ -490,7 +492,7 @@ ortho2D(Left,Right,Bottom,Top) ->
%% @doc Draw an arc of a disk
%%
-%% ``glu:partialDisk'' renders a partial disk on the z= 0 plane. A partial disk is similar
+%% ``glu:partialDisk'' renders a partial disk on the z=0 plane. A partial disk is similar
%% to a full disk, except that only the subset of the disk from `Start' through `Start'
%% + `Sweep' is included (where 0 degrees is along the +f2yf axis, 90 degrees along
%% the +`x' axis, 180 degrees along the -`y' axis, and 270 degrees along the -`x'
@@ -508,7 +510,7 @@ ortho2D(Left,Right,Bottom,Top) ->
%% Otherwise, they point along the -`z' axis.
%%
%% If texturing is turned on (with {@link glu:quadricTexture/2} ), texture coordinates are
-%% generated linearly such that where r= outer, the value at (`r', 0, 0) is (1.0,
+%% generated linearly such that where r=outer, the value at (`r', 0, 0) is (1.0,
%% 0.5), at (0, `r', 0) it is (0.5, 1.0), at (-`r', 0, 0) it is (0.0, 0.5), and
%% at (0, -`r', 0) it is (0.5, 0.0).
%%
@@ -521,7 +523,7 @@ partialDisk(Quad,Inner,Outer,Slices,Loops,Start,Sweep) ->
%%
%% ``glu:perspective'' specifies a viewing frustum into the world coordinate system. In
%% general, the aspect ratio in ``glu:perspective'' should match the aspect ratio of the
-%% associated viewport. For example, aspect= 2.0 means the viewer's angle of view is twice
+%% associated viewport. For example, aspect=2.0 means the viewer's angle of view is twice
%% as wide in `x' as it is in `y'. If the viewport is twice as wide as it is tall,
%% it displays the image without distortion.
%%
@@ -532,9 +534,9 @@ partialDisk(Quad,Inner,Outer,Slices,Loops,Start,Sweep) ->
%%
%% Given `f' defined as follows:
%%
-%% f= cotangent(fovy/2) The generated matrix is
+%% f=cotangent(fovy/2) The generated matrix is
%%
-%% (f/aspect 0 0 0 0 f 0 0 0 0(zFar+zNear)/(zNear-zFar)(2*zFar*zNear)/(zNear-zFar) 0 0 -1 0)
+%% (f/aspect 0 0 0 0 f 0 0 0 0(zFar+zNear)/(zNear-zFar)(2×zFar×zNear)/(zNear-zFar) 0 0 -1 0)
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/gluPerspective.xml">external</a> documentation.
-spec perspective(Fovy, Aspect, ZNear, ZFar) -> ok when Fovy :: float(),Aspect :: float(),ZNear :: float(),ZFar :: float().
@@ -577,16 +579,16 @@ pickMatrix(X,Y,DelX,DelY,{V1,V2,V3,V4}) ->
%% To compute the coordinates, let v=(objX objY objZ 1.0) represented as a matrix with 4 rows and 1 column.
%% Then ``glu:project'' computes v" as follows:
%%
-%% v"= P*M*v
+%% v"=P×M×v
%%
%% where P is the current projection matrix `Proj' and M is the current modelview
-%% matrix `Model' (both represented as 4*4 matrices in column-major order).
+%% matrix `Model' (both represented as 4×4 matrices in column-major order).
%%
%% The window coordinates are then computed as follows:
%%
-%% winX= view(0)+view(2)*(v"(0)+1)/2
+%% winX=view(0)+view(2)×(v"(0)+1)/2
%%
-%% winY= view(1)+view(3)*(v"(1)+1)/2
+%% winY=view(1)+view(3)×(v"(1)+1)/2
%%
%% winZ=(v"(2)+1)/2
%%
@@ -703,7 +705,7 @@ scaleImage(Format,WIn,HIn,TypeIn,DataIn,WOut,HOut,TypeOut,DataOut) ->
%% point toward the center of the sphere.
%%
%% If texturing is turned on (with {@link glu:quadricTexture/2} ), then texture coordinates
-%% are generated so that `t' ranges from 0.0 at z=-radius to 1.0 at z= radius (`t'
+%% are generated so that `t' ranges from 0.0 at z=-radius to 1.0 at z=radius (`t'
%% increases linearly along longitudinal lines), and `s' ranges from 0.0 at the +`y'
%% axis, to 0.25 at the +`x' axis, to 0.5 at the -`y' axis, to 0.75 at the -`x'
%% axis, and back to 1.0 at the +`y' axis.
@@ -723,7 +725,7 @@ sphere(Quad,Radius,Slices,Stacks) ->
%% To compute the coordinates (objX objY objZ), ``glu:unProject'' multiplies the normalized device coordinates
%% by the inverse of `Model' * `Proj' as follows:
%%
-%% (objX objY objZ W)= INV(P M) ((2(winX-view[0]))/(view[2])-1(2(winY-view[1]))/(view[3])-1 2(winZ)-1 1) INV denotes matrix inversion. W is an unused variable, included for consistent
+%% (objX objY objZ W)=INV(P M) ((2(winX-view[0]))/(view[2])-1(2(winY-view[1]))/(view[3])-1 2(winZ)-1 1) INV denotes matrix inversion. W is an unused variable, included for consistent
%% matrix notation.
%%
%% See <a href="http://www.opengl.org/sdk/docs/man/xhtml/gluUnProject.xml">external</a> documentation.
diff --git a/lib/wx/src/gen/wxCalendarCtrl.erl b/lib/wx/src/gen/wxCalendarCtrl.erl
index 01d171800b..2a476c5e92 100644
--- a/lib/wx/src/gen/wxCalendarCtrl.erl
+++ b/lib/wx/src/gen/wxCalendarCtrl.erl
@@ -75,6 +75,8 @@
update/1,updateWindowUI/1,updateWindowUI/2,validate/1,warpPointer/3]).
-export_type([wxCalendarCtrl/0]).
+-deprecated([enableYearChange/1,enableYearChange/2]).
+
%% @hidden
parent_class(wxControl) -> true;
parent_class(wxWindow) -> true;
diff --git a/lib/wx/src/gen/wxClientDC.erl b/lib/wx/src/gen/wxClientDC.erl
index 7dfebe4068..cb75fdc58d 100644
--- a/lib/wx/src/gen/wxClientDC.erl
+++ b/lib/wx/src/gen/wxClientDC.erl
@@ -54,6 +54,8 @@
startPage/1]).
-export_type([wxClientDC/0]).
+-deprecated([new/0]).
+
%% @hidden
parent_class(wxWindowDC) -> true;
parent_class(wxDC) -> true;
diff --git a/lib/wx/src/gen/wxClipboard.erl b/lib/wx/src/gen/wxClipboard.erl
index 8f1d59f603..c7336fcc47 100644
--- a/lib/wx/src/gen/wxClipboard.erl
+++ b/lib/wx/src/gen/wxClipboard.erl
@@ -130,8 +130,9 @@ usePrimarySelection(#wx_ref{type=ThisT,ref=ThisRef}, Options)
<<ThisRef:32/?UI, 0:32,BinOpt/binary>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxclipboard.html#wxclipboardissupported">external documentation</a>.
+%%<br /> Format = ?wxDF_INVALID | ?wxDF_TEXT | ?wxDF_BITMAP | ?wxDF_METAFILE | ?wxDF_SYLK | ?wxDF_DIF | ?wxDF_TIFF | ?wxDF_OEMTEXT | ?wxDF_DIB | ?wxDF_PALETTE | ?wxDF_PENDATA | ?wxDF_RIFF | ?wxDF_WAVE | ?wxDF_UNICODETEXT | ?wxDF_ENHMETAFILE | ?wxDF_FILENAME | ?wxDF_LOCALE | ?wxDF_PRIVATE | ?wxDF_HTML | ?wxDF_MAX
-spec isSupported(This, Format) -> boolean() when
- This::wxClipboard(), Format::integer().
+ This::wxClipboard(), Format::wx:wx_enum().
isSupported(#wx_ref{type=ThisT,ref=ThisRef},Format)
when is_integer(Format) ->
?CLASS(ThisT,wxClipboard),
diff --git a/lib/wx/src/gen/wxCursor.erl b/lib/wx/src/gen/wxCursor.erl
index b9e3a8e3f7..423e444f2f 100644
--- a/lib/wx/src/gen/wxCursor.erl
+++ b/lib/wx/src/gen/wxCursor.erl
@@ -35,6 +35,8 @@
saveFile/4,setDepth/2,setHeight/2,setMask/2,setPalette/2,setWidth/2]).
-export_type([wxCursor/0]).
+-deprecated([new/3,new/4]).
+
%% @hidden
parent_class(wxBitmap) -> true;
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
diff --git a/lib/wx/src/gen/wxDC.erl b/lib/wx/src/gen/wxDC.erl
index 9f57978849..42d5d7b1df 100644
--- a/lib/wx/src/gen/wxDC.erl
+++ b/lib/wx/src/gen/wxDC.erl
@@ -50,6 +50,8 @@
-export([parent_class/1]).
-export_type([wxDC/0]).
+-deprecated([computeScaleAndOrigin/1]).
+
%% @hidden
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
@@ -63,9 +65,10 @@ blit(This,DestPt={DestPtX,DestPtY},Sz={SzW,SzH},Source,SrcPt={SrcPtX,SrcPtY})
blit(This,DestPt,Sz,Source,SrcPt, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxdc.html#wxdcblit">external documentation</a>.
+%%<br /> Rop = integer
-spec blit(This, DestPt, Sz, Source, SrcPt, [Option]) -> boolean() when
This::wxDC(), DestPt::{X::integer(), Y::integer()}, Sz::{W::integer(), H::integer()}, Source::wxDC(), SrcPt::{X::integer(), Y::integer()},
- Option :: {rop, integer()}
+ Option :: {rop, wx:wx_enum()}
| {useMask, boolean()}
| {srcPtMask, {X::integer(), Y::integer()}}.
blit(#wx_ref{type=ThisT,ref=ThisRef},{DestPtX,DestPtY},{SzW,SzH},#wx_ref{type=SourceT,ref=SourceRef},{SrcPtX,SrcPtY}, Options)
@@ -310,11 +313,12 @@ drawPolygon(This,Points)
drawPolygon(This,Points, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxdc.html#wxdcdrawpolygon">external documentation</a>.
+%%<br /> FillStyle = integer
-spec drawPolygon(This, Points, [Option]) -> ok when
This::wxDC(), Points::[{X::integer(), Y::integer()}],
Option :: {xoffset, integer()}
| {yoffset, integer()}
- | {fillStyle, integer()}.
+ | {fillStyle, wx:wx_enum()}.
drawPolygon(#wx_ref{type=ThisT,ref=ThisRef},Points, Options)
when is_list(Points),is_list(Options) ->
?CLASS(ThisT,wxDC),
@@ -417,9 +421,10 @@ floodFill(This,Pt={PtX,PtY},Col)
floodFill(This,Pt,Col, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxdc.html#wxdcfloodfill">external documentation</a>.
+%%<br /> Style = integer
-spec floodFill(This, Pt, Col, [Option]) -> boolean() when
This::wxDC(), Pt::{X::integer(), Y::integer()}, Col::wx:wx_colour(),
- Option :: {style, integer()}.
+ Option :: {style, wx:wx_enum()}.
floodFill(#wx_ref{type=ThisT,ref=ThisRef},{PtX,PtY},Col, Options)
when is_integer(PtX),is_integer(PtY),tuple_size(Col) =:= 3; tuple_size(Col) =:= 4,is_list(Options) ->
?CLASS(ThisT,wxDC),
@@ -855,8 +860,9 @@ setLayoutDirection(#wx_ref{type=ThisT,ref=ThisRef},Dir)
<<ThisRef:32/?UI,Dir:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxdc.html#wxdcsetlogicalfunction">external documentation</a>.
+%%<br /> Function = integer
-spec setLogicalFunction(This, Function) -> ok when
- This::wxDC(), Function::integer().
+ This::wxDC(), Function::wx:wx_enum().
setLogicalFunction(#wx_ref{type=ThisT,ref=ThisRef},Function)
when is_integer(Function) ->
?CLASS(ThisT,wxDC),
@@ -864,8 +870,9 @@ setLogicalFunction(#wx_ref{type=ThisT,ref=ThisRef},Function)
<<ThisRef:32/?UI,Function:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxdc.html#wxdcsetmapmode">external documentation</a>.
+%%<br /> Mode = integer
-spec setMapMode(This, Mode) -> ok when
- This::wxDC(), Mode::integer().
+ This::wxDC(), Mode::wx:wx_enum().
setMapMode(#wx_ref{type=ThisT,ref=ThisRef},Mode)
when is_integer(Mode) ->
?CLASS(ThisT,wxDC),
diff --git a/lib/wx/src/gen/wxGraphicsContext.erl b/lib/wx/src/gen/wxGraphicsContext.erl
index 1dfa0dd405..575e48d7af 100644
--- a/lib/wx/src/gen/wxGraphicsContext.erl
+++ b/lib/wx/src/gen/wxGraphicsContext.erl
@@ -40,6 +40,8 @@
-export([getRenderer/1,isNull/1,parent_class/1]).
-export_type([wxGraphicsContext/0]).
+-deprecated([createLinearGradientBrush/7,createRadialGradientBrush/8]).
+
%% @hidden
parent_class(wxGraphicsObject) -> true;
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
@@ -225,9 +227,10 @@ drawLines(This,Points)
drawLines(This,Points, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxgraphicscontext.html#wxgraphicscontextdrawlines">external documentation</a>.
+%%<br /> FillStyle = integer
-spec drawLines(This, Points, [Option]) -> ok when
This::wxGraphicsContext(), Points::[{X::float(), Y::float()}],
- Option :: {fillStyle, integer()}.
+ Option :: {fillStyle, wx:wx_enum()}.
drawLines(#wx_ref{type=ThisT,ref=ThisRef},Points, Options)
when is_list(Points),is_list(Options) ->
?CLASS(ThisT,wxGraphicsContext),
@@ -247,9 +250,10 @@ drawPath(This,Path)
drawPath(This,Path, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxgraphicscontext.html#wxgraphicscontextdrawpath">external documentation</a>.
+%%<br /> FillStyle = integer
-spec drawPath(This, Path, [Option]) -> ok when
This::wxGraphicsContext(), Path::wxGraphicsPath:wxGraphicsPath(),
- Option :: {fillStyle, integer()}.
+ Option :: {fillStyle, wx:wx_enum()}.
drawPath(#wx_ref{type=ThisT,ref=ThisRef},#wx_ref{type=PathT,ref=PathRef}, Options)
when is_list(Options) ->
?CLASS(ThisT,wxGraphicsContext),
@@ -331,9 +335,10 @@ fillPath(This,Path)
fillPath(This,Path, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxgraphicscontext.html#wxgraphicscontextfillpath">external documentation</a>.
+%%<br /> FillStyle = integer
-spec fillPath(This, Path, [Option]) -> ok when
This::wxGraphicsContext(), Path::wxGraphicsPath:wxGraphicsPath(),
- Option :: {fillStyle, integer()}.
+ Option :: {fillStyle, wx:wx_enum()}.
fillPath(#wx_ref{type=ThisT,ref=ThisRef},#wx_ref{type=PathT,ref=PathRef}, Options)
when is_list(Options) ->
?CLASS(ThisT,wxGraphicsContext),
diff --git a/lib/wx/src/gen/wxGraphicsPath.erl b/lib/wx/src/gen/wxGraphicsPath.erl
index 56b853899a..246ea489ec 100644
--- a/lib/wx/src/gen/wxGraphicsPath.erl
+++ b/lib/wx/src/gen/wxGraphicsPath.erl
@@ -197,13 +197,14 @@ contains(This,C={CX,CY})
%% <br /> Also:<br />
%% contains(This, C, [Option]) -> boolean() when<br />
%% This::wxGraphicsPath(), C::{X::float(), Y::float()},<br />
-%% Option :: {fillStyle, integer()}.<br />
+%% Option :: {fillStyle, wx:wx_enum()}.<br />
%%
+%%<br /> FillStyle = integer
-spec contains(This, X, Y) -> boolean() when
This::wxGraphicsPath(), X::number(), Y::number();
(This, C, [Option]) -> boolean() when
This::wxGraphicsPath(), C::{X::float(), Y::float()},
- Option :: {fillStyle, integer()}.
+ Option :: {fillStyle, wx:wx_enum()}.
contains(This,X,Y)
when is_record(This, wx_ref),is_number(X),is_number(Y) ->
@@ -218,9 +219,10 @@ contains(#wx_ref{type=ThisT,ref=ThisRef},{CX,CY}, Options)
<<ThisRef:32/?UI,0:32,CX:64/?F,CY:64/?F, BinOpt/binary>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxgraphicspath.html#wxgraphicspathcontains">external documentation</a>.
+%%<br /> FillStyle = integer
-spec contains(This, X, Y, [Option]) -> boolean() when
This::wxGraphicsPath(), X::number(), Y::number(),
- Option :: {fillStyle, integer()}.
+ Option :: {fillStyle, wx:wx_enum()}.
contains(#wx_ref{type=ThisT,ref=ThisRef},X,Y, Options)
when is_number(X),is_number(Y),is_list(Options) ->
?CLASS(ThisT,wxGraphicsPath),
diff --git a/lib/wx/src/gen/wxGraphicsRenderer.erl b/lib/wx/src/gen/wxGraphicsRenderer.erl
index 21082bde23..2b64f86182 100644
--- a/lib/wx/src/gen/wxGraphicsRenderer.erl
+++ b/lib/wx/src/gen/wxGraphicsRenderer.erl
@@ -32,6 +32,8 @@
-export([parent_class/1]).
-export_type([wxGraphicsRenderer/0]).
+-deprecated([createLinearGradientBrush/7,createRadialGradientBrush/8]).
+
%% @hidden
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
diff --git a/lib/wx/src/gen/wxGridCellEditor.erl b/lib/wx/src/gen/wxGridCellEditor.erl
index e84cdeb49a..4f86e307b5 100644
--- a/lib/wx/src/gen/wxGridCellEditor.erl
+++ b/lib/wx/src/gen/wxGridCellEditor.erl
@@ -31,6 +31,8 @@
-export([parent_class/1]).
-export_type([wxGridCellEditor/0]).
+-deprecated([endEdit/4,paintBackground/3]).
+
%% @hidden
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
diff --git a/lib/wx/src/gen/wxIdleEvent.erl b/lib/wx/src/gen/wxIdleEvent.erl
index 4749026446..a19fdcc48e 100644
--- a/lib/wx/src/gen/wxIdleEvent.erl
+++ b/lib/wx/src/gen/wxIdleEvent.erl
@@ -38,6 +38,8 @@
resumePropagation/2,shouldPropagate/1,skip/1,skip/2,stopPropagation/1]).
-export_type([wxIdleEvent/0]).
+-deprecated([canSend/1]).
+
%% @hidden
parent_class(wxEvent) -> true;
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
diff --git a/lib/wx/src/gen/wxImage.erl b/lib/wx/src/gen/wxImage.erl
index c21b5d4789..0edaee2979 100644
--- a/lib/wx/src/gen/wxImage.erl
+++ b/lib/wx/src/gen/wxImage.erl
@@ -424,9 +424,10 @@ getImageCount(Name)
getImageCount(Name, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wximage.html#wximagegetimagecount">external documentation</a>.
+%%<br /> Type = ?wxBITMAP_TYPE_INVALID | ?wxBITMAP_TYPE_BMP | ?wxBITMAP_TYPE_BMP_RESOURCE | ?wxBITMAP_TYPE_RESOURCE | ?wxBITMAP_TYPE_ICO | ?wxBITMAP_TYPE_ICO_RESOURCE | ?wxBITMAP_TYPE_CUR | ?wxBITMAP_TYPE_CUR_RESOURCE | ?wxBITMAP_TYPE_XBM | ?wxBITMAP_TYPE_XBM_DATA | ?wxBITMAP_TYPE_XPM | ?wxBITMAP_TYPE_XPM_DATA | ?wxBITMAP_TYPE_TIF | ?wxBITMAP_TYPE_TIF_RESOURCE | ?wxBITMAP_TYPE_GIF | ?wxBITMAP_TYPE_GIF_RESOURCE | ?wxBITMAP_TYPE_PNG | ?wxBITMAP_TYPE_PNG_RESOURCE | ?wxBITMAP_TYPE_JPEG | ?wxBITMAP_TYPE_JPEG_RESOURCE | ?wxBITMAP_TYPE_PNM | ?wxBITMAP_TYPE_PNM_RESOURCE | ?wxBITMAP_TYPE_PCX | ?wxBITMAP_TYPE_PCX_RESOURCE | ?wxBITMAP_TYPE_PICT | ?wxBITMAP_TYPE_PICT_RESOURCE | ?wxBITMAP_TYPE_ICON | ?wxBITMAP_TYPE_ICON_RESOURCE | ?wxBITMAP_TYPE_ANI | ?wxBITMAP_TYPE_IFF | ?wxBITMAP_TYPE_TGA | ?wxBITMAP_TYPE_MACCURSOR | ?wxBITMAP_TYPE_MACCURSOR_RESOURCE | ?wxBITMAP_TYPE_ANY
-spec getImageCount(Name, [Option]) -> integer() when
Name::unicode:chardata(),
- Option :: {type, integer()}.
+ Option :: {type, wx:wx_enum()}.
getImageCount(Name, Options)
when is_list(Name),is_list(Options) ->
Name_UC = unicode:characters_to_binary([Name,0]),
@@ -687,9 +688,10 @@ rescale(This,Width,Height)
rescale(This,Width,Height, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wximage.html#wximagerescale">external documentation</a>.
+%%<br /> Quality = integer
-spec rescale(This, Width, Height, [Option]) -> wxImage() when
This::wxImage(), Width::integer(), Height::integer(),
- Option :: {quality, integer()}.
+ Option :: {quality, wx:wx_enum()}.
rescale(#wx_ref{type=ThisT,ref=ThisRef},Width,Height, Options)
when is_integer(Width),is_integer(Height),is_list(Options) ->
?CLASS(ThisT,wxImage),
@@ -819,9 +821,10 @@ scale(This,Width,Height)
scale(This,Width,Height, []).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wximage.html#wximagescale">external documentation</a>.
+%%<br /> Quality = integer
-spec scale(This, Width, Height, [Option]) -> wxImage() when
This::wxImage(), Width::integer(), Height::integer(),
- Option :: {quality, integer()}.
+ Option :: {quality, wx:wx_enum()}.
scale(#wx_ref{type=ThisT,ref=ThisRef},Width,Height, Options)
when is_integer(Width),is_integer(Height),is_list(Options) ->
?CLASS(ThisT,wxImage),
diff --git a/lib/wx/src/gen/wxMDIClientWindow.erl b/lib/wx/src/gen/wxMDIClientWindow.erl
index 344dcdbbaf..bfdba336f8 100644
--- a/lib/wx/src/gen/wxMDIClientWindow.erl
+++ b/lib/wx/src/gen/wxMDIClientWindow.erl
@@ -69,6 +69,8 @@
update/1,updateWindowUI/1,updateWindowUI/2,validate/1,warpPointer/3]).
-export_type([wxMDIClientWindow/0]).
+-deprecated([new/1,new/2]).
+
%% @hidden
parent_class(wxWindow) -> true;
parent_class(wxEvtHandler) -> true;
diff --git a/lib/wx/src/gen/wxMouseEvent.erl b/lib/wx/src/gen/wxMouseEvent.erl
index 97ea9e908f..29a4f13ba8 100644
--- a/lib/wx/src/gen/wxMouseEvent.erl
+++ b/lib/wx/src/gen/wxMouseEvent.erl
@@ -19,7 +19,7 @@
%% @doc See external documentation: <a href="http://www.wxwidgets.org/manuals/stable/wx_wxmouseevent.html">wxMouseEvent</a>.
%% <dl><dt>Use {@link wxEvtHandler:connect/3.} with EventType:</dt>
-%% <dd><em>left_down</em>, <em>left_up</em>, <em>middle_down</em>, <em>middle_up</em>, <em>right_down</em>, <em>right_up</em>, <em>motion</em>, <em>enter_window</em>, <em>leave_window</em>, <em>left_dclick</em>, <em>middle_dclick</em>, <em>right_dclick</em>, <em>mousewheel</em>, <em>nc_left_down</em>, <em>nc_left_up</em>, <em>nc_middle_down</em>, <em>nc_middle_up</em>, <em>nc_right_down</em>, <em>nc_right_up</em>, <em>nc_motion</em>, <em>nc_enter_window</em>, <em>nc_leave_window</em>, <em>nc_left_dclick</em>, <em>nc_middle_dclick</em>, <em>nc_right_dclick</em></dd></dl>
+%% <dd><em>left_down</em>, <em>left_up</em>, <em>middle_down</em>, <em>middle_up</em>, <em>right_down</em>, <em>right_up</em>, <em>motion</em>, <em>enter_window</em>, <em>leave_window</em>, <em>left_dclick</em>, <em>middle_dclick</em>, <em>right_dclick</em>, <em>mousewheel</em></dd></dl>
%% See also the message variant {@link wxEvtHandler:wxMouse(). #wxMouse{}} event record type.
%%
%% <p>This class is derived (and can use functions) from:
diff --git a/lib/wx/src/gen/wxPageSetupDialogData.erl b/lib/wx/src/gen/wxPageSetupDialogData.erl
index 7c453a9872..4850e62925 100644
--- a/lib/wx/src/gen/wxPageSetupDialogData.erl
+++ b/lib/wx/src/gen/wxPageSetupDialogData.erl
@@ -194,7 +194,8 @@ getMinMarginBottomRight(#wx_ref{type=ThisT,ref=ThisRef}) ->
<<ThisRef:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxpagesetupdialogdata.html#wxpagesetupdialogdatagetpaperid">external documentation</a>.
--spec getPaperId(This) -> integer() when
+%%<br /> Res = ?wxPAPER_NONE | ?wxPAPER_LETTER | ?wxPAPER_LEGAL | ?wxPAPER_A4 | ?wxPAPER_CSHEET | ?wxPAPER_DSHEET | ?wxPAPER_ESHEET | ?wxPAPER_LETTERSMALL | ?wxPAPER_TABLOID | ?wxPAPER_LEDGER | ?wxPAPER_STATEMENT | ?wxPAPER_EXECUTIVE | ?wxPAPER_A3 | ?wxPAPER_A4SMALL | ?wxPAPER_A5 | ?wxPAPER_B4 | ?wxPAPER_B5 | ?wxPAPER_FOLIO | ?wxPAPER_QUARTO | ?wxPAPER_10X14 | ?wxPAPER_11X17 | ?wxPAPER_NOTE | ?wxPAPER_ENV_9 | ?wxPAPER_ENV_10 | ?wxPAPER_ENV_11 | ?wxPAPER_ENV_12 | ?wxPAPER_ENV_14 | ?wxPAPER_ENV_DL | ?wxPAPER_ENV_C5 | ?wxPAPER_ENV_C3 | ?wxPAPER_ENV_C4 | ?wxPAPER_ENV_C6 | ?wxPAPER_ENV_C65 | ?wxPAPER_ENV_B4 | ?wxPAPER_ENV_B5 | ?wxPAPER_ENV_B6 | ?wxPAPER_ENV_ITALY | ?wxPAPER_ENV_MONARCH | ?wxPAPER_ENV_PERSONAL | ?wxPAPER_FANFOLD_US | ?wxPAPER_FANFOLD_STD_GERMAN | ?wxPAPER_FANFOLD_LGL_GERMAN | ?wxPAPER_ISO_B4 | ?wxPAPER_JAPANESE_POSTCARD | ?wxPAPER_9X11 | ?wxPAPER_10X11 | ?wxPAPER_15X11 | ?wxPAPER_ENV_INVITE | ?wxPAPER_LETTER_EXTRA | ?wxPAPER_LEGAL_EXTRA | ?wxPAPER_TABLOID_EXTRA | ?wxPAPER_A4_EXTRA | ?wxPAPER_LETTER_TRANSVERSE | ?wxPAPER_A4_TRANSVERSE | ?wxPAPER_LETTER_EXTRA_TRANSVERSE | ?wxPAPER_A_PLUS | ?wxPAPER_B_PLUS | ?wxPAPER_LETTER_PLUS | ?wxPAPER_A4_PLUS | ?wxPAPER_A5_TRANSVERSE | ?wxPAPER_B5_TRANSVERSE | ?wxPAPER_A3_EXTRA | ?wxPAPER_A5_EXTRA | ?wxPAPER_B5_EXTRA | ?wxPAPER_A2 | ?wxPAPER_A3_TRANSVERSE | ?wxPAPER_A3_EXTRA_TRANSVERSE | ?wxPAPER_DBL_JAPANESE_POSTCARD | ?wxPAPER_A6 | ?wxPAPER_JENV_KAKU2 | ?wxPAPER_JENV_KAKU3 | ?wxPAPER_JENV_CHOU3 | ?wxPAPER_JENV_CHOU4 | ?wxPAPER_LETTER_ROTATED | ?wxPAPER_A3_ROTATED | ?wxPAPER_A4_ROTATED | ?wxPAPER_A5_ROTATED | ?wxPAPER_B4_JIS_ROTATED | ?wxPAPER_B5_JIS_ROTATED | ?wxPAPER_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_DBL_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_A6_ROTATED | ?wxPAPER_JENV_KAKU2_ROTATED | ?wxPAPER_JENV_KAKU3_ROTATED | ?wxPAPER_JENV_CHOU3_ROTATED | ?wxPAPER_JENV_CHOU4_ROTATED | ?wxPAPER_B6_JIS | ?wxPAPER_B6_JIS_ROTATED | ?wxPAPER_12X11 | ?wxPAPER_JENV_YOU4 | ?wxPAPER_JENV_YOU4_ROTATED | ?wxPAPER_P16K | ?wxPAPER_P32K | ?wxPAPER_P32KBIG | ?wxPAPER_PENV_1 | ?wxPAPER_PENV_2 | ?wxPAPER_PENV_3 | ?wxPAPER_PENV_4 | ?wxPAPER_PENV_5 | ?wxPAPER_PENV_6 | ?wxPAPER_PENV_7 | ?wxPAPER_PENV_8 | ?wxPAPER_PENV_9 | ?wxPAPER_PENV_10 | ?wxPAPER_P16K_ROTATED | ?wxPAPER_P32K_ROTATED | ?wxPAPER_P32KBIG_ROTATED | ?wxPAPER_PENV_1_ROTATED | ?wxPAPER_PENV_2_ROTATED | ?wxPAPER_PENV_3_ROTATED | ?wxPAPER_PENV_4_ROTATED | ?wxPAPER_PENV_5_ROTATED | ?wxPAPER_PENV_6_ROTATED | ?wxPAPER_PENV_7_ROTATED | ?wxPAPER_PENV_8_ROTATED | ?wxPAPER_PENV_9_ROTATED | ?wxPAPER_PENV_10_ROTATED
+-spec getPaperId(This) -> wx:wx_enum() when
This::wxPageSetupDialogData().
getPaperId(#wx_ref{type=ThisT,ref=ThisRef}) ->
?CLASS(ThisT,wxPageSetupDialogData),
@@ -280,8 +281,9 @@ setMinMarginBottomRight(#wx_ref{type=ThisT,ref=ThisRef},{PtX,PtY})
<<ThisRef:32/?UI,PtX:32/?UI,PtY:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxpagesetupdialogdata.html#wxpagesetupdialogdatasetpaperid">external documentation</a>.
+%%<br /> Id = ?wxPAPER_NONE | ?wxPAPER_LETTER | ?wxPAPER_LEGAL | ?wxPAPER_A4 | ?wxPAPER_CSHEET | ?wxPAPER_DSHEET | ?wxPAPER_ESHEET | ?wxPAPER_LETTERSMALL | ?wxPAPER_TABLOID | ?wxPAPER_LEDGER | ?wxPAPER_STATEMENT | ?wxPAPER_EXECUTIVE | ?wxPAPER_A3 | ?wxPAPER_A4SMALL | ?wxPAPER_A5 | ?wxPAPER_B4 | ?wxPAPER_B5 | ?wxPAPER_FOLIO | ?wxPAPER_QUARTO | ?wxPAPER_10X14 | ?wxPAPER_11X17 | ?wxPAPER_NOTE | ?wxPAPER_ENV_9 | ?wxPAPER_ENV_10 | ?wxPAPER_ENV_11 | ?wxPAPER_ENV_12 | ?wxPAPER_ENV_14 | ?wxPAPER_ENV_DL | ?wxPAPER_ENV_C5 | ?wxPAPER_ENV_C3 | ?wxPAPER_ENV_C4 | ?wxPAPER_ENV_C6 | ?wxPAPER_ENV_C65 | ?wxPAPER_ENV_B4 | ?wxPAPER_ENV_B5 | ?wxPAPER_ENV_B6 | ?wxPAPER_ENV_ITALY | ?wxPAPER_ENV_MONARCH | ?wxPAPER_ENV_PERSONAL | ?wxPAPER_FANFOLD_US | ?wxPAPER_FANFOLD_STD_GERMAN | ?wxPAPER_FANFOLD_LGL_GERMAN | ?wxPAPER_ISO_B4 | ?wxPAPER_JAPANESE_POSTCARD | ?wxPAPER_9X11 | ?wxPAPER_10X11 | ?wxPAPER_15X11 | ?wxPAPER_ENV_INVITE | ?wxPAPER_LETTER_EXTRA | ?wxPAPER_LEGAL_EXTRA | ?wxPAPER_TABLOID_EXTRA | ?wxPAPER_A4_EXTRA | ?wxPAPER_LETTER_TRANSVERSE | ?wxPAPER_A4_TRANSVERSE | ?wxPAPER_LETTER_EXTRA_TRANSVERSE | ?wxPAPER_A_PLUS | ?wxPAPER_B_PLUS | ?wxPAPER_LETTER_PLUS | ?wxPAPER_A4_PLUS | ?wxPAPER_A5_TRANSVERSE | ?wxPAPER_B5_TRANSVERSE | ?wxPAPER_A3_EXTRA | ?wxPAPER_A5_EXTRA | ?wxPAPER_B5_EXTRA | ?wxPAPER_A2 | ?wxPAPER_A3_TRANSVERSE | ?wxPAPER_A3_EXTRA_TRANSVERSE | ?wxPAPER_DBL_JAPANESE_POSTCARD | ?wxPAPER_A6 | ?wxPAPER_JENV_KAKU2 | ?wxPAPER_JENV_KAKU3 | ?wxPAPER_JENV_CHOU3 | ?wxPAPER_JENV_CHOU4 | ?wxPAPER_LETTER_ROTATED | ?wxPAPER_A3_ROTATED | ?wxPAPER_A4_ROTATED | ?wxPAPER_A5_ROTATED | ?wxPAPER_B4_JIS_ROTATED | ?wxPAPER_B5_JIS_ROTATED | ?wxPAPER_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_DBL_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_A6_ROTATED | ?wxPAPER_JENV_KAKU2_ROTATED | ?wxPAPER_JENV_KAKU3_ROTATED | ?wxPAPER_JENV_CHOU3_ROTATED | ?wxPAPER_JENV_CHOU4_ROTATED | ?wxPAPER_B6_JIS | ?wxPAPER_B6_JIS_ROTATED | ?wxPAPER_12X11 | ?wxPAPER_JENV_YOU4 | ?wxPAPER_JENV_YOU4_ROTATED | ?wxPAPER_P16K | ?wxPAPER_P32K | ?wxPAPER_P32KBIG | ?wxPAPER_PENV_1 | ?wxPAPER_PENV_2 | ?wxPAPER_PENV_3 | ?wxPAPER_PENV_4 | ?wxPAPER_PENV_5 | ?wxPAPER_PENV_6 | ?wxPAPER_PENV_7 | ?wxPAPER_PENV_8 | ?wxPAPER_PENV_9 | ?wxPAPER_PENV_10 | ?wxPAPER_P16K_ROTATED | ?wxPAPER_P32K_ROTATED | ?wxPAPER_P32KBIG_ROTATED | ?wxPAPER_PENV_1_ROTATED | ?wxPAPER_PENV_2_ROTATED | ?wxPAPER_PENV_3_ROTATED | ?wxPAPER_PENV_4_ROTATED | ?wxPAPER_PENV_5_ROTATED | ?wxPAPER_PENV_6_ROTATED | ?wxPAPER_PENV_7_ROTATED | ?wxPAPER_PENV_8_ROTATED | ?wxPAPER_PENV_9_ROTATED | ?wxPAPER_PENV_10_ROTATED
-spec setPaperId(This, Id) -> ok when
- This::wxPageSetupDialogData(), Id::integer().
+ This::wxPageSetupDialogData(), Id::wx:wx_enum().
setPaperId(#wx_ref{type=ThisT,ref=ThisRef},Id)
when is_integer(Id) ->
?CLASS(ThisT,wxPageSetupDialogData),
@@ -293,8 +295,9 @@ setPaperId(#wx_ref{type=ThisT,ref=ThisRef},Id)
%% setPaperSize(This, Sz) -> ok when<br />
%% This::wxPageSetupDialogData(), Sz::{W::integer(), H::integer()}.<br />
%%
+%%<br /> Id = ?wxPAPER_NONE | ?wxPAPER_LETTER | ?wxPAPER_LEGAL | ?wxPAPER_A4 | ?wxPAPER_CSHEET | ?wxPAPER_DSHEET | ?wxPAPER_ESHEET | ?wxPAPER_LETTERSMALL | ?wxPAPER_TABLOID | ?wxPAPER_LEDGER | ?wxPAPER_STATEMENT | ?wxPAPER_EXECUTIVE | ?wxPAPER_A3 | ?wxPAPER_A4SMALL | ?wxPAPER_A5 | ?wxPAPER_B4 | ?wxPAPER_B5 | ?wxPAPER_FOLIO | ?wxPAPER_QUARTO | ?wxPAPER_10X14 | ?wxPAPER_11X17 | ?wxPAPER_NOTE | ?wxPAPER_ENV_9 | ?wxPAPER_ENV_10 | ?wxPAPER_ENV_11 | ?wxPAPER_ENV_12 | ?wxPAPER_ENV_14 | ?wxPAPER_ENV_DL | ?wxPAPER_ENV_C5 | ?wxPAPER_ENV_C3 | ?wxPAPER_ENV_C4 | ?wxPAPER_ENV_C6 | ?wxPAPER_ENV_C65 | ?wxPAPER_ENV_B4 | ?wxPAPER_ENV_B5 | ?wxPAPER_ENV_B6 | ?wxPAPER_ENV_ITALY | ?wxPAPER_ENV_MONARCH | ?wxPAPER_ENV_PERSONAL | ?wxPAPER_FANFOLD_US | ?wxPAPER_FANFOLD_STD_GERMAN | ?wxPAPER_FANFOLD_LGL_GERMAN | ?wxPAPER_ISO_B4 | ?wxPAPER_JAPANESE_POSTCARD | ?wxPAPER_9X11 | ?wxPAPER_10X11 | ?wxPAPER_15X11 | ?wxPAPER_ENV_INVITE | ?wxPAPER_LETTER_EXTRA | ?wxPAPER_LEGAL_EXTRA | ?wxPAPER_TABLOID_EXTRA | ?wxPAPER_A4_EXTRA | ?wxPAPER_LETTER_TRANSVERSE | ?wxPAPER_A4_TRANSVERSE | ?wxPAPER_LETTER_EXTRA_TRANSVERSE | ?wxPAPER_A_PLUS | ?wxPAPER_B_PLUS | ?wxPAPER_LETTER_PLUS | ?wxPAPER_A4_PLUS | ?wxPAPER_A5_TRANSVERSE | ?wxPAPER_B5_TRANSVERSE | ?wxPAPER_A3_EXTRA | ?wxPAPER_A5_EXTRA | ?wxPAPER_B5_EXTRA | ?wxPAPER_A2 | ?wxPAPER_A3_TRANSVERSE | ?wxPAPER_A3_EXTRA_TRANSVERSE | ?wxPAPER_DBL_JAPANESE_POSTCARD | ?wxPAPER_A6 | ?wxPAPER_JENV_KAKU2 | ?wxPAPER_JENV_KAKU3 | ?wxPAPER_JENV_CHOU3 | ?wxPAPER_JENV_CHOU4 | ?wxPAPER_LETTER_ROTATED | ?wxPAPER_A3_ROTATED | ?wxPAPER_A4_ROTATED | ?wxPAPER_A5_ROTATED | ?wxPAPER_B4_JIS_ROTATED | ?wxPAPER_B5_JIS_ROTATED | ?wxPAPER_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_DBL_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_A6_ROTATED | ?wxPAPER_JENV_KAKU2_ROTATED | ?wxPAPER_JENV_KAKU3_ROTATED | ?wxPAPER_JENV_CHOU3_ROTATED | ?wxPAPER_JENV_CHOU4_ROTATED | ?wxPAPER_B6_JIS | ?wxPAPER_B6_JIS_ROTATED | ?wxPAPER_12X11 | ?wxPAPER_JENV_YOU4 | ?wxPAPER_JENV_YOU4_ROTATED | ?wxPAPER_P16K | ?wxPAPER_P32K | ?wxPAPER_P32KBIG | ?wxPAPER_PENV_1 | ?wxPAPER_PENV_2 | ?wxPAPER_PENV_3 | ?wxPAPER_PENV_4 | ?wxPAPER_PENV_5 | ?wxPAPER_PENV_6 | ?wxPAPER_PENV_7 | ?wxPAPER_PENV_8 | ?wxPAPER_PENV_9 | ?wxPAPER_PENV_10 | ?wxPAPER_P16K_ROTATED | ?wxPAPER_P32K_ROTATED | ?wxPAPER_P32KBIG_ROTATED | ?wxPAPER_PENV_1_ROTATED | ?wxPAPER_PENV_2_ROTATED | ?wxPAPER_PENV_3_ROTATED | ?wxPAPER_PENV_4_ROTATED | ?wxPAPER_PENV_5_ROTATED | ?wxPAPER_PENV_6_ROTATED | ?wxPAPER_PENV_7_ROTATED | ?wxPAPER_PENV_8_ROTATED | ?wxPAPER_PENV_9_ROTATED | ?wxPAPER_PENV_10_ROTATED
-spec setPaperSize(This, Id) -> ok when
- This::wxPageSetupDialogData(), Id::integer();
+ This::wxPageSetupDialogData(), Id::wx:wx_enum();
(This, Sz) -> ok when
This::wxPageSetupDialogData(), Sz::{W::integer(), H::integer()}.
setPaperSize(#wx_ref{type=ThisT,ref=ThisRef},Id)
diff --git a/lib/wx/src/gen/wxPaintDC.erl b/lib/wx/src/gen/wxPaintDC.erl
index 9e81bc31af..6648f278bb 100644
--- a/lib/wx/src/gen/wxPaintDC.erl
+++ b/lib/wx/src/gen/wxPaintDC.erl
@@ -54,6 +54,8 @@
startPage/1]).
-export_type([wxPaintDC/0]).
+-deprecated([new/0]).
+
%% @hidden
parent_class(wxWindowDC) -> true;
parent_class(wxDC) -> true;
diff --git a/lib/wx/src/gen/wxPaintEvent.erl b/lib/wx/src/gen/wxPaintEvent.erl
index a13db607a4..80ac7d78ce 100644
--- a/lib/wx/src/gen/wxPaintEvent.erl
+++ b/lib/wx/src/gen/wxPaintEvent.erl
@@ -19,7 +19,7 @@
%% @doc See external documentation: <a href="http://www.wxwidgets.org/manuals/stable/wx_wxpaintevent.html">wxPaintEvent</a>.
%% <dl><dt>Use {@link wxEvtHandler:connect/3.} with EventType:</dt>
-%% <dd><em>paint</em>, <em>paint_icon</em></dd></dl>
+%% <dd><em>paint</em></dd></dl>
%% See also the message variant {@link wxEvtHandler:wxPaint(). #wxPaint{}} event record type.
%%
%% <p>This class is derived (and can use functions) from:
diff --git a/lib/wx/src/gen/wxPen.erl b/lib/wx/src/gen/wxPen.erl
index 8b8aafddba..681a7edebc 100644
--- a/lib/wx/src/gen/wxPen.erl
+++ b/lib/wx/src/gen/wxPen.erl
@@ -113,8 +113,9 @@ isOk(#wx_ref{type=ThisT,ref=ThisRef}) ->
<<ThisRef:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxpen.html#wxpensetcap">external documentation</a>.
+%%<br /> CapStyle = integer
-spec setCap(This, CapStyle) -> ok when
- This::wxPen(), CapStyle::integer().
+ This::wxPen(), CapStyle::wx:wx_enum().
setCap(#wx_ref{type=ThisT,ref=ThisRef},CapStyle)
when is_integer(CapStyle) ->
?CLASS(ThisT,wxPen),
@@ -140,8 +141,9 @@ setColour(#wx_ref{type=ThisT,ref=ThisRef},Red,Green,Blue)
<<ThisRef:32/?UI,Red:32/?UI,Green:32/?UI,Blue:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxpen.html#wxpensetjoin">external documentation</a>.
+%%<br /> JoinStyle = integer
-spec setJoin(This, JoinStyle) -> ok when
- This::wxPen(), JoinStyle::integer().
+ This::wxPen(), JoinStyle::wx:wx_enum().
setJoin(#wx_ref{type=ThisT,ref=ThisRef},JoinStyle)
when is_integer(JoinStyle) ->
?CLASS(ThisT,wxPen),
diff --git a/lib/wx/src/gen/wxPostScriptDC.erl b/lib/wx/src/gen/wxPostScriptDC.erl
index 2eb25b6a8e..5329d4562e 100644
--- a/lib/wx/src/gen/wxPostScriptDC.erl
+++ b/lib/wx/src/gen/wxPostScriptDC.erl
@@ -53,6 +53,8 @@
startPage/1]).
-export_type([wxPostScriptDC/0]).
+-deprecated([getResolution/0,setResolution/1]).
+
%% @hidden
parent_class(wxDC) -> true;
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
diff --git a/lib/wx/src/gen/wxPrintData.erl b/lib/wx/src/gen/wxPrintData.erl
index 2cb8dd3c5f..79ba26afab 100644
--- a/lib/wx/src/gen/wxPrintData.erl
+++ b/lib/wx/src/gen/wxPrintData.erl
@@ -102,7 +102,8 @@ getOrientation(#wx_ref{type=ThisT,ref=ThisRef}) ->
<<ThisRef:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxprintdata.html#wxprintdatagetpaperid">external documentation</a>.
--spec getPaperId(This) -> integer() when
+%%<br /> Res = ?wxPAPER_NONE | ?wxPAPER_LETTER | ?wxPAPER_LEGAL | ?wxPAPER_A4 | ?wxPAPER_CSHEET | ?wxPAPER_DSHEET | ?wxPAPER_ESHEET | ?wxPAPER_LETTERSMALL | ?wxPAPER_TABLOID | ?wxPAPER_LEDGER | ?wxPAPER_STATEMENT | ?wxPAPER_EXECUTIVE | ?wxPAPER_A3 | ?wxPAPER_A4SMALL | ?wxPAPER_A5 | ?wxPAPER_B4 | ?wxPAPER_B5 | ?wxPAPER_FOLIO | ?wxPAPER_QUARTO | ?wxPAPER_10X14 | ?wxPAPER_11X17 | ?wxPAPER_NOTE | ?wxPAPER_ENV_9 | ?wxPAPER_ENV_10 | ?wxPAPER_ENV_11 | ?wxPAPER_ENV_12 | ?wxPAPER_ENV_14 | ?wxPAPER_ENV_DL | ?wxPAPER_ENV_C5 | ?wxPAPER_ENV_C3 | ?wxPAPER_ENV_C4 | ?wxPAPER_ENV_C6 | ?wxPAPER_ENV_C65 | ?wxPAPER_ENV_B4 | ?wxPAPER_ENV_B5 | ?wxPAPER_ENV_B6 | ?wxPAPER_ENV_ITALY | ?wxPAPER_ENV_MONARCH | ?wxPAPER_ENV_PERSONAL | ?wxPAPER_FANFOLD_US | ?wxPAPER_FANFOLD_STD_GERMAN | ?wxPAPER_FANFOLD_LGL_GERMAN | ?wxPAPER_ISO_B4 | ?wxPAPER_JAPANESE_POSTCARD | ?wxPAPER_9X11 | ?wxPAPER_10X11 | ?wxPAPER_15X11 | ?wxPAPER_ENV_INVITE | ?wxPAPER_LETTER_EXTRA | ?wxPAPER_LEGAL_EXTRA | ?wxPAPER_TABLOID_EXTRA | ?wxPAPER_A4_EXTRA | ?wxPAPER_LETTER_TRANSVERSE | ?wxPAPER_A4_TRANSVERSE | ?wxPAPER_LETTER_EXTRA_TRANSVERSE | ?wxPAPER_A_PLUS | ?wxPAPER_B_PLUS | ?wxPAPER_LETTER_PLUS | ?wxPAPER_A4_PLUS | ?wxPAPER_A5_TRANSVERSE | ?wxPAPER_B5_TRANSVERSE | ?wxPAPER_A3_EXTRA | ?wxPAPER_A5_EXTRA | ?wxPAPER_B5_EXTRA | ?wxPAPER_A2 | ?wxPAPER_A3_TRANSVERSE | ?wxPAPER_A3_EXTRA_TRANSVERSE | ?wxPAPER_DBL_JAPANESE_POSTCARD | ?wxPAPER_A6 | ?wxPAPER_JENV_KAKU2 | ?wxPAPER_JENV_KAKU3 | ?wxPAPER_JENV_CHOU3 | ?wxPAPER_JENV_CHOU4 | ?wxPAPER_LETTER_ROTATED | ?wxPAPER_A3_ROTATED | ?wxPAPER_A4_ROTATED | ?wxPAPER_A5_ROTATED | ?wxPAPER_B4_JIS_ROTATED | ?wxPAPER_B5_JIS_ROTATED | ?wxPAPER_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_DBL_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_A6_ROTATED | ?wxPAPER_JENV_KAKU2_ROTATED | ?wxPAPER_JENV_KAKU3_ROTATED | ?wxPAPER_JENV_CHOU3_ROTATED | ?wxPAPER_JENV_CHOU4_ROTATED | ?wxPAPER_B6_JIS | ?wxPAPER_B6_JIS_ROTATED | ?wxPAPER_12X11 | ?wxPAPER_JENV_YOU4 | ?wxPAPER_JENV_YOU4_ROTATED | ?wxPAPER_P16K | ?wxPAPER_P32K | ?wxPAPER_P32KBIG | ?wxPAPER_PENV_1 | ?wxPAPER_PENV_2 | ?wxPAPER_PENV_3 | ?wxPAPER_PENV_4 | ?wxPAPER_PENV_5 | ?wxPAPER_PENV_6 | ?wxPAPER_PENV_7 | ?wxPAPER_PENV_8 | ?wxPAPER_PENV_9 | ?wxPAPER_PENV_10 | ?wxPAPER_P16K_ROTATED | ?wxPAPER_P32K_ROTATED | ?wxPAPER_P32KBIG_ROTATED | ?wxPAPER_PENV_1_ROTATED | ?wxPAPER_PENV_2_ROTATED | ?wxPAPER_PENV_3_ROTATED | ?wxPAPER_PENV_4_ROTATED | ?wxPAPER_PENV_5_ROTATED | ?wxPAPER_PENV_6_ROTATED | ?wxPAPER_PENV_7_ROTATED | ?wxPAPER_PENV_8_ROTATED | ?wxPAPER_PENV_9_ROTATED | ?wxPAPER_PENV_10_ROTATED
+-spec getPaperId(This) -> wx:wx_enum() when
This::wxPrintData().
getPaperId(#wx_ref{type=ThisT,ref=ThisRef}) ->
?CLASS(ThisT,wxPrintData),
@@ -190,8 +191,9 @@ setOrientation(#wx_ref{type=ThisT,ref=ThisRef},Orient)
<<ThisRef:32/?UI,Orient:32/?UI>>).
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxprintdata.html#wxprintdatasetpaperid">external documentation</a>.
+%%<br /> SizeId = ?wxPAPER_NONE | ?wxPAPER_LETTER | ?wxPAPER_LEGAL | ?wxPAPER_A4 | ?wxPAPER_CSHEET | ?wxPAPER_DSHEET | ?wxPAPER_ESHEET | ?wxPAPER_LETTERSMALL | ?wxPAPER_TABLOID | ?wxPAPER_LEDGER | ?wxPAPER_STATEMENT | ?wxPAPER_EXECUTIVE | ?wxPAPER_A3 | ?wxPAPER_A4SMALL | ?wxPAPER_A5 | ?wxPAPER_B4 | ?wxPAPER_B5 | ?wxPAPER_FOLIO | ?wxPAPER_QUARTO | ?wxPAPER_10X14 | ?wxPAPER_11X17 | ?wxPAPER_NOTE | ?wxPAPER_ENV_9 | ?wxPAPER_ENV_10 | ?wxPAPER_ENV_11 | ?wxPAPER_ENV_12 | ?wxPAPER_ENV_14 | ?wxPAPER_ENV_DL | ?wxPAPER_ENV_C5 | ?wxPAPER_ENV_C3 | ?wxPAPER_ENV_C4 | ?wxPAPER_ENV_C6 | ?wxPAPER_ENV_C65 | ?wxPAPER_ENV_B4 | ?wxPAPER_ENV_B5 | ?wxPAPER_ENV_B6 | ?wxPAPER_ENV_ITALY | ?wxPAPER_ENV_MONARCH | ?wxPAPER_ENV_PERSONAL | ?wxPAPER_FANFOLD_US | ?wxPAPER_FANFOLD_STD_GERMAN | ?wxPAPER_FANFOLD_LGL_GERMAN | ?wxPAPER_ISO_B4 | ?wxPAPER_JAPANESE_POSTCARD | ?wxPAPER_9X11 | ?wxPAPER_10X11 | ?wxPAPER_15X11 | ?wxPAPER_ENV_INVITE | ?wxPAPER_LETTER_EXTRA | ?wxPAPER_LEGAL_EXTRA | ?wxPAPER_TABLOID_EXTRA | ?wxPAPER_A4_EXTRA | ?wxPAPER_LETTER_TRANSVERSE | ?wxPAPER_A4_TRANSVERSE | ?wxPAPER_LETTER_EXTRA_TRANSVERSE | ?wxPAPER_A_PLUS | ?wxPAPER_B_PLUS | ?wxPAPER_LETTER_PLUS | ?wxPAPER_A4_PLUS | ?wxPAPER_A5_TRANSVERSE | ?wxPAPER_B5_TRANSVERSE | ?wxPAPER_A3_EXTRA | ?wxPAPER_A5_EXTRA | ?wxPAPER_B5_EXTRA | ?wxPAPER_A2 | ?wxPAPER_A3_TRANSVERSE | ?wxPAPER_A3_EXTRA_TRANSVERSE | ?wxPAPER_DBL_JAPANESE_POSTCARD | ?wxPAPER_A6 | ?wxPAPER_JENV_KAKU2 | ?wxPAPER_JENV_KAKU3 | ?wxPAPER_JENV_CHOU3 | ?wxPAPER_JENV_CHOU4 | ?wxPAPER_LETTER_ROTATED | ?wxPAPER_A3_ROTATED | ?wxPAPER_A4_ROTATED | ?wxPAPER_A5_ROTATED | ?wxPAPER_B4_JIS_ROTATED | ?wxPAPER_B5_JIS_ROTATED | ?wxPAPER_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_DBL_JAPANESE_POSTCARD_ROTATED | ?wxPAPER_A6_ROTATED | ?wxPAPER_JENV_KAKU2_ROTATED | ?wxPAPER_JENV_KAKU3_ROTATED | ?wxPAPER_JENV_CHOU3_ROTATED | ?wxPAPER_JENV_CHOU4_ROTATED | ?wxPAPER_B6_JIS | ?wxPAPER_B6_JIS_ROTATED | ?wxPAPER_12X11 | ?wxPAPER_JENV_YOU4 | ?wxPAPER_JENV_YOU4_ROTATED | ?wxPAPER_P16K | ?wxPAPER_P32K | ?wxPAPER_P32KBIG | ?wxPAPER_PENV_1 | ?wxPAPER_PENV_2 | ?wxPAPER_PENV_3 | ?wxPAPER_PENV_4 | ?wxPAPER_PENV_5 | ?wxPAPER_PENV_6 | ?wxPAPER_PENV_7 | ?wxPAPER_PENV_8 | ?wxPAPER_PENV_9 | ?wxPAPER_PENV_10 | ?wxPAPER_P16K_ROTATED | ?wxPAPER_P32K_ROTATED | ?wxPAPER_P32KBIG_ROTATED | ?wxPAPER_PENV_1_ROTATED | ?wxPAPER_PENV_2_ROTATED | ?wxPAPER_PENV_3_ROTATED | ?wxPAPER_PENV_4_ROTATED | ?wxPAPER_PENV_5_ROTATED | ?wxPAPER_PENV_6_ROTATED | ?wxPAPER_PENV_7_ROTATED | ?wxPAPER_PENV_8_ROTATED | ?wxPAPER_PENV_9_ROTATED | ?wxPAPER_PENV_10_ROTATED
-spec setPaperId(This, SizeId) -> ok when
- This::wxPrintData(), SizeId::integer().
+ This::wxPrintData(), SizeId::wx:wx_enum().
setPaperId(#wx_ref{type=ThisT,ref=ThisRef},SizeId)
when is_integer(SizeId) ->
?CLASS(ThisT,wxPrintData),
diff --git a/lib/wx/src/gen/wxPrintout.erl b/lib/wx/src/gen/wxPrintout.erl
index ab96a09c09..c75edd2b5a 100644
--- a/lib/wx/src/gen/wxPrintout.erl
+++ b/lib/wx/src/gen/wxPrintout.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2013. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -61,7 +61,8 @@ new(Title, OnPrintPage) ->
%% <pre>OnBeginDocument(This,StartPage,EndPage) -> boolean() </pre>
%% <pre>OnEndDocument(This) -> term() </pre>
%% <pre>HasPage(This,Page)} -> boolean() </pre>
-%% <pre>GetPageInfo(This) -> {MinPage:.integer(), MaxPage::integer(), PageFrom::integer(), PageTo::integer()} </pre>
+%% <pre>GetPageInfo(This) -> {MinPage::integer(), MaxPage::integer(),
+%% PageFrom::integer(), PageTo::integer()} </pre>
%% The <b>This</b> argument is the wxPrintout object reference to this object
%% <br /> NOTE: The callbacks may not call other processes.
new(Title, OnPrintPage, Opts) when is_list(Title), is_function(OnPrintPage), is_list(Opts) ->
diff --git a/lib/wx/src/gen/wxStyledTextCtrl.erl b/lib/wx/src/gen/wxStyledTextCtrl.erl
index f6dc2176b7..55ac410407 100644
--- a/lib/wx/src/gen/wxStyledTextCtrl.erl
+++ b/lib/wx/src/gen/wxStyledTextCtrl.erl
@@ -95,18 +95,18 @@
redo/1,registerImage/3,replaceSelection/2,replaceTarget/2,saveFile/2,
scrollToColumn/2,scrollToLine/2,searchAnchor/1,searchInTarget/2,searchNext/3,
searchPrev/3,selectAll/1,selectionDuplicate/1,selectionIsRectangle/1,
- sendMsg/2,sendMsg/3,setAnchor/2,setBackSpaceUnIndents/2,setBufferedDraw/2,
- setCaretForeground/2,setCaretLineBackAlpha/2,setCaretLineBackground/2,
- setCaretLineVisible/2,setCaretPeriod/2,setCaretSticky/2,setCaretWidth/2,
- setCharsDefault/1,setCodePage/2,setControlCharSymbol/2,setCurrentPos/2,
- setEOLMode/2,setEdgeColour/2,setEdgeColumn/2,setEdgeMode/2,setFoldExpanded/3,
- setFoldFlags/2,setFoldLevel/3,setFoldMarginColour/3,setFoldMarginHiColour/3,
- setHScrollBar/2,setHighlightGuide/2,setHotspotActiveBackground/3,
- setHotspotActiveForeground/3,setHotspotActiveUnderline/2,setHotspotSingleLine/2,
- setIndent/2,setIndentationGuides/2,setKeyWords/3,setLastKeydownProcessed/2,
- setLayoutCache/2,setLexer/2,setLexerLanguage/2,setLineIndentation/3,
- setLineState/3,setMarginLeft/2,setMarginMask/3,setMarginRight/2,setMarginSensitive/3,
- setMarginType/3,setMarginWidth/3,setMargins/3,setModEventMask/2,setMouseDownCaptures/2,
+ setAnchor/2,setBackSpaceUnIndents/2,setBufferedDraw/2,setCaretForeground/2,
+ setCaretLineBackAlpha/2,setCaretLineBackground/2,setCaretLineVisible/2,
+ setCaretPeriod/2,setCaretSticky/2,setCaretWidth/2,setCharsDefault/1,
+ setCodePage/2,setControlCharSymbol/2,setCurrentPos/2,setEOLMode/2,
+ setEdgeColour/2,setEdgeColumn/2,setEdgeMode/2,setFoldExpanded/3,setFoldFlags/2,
+ setFoldLevel/3,setFoldMarginColour/3,setFoldMarginHiColour/3,setHScrollBar/2,
+ setHighlightGuide/2,setHotspotActiveBackground/3,setHotspotActiveForeground/3,
+ setHotspotActiveUnderline/2,setHotspotSingleLine/2,setIndent/2,setIndentationGuides/2,
+ setKeyWords/3,setLastKeydownProcessed/2,setLayoutCache/2,setLexer/2,
+ setLexerLanguage/2,setLineIndentation/3,setLineState/3,setMarginLeft/2,
+ setMarginMask/3,setMarginRight/2,setMarginSensitive/3,setMarginType/3,
+ setMarginWidth/3,setMargins/3,setModEventMask/2,setMouseDownCaptures/2,
setMouseDwellTime/2,setPasteConvertEndings/2,setPrintColourMode/2,
setPrintMagnification/2,setProperty/3,setReadOnly/2,setSTCCursor/2,
setSTCFocus/2,setSavePoint/1,setScrollWidth/2,setSearchFlags/2,setSelAlpha/2,
@@ -3897,29 +3897,6 @@ scrollToColumn(#wx_ref{type=ThisT,ref=ThisRef},Column)
wxe_util:cast(?wxStyledTextCtrl_ScrollToColumn,
<<ThisRef:32/?UI,Column:32/?UI>>).
-%% @equiv sendMsg(This,Msg, [])
--spec sendMsg(This, Msg) -> integer() when
- This::wxStyledTextCtrl(), Msg::integer().
-
-sendMsg(This,Msg)
- when is_record(This, wx_ref),is_integer(Msg) ->
- sendMsg(This,Msg, []).
-
-%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxstyledtextctrl.html#wxstyledtextctrlsendmsg">external documentation</a>.
--spec sendMsg(This, Msg, [Option]) -> integer() when
- This::wxStyledTextCtrl(), Msg::integer(),
- Option :: {wp, integer()}
- | {lp, integer()}.
-sendMsg(#wx_ref{type=ThisT,ref=ThisRef},Msg, Options)
- when is_integer(Msg),is_list(Options) ->
- ?CLASS(ThisT,wxStyledTextCtrl),
- MOpts = fun({wp, Wp}, Acc) -> [<<1:32/?UI,Wp:32/?UI>>|Acc];
- ({lp, Lp}, Acc) -> [<<2:32/?UI,Lp:32/?UI>>|Acc];
- (BadOpt, _) -> erlang:error({badoption, BadOpt}) end,
- BinOpt = list_to_binary(lists:foldl(MOpts, [<<0:32>>], Options)),
- wxe_util:call(?wxStyledTextCtrl_SendMsg,
- <<ThisRef:32/?UI,Msg:32/?UI, BinOpt/binary>>).
-
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxstyledtextctrl.html#wxstyledtextctrlsetvscrollbar">external documentation</a>.
-spec setVScrollBar(This, Bar) -> ok when
This::wxStyledTextCtrl(), Bar::wxScrollBar:wxScrollBar().
diff --git a/lib/wx/src/gen/wxSystemSettings.erl b/lib/wx/src/gen/wxSystemSettings.erl
index a3bae5c85f..630162afd2 100644
--- a/lib/wx/src/gen/wxSystemSettings.erl
+++ b/lib/wx/src/gen/wxSystemSettings.erl
@@ -35,7 +35,7 @@ parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
-type wxSystemSettings() :: wx:wx_object().
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxsystemsettings.html#wxsystemsettingsgetcolour">external documentation</a>.
-%%<br /> Index = ?wxSYS_COLOUR_SCROLLBAR | ?wxSYS_COLOUR_BACKGROUND | ?wxSYS_COLOUR_DESKTOP | ?wxSYS_COLOUR_ACTIVECAPTION | ?wxSYS_COLOUR_INACTIVECAPTION | ?wxSYS_COLOUR_MENU | ?wxSYS_COLOUR_WINDOW | ?wxSYS_COLOUR_WINDOWFRAME | ?wxSYS_COLOUR_MENUTEXT | ?wxSYS_COLOUR_WINDOWTEXT | ?wxSYS_COLOUR_CAPTIONTEXT | ?wxSYS_COLOUR_ACTIVEBORDER | ?wxSYS_COLOUR_INACTIVEBORDER | ?wxSYS_COLOUR_APPWORKSPACE | ?wxSYS_COLOUR_HIGHLIGHT | ?wxSYS_COLOUR_HIGHLIGHTTEXT | ?wxSYS_COLOUR_BTNFACE | ?wxSYS_COLOUR_3DFACE | ?wxSYS_COLOUR_BTNSHADOW | ?wxSYS_COLOUR_3DSHADOW | ?wxSYS_COLOUR_GRAYTEXT | ?wxSYS_COLOUR_BTNTEXT | ?wxSYS_COLOUR_INACTIVECAPTIONTEXT | ?wxSYS_COLOUR_BTNHIGHLIGHT | ?wxSYS_COLOUR_BTNHILIGHT | ?wxSYS_COLOUR_3DHIGHLIGHT | ?wxSYS_COLOUR_3DHILIGHT | ?wxSYS_COLOUR_3DDKSHADOW | ?wxSYS_COLOUR_3DLIGHT | ?wxSYS_COLOUR_INFOTEXT | ?wxSYS_COLOUR_INFOBK | ?wxSYS_COLOUR_LISTBOX | ?wxSYS_COLOUR_HOTLIGHT | ?wxSYS_COLOUR_GRADIENTACTIVECAPTION | ?wxSYS_COLOUR_GRADIENTINACTIVECAPTION | ?wxSYS_COLOUR_MENUHILIGHT | ?wxSYS_COLOUR_MENUBAR | ?wxSYS_COLOUR_LISTBOXTEXT | ?wxSYS_COLOUR_MAX
+%%<br /> Index = ?wxSYS_COLOUR_SCROLLBAR | ?wxSYS_COLOUR_BACKGROUND | ?wxSYS_COLOUR_DESKTOP | ?wxSYS_COLOUR_ACTIVECAPTION | ?wxSYS_COLOUR_INACTIVECAPTION | ?wxSYS_COLOUR_MENU | ?wxSYS_COLOUR_WINDOW | ?wxSYS_COLOUR_WINDOWFRAME | ?wxSYS_COLOUR_MENUTEXT | ?wxSYS_COLOUR_WINDOWTEXT | ?wxSYS_COLOUR_CAPTIONTEXT | ?wxSYS_COLOUR_ACTIVEBORDER | ?wxSYS_COLOUR_INACTIVEBORDER | ?wxSYS_COLOUR_APPWORKSPACE | ?wxSYS_COLOUR_HIGHLIGHT | ?wxSYS_COLOUR_HIGHLIGHTTEXT | ?wxSYS_COLOUR_BTNFACE | ?wxSYS_COLOUR_3DFACE | ?wxSYS_COLOUR_BTNSHADOW | ?wxSYS_COLOUR_3DSHADOW | ?wxSYS_COLOUR_GRAYTEXT | ?wxSYS_COLOUR_BTNTEXT | ?wxSYS_COLOUR_INACTIVECAPTIONTEXT | ?wxSYS_COLOUR_BTNHIGHLIGHT | ?wxSYS_COLOUR_BTNHILIGHT | ?wxSYS_COLOUR_3DHIGHLIGHT | ?wxSYS_COLOUR_3DHILIGHT | ?wxSYS_COLOUR_3DDKSHADOW | ?wxSYS_COLOUR_3DLIGHT | ?wxSYS_COLOUR_INFOTEXT | ?wxSYS_COLOUR_INFOBK | ?wxSYS_COLOUR_LISTBOX | ?wxSYS_COLOUR_HOTLIGHT | ?wxSYS_COLOUR_GRADIENTACTIVECAPTION | ?wxSYS_COLOUR_GRADIENTINACTIVECAPTION | ?wxSYS_COLOUR_MENUHILIGHT | ?wxSYS_COLOUR_MENUBAR | ?wxSYS_COLOUR_LISTBOXTEXT | ?wxSYS_COLOUR_LISTBOXHIGHLIGHTTEXT | ?wxSYS_COLOUR_MAX
-spec getColour(Index) -> wx:wx_colour4() when
Index::wx:wx_enum().
getColour(Index)
diff --git a/lib/wx/src/gen/wxWindowDC.erl b/lib/wx/src/gen/wxWindowDC.erl
index babb3c0e90..4515f0e6b9 100644
--- a/lib/wx/src/gen/wxWindowDC.erl
+++ b/lib/wx/src/gen/wxWindowDC.erl
@@ -53,6 +53,8 @@
startPage/1]).
-export_type([wxWindowDC/0]).
+-deprecated([new/0]).
+
%% @hidden
parent_class(wxDC) -> true;
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
diff --git a/lib/wx/src/gen/wxe_debug.hrl b/lib/wx/src/gen/wxe_debug.hrl
index 297d99324a..6f4fa3fe34 100644
--- a/lib/wx/src/gen/wxe_debug.hrl
+++ b/lib/wx/src/gen/wxe_debug.hrl
@@ -3154,156 +3154,155 @@ wxdebug_table() ->
{3370, {wxStyledTextCtrl, pointFromPosition, 1}},
{3371, {wxStyledTextCtrl, scrollToLine, 1}},
{3372, {wxStyledTextCtrl, scrollToColumn, 1}},
- {3373, {wxStyledTextCtrl, sendMsg, 2}},
- {3374, {wxStyledTextCtrl, setVScrollBar, 1}},
- {3375, {wxStyledTextCtrl, setHScrollBar, 1}},
- {3376, {wxStyledTextCtrl, getLastKeydownProcessed, 0}},
- {3377, {wxStyledTextCtrl, setLastKeydownProcessed, 1}},
- {3378, {wxStyledTextCtrl, saveFile, 1}},
- {3379, {wxStyledTextCtrl, loadFile, 1}},
- {3380, {wxStyledTextCtrl, doDragOver, 3}},
- {3381, {wxStyledTextCtrl, doDropText, 3}},
- {3382, {wxStyledTextCtrl, getUseAntiAliasing, 0}},
- {3383, {wxStyledTextCtrl, addTextRaw, 1}},
- {3384, {wxStyledTextCtrl, insertTextRaw, 2}},
- {3385, {wxStyledTextCtrl, getCurLineRaw, 1}},
- {3386, {wxStyledTextCtrl, getLineRaw, 1}},
- {3387, {wxStyledTextCtrl, getSelectedTextRaw, 0}},
- {3388, {wxStyledTextCtrl, getTextRangeRaw, 2}},
- {3389, {wxStyledTextCtrl, setTextRaw, 1}},
- {3390, {wxStyledTextCtrl, getTextRaw, 0}},
- {3391, {wxStyledTextCtrl, appendTextRaw, 1}},
- {3392, {wxArtProvider, getBitmap, 2}},
- {3393, {wxArtProvider, getIcon, 2}},
- {3394, {wxTreeEvent, getKeyCode, 0}},
- {3395, {wxTreeEvent, getItem, 0}},
- {3396, {wxTreeEvent, getKeyEvent, 0}},
- {3397, {wxTreeEvent, getLabel, 0}},
- {3398, {wxTreeEvent, getOldItem, 0}},
- {3399, {wxTreeEvent, getPoint, 0}},
- {3400, {wxTreeEvent, isEditCancelled, 0}},
- {3401, {wxTreeEvent, setToolTip, 1}},
- {3402, {wxNotebookEvent, getOldSelection, 0}},
- {3403, {wxNotebookEvent, getSelection, 0}},
- {3404, {wxNotebookEvent, setOldSelection, 1}},
- {3405, {wxNotebookEvent, setSelection, 1}},
- {3406, {wxFileDataObject, new, 0}},
- {3407, {wxFileDataObject, addFile, 1}},
- {3408, {wxFileDataObject, getFilenames, 0}},
- {3409, {wxFileDataObject, 'Destroy', undefined}},
- {3410, {wxTextDataObject, new, 1}},
- {3411, {wxTextDataObject, getTextLength, 0}},
- {3412, {wxTextDataObject, getText, 0}},
- {3413, {wxTextDataObject, setText, 1}},
- {3414, {wxTextDataObject, 'Destroy', undefined}},
- {3415, {wxBitmapDataObject, new_1_1, 1}},
- {3416, {wxBitmapDataObject, new_1_0, 1}},
- {3417, {wxBitmapDataObject, getBitmap, 0}},
- {3418, {wxBitmapDataObject, setBitmap, 1}},
- {3419, {wxBitmapDataObject, 'Destroy', undefined}},
- {3421, {wxClipboard, new, 0}},
- {3422, {wxClipboard, destruct, 0}},
- {3423, {wxClipboard, addData, 1}},
- {3424, {wxClipboard, clear, 0}},
- {3425, {wxClipboard, close, 0}},
- {3426, {wxClipboard, flush, 0}},
- {3427, {wxClipboard, getData, 1}},
- {3428, {wxClipboard, isOpened, 0}},
- {3429, {wxClipboard, open, 0}},
- {3430, {wxClipboard, setData, 1}},
- {3432, {wxClipboard, usePrimarySelection, 1}},
- {3433, {wxClipboard, isSupported, 1}},
- {3434, {wxClipboard, get, 0}},
- {3435, {wxSpinEvent, getPosition, 0}},
- {3436, {wxSpinEvent, setPosition, 1}},
- {3437, {wxSplitterWindow, new_0, 0}},
- {3438, {wxSplitterWindow, new_2, 2}},
- {3439, {wxSplitterWindow, destruct, 0}},
- {3440, {wxSplitterWindow, create, 2}},
- {3441, {wxSplitterWindow, getMinimumPaneSize, 0}},
- {3442, {wxSplitterWindow, getSashGravity, 0}},
- {3443, {wxSplitterWindow, getSashPosition, 0}},
- {3444, {wxSplitterWindow, getSplitMode, 0}},
- {3445, {wxSplitterWindow, getWindow1, 0}},
- {3446, {wxSplitterWindow, getWindow2, 0}},
- {3447, {wxSplitterWindow, initialize, 1}},
- {3448, {wxSplitterWindow, isSplit, 0}},
- {3449, {wxSplitterWindow, replaceWindow, 2}},
- {3450, {wxSplitterWindow, setSashGravity, 1}},
- {3451, {wxSplitterWindow, setSashPosition, 2}},
- {3452, {wxSplitterWindow, setSashSize, 1}},
- {3453, {wxSplitterWindow, setMinimumPaneSize, 1}},
- {3454, {wxSplitterWindow, setSplitMode, 1}},
- {3455, {wxSplitterWindow, splitHorizontally, 3}},
- {3456, {wxSplitterWindow, splitVertically, 3}},
- {3457, {wxSplitterWindow, unsplit, 1}},
- {3458, {wxSplitterWindow, updateSize, 0}},
- {3459, {wxSplitterEvent, getSashPosition, 0}},
- {3460, {wxSplitterEvent, getX, 0}},
- {3461, {wxSplitterEvent, getY, 0}},
- {3462, {wxSplitterEvent, getWindowBeingRemoved, 0}},
- {3463, {wxSplitterEvent, setSashPosition, 1}},
- {3464, {wxHtmlWindow, new_0, 0}},
- {3465, {wxHtmlWindow, new_2, 2}},
- {3466, {wxHtmlWindow, appendToPage, 1}},
- {3467, {wxHtmlWindow, getOpenedAnchor, 0}},
- {3468, {wxHtmlWindow, getOpenedPage, 0}},
- {3469, {wxHtmlWindow, getOpenedPageTitle, 0}},
- {3470, {wxHtmlWindow, getRelatedFrame, 0}},
- {3471, {wxHtmlWindow, historyBack, 0}},
- {3472, {wxHtmlWindow, historyCanBack, 0}},
- {3473, {wxHtmlWindow, historyCanForward, 0}},
- {3474, {wxHtmlWindow, historyClear, 0}},
- {3475, {wxHtmlWindow, historyForward, 0}},
- {3476, {wxHtmlWindow, loadFile, 1}},
- {3477, {wxHtmlWindow, loadPage, 1}},
- {3478, {wxHtmlWindow, selectAll, 0}},
- {3479, {wxHtmlWindow, selectionToText, 0}},
- {3480, {wxHtmlWindow, selectLine, 1}},
- {3481, {wxHtmlWindow, selectWord, 1}},
- {3482, {wxHtmlWindow, setBorders, 1}},
- {3483, {wxHtmlWindow, setFonts, 3}},
- {3484, {wxHtmlWindow, setPage, 1}},
- {3485, {wxHtmlWindow, setRelatedFrame, 2}},
- {3486, {wxHtmlWindow, setRelatedStatusBar, 1}},
- {3487, {wxHtmlWindow, toText, 0}},
- {3488, {wxHtmlWindow, 'Destroy', undefined}},
- {3489, {wxHtmlLinkEvent, getLinkInfo, 0}},
- {3490, {wxSystemSettings, getColour, 1}},
- {3491, {wxSystemSettings, getFont, 1}},
- {3492, {wxSystemSettings, getMetric, 2}},
- {3493, {wxSystemSettings, getScreenType, 0}},
- {3494, {wxSystemOptions, getOption, 1}},
- {3495, {wxSystemOptions, getOptionInt, 1}},
- {3496, {wxSystemOptions, hasOption, 1}},
- {3497, {wxSystemOptions, isFalse, 1}},
- {3498, {wxSystemOptions, setOption_2_1, 2}},
- {3499, {wxSystemOptions, setOption_2_0, 2}},
- {3500, {wxAuiNotebookEvent, setSelection, 1}},
- {3501, {wxAuiNotebookEvent, getSelection, 0}},
- {3502, {wxAuiNotebookEvent, setOldSelection, 1}},
- {3503, {wxAuiNotebookEvent, getOldSelection, 0}},
- {3504, {wxAuiNotebookEvent, setDragSource, 1}},
- {3505, {wxAuiNotebookEvent, getDragSource, 0}},
- {3506, {wxAuiManagerEvent, setManager, 1}},
- {3507, {wxAuiManagerEvent, getManager, 0}},
- {3508, {wxAuiManagerEvent, setPane, 1}},
- {3509, {wxAuiManagerEvent, getPane, 0}},
- {3510, {wxAuiManagerEvent, setButton, 1}},
- {3511, {wxAuiManagerEvent, getButton, 0}},
- {3512, {wxAuiManagerEvent, setDC, 1}},
- {3513, {wxAuiManagerEvent, getDC, 0}},
- {3514, {wxAuiManagerEvent, veto, 1}},
- {3515, {wxAuiManagerEvent, getVeto, 0}},
- {3516, {wxAuiManagerEvent, setCanVeto, 1}},
- {3517, {wxAuiManagerEvent, canVeto, 0}},
- {3518, {wxLogNull, new, 0}},
- {3519, {wxLogNull, 'Destroy', undefined}},
- {3520, {wxTaskBarIcon, new, 0}},
- {3521, {wxTaskBarIcon, destruct, 0}},
- {3522, {wxTaskBarIcon, popupMenu, 1}},
- {3523, {wxTaskBarIcon, removeIcon, 0}},
- {3524, {wxTaskBarIcon, setIcon, 2}},
+ {3373, {wxStyledTextCtrl, setVScrollBar, 1}},
+ {3374, {wxStyledTextCtrl, setHScrollBar, 1}},
+ {3375, {wxStyledTextCtrl, getLastKeydownProcessed, 0}},
+ {3376, {wxStyledTextCtrl, setLastKeydownProcessed, 1}},
+ {3377, {wxStyledTextCtrl, saveFile, 1}},
+ {3378, {wxStyledTextCtrl, loadFile, 1}},
+ {3379, {wxStyledTextCtrl, doDragOver, 3}},
+ {3380, {wxStyledTextCtrl, doDropText, 3}},
+ {3381, {wxStyledTextCtrl, getUseAntiAliasing, 0}},
+ {3382, {wxStyledTextCtrl, addTextRaw, 1}},
+ {3383, {wxStyledTextCtrl, insertTextRaw, 2}},
+ {3384, {wxStyledTextCtrl, getCurLineRaw, 1}},
+ {3385, {wxStyledTextCtrl, getLineRaw, 1}},
+ {3386, {wxStyledTextCtrl, getSelectedTextRaw, 0}},
+ {3387, {wxStyledTextCtrl, getTextRangeRaw, 2}},
+ {3388, {wxStyledTextCtrl, setTextRaw, 1}},
+ {3389, {wxStyledTextCtrl, getTextRaw, 0}},
+ {3390, {wxStyledTextCtrl, appendTextRaw, 1}},
+ {3391, {wxArtProvider, getBitmap, 2}},
+ {3392, {wxArtProvider, getIcon, 2}},
+ {3393, {wxTreeEvent, getKeyCode, 0}},
+ {3394, {wxTreeEvent, getItem, 0}},
+ {3395, {wxTreeEvent, getKeyEvent, 0}},
+ {3396, {wxTreeEvent, getLabel, 0}},
+ {3397, {wxTreeEvent, getOldItem, 0}},
+ {3398, {wxTreeEvent, getPoint, 0}},
+ {3399, {wxTreeEvent, isEditCancelled, 0}},
+ {3400, {wxTreeEvent, setToolTip, 1}},
+ {3401, {wxNotebookEvent, getOldSelection, 0}},
+ {3402, {wxNotebookEvent, getSelection, 0}},
+ {3403, {wxNotebookEvent, setOldSelection, 1}},
+ {3404, {wxNotebookEvent, setSelection, 1}},
+ {3405, {wxFileDataObject, new, 0}},
+ {3406, {wxFileDataObject, addFile, 1}},
+ {3407, {wxFileDataObject, getFilenames, 0}},
+ {3408, {wxFileDataObject, 'Destroy', undefined}},
+ {3409, {wxTextDataObject, new, 1}},
+ {3410, {wxTextDataObject, getTextLength, 0}},
+ {3411, {wxTextDataObject, getText, 0}},
+ {3412, {wxTextDataObject, setText, 1}},
+ {3413, {wxTextDataObject, 'Destroy', undefined}},
+ {3414, {wxBitmapDataObject, new_1_1, 1}},
+ {3415, {wxBitmapDataObject, new_1_0, 1}},
+ {3416, {wxBitmapDataObject, getBitmap, 0}},
+ {3417, {wxBitmapDataObject, setBitmap, 1}},
+ {3418, {wxBitmapDataObject, 'Destroy', undefined}},
+ {3420, {wxClipboard, new, 0}},
+ {3421, {wxClipboard, destruct, 0}},
+ {3422, {wxClipboard, addData, 1}},
+ {3423, {wxClipboard, clear, 0}},
+ {3424, {wxClipboard, close, 0}},
+ {3425, {wxClipboard, flush, 0}},
+ {3426, {wxClipboard, getData, 1}},
+ {3427, {wxClipboard, isOpened, 0}},
+ {3428, {wxClipboard, open, 0}},
+ {3429, {wxClipboard, setData, 1}},
+ {3431, {wxClipboard, usePrimarySelection, 1}},
+ {3432, {wxClipboard, isSupported, 1}},
+ {3433, {wxClipboard, get, 0}},
+ {3434, {wxSpinEvent, getPosition, 0}},
+ {3435, {wxSpinEvent, setPosition, 1}},
+ {3436, {wxSplitterWindow, new_0, 0}},
+ {3437, {wxSplitterWindow, new_2, 2}},
+ {3438, {wxSplitterWindow, destruct, 0}},
+ {3439, {wxSplitterWindow, create, 2}},
+ {3440, {wxSplitterWindow, getMinimumPaneSize, 0}},
+ {3441, {wxSplitterWindow, getSashGravity, 0}},
+ {3442, {wxSplitterWindow, getSashPosition, 0}},
+ {3443, {wxSplitterWindow, getSplitMode, 0}},
+ {3444, {wxSplitterWindow, getWindow1, 0}},
+ {3445, {wxSplitterWindow, getWindow2, 0}},
+ {3446, {wxSplitterWindow, initialize, 1}},
+ {3447, {wxSplitterWindow, isSplit, 0}},
+ {3448, {wxSplitterWindow, replaceWindow, 2}},
+ {3449, {wxSplitterWindow, setSashGravity, 1}},
+ {3450, {wxSplitterWindow, setSashPosition, 2}},
+ {3451, {wxSplitterWindow, setSashSize, 1}},
+ {3452, {wxSplitterWindow, setMinimumPaneSize, 1}},
+ {3453, {wxSplitterWindow, setSplitMode, 1}},
+ {3454, {wxSplitterWindow, splitHorizontally, 3}},
+ {3455, {wxSplitterWindow, splitVertically, 3}},
+ {3456, {wxSplitterWindow, unsplit, 1}},
+ {3457, {wxSplitterWindow, updateSize, 0}},
+ {3458, {wxSplitterEvent, getSashPosition, 0}},
+ {3459, {wxSplitterEvent, getX, 0}},
+ {3460, {wxSplitterEvent, getY, 0}},
+ {3461, {wxSplitterEvent, getWindowBeingRemoved, 0}},
+ {3462, {wxSplitterEvent, setSashPosition, 1}},
+ {3463, {wxHtmlWindow, new_0, 0}},
+ {3464, {wxHtmlWindow, new_2, 2}},
+ {3465, {wxHtmlWindow, appendToPage, 1}},
+ {3466, {wxHtmlWindow, getOpenedAnchor, 0}},
+ {3467, {wxHtmlWindow, getOpenedPage, 0}},
+ {3468, {wxHtmlWindow, getOpenedPageTitle, 0}},
+ {3469, {wxHtmlWindow, getRelatedFrame, 0}},
+ {3470, {wxHtmlWindow, historyBack, 0}},
+ {3471, {wxHtmlWindow, historyCanBack, 0}},
+ {3472, {wxHtmlWindow, historyCanForward, 0}},
+ {3473, {wxHtmlWindow, historyClear, 0}},
+ {3474, {wxHtmlWindow, historyForward, 0}},
+ {3475, {wxHtmlWindow, loadFile, 1}},
+ {3476, {wxHtmlWindow, loadPage, 1}},
+ {3477, {wxHtmlWindow, selectAll, 0}},
+ {3478, {wxHtmlWindow, selectionToText, 0}},
+ {3479, {wxHtmlWindow, selectLine, 1}},
+ {3480, {wxHtmlWindow, selectWord, 1}},
+ {3481, {wxHtmlWindow, setBorders, 1}},
+ {3482, {wxHtmlWindow, setFonts, 3}},
+ {3483, {wxHtmlWindow, setPage, 1}},
+ {3484, {wxHtmlWindow, setRelatedFrame, 2}},
+ {3485, {wxHtmlWindow, setRelatedStatusBar, 1}},
+ {3486, {wxHtmlWindow, toText, 0}},
+ {3487, {wxHtmlWindow, 'Destroy', undefined}},
+ {3488, {wxHtmlLinkEvent, getLinkInfo, 0}},
+ {3489, {wxSystemSettings, getColour, 1}},
+ {3490, {wxSystemSettings, getFont, 1}},
+ {3491, {wxSystemSettings, getMetric, 2}},
+ {3492, {wxSystemSettings, getScreenType, 0}},
+ {3493, {wxSystemOptions, getOption, 1}},
+ {3494, {wxSystemOptions, getOptionInt, 1}},
+ {3495, {wxSystemOptions, hasOption, 1}},
+ {3496, {wxSystemOptions, isFalse, 1}},
+ {3497, {wxSystemOptions, setOption_2_1, 2}},
+ {3498, {wxSystemOptions, setOption_2_0, 2}},
+ {3499, {wxAuiNotebookEvent, setSelection, 1}},
+ {3500, {wxAuiNotebookEvent, getSelection, 0}},
+ {3501, {wxAuiNotebookEvent, setOldSelection, 1}},
+ {3502, {wxAuiNotebookEvent, getOldSelection, 0}},
+ {3503, {wxAuiNotebookEvent, setDragSource, 1}},
+ {3504, {wxAuiNotebookEvent, getDragSource, 0}},
+ {3505, {wxAuiManagerEvent, setManager, 1}},
+ {3506, {wxAuiManagerEvent, getManager, 0}},
+ {3507, {wxAuiManagerEvent, setPane, 1}},
+ {3508, {wxAuiManagerEvent, getPane, 0}},
+ {3509, {wxAuiManagerEvent, setButton, 1}},
+ {3510, {wxAuiManagerEvent, getButton, 0}},
+ {3511, {wxAuiManagerEvent, setDC, 1}},
+ {3512, {wxAuiManagerEvent, getDC, 0}},
+ {3513, {wxAuiManagerEvent, veto, 1}},
+ {3514, {wxAuiManagerEvent, getVeto, 0}},
+ {3515, {wxAuiManagerEvent, setCanVeto, 1}},
+ {3516, {wxAuiManagerEvent, canVeto, 0}},
+ {3517, {wxLogNull, new, 0}},
+ {3518, {wxLogNull, 'Destroy', undefined}},
+ {3519, {wxTaskBarIcon, new, 0}},
+ {3520, {wxTaskBarIcon, destruct, 0}},
+ {3521, {wxTaskBarIcon, popupMenu, 1}},
+ {3522, {wxTaskBarIcon, removeIcon, 0}},
+ {3523, {wxTaskBarIcon, setIcon, 2}},
{-1, {mod, func, -1}}
].
diff --git a/lib/wx/src/gen/wxe_funcs.hrl b/lib/wx/src/gen/wxe_funcs.hrl
index fe35cb1374..e6aced6e09 100644
--- a/lib/wx/src/gen/wxe_funcs.hrl
+++ b/lib/wx/src/gen/wxe_funcs.hrl
@@ -3151,153 +3151,152 @@
-define(wxStyledTextCtrl_PointFromPosition, 3370).
-define(wxStyledTextCtrl_ScrollToLine, 3371).
-define(wxStyledTextCtrl_ScrollToColumn, 3372).
--define(wxStyledTextCtrl_SendMsg, 3373).
--define(wxStyledTextCtrl_SetVScrollBar, 3374).
--define(wxStyledTextCtrl_SetHScrollBar, 3375).
--define(wxStyledTextCtrl_GetLastKeydownProcessed, 3376).
--define(wxStyledTextCtrl_SetLastKeydownProcessed, 3377).
--define(wxStyledTextCtrl_SaveFile, 3378).
--define(wxStyledTextCtrl_LoadFile, 3379).
--define(wxStyledTextCtrl_DoDragOver, 3380).
--define(wxStyledTextCtrl_DoDropText, 3381).
--define(wxStyledTextCtrl_GetUseAntiAliasing, 3382).
--define(wxStyledTextCtrl_AddTextRaw, 3383).
--define(wxStyledTextCtrl_InsertTextRaw, 3384).
--define(wxStyledTextCtrl_GetCurLineRaw, 3385).
--define(wxStyledTextCtrl_GetLineRaw, 3386).
--define(wxStyledTextCtrl_GetSelectedTextRaw, 3387).
--define(wxStyledTextCtrl_GetTextRangeRaw, 3388).
--define(wxStyledTextCtrl_SetTextRaw, 3389).
--define(wxStyledTextCtrl_GetTextRaw, 3390).
--define(wxStyledTextCtrl_AppendTextRaw, 3391).
--define(wxArtProvider_GetBitmap, 3392).
--define(wxArtProvider_GetIcon, 3393).
--define(wxTreeEvent_GetKeyCode, 3394).
--define(wxTreeEvent_GetItem, 3395).
--define(wxTreeEvent_GetKeyEvent, 3396).
--define(wxTreeEvent_GetLabel, 3397).
--define(wxTreeEvent_GetOldItem, 3398).
--define(wxTreeEvent_GetPoint, 3399).
--define(wxTreeEvent_IsEditCancelled, 3400).
--define(wxTreeEvent_SetToolTip, 3401).
--define(wxNotebookEvent_GetOldSelection, 3402).
--define(wxNotebookEvent_GetSelection, 3403).
--define(wxNotebookEvent_SetOldSelection, 3404).
--define(wxNotebookEvent_SetSelection, 3405).
--define(wxFileDataObject_new, 3406).
--define(wxFileDataObject_AddFile, 3407).
--define(wxFileDataObject_GetFilenames, 3408).
--define(wxFileDataObject_destroy, 3409).
--define(wxTextDataObject_new, 3410).
--define(wxTextDataObject_GetTextLength, 3411).
--define(wxTextDataObject_GetText, 3412).
--define(wxTextDataObject_SetText, 3413).
--define(wxTextDataObject_destroy, 3414).
--define(wxBitmapDataObject_new_1_1, 3415).
--define(wxBitmapDataObject_new_1_0, 3416).
--define(wxBitmapDataObject_GetBitmap, 3417).
--define(wxBitmapDataObject_SetBitmap, 3418).
--define(wxBitmapDataObject_destroy, 3419).
--define(wxClipboard_new, 3421).
--define(wxClipboard_destruct, 3422).
--define(wxClipboard_AddData, 3423).
--define(wxClipboard_Clear, 3424).
--define(wxClipboard_Close, 3425).
--define(wxClipboard_Flush, 3426).
--define(wxClipboard_GetData, 3427).
--define(wxClipboard_IsOpened, 3428).
--define(wxClipboard_Open, 3429).
--define(wxClipboard_SetData, 3430).
--define(wxClipboard_UsePrimarySelection, 3432).
--define(wxClipboard_IsSupported, 3433).
--define(wxClipboard_Get, 3434).
--define(wxSpinEvent_GetPosition, 3435).
--define(wxSpinEvent_SetPosition, 3436).
--define(wxSplitterWindow_new_0, 3437).
--define(wxSplitterWindow_new_2, 3438).
--define(wxSplitterWindow_destruct, 3439).
--define(wxSplitterWindow_Create, 3440).
--define(wxSplitterWindow_GetMinimumPaneSize, 3441).
--define(wxSplitterWindow_GetSashGravity, 3442).
--define(wxSplitterWindow_GetSashPosition, 3443).
--define(wxSplitterWindow_GetSplitMode, 3444).
--define(wxSplitterWindow_GetWindow1, 3445).
--define(wxSplitterWindow_GetWindow2, 3446).
--define(wxSplitterWindow_Initialize, 3447).
--define(wxSplitterWindow_IsSplit, 3448).
--define(wxSplitterWindow_ReplaceWindow, 3449).
--define(wxSplitterWindow_SetSashGravity, 3450).
--define(wxSplitterWindow_SetSashPosition, 3451).
--define(wxSplitterWindow_SetSashSize, 3452).
--define(wxSplitterWindow_SetMinimumPaneSize, 3453).
--define(wxSplitterWindow_SetSplitMode, 3454).
--define(wxSplitterWindow_SplitHorizontally, 3455).
--define(wxSplitterWindow_SplitVertically, 3456).
--define(wxSplitterWindow_Unsplit, 3457).
--define(wxSplitterWindow_UpdateSize, 3458).
--define(wxSplitterEvent_GetSashPosition, 3459).
--define(wxSplitterEvent_GetX, 3460).
--define(wxSplitterEvent_GetY, 3461).
--define(wxSplitterEvent_GetWindowBeingRemoved, 3462).
--define(wxSplitterEvent_SetSashPosition, 3463).
--define(wxHtmlWindow_new_0, 3464).
--define(wxHtmlWindow_new_2, 3465).
--define(wxHtmlWindow_AppendToPage, 3466).
--define(wxHtmlWindow_GetOpenedAnchor, 3467).
--define(wxHtmlWindow_GetOpenedPage, 3468).
--define(wxHtmlWindow_GetOpenedPageTitle, 3469).
--define(wxHtmlWindow_GetRelatedFrame, 3470).
--define(wxHtmlWindow_HistoryBack, 3471).
--define(wxHtmlWindow_HistoryCanBack, 3472).
--define(wxHtmlWindow_HistoryCanForward, 3473).
--define(wxHtmlWindow_HistoryClear, 3474).
--define(wxHtmlWindow_HistoryForward, 3475).
--define(wxHtmlWindow_LoadFile, 3476).
--define(wxHtmlWindow_LoadPage, 3477).
--define(wxHtmlWindow_SelectAll, 3478).
--define(wxHtmlWindow_SelectionToText, 3479).
--define(wxHtmlWindow_SelectLine, 3480).
--define(wxHtmlWindow_SelectWord, 3481).
--define(wxHtmlWindow_SetBorders, 3482).
--define(wxHtmlWindow_SetFonts, 3483).
--define(wxHtmlWindow_SetPage, 3484).
--define(wxHtmlWindow_SetRelatedFrame, 3485).
--define(wxHtmlWindow_SetRelatedStatusBar, 3486).
--define(wxHtmlWindow_ToText, 3487).
--define(wxHtmlWindow_destroy, 3488).
--define(wxHtmlLinkEvent_GetLinkInfo, 3489).
--define(wxSystemSettings_GetColour, 3490).
--define(wxSystemSettings_GetFont, 3491).
--define(wxSystemSettings_GetMetric, 3492).
--define(wxSystemSettings_GetScreenType, 3493).
--define(wxSystemOptions_GetOption, 3494).
--define(wxSystemOptions_GetOptionInt, 3495).
--define(wxSystemOptions_HasOption, 3496).
--define(wxSystemOptions_IsFalse, 3497).
--define(wxSystemOptions_SetOption_2_1, 3498).
--define(wxSystemOptions_SetOption_2_0, 3499).
--define(wxAuiNotebookEvent_SetSelection, 3500).
--define(wxAuiNotebookEvent_GetSelection, 3501).
--define(wxAuiNotebookEvent_SetOldSelection, 3502).
--define(wxAuiNotebookEvent_GetOldSelection, 3503).
--define(wxAuiNotebookEvent_SetDragSource, 3504).
--define(wxAuiNotebookEvent_GetDragSource, 3505).
--define(wxAuiManagerEvent_SetManager, 3506).
--define(wxAuiManagerEvent_GetManager, 3507).
--define(wxAuiManagerEvent_SetPane, 3508).
--define(wxAuiManagerEvent_GetPane, 3509).
--define(wxAuiManagerEvent_SetButton, 3510).
--define(wxAuiManagerEvent_GetButton, 3511).
--define(wxAuiManagerEvent_SetDC, 3512).
--define(wxAuiManagerEvent_GetDC, 3513).
--define(wxAuiManagerEvent_Veto, 3514).
--define(wxAuiManagerEvent_GetVeto, 3515).
--define(wxAuiManagerEvent_SetCanVeto, 3516).
--define(wxAuiManagerEvent_CanVeto, 3517).
--define(wxLogNull_new, 3518).
--define(wxLogNull_destroy, 3519).
--define(wxTaskBarIcon_new, 3520).
--define(wxTaskBarIcon_destruct, 3521).
--define(wxTaskBarIcon_PopupMenu, 3522).
--define(wxTaskBarIcon_RemoveIcon, 3523).
--define(wxTaskBarIcon_SetIcon, 3524).
+-define(wxStyledTextCtrl_SetVScrollBar, 3373).
+-define(wxStyledTextCtrl_SetHScrollBar, 3374).
+-define(wxStyledTextCtrl_GetLastKeydownProcessed, 3375).
+-define(wxStyledTextCtrl_SetLastKeydownProcessed, 3376).
+-define(wxStyledTextCtrl_SaveFile, 3377).
+-define(wxStyledTextCtrl_LoadFile, 3378).
+-define(wxStyledTextCtrl_DoDragOver, 3379).
+-define(wxStyledTextCtrl_DoDropText, 3380).
+-define(wxStyledTextCtrl_GetUseAntiAliasing, 3381).
+-define(wxStyledTextCtrl_AddTextRaw, 3382).
+-define(wxStyledTextCtrl_InsertTextRaw, 3383).
+-define(wxStyledTextCtrl_GetCurLineRaw, 3384).
+-define(wxStyledTextCtrl_GetLineRaw, 3385).
+-define(wxStyledTextCtrl_GetSelectedTextRaw, 3386).
+-define(wxStyledTextCtrl_GetTextRangeRaw, 3387).
+-define(wxStyledTextCtrl_SetTextRaw, 3388).
+-define(wxStyledTextCtrl_GetTextRaw, 3389).
+-define(wxStyledTextCtrl_AppendTextRaw, 3390).
+-define(wxArtProvider_GetBitmap, 3391).
+-define(wxArtProvider_GetIcon, 3392).
+-define(wxTreeEvent_GetKeyCode, 3393).
+-define(wxTreeEvent_GetItem, 3394).
+-define(wxTreeEvent_GetKeyEvent, 3395).
+-define(wxTreeEvent_GetLabel, 3396).
+-define(wxTreeEvent_GetOldItem, 3397).
+-define(wxTreeEvent_GetPoint, 3398).
+-define(wxTreeEvent_IsEditCancelled, 3399).
+-define(wxTreeEvent_SetToolTip, 3400).
+-define(wxNotebookEvent_GetOldSelection, 3401).
+-define(wxNotebookEvent_GetSelection, 3402).
+-define(wxNotebookEvent_SetOldSelection, 3403).
+-define(wxNotebookEvent_SetSelection, 3404).
+-define(wxFileDataObject_new, 3405).
+-define(wxFileDataObject_AddFile, 3406).
+-define(wxFileDataObject_GetFilenames, 3407).
+-define(wxFileDataObject_destroy, 3408).
+-define(wxTextDataObject_new, 3409).
+-define(wxTextDataObject_GetTextLength, 3410).
+-define(wxTextDataObject_GetText, 3411).
+-define(wxTextDataObject_SetText, 3412).
+-define(wxTextDataObject_destroy, 3413).
+-define(wxBitmapDataObject_new_1_1, 3414).
+-define(wxBitmapDataObject_new_1_0, 3415).
+-define(wxBitmapDataObject_GetBitmap, 3416).
+-define(wxBitmapDataObject_SetBitmap, 3417).
+-define(wxBitmapDataObject_destroy, 3418).
+-define(wxClipboard_new, 3420).
+-define(wxClipboard_destruct, 3421).
+-define(wxClipboard_AddData, 3422).
+-define(wxClipboard_Clear, 3423).
+-define(wxClipboard_Close, 3424).
+-define(wxClipboard_Flush, 3425).
+-define(wxClipboard_GetData, 3426).
+-define(wxClipboard_IsOpened, 3427).
+-define(wxClipboard_Open, 3428).
+-define(wxClipboard_SetData, 3429).
+-define(wxClipboard_UsePrimarySelection, 3431).
+-define(wxClipboard_IsSupported, 3432).
+-define(wxClipboard_Get, 3433).
+-define(wxSpinEvent_GetPosition, 3434).
+-define(wxSpinEvent_SetPosition, 3435).
+-define(wxSplitterWindow_new_0, 3436).
+-define(wxSplitterWindow_new_2, 3437).
+-define(wxSplitterWindow_destruct, 3438).
+-define(wxSplitterWindow_Create, 3439).
+-define(wxSplitterWindow_GetMinimumPaneSize, 3440).
+-define(wxSplitterWindow_GetSashGravity, 3441).
+-define(wxSplitterWindow_GetSashPosition, 3442).
+-define(wxSplitterWindow_GetSplitMode, 3443).
+-define(wxSplitterWindow_GetWindow1, 3444).
+-define(wxSplitterWindow_GetWindow2, 3445).
+-define(wxSplitterWindow_Initialize, 3446).
+-define(wxSplitterWindow_IsSplit, 3447).
+-define(wxSplitterWindow_ReplaceWindow, 3448).
+-define(wxSplitterWindow_SetSashGravity, 3449).
+-define(wxSplitterWindow_SetSashPosition, 3450).
+-define(wxSplitterWindow_SetSashSize, 3451).
+-define(wxSplitterWindow_SetMinimumPaneSize, 3452).
+-define(wxSplitterWindow_SetSplitMode, 3453).
+-define(wxSplitterWindow_SplitHorizontally, 3454).
+-define(wxSplitterWindow_SplitVertically, 3455).
+-define(wxSplitterWindow_Unsplit, 3456).
+-define(wxSplitterWindow_UpdateSize, 3457).
+-define(wxSplitterEvent_GetSashPosition, 3458).
+-define(wxSplitterEvent_GetX, 3459).
+-define(wxSplitterEvent_GetY, 3460).
+-define(wxSplitterEvent_GetWindowBeingRemoved, 3461).
+-define(wxSplitterEvent_SetSashPosition, 3462).
+-define(wxHtmlWindow_new_0, 3463).
+-define(wxHtmlWindow_new_2, 3464).
+-define(wxHtmlWindow_AppendToPage, 3465).
+-define(wxHtmlWindow_GetOpenedAnchor, 3466).
+-define(wxHtmlWindow_GetOpenedPage, 3467).
+-define(wxHtmlWindow_GetOpenedPageTitle, 3468).
+-define(wxHtmlWindow_GetRelatedFrame, 3469).
+-define(wxHtmlWindow_HistoryBack, 3470).
+-define(wxHtmlWindow_HistoryCanBack, 3471).
+-define(wxHtmlWindow_HistoryCanForward, 3472).
+-define(wxHtmlWindow_HistoryClear, 3473).
+-define(wxHtmlWindow_HistoryForward, 3474).
+-define(wxHtmlWindow_LoadFile, 3475).
+-define(wxHtmlWindow_LoadPage, 3476).
+-define(wxHtmlWindow_SelectAll, 3477).
+-define(wxHtmlWindow_SelectionToText, 3478).
+-define(wxHtmlWindow_SelectLine, 3479).
+-define(wxHtmlWindow_SelectWord, 3480).
+-define(wxHtmlWindow_SetBorders, 3481).
+-define(wxHtmlWindow_SetFonts, 3482).
+-define(wxHtmlWindow_SetPage, 3483).
+-define(wxHtmlWindow_SetRelatedFrame, 3484).
+-define(wxHtmlWindow_SetRelatedStatusBar, 3485).
+-define(wxHtmlWindow_ToText, 3486).
+-define(wxHtmlWindow_destroy, 3487).
+-define(wxHtmlLinkEvent_GetLinkInfo, 3488).
+-define(wxSystemSettings_GetColour, 3489).
+-define(wxSystemSettings_GetFont, 3490).
+-define(wxSystemSettings_GetMetric, 3491).
+-define(wxSystemSettings_GetScreenType, 3492).
+-define(wxSystemOptions_GetOption, 3493).
+-define(wxSystemOptions_GetOptionInt, 3494).
+-define(wxSystemOptions_HasOption, 3495).
+-define(wxSystemOptions_IsFalse, 3496).
+-define(wxSystemOptions_SetOption_2_1, 3497).
+-define(wxSystemOptions_SetOption_2_0, 3498).
+-define(wxAuiNotebookEvent_SetSelection, 3499).
+-define(wxAuiNotebookEvent_GetSelection, 3500).
+-define(wxAuiNotebookEvent_SetOldSelection, 3501).
+-define(wxAuiNotebookEvent_GetOldSelection, 3502).
+-define(wxAuiNotebookEvent_SetDragSource, 3503).
+-define(wxAuiNotebookEvent_GetDragSource, 3504).
+-define(wxAuiManagerEvent_SetManager, 3505).
+-define(wxAuiManagerEvent_GetManager, 3506).
+-define(wxAuiManagerEvent_SetPane, 3507).
+-define(wxAuiManagerEvent_GetPane, 3508).
+-define(wxAuiManagerEvent_SetButton, 3509).
+-define(wxAuiManagerEvent_GetButton, 3510).
+-define(wxAuiManagerEvent_SetDC, 3511).
+-define(wxAuiManagerEvent_GetDC, 3512).
+-define(wxAuiManagerEvent_Veto, 3513).
+-define(wxAuiManagerEvent_GetVeto, 3514).
+-define(wxAuiManagerEvent_SetCanVeto, 3515).
+-define(wxAuiManagerEvent_CanVeto, 3516).
+-define(wxLogNull_new, 3517).
+-define(wxLogNull_destroy, 3518).
+-define(wxTaskBarIcon_new, 3519).
+-define(wxTaskBarIcon_destruct, 3520).
+-define(wxTaskBarIcon_PopupMenu, 3521).
+-define(wxTaskBarIcon_RemoveIcon, 3522).
+-define(wxTaskBarIcon_SetIcon, 3523).
diff --git a/lib/wx/src/wxe_util.erl b/lib/wx/src/wxe_util.erl
index 3022b7f3f2..a31c3e30b8 100644
--- a/lib/wx/src/wxe_util.erl
+++ b/lib/wx/src/wxe_util.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -233,10 +233,16 @@ priv_dir(Driver0, Silent) ->
{ok, _} ->
Priv;
{error, _} ->
- opt_error_log(Silent,
- "ERROR: Could not find \'~s\' in: ~s~n",
- [Driver, Priv]),
- erlang:error({load_driver, "No driver found"})
+ SrcPriv = filename:join(Priv, erlang:system_info(system_architecture)),
+ case file:read_file_info(filename:join(SrcPriv, Driver)) of
+ {ok, _} ->
+ SrcPriv;
+ {error, _} ->
+ opt_error_log(Silent,
+ "ERROR: Could not find \'~s\' in: ~s~n",
+ [Driver, Priv]),
+ erlang:error({load_driver, "No driver found"})
+ end
end.
strip(Src, Src) ->
diff --git a/lib/wx/test/wx_basic_SUITE.erl b/lib/wx/test/wx_basic_SUITE.erl
index e240bbcfe8..cf17818a9d 100644
--- a/lib/wx/test/wx_basic_SUITE.erl
+++ b/lib/wx/test/wx_basic_SUITE.erl
@@ -308,12 +308,12 @@ data_types(_Config) ->
?m({_,_}, wxWindow:getSize(Frame)),
%% DateTime
- DateTime = calendar:now_to_datetime(erlang:now()),
+ DateTime = {Date, _Time} = calendar:now_to_datetime(erlang:now()),
io:format("DateTime ~p ~n",[DateTime]),
Cal = ?mt(wxCalendarCtrl, wxCalendarCtrl:new(Frame, ?wxID_ANY, [{date,DateTime}])),
- ?m(DateTime, wxCalendarCtrl:getDate(Cal)),
+ ?m({Date,_}, wxCalendarCtrl:getDate(Cal)),
?m(true, is_boolean(wxCalendarCtrl:setDate(Cal,DateTime))),
- ?m(DateTime, wxCalendarCtrl:getDate(Cal)),
+ ?m({Date,_}, wxCalendarCtrl:getDate(Cal)),
wxClientDC:destroy(CDC),
%%wx_test_lib:wx_destroy(Frame,Config).
diff --git a/lib/wx/test/wx_class_SUITE.erl b/lib/wx/test/wx_class_SUITE.erl
index 6ed7243c5b..22bfa53e0a 100644
--- a/lib/wx/test/wx_class_SUITE.erl
+++ b/lib/wx/test/wx_class_SUITE.erl
@@ -82,13 +82,14 @@ calendarCtrl(Config) ->
true ->
?log("DateAttr is null~n",[]);
false ->
- ?log("DateAttr is useable~n",[])
+ ?log("DateAttr is useable~n",[]),
+ DateAttr = ?mt(wxCalendarDateAttr, wxCalendarDateAttr:new()),
+ wxCalendarDateAttr:setBackgroundColour(DateAttr, {0,243,0}),
+ wxCalendarCtrl:setAttr(Cal, Day, DateAttr),
+ DateAttr1 = ?mt(wxCalendarDateAttr, wxCalendarCtrl:getAttr(Cal,Day)),
+ io:format("DateAttr ~p~n",[DateAttr1]),
+ ?m({0,243,0,255}, wxCalendarDateAttr:getBackgroundColour(DateAttr1))
end,
- DateAttr = ?mt(wxCalendarDateAttr, wxCalendarDateAttr:new()),
- wxCalendarDateAttr:setBackgroundColour(DateAttr, {0,243,0}),
- wxCalendarCtrl:setAttr(Cal, Day, DateAttr),
- DateAttr1 = ?mt(wxCalendarDateAttr, wxCalendarCtrl:getAttr(Cal,Day)),
- ?m({0,243,0,255}, wxCalendarDateAttr:getBackgroundColour(DateAttr1)),
?m({YMD, _},wxCalendarCtrl:getDate(Cal)),
@@ -476,7 +477,9 @@ taskBarIcon(Config) ->
Wx = wx:new(),
Frame = wxFrame:new(Wx, ?wxID_ANY, "Frame"),
TBI = wxTaskBarIcon:new(),
- Icon = wxIcon:new(filename:join(code:priv_dir(debugger), "erlang_bug.png")),
+ Image = wxImage:new(filename:join(code:priv_dir(debugger), "erlang_bug.png")),
+ io:format("Image ~p~n",[wxImage:ok(Image)]),
+ Icon = wxIcon:new(filename:join(code:priv_dir(debugger), "erlang_bug.png"), [{type, ?wxBITMAP_TYPE_PNG}]),
wxTaskBarIcon:setIcon(TBI, Icon, [{tooltip, "Testing wxTaskBarIcon"}]),
wxWindow:show(Frame),
wxTaskBarIcon:connect(TBI, taskbar_left_down, [{callback, fun(Ev,_) -> io:format("Left clicked: ~p~n",[Ev]) end}]),
diff --git a/lib/wx/test/wx_event_SUITE.erl b/lib/wx/test/wx_event_SUITE.erl
index 8f364049b4..53a2ee7d7b 100644
--- a/lib/wx/test/wx_event_SUITE.erl
+++ b/lib/wx/test/wx_event_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -301,35 +301,70 @@ connect_in_callback(TestInfo)
when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
connect_in_callback(Config) ->
Wx = ?mr(wx_ref, wx:new()),
+ %% wx:debug([driver,trace]),
+ %% io:format("gdb -p ~s~n",[os:getpid()]),
Frame = wxFrame:new(Wx, ?wxID_ANY, "Connect in callback"),
Panel = wxPanel:new(Frame, []),
-
+
+ Tester = self(),
+
+ %% Connect in callbacks works different in 2.9
+ %% such that new events are not fired until the previous
+ %% callback have returned.
+
+ %% That means that a callback can not wait for other events
+ %% in receive since they will not come.
+ %% It also means that you can not attach a new callback directly from
+ %% the callback since that callback will be removed when the temporary
+ %% process that executes the outer callback (may) die(s) before the callback
+ %% is invoked
+
+ %% Thus connect in callbacks needs to done in a another process, and
+ %% not in the fun directly
+ Env = wx:get_env(),
+ TestWindow =
+ fun() ->
+ wx:set_env(Env),
+ Me = self(),
+ F1 = wxFrame:new(Frame, ?wxID_ANY, "Frame size event"),
+ wxFrame:connect(F1,size,[{callback,
+ fun(_,_) ->
+ io:format("CB2 got size~n",[]),
+ Me ! {continue, F1}
+ end}]),
+ wxWindow:show(F1),
+ receive
+ {continue, F1} -> Tester ! {continue, F1}
+ end
+ end,
wxFrame:connect(Frame,size,
- [{callback,
- fun(#wx{event=#wxSize{}},_SizeEv) ->
- io:format("Frame got size~n",[]),
- F1 = wxFrame:new(Frame, ?wxID_ANY, "Frame size event"),
- CBPid = self(),
- wxFrame:connect(F1,size,[{callback,
- fun(_,_) ->
- io:format("CB2 got size~n",[]),
- CBPid ! continue
- end}]),
- wxWindow:show(F1),
- receive continue -> wxFrame:destroy(F1) end
+ [{callback,
+ fun(#wx{event=#wxSize{}},_SizeEv) ->
+ io:format("Frame got size~n",[]),
+ spawn(TestWindow)
end}]),
wxPanel:connect(Panel,size,
- [{callback,
- fun(#wx{event=#wxSize{}},_SizeEv) ->
+ [{callback,
+ fun(#wx{event=#wxSize{}},_SizeEv) ->
io:format("Panel got size~n",[]),
- F1 = wxFrame:new(Frame, ?wxID_ANY, "Panel size event"),
- wxFrame:connect(F1,size),
- wxWindow:show(F1),
- receive #wx{event=#wxSize{}} -> wxFrame:destroy(F1) end
- end}]),
+ spawn(fun() ->
+ wx:set_env(Env),
+ F1 = wxFrame:new(Frame, ?wxID_ANY,
+ "Panel size event"),
+ wxFrame:connect(F1,size),
+ wxWindow:show(F1),
+ receive
+ #wx{event=#wxSize{}} ->
+ io:format("All Fine ~n",[]),
+ wxFrame:destroy(F1)
+ end
+ end)
+ end}]),
wxFrame:show(Frame),
+
+ ok = receive {continue, F1} -> wxFrame:destroy(F1)
+ after 5000 -> timeout end,
wx_test_lib:flush(),
-
wx_test_lib:wx_destroy(Frame, Config).
%% Test that event callback which triggers another callback works
diff --git a/lib/wx/test/wx_opengl_SUITE.erl b/lib/wx/test/wx_opengl_SUITE.erl
index e8fdf603d6..f351bc93ed 100644
--- a/lib/wx/test/wx_opengl_SUITE.erl
+++ b/lib/wx/test/wx_opengl_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -92,10 +92,22 @@ canvas(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
canvas(Config) ->
WX = ?mr(wx_ref, wx:new()),
Frame = wxFrame:new(WX,1,"Hello 3D-World",[]),
- Attrs = [{attribList, [?WX_GL_RGBA,?WX_GL_DOUBLEBUFFER,0]}],
- Canvas = ?mt(wxGLCanvas, wxGLCanvas:new(Frame, Attrs)),
+ Attrs = [{attribList, [?WX_GL_RGBA,
+ ?WX_GL_DOUBLEBUFFER,
+ ?WX_GL_MIN_RED,8,
+ ?WX_GL_MIN_GREEN,8,
+ ?WX_GL_MIN_BLUE,8,
+ ?WX_GL_DEPTH_SIZE,24,0]}],
+ Canvas = ?mt(wxGLCanvas, wxGLCanvas:new(Frame, [{style,?wxFULL_REPAINT_ON_RESIZE}|
+ Attrs])),
+ wxFrame:connect(Frame, show),
?m(true, wxWindow:show(Frame)),
+
+ receive #wx{event=#wxShow{}} -> ok
+ after 1000 -> exit(show_timeout)
+ end,
+
?m(false, wx:is_null(wxGLCanvas:getContext(Canvas))),
?m({'EXIT', {{error, no_gl_context,_},_}}, gl:getString(?GL_VENDOR)),
@@ -111,7 +123,7 @@ canvas(Config) ->
%%gl:frustum( -2.0, 2.0, -2.0, 2.0, 5.0, 25.0 ),
gl:ortho( -2.0, 2.0, -2.0*H/W, 2.0*H/W, -20.0, 20.0),
gl:matrixMode(?GL_MODELVIEW),
- gl:loadIdentity(),
+ gl:loadIdentity(),
gl:enable(?GL_DEPTH_TEST),
gl:depthFunc(?GL_LESS),
{R,G,B,_} = wxWindow:getBackgroundColour(Frame),
@@ -122,7 +134,7 @@ canvas(Config) ->
?m([], flush()),
Env = wx:get_env(),
Tester = self(),
- spawn_link(fun() ->
+ spawn_link(fun() ->
wx:set_env(Env),
?m(ok, wxGLCanvas:setCurrent(Canvas)),
?m(ok, drawBox(1, Data)),
@@ -131,11 +143,20 @@ canvas(Config) ->
%% This may fail when window is deleted
catch draw_loop(2,Data,Canvas)
end),
+ %% Needed on mac with wx-2.9
+ wxGLCanvas:connect(Canvas, paint,
+ [{callback, fun(_,_) ->
+ wxGLCanvas:setCurrent(Canvas),
+ DC= wxPaintDC:new(Canvas),
+ wxPaintDC:destroy(DC)
+ end}]),
+
+
?m_receive(works),
?m([], flush()),
io:format("Undef func ~p ~n", [catch gl:uniform1d(2, 0.75)]),
timer:sleep(500),
- ?m([], flush()),
+ flush(),
wx_test_lib:wx_destroy(Frame, Config).
flush() ->
@@ -150,6 +171,8 @@ flush(Collected) ->
draw_loop(Deg,Data,Canvas) ->
timer:sleep(15),
+ {NW,NH} = wxGLCanvas:getClientSize(Canvas),
+ gl:viewport(0,0,NW,NH),
drawBox(Deg,Data),
?m(ok, wxGLCanvas:swapBuffers(Canvas)),
draw_loop(Deg+1, Data,Canvas).
@@ -181,7 +204,12 @@ glu_tesselation(Config) ->
Frame = wxFrame:new(WX,1,"Hello 3D-World",[]),
Attrs = [{attribList, [?WX_GL_RGBA,?WX_GL_DOUBLEBUFFER,0]}],
Canvas = ?mt(wxGLCanvas, wxGLCanvas:new(Frame, Attrs)),
+ wxFrame:connect(Frame, show),
?m(true, wxWindow:show(Frame)),
+
+ receive #wx{event=#wxShow{}} -> ok
+ after 1000 -> exit(show_timeout)
+ end,
?m(ok, wxGLCanvas:setCurrent(Canvas)),
{RL1,RB1} = ?m({_,_}, glu:tesselate({0,0,1}, [{-1,0,0},{1,0,0},{0,1,0}])),
diff --git a/lib/wx/test/wx_xtra_SUITE.erl b/lib/wx/test/wx_xtra_SUITE.erl
index 02a0672594..a2d4c26319 100644
--- a/lib/wx/test/wx_xtra_SUITE.erl
+++ b/lib/wx/test/wx_xtra_SUITE.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2012. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -111,6 +111,7 @@ app_dies(_Config) ->
oops(Die,?LINE),
wxFrame:show(Frame),
oops(Die,?LINE),
+ timer:sleep(100), %% Let the window be shown before DC can be created
DC0 = wxClientDC:new(Win),
oops(Die,?LINE),
DC = wxBufferedDC:new(DC0),
@@ -134,7 +135,7 @@ app_dies2(Test, N) ->
end.
oops(Die, Line) when (Die =:= last) orelse (Die =< Line) ->
- timer:sleep(500),
+ timer:sleep(300),
?log(" Exits at line ~p~n",[Line]),
exit({oops, Die});
oops(_,_) -> ok.
@@ -191,8 +192,12 @@ menu_item_debug(Config) ->
wxFrame:connect(Frame, close_window),
wxPanel:new(Frame),
- create_menus(Frame),
+ MenuBar = create_menus(Frame),
wxWindow:show(Frame),
+ N = wxMenuBar:getMenuCount(MenuBar),
+ io:format("No of menus ~p~n",[N]),
+ [io:format("Menu ~p ~p~n",[Id, wxMenuBar:getLabelTop(MenuBar, Id)])
+ || Id <- lists:seq(0, N-1)],
wx_test_lib:wx_destroy(Frame,Config).
@@ -224,14 +229,15 @@ create_menus(Frame) ->
|| Id <- lists:seq(600, 620)],
?m(ok,wxFrame:connect(Frame, command_menu_selected)),
- ?m(true, wxMenuBar:append(MenuBar, File, "&File")),
- ?m(true, wxMenuBar:append(MenuBar, Help, "&Help")),
- ?m(true, wxMenuBar:append(MenuBar, T1, "T1")),
- ?m(true, wxMenuBar:append(MenuBar, T2, "T2")),
- ?m(true, wxMenuBar:append(MenuBar, T3, "T3")),
- ?m(true, wxMenuBar:append(MenuBar, T4, "T4")),
- ?m(true, wxMenuBar:append(MenuBar, T5, "T5")),
- ?m(true, wxMenuBar:append(MenuBar, T6, "T6")),
-
- ?m(ok, wxFrame:setMenuBar(Frame,MenuBar)).
+ ?m(true, wxMenuBar:insert(MenuBar, 0,File, "&File")),
+ ?m(true, wxMenuBar:insert(MenuBar, 1,Help, "&Help")),
+ ?m(true, wxMenuBar:insert(MenuBar, 2,T1, "T1")),
+ ?m(true, wxMenuBar:insert(MenuBar, 3,T2, "T2")),
+ ?m(true, wxMenuBar:insert(MenuBar, 4,T3, "T3")),
+ ?m(true, wxMenuBar:insert(MenuBar, 5,T4, "T4")),
+ ?m(true, wxMenuBar:insert(MenuBar, 6,T5, "T5")),
+ ?m(true, wxMenuBar:insert(MenuBar, 7,T6, "T6")),
+
+ ?m(ok, wxFrame:setMenuBar(Frame,MenuBar)),
+ MenuBar.
diff --git a/lib/wx/wxwin.m4 b/lib/wx/wxwin-2.8.m4
index 52c55e2e6e..52c55e2e6e 100644
--- a/lib/wx/wxwin.m4
+++ b/lib/wx/wxwin-2.8.m4
diff --git a/lib/wx/wxwin-2.9.m4 b/lib/wx/wxwin-2.9.m4
new file mode 100644
index 0000000000..1c50dcc272
--- /dev/null
+++ b/lib/wx/wxwin-2.9.m4
@@ -0,0 +1,1060 @@
+dnl ---------------------------------------------------------------------------
+dnl Author: wxWidgets development team,
+dnl Francesco Montorsi,
+dnl Bob McCown (Mac-testing)
+dnl Creation date: 24/11/2001
+dnl RCS-ID: $Id$
+dnl ---------------------------------------------------------------------------
+
+dnl ===========================================================================
+dnl Table of Contents of this macro file:
+dnl -------------------------------------
+dnl
+dnl SECTION A: wxWidgets main macros
+dnl - WX_CONFIG_OPTIONS
+dnl - WX_CONFIG_CHECK
+dnl - WXRC_CHECK
+dnl - WX_STANDARD_OPTIONS
+dnl - WX_CONVERT_STANDARD_OPTIONS_TO_WXCONFIG_FLAGS
+dnl - WX_DETECT_STANDARD_OPTION_VALUES
+dnl
+dnl SECTION B: wxWidgets-related utilities
+dnl - WX_LIKE_LIBNAME
+dnl - WX_ARG_ENABLE_YESNOAUTO
+dnl - WX_ARG_WITH_YESNOAUTO
+dnl
+dnl SECTION C: messages to the user
+dnl - WX_STANDARD_OPTIONS_SUMMARY_MSG
+dnl - WX_STANDARD_OPTIONS_SUMMARY_MSG_BEGIN
+dnl - WX_STANDARD_OPTIONS_SUMMARY_MSG_END
+dnl - WX_BOOLOPT_SUMMARY
+dnl
+dnl The special "WX_DEBUG_CONFIGURE" variable can be set to 1 to enable extra
+dnl debug output on stdout from these macros.
+dnl ===========================================================================
+
+
+dnl ---------------------------------------------------------------------------
+dnl Macros for wxWidgets detection. Typically used in configure.in as:
+dnl
+dnl AC_ARG_ENABLE(...)
+dnl AC_ARG_WITH(...)
+dnl ...
+dnl WX_CONFIG_OPTIONS
+dnl ...
+dnl ...
+dnl WX_CONFIG_CHECK([2.6.0], [wxWin=1])
+dnl if test "$wxWin" != 1; then
+dnl AC_MSG_ERROR([
+dnl wxWidgets must be installed on your system
+dnl but wx-config script couldn't be found.
+dnl
+dnl Please check that wx-config is in path, the directory
+dnl where wxWidgets libraries are installed (returned by
+dnl 'wx-config --libs' command) is in LD_LIBRARY_PATH or
+dnl equivalent variable and wxWidgets version is 2.3.4 or above.
+dnl ])
+dnl fi
+dnl CPPFLAGS="$CPPFLAGS $WX_CPPFLAGS"
+dnl CXXFLAGS="$CXXFLAGS $WX_CXXFLAGS_ONLY"
+dnl CFLAGS="$CFLAGS $WX_CFLAGS_ONLY"
+dnl
+dnl LIBS="$LIBS $WX_LIBS"
+dnl
+dnl If you want to support standard --enable-debug/unicode/shared options, you
+dnl may do the following:
+dnl
+dnl ...
+dnl AC_CANONICAL_SYSTEM
+dnl
+dnl # define configure options
+dnl WX_CONFIG_OPTIONS
+dnl WX_STANDARD_OPTIONS([debug,unicode,shared,toolkit,wxshared])
+dnl
+dnl # basic configure checks
+dnl ...
+dnl
+dnl # we want to always have DEBUG==WX_DEBUG and UNICODE==WX_UNICODE
+dnl WX_DEBUG=$DEBUG
+dnl WX_UNICODE=$UNICODE
+dnl
+dnl WX_CONVERT_STANDARD_OPTIONS_TO_WXCONFIG_FLAGS
+dnl WX_CONFIG_CHECK([2.8.0], [wxWin=1],,[html,core,net,base],[$WXCONFIG_FLAGS])
+dnl WX_DETECT_STANDARD_OPTION_VALUES
+dnl
+dnl # write the output files
+dnl AC_CONFIG_FILES([Makefile ...])
+dnl AC_OUTPUT
+dnl
+dnl # optional: just to show a message to the user
+dnl WX_STANDARD_OPTIONS_SUMMARY_MSG
+dnl
+dnl ---------------------------------------------------------------------------
+
+
+dnl ---------------------------------------------------------------------------
+dnl WX_CONFIG_OPTIONS
+dnl
+dnl adds support for --wx-prefix, --wx-exec-prefix, --with-wxdir and
+dnl --wx-config command line options
+dnl ---------------------------------------------------------------------------
+
+AC_DEFUN([WX_CONFIG_OPTIONS],
+[
+ AC_ARG_WITH(wxdir,
+ [ --with-wxdir=PATH Use uninstalled version of wxWidgets in PATH],
+ [ wx_config_name="$withval/wx-config"
+ wx_config_args="--inplace"])
+ AC_ARG_WITH(wx-config,
+ [ --with-wx-config=CONFIG wx-config script to use (optional)],
+ wx_config_name="$withval" )
+ AC_ARG_WITH(wx-prefix,
+ [ --with-wx-prefix=PREFIX Prefix where wxWidgets is installed (optional)],
+ wx_config_prefix="$withval", wx_config_prefix="")
+ AC_ARG_WITH(wx-exec-prefix,
+ [ --with-wx-exec-prefix=PREFIX
+ Exec prefix where wxWidgets is installed (optional)],
+ wx_config_exec_prefix="$withval", wx_config_exec_prefix="")
+])
+
+dnl Helper macro for checking if wx version is at least $1.$2.$3, set's
+dnl wx_ver_ok=yes if it is:
+AC_DEFUN([_WX_PRIVATE_CHECK_VERSION],
+[
+ wx_ver_ok=""
+ if test "x$WX_VERSION" != x ; then
+ if test $wx_config_major_version -gt $1; then
+ wx_ver_ok=yes
+ else
+ if test $wx_config_major_version -eq $1; then
+ if test $wx_config_minor_version -gt $2; then
+ wx_ver_ok=yes
+ else
+ if test $wx_config_minor_version -eq $2; then
+ if test $wx_config_micro_version -ge $3; then
+ wx_ver_ok=yes
+ fi
+ fi
+ fi
+ fi
+ fi
+ fi
+])
+
+dnl ---------------------------------------------------------------------------
+dnl WX_CONFIG_CHECK(VERSION, [ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND
+dnl [, WX-LIBS [, ADDITIONAL-WX-CONFIG-FLAGS]]]])
+dnl
+dnl Test for wxWidgets, and define WX_C*FLAGS, WX_LIBS and WX_LIBS_STATIC
+dnl (the latter is for static linking against wxWidgets). Set WX_CONFIG_NAME
+dnl environment variable to override the default name of the wx-config script
+dnl to use. Set WX_CONFIG_PATH to specify the full path to wx-config - in this
+dnl case the macro won't even waste time on tests for its existence.
+dnl
+dnl Optional WX-LIBS argument contains comma- or space-separated list of
+dnl wxWidgets libraries to link against. If it is not specified then WX_LIBS
+dnl and WX_LIBS_STATIC will contain flags to link with all of the core
+dnl wxWidgets libraries.
+dnl
+dnl Optional ADDITIONAL-WX-CONFIG-FLAGS argument is appended to wx-config
+dnl invocation command in present. It can be used to fine-tune lookup of
+dnl best wxWidgets build available.
+dnl
+dnl Example use:
+dnl WX_CONFIG_CHECK([2.6.0], [wxWin=1], [wxWin=0], [html,core,net]
+dnl [--unicode --debug])
+dnl ---------------------------------------------------------------------------
+
+dnl
+dnl Get the cflags and libraries from the wx-config script
+dnl
+AC_DEFUN([WX_CONFIG_CHECK],
+[
+ dnl do we have wx-config name: it can be wx-config or wxd-config or ...
+ if test x${WX_CONFIG_NAME+set} != xset ; then
+ WX_CONFIG_NAME=wx-config
+ fi
+
+ if test "x$wx_config_name" != x ; then
+ WX_CONFIG_NAME="$wx_config_name"
+ fi
+
+ dnl deal with optional prefixes
+ if test x$wx_config_exec_prefix != x ; then
+ wx_config_args="$wx_config_args --exec-prefix=$wx_config_exec_prefix"
+ WX_LOOKUP_PATH="$wx_config_exec_prefix/bin"
+ fi
+ if test x$wx_config_prefix != x ; then
+ wx_config_args="$wx_config_args --prefix=$wx_config_prefix"
+ WX_LOOKUP_PATH="$WX_LOOKUP_PATH:$wx_config_prefix/bin"
+ fi
+ if test "$cross_compiling" = "yes"; then
+ wx_config_args="$wx_config_args --host=$host_alias"
+ fi
+
+ dnl don't search the PATH if WX_CONFIG_NAME is absolute filename
+ if test -x "$WX_CONFIG_NAME" ; then
+ AC_MSG_CHECKING(for wx-config)
+ WX_CONFIG_PATH="$WX_CONFIG_NAME"
+ AC_MSG_RESULT($WX_CONFIG_PATH)
+ else
+ AC_PATH_PROG(WX_CONFIG_PATH, $WX_CONFIG_NAME, no, "$WX_LOOKUP_PATH:$PATH")
+ fi
+
+ if test "$WX_CONFIG_PATH" != "no" ; then
+ WX_VERSION=""
+
+ min_wx_version=ifelse([$1], ,2.2.1,$1)
+ if test -z "$5" ; then
+ AC_MSG_CHECKING([for wxWidgets version >= $min_wx_version])
+ else
+ AC_MSG_CHECKING([for wxWidgets version >= $min_wx_version ($5)])
+ fi
+
+ dnl don't add the libraries ($4) to this variable as this would result in
+ dnl an error when it's used with --version below
+ WX_CONFIG_WITH_ARGS="$WX_CONFIG_PATH $wx_config_args $5"
+
+ WX_VERSION=`$WX_CONFIG_WITH_ARGS --version 2>/dev/null`
+ wx_config_major_version=`echo $WX_VERSION | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+ wx_config_minor_version=`echo $WX_VERSION | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+ wx_config_micro_version=`echo $WX_VERSION | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+
+ wx_requested_major_version=`echo $min_wx_version | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+ wx_requested_minor_version=`echo $min_wx_version | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+ wx_requested_micro_version=`echo $min_wx_version | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+
+ _WX_PRIVATE_CHECK_VERSION([$wx_requested_major_version],
+ [$wx_requested_minor_version],
+ [$wx_requested_micro_version])
+
+ if test -n "$wx_ver_ok"; then
+ AC_MSG_RESULT(yes (version $WX_VERSION))
+ WX_LIBS=`$WX_CONFIG_WITH_ARGS --libs $4`
+
+ dnl is this even still appropriate? --static is a real option now
+ dnl and WX_CONFIG_WITH_ARGS is likely to contain it if that is
+ dnl what the user actually wants, making this redundant at best.
+ dnl For now keep it in case anyone actually used it in the past.
+ AC_MSG_CHECKING([for wxWidgets static library])
+ WX_LIBS_STATIC=`$WX_CONFIG_WITH_ARGS --static --libs $4 2>/dev/null`
+ if test "x$WX_LIBS_STATIC" = "x"; then
+ AC_MSG_RESULT(no)
+ else
+ AC_MSG_RESULT(yes)
+ fi
+
+ dnl starting with version 2.2.6 wx-config has --cppflags argument
+ wx_has_cppflags=""
+ if test $wx_config_major_version -gt 2; then
+ wx_has_cppflags=yes
+ else
+ if test $wx_config_major_version -eq 2; then
+ if test $wx_config_minor_version -gt 2; then
+ wx_has_cppflags=yes
+ else
+ if test $wx_config_minor_version -eq 2; then
+ if test $wx_config_micro_version -ge 6; then
+ wx_has_cppflags=yes
+ fi
+ fi
+ fi
+ fi
+ fi
+
+ dnl starting with version 2.7.0 wx-config has --rescomp option
+ wx_has_rescomp=""
+ if test $wx_config_major_version -gt 2; then
+ wx_has_rescomp=yes
+ else
+ if test $wx_config_major_version -eq 2; then
+ if test $wx_config_minor_version -ge 7; then
+ wx_has_rescomp=yes
+ fi
+ fi
+ fi
+ if test "x$wx_has_rescomp" = x ; then
+ dnl cannot give any useful info for resource compiler
+ WX_RESCOMP=
+ else
+ WX_RESCOMP=`$WX_CONFIG_WITH_ARGS --rescomp`
+ fi
+
+ if test "x$wx_has_cppflags" = x ; then
+ dnl no choice but to define all flags like CFLAGS
+ WX_CFLAGS=`$WX_CONFIG_WITH_ARGS --cflags $4`
+ WX_CPPFLAGS=$WX_CFLAGS
+ WX_CXXFLAGS=$WX_CFLAGS
+
+ WX_CFLAGS_ONLY=$WX_CFLAGS
+ WX_CXXFLAGS_ONLY=$WX_CFLAGS
+ else
+ dnl we have CPPFLAGS included in CFLAGS included in CXXFLAGS
+ WX_CPPFLAGS=`$WX_CONFIG_WITH_ARGS --cppflags $4`
+ WX_CXXFLAGS=`$WX_CONFIG_WITH_ARGS --cxxflags $4`
+ WX_CFLAGS=`$WX_CONFIG_WITH_ARGS --cflags $4`
+
+ WX_CFLAGS_ONLY=`echo $WX_CFLAGS | sed "s@^$WX_CPPFLAGS *@@"`
+ WX_CXXFLAGS_ONLY=`echo $WX_CXXFLAGS | sed "s@^$WX_CFLAGS *@@"`
+ fi
+
+ ifelse([$2], , :, [$2])
+
+ else
+
+ if test "x$WX_VERSION" = x; then
+ dnl no wx-config at all
+ AC_MSG_RESULT(no)
+ else
+ AC_MSG_RESULT(no (version $WX_VERSION is not new enough))
+ fi
+
+ WX_CFLAGS=""
+ WX_CPPFLAGS=""
+ WX_CXXFLAGS=""
+ WX_LIBS=""
+ WX_LIBS_STATIC=""
+ WX_RESCOMP=""
+
+ if test ! -z "$5"; then
+
+ wx_error_message="
+ The configuration you asked for $PACKAGE_NAME requires a wxWidgets
+ build with the following settings:
+ $5
+ but such build is not available.
+
+ To see the wxWidgets builds available on this system, please use
+ 'wx-config --list' command. To use the default build, returned by
+ 'wx-config --selected-config', use the options with their 'auto'
+ default values."
+
+ fi
+
+ wx_error_message="
+ The requested wxWidgets build couldn't be found.
+ $wx_error_message
+
+ If you still get this error, then check that 'wx-config' is
+ in path, the directory where wxWidgets libraries are installed
+ (returned by 'wx-config --libs' command) is in LD_LIBRARY_PATH
+ or equivalent variable and wxWidgets version is $1 or above."
+
+ ifelse([$3], , AC_MSG_ERROR([$wx_error_message]), [$3])
+
+ fi
+ else
+
+ WX_CFLAGS=""
+ WX_CPPFLAGS=""
+ WX_CXXFLAGS=""
+ WX_LIBS=""
+ WX_LIBS_STATIC=""
+ WX_RESCOMP=""
+
+ ifelse([$3], , :, [$3])
+
+ fi
+
+ AC_SUBST(WX_CPPFLAGS)
+ AC_SUBST(WX_CFLAGS)
+ AC_SUBST(WX_CXXFLAGS)
+ AC_SUBST(WX_CFLAGS_ONLY)
+ AC_SUBST(WX_CXXFLAGS_ONLY)
+ AC_SUBST(WX_LIBS)
+ AC_SUBST(WX_LIBS_STATIC)
+ AC_SUBST(WX_VERSION)
+ AC_SUBST(WX_RESCOMP)
+
+ dnl need to export also WX_VERSION_MINOR and WX_VERSION_MAJOR symbols
+ dnl to support wxpresets bakefiles (we export also WX_VERSION_MICRO for completeness):
+ WX_VERSION_MAJOR="$wx_config_major_version"
+ WX_VERSION_MINOR="$wx_config_minor_version"
+ WX_VERSION_MICRO="$wx_config_micro_version"
+ AC_SUBST(WX_VERSION_MAJOR)
+ AC_SUBST(WX_VERSION_MINOR)
+ AC_SUBST(WX_VERSION_MICRO)
+])
+
+dnl ---------------------------------------------------------------------------
+dnl Get information on the wxrc program for making C++, Python and xrs
+dnl resource files.
+dnl
+dnl AC_ARG_ENABLE(...)
+dnl AC_ARG_WITH(...)
+dnl ...
+dnl WX_CONFIG_OPTIONS
+dnl ...
+dnl WX_CONFIG_CHECK(2.6.0, wxWin=1)
+dnl if test "$wxWin" != 1; then
+dnl AC_MSG_ERROR([
+dnl wxWidgets must be installed on your system
+dnl but wx-config script couldn't be found.
+dnl
+dnl Please check that wx-config is in path, the directory
+dnl where wxWidgets libraries are installed (returned by
+dnl 'wx-config --libs' command) is in LD_LIBRARY_PATH or
+dnl equivalent variable and wxWidgets version is 2.6.0 or above.
+dnl ])
+dnl fi
+dnl
+dnl WXRC_CHECK([HAVE_WXRC=1], [HAVE_WXRC=0])
+dnl if test "x$HAVE_WXRC" != x1; then
+dnl AC_MSG_ERROR([
+dnl The wxrc program was not installed or not found.
+dnl
+dnl Please check the wxWidgets installation.
+dnl ])
+dnl fi
+dnl
+dnl CPPFLAGS="$CPPFLAGS $WX_CPPFLAGS"
+dnl CXXFLAGS="$CXXFLAGS $WX_CXXFLAGS_ONLY"
+dnl CFLAGS="$CFLAGS $WX_CFLAGS_ONLY"
+dnl
+dnl LDFLAGS="$LDFLAGS $WX_LIBS"
+dnl ---------------------------------------------------------------------------
+
+dnl ---------------------------------------------------------------------------
+dnl WXRC_CHECK([ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND]])
+dnl
+dnl Test for wxWidgets' wxrc program for creating either C++, Python or XRS
+dnl resources. The variable WXRC will be set and substituted in the configure
+dnl script and Makefiles.
+dnl
+dnl Example use:
+dnl WXRC_CHECK([wxrc=1], [wxrc=0])
+dnl ---------------------------------------------------------------------------
+
+dnl
+dnl wxrc program from the wx-config script
+dnl
+AC_DEFUN([WXRC_CHECK],
+[
+ AC_ARG_VAR([WXRC], [Path to wxWidget's wxrc resource compiler])
+
+ if test "x$WX_CONFIG_NAME" = x; then
+ AC_MSG_ERROR([The wxrc tests must run after wxWidgets test.])
+ else
+
+ AC_MSG_CHECKING([for wxrc])
+
+ if test "x$WXRC" = x ; then
+ dnl wx-config --utility is a new addition to wxWidgets:
+ _WX_PRIVATE_CHECK_VERSION(2,5,3)
+ if test -n "$wx_ver_ok"; then
+ WXRC=`$WX_CONFIG_WITH_ARGS --utility=wxrc`
+ fi
+ fi
+
+ if test "x$WXRC" = x ; then
+ AC_MSG_RESULT([not found])
+ ifelse([$2], , :, [$2])
+ else
+ AC_MSG_RESULT([$WXRC])
+ ifelse([$1], , :, [$1])
+ fi
+
+ AC_SUBST(WXRC)
+ fi
+])
+
+dnl ---------------------------------------------------------------------------
+dnl WX_LIKE_LIBNAME([output-var] [prefix], [name])
+dnl
+dnl Sets the "output-var" variable to the name of a library named with same
+dnl wxWidgets rule.
+dnl E.g. for output-var=='lib', name=='test', prefix='mine', sets
+dnl the $lib variable to:
+dnl 'mine_gtk2ud_test-2.8'
+dnl if WX_PORT=gtk2, WX_UNICODE=1, WX_DEBUG=1 and WX_RELEASE=28
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_LIKE_LIBNAME],
+ [
+ wx_temp="$2""_""$WX_PORT"
+
+ dnl add the [u][d] string
+ if test "$WX_UNICODE" = "1"; then
+ wx_temp="$wx_temp""u"
+ fi
+ if test "$WX_DEBUG" = "1"; then
+ wx_temp="$wx_temp""d"
+ fi
+
+ dnl complete the name of the lib
+ wx_temp="$wx_temp""_""$3""-$WX_VERSION_MAJOR.$WX_VERSION_MINOR"
+
+ dnl save it in the user's variable
+ $1=$wx_temp
+ ])
+
+dnl ---------------------------------------------------------------------------
+dnl WX_ARG_ENABLE_YESNOAUTO/WX_ARG_WITH_YESNOAUTO
+dnl
+dnl Two little custom macros which define the ENABLE/WITH configure arguments.
+dnl Macro arguments:
+dnl $1 = the name of the --enable / --with feature
+dnl $2 = the name of the variable associated
+dnl $3 = the description of that feature
+dnl $4 = the default value for that feature
+dnl $5 = additional action to do in case option is given with "yes" value
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_ARG_ENABLE_YESNOAUTO],
+ [AC_ARG_ENABLE($1,
+ AC_HELP_STRING([--enable-$1], [$3 (default is $4)]),
+ [], [enableval="$4"])
+
+ dnl Show a message to the user about this option
+ AC_MSG_CHECKING([for the --enable-$1 option])
+ if test "$enableval" = "yes" ; then
+ AC_MSG_RESULT([yes])
+ $2=1
+ $5
+ elif test "$enableval" = "no" ; then
+ AC_MSG_RESULT([no])
+ $2=0
+ elif test "$enableval" = "auto" ; then
+ AC_MSG_RESULT([will be automatically detected])
+ $2="auto"
+ else
+ AC_MSG_ERROR([
+ Unrecognized option value (allowed values: yes, no, auto)
+ ])
+ fi
+ ])
+
+AC_DEFUN([WX_ARG_WITH_YESNOAUTO],
+ [AC_ARG_WITH($1,
+ AC_HELP_STRING([--with-$1], [$3 (default is $4)]),
+ [], [withval="$4"])
+
+ dnl Show a message to the user about this option
+ AC_MSG_CHECKING([for the --with-$1 option])
+ if test "$withval" = "yes" ; then
+ AC_MSG_RESULT([yes])
+ $2=1
+ $5
+ dnl NB: by default we don't allow --with-$1=no option
+ dnl since it does not make much sense !
+ elif test "$6" = "1" -a "$withval" = "no" ; then
+ AC_MSG_RESULT([no])
+ $2=0
+ elif test "$withval" = "auto" ; then
+ AC_MSG_RESULT([will be automatically detected])
+ $2="auto"
+ else
+ AC_MSG_ERROR([
+ Unrecognized option value (allowed values: yes, auto)
+ ])
+ fi
+ ])
+
+
+dnl ---------------------------------------------------------------------------
+dnl WX_STANDARD_OPTIONS([options-to-add])
+dnl
+dnl Adds to the configure script one or more of the following options:
+dnl --enable-[debug|unicode|shared|wxshared|wxdebug]
+dnl --with-[gtk|msw|motif|x11|mac|dfb]
+dnl --with-wxversion
+dnl Then checks for their presence and eventually set the DEBUG, UNICODE, SHARED,
+dnl PORT, WX_SHARED, WX_DEBUG, variables to one of the "yes", "no", "auto" values.
+dnl
+dnl Note that e.g. UNICODE != WX_UNICODE; the first is the value of the
+dnl --enable-unicode option (in boolean format) while the second indicates
+dnl if wxWidgets was built in Unicode mode (and still is in boolean format).
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_STANDARD_OPTIONS],
+ [
+
+ dnl the following lines will expand to WX_ARG_ENABLE_YESNOAUTO calls if and only if
+ dnl the $1 argument contains respectively the debug,unicode or shared options.
+
+ dnl be careful here not to set debug flag if only "wxdebug" was specified
+ ifelse(regexp([$1], [\bdebug]), [-1],,
+ [WX_ARG_ENABLE_YESNOAUTO([debug], [DEBUG], [Build in debug mode], [auto])])
+
+ ifelse(index([$1], [unicode]), [-1],,
+ [WX_ARG_ENABLE_YESNOAUTO([unicode], [UNICODE], [Build in Unicode mode], [auto])])
+
+ ifelse(regexp([$1], [\bshared]), [-1],,
+ [WX_ARG_ENABLE_YESNOAUTO([shared], [SHARED], [Build as shared library], [auto])])
+
+ dnl WX_ARG_WITH_YESNOAUTO cannot be used for --with-toolkit since it's an option
+ dnl which must be able to accept the auto|gtk1|gtk2|msw|... values
+ ifelse(index([$1], [toolkit]), [-1],,
+ [
+ AC_ARG_WITH([toolkit],
+ AC_HELP_STRING([--with-toolkit],
+ [Build against a specific wxWidgets toolkit (default is auto)]),
+ [], [withval="auto"])
+
+ dnl Show a message to the user about this option
+ AC_MSG_CHECKING([for the --with-toolkit option])
+ if test "$withval" = "auto" ; then
+ AC_MSG_RESULT([will be automatically detected])
+ TOOLKIT="auto"
+ else
+ TOOLKIT="$withval"
+
+ dnl PORT must be one of the allowed values
+ if test "$TOOLKIT" != "gtk1" -a "$TOOLKIT" != "gtk2" -a \
+ "$TOOLKIT" != "msw" -a "$TOOLKIT" != "motif" -a \
+ "$TOOLKIT" != "osx_carbon" -a "$TOOLKIT" != "osx_cocoa" -a \
+ "$TOOLKIT" != "dfb" -a "$TOOLKIT" != "x11"; then
+ AC_MSG_ERROR([
+ Unrecognized option value (allowed values: auto, gtk1, gtk2, msw, motif, osx_carbon, osx_cocoa, dfb, x11)
+ ])
+ fi
+
+ AC_MSG_RESULT([$TOOLKIT])
+ fi
+ ])
+
+ dnl ****** IMPORTANT *******
+ dnl Unlike for the UNICODE setting, you can build your program in
+ dnl shared mode against a static build of wxWidgets. Thus we have the
+ dnl following option which allows these mixtures. E.g.
+ dnl
+ dnl ./configure --disable-shared --with-wxshared
+ dnl
+ dnl will build your library in static mode against the first available
+ dnl shared build of wxWidgets.
+ dnl
+ dnl Note that's not possible to do the viceversa:
+ dnl
+ dnl ./configure --enable-shared --without-wxshared
+ dnl
+ dnl Doing so you would try to build your library in shared mode against a static
+ dnl build of wxWidgets. This is not possible (you would mix PIC and non PIC code) !
+ dnl A check for this combination of options is in WX_DETECT_STANDARD_OPTION_VALUES
+ dnl (where we know what 'auto' should be expanded to).
+ dnl
+ dnl If you try to build something in ANSI mode against a UNICODE build
+ dnl of wxWidgets or in RELEASE mode against a DEBUG build of wxWidgets,
+ dnl then at best you'll get ton of linking errors !
+ dnl ************************
+
+ ifelse(index([$1], [wxshared]), [-1],,
+ [
+ WX_ARG_WITH_YESNOAUTO(
+ [wxshared], [WX_SHARED],
+ [Force building against a shared build of wxWidgets, even if --disable-shared is given],
+ [auto], [], [1])
+ ])
+
+ dnl Just like for SHARED and WX_SHARED it may happen that some adventurous
+ dnl peoples will want to mix a wxWidgets release build with a debug build of
+ dnl his app/lib. So, we have both DEBUG and WX_DEBUG variables.
+ ifelse(index([$1], [wxdebug]), [-1],,
+ [
+ WX_ARG_WITH_YESNOAUTO(
+ [wxdebug], [WX_DEBUG],
+ [Force building against a debug build of wxWidgets, even if --disable-debug is given],
+ [auto], [], [1])
+ ])
+
+ dnl WX_ARG_WITH_YESNOAUTO cannot be used for --with-wxversion since it's an option
+ dnl which accepts the "auto|2.6|2.7|2.8|2.9|3.0" etc etc values
+ ifelse(index([$1], [wxversion]), [-1],,
+ [
+ AC_ARG_WITH([wxversion],
+ AC_HELP_STRING([--with-wxversion],
+ [Build against a specific version of wxWidgets (default is auto)]),
+ [], [withval="auto"])
+
+ dnl Show a message to the user about this option
+ AC_MSG_CHECKING([for the --with-wxversion option])
+ if test "$withval" = "auto" ; then
+ AC_MSG_RESULT([will be automatically detected])
+ WX_RELEASE="auto"
+ else
+
+ wx_requested_major_version=`echo $withval | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).*/\1/'`
+ wx_requested_minor_version=`echo $withval | \
+ sed 's/\([[0-9]]*\).\([[0-9]]*\).*/\2/'`
+
+ dnl both vars above must be exactly 1 digit
+ if test "${#wx_requested_major_version}" != "1" -o \
+ "${#wx_requested_minor_version}" != "1" ; then
+ AC_MSG_ERROR([
+ Unrecognized option value (allowed values: auto, 2.6, 2.7, 2.8, 2.9, 3.0)
+ ])
+ fi
+
+ WX_RELEASE="$wx_requested_major_version"".""$wx_requested_minor_version"
+ AC_MSG_RESULT([$WX_RELEASE])
+ fi
+ ])
+
+ if test "$WX_DEBUG_CONFIGURE" = "1"; then
+ echo "[[dbg]] DEBUG: $DEBUG, WX_DEBUG: $WX_DEBUG"
+ echo "[[dbg]] UNICODE: $UNICODE, WX_UNICODE: $WX_UNICODE"
+ echo "[[dbg]] SHARED: $SHARED, WX_SHARED: $WX_SHARED"
+ echo "[[dbg]] TOOLKIT: $TOOLKIT, WX_TOOLKIT: $WX_TOOLKIT"
+ echo "[[dbg]] VERSION: $VERSION, WX_RELEASE: $WX_RELEASE"
+ fi
+ ])
+
+
+dnl ---------------------------------------------------------------------------
+dnl WX_CONVERT_STANDARD_OPTIONS_TO_WXCONFIG_FLAGS
+dnl
+dnl Sets the WXCONFIG_FLAGS string using the SHARED,DEBUG,UNICODE variable values
+dnl which are different from "auto".
+dnl Thus this macro needs to be called only once all options have been set.
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_CONVERT_STANDARD_OPTIONS_TO_WXCONFIG_FLAGS],
+ [
+ if test "$WX_SHARED" = "1" ; then
+ WXCONFIG_FLAGS="--static=no "
+ elif test "$WX_SHARED" = "0" ; then
+ WXCONFIG_FLAGS="--static=yes "
+ fi
+
+ if test "$WX_DEBUG" = "1" ; then
+ WXCONFIG_FLAGS="$WXCONFIG_FLAGS""--debug=yes "
+ elif test "$WX_DEBUG" = "0" ; then
+ WXCONFIG_FLAGS="$WXCONFIG_FLAGS""--debug=no "
+ fi
+
+ dnl The user should have set WX_UNICODE=UNICODE
+ if test "$WX_UNICODE" = "1" ; then
+ WXCONFIG_FLAGS="$WXCONFIG_FLAGS""--unicode=yes "
+ elif test "$WX_UNICODE" = "0" ; then
+ WXCONFIG_FLAGS="$WXCONFIG_FLAGS""--unicode=no "
+ fi
+
+ if test "$TOOLKIT" != "auto" ; then
+ WXCONFIG_FLAGS="$WXCONFIG_FLAGS""--toolkit=$TOOLKIT "
+ fi
+
+ if test "$WX_RELEASE" != "auto" ; then
+ WXCONFIG_FLAGS="$WXCONFIG_FLAGS""--version=$WX_RELEASE "
+ fi
+
+ dnl strip out the last space of the string
+ WXCONFIG_FLAGS=${WXCONFIG_FLAGS% }
+
+ if test "$WX_DEBUG_CONFIGURE" = "1"; then
+ echo "[[dbg]] WXCONFIG_FLAGS: $WXCONFIG_FLAGS"
+ fi
+ ])
+
+
+dnl ---------------------------------------------------------------------------
+dnl _WX_SELECTEDCONFIG_CHECKFOR([RESULTVAR], [STRING], [MSG]
+dnl [, ACTION-IF-FOUND [, ACTION-IF-NOT-FOUND]])
+dnl
+dnl Outputs the given MSG. Then searches the given STRING in the wxWidgets
+dnl additional CPP flags and put the result of the search in WX_$RESULTVAR
+dnl also adding the "yes" or "no" message result to MSG.
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([_WX_SELECTEDCONFIG_CHECKFOR],
+ [
+ if test "$$1" = "auto" ; then
+
+ dnl The user does not have particular preferences for this option;
+ dnl so we will detect the wxWidgets relative build setting and use it
+ AC_MSG_CHECKING([$3])
+
+ dnl set WX_$1 variable to 1 if the $WX_SELECTEDCONFIG contains the $2
+ dnl string or to 0 otherwise.
+ dnl NOTE: 'expr match STRING REGEXP' cannot be used since on Mac it
+ dnl doesn't work; we use 'expr STRING : REGEXP' instead
+ WX_$1=$(expr "$WX_SELECTEDCONFIG" : ".*$2.*")
+
+ if test "$WX_$1" != "0"; then
+ WX_$1=1
+ AC_MSG_RESULT([yes])
+ ifelse([$4], , :, [$4])
+ else
+ WX_$1=0
+ AC_MSG_RESULT([no])
+ ifelse([$5], , :, [$5])
+ fi
+ else
+
+ dnl Use the setting given by the user
+ WX_$1=$$1
+ fi
+ ])
+
+dnl ---------------------------------------------------------------------------
+dnl WX_DETECT_STANDARD_OPTION_VALUES
+dnl
+dnl Detects the values of the following variables:
+dnl 1) WX_RELEASE
+dnl 2) WX_UNICODE
+dnl 3) WX_DEBUG
+dnl 4) WX_SHARED (and also WX_STATIC)
+dnl 5) WX_PORT
+dnl from the previously selected wxWidgets build; this macro in fact must be
+dnl called *after* calling the WX_CONFIG_CHECK macro.
+dnl
+dnl Note that the WX_VERSION_MAJOR, WX_VERSION_MINOR symbols are already set
+dnl by WX_CONFIG_CHECK macro
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_DETECT_STANDARD_OPTION_VALUES],
+ [
+ dnl IMPORTANT: WX_VERSION contains all three major.minor.micro digits,
+ dnl while WX_RELEASE only the major.minor ones.
+ WX_RELEASE="$WX_VERSION_MAJOR""$WX_VERSION_MINOR"
+ if test $WX_RELEASE -lt 26 ; then
+
+ AC_MSG_ERROR([
+ Cannot detect the wxWidgets configuration for the selected wxWidgets build
+ since its version is $WX_VERSION < 2.6.0; please install a newer
+ version of wxWidgets.
+ ])
+ fi
+
+ dnl The wx-config we are using understands the "--selected_config"
+ dnl option which returns an easy-parseable string !
+ WX_SELECTEDCONFIG=$($WX_CONFIG_WITH_ARGS --selected_config)
+
+ if test "$WX_DEBUG_CONFIGURE" = "1"; then
+ echo "[[dbg]] Using wx-config --selected-config"
+ echo "[[dbg]] WX_SELECTEDCONFIG: $WX_SELECTEDCONFIG"
+ fi
+
+
+ dnl we could test directly for WX_SHARED with a line like:
+ dnl _WX_SELECTEDCONFIG_CHECKFOR([SHARED], [shared],
+ dnl [if wxWidgets was built in SHARED mode])
+ dnl but wx-config --selected-config DOES NOT outputs the 'shared'
+ dnl word when wx was built in shared mode; it rather outputs the
+ dnl 'static' word when built in static mode.
+ if test $WX_SHARED = "1"; then
+ STATIC=0
+ elif test $WX_SHARED = "0"; then
+ STATIC=1
+ elif test $WX_SHARED = "auto"; then
+ STATIC="auto"
+ fi
+
+ dnl Now set the WX_UNICODE, WX_DEBUG, WX_STATIC variables
+ _WX_SELECTEDCONFIG_CHECKFOR([UNICODE], [unicode],
+ [if wxWidgets was built with UNICODE enabled])
+ _WX_SELECTEDCONFIG_CHECKFOR([DEBUG], [debug],
+ [if wxWidgets was built in DEBUG mode])
+ _WX_SELECTEDCONFIG_CHECKFOR([STATIC], [static],
+ [if wxWidgets was built in STATIC mode])
+
+ dnl init WX_SHARED from WX_STATIC
+ if test "$WX_STATIC" != "0"; then
+ WX_SHARED=0
+ else
+ WX_SHARED=1
+ fi
+
+ AC_SUBST(WX_UNICODE)
+ AC_SUBST(WX_DEBUG)
+ AC_SUBST(WX_SHARED)
+
+ dnl detect the WX_PORT to use
+ if test "$TOOLKIT" = "auto" ; then
+
+ dnl The user does not have particular preferences for this option;
+ dnl so we will detect the wxWidgets relative build setting and use it
+ AC_MSG_CHECKING([which wxWidgets toolkit was selected])
+
+ WX_GTKPORT1=$(expr "$WX_SELECTEDCONFIG" : ".*gtk1.*")
+ WX_GTKPORT2=$(expr "$WX_SELECTEDCONFIG" : ".*gtk2.*")
+ WX_MSWPORT=$(expr "$WX_SELECTEDCONFIG" : ".*msw.*")
+ WX_MOTIFPORT=$(expr "$WX_SELECTEDCONFIG" : ".*motif.*")
+ WX_OSXCOCOAPORT=$(expr "$WX_SELECTEDCONFIG" : ".*osx_cocoa.*")
+ WX_OSXCARBONPORT=$(expr "$WX_SELECTEDCONFIG" : ".*osx_carbon.*")
+ WX_X11PORT=$(expr "$WX_SELECTEDCONFIG" : ".*x11.*")
+ WX_DFBPORT=$(expr "$WX_SELECTEDCONFIG" : ".*dfb.*")
+
+ WX_PORT="unknown"
+ if test "$WX_GTKPORT1" != "0"; then WX_PORT="gtk1"; fi
+ if test "$WX_GTKPORT2" != "0"; then WX_PORT="gtk2"; fi
+ if test "$WX_MSWPORT" != "0"; then WX_PORT="msw"; fi
+ if test "$WX_MOTIFPORT" != "0"; then WX_PORT="motif"; fi
+ if test "$WX_OSXCOCOAPORT" != "0"; then WX_PORT="osx_cocoa"; fi
+ if test "$WX_OSXCARBONPORT" != "0"; then WX_PORT="osx_carbon"; fi
+ if test "$WX_X11PORT" != "0"; then WX_PORT="x11"; fi
+ if test "$WX_DFBPORT" != "0"; then WX_PORT="dfb"; fi
+
+ dnl NOTE: backward-compatible check for wx2.8; in wx2.9 the mac
+ dnl ports are called 'osx_cocoa' and 'osx_carbon' (see above)
+ WX_MACPORT=$(expr "$WX_SELECTEDCONFIG" : ".*mac.*")
+ if test "$WX_MACPORT" != "0"; then WX_PORT="mac"; fi
+
+ dnl check at least one of the WX_*PORT has been set !
+
+ if test "$WX_PORT" = "unknown" ; then
+ AC_MSG_ERROR([
+ Cannot detect the currently installed wxWidgets port !
+ Please check your 'wx-config --cxxflags'...
+ ])
+ fi
+
+ AC_MSG_RESULT([$WX_PORT])
+ else
+
+ dnl Use the setting given by the user
+ if test -z "$TOOLKIT" ; then
+ WX_PORT=$TOOLKIT
+ else
+ dnl try with PORT
+ WX_PORT=$PORT
+ fi
+ fi
+
+ AC_SUBST(WX_PORT)
+
+ if test "$WX_DEBUG_CONFIGURE" = "1"; then
+ echo "[[dbg]] Values of all WX_* options after final detection:"
+ echo "[[dbg]] WX_DEBUG: $WX_DEBUG"
+ echo "[[dbg]] WX_UNICODE: $WX_UNICODE"
+ echo "[[dbg]] WX_SHARED: $WX_SHARED"
+ echo "[[dbg]] WX_RELEASE: $WX_RELEASE"
+ echo "[[dbg]] WX_PORT: $WX_PORT"
+ fi
+
+ dnl Avoid problem described in the WX_STANDARD_OPTIONS which happens when
+ dnl the user gives the options:
+ dnl ./configure --enable-shared --without-wxshared
+ dnl or just do
+ dnl ./configure --enable-shared
+ dnl but there is only a static build of wxWidgets available.
+ if test "$WX_SHARED" = "0" -a "$SHARED" = "1"; then
+ AC_MSG_ERROR([
+ Cannot build shared library against a static build of wxWidgets !
+ This error happens because the wxWidgets build which was selected
+ has been detected as static while you asked to build $PACKAGE_NAME
+ as shared library and this is not possible.
+ Use the '--disable-shared' option to build $PACKAGE_NAME
+ as static library or '--with-wxshared' to use wxWidgets as shared library.
+ ])
+ fi
+
+ dnl now we can finally update the DEBUG,UNICODE,SHARED options
+ dnl to their final values if they were set to 'auto'
+ if test "$DEBUG" = "auto"; then
+ DEBUG=$WX_DEBUG
+ fi
+ if test "$UNICODE" = "auto"; then
+ UNICODE=$WX_UNICODE
+ fi
+ if test "$SHARED" = "auto"; then
+ SHARED=$WX_SHARED
+ fi
+ if test "$TOOLKIT" = "auto"; then
+ TOOLKIT=$WX_PORT
+ fi
+
+ dnl in case the user needs a BUILD=debug/release var...
+ if test "$DEBUG" = "1"; then
+ BUILD="debug"
+ elif test "$DEBUG" = "0" -o "$DEBUG" = ""; then
+ BUILD="release"
+ fi
+
+ dnl respect the DEBUG variable adding the optimize/debug flags
+ dnl NOTE: the CXXFLAGS are merged together with the CPPFLAGS so we
+ dnl don't need to set them, too
+ if test "$DEBUG" = "1"; then
+ CXXFLAGS="$CXXFLAGS -g -O0"
+ CFLAGS="$CFLAGS -g -O0"
+ else
+ CXXFLAGS="$CXXFLAGS -O2"
+ CFLAGS="$CFLAGS -O2"
+ fi
+ ])
+
+dnl ---------------------------------------------------------------------------
+dnl WX_BOOLOPT_SUMMARY([name of the boolean variable to show summary for],
+dnl [what to print when var is 1],
+dnl [what to print when var is 0])
+dnl
+dnl Prints $2 when variable $1 == 1 and prints $3 when variable $1 == 0.
+dnl This macro mainly exists just to make configure.ac scripts more readable.
+dnl
+dnl NOTE: you need to use the [" my message"] syntax for 2nd and 3rd arguments
+dnl if you want that m4 avoid to throw away the spaces prefixed to the
+dnl argument value.
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_BOOLOPT_SUMMARY],
+ [
+ if test "x$$1" = "x1" ; then
+ echo $2
+ elif test "x$$1" = "x0" ; then
+ echo $3
+ else
+ echo "$1 is $$1"
+ fi
+ ])
+
+dnl ---------------------------------------------------------------------------
+dnl WX_STANDARD_OPTIONS_SUMMARY_MSG
+dnl
+dnl Shows a summary message to the user about the WX_* variable contents.
+dnl This macro is used typically at the end of the configure script.
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_STANDARD_OPTIONS_SUMMARY_MSG],
+ [
+ echo
+ echo " The wxWidgets build which will be used by $PACKAGE_NAME $PACKAGE_VERSION"
+ echo " has the following settings:"
+ WX_BOOLOPT_SUMMARY([WX_DEBUG], [" - DEBUG build"], [" - RELEASE build"])
+ WX_BOOLOPT_SUMMARY([WX_UNICODE], [" - UNICODE mode"], [" - ANSI mode"])
+ WX_BOOLOPT_SUMMARY([WX_SHARED], [" - SHARED mode"], [" - STATIC mode"])
+ echo " - VERSION: $WX_VERSION"
+ echo " - PORT: $WX_PORT"
+ ])
+
+
+dnl ---------------------------------------------------------------------------
+dnl WX_STANDARD_OPTIONS_SUMMARY_MSG_BEGIN, WX_STANDARD_OPTIONS_SUMMARY_MSG_END
+dnl
+dnl Like WX_STANDARD_OPTIONS_SUMMARY_MSG macro but these two macros also gives info
+dnl about the configuration of the package which used the wxpresets.
+dnl
+dnl Typical usage:
+dnl WX_STANDARD_OPTIONS_SUMMARY_MSG_BEGIN
+dnl echo " - Package setting 1: $SETTING1"
+dnl echo " - Package setting 2: $SETTING1"
+dnl ...
+dnl WX_STANDARD_OPTIONS_SUMMARY_MSG_END
+dnl
+dnl ---------------------------------------------------------------------------
+AC_DEFUN([WX_STANDARD_OPTIONS_SUMMARY_MSG_BEGIN],
+ [
+ echo
+ echo " ----------------------------------------------------------------"
+ echo " Configuration for $PACKAGE_NAME $PACKAGE_VERSION successfully completed."
+ echo " Summary of main configuration settings for $PACKAGE_NAME:"
+ WX_BOOLOPT_SUMMARY([DEBUG], [" - DEBUG build"], [" - RELEASE build"])
+ WX_BOOLOPT_SUMMARY([UNICODE], [" - UNICODE mode"], [" - ANSI mode"])
+ WX_BOOLOPT_SUMMARY([SHARED], [" - SHARED mode"], [" - STATIC mode"])
+ ])
+
+AC_DEFUN([WX_STANDARD_OPTIONS_SUMMARY_MSG_END],
+ [
+ WX_STANDARD_OPTIONS_SUMMARY_MSG
+ echo
+ echo " Now, just run make."
+ echo " ----------------------------------------------------------------"
+ echo
+ ])
+
+
+dnl ---------------------------------------------------------------------------
+dnl Deprecated macro wrappers
+dnl ---------------------------------------------------------------------------
+
+AC_DEFUN([AM_OPTIONS_WXCONFIG], [WX_CONFIG_OPTIONS])
+AC_DEFUN([AM_PATH_WXCONFIG], [
+ WX_CONFIG_CHECK([$1],[$2],[$3],[$4],[$5])
+])
+AC_DEFUN([AM_PATH_WXRC], [WXRC_CHECK([$1],[$2])])