aboutsummaryrefslogtreecommitdiffstats
path: root/lib
diff options
context:
space:
mode:
Diffstat (limited to 'lib')
-rw-r--r--lib/Makefile12
-rw-r--r--lib/asn1/doc/src/asn1ct.xml6
-rw-r--r--lib/asn1/src/asn1ct.erl29
-rw-r--r--lib/asn1/src/asn1ct_check.erl50
-rw-r--r--lib/asn1/src/asn1ct_value.erl8
-rw-r--r--lib/asn1/test/asn1_SUITE.erl.src4
-rw-r--r--lib/asn1/test/test_compile_options.erl39
-rw-r--r--lib/common_test/doc/src/common_test_app.xml2
-rw-r--r--lib/common_test/doc/src/ct_hooks.xml10
-rw-r--r--lib/common_test/doc/src/ct_hooks_chapter.xml19
-rw-r--r--lib/common_test/doc/src/run_test_chapter.xml2
-rw-r--r--lib/common_test/src/ct_framework.erl14
-rw-r--r--lib/common_test/src/ct_hooks.erl143
-rw-r--r--lib/common_test/src/ct_run.erl25
-rw-r--r--lib/common_test/test/ct_hooks_SUITE.erl80
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl62
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl11
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl74
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl2
-rw-r--r--lib/compiler/src/beam_disasm.erl2
-rw-r--r--lib/compiler/src/compile.erl50
-rw-r--r--lib/compiler/src/sys_pre_expand.erl6
-rw-r--r--lib/compiler/test/Makefile1
-rw-r--r--lib/compiler/test/beam_disasm_SUITE.erl65
-rw-r--r--lib/compiler/test/error_SUITE.erl65
-rw-r--r--lib/cosFileTransfer/src/CosFileTransfer_FileTransferSession_impl.erl2
-rw-r--r--lib/crypto/c_src/Makefile.in5
-rw-r--r--lib/crypto/c_src/crypto.c58
-rw-r--r--lib/crypto/doc/src/crypto.xml8
-rw-r--r--lib/crypto/src/crypto.erl13
-rw-r--r--lib/crypto/test/crypto_SUITE.erl52
-rw-r--r--lib/dialyzer/src/dialyzer_dataflow.erl52
-rw-r--r--lib/dialyzer/src/dialyzer_typesig.erl204
-rw-r--r--lib/dialyzer/test/Makefile2
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/asn18
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/inets43
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/mnesia3
-rw-r--r--lib/dialyzer/test/race_SUITE_data/results/extract_translations4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/common_eunit2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/comparisons153
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/failing_funs20
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/flatten2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/my_sofs4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl8
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/codec_can.erl35
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl121
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/comparisons.erl322
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl250
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl21
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl42
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl7
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl19
-rw-r--r--lib/diameter/doc/src/diameter_dict.xml9
-rw-r--r--lib/diameter/make/rules.mk.in4
-rw-r--r--lib/diameter/src/compiler/diameter_codegen.erl78
-rw-r--r--lib/diameter/src/compiler/diameter_spec_util.erl50
-rw-r--r--lib/diameter/src/transport/diameter_sctp.erl19
-rw-r--r--lib/diameter/test/Makefile2
-rw-r--r--lib/docbuilder/src/docb_gen.erl4
-rw-r--r--lib/docbuilder/src/docb_transform.erl2
-rw-r--r--lib/docbuilder/src/docb_xml_check.erl1
-rw-r--r--lib/docbuilder/vsn.mk2
-rw-r--r--lib/edoc/Makefile2
-rw-r--r--lib/edoc/doc/Makefile2
-rw-r--r--lib/edoc/doc/overview.edoc7
-rw-r--r--lib/edoc/doc/src/Makefile2
-rw-r--r--lib/edoc/include/Makefile2
-rw-r--r--lib/edoc/priv/edoc_generate.src3
-rw-r--r--lib/edoc/src/Makefile2
-rw-r--r--lib/edoc/src/edoc.erl19
-rw-r--r--lib/edoc/src/edoc_data.erl2
-rw-r--r--lib/edoc/src/edoc_doclet.erl4
-rw-r--r--lib/edoc/src/edoc_extract.erl10
-rw-r--r--lib/edoc/src/edoc_layout.erl20
-rw-r--r--lib/edoc/src/edoc_lib.erl6
-rw-r--r--lib/edoc/src/edoc_parser.yrl7
-rw-r--r--lib/edoc/src/edoc_report.erl2
-rw-r--r--lib/edoc/src/edoc_run.erl2
-rw-r--r--lib/edoc/src/edoc_scanner.erl2
-rw-r--r--lib/edoc/src/edoc_specs.erl10
-rw-r--r--lib/edoc/src/edoc_tags.erl2
-rw-r--r--lib/edoc/src/edoc_types.erl7
-rw-r--r--lib/edoc/src/edoc_wiki.erl13
-rw-r--r--lib/edoc/src/otpsgml_layout.erl4
-rw-r--r--lib/edoc/test/edoc_SUITE.erl2
-rwxr-xr-xlib/erl_docgen/priv/bin/xref_mod_app.escript7
-rw-r--r--lib/erl_docgen/priv/xsl/db_html.xsl2
-rw-r--r--lib/erl_docgen/priv/xsl/db_man.xsl2
-rw-r--r--lib/erl_docgen/priv/xsl/db_pdf.xsl31
-rw-r--r--lib/erl_docgen/priv/xsl/db_pdf_params.xsl4
-rw-r--r--lib/erl_interface/doc/src/ei.xml6
-rw-r--r--lib/erl_interface/src/connect/ei_resolve.c7
-rw-r--r--lib/erl_interface/src/encode/encode_atom.c6
-rw-r--r--lib/erl_interface/src/encode/encode_string.c6
-rw-r--r--lib/erl_interface/src/legacy/erl_fix_alloc.c4
-rw-r--r--lib/erl_interface/src/misc/ei_decode_term.c10
-rw-r--r--lib/erl_interface/src/registry/reg_dump.c1
-rw-r--r--lib/erl_interface/src/registry/reg_restore.c5
-rw-r--r--lib/erl_interface/test/port_call_SUITE_data/Makefile.src2
-rw-r--r--lib/et/src/et_wx_viewer.erl4
-rw-r--r--lib/eunit/doc/overview.edoc2
-rw-r--r--lib/eunit/include/eunit.hrl102
-rw-r--r--lib/eunit/src/eunit.app.src16
-rw-r--r--lib/eunit/src/eunit.erl2
-rw-r--r--lib/eunit/src/eunit_data.erl70
-rw-r--r--lib/eunit/src/eunit_server.erl7
-rw-r--r--lib/eunit/src/eunit_surefire.erl58
-rw-r--r--lib/eunit/src/eunit_test.erl72
-rw-r--r--lib/eunit/src/eunit_tests.erl26
-rw-r--r--lib/eunit/vsn.mk2
-rw-r--r--lib/gs/contribs/bonk/sounder.erl18
-rw-r--r--lib/gs/contribs/cols/cols.erl4
-rw-r--r--lib/gs/contribs/mandel/mandel.erl2
-rw-r--r--lib/gs/contribs/othello/othello_board.erl4
-rw-r--r--lib/gs/examples/calc2.erl2
-rw-r--r--lib/hipe/cerl/erl_bif_types.erl117
-rw-r--r--lib/hipe/cerl/erl_types.erl16
-rw-r--r--lib/hipe/icode/hipe_beam_to_icode.erl2
-rw-r--r--lib/hipe/main/hipe.hrl.src7
-rw-r--r--lib/hipe/regalloc/hipe_node_sets.erl2
-rw-r--r--lib/hipe/rtl/hipe_rtl_lcm.erl2
-rw-r--r--lib/ic/doc/src/notes.xml18
-rw-r--r--lib/ic/src/ic.erl2
-rw-r--r--lib/ic/src/ic_pp.erl472
-rw-r--r--lib/ic/src/ic_pragma.erl19
-rw-r--r--lib/ic/vsn.mk2
-rw-r--r--lib/inets/Makefile4
-rw-r--r--lib/inets/doc/src/http_server.xml2
-rw-r--r--lib/inets/doc/src/httpc.xml180
-rw-r--r--lib/inets/doc/src/mod_auth.xml2
-rw-r--r--lib/inets/doc/src/mod_esi.xml12
-rw-r--r--lib/inets/doc/src/notes.xml108
-rw-r--r--lib/inets/doc/src/notes_history.xml2
-rw-r--r--lib/inets/src/ftp/ftp.erl4
-rw-r--r--lib/inets/src/http_client/httpc.erl37
-rw-r--r--lib/inets/src/http_client/httpc_cookie.erl216
-rw-r--r--lib/inets/src/http_client/httpc_handler.erl15
-rw-r--r--lib/inets/src/http_client/httpc_manager.erl6
-rw-r--r--lib/inets/src/http_lib/http_transport.erl211
-rw-r--r--lib/inets/src/http_lib/http_util.erl16
-rw-r--r--lib/inets/src/http_server/httpd_conf.erl2
-rw-r--r--lib/inets/src/http_server/httpd_esi.erl2
-rw-r--r--lib/inets/src/http_server/httpd_file.erl2
-rw-r--r--lib/inets/src/http_server/httpd_request.erl4
-rw-r--r--lib/inets/src/http_server/mod_auth_mnesia.erl2
-rw-r--r--lib/inets/src/inets_app/inets.appup.src38
-rw-r--r--lib/inets/test/ftp_suite_lib.erl35
-rw-r--r--lib/inets/test/http_format_SUITE.erl4
-rw-r--r--lib/inets/test/httpc_SUITE.erl560
-rw-r--r--lib/inets/test/httpc_cookie_SUITE.erl115
-rw-r--r--lib/inets/test/httpd_SUITE.erl308
-rw-r--r--lib/inets/test/httpd_test_lib.erl91
-rw-r--r--lib/inets/test/inets_test_lib.erl151
-rw-r--r--lib/inets/vsn.mk2
-rw-r--r--lib/kernel/doc/src/Makefile2
-rw-r--r--lib/kernel/doc/src/code.xml339
-rw-r--r--lib/kernel/doc/src/file.xml21
-rw-r--r--lib/kernel/doc/src/gen_sctp.xml148
-rw-r--r--lib/kernel/doc/src/gen_tcp.xml25
-rw-r--r--lib/kernel/doc/src/gen_udp.xml21
-rw-r--r--lib/kernel/doc/src/inet.xml68
-rw-r--r--lib/kernel/doc/src/notes.xml2
-rw-r--r--lib/kernel/doc/src/os.xml3
-rw-r--r--lib/kernel/examples/uds_dist/c_src/uds_drv.c6
-rw-r--r--lib/kernel/src/auth.erl4
-rw-r--r--lib/kernel/src/code.erl135
-rw-r--r--lib/kernel/src/code_server.erl17
-rw-r--r--lib/kernel/src/file.erl18
-rw-r--r--lib/kernel/src/gen_sctp.erl174
-rw-r--r--lib/kernel/src/gen_tcp.erl120
-rw-r--r--lib/kernel/src/gen_udp.erl87
-rw-r--r--lib/kernel/src/inet.erl147
-rw-r--r--lib/kernel/src/inet_config.erl52
-rw-r--r--lib/kernel/src/inet_dns_record_adts.pl12
-rw-r--r--lib/kernel/src/inet_res.erl4
-rw-r--r--lib/kernel/src/rpc.erl5
-rw-r--r--lib/kernel/test/application_SUITE.erl44
-rw-r--r--lib/kernel/test/code_SUITE.erl18
-rw-r--r--lib/kernel/test/disk_log_SUITE.erl4
-rw-r--r--lib/kernel/test/erl_prim_loader_SUITE.erl2
-rw-r--r--lib/kernel/test/file_SUITE.erl2
-rw-r--r--lib/kernel/test/gen_tcp_api_SUITE.erl8
-rw-r--r--lib/kernel/test/gen_udp_SUITE.erl15
-rw-r--r--lib/kernel/test/global_group_SUITE.erl16
-rw-r--r--lib/kernel/test/init_SUITE.erl2
-rw-r--r--lib/kernel/test/ram_file_SUITE.erl4
-rw-r--r--lib/kernel/test/zlib_SUITE.erl8
-rw-r--r--lib/kernel/vsn.mk2
-rw-r--r--lib/megaco/doc/src/notes.xml42
-rw-r--r--lib/megaco/src/app/megaco.appup.src11
-rw-r--r--lib/megaco/vsn.mk2
-rw-r--r--lib/mnesia/src/Makefile4
-rw-r--r--lib/mnesia/src/mnesia_controller.erl47
-rw-r--r--lib/mnesia/src/mnesia_dumper.erl9
-rw-r--r--lib/mnesia/src/mnesia_lib.erl6
-rw-r--r--lib/mnesia/src/mnesia_loader.erl244
-rw-r--r--lib/mnesia/src/mnesia_log.erl5
-rw-r--r--lib/mnesia/src/mnesia_monitor.erl84
-rw-r--r--lib/mnesia/src/mnesia_recover.erl6
-rw-r--r--lib/mnesia/src/mnesia_schema.erl505
-rw-r--r--lib/observer/src/Makefile9
-rw-r--r--lib/odbc/c_src/odbcserver.c71
-rw-r--r--lib/odbc/c_src/odbcserver.h1
-rw-r--r--lib/odbc/doc/src/databases.xml4
-rw-r--r--lib/odbc/doc/src/odbc.xml2
-rw-r--r--lib/odbc/src/odbc.appup.src6
-rw-r--r--lib/odbc/src/odbc.erl7
-rw-r--r--lib/odbc/src/odbc_internal.hrl1
-rw-r--r--lib/odbc/test/Makefile3
-rw-r--r--lib/odbc/test/mysql.erl277
-rw-r--r--lib/odbc/test/odbc.dynspec31
-rw-r--r--lib/odbc/test/odbc.spec24
-rw-r--r--lib/odbc/test/odbc.spec.win5
-rw-r--r--lib/odbc/test/odbc_connect_SUITE.erl237
-rw-r--r--lib/odbc/test/odbc_data_type_SUITE.erl516
-rw-r--r--lib/odbc/test/odbc_query_SUITE.erl64
-rw-r--r--lib/odbc/test/odbc_start_SUITE.erl27
-rw-r--r--lib/odbc/test/odbc_test.hrl13
-rw-r--r--lib/odbc/test/odbc_test_lib.erl60
-rw-r--r--lib/odbc/test/oracle.erl12
-rw-r--r--lib/odbc/test/postgres.erl23
-rw-r--r--lib/odbc/test/sqlserver.erl12
-rw-r--r--lib/odbc/vsn.mk2
-rw-r--r--lib/orber/include/Makefile66
-rw-r--r--lib/os_mon/c_src/cpu_sup.c19
-rw-r--r--lib/parsetools/doc/src/leex.xml4
-rw-r--r--lib/parsetools/doc/src/yecc.xml12
-rw-r--r--lib/parsetools/src/leex.erl177
-rw-r--r--lib/parsetools/src/yecc.erl53
-rw-r--r--lib/parsetools/test/leex_SUITE.erl20
-rw-r--r--lib/parsetools/test/yecc_SUITE.erl14
-rw-r--r--lib/percept/src/percept_db.erl11
-rw-r--r--lib/public_key/asn1/README2
-rw-r--r--lib/public_key/doc/src/public_key.xml18
-rw-r--r--lib/public_key/src/pubkey_cert.erl4
-rw-r--r--lib/public_key/src/public_key.appup.src12
-rw-r--r--lib/public_key/src/public_key.erl17
-rw-r--r--lib/public_key/test/public_key_SUITE.erl5
-rw-r--r--lib/public_key/vsn.mk2
-rw-r--r--lib/reltool/src/reltool_sys_win.erl133
-rw-r--r--lib/runtime_tools/doc/src/dbg.xml10
-rw-r--r--lib/sasl/doc/src/release_handler.xml28
-rw-r--r--lib/sasl/doc/src/systools.xml10
-rw-r--r--lib/sasl/examples/src/Makefile2
-rw-r--r--lib/sasl/src/erlsrv.erl31
-rw-r--r--lib/sasl/src/release_handler.erl241
-rw-r--r--lib/sasl/src/release_handler_1.erl289
-rw-r--r--lib/sasl/src/systools_lib.erl40
-rw-r--r--lib/sasl/src/systools_make.erl180
-rw-r--r--lib/sasl/src/systools_relup.erl68
-rw-r--r--lib/sasl/test/Makefile5
-rw-r--r--lib/sasl/test/installer.erl80
-rw-r--r--lib/sasl/test/release_handler_SUITE.erl742
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/Makefile.src117
-rwxr-xr-xlib/sasl/test/release_handler_SUITE_data/clients/start_cli138
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/erl.ini.src4
-rwxr-xr-xlib/sasl/test/release_handler_SUITE_data/heart_restart.bat3
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/README33
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.app (renamed from lib/sasl/test/release_handler_SUITE_data/lib/a-1.0/src/a.app)4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.appup3
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/priv/file0
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a.erl54
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a_sup.erl37
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/ebin/b.app7
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_lib.erl3
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_server.erl37
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.app7
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup6
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_lib.erl3
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_server.erl37
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/installer-1.0/ebin/installer.app2
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app17
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl11
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app17
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup22
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl11
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl4
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app7
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup24
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl11
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/ebin/dummy.app7
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_app.erl9
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_server.erl56
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup.erl15
-rw-r--r--lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup_2.erl15
-rwxr-xr-xlib/sasl/test/release_handler_SUITE_data/start_client (renamed from lib/sasl/test/release_handler_SUITE_data/clients/start_cli2)2
-rw-r--r--lib/sasl/test/rh_test_lib.erl100
-rw-r--r--lib/sasl/test/systools_SUITE.erl87
-rw-r--r--lib/snmp/Makefile5
-rw-r--r--lib/snmp/doc/src/Makefile4
-rw-r--r--lib/snmp/doc/src/notes.xml186
-rw-r--r--lib/snmp/doc/src/snmpc.xml15
-rw-r--r--lib/snmp/doc/src/snmpc_cmd.xml34
-rw-r--r--lib/snmp/doc/src/snmpm.xml40
-rw-r--r--lib/snmp/src/agent/snmp_target_mib.erl23
-rw-r--r--lib/snmp/src/agent/snmp_view_based_acm_mib.erl6
-rw-r--r--lib/snmp/src/agent/snmpa_agent.erl2
-rw-r--r--lib/snmp/src/agent/snmpa_conf.erl9
-rw-r--r--lib/snmp/src/agent/snmpa_mpd.erl104
-rw-r--r--lib/snmp/src/app/snmp.appup.src238
-rw-r--r--lib/snmp/src/compile/Makefile11
-rw-r--r--lib/snmp/src/compile/snmpc.erl9
-rw-r--r--lib/snmp/src/compile/snmpc.src73
-rw-r--r--lib/snmp/src/compile/snmpc_lib.erl4
-rw-r--r--lib/snmp/src/compile/snmpc_lib.hrl15
-rw-r--r--lib/snmp/src/manager/snmpm.erl8
-rw-r--r--lib/snmp/src/manager/snmpm_config.erl515
-rw-r--r--lib/snmp/src/manager/snmpm_mpd.erl47
-rw-r--r--lib/snmp/src/manager/snmpm_net_if.erl31
-rw-r--r--lib/snmp/src/manager/snmpm_server.erl77
-rw-r--r--lib/snmp/src/misc/snmp_conf.erl83
-rw-r--r--lib/snmp/src/misc/snmp_config.erl10
-rw-r--r--lib/snmp/test/snmp_compiler_test.erl48
-rw-r--r--lib/snmp/test/snmp_manager_test.erl185
-rw-r--r--lib/snmp/test/test_config/Makefile18
-rw-r--r--lib/snmp/vsn.mk2
-rw-r--r--lib/ssh/doc/src/notes.xml14
-rw-r--r--lib/ssh/src/ssh.appup.src10
-rwxr-xr-xlib/ssh/src/ssh_sftp.erl12
-rw-r--r--lib/ssh/test/Makefile2
-rw-r--r--lib/ssh/vsn.mk2
-rw-r--r--lib/ssl/c_src/esock_openssl.c2
-rw-r--r--lib/ssl/doc/src/notes.xml6
-rw-r--r--lib/ssl/doc/src/ssl.xml35
-rw-r--r--lib/ssl/doc/src/ssl_protocol.xml4
-rw-r--r--lib/ssl/doc/src/using_ssl.xml8
-rw-r--r--lib/ssl/src/ssl.appup.src2
-rw-r--r--lib/ssl/src/ssl.erl98
-rw-r--r--lib/ssl/src/ssl_certificate.erl54
-rw-r--r--lib/ssl/src/ssl_certificate_db.erl49
-rw-r--r--lib/ssl/src/ssl_connection.erl163
-rw-r--r--lib/ssl/src/ssl_handshake.erl56
-rw-r--r--lib/ssl/src/ssl_internal.hrl7
-rw-r--r--lib/ssl/src/ssl_manager.erl81
-rw-r--r--lib/ssl/src/ssl_record.erl18
-rw-r--r--lib/ssl/src/ssl_session.erl6
-rw-r--r--lib/ssl/src/ssl_session_cache.erl18
-rw-r--r--lib/ssl/src/ssl_ssl2.erl2
-rw-r--r--lib/ssl/test/Makefile4
-rw-r--r--lib/ssl/test/ssl_basic_SUITE.erl346
-rw-r--r--lib/ssl/test/ssl_packet_SUITE.erl302
-rw-r--r--lib/ssl/test/ssl_session_cache_SUITE.erl108
-rw-r--r--lib/ssl/test/ssl_test_lib.erl3
-rw-r--r--lib/ssl/vsn.mk2
-rw-r--r--lib/stdlib/doc/src/calendar.xml15
-rw-r--r--lib/stdlib/doc/src/dets.xml2
-rw-r--r--lib/stdlib/doc/src/ets.xml3
-rw-r--r--lib/stdlib/doc/src/gen_fsm.xml8
-rw-r--r--lib/stdlib/doc/src/io.xml2
-rw-r--r--lib/stdlib/doc/src/supervisor.xml9
-rw-r--r--lib/stdlib/doc/src/unicode_usage.xml2
-rw-r--r--lib/stdlib/src/calendar.erl78
-rw-r--r--lib/stdlib/src/dets.erl13
-rw-r--r--lib/stdlib/src/dets_v8.erl2
-rw-r--r--lib/stdlib/src/erl_compile.erl1
-rw-r--r--lib/stdlib/src/erl_expand_records.erl2
-rw-r--r--lib/stdlib/src/erl_internal.erl1
-rw-r--r--lib/stdlib/src/erl_scan.erl7
-rw-r--r--lib/stdlib/src/erl_tar.erl30
-rw-r--r--lib/stdlib/src/escript.erl6
-rw-r--r--lib/stdlib/src/eval_bits.erl8
-rw-r--r--lib/stdlib/src/io_lib.erl8
-rw-r--r--lib/stdlib/src/io_lib_fread.erl64
-rw-r--r--lib/stdlib/src/otp_internal.erl8
-rw-r--r--lib/stdlib/src/proplists.erl3
-rw-r--r--lib/stdlib/src/queue.erl127
-rw-r--r--lib/stdlib/src/sofs.erl5
-rw-r--r--lib/stdlib/src/supervisor.erl7
-rw-r--r--lib/stdlib/src/sys.erl4
-rw-r--r--lib/stdlib/src/timer.erl6
-rw-r--r--lib/stdlib/src/zip.erl10
-rw-r--r--lib/stdlib/test/beam_lib_SUITE.erl16
-rw-r--r--lib/stdlib/test/dets_SUITE.erl8
-rw-r--r--lib/stdlib/test/epp_SUITE.erl4
-rw-r--r--lib/stdlib/test/erl_eval_SUITE.erl2
-rw-r--r--lib/stdlib/test/erl_lint_SUITE.erl2
-rw-r--r--lib/stdlib/test/erl_scan_SUITE.erl4
-rw-r--r--lib/stdlib/test/ets_SUITE.erl124
-rw-r--r--lib/stdlib/test/file_sorter_SUITE.erl16
-rw-r--r--lib/stdlib/test/filelib_SUITE.erl4
-rw-r--r--lib/stdlib/test/io_SUITE.erl30
-rw-r--r--lib/stdlib/test/string_SUITE.erl4
-rw-r--r--lib/stdlib/test/supervisor_SUITE.erl53
-rw-r--r--lib/stdlib/test/supervisor_bridge_SUITE.erl2
-rw-r--r--lib/stdlib/test/sys_SUITE.erl2
-rw-r--r--lib/stdlib/test/tar_SUITE.erl78
-rw-r--r--lib/stdlib/test/zip_SUITE.erl3
-rw-r--r--lib/stdlib/vsn.mk2
-rw-r--r--lib/test_server/src/test_server_ctrl.erl4
-rw-r--r--lib/test_server/src/ts.config2
-rw-r--r--lib/test_server/src/ts_install_cth.erl17
-rw-r--r--lib/test_server/test/Makefile2
-rw-r--r--lib/toolbar/src/toolbar_toolconfig.erl4
-rw-r--r--lib/tools/doc/src/instrument.xml4
-rw-r--r--lib/tools/doc/src/xref.xml8
-rw-r--r--lib/tools/emacs/erlang.el86
-rw-r--r--lib/tools/src/cover.erl4
-rw-r--r--lib/typer/src/typer.erl2
-rw-r--r--lib/webtool/priv/Makefile8
-rw-r--r--lib/wx/api_gen/gen_util.erl50
-rw-r--r--lib/wx/api_gen/gl_gen.erl2
-rw-r--r--lib/wx/api_gen/wx_extra/wxListCtrl.c_src161
-rw-r--r--lib/wx/api_gen/wx_extra/wxListCtrl.erl112
-rw-r--r--lib/wx/api_gen/wx_gen.erl2
-rw-r--r--lib/wx/api_gen/wx_gen_cpp.erl362
-rw-r--r--lib/wx/api_gen/wx_gen_erl.erl310
-rw-r--r--lib/wx/api_gen/wxapi.conf13
-rw-r--r--lib/wx/c_src/gen/wxe_derived_dest.h41
-rw-r--r--lib/wx/c_src/gen/wxe_events.cpp572
-rw-r--r--lib/wx/c_src/gen/wxe_funcs.cpp191
-rw-r--r--lib/wx/c_src/gen/wxe_init.cpp2
-rw-r--r--lib/wx/c_src/gen/wxe_macros.h3370
-rw-r--r--lib/wx/c_src/wxePrintout.cpp269
-rw-r--r--lib/wx/c_src/wxe_impl.cpp40
-rw-r--r--lib/wx/c_src/wxe_impl.h11
-rw-r--r--lib/wx/examples/demo/ex_listCtrl.erl50
-rw-r--r--lib/wx/include/gl.hrl1682
-rw-r--r--lib/wx/src/gen/wxListCtrl.erl94
-rw-r--r--lib/wx/src/gen/wxListItemAttr.erl122
-rw-r--r--lib/wx/src/gen/wxe_debug.hrl3370
-rw-r--r--lib/wx/src/gen/wxe_funcs.hrl3370
-rw-r--r--lib/wx/src/wxe_server.erl52
-rw-r--r--lib/wx/test/wx_class_SUITE.erl124
-rw-r--r--lib/wx/test/wxt.erl4
-rw-r--r--lib/xmerl/include/xmerl_xsd.hrl1
-rw-r--r--lib/xmerl/src/xmerl_scan.erl2
-rw-r--r--lib/xmerl/src/xmerl_ucs.erl35
-rw-r--r--lib/xmerl/src/xmerl_xsd.erl47
-rw-r--r--lib/xmerl/test/Makefile2
-rw-r--r--lib/xmerl/test/xmerl_SUITE.erl13
-rw-r--r--lib/xmerl/test/xmerl_SUITE_data/misc.tar.gzbin47121 -> 47340 bytes
-rw-r--r--lib/xmerl/test/xmerl_xsd_SUITE.erl7
452 files changed, 19449 insertions, 12086 deletions
diff --git a/lib/Makefile b/lib/Makefile
index 7f4c309da9..98d746925f 100644
--- a/lib/Makefile
+++ b/lib/Makefile
@@ -83,19 +83,15 @@ endif
ifdef BOOTSTRAP
SUB_DIRECTORIES = \
- kernel stdlib compiler orber/include
+ kernel stdlib compiler
else
ifdef SECONDARY_BOOTSTRAP
SUB_DIRECTORIES = hipe parsetools asn1/src
else
ifdef TERTIARY_BOOTSTRAP
- SUB_DIRECTORIES = snmp
- else
- ifdef FOURTH_BOOTSTRAP
- SUB_DIRECTORIES = sasl jinterface ic syntax_tools
- else # Not bootstrap build
- SUB_DIRECTORIES = $(ERTS_SUB_DIRECTORIES) $(OTHER_SUB_DIRECTORIES)
- endif
+ SUB_DIRECTORIES = snmp sasl jinterface ic syntax_tools
+ else # Not bootstrap build
+ SUB_DIRECTORIES = $(ERTS_SUB_DIRECTORIES) $(OTHER_SUB_DIRECTORIES)
endif
endif
endif
diff --git a/lib/asn1/doc/src/asn1ct.xml b/lib/asn1/doc/src/asn1ct.xml
index 265f8735c2..50458b4a9a 100644
--- a/lib/asn1/doc/src/asn1ct.xml
+++ b/lib/asn1/doc/src/asn1ct.xml
@@ -53,7 +53,7 @@
<v>Option = ber_bin | per_bin | uper_bin | der | compact_bit_string |
noobj | {n2n,EnumTypeName} |{outdir,Dir} | {i,IncludeDir} | optimize |
driver | asn1config | undec_rest | {inline,OutputName} | inline |
- {macro_name_prefix, Prefix} | {record_name_prefix, Prefix} | verbose</v>
+ {macro_name_prefix, Prefix} | {record_name_prefix, Prefix} | verbose | warnings_as_errors</v>
<v>OldOption = ber | per</v>
<v>Reason = term()</v>
<v>Prefix = string()</v>
@@ -289,6 +289,10 @@ Binary = binary()
<p>Causes more verbose information from the compiler
describing what it is doing.</p>
</item>
+ <tag><c>warnings_as_errors</c></tag>
+ <item>
+ <p>Causes warnings to be treated as errors.</p>
+ </item>
</taglist>
<p>Any additional option that is applied will be passed to
the final step when the generated .erl file is compiled.
diff --git a/lib/asn1/src/asn1ct.erl b/lib/asn1/src/asn1ct.erl
index a167d27f82..e26fadd160 100644
--- a/lib/asn1/src/asn1ct.erl
+++ b/lib/asn1/src/asn1ct.erl
@@ -39,7 +39,7 @@
add_tobe_refed_func/1,add_generated_refed_func/1,
maybe_rename_function/3,latest_sindex/0,current_sindex/0,
set_current_sindex/1,next_sindex/0,maybe_saved_sindex/2,
- parse_and_save/2,verbose/3,warning/3,error/3]).
+ parse_and_save/2,verbose/3,warning/3,warning/4,error/3]).
-include("asn1_records.hrl").
-include_lib("stdlib/include/erl_compile.hrl").
@@ -825,10 +825,13 @@ generate({true,{M,_Module,GenTOrV}},OutFile,EncodingRule,Options) ->
case catch specialized_decode_prepare(EncodingRule,M,GenTOrV,Options) of
{error, enoent} -> ok;
{error, Reason} -> warning("Error in configuration "
- "file: ~n~p~n",[Reason],Options);
+ "file: ~n~p~n",[Reason],Options,
+ "Error in configuration file");
{'EXIT',Reason} -> warning("Internal error when "
"analyzing configuration "
- "file: ~n~p~n",[Reason],Options);
+ "file: ~n~p~n",[Reason],Options,
+ "Internal error when "
+ "analyzing configuration");
_ -> ok
end,
@@ -2524,14 +2527,14 @@ type_check(#'Externaltypereference'{}) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% Report functions.
%%
-%% Errors messages are controlled with the 'errors' compiler option
+%% Error messages are controlled with the 'errors' compiler option
%% Warning messages are controlled with the 'warnings' compiler option
%% Verbose messages are controlled with the 'verbose' compiler option
error(Format, Args, S) ->
case is_error(S) of
true ->
- io:format("Error: " ++ Format, Args);
+ io:format(Format, Args);
false ->
ok
end.
@@ -2544,6 +2547,17 @@ warning(Format, Args, S) ->
ok
end.
+warning(Format, Args, S, Reason) ->
+ case {is_werr(S), is_error(S), is_warning(S)} of
+ {true, true, _} ->
+ io:format(Format, Args),
+ throw({error, Reason});
+ {false, _, true} ->
+ io:format(Format, Args);
+ _ ->
+ ok
+ end.
+
verbose(Format, Args, S) ->
case is_verbose(S) of
true ->
@@ -2566,3 +2580,8 @@ is_verbose(S) when is_record(S, state) ->
is_verbose(S#state.options);
is_verbose(O) ->
lists:member(verbose, O).
+
+is_werr(S) when is_record(S, state) ->
+ is_werr(S#state.options);
+is_werr(O) ->
+ lists:member(warnings_as_errors, O).
diff --git a/lib/asn1/src/asn1ct_check.erl b/lib/asn1/src/asn1ct_check.erl
index efd731f052..e318477234 100644
--- a/lib/asn1/src/asn1ct_check.erl
+++ b/lib/asn1/src/asn1ct_check.erl
@@ -2031,7 +2031,7 @@ get_objectset_def2(_S,T = #typedef{typespec=#'ObjectSet'{}},_CField) ->
T;
get_objectset_def2(S,T,_CField) ->
asn1ct:warning("get_objectset_def2: uncontrolled object set structure:~n~p~n",
- [T],S).
+ [T],S,"get_objectset_def2: uncontrolled object set structure").
type_name(S,#type{def=Def}) ->
CurrMod = S#state.mname,
@@ -2705,7 +2705,7 @@ normalize_value(S,Type,{'DEFAULT',Value},NameList) ->
normalize_objectclassfieldvalue(S,Value,NL);
Err ->
asn1ct:warning("could not check default value ~p~nType:~n~p~nNameList:~n~p~n",
- [Value,Type,Err],S),
+ [Value,Type,Err],S,"could not check default value"),
Value
end;
normalize_value(S,Type,Val,NameList) ->
@@ -2791,22 +2791,27 @@ normalize_bitstring(S,Value,Type)->
case catch lists:map(F,RecList) of
{error,Reason} ->
asn1ct:warning("default value not "
- "compatible with type definition ~p~n",
- [Reason],S),
+ "compatible with type definition ~p~n",
+ [Reason],S,
+ "default value not "
+ "compatible with type definition"),
Value;
NewList ->
NewList
end;
_ ->
asn1ct:warning("default value not "
- "compatible with type definition ~p~n",
- [RecList],S),
+ "compatible with type definition ~p~n",
+ [RecList],S,
+ "default value not "
+ "compatible with type definition"),
Value
end;
{Name,String} when is_atom(Name) ->
normalize_bitstring(S,String,Type);
Other ->
- asn1ct:warning("illegal default value ~p~n",[Other],S),
+ asn1ct:warning("illegal default value ~p~n",[Other],S,
+ "illegal default value"),
Value
end.
@@ -2846,12 +2851,14 @@ normalize_octetstring(S,Value,CType) ->
lists:map(fun([])-> ok;
(H)when H > 255->
asn1ct:warning("not legal octet value ~p in OCTET STRING, ~p~n",
- [H,List],S);
+ [H,List],S,
+ "not legal octet value ~p in OCTET STRING");
(_)-> ok
end, List),
List;
Other ->
- asn1ct:warning("unknown default value ~p~n",[Other],S),
+ asn1ct:warning("unknown default value ~p~n",[Other],S,
+ "unknown default value"),
Value
end.
@@ -2908,13 +2915,15 @@ normalize_enumerated(S,{Name,EnumV},CType) when is_atom(Name) ->
normalize_enumerated(S,Value,{CType1,CType2}) when is_list(CType1), is_list(CType2)->
normalize_enumerated(S,Value,CType1++CType2);
normalize_enumerated(S,V,CType) ->
- asn1ct:warning("Enumerated unknown type ~p~n",[CType],S),
+ asn1ct:warning("Enumerated unknown type ~p~n",[CType],S,
+ "Enumerated unknown type"),
V.
normalize_enumerated2(S,V,Enum) ->
case lists:keysearch(V,1,Enum) of
{value,{Val,_}} -> Val;
_ ->
- asn1ct:warning("Enumerated value is not correct ~p~n",[V],S),
+ asn1ct:warning("enumerated value is not correct ~p~n",[V],S,
+ "enumerated value is not correct"),
V
end.
@@ -2925,7 +2934,8 @@ normalize_choice(S,{'CHOICE',{C,V}},CType,NameList) when is_atom(C) ->
{C,normalize_value(S,CT,{'DEFAULT',V},
[Name|NameList])};
Other ->
- asn1ct:warning("Wrong format of type/value ~p/~p~n",[Other,V],S),
+ asn1ct:warning("Wrong format of type/value ~p/~p~n",[Other,V],S,
+ "Wrong format of type/value"),
{C,V}
end;
normalize_choice(S,{'DEFAULT',ValueList},CType,NameList) when is_list(ValueList) ->
@@ -3101,7 +3111,8 @@ normalize_s_of(SorS,S,Value,Type,NameList) when is_list(Value) ->
List when is_list(List) ->
List;
_ ->
- asn1ct:warning("~p could not handle value ~p~n",[SorS,Value],S),
+ asn1ct:warning("~p could not handle value ~p~n",[SorS,Value],S,
+ "could not handle value"),
Value
end;
normalize_s_of(SorS,S,Value,Type,NameList)
@@ -3159,7 +3170,8 @@ get_normalized_value(S,Val,Type,Func,AddArg) ->
V2 = sort_val_if_set(AddArg,NewVal,Type),
call_Func(update_state(S,ExtM),V2,Type,Func,AddArg);
_ ->
- asn1ct:warning("default value not comparable ~p~n",[Val],S),
+ asn1ct:warning("default value not comparable ~p~n",[Val],S,
+ "default value not comparable"),
Val
end.
@@ -5756,7 +5768,8 @@ ascending_order_check1(S,TypeName,
[C1 = #'ComponentType'{tags=[{_,T}|_]},
C2 = #'ComponentType'{tags=[{_,T}|_]}|Rest]) ->
asn1ct:warning("Indistinct tag ~p in SET ~p, components ~p and ~p~n",
- [T,TypeName,C1#'ComponentType'.name,C2#'ComponentType'.name],S),
+ [T,TypeName,C1#'ComponentType'.name,C2#'ComponentType'.name],S,
+ "Indistinct tag in SET"),
ascending_order_check1(S,TypeName,[C2|Rest]);
ascending_order_check1(S,TypeName,
[C1 = #'ComponentType'{tags=[{'UNIVERSAL',T1}|_]},
@@ -5764,9 +5777,10 @@ ascending_order_check1(S,TypeName,
case (decode_type(T1) == decode_type(T2)) of
true ->
asn1ct:warning("Indistinct tags ~p and ~p in"
- " SET ~p, components ~p and ~p~n",
- [T1,T2,TypeName,C1#'ComponentType'.name,
- C2#'ComponentType'.name],S),
+ " SET ~p, components ~p and ~p~n",
+ [T1,T2,TypeName,C1#'ComponentType'.name,
+ C2#'ComponentType'.name],S,
+ "Indistinct tags and in SET"),
ascending_order_check1(S,TypeName,[C2|Rest]);
_ ->
ascending_order_check1(S,TypeName,[C2|Rest])
diff --git a/lib/asn1/src/asn1ct_value.erl b/lib/asn1/src/asn1ct_value.erl
index 693e039a13..d099376b1b 100644
--- a/lib/asn1/src/asn1ct_value.erl
+++ b/lib/asn1/src/asn1ct_value.erl
@@ -435,11 +435,11 @@ get_encoding_rule(M) ->
open_type_value(ber) ->
[4,9,111,112,101,110,95,116,121,112,101];
open_type_value(ber_bin) ->
- [4,9,111,112,101,110,95,116,121,112,101];
-% <<4,9,111,112,101,110,95,116,121,112,101>>;
+% [4,9,111,112,101,110,95,116,121,112,101];
+ <<4,9,111,112,101,110,95,116,121,112,101>>;
open_type_value(ber_bin_v2) ->
- [4,9,111,112,101,110,95,116,121,112,101];
-% <<4,9,111,112,101,110,95,116,121,112,101>>;
+% [4,9,111,112,101,110,95,116,121,112,101];
+ <<4,9,111,112,101,110,95,116,121,112,101>>;
open_type_value(per) ->
"\n\topen_type"; %octet string value "open_type"
open_type_value(per_bin) ->
diff --git a/lib/asn1/test/asn1_SUITE.erl.src b/lib/asn1/test/asn1_SUITE.erl.src
index 582ccd877c..e7f93a4053 100644
--- a/lib/asn1/test/asn1_SUITE.erl.src
+++ b/lib/asn1/test/asn1_SUITE.erl.src
@@ -2236,8 +2236,10 @@ test_compile_options(Config) ->
?line ok = test_compile_options:path(Config),
?line ok = test_compile_options:noobj(Config),
?line ok = test_compile_options:record_name_prefix(Config),
- ?line ok = test_compile_options:verbose(Config)
+ ?line ok = test_compile_options:verbose(Config),
+ ?line ok = test_compile_options:warnings_as_errors(Config)
end.
+
testDoubleEllipses(suite) -> [];
testDoubleEllipses(Config) ->
?line testDoubleEllipses:compile(Config,?BER,[]),
diff --git a/lib/asn1/test/test_compile_options.erl b/lib/asn1/test/test_compile_options.erl
index 5e027cdedb..5cb212eddf 100644
--- a/lib/asn1/test/test_compile_options.erl
+++ b/lib/asn1/test/test_compile_options.erl
@@ -24,7 +24,7 @@
-export([wrong_path/1,comp/2,path/1,ticket_6143/1,noobj/1,
- record_name_prefix/1,verbose/1]).
+ record_name_prefix/1,verbose/1,warnings_as_errors/1]).
%% OTP-5689
wrong_path(Config) ->
@@ -141,6 +141,43 @@ verbose(Config) when is_list(Config) ->
?line [] = test_server:capture_get(),
ok.
+warnings_as_errors(Config) when is_list(Config) ->
+ PrivDir = ?config(priv_dir,Config),
+ Asn1File = filename:join([PrivDir,"WERROR.asn1"]),
+ OutFile = filename:join([PrivDir,"WERROR.erl"]),
+ Opts = [{outdir,PrivDir},noobj,verbose],
+
+ %% Generate WERR.asn to emit warning
+ %% Warning: Wrong format of type/value
+ %% false/{'Externalvaluereference',_,'WERR',noInvokeId}
+ Warn = <<"WERROR DEFINITIONS IMPLICIT TAGS ::=\n"
+ "\n"
+ "BEGIN\n"
+ "\n"
+ "InvokeId ::= CHOICE\n"
+ "{\n"
+ " present INTEGER,\n"
+ " absent NULL\n"
+ "}\n"
+ "\n"
+ "noInvokeId InvokeId ::= absent:NULL\n"
+ "\n"
+ "NoInvokeId InvokeId ::= {noInvokeId}\n"
+ "\n"
+ "END -- end of useful definitions.\n">>,
+ ?line ok = file:write_file(Asn1File, Warn),
+
+ %% Test warnings_as_errors compile
+ ?line false = filelib:is_regular(OutFile),
+ ?line {error, _} = asn1ct:compile(Asn1File, [warnings_as_errors|Opts]),
+ ?line false = filelib:is_regular(OutFile),
+
+ %% Test normal compile
+ ?line ok = asn1ct:compile(Asn1File, Opts),
+ ?line true = filelib:is_regular(OutFile),
+ ?line ok = file:delete(OutFile),
+ ok.
+
outfiles_check(OutDir) ->
outfiles_check(OutDir,outfiles1()).
diff --git a/lib/common_test/doc/src/common_test_app.xml b/lib/common_test/doc/src/common_test_app.xml
index c92566de37..57b032b3fd 100644
--- a/lib/common_test/doc/src/common_test_app.xml
+++ b/lib/common_test/doc/src/common_test_app.xml
@@ -144,7 +144,7 @@
<v> UserData = term()</v>
<v> Conns = [atom()]</v>
<v> CSSFile = string()</v>
- <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs}]</v>
+ <v> CTHs = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]</v>
<v> CTHModule = atom()</v>
<v> CTHInitArgs = term()</v>
</type>
diff --git a/lib/common_test/doc/src/ct_hooks.xml b/lib/common_test/doc/src/ct_hooks.xml
index 7d5c9f4750..f9fc1858d0 100644
--- a/lib/common_test/doc/src/ct_hooks.xml
+++ b/lib/common_test/doc/src/ct_hooks.xml
@@ -81,12 +81,14 @@
<funcs>
<func>
- <name>Module:init(Id, Opts) -&gt; State</name>
+ <name>Module:init(Id, Opts) -&gt; {ok, State} |
+ {ok, State, Priority}</name>
<fsummary>Initiates the Common Test Hook</fsummary>
<type>
<v>Id = reference() | term()</v>
<v>Opts = term()</v>
<v>State = term()</v>
+ <v>Priority = integer()</v>
</type>
<desc>
@@ -103,6 +105,10 @@
if <seealso marker="#Module:id-1">id/1</seealso> is not implemented.
</p>
+ <p><c>Priority</c> is the relative priority of this hook. Hooks with a
+ lower priority will be executed first. If no priority is given,
+ it will be set to 0. </p>
+
<p>For details about when init is called see
<seealso marker="ct_hooks_chapter#scope">scope</seealso>
in the User's Guide.</p>
@@ -296,7 +302,7 @@
<p>Note that it is not possible to add CTH's here right now,
that feature might be added later,
- but it would right now break backwards compatability.</p>
+ but it would right now break backwards compatibility.</p>
</desc>
</func>
diff --git a/lib/common_test/doc/src/ct_hooks_chapter.xml b/lib/common_test/doc/src/ct_hooks_chapter.xml
index fc5ab48e1b..dbb4310040 100644
--- a/lib/common_test/doc/src/ct_hooks_chapter.xml
+++ b/lib/common_test/doc/src/ct_hooks_chapter.xml
@@ -94,9 +94,11 @@
<seealso marker="common_test#Module:init_per_group-2">
init_per_group/2</seealso>. <c>CTH</c> in this case can be either
only the module name of the CTH or a tuple with the module name and the
- initial arguments to the CTH. Eg:
+ initial arguments and optionally the hook priority of the CTH. Eg:
<c>{ct_hooks,[my_cth_module]}</c> or
- <c>{ct_hooks,[{my_cth_module,[{debug,true}]}]}</c></p>
+ <c>{ct_hooks,[{my_cth_module,[{debug,true}]}]}</c> or
+ <c>{ct_hooks,[{my_cth_module,[{debug,true}],500}]}</c>
+ </p>
<section>
<title>Overriding CTHs</title>
@@ -109,7 +111,16 @@
<c>id</c> in both places, Common Test knows that this CTH
has already been installed and will not try to install it again.</p>
</section>
-
+
+ <section>
+ <title>CTH Priority</title>
+ <p>By default each CTH installed will be executed in the order which
+ they are installed. This is not always wanted so common_test allows
+ the user to specify a priority for each hook. The priority can either
+ be specified in the CTH <seealso marker="ct_hooks#Module:init-2">init/2
+ </seealso> function or when installing the hook. The priority given at
+ installation will override the priority returned by the CTH. </p>
+ </section>
</section>
<marker id="scope"/>
@@ -331,7 +342,7 @@ id(Opts) ->
%% any common state.
init(Id, Opts) ->
{ok,D} = file:open(Id,[write]),
- #state{ file_handle = D, total = 0, data = [] }.
+ {ok, #state{ file_handle = D, total = 0, data = [] }}.
%% @doc Called before init_per_suite is called.
pre_init_per_suite(Suite,Config,State) ->
diff --git a/lib/common_test/doc/src/run_test_chapter.xml b/lib/common_test/doc/src/run_test_chapter.xml
index e6fb85634f..e668568795 100644
--- a/lib/common_test/doc/src/run_test_chapter.xml
+++ b/lib/common_test/doc/src/run_test_chapter.xml
@@ -488,7 +488,7 @@
LogDir = string()
EventHandlers = atom() | [atom()]
InitArgs = [term()]
- CTHModules = [CTHModule | {CTHModule, CTHInitArgs}]
+ CTHModules = [CTHModule | {CTHModule, CTHInitArgs} | {CTHModule, CTHInitArgs, CTHPriority}]
CTHModule = atom()
CTHInitArgs = term()
DirRef = DirAlias | Dir
diff --git a/lib/common_test/src/ct_framework.erl b/lib/common_test/src/ct_framework.erl
index 809616d8e3..2ebc6c311a 100644
--- a/lib/common_test/src/ct_framework.erl
+++ b/lib/common_test/src/ct_framework.erl
@@ -240,7 +240,8 @@ add_defaults(Mod,Func,FuncInfo,DoInit) ->
case (catch Mod:suite()) of
{'EXIT',{undef,_}} ->
SuiteInfo = merge_with_suite_defaults(Mod,[]),
- case add_defaults1(Mod,Func,FuncInfo,SuiteInfo,DoInit) of
+ SuiteInfoNoCTH = [I || I <- SuiteInfo, element(1,I) =/= ct_hooks],
+ case add_defaults1(Mod,Func,FuncInfo,SuiteInfoNoCTH,DoInit) of
Error = {error,_} -> {SuiteInfo,Error};
MergedInfo -> {SuiteInfo,MergedInfo}
end;
@@ -251,10 +252,11 @@ add_defaults(Mod,Func,FuncInfo,DoInit) ->
(_) -> false
end, SuiteInfo) of
true ->
- SuiteInfoNoCTH =
- lists:keydelete(ct_hooks,1,SuiteInfo),
- SuiteInfo1 = merge_with_suite_defaults(Mod,SuiteInfoNoCTH),
- case add_defaults1(Mod,Func,FuncInfo,SuiteInfo1,DoInit) of
+ SuiteInfo1 = merge_with_suite_defaults(Mod,SuiteInfo),
+ SuiteInfoNoCTH = [I || I <- SuiteInfo1,
+ element(1,I) =/= ct_hooks],
+ case add_defaults1(Mod,Func,FuncInfo,
+ SuiteInfoNoCTH,DoInit) of
Error = {error,_} -> {SuiteInfo1,Error};
MergedInfo -> {SuiteInfo1,MergedInfo}
end;
@@ -435,7 +437,7 @@ try_set_default(Name,Key,Info,Where) ->
%%% @doc Test server framework callback, called by the test_server
%%% when a test case is finished.
end_tc(Mod, Fun, Args) ->
- %% Have to keep end_tc/3 for backwards compatabilty issues
+ %% Have to keep end_tc/3 for backwards compatibility issues
end_tc(Mod, Fun, Args, '$end_tc_dummy').
end_tc(?MODULE,error_in_suite,_, _) -> % bad start!
ok;
diff --git a/lib/common_test/src/ct_hooks.erl b/lib/common_test/src/ct_hooks.erl
index 984e04b90f..f243b87f54 100644
--- a/lib/common_test/src/ct_hooks.erl
+++ b/lib/common_test/src/ct_hooks.erl
@@ -31,11 +31,11 @@
-export([on_tc_skip/2]).
-export([on_tc_fail/2]).
--type proplist() :: [{atom(),term()}].
-
%% If you change this, remember to update ct_util:look -> stop clause as well.
-define(config_name, ct_hooks).
+-record(ct_hook_config, {id, module, prio, scope, opts = [], state = []}).
+
%% -------------------------------------------------------------------------
%% API Functions
%% -------------------------------------------------------------------------
@@ -44,22 +44,22 @@
-spec init(State :: term()) -> ok |
{error, Reason :: term()}.
init(Opts) ->
- call([{Hook, call_id, undefined} || Hook <- get_new_hooks(Opts)],
- ok, init, []).
+ call(get_new_hooks(Opts, undefined), ok, init, []).
%% @doc Called after all suites are done.
-spec terminate(Hooks :: term()) ->
ok.
terminate(Hooks) ->
- call([{HookId, fun call_terminate/3} || {HookId,_,_} <- Hooks],
+ call([{HookId, fun call_terminate/3}
+ || #ct_hook_config{id = HookId} <- Hooks],
ct_hooks_terminate_dummy, terminate, Hooks),
ok.
%% @doc Called as each test case is started. This includes all configuration
%% tests.
-spec init_tc(Mod :: atom(), Func :: atom(), Args :: list()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()}.
@@ -68,11 +68,11 @@ init_tc(ct_framework, _Func, Args) ->
init_tc(Mod, init_per_suite, Config) ->
Info = try proplists:get_value(ct_hooks, Mod:suite(),[]) of
List when is_list(List) ->
- [{ct_hooks,List}];
+ [{?config_name,List}];
CTHook when is_atom(CTHook) ->
- [{ct_hooks,[CTHook]}]
+ [{?config_name,[CTHook]}]
catch error:undef ->
- [{ct_hooks,[]}]
+ [{?config_name,[]}]
end,
call(fun call_generic/3, Config ++ Info, [pre_init_per_suite, Mod]);
init_tc(Mod, end_per_suite, Config) ->
@@ -92,7 +92,7 @@ init_tc(_Mod, TC, Config) ->
Args :: list(),
Result :: term(),
Resturn :: term()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()} |
@@ -131,36 +131,48 @@ on_tc_fail(_How, {Suite, Case, Reason}) ->
%% -------------------------------------------------------------------------
%% Internal Functions
%% -------------------------------------------------------------------------
-call_id(Mod, Config, Meta) when is_atom(Mod) ->
- call_id({Mod, []}, Config, Meta);
-call_id({Mod, Opts}, Config, Scope) ->
+call_id(#ct_hook_config{ module = Mod, opts = Opts} = Hook, Config, Scope) ->
Id = catch_apply(Mod,id,[Opts], make_ref()),
- {Config, {Id, scope(Scope), {Mod, {Id,Opts}}}}.
+ {Config, Hook#ct_hook_config{ id = Id, scope = scope(Scope)}}.
-call_init({Mod,{Id,Opts}},Config,_Meta) ->
- NewState = Mod:init(Id, Opts),
- {Config, {Mod, NewState}}.
-
-call_terminate({Mod, State}, _, _) ->
+call_init(#ct_hook_config{ module = Mod, opts = Opts, id = Id, prio = P} = Hook,
+ Config,_Meta) ->
+ case Mod:init(Id, Opts) of
+ {ok, NewState} when P =:= undefined ->
+ {Config, Hook#ct_hook_config{ state = NewState, prio = 0 } };
+ {ok, NewState} ->
+ {Config, Hook#ct_hook_config{ state = NewState } };
+ {ok, NewState, Prio} when P =:= undefined ->
+ %% Only set prio if not already set when installing hook
+ {Config, Hook#ct_hook_config{ state = NewState, prio = Prio } };
+ {ok, NewState, _} ->
+ {Config, Hook#ct_hook_config{ state = NewState } };
+ NewState -> %% Keep for backward compatability reasons
+ {Config, Hook#ct_hook_config{ state = NewState } }
+ end.
+
+call_terminate(#ct_hook_config{ module = Mod, state = State} = Hook, _, _) ->
catch_apply(Mod,terminate,[State], ok),
- {[],{Mod,State}}.
+ {[],Hook}.
-call_cleanup({Mod, State}, Reason, [Function, _Suite | Args]) ->
+call_cleanup(#ct_hook_config{ module = Mod, state = State} = Hook,
+ Reason, [Function, _Suite | Args]) ->
NewState = catch_apply(Mod,Function, Args ++ [Reason, State],
State),
- {Reason, {Mod, NewState}}.
+ {Reason, Hook#ct_hook_config{ state = NewState } }.
-call_generic({Mod, State}, Value, [Function | Args]) ->
+call_generic(#ct_hook_config{ module = Mod, state = State} = Hook,
+ Value, [Function | Args]) ->
{NewValue, NewState} = catch_apply(Mod, Function, Args ++ [Value, State],
{Value,State}),
- {NewValue, {Mod, NewState}}.
+ {NewValue, Hook#ct_hook_config{ state = NewState } }.
%% Generic call function
call(Fun, Config, Meta) ->
maybe_lock(),
Hooks = get_hooks(),
- Res = call([{HookId,Fun} || {HookId,_, _} <- Hooks] ++
- get_new_hooks(Config, Fun),
+ Res = call(get_new_hooks(Config, Fun) ++
+ [{HookId,Fun} || #ct_hook_config{id = HookId} <- Hooks],
remove(?config_name,Config), Meta, Hooks),
maybe_unlock(),
Res.
@@ -173,19 +185,20 @@ call(Fun, Config, Meta, NoChangeRet) when is_function(Fun) ->
call([{Hook, call_id, NextFun} | Rest], Config, Meta, Hooks) ->
try
- {Config, {NewId, _, _} = NewHook} = call_id(Hook, Config, Meta),
+ {Config, #ct_hook_config{ id = NewId } = NewHook} =
+ call_id(Hook, Config, Meta),
{NewHooks, NewRest} =
- case lists:keyfind(NewId, 1, Hooks) of
+ case lists:keyfind(NewId, #ct_hook_config.id, Hooks) of
false when NextFun =:= undefined ->
{Hooks ++ [NewHook],
- [{NewId, fun call_init/3} | Rest]};
+ [{NewId, call_init} | Rest]};
ExistingHook when is_tuple(ExistingHook) ->
{Hooks, Rest};
_ ->
{Hooks ++ [NewHook],
- [{NewId, fun call_init/3},{NewId,NextFun} | Rest]}
+ [{NewId, call_init}, {NewId,NextFun} | Rest]}
end,
- call(NewRest, Config, Meta, NewHooks)
+ call(resort(NewRest,NewHooks), Config, Meta, NewHooks)
catch Error:Reason ->
Trace = erlang:get_stacktrace(),
ct_logs:log("Suite Hook","Failed to start a CTH: ~p:~p",
@@ -193,13 +206,16 @@ call([{Hook, call_id, NextFun} | Rest], Config, Meta, Hooks) ->
call([], {fail,"Failed to start CTH"
", see the CT Log for details"}, Meta, Hooks)
end;
+call([{HookId, call_init} | Rest], Config, Meta, Hooks) ->
+ call([{HookId, fun call_init/3} | Rest], Config, Meta, Hooks);
call([{HookId, Fun} | Rest], Config, Meta, Hooks) ->
try
- {_,Scope,ModState} = lists:keyfind(HookId, 1, Hooks),
- {NewConf, NewHookInfo} = Fun(ModState, Config, Meta),
+ Hook = lists:keyfind(HookId, #ct_hook_config.id, Hooks),
+ {NewConf, NewHook} = Fun(Hook, Config, Meta),
NewCalls = get_new_hooks(NewConf, Fun),
- NewHooks = lists:keyreplace(HookId, 1, Hooks, {HookId, Scope, NewHookInfo}),
- call(NewCalls ++ Rest, remove(?config_name, NewConf), Meta,
+ NewHooks = lists:keyreplace(HookId, #ct_hook_config.id, Hooks, NewHook),
+ call(resort(NewCalls ++ Rest,NewHooks), %% Resort if call_init changed prio
+ remove(?config_name, NewConf), Meta,
terminate_if_scope_ends(HookId, Meta, NewHooks))
catch throw:{error_in_cth_call,Reason} ->
call(Rest, {fail, Reason}, Meta,
@@ -237,19 +253,26 @@ terminate_if_scope_ends(HookId, [on_tc_skip,Suite,end_per_suite], Hooks) ->
terminate_if_scope_ends(HookId, [Function,Tag|T], Hooks) when T =/= [] ->
terminate_if_scope_ends(HookId,[Function,Tag],Hooks);
terminate_if_scope_ends(HookId, Function, Hooks) ->
- case lists:keyfind(HookId, 1, Hooks) of
- {HookId, Function, _ModState} = Hook ->
+ case lists:keyfind(HookId, #ct_hook_config.id, Hooks) of
+ #ct_hook_config{ id = HookId, scope = Function} = Hook ->
terminate([Hook]),
- lists:keydelete(HookId, 1, Hooks);
+ lists:keydelete(HookId, #ct_hook_config.id, Hooks);
_ ->
Hooks
end.
%% Fetch hook functions
get_new_hooks(Config, Fun) ->
- lists:foldl(fun(NewHook, Acc) ->
- [{NewHook, call_id, Fun} | Acc]
- end, [], get_new_hooks(Config)).
+ lists:map(fun(NewHook) when is_atom(NewHook) ->
+ {#ct_hook_config{ module = NewHook }, call_id, Fun};
+ ({NewHook,Opts}) ->
+ {#ct_hook_config{ module = NewHook,
+ opts = Opts}, call_id, Fun};
+ ({NewHook,Opts,Prio}) ->
+ {#ct_hook_config{ module = NewHook,
+ opts = Opts,
+ prio = Prio }, call_id, Fun}
+ end, get_new_hooks(Config)).
get_new_hooks(Config) when is_list(Config) ->
lists:flatmap(fun({?config_name, HookConfigs}) ->
@@ -264,7 +287,43 @@ save_suite_data_async(Hooks) ->
ct_util:save_suite_data_async(?config_name, Hooks).
get_hooks() ->
- ct_util:read_suite_data(?config_name).
+ lists:keysort(#ct_hook_config.prio,ct_util:read_suite_data(?config_name)).
+
+%% Sort all calls in this order:
+%% call_id < call_init < Hook Priority 1 < .. < Hook Priority N
+%% If Hook Priority is equal, check when it has been installed and
+%% sort on that instead.
+resort(Calls, Hooks) ->
+ lists:sort(
+ fun({_,_,_},_) ->
+ true;
+ (_,{_,_,_}) ->
+ false;
+ ({_,call_init},_) ->
+ true;
+ (_,{_,call_init}) ->
+ false;
+ ({Id1,_},{Id2,_}) ->
+ P1 = (lists:keyfind(Id1, #ct_hook_config.id, Hooks))#ct_hook_config.prio,
+ P2 = (lists:keyfind(Id2, #ct_hook_config.id, Hooks))#ct_hook_config.prio,
+ if
+ P1 == P2 ->
+ %% If priorities are equal, we check the position in the
+ %% hooks list
+ pos(Id1,Hooks) < pos(Id2,Hooks);
+ true ->
+ P1 < P2
+ end
+ end,Calls).
+
+pos(Id,Hooks) ->
+ pos(Id,Hooks,0).
+pos(Id,[#ct_hook_config{ id = Id}|_],Num) ->
+ Num;
+pos(Id,[_|Rest],Num) ->
+ pos(Id,Rest,Num+1).
+
+
catch_apply(M,F,A, Default) ->
try
diff --git a/lib/common_test/src/ct_run.erl b/lib/common_test/src/ct_run.erl
index c01e97b358..877ec9c7dd 100644
--- a/lib/common_test/src/ct_run.erl
+++ b/lib/common_test/src/ct_run.erl
@@ -521,8 +521,8 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
- "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
- "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
+ "\n\t[-event_handler EvHandler1 and EvHandler2 .. EvHandlerN]"
+ "\n\t[-ct_hooks CTHook1 and CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
"\n\t[-no_auto_compile]"
"\n\t[-multiply_timetraps N]"
@@ -540,8 +540,8 @@ script_usage() ->
"\n\t[-silent_connections [ConnType1 ConnType2 .. ConnTypeN]]"
"\n\t[-stylesheet CSSFile]"
"\n\t[-cover CoverCfgFile]"
- "\n\t[-event_handler EvHandler1 EvHandler2 .. EvHandlerN]"
- "\n\t[-ct_hooks CTHook1 CTHook2 .. CTHookN]"
+ "\n\t[-event_handler EvHandler1 and EvHandler2 .. EvHandlerN]"
+ "\n\t[-ct_hooks CTHook1 and CTHook2 .. CTHookN]"
"\n\t[-include InclDir1 InclDir2 .. InclDirN]"
"\n\t[-no_auto_compile]"
"\n\t[-multiply_timetraps N]"
@@ -2070,15 +2070,21 @@ ct_hooks_args2opts(Args) ->
ct_hooks_args2opts(
proplists:get_value(ct_hooks, Args, []),[]).
+ct_hooks_args2opts([CTH,Arg,Prio,"and"| Rest],Acc) ->
+ ct_hooks_args2opts(Rest,[{list_to_atom(CTH),
+ parse_cth_args(Arg),
+ parse_cth_args(Prio)}|Acc]);
ct_hooks_args2opts([CTH,Arg,"and"| Rest],Acc) ->
ct_hooks_args2opts(Rest,[{list_to_atom(CTH),
- parse_cth_args(Arg)}|Acc]);
+ parse_cth_args(Arg)}|Acc]);
ct_hooks_args2opts([CTH], Acc) ->
ct_hooks_args2opts([CTH,"and"],Acc);
ct_hooks_args2opts([CTH, "and" | Rest], Acc) ->
ct_hooks_args2opts(Rest,[list_to_atom(CTH)|Acc]);
ct_hooks_args2opts([CTH, Args], Acc) ->
ct_hooks_args2opts([CTH, Args, "and"],Acc);
+ct_hooks_args2opts([CTH, Args, Prio], Acc) ->
+ ct_hooks_args2opts([CTH, Args, Prio, "and"],Acc);
ct_hooks_args2opts([],Acc) ->
lists:reverse(Acc).
@@ -2225,7 +2231,14 @@ opts2args(EnvStartOpts) ->
({ct_hooks,CTHs}) when is_list(CTHs) ->
io:format(user,"ct_hooks: ~p",[CTHs]),
Strs = lists:flatmap(
- fun({CTH,Arg}) ->
+ fun({CTH,Arg,Prio}) ->
+ [atom_to_list(CTH),
+ lists:flatten(
+ io_lib:format("~p",[Arg])),
+ lists:flatten(
+ io_lib:format("~p",[Prio])),
+ "and"];
+ ({CTH,Arg}) ->
[atom_to_list(CTH),
lists:flatten(
io_lib:format("~p",[Arg])),
diff --git a/lib/common_test/test/ct_hooks_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE.erl
index 8574d7aabc..5c99f0f9f7 100644
--- a/lib/common_test/test/ct_hooks_SUITE.erl
+++ b/lib/common_test/test/ct_hooks_SUITE.erl
@@ -83,7 +83,7 @@ all(suite) ->
fail_post_suite_cth, skip_pre_suite_cth,
skip_post_suite_cth, recover_post_suite_cth, update_config_cth,
state_update_cth, options_cth, same_id_cth,
- fail_n_skip_with_minimal_cth
+ fail_n_skip_with_minimal_cth, prio_cth
]
)
.
@@ -209,6 +209,11 @@ fail_n_skip_with_minimal_cth(Config) when is_list(Config) ->
do_test(fail_n_skip_with_minimal_cth, "ct_cth_fail_one_skip_one_SUITE.erl",
[minimal_terminate_cth],Config).
+prio_cth(Config) when is_list(Config) ->
+ do_test(prio_cth, "ct_cth_prio_SUITE.erl",
+ [{empty_cth,[1000],1000},{empty_cth,[900],900},
+ {prio_cth,[1100,100],100},{prio_cth,[1100]}],Config).
+
%%%-----------------------------------------------------------------
%%% HELP FUNCTIONS
%%%-----------------------------------------------------------------
@@ -296,9 +301,9 @@ test_events(two_empty_cth) ->
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
{?eh,cth,{'_',id,[[]]}},
- {?eh,cth,{'_',init,['_',[]]}},
{?eh,cth,{'_',id,[[]]}},
{?eh,cth,{'_',init,['_',[]]}},
+ {?eh,cth,{'_',init,['_',[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
@@ -365,9 +370,9 @@ test_events(minimal_and_maximal_cth) ->
[
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
+ {?eh,cth,{'_',id,[[]]}},
{negative,{?eh,cth,{'_',id,['_',[]]}},
{?eh,cth,{'_',init,['_',[]]}}},
- {?eh,cth,{'_',id,[[]]}},
{?eh,cth,{'_',init,['_',[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
@@ -954,8 +959,8 @@ test_events(same_id_cth) ->
{?eh,start_logging,{'DEF','RUNDIR'}},
{?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}},
{?eh,cth,{'_',id,[[]]}},
- {?eh,cth,{'_',init,[same_id_cth,[]]}},
{?eh,cth,{'_',id,[[]]}},
+ {?eh,cth,{'_',init,[same_id_cth,[]]}},
{?eh,tc_start,{ct_cth_empty_SUITE,init_per_suite}},
{?eh,cth,{'_',pre_init_per_suite,[ct_cth_empty_SUITE,'$proplist',[]]}},
{negative,
@@ -1001,6 +1006,73 @@ test_events(fail_n_skip_with_minimal_cth) ->
{?eh,stop_logging,[]}
];
+test_events(prio_cth) ->
+
+ GenPre = fun(Func,States) ->
+ [{?eh,cth,{'_',Func,['_','_',State]}} ||
+ State <- States]
+ end,
+
+ GenPost = fun(Func,States) ->
+ [{?eh,cth,{'_',Func,['_','_','_',State]}} ||
+ State <- States]
+ end,
+
+ [{?eh,start_logging,{'DEF','RUNDIR'}},
+ {?eh,test_start,{'DEF',{'START_TIME','LOGDIR'}}}] ++
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,init_per_suite}}] ++
+ GenPre(pre_init_per_suite,
+ [[1100,100],[800],[900],[1000],[1200,1050],[1100],[1200]]) ++
+ GenPost(post_init_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,init_per_suite,ok}},
+
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,{init_per_group,'_',[]}}}] ++
+ GenPre(pre_init_per_group,
+ [[1100,100],[600,200],[600,600],[700],[800],
+ [900],[1000],[1200,1050],[1100],[1200]]) ++
+ GenPost(post_init_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,{init_per_group,'_',[]},ok}}] ++
+
+ [{?eh,tc_start,{ct_cth_prio_SUITE,test_case}}] ++
+ GenPre(pre_init_per_testcase,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ GenPost(post_end_per_testcase,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,test_case,ok}},
+
+ {?eh,tc_start,{ct_cth_prio_SUITE,{end_per_group,'_',[]}}}] ++
+ GenPre(pre_end_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ GenPost(post_end_per_group,
+ [[1100,100],[600,200],[600,600],[600],[700],[800],
+ [900],[900,900],[500,900],[1000],[1200,1050],
+ [1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,{end_per_group,'_',[]},ok}}],
+
+ {?eh,tc_start,{ct_cth_prio_SUITE,end_per_suite}}] ++
+ GenPre(pre_end_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ GenPost(post_end_per_suite,
+ [[1100,100],[600,200],[600,600],[700],[800],[900],[1000],
+ [1200,1050],[1100],[1200]]) ++
+ [{?eh,tc_done,{ct_cth_prio_SUITE,end_per_suite,ok}},
+ {?eh,test_done,{'DEF','STOP_TIME'}},
+ {?eh,stop_logging,[]}];
+
test_events(ok) ->
ok.
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl
new file mode 100644
index 0000000000..d564398cd0
--- /dev/null
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/ct_cth_prio_SUITE.erl
@@ -0,0 +1,62 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(ct_cth_prio_SUITE).
+
+%% Note: This directive should only be used in test suites.
+-compile(export_all).
+
+-include("ct.hrl").
+
+suite() ->
+ ([{timetrap, {minutes, 10}},
+ {ct_hooks, [{empty_cth,[800],800},
+ {prio_cth,[1200]},{prio_cth,[1200,1050],1050}]}]).
+
+%% Test server callback functions
+init_per_suite(Config) ->
+ [{ct_hooks, [{empty_cth,[700],700},
+ {prio_cth,[600,600]},
+ {prio_cth,[600,200],200}]}|Config].
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_group(_G, Config) ->
+ [{ct_hooks, [{empty_cth,[600],600},
+ {prio_cth,[900,900]},{prio_cth,[500,900],900}]}|Config].
+
+end_per_group(_G, _Config) ->
+ ok.
+
+init_per_testcase(_TestCase, Config) ->
+ Config.
+
+end_per_testcase(_TestCase, _Config) ->
+ ok.
+
+all() ->
+ [{group,test_group}].
+
+groups() ->
+ [{test_group,[],[test_case]}].
+
+%% Test cases starts here.
+test_case(Config) when is_list(Config) ->
+ ok.
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
index ebebfd18a9..7befcfa57c 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
@@ -59,8 +59,7 @@
-include_lib("common_test/src/ct_util.hrl").
-include_lib("common_test/include/ct_event.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -71,17 +70,17 @@
%% @doc Always called before any other callback function. Use this to initiate
%% any common state. It should return an state for this CTH.
--spec init(Id :: term(), Opts :: proplist()) ->
- State :: #state{}.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
init(Id, Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
data = {?MODULE, init, [Id, Opts]}}),
- Opts.
+ {ok,Opts}.
%% @doc The ID is used to uniquly identify an CTH instance, if two CTH's
%% return the same ID the seconds CTH is ignored. This function should NOT
%% have any side effects as it might be called multiple times by common test.
--spec id(Opts :: proplist()) ->
+-spec id(Opts :: proplists:proplist()) ->
Id :: term().
id(Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl
new file mode 100644
index 0000000000..82511ab0d3
--- /dev/null
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/prio_cth.erl
@@ -0,0 +1,74 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2010-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+
+-module(prio_cth).
+
+
+-include_lib("common_test/src/ct_util.hrl").
+
+
+%% CT Hooks
+-compile(export_all).
+
+id(Opts) ->
+ empty_cth:id(Opts).
+
+init(Id, Opts) ->
+ {ok, [Prio|_] = State} = empty_cth:init(Id, Opts),
+ {ok, State, Prio}.
+
+pre_init_per_suite(Suite, Config, State) ->
+ empty_cth:pre_init_per_suite(Suite,Config,State).
+
+post_init_per_suite(Suite,Config,Return,State) ->
+ empty_cth:post_init_per_suite(Suite,Config,Return,State).
+
+pre_end_per_suite(Suite,Config,State) ->
+ empty_cth:pre_end_per_suite(Suite,Config,State).
+
+post_end_per_suite(Suite,Config,Return,State) ->
+ empty_cth:post_end_per_suite(Suite,Config,Return,State).
+
+pre_init_per_group(Group,Config,State) ->
+ empty_cth:pre_init_per_group(Group,Config,State).
+
+post_init_per_group(Group,Config,Return,State) ->
+ empty_cth:post_init_per_group(Group,Config,Return,State).
+
+pre_end_per_group(Group,Config,State) ->
+ empty_cth:pre_end_per_group(Group,Config,State).
+
+post_end_per_group(Group,Config,Return,State) ->
+ empty_cth:post_end_per_group(Group,Config,Return,State).
+
+pre_init_per_testcase(TC,Config,State) ->
+ empty_cth:pre_init_per_testcase(TC,Config,State).
+
+post_end_per_testcase(TC,Config,Return,State) ->
+ empty_cth:post_end_per_testcase(TC,Config,Return,State).
+
+on_tc_fail(TC, Reason, State) ->
+ empty_cth:on_tc_fail(TC,Reason,State).
+
+on_tc_skip(TC, Reason, State) ->
+ empty_cth:on_tc_skip(TC,Reason,State).
+
+terminate(State) ->
+ empty_cth:terminate(State).
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
index 35c990c0be..9da48d3a4c 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/state_update_cth.erl
@@ -29,7 +29,7 @@
init(Id, Opts) ->
State = empty_cth:init(Id, Opts),
- [init|State].
+ {ok, [init|State]}.
pre_init_per_suite(Suite, Config, State) ->
empty_cth:pre_init_per_suite(Suite,Config,State),
diff --git a/lib/compiler/src/beam_disasm.erl b/lib/compiler/src/beam_disasm.erl
index 017ca129b0..bb62bb04b3 100644
--- a/lib/compiler/src/beam_disasm.erl
+++ b/lib/compiler/src/beam_disasm.erl
@@ -204,7 +204,7 @@ process_chunks(F) ->
optional_chunk(F, ChunkTag) ->
case beam_lib:chunks(F, [ChunkTag]) of
{ok,{_Module,[{ChunkTag,Chunk}]}} -> Chunk;
- {error,beam_lib,{missing_chunk,_,ChunkTag}} -> none
+ {error,beam_lib,{missing_chunk,_,_}} -> none
end.
%%-----------------------------------------------------------------------
diff --git a/lib/compiler/src/compile.erl b/lib/compiler/src/compile.erl
index ce8a5bf864..e46c667e47 100644
--- a/lib/compiler/src/compile.erl
+++ b/lib/compiler/src/compile.erl
@@ -113,7 +113,7 @@ noenv_forms(Forms, Opt) when is_atom(Opt) ->
noenv_output_generated(Opts) ->
{_,Passes} = passes(file, expand_opts(Opts)),
- any(fun ({save_binary,_F}) -> true;
+ any(fun ({save_binary,_T,_F}) -> true;
(_Other) -> false
end, Passes).
@@ -122,6 +122,7 @@ noenv_output_generated(Opts) ->
%%
-define(pass(P), {P,fun P/1}).
+-define(pass(P,T), {P,fun T/1,fun P/1}).
env_default_opts() ->
Key = "ERL_COMPILER_OPTIONS",
@@ -304,7 +305,7 @@ run_tc({Name,Fun}, St) ->
Val.
comp_ret_ok(#compile{code=Code,warnings=Warn0,module=Mod,options=Opts}=St) ->
- case member(warnings_as_errors, Opts) andalso length(Warn0) > 0 of
+ case werror(St) of
true ->
case member(report_warnings, Opts) of
true ->
@@ -339,6 +340,11 @@ comp_ret_err(#compile{warnings=Warn0,errors=Err0,options=Opts}=St) ->
false -> error
end.
+not_werror(St) -> not werror(St).
+
+werror(#compile{options=Opts,warnings=Ws}) ->
+ Ws =/= [] andalso member(warnings_as_errors, Opts).
+
%% messages_per_file([{File,[Message]}]) -> [{File,[Message]}]
messages_per_file(Ms) ->
T = lists:sort([{File,M} || {File,Messages} <- Ms, M <- Messages]),
@@ -373,7 +379,7 @@ passes(Type, Opts) ->
%% insert a first pass to remove the file (unless the
%% source file is a BEAM file).
{Ext,case last(Passes) of
- {save_binary,_Fun} ->
+ {save_binary,_TestFun,_Fun} ->
case Passes of
[{read_beam_file,_}|_] ->
%% The BEAM is both input and output.
@@ -655,7 +661,7 @@ asm_passes() ->
binary_passes() ->
[{native_compile,fun test_native/1,fun native_compile/1},
- {unless,binary,?pass(save_binary)}].
+ {unless,binary,?pass(save_binary,not_werror)}].
%%%
%%% Compiler passes.
@@ -1379,28 +1385,34 @@ report_errors(#compile{options=Opts,errors=Errors}) ->
end.
report_warnings(#compile{options=Opts,warnings=Ws0}) ->
- case member(report_warnings, Opts) of
+ Werror = member(warnings_as_errors, Opts),
+ P = case Werror of
+ true -> "";
+ false -> "Warning: "
+ end,
+ ReportWerror = Werror andalso member(report_errors, Opts),
+ case member(report_warnings, Opts) orelse ReportWerror of
true ->
- Ws1 = flatmap(fun({{F,_L},Eds}) -> format_message(F, Eds);
- ({F,Eds}) -> format_message(F, Eds) end,
+ Ws1 = flatmap(fun({{F,_L},Eds}) -> format_message(F, P, Eds);
+ ({F,Eds}) -> format_message(F, P, Eds) end,
Ws0),
Ws = lists:sort(Ws1),
foreach(fun({_,Str}) -> io:put_chars(Str) end, Ws);
false -> ok
end.
-format_message(F, [{{Line,Column}=Loc,Mod,E}|Es]) ->
- M = {{F,Loc},io_lib:format("~s:~w:~w Warning: ~s\n",
- [F,Line,Column,Mod:format_error(E)])},
- [M|format_message(F, Es)];
-format_message(F, [{Line,Mod,E}|Es]) ->
- M = {{F,{Line,0}},io_lib:format("~s:~w: Warning: ~s\n",
- [F,Line,Mod:format_error(E)])},
- [M|format_message(F, Es)];
-format_message(F, [{Mod,E}|Es]) ->
- M = {none,io_lib:format("~s: Warning: ~s\n", [F,Mod:format_error(E)])},
- [M|format_message(F, Es)];
-format_message(_, []) -> [].
+format_message(F, P, [{{Line,Column}=Loc,Mod,E}|Es]) ->
+ M = {{F,Loc},io_lib:format("~s:~w:~w ~s~s\n",
+ [F,Line,Column,P,Mod:format_error(E)])},
+ [M|format_message(F, P, Es)];
+format_message(F, P, [{Line,Mod,E}|Es]) ->
+ M = {{F,{Line,0}},io_lib:format("~s:~w: ~s~s\n",
+ [F,Line,P,Mod:format_error(E)])},
+ [M|format_message(F, P, Es)];
+format_message(F, P, [{Mod,E}|Es]) ->
+ M = {none,io_lib:format("~s: ~s~s\n", [F,P,Mod:format_error(E)])},
+ [M|format_message(F, P, Es)];
+format_message(_, _, []) -> [].
%% list_errors(File, ErrorDescriptors) -> ok
diff --git a/lib/compiler/src/sys_pre_expand.erl b/lib/compiler/src/sys_pre_expand.erl
index 480954adac..dd6f24e21f 100644
--- a/lib/compiler/src/sys_pre_expand.erl
+++ b/lib/compiler/src/sys_pre_expand.erl
@@ -223,10 +223,8 @@ attribute(export, Es, _L, St) ->
St#expand{exports=union(from_list(Es), St#expand.exports)};
attribute(import, Is, _L, St) ->
import(Is, St);
-attribute(compile, C, _L, St) when is_list(C) ->
- St#expand{compile=St#expand.compile ++ C};
-attribute(compile, C, _L, St) ->
- St#expand{compile=St#expand.compile ++ [C]};
+attribute(compile, _C, _L, St) ->
+ St;
attribute(Name, Val, Line, St) when is_list(Val) ->
St#expand{attributes=St#expand.attributes ++ [{Name,Line,Val}]};
attribute(Name, Val, Line, St) ->
diff --git a/lib/compiler/test/Makefile b/lib/compiler/test/Makefile
index fe713fd019..b90adaf917 100644
--- a/lib/compiler/test/Makefile
+++ b/lib/compiler/test/Makefile
@@ -9,6 +9,7 @@ MODULES= \
andor_SUITE \
apply_SUITE \
beam_validator_SUITE \
+ beam_disasm_SUITE \
bs_bincomp_SUITE \
bs_bit_binaries_SUITE \
bs_construct_SUITE \
diff --git a/lib/compiler/test/beam_disasm_SUITE.erl b/lib/compiler/test/beam_disasm_SUITE.erl
new file mode 100644
index 0000000000..44574ae64a
--- /dev/null
+++ b/lib/compiler/test/beam_disasm_SUITE.erl
@@ -0,0 +1,65 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(beam_disasm_SUITE).
+
+-include_lib("test_server/include/test_server.hrl").
+
+-export([all/0, suite/0,groups/0,init_per_suite/1, end_per_suite/1,
+ init_per_group/2,end_per_group/2]).
+
+-export([stripped/1]).
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ [stripped].
+
+groups() ->
+ [].
+
+init_per_suite(Config) ->
+ Config.
+
+end_per_suite(_Config) ->
+ ok.
+
+init_per_group(_GroupName, Config) ->
+ Config.
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
+stripped(doc) ->
+ ["Check that stripped beam files can be disassembled"];
+stripped(Config) when is_list(Config) ->
+ ?line PrivDir = ?config(priv_dir, Config),
+ ?line SrcName = filename:join(PrivDir, "tmp.erl"),
+ ?line BeamName = filename:join(PrivDir, "tmp.beam"),
+ Prog = <<"-module(tmp).\n-export([tmp/0]).\ntmp()->ok.\n">>,
+ ?line ok = file:write_file(SrcName, Prog),
+ ?line {ok, tmp} =
+ compile:file(SrcName, [{outdir, PrivDir}]),
+ ?line {beam_file, tmp, _, Attr, CompileInfo, [_|_]} =
+ beam_disasm:file(BeamName),
+ ?line true = is_list(Attr),
+ ?line true = is_list(CompileInfo),
+ ?line {ok, {tmp, _}} = beam_lib:strip(BeamName),
+ ?line {beam_file, tmp, _, none, none, [_|_]} =
+ beam_disasm:file(BeamName),
+ ok.
diff --git a/lib/compiler/test/error_SUITE.erl b/lib/compiler/test/error_SUITE.erl
index 6e0aadf007..eb5e50818e 100644
--- a/lib/compiler/test/error_SUITE.erl
+++ b/lib/compiler/test/error_SUITE.erl
@@ -183,23 +183,47 @@ get_compilation_errors(Config, Filename) ->
E.
warnings_as_errors(Config) when is_list(Config) ->
- Ts = [{warnings_as_errors,
+ ?line TestFile = test_filename(Config),
+ ?line BeamFile = filename:rootname(TestFile, ".erl") ++ ".beam",
+ ?line OutDir = ?config(priv_dir, Config),
+
+ Ts1 = [{warnings_as_errors,
<<"
t() ->
A = unused,
ok.
">>,
- [export_all,warnings_as_errors],
- {error,
- [],
- [{3,erl_lint,{unused_var,'A'}}]} }],
- ?line [] = run(Config, Ts),
+ [warnings_as_errors, export_all, {outdir, OutDir}],
+ {error,
+ [],
+ [{3,erl_lint,{unused_var,'A'}}]} }],
+ ?line [] = run(Ts1, TestFile, write_beam),
+ ?line false = filelib:is_regular(BeamFile),
+
+ Ts2 = [{warning_unused_var,
+ <<"
+ t() ->
+ A = unused,
+ ok.
+ ">>,
+ [return_warnings, export_all, {outdir, OutDir}],
+ {warning,
+ [{3,erl_lint,{unused_var,'A'}}]} }],
+
+ ?line [] = run(Ts2, TestFile, write_beam),
+ ?line true = filelib:is_regular(BeamFile),
+ ?line ok = file:delete(BeamFile),
+
ok.
run(Config, Tests) ->
+ ?line File = test_filename(Config),
+ run(Tests, File, dont_write_beam).
+
+run(Tests, File, WriteBeam) ->
F = fun({N,P,Ws,E}, BadL) ->
- case catch run_test(Config, P, Ws) of
+ case catch run_test(P, File, Ws, WriteBeam) of
E ->
BadL;
Bad ->
@@ -211,8 +235,12 @@ run(Config, Tests) ->
lists:foldl(F, [], Tests).
run2(Config, Tests) ->
+ ?line File = test_filename(Config),
+ run2(Tests, File, dont_write_beam).
+
+run2(Tests, File, WriteBeam) ->
F = fun({N,P,Ws,E}, BadL) ->
- case catch filter(run_test(Config, P, Ws)) of
+ case catch filter(run_test(P, File, Ws, WriteBeam)) of
E ->
BadL;
Bad ->
@@ -231,12 +259,19 @@ filter(X) ->
%% Compiles a test module and returns the list of errors and warnings.
-run_test(Conf, Test0, Warnings) ->
- Filename = 'errors_test.erl',
- ?line DataDir = ?config(priv_dir, Conf),
+test_filename(Conf) ->
+ Filename = "errors_test.erl",
+ DataDir = ?config(priv_dir, Conf),
+ filename:join(DataDir, Filename).
+
+run_test(Test0, File, Warnings, WriteBeam) ->
?line Test = ["-module(errors_test). ", Test0],
- ?line File = filename:join(DataDir, Filename),
- ?line Opts = [binary,return_errors|Warnings],
+ ?line Opts = case WriteBeam of
+ dont_write_beam ->
+ [binary,return_errors|Warnings];
+ write_beam ->
+ [return_errors|Warnings]
+ end,
?line ok = file:write_file(File, Test),
%% Compile once just to print all errors and warnings.
@@ -252,6 +287,10 @@ run_test(Conf, Test0, Warnings) ->
%io:format("compile:file(~s,~p) ->~n~p~n",
% [File,Opts,Ws]),
[];
+ {ok,errors_test,[{_File,Ws}]} ->
+ {warning,Ws};
+ {ok,errors_test,[]} ->
+ [];
{error,[{XFile,Es}],Ws} = _ZZ when is_list(XFile) ->
%io:format("compile:file(~s,~p) ->~n~p~n",
% [File,Opts,_ZZ]),
diff --git a/lib/cosFileTransfer/src/CosFileTransfer_FileTransferSession_impl.erl b/lib/cosFileTransfer/src/CosFileTransfer_FileTransferSession_impl.erl
index e222c5b92b..5dbe6f6b2f 100644
--- a/lib/cosFileTransfer/src/CosFileTransfer_FileTransferSession_impl.erl
+++ b/lib/cosFileTransfer/src/CosFileTransfer_FileTransferSession_impl.erl
@@ -792,7 +792,7 @@ target_FTS_operation(State, _SrcFile, DestFile, Op, Offset) ->
%% Delete the temporary local copy.
delete_tmp_file(TempName,
"Transfer completed but failed to remove temporary local copy."),
- %% Completed the transfer succesfully.
+ %% Completed the transfer successfully.
{reply, ok, State};
{error, epath} ->
delete_tmp_file(TempName,
diff --git a/lib/crypto/c_src/Makefile.in b/lib/crypto/c_src/Makefile.in
index 276c84d601..c2a986c334 100644
--- a/lib/crypto/c_src/Makefile.in
+++ b/lib/crypto/c_src/Makefile.in
@@ -41,6 +41,7 @@ CFLAGS = $(DED_CFLAGS)
SSL_LIBDIR = @SSL_LIBDIR@
SSL_INCLUDE = @SSL_INCLUDE@
SSL_CRYPTO_LIBNAME = @SSL_CRYPTO_LIBNAME@
+SSL_SSL_LIBNAME = @SSL_SSL_LIBNAME@
INCLUDES = $(SSL_INCLUDE) $(DED_INCLUDES)
@@ -84,7 +85,7 @@ DYNAMIC_CRYPTO_LIB=@SSL_DYNAMIC_ONLY@
ifeq ($(DYNAMIC_CRYPTO_LIB),yes)
SSL_DED_LD_RUNTIME_LIBRARY_PATH = @SSL_DED_LD_RUNTIME_LIBRARY_PATH@
-CRYPTO_LINK_LIB=$(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) -l$(SSL_CRYPTO_LIBNAME)
+CRYPTO_LINK_LIB=$(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) -l$(SSL_CRYPTO_LIBNAME) -l$(SSL_SSL_LIBNAME)
else
SSL_DED_LD_RUNTIME_LIBRARY_PATH=
CRYPTO_LINK_LIB=$(SSL_LIBDIR)/lib$(SSL_CRYPTO_LIBNAME).a
@@ -112,7 +113,7 @@ $(LIBDIR)/crypto$(TYPEMARKER).so: $(OBJS)
$(LIBDIR)/crypto$(TYPEMARKER).dll: $(OBJS)
$(INSTALL_DIR) $(LIBDIR)
- $(LD) $(LDFLAGS) -o $@ $(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) $(OBJS) -l$(SSL_CRYPTO_LIBNAME)
+ $(LD) $(LDFLAGS) -o $@ $(SSL_DED_LD_RUNTIME_LIBRARY_PATH) -L$(SSL_LIBDIR) $(OBJS) -l$(SSL_CRYPTO_LIBNAME) -l$(SSL_SSL_LIBNAME)
clean:
ifeq ($(findstring win32,$(TARGET)), win32)
diff --git a/lib/crypto/c_src/crypto.c b/lib/crypto/c_src/crypto.c
index c781ccb302..83772d9023 100644
--- a/lib/crypto/c_src/crypto.c
+++ b/lib/crypto/c_src/crypto.c
@@ -43,6 +43,7 @@
#include <openssl/aes.h>
#include <openssl/md5.h>
#include <openssl/md4.h>
+#include <openssl/md2.h>
#include <openssl/sha.h>
#include <openssl/bn.h>
#include <openssl/objects.h>
@@ -267,6 +268,7 @@ static ERL_NIF_TERM atom_true;
static ERL_NIF_TERM atom_false;
static ERL_NIF_TERM atom_sha;
static ERL_NIF_TERM atom_md5;
+static ERL_NIF_TERM atom_md2;
static ERL_NIF_TERM atom_ripemd160;
static ERL_NIF_TERM atom_error;
static ERL_NIF_TERM atom_rsa_pkcs1_padding;
@@ -337,6 +339,7 @@ static int load(ErlNifEnv* env, void** priv_data, ERL_NIF_TERM load_info)
atom_false = enif_make_atom(env,"false");
atom_sha = enif_make_atom(env,"sha");
atom_md5 = enif_make_atom(env,"md5");
+ atom_md2 = enif_make_atom(env,"md2");
atom_ripemd160 = enif_make_atom(env,"ripemd160");
atom_error = enif_make_atom(env,"error");
atom_rsa_pkcs1_padding = enif_make_atom(env,"rsa_pkcs1_padding");
@@ -1047,16 +1050,28 @@ static ERL_NIF_TERM dss_verify(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv
return(i > 0) ? atom_true : atom_false;
}
+struct hash_def {
+ int type;
+ unsigned int m_len;
+ unsigned char * (*func) (const unsigned char *d, size_t n, unsigned char *md);
+};
+
+static const struct hash_def md2_hash_def = { NID_md2, MD2_DIGEST_LENGTH, &MD2};
+static const struct hash_def md5_hash_def = { NID_md5, MD5_DIGEST_LENGTH, &MD5};
+static const struct hash_def sha1_hash_def = { NID_sha1, SHA_DIGEST_LENGTH, &SHA1};
+
static ERL_NIF_TERM rsa_verify(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv[])
{/* (Type, Data, Signature, Key=[E,N]) */
ErlNifBinary data_bin, sign_bin;
unsigned char hmacbuf[SHA_DIGEST_LENGTH];
ERL_NIF_TERM head, tail, ret;
- int i, is_sha;
+ int i;
RSA* rsa = RSA_new();
+ const struct hash_def *hash_def = NULL;
- if (argv[0] == atom_sha) is_sha = 1;
- else if (argv[0] == atom_md5) is_sha = 0;
+ if (argv[0] == atom_sha) hash_def = &sha1_hash_def;
+ else if (argv[0] == atom_md5) hash_def = &md5_hash_def;
+ else if (argv[0] == atom_md2) hash_def = &md2_hash_def;
else goto badarg;
if (!inspect_mpint(env, argv[1], &data_bin)
@@ -1070,16 +1085,9 @@ static ERL_NIF_TERM rsa_verify(ErlNifEnv* env, int argc, const ERL_NIF_TERM argv
ret = enif_make_badarg(env);
}
else {
- if (is_sha) {
- SHA1(data_bin.data+4, data_bin.size-4, hmacbuf);
- i = RSA_verify(NID_sha1, hmacbuf, SHA_DIGEST_LENGTH,
- sign_bin.data+4, sign_bin.size-4, rsa);
- }
- else {
- MD5(data_bin.data+4, data_bin.size-4, hmacbuf);
- i = RSA_verify(NID_md5, hmacbuf, MD5_DIGEST_LENGTH,
- sign_bin.data+4, sign_bin.size-4, rsa);
- }
+ (void) *hash_def->func(data_bin.data+4, data_bin.size-4, hmacbuf);
+ i = RSA_verify(hash_def->type, hmacbuf, hash_def->m_len,
+ sign_bin.data+4, sign_bin.size-4, rsa);
ret = (i==1 ? atom_true : atom_false);
}
RSA_free(rsa);
@@ -1221,10 +1229,12 @@ static ERL_NIF_TERM rsa_sign_nif(ErlNifEnv* env, int argc, const ERL_NIF_TERM ar
unsigned char hmacbuf[SHA_DIGEST_LENGTH];
unsigned rsa_s_len;
RSA *rsa = RSA_new();
- int i, is_sha;
+ int i;
+ const struct hash_def *hash_def = NULL;
- if (argv[0] == atom_sha) is_sha = 1;
- else if (argv[0] == atom_md5) is_sha = 0;
+ if (argv[0] == atom_sha) hash_def = &sha1_hash_def;
+ else if (argv[0] == atom_md5) hash_def = &md5_hash_def;
+ else if (argv[0] == atom_md2) hash_def = &md2_hash_def;
else goto badarg;
if (!inspect_mpint(env,argv[1],&data_bin)
@@ -1240,18 +1250,10 @@ static ERL_NIF_TERM rsa_sign_nif(ErlNifEnv* env, int argc, const ERL_NIF_TERM ar
return enif_make_badarg(env);
}
enif_alloc_binary(RSA_size(rsa), &ret_bin);
- if (is_sha) {
- SHA1(data_bin.data+4, data_bin.size-4, hmacbuf);
- ERL_VALGRIND_ASSERT_MEM_DEFINED(hmacbuf, SHA_DIGEST_LENGTH);
- i = RSA_sign(NID_sha1, hmacbuf, SHA_DIGEST_LENGTH,
- ret_bin.data, &rsa_s_len, rsa);
- }
- else {
- MD5(data_bin.data+4, data_bin.size-4, hmacbuf);
- ERL_VALGRIND_ASSERT_MEM_DEFINED(hmacbuf, MD5_DIGEST_LENGTH);
- i = RSA_sign(NID_md5, hmacbuf,MD5_DIGEST_LENGTH,
- ret_bin.data, &rsa_s_len, rsa);
- }
+ (void) *hash_def->func(data_bin.data+4, data_bin.size-4, hmacbuf);
+ ERL_VALGRIND_ASSERT_MEM_DEFINED(hmacbuf, hash_def->m_len);
+ i = RSA_sign(hash_def->type, hmacbuf, hash_def->m_len,
+ ret_bin.data, &rsa_s_len, rsa);
RSA_free(rsa);
if (i) {
ERL_VALGRIND_MAKE_MEM_DEFINED(ret_bin.data, rsa_s_len);
diff --git a/lib/crypto/doc/src/crypto.xml b/lib/crypto/doc/src/crypto.xml
index 179ba4498c..b593958264 100644
--- a/lib/crypto/doc/src/crypto.xml
+++ b/lib/crypto/doc/src/crypto.xml
@@ -347,7 +347,7 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
</func>
<func>
<name>sha_mac_96(Key, Data) -> Mac</name>
- <fsummary>Compute an <c>MD5 MAC</c>message authentification code</fsummary>
+ <fsummary>Compute an <c>SHA MAC</c>message authentification code</fsummary>
<type>
<v>Key = Data = iolist() | binary()</v>
<v>Mac = binary()</v>
@@ -744,7 +744,7 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
<p>Generate a random number <c><![CDATA[N, Lo =< N < Hi.]]></c> Uses the
<c>crypto</c> library pseudo-random number generator. The
arguments (and result) can be either erlang integers or binary
- multi-precision integers.</p>
+ multi-precision integers. <c>Hi</c> must be larger than <c>Lo</c>.</p>
</desc>
</func>
<func>
@@ -795,7 +795,7 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
<v>E, N, D = Mpint</v>
<d>Where <c>E</c> is the public exponent, <c>N</c> is public modulus and
<c>D</c> is the private exponent.</d>
- <v>DigestType = md5 | sha</v>
+ <v>DigestType = md2 | md5 | sha</v>
<d>The default <c>DigestType</c> is sha.</d>
<v>Mpint = binary()</v>
<v>Signature = binary()</v>
@@ -817,7 +817,7 @@ Mpint() = <![CDATA[<<ByteLen:32/integer-big, Bytes:ByteLen/binary>>]]>
<v>Key = [E, N]</v>
<v>E, N = Mpint</v>
<d>Where <c>E</c> is the public exponent and <c>N</c> is public modulus.</d>
- <v>DigestType = md5 | sha</v>
+ <v>DigestType = md2 | md5 | sha</v>
<d> The default <c>DigestType</c> is sha.</d>
<v>Mpint = binary()</v>
</type>
diff --git a/lib/crypto/src/crypto.erl b/lib/crypto/src/crypto.erl
index c35dfcebab..ddad00f4b4 100644
--- a/lib/crypto/src/crypto.erl
+++ b/lib/crypto/src/crypto.erl
@@ -91,7 +91,7 @@
aes_ctr_stream_init, aes_ctr_stream_encrypt, aes_ctr_stream_decrypt,
info_lib]).
--type rsa_digest_type() :: 'md5' | 'sha'.
+-type rsa_digest_type() :: 'md2' | 'md5' | 'sha'.
-type dss_digest_type() :: 'none' | 'sha'.
-type crypto_integer() :: binary() | integer().
@@ -415,6 +415,13 @@ rand_uniform(From,To) when is_binary(From), is_binary(To) ->
Whatever
end;
rand_uniform(From,To) when is_integer(From),is_integer(To) ->
+ if From < 0 ->
+ rand_uniform_pos(0, To - From) + From;
+ true ->
+ rand_uniform_pos(From, To)
+ end.
+
+rand_uniform_pos(From,To) when From < To ->
BinFrom = mpint(From),
BinTo = mpint(To),
case rand_uniform(BinFrom, BinTo) of
@@ -422,7 +429,9 @@ rand_uniform(From,To) when is_integer(From),is_integer(To) ->
erlint(Result);
Other ->
Other
- end.
+ end;
+rand_uniform_pos(_,_) ->
+ error(badarg).
rand_uniform_nif(_From,_To) -> ?nif_stub.
diff --git a/lib/crypto/test/crypto_SUITE.erl b/lib/crypto/test/crypto_SUITE.erl
index 283aadb6ea..26d10d892a 100644
--- a/lib/crypto/test/crypto_SUITE.erl
+++ b/lib/crypto/test/crypto_SUITE.erl
@@ -138,14 +138,15 @@ link_test_2(Drv) ->
Libs = os:cmd(Cmd),
io:format("~p\n", [Libs]),
case string:str(Libs, "libcrypto") of
- 0 -> ok;
- _ ->
+ 0 ->
case ?t:is_commercial() of
true ->
- ?t:fail({libcrypto,not_statically_linked});
+ ?t:fail({libcrypto,statically_linked});
false ->
- {comment,"Not statically linked (OK for open-source platform)"}
- end
+ {comment,"Statically linked (OK for open-source platform)"}
+ end;
+ _ ->
+ ok
end
end.
@@ -878,10 +879,17 @@ rand_uniform_aux_test(0) ->
rand_uniform_aux_test(N) ->
?line L = N*1000,
?line H = N*100000+1,
+ ?line crypto_rand_uniform(L, H),
+ ?line crypto_rand_uniform(-L, L),
+ ?line crypto_rand_uniform(-H, -L),
+ ?line crypto_rand_uniform(-H, L),
+ ?line rand_uniform_aux_test(N-1).
+
+crypto_rand_uniform(L,H) ->
?line R1 = crypto:rand_uniform(L, H),
?line t(R1 >= L),
- ?line t(R1 < H),
- ?line rand_uniform_aux_test(N-1).
+ ?line t(R1 < H).
+
%%
%%
@@ -1075,16 +1083,30 @@ rsa_sign_test(Config) when is_list(Config) ->
PrivKey = [crypto:mpint(PubEx), crypto:mpint(Mod), crypto:mpint(PrivEx)],
PubKey = [crypto:mpint(PubEx), crypto:mpint(Mod)],
- ?line Sig1 = crypto:rsa_sign(sized_binary(Msg), PrivKey),
- ?line m(crypto:rsa_verify(sized_binary(Msg), sized_binary(Sig1),PubKey), true),
-
- ?line Sig2 = crypto:rsa_sign(md5, sized_binary(Msg), PrivKey),
- ?line m(crypto:rsa_verify(md5, sized_binary(Msg), sized_binary(Sig2),PubKey), true),
+ ?line Sig = crypto:rsa_sign(sized_binary(Msg), PrivKey),
+ ?line m(crypto:rsa_verify(sized_binary(Msg), sized_binary(Sig),PubKey), true),
- ?line m(Sig1 =:= Sig2, false),
- ?line m(crypto:rsa_verify(md5, sized_binary(Msg), sized_binary(Sig1),PubKey), false),
- ?line m(crypto:rsa_verify(sha, sized_binary(Msg), sized_binary(Sig1),PubKey), true),
+ ?line Sig_md2 = crypto:rsa_sign(md2, sized_binary(Msg), PrivKey),
+ ?line Sig_md5 = crypto:rsa_sign(md5, sized_binary(Msg), PrivKey),
+ ?line Sig_sha = crypto:rsa_sign(sha, sized_binary(Msg), PrivKey),
+
+ ?line m(Sig =:= Sig_sha, true),
+ ?line m(Sig_md2 =:= Sig_md5, false),
+ ?line m(Sig_md2 =:= Sig_sha, false),
+ ?line m(Sig_md5 =:= Sig_sha, false),
+ ?line m(crypto:rsa_verify(md2, sized_binary(Msg), sized_binary(Sig_md2),PubKey), true),
+ ?line m(crypto:rsa_verify(md2, sized_binary(Msg), sized_binary(Sig_md5),PubKey), false),
+ ?line m(crypto:rsa_verify(md2, sized_binary(Msg), sized_binary(Sig_sha),PubKey), false),
+
+ ?line m(crypto:rsa_verify(md5, sized_binary(Msg), sized_binary(Sig_md2),PubKey), false),
+ ?line m(crypto:rsa_verify(md5, sized_binary(Msg), sized_binary(Sig_md5),PubKey), true),
+ ?line m(crypto:rsa_verify(md5, sized_binary(Msg), sized_binary(Sig_sha),PubKey), false),
+
+ ?line m(crypto:rsa_verify(sha, sized_binary(Msg), sized_binary(Sig_md2),PubKey), false),
+ ?line m(crypto:rsa_verify(sha, sized_binary(Msg), sized_binary(Sig_md5),PubKey), false),
+ ?line m(crypto:rsa_verify(sha, sized_binary(Msg), sized_binary(Sig_sha),PubKey), true),
+
ok.
dsa_sign_test(doc) ->
diff --git a/lib/dialyzer/src/dialyzer_dataflow.erl b/lib/dialyzer/src/dialyzer_dataflow.erl
index 7137dbc036..659297f993 100644
--- a/lib/dialyzer/src/dialyzer_dataflow.erl
+++ b/lib/dialyzer/src/dialyzer_dataflow.erl
@@ -528,7 +528,7 @@ handle_apply(Tree, Map, State) ->
{CallSitesKnown, FunList} =
case state__lookup_call_site(Tree, State2) of
error -> {false, []};
- {ok, [external]} -> {false, {}};
+ {ok, [external]} -> {false, []};
{ok, List} -> {true, List}
end,
case CallSitesKnown of
@@ -554,7 +554,13 @@ handle_apply(Tree, Map, State) ->
{State3, enter_type(Op, OpType1, Map2), t_none()};
false ->
Map3 = enter_type_lists(Args, NewArgs, Map2),
- {State2, enter_type(Op, OpType1, Map3), t_fun_range(OpType1)}
+ Range0 = t_fun_range(OpType1),
+ Range =
+ case t_is_unit(Range0) of
+ true -> t_none();
+ false -> Range0
+ end,
+ {State2, enter_type(Op, OpType1, Map3), Range}
end
end;
true ->
@@ -1414,6 +1420,17 @@ do_clause(C, Arg, ArgType0, OrigArgType, Map,
false ->
true
end;
+ [Pat0, Pat1] -> % binary comprehension
+ case cerl:is_c_cons(Pat0) of
+ true ->
+ not (cerl:is_c_var(cerl:cons_hd(Pat0)) andalso
+ cerl:is_c_var(cerl:cons_tl(Pat0)) andalso
+ cerl:is_c_var(Pat1) andalso
+ cerl:is_literal(Guard) andalso
+ (cerl:concrete(Guard) =:= true));
+ false ->
+ true
+ end;
_ -> true
end;
false ->
@@ -2915,7 +2932,7 @@ state__get_warnings(#state{tree_map = TreeMap, fun_tab = FunTab,
{Warn, Msg} =
case dialyzer_callgraph:lookup_name(FunLbl, Callgraph) of
error -> {true, {unused_fun, []}};
- {ok, {_M, F, A}} = MFA ->
+ {ok, {_M, F, A} = MFA} ->
{not sets:is_element(MFA, NoWarnUnused),
{unused_fun, [F, A]}}
end,
@@ -2935,7 +2952,7 @@ state__get_warnings(#state{tree_map = TreeMap, fun_tab = FunTab,
%% Check if the function has a contract that allows this.
Warn =
case Contract of
- none -> true;
+ none -> not parent_allows_this(FunLbl, State);
{value, C} ->
GenRet = dialyzer_contracts:get_contract_return(C),
not t_is_unit(GenRet)
@@ -3423,6 +3440,33 @@ map_pats(Pats) ->
end,
cerl_trees:map(Fun, Pats).
+parent_allows_this(FunLbl, #state{callgraph = Callgraph, plt = Plt} =State) ->
+ case state__is_escaping(FunLbl, State) of
+ false -> false; % if it isn't escaping it can't be a return value
+ true ->
+ case state__lookup_name(FunLbl, State) of
+ {_M, _F, _A} -> false; % if it has a name it is not a fun
+ _ ->
+ case dialyzer_callgraph:in_neighbours(FunLbl, Callgraph) of
+ [Parent] ->
+ case state__lookup_name(Parent, State) of
+ {_M, _F, _A} = PMFA ->
+ case dialyzer_plt:lookup_contract(Plt, PMFA) of
+ none -> false;
+ {value, C} ->
+ GenRet = dialyzer_contracts:get_contract_return(C),
+ case erl_types:t_is_fun(GenRet) of
+ false -> false; % element of structure? far-fetched...
+ true -> t_is_unit(t_fun_range(GenRet))
+ end
+ end;
+ _ -> false % parent should have a name to have a contract
+ end;
+ _ -> false % called in other funs? far-fetched...
+ end
+ end
+ end.
+
classify_returns(Tree) ->
case find_terminals(cerl:fun_body(Tree)) of
{false, false} -> no_match;
diff --git a/lib/dialyzer/src/dialyzer_typesig.erl b/lib/dialyzer/src/dialyzer_typesig.erl
index c45615d670..06863d89a7 100644
--- a/lib/dialyzer/src/dialyzer_typesig.erl
+++ b/lib/dialyzer/src/dialyzer_typesig.erl
@@ -62,7 +62,8 @@
-type dep() :: integer(). %% type variable names used as constraint ids
-type type_var() :: erl_types:erl_type(). %% actually: {'c','var',_,_}
--record(fun_var, {'fun' :: fun((_) -> erl_types:erl_type()), deps :: [dep()]}).
+-record(fun_var, {'fun' :: fun((_) -> erl_types:erl_type()), deps :: [dep()],
+ origin :: integer()}).
-type constr_op() :: 'eq' | 'sub'.
-type fvar_or_type() :: #fun_var{} | erl_types:erl_type().
@@ -121,8 +122,10 @@
-ifdef(DEBUG).
-define(debug(__String, __Args), io:format(__String, __Args)).
+-define(mk_fun_var(Fun, Vars), mk_fun_var(?LINE, Fun, Vars)).
-else.
-define(debug(__String, __Args), ok).
+-define(mk_fun_var(Fun, Vars), mk_fun_var(Fun, Vars)).
-endif.
%% ============================================================================
@@ -218,10 +221,10 @@ traverse(Tree, DefinedVars, State) ->
binary ->
{State1, SegTypes} = traverse_list(cerl:binary_segments(Tree),
DefinedVars, State),
- Type = mk_fun_var(fun(Map) ->
- TmpSegTypes = lookup_type_list(SegTypes, Map),
- t_bitstr_concat(TmpSegTypes)
- end, SegTypes),
+ Type = ?mk_fun_var(fun(Map) ->
+ TmpSegTypes = lookup_type_list(SegTypes, Map),
+ t_bitstr_concat(TmpSegTypes)
+ end, SegTypes),
{state__store_conj(mk_var(Tree), sub, Type, State1), mk_var(Tree)};
bitstr ->
Size = cerl:bitstr_size(Tree),
@@ -236,7 +239,7 @@ traverse(Tree, DefinedVars, State) ->
N when is_integer(N) -> {State1, t_bitstr(0, N)};
any -> % Size is not a literal
{state__store_conj(SizeType, sub, t_non_neg_integer(), State1),
- mk_fun_var(bitstr_constr(SizeType, UnitVal), [SizeType])}
+ ?mk_fun_var(bitstr_constr(SizeType, UnitVal), [SizeType])}
end,
ValTypeConstr =
case cerl:concrete(cerl:bitstr_type(Tree)) of
@@ -250,8 +253,8 @@ traverse(Tree, DefinedVars, State) ->
case state__is_in_match(State1) of
true ->
Flags = cerl:concrete(cerl:bitstr_flags(Tree)),
- mk_fun_var(bitstr_val_constr(SizeType, UnitVal, Flags),
- [SizeType]);
+ ?mk_fun_var(bitstr_val_constr(SizeType, UnitVal, Flags),
+ [SizeType]);
false -> t_integer()
end;
utf8 -> t_integer();
@@ -281,24 +284,24 @@ traverse(Tree, DefinedVars, State) ->
{State, t_cons(HdVar, TlVar)};
false ->
ConsVar = mk_var(Tree),
- ConsType = mk_fun_var(fun(Map) ->
- t_cons(lookup_type(HdVar, Map),
- lookup_type(TlVar, Map))
- end, [HdVar, TlVar]),
- HdType = mk_fun_var(fun(Map) ->
- Cons = lookup_type(ConsVar, Map),
- case t_is_cons(Cons) of
- false -> t_any();
- true -> t_cons_hd(Cons)
- end
- end, [ConsVar]),
- TlType = mk_fun_var(fun(Map) ->
- Cons = lookup_type(ConsVar, Map),
- case t_is_cons(Cons) of
- false -> t_any();
- true -> t_cons_tl(Cons)
- end
- end, [ConsVar]),
+ ConsType = ?mk_fun_var(fun(Map) ->
+ t_cons(lookup_type(HdVar, Map),
+ lookup_type(TlVar, Map))
+ end, [HdVar, TlVar]),
+ HdType = ?mk_fun_var(fun(Map) ->
+ Cons = lookup_type(ConsVar, Map),
+ case t_is_cons(Cons) of
+ false -> t_any();
+ true -> t_cons_hd(Cons)
+ end
+ end, [ConsVar]),
+ TlType = ?mk_fun_var(fun(Map) ->
+ Cons = lookup_type(ConsVar, Map),
+ case t_is_cons(Cons) of
+ false -> t_any();
+ true -> t_cons_tl(Cons)
+ end
+ end, [ConsVar]),
State2 = state__store_conj_lists([HdVar, TlVar, ConsVar], sub,
[HdType, TlType, ConsType],
State1),
@@ -656,25 +659,25 @@ get_plt_constr(MFA, Dst, ArgVars, State) ->
{RetType, ArgCs} =
case PltRes of
none ->
- {mk_fun_var(fun(Map) ->
- ArgTypes = lookup_type_list(ArgVars, Map),
- dialyzer_contracts:get_contract_return(C, ArgTypes)
- end, ArgVars), GenArgs};
+ {?mk_fun_var(fun(Map) ->
+ ArgTypes = lookup_type_list(ArgVars, Map),
+ dialyzer_contracts:get_contract_return(C, ArgTypes)
+ end, ArgVars), GenArgs};
{value, {PltRetType, PltArgTypes}} ->
%% Need to combine the contract with the success typing.
- {mk_fun_var(
- fun(Map) ->
- ArgTypes0 = lookup_type_list(ArgVars, Map),
- ArgTypes = case FunModule =:= Module of
- false ->
- List = lists:zip(PltArgTypes, ArgTypes0),
- [erl_types:t_unopaque_on_mismatch(T1, T2, Opaques)
- || {T1, T2} <- List];
- true -> ArgTypes0
- end,
- CRet = dialyzer_contracts:get_contract_return(C, ArgTypes),
- t_inf(CRet, PltRetType, opaque)
- end, ArgVars),
+ {?mk_fun_var(
+ fun(Map) ->
+ ArgTypes0 = lookup_type_list(ArgVars, Map),
+ ArgTypes = case FunModule =:= Module of
+ false ->
+ List = lists:zip(PltArgTypes, ArgTypes0),
+ [erl_types:t_unopaque_on_mismatch(T1, T2, Opaques)
+ || {T1, T2} <- List];
+ true -> ArgTypes0
+ end,
+ CRet = dialyzer_contracts:get_contract_return(C, ArgTypes),
+ t_inf(CRet, PltRetType, opaque)
+ end, ArgVars),
[t_inf(X, Y, opaque) || {X, Y} <- lists:zip(GenArgs, PltArgTypes)]}
end,
state__store_conj_lists([Dst|ArgVars], sub, [RetType|ArgCs], State)
@@ -766,10 +769,10 @@ handle_clauses_1([Clause|Tail], TopVar, Arg, DefinedVars,
case SubtrTypes =:= overflow of
true -> S;
false ->
- SubtrPatVar = mk_fun_var(fun(Map) ->
- TmpType = lookup_type(Arg, Map),
- t_subtract_list(TmpType, SubtrTypes)
- end, [Arg]),
+ SubtrPatVar = ?mk_fun_var(fun(Map) ->
+ TmpType = lookup_type(Arg, Map),
+ t_subtract_list(TmpType, SubtrTypes)
+ end, [Arg]),
state__store_conj(Arg, sub, SubtrPatVar, S)
end
end,
@@ -1043,10 +1046,10 @@ handle_guard(Guard, DefinedVars, State) ->
get_bif_constr({erlang, Op, 2}, Dst, Args = [Arg1, Arg2], _State)
when Op =:= '+'; Op =:= '-'; Op =:= '*' ->
- ReturnType = mk_fun_var(fun(Map) ->
- TmpArgTypes = lookup_type_list(Args, Map),
- erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
- end, Args),
+ ReturnType = ?mk_fun_var(fun(Map) ->
+ TmpArgTypes = lookup_type_list(Args, Map),
+ erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
+ end, Args),
ArgFun =
fun(A, Pos) ->
F =
@@ -1074,7 +1077,7 @@ get_bif_constr({erlang, Op, 2}, Dst, Args = [Arg1, Arg2], _State)
end
end
end,
- mk_fun_var(F, [Dst, A])
+ ?mk_fun_var(F, [Dst, A])
end,
Arg1FunVar = ArgFun(Arg2, 2),
Arg2FunVar = ArgFun(Arg1, 1),
@@ -1131,12 +1134,12 @@ get_bif_constr({erlang, Op, 2}, Dst, [Arg1, Arg2] = Args, _State)
'>=' -> {ArgFun(Arg1, Arg2, '>='), ArgFun(Arg2, Arg1, '=<')}
end,
DstArgs = [Dst, Arg1, Arg2],
- Arg1Var = mk_fun_var(Arg1Fun, DstArgs),
- Arg2Var = mk_fun_var(Arg2Fun, DstArgs),
- DstVar = mk_fun_var(fun(Map) ->
- TmpArgTypes = lookup_type_list(Args, Map),
- erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
- end, Args),
+ Arg1Var = ?mk_fun_var(Arg1Fun, DstArgs),
+ Arg2Var = ?mk_fun_var(Arg2Fun, DstArgs),
+ DstVar = ?mk_fun_var(fun(Map) ->
+ TmpArgTypes = lookup_type_list(Args, Map),
+ erl_bif_types:type(erlang, Op, 2, TmpArgTypes)
+ end, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstVar),
mk_constraint(Arg1, sub, Arg1Var),
mk_constraint(Arg2, sub, Arg2Var)]);
@@ -1172,13 +1175,13 @@ get_bif_constr({erlang, '++', 2}, Dst, [Hd, Tl] = Args, _State) ->
end
end,
DstL = [Dst],
- HdVar = mk_fun_var(HdFun, DstL),
- TlVar = mk_fun_var(TlFun, DstL),
+ HdVar = ?mk_fun_var(HdFun, DstL),
+ TlVar = ?mk_fun_var(TlFun, DstL),
ArgTypes = erl_bif_types:arg_types(erlang, '++', 2),
- ReturnType = mk_fun_var(fun(Map) ->
- TmpArgTypes = lookup_type_list(Args, Map),
- erl_bif_types:type(erlang, '++', 2, TmpArgTypes)
- end, Args),
+ ReturnType = ?mk_fun_var(fun(Map) ->
+ TmpArgTypes = lookup_type_list(Args, Map),
+ erl_bif_types:type(erlang, '++', 2, TmpArgTypes)
+ end, Args),
Cs = mk_constraints(Args, sub, ArgTypes),
mk_conj_constraint_list([mk_constraint(Dst, sub, ReturnType),
mk_constraint(Hd, sub, HdVar),
@@ -1209,7 +1212,7 @@ get_bif_constr({erlang, is_function, 2}, Dst, [Fun, Arity], _State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Dst, Arity]),
+ ArgV = ?mk_fun_var(ArgFun, [Dst, Arity]),
mk_conj_constraint_list([mk_constraint(Dst, sub, t_boolean()),
mk_constraint(Arity, sub, t_integer()),
mk_constraint(Fun, sub, ArgV)]);
@@ -1232,12 +1235,12 @@ get_bif_constr({erlang, is_record, 2}, Dst, [Var, Tag] = Args, _State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Dst]),
+ ArgV = ?mk_fun_var(ArgFun, [Dst]),
DstFun = fun(Map) ->
TmpArgTypes = lookup_type_list(Args, Map),
erl_bif_types:type(erlang, is_record, 2, TmpArgTypes)
end,
- DstV = mk_fun_var(DstFun, Args),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Tag, sub, t_atom()),
mk_constraint(Var, sub, ArgV)]);
@@ -1280,7 +1283,7 @@ get_bif_constr({erlang, is_record, 3}, Dst, [Var, Tag, Arity] = Args, State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Tag, Arity, Dst]),
+ ArgV = ?mk_fun_var(ArgFun, [Tag, Arity, Dst]),
DstFun = fun(Map) ->
[TmpVar, TmpTag, TmpArity] = TmpArgTypes = lookup_type_list(Args, Map),
TmpArgTypes2 =
@@ -1314,7 +1317,7 @@ get_bif_constr({erlang, is_record, 3}, Dst, [Var, Tag, Arity] = Args, State) ->
end,
erl_bif_types:type(erlang, is_record, 3, TmpArgTypes2)
end,
- DstV = mk_fun_var(DstFun, Args),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arity, sub, t_integer()),
mk_constraint(Tag, sub, t_atom()),
@@ -1359,9 +1362,9 @@ get_bif_constr({erlang, 'and', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end
end,
- ArgV1 = mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
- ArgV2 = mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
- DstV = mk_fun_var(DstFun, Args),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg1, sub, ArgV1),
mk_constraint(Arg2, sub, ArgV2)]);
@@ -1403,9 +1406,9 @@ get_bif_constr({erlang, 'or', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end
end,
- ArgV1 = mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
- ArgV2 = mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
- DstV = mk_fun_var(DstFun, Args),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg2), [Arg2, Dst]),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg1), [Arg1, Dst]),
+ DstV = ?mk_fun_var(DstFun, Args),
F = fun(A) ->
try [mk_constraint(A, sub, True)]
catch throw:error -> []
@@ -1433,8 +1436,8 @@ get_bif_constr({erlang, 'not', 1}, Dst, [Arg] = Args, _State) ->
end
end
end,
- ArgV = mk_fun_var(Fun(Dst), [Dst]),
- DstV = mk_fun_var(Fun(Arg), Args),
+ ArgV = ?mk_fun_var(Fun(Dst), [Dst]),
+ DstV = ?mk_fun_var(Fun(Arg), Args),
mk_conj_constraint_list([mk_constraint(Arg, sub, ArgV),
mk_constraint(Dst, sub, DstV)]);
get_bif_constr({erlang, '=:=', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
@@ -1467,9 +1470,9 @@ get_bif_constr({erlang, '=:=', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end,
DstArgs = [Dst, Arg1, Arg2],
- ArgV1 = mk_fun_var(ArgFun(Arg1, Arg2), DstArgs),
- ArgV2 = mk_fun_var(ArgFun(Arg2, Arg1), DstArgs),
- DstV = mk_fun_var(DstFun, Args),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg1, Arg2), DstArgs),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg2, Arg1), DstArgs),
+ DstV = ?mk_fun_var(DstFun, Args),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg1, sub, ArgV1),
mk_constraint(Arg2, sub, ArgV2)]);
@@ -1510,10 +1513,10 @@ get_bif_constr({erlang, '==', 2}, Dst, [Arg1, Arg2] = Args, _State) ->
end
end
end,
- DstV = mk_fun_var(DstFun, Args),
+ DstV = ?mk_fun_var(DstFun, Args),
ArgL = [Arg1, Arg2, Dst],
- ArgV1 = mk_fun_var(ArgFun(Arg2, Arg1), ArgL),
- ArgV2 = mk_fun_var(ArgFun(Arg1, Arg2), ArgL),
+ ArgV1 = ?mk_fun_var(ArgFun(Arg2, Arg1), ArgL),
+ ArgV2 = ?mk_fun_var(ArgFun(Arg1, Arg2), ArgL),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg1, sub, ArgV1),
mk_constraint(Arg2, sub, ArgV2)]);
@@ -1531,7 +1534,7 @@ get_bif_constr({erlang, element, 2} = _BIF, Dst, Args,
end,
erl_bif_types:type(erlang, element, 2, ATs2)
end,
- ReturnType = mk_fun_var(Fun, Args),
+ ReturnType = ?mk_fun_var(Fun, Args),
ArgTypes = erl_bif_types:arg_types(erlang, element, 2),
Cs = mk_constraints(Args, sub, ArgTypes),
NewCs =
@@ -1553,7 +1556,7 @@ get_bif_constr({M, F, A} = _BIF, Dst, Args, State) ->
false -> T
end
end,
- ReturnType = mk_fun_var(fun(Map) ->
+ ReturnType = ?mk_fun_var(fun(Map) ->
TmpArgTypes0 = lookup_type_list(Args, Map),
TmpArgTypes = [UnopaqueFun(T) || T<- TmpArgTypes0],
erl_bif_types:type(M, F, A, TmpArgTypes)
@@ -1608,7 +1611,7 @@ get_bif_test_constr(Dst, Arg, Type, State) ->
false -> t_any()
end
end,
- ArgV = mk_fun_var(ArgFun, [Dst]),
+ ArgV = ?mk_fun_var(ArgFun, [Dst]),
DstFun = fun(Map) ->
ArgType = lookup_type(Arg, Map),
case t_is_none(t_inf(ArgType, Type)) of
@@ -1633,7 +1636,7 @@ get_bif_test_constr(Dst, Arg, Type, State) ->
end
end
end,
- DstV = mk_fun_var(DstFun, [Arg]),
+ DstV = ?mk_fun_var(DstFun, [Arg]),
mk_conj_constraint_list([mk_constraint(Dst, sub, DstV),
mk_constraint(Arg, sub, ArgV)]).
@@ -1684,11 +1687,14 @@ solve_scc(SCC, Map, State, TryingUnit) ->
true ->
?debug("SCC ~w reached fixpoint\n", [SCC]),
NewTypes = unsafe_lookup_type_list(Funs, Map2),
- case lists:all(fun(T) -> t_is_none(t_fun_range(T)) end, NewTypes)
+ case erl_types:any_none([t_fun_range(T) || T <- NewTypes])
andalso TryingUnit =:= false of
true ->
- UnitTypes = [t_fun(state__fun_arity(F, State), t_unit())
- || F <- Funs],
+ UnitTypes =
+ [case t_is_none(t_fun_range(T)) of
+ false -> T;
+ true -> t_fun(t_fun_args(T), t_unit())
+ end || T <- NewTypes],
Map3 = enter_type_lists(Funs, UnitTypes, Map2),
solve_scc(SCC, Map3, State, true);
false ->
@@ -2320,12 +2326,25 @@ mk_constraint(Lhs, Op, Rhs) ->
constraint_opnd_is_any(#fun_var{}) -> false;
constraint_opnd_is_any(Type) -> t_is_any(Type).
+-ifdef(DEBUG).
+
+-spec mk_fun_var(fun((_) -> erl_types:erl_type()), [erl_types:erl_type()],
+ integer()) -> #fun_var{}.
+
+mk_fun_var(Line, Fun, Types) ->
+ Deps = [t_var_name(Var) || Var <- t_collect_vars(t_product(Types))],
+ #fun_var{'fun' = Fun, deps = ordsets:from_list(Deps), origin = Line}.
+
+-else.
+
-spec mk_fun_var(fun((_) -> erl_types:erl_type()), [erl_types:erl_type()]) -> #fun_var{}.
mk_fun_var(Fun, Types) ->
Deps = [t_var_name(Var) || Var <- t_collect_vars(t_product(Types))],
#fun_var{'fun' = Fun, deps = ordsets:from_list(Deps)}.
+-endif.
+
-spec get_deps(constr()) -> [dep()].
get_deps(#constraint{deps = D}) -> D;
@@ -2676,8 +2695,9 @@ find_constraint(Tuple, [_|Cs]) ->
-endif.
-ifdef(DEBUG).
-format_type(#fun_var{deps = Deps}) ->
- io_lib:format("Fun(~s)", [lists:flatten([format_type(t_var(X))||X<-Deps])]);
+format_type(#fun_var{deps = Deps, origin = Origin}) ->
+ io_lib:format("Fun@L~p(~s)",
+ [Origin, lists:flatten([format_type(t_var(X))||X<-Deps])]);
format_type(Type) ->
case cerl:is_literal(Type) of
true -> io_lib:format("~w", [cerl:concrete(Type)]);
diff --git a/lib/dialyzer/test/Makefile b/lib/dialyzer/test/Makefile
index 69a8fd742e..47deb17f1d 100644
--- a/lib/dialyzer/test/Makefile
+++ b/lib/dialyzer/test/Makefile
@@ -26,7 +26,7 @@ include $(ERL_TOP)/make/otp_release_targets.mk
release_tests_spec:
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DATA) $(AUXILIARY_FILES) $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
cd $(RELSYSDIR);\
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/asn1 b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
index ac83366bc8..292275dd6e 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/asn1
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
@@ -2,11 +2,11 @@
asn1ct.erl:1500: The variable Err can never match since previous clauses completely covered the type #type{}
asn1ct.erl:1596: The variable _ can never match since previous clauses completely covered the type 'ber_bin_v2'
asn1ct.erl:1673: The pattern 'all' can never match the type 'asn1_module' | 'exclusive_decode' | 'partial_decode'
-asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()],[any()]>
+asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | [any()] | char()],[any()]>
asn1ct.erl:909: Guard test is_atom(Ext::[49 | 97 | 98 | 100 | 110 | 115]) can never succeed
asn1ct_check.erl:1698: The pattern {'error', _} can never match the type [any()]
asn1ct_check.erl:2733: The pattern {'type', Tag, _, _, _, _} can never match the type 'ASN1_OPEN_TYPE' | {_,_} | {'fixedtypevaluefield',_,_}
-asn1ct_check.erl:2738: The pattern <_S, _> can never match since previous clauses completely covered the type <#state{},#ObjectClassFieldType{class::#objectclass{fields::maybe_improper_list() | {_,_,_,_}},fieldname::{_,maybe_improper_list()},type::'ASN1_OPEN_TYPE' | {_,_} | {'fixedtypevaluefield',_,_}}>
+asn1ct_check.erl:2738: The pattern <_S, _> can never match since previous clauses completely covered the type <#state{},#'ObjectClassFieldType'{class::#objectclass{fields::maybe_improper_list() | {_,_,_,_}},fieldname::{_,maybe_improper_list()},type::'ASN1_OPEN_TYPE' | {_,_} | {'fixedtypevaluefield',_,_}}>
asn1ct_check.erl:2887: The variable Other can never match since previous clauses completely covered the type any()
asn1ct_check.erl:3188: The pattern <_S, [], B> can never match the type <#state{},{'SingleValue',_},{'ValueRange',_}>
asn1ct_check.erl:3190: The pattern <_S, A, []> can never match the type <#state{},{'SingleValue',_},{'ValueRange',_}>
@@ -29,8 +29,8 @@ asn1ct_check.erl:5128: Guard test is_record(Type::{_,_} | {'fixedtypevaluefield'
asn1ct_check.erl:540: The pattern <_S, {'poc', _ObjSet, _Params}> can never match since previous clauses completely covered the type <#state{},_>
asn1ct_check.erl:5517: The pattern <_, []> can never match the type <_,[{'ABSTRACT-SYNTAX',{_,_,_}} | {'TYPE-IDENTIFIER',{_,_,_}},...]>
asn1ct_constructed_ber.erl:1075: The pattern {{{'ObjectClassFieldType', _, _, _, {'objectfield', PrimFieldName1, PFNList}}, _}, {'componentrelation', _, _}} can never match the type {#type{},_}
-asn1ct_constructed_ber.erl:695: The pattern {'EXTENSIONMARK', _, _} can never match the type #ComponentType{}
-asn1ct_constructed_ber.erl:748: The pattern <Erules, TopType, {CompList, _ExtList}> can never match the type <_,maybe_improper_list(),[#ComponentType{typespec::{_,_,_,_,_,_}}]>
+asn1ct_constructed_ber.erl:695: The pattern {'EXTENSIONMARK', _, _} can never match the type #'ComponentType'{}
+asn1ct_constructed_ber.erl:748: The pattern <Erules, TopType, {CompList, _ExtList}> can never match the type <_,maybe_improper_list(),[#'ComponentType'{typespec::{_,_,_,_,_,_}}]>
asn1ct_constructed_ber_bin_v2.erl:914: The pattern {{{'ObjectClassFieldType', _, _, _, {'objectfield', PrimFieldName1, PFNList}}, _}, {'componentrelation', _, _}} can never match the type {#type{},_}
asn1ct_gen.erl:740: The pattern [] can never match the type [any(),...]
asn1ct_gen_ber.erl:974: The pattern <Erules, [{Name, Def} | Rest]> can never match the type <_,[#typedef{name::atom(),typespec::{_,_,_,_,_,_}}]>
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/inets b/lib/dialyzer/test/r9c_SUITE_data/results/inets
index fd5e36a3cd..0177dcc88c 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/inets
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/inets
@@ -3,13 +3,15 @@ ftp.erl:1243: The pattern {'ok', {N, Bytes}} can never match the type 'eof' | {'
ftp.erl:640: The pattern {'closed', _Why} can never match the type 'perm_fname_not_allowed' | 'perm_neg_compl' | 'perm_no_space' | 'pos_compl' | 'pos_interm' | 'pos_interm_acct' | 'trans_neg_compl' | 'trans_no_space' | {'error' | 'perm_fname_not_allowed' | 'perm_neg_compl' | 'perm_no_space' | 'pos_compl' | 'pos_interm' | 'pos_interm_acct' | 'pos_prel' | 'trans_neg_compl' | 'trans_no_space',atom() | [any()] | {'invalid_server_response',[any(),...]}}
http.erl:117: The pattern {'error', Reason} can never match the type #req_headers{connection::[45 | 97 | 101 | 105 | 107 | 108 | 112 | 118,...],content_length::[48,...],other::[{_,_}]}
http.erl:138: Function close_session/2 will never be called
-http_lib.erl:286: The call http_lib:close('ip_comm' | {'ssl',_},any()) will never return since it differs in the 1st argument from the success typing arguments: ('http' | 'https',any())
-http_lib.erl:424: The variable _ can never match since previous clauses completely covered the type any()
-http_lib.erl:438: The variable _ can never match since previous clauses completely covered the type any()
+http_lib.erl:286: The call http_lib:close('ip_comm' | {'ssl',_},port() | {'sslsocket',_,_}) will never return since it differs in the 1st argument from the success typing arguments: ('http' | 'https',port() | {'sslsocket',_,pid() | {_,{'config',_,_,_,_,{_,_,_,_}}} | {'sslsocket',_,pid() | {'sslsocket',_,pid() | {_,_,_}}}})
+http_lib.erl:415: The pattern 61 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:417: The pattern 59 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:420: The pattern 13 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:424: The variable _ can never match since previous clauses completely covered the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:428: Function read_chunk_ext_val/6 will never be called
+http_lib.erl:444: The pattern 10 can never match the type 'http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | #http_request{method::'DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),path::'*' | binary() | string() | {'abs_path',binary() | string()} | {'scheme',binary() | string(),binary() | string()} | {'absoluteURI','http' | 'https',binary() | string(),'undefined' | non_neg_integer(),binary() | string()},version::{non_neg_integer(),non_neg_integer()}} | #http_response{version::{non_neg_integer(),non_neg_integer()},status::integer(),phrase::binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}
+http_lib.erl:552: Call to missing or unexported function ssl:accept/2
http_lib.erl:99: Function getHeaderValue/2 will never be called
-httpc_handler.erl:322: Function status_continue/2 has no local return
-httpc_handler.erl:37: Function init_connection/2 has no local return
-httpc_handler.erl:65: Function next_response_with_request/2 has no local return
httpc_handler.erl:660: Function exit_session_ok/2 has no local return
httpc_manager.erl:145: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
httpc_manager.erl:160: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
@@ -24,11 +26,14 @@ httpd_manager.erl:885: The pattern {'EXIT', Reason} can never match since previo
httpd_manager.erl:919: Function auth_status/1 will never be called
httpd_manager.erl:926: Function sec_status/1 will never be called
httpd_manager.erl:933: Function acceptor_status/1 will never be called
-httpd_request_handler.erl:374: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 66 | 98 | 100 | 103 | 105 | 111 | 116 | 121,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:378: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:401: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',[[any()]]}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+httpd_request_handler.erl:374: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 66 | 98 | 100 | 103 | 105 | 111 | 116 | 121,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_},socket::port() | {'sslsocket',_,_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
+httpd_request_handler.erl:378: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_},socket::port() | {'sslsocket',_,_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
+httpd_request_handler.erl:401: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_},socket::port() | {'sslsocket',_,_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
+httpd_request_handler.erl:489: The variable Other can never match since previous clauses completely covered the type {'error',_} | {'ok','http_eoh' | binary() | maybe_improper_list(any(),binary() | []) | {'http_error',binary() | string()} | {'http_request','DELETE' | 'GET' | 'HEAD' | 'OPTIONS' | 'POST' | 'PUT' | 'TRACE' | binary() | string(),'*' | binary() | string() | {'abs_path',binary() | [any()]} | {'scheme',binary() | [any()],binary() | [any()]} | {'absoluteURI','http' | 'https',binary() | [any()],'undefined' | non_neg_integer(),binary() | [any()]},{non_neg_integer(),non_neg_integer()}} | {'http_response',{non_neg_integer(),non_neg_integer()},integer(),binary() | string()} | {'http_header',integer(),atom() | binary() | string(),_,binary() | string()}}
+httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',_}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
httpd_request_handler.erl:645: Function will never be called
+httpd_socket.erl:129: Call to missing or unexported function ssl:accept/2
+httpd_socket.erl:49: The pattern {'ok', _} can never match the type {'error',_}
httpd_sup.erl:63: The variable Else can never match since previous clauses completely covered the type {'error',_} | {'ok',[any()],_,_}
httpd_sup.erl:88: The pattern {'error', Reason} can never match the type {'ok',_,_}
httpd_sup.erl:92: The variable Else can never match since previous clauses completely covered the type {'ok',_,_}
@@ -38,17 +43,17 @@ mod_auth_plain.erl:100: The variable _ can never match since previous clauses co
mod_auth_plain.erl:159: The variable _ can never match since previous clauses completely covered the type [any()]
mod_auth_plain.erl:83: The variable O can never match since previous clauses completely covered the type [any()]
mod_cgi.erl:372: The pattern {'http_response', NewAccResponse} can never match the type 'ok'
-mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
mod_dir.erl:72: The pattern {'error', Reason} can never match the type {'ok',[[[any()] | char()],...]}
-mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [any()] | char()]>
-mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_htaccess.erl:460: The pattern {'error', BadData} can never match the type {'ok',_}
-mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
-mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],string()}
+mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],string()}
+mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_include.erl:716: Function read_error/3 will never be called
mod_include.erl:719: Function read_error/4 will never be called
mod_security_server.erl:386: The variable O can never match since previous clauses completely covered the type [any()]
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
index e199581a0e..2be71ac7d7 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
@@ -6,6 +6,7 @@ mnesia_bup.erl:111: The created fun has no local return
mnesia_bup.erl:574: Function fallback_receiver/2 has no local return
mnesia_bup.erl:967: Function uninstall_fallback_master/2 has no local return
mnesia_checkpoint.erl:1014: The variable Error can never match since previous clauses completely covered the type {'ok',#checkpoint_args{nodes::[any()],retainers::[any(),...]}}
+mnesia_checkpoint.erl:894: The call sys:handle_system_msg(Msg::any(),From::any(),'no_parent','mnesia_checkpoint',[],Cp::#checkpoint_args{}) breaks the contract (Msg,From,Parent,Module,Debug,Misc) -> Void when is_subtype(Msg,term()), is_subtype(From,{pid(),Tag::_}), is_subtype(Parent,pid()), is_subtype(Module,module()), is_subtype(Debug,[dbg_opt()]), is_subtype(Misc,term()), is_subtype(Void,term())
mnesia_controller.erl:1666: The variable Tab can never match since previous clauses completely covered the type [any()]
mnesia_controller.erl:1679: The pattern {'stop', Reason, Reply, State2} can never match the type {'noreply',_} | {'reply',_,_} | {'stop','shutdown',#state{}}
mnesia_controller.erl:1685: The pattern {'noreply', State2, _Timeout} can never match the type {'reply',_,_}
@@ -15,6 +16,7 @@ mnesia_frag.erl:294: The call mnesia_frag:remote_collect(Ref::reference(),{'erro
mnesia_frag.erl:304: The call mnesia_frag:remote_collect(Ref::reference(),{'error',{'node_not_running',_}},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_frag.erl:312: The call mnesia_frag:remote_collect(Ref::reference(),LocalRes::{'error',_},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_index.erl:52: The call mnesia_lib:other_val(Var::{_,'commit_work' | 'index' | 'setorbag' | 'storage_type' | {'index',_}},_ReASoN_::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
+mnesia_lib.erl:1028: The pattern {'EXIT', Reason} can never match the type [any()] | {'error',_}
mnesia_lib.erl:957: The pattern {'ok', {0, _}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_lib.erl:959: The pattern {'ok', {_, Bin}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_loader.erl:36: The call mnesia_lib:other_val(Var::{_,'access_mode' | 'cstruct' | 'db_nodes' | 'setorbag' | 'snmp' | 'storage_type'},Reason::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
@@ -30,5 +32,6 @@ mnesia_schema.erl:1258: Guard test FromS::'disc_copies' | 'disc_only_copies' | '
mnesia_schema.erl:1639: The pattern {'false', 'mandatory'} can never match the type {'false','optional'}
mnesia_schema.erl:2434: The variable Reason can never match since previous clauses completely covered the type {'error',_} | {'ok',_}
mnesia_schema.erl:451: Guard test UseDirAnyway::'false' == 'true' can never succeed
+mnesia_text.erl:180: The variable T can never match since previous clauses completely covered the type {'error',{integer(),atom() | tuple(),_}} | {'ok',_}
mnesia_tm.erl:1522: Function commit_participant/5 has no local return
mnesia_tm.erl:2169: Function system_terminate/4 has no local return
diff --git a/lib/dialyzer/test/race_SUITE_data/results/extract_translations b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
index f7d5abc6f5..62aa1aa511 100644
--- a/lib/dialyzer/test/race_SUITE_data/results/extract_translations
+++ b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
@@ -1,5 +1,5 @@
-extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 135
+extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 135
extract_translations.erl:146: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
-extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 148
+extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 148
extract_translations.erl:154: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
diff --git a/lib/dialyzer/test/small_SUITE_data/results/common_eunit b/lib/dialyzer/test/small_SUITE_data/results/common_eunit
new file mode 100644
index 0000000000..bb5fd1c9ac
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/results/common_eunit
@@ -0,0 +1,2 @@
+
+common_eunit.erl:57: The created fun has no local return
diff --git a/lib/dialyzer/test/small_SUITE_data/results/comparisons b/lib/dialyzer/test/small_SUITE_data/results/comparisons
new file mode 100644
index 0000000000..642585d25e
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/results/comparisons
@@ -0,0 +1,153 @@
+
+comparisons.erl:100: The pattern 'true' can never match the type 'false'
+comparisons.erl:101: The pattern 'true' can never match the type 'false'
+comparisons.erl:102: The pattern 'false' can never match the type 'true'
+comparisons.erl:103: The pattern 'false' can never match the type 'true'
+comparisons.erl:104: The pattern 'true' can never match the type 'false'
+comparisons.erl:105: The pattern 'true' can never match the type 'false'
+comparisons.erl:107: The pattern 'true' can never match the type 'false'
+comparisons.erl:108: The pattern 'true' can never match the type 'false'
+comparisons.erl:109: The pattern 'false' can never match the type 'true'
+comparisons.erl:110: The pattern 'false' can never match the type 'true'
+comparisons.erl:111: The pattern 'true' can never match the type 'false'
+comparisons.erl:112: The pattern 'true' can never match the type 'false'
+comparisons.erl:113: The pattern 'false' can never match the type 'true'
+comparisons.erl:114: The pattern 'false' can never match the type 'true'
+comparisons.erl:115: The pattern 'true' can never match the type 'false'
+comparisons.erl:116: The pattern 'true' can never match the type 'false'
+comparisons.erl:117: The pattern 'false' can never match the type 'true'
+comparisons.erl:118: The pattern 'false' can never match the type 'true'
+comparisons.erl:123: The pattern 'false' can never match the type 'true'
+comparisons.erl:124: The pattern 'false' can never match the type 'true'
+comparisons.erl:125: The pattern 'true' can never match the type 'false'
+comparisons.erl:126: The pattern 'true' can never match the type 'false'
+comparisons.erl:127: The pattern 'false' can never match the type 'true'
+comparisons.erl:128: The pattern 'false' can never match the type 'true'
+comparisons.erl:129: The pattern 'true' can never match the type 'false'
+comparisons.erl:130: The pattern 'true' can never match the type 'false'
+comparisons.erl:132: The pattern 'true' can never match the type 'false'
+comparisons.erl:133: The pattern 'true' can never match the type 'false'
+comparisons.erl:134: The pattern 'false' can never match the type 'true'
+comparisons.erl:135: The pattern 'false' can never match the type 'true'
+comparisons.erl:136: The pattern 'true' can never match the type 'false'
+comparisons.erl:137: The pattern 'true' can never match the type 'false'
+comparisons.erl:138: The pattern 'false' can never match the type 'true'
+comparisons.erl:139: The pattern 'false' can never match the type 'true'
+comparisons.erl:140: The pattern 'true' can never match the type 'false'
+comparisons.erl:141: The pattern 'true' can never match the type 'false'
+comparisons.erl:142: The pattern 'false' can never match the type 'true'
+comparisons.erl:143: The pattern 'false' can never match the type 'true'
+comparisons.erl:144: The pattern 'true' can never match the type 'false'
+comparisons.erl:145: The pattern 'true' can never match the type 'false'
+comparisons.erl:146: The pattern 'false' can never match the type 'true'
+comparisons.erl:147: The pattern 'false' can never match the type 'true'
+comparisons.erl:152: The pattern 'false' can never match the type 'true'
+comparisons.erl:153: The pattern 'false' can never match the type 'true'
+comparisons.erl:154: The pattern 'true' can never match the type 'false'
+comparisons.erl:155: The pattern 'true' can never match the type 'false'
+comparisons.erl:157: The pattern 'true' can never match the type 'false'
+comparisons.erl:158: The pattern 'true' can never match the type 'false'
+comparisons.erl:159: The pattern 'false' can never match the type 'true'
+comparisons.erl:160: The pattern 'false' can never match the type 'true'
+comparisons.erl:161: The pattern 'true' can never match the type 'false'
+comparisons.erl:162: The pattern 'true' can never match the type 'false'
+comparisons.erl:163: The pattern 'false' can never match the type 'true'
+comparisons.erl:164: The pattern 'false' can never match the type 'true'
+comparisons.erl:165: The pattern 'true' can never match the type 'false'
+comparisons.erl:166: The pattern 'true' can never match the type 'false'
+comparisons.erl:167: The pattern 'false' can never match the type 'true'
+comparisons.erl:168: The pattern 'false' can never match the type 'true'
+comparisons.erl:169: The pattern 'true' can never match the type 'false'
+comparisons.erl:170: The pattern 'true' can never match the type 'false'
+comparisons.erl:171: The pattern 'false' can never match the type 'true'
+comparisons.erl:172: The pattern 'false' can never match the type 'true'
+comparisons.erl:173: The pattern 'true' can never match the type 'false'
+comparisons.erl:174: The pattern 'true' can never match the type 'false'
+comparisons.erl:175: The pattern 'false' can never match the type 'true'
+comparisons.erl:176: The pattern 'false' can never match the type 'true'
+comparisons.erl:186: The pattern 'false' can never match the type 'true'
+comparisons.erl:187: The pattern 'false' can never match the type 'true'
+comparisons.erl:188: The pattern 'true' can never match the type 'false'
+comparisons.erl:189: The pattern 'true' can never match the type 'false'
+comparisons.erl:190: The pattern 'false' can never match the type 'true'
+comparisons.erl:191: The pattern 'false' can never match the type 'true'
+comparisons.erl:192: The pattern 'true' can never match the type 'false'
+comparisons.erl:193: The pattern 'true' can never match the type 'false'
+comparisons.erl:203: The pattern 'false' can never match the type 'true'
+comparisons.erl:204: The pattern 'false' can never match the type 'true'
+comparisons.erl:205: The pattern 'true' can never match the type 'false'
+comparisons.erl:206: The pattern 'true' can never match the type 'false'
+comparisons.erl:208: The pattern 'true' can never match the type 'false'
+comparisons.erl:209: The pattern 'true' can never match the type 'false'
+comparisons.erl:210: The pattern 'false' can never match the type 'true'
+comparisons.erl:211: The pattern 'false' can never match the type 'true'
+comparisons.erl:221: The pattern 'true' can never match the type 'false'
+comparisons.erl:222: The pattern 'true' can never match the type 'false'
+comparisons.erl:223: The pattern 'false' can never match the type 'true'
+comparisons.erl:224: The pattern 'false' can never match the type 'true'
+comparisons.erl:225: The pattern 'true' can never match the type 'false'
+comparisons.erl:226: The pattern 'true' can never match the type 'false'
+comparisons.erl:227: The pattern 'false' can never match the type 'true'
+comparisons.erl:228: The pattern 'false' can never match the type 'true'
+comparisons.erl:242: The pattern 'false' can never match the type 'true'
+comparisons.erl:243: The pattern 'false' can never match the type 'true'
+comparisons.erl:244: The pattern 'true' can never match the type 'false'
+comparisons.erl:245: The pattern 'true' can never match the type 'false'
+comparisons.erl:246: The pattern 'false' can never match the type 'true'
+comparisons.erl:247: The pattern 'false' can never match the type 'true'
+comparisons.erl:248: The pattern 'true' can never match the type 'false'
+comparisons.erl:249: The pattern 'true' can never match the type 'false'
+comparisons.erl:251: The pattern 'true' can never match the type 'false'
+comparisons.erl:252: The pattern 'true' can never match the type 'false'
+comparisons.erl:253: The pattern 'false' can never match the type 'true'
+comparisons.erl:254: The pattern 'false' can never match the type 'true'
+comparisons.erl:263: The pattern 'false' can never match the type 'true'
+comparisons.erl:264: The pattern 'false' can never match the type 'true'
+comparisons.erl:265: The pattern 'true' can never match the type 'false'
+comparisons.erl:266: The pattern 'true' can never match the type 'false'
+comparisons.erl:268: The pattern 'true' can never match the type 'false'
+comparisons.erl:269: The pattern 'true' can never match the type 'false'
+comparisons.erl:270: The pattern 'false' can never match the type 'true'
+comparisons.erl:271: The pattern 'false' can never match the type 'true'
+comparisons.erl:272: The pattern 'true' can never match the type 'false'
+comparisons.erl:273: The pattern 'true' can never match the type 'false'
+comparisons.erl:274: The pattern 'false' can never match the type 'true'
+comparisons.erl:275: The pattern 'false' can never match the type 'true'
+comparisons.erl:293: The pattern 'false' can never match the type 'true'
+comparisons.erl:294: The pattern 'false' can never match the type 'true'
+comparisons.erl:295: The pattern 'true' can never match the type 'false'
+comparisons.erl:296: The pattern 'true' can never match the type 'false'
+comparisons.erl:311: The pattern 'true' can never match the type 'false'
+comparisons.erl:312: The pattern 'true' can never match the type 'false'
+comparisons.erl:313: The pattern 'false' can never match the type 'true'
+comparisons.erl:314: The pattern 'false' can never match the type 'true'
+comparisons.erl:44: The pattern 'false' can never match the type 'true'
+comparisons.erl:45: The pattern 'false' can never match the type 'true'
+comparisons.erl:46: The pattern 'true' can never match the type 'false'
+comparisons.erl:47: The pattern 'true' can never match the type 'false'
+comparisons.erl:48: The pattern 'false' can never match the type 'true'
+comparisons.erl:49: The pattern 'false' can never match the type 'true'
+comparisons.erl:50: The pattern 'true' can never match the type 'false'
+comparisons.erl:51: The pattern 'true' can never match the type 'false'
+comparisons.erl:52: The pattern 'false' can never match the type 'true'
+comparisons.erl:53: The pattern 'false' can never match the type 'true'
+comparisons.erl:54: The pattern 'true' can never match the type 'false'
+comparisons.erl:55: The pattern 'true' can never match the type 'false'
+comparisons.erl:69: The pattern 'false' can never match the type 'true'
+comparisons.erl:70: The pattern 'false' can never match the type 'true'
+comparisons.erl:71: The pattern 'true' can never match the type 'false'
+comparisons.erl:72: The pattern 'true' can never match the type 'false'
+comparisons.erl:73: The pattern 'false' can never match the type 'true'
+comparisons.erl:74: The pattern 'false' can never match the type 'true'
+comparisons.erl:75: The pattern 'true' can never match the type 'false'
+comparisons.erl:76: The pattern 'true' can never match the type 'false'
+comparisons.erl:77: The pattern 'false' can never match the type 'true'
+comparisons.erl:78: The pattern 'false' can never match the type 'true'
+comparisons.erl:79: The pattern 'true' can never match the type 'false'
+comparisons.erl:80: The pattern 'true' can never match the type 'false'
+comparisons.erl:94: The pattern 'false' can never match the type 'true'
+comparisons.erl:95: The pattern 'false' can never match the type 'true'
+comparisons.erl:96: The pattern 'true' can never match the type 'false'
+comparisons.erl:97: The pattern 'true' can never match the type 'false'
+comparisons.erl:98: The pattern 'false' can never match the type 'true'
+comparisons.erl:99: The pattern 'false' can never match the type 'true'
diff --git a/lib/dialyzer/test/small_SUITE_data/results/failing_funs b/lib/dialyzer/test/small_SUITE_data/results/failing_funs
new file mode 100644
index 0000000000..a1fb22cbc6
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/results/failing_funs
@@ -0,0 +1,20 @@
+
+failing_funs.erl:101: The created fun has no local return
+failing_funs.erl:104: The created fun has no local return
+failing_funs.erl:127: The created fun has no local return
+failing_funs.erl:135: The created fun has no local return
+failing_funs.erl:138: The created fun has no local return
+failing_funs.erl:13: Function foo3/0 has no local return
+failing_funs.erl:13: The pattern 'b' can never match the type 'a'
+failing_funs.erl:161: The created fun has no local return
+failing_funs.erl:169: The created fun has no local return
+failing_funs.erl:172: The created fun has no local return
+failing_funs.erl:17: The pattern 'b' can never match the type 'a'
+failing_funs.erl:195: The created fun has no local return
+failing_funs.erl:203: The created fun has no local return
+failing_funs.erl:206: The created fun has no local return
+failing_funs.erl:229: The created fun has no local return
+failing_funs.erl:55: The created fun has no local return
+failing_funs.erl:62: The created fun has no local return
+failing_funs.erl:69: The created fun has no local return
+failing_funs.erl:76: The created fun has no local return
diff --git a/lib/dialyzer/test/small_SUITE_data/results/flatten b/lib/dialyzer/test/small_SUITE_data/results/flatten
index 4571214e49..8aa44dd002 100644
--- a/lib/dialyzer/test/small_SUITE_data/results/flatten
+++ b/lib/dialyzer/test/small_SUITE_data/results/flatten
@@ -1,2 +1,2 @@
-flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
diff --git a/lib/dialyzer/test/small_SUITE_data/results/my_sofs b/lib/dialyzer/test/small_SUITE_data/results/my_sofs
index bfee0bce0d..bc97c08d62 100644
--- a/lib/dialyzer/test/small_SUITE_data/results/my_sofs
+++ b/lib/dialyzer/test/small_SUITE_data/results/my_sofs
@@ -1,3 +1,3 @@
-my_sofs.erl:34: The pattern {'Set', _, _} can never match the type #OrdSet{}
-my_sofs.erl:54: The pattern {'Set', _, _} can never match the type #OrdSet{}
+my_sofs.erl:34: The pattern {'Set', _, _} can never match the type #'OrdSet'{}
+my_sofs.erl:54: The pattern {'Set', _, _} can never match the type #'OrdSet'{}
diff --git a/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
new file mode 100644
index 0000000000..c1e82bfa59
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
@@ -0,0 +1,8 @@
+-module(test).
+
+-export([bin_compr/0]).
+
+bin_compr() ->
+% [ 0 || {N, V} <- [{a, b}] ]. % Works ok
+ << <<>> || {A, B} <- [{a, b}] >>. % Complains
+% << <<>> || X <- [{a, b}] >>. % Works ok
diff --git a/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
new file mode 100644
index 0000000000..8abf872b37
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
@@ -0,0 +1,35 @@
+%%---------------------------------------------------------------------
+%% From: Peer Stritzinger
+%% Date: 1 May 2011
+%% Subject: Dialyzer v2.2.0 crash
+%%
+%% Binaries of the form <<_:N,_:_*M>> in specs resulted in a crash:
+%% dialyzer: Analysis failed with error: {{case_clause,8},
+%% [{erl_types,t_form_to_string,1},
+%% {erl_types,t_form_to_string,1},
+%% {dialyzer_contracts,contract_to_string_1,1},
+%% {dialyzer_contracts,extra_contract_warning,6},
+%% {dialyzer_contracts,picky_contract_check,7},
+%% because function erl_types:t_form_to_string/1 was not the inverse
+%% of erl_types:t_to_string/2.
+%%
+%% Fixed on the same date and send to OTP for inclusion.
+%%---------------------------------------------------------------------
+-module(codec_can).
+
+-export([recv/3, decode/1]).
+
+-record(can_pkt, {id, data :: binary(), timestamp}).
+
+-type can_pkt() :: #can_pkt{}.
+-type channel() :: atom() | pid() | {atom(),_}.
+
+-spec recv(<<_:64,_:_*8>>, fun((can_pkt()) -> R), channel()) -> R.
+recv(Packet, Fun, Chan) ->
+ #can_pkt{id = Can_id, data = Can_data} = P = decode(Packet),
+ Fun(P).
+
+-spec decode(<<_:64,_:_*8>>) -> #can_pkt{id::<<_:11>>,timestamp::char()}.
+decode(<<_:12, Len:4, Timestamp:16, 0:3, Id:11/bitstring, 0:18,
+ Data:Len/binary, _/binary>>) ->
+ #can_pkt{id = Id, data = Data, timestamp = Timestamp}.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl b/lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl
new file mode 100644
index 0000000000..bca390068e
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/common_eunit.erl
@@ -0,0 +1,121 @@
+%%=====================================================================
+%% Program with an erroneous type declaration that caused dialyzer to
+%% go into an infinite loop. There are some comments that explain the
+%% symptoms and the culprit: the return of test_fun() is erroneous and
+%% its type should read
+%% fun((config()) -> test_rep() | [test_rep()])
+%% instead. But this should not throw dialyzer into an infinite loop.
+%% This concerned dialyzer in R14B02 (and probably prior).
+%%=====================================================================
+-module(common_eunit).
+
+-export([expand_cases/2]).
+
+-type test_name() :: atom() | {'group', atom()}.
+
+-type test_rep() :: {{atom(), atom(), arity()}, fun()}
+ | {'setup', fun(), fun()}
+ | {'setup', fun(), fun(), fun()}
+ | {atom(), test_rep()}
+ | {atom(), term(), test_rep()}.
+
+-type config() :: [proplists:property()].
+
+-type control() :: tuple() | atom().
+
+%% The combination of the following type and the (erroneous) spec for
+%% expand_cases/2 is the reason for the infinite loop in dialyzer.
+-type test_fun() :: fun((config()) -> test_rep()).
+
+%% If one comments out this spec the infinite loop disappears.
+-spec expand_cases(atom(), test_name() | [test_name()]) -> test_fun().
+expand_cases(Module, Cases) ->
+ if is_list(Cases) ->
+ TestFuns = [expand_case(Module, Case) || Case <- Cases],
+ fun(Config) -> [F(Config) || F <- TestFuns] end;
+ is_atom(Cases); is_tuple(Cases) ->
+ expand_cases(Module, [Cases])
+ end.
+
+-spec expand_case(atom(), test_name()) -> test_fun().
+expand_case(Module, CaseName) when is_atom(CaseName) ->
+ TestFun = fun(Config) ->
+ {{Module, CaseName, 1},
+ fun() -> apply(Module, CaseName, [Config]) end}
+ end,
+ setup_wrapper(Module, TestFun, {init_per_testcase, [CaseName]},
+ {end_per_testcase, [CaseName]});
+expand_case(Module, {group, GroupName}) ->
+ {Control, Cases} = group_specification(Module, GroupName),
+ TestFun = control_wrapper(Control, expand_cases(Module, Cases)),
+ setup_wrapper(Module, TestFun, {init_per_group, [GroupName]},
+ {end_per_group, [GroupName]}).
+
+-spec control_wrapper([control()], test_fun()) -> test_fun().
+control_wrapper([Control|T], TestFun0) ->
+ TestFun1 = control_wrapper(T, TestFun0),
+ fun(Config) ->
+ case Control of
+ parallel ->
+ {inparallel, TestFun1(Config)};
+ sequence ->
+ {inorder, TestFun1(Config)};
+ {timetrap, Time} ->
+ Seconds = case Time of
+ {hours, Hs} -> Hs * 60 * 60;
+ {minutes, Ms} -> Ms * 60;
+ {seconds, Ss} -> Ss;
+ MSs -> MSs / 1000
+ end,
+ {timeout, Seconds, TestFun1(Config)};
+ C when is_atom(C) ->
+ {C, TestFun1(Config)};
+ {C, Arg} ->
+ {C, Arg, TestFun1(Config)}
+ end
+ end;
+control_wrapper([], TestFun) ->
+ TestFun.
+
+-spec setup_wrapper(atom(), test_fun(), Callback, Callback) -> test_fun()
+ when Callback :: {atom(), list()}.
+setup_wrapper(Module, TestFun, {Setup, SA}, {Cleanup, CA}) ->
+ case erlang:function_exported(Module, Setup, length(SA) + 1) of
+ true ->
+ case erlang:function_exported(Module, Cleanup, length(CA) + 1) of
+ true ->
+ fun(Config0) ->
+ {setup,
+ fun() ->
+ apply(Module, Setup, SA ++ [Config0])
+ end,
+ fun(Config1) ->
+ apply(Module, Cleanup, CA ++ [Config1])
+ end,
+ TestFun}
+ end;
+ false ->
+ fun(Config) ->
+ {setup,
+ fun() ->
+ apply(Module, Setup, SA ++ [Config])
+ end,
+ TestFun}
+ end
+ end;
+ false ->
+ TestFun
+ end.
+
+-spec group_specification(atom(), atom()) -> {[control()], [test_name()]}.
+group_specification(Module, GroupName) ->
+ case lists:keyfind(GroupName, 1, Module:groups()) of
+ {_, Control, Cases} when is_list(Control), is_list(Cases) ->
+ {Control, Cases};
+ {_, Cases} when is_list(Cases) ->
+ {[], Cases};
+ false ->
+ exit({missing_group, GroupName});
+ _ ->
+ exit({bad_group_spec, GroupName})
+ end.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/comparisons.erl b/lib/dialyzer/test/small_SUITE_data/src/comparisons.erl
new file mode 100644
index 0000000000..70e3cb6af4
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/comparisons.erl
@@ -0,0 +1,322 @@
+-module(comparisons).
+
+-compile(export_all).
+
+-define(r, get(r)).
+
+integer() -> integer(?r).
+integer(X) when is_integer(X) -> X.
+
+mfloat() -> float(?r).
+mfloat(X) when is_float(X) -> X.
+
+atom() -> atom(?r).
+atom(X) when is_atom(X) -> X.
+
+tuple() -> tuple(?r).
+tuple(X) when is_tuple(X) -> X.
+
+list() -> list(?r).
+list(X) when is_list(X) -> X.
+
+i() -> integer().
+f() -> mfloat().
+n() -> case ?r of 1 -> i(); 2 -> f() end.
+a() -> atom().
+t() -> tuple().
+l() -> list().
+na() -> case ?r of 1 -> n(); 2 -> a() end.
+at() -> case ?r of 1 -> t(); 2 -> a() end.
+tl() -> case ?r of 1 -> t(); 2 -> l() end.
+
+test_i_ll_i() -> case i() < i() of true -> maybe; false -> maybe_too end.
+test_i_le_i() -> case i() =< i() of true -> maybe; false -> maybe_too end.
+test_i_gg_i() -> case i() > i() of true -> maybe; false -> maybe_too end.
+test_i_ge_i() -> case i() >= i() of true -> maybe; false -> maybe_too end.
+test_i_ll_f() -> case i() < f() of true -> maybe; false -> maybe_too end.
+test_i_le_f() -> case i() =< f() of true -> maybe; false -> maybe_too end.
+test_i_gg_f() -> case i() > f() of true -> maybe; false -> maybe_too end.
+test_i_ge_f() -> case i() >= f() of true -> maybe; false -> maybe_too end.
+test_i_ll_n() -> case i() < n() of true -> maybe; false -> maybe_too end.
+test_i_le_n() -> case i() =< n() of true -> maybe; false -> maybe_too end.
+test_i_gg_n() -> case i() > n() of true -> maybe; false -> maybe_too end.
+test_i_ge_n() -> case i() >= n() of true -> maybe; false -> maybe_too end.
+test_i_ll_a() -> case i() < a() of true -> always; false -> never end.
+test_i_le_a() -> case i() =< a() of true -> always; false -> never end.
+test_i_gg_a() -> case i() > a() of true -> never; false -> always end.
+test_i_ge_a() -> case i() >= a() of true -> never; false -> always end.
+test_i_ll_t() -> case i() < t() of true -> always; false -> never end.
+test_i_le_t() -> case i() =< t() of true -> always; false -> never end.
+test_i_gg_t() -> case i() > t() of true -> never; false -> always end.
+test_i_ge_t() -> case i() >= t() of true -> never; false -> always end.
+test_i_ll_l() -> case i() < l() of true -> always; false -> never end.
+test_i_le_l() -> case i() =< l() of true -> always; false -> never end.
+test_i_gg_l() -> case i() > l() of true -> never; false -> always end.
+test_i_ge_l() -> case i() >= l() of true -> never; false -> always end.
+
+test_f_ll_i() -> case f() < i() of true -> maybe; false -> maybe_too end.
+test_f_le_i() -> case f() =< i() of true -> maybe; false -> maybe_too end.
+test_f_gg_i() -> case f() > i() of true -> maybe; false -> maybe_too end.
+test_f_ge_i() -> case f() >= i() of true -> maybe; false -> maybe_too end.
+test_f_ll_f() -> case f() < f() of true -> maybe; false -> maybe_too end.
+test_f_le_f() -> case f() =< f() of true -> maybe; false -> maybe_too end.
+test_f_gg_f() -> case f() > f() of true -> maybe; false -> maybe_too end.
+test_f_ge_f() -> case f() >= f() of true -> maybe; false -> maybe_too end.
+test_f_ll_n() -> case f() < n() of true -> maybe; false -> maybe_too end.
+test_f_le_n() -> case f() =< n() of true -> maybe; false -> maybe_too end.
+test_f_gg_n() -> case f() > n() of true -> maybe; false -> maybe_too end.
+test_f_ge_n() -> case f() >= n() of true -> maybe; false -> maybe_too end.
+test_f_ll_a() -> case f() < a() of true -> always; false -> never end.
+test_f_le_a() -> case f() =< a() of true -> always; false -> never end.
+test_f_gg_a() -> case f() > a() of true -> never; false -> always end.
+test_f_ge_a() -> case f() >= a() of true -> never; false -> always end.
+test_f_ll_t() -> case f() < t() of true -> always; false -> never end.
+test_f_le_t() -> case f() =< t() of true -> always; false -> never end.
+test_f_gg_t() -> case f() > t() of true -> never; false -> always end.
+test_f_ge_t() -> case f() >= t() of true -> never; false -> always end.
+test_f_ll_l() -> case f() < l() of true -> always; false -> never end.
+test_f_le_l() -> case f() =< l() of true -> always; false -> never end.
+test_f_gg_l() -> case f() > l() of true -> never; false -> always end.
+test_f_ge_l() -> case f() >= l() of true -> never; false -> always end.
+
+test_n_ll_i() -> case n() < i() of true -> maybe; false -> maybe_too end.
+test_n_le_i() -> case n() =< i() of true -> maybe; false -> maybe_too end.
+test_n_gg_i() -> case n() > i() of true -> maybe; false -> maybe_too end.
+test_n_ge_i() -> case n() >= i() of true -> maybe; false -> maybe_too end.
+test_n_ll_f() -> case n() < f() of true -> maybe; false -> maybe_too end.
+test_n_le_f() -> case n() =< f() of true -> maybe; false -> maybe_too end.
+test_n_gg_f() -> case n() > f() of true -> maybe; false -> maybe_too end.
+test_n_ge_f() -> case n() >= f() of true -> maybe; false -> maybe_too end.
+test_n_ll_n() -> case n() < n() of true -> maybe; false -> maybe_too end.
+test_n_le_n() -> case n() =< n() of true -> maybe; false -> maybe_too end.
+test_n_gg_n() -> case n() > n() of true -> maybe; false -> maybe_too end.
+test_n_ge_n() -> case n() >= n() of true -> maybe; false -> maybe_too end.
+test_n_ll_a() -> case n() < a() of true -> always; false -> never end.
+test_n_le_a() -> case n() =< a() of true -> always; false -> never end.
+test_n_gg_a() -> case n() > a() of true -> never; false -> always end.
+test_n_ge_a() -> case n() >= a() of true -> never; false -> always end.
+test_n_ll_t() -> case n() < t() of true -> always; false -> never end.
+test_n_le_t() -> case n() =< t() of true -> always; false -> never end.
+test_n_gg_t() -> case n() > t() of true -> never; false -> always end.
+test_n_ge_t() -> case n() >= t() of true -> never; false -> always end.
+test_n_ll_l() -> case n() < l() of true -> always; false -> never end.
+test_n_le_l() -> case n() =< l() of true -> always; false -> never end.
+test_n_gg_l() -> case n() > l() of true -> never; false -> always end.
+test_n_ge_l() -> case n() >= l() of true -> never; false -> always end.
+
+test_a_ll_i() -> case a() < i() of true -> never; false -> always end.
+test_a_le_i() -> case a() =< i() of true -> never; false -> always end.
+test_a_gg_i() -> case a() > i() of true -> always; false -> never end.
+test_a_ge_i() -> case a() >= i() of true -> always; false -> never end.
+test_a_ll_f() -> case a() < f() of true -> never; false -> always end.
+test_a_le_f() -> case a() =< f() of true -> never; false -> always end.
+test_a_gg_f() -> case a() > f() of true -> always; false -> never end.
+test_a_ge_f() -> case a() >= f() of true -> always; false -> never end.
+test_a_ll_n() -> case a() < n() of true -> never; false -> always end.
+test_a_le_n() -> case a() =< n() of true -> never; false -> always end.
+test_a_gg_n() -> case a() > n() of true -> always; false -> never end.
+test_a_ge_n() -> case a() >= n() of true -> always; false -> never end.
+test_a_ll_a() -> case a() < a() of true -> maybe; false -> maybe_too end.
+test_a_le_a() -> case a() =< a() of true -> maybe; false -> maybe_too end.
+test_a_gg_a() -> case a() > a() of true -> maybe; false -> maybe_too end.
+test_a_ge_a() -> case a() >= a() of true -> maybe; false -> maybe_too end.
+test_a_ll_t() -> case a() < t() of true -> always; false -> never end.
+test_a_le_t() -> case a() =< t() of true -> always; false -> never end.
+test_a_gg_t() -> case a() > t() of true -> never; false -> always end.
+test_a_ge_t() -> case a() >= t() of true -> never; false -> always end.
+test_a_ll_l() -> case a() < l() of true -> always; false -> never end.
+test_a_le_l() -> case a() =< l() of true -> always; false -> never end.
+test_a_gg_l() -> case a() > l() of true -> never; false -> always end.
+test_a_ge_l() -> case a() >= l() of true -> never; false -> always end.
+
+test_t_ll_i() -> case t() < i() of true -> never; false -> always end.
+test_t_le_i() -> case t() =< i() of true -> never; false -> always end.
+test_t_gg_i() -> case t() > i() of true -> always; false -> never end.
+test_t_ge_i() -> case t() >= i() of true -> always; false -> never end.
+test_t_ll_f() -> case t() < f() of true -> never; false -> always end.
+test_t_le_f() -> case t() =< f() of true -> never; false -> always end.
+test_t_gg_f() -> case t() > f() of true -> always; false -> never end.
+test_t_ge_f() -> case t() >= f() of true -> always; false -> never end.
+test_t_ll_n() -> case t() < n() of true -> never; false -> always end.
+test_t_le_n() -> case t() =< n() of true -> never; false -> always end.
+test_t_gg_n() -> case t() > n() of true -> always; false -> never end.
+test_t_ge_n() -> case t() >= n() of true -> always; false -> never end.
+test_t_ll_a() -> case t() < a() of true -> never; false -> always end.
+test_t_le_a() -> case t() =< a() of true -> never; false -> always end.
+test_t_gg_a() -> case t() > a() of true -> always; false -> never end.
+test_t_ge_a() -> case t() >= a() of true -> always; false -> never end.
+test_t_ll_t() -> case t() < t() of true -> maybe; false -> maybe_too end.
+test_t_le_t() -> case t() =< t() of true -> maybe; false -> maybe_too end.
+test_t_gg_t() -> case t() > t() of true -> maybe; false -> maybe_too end.
+test_t_ge_t() -> case t() >= t() of true -> maybe; false -> maybe_too end.
+test_t_ll_l() -> case t() < l() of true -> always; false -> never end.
+test_t_le_l() -> case t() =< l() of true -> always; false -> never end.
+test_t_gg_l() -> case t() > l() of true -> never; false -> always end.
+test_t_ge_l() -> case t() >= l() of true -> never; false -> always end.
+
+test_l_ll_i() -> case l() < i() of true -> never; false -> always end.
+test_l_le_i() -> case l() =< i() of true -> never; false -> always end.
+test_l_gg_i() -> case l() > i() of true -> always; false -> never end.
+test_l_ge_i() -> case l() >= i() of true -> always; false -> never end.
+test_l_ll_f() -> case l() < f() of true -> never; false -> always end.
+test_l_le_f() -> case l() =< f() of true -> never; false -> always end.
+test_l_gg_f() -> case l() > f() of true -> always; false -> never end.
+test_l_ge_f() -> case l() >= f() of true -> always; false -> never end.
+test_l_ll_n() -> case l() < n() of true -> never; false -> always end.
+test_l_le_n() -> case l() =< n() of true -> never; false -> always end.
+test_l_gg_n() -> case l() > n() of true -> always; false -> never end.
+test_l_ge_n() -> case l() >= n() of true -> always; false -> never end.
+test_l_ll_a() -> case l() < a() of true -> never; false -> always end.
+test_l_le_a() -> case l() =< a() of true -> never; false -> always end.
+test_l_gg_a() -> case l() > a() of true -> always; false -> never end.
+test_l_ge_a() -> case l() >= a() of true -> always; false -> never end.
+test_l_ll_t() -> case l() < t() of true -> never; false -> always end.
+test_l_le_t() -> case l() =< t() of true -> never; false -> always end.
+test_l_gg_t() -> case l() > t() of true -> always; false -> never end.
+test_l_ge_t() -> case l() >= t() of true -> always; false -> never end.
+test_l_ll_l() -> case l() < l() of true -> maybe; false -> maybe_too end.
+test_l_le_l() -> case l() =< l() of true -> maybe; false -> maybe_too end.
+test_l_gg_l() -> case l() > l() of true -> maybe; false -> maybe_too end.
+test_l_ge_l() -> case l() >= l() of true -> maybe; false -> maybe_too end.
+
+test_n_ll_na() -> case n() < na() of true -> maybe; false -> maybe_too end.
+test_n_le_na() -> case n() =< na() of true -> maybe; false -> maybe_too end.
+test_n_gg_na() -> case n() > na() of true -> maybe; false -> maybe_too end.
+test_n_ge_na() -> case n() >= na() of true -> maybe; false -> maybe_too end.
+test_n_ll_at() -> case n() < at() of true -> always; false -> never end.
+test_n_le_at() -> case n() =< at() of true -> always; false -> never end.
+test_n_gg_at() -> case n() > at() of true -> never; false -> always end.
+test_n_ge_at() -> case n() >= at() of true -> never; false -> always end.
+test_n_ll_tl() -> case n() < tl() of true -> always; false -> never end.
+test_n_le_tl() -> case n() =< tl() of true -> always; false -> never end.
+test_n_gg_tl() -> case n() > tl() of true -> never; false -> always end.
+test_n_ge_tl() -> case n() >= tl() of true -> never; false -> always end.
+
+test_a_ll_na() -> case a() < na() of true -> maybe; false -> maybe_too end.
+test_a_le_na() -> case a() =< na() of true -> maybe; false -> maybe_too end.
+test_a_gg_na() -> case a() > na() of true -> maybe; false -> maybe_too end.
+test_a_ge_na() -> case a() >= na() of true -> maybe; false -> maybe_too end.
+test_a_ll_at() -> case a() < at() of true -> maybe; false -> maybe_too end.
+test_a_le_at() -> case a() =< at() of true -> maybe; false -> maybe_too end.
+test_a_gg_at() -> case a() > at() of true -> maybe; false -> maybe_too end.
+test_a_ge_at() -> case a() >= at() of true -> maybe; false -> maybe_too end.
+test_a_ll_tl() -> case a() < tl() of true -> always; false -> never end.
+test_a_le_tl() -> case a() =< tl() of true -> always; false -> never end.
+test_a_gg_tl() -> case a() > tl() of true -> never; false -> always end.
+test_a_ge_tl() -> case a() >= tl() of true -> never; false -> always end.
+
+test_t_ll_na() -> case t() < na() of true -> never; false -> always end.
+test_t_le_na() -> case t() =< na() of true -> never; false -> always end.
+test_t_gg_na() -> case t() > na() of true -> always; false -> never end.
+test_t_ge_na() -> case t() >= na() of true -> always; false -> never end.
+test_t_ll_at() -> case t() < at() of true -> maybe; false -> maybe_too end.
+test_t_le_at() -> case t() =< at() of true -> maybe; false -> maybe_too end.
+test_t_gg_at() -> case t() > at() of true -> maybe; false -> maybe_too end.
+test_t_ge_at() -> case t() >= at() of true -> maybe; false -> maybe_too end.
+test_t_ll_tl() -> case t() < tl() of true -> maybe; false -> maybe_too end.
+test_t_le_tl() -> case t() =< tl() of true -> maybe; false -> maybe_too end.
+test_t_gg_tl() -> case t() > tl() of true -> maybe; false -> maybe_too end.
+test_t_ge_tl() -> case t() >= tl() of true -> maybe; false -> maybe_too end.
+
+test_l_ll_na() -> case l() < na() of true -> never; false -> always end.
+test_l_le_na() -> case l() =< na() of true -> never; false -> always end.
+test_l_gg_na() -> case l() > na() of true -> always; false -> never end.
+test_l_ge_na() -> case l() >= na() of true -> always; false -> never end.
+test_l_ll_at() -> case l() < at() of true -> never; false -> always end.
+test_l_le_at() -> case l() =< at() of true -> never; false -> always end.
+test_l_gg_at() -> case l() > at() of true -> always; false -> never end.
+test_l_ge_at() -> case l() >= at() of true -> always; false -> never end.
+test_l_ll_tl() -> case l() < tl() of true -> maybe; false -> maybe_too end.
+test_l_le_tl() -> case l() =< tl() of true -> maybe; false -> maybe_too end.
+test_l_gg_tl() -> case l() > tl() of true -> maybe; false -> maybe_too end.
+test_l_ge_tl() -> case l() >= tl() of true -> maybe; false -> maybe_too end.
+
+test_na_ll_n() -> case na() < n() of true -> maybe; false -> maybe_too end.
+test_na_le_n() -> case na() =< n() of true -> maybe; false -> maybe_too end.
+test_na_gg_n() -> case na() > n() of true -> maybe; false -> maybe_too end.
+test_na_ge_n() -> case na() >= n() of true -> maybe; false -> maybe_too end.
+test_na_ll_a() -> case na() < a() of true -> maybe; false -> maybe_too end.
+test_na_le_a() -> case na() =< a() of true -> maybe; false -> maybe_too end.
+test_na_gg_a() -> case na() > a() of true -> maybe; false -> maybe_too end.
+test_na_ge_a() -> case na() >= a() of true -> maybe; false -> maybe_too end.
+test_na_ll_t() -> case na() < t() of true -> always; false -> never end.
+test_na_le_t() -> case na() =< t() of true -> always; false -> never end.
+test_na_gg_t() -> case na() > t() of true -> never; false -> always end.
+test_na_ge_t() -> case na() >= t() of true -> never; false -> always end.
+test_na_ll_l() -> case na() < l() of true -> always; false -> never end.
+test_na_le_l() -> case na() =< l() of true -> always; false -> never end.
+test_na_gg_l() -> case na() > l() of true -> never; false -> always end.
+test_na_ge_l() -> case na() >= l() of true -> never; false -> always end.
+
+test_at_ll_n() -> case at() < n() of true -> never; false -> always end.
+test_at_le_n() -> case at() =< n() of true -> never; false -> always end.
+test_at_gg_n() -> case at() > n() of true -> always; false -> never end.
+test_at_ge_n() -> case at() >= n() of true -> always; false -> never end.
+test_at_ll_a() -> case at() < a() of true -> maybe; false -> maybe_too end.
+test_at_le_a() -> case at() =< a() of true -> maybe; false -> maybe_too end.
+test_at_gg_a() -> case at() > a() of true -> maybe; false -> maybe_too end.
+test_at_ge_a() -> case at() >= a() of true -> maybe; false -> maybe_too end.
+test_at_ll_t() -> case at() < t() of true -> maybe; false -> maybe_too end.
+test_at_le_t() -> case at() =< t() of true -> maybe; false -> maybe_too end.
+test_at_gg_t() -> case at() > t() of true -> maybe; false -> maybe_too end.
+test_at_ge_t() -> case at() >= t() of true -> maybe; false -> maybe_too end.
+test_at_ll_l() -> case at() < l() of true -> always; false -> never end.
+test_at_le_l() -> case at() =< l() of true -> always; false -> never end.
+test_at_gg_l() -> case at() > l() of true -> never; false -> always end.
+test_at_ge_l() -> case at() >= l() of true -> never; false -> always end.
+
+test_tl_ll_n() -> case tl() < n() of true -> never; false -> always end.
+test_tl_le_n() -> case tl() =< n() of true -> never; false -> always end.
+test_tl_gg_n() -> case tl() > n() of true -> always; false -> never end.
+test_tl_ge_n() -> case tl() >= n() of true -> always; false -> never end.
+test_tl_ll_a() -> case tl() < a() of true -> never; false -> always end.
+test_tl_le_a() -> case tl() =< a() of true -> never; false -> always end.
+test_tl_gg_a() -> case tl() > a() of true -> always; false -> never end.
+test_tl_ge_a() -> case tl() >= a() of true -> always; false -> never end.
+test_tl_ll_t() -> case tl() < t() of true -> maybe; false -> maybe_too end.
+test_tl_le_t() -> case tl() =< t() of true -> maybe; false -> maybe_too end.
+test_tl_gg_t() -> case tl() > t() of true -> maybe; false -> maybe_too end.
+test_tl_ge_t() -> case tl() >= t() of true -> maybe; false -> maybe_too end.
+test_tl_ll_l() -> case tl() < l() of true -> maybe; false -> maybe_too end.
+test_tl_le_l() -> case tl() =< l() of true -> maybe; false -> maybe_too end.
+test_tl_gg_l() -> case tl() > l() of true -> maybe; false -> maybe_too end.
+test_tl_ge_l() -> case tl() >= l() of true -> maybe; false -> maybe_too end.
+
+test_na_ll_na() -> case na() < na() of true -> maybe; false -> maybe_too end.
+test_na_le_na() -> case na() =< na() of true -> maybe; false -> maybe_too end.
+test_na_gg_na() -> case na() > na() of true -> maybe; false -> maybe_too end.
+test_na_ge_na() -> case na() >= na() of true -> maybe; false -> maybe_too end.
+test_na_ll_at() -> case na() < at() of true -> maybe; false -> maybe_too end.
+test_na_le_at() -> case na() =< at() of true -> maybe; false -> maybe_too end.
+test_na_gg_at() -> case na() > at() of true -> maybe; false -> maybe_too end.
+test_na_ge_at() -> case na() >= at() of true -> maybe; false -> maybe_too end.
+test_na_ll_tl() -> case na() < tl() of true -> always; false -> never end.
+test_na_le_tl() -> case na() =< tl() of true -> always; false -> never end.
+test_na_gg_tl() -> case na() > tl() of true -> never; false -> always end.
+test_na_ge_tl() -> case na() >= tl() of true -> never; false -> always end.
+
+test_at_ll_na() -> case at() < na() of true -> maybe; false -> maybe_too end.
+test_at_le_na() -> case at() =< na() of true -> maybe; false -> maybe_too end.
+test_at_gg_na() -> case at() > na() of true -> maybe; false -> maybe_too end.
+test_at_ge_na() -> case at() >= na() of true -> maybe; false -> maybe_too end.
+test_at_ll_at() -> case at() < at() of true -> maybe; false -> maybe_too end.
+test_at_le_at() -> case at() =< at() of true -> maybe; false -> maybe_too end.
+test_at_gg_at() -> case at() > at() of true -> maybe; false -> maybe_too end.
+test_at_ge_at() -> case at() >= at() of true -> maybe; false -> maybe_too end.
+test_at_ll_tl() -> case at() < tl() of true -> maybe; false -> maybe_too end.
+test_at_le_tl() -> case at() =< tl() of true -> maybe; false -> maybe_too end.
+test_at_gg_tl() -> case at() > tl() of true -> maybe; false -> maybe_too end.
+test_at_ge_tl() -> case at() >= tl() of true -> maybe; false -> maybe_too end.
+
+test_tl_ll_na() -> case tl() < na() of true -> never; false -> always end.
+test_tl_le_na() -> case tl() =< na() of true -> never; false -> always end.
+test_tl_gg_na() -> case tl() > na() of true -> always; false -> never end.
+test_tl_ge_na() -> case tl() >= na() of true -> always; false -> never end.
+test_tl_ll_at() -> case tl() < at() of true -> maybe; false -> maybe_too end.
+test_tl_le_at() -> case tl() =< at() of true -> maybe; false -> maybe_too end.
+test_tl_gg_at() -> case tl() > at() of true -> maybe; false -> maybe_too end.
+test_tl_ge_at() -> case tl() >= at() of true -> maybe; false -> maybe_too end.
+test_tl_ll_tl() -> case tl() < tl() of true -> maybe; false -> maybe_too end.
+test_tl_le_tl() -> case tl() =< tl() of true -> maybe; false -> maybe_too end.
+test_tl_gg_tl() -> case tl() > tl() of true -> maybe; false -> maybe_too end.
+test_tl_ge_tl() -> case tl() >= tl() of true -> maybe; false -> maybe_too end.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl b/lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl
new file mode 100644
index 0000000000..1784c4a494
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/failing_funs.erl
@@ -0,0 +1,250 @@
+-module(failing_funs).
+
+-compile(export_all).
+
+% Crashes with system call. No spec.
+foo1() -> halt().
+
+% Crashes with system call. With spec.
+-spec foo2() -> no_return().
+foo2() -> halt().
+
+% Crashes on its own. No spec.
+foo3() -> case a of b -> ok end.
+
+% Crashes on its own. With spec.
+-spec foo4() -> no_return().
+foo4() -> case a of b -> ok end.
+
+% Creates fun that crashes with system call. No spec.
+foo5() -> fun() -> halt() end.
+
+% Creates fun that crashes with system call. With spec.
+-spec foo6() -> fun(() -> no_return()).
+foo6() -> fun() -> halt() end.
+
+% Creates fun from named fun that will crash. Neither have spec.
+foo7() -> fun foo1/0.
+
+% Creates fun from named fun that will crash. Has spec.
+-spec foo8() -> fun(() -> no_return()).
+foo8() -> fun foo1/0.
+
+% Creates fun from named fun that will crash. Named has spec.
+foo9() -> fun foo2/0.
+
+% Creates fun from named fun that will crash. Both have specs.
+-spec foo10() -> fun(() -> no_return()).
+foo10() -> fun foo2/0.
+
+% Creates fun from named fun that will crash. Neither have spec.
+foo11() -> fun foo3/0.
+
+% Creates fun from named fun that will crash. Has spec.
+-spec foo12() -> fun(() -> no_return()).
+foo12() -> fun foo3/0.
+
+% Creates fun from named fun that will crash. Named has spec.
+foo13() -> fun foo4/0.
+
+% Creates fun from named fun that will crash. Both have specs.
+-spec foo14() -> fun(() -> no_return()).
+foo14() -> fun foo4/0.
+
+% Creates fun calling a named fun that will crash. Neither have spec.
+foo15() -> fun() -> foo1() end.
+
+% Creates fun calling a named fun that will crash. Has spec.
+-spec foo16() -> fun(() -> no_return()).
+foo16() -> fun() -> foo1() end.
+
+% Creates fun calling a named fun that will crash. Named has spec.
+foo17() -> fun() -> foo2() end.
+
+% Creates fun calling a named fun that will crash. Both have specs.
+-spec foo18() -> fun(() -> no_return()).
+foo18() -> fun() -> foo2() end.
+
+% Creates fun calling a named fun that will crash. Neither have spec.
+foo19() -> fun() -> foo3() end.
+
+% Creates fun calling a named fun that will crash. Has spec.
+-spec foo20() -> fun(() -> no_return()).
+foo20() -> fun() -> foo3() end.
+
+% Creates fun calling a named fun that will crash. Named has spec.
+foo21() -> fun() -> foo4() end.
+
+% Creates fun calling a named fun that will crash. Both have specs.
+-spec foo22() -> fun(() -> no_return()).
+foo22() -> fun() -> foo4() end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo23() ->
+ Bomb = fun() -> halt() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> halt() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo24() -> fun(() -> no_return()).
+foo24() ->
+ Bomb = fun() -> halt() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> halt() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo25() ->
+ Bomb = fun() -> foo1() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo1() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo26() -> fun(() -> no_return()).
+foo26() ->
+ Bomb = fun foo1/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo1/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo27() ->
+ Bomb = fun foo1/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo1/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo28() -> fun(() -> no_return()).
+foo28() ->
+ Bomb = fun() -> foo1() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo1() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo29() ->
+ Bomb = fun() -> foo2() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo2() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo30() -> fun(() -> no_return()).
+foo30() ->
+ Bomb = fun foo2/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo2/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo31() ->
+ Bomb = fun foo2/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo2/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo32() -> fun(() -> no_return()).
+foo32() ->
+ Bomb = fun() -> foo2() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo2() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo33() ->
+ Bomb = fun() -> foo3() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo3() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo34() -> fun(() -> no_return()).
+foo34() ->
+ Bomb = fun foo3/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo3/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo35() ->
+ Bomb = fun foo3/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo3/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo36() -> fun(() -> no_return()).
+foo36() ->
+ Bomb = fun() -> foo3() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo3() end
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo37() ->
+ Bomb = fun() -> foo4() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo4() end
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo38() -> fun(() -> no_return()).
+foo38() ->
+ Bomb = fun foo4/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo4/0
+ end.
+
+% Creates two funs with no local return and will return one or die. No spec.
+foo39() ->
+ Bomb = fun foo4/0,
+ case get(42) of
+ a -> Bomb();
+ b -> fun foo4/0
+ end.
+
+% Creates two funs with no local return and will return one or die. With spec.
+-spec foo40() -> fun(() -> no_return()).
+foo40() ->
+ Bomb = fun() -> foo4() end,
+ case get(42) of
+ a -> Bomb();
+ b -> fun() -> foo4() end
+ end.
+
+% Obtains two funs with no local return and will return one or die. No spec.
+foo41() ->
+ Bomb = foo5(),
+ case get(42) of
+ a -> Bomb();
+ b -> foo5()
+ end.
+
+% Obtains two funs with no local return and will return one or die. With spec.
+-spec foo42() -> fun(() -> no_return()).
+foo42() ->
+ Bomb = foo5(),
+ case get(42) of
+ a -> Bomb();
+ b -> foo5()
+ end.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
index 4f1268eba8..086df3464b 100644
--- a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
+++ b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
@@ -6,9 +6,7 @@
-export([parse/1]).
--type proplist() :: [{atom(), any()}].
-
--spec parse(string()) -> proplist().
+-spec parse(string()) -> proplists:proplist().
parse(FileName) ->
{ok, IoDevice} = file:open(FileName, [read, binary, {encoding, utf8}]),
do_parse(IoDevice, []).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
new file mode 100644
index 0000000000..109aa88f16
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
@@ -0,0 +1,21 @@
+%%=====================================================================
+%% From: Ken Robinson
+%% Date: 28/04/2011, 17:26
+%%
+%% Program that produced bogus "Function has no local return" warnings
+%% due to erlang:list_to_bitstring/1 having erroneous hard coded type
+%% information, namely accepting iolist() instead of bitstrlist().
+%% Fixed 29/04/2011.
+%%=====================================================================
+
+-module(list_to_bitstring).
+
+-export([l2bs/0, l2bs_ok/0]).
+
+%% This function was producing a warning
+l2bs() ->
+ erlang:list_to_bitstring([<<42>>, <<42:13>>]).
+
+%% while this one was ok.
+l2bs_ok() ->
+ erlang:list_to_bitstring([<<42>>, <<42,42>>]).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
new file mode 100644
index 0000000000..5c24902590
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
@@ -0,0 +1,42 @@
+%% Dialyzer couldn't infer that monitor_diskspace would go in an infinite loop
+%% instead of crashing due to the existence of list comprehensions that have a
+%% normal success typing. These were added to the monitor_diskspace's SCC and
+%% dialyzer_typesig didn't try to assign unit() to monitor_diskspace, as it
+%% required all the members of the SCC to return none().
+%%
+%% Testcase was submitted in erlang-questions mailing list by Prashanth Mundkur
+%% (http://erlang.org/pipermail/erlang-questions/2011-May/058063.html)
+
+-module(no_return_bug).
+-export([diskspace/1, monitor_diskspace/2, refresh_tags/1, monitor_launch/0]).
+
+-type diskinfo() :: {non_neg_integer(), non_neg_integer()}.
+
+-spec diskspace(nonempty_string()) -> {'ok', diskinfo()} | {'error', term()}.
+diskspace(Path) ->
+ case Path of
+ "a" -> {ok, {0,0}};
+ _ -> {error, error}
+ end.
+
+-spec monitor_diskspace(nonempty_string(),
+ [{diskinfo(), nonempty_string()}]) ->
+ no_return().
+monitor_diskspace(Root, Vols) ->
+ Df = fun(VolName) ->
+ diskspace(filename:join([Root, VolName]))
+ end,
+ NewVols = [{Space, VolName}
+ || {VolName, {ok, Space}}
+ <- [{VolName, Df(VolName)}
+ || {_OldSpace, VolName} <- Vols]],
+ monitor_diskspace(Root, NewVols).
+
+-spec refresh_tags(nonempty_string()) -> no_return().
+refresh_tags(Root) ->
+ {ok, _} = diskspace(Root),
+ refresh_tags(Root).
+
+monitor_launch() ->
+ spawn_link(fun() -> refresh_tags("abc") end),
+ spawn_link(fun() -> monitor_diskspace("root", [{{0,0}, "a"}]) end).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
new file mode 100644
index 0000000000..63daeee9e3
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
@@ -0,0 +1,7 @@
+-module(nowarnunused).
+
+-compile({nowarn_unused_function, return_error/2}).
+
+-spec return_error(integer(), any()) -> no_return().
+return_error(Line, Message) ->
+ throw({error, {Line, ?MODULE, Message}}).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl b/lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl
new file mode 100644
index 0000000000..d3b504ae04
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/rebar_no_return.erl
@@ -0,0 +1,19 @@
+-module(rebar_no_return).
+
+-export([t/0]).
+
+-spec t() -> no_return().
+t() ->
+ F = log_and_halt("baz"),
+ F("foo", 123).
+
+-spec log_and_halt(string()) -> fun((string(),integer()) -> no_return()).
+log_and_halt(Msg) ->
+ fun(_, _) ->
+ abort(Msg)
+ end.
+
+-spec abort(string()) -> no_return().
+abort(Msg) ->
+ io:format("~s~n", [Msg]),
+ halt(1).
diff --git a/lib/diameter/doc/src/diameter_dict.xml b/lib/diameter/doc/src/diameter_dict.xml
index a87f59bad5..e7c530f1b8 100644
--- a/lib/diameter/doc/src/diameter_dict.xml
+++ b/lib/diameter/doc/src/diameter_dict.xml
@@ -105,7 +105,7 @@ quantity is insignificant.</p>
<p>
The tags, their arguments and the contents of each corresponding
section are as follows.
-Each section can occur only once unless otherwise specified.
+Each section can occur at most once unless otherwise specified.
The order in which sections are specified is unimportant.</p>
<taglist>
@@ -115,6 +115,7 @@ The order in which sections are specified is unimportant.</p>
<p>
Defines the integer Number as the Diameter Application Id of the
application in question.
+Required if the dictionary defines <c>@messages</c>.
The section has empty content.</p>
<p>
@@ -370,7 +371,11 @@ Integer values can be prefixed with 0x to be interpreted as
hexidecimal.</p>
<p>
-Can occur 0 or more times (with different values of Name).</p>
+Can occur 0 or more times (with different values of Name).
+The AVP in question can be defined in an inherited dictionary in order
+to introduce additional values.
+An AVP so extended must be referenced by in a <c>@messages</c> or
+<c>@grouped</c> section.</p>
<p>
Example:</p>
diff --git a/lib/diameter/make/rules.mk.in b/lib/diameter/make/rules.mk.in
index 4a1a55b8d3..6318f2bc9c 100644
--- a/lib/diameter/make/rules.mk.in
+++ b/lib/diameter/make/rules.mk.in
@@ -164,7 +164,7 @@ $(MAN3DIR)/%.3:: %.xml
date=`date +"%B %e %Y"`; \
xsltproc --output "$@" --stringparam company "Ericsson AB" --stringparam docgen "$(DOCGEN)" --stringparam gendate "$$date" --stringparam appname "$(APPLICATION)" --stringparam appver "$(VSN)" --xinclude -path $(DOCGEN)/priv/docbuilder_dtd -path $(DOCGEN)/priv/dtd_man_entities $(DOCGEN)/priv/xsl/db_man.xsl $<
-# left for compatability
+# left for compatibility
$(MAN4DIR)/%.4:: %.xml
date=`date +"%B %e %Y"`; \
xsltproc --output "$@" --stringparam company "Ericsson AB" --stringparam docgen "$(DOCGEN)" --stringparam gendate "$$date" --stringparam appname "$(APPLICATION)" --stringparam appver "$(VSN)" --xinclude -path $(DOCGEN)/priv/docbuilder_dtd -path $(DOCGEN)/priv/dtd_man_entities $(DOCGEN)/priv/xsl/db_man.xsl $<
@@ -173,7 +173,7 @@ $(MAN4DIR)/%.5:: %.xml
date=`date +"%B %e %Y"`; \
xsltproc --output "$@" --stringparam company "Ericsson AB" --stringparam docgen "$(DOCGEN)" --stringparam gendate "$$date" --stringparam appname "$(APPLICATION)" --stringparam appver "$(VSN)" --xinclude -path $(DOCGEN)/priv/docbuilder_dtd -path $(DOCGEN)/priv/dtd_man_entities $(DOCGEN)/priv/xsl/db_man.xsl $<
-# left for compatability
+# left for compatibility
$(MAN6DIR)/%.6:: %_app.xml
date=`date +"%B %e %Y"`; \
xsltproc --output "$@" --stringparam company "Ericsson AB" --stringparam docgen "$(DOCGEN)" --stringparam gendate "$$date" --stringparam appname "$(APPLICATION)" --stringparam appver "$(VSN)" --xinclude -path $(DOCGEN)/priv/docbuilder_dtd -path $(DOCGEN)/priv/dtd_man_entities $(DOCGEN)/priv/xsl/db_man.xsl $<
diff --git a/lib/diameter/src/compiler/diameter_codegen.erl b/lib/diameter/src/compiler/diameter_codegen.erl
index 213ba0d22c..30caebc544 100644
--- a/lib/diameter/src/compiler/diameter_codegen.erl
+++ b/lib/diameter/src/compiler/diameter_codegen.erl
@@ -250,9 +250,14 @@ f_name(Name) ->
%%% ------------------------------------------------------------------------
f_id(Spec) ->
- Id = orddict:fetch(id, Spec),
{?function, id, 0,
- [{?clause, [], [], [?INTEGER(Id)]}]}.
+ [c_id(orddict:find(id, Spec))]}.
+
+c_id({ok, Id}) ->
+ {?clause, [], [], [?INTEGER(Id)]};
+
+c_id(error) ->
+ ?UNEXPECTED(0).
%%% ------------------------------------------------------------------------
%%% # vendor_id/0
@@ -454,9 +459,10 @@ avp(Spec) ->
Native = get_value(avp_types, Spec),
Custom = get_value(custom_types, Spec),
Imported = get_value(import_avps, Spec),
- avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom).
+ Enums = get_value(enums, Spec),
+ avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom, Enums).
-avp(Native, Imported, Custom) ->
+avp(Native, Imported, Custom, Enums) ->
Dict = orddict:from_list(Native),
report(native, Dict),
@@ -470,8 +476,8 @@ avp(Native, Imported, Custom) ->
false == lists:member(N, CustomNames)
end,
Native))
- ++ lists:flatmap(fun c_imported_avp/1, Imported)
- ++ lists:flatmap(fun(C) -> c_custom_avp(C, Dict) end, Custom).
+ ++ lists:flatmap(fun(I) -> cs_imported_avp(I, Enums) end, Imported)
+ ++ lists:flatmap(fun(C) -> cs_custom_avp(C, Dict) end, Custom).
c_base_avp({AvpName, T}) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
@@ -487,23 +493,35 @@ base_avp(AvpName, 'Grouped') ->
base_avp(_, Type) ->
?APPLY(diameter_types, Type, [?VAR('T'), ?VAR('Data')]).
-c_imported_avp({Mod, Avps}) ->
- lists:map(fun(A) -> imported_avp(Mod, A) end, Avps).
+cs_imported_avp({Mod, Avps}, Enums) ->
+ lists:map(fun(A) -> imported_avp(Mod, A, Enums) end, Avps).
-imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}) ->
+imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}, _) ->
c_base_avp({AvpName, T});
-imported_avp(Mod, {AvpName, _, _, _, _}) ->
+imported_avp(Mod, {AvpName, _, 'Enumerated' = T, _, _}, Enums) ->
+ case lists:keymember(AvpName, 1, Enums) of
+ true ->
+ c_base_avp({AvpName, T});
+ false ->
+ c_imported_avp(Mod, AvpName)
+ end;
+
+imported_avp(Mod, {AvpName, _, _, _, _}, _) ->
+ c_imported_avp(Mod, AvpName).
+
+c_imported_avp(Mod, AvpName) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, avp, [?VAR('T'),
?VAR('Data'),
?ATOM(AvpName)])]}.
-c_custom_avp({Mod, Avps}, Dict) ->
- lists:map(fun(N) -> custom_avp(Mod, N, orddict:fetch(N, Dict)) end, Avps).
+cs_custom_avp({Mod, Avps}, Dict) ->
+ lists:map(fun(N) -> c_custom_avp(Mod, N, orddict:fetch(N, Dict)) end,
+ Avps).
-custom_avp(Mod, AvpName, Type) ->
+c_custom_avp(Mod, AvpName, Type) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, AvpName, [?VAR('T'), ?ATOM(Type), ?VAR('Data')])]}.
@@ -516,9 +534,25 @@ f_enumerated_avp(Spec) ->
{?function, enumerated_avp, 3, enumerated_avp(Spec) ++ [?UNEXPECTED(3)]}.
enumerated_avp(Spec) ->
- lists:flatmap(fun c_enumerated_avp/1, get_value(enums, Spec)).
+ Enums = get_value(enums, Spec),
+ lists:flatmap(fun cs_enumerated_avp/1, Enums)
+ ++ lists:flatmap(fun({M,Es}) -> enumerated_avp(M, Es, Enums) end,
+ get_value(import_enums, Spec)).
+
+enumerated_avp(Mod, Es, Enums) ->
+ lists:flatmap(fun({N,_}) ->
+ cs_enumerated_avp(lists:keymember(N, 1, Enums),
+ Mod,
+ N)
+ end,
+ Es).
-c_enumerated_avp({AvpName, Values}) ->
+cs_enumerated_avp(true, Mod, Name) ->
+ [c_imported_avp(Mod, Name)];
+cs_enumerated_avp(false, _, _) ->
+ [].
+
+cs_enumerated_avp({AvpName, Values}) ->
lists:flatmap(fun(V) -> c_enumerated_avp(AvpName, V) end, Values).
c_enumerated_avp(AvpName, {I,_}) ->
@@ -537,10 +571,14 @@ f_msg_header(Spec) ->
{?function, msg_header, 1, msg_header(Spec) ++ [?UNEXPECTED(1)]}.
msg_header(Spec) ->
+ msg_header(get_value(messages, Spec), Spec).
+
+msg_header([], _) ->
+ [];
+msg_header(Msgs, Spec) ->
ApplId = orddict:fetch(id, Spec),
- lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end,
- get_value(messages, Spec)).
+ lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end, Msgs).
%% Note that any application id in the message header spec is ignored.
@@ -616,10 +654,12 @@ f_empty_value(Spec) ->
{?function, empty_value, 1, empty_value(Spec)}.
empty_value(Spec) ->
+ Imported = lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
Groups = get_value(grouped, Spec)
++ lists:flatmap(fun avps/1, get_value(import_groups, Spec)),
- Enums = get_value(enums, Spec)
- ++ lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
+ Enums = [T || {N,_} = T <- get_value(enums, Spec),
+ not lists:keymember(N, 1, Imported)]
+ ++ Imported,
lists:map(fun c_empty_value/1, Groups ++ Enums)
++ [{?clause, [?VAR('Name')], [], [?CALL(empty, [?VAR('Name')])]}].
diff --git a/lib/diameter/src/compiler/diameter_spec_util.erl b/lib/diameter/src/compiler/diameter_spec_util.erl
index 322d53a199..b60886b678 100644
--- a/lib/diameter/src/compiler/diameter_spec_util.erl
+++ b/lib/diameter/src/compiler/diameter_spec_util.erl
@@ -39,11 +39,11 @@ parse(Path, Options) ->
{ok, B} = file:read_file(Path),
Chunks = chunk(B),
Spec = make_spec(Chunks),
- true = enums_defined(Spec), %% sanity checks
- true = groups_defined(Spec), %%
+ true = groups_defined(Spec), %% sanity checks
true = customs_defined(Spec), %%
Full = import_enums(import_groups(import_avps(insert_codes(Spec),
Options))),
+ true = enums_defined(Full), %% sanity checks
true = v_flags_set(Spec),
Full.
@@ -243,35 +243,48 @@ get_value(Key, Spec) ->
%% with an appropriate type.
enums_defined(Spec) ->
- is_defined(Spec, 'Enumerated', enums).
+ Avps = get_value(avp_types, Spec),
+ Import = get_value(import_enums, Spec),
+ lists:all(fun({N,_}) ->
+ true = enum_defined(N, Avps, Import)
+ end,
+ get_value(enums, Spec)).
-groups_defined(Spec) ->
- is_defined(Spec, 'Grouped', grouped).
+enum_defined(Name, Avps, Import) ->
+ case lists:keyfind(Name, 1, Avps) of
+ {Name, _, 'Enumerated', _, _} ->
+ true;
+ {Name, _, T, _, _} ->
+ ?ERROR({avp_has_wrong_type, Name, 'Enumerated', T});
+ false ->
+ lists:any(fun({_,Is}) -> lists:keymember(Name, 1, Is) end, Import)
+ orelse ?ERROR({avp_not_defined, Name, 'Enumerated'})
+ end.
+%% Note that an AVP is imported only if referenced by a message or
+%% grouped AVP, so the final branch will fail if an enum definition is
+%% extended without this being the case.
-is_defined(Spec, Type, Key) ->
+groups_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(T) -> true = is_local(name(Key, T), Type, Avps) end,
- get_value(Key, Spec)).
+ lists:all(fun({N,_,_,_}) -> true = group_defined(N, Avps) end,
+ get_value(grouped, Spec)).
-name(enums, {N,_}) -> N;
-name(grouped, {N,_,_,_}) -> N.
-
-is_local(Name, Type, Avps) ->
+group_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
- {Name, _, Type, _, _} ->
+ {Name, _, 'Grouped', _, _} ->
true;
{Name, _, T, _, _} ->
- ?ERROR({avp_has_wrong_type, Name, Type, T});
+ ?ERROR({avp_has_wrong_type, Name, 'Grouped', T});
false ->
- ?ERROR({avp_not_defined, Name, Type})
+ ?ERROR({avp_not_defined, Name, 'Grouped'})
end.
customs_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(A) -> true = is_local(A, Avps) end,
+ lists:all(fun(A) -> true = custom_defined(A, Avps) end,
lists:flatmap(fun last/1, get_value(custom_types, Spec))).
-is_local(Name, Avps) ->
+custom_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
{Name, _, T, _, _} when T == 'Grouped';
T == 'Enumerated' ->
@@ -510,6 +523,9 @@ choose(false, _, X) -> X.
%% ------------------------------------------------------------------------
%% import_groups/1
%% import_enums/1
+%%
+%% For each inherited module, store the content of imported AVP's of
+%% type grouped/enumerated in a new key.
import_groups(Spec) ->
orddict:store(import_groups, import(grouped, Spec), Spec).
diff --git a/lib/diameter/src/transport/diameter_sctp.erl b/lib/diameter/src/transport/diameter_sctp.erl
index 92aa8488a0..46473e7bf1 100644
--- a/lib/diameter/src/transport/diameter_sctp.erl
+++ b/lib/diameter/src/transport/diameter_sctp.erl
@@ -525,7 +525,22 @@ recv({[#sctp_sndrcvinfo{stream = Id}], Bin}, #transport{parent = Pid})
recv({[], #sctp_shutdown_event{assoc_id = Id}},
#transport{assoc_id = Id}) ->
- stop.
+ stop;
+
+%% Note that diameter_sctp(3) documents that sctp_events cannot be
+%% specified in the list of options passed to gen_sctp and that
+%% gen_opts/1 guards against this. This is to ensure that we know what
+%% events to expect and also to ensure that we receive
+%% #sctp_sndrcvinfo{} with each incoming message (data_io_event =
+%% true). Adaptation layer events (ie. #sctp_adaptation_event{}) are
+%% disabled by default so don't handle it. We could simply disable
+%% events we don't react to but don't.
+
+recv({[], #sctp_paddr_change{}}, _) ->
+ ok;
+
+recv({[], #sctp_pdapi_event{}}, _) ->
+ ok.
%% up/1
@@ -591,7 +606,7 @@ f([], _, _) ->
%% assoc_id/1
-assoc_id(#sctp_shutdown_event{assoc_id = Id}) -> %% undocumented
+assoc_id(#sctp_shutdown_event{assoc_id = Id}) ->
Id;
assoc_id(#sctp_assoc_change{assoc_id = Id}) ->
Id;
diff --git a/lib/diameter/test/Makefile b/lib/diameter/test/Makefile
index 823e2f0311..b3648c7bb1 100644
--- a/lib/diameter/test/Makefile
+++ b/lib/diameter/test/Makefile
@@ -404,5 +404,5 @@ release_tests_spec: tests
# $(HRL_FILES) $(ERL_FILES) \
# $(RELSYSDIR)
#
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/docbuilder/src/docb_gen.erl b/lib/docbuilder/src/docb_gen.erl
index 0d8d640324..75494314f1 100644
--- a/lib/docbuilder/src/docb_gen.erl
+++ b/lib/docbuilder/src/docb_gen.erl
@@ -18,6 +18,10 @@
-module(docb_gen).
-export([module/1, module/2, users_guide/1, users_guide/2]).
+-deprecated([{module,1,next_major_release},
+ {module,2,next_major_release},
+ {users_guide,1,next_major_release},
+ {users_guide,2,next_major_release}]).
-record(args, {suffix=".xml",
layout=docb_edoc_xml_cb,
diff --git a/lib/docbuilder/src/docb_transform.erl b/lib/docbuilder/src/docb_transform.erl
index 9c7561b07b..736ac92274 100644
--- a/lib/docbuilder/src/docb_transform.erl
+++ b/lib/docbuilder/src/docb_transform.erl
@@ -18,6 +18,8 @@
-module(docb_transform).
-export([file/1, file/2]).
+-deprecated([{file,1,next_major_release},
+ {file,2,next_major_release}]).
%% file(File) -> ok | {error, Reason}
%% file(File, Opts) -> ok | {error, Reason}
diff --git a/lib/docbuilder/src/docb_xml_check.erl b/lib/docbuilder/src/docb_xml_check.erl
index 8ae5cd2eac..5912e22e7b 100644
--- a/lib/docbuilder/src/docb_xml_check.erl
+++ b/lib/docbuilder/src/docb_xml_check.erl
@@ -18,6 +18,7 @@
-module(docb_xml_check).
-export([validate/1]).
+-deprecated([{validate,1,next_major_release}]).
%% validate(File) -> ok | error | {error, badfile}
%% File = string(), file name with or without ".xml" extension
diff --git a/lib/docbuilder/vsn.mk b/lib/docbuilder/vsn.mk
index 2475966ec2..6df438a537 100644
--- a/lib/docbuilder/vsn.mk
+++ b/lib/docbuilder/vsn.mk
@@ -1 +1 @@
-DOCB_VSN = 0.9.8.10
+DOCB_VSN = 0.9.8.11
diff --git a/lib/edoc/Makefile b/lib/edoc/Makefile
index e512e390e3..1add669398 100644
--- a/lib/edoc/Makefile
+++ b/lib/edoc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/Makefile b/lib/edoc/doc/Makefile
index a0f6484382..c5f68b25d0 100644
--- a/lib/edoc/doc/Makefile
+++ b/lib/edoc/doc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id: Makefile,v 1.1.1.1 2004/10/04 13:53:33 richardc Exp $
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/overview.edoc b/lib/edoc/doc/overview.edoc
index bd603b7a13..fa699c6f08 100644
--- a/lib/edoc/doc/overview.edoc
+++ b/lib/edoc/doc/overview.edoc
@@ -1084,10 +1084,11 @@ Details:
the Erlang programming language.</li>
<li>`boolean()' is the subset of `atom()' consisting
of the atoms `true' and `false'.</li>
- <li>`char()' is a subset of
- `integer()' representing character codes.</li>
+ <li>`char()' is the subset of `integer()' representing
+ Unicode character codes: hex 000000-10FFFF.</li>
<li>`tuple()' is the set of all tuples `{...}'.</li>
- <li>`list(T)' is just an alias for `[T]'.</li>
+ <li>`list(T)' is just an alias for `[T]'; list() is an alias
+ for `list(any())', i.e., `[any()]'.</li>
<li>`nil()' is an alias for the empty list `[]'.</li>
<li>`cons(H,T)' is the list constructor. This is usually not
used directly. It is possible to recursively define `list(T)
diff --git a/lib/edoc/doc/src/Makefile b/lib/edoc/doc/src/Makefile
index 5ee0096f0f..b933094464 100644
--- a/lib/edoc/doc/src/Makefile
+++ b/lib/edoc/doc/src/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/include/Makefile b/lib/edoc/include/Makefile
index 0533c27567..5b2ad38c9d 100644
--- a/lib/edoc/include/Makefile
+++ b/lib/edoc/include/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/priv/edoc_generate.src b/lib/edoc/priv/edoc_generate.src
index e87fdbc902..7ec89207b0 100644
--- a/lib/edoc/priv/edoc_generate.src
+++ b/lib/edoc/priv/edoc_generate.src
@@ -14,9 +14,6 @@
# Portions created by Ericsson are Copyright 1999-2000, Ericsson
# Utvecklings AB. All Rights Reserved.''
#
-# $Id$
-#
-#
#EDOC_DIR=/clearcase/otp/internal_tools/edoc
EDOC_DIR=/home/otp/sgml/edoc-%EDOC_VSN%
diff --git a/lib/edoc/src/Makefile b/lib/edoc/src/Makefile
index 9c5a9d30d1..fcb0b61292 100644
--- a/lib/edoc/src/Makefile
+++ b/lib/edoc/src/Makefile
@@ -23,7 +23,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/edoc-$(VSN)
EBIN = ../ebin
XMERL = ../../xmerl
-ERL_COMPILE_FLAGS += -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
+ERL_COMPILE_FLAGS += -pa $(XMERL) -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
SOURCES= \
edoc.erl edoc_data.erl edoc_doclet.erl edoc_extract.erl \
diff --git a/lib/edoc/src/edoc.erl b/lib/edoc/src/edoc.erl
index 360f2dbc9e..a279f7dcb3 100644
--- a/lib/edoc/src/edoc.erl
+++ b/lib/edoc/src/edoc.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2007 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @version {@version}
@@ -60,8 +58,6 @@
-compile({no_auto_import,[error/1]}).
--import(edoc_report, [report/2, report/3, error/1, error/3]).
-
-include("edoc.hrl").
@@ -179,8 +175,8 @@ application(App, Options) when is_atom(App) ->
Dir when is_list(Dir) ->
application(App, Dir, Options);
_ ->
- report("cannot find application directory for '~s'.",
- [App]),
+ edoc_report:report("cannot find application directory for '~s'.",
+ [App]),
exit(error)
end.
@@ -663,8 +659,8 @@ read_source(Name, Opts0) ->
check_forms(Forms, Name),
Forms;
{error, R} ->
- error({"error reading file '~s'.",
- [edoc_lib:filename(Name)]}),
+ edoc_report:error({"error reading file '~s'.",
+ [edoc_lib:filename(Name)]}),
exit({error, R})
end.
@@ -688,11 +684,10 @@ check_forms(Fs, Name) ->
error_marker ->
case erl_syntax:error_marker_info(F) of
{L, M, D} ->
- error(L, Name, {format_error, M, D});
-
+ edoc_report:error(L, Name, {format_error, M, D});
Other ->
- report(Name, "unknown error in "
- "source code: ~w.", [Other])
+ edoc_report:report(Name, "unknown error in "
+ "source code: ~w.", [Other])
end,
exit(error);
_ ->
diff --git a/lib/edoc/src/edoc_data.erl b/lib/edoc/src/edoc_data.erl
index 27f43dca5a..e3b5a0d51b 100644
--- a/lib/edoc/src/edoc_data.erl
+++ b/lib/edoc/src/edoc_data.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_doclet.erl b/lib/edoc/src/edoc_doclet.erl
index 30eef3e63a..c66be9d7c7 100644
--- a/lib/edoc/src/edoc_doclet.erl
+++ b/lib/edoc/src/edoc_doclet.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003-2006 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -52,7 +50,7 @@
-define(IMAGE, "erlang.png").
-define(NL, "\n").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
%% Sources is the list of inputs in the order they were found. Packages
%% and Modules are sorted lists of atoms without duplicates. (They
diff --git a/lib/edoc/src/edoc_extract.erl b/lib/edoc/src/edoc_extract.erl
index 5e28762c53..1209d86fe5 100644
--- a/lib/edoc/src/edoc_extract.erl
+++ b/lib/edoc/src/edoc_extract.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -238,8 +236,8 @@ file(File, Context, Env, Opts) ->
case file:read_file(File) of
{ok, Bin} ->
{ok, text(binary_to_list(Bin), Context, Env, Opts, File)};
- {error, _R} = Error ->
- Error
+ {error, _} = Error ->
+ Error
end.
@@ -298,8 +296,8 @@ get_module_info(Forms, File) ->
{Name, Vars} = case lists:keyfind(module, 1, L) of
{module, N} when is_atom(N) ->
{N, none};
- {module, {N, _Vs} = NVs} when is_atom(N) ->
- NVs;
+ {module, {N, _}=Mod} when is_atom(N) ->
+ Mod;
_ ->
report(File, "module name missing.", []),
exit(error)
diff --git a/lib/edoc/src/edoc_layout.erl b/lib/edoc/src/edoc_layout.erl
index 3ec87b7060..1c0841815f 100644
--- a/lib/edoc/src/edoc_layout.erl
+++ b/lib/edoc/src/edoc_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @author Richard Carlsson <[email protected]>
%% @copyright 2001-2006 Richard Carlsson
%% @see edoc
@@ -33,7 +31,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(HTML_EXPORT, xmerl_html).
-define(DEFAULT_XML_EXPORT, ?HTML_EXPORT).
@@ -959,12 +957,16 @@ local_label(R) ->
xhtml(Title, CSS, Body) ->
[{html, [?NL,
- {head, [?NL,
- {title, Title},
- ?NL] ++ CSS},
- ?NL,
- {body, [{bgcolor, "white"}], Body},
- ?NL]
+ {head, [?NL,
+ {meta, [{'http-equiv',"Content-Type"},
+ {content, "text/html; charset=ISO-8859-1"}],
+ []},
+ ?NL,
+ {title, Title},
+ ?NL] ++ CSS},
+ ?NL,
+ {body, [{bgcolor, "white"}], Body},
+ ?NL]
},
?NL].
diff --git a/lib/edoc/src/edoc_lib.erl b/lib/edoc/src/edoc_lib.erl
index 585e30a2d2..6c698e83ef 100644
--- a/lib/edoc/src/edoc_lib.erl
+++ b/lib/edoc/src/edoc_lib.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -40,7 +38,7 @@
-import(edoc_report, [report/2, warning/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(FILE_BASE, "/").
@@ -494,7 +492,7 @@ uri_get_file(File0) ->
uri_get_http(URI) ->
%% Try using option full_result=false
case catch {ok, httpc:request(get, {URI,[]}, [],
- [{full_result, false}])} of
+ [{full_result, false}])} of
{'EXIT', _} ->
uri_get_http_r10(URI);
Result ->
diff --git a/lib/edoc/src/edoc_parser.yrl b/lib/edoc/src/edoc_parser.yrl
index 6943f1bdb8..3ce4cde4fb 100644
--- a/lib/edoc/src/edoc_parser.yrl
+++ b/lib/edoc/src/edoc_parser.yrl
@@ -23,9 +23,6 @@
%% USA
%%
%% Author contact: [email protected]
-%%
-%% $Id $
-%%
%% =====================================================================
Nonterminals
@@ -362,10 +359,10 @@ parse_spec(S, L) ->
{ok, Spec} ->
Spec;
{error, E} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end;
{error, E, _} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end.
%% ---------------------------------------------------------------------
diff --git a/lib/edoc/src/edoc_report.erl b/lib/edoc/src/edoc_report.erl
index ee54c60c90..f082513bee 100644
--- a/lib/edoc/src/edoc_report.erl
+++ b/lib/edoc/src/edoc_report.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_run.erl b/lib/edoc/src/edoc_run.erl
index 96e5ea4631..1355db840f 100644
--- a/lib/edoc/src/edoc_run.erl
+++ b/lib/edoc/src/edoc_run.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
diff --git a/lib/edoc/src/edoc_scanner.erl b/lib/edoc/src/edoc_scanner.erl
index 9d2e6f3aed..8e895ad1ad 100644
--- a/lib/edoc/src/edoc_scanner.erl
+++ b/lib/edoc/src/edoc_scanner.erl
@@ -13,8 +13,6 @@
%% AB. Portions created by Ericsson are Copyright 1999, Ericsson
%% Utvecklings AB. All Rights Reserved.''
%%
-%% $Id: $
-%%
%% @private
%% @copyright Richard Carlsson 2001-2003. Portions created by Ericsson
%% are Copyright 1999, Ericsson Utvecklings AB. All Rights Reserved.
diff --git a/lib/edoc/src/edoc_specs.erl b/lib/edoc/src/edoc_specs.erl
index 519ade726f..5acf8ac0d5 100644
--- a/lib/edoc/src/edoc_specs.erl
+++ b/lib/edoc/src/edoc_specs.erl
@@ -27,7 +27,6 @@
-include("edoc.hrl").
-include("edoc_types.hrl").
--type proplist() :: [proplists:property()].
-type syntaxTree() :: erl_syntax:syntaxTree().
-define(TOP_TYPE, term).
@@ -87,8 +86,9 @@ dummy_spec(Form) ->
#tag{name = spec, line = element(2, hd(TypeSpecs)),
origin = code, data = S}.
--spec docs(Forms::[syntaxTree()], CommentFun) -> dict() when
- CommentFun :: fun(([syntaxTree()], Line :: term()) -> #tag{}).
+-spec docs(Forms::[syntaxTree()],
+ CommentFun :: fun( ([syntaxTree()], Line :: term()) -> #tag{} ))
+ -> dict().
%% @doc Find comments after -type/-opaque declarations.
%% Postcomments "inside" the type are skipped.
@@ -98,7 +98,7 @@ docs(Forms, CommentFun) ->
-type entry() :: #entry{}.
-type module_info() :: #module{}.
-type entries() :: [entry()].
--spec add_data(Entries::entries(), Options::proplist(),
+-spec add_data(Entries::entries(), Options::proplists:proplist(),
File::file:filename(), Module::module_info()) -> entries().
%% @doc Create tags a la EDoc for Erlang specifications and types.
@@ -305,8 +305,6 @@ d2e({ann_type,_,[V, T0]}) ->
%% layout module.
T = d2e(T0),
?add_t_ann(T, element(3, V));
-d2e({type,_,no_return,[]}) ->
- #t_type{name = #t_name{name = none}};
d2e({remote_type,_,[{atom,_,M},{atom,_,F},Ts0]}) ->
Ts = d2e(Ts0),
typevar_anno(#t_type{name = #t_name{module = M, name = F}, args = Ts}, Ts);
diff --git a/lib/edoc/src/edoc_tags.erl b/lib/edoc/src/edoc_tags.erl
index 8ee8f87b5f..80989428ce 100644
--- a/lib/edoc/src/edoc_tags.erl
+++ b/lib/edoc/src/edoc_tags.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_types.erl b/lib/edoc/src/edoc_types.erl
index 1ded63dffe..a54544868c 100644
--- a/lib/edoc/src/edoc_types.erl
+++ b/lib/edoc/src/edoc_types.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -34,13 +32,13 @@
%% @headerfile "edoc_types.hrl"
-include("edoc_types.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
is_predefined(any, 0) -> true;
is_predefined(atom, 0) -> true;
is_predefined(binary, 0) -> true;
-is_predefined(bool, 0) -> true;
+is_predefined(bool, 0) -> true; % kept for backwards compatibility
is_predefined(char, 0) -> true;
is_predefined(cons, 2) -> true;
is_predefined(deep_string, 0) -> true;
@@ -51,6 +49,7 @@ is_predefined(list, 0) -> true;
is_predefined(list, 1) -> true;
is_predefined(nil, 0) -> true;
is_predefined(none, 0) -> true;
+is_predefined(no_return, 0) -> true;
is_predefined(number, 0) -> true;
is_predefined(pid, 0) -> true;
is_predefined(port, 0) -> true;
diff --git a/lib/edoc/src/edoc_wiki.erl b/lib/edoc/src/edoc_wiki.erl
index 9a31bc9a82..2f2d14853c 100644
--- a/lib/edoc/src/edoc_wiki.erl
+++ b/lib/edoc/src/edoc_wiki.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -70,7 +68,7 @@
-export([parse_xml/2, expand_text/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(BASE_HEADING, 3).
@@ -82,8 +80,8 @@ parse_xml(Data, Line) ->
parse_xml_1(Text, Line) ->
Text1 = "<doc>" ++ Text ++ "</doc>",
- Options = [{line, Line}, {encoding, "iso-8859-1"}],
- case catch {ok, xmerl_scan:string(Text1, Options)} of
+ Opts = [{line, Line}, {encoding, 'iso-8859-1'}],
+ case catch {ok, xmerl_scan:string(Text1, Opts)} of
{ok, {E, _}} ->
E#xmlElement.content;
{'EXIT', {fatal, {Reason, L, _C}}} ->
@@ -360,10 +358,7 @@ par_text(Cs, As, Bs, E, Es) ->
[] -> Bs;
_ -> [#xmlElement{name = p, content = Es1} | Bs]
end,
- Bs1 = case Ss of
- [] -> Bs0;
- _ -> [#xmlText{value = Ss} | Bs0]
- end,
+ Bs1 = [#xmlText{value = Ss} | Bs0],
case Cs2 of
[] ->
par(Es, [], Bs1);
diff --git a/lib/edoc/src/otpsgml_layout.erl b/lib/edoc/src/otpsgml_layout.erl
index 45f74b299e..d425dc0ed8 100644
--- a/lib/edoc/src/otpsgml_layout.erl
+++ b/lib/edoc/src/otpsgml_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @author Richard Carlsson <[email protected]>
%% @author Kenneth Lundin <[email protected]>
%% @copyright 2001-2004 Richard Carlsson
@@ -34,7 +32,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(SGML_EXPORT, xmerl_otpsgml).
-define(DEFAULT_XML_EXPORT, ?SGML_EXPORT).
diff --git a/lib/edoc/test/edoc_SUITE.erl b/lib/edoc/test/edoc_SUITE.erl
index 0d57591e3e..5b95c35756 100644
--- a/lib/edoc/test/edoc_SUITE.erl
+++ b/lib/edoc/test/edoc_SUITE.erl
@@ -13,8 +13,6 @@
%% Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
%% AB. All Rights Reserved.''
%%
-%% $Id$
-%%
-module(edoc_SUITE).
-include_lib("test_server/include/test_server.hrl").
diff --git a/lib/erl_docgen/priv/bin/xref_mod_app.escript b/lib/erl_docgen/priv/bin/xref_mod_app.escript
index 13671ef2f8..c2bd62f9e0 100755
--- a/lib/erl_docgen/priv/bin/xref_mod_app.escript
+++ b/lib/erl_docgen/priv/bin/xref_mod_app.escript
@@ -73,7 +73,12 @@ usage() ->
modapp(TopDir) ->
AppDirs = filelib:wildcard(filename:join([TopDir,"lib","*"])),
AM = [appmods(D) || D <- AppDirs],
- lists:keysort(1, [{M,A} || {A,Ms} <- AM, M <- Ms]).
+ ERTS = [preloaded(TopDir) || lists:keyfind("erts", 1, AM) =:= false],
+ lists:keysort(1, [{M,A} || {A,Ms} <- ERTS++AM, M <- Ms]).
+
+preloaded(TopDir) ->
+ {"preloaded",Mods} = appmods(filename:join([TopDir,"erts","preloaded"])),
+ {"erts",Mods}.
%% It's OK if too much data is generated as long as all applications
%% and all modules are mentioned.
diff --git a/lib/erl_docgen/priv/xsl/db_html.xsl b/lib/erl_docgen/priv/xsl/db_html.xsl
index 982572aeef..a9052f29e5 100644
--- a/lib/erl_docgen/priv/xsl/db_html.xsl
+++ b/lib/erl_docgen/priv/xsl/db_html.xsl
@@ -433,6 +433,8 @@
<!-- Search "local types" as well -->
<xsl:variable name="local_types"
select="ancestor::desc/preceding-sibling::type
+ [string-length(@name) > 0]
+ | ancestor::type_desc/preceding-sibling::type
[string-length(@name) > 0]"/>
<xsl:variable name="has_anno_in_local_type">
<xsl:for-each select="$local_types">
diff --git a/lib/erl_docgen/priv/xsl/db_man.xsl b/lib/erl_docgen/priv/xsl/db_man.xsl
index 25b62f68c5..8db4714249 100644
--- a/lib/erl_docgen/priv/xsl/db_man.xsl
+++ b/lib/erl_docgen/priv/xsl/db_man.xsl
@@ -363,6 +363,8 @@
<!-- Search "local types" as well -->
<xsl:variable name="local_types"
select="ancestor::desc/preceding-sibling::type
+ [string-length(@name) > 0]
+ | ancestor::type_desc/preceding-sibling::type
[string-length(@name) > 0]"/>
<xsl:variable name="has_anno_in_local_type">
<xsl:for-each select="$local_types">
diff --git a/lib/erl_docgen/priv/xsl/db_pdf.xsl b/lib/erl_docgen/priv/xsl/db_pdf.xsl
index 5119e3e36a..35f6349f70 100644
--- a/lib/erl_docgen/priv/xsl/db_pdf.xsl
+++ b/lib/erl_docgen/priv/xsl/db_pdf.xsl
@@ -410,6 +410,8 @@
<!-- Search "local types" as well -->
<xsl:variable name="local_types"
select="ancestor::desc/preceding-sibling::type
+ [string-length(@name) > 0]
+ | ancestor::type_desc/preceding-sibling::type
[string-length(@name) > 0]"/>
<xsl:variable name="has_anno_in_local_type">
<xsl:for-each select="$local_types">
@@ -1380,16 +1382,15 @@
<!-- Func -->
<xsl:template match="func">
<xsl:param name="partnum"/>
-
- <xsl:apply-templates select="name"/>
- <xsl:apply-templates
- select="name[string-length(@arity) > 0 and position()=last()]"
- mode="types"/>
-
- <xsl:apply-templates select="fsummary|type|desc">
- <xsl:with-param name="partnum" select="$partnum"/>
- </xsl:apply-templates>
-
+ <fo:block space-before="1.5em">
+ <xsl:apply-templates select="name"/>
+ <xsl:apply-templates
+ select="name[string-length(@arity) > 0 and position()=last()]"
+ mode="types"/>
+ <xsl:apply-templates select="fsummary|type|desc">
+ <xsl:with-param name="partnum" select="$partnum"/>
+ </xsl:apply-templates>
+ </fo:block>
</xsl:template>
@@ -1422,14 +1423,10 @@
<xsl:param name="partnum"/>
<xsl:choose>
<xsl:when test="ancestor::cref">
- <fo:block id="{generate-id(nametext)}">
- <xsl:value-of select="ret"/><xsl:text> </xsl:text><xsl:value-of select="nametext"/>
- </fo:block>
+ <fo:block id="{generate-id(nametext)}"><xsl:value-of select="ret"/><xsl:text></xsl:text><xsl:value-of select="nametext"/></fo:block>
</xsl:when>
<xsl:otherwise>
- <fo:block id="{generate-id(.)}">
- <xsl:value-of select="."/>
- </fo:block>
+ <fo:block id="{generate-id(.)}"><xsl:value-of select="."/></fo:block>
</xsl:otherwise>
</xsl:choose>
</xsl:template>
@@ -1466,7 +1463,7 @@
</fo:block>
</fo:list-item-label>
<fo:list-item-body start-indent="body-start()" format="justify">
- <fo:block font-weight="bold">
+ <fo:block font-weight="bold" font-family="monospace" >
<xsl:apply-templates>
<xsl:with-param name="partnum" select="$partnum"/>
</xsl:apply-templates>
diff --git a/lib/erl_docgen/priv/xsl/db_pdf_params.xsl b/lib/erl_docgen/priv/xsl/db_pdf_params.xsl
index 7de20f2092..3dfecf8b74 100644
--- a/lib/erl_docgen/priv/xsl/db_pdf_params.xsl
+++ b/lib/erl_docgen/priv/xsl/db_pdf_params.xsl
@@ -316,8 +316,8 @@
<xsl:attribute name="font-family">monospace</xsl:attribute>
<!-- xsl:attribute name="font-size">0.8em</xsl:attribute -->
<xsl:attribute name="keep-with-next.within-page">always</xsl:attribute>
- <xsl:attribute name="space-after">0.3em</xsl:attribute>
- <xsl:attribute name="space-before">1.5em</xsl:attribute>
+ <xsl:attribute name="space-after">0.25em</xsl:attribute>
+ <!-- xsl:attribute name="space-before">1.5em</xsl:attribute -->
</xsl:attribute-set>
<xsl:attribute-set name="type-listblock">
diff --git a/lib/erl_interface/doc/src/ei.xml b/lib/erl_interface/doc/src/ei.xml
index de4e4b4301..76e02a6858 100644
--- a/lib/erl_interface/doc/src/ei.xml
+++ b/lib/erl_interface/doc/src/ei.xml
@@ -581,9 +581,9 @@ ei_x_encode_empty_list(&amp;x);
<c><![CDATA[term]]></c> union, it is decoded, and the appropriate field
in <c><![CDATA[term->value]]></c> is set, and <c><![CDATA[*index]]></c> is
incremented by the term size.</p>
- <p>The function returns 0 on successful decoding, -1 on error,
- and 1 if the term seems alright, but does not fit in the
- <c><![CDATA[term]]></c> structure. If it returns 0, the <c><![CDATA[index]]></c>
+ <p>The function returns 1 on successful decoding, -1 on error,
+ and 0 if the term seems alright, but does not fit in the
+ <c><![CDATA[term]]></c> structure. If it returns 1, the <c><![CDATA[index]]></c>
will be incremented, and the <c><![CDATA[term]]></c> contains the
decoded term.</p>
<p>The <c><![CDATA[term]]></c> structure will contain the arity for a tuple
diff --git a/lib/erl_interface/src/connect/ei_resolve.c b/lib/erl_interface/src/connect/ei_resolve.c
index 50c5a4161d..ba8f8fbce3 100644
--- a/lib/erl_interface/src/connect/ei_resolve.c
+++ b/lib/erl_interface/src/connect/ei_resolve.c
@@ -185,7 +185,12 @@ static int verify_dns_configuration(void)
* align: increment buf until it is dword-aligned, reduce len by same amount.
* advance: increment buf by n bytes, reduce len by same amount .
*/
-#define align_buf(buf,len) for (;(((unsigned)buf)&0x3); (buf)++, len--)
+#if defined SIZEOF_VOID_P
+#define ALIGNBYTES (SIZEOF_VOID_P - 1)
+#else
+#define ALIGNBYTES (sizeof(void*) - 1)
+#endif
+#define align_buf(buf,len) for (;(((unsigned)buf) & ALIGNBYTES); (buf)++, len--)
#define advance_buf(buf,len,n) ((buf)+=(n),(len)-=(n))
/* "and now the tricky part..." */
diff --git a/lib/erl_interface/src/encode/encode_atom.c b/lib/erl_interface/src/encode/encode_atom.c
index 69f2d1451c..b1a4479034 100644
--- a/lib/erl_interface/src/encode/encode_atom.c
+++ b/lib/erl_interface/src/encode/encode_atom.c
@@ -17,13 +17,17 @@
* %CopyrightEnd%
*/
#include <string.h>
+#include <limits.h>
#include "eidef.h"
#include "eiext.h"
#include "putget.h"
int ei_encode_atom(char *buf, int *index, const char *p)
{
- return ei_encode_atom_len(buf, index, p, strlen(p));
+ size_t len = strlen(p);
+
+ if (len >= INT_MAX) return -1;
+ return ei_encode_atom_len(buf, index, p, len);
}
int ei_encode_atom_len(char *buf, int *index, const char *p, int len)
diff --git a/lib/erl_interface/src/encode/encode_string.c b/lib/erl_interface/src/encode/encode_string.c
index 1d342cb605..593bbf2b6d 100644
--- a/lib/erl_interface/src/encode/encode_string.c
+++ b/lib/erl_interface/src/encode/encode_string.c
@@ -17,6 +17,7 @@
* %CopyrightEnd%
*/
#include <string.h>
+#include <limits.h>
#include "eidef.h"
#include "eiext.h"
#include "putget.h"
@@ -24,7 +25,10 @@
int ei_encode_string(char *buf, int *index, const char *p)
{
- return ei_encode_string_len(buf, index, p, strlen(p));
+ size_t len = strlen(p);
+
+ if (len >= INT_MAX) return -1;
+ return ei_encode_string_len(buf, index, p, len);
}
int ei_encode_string_len(char *buf, int *index, const char *p, int len)
diff --git a/lib/erl_interface/src/legacy/erl_fix_alloc.c b/lib/erl_interface/src/legacy/erl_fix_alloc.c
index 20f3024e41..ca09fc3b8b 100644
--- a/lib/erl_interface/src/legacy/erl_fix_alloc.c
+++ b/lib/erl_interface/src/legacy/erl_fix_alloc.c
@@ -109,6 +109,10 @@ void *erl_eterm_alloc (void)
erl_eterm_state->freed--;
} else if ((b = malloc(sizeof(*b))) == NULL) {
erl_errno = ENOMEM;
+#ifdef _REENTRANT
+ ei_mutex_unlock(erl_eterm_state->lock);
+#endif /* _REENTRANT */
+ return NULL;
}
erl_eterm_state->allocated++;
b->free = 0;
diff --git a/lib/erl_interface/src/misc/ei_decode_term.c b/lib/erl_interface/src/misc/ei_decode_term.c
index bfb4571337..0b82ef0e35 100644
--- a/lib/erl_interface/src/misc/ei_decode_term.c
+++ b/lib/erl_interface/src/misc/ei_decode_term.c
@@ -25,8 +25,8 @@
#include "ei_decode_term.h"
#include "putget.h"
-/* Returns 0 on successful encoding, -1 on error, and 1 if the term seems
- alright, but does not fit in the term structure. If it returns 0, the
+/* Returns 1 on successful encoding, -1 on error, and 0 if the term seems
+ alright, but does not fit in the term structure. If it returns 1, the
index will be incremented, and the term contains the decoded term. */
int ei_decode_ei_term(const char* buf, int* index, ei_term* term)
@@ -111,10 +111,10 @@ int ei_decode_ei_term(const char* buf, int* index, ei_term* term)
break;
case ERL_SMALL_TUPLE_EXT:
term->arity = get8(s);
- break; /*return 0;*/
+ break;
case ERL_LARGE_TUPLE_EXT:
term->arity = get32be(s);
- break; /*return 0;*/
+ break;
case ERL_NIL_EXT:
term->arity = 0;
break;
@@ -123,7 +123,7 @@ int ei_decode_ei_term(const char* buf, int* index, ei_term* term)
return 0;
case ERL_LIST_EXT:
term->arity = get32be(s);
- break; /*return 0;*/
+ break;
case ERL_BINARY_EXT:
term->size = get32be(s);
return 0;
diff --git a/lib/erl_interface/src/registry/reg_dump.c b/lib/erl_interface/src/registry/reg_dump.c
index 1e640fb506..d2854c10b5 100644
--- a/lib/erl_interface/src/registry/reg_dump.c
+++ b/lib/erl_interface/src/registry/reg_dump.c
@@ -215,6 +215,7 @@ static int mn_send_write(int fd, erlang_pid *mnesia, const char *key, ei_reg_obj
else ei_encode_long(msgbuf,&index,(long)(obj->val.p)); /* just the pointer */
break;
default:
+ if (dbuf) free(dbuf);
return -1;
}
diff --git a/lib/erl_interface/src/registry/reg_restore.c b/lib/erl_interface/src/registry/reg_restore.c
index 765c3f4314..7bc1c758af 100644
--- a/lib/erl_interface/src/registry/reg_restore.c
+++ b/lib/erl_interface/src/registry/reg_restore.c
@@ -303,6 +303,9 @@ int ei_reg_restore(int fd, ei_reg *reg, const char *mntab)
if (mn_decode_insert(reg,msgbuf,&index,keybuf)) goto restore_failure;
}
+ if (keybuf) free(keybuf);
+ if (dbuf) free(dbuf);
+
/* wait for unlink */
if (mn_unlink(fd)) return -1;
@@ -310,8 +313,6 @@ int ei_reg_restore(int fd, ei_reg *reg, const char *mntab)
ei_hash_foreach(reg->tab,clean_obj);
/* success */
- if (keybuf) free(keybuf);
- if (dbuf) free(dbuf);
return 0;
restore_failure:
diff --git a/lib/erl_interface/test/port_call_SUITE_data/Makefile.src b/lib/erl_interface/test/port_call_SUITE_data/Makefile.src
index dc7385ba32..0799187d64 100644
--- a/lib/erl_interface/test/port_call_SUITE_data/Makefile.src
+++ b/lib/erl_interface/test/port_call_SUITE_data/Makefile.src
@@ -26,7 +26,7 @@ LIBPATH = @erl_interface_libpath@
LIBERL = $(LIBPATH)/@erl_interface_lib_drv@
LIBEI = $(LIBPATH)/@erl_interface_eilib_drv@
-SHLIB_EXTRA_LDLIBS = $(LIBERL) $(LIBEI)
+SHLIB_EXTRA_LDLIBS = $(LIBERL) $(LIBEI) @erl_interface_threadlib@
SHLIB_EXTRA_CFLAGS = -I@erl_interface_include@ -I../all_SUITE_data
diff --git a/lib/et/src/et_wx_viewer.erl b/lib/et/src/et_wx_viewer.erl
index 7d4286ed9d..386f8fc86b 100644
--- a/lib/et/src/et_wx_viewer.erl
+++ b/lib/et/src/et_wx_viewer.erl
@@ -257,10 +257,10 @@ parse_opt([H | T], S, CollectorOpt) ->
Actors = [create_actor(Name) || Name <- ActorNames2],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{include, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, include, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, include, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{exclude, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, exclude, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, exclude, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{first_event, _FirstKey} ->
%% NYI
diff --git a/lib/eunit/doc/overview.edoc b/lib/eunit/doc/overview.edoc
index be05a13fba..2583f0be25 100644
--- a/lib/eunit/doc/overview.edoc
+++ b/lib/eunit/doc/overview.edoc
@@ -913,7 +913,7 @@ To make the descriptions simpler, we first list some definitions:
<td>`CleanupX'</td><td>`(X::any(), R::any()) -> any()'</td>
</tr>
<tr>
-<td>`Instantiator'</td><td>`((R::any()) -> Tests | {with, [AbstractTestFun::((any()) -> any())]}'</td>
+<td>`Instantiator'</td><td>`((R::any()) -> Tests) | {with, [AbstractTestFun::((any()) -> any())]}'</td>
</tr>
<tr>
<td>`Where'</td><td>`local | spawn | {spawn, Node::atom()}'</td>
diff --git a/lib/eunit/include/eunit.hrl b/lib/eunit/include/eunit.hrl
index 82ba982f03..493ba60a2d 100644
--- a/lib/eunit/include/eunit.hrl
+++ b/lib/eunit/include/eunit.hrl
@@ -39,6 +39,7 @@
-ifndef(EUNIT_HRL).
-define(EUNIT_HRL, true).
+
%% allow defining TEST to override NOTEST
-ifdef(TEST).
-undef(NOTEST).
@@ -164,7 +165,7 @@
%% This is mostly a convenience which gives more detailed reports.
%% Note: Guard is a guarded pattern, and can not be used for value.
-ifdef(NOASSERT).
--define(assertMatch(Guard,Expr),ok).
+-define(assertMatch(Guard, Expr), ok).
-else.
-define(assertMatch(Guard, Expr),
((fun () ->
@@ -174,17 +175,37 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected, (??Guard)},
+ {pattern, (??Guard)},
{value, __V}]})
end
end)())).
-endif.
-define(_assertMatch(Guard, Expr), ?_test(?assertMatch(Guard, Expr))).
+%% This is the inverse case of assertMatch, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotMatch(Guard, Expr), ok).
+-else.
+-define(assertNotMatch(Guard, Expr),
+ ((fun () ->
+ __V = (Expr),
+ case __V of
+ Guard -> .erlang:error({assertNotMatch_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern, (??Guard)},
+ {value, __V}]});
+ _ -> ok
+ end
+ end)())).
+-endif.
+-define(_assertNotMatch(Guard, Expr), ?_test(?assertNotMatch(Guard, Expr))).
+
%% This is a convenience macro which gives more detailed reports when
%% the expected LHS value is not a pattern, but a computed value
-ifdef(NOASSERT).
--define(assertEqual(Expect,Expr),ok).
+-define(assertEqual(Expect, Expr), ok).
-else.
-define(assertEqual(Expect, Expr),
((fun (__X) ->
@@ -201,9 +222,29 @@
-endif.
-define(_assertEqual(Expect, Expr), ?_test(?assertEqual(Expect, Expr))).
+%% This is the inverse case of assertEqual, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotEqual(Unexpected, Expr), ok).
+-else.
+-define(assertNotEqual(Unexpected, Expr),
+ ((fun (__X) ->
+ case (Expr) of
+ __X -> .erlang:error({assertNotEqual_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {value, __X}]});
+ _ -> ok
+ end
+ end)(Unexpected))).
+-endif.
+-define(_assertNotEqual(Unexpected, Expr),
+ ?_test(?assertNotEqual(Unexpected, Expr))).
+
%% Note: Class and Term are patterns, and can not be used for value.
+%% Term can be a guarded pattern, but Class cannot.
-ifdef(NOASSERT).
--define(assertException(Class, Term, Expr),ok).
+-define(assertException(Class, Term, Expr), ok).
-else.
-define(assertException(Class, Term, Expr),
((fun () ->
@@ -212,7 +253,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_success, __V}]})
@@ -223,7 +264,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_exception,
@@ -243,6 +284,43 @@
-define(_assertExit(Term, Expr), ?_assertException(exit, Term, Expr)).
-define(_assertThrow(Term, Expr), ?_assertException(throw, Term, Expr)).
+%% This is the inverse case of assertException, for convenience.
+%% Note: Class and Term are patterns, and can not be used for value.
+%% Both Class and Term can be guarded patterns.
+-ifdef(NOASSERT).
+-define(assertNotException(Class, Term, Expr), ok).
+-else.
+-define(assertNotException(Class, Term, Expr),
+ ((fun () ->
+ try (Expr) of
+ _ -> ok
+ catch
+ __C:__T ->
+ case __C of
+ Class ->
+ case __T of
+ Term ->
+ .erlang:error({assertNotException_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern,
+ "{ "++(??Class)++" , "
+ ++(??Term)++" , [...] }"},
+ {unexpected_exception,
+ {__C, __T,
+ .erlang:get_stacktrace()
+ }}]});
+ _ -> ok
+ end;
+ _ -> ok
+ end
+ end
+ end)())).
+-endif.
+-define(_assertNotException(Class, Term, Expr),
+ ?_test(?assertNotException(Class, Term, Expr))).
+
%% Macros for running operating system commands. (Note that these
%% require EUnit to be present at runtime, or at least eunit_lib.)
@@ -267,7 +345,7 @@
%% these are only used for testing; they always return 'ok' on success,
%% and have no effect if debugging/testing is turned off
-ifdef(NOASSERT).
--define(assertCmdStatus(N, Cmd),ok).
+-define(assertCmdStatus(N, Cmd), ok).
-else.
-define(assertCmdStatus(N, Cmd),
((fun () ->
@@ -285,7 +363,7 @@
-define(assertCmd(Cmd), ?assertCmdStatus(0, Cmd)).
-ifdef(NOASSERT).
--define(assertCmdOutput(T, Cmd),ok).
+-define(assertCmdOutput(T, Cmd), ok).
-else.
-define(assertCmdOutput(T, Cmd),
((fun () ->
@@ -313,11 +391,12 @@
-define(debugHere, ok).
-define(debugFmt(S, As), ok).
-define(debugVal(E), (E)).
--define(debugTime(S,E), (E)).
+-define(debugTime(S, E), (E)).
-else.
-define(debugMsg(S),
(begin
- .io:fwrite(user, <<"~s:~w: ~s\n">>, [?FILE, ?LINE, S]),
+ .io:fwrite(user, <<"~s:~w:~w: ~s\n">>,
+ [?FILE, ?LINE, self(), S]),
ok
end)).
-define(debugHere, (?debugMsg("<-"))).
@@ -327,7 +406,7 @@
?debugFmt(<<"~s = ~P">>, [(??E), __V, 15]),
__V
end)(E))).
--define(debugTime(S,E),
+-define(debugTime(S, E),
((fun () ->
{__T0, _} = statistics(wall_clock),
__V = (E),
@@ -337,4 +416,5 @@
end)())).
-endif.
+
-endif. % EUNIT_HRL
diff --git a/lib/eunit/src/eunit.app.src b/lib/eunit/src/eunit.app.src
index 4fd76588c3..5e16dfa2ce 100644
--- a/lib/eunit/src/eunit.app.src
+++ b/lib/eunit/src/eunit.app.src
@@ -5,17 +5,17 @@
{vsn, "%VSN%"},
{modules, [eunit,
eunit_autoexport,
- eunit_striptests,
- eunit_server,
+ eunit_data,
+ eunit_lib,
+ eunit_listener,
eunit_proc,
eunit_serial,
+ eunit_server,
+ eunit_striptests,
+ eunit_surefire,
eunit_test,
eunit_tests,
- eunit_lib,
- eunit_listener,
- eunit_data,
- eunit_tty,
- eunit_surefire]},
+ eunit_tty]},
{registered,[]},
- {applications, [stdlib]},
+ {applications, [kernel,stdlib]},
{env, []}]}.
diff --git a/lib/eunit/src/eunit.erl b/lib/eunit/src/eunit.erl
index da35c5c2ec..15fc3bdf32 100644
--- a/lib/eunit/src/eunit.erl
+++ b/lib/eunit/src/eunit.erl
@@ -16,7 +16,7 @@
%% $Id: eunit.erl 339 2009-04-05 14:10:47Z rcarlsson $
%%
%% @copyright 2004-2009 Micka�l R�mond, Richard Carlsson
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% [http://www.process-one.net/]
%% @author Richard Carlsson <[email protected]>
%% [http://user.it.uu.se/~richardc/]
diff --git a/lib/eunit/src/eunit_data.erl b/lib/eunit/src/eunit_data.erl
index 0543b6c543..288dd74ddf 100644
--- a/lib/eunit/src/eunit_data.erl
+++ b/lib/eunit/src/eunit_data.erl
@@ -146,8 +146,10 @@ iter_next(I = #iter{next = [T | Ts]}) ->
iter_prev(#iter{prev = []}) ->
none;
-iter_prev(#iter{prev = [T | Ts], next = Next, pos = Pos} = I) ->
- {T, I#iter{prev = Ts, next = [T | Next], pos = Pos - 1}}.
+iter_prev(#iter{prev = [T | Ts]} = I) ->
+ {T, I#iter{prev = Ts,
+ next = [T | I#iter.next],
+ pos = I#iter.pos - 1}}.
%% ---------------------------------------------------------------------
@@ -363,7 +365,8 @@ parse({file, F} = T) when is_list(F) ->
parse({dir, D}=T) when is_list(D) ->
case eunit_lib:is_string(D) of
true ->
- {data, {"directory \"" ++ D ++ "\"", get_directory_modules(D)}};
+ {data, {"directory \"" ++ D ++ "\"",
+ get_directory_module_tests(D)}};
false ->
bad_test(T)
end;
@@ -385,10 +388,10 @@ parse({S, T1} = T) when is_list(S) ->
end;
parse({S, T1}) when is_binary(S) ->
group(#group{tests = T1, desc = S});
-parse(T) when tuple_size(T) > 2, is_list(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_list(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
-parse(T) when tuple_size(T) > 2, is_binary(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_binary(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
parse(M) when is_atom(M) ->
@@ -596,7 +599,7 @@ testfuns(Es, M, TestSuffix, GeneratorSuffix) ->
%% ---------------------------------------------------------------------
-%% Getting a test set from a file
+%% Getting a test set from a file (text file or object file)
%% @throws {file_read_error, {Reason::atom(), Message::string(),
%% fileName()}}
@@ -625,17 +628,23 @@ get_file_tests(F) ->
is_module_filename(F) ->
filename:extension(F) =:= code:objfile_extension().
+objfile_test({M, File}) ->
+ {setup,
+ fun () ->
+ %% TODO: better error/stacktrace for this internal fun
+ code:purge(M),
+ {module,M} = code:load_abs(filename:rootname(File)),
+ ok
+ end,
+ {module, M}};
objfile_test(File) ->
+ objfile_test({objfile_module(File), File}).
+
+objfile_module(File) ->
try
- {module, M} = lists:keyfind(module, 1, beam_lib:info(File)),
- {setup,
- fun () ->
- %% TODO: better error/stacktrace for this internal fun
- code:purge(M),
- {module,M} = code:load_abs(filename:rootname(File)),
- ok
- end,
- {module, M}}
+ {value, {module, M}} = lists:keysearch(module, 1,
+ beam_lib:info(File)),
+ M
catch
_:_ ->
throw({file_read_error,
@@ -644,15 +653,34 @@ objfile_test(File) ->
%% ---------------------------------------------------------------------
-%% Getting a list of module names from object files in a directory
-
-%% @throws {file_read_error, {Reason::atom(), Message::string(),
-%% fileName()}}
+%% Getting a set of module tests from the object files in a directory
+
+%% @throws {file_read_error,
+%% {Reason::atom(), Message::string(), fileName()}}
+
+get_directory_module_tests(D) ->
+ Ms = get_directory_modules(D),
+ %% for all 'm' in the set, remove 'm_tests' if present
+ F = fun ({M,_}, S) ->
+ Name = atom_to_list(M),
+ case lists:suffix(?DEFAULT_TESTMODULE_SUFFIX, Name) of
+ false ->
+ Name1 = Name ++ ?DEFAULT_TESTMODULE_SUFFIX,
+ M1 = list_to_atom(Name1),
+ dict:erase(M1, S);
+ true ->
+ S
+ end
+ end,
+ [objfile_test(Obj)
+ || Obj <- dict:to_list(lists:foldl(F, dict:from_list(Ms), Ms))].
%% TODO: handle packages (recursive search for files)
-
get_directory_modules(D) ->
- [objfile_test(filename:join(D, F))
+ [begin
+ F1 = filename:join(D, F),
+ {objfile_module(F1), F1}
+ end
|| F <- eunit_lib:list_dir(D), is_module_filename(F)].
diff --git a/lib/eunit/src/eunit_server.erl b/lib/eunit/src/eunit_server.erl
index bf1bb9bcef..2cdfef2668 100644
--- a/lib/eunit/src/eunit_server.erl
+++ b/lib/eunit/src/eunit_server.erl
@@ -59,8 +59,9 @@ watch(Server, Module, Opts) when is_atom(Module) ->
watch_path(Server, Path, Opts) ->
command(Server, {watch, {path, filename:flatten(Path)}, Opts}).
+%% note that the user must use $ at the end to match whole paths only
watch_regexp(Server, Regex, Opts) ->
- case regexp:parse(Regex) of
+ case re:compile(Regex,[anchored]) of
{ok, R} ->
command(Server, {watch, {regexp, R}, Opts});
{error, _}=Error ->
@@ -278,8 +279,8 @@ is_watched(Path, St) ->
match_any(sets:to_list(St#state.regexps), Path).
match_any([R | Rs], Str) ->
- case regexp:first_match(Str, R) of
- {match, _, _} -> true;
+ case re:run(Str, R, [{capture,none}]) of
+ match -> true;
_ -> match_any(Rs, Str)
end;
match_any([], _Str) -> false.
diff --git a/lib/eunit/src/eunit_surefire.erl b/lib/eunit/src/eunit_surefire.erl
index dfb08c90b2..6e0a447105 100644
--- a/lib/eunit/src/eunit_surefire.erl
+++ b/lib/eunit/src/eunit_surefire.erl
@@ -15,7 +15,7 @@
%%
%% $Id: $
%%
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% @copyright 2009 Micka�l R�mond, Paul Guyot
%% @see eunit
%% @doc Surefire reports for EUnit (Format used by Maven and Atlassian
@@ -64,6 +64,7 @@
}).
-record(testsuite,
{
+ id = 0 :: integer(),
name = <<>> :: binary(),
time = 0 :: integer(),
output = <<>> :: binary(),
@@ -76,7 +77,7 @@
-record(state, {verbose = false,
indent = 0,
xmldir = ".",
- testsuite = #testsuite{}
+ testsuites = [] :: [#testsuite{}]
}).
start() ->
@@ -89,55 +90,60 @@ init(Options) ->
XMLDir = proplists:get_value(dir, Options, ?XMLDIR),
St = #state{verbose = proplists:get_bool(verbose, Options),
xmldir = XMLDir,
- testsuite = #testsuite{}},
+ testsuites = []},
receive
{start, _Reference} ->
St
end.
terminate({ok, _Data}, St) ->
- TestSuite = St#state.testsuite,
+ TestSuites = St#state.testsuites,
XmlDir = St#state.xmldir,
- write_report(TestSuite, XmlDir),
+ write_reports(TestSuites, XmlDir),
ok;
terminate({error, _Reason}, _St) ->
%% Don't report any errors here, since eunit_tty takes care of that.
%% Just terminate.
ok.
-handle_begin(group, Data, St) ->
+handle_begin(Kind, Data, St) when Kind == group; Kind == test ->
+ %% Run this code both for groups and tests; test is a bit
+ %% surprising: This is a workaround for the fact that we don't get
+ %% a group (handle_begin(group, ...) for testsuites (modules)
+ %% which only have one test case. In that case we get a test case
+ %% with an id comprised of just one integer - the group id.
NewId = proplists:get_value(id, Data),
case NewId of
[] ->
St;
- [_GroupId] ->
+ [GroupId] ->
Desc = proplists:get_value(desc, Data),
- TestSuite = St#state.testsuite,
- NewTestSuite = TestSuite#testsuite{name = Desc},
- St#state{testsuite=NewTestSuite};
+ TestSuite = #testsuite{id = GroupId, name = Desc},
+ St#state{testsuites=store_suite(TestSuite, St#state.testsuites)};
%% Surefire format is not hierarchic: Ignore subgroups:
_ ->
St
- end;
-handle_begin(test, _Data, St) ->
- St.
+ end.
handle_end(group, Data, St) ->
%% Retrieve existing test suite:
case proplists:get_value(id, Data) of
[] ->
St;
- [_GroupId|_] ->
- TestSuite = St#state.testsuite,
+ [GroupId|_] ->
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Update TestSuite data:
Time = proplists:get_value(time, Data),
Output = proplists:get_value(output, Data),
NewTestSuite = TestSuite#testsuite{ time = Time, output = Output },
- St#state{testsuite=NewTestSuite}
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}
end;
handle_end(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -149,7 +155,7 @@ handle_end(test, Data, St) ->
TestCase = #testcase{name = Name, description = Desc,
time = Time,output = Output},
NewTestSuite = add_testcase_to_testsuite(Result, TestCase, TestSuite),
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
%% Cancel group does not give information on the individual cancelled test case
%% We ignore this event
@@ -157,7 +163,9 @@ handle_cancel(group, _Data, St) ->
St;
handle_cancel(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -171,7 +179,7 @@ handle_cancel(test, Data, St) ->
NewTestSuite = TestSuite#testsuite{
skipped = TestSuite#testsuite.skipped+1,
testcases=[TestCase|TestSuite#testsuite.testcases] },
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
format_name({Module, Function, Arity}, Line) ->
lists:flatten([atom_to_list(Module), ":", atom_to_list(Function), "/",
@@ -183,6 +191,12 @@ format_desc(Desc) when is_binary(Desc) ->
format_desc(Desc) when is_list(Desc) ->
Desc.
+lookup_suite_by_group_id(GroupId, TestSuites) ->
+ #testsuite{} = lists:keyfind(GroupId, #testsuite.id, TestSuites).
+
+store_suite(#testsuite{id=GroupId} = TestSuite, TestSuites) ->
+ lists:keystore(GroupId, #testsuite.id, TestSuites, TestSuite).
+
%% Add testcase to testsuite depending on the result of the test.
add_testcase_to_testsuite(ok, TestCaseTmp, TestSuite) ->
TestCase = TestCaseTmp#testcase{ result = ok },
@@ -214,6 +228,10 @@ add_testcase_to_testsuite({error, Exception}, TestCaseTmp, TestSuite) ->
%% Write a report to the XML directory.
%% This function opens the report file, calls write_report_to/2 and closes the file.
%% ----------------------------------------------------------------------------
+write_reports(TestSuites, XmlDir) ->
+ lists:foreach(fun(TestSuite) -> write_report(TestSuite, XmlDir) end,
+ TestSuites).
+
write_report(#testsuite{name = Name} = TestSuite, XmlDir) ->
Filename = filename:join(XmlDir, lists:flatten(["TEST-", escape_suitename(Name)], ".xml")),
case file:open(Filename, [write, raw]) of
diff --git a/lib/eunit/src/eunit_test.erl b/lib/eunit/src/eunit_test.erl
index d322c4b420..9ac1d1e7d9 100644
--- a/lib/eunit/src/eunit_test.erl
+++ b/lib/eunit/src/eunit_test.erl
@@ -131,12 +131,27 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,"[ _ ]"},
+ {pattern,"[ _ ]"},
{value,[]}]},
_}}
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotMatch(ok, error),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotMatch([_], [42]),
+ {error,{error,{assertNotMatch_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,"[ _ ]"},
+ {value,[42]}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertEqual(ok, ok),
{ok, ok} = run_testfun(F)
end),
@@ -152,6 +167,20 @@ macro_test_() ->
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotEqual(1, 0),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotEqual(2, 1+1),
+ {error,{error,{assertNotEqual_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {value,2}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertException(error, badarith,
erlang:error(badarith)),
{ok, ok} = run_testfun(F)
@@ -162,7 +191,7 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
{unexpected_success,ok}]},
_}}
= run_testfun(F)
@@ -174,15 +203,48 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
+ {unexpected_exception,
+ {error,badarith,_}}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertError(badarith,
+ erlang:error(badarith)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertExit(normal, exit(normal)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertThrow(foo, throw(foo)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith, 42),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarg)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarith)),
+ {error,{error,{assertNotException_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,_},
{unexpected_exception,
{error,badarith,_}}]},
_}}
= run_testfun(F)
end)
]}.
-
-under_eunit_test() -> ?assert(?UNDER_EUNIT).
-endif.
diff --git a/lib/eunit/src/eunit_tests.erl b/lib/eunit/src/eunit_tests.erl
index 37c0b4d6ae..a63d102d98 100644
--- a/lib/eunit/src/eunit_tests.erl
+++ b/lib/eunit/src/eunit_tests.erl
@@ -26,17 +26,17 @@
-include("eunit.hrl").
-ifdef(TEST).
-%% Cause all the other modules to be tested as well as this one.
-full_test_() ->
- %%{application, eunit}. % this currently causes a loop
- %% We use the below until loop detection is implemented
- [eunit_autoexport,
- eunit_striptests,
- eunit_server,
- eunit_proc,
- eunit_serial,
- eunit_test,
- eunit_lib,
- eunit_data,
- eunit_tty].
+id(X) -> X. % for suppressing compiler warnings
-endif.
+
+under_eunit_test() -> ?assert(?UNDER_EUNIT).
+
+let_test() -> ?assertEqual(42, ?LET(X, 17, X+25)).
+
+if_test_() ->
+ [?_assertEqual(17, ?IF(id(1) > 0, 17, 42)),
+ ?_assertEqual(42, ?IF(id(1) < 0, 17, 42))].
+
+matches_test_() ->
+ [?_assert(?MATCHES("hel"++_, "hello")),
+ ?_assertNot(?MATCHES("hal"++_, "hello"))].
diff --git a/lib/eunit/vsn.mk b/lib/eunit/vsn.mk
index d7edd7977b..d933085bbc 100644
--- a/lib/eunit/vsn.mk
+++ b/lib/eunit/vsn.mk
@@ -1 +1 @@
-EUNIT_VSN = 2.1.7
+EUNIT_VSN = 2.2.0
diff --git a/lib/gs/contribs/bonk/sounder.erl b/lib/gs/contribs/bonk/sounder.erl
index 11ab03d167..899f20d4e0 100644
--- a/lib/gs/contribs/bonk/sounder.erl
+++ b/lib/gs/contribs/bonk/sounder.erl
@@ -72,13 +72,13 @@ stop() ->
sounder ! {stop},
ok end.
-new(File) when list(File) -> new(list_to_atom(File));
-new(File) when atom(File) ->
+new(File) when is_list(File) -> new(list_to_atom(File));
+new(File) when is_atom(File) ->
catch begin check(),
sounder ! {new,File,self()},
wait_for_ack(sounder) end.
-play(No) when integer(No) ->
+play(No) when is_integer(No) ->
catch begin check(),
sounder ! {play, No, self()},
wait_for_ack(sounder) end.
@@ -94,14 +94,14 @@ go() ->
loop(Port) ->
receive
- {new, File, From} when atom(File) ->
+ {new, File, From} when is_atom(File) ->
Port ! {self(),{command,lists:append([0],atom_to_list(File))}},
From ! {sounder,wait_for_ack(Port)},
loop(Port);
{play,silent,From} ->
From ! {sounder,false},
loop(Port);
- {play,No,From} when integer(No) ->
+ {play,No,From} when is_integer(No) ->
Port ! {self(),{command,[No]}},
From ! {sounder,wait_for_ack(Port)},
loop(Port);
@@ -118,13 +118,13 @@ loop(Port) ->
nosound() ->
receive
- {new,File,From} when atom(File) ->
+ {new,File,From} when is_atom(File) ->
From ! {sounder,{ok,silent}},
nosound();
{play,silent,From} ->
From ! {sounder,true},
nosound();
- {play,No,From} when integer(No) ->
+ {play,No,From} when is_integer(No) ->
From ! {sounder,{error,no_audio_cap}},
nosound();
{stop} ->
@@ -135,7 +135,7 @@ nosound() ->
wait_for_ack(sounder) ->
receive {sounder,Res} -> Res end;
-wait_for_ack(Port) when port(Port) ->
+wait_for_ack(Port) when is_port(Port) ->
receive
{Port,{data,"ok"}} ->
ok;
@@ -149,7 +149,7 @@ wait_for_ack(Port) when port(Port) ->
check() ->
case whereis(sounder) of
- Pid when pid(Pid) ->
+ Pid when is_pid(Pid) ->
ok;
undefined ->
throw({error,sounder_not_started})
diff --git a/lib/gs/contribs/cols/cols.erl b/lib/gs/contribs/cols/cols.erl
index 67b46d0dfb..439eb717f7 100644
--- a/lib/gs/contribs/cols/cols.erl
+++ b/lib/gs/contribs/cols/cols.erl
@@ -278,7 +278,7 @@ fall_column([], _X, _Y, ColumnAcc, ChecksAcc) ->
fall_column([black|Colors], X, Y, ColumnAcc, ChecksAcc) ->
case find_box(Colors) of
false -> {ColumnAcc, ChecksAcc};
- NewColors when list(NewColors) ->
+ NewColors when is_list(NewColors) ->
fall_one_step(NewColors, X, Y, ColumnAcc, ChecksAcc)
end;
fall_column([Color|Colors], X, Y, ColumnAcc, ChecksAcc) ->
@@ -330,7 +330,7 @@ new_column_list([], _, _) -> [].
%%----------------------------------------------------------------------
%% Returns: a reversed list of colors.
%%----------------------------------------------------------------------
-columntuple_to_list(ColumnTuple) when tuple(ColumnTuple) ->
+columntuple_to_list(ColumnTuple) when is_tuple(ColumnTuple) ->
columntuple_to_list(tuple_to_list(ColumnTuple),[]).
columntuple_to_list([],Acc) -> Acc;
diff --git a/lib/gs/contribs/mandel/mandel.erl b/lib/gs/contribs/mandel/mandel.erl
index d4d2452463..579f8e487b 100644
--- a/lib/gs/contribs/mandel/mandel.erl
+++ b/lib/gs/contribs/mandel/mandel.erl
@@ -119,7 +119,7 @@ start_client(Opts,Nodes) ->
try_random(random,Low,High) ->
random:uniform()*(High-Low)+Low;
-try_random(Float,_Low,_High) when number(Float) -> Float.
+try_random(Float,_Low,_High) when is_number(Float) -> Float.
%%-----------------------------------------------------------------
diff --git a/lib/gs/contribs/othello/othello_board.erl b/lib/gs/contribs/othello/othello_board.erl
index 0206ba2ded..6ccb79b7e4 100644
--- a/lib/gs/contribs/othello/othello_board.erl
+++ b/lib/gs/contribs/othello/othello_board.erl
@@ -147,7 +147,7 @@ but_pressed("Help",_ButtId,_User,GamePid,_Shell,_Wids,_Op) ->
but_pressed("Newgame",_ButtId,_User,GamePid,_Shell,Wids,Options) ->
new_game(GamePid,Wids,Options);
but_pressed([],ButtId,User,GamePid,_Shell,_Wids,_Op)
- when pid(GamePid),User == player ->
+ when is_pid(GamePid),User == player ->
[C,R] = atom_to_list(ButtId),
GamePid ! {self(),position,othello_adt:pos(C-96,translate(R-48))},
GamePid;
@@ -243,7 +243,7 @@ game_msg(Msg,User,GamePid,Shell,Wids,Options) ->
end.
-new_game(GamePid,Wids,Options) when pid(GamePid) ->
+new_game(GamePid,Wids,Options) when is_pid(GamePid) ->
exit(GamePid,kill),
new_game(Wids,Options);
new_game(_,Wids,Options) ->
diff --git a/lib/gs/examples/calc2.erl b/lib/gs/examples/calc2.erl
index d28780de01..9969a6c40f 100644
--- a/lib/gs/examples/calc2.erl
+++ b/lib/gs/examples/calc2.erl
@@ -54,7 +54,7 @@ calc() ->
calc_loop(Lbl,M,V,Op) ->
receive
- {gs,_,click,D,_} when integer(D) ->
+ {gs,_,click,D,_} when is_integer(D) ->
digit_press(Lbl,M,V*10+D,Op);
{gs,_,click,'C',_} ->
c(Lbl,M,V,Op);
diff --git a/lib/hipe/cerl/erl_bif_types.erl b/lib/hipe/cerl/erl_bif_types.erl
index 0b47c7b6e1..4163f2dae2 100644
--- a/lib/hipe/cerl/erl_bif_types.erl
+++ b/lib/hipe/cerl/erl_bif_types.erl
@@ -366,7 +366,7 @@ type(erlang, '>', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMax), is_integer(RhsMin), RhsMin >= LhsMax -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('>', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '>=', 2, Xs = [Lhs, Rhs]) ->
@@ -384,7 +384,7 @@ type(erlang, '>=', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMax), is_integer(RhsMin), RhsMin > LhsMax -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('>=', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '<', 2, Xs = [Lhs, Rhs]) ->
@@ -402,7 +402,7 @@ type(erlang, '<', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMin), is_integer(RhsMax), RhsMax =< LhsMin -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('<', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '=<', 2, Xs = [Lhs, Rhs]) ->
@@ -420,7 +420,7 @@ type(erlang, '=<', 2, Xs = [Lhs, Rhs]) ->
is_integer(LhsMin), is_integer(RhsMax), RhsMax < LhsMin -> F;
true -> t_boolean()
end;
- false -> t_boolean()
+ false -> compare('=<', Lhs, Rhs)
end,
strict(Xs, Ans);
type(erlang, '+', 1, Xs) ->
@@ -672,6 +672,9 @@ type(erlang, call_on_load_function, 1, Xs) ->
type(erlang, cancel_timer, 1, Xs) ->
strict(arg_types(erlang, cancel_timer, 1), Xs,
fun (_) -> t_sup(t_integer(), t_atom('false')) end);
+type(erlang, check_old_code, 1, Xs) ->
+ strict(arg_types(erlang, check_old_code, 1), Xs,
+ fun (_) -> t_boolean() end);
type(erlang, check_process_code, 2, Xs) ->
strict(arg_types(erlang, check_process_code, 2), Xs,
fun (_) -> t_boolean() end);
@@ -702,7 +705,7 @@ type(erlang, demonitor, 1, Xs) ->
type(erlang, demonitor, 2, Xs) ->
strict(arg_types(erlang, demonitor, 2), Xs, fun (_) -> t_boolean() end);
type(erlang, disconnect_node, 1, Xs) ->
- strict(arg_types(erlang, disconnect_node, 1), Xs, fun (_) -> t_boolean() end);
+ strict(arg_types(erlang, disconnect_node, 1), Xs, fun (_) -> t_sup([t_boolean(), t_atom('ignored')]) end);
type(erlang, display, 1, _) -> t_atom('true');
type(erlang, display_string, 1, Xs) ->
strict(arg_types(erlang, display_string, 1), Xs, fun(_) -> t_atom('true') end);
@@ -736,6 +739,7 @@ type(erlang, element, 2, Xs) ->
type(erlang, erase, 0, _) -> t_any();
type(erlang, erase, 1, _) -> t_any();
type(erlang, external_size, 1, _) -> t_integer();
+type(erlang, external_size, 2, _) -> t_integer();
type(erlang, finish_after_on_load, 2, Xs) ->
%% Internal BIF used by on_load.
strict(arg_types(erlang, finish_after_on_load, 2), Xs,
@@ -1124,7 +1128,7 @@ type(erlang, nodes, 0, _) -> t_list(t_node());
type(erlang, nodes, 1, Xs) ->
strict(arg_types(erlang, nodes, 1), Xs, fun (_) -> t_list(t_node()) end);
type(erlang, now, 0, _) ->
- t_time();
+ t_timestamp();
type(erlang, open_port, 2, Xs) ->
strict(arg_types(erlang, open_port, 2), Xs, fun (_) -> t_port() end);
type(erlang, phash, 2, Xs) ->
@@ -1199,6 +1203,7 @@ type(erlang, process_flag, 2, Xs) ->
case t_atom_vals(Flag) of
['error_handler'] -> t_atom();
['min_heap_size'] -> t_non_neg_integer();
+ ['scheduler'] -> t_non_neg_integer();
['monitor_nodes'] -> t_boolean();
['priority'] -> t_process_priority_level();
['save_calls'] -> t_non_neg_integer();
@@ -1585,8 +1590,7 @@ type(erlang, system_info, 1, Xs) ->
['multi_scheduling_blockers'] ->
t_list(t_pid());
['os_type'] ->
- t_tuple([t_sup([t_atom('ose'), % XXX: undocumented
- t_atom('unix'),
+ t_tuple([t_sup([t_atom('unix'),
t_atom('vxworks'),
t_atom('win32')]),
t_atom()]);
@@ -1900,7 +1904,7 @@ type(prim_file, internal_native2name, 1, Xs) ->
fun (_) -> t_prim_file_name() end);
type(prim_file, internal_normalize_utf8, 1, Xs) ->
strict(arg_types(prim_file, internal_normalize_utf8, 1), Xs,
- fun (_) -> t_binary() end);
+ fun (_) -> t_unicode_string() end);
%%-- gen_tcp ------------------------------------------------------------------
%% NOTE: All type information for this module added to avoid loss of precision
type(gen_tcp, accept, 1, Xs) ->
@@ -2325,10 +2329,7 @@ type(lists, keyfind, 3, Xs) ->
case t_tuple_subtypes(Tuple) of
unknown -> Ret;
List ->
- Keys = [type(erlang, element, 2, [Y, S])
- || S <- List],
- Infs = [t_inf(Key, X) || Key <- Keys],
- case all_is_none(Infs) of
+ case key_comparisons_fail(X, Y, List) of
true -> t_atom('false');
false -> Ret
end
@@ -2358,9 +2359,7 @@ type(lists, keymember, 3, Xs) ->
case t_tuple_subtypes(Tuple) of
unknown -> t_boolean();
List ->
- Keys = [type(erlang, element, 2, [Y,S]) || S <- List],
- Infs = [t_inf(Key, X) || Key <- Keys],
- case all_is_none(Infs) of
+ case key_comparisons_fail(X, Y, List) of
true -> t_atom('false');
false -> t_boolean()
end
@@ -2390,10 +2389,7 @@ type(lists, keysearch, 3, Xs) ->
case t_tuple_subtypes(Tuple) of
unknown -> Ret;
List ->
- Keys = [type(erlang, element, 2, [Y, S])
- || S <- List],
- Infs = [t_inf(Key, X) || Key <- Keys],
- case all_is_none(Infs) of
+ case key_comparisons_fail(X, Y, List) of
true -> t_atom('false');
false -> Ret
end
@@ -2693,7 +2689,7 @@ type(os, getpid, 0, _) -> t_string();
type(os, putenv, 2, Xs) ->
strict(arg_types(os, putenv, 2), Xs, fun (_) -> t_atom('true') end);
type(os, timestamp, 0, _) ->
- t_time();
+ t_timestamp();
%%-- re -----------------------------------------------------------------------
type(re, compile, 1, Xs) ->
strict(arg_types(re, compile, 1), Xs,
@@ -2821,9 +2817,6 @@ list_replace(1, E, [_X | Xs]) ->
any_is_none_or_unit(Ts) ->
lists:any(fun erl_types:t_is_none_or_unit/1, Ts).
-all_is_none(Ts) ->
- lists:all(fun erl_types:t_is_none/1, Ts).
-
check_guard([X], Test, Type) ->
check_guard_single(X, Test, Type).
@@ -3176,6 +3169,59 @@ arith(Op, X1, X2) ->
end.
%%=============================================================================
+%% Comparison of terms
+%%=============================================================================
+
+compare(Op, Lhs, Rhs) ->
+ case t_is_none(t_inf(Lhs, Rhs)) of
+ false -> t_boolean();
+ true ->
+ case Op of
+ '<' -> always_smaller(Lhs, Rhs);
+ '>' -> always_smaller(Rhs, Lhs);
+ '=<' -> always_smaller(Lhs, Rhs);
+ '>=' -> always_smaller(Rhs, Lhs)
+ end
+ end.
+
+always_smaller(Type1, Type2) ->
+ {Min1, Max1} = type_ranks(Type1),
+ {Min2, Max2} = type_ranks(Type2),
+ if Max1 < Min2 -> t_atom('true');
+ Min1 > Max2 -> t_atom('false');
+ true -> t_boolean()
+ end.
+
+type_ranks(Type) ->
+ type_ranks(Type, 1, 0, 0, type_order()).
+
+type_ranks(_Type, _I, Min, Max, []) -> {Min, Max};
+type_ranks(Type, I, Min, Max, [TypeClass|Rest]) ->
+ {NewMin, NewMax} =
+ case t_is_none(t_inf(Type, TypeClass)) of
+ true -> {Min, Max};
+ false -> case Min of
+ 0 -> {I, I};
+ _ -> {Min, I}
+ end
+ end,
+ type_ranks(Type, I+1, NewMin, NewMax, Rest).
+
+type_order() ->
+ [t_number(), t_atom(), t_reference(), t_fun(), t_port(), t_pid(), t_tuple(),
+ t_list(), t_binary()].
+
+key_comparisons_fail(X0, KeyPos, TupleList) ->
+ X = case t_is_number(t_inf(X0, t_number())) of
+ false -> X0;
+ true -> t_number()
+ end,
+ lists:all(fun(Tuple) ->
+ Key = type(erlang, element, 2, [KeyPos, Tuple]),
+ t_is_none(t_inf(Key, X))
+ end, TupleList).
+
+%%=============================================================================
-spec arg_types(atom(), atom(), arity()) -> [erl_types:erl_type()] | 'unknown'.
@@ -3396,6 +3442,8 @@ arg_types(erlang, call_on_load_function, 1) ->
[t_atom()];
arg_types(erlang, cancel_timer, 1) ->
[t_reference()];
+arg_types(erlang, check_old_code, 1) ->
+ [t_atom()];
arg_types(erlang, check_process_code, 2) ->
[t_pid(), t_atom()];
arg_types(erlang, concat_binary, 1) ->
@@ -3442,6 +3490,8 @@ arg_types(erlang, exit, 2) ->
[t_sup(t_pid(), t_port()), t_any()];
arg_types(erlang, external_size, 1) ->
[t_any()]; % takes any term as input
+arg_types(erlang, external_size, 2) ->
+ [t_any(), t_list()]; % takes any term as input and a list of options
arg_types(erlang, finish_after_on_load, 2) ->
[t_atom(), t_boolean()];
arg_types(erlang, float, 1) ->
@@ -3696,6 +3746,7 @@ arg_types(erlang, process_display, 2) ->
arg_types(erlang, process_flag, 2) ->
[t_sup([t_atom('trap_exit'), t_atom('error_handler'),
t_atom('min_heap_size'), t_atom('priority'), t_atom('save_calls'),
+ t_atom('scheduler'), % undocumented
t_atom('monitor_nodes'), % undocumented
t_tuple([t_atom('monitor_nodes'), t_list()])]), % undocumented
t_sup([t_boolean(), t_atom(), t_non_neg_integer()])];
@@ -3734,7 +3785,7 @@ arg_types(erlang, send, 3) ->
arg_types(erlang, send_after, 3) ->
[t_non_neg_integer(), t_sup(t_pid(), t_atom()), t_any()];
arg_types(erlang, seq_trace, 2) ->
- [t_atom(), t_sup([t_boolean(), t_tuple([t_fixnum(), t_fixnum()]), t_nil()])];
+ [t_atom(), t_sup([t_boolean(), t_tuple([t_fixnum(), t_fixnum()]), t_fixnum(), t_nil()])];
arg_types(erlang, seq_trace_info, 1) ->
[t_seq_trace_info()];
arg_types(erlang, seq_trace_print, 1) ->
@@ -3983,7 +4034,7 @@ arg_types(ets, match_object, 3) ->
arg_types(ets, match_spec_compile, 1) ->
[t_matchspecs()];
arg_types(ets, match_spec_run_r, 3) ->
- [t_matchspecs(), t_any(), t_list()];
+ [t_list(t_tuple()),t_matchspecs(), t_list()];
arg_types(ets, member, 2) ->
[t_tab(), t_any()];
arg_types(ets, new, 2) ->
@@ -4015,8 +4066,12 @@ arg_types(ets, select_reverse, 3) ->
arg_types(ets, slot, 2) ->
[t_tab(), t_non_neg_fixnum()]; % 2nd arg can be 0
arg_types(ets, setopts, 2) ->
- Opt = t_sup(t_tuple([t_atom('heir'), t_pid(), t_any()]),
- t_tuple([t_atom('heir'), t_atom('none')])),
+ Opt = t_sup([t_tuple([t_atom('heir'), t_pid(), t_any()]),
+ t_tuple([t_atom('heir'), t_atom('none')]),
+ t_tuple([t_atom('protection'),
+ t_sup([t_atom('protected'),
+ t_atom('private'),
+ t_atom('public')])])]),
[t_tab(), t_sup(Opt, t_list(Opt))];
arg_types(ets, update_counter, 3) ->
Int = t_integer(),
@@ -4458,6 +4513,9 @@ t_date() ->
t_time() ->
t_tuple([t_non_neg_fixnum(), t_non_neg_fixnum(), t_non_neg_fixnum()]).
+t_timestamp() ->
+ t_tuple([t_non_neg_fixnum(), t_non_neg_fixnum(), t_non_neg_fixnum()]).
+
t_packet() ->
t_sup([t_binary(), t_iolist(), t_httppacket()]).
@@ -4805,6 +4863,9 @@ t_ets_info_items() ->
t_atom('owner'),
t_atom('protection'),
t_atom('size'),
+ t_atom('compressed'),
+ t_atom('heir'),
+ t_atom('stats'),
t_atom('type')]).
%% =====================================================================
diff --git a/lib/hipe/cerl/erl_types.erl b/lib/hipe/cerl/erl_types.erl
index 1748c1cc16..7ff170776e 100644
--- a/lib/hipe/cerl/erl_types.erl
+++ b/lib/hipe/cerl/erl_types.erl
@@ -211,7 +211,8 @@
record_field_diffs_to_string/2,
subst_all_vars_to_any/1,
lift_list_to_pos_empty/1,
- is_erl_type/1
+ is_erl_type/1,
+ atom_to_string/1
]).
%%-define(DO_ERL_TYPES_TEST, true).
@@ -3360,14 +3361,14 @@ t_to_string(?var(Id), _RecDict) when is_integer(Id) ->
record_to_string(Tag, [_|Fields], FieldNames, RecDict) ->
FieldStrings = record_fields_to_string(Fields, FieldNames, RecDict, []),
- "#" ++ atom_to_list(Tag) ++ "{" ++ string:join(FieldStrings, ",") ++ "}".
+ "#" ++ atom_to_string(Tag) ++ "{" ++ string:join(FieldStrings, ",") ++ "}".
record_fields_to_string([F|Fs], [{FName, _DefType}|FDefs], RecDict, Acc) ->
NewAcc =
case t_is_any(F) orelse t_is_atom('undefined', F) of
true -> Acc;
false ->
- StrFV = atom_to_list(FName) ++ "::" ++ t_to_string(F, RecDict),
+ StrFV = atom_to_string(FName) ++ "::" ++ t_to_string(F, RecDict),
%% ActualDefType = t_subtract(DefType, t_atom('undefined')),
%% Str = case t_is_any(ActualDefType) of
%% true -> StrFV;
@@ -3393,7 +3394,7 @@ field_diffs([F|Fs], [{FName, DefType}|FDefs], RecDict, Acc) ->
case t_is_subtype(F, DefType) of
true -> Acc;
false ->
- Str = atom_to_list(FName) ++ "::" ++ t_to_string(DefType, RecDict),
+ Str = atom_to_string(FName) ++ "::" ++ t_to_string(DefType, RecDict),
[Str|Acc]
end,
field_diffs(Fs, FDefs, RecDict, NewAcc);
@@ -3906,7 +3907,7 @@ t_form_to_string({type, _L, union, Args}) ->
string:join(t_form_to_string_list(Args), " | ");
t_form_to_string({type, _L, Name, []} = T) ->
try t_to_string(t_from_form(T))
- catch throw:{error, _} -> atom_to_list(Name) ++ "()"
+ catch throw:{error, _} -> atom_to_string(Name) ++ "()"
end;
t_form_to_string({type, _L, Name, List}) ->
io_lib:format("~w(~s)",
@@ -3920,6 +3921,11 @@ t_form_to_string_list([H|T], Acc) ->
t_form_to_string_list([], Acc) ->
lists:reverse(Acc).
+-spec atom_to_string(atom()) -> string().
+
+atom_to_string(Atom) ->
+ lists:flatten(io_lib:format("~w", [Atom])).
+
%%=============================================================================
%%
%% Utilities
diff --git a/lib/hipe/icode/hipe_beam_to_icode.erl b/lib/hipe/icode/hipe_beam_to_icode.erl
index d7eb035551..cfed410240 100644
--- a/lib/hipe/icode/hipe_beam_to_icode.erl
+++ b/lib/hipe/icode/hipe_beam_to_icode.erl
@@ -720,7 +720,7 @@ trans_fun([{test,bs_get_float2,{f,Lbl},[Ms,_Live,Size,Unit,{field_flags,Flags0},
?EXIT({bad_bs_size_constant,Size});
BitReg ->
Bits = mk_var(BitReg),
- {{bs_get_float,Unit,Flags}, [Bits,MsVar]}
+ {{bs_get_float,Unit,Flags}, [MsVar,Bits]}
end,
trans_op_call({hipe_bs_primop,Name}, Lbl, Args, [Dst,MsVar], Env, Instructions);
trans_fun([{test,bs_get_integer2,{f,Lbl},[Ms,_Live,Size,Unit,{field_flags,Flags0},X]}|
diff --git a/lib/hipe/main/hipe.hrl.src b/lib/hipe/main/hipe.hrl.src
index a1fbeda9cf..ec55c707ef 100644
--- a/lib/hipe/main/hipe.hrl.src
+++ b/lib/hipe/main/hipe.hrl.src
@@ -50,9 +50,8 @@
%% Flags:
%% DEBUG - Turns on debugging. (Can be defined to a integer
%% value to determine the level of debugging)
-%% VERBOSE - More info is printed...
%% HIPE_LOGGING - Turn on logging of messages with erl_logger.
-%% DO_ASSERT - Turn on Assertions.
+%% DO_ASSERT - Turn on assertions.
%% TIMING - Turn on timing.
%% HIPE_INSTRUMENT_COMPILER - Turn on instrumentation of the compiler.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
@@ -107,13 +106,9 @@
%%
%% Define the exit macro
%%
--ifdef(VERBOSE).
--define(EXIT(Reason), erlang:error({?MODULE,?LINE,Reason})).
--else.
-define(EXIT(Reason),
?msg("EXITED with reason ~w @~w:~w\n", [Reason,?MODULE,?LINE]),
erlang:error({?MODULE,?LINE,Reason})).
--endif.
%%
%% Assertions.
diff --git a/lib/hipe/regalloc/hipe_node_sets.erl b/lib/hipe/regalloc/hipe_node_sets.erl
index b5e2971c4d..0bb21d7506 100644
--- a/lib/hipe/regalloc/hipe_node_sets.erl
+++ b/lib/hipe/regalloc/hipe_node_sets.erl
@@ -29,7 +29,7 @@
-record(node_sets,
{spilled, % Nodes marked for spilling
- colored % Nodes succesfully colored
+ colored % Nodes successfully colored
}).
spilled(Node_sets) -> Node_sets#node_sets.spilled.
diff --git a/lib/hipe/rtl/hipe_rtl_lcm.erl b/lib/hipe/rtl/hipe_rtl_lcm.erl
index 5d65389d48..d45ab4ed46 100644
--- a/lib/hipe/rtl/hipe_rtl_lcm.erl
+++ b/lib/hipe/rtl/hipe_rtl_lcm.erl
@@ -269,7 +269,7 @@ insert_expr_last(CFG0, Label, Instr) ->
%% is a branch operation).
insert_expr_last_work(_, Instr, []) ->
%% This case should not happen since this means that block was completely
- %% empty when the function was called. For compability we insert it last.
+ %% empty when the function was called. For compatibility we insert it last.
[Instr];
insert_expr_last_work(_, Instr, [Code1]) ->
%% We insert the code next to last.
diff --git a/lib/ic/doc/src/notes.xml b/lib/ic/doc/src/notes.xml
index 5f6c31069c..de519d5f84 100644
--- a/lib/ic/doc/src/notes.xml
+++ b/lib/ic/doc/src/notes.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>1998</year><year>2010</year>
+ <year>1998</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -31,6 +31,22 @@
</header>
<section>
+ <title>IC 4.2.27</title>
+
+ <section>
+ <title>Improvements and New Features</title>
+ <list type="bulleted">
+ <item>
+ <p>
+ Reduced compile overhead (Thanks to Haitao Li).</p>
+ <p>
+ Own Id: OTP-9460 </p>
+ </item>
+ </list>
+ </section>
+ </section>
+
+ <section>
<title>IC 4.2.26</title>
<section>
diff --git a/lib/ic/src/ic.erl b/lib/ic/src/ic.erl
index 3c6ce3d9d6..e22179fe42 100644
--- a/lib/ic/src/ic.erl
+++ b/lib/ic/src/ic.erl
@@ -320,7 +320,7 @@ pragma(G, File, T) ->
time,
time("pragma registration ", ic_pragma, pragma_reg, [G,T]),
ic_pragma:pragma_reg(G,T)) of
- %% All pragmas were succesfully applied
+ %% All pragmas were successfully applied
{ok,Clean} ->
typing(G, File, Clean);
diff --git a/lib/ic/src/ic_pp.erl b/lib/ic/src/ic_pp.erl
index db06118d32..8b53473caa 100644
--- a/lib/ic/src/ic_pp.erl
+++ b/lib/ic/src/ic_pp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -92,6 +92,14 @@
%%
%%======================================================================================
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+-record(mio, {valid = true, %% multiple include valid
+ cmacro, %% controlling macro of the current conditional directive
+ depth = 0, %% conditional directive depth
+ included = []}).
@@ -130,7 +138,7 @@ run(FileList, FileName, IncDir, Flags) ->
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
- {Out, Err, War, _Defs, IfCou} = expand(File, FileName, IncDir, Flags),
+ {Out, Err, War, _Defs, _Mio, IfCou} = expand(File, FileName, IncDir, Flags),
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -155,9 +163,9 @@ run(FileList, FileName, IncDir, Flags) ->
%% The entry for all included files
%%
%%
-%% Output {Out, Defs, Err, War}
+%% Output {Out, Err, War, Defs, MultipleIncludeValid}
%%======================================================================================
-run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir) ->
+run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir, Mio) ->
%%----------------------------------------------------------
%% Run the first phase, i.e tokenise the file
@@ -169,18 +177,21 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
-
- %% Try first pass without file info start/end
- {OutT, ErrT, WarT, DefsT, IfCouT} =
- expand(File, Defs, Err, War, [FileName|IncFile], IncDir),
-
- {Out2, Err2, War2, Defs2, IfCou2} =
- case only_nls(OutT) of
- true -> %% The file is defined before
- {["\n"], ErrT, WarT, DefsT, IfCouT};
- false -> %% The file is not defined before, try second pass
- expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War, [FileName|IncFile], IncDir)
- end,
+ {Out2, Err2, War2, Defs2, Mio2, IfCou2} =
+ expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War,
+ [FileName|IncFile], IncDir,
+ #mio{included=Mio#mio.included}),
+
+ MergeIncluded = sets:to_list(sets:from_list(Mio#mio.included ++ Mio2#mio.included)),
+
+ Mio3 =
+ case {Mio2#mio.valid, Mio2#mio.cmacro} of
+ {V, Macro} when V == false;
+ Macro == undefined ->
+ update_mio(Mio#mio{included=MergeIncluded});
+ {true, _} ->
+ update_mio({include, FileName}, Mio#mio{included=MergeIncluded})
+ end,
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -192,26 +203,7 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
[]
end,
- {Out2, Defs2, Err2++IfError, War2}.
-
-
-
-%% Return true if there is no data
-%% other than new lines
-only_nls([]) ->
- true;
-only_nls(["\n"|Rem]) ->
- only_nls(Rem);
-only_nls(["\r","\n"|Rem]) ->
- only_nls(Rem);
-only_nls([_|_Rem]) ->
- false.
-
-
-
-
-
-
+ {Out2, Defs2, Err2++IfError, War2, Mio3}.
@@ -647,87 +639,86 @@ expand(List, FileName, IncDir, Flags) ->
%% Get all definitions from preprocessor commnads
%% and merge them on top of the file collected.
CLDefs = get_cmd_line_defs(Flags),
- expand(List, [], [], CLDefs, [FileName], IncDir, check_all, [], [], 1, FileName).
-
-expand(List, Defs, Err, War, [FileName|IncFile], IncDir) ->
- expand(List, [], [], Defs, [FileName|IncFile], IncDir, check_all, Err, War, 1, FileName).
+ expand(List, [], [], CLDefs, [FileName], IncDir, #mio{}, check_all, [], [], 1, FileName).
+expand(List, Defs, Err, War, [FileName|IncFile], IncDir, Mio) ->
+ expand(List, [], [], Defs, [FileName|IncFile], IncDir, Mio, check_all, Err, War, 1, FileName).
%%=======================================================
%% Main loop for the expansion
%%=======================================================
-expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, IfCou, Err, War, _L, _FN) ->
+expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, Mio, IfCou, Err, War, _L, _FN) ->
% io:format("~n ===============~n"),
% io:format(" definitions ~p~n",[lists:reverse(Defs)]),
% io:format(" found warnings ~p~n",[lists:reverse(War)]),
% io:format(" found errors ~p~n",[lists:reverse(Err)]),
% io:format(" ===============~n~n~n"),
- {Out, Err, War, Defs, IfCou};
+ {Out, Err, War, Defs, Mio, IfCou};
-expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
%%---------------------------------------
%% Searching for endif,
%% i.e skip all source lines until matching
%% end if is encountered
%%---------------------------------------
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifdef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifndef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "if" ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{{'if', true}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Rem2, Err2, War2, Nl} -> Not implemented yet
{{'if', error}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN)
end;
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "endif" ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
case Endif of
1 ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L+Nl, FN);
_ ->
IfCou2 = {endif, Endif-1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L+Nl, FN)
end;
-expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
%% Solves a bug when spaces in front of hashmark !
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
@@ -736,121 +727,132 @@ expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine},
%%---------------------------------------
%% Check all tokens
%%---------------------------------------
-expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+1, FN);
+expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L+1, FN);
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN) ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN) ->
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{define, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{undef, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{{include, ok}, FileName, FileCont, Rem2, Nl, Err2, War2} ->
- {Out3, Defs3, Err3, War3} =
- run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir),
+ {Out3, Defs3, Err3, War3, Mio2} =
+ run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir, Mio),
Nls = [],
Out4 = Out3++Nls++Out,
- expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, check_all, Err3, War3, L+Nl, FN);
+ expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, Mio2, check_all, Err3, War3, L+Nl, FN);
{{include, error}, Rem2, Nl, Err2, War2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
+
+ {{include, skip}, Rem2} ->
+ Out2 = [$\n|Out],
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+1, FN);
{{ifdef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
{{ifdef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(ifdef, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{ifndef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
- {{ifndef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
+ {{ifndef, false}, Macro, Rem2, Err2, War2, Nl} ->
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio({ifndef, Macro}, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{endif, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(endif, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{'if', true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Removed, Rem2, Nl} -> Not implemented at present
{{'if', error}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio('if', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{'else', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`else' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('else', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{'elif', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`elif' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('elif', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{warning, {WarningText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
War2 = {FileName, L, "warning: #warning "++detokenise(WarningText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, [War2|War], L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, [War2|War], L+Nl, FN);
{error, {ErrorText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
Err2 = {FileName, L, detokenise(ErrorText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
{{line, ok}, {_Removed, Rem2, Nl}, L2, FN2, LineText} ->
Out2 = lists:duplicate(Nl,$\n)++LineText++Out,
[_X|IF] = IncFile,
IncFile2 = [FN2|IF],
- expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, check_all, Err, War, L2, FN2);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, update_mio(Mio), check_all, Err, War, L2, FN2);
{{line, error}, {_Removed, Rem2, Nl}, Err2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
hash_mark ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN);
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN);
{pragma, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{ident, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{not_recognised, {Removed, Rem2, Nl}} ->
Text = lists:reverse([$#|Command]),
RemovedS = lists:reverse([?space|detokenise(Removed)]),
Out2 = [$\n|RemovedS]++Text++Out,
+ Mio2 = update_mio(Mio),
case Command of
[X|_T] when ?is_upper(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_lower(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_underline(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
_ ->
Err2 = {FN, L, "invalid preprocessing directive name"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN)
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN)
end;
Else ->
@@ -859,19 +861,19 @@ expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all
end;
-expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
LL = io_lib:format("~p",[L]),
- expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, Mio, IncDir, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{Y,M,D},{_H,_Mi,_S}} = calendar:universal_time(),
Date = io_lib:format("\"~s ~p ~p\"",[month(M),D,Y]),
- expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{_Y,_M,_D},{H,Mi,S}} = calendar:universal_time(),
HS = if H < 10 -> "0"++integer_to_list(H);
true -> integer_to_list(H)
@@ -883,40 +885,40 @@ expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err,
true -> integer_to_list(S)
end,
Time = io_lib:format("\"~s:~s:~s\"",[HS,MiS,SS]),
- expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
IL = io_lib:format("~p",[length(IncFile)-1]),
- expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
[BF|_T] = lists:reverse(IncFile),
- expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Out2, Err2, War2, Rem2, SelfRef2} =
source_line(Var, Rem, SelfRef, Defs, Err, War, L, FN),
- expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, IfCou, Err2, War2, L, FN);
+ expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err2, War2, L, FN);
-expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
SelfRef2 = lists:delete(Str,SelfRef),
- expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Str2, Rem2, Nl} = expand_string_part([$"|Str], Rem),
- expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+Nl, FN).
+ expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L+Nl, FN).
@@ -954,13 +956,14 @@ expand_string_part([{string_part, Str_part} | Rem], Str, Nl) ->
get_cmd_line_defs(Flags) ->
Adjusted = parse_cmd_line(Flags,[]),
- {_Out, _Err, _War, Defs, _IfCou} =
+ {_Out, _Err, _War, Defs, _IfCou, _Mio} =
expand(tokenise(Adjusted,""),
[],
[],
[],
[],
[],
+ #mio{},
check_all,
[],
[],
@@ -1030,10 +1033,10 @@ collect_undefine([C|Rest],Found) ->
%%======================================================================================
%%======================================================================================
-pp_command(Command, [space|File], Defs, IncDir, Err, War, L, FN) ->
- pp_command(Command, File, Defs, IncDir, Err, War, L, FN);
+pp_command(Command, [space|File], Defs, IncDir, Mio, Err, War, L, FN) ->
+ pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN);
-pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
+pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN) ->
case Command of
%%----------------------------------------
@@ -1081,14 +1084,16 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
%% #include
%%----------------------------------------
"include" ->
- case include(File, IncDir) of
- {error, Rem, Nl, Err2} ->
- {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
- {error, Rem, Nl, Err2, NameNl} ->
- {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
- {ok, FileName, FileCont, Rem, Nl} ->
- {{include, ok}, FileName, FileCont, Rem, Nl, Err, War}
- end;
+ case include(File, IncDir, Mio) of
+ {error, Rem, Nl, Err2} ->
+ {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
+ {error, Rem, Nl, Err2, NameNl} ->
+ {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
+ {ok, FileNamePath, FileCont, Rem, Nl} ->
+ {{include, ok}, FileNamePath, FileCont, Rem, Nl, Err, War};
+ {skip, Rem} ->
+ {{include, skip}, Rem}
+ end;
%%----------------------------------------
%% #ifdef
@@ -1127,14 +1132,14 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end;
{ok, Rem, Name, No_of_para, _Parameters, _Macro, Err2, War2, Nl} ->
case is_defined_before(Name, No_of_para, Defs) of
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end
end;
@@ -1408,29 +1413,32 @@ undef(_Rem) ->
%%===============================================================
%%===============================================================
-include(File, IncDir) ->
+include(File, IncDir, Mio) ->
case include2(File) of
- {ok, FileName, Rem, Nl, FileType} ->
- %% The error handling is lite strange just to make it compatible to gcc
- case {read_inc_file(FileName, IncDir), Nl, FileType} of
- {{ok, FileList, FileNamePath}, _, _} ->
- {ok, FileNamePath, FileList, Rem, Nl};
- {{error, Text}, _, own_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, Text}, 1, sys_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, _Text}, _, sys_file} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
- end;
-
- {error, {_Removed, Rem, Nl}} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ {ok, FileName, Rem, Nl, FileType} ->
+ Result = read_inc_file(FileName, IncDir, Mio),
+ case {Result, Nl, FileType} of
+ {{ok, FileNamePath, FileCont}, _, _} ->
+ {ok, FileNamePath, FileCont, Rem, Nl};
+ {skip, _, _} ->
+ {skip, Rem};
+ {{error, Text}, _, own_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, Text}, 1, sys_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, _Text}, _, sys_file} ->
+ {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ end;
+ {error, {_Removed, Rem, Nl}} ->
+ {error, Rem, Nl, "`#include' expects \#FILENAME\" or <FILENAME>"}
end.
+
+
count_nl([],Nl) ->
Nl;
count_nl([$\n|T],Nl) ->
@@ -1909,18 +1917,37 @@ include_dir(Flags,IncDir) ->
%% Read a included file. Try current dir first then the IncDir list
%%===============================================================
-read_inc_file(FileName, IncDir) ->
- case catch file:read_file(FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, FileName};
+read_inc_file(FileName, IncDir, Mio) ->
+ case find_inc_file(FileName, IncDir) of
+ {ok, AbsFile} ->
+ %% is included before?
+ case lists:member(FileName, Mio#mio.included) of
+ false ->
+ case catch file:read_file(AbsFile) of
+ {ok, Bin} ->
+ FileList = binary_to_list(Bin),
+ {ok, AbsFile, FileList};
+ {error, Text} ->
+ {error, Text}
+ end;
+ true ->
+ skip
+ end;
+ {error, Text} ->
+ {error, Text}
+ end.
+
+find_inc_file(FileName, IncDir) ->
+ case catch file:read_file_info(FileName) of
+ {ok, _} ->
+ {ok, FileName};
{error, _} ->
- read_inc_file2(FileName, IncDir)
+ find_inc_file2(FileName, IncDir)
end.
-read_inc_file2(_FileName, []) ->
+find_inc_file2(_FileName, []) ->
{error, "No such file or directory"};
-read_inc_file2(FileName, [D|Rem]) ->
+find_inc_file2(FileName, [D|Rem]) ->
Dir = case lists:last(D) of
$/ ->
D;
@@ -1928,17 +1955,14 @@ read_inc_file2(FileName, [D|Rem]) ->
D++"/"
end,
- case catch file:read_file(Dir++FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, Dir++FileName};
+ case catch file:read_file_info(Dir++FileName) of
+ {ok, _} ->
+ {ok, Dir++FileName};
{error, _} ->
- read_inc_file2(FileName, Rem)
+ find_inc_file2(FileName, Rem)
end.
-
-
%%===============================================================
%% Read parameters of a macro or a variable in a source line
%%===============================================================
@@ -2135,5 +2159,73 @@ month(11) -> "Nov";
month(12) -> "Dec".
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+update_mio({include, FileName}, #mio{included=Inc}=Mio) ->
+ Mio#mio{valid=false, included=[FileName|Inc]};
+
+%% valid=false & cmacro=undefined indicates it is already decided this file is
+%% not subject to MIO
+update_mio(_, #mio{valid=false, depth=0, cmacro=undefined}=Mio) ->
+ Mio;
+
+%% if valid=true, there is no non-whitespace tokens before this ifndef
+update_mio({'ifndef', Macro}, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, cmacro=Macro, depth=1};
+
+%% detect any tokens before top level #ifndef
+update_mio(_, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false};
+
+%% If cmacro is alreay set, this is after the top level #endif
+update_mio({'ifndef', _}, #mio{valid=true, depth=0}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+
+%% non-top level conditional, just update depth
+update_mio({'ifndef', _}, #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{depth=D+1};
+update_mio('ifdef', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+update_mio('if', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+
+%% top level #else #elif invalidates multiple include optimization
+update_mio('else', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('else', Mio) ->
+ Mio;
+update_mio('elif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('elif', Mio) ->
+ Mio;
+
+%% AT exit to top level, if the controlling macro is not set, this could be the
+%% end of a non-ifndef conditional block, or there were tokens before entering
+%% the #ifndef block. In either way, this invalidates the MIO
+%%
+%% It doesn't matter if `valid` is true at the time of exiting, it is set to
+%% true. This will be used to detect if more tokens are following the top
+%% level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=true, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 1 ->
+ Mio#mio{valid=true, depth=D-1};
+
+%%if more tokens are following the top level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{valid=true, depth=D-1};
+update_mio(_, Mio) ->
+ Mio#mio{valid=false}.
+
+%% clear `valid`, this doesn't matter since #endif will restore it if
+%% appropriate
+update_mio(Mio) ->
+ Mio#mio{valid=false}.
diff --git a/lib/ic/src/ic_pragma.erl b/lib/ic/src/ic_pragma.erl
index 45cb64c9c8..7f2216b9dc 100644
--- a/lib/ic/src/ic_pragma.erl
+++ b/lib/ic/src/ic_pragma.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1998-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1998-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -1600,9 +1600,8 @@ remove_inheriters(S,RS,InheriterList) ->
[_OneOnly] ->
ReducedInhList;
_Other ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits,'_','_'}),
% CodeOptList =
% [X || X <- EtsList, element(1,X) == codeopt],
NoInheriters =remove_inheriters2(S,ReducedInhList,CleanList),
@@ -1648,9 +1647,8 @@ remove_inh([X],[Y],List,EtsList) ->
%%% from others in the list
%%%----------------------------------------------
remove_inherited(S,InheriterList) ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits, '_', '_'}),
remove_inherited(S,InheriterList,CleanList).
@@ -1694,11 +1692,8 @@ remove_inhed([X],[Y],List,EtsList) ->
%% are inherited from scope in the list
%%%----------------------------------------------
get_inherited(S,Scope,OpScopeList) ->
- EtsList = ets:tab2list(S),
- [[element(3,X)] || X <- EtsList,
- element(1,X) == inherits,
- element(2,X) == Scope,
- member([element(3,X)],OpScopeList)].
+ EtsList1 = ets:match(S, {inherits, Scope, '$1'}),
+ [X || X <- EtsList1, member(X, OpScopeList)].
@@ -1771,9 +1766,7 @@ inherits2(_X,Y,Z,EtsList) ->
%% false otherwise
%%
is_inherited_by(Interface1,Interface2,PragmaTab) ->
- FullList = ets:tab2list(PragmaTab),
- InheritsList =
- [X || X <- FullList, element(1,X) == inherits],
+ InheritsList = ets:match(PragmaTab, {inherits, '_', '_'}),
inherits(Interface2,Interface1,InheritsList).
diff --git a/lib/ic/vsn.mk b/lib/ic/vsn.mk
index 6d6c7fa625..6561ccd2a7 100644
--- a/lib/ic/vsn.mk
+++ b/lib/ic/vsn.mk
@@ -1 +1 @@
-IC_VSN = 4.2.26
+IC_VSN = 4.2.27
diff --git a/lib/inets/Makefile b/lib/inets/Makefile
index ec05efa461..f4c2746b0a 100644
--- a/lib/inets/Makefile
+++ b/lib/inets/Makefile
@@ -36,6 +36,8 @@ SPECIAL_TARGETS =
# ----------------------------------------------------
include $(ERL_TOP)/make/otp_subdir.mk
+.PHONY: info gclean
+
info:
@echo "OS: $(OS)"
@echo "DOCB: $(DOCB)"
@@ -44,3 +46,5 @@ info:
@echo "APP_VSN: $(APP_VSN)"
@echo ""
+gclean:
+ git clean -fXd
diff --git a/lib/inets/doc/src/http_server.xml b/lib/inets/doc/src/http_server.xml
index 599a939913..f29b505bc7 100644
--- a/lib/inets/doc/src/http_server.xml
+++ b/lib/inets/doc/src/http_server.xml
@@ -406,7 +406,7 @@ http://your.server.org/***/Module[:/]Function(?QueryString|/PathInfo)
phase instead of first generating the whole web page and
then sending it to the client. The option to implement a
function with arity two is only kept for
- backwardcompatibilty reasons.
+ backwards compatibility reasons.
See <seealso marker="mod_esi">mod_esi(3)</seealso> for
implementation details of the esi callback function.</p>
</section>
diff --git a/lib/inets/doc/src/httpc.xml b/lib/inets/doc/src/httpc.xml
index f6b6827e93..d1671ac9bd 100644
--- a/lib/inets/doc/src/httpc.xml
+++ b/lib/inets/doc/src/httpc.xml
@@ -144,7 +144,7 @@ filename() = string()
<v>Result = {status_line(), headers(), Body} |
{status_code(), Body} | request_id() </v>
<v>Body = string() | binary()</v>
- <v>Profile = profile()</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
<v>Reason = term() </v>
</type>
<desc>
@@ -194,16 +194,16 @@ filename() = string()
<v>Result = {status_line(), headers(), Body} |
{status_code(), Body} | request_id() </v>
<v>Body = string() | binary()</v>
- <v>Profile = profile() </v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
<v>Reason = {connect_failed, term()} |
{send_failed, term()} | term() </v>
</type>
<desc>
<p>Sends a HTTP-request. The function can be both synchronous
- and asynchronous. In the later case the function will return
- <c>{ok, RequestId}</c> and later on the information will be delivered
- to the <c>receiver</c> depending on that value. </p>
+ and asynchronous. In the later case the function will return
+ <c>{ok, RequestId}</c> and later on the information will be delivered
+ to the <c>receiver</c> depending on that value. </p>
<p>Http option (<c>http_option()</c>) details: </p>
<taglist>
@@ -211,7 +211,7 @@ filename() = string()
<item>
<p>Timeout time for the request. </p>
<p>The clock starts ticking as soon as the request has been
- sent. </p>
+ sent. </p>
<p>Time is in milliseconds. </p>
<p>Defaults to <c>infinity</c>. </p>
</item>
@@ -219,7 +219,7 @@ filename() = string()
<tag><c><![CDATA[connect_timeout]]></c></tag>
<item>
<p>Connection timeout time, used during the initial request,
- when the client is <em>connecting</em> to the server. </p>
+ when the client is <em>connecting</em> to the server. </p>
<p>Time is in milliseconds. </p>
<p>Defaults to the value of the <c>timeout</c> option. </p>
</item>
@@ -227,60 +227,61 @@ filename() = string()
<tag><c><![CDATA[ssl]]></c></tag>
<item>
<p>This is the default ssl config option, currently defaults to
- <c>essl</c>, see below. </p>
+ <c>essl</c>, see below. </p>
<p>Defaults to <c>[]</c>. </p>
</item>
<tag><c><![CDATA[ossl]]></c></tag>
<item>
<p>If using the OpenSSL based (old) implementation of SSL,
- these SSL-specific options are used. </p>
+ these SSL-specific options are used. </p>
<p>Defaults to <c>[]</c>. </p>
</item>
<tag><c><![CDATA[essl]]></c></tag>
<item>
<p>If using the Erlang based (new) implementation of SSL,
- these SSL-specific options are used. </p>
+ these SSL-specific options are used. </p>
<p>Defaults to <c>[]</c>. </p>
</item>
<tag><c><![CDATA[autoredirect]]></c></tag>
<item>
- <p>Should the client automatically retrieve the information
- from the new URI and return that as the result instead
- of a 30X-result code. </p>
- <p>Note that for some 30X-result codes automatic redirect
- is not allowed. In these cases the 30X-result will always
- be returned. </p>
- <p>Defaults to <c>true</c>. </p>
+ <p>Should the client automatically retrieve the information
+ from the new URI and return that as the result instead
+ of a 30X-result code. </p>
+ <p>Note that for some 30X-result codes automatic redirect
+ is not allowed. In these cases the 30X-result will always
+ be returned. </p>
+ <p>Defaults to <c>true</c>. </p>
</item>
<tag><c><![CDATA[proxy_auth]]></c></tag>
<item>
<p>A proxy-authorization header using the provided user name and
- password will be added to the request. </p>
+ password will be added to the request. </p>
</item>
<tag><c><![CDATA[version]]></c></tag>
<item>
<p>Can be used to make the client act as an <c>HTTP/1.0</c> or
- <c>HTTP/0.9</c> client. By default this is an <c>HTTP/1.1</c>
- client. When using <c>HTTP/1.0</c> persistent connections will
- not be used. </p>
- <p>Defaults to the string <c>"HTTP/1.1"</c>. </p>
+ <c>HTTP/0.9</c> client. By default this is an <c>HTTP/1.1</c>
+ client. When using <c>HTTP/1.0</c> persistent connections will
+ not be used. </p>
+ <p>Defaults to the string <c>"HTTP/1.1"</c>. </p>
</item>
<tag><c><![CDATA[relaxed]]></c></tag>
<item>
- <p>If set to <c>true</c> workarounds for known server deviations from
- the HTTP-standard are enabled. </p>
+ <p>If set to <c>true</c> workarounds for known server deviations
+ from the HTTP-standard are enabled. </p>
<p>Defaults to <c>false</c>. </p>
</item>
<tag><c><![CDATA[url_encode]]></c></tag>
<item>
- <p>Will apply Percent-encoding, also known as URL encoding on the URL.</p>
+ <p>Will apply Percent-encoding, also known as URL encoding on the
+ URL.</p>
<p>Defaults to <c>false</c>. </p>
</item>
</taglist>
@@ -296,77 +297,77 @@ filename() = string()
<tag><c><![CDATA[stream]]></c></tag>
<item>
<p>Streams the body of a 200 or 206 response to the calling
- process or to a file. When streaming to the calling process
- using the option <c>self</c> the following stream messages
- will be sent to that process: <c>{http, {RequestId,
- stream_start, Headers}, {http, {RequestId, stream,
- BinBodyPart}, {http, {RequestId, stream_end, Headers}</c>. When
- streaming to to the calling processes using the option
- <c>{self, once}</c> the first message will have an additional
- element e.i. <c>{http, {RequestId, stream_start, Headers, Pid}</c>,
- this is the process id that should be used as an argument to
- <c>http:stream_next/1</c> to trigger the next message to be sent to
- the calling process. </p>
+ process or to a file. When streaming to the calling process
+ using the option <c>self</c> the following stream messages
+ will be sent to that process: <c>{http, {RequestId,
+ stream_start, Headers}, {http, {RequestId, stream,
+ BinBodyPart}, {http, {RequestId, stream_end, Headers}</c>. When
+ streaming to to the calling processes using the option
+ <c>{self, once}</c> the first message will have an additional
+ element e.i. <c>{http, {RequestId, stream_start, Headers, Pid}</c>,
+ this is the process id that should be used as an argument to
+ <c>http:stream_next/1</c> to trigger the next message to be sent to
+ the calling process. </p>
<p>Note that it is possible that chunked encoding will add
- headers so that there are more headers in the <c>stream_end</c>
- message than in the <c>stream_start</c>.
- When streaming to a file and the request is asynchronous the
- message <c>{http, {RequestId, saved_to_file}}</c> will be sent. </p>
+ headers so that there are more headers in the <c>stream_end</c>
+ message than in the <c>stream_start</c>.
+ When streaming to a file and the request is asynchronous the
+ message <c>{http, {RequestId, saved_to_file}}</c> will be sent. </p>
<p>Defaults to <c>none</c>. </p>
</item>
<tag><c><![CDATA[body_format]]></c></tag>
<item>
<p>Defines if the body shall be delivered as a string or as a
- binary. This option is only valid for the synchronous
- request. </p>
+ binary. This option is only valid for the synchronous
+ request. </p>
<p>Defaults to <c>string</c>. </p>
</item>
<tag><c><![CDATA[full_result]]></c></tag>
<item>
<p>Should a "full result" be returned to the caller (that is,
- the body, the headers and the entire status-line) or not
- (the body and the status code). </p>
+ the body, the headers and the entire status-line) or not
+ (the body and the status code). </p>
<p>Defaults to <c>true</c>. </p>
</item>
<tag><c><![CDATA[header_as_is]]></c></tag>
<item>
<p>Shall the headers provided by the user be made
- lower case or be regarded as case sensitive. </p>
+ lower case or be regarded as case sensitive. </p>
<p>Note that the http standard requires them to be
- case insenstive. This feature should only be used if there is
- no other way to communicate with the server or for testing
- purpose. Also note that when this option is used no headers
- will be automatically added, all necessary headers have to be
- provided by the user. </p>
- <p>Defaults to <c>false</c>. </p>
+ case insenstive. This feature should only be used if there is
+ no other way to communicate with the server or for testing
+ purpose. Also note that when this option is used no headers
+ will be automatically added, all necessary headers have to be
+ provided by the user. </p>
+ <p>Defaults to <c>false</c>. </p>
</item>
<tag><c><![CDATA[socket_opts]]></c></tag>
<item>
<p>Socket options to be used for this and subsequent
- request(s). </p>
- <p>Overrides any value set by the
- <seealso marker="#set_options">set_options</seealso>
- function. </p>
+ request(s). </p>
+ <p>Overrides any value set by the
+ <seealso marker="#set_options">set_options</seealso>
+ function. </p>
<p>Note that the validity of the options are <em>not</em>
- checked in any way. </p>
+ checked in any way. </p>
<p>Note that this may change the socket behaviour
- (see <seealso marker="kernel:inet#setopts/2">inet:setopts/2</seealso>)
- for an already existing one, and therefore an already connected
- request handler. </p>
+ (see <seealso marker="kernel:inet#setopts/2">inet:setopts/2</seealso>)
+ for an already existing one, and therefore an already connected
+ request handler. </p>
<p>By default the socket options set by the
- <seealso marker="#set_options">set_options/1,2</seealso>
- function are used when establishing a connection. </p>
+ <seealso marker="#set_options">set_options/1,2</seealso>
+ function are used when establishing a connection. </p>
</item>
<tag><c><![CDATA[receiver]]></c></tag>
<item>
<p>Defines how the client will deliver the result of an
- asynchroneous request (<c>sync</c> has the value
- <c>false</c>). </p>
+ asynchroneous request (<c>sync</c> has the value
+ <c>false</c>). </p>
<taglist>
<tag><c><![CDATA[pid()]]></c></tag>
@@ -380,7 +381,7 @@ filename() = string()
<tag><c><![CDATA[function/1]]></c></tag>
<item>
<p>Information will be delivered to the receiver via calls
- to the provided fun: </p>
+ to the provided fun: </p>
<pre>
Receiver(ReplyInfo)
</pre>
@@ -389,7 +390,7 @@ Receiver(ReplyInfo)
<tag><c><![CDATA[{Module, Funcion, Args}]]></c></tag>
<item>
<p>Information will be delivered to the receiver via calls
- to the callback function: </p>
+ to the callback function: </p>
<pre>
apply(Module, Function, [ReplyInfo | Args])
</pre>
@@ -410,7 +411,7 @@ apply(Module, Function, [ReplyInfo | Args])
</pre>
<p>Defaults to the <c>pid()</c> of the process calling the request
- function (<c>self()</c>). </p>
+ function (<c>self()</c>). </p>
</item>
</taglist>
@@ -425,7 +426,7 @@ apply(Module, Function, [ReplyInfo | Args])
<type>
<v>RequestId = request_id() - A unique identifier as returned
by request/4</v>
- <v>Profile = profile()</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
</type>
<desc>
<p>Cancels an asynchronous HTTP-request. </p>
@@ -514,11 +515,10 @@ apply(Module, Function, [ReplyInfo | Args])
This option is used to switch on (or off)
different levels of erlang trace on the client.
It is a debug feature.</d>
- <v>Profile = profile()</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
</type>
<desc>
- <p>Sets options to be used for subsequent
- requests.</p>
+ <p>Sets options to be used for subsequent requests.</p>
<note>
<p>If possible the client will keep its connections
alive and use persistent connections
@@ -548,7 +548,7 @@ apply(Module, Function, [ReplyInfo | Args])
</type>
<desc>
<p>Triggers the next message to be streamed, e.i.
- same behavior as active once for sockets.</p>
+ same behavior as active once for sockets. </p>
<marker id="verify_cookies"></marker>
<marker id="store_cookies"></marker>
@@ -562,14 +562,14 @@ apply(Module, Function, [ReplyInfo | Args])
<type>
<v>SetCookieHeaders = headers() - where field = "set-cookie"</v>
<v>Url = url()</v>
- <v>Profile = profile()</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
</type>
<desc>
<p>Saves the cookies defined in SetCookieHeaders
- in the client profile's cookie database. You need to
- call this function if you have set the option <c>cookies</c> to <c>verify</c>.
- If no profile is specified the default profile will be used.
- </p>
+ in the client profile's cookie database. You need to
+ call this function if you have set the option <c>cookies</c>
+ to <c>verify</c>.
+ If no profile is specified the default profile will be used. </p>
<marker id="cookie_header"></marker>
</desc>
@@ -582,13 +582,12 @@ apply(Module, Function, [ReplyInfo | Args])
making a request to Url using the profile <c>Profile</c>.</fsummary>
<type>
<v>Url = url()</v>
- <v>Profile = profile()</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
</type>
<desc>
<p>Returns the cookie header that would be sent
- when making a request to <c>Url</c> using the profile <c>Profile</c>.
- If no profile is specified the default profile will be used.
- </p>
+ when making a request to <c>Url</c> using the profile <c>Profile</c>.
+ If no profile is specified the default profile will be used. </p>
<marker id="reset_cookies"></marker>
</desc>
@@ -600,12 +599,12 @@ apply(Module, Function, [ReplyInfo | Args])
<name>reset_cookies(Profile) -> void()</name>
<fsummary>Reset the cookie database.</fsummary>
<type>
- <v>Profile = profile()</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
</type>
<desc>
- <p>Resets (clears) the cookie database for the specified <c>Profile</c>.
- If no profile is specified the default profile will be used.
- </p>
+ <p>Resets (clears) the cookie database for the specified
+ <c>Profile</c>. If no profile is specified the default profile
+ will be used. </p>
</desc>
</func>
@@ -615,17 +614,16 @@ apply(Module, Function, [ReplyInfo | Args])
<name>which_cookies(Profile) -> cookies()</name>
<fsummary>Dumps out the entire cookie database.</fsummary>
<type>
- <v>Profile = profile()</v>
- <v>cookies() = [cooie_stores()]</v>
- <v>cookie_stores() = {cookies, icookies()} | {session_cookies, icookies()}</v>
- <v>icookies() = [icookie()]</v>
+ <v>Profile = profile() | pid() (when started <c>stand_alone</c>)</v>
+ <v>cookies() = [cookie_stores()]</v>
+ <v>cookie_stores() = {cookies, cookies()} | {session_cookies, cookies()}</v>
+ <v>cookies() = [cookie()]</v>
<v>cookie() = term()</v>
</type>
<desc>
<p>This function produces a list of the entire cookie database.
- It is intended for debugging/testing purposes.
- If no profile is specified the default profile will be used.
- </p>
+ It is intended for debugging/testing purposes.
+ If no profile is specified the default profile will be used. </p>
</desc>
</func>
</funcs>
diff --git a/lib/inets/doc/src/mod_auth.xml b/lib/inets/doc/src/mod_auth.xml
index 42c49e9c35..2134ebeeae 100644
--- a/lib/inets/doc/src/mod_auth.xml
+++ b/lib/inets/doc/src/mod_auth.xml
@@ -80,7 +80,7 @@
<marker id="delete_user"></marker>
<p><c>delete_user/2, delete_user/3</c> and <c>delete_user/4</c>
deletes a user
- from the user database. If the operation is succesfull, this
+ from the user database. If the operation is successful, this
function returns <c>true</c>. If an error occurs,
<c>{error,Reason}</c> is returned. When <c>delete_user/2</c> is
called the Port and Dir options are mandatory.</p>
diff --git a/lib/inets/doc/src/mod_esi.xml b/lib/inets/doc/src/mod_esi.xml
index 9674cd9a88..9906ae0895 100644
--- a/lib/inets/doc/src/mod_esi.xml
+++ b/lib/inets/doc/src/mod_esi.xml
@@ -31,8 +31,8 @@
<module>mod_esi</module>
<modulesummary>Erlang Server Interface </modulesummary>
<description>
- <p>This module defines the API - Erlang Server Interface (ESI).
- Which is a more efficient way of writing erlang scripts
+ <p>This module defines the Erlang Server Interface (ESI) API.
+ It is a more efficient way of writing erlang scripts
for your Inets web server than writing them as common CGI scripts.</p>
<marker id="deliver"></marker>
@@ -95,12 +95,12 @@
the server uses when <c>deliver/2</c> is called; do not
assume anything about the datatype.</p>
<p>Use this callback function to dynamically generate dynamic web
- content. when a part of the page is generated send the
+ content. When a part of the page is generated send the
data back to the client through <c>deliver/2</c>. Note
that the first chunk of data sent to the client must at
least contain all HTTP header fields that the response
will generate. If the first chunk does not contain the
- <em>End of HTTP the header</em>, that is <c>"\r\n\r\n",</c>
+ <em>End of HTTP header</em>, that is <c>"\r\n\r\n",</c>
the server will
assume that no HTTP header fields will be generated.</p>
</desc>
@@ -118,8 +118,8 @@
<desc>
<p>This callback format consumes a lot of memory since the
whole response must be generated before it is sent to the
- user. This functions is deprecated and only keept for backwards
- compatibility.
+ user. This function is deprecated and only kept for backwards
+ compatibility.
For new development Module:Function/3 should be used.</p>
</desc>
</func>
diff --git a/lib/inets/doc/src/notes.xml b/lib/inets/doc/src/notes.xml
index 0926df8581..5b5dfdde21 100644
--- a/lib/inets/doc/src/notes.xml
+++ b/lib/inets/doc/src/notes.xml
@@ -32,6 +32,114 @@
<file>notes.xml</file>
</header>
+ <section><title>Inets 5.7.1</title>
+
+ <section><title>Improvements and New Features</title>
+ <p>-</p>
+
+<!--
+ <list>
+ <item>
+ <p>[httpc|httpd] Added support for IPv6 with ssl. </p>
+ <p>Own Id: OTP-5566</p>
+ </item>
+
+ </list>
+-->
+
+ </section>
+
+ <section><title>Fixed Bugs and Malfunctions</title>
+<!--
+ <p>-</p>
+-->
+
+ <list>
+ <item>
+ <p>[httpc] Parsing of a cookie expire date should be more forgiving.
+ That is, if the parsing fails, the date should be ignored.
+ Also added support for (yet another) date format:
+ "Tue Jan 01 08:00:01 2036 GMT". </p>
+ <p>Own Id: OTP-9433</p>
+ </item>
+
+ <item>
+ <p>[httpc] Rewrote cookie parsing. Among other things solving
+ cookie processing from www.expedia.com. </p>
+ <p>Own Id: OTP-9434</p>
+ </item>
+
+ <item>
+ <p>[httpd] Fix httpd directory traversal on Windows.
+ Directory traversal was possible on Windows where
+ backward slash is used as directory separator. </p>
+ <p>Andr�s Veres-Szentkir�lyi.</p>
+ <p>Own Id: OTP-9561</p>
+ </item>
+
+ </list>
+ </section>
+
+ </section> <!-- 5.7.1 -->
+
+
+ <section><title>Inets 5.7</title>
+
+ <section><title>Improvements and New Features</title>
+<!--
+ <p>-</p>
+-->
+
+ <list>
+ <item>
+ <p>[httpc|httpd] Added support for IPv6 with ssl. </p>
+ <p>Own Id: OTP-5566</p>
+ </item>
+
+ </list>
+
+ </section>
+
+ <section><title>Fixed Bugs and Malfunctions</title>
+<!--
+ <p>-</p>
+-->
+
+ <list>
+ <item>
+ <p>[httpc] Remove unnecessary usage of iolist_to_binary when
+ processing body (for PUT and POST). </p>
+ <p>Filipe David Manana</p>
+ <p>Own Id: OTP-9317</p>
+ </item>
+
+ <item>
+ <p>[ftp] FTP client doesn't work with IPv6 host.</p>
+ <p>Attila Rajmund Nohl</p>
+ <p>Own Id: OTP-9342 Aux Id: seq11853</p>
+ </item>
+
+ <item>
+ <p>[httpd] Peer/sockname resolv doesn't work with IPv6 addrs
+ in HTTP. </p>
+ <p>Attila Rajmund Nohl.</p>
+ <p>Own Id: OTP-9343</p>
+ </item>
+
+ <item>
+ <p>[httpc] Clients started stand-alone not properly handled.
+ Also it was not documented how to use them, that is that
+ once started, they are represented by a <c>pid()</c> and not by
+ their <c>profile()</c>. </p>
+ <p>Own Id: OTP-9365</p>
+ </item>
+
+ </list>
+ </section>
+
+ </section> <!-- 5.7 -->
+
+
<section><title>Inets 5.6</title>
<section><title>Improvements and New Features</title>
diff --git a/lib/inets/doc/src/notes_history.xml b/lib/inets/doc/src/notes_history.xml
index 6480bad758..f70ce5cf46 100644
--- a/lib/inets/doc/src/notes_history.xml
+++ b/lib/inets/doc/src/notes_history.xml
@@ -123,7 +123,7 @@
re-receive of acknowledgments. If multiple copies of the
same acknowledgments is received the spurious ones are
silently ignored. This fix was intended for inets-4.7.14
- but accidentaly it was not included in that release.</p>
+ but accidentally it was not included in that release.</p>
<p>Own Id: OTP-6706 Aux Id: OTP-6691 </p>
</item>
</list>
diff --git a/lib/inets/src/ftp/ftp.erl b/lib/inets/src/ftp/ftp.erl
index fe6cb0c191..ac72963347 100644
--- a/lib/inets/src/ftp/ftp.erl
+++ b/lib/inets/src/ftp/ftp.erl
@@ -1038,10 +1038,12 @@ handle_call({_, {open, ip_comm, Opts}}, From, State) ->
Port = key_search(port, Opts, ?FTP_PORT),
Timeout = key_search(timeout, Opts, ?CONNECTION_TIMEOUT),
Progress = key_search(progress, Opts, ignore),
+ IpFamily = key_search(ipfamily, Opts, inet),
State2 = State#state{client = From,
mode = Mode,
- progress = progress(Progress)},
+ progress = progress(Progress),
+ ipfamily = IpFamily},
?fcrd("handle_call(open) -> setup ctrl connection with",
[{host, Host}, {port, Port}, {timeout, Timeout}]),
diff --git a/lib/inets/src/http_client/httpc.erl b/lib/inets/src/http_client/httpc.erl
index 6ffa5e8ba5..fe8e93af1f 100644
--- a/lib/inets/src/http_client/httpc.erl
+++ b/lib/inets/src/http_client/httpc.erl
@@ -64,17 +64,16 @@ default_profile() ->
profile_name(?DEFAULT_PROFILE) ->
httpc_manager;
+profile_name(Profile) when is_pid(Profile) ->
+ Profile;
profile_name(Profile) ->
- profile_name("httpc_manager_", Profile).
+ Prefix = lists:flatten(io_lib:format("~w_", [?MODULE])),
+ profile_name(Prefix, Profile).
profile_name(Prefix, Profile) when is_atom(Profile) ->
list_to_atom(Prefix ++ atom_to_list(Profile));
-profile_name(Prefix, Profile) when is_pid(Profile) ->
- ProfileStr0 =
- string:strip(string:strip(erlang:pid_to_list(Profile), left, $<), right, $>),
- F = fun($.) -> $_; (X) -> X end,
- ProfileStr = [F(C) || C <- ProfileStr0],
- list_to_atom(Prefix ++ "pid_" ++ ProfileStr).
+profile_name(_Prefix, Profile) when is_pid(Profile) ->
+ Profile.
%%--------------------------------------------------------------------------
@@ -115,9 +114,11 @@ request(Url, Profile) ->
%% {keyfile, path()} | {password, string()} | {cacertfile, path()} |
%% {ciphers, string()}
%% Options - [Option]
-%% Option - {sync, Boolean} | {body_format, BodyFormat} |
-%% {full_result, Boolean} | {stream, To} |
-%% {headers_as_is, Boolean}
+%% Option - {sync, Boolean} |
+%% {body_format, BodyFormat} |
+%% {full_result, Boolean} |
+%% {stream, To} |
+%% {headers_as_is, Boolean}
%% StatusLine = {HTTPVersion, StatusCode, ReasonPhrase}</v>
%% HTTPVersion = string()
%% StatusCode = integer()
@@ -518,17 +519,15 @@ mk_chunkify_fun(ProcessBody) ->
eof ->
{ok, <<"0\r\n\r\n">>, eof_body};
{ok, Data, NewAcc} ->
- {ok, mk_chunk_bin(Data), NewAcc}
+ Chunk = [
+ integer_to_list(iolist_size(Data), 16),
+ "\r\n",
+ Data,
+ "\r\n"],
+ {ok, Chunk, NewAcc}
end
end.
-mk_chunk_bin(Data) ->
- Bin = iolist_to_binary(Data),
- iolist_to_binary([hex_size(Bin), "\r\n", Bin, "\r\n"]).
-
-hex_size(Bin) ->
- hd(io_lib:format("~.16B", [size(Bin)])).
-
handle_answer(RequestId, false, _) ->
{ok, RequestId};
@@ -552,9 +551,7 @@ return_answer(Options, {{"HTTP/0.9",_,_}, _, BinBody}) ->
{ok, Body};
return_answer(Options, {StatusLine, Headers, BinBody}) ->
-
Body = maybe_format_body(BinBody, Options),
-
case proplists:get_value(full_result, Options, true) of
true ->
{ok, {StatusLine, Headers, Body}};
diff --git a/lib/inets/src/http_client/httpc_cookie.erl b/lib/inets/src/http_client/httpc_cookie.erl
index 4d61f82b5a..1addbe944d 100644
--- a/lib/inets/src/http_client/httpc_cookie.erl
+++ b/lib/inets/src/http_client/httpc_cookie.erl
@@ -18,12 +18,32 @@
%%
%% Description: Cookie handling according to RFC 2109
+%% The syntax for the Set-Cookie response header is
+%%
+%% set-cookie = "Set-Cookie:" cookies
+%% cookies = 1#cookie
+%% cookie = NAME "=" VALUE *(";" cookie-av)
+%% NAME = attr
+%% VALUE = value
+%% cookie-av = "Comment" "=" value
+%% | "Domain" "=" value
+%% | "Max-Age" "=" value
+%% | "Path" "=" value
+%% | "Secure"
+%% | "Version" "=" 1*DIGIT
+
+
+%% application:start(inets).
+%% httpc:set_options([{cookies, enabled}, {proxy, {{"www-proxy.ericsson.se",8080}, ["*.ericsson.se"]}}]).
+%% (catch httpc:request("http://www.expedia.com")).
+
-module(httpc_cookie).
-include("httpc_internal.hrl").
-export([open_db/3, close_db/1, insert/2, header/4, cookies/3]).
-export([reset_db/1, which_cookies/1]).
+-export([image_of/2, print/2]).
-record(cookie_db, {db, session_db}).
@@ -125,7 +145,7 @@ insert(#cookie_db{db = Db} = CookieDb,
name = Name,
path = Path,
max_age = 0}) ->
- ?hcrt("insert", [{domain, Key}, {name, Name}, {path, Path}]),
+ ?hcrt("insert cookie", [{domain, Key}, {name, Name}, {path, Path}]),
Pattern = #http_cookie{domain = Key, name = Name, path = Path, _ = '_'},
case dets:match_object(Db, Pattern) of
[] ->
@@ -136,7 +156,7 @@ insert(#cookie_db{db = Db} = CookieDb,
ok;
insert(#cookie_db{db = Db} = CookieDb,
#http_cookie{domain = Key, name = Name, path = Path} = Cookie) ->
- ?hcrt("insert", [{cookie, Cookie}]),
+ ?hcrt("insert cookie", [{cookie, Cookie}]),
Pattern = #http_cookie{domain = Key,
name = Name,
path = Path,
@@ -163,6 +183,7 @@ header(CookieDb, Scheme, {Host, _}, Path) ->
[] ->
{"cookie", ""};
Cookies ->
+ %% print_cookies("Header Cookies", Cookies),
{"cookie", cookies_to_string(Scheme, Cookies)}
end.
@@ -173,11 +194,20 @@ header(CookieDb, Scheme, {Host, _}, Path) ->
%%--------------------------------------------------------------------
cookies(Headers, RequestPath, RequestHost) ->
+
?hcrt("cookies", [{headers, Headers},
{request_path, RequestPath},
{request_host, RequestHost}]),
+
Cookies = parse_set_cookies(Headers, {RequestPath, RequestHost}),
- accept_cookies(Cookies, RequestPath, RequestHost).
+
+ %% print_cookies("Parsed Cookies", Cookies),
+
+ AcceptedCookies = accept_cookies(Cookies, RequestPath, RequestHost),
+
+ %% print_cookies("Accepted Cookies", AcceptedCookies),
+
+ AcceptedCookies.
%%--------------------------------------------------------------------
@@ -266,7 +296,8 @@ cookies_to_string(_, [], CookieStrs) ->
lists:flatten(lists:reverse(CookieStrs))
end;
-cookies_to_string(https, [#http_cookie{secure = true} = Cookie| Cookies],
+cookies_to_string(https = Scheme,
+ [#http_cookie{secure = true} = Cookie| Cookies],
CookieStrs) ->
Str = case Cookies of
[] ->
@@ -274,7 +305,7 @@ cookies_to_string(https, [#http_cookie{secure = true} = Cookie| Cookies],
_ ->
cookie_to_string(Cookie) ++ "; "
end,
- cookies_to_string(https, Cookies, [Str | CookieStrs]);
+ cookies_to_string(Scheme, Cookies, [Str | CookieStrs]);
cookies_to_string(Scheme, [#http_cookie{secure = true}| Cookies],
CookieStrs) ->
@@ -303,63 +334,54 @@ add_domain(Str, #http_cookie{domain_default = true}) ->
add_domain(Str, #http_cookie{domain = Domain}) ->
Str ++ "; $Domain=" ++ Domain.
-parse_set_cookies(OtherHeaders, DefaultPathDomain) ->
- SetCookieHeaders =
- lists:foldl(fun({"set-cookie", Value}, Acc) ->
- [string:tokens(Value, ",")| Acc];
- (_, Acc) ->
- Acc
- end, [], OtherHeaders),
-
- lists:flatten(
- lists:map(fun(CookieHeader) ->
- NewHeader = fix_netscape_cookie(CookieHeader, []),
- parse_set_cookie(NewHeader, [], DefaultPathDomain)
- end,
- SetCookieHeaders)).
-
-parse_set_cookie([], AccCookies, _) ->
- AccCookies;
-parse_set_cookie([CookieHeader | CookieHeaders], AccCookies,
- Defaults = {DefaultPath, DefaultDomain}) ->
- [CookieStr | Attributes] = case string:tokens(CookieHeader, ";") of
- [CStr] ->
- [CStr, ""];
- [CStr | Attr] ->
- [CStr, Attr]
- end,
- Pos = string:chr(CookieStr, $=),
- Name = string:substr(CookieStr, 1, Pos - 1),
- Value = string:substr(CookieStr, Pos + 1),
- Cookie = #http_cookie{name = string:strip(Name),
- value = string:strip(Value)},
- NewAttributes = parse_set_cookie_attributes(Attributes),
- TmpCookie = cookie_attributes(NewAttributes, Cookie),
+parse_set_cookies(CookieHeaders, DefaultPathDomain) ->
+ SetCookieHeaders = [Value || {"set-cookie", Value} <- CookieHeaders],
+ Cookies = [parse_set_cookie(SetCookieHeader, DefaultPathDomain) ||
+ SetCookieHeader <- SetCookieHeaders],
+ %% print_cookies("Parsed Cookies", Cookies),
+ Cookies.
+
+parse_set_cookie(CookieHeader, {DefaultPath, DefaultDomain}) ->
+ %% io:format("Raw Cookie: ~s~n", [CookieHeader]),
+ Pos = string:chr(CookieHeader, $=),
+ Name = string:substr(CookieHeader, 1, Pos - 1),
+ {Value, Attrs} =
+ case string:substr(CookieHeader, Pos + 1) of
+ [$;|ValueAndAttrs] ->
+ {"", string:tokens(ValueAndAttrs, ";")};
+ ValueAndAttrs ->
+ [V | A] = string:tokens(ValueAndAttrs, ";"),
+ {V, A}
+ end,
+ Cookie = #http_cookie{name = string:strip(Name),
+ value = string:strip(Value)},
+ Attributes = parse_set_cookie_attributes(Attrs),
+ TmpCookie = cookie_attributes(Attributes, Cookie),
%% Add runtime defult values if necessary
- NewCookie = domain_default(path_default(TmpCookie, DefaultPath),
- DefaultDomain),
- parse_set_cookie(CookieHeaders, [NewCookie | AccCookies], Defaults).
-
-parse_set_cookie_attributes([]) ->
- [];
-parse_set_cookie_attributes([Attributes]) ->
- lists:map(fun(Attr) ->
- [AttrName, AttrValue] =
- case string:tokens(Attr, "=") of
- %% All attributes have the form
- %% Name=Value except "secure"!
- [Name] ->
- [Name, ""];
- [Name, Value] ->
- [Name, Value];
- %% Anything not expected will be
- %% disregarded
- _ ->
- ["Dummy",""]
- end,
- {http_util:to_lower(string:strip(AttrName)),
- string:strip(AttrValue)}
- end, Attributes).
+ NewCookie = domain_default(path_default(TmpCookie, DefaultPath),
+ DefaultDomain),
+ NewCookie.
+
+parse_set_cookie_attributes(Attributes) when is_list(Attributes) ->
+ [parse_set_cookie_attribute(A) || A <- Attributes].
+
+parse_set_cookie_attribute(Attribute) ->
+ {AName, AValue} =
+ case string:tokens(Attribute, "=") of
+ %% All attributes have the form
+ %% Name=Value except "secure"!
+ [Name] ->
+ {Name, ""};
+ [Name, Value] ->
+ {Name, Value};
+ %% Anything not expected will be
+ %% disregarded
+ _ ->
+ {"Dummy", ""}
+ end,
+ StrippedName = http_util:to_lower(string:strip(AName)),
+ StrippedValue = string:strip(AValue),
+ {StrippedName, StrippedValue}.
cookie_attributes([], Cookie) ->
Cookie;
@@ -375,10 +397,15 @@ cookie_attributes([{"max-age", Value}| Attributes], Cookie) ->
Cookie#http_cookie{max_age = ExpireTime});
%% Backwards compatibility with netscape cookies
cookie_attributes([{"expires", Value}| Attributes], Cookie) ->
- Time = http_util:convert_netscapecookie_date(Value),
- ExpireTime = calendar:datetime_to_gregorian_seconds(Time),
- cookie_attributes(Attributes,
- Cookie#http_cookie{max_age = ExpireTime});
+ try http_util:convert_netscapecookie_date(Value) of
+ Time ->
+ ExpireTime = calendar:datetime_to_gregorian_seconds(Time),
+ cookie_attributes(Attributes,
+ Cookie#http_cookie{max_age = ExpireTime})
+ catch
+ _:_ ->
+ cookie_attributes(Attributes, Cookie)
+ end;
cookie_attributes([{"path", Value}| Attributes], Cookie) ->
cookie_attributes(Attributes,
Cookie#http_cookie{path = Value});
@@ -404,7 +431,7 @@ path_default(#http_cookie{path = undefined} = Cookie, DefaultPath) ->
path_default(Cookie, _) ->
Cookie.
-%% Note: if the path is only / that / will be keept
+%% Note: if the path is only / that / will be kept
skip_right_most_slash("/") ->
"/";
skip_right_most_slash(Str) ->
@@ -476,20 +503,43 @@ path_sort(Cookies)->
lists:reverse(lists:keysort(#http_cookie.path, Cookies)).
-%% Informally, the Set-Cookie response header comprises the token
-%% Set-Cookie:, followed by a comma-separated list of one or more
-%% cookies. Netscape cookies expires attribute may also have a,
-%% in this case the header list will have been incorrectly split
-%% in parse_set_cookies/2 this functions fix that problem.
-fix_netscape_cookie([Cookie1, Cookie2 | Rest], Acc) ->
- case inets_regexp:match(string:to_lower(Cookie1), "expires=") of
- {_, _, _} ->
- fix_netscape_cookie(Rest, [Cookie1 ++ Cookie2 | Acc]);
- nomatch ->
- fix_netscape_cookie([Cookie2 |Rest], [Cookie1| Acc])
- end;
-fix_netscape_cookie([Cookie | Rest], Acc) ->
- fix_netscape_cookie(Rest, [Cookie | Acc]);
-
-fix_netscape_cookie([], Acc) ->
- Acc.
+%% print_cookies(Header, Cookies) ->
+%% io:format("~s:~n", [Header]),
+%% Prefix = " ",
+%% lists:foreach(fun(Cookie) -> print(Prefix, Cookie) end, Cookies).
+
+image_of(Prefix,
+ #http_cookie{domain = Domain,
+ domain_default = DomainDef,
+ name = Name,
+ value = Value,
+ comment = Comment,
+ max_age = MaxAge,
+ path = Path,
+ path_default = PathDef,
+ secure = Sec,
+ version = Version}) ->
+ lists:flatten(
+ io_lib:format("~sCookie ~s: "
+ "~n~s Value: ~p"
+ "~n~s Domain: ~p"
+ "~n~s DomainDef: ~p"
+ "~n~s Comment: ~p"
+ "~n~s MaxAge: ~p"
+ "~n~s Path: ~p"
+ "~n~s PathDef: ~p"
+ "~n~s Secure: ~p"
+ "~n~s Version: ~p",
+ [Prefix, Name,
+ Prefix, Value,
+ Prefix, Domain,
+ Prefix, DomainDef,
+ Prefix, Comment,
+ Prefix, MaxAge,
+ Prefix, Path,
+ Prefix, PathDef,
+ Prefix, Sec,
+ Prefix, Version])).
+
+print(Prefix, Cookie) when is_record(Cookie, http_cookie) ->
+ io:format("~s~n", [image_of(Prefix, Cookie)]).
diff --git a/lib/inets/src/http_client/httpc_handler.erl b/lib/inets/src/http_client/httpc_handler.erl
index 1f0e012e7e..587e24cc8d 100644
--- a/lib/inets/src/http_client/httpc_handler.erl
+++ b/lib/inets/src/http_client/httpc_handler.erl
@@ -515,7 +515,7 @@ handle_info({Proto, _Socket, Data},
{stop, normal, NewState}
end,
- ?hcri("data processed", []),
+ ?hcri("data processed", [{final_result, FinalResult}]),
FinalResult;
@@ -629,8 +629,9 @@ handle_info(timeout_queue, #state{timers = Timers} = State) ->
Timers#timers{queue_timer = undefined}}};
%% Setting up the connection to the server somehow failed.
-handle_info({init_error, _, ClientErrMsg},
+handle_info({init_error, Tag, ClientErrMsg},
State = #state{request = Request}) ->
+ ?hcrv("init error", [{tag, Tag}, {client_error, ClientErrMsg}]),
NewState = answer_request(Request, ClientErrMsg, State),
{stop, normal, NewState};
@@ -707,9 +708,9 @@ terminate(normal,
%% And, just in case, close our side (**really** overkill)
http_transport:close(SocketType, Socket);
-terminate(Reason, #state{session = #session{id = Id,
- socket = Socket,
- socket_type = SocketType},
+terminate(Reason, #state{session = #session{id = Id,
+ socket = Socket,
+ socket_type = SocketType},
request = undefined,
profile_name = ProfileName,
timers = Timers,
@@ -1156,7 +1157,7 @@ handle_cookies(Headers, Request, #options{cookies = enabled}, ProfileName) ->
httpc_manager:store_cookies(Cookies, Request#request.address,
ProfileName).
-%% This request could not be pipelined or used as sequential keept alive
+%% This request could not be pipelined or used as sequential keep alive
%% queue
handle_queue(#state{status = close} = State, _) ->
{stop, normal, State};
@@ -1403,7 +1404,7 @@ try_to_enable_pipeline_or_keep_alive(
answer_request(#request{id = RequestId, from = From} = Request, Msg,
#state{timers = Timers, profile_name = ProfileName} = State) ->
- ?hcrt("answer request", [{request, Request}]),
+ ?hcrt("answer request", [{request, Request}, {msg, Msg}]),
httpc_response:send(From, Msg),
RequestTimers = Timers#timers.request_timers,
TimerRef =
diff --git a/lib/inets/src/http_client/httpc_manager.erl b/lib/inets/src/http_client/httpc_manager.erl
index 7f66b477eb..9015bf1ce2 100644
--- a/lib/inets/src/http_client/httpc_manager.erl
+++ b/lib/inets/src/http_client/httpc_manager.erl
@@ -52,7 +52,7 @@
cancel = [], % [{RequestId, HandlerPid, ClientPid}]
handler_db, % ets() - Entry: #handler_info{}
cookie_db, % cookie_db()
- session_db, % ets() - Entry: #tcp_session{}
+ session_db, % ets() - Entry: #session{}
profile_name, % atom()
options = #options{}
}).
@@ -178,7 +178,7 @@ request_done(RequestId, ProfileName) ->
%%--------------------------------------------------------------------
%% Function: insert_session(Session, ProfileName) -> _
-%% Session - #tcp_session{}
+%% Session - #session{}
%% ProfileName - atom()
%%
%% Description: Inserts session information into the httpc manager
@@ -669,7 +669,7 @@ select_session(Method, HostPort, Scheme, SessionType,
(SessionType =:= keep_alive) of
true ->
%% Look for handlers connecting to this host (HostPort)
- %% tcp_session with record name field (tcp_session) and
+ %% session with record name field (session) and
%% socket fields ignored. The fields id (part of: HostPort),
%% client_close, scheme and type specified.
%% The fields id (part of: HandlerPid) and queue_length
diff --git a/lib/inets/src/http_lib/http_transport.erl b/lib/inets/src/http_lib/http_transport.erl
index 01b51d531a..9b8190ebed 100644
--- a/lib/inets/src/http_lib/http_transport.erl
+++ b/lib/inets/src/http_lib/http_transport.erl
@@ -33,8 +33,8 @@
peername/2, sockname/2,
resolve/0
]).
-
-export([negotiate/3]).
+-export([ipv4_name/1, ipv6_name/1]).
-include_lib("inets/src/inets_app/inets_internal.hrl").
-include("http_internal.hrl").
@@ -142,8 +142,8 @@ connect({ossl, SslConfig}, {Host, Port}, _, Timeout) ->
ERROR
end;
-connect({essl, SslConfig}, {Host, Port}, _, Timeout) ->
- Opts = [binary, {active, false}, {ssl_imp, new}] ++ SslConfig,
+connect({essl, SslConfig}, {Host, Port}, Opts0, Timeout) ->
+ Opts = [binary, {active, false}, {ssl_imp, new} | Opts0] ++ SslConfig,
?hlrt("connect using essl",
[{host, Host},
{port, Port},
@@ -176,8 +176,8 @@ connect({essl, SslConfig}, {Host, Port}, _, Timeout) ->
listen(SocketType, Port) ->
listen(SocketType, undefined, Port).
-listen(ip_comm = SocketType, Addr, Port) ->
- listen(SocketType, Addr, Port, undefined);
+listen(ip_comm = _SocketType, Addr, Port) ->
+ listen_ip_comm(Addr, Port, undefined);
%% Wrapper for backaward compatibillity
listen({ssl, SSLConfig}, Addr, Port) ->
@@ -187,35 +187,33 @@ listen({ssl, SSLConfig}, Addr, Port) ->
{ssl_config, SSLConfig}]),
listen({?HTTP_DEFAULT_SSL_KIND, SSLConfig}, Addr, Port);
-listen({ossl, SSLConfig} = Ssl, Addr, Port) ->
+listen({ossl, SSLConfig}, Addr, Port) ->
?hlrt("listen (ossl)",
[{addr, Addr},
{port, Port},
{ssl_config, SSLConfig}]),
- Opt = sock_opt(Ssl, Addr, SSLConfig),
- ?hlrt("listen options", [{opt, Opt}]),
- ssl:listen(Port, [{ssl_imp, old} | Opt]);
+ listen_ssl(Addr, Port, [{ssl_imp, old} | SSLConfig]);
-listen({essl, SSLConfig} = Ssl, Addr, Port) ->
+listen({essl, SSLConfig}, Addr, Port) ->
?hlrt("listen (essl)",
[{addr, Addr},
{port, Port},
{ssl_config, SSLConfig}]),
- Opt = sock_opt(Ssl, Addr, SSLConfig),
- ?hlrt("listen options", [{opt, Opt}]),
- Opt2 = [{ssl_imp, new}, {reuseaddr, true} | Opt],
- ssl:listen(Port, Opt2).
+ listen_ssl(Addr, Port, [{ssl_imp, new}, {reuseaddr, true} | SSLConfig]).
+
listen(ip_comm, Addr, Port, Fd) ->
- case (catch listen_ip_comm(Addr, Port, Fd)) of
+ listen_ip_comm(Addr, Port, Fd).
+
+listen_ip_comm(Addr, Port, Fd) ->
+ case (catch do_listen_ip_comm(Addr, Port, Fd)) of
{'EXIT', Reason} ->
{error, {exit, Reason}};
Else ->
Else
end.
-
-listen_ip_comm(Addr, Port, Fd) ->
+do_listen_ip_comm(Addr, Port, Fd) ->
{NewPort, Opts, IpFamily} = get_socket_info(Addr, Port, Fd),
case IpFamily of
inet6fb4 ->
@@ -248,6 +246,41 @@ listen_ip_comm(Addr, Port, Fd) ->
gen_tcp:listen(NewPort, Opts2)
end.
+
+listen_ssl(Addr, Port, Opts0) ->
+ IpFamily = ipfamily_default(Addr, Port),
+ BaseOpts = [{backlog, 128}, {reuseaddr, true} | Opts0],
+ Opts = sock_opts(Addr, BaseOpts),
+ case IpFamily of
+ inet6fb4 ->
+ Opts2 = [inet6 | Opts],
+ ?hlrt("try ipv6 listen", [{opts, Opts2}]),
+ case (catch ssl:listen(Port, Opts2)) of
+ {error, Reason} when ((Reason =:= nxdomain) orelse
+ (Reason =:= eafnosupport)) ->
+ Opts3 = [inet | Opts],
+ ?hlrt("ipv6 listen failed - try ipv4 instead",
+ [{reason, Reason}, {opts, Opts3}]),
+ ssl:listen(Port, Opts3);
+
+ {'EXIT', Reason} ->
+ Opts3 = [inet | Opts],
+ ?hlrt("ipv6 listen exit - try ipv4 instead",
+ [{reason, Reason}, {opts, Opts3}]),
+ ssl:listen(Port, Opts3);
+
+ Other ->
+ ?hlrt("ipv6 listen done", [{other, Other}]),
+ Other
+ end;
+
+ _ ->
+ Opts2 = [IpFamily | Opts],
+ ?hlrt("listen", [{opts, Opts2}]),
+ ssl:listen(Port, Opts2)
+ end.
+
+
ipfamily_default(Addr, Port) ->
httpd_conf:lookup(Addr, Port, ipfamily, inet6fb4).
@@ -257,9 +290,9 @@ get_socket_info(Addr, Port, Fd0) ->
%% The presence of a file descriptor takes precedence
case get_fd(Port, Fd0, IpFamilyDefault) of
{Fd, IpFamily} ->
- {0, sock_opt(ip_comm, Addr, [{fd, Fd} | BaseOpts]), IpFamily};
+ {0, sock_opts(Addr, [{fd, Fd} | BaseOpts]), IpFamily};
undefined ->
- {Port, sock_opt(ip_comm, Addr, BaseOpts), IpFamilyDefault}
+ {Port, sock_opts(Addr, BaseOpts), IpFamilyDefault}
end.
get_fd(Port, undefined = _Fd, IpFamilyDefault) ->
@@ -499,44 +532,28 @@ close({essl, _}, Socket) ->
%% connection, usning either gen_tcp or ssl.
%%-------------------------------------------------------------------------
peername(ip_comm, Socket) ->
- case inet:peername(Socket) of
- {ok,{{A, B, C, D}, Port}} ->
- PeerName = integer_to_list(A)++"."++integer_to_list(B)++"."++
- integer_to_list(C)++"."++integer_to_list(D),
- {Port, PeerName};
- {ok,{{A, B, C, D, E, F, G, H}, Port}} ->
- PeerName = http_util:integer_to_hexlist(A) ++ ":"++
- http_util:integer_to_hexlist(B) ++ ":" ++
- http_util:integer_to_hexlist(C) ++ ":" ++
- http_util:integer_to_hexlist(D) ++ ":" ++
- http_util:integer_to_hexlist(E) ++ ":" ++
- http_util:integer_to_hexlist(F) ++ ":" ++
- http_util:integer_to_hexlist(G) ++":"++
- http_util:integer_to_hexlist(H),
- {Port, PeerName};
- {error, _} ->
- {-1, "unknown"}
- end;
+ do_peername(inet:peername(Socket));
%% Wrapper for backaward compatibillity
peername({ssl, SSLConfig}, Socket) ->
peername({?HTTP_DEFAULT_SSL_KIND, SSLConfig}, Socket);
peername({ossl, _}, Socket) ->
- peername_ssl(Socket);
+ do_peername(ssl:peername(Socket));
peername({essl, _}, Socket) ->
- peername_ssl(Socket).
-
-peername_ssl(Socket) ->
- case ssl:peername(Socket) of
- {ok,{{A, B, C, D}, Port}} ->
- PeerName = integer_to_list(A)++"."++integer_to_list(B)++"."++
- integer_to_list(C)++"."++integer_to_list(D),
- {Port, PeerName};
- {error, _} ->
- {-1, "unknown"}
- end.
+ do_peername(ssl:peername(Socket)).
+
+do_peername({ok, {Addr, Port}})
+ when is_tuple(Addr) andalso (size(Addr) =:= 4) ->
+ PeerName = ipv4_name(Addr),
+ {Port, PeerName};
+do_peername({ok, {Addr, Port}})
+ when is_tuple(Addr) andalso (size(Addr) =:= 8) ->
+ PeerName = ipv6_name(Addr),
+ {Port, PeerName};
+do_peername({error, _}) ->
+ {-1, "unknown"}.
%%-------------------------------------------------------------------------
@@ -550,44 +567,28 @@ peername_ssl(Socket) ->
%% other end of connection, using either gen_tcp or ssl.
%%-------------------------------------------------------------------------
sockname(ip_comm, Socket) ->
- case inet:sockname(Socket) of
- {ok,{{A, B, C, D}, Port}} ->
- SockName = integer_to_list(A)++"."++integer_to_list(B)++"."++
- integer_to_list(C)++"."++integer_to_list(D),
- {Port, SockName};
- {ok,{{A, B, C, D, E, F, G, H}, Port}} ->
- SockName = http_util:integer_to_hexlist(A) ++ ":"++
- http_util:integer_to_hexlist(B) ++ ":" ++
- http_util:integer_to_hexlist(C) ++ ":" ++
- http_util:integer_to_hexlist(D) ++ ":" ++
- http_util:integer_to_hexlist(E) ++ ":" ++
- http_util:integer_to_hexlist(F) ++ ":" ++
- http_util:integer_to_hexlist(G) ++":"++
- http_util:integer_to_hexlist(H),
- {Port, SockName};
- {error, _} ->
- {-1, "unknown"}
- end;
+ do_sockname(inet:sockname(Socket));
%% Wrapper for backaward compatibillity
sockname({ssl, SSLConfig}, Socket) ->
sockname({?HTTP_DEFAULT_SSL_KIND, SSLConfig}, Socket);
sockname({ossl, _}, Socket) ->
- sockname_ssl(Socket);
+ do_sockname(ssl:sockname(Socket));
sockname({essl, _}, Socket) ->
- sockname_ssl(Socket).
-
-sockname_ssl(Socket) ->
- case ssl:sockname(Socket) of
- {ok,{{A, B, C, D}, Port}} ->
- SockName = integer_to_list(A)++"."++integer_to_list(B)++"."++
- integer_to_list(C)++"."++integer_to_list(D),
- {Port, SockName};
- {error, _} ->
- {-1, "unknown"}
- end.
+ do_sockname(ssl:sockname(Socket)).
+
+do_sockname({ok, {Addr, Port}})
+ when is_tuple(Addr) andalso (size(Addr) =:= 4) ->
+ SockName = ipv4_name(Addr),
+ {Port, SockName};
+do_sockname({ok, {Addr, Port}})
+ when is_tuple(Addr) andalso (size(Addr) =:= 8) ->
+ SockName = ipv6_name(Addr),
+ {Port, SockName};
+do_sockname({error, _}) ->
+ {-1, "unknown"}.
%%-------------------------------------------------------------------------
@@ -601,29 +602,49 @@ resolve() ->
Name.
+%%-------------------------------------------------------------------------
+%% ipv4_name(Ipv4Addr) -> string()
+%% ipv6_name(Ipv6Addr) -> string()
+%% Ipv4Addr = ip4_address()
+%% Ipv6Addr = ip6_address()
+%%
+%% Description: Returns the local hostname.
+%%-------------------------------------------------------------------------
+ipv4_name({A, B, C, D}) ->
+ integer_to_list(A) ++ "." ++
+ integer_to_list(B) ++ "." ++
+ integer_to_list(C) ++ "." ++
+ integer_to_list(D).
+
+ipv6_name({A, B, C, D, E, F, G, H}) ->
+ http_util:integer_to_hexlist(A) ++ ":"++
+ http_util:integer_to_hexlist(B) ++ ":" ++
+ http_util:integer_to_hexlist(C) ++ ":" ++
+ http_util:integer_to_hexlist(D) ++ ":" ++
+ http_util:integer_to_hexlist(E) ++ ":" ++
+ http_util:integer_to_hexlist(F) ++ ":" ++
+ http_util:integer_to_hexlist(G) ++ ":" ++
+ http_util:integer_to_hexlist(H).
+
+
%%%========================================================================
%%% Internal functions
%%%========================================================================
+%% -- sock_opts --
%% Address any comes from directive: BindAddress "*"
-sock_opt(ip_comm, any = Addr, Opts) ->
- sock_opt2([{ip, Addr} | Opts]);
-sock_opt(ip_comm, undefined, Opts) ->
- sock_opt2(Opts);
-sock_opt(_, any = _Addr, Opts) ->
- sock_opt2(Opts);
-sock_opt(_, undefined = _Addr, Opts) ->
- sock_opt2(Opts);
-sock_opt(_, {_,_,_,_} = Addr, Opts) ->
- sock_opt2([{ip, Addr} | Opts]);
-sock_opt(ip_comm, Addr, Opts) ->
- sock_opt2([{ip, Addr} | Opts]);
-sock_opt(_, Addr, Opts) ->
- sock_opt2([{ip, Addr} | Opts]).
-
-sock_opt2(Opts) ->
+sock_opts(undefined, Opts) ->
+ sock_opts(Opts);
+sock_opts(any = Addr, Opts) ->
+ sock_opts([{ip, Addr} | Opts]);
+sock_opts(Addr, Opts) ->
+ sock_opts([{ip, Addr} | Opts]).
+
+sock_opts(Opts) ->
[{packet, 0}, {active, false} | Opts].
+
+%% -- negotiate --
negotiate(ip_comm,_,_) ->
?hlrt("negotiate(ip_comm)", []),
ok;
diff --git a/lib/inets/src/http_lib/http_util.erl b/lib/inets/src/http_lib/http_util.erl
index 5511ed388d..973600d7be 100644
--- a/lib/inets/src/http_lib/http_util.erl
+++ b/lib/inets/src/http_lib/http_util.erl
@@ -104,6 +104,22 @@ convert_netscapecookie_date([_D,_A,_Y, $ ,
Sec = list_to_integer([S1,S2]),
{{Year,Month,Day},{Hour,Min,Sec}};
+%% Example: Tue Jan 01 08:00:01 2036 GMT
+convert_netscapecookie_date([_D,_A,_Y, $ ,
+ M,O,N, $ ,
+ D1,D2, $ ,
+ H1,H2, $:,
+ M1,M2, $:,
+ S1,S2, $ ,
+ Y1,Y2,Y3,Y4, $ |_Rest]) ->
+ Year = list_to_integer([Y1,Y2,Y3,Y4]),
+ Day = list_to_integer([D1,D2]),
+ Month = convert_month([M,O,N]),
+ Hour = list_to_integer([H1,H2]),
+ Min = list_to_integer([M1,M2]),
+ Sec = list_to_integer([S1,S2]),
+ {{Year,Month,Day},{Hour,Min,Sec}};
+
%% Sloppy...
convert_netscapecookie_date([_D,_A,_Y, $,, _SP,
D1,D2,_DA,
diff --git a/lib/inets/src/http_server/httpd_conf.erl b/lib/inets/src/http_server/httpd_conf.erl
index f4d8a6c09f..d1b1ea0e14 100644
--- a/lib/inets/src/http_server/httpd_conf.erl
+++ b/lib/inets/src/http_server/httpd_conf.erl
@@ -305,7 +305,7 @@ load("MaxKeepAliveRequests " ++ MaxRequests, []) ->
" is an invalid MaxKeepAliveRequests")}
end;
-%% This clause is keept for backwards compability
+%% This clause is kept for backwards compatibility
load("MaxKeepAliveRequest " ++ MaxRequests, []) ->
case make_integer(MaxRequests) of
{ok, Integer} ->
diff --git a/lib/inets/src/http_server/httpd_esi.erl b/lib/inets/src/http_server/httpd_esi.erl
index 026ec9a5fe..aac5645282 100644
--- a/lib/inets/src/http_server/httpd_esi.erl
+++ b/lib/inets/src/http_server/httpd_esi.erl
@@ -39,7 +39,7 @@
%% body part. Note that it is presumed that <Data> starts with a
%% string including "\r\n\r\n" if there is any header information
%% present. The returned headers will not contain the HTTP header body
-%% delimiter \r\n. (All header, header delimiters are keept.)
+%% delimiter \r\n. (All header, header delimiters are kept.)
%% Ex: ["Content-Type : text/html\r\n Connection : closing \r\n\r\n" |
%% io_list()] --> {"Content-Type : text/html\r\n Connection : closing \r\n",
%% io_list()}
diff --git a/lib/inets/src/http_server/httpd_file.erl b/lib/inets/src/http_server/httpd_file.erl
index ccc1f7874a..e8a8ab6411 100644
--- a/lib/inets/src/http_server/httpd_file.erl
+++ b/lib/inets/src/http_server/httpd_file.erl
@@ -33,7 +33,7 @@ handle_error(enotdir, Op, ModData, Path) ->
handle_error(404, Op, ModData, Path,
": A component of the file name is not a directory");
handle_error(emfile, Op, _ModData, Path) ->
- handle_error(500, Op, none, Path, ": To many open files");
+ handle_error(500, Op, none, Path, ": Too many open files");
handle_error({enfile,_}, Op, _ModData, Path) ->
handle_error(500, Op, none, Path, ": File table overflow");
handle_error(_Reason, Op, ModData, Path) ->
diff --git a/lib/inets/src/http_server/httpd_request.erl b/lib/inets/src/http_server/httpd_request.erl
index 7084d9824a..90f8bdd912 100644
--- a/lib/inets/src/http_server/httpd_request.erl
+++ b/lib/inets/src/http_server/httpd_request.erl
@@ -312,8 +312,8 @@ validate_uri(RequestURI) ->
{'EXIT',_Reason} ->
{error, {bad_request, {malformed_syntax, RequestURI}}};
_ ->
- Path = format_request_uri(UriNoQueryNoHex),
- Path2=[X||X<-string:tokens(Path, "/"),X=/="."], %% OTP-5938
+ Path = format_request_uri(UriNoQueryNoHex),
+ Path2 = [X||X<-string:tokens(Path, "/\\"),X=/="."],
validate_path( Path2,0, RequestURI)
end.
diff --git a/lib/inets/src/http_server/mod_auth_mnesia.erl b/lib/inets/src/http_server/mod_auth_mnesia.erl
index ffe028617b..b7b9520649 100644
--- a/lib/inets/src/http_server/mod_auth_mnesia.erl
+++ b/lib/inets/src/http_server/mod_auth_mnesia.erl
@@ -55,7 +55,7 @@ store_directory_data(_Directory, _DirData, _Server_root) ->
%% API
%%
-%% Compability API
+%% Compatibility API
store_user(UserName, Password, Port, Dir, _AccessPassword) ->
%% AccessPassword is ignored - was not used in previous version
diff --git a/lib/inets/src/inets_app/inets.appup.src b/lib/inets/src/inets_app/inets.appup.src
index 47f3fbba58..d5fdf86a60 100644
--- a/lib/inets/src/inets_app/inets.appup.src
+++ b/lib/inets/src/inets_app/inets.appup.src
@@ -18,6 +18,25 @@
{"%VSN%",
[
+ {"5.7",
+ [
+ {load_module, httpd_request, soft_purge, soft_purge, []},
+ {load_module, httpc_cookie, soft_purge, soft_purge, [http_util]},
+ {load_module, http_util, soft_purge, soft_purge, []}
+ ]
+ },
+ {"5.6",
+ [
+ {load_module, httpd_request, soft_purge, soft_purge, []},
+ {load_module, httpc, soft_purge, soft_purge, [httpc_manager]},
+ {load_module, http_transport, soft_purge, soft_purge, [http_transport]},
+ {load_module, httpc_cookie, soft_purge, soft_purge, [http_util]},
+ {load_module, http_util, soft_purge, soft_purge, []},
+ {update, httpc_handler, soft, soft_purge, soft_purge, []},
+ {update, httpc_manager, soft, soft_purge, soft_purge, [httpc_handler]},
+ {update, ftp, soft, soft_purge, soft_purge, []}
+ ]
+ },
{"5.5.2",
[
{restart_application, inets}
@@ -40,6 +59,25 @@
}
],
[
+ {"5.7",
+ [
+ {load_module, httpd_request, soft_purge, soft_purge, []},
+ {load_module, httpc_cookie, soft_purge, soft_purge, [http_util]},
+ {load_module, http_util, soft_purge, soft_purge, []}
+ ]
+ },
+ {"5.6",
+ [
+ {load_module, httpd_request, soft_purge, soft_purge, []},
+ {load_module, httpc, soft_purge, soft_purge, [httpc_manager]},
+ {load_module, http_transport, soft_purge, soft_purge, [http_transport]},
+ {load_module, httpc_cookie, soft_purge, soft_purge, [http_util]},
+ {load_module, http_util, soft_purge, soft_purge, []},
+ {update, httpc_handler, soft, soft_purge, soft_purge, []},
+ {update, httpc_manager, soft, soft_purge, soft_purge, [httpc_handler]},
+ {update, ftp, soft, soft_purge, soft_purge, []}
+ ]
+ },
{"5.5.2",
[
{restart_application, inets}
diff --git a/lib/inets/test/ftp_suite_lib.erl b/lib/inets/test/ftp_suite_lib.erl
index d0d07a8358..3ebd02229e 100644
--- a/lib/inets/test/ftp_suite_lib.erl
+++ b/lib/inets/test/ftp_suite_lib.erl
@@ -1129,10 +1129,16 @@ ticket_6035(Config) ->
LogFile = filename:join([PrivDir,"ticket_6035.log"]),
try
begin
+ p("ticket_6035 -> select ftpd host"),
Host = dirty_select_ftpd_host(Config),
+ p("ticket_6035 -> ftpd host selected (~p) => now spawn ftp owner", [Host]),
Pid = spawn(?MODULE, open_wait_6035, [Host, self()]),
+ p("ticket_6035 -> waiter spawned: ~p => now open error logfile (~p)",
+ [Pid, LogFile]),
error_logger:logfile({open, LogFile}),
- ok = kill_ftp_proc_6035(Pid,LogFile),
+ p("ticket_6035 -> error logfile open => now kill waiter process"),
+ true = kill_ftp_proc_6035(Pid, LogFile),
+ p("ticket_6035 -> waiter process killed => now close error logfile"),
error_logger:logfile(close),
p("ticket_6035 -> done", []),
ok
@@ -1146,7 +1152,7 @@ kill_ftp_proc_6035(Pid, LogFile) ->
p("kill_ftp_proc_6035 -> entry"),
receive
open ->
- p("kill_ftp_proc_6035 -> received open: send shutdown"),
+ p("kill_ftp_proc_6035 -> received open => now issue shutdown"),
exit(Pid, shutdown),
kill_ftp_proc_6035(Pid, LogFile);
{open_failed, Reason} ->
@@ -1159,11 +1165,11 @@ kill_ftp_proc_6035(Pid, LogFile) ->
is_error_report_6035(LogFile)
end.
-open_wait_6035(FtpServer, From) ->
- p("open_wait_6035 -> try connect to ~s", [FtpServer]),
+open_wait_6035({Tag, FtpServer}, From) ->
+ p("open_wait_6035 -> try connect to [~p] ~s for ~p", [Tag, FtpServer, From]),
case ftp:open(FtpServer, [{timeout, timer:seconds(15)}]) of
{ok, Pid} ->
- p("open_wait_6035 -> connected, now login"),
+ p("open_wait_6035 -> connected (~p), now login", [Pid]),
LoginResult = ftp:user(Pid,"anonymous","kldjf"),
p("open_wait_6035 -> login result: ~p", [LoginResult]),
From ! open,
@@ -1191,22 +1197,27 @@ is_error_report_6035(LogFile) ->
Res =
case file:read_file(LogFile) of
{ok, Bin} ->
- p("is_error_report_6035 -> logfile read"),
- read_log_6035(binary_to_list(Bin));
+ Txt = binary_to_list(Bin),
+ p("is_error_report_6035 -> logfile read: ~n~p", [Txt]),
+ read_log_6035(Txt);
_ ->
- ok
+ false
end,
p("is_error_report_6035 -> logfile read result: "
"~n ~p", [Res]),
- file:delete(LogFile),
+ %% file:delete(LogFile),
Res.
read_log_6035("=ERROR REPORT===="++_Rest) ->
- error_report;
-read_log_6035([_H|T]) ->
+ p("read_log_6035 -> ERROR REPORT detected"),
+ true;
+read_log_6035([H|T]) ->
+ p("read_log_6035 -> OTHER: "
+ "~p", [H]),
read_log_6035(T);
read_log_6035([]) ->
- ok.
+ p("read_log_6035 -> done"),
+ false.
%%--------------------------------------------------------------------
diff --git a/lib/inets/test/http_format_SUITE.erl b/lib/inets/test/http_format_SUITE.erl
index 931ac6e024..04c7358715 100644
--- a/lib/inets/test/http_format_SUITE.erl
+++ b/lib/inets/test/http_format_SUITE.erl
@@ -584,7 +584,9 @@ convert_netscapecookie_date(Config) when is_list(Config) ->
http_util:convert_netscapecookie_date("Sun, 12-Dec-06 08:59:38 GMT"),
{{2006,12,12},{8,59,38}} =
http_util:convert_netscapecookie_date("Sun 12-Dec-06 08:59:38 GMT"),
- ok.
+ {{2036,1,1},{8,0,1}} =
+ http_util:convert_netscapecookie_date("Tue Jan 01 08:00:01 2036 GMT"),
+ ok.
%%--------------------------------------------------------------------
%%% Internal functions
diff --git a/lib/inets/test/httpc_SUITE.erl b/lib/inets/test/httpc_SUITE.erl
index 1998bd3950..6edd5371af 100644
--- a/lib/inets/test/httpc_SUITE.erl
+++ b/lib/inets/test/httpc_SUITE.erl
@@ -64,16 +64,6 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
[
- proxy_options,
- proxy_head,
- proxy_get,
- proxy_trace,
- proxy_post,
- proxy_put,
- proxy_delete,
- proxy_auth,
- proxy_headers,
- proxy_emulate_lower_versions,
http_options,
http_head,
http_get,
@@ -88,15 +78,6 @@ all() ->
http_headers,
http_headers_dummy,
http_bad_response,
- ssl_head,
- ossl_head,
- essl_head,
- ssl_get,
- ossl_get,
- essl_get,
- ssl_trace,
- ossl_trace,
- essl_trace,
http_redirect,
http_redirect_loop,
http_internal_server_error,
@@ -106,21 +87,44 @@ all() ->
http_emulate_lower_versions,
http_relaxed,
page_does_not_exist,
- proxy_page_does_not_exist,
- proxy_https_not_supported,
- http_stream,
- http_stream_once,
- proxy_stream,
parse_url,
options,
- ipv6,
headers_as_is,
+ {group, proxy},
+ {group, ssl},
+ {group, stream},
+ {group, ipv6},
{group, tickets},
initial_server_connect
].
groups() ->
- [{tickets, [], [hexed_query_otp_6191,
+ [
+ {proxy, [], [proxy_options,
+ proxy_head,
+ proxy_get,
+ proxy_trace,
+ proxy_post,
+ proxy_put,
+ proxy_delete,
+ proxy_auth,
+ proxy_headers,
+ proxy_emulate_lower_versions,
+ proxy_page_does_not_exist,
+ proxy_https_not_supported]},
+ {ssl, [], [ssl_head,
+ ossl_head,
+ essl_head,
+ ssl_get,
+ ossl_get,
+ essl_get,
+ ssl_trace,
+ ossl_trace,
+ essl_trace]},
+ {stream, [], [http_stream,
+ http_stream_once,
+ proxy_stream]},
+ {tickets, [], [hexed_query_otp_6191,
empty_body_otp_6243,
empty_response_header_otp_6830,
transfer_encoding_otp_6807,
@@ -139,7 +143,10 @@ groups() ->
{otp_8154, [], [otp_8154_1]},
{otp_8106, [], [otp_8106_pid,
otp_8106_fun,
- otp_8106_mfa]}].
+ otp_8106_mfa]},
+ {ipv6, [], [ipv6_ipcomm, ipv6_essl]}
+ ].
+
init_per_group(_GroupName, Config) ->
@@ -213,36 +220,38 @@ end_per_suite(Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
+
init_per_testcase(otp_8154_1 = Case, Config) ->
init_per_testcase(Case, 5, Config);
-init_per_testcase(initial_server_connect, Config) ->
+init_per_testcase(initial_server_connect = Case, Config) ->
%% Try to check if crypto actually exist or not,
%% this test case does not work unless it does
- case (catch crypto:start()) of
- ok ->
- application:start(public_key),
- application:start(ssl),
+ try
+ begin
+ ensure_started(crypto),
+ ensure_started(public_key),
+ ensure_started(ssl),
inets:start(),
- Config;
- _ ->
- {skip,"Could not start crypto"}
+ Config
+ end
+ catch
+ throw:{error, {failed_starting, App, ActualError}} ->
+ tsp("init_per_testcase(~w) -> failed starting ~w: "
+ "~n ~p", [Case, App, ActualError]),
+ SkipString =
+ "Could not start " ++ atom_to_list(App),
+ {skip, SkipString};
+ _:X ->
+ SkipString =
+ lists:flatten(
+ io_lib:format("Failed starting apps: ~p", [X])),
+ {skip, SkipString}
end;
init_per_testcase(Case, Config) ->
init_per_testcase(Case, 2, Config).
-init_per_testcase_ssl(Tag, PrivDir, SslConfFile, Config) ->
- tsp("init_per_testcase_ssl -> stop ssl"),
- application:stop(ssl),
- Config2 = lists:keydelete(local_ssl_server, 1, Config),
- %% Will start inets
- tsp("init_per_testcase_ssl -> try start http server (including inets)"),
- Server = inets_test_lib:start_http_server(
- filename:join(PrivDir, SslConfFile), Tag),
- tsp("init_per_testcase -> Server: ~p", [Server]),
- [{local_ssl_server, Server} | Config2].
-
init_per_testcase(Case, Timeout, Config) ->
io:format(user, "~n~n*** INIT ~w:~w[~w] ***~n~n",
[?MODULE, Case, Timeout]),
@@ -261,13 +270,16 @@ init_per_testcase(Case, Timeout, Config) ->
NewConfig =
case atom_to_list(Case) of
[$s, $s, $l | _] ->
- init_per_testcase_ssl(ssl, PrivDir, SslConfFile, [{watchdog, Dog} | TmpConfig]);
+ init_per_testcase_ssl(ssl, PrivDir, SslConfFile,
+ [{watchdog, Dog} | TmpConfig]);
[$o, $s, $s, $l | _] ->
- init_per_testcase_ssl(ossl, PrivDir, SslConfFile, [{watchdog, Dog} | TmpConfig]);
+ init_per_testcase_ssl(ossl, PrivDir, SslConfFile,
+ [{watchdog, Dog} | TmpConfig]);
[$e, $s, $s, $l | _] ->
- init_per_testcase_ssl(essl, PrivDir, SslConfFile, [{watchdog, Dog} | TmpConfig]);
+ init_per_testcase_ssl(essl, PrivDir, SslConfFile,
+ [{watchdog, Dog} | TmpConfig]);
"proxy_" ++ Rest ->
io:format("init_per_testcase -> Rest: ~p~n", [Rest]),
@@ -275,16 +287,23 @@ init_per_testcase(Case, Timeout, Config) ->
"https_not_supported" ->
tsp("init_per_testcase -> [proxy case] start inets"),
inets:start(),
- tsp("init_per_testcase -> [proxy case] start ssl"),
- application:start(crypto),
- application:start(public_key),
- case (catch application:start(ssl)) of
+ tsp("init_per_testcase -> "
+ "[proxy case] start crypto, public_key and ssl"),
+ try ensure_started([crypto, public_key, ssl]) of
ok ->
- [{watchdog, Dog} | TmpConfig];
- _ ->
- [{skip, "SSL does not seem to be supported"}
- | TmpConfig]
+ [{watchdog, Dog} | TmpConfig]
+ catch
+ throw:{error, {failed_starting, App, _}} ->
+ SkipString =
+ "Could not start " ++ atom_to_list(App),
+ {skip, SkipString};
+ _:X ->
+ SkipString =
+ lists:flatten(
+ io_lib:format("Failed starting apps: ~p", [X])),
+ {skip, SkipString}
end;
+
_ ->
%% We use erlang.org for the proxy tests
%% and after the switch to erlang-web, many
@@ -321,6 +340,33 @@ init_per_testcase(Case, Timeout, Config) ->
[{skip, "proxy not responding"} | TmpConfig]
end
end;
+
+ "ipv6_" ++ _Rest ->
+ %% Ensure needed apps (crypto, public_key and ssl) started
+ try ensure_started([crypto, public_key, ssl]) of
+ ok ->
+ Profile = ipv6,
+ %% A stand-alone profile is represented by a pid()
+ {ok, ProfilePid} =
+ inets:start(httpc,
+ [{profile, Profile},
+ {data_dir, PrivDir}], stand_alone),
+ httpc:set_options([{ipfamily, inet6}], ProfilePid),
+ tsp("httpc profile pid: ~p", [ProfilePid]),
+ [{watchdog, Dog}, {profile, ProfilePid}| TmpConfig]
+ catch
+ throw:{error, {failed_starting, App, ActualError}} ->
+ tsp("init_per_testcase(~w) -> failed starting ~w: "
+ "~n ~p", [Case, App, ActualError]),
+ SkipString =
+ "Could not start " ++ atom_to_list(App),
+ {skip, SkipString};
+ _:X ->
+ SkipString =
+ lists:flatten(
+ io_lib:format("Failed starting apps: ~p", [X])),
+ {skip, SkipString}
+ end;
_ ->
TmpConfig2 = lists:keydelete(local_server, 1, TmpConfig),
Server =
@@ -330,9 +376,7 @@ init_per_testcase(Case, Timeout, Config) ->
[{watchdog, Dog}, {local_server, Server} | TmpConfig2]
end,
- %% httpc:set_options([{proxy, {{?PROXY, ?PROXY_PORT},
- %% ["localhost", ?IPV6_LOCAL_HOST]}}]),
-
+ %% This will fail for the ipv6_ - cases (but that is ok)
httpc:set_options([{proxy, {{?PROXY, ?PROXY_PORT},
["localhost", ?IPV6_LOCAL_HOST]}},
{ipfamily, inet6fb4}]),
@@ -341,6 +385,19 @@ init_per_testcase(Case, Timeout, Config) ->
NewConfig.
+init_per_testcase_ssl(Tag, PrivDir, SslConfFile, Config) ->
+ tsp("init_per_testcase_ssl(~w) -> stop ssl", [Tag]),
+ application:stop(ssl),
+ Config2 = lists:keydelete(local_ssl_server, 1, Config),
+ %% Will start inets
+ tsp("init_per_testcase_ssl(~w) -> try start http server (including inets)",
+ [Tag]),
+ Server = inets_test_lib:start_http_server(
+ filename:join(PrivDir, SslConfFile), Tag),
+ tsp("init_per_testcase(~w) -> Server: ~p", [Tag, Server]),
+ [{local_ssl_server, Server} | Config2].
+
+
%%--------------------------------------------------------------------
%% Function: end_per_testcase(Case, Config) -> _
%% Case - atom()
@@ -349,13 +406,36 @@ init_per_testcase(Case, Timeout, Config) ->
%% A list of key/value pairs, holding the test case configuration.
%% Description: Cleanup after each test case
%%--------------------------------------------------------------------
-end_per_testcase(http_save_to_file, Config) ->
- PrivDir = ?config(priv_dir, Config),
+end_per_testcase(http_save_to_file = Case, Config) ->
+ io:format(user, "~n~n*** END ~w:~w ***~n~n",
+ [?MODULE, Case]),
+ PrivDir = ?config(priv_dir, Config),
FullPath = filename:join(PrivDir, "dummy.html"),
file:delete(FullPath),
finish(Config);
-end_per_testcase(_, Config) ->
+end_per_testcase(Case, Config) ->
+ io:format(user, "~n~n*** END ~w:~w ***~n~n",
+ [?MODULE, Case]),
+ case atom_to_list(Case) of
+ "ipv6_" ++ _Rest ->
+ tsp("end_per_testcase(~w) -> stop ssl", [Case]),
+ application:stop(ssl),
+ tsp("end_per_testcase(~w) -> stop public_key", [Case]),
+ application:stop(public_key),
+ tsp("end_per_testcase(~w) -> stop crypto", [Case]),
+ application:stop(crypto),
+ ProfilePid = ?config(profile, Config),
+ tsp("end_per_testcase(~w) -> stop httpc profile (~p)",
+ [Case, ProfilePid]),
+ unlink(ProfilePid),
+ inets:stop(stand_alone, ProfilePid),
+ tsp("end_per_testcase(~w) -> httpc profile (~p) stopped",
+ [Case, ProfilePid]),
+ ok;
+ _ ->
+ ok
+ end,
finish(Config).
finish(Config) ->
@@ -364,6 +444,7 @@ finish(Config) ->
undefined ->
ok;
_ ->
+ tsp("finish -> stop watchdog (~p)", [Dog]),
test_server:timetrap_cancel(Dog)
end.
@@ -565,7 +646,7 @@ http_relaxed(suite) ->
http_relaxed(Config) when is_list(Config) ->
ok = httpc:set_options([{ipv6, disabled}]), % also test the old option
%% ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++
"/missing_reason_phrase.html",
@@ -591,7 +672,7 @@ http_dummy_pipe(suite) ->
[];
http_dummy_pipe(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/foobar.html",
@@ -905,7 +986,7 @@ http_headers_dummy(suite) ->
[];
http_headers_dummy(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/dummy_headers.html",
@@ -970,7 +1051,7 @@ http_bad_response(suite) ->
[];
http_bad_response(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/missing_crlf.html",
@@ -1089,9 +1170,9 @@ ssl_get(SslTag, Config) when is_list(Config) ->
httpc:request(get, {URL, []}, [{ssl, SSLConfig}], []),
inets_test_lib:check_body(Body);
{ok, _} ->
- {skip, "Failed to start local http-server"};
+ {skip, "local http-server not started"};
_ ->
- {skip, "Failed to start SSL"}
+ {skip, "SSL not started"}
end.
@@ -1149,9 +1230,9 @@ ssl_trace(SslTag, Config) when is_list(Config) ->
tsf({failed, Error})
end;
{ok, _} ->
- {skip, "Failed to start local http-server"};
+ {skip, "local http-server not started"};
_ ->
- {skip, "Failed to start SSL"}
+ {skip, "SSL not started"}
end.
@@ -1170,7 +1251,7 @@ http_redirect(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
tsp("http_redirect -> start dummy server inet"),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
tsp("http_redirect -> server port = ~p", [Port]),
URL300 = ?URL_START ++ integer_to_list(Port) ++ "/300.html",
@@ -1282,7 +1363,7 @@ http_redirect_loop(suite) ->
[];
http_redirect_loop(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/redirectloop.html",
@@ -1299,7 +1380,7 @@ http_internal_server_error(suite) ->
[];
http_internal_server_error(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL500 = ?URL_START ++ integer_to_list(Port) ++ "/500.html",
@@ -1335,7 +1416,7 @@ http_userinfo(suite) ->
http_userinfo(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URLAuth = "http://alladin:sesame@localhost:"
++ integer_to_list(Port) ++ "/userinfo.html",
@@ -1361,7 +1442,7 @@ http_cookie(suite) ->
[];
http_cookie(Config) when is_list(Config) ->
ok = httpc:set_options([{cookies, enabled}, {ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URLStart = ?URL_START
++ integer_to_list(Port),
@@ -1735,7 +1816,7 @@ http_stream_once(Config) when is_list(Config) ->
p("http_stream_once -> set ipfamily to inet", []),
ok = httpc:set_options([{ipfamily, inet}]),
p("http_stream_once -> start dummy server", []),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
PortStr = integer_to_list(Port),
p("http_stream_once -> once", []),
@@ -1871,28 +1952,79 @@ parse_url(Config) when is_list(Config) ->
%%-------------------------------------------------------------------------
-ipv6() ->
- [{require,ipv6_hosts}].
-ipv6(doc) ->
- ["Test ipv6."];
-ipv6(suite) ->
- [];
-ipv6(Config) when is_list(Config) ->
- {ok, Hostname} = inet:gethostname(),
-
- case lists:member(list_to_atom(Hostname),
- ct:get_config(ipv6_hosts)) of
- true ->
- {DummyServerPid, Port} = dummy_server(self(), ipv6),
-
- URL = "http://[" ++ ?IPV6_LOCAL_HOST ++ "]:" ++
+
+ipv6_ipcomm() ->
+ [{require, ipv6_hosts}].
+ipv6_ipcomm(doc) ->
+ ["Test ip_comm ipv6."];
+ipv6_ipcomm(suite) ->
+ [];
+ipv6_ipcomm(Config) when is_list(Config) ->
+ HTTPOptions = [],
+ SocketType = ip_comm,
+ Scheme = "http",
+ Extra = [],
+ ipv6(SocketType, Scheme, HTTPOptions, Extra, Config).
+
+
+%%-------------------------------------------------------------------------
+
+ipv6_essl() ->
+ [{require, ipv6_hosts}].
+ipv6_essl(doc) ->
+ ["Test essl ipv6."];
+ipv6_essl(suite) ->
+ [];
+ipv6_essl(Config) when is_list(Config) ->
+ DataDir = ?config(data_dir, Config),
+ CertFile = filename:join(DataDir, "ssl_client_cert.pem"),
+ SSLOptions = [{certfile, CertFile}, {keyfile, CertFile}],
+ SSLConfig = {essl, SSLOptions},
+ tsp("ssl_ipv6 -> make request using: "
+ "~n SSLOptions: ~p", [SSLOptions]),
+ HTTPOptions = [{ssl, SSLConfig}],
+ SocketType = essl,
+ Scheme = "https",
+ Extra = SSLOptions,
+ ipv6(SocketType, Scheme, HTTPOptions, Extra, Config).
+
+
+%%-------------------------------------------------------------------------
+
+ipv6(SocketType, Scheme, HTTPOptions, Extra, Config) ->
+ %% Check if we are a IPv6 host
+ tsp("ipv6 -> verify ipv6 support", []),
+ case inets_test_lib:has_ipv6_support(Config) of
+ {ok, Addr} ->
+ tsp("ipv6 -> ipv6 supported: ~p", [Addr]),
+ {DummyServerPid, Port} = dummy_server(SocketType, ipv6, Extra),
+ Profile = ?config(profile, Config),
+ URL =
+ Scheme ++
+ "://[" ++ http_transport:ipv6_name(Addr) ++ "]:" ++
integer_to_list(Port) ++ "/foobar.html",
- {ok, {{_,200,_}, [_ | _], [_|_]}} =
- httpc:request(get, {URL, []}, [], []),
-
- DummyServerPid ! stop,
+ tsp("ipv6 -> issue request with: "
+ "~n URL: ~p"
+ "~n HTTPOptions: ~p", [URL, HTTPOptions]),
+ case httpc:request(get, {URL, []}, HTTPOptions, [], Profile) of
+ {ok, {{_,200,_}, [_ | _], [_|_]}} ->
+ tsp("ipv6 -> expected result"),
+ DummyServerPid ! stop,
+ ok;
+ {ok, Unexpected} ->
+ tsp("ipv6 -> unexpected result: "
+ "~n ~p", [Unexpected]),
+ DummyServerPid ! stop,
+ tsf({unexpected_result, Unexpected});
+ {error, Reason} ->
+ tsp("ipv6 -> error: "
+ "~n Reason: ~p", [Reason]),
+ DummyServerPid ! stop,
+ tsf(Reason)
+ end,
ok;
- false ->
+ _ ->
+ tsp("ipv6 -> ipv6 not supported", []),
{skip, "Host does not support IPv6"}
end.
@@ -1945,7 +2077,7 @@ http_invalid_http(suite) ->
[];
http_invalid_http(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/invalid_http.html",
@@ -2002,7 +2134,7 @@ transfer_encoding_otp_6807(suite) ->
[];
transfer_encoding_otp_6807(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++
"/capital_transfer_encoding.html",
@@ -2035,7 +2167,7 @@ empty_response_header_otp_6830(suite) ->
[];
empty_response_header_otp_6830(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/no_headers.html",
{ok, {{_,200,_}, [], [_ | _]}} = httpc:request(URL),
@@ -2052,7 +2184,7 @@ no_content_204_otp_6982(suite) ->
[];
no_content_204_otp_6982(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/no_content.html",
{ok, {{_,204,_}, [], []}} = httpc:request(URL),
@@ -2070,7 +2202,7 @@ missing_CR_otp_7304(suite) ->
[];
missing_CR_otp_7304(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/missing_CR.html",
{ok, {{_,200,_}, _, [_ | _]}} = httpc:request(URL),
@@ -2089,7 +2221,7 @@ otp_7883_1(suite) ->
otp_7883_1(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/just_close.html",
{error, socket_closed_remotely} = httpc:request(URL),
@@ -2105,7 +2237,7 @@ otp_7883_2(suite) ->
otp_7883_2(Config) when is_list(Config) ->
ok = httpc:set_options([{ipfamily, inet}]),
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++ "/just_close.html",
Method = get,
@@ -2626,7 +2758,7 @@ otp_8371(suite) ->
[];
otp_8371(Config) when is_list(Config) ->
ok = httpc:set_options([{ipv6, disabled}]), % also test the old option
- {DummyServerPid, Port} = dummy_server(self(), ipv4),
+ {DummyServerPid, Port} = dummy_server(ipv4),
URL = ?URL_START ++ integer_to_list(Port) ++
"/ensure_host_header_with_port.html",
@@ -2864,75 +2996,179 @@ receive_streamed_body(RequestId, Body, Pid) ->
test_server:fail(Msg)
end.
+%% Perform a synchronous stop
+dummy_server_stop(Pid) ->
+ Pid ! {stop, self()},
+ receive
+ {stopped, Pid} ->
+ ok
+ end.
+
+dummy_server(IpV) ->
+ dummy_server(self(), ip_comm, IpV, []).
+dummy_server(SocketType, IpV, Extra) ->
+ dummy_server(self(), SocketType, IpV, Extra).
-dummy_server(Caller, IpV) ->
- Pid = spawn(httpc_SUITE, dummy_server_init, [Caller, IpV]),
+dummy_server(Caller, SocketType, IpV, Extra) ->
+ Args = [Caller, SocketType, IpV, Extra],
+ Pid = spawn(httpc_SUITE, dummy_server_init, Args),
receive
{port, Port} ->
{Pid, Port}
end.
-dummy_server_init(Caller, IpV) ->
+dummy_server_init(Caller, ip_comm, IpV, _) ->
+ BaseOpts = [binary, {packet, 0}, {reuseaddr,true}, {active, false}],
{ok, ListenSocket} =
case IpV of
ipv4 ->
- gen_tcp:listen(0, [binary, inet, {packet, 0},
- {reuseaddr,true},
- {active, false}]);
+ tsp("ip_comm ipv4 listen", []),
+ gen_tcp:listen(0, [inet | BaseOpts]);
ipv6 ->
- gen_tcp:listen(0, [binary, inet6, {packet, 0},
- {reuseaddr,true},
- {active, false}])
+ tsp("ip_comm ipv6 listen", []),
+ gen_tcp:listen(0, [inet6 | BaseOpts])
end,
{ok, Port} = inet:port(ListenSocket),
- tsp("dummy_server_init -> Port: ~p", [Port]),
+ tsp("dummy_server_init(ip_comm) -> Port: ~p", [Port]),
Caller ! {port, Port},
- dummy_server_loop({httpd_request, parse, [?HTTP_MAX_HEADER_SIZE]},
- [], ListenSocket).
+ dummy_ipcomm_server_loop({httpd_request, parse, [?HTTP_MAX_HEADER_SIZE]},
+ [], ListenSocket);
+dummy_server_init(Caller, essl, IpV, SSLOptions) ->
+ BaseOpts = [{ssl_imp, new},
+ {backlog, 128}, binary, {reuseaddr,true}, {active, false} |
+ SSLOptions],
+ dummy_ssl_server_init(Caller, BaseOpts, IpV);
+dummy_server_init(Caller, ossl, IpV, SSLOptions) ->
+ BaseOpts = [{ssl_imp, old},
+ {backlog, 128}, binary, {active, false} | SSLOptions],
+ dummy_ssl_server_init(Caller, BaseOpts, IpV).
+
+dummy_ssl_server_init(Caller, BaseOpts, IpV) ->
+ {ok, ListenSocket} =
+ case IpV of
+ ipv4 ->
+ tsp("dummy_ssl_server_init -> ssl ipv4 listen", []),
+ ssl:listen(0, [inet | BaseOpts]);
+ ipv6 ->
+ tsp("dummy_ssl_server_init -> ssl ipv6 listen", []),
+ ssl:listen(0, [inet6 | BaseOpts])
+ end,
+ tsp("dummy_ssl_server_init -> ListenSocket: ~p", [ListenSocket]),
+ {ok, {_, Port}} = ssl:sockname(ListenSocket),
+ tsp("dummy_ssl_server_init -> Port: ~p", [Port]),
+ Caller ! {port, Port},
+ dummy_ssl_server_loop({httpd_request, parse, [?HTTP_MAX_HEADER_SIZE]},
+ [], ListenSocket).
-dummy_server_loop(MFA, Handlers, ListenSocket) ->
+dummy_ipcomm_server_loop(MFA, Handlers, ListenSocket) ->
receive
stop ->
- lists:foreach(fun(Handler) -> Handler ! stop end, Handlers)
+ tsp("dummy_ipcomm_server_loop -> stop handlers", []),
+ lists:foreach(fun(Handler) -> Handler ! stop end, Handlers);
+ {stop, From} ->
+ tsp("dummy_ipcomm_server_loop -> "
+ "stop command from ~p for handlers (~p)", [From, Handlers]),
+ Stopper = fun(Handler) -> Handler ! stop end,
+ lists:foreach(Stopper, Handlers),
+ From ! {stopped, self()}
after 0 ->
+ tsp("dummy_ipcomm_server_loop -> await accept", []),
{ok, Socket} = gen_tcp:accept(ListenSocket),
+ tsp("dummy_ipcomm_server_loop -> accepted: ~p", [Socket]),
HandlerPid = dummy_request_handler(MFA, Socket),
+ tsp("dummy_icomm_server_loop -> handler created: ~p", [HandlerPid]),
gen_tcp:controlling_process(Socket, HandlerPid),
- HandlerPid ! controller,
- dummy_server_loop(MFA, [HandlerPid | Handlers],
+ tsp("dummy_ipcomm_server_loop -> "
+ "control transfered to handler", []),
+ HandlerPid ! ipcomm_controller,
+ tsp("dummy_ipcomm_server_loop -> "
+ "handler informed about control transfer", []),
+ dummy_ipcomm_server_loop(MFA, [HandlerPid | Handlers],
ListenSocket)
end.
+dummy_ssl_server_loop(MFA, Handlers, ListenSocket) ->
+ receive
+ stop ->
+ tsp("dummy_ssl_server_loop -> stop handlers", []),
+ lists:foreach(fun(Handler) -> Handler ! stop end, Handlers);
+ {stop, From} ->
+ tsp("dummy_ssl_server_loop -> "
+ "stop command from ~p for handlers (~p)", [From, Handlers]),
+ Stopper = fun(Handler) -> Handler ! stop end,
+ lists:foreach(Stopper, Handlers),
+ From ! {stopped, self()}
+ after 0 ->
+ tsp("dummy_ssl_server_loop -> await accept", []),
+ {ok, Socket} = ssl:transport_accept(ListenSocket),
+ tsp("dummy_ssl_server_loop -> accepted: ~p", [Socket]),
+ HandlerPid = dummy_request_handler(MFA, Socket),
+ tsp("dummy_ssl_server_loop -> handler created: ~p", [HandlerPid]),
+ ssl:controlling_process(Socket, HandlerPid),
+ tsp("dummy_ssl_server_loop -> control transfered to handler", []),
+ HandlerPid ! ssl_controller,
+ tsp("dummy_ssl_server_loop -> "
+ "handler informed about control transfer", []),
+ dummy_ssl_server_loop(MFA, [HandlerPid | Handlers],
+ ListenSocket)
+ end.
+
dummy_request_handler(MFA, Socket) ->
+ tsp("spawn request handler", []),
spawn(httpc_SUITE, dummy_request_handler_init, [MFA, Socket]).
dummy_request_handler_init(MFA, Socket) ->
- receive
- controller ->
- inet:setopts(Socket, [{active, true}])
- end,
- dummy_request_handler_loop(MFA, Socket).
+ SockType =
+ receive
+ ipcomm_controller ->
+ tsp("dummy_request_handler_init -> "
+ "received ip_comm controller - activate", []),
+ inet:setopts(Socket, [{active, true}]),
+ ip_comm;
+ ssl_controller ->
+ tsp("dummy_request_handler_init -> "
+ "received ssl controller - activate", []),
+ ssl:setopts(Socket, [{active, true}]),
+ ssl
+ end,
+ dummy_request_handler_loop(MFA, SockType, Socket).
-dummy_request_handler_loop({Module, Function, Args}, Socket) ->
+dummy_request_handler_loop({Module, Function, Args}, SockType, Socket) ->
tsp("dummy_request_handler_loop -> entry with"
"~n Module: ~p"
"~n Function: ~p"
"~n Args: ~p", [Module, Function, Args]),
receive
- {tcp, _, Data} ->
- tsp("dummy_request_handler_loop -> Data ~p", [Data]),
- case handle_request(Module, Function, [Data | Args], Socket) of
- stop ->
+ {Proto, _, Data} when (Proto =:= tcp) orelse (Proto =:= ssl) ->
+ tsp("dummy_request_handler_loop -> [~w] Data ~p", [Proto, Data]),
+ case handle_request(Module, Function, [Data | Args], Socket, Proto) of
+ stop when Proto =:= tcp ->
gen_tcp:close(Socket);
+ stop when Proto =:= ssl ->
+ ssl:close(Socket);
NewMFA ->
- dummy_request_handler_loop(NewMFA, Socket)
+ dummy_request_handler_loop(NewMFA, SockType, Socket)
end;
- stop ->
- gen_tcp:close(Socket)
+ stop when SockType =:= ip_comm ->
+ gen_tcp:close(Socket);
+ stop when SockType =:= ssl ->
+ ssl:close(Socket)
end.
-handle_request(Module, Function, Args, Socket) ->
+
+mk_close(tcp) -> fun(Sock) -> gen_tcp:close(Sock) end;
+mk_close(ssl) -> fun(Sock) -> ssl:close(Sock) end.
+
+mk_send(tcp) -> fun(Sock, Data) -> gen_tcp:send(Sock, Data) end;
+mk_send(ssl) -> fun(Sock, Data) -> ssl:send(Sock, Data) end.
+
+handle_request(Module, Function, Args, Socket, Proto) ->
+ Close = mk_close(Proto),
+ Send = mk_send(Proto),
+ handle_request(Module, Function, Args, Socket, Close, Send).
+
+handle_request(Module, Function, Args, Socket, Close, Send) ->
tsp("handle_request -> entry with"
"~n Module: ~p"
"~n Function: ~p"
@@ -2941,7 +3177,7 @@ handle_request(Module, Function, Args, Socket) ->
{ok, Result} ->
tsp("handle_request -> ok"
"~n Result: ~p", [Result]),
- case (catch handle_http_msg(Result, Socket)) of
+ case (catch handle_http_msg(Result, Socket, Close, Send)) of
stop ->
stop;
<<>> ->
@@ -2949,7 +3185,8 @@ handle_request(Module, Function, Args, Socket) ->
{httpd_request, parse, [[<<>>, ?HTTP_MAX_HEADER_SIZE]]};
Data ->
handle_request(httpd_request, parse,
- [Data |[?HTTP_MAX_HEADER_SIZE]], Socket)
+ [Data |[?HTTP_MAX_HEADER_SIZE]], Socket,
+ Close, Send)
end;
NewMFA ->
tsp("handle_request -> "
@@ -2957,7 +3194,7 @@ handle_request(Module, Function, Args, Socket) ->
NewMFA
end.
-handle_http_msg({_, RelUri, _, {_, Headers}, Body}, Socket) ->
+handle_http_msg({_, RelUri, _, {_, Headers}, Body}, Socket, Close, Send) ->
tsp("handle_http_msg -> entry with: "
"~n RelUri: ~p"
"~n Headers: ~p"
@@ -3114,16 +3351,16 @@ handle_http_msg({_, RelUri, _, {_, Headers}, Body}, Socket) ->
"Expires:Sat, 29 Oct 1994 19:43:31 GMT\r\n" ++
"Proxy-Authenticate:#1Basic" ++
"\r\n\r\n",
- gen_tcp:send(Socket, Head),
- gen_tcp:send(Socket, http_chunk:encode("<HTML><BODY>fo")),
- gen_tcp:send(Socket, http_chunk:encode("obar</BODY></HTML>")),
+ Send(Socket, Head),
+ Send(Socket, http_chunk:encode("<HTML><BODY>fo")),
+ Send(Socket, http_chunk:encode("obar</BODY></HTML>")),
http_chunk:encode_last();
"/capital_transfer_encoding.html" ->
Head = "HTTP/1.1 200 ok\r\n" ++
"Transfer-Encoding:Chunked\r\n\r\n",
- gen_tcp:send(Socket, Head),
- gen_tcp:send(Socket, http_chunk:encode("<HTML><BODY>fo")),
- gen_tcp:send(Socket, http_chunk:encode("obar</BODY></HTML>")),
+ Send(Socket, Head),
+ Send(Socket, http_chunk:encode("<HTML><BODY>fo")),
+ Send(Socket, http_chunk:encode("obar</BODY></HTML>")),
http_chunk:encode_last();
"/cookie.html" ->
"HTTP/1.1 200 ok\r\n" ++
@@ -3142,20 +3379,20 @@ handle_http_msg({_, RelUri, _, {_, Headers}, Body}, Socket) ->
"/once_chunked.html" ->
Head = "HTTP/1.1 200 ok\r\n" ++
"Transfer-Encoding:Chunked\r\n\r\n",
- gen_tcp:send(Socket, Head),
- gen_tcp:send(Socket, http_chunk:encode("<HTML><BODY>fo")),
- gen_tcp:send(Socket,
+ Send(Socket, Head),
+ Send(Socket, http_chunk:encode("<HTML><BODY>fo")),
+ Send(Socket,
http_chunk:encode("obar</BODY></HTML>")),
http_chunk:encode_last();
"/once.html" ->
Head = "HTTP/1.1 200 ok\r\n" ++
"Content-Length:32\r\n\r\n",
- gen_tcp:send(Socket, Head),
- gen_tcp:send(Socket, "<HTML><BODY>fo"),
+ Send(Socket, Head),
+ Send(Socket, "<HTML><BODY>fo"),
test_server:sleep(1000),
- gen_tcp:send(Socket, "ob"),
+ Send(Socket, "ob"),
test_server:sleep(1000),
- gen_tcp:send(Socket, "ar</BODY></HTML>");
+ Send(Socket, "ar</BODY></HTML>");
"/invalid_http.html" ->
"HTTP/1.1 301\r\nDate:Sun, 09 Dec 2007 13:04:18 GMT\r\n" ++
"Transfer-Encoding:chunked\r\n\r\n";
@@ -3178,9 +3415,9 @@ handle_http_msg({_, RelUri, _, {_, Headers}, Body}, Socket) ->
ok;
close ->
%% Nothing to send, just close
- gen_tcp:close(Socket);
+ Close(Socket);
_ when is_list(Msg) orelse is_binary(Msg) ->
- gen_tcp:send(Socket, Msg)
+ Send(Socket, Msg)
end,
tsp("handle_http_msg -> done"),
NextRequest.
@@ -3316,3 +3553,20 @@ dummy_ssl_server_hang_loop(_) ->
stop ->
ok
end.
+
+
+ensure_started([]) ->
+ ok;
+ensure_started([App|Apps]) ->
+ ensure_started(App),
+ ensure_started(Apps);
+ensure_started(App) when is_atom(App) ->
+ case (catch application:start(App)) of
+ ok ->
+ ok;
+ {error, {already_started, _}} ->
+ ok;
+ Error ->
+ throw({error, {failed_starting, App, Error}})
+ end.
+
diff --git a/lib/inets/test/httpc_cookie_SUITE.erl b/lib/inets/test/httpc_cookie_SUITE.erl
index feef5f1eea..866fa9d525 100644
--- a/lib/inets/test/httpc_cookie_SUITE.erl
+++ b/lib/inets/test/httpc_cookie_SUITE.erl
@@ -119,10 +119,18 @@ end_per_testcase(Case, Config) ->
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- [session_cookies_only, netscape_cookies, cookie_cancel,
- cookie_expires, persistent_cookie, domain_cookie,
- secure_cookie, update_cookie, update_cookie_session,
- cookie_attributes].
+ [
+ session_cookies_only,
+ netscape_cookies,
+ cookie_cancel,
+ cookie_expires,
+ persistent_cookie,
+ domain_cookie,
+ secure_cookie,
+ update_cookie,
+ update_cookie_session,
+ cookie_attributes
+ ].
groups() ->
[].
@@ -305,38 +313,93 @@ secure_cookie(Config) when is_list(Config) ->
tsp("secure_cookie -> done"),
ok.
+expect_cookie_header(No, ExpectedCookie) ->
+ case httpc:cookie_header(?URL) of
+ {"cookie", ExpectedCookie} ->
+ ok;
+ {"cookie", BadCookie} ->
+ io:format("Bad Cookie ~w: "
+ "~n Expected: ~s"
+ "~n Received: ~s"
+ "~n", [No, ExpectedCookie, BadCookie]),
+ exit({bad_cookie_header, No, ExpectedCookie, BadCookie})
+ end.
+
+print_cookies(Pre) ->
+ io:format("~s: ", [Pre]),
+ print_cookies2(httpc:which_cookies()).
+
+print_cookies2([]) ->
+ ok;
+print_cookies2([{cookies, Cookies}|Rest]) ->
+ print_cookies3("Cookies", Cookies),
+ print_cookies2(Rest);
+print_cookies2([{session_cookies, Cookies}|Rest]) ->
+ print_cookies3("Session Cookies", Cookies),
+ print_cookies2(Rest);
+print_cookies2([_|Rest]) ->
+ print_cookies2(Rest).
+
+print_cookies3(Header, []) ->
+ io:format(" ~s: []", [Header]);
+print_cookies3(Header, Cookies) ->
+ io:format(" ~s: ", [Header]),
+ Prefix = " ",
+ PrintCookie =
+ fun(Cookie) ->
+ io:format("~s", [httpc_cookie:image_of(Prefix, Cookie)])
+ end,
+ lists:foreach(PrintCookie, Cookies).
+
update_cookie(doc)->
- ["Test that a cookie can be updated."];
+ ["Test that a (plain) cookie can be updated."];
update_cookie(suite) ->
[];
-update_cookie(Config) when is_list(Config)->
- SetCookieHeaders = [{"set-cookie", "test_cookie=true; path=/;"
- "max-age=6500"},
- {"set-cookie", "test_cookie2=true; path=/;"
- "max-age=6500"}],
- http:verify_cookies(SetCookieHeaders, ?URL),
- {"cookie", "$Version=0; test_cookie2=true; $Path=/; "
- "test_cookie=true; $Path=/"} = http:cookie_header(?URL),
- NewSetCookieHeaders = [{"set-cookie", "test_cookie=false; "
- "path=/;max-age=6500"}],
- http:verify_cookies(NewSetCookieHeaders, ?URL),
- {"cookie", "$Version=0; test_cookie2=true; $Path=/; "
- "test_cookie=false; $Path=/"} = http:cookie_header(?URL).
-
+update_cookie(Config) when is_list(Config) ->
+ print_cookies("Cookies before store"),
+
+ SetCookieHeaders =
+ [{"set-cookie", "test_cookie=true; path=/; max-age=6500"},
+ {"set-cookie", "test_cookie2=true; path=/; max-age=6500"}],
+ httpc:store_cookies(SetCookieHeaders, ?URL),
+ print_cookies("Cookies after first store"),
+ ExpectCookie1 =
+ "$Version=0; "
+ "test_cookie=true; $Path=/; "
+ "test_cookie2=true; $Path=/",
+ expect_cookie_header(1, ExpectCookie1),
+
+ NewSetCookieHeaders =
+ [{"set-cookie", "test_cookie=false; path=/; max-age=6500"}],
+ httpc:store_cookies(NewSetCookieHeaders, ?URL),
+ print_cookies("Cookies after second store"),
+ ExpectCookie2 =
+ "$Version=0; "
+ "test_cookie2=true; $Path=/; "
+ "test_cookie=false; $Path=/",
+ expect_cookie_header(2, ExpectCookie2).
+
update_cookie_session(doc)->
- ["Test that a cookie can be updated."];
+ ["Test that a session cookie can be updated."];
update_cookie_session(suite) ->
[];
update_cookie_session(Config) when is_list(Config)->
+ print_cookies("Cookies before store"),
+
SetCookieHeaders = [{"set-cookie", "test_cookie=true; path=/"},
{"set-cookie", "test_cookie2=true; path=/"}],
- http:verify_cookies(SetCookieHeaders, ?URL),
- {"cookie", "$Version=0; test_cookie2=true; $Path=/; "
- "test_cookie=true; $Path=/"} = http:cookie_header(?URL),
+ httpc:store_cookies(SetCookieHeaders, ?URL),
+ print_cookies("Cookies after first store"),
+ ExpectedCookie1 =
+ "$Version=0; test_cookie=true; $Path=/; test_cookie2=true; $Path=/",
+ expect_cookie_header(1, ExpectedCookie1),
+
NewSetCookieHeaders = [{"set-cookie", "test_cookie=false; path=/"}],
- http:verify_cookies(NewSetCookieHeaders, ?URL),
- {"cookie", "$Version=0; test_cookie2=true; $Path=/; "
- "test_cookie=false; $Path=/"} = http:cookie_header(?URL).
+ httpc:store_cookies(NewSetCookieHeaders, ?URL),
+ print_cookies("Cookies after second store"),
+ ExpectedCookie2 =
+ "$Version=0; test_cookie2=true; $Path=/; test_cookie=false; $Path=/",
+ expect_cookie_header(2, ExpectedCookie2).
cookie_attributes(doc) ->
diff --git a/lib/inets/test/httpd_SUITE.erl b/lib/inets/test/httpd_SUITE.erl
index fde5178879..1112208295 100644
--- a/lib/inets/test/httpd_SUITE.erl
+++ b/lib/inets/test/httpd_SUITE.erl
@@ -207,8 +207,11 @@
-export([ticket_5775/1,ticket_5865/1,ticket_5913/1,ticket_6003/1,
ticket_7304/1]).
-%%% Misc
--export([ipv6_hostname/1, ipv6_address/1]).
+%%% IPv6 tests
+-export([ipv6_hostname_ipcomm/0, ipv6_hostname_ipcomm/1,
+ ipv6_address_ipcomm/0, ipv6_address_ipcomm/1,
+ ipv6_hostname_essl/0, ipv6_hostname_essl/1,
+ ipv6_address_essl/0, ipv6_address_essl/1]).
%% Help functions
-export([cleanup_mnesia/0, setup_mnesia/0, setup_mnesia/1]).
@@ -241,9 +244,15 @@
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- [{group, ip}, {group, ssl}, {group, http_1_1_ip},
- {group, http_1_0_ip}, {group, http_0_9_ip},
- {group, tickets}].
+ [
+ {group, ip},
+ {group, ssl},
+ {group, http_1_1_ip},
+ {group, http_1_0_ip},
+ {group, http_0_9_ip},
+ {group, ipv6},
+ {group, tickets}
+ ].
groups() ->
[{ip, [],
@@ -329,7 +338,8 @@ groups() ->
{http_1_0_ip, [],
[ip_head_1_0, ip_get_1_0, ip_post_1_0]},
{http_0_9_ip, [], [ip_get_0_9]},
- {ipv6, [], [ipv6_hostname, ipv6_address]},
+ {ipv6, [], [ipv6_hostname_ipcomm, ipv6_address_ipcomm,
+ ipv6_hostname_essl, ipv6_address_essl]},
{tickets, [],
[ticket_5775, ticket_5865, ticket_5913, ticket_6003,
ticket_7304]}].
@@ -408,10 +418,10 @@ init_per_testcase2(Case, Config) ->
"~n Config: ~p"
"~n", [?MODULE, Case, Config]),
- IpNormal = integer_to_list(?IP_PORT) ++ ".conf",
- IpHtacess = integer_to_list(?IP_PORT) ++ "htacess.conf",
- SslNormal = integer_to_list(?SSL_PORT) ++ ".conf",
- SslHtacess = integer_to_list(?SSL_PORT) ++ "htacess.conf",
+ IpNormal = integer_to_list(?IP_PORT) ++ ".conf",
+ IpHtaccess = integer_to_list(?IP_PORT) ++ "htaccess.conf",
+ SslNormal = integer_to_list(?SSL_PORT) ++ ".conf",
+ SslHtaccess = integer_to_list(?SSL_PORT) ++ "htaccess.conf",
DataDir = ?config(data_dir, Config),
SuiteTopDir = ?config(suite_top_dir, Config),
@@ -471,9 +481,9 @@ init_per_testcase2(Case, Config) ->
io:format(user, "~w:init_per_testcase2(~w) -> ip testcase setups~n",
[?MODULE, Case]),
create_config([{port, ?IP_PORT}, {sock_type, ip_comm} | NewConfig],
- normal_acess, IpNormal),
+ normal_access, IpNormal),
create_config([{port, ?IP_PORT}, {sock_type, ip_comm} | NewConfig],
- mod_htaccess, IpHtacess),
+ mod_htaccess, IpHtaccess),
%% To be used by SSL test cases
io:format(user, "~w:init_per_testcase2(~w) -> ssl testcase setups~n",
@@ -491,9 +501,9 @@ init_per_testcase2(Case, Config) ->
end,
create_config([{port, ?SSL_PORT}, {sock_type, SocketType} | NewConfig],
- normal_acess, SslNormal),
+ normal_access, SslNormal),
create_config([{port, ?SSL_PORT}, {sock_type, SocketType} | NewConfig],
- mod_htaccess, SslHtacess),
+ mod_htaccess, SslHtaccess),
%% To be used by IPv6 test cases. Case-clause is so that
%% you can do ts:run(inets, httpd_SUITE, <test case>)
@@ -501,22 +511,52 @@ init_per_testcase2(Case, Config) ->
%% on 'test_host_ipv6_only' that will only be present
%% when you run the whole test suite due to shortcomings
%% of the test server.
- %% case (catch ?config(test_host_ipv6_only, Config)) of
- %% {_,IPv6Host,IPv6Adress,_,_} ->
- %% create_ipv6_config([{port, ?IP_PORT},
- %% {sock_type, ip_comm} | NewConfig],
- %% "ipv6_hostname.conf", IPv6Host),
- %% create_ipv6_config([{port, ?IP_PORT},
- %% {sock_type, ip_comm} | NewConfig],
- %% "ipv6_address.conf", IPv6Adress);
- %% _ ->
- %% ok
- %% end,
-
+
+ io:format(user, "~w:init_per_testcase2(~w) -> "
+ "maybe generate IPv6 config file(s)", [?MODULE, Case]),
+ NewConfig2 =
+ case atom_to_list(Case) of
+ "ipv6_" ++ _ ->
+ case (catch inets_test_lib:has_ipv6_support(NewConfig)) of
+ {ok, IPv6Address0} ->
+ {ok, Hostname} = inet:gethostname(),
+ IPv6Address = http_transport:ipv6_name(IPv6Address0),
+ create_ipv6_config([{port, ?IP_PORT},
+ {sock_type, ip_comm},
+ {ipv6_host, IPv6Address} |
+ NewConfig],
+ "ipv6_hostname_ipcomm.conf",
+ Hostname),
+ create_ipv6_config([{port, ?IP_PORT},
+ {sock_type, ip_comm},
+ {ipv6_host, IPv6Address} |
+ NewConfig],
+ "ipv6_address_ipcomm.conf",
+ IPv6Address),
+ create_ipv6_config([{port, ?SSL_PORT},
+ {sock_type, essl},
+ {ipv6_host, IPv6Address} |
+ NewConfig],
+ "ipv6_hostname_essl.conf",
+ Hostname),
+ create_ipv6_config([{port, ?SSL_PORT},
+ {sock_type, essl},
+ {ipv6_host, IPv6Address} |
+ NewConfig],
+ "ipv6_address_essl.conf",
+ IPv6Address),
+ [{ipv6_host, IPv6Address} | NewConfig];
+ _ ->
+ NewConfig
+ end;
+ _ ->
+ NewConfig
+ end,
+
io:format(user, "~w:init_per_testcase2(~w) -> done~n",
[?MODULE, Case]),
- NewConfig.
+ NewConfig2.
init_per_testcase3(Case, Config) ->
@@ -547,10 +587,10 @@ init_per_testcase3(Case, Config) ->
[?MODULE, Case]),
inets:disable_trace();
_ ->
- %% TraceLevel = max,
io:format(user, "~w:init_per_testcase3(~w) -> enabling trace",
[?MODULE, Case]),
- TraceLevel = 70,
+ %% TraceLevel = 70,
+ TraceLevel = max,
TraceDest = io,
inets:enable_trace(TraceLevel, TraceDest, httpd)
end,
@@ -569,7 +609,7 @@ init_per_testcase3(Case, Config) ->
inets_test_lib:start_http_server(
filename:join(TcTopDir,
integer_to_list(?IP_PORT) ++
- "htacess.conf")),
+ "htaccess.conf")),
"mod_htaccess";
"ip_" ++ Rest ->
inets_test_lib:start_http_server(
@@ -602,11 +642,11 @@ init_per_testcase3(Case, Config) ->
case inets_test_lib:start_http_server_ssl(
filename:join(TcTopDir,
integer_to_list(?SSL_PORT) ++
- "htacess.conf"), SslTag) of
+ "htaccess.conf"), SslTag) of
ok ->
"mod_htaccess";
Other ->
- error_logger:info_report("Other: ~p~n", [Other]),
+ error_logger:info_msg("Other: ~p~n", [Other]),
{skip, "SSL does not seem to be supported"}
end;
[X, $s, $s, $l, $_ | Rest] ->
@@ -623,20 +663,17 @@ init_per_testcase3(Case, Config) ->
ok ->
Rest;
Other ->
- error_logger:info_report("Other: ~p~n", [Other]),
+ error_logger:info_msg("Other: ~p~n", [Other]),
{skip, "SSL does not seem to be supported"}
end;
"ipv6_" ++ _ = TestCaseStr ->
- {ok, Hostname} = inet:gethostname(),
-
- case lists:member(list_to_atom(Hostname),
- ?config(ipv6_hosts, Config)) of
- true ->
+ case inets_test_lib:has_ipv6_support() of
+ {ok, _} ->
inets_test_lib:start_http_server(
filename:join(TcTopDir,
TestCaseStr ++ ".conf"));
- false ->
+ _ ->
{skip, "Host does not support IPv6"}
end
end,
@@ -650,8 +687,8 @@ init_per_testcase3(Case, Config) ->
"mod_htaccess" ->
ServerRoot = ?config(server_root, Config),
Path = filename:join([ServerRoot, "htdocs"]),
- catch remove_htacess(Path),
- create_htacess_data(Path, ?config(address, Config)),
+ catch remove_htaccess(Path),
+ create_htaccess_data(Path, ?config(address, Config)),
[{watchdog, Dog} | NewConfig];
"range" ->
ServerRoot = ?config(server_root, Config),
@@ -2409,30 +2446,76 @@ ip_mod_cgi_chunked_encoding_test(Config) when is_list(Config) ->
ok.
%-------------------------------------------------------------------------
-ipv6_hostname(doc) ->
+
+ipv6_hostname_ipcomm() ->
+ [{require, ipv6_hosts}].
+ipv6_hostname_ipcomm(X) ->
+ SocketType = ip_comm,
+ Port = ?IP_PORT,
+ ipv6_hostname(SocketType, Port, X).
+
+ipv6_hostname_essl() ->
+ [{require, ipv6_hosts}].
+ipv6_hostname_essl(X) ->
+ SocketType = essl,
+ Port = ?SSL_PORT,
+ ipv6_hostname(SocketType, Port, X).
+
+ipv6_hostname(_SocketType, _Port, doc) ->
["Test standard ipv6 address"];
-ipv6_hostname(suite)->
+ipv6_hostname(_SocketType, _Port, suite)->
[];
-ipv6_hostname(Config) when is_list(Config) ->
+ipv6_hostname(SocketType, Port, Config) when is_list(Config) ->
+ tsp("ipv6_hostname -> entry with"
+ "~n SocketType: ~p"
+ "~n Port: ~p"
+ "~n Config: ~p", [SocketType, Port, Config]),
Host = ?config(host, Config),
- httpd_test_lib:verify_request(ip_comm, Host, ?IP_PORT, node(),
- "GET / HTTP/1.1\r\n\r\n",
- [{statuscode, 200},
- {version, "HTTP/1.1"}]),
+ URI = "GET HTTP://" ++
+ Host ++ ":" ++ integer_to_list(Port) ++ "/ HTTP/1.1\r\n\r\n",
+ tsp("ipv6_hostname -> Host: ~p", [Host]),
+ httpd_test_lib:verify_request(SocketType, Host, Port, [inet6],
+ node(),
+ URI,
+ [{statuscode, 200}, {version, "HTTP/1.1"}]),
ok.
%%-------------------------------------------------------------------------
-ipv6_address(doc) ->
+
+ipv6_address_ipcomm() ->
+ [{require, ipv6_hosts}].
+ipv6_address_ipcomm(X) ->
+ SocketType = ip_comm,
+ Port = ?IP_PORT,
+ ipv6_address(SocketType, Port, X).
+
+ipv6_address_essl() ->
+ [{require, ipv6_hosts}].
+ipv6_address_essl(X) ->
+ SocketType = essl,
+ Port = ?SSL_PORT,
+ ipv6_address(SocketType, Port, X).
+
+ipv6_address(_SocketType, _Port, doc) ->
["Test standard ipv6 address"];
-ipv6_address(suite)->
+ipv6_address(_SocketType, _Port, suite)->
[];
-ipv6_address(Config) when is_list(Config) ->
- httpd_test_lib:verify_request(ip_comm, ?IPV6_LOCAL_HOST, ?IP_PORT,
- node(), "GET / HTTP/1.1\r\n\r\n",
- [{statuscode, 200},
- {version, "HTTP/1.1"}]),
+ipv6_address(SocketType, Port, Config) when is_list(Config) ->
+ tsp("ipv6_address -> entry with"
+ "~n SocketType: ~p"
+ "~n Port: ~p"
+ "~n Config: ~p", [SocketType, Port, Config]),
+ Host = ?config(host, Config),
+ tsp("ipv6_address -> Host: ~p", [Host]),
+ URI = "GET HTTP://" ++
+ Host ++ ":" ++ integer_to_list(Port) ++ "/ HTTP/1.1\r\n\r\n",
+ httpd_test_lib:verify_request(SocketType, Host, Port, [inet6],
+ node(),
+ URI,
+ [{statuscode, 200}, {version, "HTTP/1.1"}]),
ok.
+
%%--------------------------------------------------------------------
ticket_5775(doc) ->
["Tests that content-length is correct"];
@@ -2805,22 +2888,22 @@ cleanup_mnesia() ->
mnesia:delete_schema([node()]),
ok.
-create_htacess_data(Path, IpAddress)->
- create_htacess_dirs(Path),
+create_htaccess_data(Path, IpAddress)->
+ create_htaccess_dirs(Path),
create_html_file(filename:join([Path,"ht/open/dummy.html"])),
create_html_file(filename:join([Path,"ht/blocknet/dummy.html"])),
create_html_file(filename:join([Path,"ht/secret/dummy.html"])),
create_html_file(filename:join([Path,"ht/secret/top_secret/dummy.html"])),
- create_htacess_file(filename:join([Path,"ht/open/.htaccess"]),
+ create_htaccess_file(filename:join([Path,"ht/open/.htaccess"]),
Path, "user one Aladdin"),
- create_htacess_file(filename:join([Path,"ht/secret/.htaccess"]),
+ create_htaccess_file(filename:join([Path,"ht/secret/.htaccess"]),
Path, "group group1 group2"),
- create_htacess_file(filename:join([Path,
+ create_htaccess_file(filename:join([Path,
"ht/secret/top_secret/.htaccess"]),
Path, "user four"),
- create_htacess_file(filename:join([Path,"ht/blocknet/.htaccess"]),
+ create_htaccess_file(filename:join([Path,"ht/blocknet/.htaccess"]),
Path, nouser, IpAddress),
create_user_group_file(filename:join([Path,"ht","users.file"]),
@@ -2835,7 +2918,7 @@ create_html_file(PathAndFileName)->
"<html><head><title>test</title></head>
<body>testar</body></html>")).
-create_htacess_file(PathAndFileName, BaseDir, RequireData)->
+create_htaccess_file(PathAndFileName, BaseDir, RequireData)->
file:write_file(PathAndFileName,
list_to_binary(
"AuthUserFile "++ BaseDir ++
@@ -2844,7 +2927,7 @@ create_htacess_file(PathAndFileName, BaseDir, RequireData)->
" Basic\n<Limit>\nrequire " ++ RequireData ++
"\n</Limit>")).
-create_htacess_file(PathAndFileName, BaseDir, nouser, IpAddress)->
+create_htaccess_file(PathAndFileName, BaseDir, nouser, IpAddress)->
file:write_file(PathAndFileName,list_to_binary(
"AuthUserFile "++ BaseDir ++
"/ht/users.file\nAuthGroupFile " ++
@@ -2858,14 +2941,14 @@ create_htacess_file(PathAndFileName, BaseDir, nouser, IpAddress)->
create_user_group_file(PathAndFileName, Data)->
file:write_file(PathAndFileName, list_to_binary(Data)).
-create_htacess_dirs(Path)->
+create_htaccess_dirs(Path)->
ok = file:make_dir(filename:join([Path,"ht"])),
ok = file:make_dir(filename:join([Path,"ht/open"])),
ok = file:make_dir(filename:join([Path,"ht/blocknet"])),
ok = file:make_dir(filename:join([Path,"ht/secret"])),
ok = file:make_dir(filename:join([Path,"ht/secret/top_secret"])).
-remove_htacess_dirs(Path)->
+remove_htaccess_dirs(Path)->
file:del_dir(filename:join([Path,"ht/secret/top_secret"])),
file:del_dir(filename:join([Path,"ht/secret"])),
file:del_dir(filename:join([Path,"ht/blocknet"])),
@@ -2888,7 +2971,7 @@ format_ip(IpAddress,Pos)when Pos > 0->
format_ip(IpAddress, _Pos)->
"1" ++ IpAddress.
-remove_htacess(Path)->
+remove_htaccess(Path)->
file:delete(filename:join([Path,"ht/open/dummy.html"])),
file:delete(filename:join([Path,"ht/secret/dummy.html"])),
file:delete(filename:join([Path,"ht/secret/top_secret/dummy.html"])),
@@ -2899,7 +2982,7 @@ remove_htacess(Path)->
file:delete(filename:join([Path,"ht/secret/top_secret/.htaccess"])),
file:delete(filename:join([Path,"ht","users.file"])),
file:delete(filename:join([Path,"ht","groups.file"])),
- remove_htacess_dirs(Path).
+ remove_htaccess_dirs(Path).
dos_hostname_poll(Type, Host, Port, Node, Hosts) ->
@@ -2939,35 +3022,66 @@ create_range_data(Path) ->
"12345678901234567890",
"12345678901234567890"])).
-%% create_ipv6_config(Config, FileName, Ipv6Address) ->
-%% ServerRoot = ?config(server_root, Config),
-%% TcTopDir = ?config(tc_top_dir, Config),
-%% Port = ?config(port, Config),
-%% SockType = ?config(sock_type, Config),
-%%
-%% MaxHdrSz = io_lib:format("~p", [256]),
-%% MaxHdrAct = io_lib:format("~p", [close]),
-%%
-%% Mod_order = "Modules mod_alias mod_auth mod_esi mod_actions mod_cgi"
-%% " mod_include mod_dir mod_get mod_head"
-%% " mod_log mod_disk_log mod_trace",
-%%
-%% HttpConfig = [cline(["BindAddress ", "[" ++ Ipv6Address ++"]|inet6"]),
-%% cline(["Port ", integer_to_list(Port)]),
-%% cline(["ServerName ", "httpc_test"]),
-%% cline(["SocketType ", atom_to_list(SockType)]),
-%% cline([Mod_order]),
-%% cline(["ServerRoot ", ServerRoot]),
-%% cline(["DocumentRoot ",
-%% filename:join(ServerRoot, "htdocs")]),
-%% cline(["MaxHeaderSize ",MaxHdrSz]),
-%% cline(["MaxHeaderAction ",MaxHdrAct]),
-%% cline(["DirectoryIndex ", "index.html "]),
-%% cline(["DefaultType ", "text/plain"])],
-%% ConfigFile = filename:join([TcTopDir,FileName]),
-%% {ok, Fd} = file:open(ConfigFile, [write]),
-%% ok = file:write(Fd, lists:flatten(HttpConfig)),
-%% ok = file:close(Fd).
+create_ipv6_config(Config, FileName, Ipv6Address) ->
+ ServerRoot = ?config(server_root, Config),
+ TcTopDir = ?config(tc_top_dir, Config),
+ Port = ?config(port, Config),
+ SockType = ?config(sock_type, Config),
+ Mods = io_lib:format("~p", [httpd_mod]),
+ Funcs = io_lib:format("~p", [ssl_password_cb]),
+ Host = ?config(ipv6_host, Config),
+
+ MaxHdrSz = io_lib:format("~p", [256]),
+ MaxHdrAct = io_lib:format("~p", [close]),
+
+ Mod_order = "Modules mod_alias mod_auth mod_esi mod_actions mod_cgi"
+ " mod_include mod_dir mod_get mod_head"
+ " mod_log mod_disk_log mod_trace",
+
+ SSL =
+ if
+ (SockType =:= ssl) orelse
+ (SockType =:= ossl) orelse
+ (SockType =:= essl) ->
+ [cline(["SSLCertificateFile ",
+ filename:join(ServerRoot, "ssl/ssl_server.pem")]),
+ cline(["SSLCertificateKeyFile ",
+ filename:join(ServerRoot, "ssl/ssl_server.pem")]),
+ cline(["SSLCACertificateFile ",
+ filename:join(ServerRoot, "ssl/ssl_server.pem")]),
+ cline(["SSLPasswordCallbackModule ", Mods]),
+ cline(["SSLPasswordCallbackFunction ", Funcs]),
+ cline(["SSLVerifyClient 0"]),
+ cline(["SSLVerifyDepth 1"])];
+ true ->
+ []
+ end,
+
+ BindAddress = "[" ++ Ipv6Address ++"]|inet6",
+
+ HttpConfig =
+ [cline(["BindAddress ", BindAddress]),
+ cline(["Port ", integer_to_list(Port)]),
+ cline(["ServerName ", Host]),
+ cline(["SocketType ", atom_to_list(SockType)]),
+ cline([Mod_order]),
+ cline(["ServerRoot ", ServerRoot]),
+ cline(["DocumentRoot ", filename:join(ServerRoot, "htdocs")]),
+ cline(["MaxHeaderSize ",MaxHdrSz]),
+ cline(["MaxHeaderAction ",MaxHdrAct]),
+ cline(["DirectoryIndex ", "index.html "]),
+ cline(["DefaultType ", "text/plain"]),
+ SSL],
+ ConfigFile = filename:join([TcTopDir,FileName]),
+ {ok, Fd} = file:open(ConfigFile, [write]),
+ ok = file:write(Fd, lists:flatten(HttpConfig)),
+ ok = file:close(Fd).
+
+
+%% tsp(F) ->
+%% inets_test_lib:tsp(F).
+tsp(F, A) ->
+ inets_test_lib:tsp(F, A).
tsf(Reason) ->
- test_server:fail(Reason).
+ inets_test_lib:tsf(Reason).
diff --git a/lib/inets/test/httpd_test_lib.erl b/lib/inets/test/httpd_test_lib.erl
index 3189a758a5..2903aaafa5 100644
--- a/lib/inets/test/httpd_test_lib.erl
+++ b/lib/inets/test/httpd_test_lib.erl
@@ -22,7 +22,7 @@
-include("inets_test_lib.hrl").
%% Poll functions
--export([verify_request/6, verify_request/7, is_expect/1]).
+-export([verify_request/6, verify_request/7, verify_request/8, is_expect/1]).
-record(state, {request, % string()
socket, % socket()
@@ -81,33 +81,57 @@
%%------------------------------------------------------------------
verify_request(SocketType, Host, Port, Node, RequestStr, Options) ->
verify_request(SocketType, Host, Port, Node, RequestStr, Options, 30000).
-verify_request(SocketType, Host, Port, Node, RequestStr, Options, TimeOut) ->
- {ok, Socket} = inets_test_lib:connect_bin(SocketType, Host, Port),
+verify_request(SocketType, Host, Port, TranspOpts, Node, RequestStr, Options)
+ when is_list(TranspOpts) ->
+ verify_request(SocketType, Host, Port, TranspOpts, Node, RequestStr, Options, 30000);
+verify_request(SocketType, Host, Port, Node, RequestStr, Options, TimeOut)
+ when (is_integer(TimeOut) orelse (TimeOut =:= infinity)) ->
+ verify_request(SocketType, Host, Port, [], Node, RequestStr, Options, TimeOut).
+verify_request(SocketType, Host, Port, TranspOpts, Node, RequestStr, Options, TimeOut) ->
+ tsp("verify_request -> entry with"
+ "~n SocketType: ~p"
+ "~n Host: ~p"
+ "~n Port: ~p"
+ "~n TranspOpts: ~p"
+ "~n Node: ~p"
+ "~n Options: ~p"
+ "~n TimeOut: ~p",
+ [SocketType, Host, Port, TranspOpts, Node, Options, TimeOut]),
+ case (catch inets_test_lib:connect_bin(SocketType, Host, Port, TranspOpts)) of
+ {ok, Socket} ->
+ tsp("verify_request -> connected - now send message"),
+ SendRes = inets_test_lib:send(SocketType, Socket, RequestStr),
+ tsp("verify_request -> send result: "
+ "~n ~p", [SendRes]),
+ State = case inets_regexp:match(RequestStr, "printenv") of
+ nomatch ->
+ #state{};
+ _ ->
+ #state{print = true}
+ end,
+
+ case request(State#state{request = RequestStr,
+ socket = Socket}, TimeOut) of
+ {error, Reason} ->
+ tsp("request failed: "
+ "~n Reason: ~p", [Reason]),
+ {error, Reason};
+ NewState ->
+ tsp("validate reply: "
+ "~n NewState: ~p", [NewState]),
+ ValidateResult =
+ validate(RequestStr, NewState, Options, Node, Port),
+ tsp("validation result: "
+ "~n ~p", [ValidateResult]),
+ inets_test_lib:close(SocketType, Socket),
+ ValidateResult
+ end;
- _SendRes = inets_test_lib:send(SocketType, Socket, RequestStr),
-
- State = case inets_regexp:match(RequestStr, "printenv") of
- nomatch ->
- #state{};
- _ ->
- #state{print = true}
- end,
-
- case request(State#state{request = RequestStr,
- socket = Socket}, TimeOut) of
- {error, Reason} ->
- tsp("request failed: "
- "~n Reason: ~p", [Reason]),
- {error, Reason};
- NewState ->
- tsp("validate reply: "
- "~n NewState: ~p", [NewState]),
- ValidateResult = validate(RequestStr, NewState, Options,
- Node, Port),
- tsp("validation result: "
- "~n ~p", [ValidateResult]),
- inets_test_lib:close(SocketType, Socket),
- ValidateResult
+ ConnectError ->
+ tsp("verify_request -> connect failed: "
+ "~n ~p"
+ "~n", [ConnectError]),
+ tsf({connect_failure, ConnectError})
end.
request(#state{mfa = {Module, Function, Args},
@@ -214,7 +238,10 @@ validate(RequestStr, #state{status_line = {Version, StatusCode, _},
headers = Headers,
body = Body}, Options, N, P) ->
- %io:format("Status~p: H:~p B:~p~n", [StatusCode, Headers, Body]),
+ %% tsp("validate -> entry with"
+ %% "~n StatusCode: ~p"
+ %% "~n Headers: ~p"
+ %% "~n Body: ~p", [StatusCode, Headers, Body]),
check_version(Version, Options),
case lists:keysearch(statuscode, 1, Options) of
{value, _} ->
@@ -342,8 +369,10 @@ print(_, _, #state{print = false}) ->
ok.
-%% tsp(F) ->
-%% tsp(F, []).
+tsp(F) ->
+ inets_test_lib:tsp(F).
tsp(F, A) ->
- test_server:format("~p ~p:" ++ F ++ "~n", [self(), ?MODULE | A]).
+ inets_test_lib:tsp(F, A).
+tsf(Reason) ->
+ inets_test_lib:tsf(Reason).
diff --git a/lib/inets/test/inets_test_lib.erl b/lib/inets/test/inets_test_lib.erl
index 6cedaf9638..2e19c41f16 100644
--- a/lib/inets/test/inets_test_lib.erl
+++ b/lib/inets/test/inets_test_lib.erl
@@ -26,18 +26,64 @@
-export([start_http_server/1, start_http_server/2]).
-export([start_http_server_ssl/1, start_http_server_ssl/2]).
-export([hostname/0]).
--export([connect_bin/3, connect_byte/3, send/3, close/2]).
+-export([connect_bin/3, connect_bin/4,
+ connect_byte/3, connect_byte/4,
+ send/3, close/2]).
-export([copy_file/3, copy_files/2, copy_dirs/2, del_dirs/1]).
-export([info/4, log/4, debug/4, print/4]).
+-export([tsp/1, tsp/2, tsf/1]).
-export([check_body/1]).
-export([millis/0, millis_diff/2, hours/1, minutes/1, seconds/1, sleep/1]).
--export([oscmd/1]).
+-export([oscmd/1, has_ipv6_support/1]).
-export([non_pc_tc_maybe_skip/4, os_based_skip/1, skip/3, fail/3]).
-export([flush/0]).
-export([start_node/1, stop_node/1]).
%% -- Misc os command and stuff
+has_ipv6_support(Config) ->
+ case lists:keysearch(ipv6_hosts, 1, Config) of
+ false ->
+ %% Do a basic check to se if
+ %% our own host has a working IPv6 address...
+ tsp("has_ipv6_support -> no ipv6_hosts config"),
+ {ok, Hostname} = inet:gethostname(),
+ case inet:getaddrs(Hostname, inet6) of
+ {ok, [Addr|_]} when is_tuple(Addr) andalso
+ (element(1, Addr) =/= 0) ->
+ %% We actually need to test that the addr can be used,
+ %% this is done by attempting to create a (tcp)
+ %% listen socket
+ tsp("has_ipv6_support -> check Addr: ~p", [Addr]),
+ case (catch gen_tcp:listen(0, [inet6, {ip, Addr}])) of
+ {ok, LSock} ->
+ tsp("has_ipv6_support -> we are ipv6 host"),
+ gen_tcp:close(LSock),
+ {ok, Addr};
+ _ ->
+ undefined
+ end;
+ _ ->
+ undefined
+ end;
+ {value, {_, Hosts}} when is_list(Hosts) ->
+ %% Check if our host is in the list of *known* IPv6 hosts
+ tsp("has_ipv6_support -> Hosts: ~p", [Hosts]),
+ {ok, Hostname} = inet:gethostname(),
+ case lists:member(list_to_atom(Hostname), Hosts) of
+ true ->
+ tsp("has_ipv6_support -> we are known ipv6 host"),
+ {ok, [Addr|_]} = inet:getaddrs(Hostname, inet6),
+ {ok, Addr};
+ false ->
+ undefined
+ end;
+
+ _ ->
+ undefined
+
+ end.
+
oscmd(Cmd) ->
string:strip(os:cmd(Cmd), right, $\n).
@@ -87,31 +133,34 @@ start_http_server(Conf) ->
start_http_server(Conf, ?HTTP_DEFAULT_SSL_KIND).
start_http_server(Conf, essl = _SslTag) ->
+ tsp("start_http_server(essl) -> entry - try start crypto and public_key"),
application:start(crypto),
+ application:start(public_key),
do_start_http_server(Conf);
-start_http_server(Conf, _SslTag) ->
+start_http_server(Conf, SslTag) ->
+ tsp("start_http_server(~w) -> entry", [SslTag]),
do_start_http_server(Conf).
do_start_http_server(Conf) ->
- tsp("start http server with "
+ tsp("do_start_http_server -> entry with"
"~n Conf: ~p"
"~n", [Conf]),
application:load(inets),
case application:set_env(inets, services, [{httpd, Conf}]) of
ok ->
+ tsp("start_http_server -> httpd conf stored in inets app env"),
case application:start(inets) of
ok ->
+ tsp("start_http_server -> inets started"),
ok;
Error1 ->
- test_server:format("<ERROR> Failed starting application: "
- "~n Error: ~p"
- "~n", [Error1]),
+ tsp("<ERROR> Failed starting application: "
+ "~n Error1: ~p", [Error1]),
Error1
end;
Error2 ->
- test_server:format("<ERROR> Failed set application env: "
- "~n Error: ~p"
- "~n", [Error2]),
+ tsp("<ERROR> Failed set application env: "
+ "~n Error: ~p", [Error2]),
Error2
end.
@@ -285,29 +334,45 @@ os_based_skip(_) ->
%% Host -> atom() | string() | {A, B, C, D}
%% Port -> integer()
-connect_bin(ssl, Host, Port) ->
- connect(ssl, Host, Port, [binary, {packet,0}]);
-connect_bin(ossl, Host, Port) ->
- connect(ssl, Host, Port, [{ssl_imp, old}, binary, {packet,0}]);
-connect_bin(essl, Host, Port) ->
- connect(ssl, Host, Port, [{ssl_imp, new}, binary, {packet,0}, {reuseaddr, true}]);
-connect_bin(ip_comm, Host, Port) ->
- Opts = [inet6, binary, {packet,0}],
+connect_bin(SockType, Host, Port) ->
+ connect_bin(SockType, Host, Port, []).
+
+connect_bin(ssl, Host, Port, Opts0) ->
+ Opts = [binary, {packet,0} | Opts0],
+ connect(ssl, Host, Port, Opts);
+connect_bin(ossl, Host, Port, Opts0) ->
+ Opts = [{ssl_imp, old}, binary, {packet,0} | Opts0],
+ connect(ssl, Host, Port, Opts);
+connect_bin(essl, Host, Port, Opts0) ->
+ Opts = [{ssl_imp, new}, binary, {packet,0}, {reuseaddr, true} | Opts0],
+ connect(ssl, Host, Port, Opts);
+connect_bin(ip_comm, Host, Port, Opts0) ->
+ Opts = [binary, {packet, 0} | Opts0],
connect(ip_comm, Host, Port, Opts).
+
+connect_byte(SockType, Host, Port) ->
+ connect_byte(SockType, Host, Port, []).
-connect_byte(ssl, Host, Port) ->
- connect(ssl, Host, Port, [{packet,0}]);
-connect_byte(ossl, Host, Port) ->
- connect(ssl, Host, Port, [{ssl_imp, old}, {packet,0}]);
-connect_byte(essl, Host, Port) ->
- connect(ssl, Host, Port, [{ssl_imp, new}, {packet,0}]);
-connect_byte(ip_comm, Host, Port) ->
- Opts = [inet6, {packet,0}],
+connect_byte(ssl, Host, Port, Opts0) ->
+ Opts = [{packet,0} | Opts0],
+ connect(ssl, Host, Port, Opts);
+connect_byte(ossl, Host, Port, Opts0) ->
+ Opts = [{ssl_imp, old}, {packet,0} | Opts0],
+ connect(ssl, Host, Port, Opts);
+connect_byte(essl, Host, Port, Opts0) ->
+ Opts = [{ssl_imp, new}, {packet,0} | Opts0],
+ connect(ssl, Host, Port, Opts);
+connect_byte(ip_comm, Host, Port, Opts0) ->
+ Opts = [{packet,0} | Opts0],
connect(ip_comm, Host, Port, Opts).
connect(ssl, Host, Port, Opts) ->
+ tsp("connect(ssl) -> entry with"
+ "~n Host: ~p"
+ "~n Port: ~p"
+ "~n Opts: ~p", [Host, Port, Opts]),
ssl:start(),
%% Does not support ipv6 in old ssl
case ssl:connect(Host, Port, Opts) of
@@ -319,21 +384,28 @@ connect(ssl, Host, Port, Opts) ->
Error
end;
connect(ip_comm, Host, Port, Opts) ->
+ tsp("connect(ip_comm) -> entry with"
+ "~n Host: ~p"
+ "~n Port: ~p"
+ "~n Opts: ~p", [Host, Port, Opts]),
case gen_tcp:connect(Host,Port, Opts) of
{ok, Socket} ->
- %% tsp("connect success"),
+ tsp("connect success"),
{ok, Socket};
{error, nxdomain} ->
- tsp("nxdomain opts: ~p", [Opts]),
+ tsp("connect error nxdomain when opts: ~p", [Opts]),
connect(ip_comm, Host, Port, lists:delete(inet6, Opts));
{error, eafnosupport} ->
- tsp("eafnosupport opts: ~p", [Opts]),
+ tsp("connect error eafnosupport when opts: ~p", [Opts]),
+ connect(ip_comm, Host, Port, lists:delete(inet6, Opts));
+ {error, econnreset} ->
+ tsp("connect error econnreset when opts: ~p", [Opts]),
connect(ip_comm, Host, Port, lists:delete(inet6, Opts));
{error, enetunreach} ->
- tsp("eafnosupport opts: ~p", [Opts]),
+ tsp("connect error eafnosupport when opts: ~p", [Opts]),
connect(ip_comm, Host, Port, lists:delete(inet6, Opts));
{error, {enfile,_}} ->
- tsp("Error enfile"),
+ tsp("connect error enfile when opts: ~p", [Opts]),
{error, enfile};
Error ->
tsp("Unexpected error: "
@@ -414,7 +486,22 @@ flush() ->
tsp(F) ->
tsp(F, []).
tsp(F, A) ->
- test_server:format("~p ~p ~p:" ++ F ++ "~n", [node(), self(), ?MODULE | A]).
+ Timestamp = formated_timestamp(),
+ test_server:format("*** ~s ~p ~p ~w:" ++ F ++ "~n",
+ [Timestamp, node(), self(), ?MODULE | A]).
tsf(Reason) ->
test_server:fail(Reason).
+
+formated_timestamp() ->
+ format_timestamp( os:timestamp() ).
+
+format_timestamp({_N1, _N2, N3} = Now) ->
+ {Date, Time} = calendar:now_to_datetime(Now),
+ {YYYY,MM,DD} = Date,
+ {Hour,Min,Sec} = Time,
+ FormatDate =
+ io_lib:format("~.4w:~.2.0w:~.2.0w ~.2.0w:~.2.0w:~.2.0w 4~w",
+ [YYYY,MM,DD,Hour,Min,Sec,round(N3/1000)]),
+ lists:flatten(FormatDate).
+
diff --git a/lib/inets/vsn.mk b/lib/inets/vsn.mk
index c0e25a30e3..0e77bf913d 100644
--- a/lib/inets/vsn.mk
+++ b/lib/inets/vsn.mk
@@ -18,7 +18,7 @@
# %CopyrightEnd%
APPLICATION = inets
-INETS_VSN = 5.6
+INETS_VSN = 5.7.1
PRE_VSN =
APP_VSN = "$(APPLICATION)-$(INETS_VSN)$(PRE_VSN)"
diff --git a/lib/kernel/doc/src/Makefile b/lib/kernel/doc/src/Makefile
index de10e31d36..214e994889 100644
--- a/lib/kernel/doc/src/Makefile
+++ b/lib/kernel/doc/src/Makefile
@@ -104,6 +104,8 @@ TOP_SPECS_FILE = specs.xml
# ----------------------------------------------------
XML_FLAGS +=
+SPECS_ESRC = ../../src
+
SPECS_FLAGS = -I../../include
# ----------------------------------------------------
diff --git a/lib/kernel/doc/src/code.xml b/lib/kernel/doc/src/code.xml
index 6f85388c22..98cdd416b0 100644
--- a/lib/kernel/doc/src/code.xml
+++ b/lib/kernel/doc/src/code.xml
@@ -288,196 +288,156 @@
<datatypes>
<datatype>
+ <name name="load_ret"/>
+ </datatype>
+ <datatype>
<name name="load_error_rsn"/>
</datatype>
</datatypes>
<funcs>
<func>
- <name>set_path(Path) -> true | {error, What}</name>
+ <name name="set_path" arity="1"/>
<fsummary>Set the code server search path</fsummary>
- <type>
- <v>Path = [Dir]</v>
- <v>Dir = string()</v>
- <v>What = bad_directory | bad_path</v>
- </type>
<desc>
- <p>Sets the code path to the list of directories <c>Path</c>.</p>
+ <p>Sets the code path to the list of directories <c><anno>Path</anno></c>.</p>
<p>Returns <c>true</c> if successful, or
- <c>{error, bad_directory}</c> if any <c>Dir</c> is not
+ <c>{error, bad_directory}</c> if any <c><anno>Dir</anno></c> is not
the name of a directory, or <c>{error, bad_path}</c> if
the argument is invalid.</p>
</desc>
</func>
<func>
- <name>get_path() -> Path</name>
+ <name name="get_path" arity="0"/>
<fsummary>Return the code server search path</fsummary>
- <type>
- <v>Path = [Dir]</v>
- <v>Dir = string()</v>
- </type>
<desc>
<p>Returns the code path</p>
</desc>
</func>
<func>
- <name>add_path(Dir) -> true | {error, What}</name>
- <name>add_pathz(Dir) -> true | {error, What}</name>
+ <name name="add_path" arity="1"/>
+ <name name="add_pathz" arity="1"/>
<fsummary>Add a directory to the end of the code path</fsummary>
- <type>
- <v>Dir = string()</v>
- <v>What = bad_directory</v>
- </type>
+ <type name="add_path_ret"/>
<desc>
- <p>Adds <c>Dir</c> to the code path. The directory is added as
- the last directory in the new path. If <c>Dir</c> already
+ <p>Adds <c><anno>Dir</anno></c> to the code path. The directory is added as
+ the last directory in the new path. If <c><anno>Dir</anno></c> already
exists in the path, it is not added.</p>
<p>Returns <c>true</c> if successful, or
- <c>{error, bad_directory}</c> if <c>Dir</c> is not the name
+ <c>{error, bad_directory}</c> if <c><anno>Dir</anno></c> is not the name
of a directory.</p>
</desc>
</func>
<func>
- <name>add_patha(Dir) -> true | {error, What}</name>
+ <name name="add_patha" arity="1"/>
<fsummary>Add a directory to the beginning of the code path</fsummary>
- <type>
- <v>Dir = string()</v>
- <v>What = bad_directory</v>
- </type>
+ <type name="add_path_ret"/>
<desc>
- <p>Adds <c>Dir</c> to the beginning of the code path. If
- <c>Dir</c> already exists, it is removed from the old
+ <p>Adds <c><anno>Dir</anno></c> to the beginning of the code path. If
+ <c><anno>Dir</anno></c> already exists, it is removed from the old
position in the code path.</p>
<p>Returns <c>true</c> if successful, or
- <c>{error, bad_directory}</c> if <c>Dir</c> is not the name
+ <c>{error, bad_directory}</c> if <c><anno>Dir</anno></c> is not the name
of a directory.</p>
</desc>
</func>
<func>
- <name>add_paths(Dirs) -> ok</name>
- <name>add_pathsz(Dirs) -> ok</name>
+ <name name="add_paths" arity="1"/>
+ <name name="add_pathsz" arity="1"/>
<fsummary>Add directories to the end of the code path</fsummary>
- <type>
- <v>Dirs = [Dir]</v>
- <v>Dir = string()</v>
- </type>
<desc>
- <p>Adds the directories in <c>Dirs</c> to the end of the code
- path. If a <c>Dir</c> already exists, it is not added. This
+ <p>Adds the directories in <c><anno>Dirs</anno></c> to the end of the code
+ path. If a <c><anno>Dir</anno></c> already exists, it is not added. This
function always returns <c>ok</c>, regardless of the validity
- of each individual <c>Dir</c>.</p>
+ of each individual <c><anno>Dir</anno></c>.</p>
</desc>
</func>
<func>
- <name>add_pathsa(Dirs) -> ok</name>
+ <name name="add_pathsa" arity="1"/>
<fsummary>Add directories to the beginning of the code path</fsummary>
- <type>
- <v>Dirs = [Dir]</v>
- <v>Dir = string()</v>
- </type>
<desc>
- <p>Adds the directories in <c>Dirs</c> to the beginning of
- the code path. If a <c>Dir</c> already exists, it is removed
+ <p>Adds the directories in <c><anno>Dirs</anno></c> to the beginning of
+ the code path. If a <c><anno>Dir</anno></c> already exists, it is removed
from the old position in the code path. This function always
returns <c>ok</c>, regardless of the validity of each
- individual <c>Dir</c>.</p>
+ individual <c><anno>Dir</anno></c>.</p>
</desc>
</func>
<func>
- <name>del_path(Name | Dir) -> true | false | {error, What}</name>
+ <name name="del_path" arity="1"/>
<fsummary>Delete a directory from the code path</fsummary>
- <type>
- <v>Name = atom()</v>
- <v>Dir = string()</v>
- <v>What = bad_name</v>
- </type>
<desc>
<p>Deletes a directory from the code path. The argument can be
- an atom <c>Name</c>, in which case the directory with
- the name <c>.../Name[-Vsn][/ebin]</c> is deleted from the code
+ an atom <c><anno>Name</anno></c>, in which case the directory with
+ the name <c>.../<anno>Name</anno>[-Vsn][/ebin]</c> is deleted from the code
path. It is also possible to give the complete directory name
- <c>Dir</c> as argument.</p>
+ <c><anno>Dir</anno></c> as argument.</p>
<p>Returns <c>true</c> if successful, or <c>false</c> if
the directory is not found, or <c>{error, bad_name}</c> if
the argument is invalid.</p>
</desc>
</func>
<func>
- <name>replace_path(Name, Dir) -> true | {error, What}</name>
+ <name name="replace_path" arity="2"/>
<fsummary>Replace a directory with another in the code path</fsummary>
- <type>
- <v>Name = atom()</v>
- <v>Dir = string()</v>
- <v>What = bad_name | bad_directory | {badarg, term()}</v>
- </type>
<desc>
<p>This function replaces an old occurrence of a directory
- named <c>.../Name[-Vsn][/ebin]</c>, in the code path, with
- <c>Dir</c>. If <c>Name</c> does not exist, it adds the new
- directory <c>Dir</c> last in the code path. The new directory
- must also be named <c>.../Name[-Vsn][/ebin]</c>. This function
+ named <c>.../<anno>Name</anno>[-Vsn][/ebin]</c>, in the code path, with
+ <c><anno>Dir</anno></c>. If <c><anno>Name</anno></c> does not exist, it adds the new
+ directory <c><anno>Dir</anno></c> last in the code path. The new directory
+ must also be named <c>.../<anno>Name</anno>[-Vsn][/ebin]</c>. This function
should be used if a new version of the directory (library) is
added to a running system.</p>
<p>Returns <c>true</c> if successful, or
- <c>{error, bad_name}</c> if <c>Name</c> is not found, or
- <c>{error, bad_directory}</c> if <c>Dir</c> does not exist, or
- <c>{error, {badarg, [Name, Dir]}}</c> if <c>Name</c> or
- <c>Dir</c> is invalid.</p>
+ <c>{error, bad_name}</c> if <c><anno>Name</anno></c> is not found, or
+ <c>{error, bad_directory}</c> if <c><anno>Dir</anno></c> does not exist, or
+ <c>{error, {badarg, [<anno>Name</anno>, <anno>Dir</anno>]}}</c> if <c><anno>Name</anno></c> or
+ <c><anno>Dir</anno></c> is invalid.</p>
</desc>
</func>
<func>
- <name>load_file(Module) -> {module, Module} | {error, What}</name>
+ <name name="load_file" arity="1"/>
<fsummary>Load a module</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>What = nofile | sticky_directory | badarg | term()</v>
- </type>
+ <type name="load_ret"/>
<desc>
- <p>Tries to load the Erlang module <c>Module</c>, using
+ <p>Tries to load the Erlang module <c><anno>Module</anno></c>, using
the code path. It looks for the object code file with an
extension that corresponds to the Erlang machine used, for
- example <c>Module.beam</c>. The loading fails if the module
+ example <c><anno>Module</anno>.beam</c>. The loading fails if the module
name found in the object code differs from the name
- <c>Module</c>.
+ <c><anno>Module</anno></c>.
<seealso marker="#load_binary/3">load_binary/3</seealso> must
be used to load object code with a module name that is
different from the file name.</p>
- <p>Returns <c>{module, Module}</c> if successful, or
+ <p>Returns <c>{module, <anno>Module</anno>}</c> if successful, or
<c>{error, nofile}</c> if no object code is found, or
<c>{error, sticky_directory}</c> if the object code resides in
- a sticky directory, or <c>{error, badarg}</c> if the argument
- is invalid. Also if the loading fails, an error tuple is
+ a sticky directory. Also if the loading fails, an error tuple is
returned. See
<seealso marker="erts:erlang#load_module/2">erlang:load_module/2</seealso>
- for possible values of <c>What</c>.</p>
+ for possible values of <c><anno>What</anno></c>.</p>
</desc>
</func>
<func>
- <name>load_abs(Filename) -> {module, Module} | {error, What}</name>
+ <name name="load_abs" arity="1"/>
<fsummary>Load a module, residing in a given file</fsummary>
- <type>
- <v>Filename = string()</v>
- <v>Module = atom()</v>
- <v>What = nofile | sticky_directory | badarg | term()</v>
- </type>
+ <type name="load_ret"/>
+ <type name="loaded_filename"/>
+ <type name="loaded_ret_atoms"/>
<desc>
- <p>Does the same as <c>load_file(Module)</c>, but
- <c>Filename</c> is either an absolute file name, or a
+ <p>Does the same as <c>load_file(<anno>Module</anno>)</c>, but
+ <c><anno>Filename</anno></c> is either an absolute file name, or a
relative file name. The code path is not searched. It returns
a value in the same way as
<seealso marker="#load_file/1">load_file/1</seealso>. Note
- that <c>Filename</c> should not contain the extension (for
+ that <c><anno>Filename</anno></c> should not contain the extension (for
example <c>".beam"</c>); <c>load_abs/1</c> adds the correct
extension itself.</p>
</desc>
</func>
<func>
- <name>ensure_loaded(Module) -> {module, Module} | {error, What}</name>
+ <name name="ensure_loaded" arity="1"/>
<fsummary>Ensure that a module is loaded</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>What = nofile | sticky_directory | embedded | badarg | term()</v>
- </type>
<desc>
<p>Tries to to load a module in the same way as
<seealso marker="#load_file/1">load_file/1</seealso>,
@@ -487,54 +447,45 @@
</desc>
</func>
<func>
- <name>load_binary(Module, Filename, Binary) -> {module, Module} | {error, What}</name>
+ <name name="load_binary" arity="3"/>
<fsummary>Load object code for a module</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>Filename = string()</v>
- <v>What = sticky_directory | badarg | term()</v>
- </type>
+ <type name="loaded_filename"/>
+ <type name="loaded_ret_atoms"/>
<desc>
<p>This function can be used to load object code on remote
- Erlang nodes. The argument <c>Binary</c> must contain
- object code for <c>Module</c>.
- <c>Filename</c> is only used by the code server to keep a
- record of from which file the object code for <c>Module</c>
- comes. Accordingly, <c>Filename</c> is not opened and read by
+ Erlang nodes. The argument <c><anno>Binary</anno></c> must contain
+ object code for <c><anno>Module</anno></c>.
+ <c><anno>Filename</anno></c> is only used by the code server to keep a
+ record of from which file the object code for <c><anno>Module</anno></c>
+ comes. Accordingly, <c><anno>Filename</anno></c> is not opened and read by
the code server.</p>
- <p>Returns <c>{module, Module}</c> if successful, or
+ <p>Returns <c>{module, <anno>Module</anno>}</c> if successful, or
<c>{error, sticky_directory}</c> if the object code resides in
a sticky directory, or <c>{error, badarg}</c> if any argument
is invalid. Also if the loading fails, an error tuple is
returned. See
<seealso marker="erts:erlang#load_module/2">erlang:load_module/2</seealso>
- for possible values of <c>What</c>.</p>
+ for possible values of <c><anno>What</anno></c>.</p>
</desc>
</func>
<func>
- <name>delete(Module) -> true | false</name>
+ <name name="delete" arity="1"/>
<fsummary>Removes current code for a module</fsummary>
- <type>
- <v>Module = atom()</v>
- </type>
<desc>
- <p>Removes the current code for <c>Module</c>, that is,
- the current code for <c>Module</c> is made old. This means
+ <p>Removes the current code for <c><anno>Module</anno></c>, that is,
+ the current code for <c><anno>Module</anno></c> is made old. This means
that processes can continue to execute the code in the module,
but that no external function calls can be made to it.</p>
<p>Returns <c>true</c> if successful, or <c>false</c> if there
- is old code for <c>Module</c> which must be purged first, or
- if <c>Module</c> is not a (loaded) module.</p>
+ is old code for <c><anno>Module</anno></c> which must be purged first, or
+ if <c><anno>Module</anno></c> is not a (loaded) module.</p>
</desc>
</func>
<func>
- <name>purge(Module) -> true | false</name>
+ <name name="purge" arity="1"/>
<fsummary>Removes old code for a module</fsummary>
- <type>
- <v>Module = atom()</v>
- </type>
<desc>
- <p>Purges the code for <c>Module</c>, that is, removes code
+ <p>Purges the code for <c><anno>Module</anno></c>, that is, removes code
marked as old. If some processes still linger in the old code,
these processes are killed before the code is removed.</p>
<p>Returns <c>true</c> if successful and any process needed to
@@ -542,31 +493,26 @@
</desc>
</func>
<func>
- <name>soft_purge(Module) -> true | false</name>
+ <name name="soft_purge" arity="1"/>
<fsummary>Removes old code for a module, unless no process uses it</fsummary>
- <type>
- <v>Module = atom()</v>
- </type>
<desc>
- <p>Purges the code for <c>Module</c>, that is, removes code
+ <p>Purges the code for <c><anno>Module</anno></c>, that is, removes code
marked as old, but only if no processes linger in it.</p>
<p>Returns <c>false</c> if the module could not be purged due
to processes lingering in old code, otherwise <c>true</c>.</p>
</desc>
</func>
<func>
- <name>is_loaded(Module) -> {file, Loaded} | false</name>
+ <name name="is_loaded" arity="1"/>
<fsummary>Check if a module is loaded</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>Loaded = Absname | preloaded | cover_compiled</v>
- <v>Absname = string()</v>
- </type>
- <desc>
- <p>Checks if <c>Module</c> is loaded. If it is,
- <c>{file, Loaded}</c> is returned, otherwise <c>false</c>.</p>
- <p>Normally, <c>Loaded</c> is the absolute file name
- <c>Absname</c> from which the code was obtained. If the module
+ <type name="loaded_filename"/>
+ <type name="loaded_ret_atoms"/>
+ <type_desc name="loaded_filename"><c><anno>Filename</anno></c> is an absolute filename</type_desc>
+ <desc>
+ <p>Checks if <c><anno>Module</anno></c> is loaded. If it is,
+ <c>{file, <anno>Loaded</anno>}</c> is returned, otherwise <c>false</c>.</p>
+ <p>Normally, <c><anno>Loaded</anno></c> is the absolute file name
+ <c>Filename</c> from which the code was obtained. If the module
is preloaded (see
<seealso marker="sasl:script">script(4)</seealso>),
<c>Loaded==preloaded</c>. If the module is Cover compiled (see
@@ -575,32 +521,26 @@
</desc>
</func>
<func>
- <name>all_loaded() -> [{Module, Loaded}]</name>
+ <name name="all_loaded" arity="0"/>
<fsummary>Get all loaded modules</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>Loaded = Absname | preloaded | cover_compiled</v>
- <v>Absname = string()</v>
- </type>
+ <type name="loaded_filename"/>
+ <type name="loaded_ret_atoms"/>
+ <type_desc name="loaded_filename"><c><anno>Filename</anno></c> is an absolute filename</type_desc>
<desc>
- <p>Returns a list of tuples <c>{Module, Loaded}</c> for all
- loaded modules. <c>Loaded</c> is normally the absolute file
+ <p>Returns a list of tuples <c>{<anno>Module</anno>, <anno>Loaded</anno>}</c> for all
+ loaded modules. <c><anno>Loaded</anno></c> is normally the absolute file
name, as described for
<seealso marker="#is_loaded/1">is_loaded/1</seealso>.</p>
</desc>
</func>
<func>
- <name>which(Module) -> Which</name>
+ <name name="which" arity="1"/>
<fsummary>The object code file of a module</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>Which = Filename | non_existing | preloaded | cover_compiled</v>
- <v>Filename = string()</v>
- </type>
+ <type name="loaded_ret_atoms"/>
<desc>
<p>If the module is not loaded, this function searches the code
path for the first file which contains object code for
- <c>Module</c> and returns the absolute file name. If
+ <c><anno>Module</anno></c> and returns the absolute file name. If
the module is loaded, it returns the name of the file which
contained the loaded object code. If the module is pre-loaded,
<c>preloaded</c> is returned. If the module is Cover compiled,
@@ -609,21 +549,16 @@
</desc>
</func>
<func>
- <name>get_object_code(Module) -> {Module, Binary, Filename} | error</name>
+ <name name="get_object_code" arity="1"/>
<fsummary>Get the object code for a module</fsummary>
- <type>
- <v>Module = atom()</v>
- <v>Binary = binary()</v>
- <v>Filename = string()</v>
- </type>
<desc>
<p>Searches the code path for the object code of the module
- <c>Module</c>. It returns <c>{Module, Binary, Filename}</c>
- if successful, and <c>error</c> if not. <c>Binary</c> is a
+ <c><anno>Module</anno></c>. It returns <c>{<anno>Module</anno>, <anno>Binary</anno>, <anno>Filename</anno>}</c>
+ if successful, and <c>error</c> if not. <c><anno>Binary</anno></c> is a
binary data object which contains the object code for
the module. This can be useful if code is to be loaded on a
remote node in a distributed system. For example, loading
- module <c>Module</c> on a node <c>Node</c> is done as
+ module <c><anno>Module</anno></c> on a node <c>Node</c> is done as
follows:</p>
<code type="none">
...
@@ -633,7 +568,7 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>root_dir() -> string()</name>
+ <name name="root_dir" arity="0"/>
<fsummary>Root directory of Erlang/OTP</fsummary>
<desc>
<p>Returns the root directory of Erlang/OTP, which is
@@ -644,7 +579,7 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>lib_dir() -> string()</name>
+ <name name="lib_dir" arity="0"/>
<fsummary>Library directory of Erlang/OTP</fsummary>
<desc>
<p>Returns the library directory, <c>$OTPROOT/lib</c>, where
@@ -655,19 +590,16 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>lib_dir(Name) -> string() | {error, bad_name}</name>
+ <name name="lib_dir" arity="1"/>
<fsummary>Library directory for an application</fsummary>
- <type>
- <v>Name = atom()</v>
- </type>
<desc>
<p>This function is mainly intended for finding out the path
for the "library directory", the top directory, for an
- application <c>Name</c> located under <c>$OTPROOT/lib</c> or
+ application <c><anno>Name</anno></c> located under <c>$OTPROOT/lib</c> or
on a directory referred to via the <c>ERL_LIBS</c>
environment variable.</p>
- <p>If there is a regular directory called <c>Name</c> or
- <c>Name-Vsn</c> in the code path with an <c>ebin</c>
+ <p>If there is a regular directory called <c><anno>Name</anno></c> or
+ <c><anno>Name</anno>-Vsn</c> in the code path with an <c>ebin</c>
subdirectory, the path to this directory is returned (not
the <c>ebin</c> directory). If the directory refers to a
directory in an archive, the archive name is stripped away
@@ -681,23 +613,19 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
<pre>
> <input>code:lib_dir(mnesia).</input>
"/usr/local/otp/lib/mnesia-4.2.2"</pre>
- <p>Returns <c>{error, bad_name}</c> if <c>Name</c>
+ <p>Returns <c>{error, bad_name}</c> if <c><anno>Name</anno></c>
is not the name of an application under <c>$OTPROOT/lib</c> or
on a directory referred to via the <c>ERL_LIBS</c>
environment variable. Fails with an exception if <c>Name</c>
has the wrong type.</p>
- <warning><p>For backward compatibility, <c>Name</c> is also allowed to
+ <warning><p>For backward compatibility, <c><anno>Name</anno></c> is also allowed to
be a string. That will probably change in a future release.</p></warning>
</desc>
</func>
<func>
- <name>lib_dir(Name, SubDir) -> string() | {error, bad_name}</name>
+ <name name="lib_dir" arity="2"/>
<fsummary>subdirectory for an application</fsummary>
- <type>
- <v>Name = atom()</v>
- <v>SubDir = atom()</v>
- </type>
<desc>
<p>Returns the path to a subdirectory directly under the top
directory of an application. Normally the subdirectories
@@ -711,12 +639,12 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
> <input>code:lib_dir(megaco, priv).</input>
"/usr/local/otp/lib/megaco-3.9.1.1/priv"</pre>
- <p>Fails with an exception if <c>Name</c> or <c>SubDir</c> has
+ <p>Fails with an exception if <c><anno>Name</anno></c> or <c><anno>SubDir</anno></c> has
the wrong type.</p>
</desc>
</func>
<func>
- <name>compiler_dir() -> string()</name>
+ <name name="compiler_dir" arity="0"/>
<fsummary>Library directory for the compiler</fsummary>
<desc>
<p>Returns the compiler library directory. Equivalent to
@@ -724,21 +652,18 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>priv_dir(Name) -> string() | {error, bad_name}</name>
+ <name name="priv_dir" arity="1"/>
<fsummary>Priv directory for an application</fsummary>
- <type>
- <v>Name = atom()</v>
- </type>
<desc>
<p>Returns the path to the <c>priv</c> directory in an
- application. Equivalent to <c>code:lib_dir(Name,priv).</c>.</p>
+ application. Equivalent to <c>code:lib_dir(<anno>Name</anno>, priv).</c>.</p>
- <warning><p>For backward compatibility, <c>Name</c> is also allowed to
+ <warning><p>For backward compatibility, <c><anno>Name</anno></c> is also allowed to
be a string. That will probably change in a future release.</p></warning>
</desc>
</func>
<func>
- <name>objfile_extension() -> ".beam"</name>
+ <name name="objfile_extension" arity="0"/>
<fsummary>Object code file extension</fsummary>
<desc>
<p>Returns the object code file extension that corresponds to
@@ -746,24 +671,16 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>stick_dir(Dir) -> ok | error</name>
+ <name name="stick_dir" arity="1"/>
<fsummary>Mark a directory as sticky</fsummary>
- <type>
- <v>Dir = string()</v>
- <v>What = term()</v>
- </type>
<desc>
- <p>This function marks <c>Dir</c> as sticky.</p>
+ <p>This function marks <c><anno>Dir</anno></c> as sticky.</p>
<p>Returns <c>ok</c> if successful or <c>error</c> if not.</p>
</desc>
</func>
<func>
- <name>unstick_dir(Dir) -> ok | error</name>
+ <name name="unstick_dir" arity="1"/>
<fsummary>Remove a sticky directory mark</fsummary>
- <type>
- <v>Dir = string()</v>
- <v>What = term()</v>
- </type>
<desc>
<p>This function unsticks a directory which has been marked as
sticky.</p>
@@ -771,45 +688,39 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>is_sticky(Module) -> true | false</name>
+ <name name="is_sticky" arity="1"/>
<fsummary>Test whether a module is sticky</fsummary>
- <type>
- <v>Module = atom()</v>
- </type>
<desc>
- <p>This function returns <c>true</c> if <c>Module</c> is the
+ <p>This function returns <c>true</c> if <c><anno>Module</anno></c> is the
name of a module that has been loaded from a sticky directory
(or in other words: an attempt to reload the module will fail),
- or <c>false</c> if <c>Module</c> is not a loaded module or is
+ or <c>false</c> if <c><anno>Module</anno></c> is not a loaded module or is
not sticky.</p>
</desc>
</func>
<func>
- <name>rehash() -> ok</name>
+ <name name="rehash" arity="0"/>
<fsummary>Rehash or create code path cache</fsummary>
<desc>
<p>This function creates or rehashes the code path cache.</p>
</desc>
</func>
<func>
- <name>where_is_file(Filename) -> Absname | non_existing</name>
+ <name name="where_is_file" arity="1"/>
<fsummary>Full name of a file located in the code path</fsummary>
- <type>
- <v>Filename = Absname = string()</v>
- </type>
<desc>
- <p>Searches the code path for <c>Filename</c>, a file of
+ <p>Searches the code path for <c><anno>Filename</anno></c>, a file of
arbitrary type. If found, the full name is returned.
<c>non_existing</c> is returned if the file cannot be found.
The function can be useful, for example, to locate
application resource files. If the code path cache is used,
the code server will efficiently read the full name from
- the cache, provided that <c>Filename</c> is an object code
+ the cache, provided that <c><anno>Filename</anno></c> is an object code
file or an <c>.app</c> file.</p>
</desc>
</func>
<func>
- <name>clash() -> ok</name>
+ <name name="clash" arity="0"/>
<fsummary>Search for modules with identical names.</fsummary>
<desc>
<p>Searches the entire code space for module names with
@@ -817,10 +728,10 @@ rpc:call(Node, code, load_binary, [Module, Filename, Binary]),
</desc>
</func>
<func>
- <name>is_module_native(Module) -> true | false | undefined</name>
+ <name>is_module_native(Module) -> boolean() | undefined</name>
<fsummary>Test whether a module has native code</fsummary>
<type>
- <v>Module = atom()</v>
+ <v>Module = module()</v>
</type>
<desc>
<p>This function returns <c>true</c> if <c>Module</c> is
diff --git a/lib/kernel/doc/src/file.xml b/lib/kernel/doc/src/file.xml
index e0feaf6ee7..861c582211 100644
--- a/lib/kernel/doc/src/file.xml
+++ b/lib/kernel/doc/src/file.xml
@@ -95,9 +95,6 @@
<datatypes>
<datatype>
- <name name="bindings"/>
- </datatype>
- <datatype>
<name name="deep_list"/>
</datatype>
<datatype>
@@ -136,12 +133,6 @@
</desc>
</datatype>
<datatype>
- <name name="date"/>
- </datatype>
- <datatype>
- <name name="time"/>
- </datatype>
- <datatype>
<name name="date_time"/>
<desc>
<p>Must denote a valid date and time.</p>
@@ -1220,15 +1211,15 @@ f.txt: {person, "kalle", 25}.
<item>
<p>The current system access to the file.</p>
</item>
- <tag><c>atime = time()</c></tag>
+ <tag><c>atime = <seealso marker="#type-date_time">date_time()</seealso></c></tag>
<item>
<p>The last (local) time the file was read.</p>
</item>
- <tag><c>mtime = time()</c></tag>
+ <tag><c>mtime = <seealso marker="#type-date_time">date_time()</seealso></c></tag>
<item>
<p>The last (local) time the file was written.</p>
</item>
- <tag><c>ctime = time()</c></tag>
+ <tag><c>ctime = <seealso marker="#type-date_time">date_time()</seealso></c></tag>
<item>
<p>The interpretation of this time field depends on
the operating system. On Unix, it is the last time
@@ -1669,15 +1660,15 @@ f.txt: {person, "kalle", 25}.
<p>The following fields are used from the record, if they are
given.</p>
<taglist>
- <tag><c>atime = time()</c></tag>
+ <tag><c>atime = <seealso marker="#type-date_time">date_time()</seealso></c></tag>
<item>
<p>The last (local) time the file was read.</p>
</item>
- <tag><c>mtime = time()</c></tag>
+ <tag><c>mtime = <seealso marker="#type-date_time">date_time()</seealso></c></tag>
<item>
<p>The last (local) time the file was written.</p>
</item>
- <tag><c>ctime = time()</c></tag>
+ <tag><c>ctime = <seealso marker="#type-date_time">date_time()</seealso></c></tag>
<item>
<p>On Unix, any value give for this field will be ignored
(the "ctime" for the file will be set to the current
diff --git a/lib/kernel/doc/src/gen_sctp.xml b/lib/kernel/doc/src/gen_sctp.xml
index 5ceb82ae41..cc49090386 100644
--- a/lib/kernel/doc/src/gen_sctp.xml
+++ b/lib/kernel/doc/src/gen_sctp.xml
@@ -63,14 +63,13 @@
<item><seealso marker="#options">SCTP SOCKET OPTIONS</seealso></item>
<item><seealso marker="#examples">SCTP EXAMPLES</seealso></item>
<item><seealso marker="#seealso">SEE ALSO</seealso></item>
- <item><seealso marker="#authors">AUTHORS</seealso></item>
</list>
<marker id="types"></marker>
</section>
<datatypes>
<datatype>
- <name name="assoc_id"/>
+ <name><marker id="type-assoc_id">assoc_id()</marker></name>
<desc>
<p>An opaque term returned in for example #sctp_paddr_change{}
that identifies an association for an SCTP socket. The term
@@ -80,36 +79,18 @@
</desc>
</datatype>
<datatype>
- <name name="hostname"/>
- </datatype>
- <datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of an SCTP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="sctp_option"/>
+ <name name="option"/>
<desc>
<p>One of the
<seealso marker="#options">SCTP Socket Options.</seealso></p>
- <marker id="type-sctp_socket"></marker>
</desc>
</datatype>
<datatype>
- <name name="sctp_socket"/>
+ <name name="option_name"/>
+ <desc><marker id="type-sctp_socket"></marker></desc>
+ </datatype>
+ <datatype>
+ <name><marker id="type-sctp_socket">sctp_socket()</marker></name>
<desc>
<p>Socket identifier returned from <c>open/*</c>.</p>
<marker id="exports"></marker>
@@ -175,8 +156,8 @@
#sctp_assoc_change{
state = atom(),
error = atom(),
- outbound_streams = int(),
- inbound_streams = int(),
+ outbound_streams = integer(),
+ inbound_streams = integer(),
assoc_id = assoc_id()
} </pre>
<p>The number of outbound and inbound streams can be set by
@@ -300,6 +281,19 @@
The default <c><anno>IP</anno></c> and <c><anno>Port</anno></c> are <c>any</c>
and <c>0</c>, meaning bind to all local addresses on any
one free port.</p>
+
+ <p>Other options are:</p>
+ <taglist>
+ <tag><c>inet6</c></tag>
+ <item>
+ <p>Set up the socket for IPv6.</p>
+ </item>
+ <tag><c>inet</c></tag>
+ <item>
+ <p>Set up the socket for IPv4. This is the default.</p>
+ </item>
+ </taglist>
+
<p>A default set of socket <seealso marker="#options">options</seealso>
is used. In particular, the socket is opened in
<seealso marker="#option-binary">binary</seealso> and
@@ -350,7 +344,7 @@
#sctp_paddr_change{
addr = {ip_address(),port()},
state = atom(),
- error = int(),
+ error = integer(),
assoc_id = assoc_id()
} </pre>
<p>Indicates change of the status of the peer's IP address given by
@@ -387,7 +381,7 @@
<pre>
#sctp_send_failed{
flags = true | false,
- error = int(),
+ error = integer(),
info = #sctp_sndrcvinfo{},
assoc_id = assoc_id()
data = binary()
@@ -407,7 +401,7 @@
<item>
<pre>
#sctp_adaptation_event{
- adaptation_ind = int(),
+ adaptation_ind = integer(),
assoc_id = assoc_id()
} </pre>
<p>Delivered when a peer sends an Adaptation Layer Indication
@@ -505,7 +499,7 @@
</list>
<marker id="option-buffer"></marker>
</item>
- <tag><c>{buffer, int()}</c></tag>
+ <tag><c>{buffer, integer()}</c></tag>
<item>
<p>Determines the size of the user-level software buffer used by
the SCTP driver. Not to be confused with <c>sndbuf</c>
@@ -515,7 +509,7 @@
In fact, the <c>val(buffer)</c> is automatically set to
the above maximum when <c>sndbuf</c> or <c>recbuf</c> values are set.</p>
</item>
- <tag><c>{tos, int()}</c></tag>
+ <tag><c>{tos, integer()}</c></tag>
<item>
<p>Sets the Type-Of-Service field on the IP datagrams being sent,
to the given value, which effectively determines a prioritization
@@ -523,7 +517,7 @@
are system-dependent. TODO: we do not provide
symbolic names for these values yet.</p>
</item>
- <tag><c>{priority, int()}</c></tag>
+ <tag><c>{priority, integer()}</c></tag>
<item>
<p>A protocol-independent equivalent of <c>tos</c> above. Setting
priority implies setting tos as well.</p>
@@ -542,7 +536,7 @@
required for high-throughput servers).</p>
<marker id="option-linger"></marker>
</item>
- <tag><c>{linger, {true|false, int()}</c></tag>
+ <tag><c>{linger, {true|false, integer()}</c></tag>
<item>
<p>Determines the timeout in seconds for flushing unsent data in the
<c>gen_sctp:close/1</c> socket call. If the 1st component of the value
@@ -552,14 +546,14 @@
the flushing time-out in seconds.</p>
<marker id="option-sndbuf"></marker>
</item>
- <tag><c>{sndbuf, int()}</c></tag>
+ <tag><c>{sndbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* send buffer for this socket.
Sending errors would occur for datagrams larger than
<c>val(sndbuf)</c>. Setting this option also adjusts
the size of the driver buffer (see <c>buffer</c> above).</p>
</item>
- <tag><c>{recbuf, int()}</c></tag>
+ <tag><c>{recbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* recv buffer for this socket.
Sending errors would occur for datagrams larger than
@@ -571,9 +565,9 @@
<pre>
#sctp_rtoinfo{
assoc_id = assoc_id(),
- initial = int(),
- max = int(),
- min = int()
+ initial = integer(),
+ max = integer(),
+ min = integer()
} </pre>
<p>Determines re-transmission time-out parameters, in milliseconds,
for the association(s) given by <c>assoc_id</c>.
@@ -586,11 +580,11 @@
<pre>
#sctp_assocparams{
assoc_id = assoc_id(),
- asocmaxrxt = int(),
- number_peer_destinations = int(),
- peer_rwnd = int(),
- local_rwnd = int(),
- cookie_life = int()
+ asocmaxrxt = integer(),
+ number_peer_destinations = integer(),
+ peer_rwnd = integer(),
+ local_rwnd = integer(),
+ cookie_life = integer()
} </pre>
<p>Determines association parameters for the association(s) given by
<c>assoc_id</c>. <c>assoc_id = 0</c> (default) indicates
@@ -601,10 +595,10 @@
<item>
<pre>
#sctp_initmsg{
- num_ostreams = int(),
- max_instreams = int(),
- max_attempts = int(),
- max_init_timeo = int()
+ num_ostreams = integer(),
+ max_instreams = integer(),
+ max_attempts = integer(),
+ max_init_timeo = integer()
} </pre>
<p>Determines the default parameters which this socket attempts
to negotiate with its peer while establishing an association with it.
@@ -630,10 +624,11 @@
</list>
<p></p>
</item>
- <tag><c>{sctp_autoclose, int()|infinity}</c></tag>
+ <tag><c>{sctp_autoclose, integer() >= 0}</c></tag>
<item>
<p>Determines the time (in seconds) after which an idle association is
- automatically closed.</p>
+ automatically closed. <c>0</c> means that the association is
+ never automatically closed.</p>
</item>
<tag><c>{sctp_nodelay, true|false}</c></tag>
<item>
@@ -655,7 +650,7 @@
<p>Turns on|off automatic mapping of IPv4 addresses into IPv6 ones
(if the socket address family is AF_INET6).</p>
</item>
- <tag><c>{sctp_maxseg, int()}</c></tag>
+ <tag><c>{sctp_maxseg, integer()}</c></tag>
<item>
<p>Determines the maximum chunk size if message fragmentation is used.
If <c>0</c>, the chunk size is limited by the Path MTU only.</p>
@@ -693,7 +688,7 @@
<marker id="record-sctp_setadaptation"></marker>
<pre>
#sctp_setadaptation{
- adaptation_ind = int()
+ adaptation_ind = integer()
} </pre>
<p>When set, requests that the local endpoint uses the value given by
<c>adaptation_ind</c> as the Adaptation Indication parameter for
@@ -707,10 +702,10 @@
#sctp_paddrparams{
assoc_id = assoc_id(),
address = {IP, Port},
- hbinterval = int(),
- pathmaxrxt = int(),
- pathmtu = int(),
- sackdelay = int(),
+ hbinterval = integer(),
+ pathmaxrxt = integer(),
+ pathmtu = integer(),
+ sackdelay = integer(),
flags = list()
}
IP = ip_address()
@@ -771,14 +766,14 @@
<marker id="record-sctp_sndrcvinfo"></marker>
<pre>
#sctp_sndrcvinfo{
- stream = int(),
- ssn = int(),
+ stream = integer(),
+ ssn = integer(),
flags = list(),
- ppid = int(),
- context = int(),
- timetolive = int(),
- tsn = int(),
- cumtsn = int(),
+ ppid = integer(),
+ context = integer(),
+ timetolive = integer(),
+ tsn = integer(),
+ cumtsn = integer(),
assoc_id = assoc_id()
} </pre>
<p><c>#sctp_sndrcvinfo{}</c> is used both in this socket option, and as
@@ -853,7 +848,7 @@
<pre>
#sctp_assoc_value{
assoc_id = assoc_id(),
- assoc_value = int()
+ assoc_value = integer()
} </pre>
<p>Rarely used. Determines the ACK time
(given by <c>assoc_value</c> in milliseconds) for
@@ -866,12 +861,12 @@
#sctp_status{
assoc_id = assoc_id(),
state = atom(),
- rwnd = int(),
- unackdata = int(),
- penddata = int(),
- instrms = int(),
- outstrms = int(),
- fragmentation_point = int(),
+ rwnd = integer(),
+ unackdata = integer(),
+ penddata = integer(),
+ instrms = integer(),
+ outstrms = integer(),
+ fragmentation_point = integer(),
primary = #sctp_paddrinfo{}
} </pre>
<p>This option is read-only. It determines the status of
@@ -946,10 +941,10 @@
assoc_id = assoc_id(),
address = {IP, Port},
state = inactive | active,
- cwnd = int(),
- srtt = int(),
- rto = int(),
- mtu = int()
+ cwnd = integer(),
+ srtt = integer(),
+ rto = integer(),
+ mtu = integer()
}
IP = ip_address()
Port = port_number() </pre>
@@ -990,7 +985,7 @@
server(IP, Port) when is_tuple(IP) orelse IP == any orelse IP == loopback,
is_integer(Port) -&gt;
- {ok,S} = gen_sctp:open([{ip,IP},{port,Port}],[{recbuf,65536}]),
+ {ok,S} = gen_sctp:open(Port, [{recbuf,65536}, {ip,IP}]),
io:format("Listening on ~w:~w. ~w~n", [IP,Port,S]),
ok = gen_sctp:listen(S, true),
server_loop(S).
@@ -1119,7 +1114,6 @@ client_loop(S, Peer1, Port1, AssocId1, Peer2, Port2, AssocId2) -&gt;
<seealso marker="gen_udp">gen_udp(3)</seealso>,
<url href="http://www.rfc-archive.org/getrfc.php?rfc=2960">RFC2960</url> (Stream Control Transmission Protocol),
<url href="http://tools.ietf.org/html/draft-ietf-tsvwg-sctpsocket-13">Sockets API Extensions for SCTP.</url></p>
- <marker id="authors"></marker>
</section>
</erlref>
diff --git a/lib/kernel/doc/src/gen_tcp.xml b/lib/kernel/doc/src/gen_tcp.xml
index f1d42d9faa..8a5d40bb16 100644
--- a/lib/kernel/doc/src/gen_tcp.xml
+++ b/lib/kernel/doc/src/gen_tcp.xml
@@ -37,7 +37,7 @@
binary and closing the connection:</p>
<code type="none">
client() ->
- SomeHostInNet = "localhost" % to make it runnable on one machine
+ SomeHostInNet = "localhost", % to make it runnable on one machine
{ok, Sock} = gen_tcp:connect(SomeHostInNet, 5678,
[binary, {packet, 0}]),
ok = gen_tcp:send(Sock, "Some Data"),
@@ -65,25 +65,16 @@ do_recv(Sock, Bs) ->
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
- <name name="port_number"/>
+ <name name="connect_option"/>
</datatype>
<datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="listen_option"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -122,7 +113,7 @@ do_recv(Sock, Bs) ->
<item>
<p>Specify which local port number to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been connected without using
<c>gen_tcp</c>, use this option to pass the file
@@ -196,6 +187,10 @@ do_recv(Sock, Bs) ->
<p>If the host has several network interfaces, this option
specifies which one to listen on.</p>
</item>
+ <tag><c>{port, Port}</c></tag>
+ <item>
+ <p>Specify which local port number to use.</p>
+ </item>
<tag><c>{fd, Fd}</c></tag>
<item>
<p>If a socket has somehow been connected without using
diff --git a/lib/kernel/doc/src/gen_udp.xml b/lib/kernel/doc/src/gen_udp.xml
index c0e783f508..daa9b7d887 100644
--- a/lib/kernel/doc/src/gen_udp.xml
+++ b/lib/kernel/doc/src/gen_udp.xml
@@ -36,25 +36,10 @@
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -87,7 +72,7 @@
<p>If the host has several network interfaces, this option
specifies which one to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been opened without using
<c>gen_udp</c>, use this option to pass the file
diff --git a/lib/kernel/doc/src/inet.xml b/lib/kernel/doc/src/inet.xml
index fd843b00d9..fad5af85bb 100644
--- a/lib/kernel/doc/src/inet.xml
+++ b/lib/kernel/doc/src/inet.xml
@@ -105,6 +105,9 @@ fe80::204:acff:fe17:bf38
<name name="ip6_address"/>
</datatype>
<datatype>
+ <name name="port_number"/>
+ </datatype>
+ <datatype>
<name name="posix"/>
<desc><p>An atom which is named from the Posix error codes
used in Unix, and in the runtime libraries of most
@@ -119,7 +122,7 @@ fe80::204:acff:fe17:bf38
</desc>
</datatype>
<datatype>
- <name name="family_option"/>
+ <name name="address_family"/>
</datatype>
</datatypes>
@@ -250,26 +253,15 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getopts(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getopts" arity="2"/>
<fsummary>Get one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt | RawOptReq]</v>
- <v>Opt = atom()</v>
- <v>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueSpec = ValueSize | ValueBin</v>
- <v>ValueSize = integer()</v>
- <v>ValueBin = binary()</v>
- <v>OptionValues = [{Opt, Val} | {raw, Protocol, OptionNum, ValueBin}]</v>
- </type>
<type name="socket_getopt"/>
+ <type name="socket_setopt"/>
<desc>
<p>Gets one or more options for a socket.
See <seealso marker="#setopts/2">setopts/2</seealso>
for a list of available options.</p>
- <p>The number of elements in the returned <c>OptionValues</c>
+ <p>The number of elements in the returned <c><anno>OptionValues</anno></c>
list does not necessarily correspond to the number of options
asked for. If the operating system fails to support an option,
it is simply left out in the returned list. An error tuple is only
@@ -277,12 +269,12 @@ fe80::204:acff:fe17:bf38
(i.e. the socket is closed or the buffer size in a raw request
is too large). This behavior is kept for backward
compatibility reasons.</p>
- <p>A <c>RawOptReq</c> can be used to get information about
+ <p>A raw option request <c>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</c> can be used to get information about
socket options not (explicitly) supported by the emulator. The
use of raw socket options makes the code non portable, but
allows the Erlang programmer to take advantage of unusual features
present on the current platform.</p>
- <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
+ <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
by the protocol level, the option number and either a binary
or the size, in bytes, of the
buffer in which the option value is to be stored. A binary
@@ -325,19 +317,14 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getstat(Socket)</name>
- <name>getstat(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getstat" arity="1"/>
+ <name name="getstat" arity="2"/>
<fsummary>Get one or more statistic options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt]</v>
- <v>OptionValues = [{Opt, Val}]</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="stat_option"/>
<desc>
<p>Gets one or more statistic options for a socket.</p>
- <p><c>getstat(Socket)</c> is equivalent to
- <c>getstat(Socket,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
+ <p><c>getstat(<anno>Socket</anno>)</c> is equivalent to
+ <c>getstat(<anno>Socket</anno>,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
<p>The following options are available:</p>
<taglist>
<tag><c>recv_avg</c></tag>
@@ -394,12 +381,8 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>port(Socket) -> {ok, Port} | {error, any()}</name>
+ <name name="port" arity="1"/>
<fsummary>Return the local port number for a socket</fsummary>
- <type>
- <v>Socket = socket()</v>
- <v>Port = integer()</v>
- </type>
<desc>
<p>Returns the local port number for a socket.</p>
</desc>
@@ -412,16 +395,9 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>setopts(Socket, Options) -> ok | {error, posix()}</name>
+ <name name="setopts" arity="2"/>
<fsummary>Set one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [{Opt, Val} | {raw, Protocol, Option, ValueBin}]</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueBin = binary()</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="socket_setopt"/>
<desc>
<p>Sets one or more options for a socket. The following options
are available:</p>
@@ -579,8 +555,14 @@ fe80::204:acff:fe17:bf38
mode will return <c>{ok, HttpPacket}</c> from <c>gen_tcp:recv</c>
while an active socket will send messages like <c>{http,
Socket, HttpPacket}</c>.</p>
- <p>Note that the packet type <c>httph</c> is not
- needed when reading from a socket.</p>
+ </item>
+ <tag><c>httph | httph_bin</c></tag>
+ <item>
+ <p>These two types are often not needed as the socket will
+ automatically switch from <c>http</c>/<c>http_bin</c> to
+ <c>httph</c>/<c>httph_bin</c> internally after the first line
+ has been read. There might be occasions however when they are
+ useful, such as parsing trailers from chunked encoding.</p>
</item>
</taglist>
</item>
diff --git a/lib/kernel/doc/src/notes.xml b/lib/kernel/doc/src/notes.xml
index e325443f6c..fc8360b3d1 100644
--- a/lib/kernel/doc/src/notes.xml
+++ b/lib/kernel/doc/src/notes.xml
@@ -2535,7 +2535,7 @@
<c>badarg</c> if a process is already registered. As it
turns out there is no check in <c>global</c> if a process is
registered under more than one name. If some process is
- accidentaly or by design given several names, it is
+ accidentally or by design given several names, it is
possible that the name registry becomes inconsistent due
to the way the resolve function is called when name
clashes are discovered (see <c>register_name/3</c> in
diff --git a/lib/kernel/doc/src/os.xml b/lib/kernel/doc/src/os.xml
index 56fc1834ec..e94119845a 100644
--- a/lib/kernel/doc/src/os.xml
+++ b/lib/kernel/doc/src/os.xml
@@ -126,9 +126,10 @@ DirOut = os:cmd("dir"), % on Win32 platform</code>
</desc>
</func>
<func>
- <name>timestamp() -> {MegaSecs, Secs, MicroSecs}</name>
+ <name>timestamp() -> Timestamp</name>
<fsummary>Returna a timestamp from the OS in the erlang:now/0 format</fsummary>
<type>
+ <v>Timestamp = {MegaSecs, Secs, MicroSecs} = <seealso marker="erts:erlang#type-timestamp">erlang:timestamp()</seealso></v>
<v>MegaSecs = Secs = MicroSecs = integer() >= 0</v>
</type>
<desc>
diff --git a/lib/kernel/examples/uds_dist/c_src/uds_drv.c b/lib/kernel/examples/uds_dist/c_src/uds_drv.c
index fb10a375f4..9327ab19dc 100644
--- a/lib/kernel/examples/uds_dist/c_src/uds_drv.c
+++ b/lib/kernel/examples/uds_dist/c_src/uds_drv.c
@@ -111,7 +111,7 @@ do { \
typedef enum {
portTypeUnknown, /* An uninitialized port */
portTypeListener, /* A listening port/socket */
- portTypeAcceptor, /* An intermidiate stage when accepting
+ portTypeAcceptor, /* An intermediate stage when accepting
on a listen port */
portTypeConnector, /* An intermediate stage when connecting */
portTypeCommand, /* A connected open port in command mode */
@@ -401,7 +401,7 @@ static void uds_finish(void)
/*
** Protocol to control:
** 'C': Set port in command mode.
-** 'I': Set port in intermidiate mode
+** 'I': Set port in intermediate mode
** 'D': Set port in data mode
** 'N': Get identification number for listen port
** 'S': Get statistics
@@ -1000,7 +1000,7 @@ static int ensure_dir(char *path)
/*
** Try to open a lock file and lock the first byte write-only (advisory)
-** return the file descriptor if succesful, otherwise -1 (<0).
+** return the file descriptor if successful, otherwise -1 (<0).
*/
static int try_lock(char *sockname, Byte *p_creation)
{
diff --git a/lib/kernel/src/auth.erl b/lib/kernel/src/auth.erl
index 25c88a4e1d..c329a5652a 100644
--- a/lib/kernel/src/auth.erl
+++ b/lib/kernel/src/auth.erl
@@ -58,7 +58,7 @@ start_link() ->
%%--Deprecated interface------------------------------------------------
-spec is_auth(Node) -> 'yes' | 'no' when
- Node :: Node :: node().
+ Node :: node().
is_auth(Node) ->
case net_adm:ping(Node) of
@@ -212,7 +212,7 @@ handle_info({From,badcookie,net_kernel,{From,spawn_link,_M,_F,_A,_Gleader}}, O)
{noreply, O};
handle_info({_From,badcookie,ddd_server,_Mess}, O) ->
%% Ignore bad messages to the ddd server, they will be resent
- %% If the authentication is succesful
+ %% If the authentication is successful
{noreply, O};
handle_info({From,badcookie,rex,_Msg}, O) ->
auth:print(getnode(From),
diff --git a/lib/kernel/src/code.erl b/lib/kernel/src/code.erl
index b0f99305f2..882e9625fe 100644
--- a/lib/kernel/src/code.erl
+++ b/lib/kernel/src/code.erl
@@ -82,7 +82,8 @@
%% add_pathsa([Dir]) -> ok
%% add_pathsz([Dir]) -> ok
%% del_path(Dir) -> boolean() | {error, bad_name}
-%% replace_path(Name, Dir) -> true | replace_path_error()
+%% replace_path(Name, Dir) -> true | {error, bad_directory | bad_name
+%% | {badarg,_}}
%% load_file(Module) -> {module, Module} | {error, What :: atom()}
%% load_abs(File) -> {module, Module} | {error, What :: atom()}
%% load_abs(File, Module) -> {module, Module} | {error, What :: atom()}
@@ -113,11 +114,16 @@
%% Some types for basic exported functions of this module
%%----------------------------------------------------------------------------
--type load_error_rsn() :: 'badfile' | 'native_code' | 'nofile' | 'not_purged'
- | 'sticky_directory'. % for some functions only
--type load_ret() :: {'error', load_error_rsn()} | {'module', atom()}.
+-type load_error_rsn() :: 'badfile'
+ | 'native_code'
+ | 'nofile'
+ | 'not_purged'
+ | 'on_load'
+ | 'sticky_directory'.
+-type load_ret() :: {'error', What :: load_error_rsn()}
+ | {'module', Module :: module()}.
-type loaded_ret_atoms() :: 'cover_compiled' | 'preloaded'.
--type loaded_filename() :: file:filename() | loaded_ret_atoms().
+-type loaded_filename() :: (Filename :: file:filename()) | loaded_ret_atoms().
%%----------------------------------------------------------------------------
%% User interface
@@ -127,55 +133,74 @@
objfile_extension() ->
init:objfile_extension().
--spec load_file(Module :: atom()) -> load_ret().
+-spec load_file(Module) -> load_ret() when
+ Module :: module().
load_file(Mod) when is_atom(Mod) ->
call({load_file,Mod}).
--spec ensure_loaded(Module :: atom()) -> load_ret().
+-spec ensure_loaded(Module) -> {module, Module} | {error, What} when
+ Module :: module(),
+ What :: embedded | badfile | native_code | nofile | on_load.
ensure_loaded(Mod) when is_atom(Mod) ->
call({ensure_loaded,Mod}).
%% XXX File as an atom is allowed only for backwards compatibility.
--spec load_abs(Filename :: file:filename()) -> load_ret().
+-spec load_abs(Filename) -> load_ret() when
+ Filename :: file:filename().
load_abs(File) when is_list(File); is_atom(File) -> call({load_abs,File,[]}).
%% XXX Filename is also an atom(), e.g. 'cover_compiled'
--spec load_abs(Filename :: loaded_filename(), Module :: atom()) -> load_ret().
+-spec load_abs(Filename :: loaded_filename(), Module :: module()) -> load_ret().
load_abs(File, M) when (is_list(File) orelse is_atom(File)), is_atom(M) ->
call({load_abs,File,M}).
%% XXX Filename is also an atom(), e.g. 'cover_compiled'
--spec load_binary(Module :: atom(), Filename :: loaded_filename(), Binary :: binary()) -> load_ret().
+-spec load_binary(Module, Filename, Binary) ->
+ {module, Module} | {error, What} when
+ Module :: module(),
+ Filename :: loaded_filename(),
+ Binary :: binary(),
+ What :: badarg | load_error_rsn().
load_binary(Mod, File, Bin)
when is_atom(Mod), (is_list(File) orelse is_atom(File)), is_binary(Bin) ->
call({load_binary,Mod,File,Bin}).
--spec load_native_partial(Module :: atom(), Binary :: binary()) -> load_ret().
+-spec load_native_partial(Module :: module(), Binary :: binary()) -> load_ret().
load_native_partial(Mod, Bin) when is_atom(Mod), is_binary(Bin) ->
call({load_native_partial,Mod,Bin}).
--spec load_native_sticky(Module :: atom(), Binary :: binary(), WholeModule :: 'false' | binary()) -> load_ret().
+-spec load_native_sticky(Module :: module(), Binary :: binary(), WholeModule :: 'false' | binary()) -> load_ret().
load_native_sticky(Mod, Bin, WholeModule)
when is_atom(Mod), is_binary(Bin),
(is_binary(WholeModule) orelse WholeModule =:= false) ->
call({load_native_sticky,Mod,Bin,WholeModule}).
--spec delete(Module :: atom()) -> boolean().
+-spec delete(Module) -> boolean() when
+ Module :: module().
delete(Mod) when is_atom(Mod) -> call({delete,Mod}).
--spec purge(Module :: atom()) -> boolean().
+-spec purge(Module) -> boolean() when
+ Module :: module().
purge(Mod) when is_atom(Mod) -> call({purge,Mod}).
--spec soft_purge(Module :: atom()) -> boolean().
+-spec soft_purge(Module) -> boolean() when
+ Module :: module().
soft_purge(Mod) when is_atom(Mod) -> call({soft_purge,Mod}).
--spec is_loaded(Module :: atom()) -> {'file', loaded_filename()} | 'false'.
+-spec is_loaded(Module) -> {'file', Loaded} | false when
+ Module :: module(),
+ Loaded :: loaded_filename().
is_loaded(Mod) when is_atom(Mod) -> call({is_loaded,Mod}).
--spec get_object_code(Module :: atom()) -> {atom(), binary(), file:filename()} | 'error'.
+-spec get_object_code(Module) -> {Module, Binary, Filename} | error when
+ Module :: module(),
+ Binary :: binary(),
+ Filename :: file:filename().
get_object_code(Mod) when is_atom(Mod) -> call({get_object_code, Mod}).
--spec all_loaded() -> [{atom(), loaded_filename()}].
+-spec all_loaded() -> [{Module, Loaded}] when
+ Module :: module(),
+ Loaded :: loaded_filename().
all_loaded() -> call(all_loaded).
-spec stop() -> no_return().
@@ -188,65 +213,86 @@ root_dir() -> call({dir,root_dir}).
lib_dir() -> call({dir,lib_dir}).
%% XXX is_list() is for backwards compatibility -- take out in future version
--spec lib_dir(App :: atom()) -> file:filename() | {'error', 'bad_name'}.
+-spec lib_dir(Name) -> file:filename() | {'error', 'bad_name'} when
+ Name :: atom().
lib_dir(App) when is_atom(App) ; is_list(App) -> call({dir,{lib_dir,App}}).
--spec lib_dir(App :: atom(), SubDir :: atom()) -> file:filename() | {'error', 'bad_name'}.
+-spec lib_dir(Name, SubDir) -> file:filename() | {'error', 'bad_name'} when
+ Name :: atom(),
+ SubDir :: atom().
lib_dir(App, SubDir) when is_atom(App), is_atom(SubDir) -> call({dir,{lib_dir,App,SubDir}}).
-spec compiler_dir() -> file:filename().
compiler_dir() -> call({dir,compiler_dir}).
%% XXX is_list() is for backwards compatibility -- take out in future version
--spec priv_dir(App :: atom()) -> file:filename() | {'error', 'bad_name'}.
+-spec priv_dir(Name) -> file:filename() | {'error', 'bad_name'} when
+ Name :: atom().
priv_dir(App) when is_atom(App) ; is_list(App) -> call({dir,{priv_dir,App}}).
--spec stick_dir(Directory :: file:filename()) -> 'ok' | 'error'.
+-spec stick_dir(Dir) -> 'ok' | 'error' when
+ Dir :: file:filename().
stick_dir(Dir) when is_list(Dir) -> call({stick_dir,Dir}).
--spec unstick_dir(Directory :: file:filename()) -> 'ok' | 'error'.
+-spec unstick_dir(Dir) -> 'ok' | 'error' when
+ Dir :: file:filename().
unstick_dir(Dir) when is_list(Dir) -> call({unstick_dir,Dir}).
--spec stick_mod(Module :: atom()) -> 'true'.
+-spec stick_mod(Module :: module()) -> 'true'.
stick_mod(Mod) when is_atom(Mod) -> call({stick_mod,Mod}).
--spec unstick_mod(Module :: atom()) -> 'true'.
+-spec unstick_mod(Module :: module()) -> 'true'.
unstick_mod(Mod) when is_atom(Mod) -> call({unstick_mod,Mod}).
--spec is_sticky(Module :: atom()) -> boolean().
+-spec is_sticky(Module) -> boolean() when
+ Module :: module().
is_sticky(Mod) when is_atom(Mod) -> call({is_sticky,Mod}).
--spec set_path(Directories :: [file:filename()]) ->
- 'true' | {'error', 'bad_directory' | 'bad_path'}.
+-spec set_path(Path) -> 'true' | {'error', What} when
+ Path :: [Dir :: file:filename()],
+ What :: 'bad_directory' | 'bad_path'.
set_path(PathList) when is_list(PathList) -> call({set_path,PathList}).
--spec get_path() -> [file:filename()].
+-spec get_path() -> Path when
+ Path :: [Dir :: file:filename()].
get_path() -> call(get_path).
-type add_path_ret() :: 'true' | {'error', 'bad_directory'}.
--spec add_path(Directory :: file:filename()) -> add_path_ret().
+-spec add_path(Dir) -> add_path_ret() when
+ Dir :: file:filename().
add_path(Dir) when is_list(Dir) -> call({add_path,last,Dir}).
--spec add_pathz(Directory :: file:filename()) -> add_path_ret().
+-spec add_pathz(Dir) -> add_path_ret() when
+ Dir :: file:filename().
add_pathz(Dir) when is_list(Dir) -> call({add_path,last,Dir}).
--spec add_patha(Directory :: file:filename()) -> add_path_ret().
+-spec add_patha(Dir) -> add_path_ret() when
+ Dir :: file:filename().
add_patha(Dir) when is_list(Dir) -> call({add_path,first,Dir}).
--spec add_paths(Directories :: [file:filename()]) -> 'ok'.
+-spec add_paths(Dirs) -> 'ok' when
+ Dirs :: [Dir :: file:filename()].
add_paths(Dirs) when is_list(Dirs) -> call({add_paths,last,Dirs}).
--spec add_pathsz(Directories :: [file:filename()]) -> 'ok'.
+-spec add_pathsz(Dirs) -> 'ok' when
+ Dirs :: [Dir :: file:filename()].
add_pathsz(Dirs) when is_list(Dirs) -> call({add_paths,last,Dirs}).
--spec add_pathsa(Directories :: [file:filename()]) -> 'ok'.
+-spec add_pathsa(Dirs) -> 'ok' when
+ Dirs :: [Dir :: file:filename()].
add_pathsa(Dirs) when is_list(Dirs) -> call({add_paths,first,Dirs}).
--spec del_path(Name :: file:filename() | atom()) -> boolean() | {'error', 'bad_name'}.
+-spec del_path(NameOrDir) -> boolean() | {'error', What} when
+ NameOrDir :: Name | Dir,
+ Name :: atom(),
+ Dir :: file:filename(),
+ What :: 'bad_name'.
del_path(Name) when is_list(Name) ; is_atom(Name) -> call({del_path,Name}).
--type replace_path_error() :: {'error', 'bad_directory' | 'bad_name' | {'badarg',_}}.
--spec replace_path(Name:: atom(), Dir :: file:filename()) -> 'true' | replace_path_error().
+-spec replace_path(Name, Dir) -> 'true' | {'error', What} when
+ Name:: atom(),
+ Dir :: file:filename(),
+ What :: 'bad_directory' | 'bad_name' | {'badarg',_}.
replace_path(Name, Dir) when (is_atom(Name) orelse is_list(Name)),
(is_atom(Dir) orelse is_list(Dir)) ->
call({replace_path,Name,Dir}).
@@ -351,10 +397,9 @@ get_mode(Flags) ->
%% In that case return the name of the file which contains
%% the loaded object code
--type which_ret_atoms() :: loaded_ret_atoms() | 'non_existing'.
-
--spec which(Module :: atom()) -> file:filename() | which_ret_atoms().
-
+-spec which(Module) -> Which when
+ Module :: module(),
+ Which :: file:filename() | loaded_ret_atoms() | non_existing.
which(Module) when is_atom(Module) ->
case is_loaded(Module) of
false ->
@@ -394,9 +439,9 @@ which(File, Base, [Directory|Tail]) ->
%% Search the code path for a specific file. Try to locate
%% it in the code path cache if possible.
--spec where_is_file(Filename :: file:filename()) ->
- 'non_existing' | file:filename().
-
+-spec where_is_file(Filename) -> non_existing | Absname when
+ Filename :: file:filename(),
+ Absname :: file:filename().
where_is_file(File) when is_list(File) ->
case call({is_cached,File}) of
no ->
diff --git a/lib/kernel/src/code_server.erl b/lib/kernel/src/code_server.erl
index 4a1fc7df34..85bbff9cc3 100644
--- a/lib/kernel/src/code_server.erl
+++ b/lib/kernel/src/code_server.erl
@@ -1379,8 +1379,12 @@ absname_vr([[X, $:]|Name], _, _AbsBase) ->
%% Kill all processes running code from *old* Module, and then purge the
%% module. Return true if any processes killed, else false.
-do_purge(Mod) ->
- do_purge(processes(), to_atom(Mod), false).
+do_purge(Mod0) ->
+ Mod = to_atom(Mod0),
+ case erlang:check_old_code(Mod) of
+ false -> false;
+ true -> do_purge(processes(), Mod, false)
+ end.
do_purge([P|Ps], Mod, Purged) ->
case erlang:check_process_code(P, Mod) of
@@ -1399,16 +1403,19 @@ do_purge([], Mod, Purged) ->
Purged.
%% do_soft_purge(Module)
-%% Purge old code only if no procs remain that run old code
+%% Purge old code only if no procs remain that run old code.
%% Return true in that case, false if procs remain (in this
%% case old code is not purged)
do_soft_purge(Mod) ->
- catch do_soft_purge(processes(), Mod).
+ case erlang:check_old_code(Mod) of
+ false -> true;
+ true -> do_soft_purge(processes(), Mod)
+ end.
do_soft_purge([P|Ps], Mod) ->
case erlang:check_process_code(P, Mod) of
- true -> throw(false);
+ true -> false;
false -> do_soft_purge(Ps, Mod)
end;
do_soft_purge([], Mod) ->
diff --git a/lib/kernel/src/file.erl b/lib/kernel/src/file.erl
index f1a8aa9f77..5e4e1b0ba8 100644
--- a/lib/kernel/src/file.erl
+++ b/lib/kernel/src/file.erl
@@ -100,15 +100,7 @@
| 'enotblk' | 'enotdir' | 'enotsup' | 'enxio' | 'eperm'
| 'epipe' | 'erofs' | 'espipe' | 'esrch' | 'estale'
| 'exdev'.
--type bindings() :: erl_eval:binding_struct().
-
--type date() :: {Year :: pos_integer(),
- Month :: pos_integer(),
- Day ::pos_integer()}.
--type time() :: {Hour :: non_neg_integer(),
- Minute :: non_neg_integer(),
- Second :: non_neg_integer()}.
--type date_time() :: {date(), time()}.
+-type date_time() :: calendar:datetime().
-type posix_file_advise() :: 'normal' | 'sequential' | 'random'
| 'no_reuse' | 'will_need' | 'dont_need'.
@@ -920,7 +912,7 @@ eval(File) ->
-spec eval(Filename, Bindings) -> ok | {error, Reason} when
Filename :: name(),
- Bindings :: bindings(),
+ Bindings :: erl_eval:binding_struct(),
Reason :: posix() | badarg | terminated | system_limit
| {Line :: integer(), Mod :: module(), Term :: term()}.
@@ -948,7 +940,7 @@ path_eval(Path, File) ->
{ok, FullName} | {error, Reason} when
Path :: [Dir :: name()],
Filename :: name(),
- Bindings :: bindings(),
+ Bindings :: erl_eval:binding_struct(),
FullName :: filename(),
Reason :: posix() | badarg | terminated | system_limit
| {Line :: integer(), Mod :: module(), Term :: term()}.
@@ -979,7 +971,7 @@ script(File) ->
-spec script(Filename, Bindings) -> {ok, Value} | {error, Reason} when
Filename :: name(),
- Bindings :: bindings(),
+ Bindings :: erl_eval:binding_struct(),
Value :: term(),
Reason :: posix() | badarg | terminated | system_limit
| {Line :: integer(), Mod :: module(), Term :: term()}.
@@ -1010,7 +1002,7 @@ path_script(Path, File) ->
{ok, Value, FullName} | {error, Reason} when
Path :: [Dir :: name()],
Filename :: name(),
- Bindings :: bindings(),
+ Bindings :: erl_eval:binding_struct(),
Value :: term(),
FullName :: filename(),
Reason :: posix() | badarg | terminated | system_limit
diff --git a/lib/kernel/src/gen_sctp.erl b/lib/kernel/src/gen_sctp.erl
index 004f03f231..6cebb7ab97 100644
--- a/lib/kernel/src/gen_sctp.erl
+++ b/lib/kernel/src/gen_sctp.erl
@@ -33,55 +33,85 @@
-export([error_string/1]).
-export([controlling_process/2]).
--opaque assoc_id() :: term().
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
--type sctp_option() ::
- {mode, list | binary} | list | binary
- | {active, true | false | once}
- | {buffer, non_neg_integer()}
- | {tos, integer()}
- | {priority, integer()}
- | {dontroute, boolean()}
- | {reuseaddr, boolean()}
- | {linger, {boolean(), non_neg_integer()}}
- | {sndbuf, non_neg_integer()}
- | {recbuf, non_neg_integer()}
- | {sctp_rtoinfo, #sctp_rtoinfo{}}
- | {sctp_associnfo, #sctp_assocparams{}}
- | {sctp_initmsg, #sctp_initmsg{}}
- | {sctp_autoclose, timeout()}
- | {sctp_nodelay, boolean()}
- | {sctp_disable_fragments, boolean()}
- | {sctp_i_want_mapped_v4_addr, boolean()}
- | {sctp_maxseg, non_neg_integer()}
- | {sctp_primary_addr, #sctp_prim{}}
- | {sctp_set_peer_primary_addr, #sctp_setpeerprim{}}
- | {sctp_adaptation_layer, #sctp_setadaptation{}}
- | {sctp_peer_addr_params, #sctp_paddrparams{}}
- | {sctp_default_send_param, #sctp_sndrcvinfo{}}
- | {sctp_events, #sctp_event_subscribe{}}
- | {sctp_delayed_ack_time, #sctp_assoc_value{}}
- | {sctp_status, #sctp_status{}}
- | {sctp_get_peer_addr_info, #sctp_paddrinfo{}}.
--opaque sctp_socket() :: port().
-
--spec open() -> {ok, Socket} | {error, posix()} when
+-type assoc_id() :: term().
+-type option() ::
+ {active, true | false | once} |
+ {buffer, non_neg_integer()} |
+ {dontroute, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {mode, list | binary} | list | binary |
+ {priority, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sctp_adaptation_layer, #sctp_setadaptation{}} |
+ {sctp_associnfo, #sctp_assocparams{}} |
+ {sctp_autoclose, non_neg_integer()} |
+ {sctp_default_send_param, #sctp_sndrcvinfo{}} |
+ {sctp_delayed_ack_time, #sctp_assoc_value{}} |
+ {sctp_disable_fragments, boolean()} |
+ {sctp_events, #sctp_event_subscribe{}} |
+ {sctp_get_peer_addr_info, #sctp_paddrinfo{}} |
+ {sctp_i_want_mapped_v4_addr, boolean()} |
+ {sctp_initmsg, #sctp_initmsg{}} |
+ {sctp_maxseg, non_neg_integer()} |
+ {sctp_nodelay, boolean()} |
+ {sctp_peer_addr_params, #sctp_paddrparams{}} |
+ {sctp_primary_addr, #sctp_prim{}} |
+ {sctp_rtoinfo, #sctp_rtoinfo{}} |
+ {sctp_set_peer_primary_addr, #sctp_setpeerprim{}} |
+ {sctp_status, #sctp_status{}} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ buffer |
+ dontroute |
+ linger |
+ mode |
+ priority |
+ recbuf |
+ reuseaddr |
+ sctp_adaptation_layer |
+ sctp_associnfo |
+ sctp_autoclose |
+ sctp_default_send_param |
+ sctp_delayed_ack_time |
+ sctp_disable_fragments |
+ sctp_events |
+ sctp_get_peer_addr_info |
+ sctp_i_want_mapped_v4_addr |
+ sctp_initmsg |
+ sctp_maxseg |
+ sctp_nodelay |
+ sctp_peer_addr_params |
+ sctp_primary_addr |
+ sctp_rtoinfo |
+ sctp_set_peer_primary_addr |
+ sctp_status |
+ sndbuf |
+ tos.
+-type sctp_socket() :: port().
+
+-export_type([assoc_id/0, option/0, option_name/0, sctp_socket/0]).
+
+-spec open() -> {ok, Socket} | {error, inet:posix()} when
Socket :: sctp_socket().
open() ->
open([]).
--spec open(Port) -> {ok, Socket} | {error, posix()} when
- Port :: port_number(),
+-spec open(Port) -> {ok, Socket} | {error, inet:posix()} when
+ Port :: inet:port_number(),
Socket :: sctp_socket();
- (Opts) -> {ok, Socket} | {error, posix()} when
+ (Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Opts) when is_list(Opts) ->
@@ -98,11 +128,15 @@ open(Port) when is_integer(Port) ->
open(X) ->
erlang:error(badarg, [X]).
--spec open(Port, Opts) -> {ok, Socket} | {error, posix()} when
+-spec open(Port, Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Port, Opts) when is_integer(Port), is_list(Opts) ->
@@ -110,7 +144,7 @@ open(Port, Opts) when is_integer(Port), is_list(Opts) ->
open(Port, Opts) ->
erlang:error(badarg, [Port,Opts]).
--spec close(Socket) -> ok | {error, posix()} when
+-spec close(Socket) -> ok | {error, inet:posix()} when
Socket :: sctp_socket().
close(S) when is_port(S) ->
@@ -138,22 +172,22 @@ listen(S, Flag) when is_port(S), is_boolean(Flag) ->
listen(S, Flag) ->
erlang:error(badarg, [S,Flag]).
--spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, posix()} when
+-spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Assoc :: #sctp_assoc_change{}.
connect(S, Addr, Port, Opts) ->
connect(S, Addr, Port, Opts, infinity).
-spec connect(Socket, Addr, Port, Opts, Timeout) ->
- {ok, Assoc} | {error, posix()} when
+ {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Timeout :: timeout(),
Assoc :: #sctp_assoc_change{}.
@@ -166,21 +200,21 @@ connect(S, Addr, Port, Opts, Timeout) ->
end.
-spec connect_init(Socket, Addr, Port, Opts) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()].
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()].
connect_init(S, Addr, Port, Opts) ->
connect_init(S, Addr, Port, Opts, infinity).
-spec connect_init(Socket, Addr, Port, Opts, Timeout) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()],
Timeout :: timeout().
connect_init(S, Addr, Port, Opts, Timeout) ->
@@ -232,7 +266,7 @@ eof(S, #sctp_assoc_change{assoc_id=AssocId}) when is_port(S) ->
eof(S, Assoc) ->
erlang:error(badarg, [S,Assoc]).
--spec abort(Socket, Assoc) -> ok | {error, posix()} when
+-spec abort(Socket, Assoc) -> ok | {error, inet:posix()} when
Socket :: sctp_socket(),
Assoc :: #sctp_assoc_change{}.
@@ -294,13 +328,13 @@ send(S, AssocChange, Stream, Data) ->
-spec recv(Socket) -> {ok, {FromIP, FromPort, AncData, Data}}
| {error, Reason} when
Socket :: sctp_socket(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
@@ -311,13 +345,13 @@ recv(S) ->
| {error, Reason} when
Socket :: sctp_socket(),
Timeout :: timeout(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
diff --git a/lib/kernel/src/gen_tcp.erl b/lib/kernel/src/gen_tcp.erl
index bee61ca84a..8ab18c01b4 100644
--- a/lib/kernel/src/gen_tcp.erl
+++ b/lib/kernel/src/gen_tcp.erl
@@ -28,34 +28,108 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {bit8, clear | set | on | off} |
+ {buffer, non_neg_integer()} |
+ {delay_send, boolean()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {exit_on_close, boolean()} |
+ {header, non_neg_integer()} |
+ {high_watermark, non_neg_integer()} |
+ {keepalive, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {low_watermark, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {nodelay, boolean()} |
+ {packet,
+ 0 | 1 | 2 | 4 | raw | sunrm | asn1 |
+ cdr | fcgi | line | tpkt | http | httph | http_bin | httph_bin } |
+ {packet_size, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {send_timeout, non_neg_integer() | infinity} |
+ {send_timeout_close, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ bit8 |
+ buffer |
+ delay_send |
+ deliver |
+ dontroute |
+ exit_on_close |
+ header |
+ high_watermark |
+ keepalive |
+ linger |
+ low_watermark |
+ mode |
+ nodelay |
+ packet |
+ packet_size |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ recbuf |
+ reuseaddr |
+ send_timeout |
+ send_timeout_close |
+ sndbuf |
+ tos.
+-type connect_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {tcp_module, module()} |
+ option().
+-type listen_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {backlog, B :: non_neg_integer()} |
+ {tcp_module, module()} |
+ option().
-type socket() :: port().
+-export_type([option/0, option_name/0, connect_option/0, listen_option/0]).
+
%%
%% Connect a socket
%%
-spec connect(Address, Port, Options) -> {ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts) ->
connect(Address,Port,Opts,infinity).
-spec connect(Address, Port, Options, Timeout) ->
{ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Timeout :: timeout(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts, Time) ->
Timer = inet:start_timer(Time),
@@ -97,10 +171,10 @@ try_connect([], _Port, _Opts, _Timer, _Mod, Err) ->
%%
-spec listen(Port, Options) -> {ok, ListenSocket} | {error, Reason} when
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Options :: [listen_option()],
ListenSocket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
listen(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -119,7 +193,7 @@ listen(Port, Opts) ->
-spec accept(ListenSocket) -> {ok, Socket} | {error, Reason} when
ListenSocket :: socket(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S) ->
case inet_db:lookup_socket(S) of
@@ -133,7 +207,7 @@ accept(S) ->
ListenSocket :: socket(),
Timeout :: timeout(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S, Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -150,7 +224,7 @@ accept(S, Time) when is_port(S) ->
-spec shutdown(Socket, How) -> ok | {error, Reason} when
Socket :: socket(),
How :: read | write | read_write,
- Reason :: posix().
+ Reason :: inet:posix().
shutdown(S, How) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -176,8 +250,8 @@ close(S) ->
-spec send(Socket, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Packet :: string() | binary(),
- Reason :: posix().
+ Packet :: iodata(),
+ Reason :: inet:posix().
send(S, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -195,7 +269,7 @@ send(S, Packet) when is_port(S) ->
Socket :: socket(),
Length :: non_neg_integer(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length) when is_port(S) ->
@@ -211,7 +285,7 @@ recv(S, Length) when is_port(S) ->
Length :: non_neg_integer(),
Timeout :: timeout(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length, Time) when is_port(S) ->
@@ -237,7 +311,7 @@ unrecv(S, Data) when is_port(S) ->
-spec controlling_process(Socket, Pid) -> ok | {error, Reason} when
Socket :: socket(),
Pid :: pid(),
- Reason :: closed | not_owner | posix().
+ Reason :: closed | not_owner | inet:posix().
controlling_process(S, NewOwner) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/gen_udp.erl b/lib/kernel/src/gen_udp.erl
index 7d14615c04..8688799ae9 100644
--- a/lib/kernel/src/gen_udp.erl
+++ b/lib/kernel/src/gen_udp.erl
@@ -25,25 +25,74 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {add_membership, {inet:ip_address(), inet:ip_address()}} |
+ {broadcast, boolean()} |
+ {buffer, non_neg_integer()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {drop_membership, {inet:ip_address(), inet:ip_address()}} |
+ {header, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {multicast_if, inet:ip_address()} |
+ {multicast_loop, boolean()} |
+ {multicast_ttl, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {read_packets, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ broadcast |
+ buffer |
+ deliver |
+ dontroute |
+ header |
+ mode |
+ multicast_if |
+ multicast_loop |
+ multicast_ttl |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ read_packets |
+ recbuf |
+ reuseaddr |
+ sndbuf |
+ tos.
-type socket() :: port().
+-export_type([option/0, option_name/0]).
+
-spec open(Port) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
+ Port :: inet:port_number(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port) ->
open(Port, []).
-spec open(Port, Opts) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
- Opts :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Opts :: [Option],
+ Option :: {ip, inet:ip_address()}
+ | {fd, non_neg_integer()}
+ | {ifaddr, inet:ip_address()}
+ | inet:address_family()
+ | {port, inet:port_number()}
+ | option(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -58,10 +107,10 @@ close(S) ->
-spec send(Socket, Address, Port, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Packet :: iodata(),
+ Reason :: not_owner | inet:posix().
send(S, Address, Port, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -92,10 +141,10 @@ send(S, Packet) when is_port(S) ->
{ok, {Address, Port, Packet}} | {error, Reason} when
Socket :: socket(),
Length :: non_neg_integer(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len) when is_port(S), is_integer(Len) ->
case inet_db:lookup_socket(S) of
@@ -110,10 +159,10 @@ recv(S,Len) when is_port(S), is_integer(Len) ->
Socket :: socket(),
Length :: non_neg_integer(),
Timeout :: timeout(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len,Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/inet.erl b/lib/kernel/src/inet.erl
index 5649188c38..48a6f3db65 100644
--- a/lib/kernel/src/inet.erl
+++ b/lib/kernel/src/inet.erl
@@ -63,8 +63,9 @@
%% timer interface
-export([start_timer/1, timeout/1, timeout/2, stop_timer/1]).
--export_type([family_option/0, hostent/0, hostname/0, ip4_address/0,
- ip6_address/0, ip_address/0, posix/0, socket/0]).
+-export_type([address_family/0, hostent/0, hostname/0, ip4_address/0,
+ ip6_address/0, ip_address/0, posix/0, socket/0,
+ port_number/0]).
%% imports
-import(lists, [append/1, duplicate/2, filter/2, foldl/3]).
@@ -87,98 +88,15 @@
-type ip6_address() :: {0..65535,0..65535,0..65535,0..65535,
0..65535,0..65535,0..65535,0..65535}.
-type ip_address() :: ip4_address() | ip6_address().
--type ip_port() :: 0..65535.
+-type port_number() :: 0..65535.
-type posix() :: exbadport | exbadseq | file:posix().
-type socket() :: port().
-type socket_setopt() ::
- {'raw', non_neg_integer(), non_neg_integer(), binary()} |
- %% TCP/UDP options
- {'reuseaddr', boolean()} |
- {'keepalive', boolean()} |
- {'dontroute', boolean()} |
- {'linger', {boolean(), non_neg_integer()}} |
- {'broadcast', boolean()} |
- {'sndbuf', non_neg_integer()} |
- {'recbuf', non_neg_integer()} |
- {'priority', non_neg_integer()} |
- {'tos', non_neg_integer()} |
- {'nodelay', boolean()} |
- {'multicast_ttl', non_neg_integer()} |
- {'multicast_loop', boolean()} |
- {'multicast_if', ip_address()} |
- {'add_membership', {ip_address(), ip_address()}} |
- {'drop_membership', {ip_address(), ip_address()}} |
- {'header', non_neg_integer()} |
- {'buffer', non_neg_integer()} |
- {'active', boolean() | 'once'} |
- {'packet',
- 0 | 1 | 2 | 4 | 'raw' | 'sunrm' | 'asn1' |
- 'cdr' | 'fcgi' | 'line' | 'tpkt' | 'http' | 'httph' | 'http_bin' | 'httph_bin' } |
- {'mode', 'list' | 'binary'} |
- {'port', 'port', 'term'} |
- {'exit_on_close', boolean()} |
- {'low_watermark', non_neg_integer()} |
- {'high_watermark', non_neg_integer()} |
- {'bit8', 'clear' | 'set' | 'on' | 'off'} |
- {'send_timeout', non_neg_integer() | 'infinity'} |
- {'send_timeout_close', boolean()} |
- {'delay_send', boolean()} |
- {'packet_size', non_neg_integer()} |
- {'read_packets', non_neg_integer()} |
- %% SCTP options
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- {'sctp_associnfo', #sctp_assocparams{}} |
- {'sctp_initmsg', #sctp_initmsg{}} |
- {'sctp_nodelay', boolean()} |
- {'sctp_autoclose', non_neg_integer()} |
- {'sctp_disable_fragments', boolean()} |
- {'sctp_i_want_mapped_v4_addr', boolean()} |
- {'sctp_maxseg', non_neg_integer()} |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- {'sctp_events', #sctp_event_subscribe{}} |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
+ gen_sctp:option() | gen_tcp:option() | gen_udp:option().
-type socket_getopt() ::
- {'raw',
- non_neg_integer(), non_neg_integer(), binary()|non_neg_integer()} |
- %% TCP/UDP options
- 'reuseaddr' | 'keepalive' | 'dontroute' | 'linger' |
- 'broadcast' | 'sndbuf' | 'recbuf' | 'priority' | 'tos' | 'nodelay' |
- 'multicast_ttl' | 'multicast_loop' | 'multicast_if' |
- 'add_membership' | 'drop_membership' |
- 'header' | 'buffer' | 'active' | 'packet' | 'mode' | 'port' |
- 'exit_on_close' | 'low_watermark' | 'high_watermark' | 'bit8' |
- 'send_timeout' | 'send_timeout_close' |
- 'delay_send' | 'packet_size' | 'read_packets' |
- %% SCTP options
- {'sctp_status', #sctp_status{}} |
- 'sctp_get_peer_addr_info' |
- {'sctp_get_peer_addr_info', #sctp_status{}} |
- 'sctp_rtoinfo' |
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- 'sctp_associnfo' |
- {'sctp_associnfo', #sctp_assocparams{}} |
- 'sctp_initmsg' |
- {'sctp_initmsg', #sctp_initmsg{}} |
- 'sctp_nodelay' | 'sctp_autoclose' | 'sctp_disable_fragments' |
- 'sctp_i_want_mapped_v4_addr' | 'sctp_maxseg' |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- 'sctp_adaptation_layer' |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- 'sctp_default_send_param' |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- 'sctp_events' |
- {'sctp_events', #sctp_event_subscribe{}} |
- 'sctp_delayed_ack_time' |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
-
+ gen_sctp:option_name() | gen_tcp:option_name() | gen_udp:option_name().
-type ether_address() :: [0..255].
-type if_setopt() ::
@@ -196,7 +114,7 @@
'addr' | 'broadaddr' | 'dstaddr' |
'mtu' | 'netmask' | 'flags' |'hwaddr'.
--type family_option() :: 'inet' | 'inet6'.
+-type address_family() :: 'inet' | 'inet6'.
-type protocol_option() :: 'tcp' | 'udp' | 'sctp'.
-type stat_option() ::
'recv_cnt' | 'recv_max' | 'recv_avg' | 'recv_oct' | 'recv_dvi' |
@@ -229,7 +147,7 @@ close(Socket) ->
peername(Socket) ->
prim_inet:peername(Socket).
--spec setpeername(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setpeername(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setpeername(Socket, {IP,Port}) ->
@@ -246,7 +164,7 @@ setpeername(Socket, undefined) ->
sockname(Socket) ->
prim_inet:sockname(Socket).
--spec setsockname(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setsockname(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setsockname(Socket, {IP,Port}) ->
@@ -254,7 +172,9 @@ setsockname(Socket, {IP,Port}) ->
setsockname(Socket, undefined) ->
prim_inet:setsockname(Socket, undefined).
--spec port(Socket :: socket()) -> {'ok', ip_port()} | {'error', any()}.
+-spec port(Socket) -> {'ok', Port} | {'error', any()} when
+ Socket :: socket(),
+ Port :: port_number().
port(Socket) ->
case prim_inet:sockname(Socket) of
@@ -268,16 +188,18 @@ port(Socket) ->
send(Socket, Packet) ->
prim_inet:send(Socket, Packet).
--spec setopts(Socket :: socket(), Opts :: [socket_setopt()]) ->
- 'ok' | {'error', posix()}.
+-spec setopts(Socket, Options) -> ok | {error, posix()} when
+ Socket :: socket(),
+ Options :: [socket_setopt()].
setopts(Socket, Opts) ->
prim_inet:setopts(Socket, Opts).
-spec getopts(Socket, Options) ->
- {'ok', [socket_setopt()]} | {'error', posix()} when
+ {'ok', OptionValues} | {'error', posix()} when
Socket :: socket(),
- Options :: [socket_getopt()].
+ Options :: [socket_getopt()],
+ OptionValues :: [socket_setopt()].
getopts(Socket, Opts) ->
prim_inet:getopts(Socket, Opts).
@@ -419,14 +341,19 @@ gethostname() ->
gethostname(Socket) ->
prim_inet:gethostname(Socket).
--spec getstat(Socket :: socket()) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket) ->
prim_inet:getstat(Socket, stats()).
--spec getstat(Socket :: socket(), Statoptions :: [stat_option()]) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket, Options) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ Options :: [stat_option()],
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket,What) ->
prim_inet:getstat(Socket, What).
@@ -441,14 +368,14 @@ gethostbyname(Name) ->
-spec gethostbyname(Hostname, Family) ->
{ok, Hostent} | {error, posix()} when
Hostname :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Hostent :: hostent().
gethostbyname(Name,Family) ->
gethostbyname_tm(Name, Family, false).
-spec gethostbyname(Name :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', #hostent{}} | {'error', posix()}.
@@ -527,14 +454,14 @@ getfd(Socket) ->
-spec getaddr(Host, Family) -> {ok, Address} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Address :: ip_address().
getaddr(Address, Family) ->
getaddr(Address, Family, infinity).
-spec getaddr(Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', ip_address()} | {'error', posix()}.
@@ -553,14 +480,14 @@ getaddr_tm(Address, Family, Timer) ->
-spec getaddrs(Host, Family) ->
{ok, Addresses} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Addresses :: [ip_address()].
getaddrs(Address, Family) ->
getaddrs(Address, Family, infinity).
-spec getaddrs(Host :: ip_address() | string() | atom(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', [ip_address()]} | {'error', posix()}.
@@ -570,7 +497,7 @@ getaddrs(Address, Family, Timeout) ->
stop_timer(Timer),
Res.
--spec getservbyport(Port :: ip_port(), Protocol :: atom() | string()) ->
+-spec getservbyport(Port :: port_number(), Protocol :: atom() | string()) ->
{'ok', string()} | {'error', posix()}.
getservbyport(Port, Proto) ->
@@ -584,7 +511,7 @@ getservbyport(Port, Proto) ->
-spec getservbyname(Name :: atom() | string(),
Protocol :: atom() | string()) ->
- {'ok', ip_port()} | {'error', posix()}.
+ {'ok', port_number()} | {'error', posix()}.
getservbyname(Name, Protocol) when is_atom(Name) ->
case inet_udp:open(0, []) of
@@ -1067,7 +994,7 @@ gethostbyaddr_tm_native(Addr, Timer, Opts) ->
-spec open(Fd :: integer(),
Addr :: ip_address(),
- Port :: ip_port(),
+ Port :: port_number(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
Family :: 'inet' | 'inet6',
@@ -1108,7 +1035,7 @@ open(Fd, _Addr, _Port, Opts, Protocol, Family, Module) ->
-spec fdopen(Fd :: non_neg_integer(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
- Family :: family_option(),
+ Family :: address_family(),
Module :: atom()) ->
{'ok', socket()} | {'error', posix()}.
diff --git a/lib/kernel/src/inet_config.erl b/lib/kernel/src/inet_config.erl
index 2458876326..1ddbdcec25 100644
--- a/lib/kernel/src/inet_config.erl
+++ b/lib/kernel/src/inet_config.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -44,26 +44,6 @@
%%
-spec init() -> 'ok'.
init() ->
- OsType = os:type(),
- case OsType of
- {ose,_} ->
- case init:get_argument(loader) of
- {ok,[["ose_inet"]]} ->
- %% port already started by prim_loader
- ok;
- _Other ->
- %% Setup reserved port for ose_inet driver (only OSE)
- case catch erlang:open_port({spawn,"ose_inet"}, [binary]) of
- {'EXIT',Why} ->
- error("can't open port for ose_inet: ~p", [Why]);
- OseInetPort ->
- erlang:display({ose_inet_port,OseInetPort})
- end
- end;
- _ ->
- ok
- end,
-
set_hostname(),
%% Note: In shortnames (or non-distributed) mode we don't need to know
@@ -71,6 +51,7 @@ init() ->
%% the user to provide it (by means of inetrc), so we need to look
%% for it ourselves.
+ OsType = os:type(),
do_load_resolv(OsType, erl_dist_mode()),
case OsType of
@@ -226,35 +207,6 @@ do_load_resolv(vxworks, _) ->
load_resolv(Resolv, resolv)
end;
-do_load_resolv({ose,_Type}, _) ->
- inet_db:set_lookup([file, dns]),
- case os:getenv("NAMESERVER") of
- false ->
- case os:getenv("RESOLVFILE") of
- false ->
- erlang:display('Warning: No NAMESERVER or RESOLVFILE specified!'),
- no_resolv;
- Resolv ->
- load_resolv(Resolv, resolv)
- end;
- Ns ->
- {ok,IP} = inet_parse:address(Ns),
- inet_db:add_rc_list([{nameserver,IP}])
- end,
- case os:getenv("DOMAIN") of
- false ->
- no_domain;
- D ->
- ok = inet_db:add_rc_list([{domain,D}])
- end,
- case os:getenv("HOSTSFILE") of
- false ->
- erlang:display('Warning: No HOSTSFILE specified!'),
- no_hosts_file;
- File ->
- load_hosts(File, ose)
- end;
-
do_load_resolv(_, _) ->
inet_db:set_lookup([native]).
diff --git a/lib/kernel/src/inet_dns_record_adts.pl b/lib/kernel/src/inet_dns_record_adts.pl
index b1d8fab939..da50c7114f 100644
--- a/lib/kernel/src/inet_dns_record_adts.pl
+++ b/lib/kernel/src/inet_dns_record_adts.pl
@@ -2,7 +2,7 @@
#
# %CopyrightBegin%
#
-# Copyright Ericsson AB 2009. All Rights Reserved.
+# Copyright Ericsson AB 2009-2011. All Rights Reserved.
#
# The contents of this file are subject to the Erlang Public License,
# Version 1.1, (the "License"); you may not use this file except in
@@ -73,6 +73,10 @@ while( my ($Name, $r) = each(%Names)) {
# "@Values" = "V1,V2"...",VN"
my @D = @DATA;
foreach my $line (@D) {
+ # Ignore !name lines
+ if ($line =~ s/^\!(\S+)\s+//) {
+ next if $1 eq $Name;
+ }
my $m = 1;
# For leading * iterate $n times, otherwise once
$line =~ s/^\s*[*]// and $m = $n;
@@ -155,9 +159,9 @@ make_Name() -> \
make_Name(L) when is_list(L) -> \
make_Name(#Record{}, L).
-%% Generate #Record{} with one updated field
-%%
-*make_Name(Field, Value) -> \
+!dns_rr_opt %% Generate #Record{} with one updated field
+!dns_rr_opt %%
+!dns_rr_opt *make_Name(Field, Value) -> \
#Record{Field=Value};
%%
%% Update #Record{} from property list
diff --git a/lib/kernel/src/inet_res.erl b/lib/kernel/src/inet_res.erl
index d1f5644ff7..59ba408d7a 100644
--- a/lib/kernel/src/inet_res.erl
+++ b/lib/kernel/src/inet_res.erl
@@ -407,7 +407,7 @@ gethostbyname(Name) ->
-spec gethostbyname(Name, Family) -> {ok, Hostent} | {error, Reason} when
Name :: dns_name(),
Hostent :: inet:hostent(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family) ->
@@ -418,7 +418,7 @@ gethostbyname(Name,Family) ->
Name :: dns_name(),
Hostent :: inet:hostent(),
Timeout :: timeout(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family,Timeout) ->
diff --git a/lib/kernel/src/rpc.erl b/lib/kernel/src/rpc.erl
index be35f99ed2..e214ffa404 100644
--- a/lib/kernel/src/rpc.erl
+++ b/lib/kernel/src/rpc.erl
@@ -662,9 +662,10 @@ async_call(Node, Mod, Fun, Args) ->
ReplyTo ! {self(), {promise_reply, R}} %% self() is key
end).
--spec yield(Key) -> {value, Val} | timeout when
+-spec yield(Key) -> Res | {badrpc, Reason} when
Key :: key(),
- Val :: (Res :: term()) | {badrpc, Reason :: term()}.
+ Res :: term(),
+ Reason :: term().
yield(Key) when is_pid(Key) ->
{value,R} = do_yield(Key, infinity),
diff --git a/lib/kernel/test/application_SUITE.erl b/lib/kernel/test/application_SUITE.erl
index 4ae4151004..2c5b8ccb66 100644
--- a/lib/kernel/test/application_SUITE.erl
+++ b/lib/kernel/test/application_SUITE.erl
@@ -967,7 +967,7 @@ otp_1586(doc) ->
["Test recursive load of applications."];
otp_1586(Conf) when is_list(Conf) ->
Dir = ?config(priv_dir,Conf),
- {ok, Fd} = file:open(filename:join(Dir, "app5.app"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "app5.app"), [write]),
w_app5(Fd),
file:close(Fd),
?line code:add_patha(Dir),
@@ -1021,10 +1021,10 @@ otp_2012(Conf) when is_list(Conf) ->
?line yes = global:register_name(conf_change, CcPid),
% Write a .app file
- {ok, Fd} = file:open("app1.app", write),
+ {ok, Fd} = file:open("app1.app", [write]),
w_app1(Fd),
file:close(Fd),
- {ok, Fd2} = file:open("app2.app", write),
+ {ok, Fd2} = file:open("app2.app", [write]),
w_app1(Fd2),
file:close(Fd2),
@@ -1096,7 +1096,7 @@ otp_2973(doc) ->
["Test of two processes simultanously starting the same application."];
otp_2973(Conf) when is_list(Conf) ->
% Write a .app file
- {ok, Fd} = file:open("app0.app", write),
+ {ok, Fd} = file:open("app0.app", [write]),
w_app(Fd, app0()),
file:close(Fd),
@@ -1138,7 +1138,7 @@ otp_2973(Conf) when is_list(Conf) ->
% Write a .app file
- ?line {ok, Fda} = file:open("app_start_error.app", write),
+ ?line {ok, Fda} = file:open("app_start_error.app", [write]),
?line w_app_start_error(Fda),
?line file:close(Fda),
@@ -1273,12 +1273,12 @@ otp_4066(Conf) when is_list(Conf) ->
App1Nodes = {app1, AllNodes},
Dir = ?config(priv_dir,Conf),
- ?line {ok, FdC} = file:open(filename:join(Dir, "otp_4066.config"), write),
+ ?line {ok, FdC} = file:open(filename:join(Dir, "otp_4066.config"), [write]),
?line write_config(FdC, config_4066(AllNodes, 5000, [App1Nodes])),
?line file:close(FdC),
% Write the app1.app file
- ?line {ok, FdA12} = file:open(filename:join(Dir, "app1.app"), write),
+ ?line {ok, FdA12} = file:open(filename:join(Dir, "app1.app"), [write]),
?line w_app1(FdA12),
?line file:close(FdA12),
@@ -1441,7 +1441,7 @@ otp_5606(Conf) when is_list(Conf) ->
%% Write a config file
Dir = ?config(priv_dir, Conf),
- {ok, Fd} = file:open(filename:join(Dir, "sys.config"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "sys.config"), [write]),
NodeNames = [Ncp1, Ncp2] = node_names([cp1, cp2], Conf),
(config4(NodeNames))(Fd, 10000),
file:close(Fd),
@@ -2436,7 +2436,7 @@ start_node_config_sf(Name, SysConfigFun, Conf) ->
write_config_file(SysConfigFun, Conf) ->
Dir = ?config(priv_dir, Conf),
- {ok, Fd} = file:open(filename:join(Dir, "sys.config"), write),
+ {ok, Fd} = file:open(filename:join(Dir, "sys.config"), [write]),
SysConfigFun(Fd),
file:close(Fd),
filename:join(Dir,"sys").
@@ -2571,15 +2571,15 @@ cc(List) ->
create_app() ->
?line Dir = "./",
?line App1 = Dir ++ "app1",
- ?line {ok, Fd1} = file:open(App1++".app",write),
+ ?line {ok, Fd1} = file:open(App1++".app",[write]),
?line io:format(Fd1, "~p. \n", [app1()]),
?line file:close(Fd1),
?line App2 = Dir ++ "app2",
- ?line {ok, Fd2} = file:open(App2++".app",write),
+ ?line {ok, Fd2} = file:open(App2++".app",[write]),
?line io:format(Fd2, "~p. \n", [app2()]),
?line file:close(Fd2),
?line App3 = Dir ++ "app_sp",
- ?line {ok, Fd3} = file:open(App3++".app",write),
+ ?line {ok, Fd3} = file:open(App3++".app",[write]),
?line io:format(Fd3, "~p. \n", [app_sp()]),
?line file:close(Fd3),
ok.
@@ -2591,7 +2591,7 @@ create_script(ScriptName) ->
?line Apps = which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2610,7 +2610,7 @@ create_script_dc(ScriptName) ->
?line Apps = which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2630,7 +2630,7 @@ create_script_3002(ScriptName) ->
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
?line {value,{_,_,SaslVer}} = lists:keysearch(sasl,1,Apps),
- ?line {ok,Fd} = file:open(Name++".rel",write),
+ ?line {ok,Fd} = file:open(Name++".rel",[write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"LATEST\"}, \n"
" {erts, \"4.4\"}, \n"
@@ -2646,22 +2646,22 @@ create_script_3002(ScriptName) ->
distr_changed_prep(Conf) when is_list(Conf) ->
% Write .app files
- ?line {ok, Fd1} = file:open("app1.app", write),
+ ?line {ok, Fd1} = file:open("app1.app", [write]),
?line w_app1(Fd1),
?line file:close(Fd1),
- ?line {ok, Fd2} = file:open("app2.app", write),
+ ?line {ok, Fd2} = file:open("app2.app", [write]),
?line w_app2(Fd2),
?line file:close(Fd2),
- ?line {ok, Fd3} = file:open("app3.app", write),
+ ?line {ok, Fd3} = file:open("app3.app", [write]),
?line w_app3(Fd3),
?line file:close(Fd3),
- ?line {ok, Fd4} = file:open("app6.app", write),
+ ?line {ok, Fd4} = file:open("app6.app", [write]),
?line w_app6(Fd4),
?line file:close(Fd4),
- ?line {ok, Fd5} = file:open("app7.app", write),
+ ?line {ok, Fd5} = file:open("app7.app", [write]),
?line w_app7(Fd5),
?line file:close(Fd5),
- ?line {ok, Fd6} = file:open("app8.app", write),
+ ?line {ok, Fd6} = file:open("app8.app", [write]),
?line w_app8(Fd6),
?line file:close(Fd6),
@@ -2683,7 +2683,7 @@ distr_changed_prep(Conf) when is_list(Conf) ->
WithSyncTime = config_fun(config_dc(NodeNames)),
?line Dir = ?config(priv_dir,Conf),
- ?line {ok, Fd_dc2} = file:open(filename:join(Dir, "sys2.config"), write),
+ ?line {ok, Fd_dc2} = file:open(filename:join(Dir, "sys2.config"), [write]),
?line (config_dc2(NodeNames))(Fd_dc2),
?line file:close(Fd_dc2),
?line Config2 = filename:join(Dir, "sys2"),
diff --git a/lib/kernel/test/code_SUITE.erl b/lib/kernel/test/code_SUITE.erl
index 3ad49254f1..86cccebc29 100644
--- a/lib/kernel/test/code_SUITE.erl
+++ b/lib/kernel/test/code_SUITE.erl
@@ -258,8 +258,8 @@ replace_path(Config) when is_list(Config) ->
%% Add a completly new application.
- NewAppName = "blurf_blarfer",
- ?line NewAppDir = filename:join(Cwd, NewAppName ++ "-6.33.1"),
+ NewAppName = 'blurf_blarfer',
+ ?line NewAppDir = filename:join(Cwd, atom_to_list(NewAppName) ++ "-6.33.1"),
?line ok = file:make_dir(NewAppDir),
?line true = code:replace_path(NewAppName, NewAppDir),
?line NewAppDir = code:lib_dir(NewAppName),
@@ -410,8 +410,10 @@ all_loaded_1() ->
?line Loaded2 = match_and_remove(Preloaded, Loaded1),
ObjExt = code:objfile_extension(),
- ?line [] = lists:filter(fun({Mod,AbsName}) when is_atom(Mod), is_list(AbsName) ->
- Mod =:= filename:basename(AbsName, ObjExt);
+ ?line [] = lists:filter(fun({Mod,AbsName}) when is_atom(Mod),
+ is_list(AbsName) ->
+ Mod =/= list_to_atom(filename:basename(AbsName,
+ ObjExt));
(_) -> true
end,
Loaded2),
@@ -1023,8 +1025,8 @@ mult_lib_roots(Config) when is_list(Config) ->
"my_dummy_app-c/ebin/code_SUITE_mult_root_module"),
%% Set up ERL_LIBS and start a slave node.
- ErlLibs = filename:join(DataDir, first_root) ++ mult_lib_sep() ++
- filename:join(DataDir, second_root),
+ ErlLibs = filename:join(DataDir, "first_root") ++ mult_lib_sep() ++
+ filename:join(DataDir, "second_root"),
?line {ok,Node} =
?t:start_node(mult_lib_roots, slave,
@@ -1344,7 +1346,7 @@ create_script(Config) ->
?line Apps = application_controller:which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel, 1, Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib, 1, Apps),
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"9.42\"}, \n"
@@ -1409,7 +1411,7 @@ create_big_script(Config,Local) ->
%% Now we should have only "real" applications...
?line [application:load(list_to_atom(Y)) || {match,[Y]} <- [ re:run(X,code:lib_dir()++"/"++"([^/-]*).*/ebin",[{capture,[1],list}]) || X <- code:get_path()],filter_app(Y,Local)],
?line Apps = [ {N,V} || {N,_,V} <- application:loaded_applications()],
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"9.42\"}, \n"
diff --git a/lib/kernel/test/disk_log_SUITE.erl b/lib/kernel/test/disk_log_SUITE.erl
index 4ae47b4762..ee1e2319b5 100644
--- a/lib/kernel/test/disk_log_SUITE.erl
+++ b/lib/kernel/test/disk_log_SUITE.erl
@@ -4917,7 +4917,7 @@ mark(FileName, What) ->
ok = file:close(Fd).
crash(File, Where) ->
- {ok, Fd} = file:open(File, read_write),
+ {ok, Fd} = file:open(File, [read,write]),
file:position(Fd, Where),
ok = file:write(Fd, [10]),
ok = file:close(Fd).
@@ -4933,7 +4933,7 @@ writable(Fname) ->
file:write_file_info(Fname, Info#file_info{mode = Mode}).
truncate(File, Where) ->
- {ok, Fd} = file:open(File, read_write),
+ {ok, Fd} = file:open(File, [read,write]),
file:position(Fd, Where),
ok = file:truncate(Fd),
ok = file:close(Fd).
diff --git a/lib/kernel/test/erl_prim_loader_SUITE.erl b/lib/kernel/test/erl_prim_loader_SUITE.erl
index f47c4603cf..7599a89779 100644
--- a/lib/kernel/test/erl_prim_loader_SUITE.erl
+++ b/lib/kernel/test/erl_prim_loader_SUITE.erl
@@ -547,8 +547,6 @@ host() ->
stop_node(Node) ->
test_server:stop_node(Node).
-get_loader_flag({ose,_}) ->
- " -loader ose_inet ";
get_loader_flag(_) ->
" -loader inet ".
diff --git a/lib/kernel/test/file_SUITE.erl b/lib/kernel/test/file_SUITE.erl
index fdab2eb02b..77fc7e73f9 100644
--- a/lib/kernel/test/file_SUITE.erl
+++ b/lib/kernel/test/file_SUITE.erl
@@ -2165,7 +2165,7 @@ write_compressed(Config) when is_list(Config) ->
?line Second = io:get_line(Fd1, ''),
?line ok = ?FILE_MODULE:close(Fd1),
- %% Verify succesful compression by uncompressing the file
+ %% Verify successful compression by uncompressing the file
%% using zlib:gunzip/1.
?line {ok,Contents} = file:read_file(MyFile),
diff --git a/lib/kernel/test/gen_tcp_api_SUITE.erl b/lib/kernel/test/gen_tcp_api_SUITE.erl
index fd4685cdad..cbaec2d6dd 100644
--- a/lib/kernel/test/gen_tcp_api_SUITE.erl
+++ b/lib/kernel/test/gen_tcp_api_SUITE.erl
@@ -158,6 +158,10 @@ t_shutdown_error(Config) when is_list(Config) ->
t_fdopen(Config) when is_list(Config) ->
?line Question = "Aaaa... Long time ago in a small town in Germany,",
+ ?line Question1 = list_to_binary(Question),
+ ?line Question2 = [<<"Aaaa">>, "... ", $L, <<>>, $o, "ng time ago ",
+ ["in ", [], <<"a small town">>, [" in Germany,", <<>>]]],
+ ?line Question1 = iolist_to_binary(Question2),
?line Answer = "there was a shoemaker, Schumacher was his name.",
?line {ok, L} = gen_tcp:listen(0, [{active, false}]),
?line {ok, Port} = inet:port(L),
@@ -167,6 +171,10 @@ t_fdopen(Config) when is_list(Config) ->
?line {ok, Server} = gen_tcp:fdopen(FD, []),
?line ok = gen_tcp:send(Client, Question),
?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
+ ?line ok = gen_tcp:send(Client, Question1),
+ ?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
+ ?line ok = gen_tcp:send(Client, Question2),
+ ?line {ok, Question} = gen_tcp:recv(Server, length(Question), 2000),
?line ok = gen_tcp:send(Server, Answer),
?line {ok, Answer} = gen_tcp:recv(Client, length(Answer), 2000),
?line ok = gen_tcp:close(Client),
diff --git a/lib/kernel/test/gen_udp_SUITE.erl b/lib/kernel/test/gen_udp_SUITE.erl
index d8a5519195..514deaf065 100644
--- a/lib/kernel/test/gen_udp_SUITE.erl
+++ b/lib/kernel/test/gen_udp_SUITE.erl
@@ -201,13 +201,21 @@ binary_passive_recv(suite) ->
binary_passive_recv(doc) ->
["OTP-3823 gen_udp:recv does not return address in binary mode"];
binary_passive_recv(Config) when is_list(Config) ->
- ?line D = "The quick brown fox jumps over a lazy dog",
- ?line B = list_to_binary(D),
+ ?line D1 = "The quick brown fox jumps over a lazy dog",
+ ?line D2 = list_to_binary(D1),
+ ?line D3 = ["The quick", <<" brown ">>, "fox jumps ", <<"over ">>,
+ <<>>, $a, [[], " lazy ", <<"dog">>]],
+ ?line D2 = iolist_to_binary(D3),
+ ?line B = D2,
?line {ok, R} = gen_udp:open(0, [binary, {active, false}]),
?line {ok, RP} = inet:port(R),
?line {ok, S} = gen_udp:open(0),
?line {ok, SP} = inet:port(S),
- ?line ok = gen_udp:send(S, localhost, RP, D),
+ ?line ok = gen_udp:send(S, localhost, RP, D1),
+ ?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
+ ?line ok = gen_udp:send(S, localhost, RP, D2),
+ ?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
+ ?line ok = gen_udp:send(S, localhost, RP, D3),
?line {ok, {{127, 0, 0, 1}, SP, B}} = gen_udp:recv(R, byte_size(B)+1),
?line ok = gen_udp:close(S),
?line ok = gen_udp:close(R),
@@ -400,6 +408,7 @@ open_fd(Config) when is_list(Config) ->
{ok,S1} = gen_udp:open(0),
{ok,P2} = inet:port(S1),
{ok,FD} = prim_inet:getfd(S1),
+ {error,einval} = gen_udp:open(P2, [inet6, {fd,FD}]),
{ok,S2} = gen_udp:open(P2, [{fd,FD}]),
{ok,S3} = gen_udp:open(0),
{ok,P3} = inet:port(S3),
diff --git a/lib/kernel/test/global_group_SUITE.erl b/lib/kernel/test/global_group_SUITE.erl
index 13b2fd07b5..799b0d9d05 100644
--- a/lib/kernel/test/global_group_SUITE.erl
+++ b/lib/kernel/test/global_group_SUITE.erl
@@ -100,7 +100,7 @@ start_gg_proc(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd}=file:open(File, write),
+ ?line {ok, Fd}=file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -135,7 +135,7 @@ no_gg_proc(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "no_global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
?line config_no(Fd),
?line NN = node_name(atom_to_list(node())),
@@ -308,7 +308,7 @@ no_gg_proc_sync(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "no_global_group_sync.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz], Config),
@@ -482,7 +482,7 @@ compatible(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group_comp.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz], Config),
@@ -655,7 +655,7 @@ one_grp(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -742,7 +742,7 @@ one_grp_x(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3] = node_names([cp1, cp2, cp3], Config),
?line config(Fd, Ncp1, Ncp2, Ncp3, "cpx", "cpy", "cpz", "cpq"),
@@ -804,7 +804,7 @@ two_grp(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz,Ncpq] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz,cpq], Config),
@@ -1104,7 +1104,7 @@ hidden_groups(Config) when is_list(Config) ->
?line Dir = ?config(priv_dir, Config),
?line File = filename:join(Dir, "global_group.config"),
- ?line {ok, Fd} = file:open(File, write),
+ ?line {ok, Fd} = file:open(File, [write]),
[Ncp1,Ncp2,Ncp3,Ncpx,Ncpy,Ncpz,Ncpq] =
node_names([cp1,cp2,cp3,cpx,cpy,cpz,cpq], Config),
diff --git a/lib/kernel/test/init_SUITE.erl b/lib/kernel/test/init_SUITE.erl
index 2db0f7dcb8..b39fadd65f 100644
--- a/lib/kernel/test/init_SUITE.erl
+++ b/lib/kernel/test/init_SUITE.erl
@@ -656,7 +656,7 @@ create_script(Config) ->
?line Apps = application_controller:which_applications(),
?line {value,{_,_,KernelVer}} = lists:keysearch(kernel,1,Apps),
?line {value,{_,_,StdlibVer}} = lists:keysearch(stdlib,1,Apps),
- ?line {ok,Fd} = file:open(Name ++ ".rel", write),
+ ?line {ok,Fd} = file:open(Name ++ ".rel", [write]),
?line io:format(Fd,
"{release, {\"Test release 3\", \"P2A\"}, \n"
" {erts, \"4.4\"}, \n"
diff --git a/lib/kernel/test/ram_file_SUITE.erl b/lib/kernel/test/ram_file_SUITE.erl
index 9b3fbb91fc..ab95a3ff5f 100644
--- a/lib/kernel/test/ram_file_SUITE.erl
+++ b/lib/kernel/test/ram_file_SUITE.erl
@@ -552,7 +552,7 @@ large_file_light(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
%% Marker for next test case that is to heavy to run in a suite.
?line ok = ?FILE_MODULE:write_file(
- filename:join(PrivDir, large_file_light),
+ filename:join(PrivDir, "large_file_light"),
<<"TAG">>),
%%
?line Data = "abcdefghijklmnopqrstuvwzyz",
@@ -582,7 +582,7 @@ large_file_heavy(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
%% Check previous test case marker.
case ?FILE_MODULE:read_file_info(
- filename:join(PrivDir, large_file_light)) of
+ filename:join(PrivDir, "large_file_light")) of
{ok,_} ->
{skipped,"Too heavy for casual testing!"};
_ ->
diff --git a/lib/kernel/test/zlib_SUITE.erl b/lib/kernel/test/zlib_SUITE.erl
index 9eb84c9167..4ad9c6923d 100644
--- a/lib/kernel/test/zlib_SUITE.erl
+++ b/lib/kernel/test/zlib_SUITE.erl
@@ -412,6 +412,7 @@ api_crc32(Config) when is_list(Config) ->
Compressed = list_to_binary(Compressed1 ++ Compressed2),
CRC1 = ?m( CRC1 when is_integer(CRC1), zlib:crc32(Z1)),
?m(CRC1 when is_integer(CRC1), zlib:crc32(Z1,Bin)),
+ ?m(CRC1 when is_integer(CRC1), zlib:crc32(Z1,binary_to_list(Bin))),
?m(CRC2 when is_integer(CRC2), zlib:crc32(Z1,Compressed)),
CRC2 = ?m(CRC2 when is_integer(CRC2), zlib:crc32(Z1,0,Compressed)),
?m(CRC3 when CRC2 /= CRC3, zlib:crc32(Z1,234,Compressed)),
@@ -437,6 +438,7 @@ api_adler32(Config) when is_list(Config) ->
Compressed2 = ?m(_, zlib:deflate(Z1, <<>>, finish)),
Compressed = list_to_binary(Compressed1 ++ Compressed2),
?m(ADLER1 when is_integer(ADLER1), zlib:adler32(Z1,Bin)),
+ ?m(ADLER1 when is_integer(ADLER1), zlib:adler32(Z1,binary_to_list(Bin))),
ADLER2 = ?m(ADLER2 when is_integer(ADLER2), zlib:adler32(Z1,Compressed)),
?m(ADLER2 when is_integer(ADLER2), zlib:adler32(Z1,1,Compressed)),
?m(ADLER3 when ADLER2 /= ADLER3, zlib:adler32(Z1,234,Compressed)),
@@ -464,6 +466,7 @@ api_un_compress(Config) when is_list(Config) ->
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<120,156,3>>)),
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<120,156,3,0>>)),
?m({'EXIT',{data_error,_}}, zlib:uncompress(<<0,156,3,0,0,0,0,1>>)),
+ ?m(Bin, zlib:uncompress(binary_to_list(Comp))),
?m(Bin, zlib:uncompress(Comp)).
api_un_zip(doc) -> "Test zip";
@@ -472,10 +475,12 @@ api_un_zip(Config) when is_list(Config) ->
?m(?BARG,zlib:zip(not_a_binary)),
Bin = <<1,11,1,23,45>>,
?line Comp = zlib:zip(Bin),
+ ?m(Comp, zlib:zip(binary_to_list(Bin))),
?m(?BARG,zlib:unzip(not_a_binary)),
?m({'EXIT',{data_error,_}}, zlib:unzip(<<171,171,171,171,171>>)),
?m({'EXIT',{data_error,_}}, zlib:unzip(<<>>)),
?m(Bin, zlib:unzip(Comp)),
+ ?m(Bin, zlib:unzip(binary_to_list(Comp))),
%% OTP-6396
B = <<131,104,19,100,0,13,99,95,99,105,100,95,99,115,103,115,110,95,50,97,1,107,0,4,208,161,246,29,107,0,3,237,166,224,107,0,6,66,240,153,0,2,10,1,0,8,97,116,116,97,99,104,101,100,104,2,100,0,22,117,112,100,97,116,101,95,112,100,112,95,99,111,110,116,101,120,116,95,114,101,113,107,0,114,69,3,12,1,11,97,31,113,150,64,104,132,61,64,104,12,3,197,31,113,150,64,104,132,61,64,104,12,1,11,97,31,115,150,64,104,116,73,64,104,0,0,0,0,0,0,65,149,16,61,65,149,16,61,1,241,33,4,5,0,33,4,4,10,6,10,181,4,10,6,10,181,38,15,99,111,109,109,97,110,100,1,114,45,97,112,110,45,49,3,99,111,109,5,109,110,99,57,57,6,109,99,99,50,52,48,4,103,112,114,115,8,0,104,2,104,2,100,0,8,97,99,116,105,118,97,116,101,104,23,100,0,11,112,100,112,95,99,111,110,116,1,120,116,100,0,7,112,114,105,109,97,114,121,97,1,100,0,9,117,110,100,101,102,105,110,101,100,97,1,97,4,97,4,97,7,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,10100,100,0,9,117,110,100,101,102,105,110,101,100,100,0,5,102,97,108,115,101,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,1,101,100,97,0,100,0,9,117,110,100,101,102,105,110,101,100,107,0,4,16,0,1,144,107,0,4,61,139,186,181,107,0,4,10,8,201,49,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,0,101,100,100,0,9,117,110,100,101,102,105,110,101,100,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,21,106,108,0,0,0,3,104,2,97,1,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,167,20,104,2,97,4,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,21,104,2,97,10,104,2,104,3,98,0,0,7,214,97,11,97,20,104,3,97,17,97,16,97,26,106,100,0,5,118,101,114,57,57,100,0,9,117,110,0,101,102,105,110,101,100,107,0,2,0,244,107,0,4,10,6,102,195,107,0,4,10,6,102,195,100,0,9,117,110,100,101,102,105,110,101,100,100,0,9,117,110,100,101,102,105,110,101,100,107,0,125,248,143,0,203,25115,157,116,65,185,65,172,55,87,164,88,225,50,203,251,115,157,116,65,185,65,172,55,87,164,88,225,50,0,0,82,153,50,0,200,98,87,148,237,193,185,65,149,167,69,144,14,16,153,50,3,81,70,94,13,109,193,1,120,5,181,113,198,118,50,3,81,70,94,13,109,193,185,120,5,181,113,198,118,153,3,81,70,94,13,109,193,185,120,5,181,113,198,118,153,50,16,1,2,3,4,5,6,7,8,9,0,1,2,3,4,5,6,113,92,2,119,128,0,0,108,0,0,1,107,0,114,69,3,12,1,11,97,31,113,150,64,104,132,61,64,104,12,3,11,97,31,113,150,64,104,132,61,64,104,12,1,11,97,31,115,150,64,104,116,73,64,104,0,0,0,0,0,0,65,149,16,61,65,149,16,61,1,241,33,4,0,33,4,4,10,6,10,181,4,10,6,10,181,38,15,99,111,109,109,97,110,100,101,114,45,97,112,110,45,49,3,99,111,109,5,109,110,99,57,57,6,109,99,99,50,52,48,4,103,112,114,115,8,0,106>>,
@@ -504,10 +509,12 @@ api_g_un_zip(Config) when is_list(Config) ->
?m(?BARG,zlib:gzip(not_a_binary)),
Bin = <<1,11,1,23,45>>,
?line Comp = zlib:gzip(Bin),
+ ?m(Comp, zlib:gzip(binary_to_list(Bin))),
?m(?BARG, zlib:gunzip(not_a_binary)),
?m(?DATA_ERROR, zlib:gunzip(<<171,171,171,171,171>>)),
?m(?DATA_ERROR, zlib:gunzip(<<>>)),
?m(Bin, zlib:gunzip(Comp)),
+ ?m(Bin, zlib:gunzip(binary_to_list(Comp))),
%% Bad CRC; bad length.
BadCrc = bad_crc_data(),
@@ -844,6 +851,7 @@ dictionary_usage({run}) ->
?m(ok, zlib:inflateInit(Z2)),
?line {'EXIT',{{need_dictionary,DictID},_}} = (catch zlib:inflate(Z2, Compressed)),
?m(ok, zlib:inflateSetDictionary(Z2, Dict)),
+ ?m(ok, zlib:inflateSetDictionary(Z2, binary_to_list(Dict))),
?line Uncompressed = ?m(B when is_list(B), zlib:inflate(Z2, [])),
?m(ok, zlib:inflateEnd(Z2)),
?m(ok, zlib:close(Z2)),
diff --git a/lib/kernel/vsn.mk b/lib/kernel/vsn.mk
index e7b71cc168..8be265e79d 100644
--- a/lib/kernel/vsn.mk
+++ b/lib/kernel/vsn.mk
@@ -1 +1 @@
-KERNEL_VSN = 2.14.4
+KERNEL_VSN = 2.14.5
diff --git a/lib/megaco/doc/src/notes.xml b/lib/megaco/doc/src/notes.xml
index 4f678a2a1b..2aba8db71b 100644
--- a/lib/megaco/doc/src/notes.xml
+++ b/lib/megaco/doc/src/notes.xml
@@ -36,6 +36,48 @@
section is the version number of Megaco.</p>
+ <section><title>Megaco 3.15.1.1</title>
+
+ <p>Version 3.15.1.1 supports code replacement in runtime from/to
+ version 3.15.1 and 3.15.</p>
+
+ <section>
+ <title>Improvements and new features</title>
+
+<!--
+ <p>-</p>
+-->
+
+ <list type="bulleted">
+ <item>
+ <p>Correct various XML errors. </p>
+ <p>Own Id: OTP-9550</p>
+ </item>
+
+ </list>
+
+ </section>
+
+ <section>
+ <title>Fixed bugs and malfunctions</title>
+
+ <p>-</p>
+
+ <!--
+ <list type="bulleted">
+ <item>
+ <p>Fixing miscellaneous things detected by dialyzer. </p>
+ <p>Own Id: OTP-9075</p>
+ </item>
+
+ </list>
+ -->
+
+ </section>
+
+ </section> <!-- 3.15.1.1 -->
+
+
<section><title>Megaco 3.15.1</title>
<p>Version 3.15.1 supports code replacement in runtime from/to
diff --git a/lib/megaco/src/app/megaco.appup.src b/lib/megaco/src/app/megaco.appup.src
index 01b070d79f..7107178d1a 100644
--- a/lib/megaco/src/app/megaco.appup.src
+++ b/lib/megaco/src/app/megaco.appup.src
@@ -136,10 +136,17 @@
%% |
%% v
%% 3.15.1
+%% |
+%% v
+%% 3.15.1.1
%%
%%
{"%VSN%",
[
+ {"3.15.1",
+ [
+ ]
+ },
{"3.15",
[
{load_module, megaco_flex_scanner, soft_purge, soft_purge, []},
@@ -153,6 +160,10 @@
}
],
[
+ {"3.15.1",
+ [
+ ]
+ },
{"3.15",
[
{load_module, megaco_flex_scanner, soft_purge, soft_purge, []},
diff --git a/lib/megaco/vsn.mk b/lib/megaco/vsn.mk
index 5f71712360..c1476488ca 100644
--- a/lib/megaco/vsn.mk
+++ b/lib/megaco/vsn.mk
@@ -18,6 +18,6 @@
# %CopyrightEnd%
APPLICATION = megaco
-MEGACO_VSN = 3.15.1
+MEGACO_VSN = 3.15.1.1
PRE_VSN =
APP_VSN = "$(APPLICATION)-$(MEGACO_VSN)$(PRE_VSN)"
diff --git a/lib/mnesia/src/Makefile b/lib/mnesia/src/Makefile
index e032f563fa..1c8ec54605 100644
--- a/lib/mnesia/src/Makefile
+++ b/lib/mnesia/src/Makefile
@@ -1,7 +1,7 @@
#
# %CopyrightBegin%
#
-# Copyright Ericsson AB 1996-2009. All Rights Reserved.
+# Copyright Ericsson AB 1996-2011. All Rights Reserved.
#
# The contents of this file are subject to the Erlang Public License,
# Version 1.1, (the "License"); you may not use this file except in
@@ -113,6 +113,8 @@ clean:
docs:
+$(TARGET_FILES): $(HRL_FILES)
+
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
diff --git a/lib/mnesia/src/mnesia_controller.erl b/lib/mnesia/src/mnesia_controller.erl
index d4b2c7b5cc..1d3bd55b48 100644
--- a/lib/mnesia/src/mnesia_controller.erl
+++ b/lib/mnesia/src/mnesia_controller.erl
@@ -57,7 +57,8 @@
release_schema_commit_lock/0,
create_table/1,
get_disc_copy/1,
- get_cstructs/0,
+ get_remote_cstructs/0, % new function
+ get_cstructs/0, % old function
sync_and_block_table_whereabouts/4,
sync_del_table_copy_whereabouts/2,
block_table/1,
@@ -278,9 +279,51 @@ rec_tabs([], _, _, Init) ->
unlink(Init),
ok.
-get_cstructs() ->
+%% New function that does exactly what get_cstructs() used to do.
+%% When this function is called, we know that the calling node knows
+%% how to convert cstructs on the receiving end (should they differ).
+get_remote_cstructs() ->
call(get_cstructs).
+%% Old function kept for backwards compatibility; converts cstructs before sending.
+get_cstructs() ->
+ {cstructs, Cstructs, Running} = call(get_cstructs),
+ Node = node(group_leader()),
+ {cstructs, normalize_cstructs(Cstructs, Node), Running}.
+
+normalize_cstructs(Cstructs, Node) ->
+ %% backward-compatibility hack; normalize before returning
+ case rpc:call(Node, mnesia_lib, val, [{schema,cstruct}]) of
+ {badrpc, _} ->
+ %% assume it's not a schema merge
+ Cstructs;
+ #cstruct{} ->
+ %% same format
+ Cstructs;
+ Cstruct ->
+ %% some other format
+ RemoteFields = [F || {F,_} <- rpc:call(Node, mnesia_schema, cs2list, [Cstruct])],
+ [convert_cs(Cs, RemoteFields) || Cs <- Cstructs]
+ end.
+
+convert_cs(Cs, Fields) ->
+ MyFields = record_info(fields, cstruct),
+ convert(tl(tuple_to_list(Cs)), MyFields, Fields, []).
+
+convert([H|T], [F|FsL], [F|FsR], Acc) ->
+ convert(T, FsL, FsR, [H|Acc]);
+convert([H|T], [Fl|FsL] = L, [Fr|FsR] = R, Acc) ->
+ case {lists:member(Fl, FsR), lists:member(Fr, FsL)} of
+ {true, false} ->
+ convert(T, L, FsR, [H|Acc]);
+ {false, true} ->
+ %% Field Fl doesn't exist on receiver side; skip.
+ convert(T, FsL, R, Acc)
+ end;
+convert([], _, _, Acc) ->
+ list_to_tuple([cstruct|lists:reverse(Acc)]).
+
+
update(Fun) ->
call({update,Fun}).
diff --git a/lib/mnesia/src/mnesia_dumper.erl b/lib/mnesia/src/mnesia_dumper.erl
index 92fd9dfade..f8d7664156 100644
--- a/lib/mnesia/src/mnesia_dumper.erl
+++ b/lib/mnesia/src/mnesia_dumper.erl
@@ -214,7 +214,12 @@ insert_rec(Rec, InPlace, InitBy, LogV) when is_record(Rec, commit) ->
{Tid, committed} ->
do_insert_rec(Tid, Rec, InPlace, InitBy, LogV);
{Tid, aborted} ->
- mnesia_schema:undo_prepare_commit(Tid, Rec)
+ case InitBy of
+ startup ->
+ mnesia_schema:undo_prepare_commit(Tid, Rec);
+ _ ->
+ ok
+ end
end;
insert_rec(H, _InPlace, _InitBy, _LogV) when is_record(H, log_header) ->
CurrentVersion = mnesia_log:version(),
@@ -359,7 +364,7 @@ dets_insert(Op,Tab,Key,Val) ->
ok = dets:delete_object(Tab, Val);
clear_table ->
dets_cleared(Tab),
- ok = dets:match_delete(Tab, '_')
+ ok = dets:delete_all_objects(Tab)
end.
dets_updated(Tab,Key) ->
diff --git a/lib/mnesia/src/mnesia_lib.erl b/lib/mnesia/src/mnesia_lib.erl
index 7e926a6258..e8b8c58c70 100644
--- a/lib/mnesia/src/mnesia_lib.erl
+++ b/lib/mnesia/src/mnesia_lib.erl
@@ -1141,12 +1141,18 @@ db_erase(ram_copies, Tab, Key) -> ?ets_delete(Tab, Key), ok;
db_erase(disc_copies, Tab, Key) -> ?ets_delete(Tab, Key), ok;
db_erase(disc_only_copies, Tab, Key) -> dets:delete(Tab, Key).
+db_match_erase(Tab, '_') ->
+ db_delete_all(val({Tab, storage_type}),Tab);
db_match_erase(Tab, Pat) ->
db_match_erase(val({Tab, storage_type}), Tab, Pat).
db_match_erase(ram_copies, Tab, Pat) -> ?ets_match_delete(Tab, Pat), ok;
db_match_erase(disc_copies, Tab, Pat) -> ?ets_match_delete(Tab, Pat), ok;
db_match_erase(disc_only_copies, Tab, Pat) -> dets:match_delete(Tab, Pat).
+db_delete_all(ram_copies, Tab) -> ets:delete_all_objects(Tab);
+db_delete_all(disc_copies, Tab) -> ets:delete_all_objects(Tab);
+db_delete_all(disc_only_copies, Tab) -> dets:delete_all_objects(Tab).
+
db_first(Tab) ->
db_first(val({Tab, storage_type}), Tab).
db_first(ram_copies, Tab) -> ?ets_first(Tab);
diff --git a/lib/mnesia/src/mnesia_loader.erl b/lib/mnesia/src/mnesia_loader.erl
index e785b795d1..eb83168498 100644
--- a/lib/mnesia/src/mnesia_loader.erl
+++ b/lib/mnesia/src/mnesia_loader.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1998-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1998-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -27,7 +27,6 @@
net_load_table/4,
send_table/3]).
--export([old_node_init_table/6]). %% Spawned old node protocol conversion hack
-export([spawned_receiver/8]). %% Spawned lock taking process
-import(mnesia_lib, [set/2, fatal/2, verbose/2, dbg_out/2]).
@@ -36,7 +35,7 @@
val(Var) ->
case ?catch_val(Var) of
- {'EXIT', Reason} -> mnesia_lib:other_val(Var, Reason);
+ {'EXIT', Reason} -> mnesia_lib:other_val(Var, Reason);
Value -> Value
end.
@@ -51,7 +50,7 @@ disc_load_table(Tab, Reason) ->
?eval_debug_fun({?MODULE, do_get_disc_copy},
[{tab, Tab},
{reason, Reason},
- {storage, Storage},
+ {storage, Storage},
{type, Type}]),
do_get_disc_copy2(Tab, Reason, Storage, Type).
@@ -63,19 +62,19 @@ do_get_disc_copy2(Tab, Reason, Storage, Type) when Storage == disc_copies ->
%% NOW we create the actual table
Repair = mnesia_monitor:get_env(auto_repair),
Args = [{keypos, 2}, public, named_table, Type],
- case Reason of
+ case Reason of
{dumper, _} -> %% Resources allready allocated
ignore;
_ ->
mnesia_monitor:mktab(Tab, Args),
- Count = mnesia_log:dcd2ets(Tab, Repair),
+ Count = mnesia_log:dcd2ets(Tab, Repair),
case ets:info(Tab, size) of
X when X < Count * 4 ->
- ok = mnesia_log:ets2dcd(Tab);
+ ok = mnesia_log:ets2dcd(Tab);
_ ->
ignore
end
- end,
+ end,
mnesia_index:init_index(Tab, Storage),
snmpify(Tab, Storage),
set({Tab, load_node}, node()),
@@ -84,7 +83,7 @@ do_get_disc_copy2(Tab, Reason, Storage, Type) when Storage == disc_copies ->
do_get_disc_copy2(Tab, Reason, Storage, Type) when Storage == ram_copies ->
Args = [{keypos, 2}, public, named_table, Type],
- case Reason of
+ case Reason of
{dumper, _} -> %% Resources allready allocated
ignore;
_ ->
@@ -94,12 +93,12 @@ do_get_disc_copy2(Tab, Reason, Storage, Type) when Storage == ram_copies ->
Repair = mnesia_monitor:get_env(auto_repair),
case mnesia_monitor:use_dir() of
true ->
- case mnesia_lib:exists(Fname) of
+ case mnesia_lib:exists(Fname) of
true -> mnesia_log:dcd2ets(Tab, Repair);
false ->
case mnesia_lib:exists(Datname) of
true ->
- mnesia_lib:dets_to_ets(Tab, Tab, Datname,
+ mnesia_lib:dets_to_ets(Tab, Tab, Datname,
Type, Repair, no);
false ->
false
@@ -154,11 +153,11 @@ do_get_disc_copy2(Tab, Reason, Storage, Type) when Storage == disc_only_copies -
%% Disable rehashing of table
%% Release read lock on table
%% Send table to receiver in chunks
-%%
+%%
%% Grab read lock on table
%% Block dirty updates
%% Update wherabouts
-%%
+%%
%% Cancel the update subscription
%% Process the subscription events
%% Optionally dump to disc
@@ -166,7 +165,7 @@ do_get_disc_copy2(Tab, Reason, Storage, Type) when Storage == disc_only_copies -
%% Release read lock on table
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
--define(MAX_TRANSFER_SIZE, 7500).
+-define(MAX_TRANSFER_SIZE, 7500).
-define(MAX_RAM_FILE_SIZE, 1000000).
-define(MAX_RAM_TRANSFERS, (?MAX_RAM_FILE_SIZE div ?MAX_TRANSFER_SIZE) + 1).
-define(MAX_NOPACKETS, 20).
@@ -187,14 +186,14 @@ try_net_load_table(Tab, Reason, Ns, Cs) ->
do_get_network_copy(Tab, _Reason, _Ns, unknown, _Cs) ->
verbose("Local table copy of ~p has recently been deleted, ignored.~n", [Tab]),
{not_loaded, storage_unknown};
-do_get_network_copy(Tab, Reason, Ns, Storage, Cs) ->
+do_get_network_copy(Tab, Reason, Ns, Storage, Cs) ->
[Node | Tail] = Ns,
case lists:member(Node,val({current, db_nodes})) of
true ->
dbg_out("Getting table ~p (~p) from node ~p: ~p~n",
[Tab, Storage, Node, Reason]),
?eval_debug_fun({?MODULE, do_get_network_copy},
- [{tab, Tab}, {reason, Reason},
+ [{tab, Tab}, {reason, Reason},
{nodes, Ns}, {storage, Storage}]),
case init_receiver(Node, Tab, Storage, Cs, Reason) of
ok ->
@@ -208,7 +207,7 @@ do_get_network_copy(Tab, Reason, Ns, Storage, Cs) ->
restart ->
try_net_load_table(Tab, Reason, Tail ++ [Node], Cs);
down ->
- try_net_load_table(Tab, Reason, Tail, Cs)
+ try_net_load_table(Tab, Reason, Tail, Cs)
end;
false ->
try_net_load_table(Tab, Reason, Tail, Cs)
@@ -223,10 +222,10 @@ do_snmpify(Tab, Us, Storage) ->
Snmp = mnesia_snmp_hook:create_table(Us, Tab, Storage),
set({Tab, {index, snmp}}, Snmp).
-%% Start the recieiver
+%% Start the recieiver
init_receiver(Node, Tab, Storage, Cs, Reas={dumper,add_table_copy}) ->
case start_remote_sender(Node, Tab, Storage) of
- {SenderPid, TabSize, DetsData} ->
+ {SenderPid, TabSize, DetsData} ->
start_receiver(Tab,Storage,Cs,SenderPid,TabSize,DetsData,Reas);
Else ->
Else
@@ -234,21 +233,21 @@ init_receiver(Node, Tab, Storage, Cs, Reas={dumper,add_table_copy}) ->
init_receiver(Node, Tab,Storage,Cs,Reason) ->
%% Grab a schema lock to avoid deadlock between table_loader and schema_commit dumping.
%% Both may grab tables-locks in different order.
- Load =
- fun() ->
- {_,Tid,Ts} = get(mnesia_activity_state),
+ Load =
+ fun() ->
+ {_,Tid,Ts} = get(mnesia_activity_state),
mnesia_locker:rlock(Tid, Ts#tidstore.store, {schema, Tab}),
- %% Check that table still exists
+ %% Check that table still exists
Active = val({Tab, active_replicas}),
%% Check that we havn't loaded it already
case val({Tab,where_to_read}) == node() of
true -> ok;
_ ->
- %% And that sender still got a copy
- %% (something might have happend while
+ %% And that sender still got a copy
+ %% (something might have happend while
%% we where waiting for the lock)
true = lists:member(Node, Active),
- {SenderPid, TabSize, DetsData} =
+ {SenderPid, TabSize, DetsData} =
start_remote_sender(Node,Tab,Storage),
Init = table_init_fun(SenderPid),
Args = [self(),Tab,Storage,Cs,SenderPid,
@@ -258,18 +257,18 @@ init_receiver(Node, Tab,Storage,Cs,Reason) ->
wait_on_load_complete(Pid)
end
end,
- Res =
+ Res =
case mnesia:transaction(Load, 20) of
- {atomic, {error,Result}} when
- element(1,Reason) == dumper ->
+ {atomic, {error,Result}} when
+ element(1,Reason) == dumper ->
{error,Result};
- {atomic, {error,Result}} ->
+ {atomic, {error,Result}} ->
fatal("Cannot create table ~p: ~p~n",
[[Tab, Storage], Result]);
{atomic, Result} -> Result;
{aborted, nomore} -> restart;
- {aborted, _Reas} ->
- verbose("Receiver failed on ~p from ~p:~nReason: ~p~n",
+ {aborted, _Reas} ->
+ verbose("Receiver failed on ~p from ~p:~nReason: ~p~n",
[Tab,Node,_Reas]),
down %% either this node or sender is dying
end,
@@ -279,7 +278,7 @@ init_receiver(Node, Tab,Storage,Cs,Reason) ->
start_remote_sender(Node,Tab,Storage) ->
mnesia_controller:start_remote_sender(Node, Tab, self(), Storage),
put(mnesia_table_sender_node, {Tab, Node}),
- receive
+ receive
{SenderPid, {first, TabSize}} ->
{SenderPid, TabSize, false};
{SenderPid, {first, TabSize, DetsData}} ->
@@ -291,22 +290,14 @@ start_remote_sender(Node,Tab,Storage) ->
end.
table_init_fun(SenderPid) ->
- PConv = mnesia_monitor:needs_protocol_conversion(node(SenderPid)),
- MeMyselfAndI = self(),
fun(read) ->
- Receiver =
- if
- PConv == true ->
- MeMyselfAndI ! {actual_tabrec, self()},
- MeMyselfAndI; %% Old mnesia
- PConv == false -> self()
- end,
+ Receiver = self(),
SenderPid ! {Receiver, more},
get_data(SenderPid, Receiver)
end.
%% Add_table_copy get's it's own locks.
-start_receiver(Tab,Storage,Cs,SenderPid,TabSize,DetsData,{dumper,add_table_copy}) ->
+start_receiver(Tab,Storage,Cs,SenderPid,TabSize,DetsData,{dumper,add_table_copy}) ->
Init = table_init_fun(SenderPid),
case do_init_table(Tab,Storage,Cs,SenderPid,TabSize,DetsData,self(), Init) of
Err = {error, _} ->
@@ -317,8 +308,8 @@ start_receiver(Tab,Storage,Cs,SenderPid,TabSize,DetsData,{dumper,add_table_copy}
end.
spawned_receiver(ReplyTo,Tab,Storage,Cs, SenderPid,TabSize,DetsData, Init) ->
- process_flag(trap_exit, true),
- Done = do_init_table(Tab,Storage,Cs,
+ process_flag(trap_exit, true),
+ Done = do_init_table(Tab,Storage,Cs,
SenderPid,TabSize,DetsData,
ReplyTo, Init),
ReplyTo ! {self(),Done},
@@ -327,17 +318,17 @@ spawned_receiver(ReplyTo,Tab,Storage,Cs, SenderPid,TabSize,DetsData, Init) ->
exit(normal).
wait_on_load_complete(Pid) ->
- receive
- {Pid, Res} ->
+ receive
+ {Pid, Res} ->
Res;
- {'EXIT', Pid, Reason} ->
+ {'EXIT', Pid, Reason} ->
exit(Reason);
- Else ->
+ Else ->
Pid ! Else,
wait_on_load_complete(Pid)
end.
-do_init_table(Tab,Storage,Cs,SenderPid,
+do_init_table(Tab,Storage,Cs,SenderPid,
TabSize,DetsInfo,OrigTabRec,Init) ->
case create_table(Tab, TabSize, Storage, Cs) of
{Storage,Tab} ->
@@ -345,11 +336,9 @@ do_init_table(Tab,Storage,Cs,SenderPid,
Node = node(SenderPid),
put(mnesia_table_receiver, {Tab, Node, SenderPid}),
mnesia_tm:block_tab(Tab),
- PConv = mnesia_monitor:needs_protocol_conversion(Node),
-
- case init_table(Tab,Storage,Init,PConv,DetsInfo,SenderPid) of
- ok ->
- tab_receiver(Node,Tab,Storage,Cs,PConv,OrigTabRec);
+ case init_table(Tab,Storage,Init,DetsInfo,SenderPid) of
+ ok ->
+ tab_receiver(Node,Tab,Storage,Cs,OrigTabRec);
Reason ->
Msg = "[d]ets:init table failed",
verbose("~s: ~p: ~p~n", [Msg, Tab, Reason]),
@@ -360,7 +349,7 @@ do_init_table(Tab,Storage,Cs,SenderPid,
end.
create_table(Tab, TabSize, Storage, Cs) ->
- if
+ if
Storage == disc_only_copies ->
mnesia_lib:lock_table(Tab),
Tmp = mnesia_lib:tab2tmp(Tab),
@@ -390,54 +379,30 @@ create_table(Tab, TabSize, Storage, Cs) ->
end
end.
-tab_receiver(Node, Tab, Storage, Cs, PConv, OrigTabRec) ->
+tab_receiver(Node, Tab, Storage, Cs, OrigTabRec) ->
receive
- {SenderPid, {no_more, DatBin}} when PConv == false ->
+ {SenderPid, {no_more, DatBin}} ->
finish_copy(Storage,Tab,Cs,SenderPid,DatBin,OrigTabRec);
-
- %% Protocol conversion hack
- {SenderPid, {no_more, DatBin}} when is_pid(PConv) ->
- PConv ! {SenderPid, no_more},
- receive
- {old_init_table_complete, ok} ->
- finish_copy(Storage, Tab, Cs, SenderPid, DatBin,OrigTabRec);
- {old_init_table_complete, Reason} ->
- Msg = "OLD: [d]ets:init table failed",
- verbose("~s: ~p: ~p~n", [Msg, Tab, Reason]),
- down(Tab, Storage)
- end;
-
- {actual_tabrec, Pid} ->
- tab_receiver(Node, Tab, Storage, Cs, Pid,OrigTabRec);
-
- {SenderPid, {more, [Recs]}} when is_pid(PConv) ->
- PConv ! {SenderPid, {more, Recs}}, %% Forward Msg to OldNodes
- tab_receiver(Node, Tab, Storage, Cs, PConv,OrigTabRec);
- {'EXIT', PConv, Reason} -> %% [d]ets:init process crashed
- Msg = "Receiver crashed",
- verbose("~s: ~p: ~p~n", [Msg, Tab, Reason]),
- down(Tab, Storage);
-
%% Protocol conversion hack
{copier_done, Node} ->
verbose("Sender of table ~p crashed on node ~p ~n", [Tab, Node]),
down(Tab, Storage);
-
+
{'EXIT', Pid, Reason} ->
handle_exit(Pid, Reason),
- tab_receiver(Node, Tab, Storage, Cs, PConv,OrigTabRec)
+ tab_receiver(Node, Tab, Storage, Cs, OrigTabRec)
end.
make_table_fun(Pid, TabRec) ->
fun(close) ->
ok;
(read) ->
- get_data(Pid, TabRec)
+ get_data(Pid, TabRec)
end.
get_data(Pid, TabRec) ->
- receive
+ receive
{Pid, {more_z, CompressedRecs}} when is_binary(CompressedRecs) ->
Pid ! {TabRec, more},
{zlib_uncompress(CompressedRecs), make_table_fun(Pid,TabRec)};
@@ -448,7 +413,7 @@ get_data(Pid, TabRec) ->
end_of_input;
{copier_done, Node} ->
case node(Pid) of
- Node ->
+ Node ->
{copier_done, Node};
_ ->
get_data(Pid, TabRec)
@@ -458,10 +423,10 @@ get_data(Pid, TabRec) ->
get_data(Pid, TabRec)
end.
-init_table(Tab, disc_only_copies, Fun, false, DetsInfo,Sender) ->
+init_table(Tab, disc_only_copies, Fun, DetsInfo,Sender) ->
ErtsVer = erlang:system_info(version),
case DetsInfo of
- {ErtsVer, DetsData} ->
+ {ErtsVer, DetsData} ->
Res = (catch dets:is_compatible_bchunk_format(Tab, DetsData)),
case Res of
{'EXIT',{undef,[{dets,_,_}|_]}} ->
@@ -481,28 +446,19 @@ init_table(Tab, disc_only_copies, Fun, false, DetsInfo,Sender) ->
_ ->
dets:init_table(Tab, Fun)
end;
-init_table(Tab, _, Fun, false, _DetsInfo,_) ->
+init_table(Tab, _, Fun, _DetsInfo,_) ->
case catch ets:init_table(Tab, Fun) of
true ->
ok;
{'EXIT', Else} -> Else
- end;
-init_table(Tab, Storage, Fun, true, _DetsInfo, Sender) -> %% Old Nodes
- spawn_link(?MODULE, old_node_init_table,
- [Tab, Storage, Fun, self(), false, Sender]),
- ok.
+ end.
-old_node_init_table(Tab, Storage, Fun, TabReceiver, DetsInfo,Sender) ->
- Res = init_table(Tab, Storage, Fun, false, DetsInfo,Sender),
- TabReceiver ! {old_init_table_complete, Res},
- unlink(TabReceiver),
- ok.
finish_copy(Storage,Tab,Cs,SenderPid,DatBin,OrigTabRec) ->
TabRef = {Storage, Tab},
subscr_receiver(TabRef, Cs#cstruct.record_name),
case handle_last(TabRef, Cs#cstruct.type, DatBin) of
- ok ->
+ ok ->
mnesia_index:init_index(Tab, Storage),
snmpify(Tab, Storage),
%% OrigTabRec must not be the spawned tab-receiver
@@ -534,7 +490,7 @@ subscr_receiver(TabRef = {_, Tab}, RecName) ->
ok
end.
-handle_event(TabRef, write, Rec) ->
+handle_event(TabRef, write, Rec) ->
db_put(TabRef, Rec);
handle_event(TabRef, delete, {_Tab, Key}) ->
db_erase(TabRef, Key);
@@ -545,8 +501,8 @@ handle_event(TabRef, clear_table, {_Tab, _Key}) ->
handle_last({disc_copies, Tab}, _Type, nobin) ->
Ret = mnesia_log:ets2dcd(Tab),
- Fname = mnesia_lib:tab2dat(Tab),
- case mnesia_lib:exists(Fname) of
+ Fname = mnesia_lib:tab2dat(Tab),
+ case mnesia_lib:exists(Fname) of
true -> %% Remove old .DAT files.
file:delete(Fname);
false ->
@@ -653,31 +609,29 @@ send_table(Pid, Tab, RemoteS) ->
{error, {no_exists, Tab}};
Storage ->
%% Send first
- TabSize = mnesia:table_info(Tab, size),
- Pconvert = mnesia_monitor:needs_protocol_conversion(node(Pid)),
+ TabSize = mnesia:table_info(Tab, size),
KeysPerTransfer = calc_nokeys(Storage, Tab),
ChunkData = dets:info(Tab, bchunk_format),
- UseDetsChunk =
- Storage == RemoteS andalso
- Storage == disc_only_copies andalso
- ChunkData /= undefined andalso
- Pconvert == false,
- if
+ UseDetsChunk =
+ Storage == RemoteS andalso
+ Storage == disc_only_copies andalso
+ ChunkData /= undefined,
+ if
UseDetsChunk == true ->
DetsInfo = erlang:system_info(version),
Pid ! {self(), {first, TabSize, {DetsInfo, ChunkData}}};
true ->
Pid ! {self(), {first, TabSize}}
end,
-
+
%% Debug info
put(mnesia_table_sender, {Tab, node(Pid), Pid}),
{Init, Chunk} = reader_funcs(UseDetsChunk, Tab, Storage, KeysPerTransfer),
-
+
SendIt = fun() ->
prepare_copy(Pid, Tab, Storage),
- send_more(Pid, 1, Chunk, Init(), Tab, Pconvert),
+ send_more(Pid, 1, Chunk, Init(), Tab),
finish_copy(Pid, Tab, Storage, RemoteS)
end,
@@ -698,7 +652,7 @@ send_table(Pid, Tab, RemoteS) ->
{error, Reason}
end
end.
-
+
prepare_copy(Pid, Tab, Storage) ->
Trans =
fun() ->
@@ -717,11 +671,11 @@ prepare_copy(Pid, Tab, Storage) ->
update_where_to_write(Tab, Node) ->
case val({Tab, access_mode}) of
- read_only ->
+ read_only ->
ignore;
- read_write ->
+ read_write ->
Current = val({current, db_nodes}),
- Ns =
+ Ns =
case lists:member(Node, Current) of
true -> Current;
false -> [Node | Current]
@@ -729,27 +683,27 @@ update_where_to_write(Tab, Node) ->
update_where_to_write(Ns, Tab, Node)
end.
-update_where_to_write([], _, _) ->
+update_where_to_write([], _, _) ->
ok;
update_where_to_write([H|T], Tab, AddNode) ->
- rpc:call(H, mnesia_controller, call,
+ rpc:call(H, mnesia_controller, call,
[{update_where_to_write, [add, Tab, AddNode], self()}]),
update_where_to_write(T, Tab, AddNode).
-send_more(Pid, N, Chunk, DataState, Tab, OldNode) ->
+send_more(Pid, N, Chunk, DataState, Tab) ->
receive
{NewPid, more} ->
- case send_packet(N - 1, NewPid, Chunk, DataState, OldNode) of
- New when is_integer(New) ->
+ case send_packet(N - 1, NewPid, Chunk, DataState) of
+ New when is_integer(New) ->
New - 1;
NewData ->
- send_more(NewPid, ?MAX_NOPACKETS, Chunk, NewData, Tab, OldNode)
+ send_more(NewPid, ?MAX_NOPACKETS, Chunk, NewData, Tab)
end;
{_NewPid, {old_protocol, Tab}} ->
Storage = val({Tab, storage_type}),
- {Init, NewChunk} =
+ {Init, NewChunk} =
reader_funcs(false, Tab, Storage, calc_nokeys(Storage, Tab)),
- send_more(Pid, 1, NewChunk, Init(), Tab, OldNode);
+ send_more(Pid, 1, NewChunk, Init(), Tab);
{copier_done, Node} when Node == node(Pid)->
verbose("Receiver of table ~p crashed on ~p (more)~n", [Tab, Node]),
@@ -770,7 +724,7 @@ dets_bchunk(Tab, Chunk) -> %% Arrg
case dets:bchunk(Tab, Chunk) of
{Cont, Data} -> {Data, Cont};
Else -> Else
- end.
+ end.
zlib_compress(Data, Level) ->
BinData = term_to_binary(Data),
@@ -793,28 +747,20 @@ compression_level() ->
Val -> Val
end.
-send_packet(N, Pid, _Chunk, '$end_of_table', OldNode) ->
- case OldNode of
- true -> ignore; %% Old nodes can't handle the new no_more
- false -> Pid ! {self(), no_more}
- end,
+send_packet(N, Pid, _Chunk, '$end_of_table') ->
+ Pid ! {self(), no_more},
N;
-send_packet(N, Pid, Chunk, {[], Cont}, OldNode) ->
- send_packet(N, Pid, Chunk, Chunk(Cont), OldNode);
-send_packet(N, Pid, Chunk, {Recs, Cont}, OldNode) when N < ?MAX_NOPACKETS ->
- case OldNode of
- true ->
- Pid ! {self(), {more, [Recs]}}; %% Old need's wrapping list
- false ->
- case compression_level() of
- 0 ->
- Pid ! {self(), {more, Recs}};
- Level ->
- Pid ! {self(), {more_z, zlib_compress(Recs, Level)}}
- end
+send_packet(N, Pid, Chunk, {[], Cont}) ->
+ send_packet(N, Pid, Chunk, Chunk(Cont));
+send_packet(N, Pid, Chunk, {Recs, Cont}) when N < ?MAX_NOPACKETS ->
+ case compression_level() of
+ 0 ->
+ Pid ! {self(), {more, Recs}};
+ Level ->
+ Pid ! {self(), {more_z, zlib_compress(Recs, Level)}}
end,
- send_packet(N+1, Pid, Chunk, Chunk(Cont), OldNode);
-send_packet(_N, _Pid, _Chunk, DataState, _OldNode) ->
+ send_packet(N+1, Pid, Chunk, Chunk(Cont));
+send_packet(_N, _Pid, _Chunk, DataState) ->
DataState.
finish_copy(Pid, Tab, Storage, RemoteS) ->
@@ -855,5 +801,5 @@ dat2bin(_Tab, _LocalS, _RemoteS) ->
handle_exit(Pid, Reason) when node(Pid) == node() ->
exit(Reason);
-handle_exit(_Pid, _Reason) -> %% Not from our node, this will be handled by
+handle_exit(_Pid, _Reason) -> %% Not from our node, this will be handled by
ignore. %% mnesia_down soon.
diff --git a/lib/mnesia/src/mnesia_log.erl b/lib/mnesia/src/mnesia_log.erl
index 9e804cc4c2..94153473cb 100644
--- a/lib/mnesia/src/mnesia_log.erl
+++ b/lib/mnesia/src/mnesia_log.erl
@@ -1021,7 +1021,8 @@ add_recs([LogH|Rest], N)
LogH#log_header.log_version >= "1.0" ->
add_recs(Rest, N);
add_recs([{{Tab, _Key}, _Val, clear_table} | Rest], N) ->
- true = ets:match_delete(Tab, '_'),
- add_recs(Rest, N+ets:info(Tab, size));
+ Size = ets:info(Tab, size),
+ true = ets:delete_all_objects(Tab),
+ add_recs(Rest, N+Size);
add_recs([], N) ->
N.
diff --git a/lib/mnesia/src/mnesia_monitor.erl b/lib/mnesia/src/mnesia_monitor.erl
index b6eda9ad3a..e110ad3241 100644
--- a/lib/mnesia/src/mnesia_monitor.erl
+++ b/lib/mnesia/src/mnesia_monitor.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -76,13 +76,13 @@
-include("mnesia.hrl").
--record(state, {supervisor, pending_negotiators = [],
+-record(state, {supervisor, pending_negotiators = [],
going_down = [], tm_started = false, early_connects = [],
connecting, mq = []}).
--define(current_protocol_version, {7,6}).
+-define(current_protocol_version, {8,0}).
--define(previous_protocol_version, {7,5}).
+-define(previous_protocol_version, {7,6}).
start() ->
gen_server:start_link({local, ?MODULE}, ?MODULE,
@@ -151,12 +151,12 @@ check_protocol([{Node, {accept, Mon, Version, Protocol}} | Tail], Protocols) ->
case lists:member(Protocol, Protocols) of
true ->
case Protocol == protocol_version() of
- true ->
+ true ->
set({protocol, Node}, {Protocol, false});
false ->
set({protocol, Node}, {Protocol, true})
end,
- [node(Mon) | check_protocol(Tail, Protocols)];
+ [node(Mon) | check_protocol(Tail, Protocols)];
false ->
verbose("Failed to connect with ~p. ~p protocols rejected. "
"expected version = ~p, expected protocol = ~p~n",
@@ -179,7 +179,7 @@ check_protocol([], [Protocol | _Protocols]) ->
set(protocol_version, Protocol),
[].
-protocol_version() ->
+protocol_version() ->
case ?catch_val(protocol_version) of
{'EXIT', _} -> ?current_protocol_version;
Version -> Version
@@ -189,14 +189,14 @@ protocol_version() ->
%% preferred protocols are first in the list
acceptable_protocol_versions() ->
[protocol_version(), ?previous_protocol_version].
-
+
needs_protocol_conversion(Node) ->
case {?catch_val({protocol, Node}), protocol_version()} of
{{'EXIT', _}, _} ->
false;
- {{_, Bool}, ?current_protocol_version} ->
+ {{_, Bool}, ?current_protocol_version} ->
Bool;
- {{_, Bool}, _} ->
+ {{_, Bool}, _} ->
not Bool
end.
@@ -255,15 +255,15 @@ terminate_proc(Who, Reason, _State) ->
%%----------------------------------------------------------------------
init([Parent]) ->
process_flag(trap_exit, true),
- ?ets_new_table(mnesia_gvar, [set, public, named_table]),
- ?ets_new_table(mnesia_stats, [set, public, named_table]),
+ ?ets_new_table(mnesia_gvar, [set, public, named_table]),
+ ?ets_new_table(mnesia_stats, [set, public, named_table]),
set(subscribers, []),
set(activity_subscribers, []),
mnesia_lib:verbose("~p starting: ~p~n", [?MODULE, self()]),
Version = mnesia:system_info(version),
set(version, Version),
dbg_out("Version: ~p~n", [Version]),
-
+
case catch process_config_args(env()) of
ok ->
mnesia_lib:set({'$$$_report', current_pos}, 0),
@@ -283,7 +283,7 @@ init([Parent]) ->
set(checkpoints, []),
set(pending_checkpoints, []),
set(pending_checkpoint_pids, []),
-
+
{ok, #state{supervisor = Parent}};
{'EXIT', Reason} ->
mnesia_lib:report_fatal("Bad configuration: ~p~n", [Reason]),
@@ -398,9 +398,9 @@ handle_call({unsafe_close_log, Name}, _From, State) ->
disk_log:close(Name),
{reply, ok, State};
-handle_call({negotiate_protocol, Mon, _Version, _Protocols}, _From, State)
+handle_call({negotiate_protocol, Mon, _Version, _Protocols}, _From, State)
when State#state.tm_started == false ->
- State2 = State#state{early_connects = [node(Mon) | State#state.early_connects]},
+ State2 = State#state{early_connects = [node(Mon) | State#state.early_connects]},
{reply, {node(), {reject, self(), uninitialized, uninitialized}}, State2};
%% From remote monitor..
@@ -412,7 +412,7 @@ handle_call({negotiate_protocol, Mon, Version, Protocols}, From, State)
true ->
accept_protocol(Mon, MyVersion, Protocol, From, State);
false ->
- %% in this release we should be able to handle the previous
+ %% in this release we should be able to handle the previous
%% protocol
case hd(Protocols) of
?previous_protocol_version ->
@@ -427,7 +427,7 @@ handle_call({negotiate_protocol, Mon, Version, Protocols}, From, State)
end;
%% Local request to negotiate with other monitors (nodes).
-handle_call({negotiate_protocol, Nodes}, From, State) ->
+handle_call({negotiate_protocol, Nodes}, From, State) ->
case mnesia_lib:intersect(State#state.going_down, Nodes) of
[] ->
spawn_link(?MODULE, negotiate_protocol_impl, [Nodes, From]),
@@ -461,7 +461,7 @@ accept_protocol(Mon, Version, Protocol, From, State) ->
%% No need for wait
link(Mon), %% link to remote Monitor
case Protocol == protocol_version() of
- true ->
+ true ->
set({protocol, Node}, {Protocol, false});
false ->
set({protocol, Node}, {Protocol, true})
@@ -509,7 +509,7 @@ handle_cast({disconnect, Node}, State) ->
ignore;
undefined ->
ignore;
- RemoteMon when is_pid(RemoteMon) ->
+ RemoteMon when is_pid(RemoteMon) ->
unlink(RemoteMon)
end,
{noreply, State};
@@ -534,7 +534,7 @@ handle_info({'EXIT', Pid, R}, State) when Pid == State#state.supervisor ->
dbg_out("~p was ~p by supervisor~n",[?MODULE, R]),
{stop, R, State};
-handle_info({'EXIT', Pid, fatal}, State) when node(Pid) == node() ->
+handle_info({'EXIT', Pid, fatal}, State) when node(Pid) == node() ->
dbg_out("~p got FATAL ERROR from: ~p~n",[?MODULE, Pid]),
exit(State#state.supervisor, shutdown),
{noreply, State};
@@ -550,7 +550,7 @@ handle_info(Msg = {'EXIT',Pid,_}, State) ->
Node /= node() ->
{noreply, State#state{mq = State#state.mq ++ [{info, Msg}]}};
true ->
- %% We have probably got an exit signal from
+ %% We have probably got an exit signal from
%% disk_log or dets
Hint = "Hint: check that the disk still is writable",
fatal("~p got unexpected info: ~p; ~p~n",
@@ -567,10 +567,10 @@ handle_info({nodeup, Node}, State) ->
%% Let's check if Mnesia is running there in order
%% to detect if the network has been partitioned
%% due to communication failure.
-
+
HasDown = mnesia_recover:has_mnesia_down(Node),
ImRunning = mnesia_lib:is_running(),
-
+
if
%% If I'm not running the test will be made later.
HasDown == true, ImRunning == yes ->
@@ -589,7 +589,7 @@ handle_info({disk_log, _Node, Log, Info}, State) ->
{truncated, _No} ->
ok;
_ ->
- mnesia_lib:important("Warning Log file ~p error reason ~s~n",
+ mnesia_lib:important("Warning Log file ~p error reason ~s~n",
[Log, disk_log:format_error(Info)])
end,
{noreply, State};
@@ -681,38 +681,38 @@ env() ->
send_compressed
].
-default_env(access_module) ->
+default_env(access_module) ->
mnesia;
-default_env(auto_repair) ->
+default_env(auto_repair) ->
true;
-default_env(backup_module) ->
+default_env(backup_module) ->
mnesia_backup;
-default_env(debug) ->
+default_env(debug) ->
none;
default_env(dir) ->
Name = lists:concat(["Mnesia.", node()]),
filename:absname(Name);
-default_env(dump_log_load_regulation) ->
+default_env(dump_log_load_regulation) ->
false;
-default_env(dump_log_time_threshold) ->
+default_env(dump_log_time_threshold) ->
timer:minutes(3);
-default_env(dump_log_update_in_place) ->
+default_env(dump_log_update_in_place) ->
true;
default_env(dump_log_write_threshold) ->
1000;
-default_env(embedded_mnemosyne) ->
+default_env(embedded_mnemosyne) ->
false;
-default_env(event_module) ->
+default_env(event_module) ->
mnesia_event;
-default_env(extra_db_nodes) ->
+default_env(extra_db_nodes) ->
[];
-default_env(ignore_fallback_at_startup) ->
+default_env(ignore_fallback_at_startup) ->
false;
default_env(fallback_error_function) ->
{mnesia, lkill};
-default_env(max_wait_for_decision) ->
+default_env(max_wait_for_decision) ->
infinity;
-default_env(schema_location) ->
+default_env(schema_location) ->
opt_disc;
default_env(core_dir) ->
false;
@@ -732,7 +732,7 @@ check_type(Env, Val) ->
NewVal ->
NewVal
end.
-
+
do_check_type(access_module, A) when is_atom(A) -> A;
do_check_type(auto_repair, B) -> bool(B);
do_check_type(backup_module, B) when is_atom(B) -> B;
@@ -749,7 +749,7 @@ do_check_type(dump_log_update_in_place, B) -> bool(B);
do_check_type(dump_log_write_threshold, I) when is_integer(I), I > 0 -> I;
do_check_type(event_module, A) when is_atom(A) -> A;
do_check_type(ignore_fallback_at_startup, B) -> bool(B);
-do_check_type(fallback_error_function, {Mod, Func})
+do_check_type(fallback_error_function, {Mod, Func})
when is_atom(Mod), is_atom(Func) -> {Mod, Func};
do_check_type(embedded_mnemosyne, B) -> bool(B);
do_check_type(extra_db_nodes, L) when is_list(L) ->
@@ -804,8 +804,8 @@ detect_inconcistency(Nodes, Context) ->
has_remote_mnesia_down(Node) ->
HasDown = mnesia_recover:has_mnesia_down(Node),
Master = mnesia_recover:get_master_nodes(schema),
- if
- HasDown == true, Master == [] ->
+ if
+ HasDown == true, Master == [] ->
{true, node()};
true ->
{false, node()}
diff --git a/lib/mnesia/src/mnesia_recover.erl b/lib/mnesia/src/mnesia_recover.erl
index b3eed1de6e..4750291a10 100644
--- a/lib/mnesia/src/mnesia_recover.erl
+++ b/lib/mnesia/src/mnesia_recover.erl
@@ -227,11 +227,13 @@ do_log_decision(D, DoTell, NodeD) ->
note_outcome(D2),
case mnesia_monitor:use_dir() of
true ->
- mnesia_log:append(latest_log, D2),
if
DoTell == true, Outcome /= unclear ->
tell_im_certain(NodeD#decision.disc_nodes--[node()],D2),
- tell_im_certain(NodeD#decision.ram_nodes--[node()], D2);
+ tell_im_certain(NodeD#decision.ram_nodes--[node()], D2),
+ mnesia_log:log(D2);
+ Outcome /= unclear ->
+ mnesia_log:log(D2);
true ->
ignore
end;
diff --git a/lib/mnesia/src/mnesia_schema.erl b/lib/mnesia/src/mnesia_schema.erl
index fef72ad39c..05be474aea 100644
--- a/lib/mnesia/src/mnesia_schema.erl
+++ b/lib/mnesia/src/mnesia_schema.erl
@@ -100,7 +100,7 @@
]).
%% Needed outside to be able to use/set table_properties
-%% from user (not supported)
+%% from user (not supported)
-export([schema_transaction/1,
insert_schema_ops/2,
do_create_table/1,
@@ -118,9 +118,9 @@
%% Here comes the init function which also resides in
%% this module, it is called upon by the trans server
%% at startup of the system
-%%
+%%
%% We have a meta table which looks like
-%% {table, schema,
+%% {table, schema,
%% {type, set},
%% {disc_copies, all},
%% {arity, 2}
@@ -149,14 +149,14 @@ exit_on_error(GoodRes) ->
val(Var) ->
case ?catch_val(Var) of
- {'EXIT', Reason} -> mnesia_lib:other_val(Var, Reason);
- Value -> Value
+ {'EXIT', Reason} -> mnesia_lib:other_val(Var, Reason);
+ Value -> Value
end.
%% This function traverses all cstructs in the schema and
%% sets all values in mnesia_gvar accordingly for each table/cstruct
-set_schema('$end_of_table') ->
+set_schema('$end_of_table') ->
[];
set_schema(Tab) ->
do_set_schema(Tab),
@@ -253,8 +253,8 @@ version() ->
incr_version(Cs) ->
{{Major, Minor}, _} = Cs#cstruct.version,
Nodes = mnesia_lib:intersect(val({schema, disc_copies}),
- mnesia_lib:cs_to_nodes(Cs)),
- V =
+ mnesia_lib:cs_to_nodes(Cs)),
+ V =
case Nodes -- val({Cs#cstruct.name, active_replicas}) of
[] -> {Major + 1, 0}; % All replicas are active
_ -> {Major, Minor + 1} % Some replicas are inactive
@@ -359,7 +359,7 @@ delete_schema2() ->
{error, Reason} ->
{error, Reason}
end.
-
+
ensure_no_schema([H|T]) when is_atom(H) ->
case rpc:call(H, ?MODULE, remote_read_schema, []) of
{badrpc, Reason} ->
@@ -407,7 +407,7 @@ opt_create_dir(UseDir, Dir) when UseDir == true->
check_can_write(Dir);
false ->
case file:make_dir(Dir) of
- ok ->
+ ok ->
verbose("Create Directory ~p~n", [Dir]),
ok;
{error, Reason} ->
@@ -417,7 +417,7 @@ opt_create_dir(UseDir, Dir) when UseDir == true->
end;
opt_create_dir(false, _) ->
{error, {has_no_disc, node()}}.
-
+
check_can_write(Dir) ->
case file:read_file_info(Dir) of
{ok, FI} when FI#file_info.type == directory,
@@ -450,7 +450,7 @@ read_schema(Keep) ->
read_schema(Keep, IgnoreFallback) ->
lock_schema(),
- Res =
+ Res =
case mnesia:system_info(is_running) of
yes ->
{ok, ram, get_create_list(schema)};
@@ -477,7 +477,7 @@ read_disc_schema(Keep, IgnoreFallback) ->
case mnesia_bup:fallback_exists() of
true when IgnoreFallback == false, Running /= yes ->
mnesia_bup:fallback_to_schema();
- _ ->
+ _ ->
%% If we're running, we read the schema file even
%% if fallback exists
Dat = mnesia_lib:tab2dat(schema),
@@ -499,7 +499,7 @@ read_disc_schema(Keep, IgnoreFallback) ->
end.
do_read_disc_schema(Fname, Keep) ->
- T =
+ T =
case Keep of
false ->
Args = [{keypos, 2}, public, set],
@@ -523,7 +523,7 @@ do_read_disc_schema(Fname, Keep) ->
get_initial_schema(SchemaStorage, Nodes) ->
Cs = #cstruct{name = schema,
record_name = schema,
- attributes = [table, cstruct]},
+ attributes = [table, cstruct]},
Cs2 =
case SchemaStorage of
ram_copies -> Cs#cstruct{ram_copies = Nodes};
@@ -532,7 +532,7 @@ get_initial_schema(SchemaStorage, Nodes) ->
cs2list(Cs2).
read_cstructs_from_disc() ->
- %% Assumptions:
+ %% Assumptions:
%% - local schema lock in global
%% - use_dir is true
%% - Mnesia is not running
@@ -552,14 +552,14 @@ read_cstructs_from_disc() ->
end,
Cstructs = dets:traverse(Tab, Fun),
dets:close(Tab),
- {ok, Cstructs};
+ {ok, Cstructs};
{error, Reason} ->
{error, Reason}
end;
false ->
{error, "No schema file exists"}
end.
-
+
%% We run a very special type of transactions when we
%% we want to manipulate the schema.
@@ -593,20 +593,20 @@ schema_transaction(Fun) ->
%% This process may dump the transaction log, and should
%% therefore not be run in an application process
-%%
+%%
schema_coordinator(Client, _Fun, undefined) ->
Res = {aborted, {node_not_running, node()}},
Client ! {transaction_done, Res, self()},
unlink(Client);
-
+
schema_coordinator(Client, Fun, Controller) when is_pid(Controller) ->
%% Do not trap exit in order to automatically die
%% when the controller dies
link(Controller),
unlink(Client),
-
- %% Fulfull the transaction even if the client dies
+
+ %% Fulfull the transaction even if the client dies
Res = mnesia:transaction(Fun),
Client ! {transaction_done, Res, self()},
unlink(Controller), % Avoids spurious exit message
@@ -619,7 +619,7 @@ schema_coordinator(Client, Fun, Controller) when is_pid(Controller) ->
insert_schema_ops({_Mod, _Tid, Ts}, SchemaIOps) ->
do_insert_schema_ops(Ts#tidstore.store, SchemaIOps).
-
+
do_insert_schema_ops(Store, [Head | Tail]) ->
?ets_insert(Store, Head),
do_insert_schema_ops(Store, Tail);
@@ -628,15 +628,56 @@ do_insert_schema_ops(_Store, []) ->
cs2list(Cs) when is_record(Cs, cstruct) ->
Tags = record_info(fields, cstruct),
- rec2list(Tags, 2, Cs);
+ rec2list(Tags, Tags, 2, Cs);
cs2list(CreateList) when is_list(CreateList) ->
- CreateList.
-
-rec2list([Tag | Tags], Pos, Rec) ->
+ CreateList;
+%% 4.4.19
+cs2list(Cs) when element(1, Cs) == cstruct, tuple_size(Cs) == 18 ->
+ Tags = [name,type,ram_copies,disc_copies,disc_only_copies,
+ load_order,access_mode,majority,index,snmp,local_content,
+ record_name,attributes,user_properties,frag_properties,
+ cookie,version],
+ rec2list(Tags, Tags, 2, Cs);
+%% 4.4.18 and earlier
+cs2list(Cs) when element(1, Cs) == cstruct, tuple_size(Cs) == 17 ->
+ Tags = [name,type,ram_copies,disc_copies,disc_only_copies,
+ load_order,access_mode,index,snmp,local_content,
+ record_name,attributes,user_properties,frag_properties,
+ cookie,version],
+ rec2list(Tags, Tags, 2, Cs).
+
+cs2list(false, Cs) ->
+ cs2list(Cs);
+cs2list(ver4_4_18, Cs) ->
+ Orig = record_info(fields, cstruct),
+ Tags = [name,type,ram_copies,disc_copies,disc_only_copies,
+ load_order,access_mode,index,snmp,local_content,
+ record_name,attributes,user_properties,frag_properties,
+ cookie,version],
+ rec2list(Tags, Orig, 2, Cs);
+cs2list(ver4_4_19, Cs) ->
+ Orig = record_info(fields, cstruct),
+ Tags = [name,type,ram_copies,disc_copies,disc_only_copies,
+ load_order,access_mode,majority,index,snmp,local_content,
+ record_name,attributes,user_properties,frag_properties,
+ cookie,version],
+ rec2list(Tags, Orig, 2, Cs).
+
+rec2list([Tag | Tags], [Tag | Orig], Pos, Rec) ->
Val = element(Pos, Rec),
- [{Tag, Val} | rec2list(Tags, Pos + 1, Rec)];
-rec2list([], _Pos, _Rec) ->
- [].
+ [{Tag, Val} | rec2list(Tags, Orig, Pos + 1, Rec)];
+rec2list([], _, _Pos, _Rec) ->
+ [];
+rec2list(Tags, [_|Orig], Pos, Rec) ->
+ rec2list(Tags, Orig, Pos+1, Rec).
+
+api_list2cs(List) when is_list(List) ->
+ Name = pick(unknown, name, List, must),
+ Keys = check_keys(Name, List, record_info(fields, cstruct)),
+ check_duplicates(Name, Keys),
+ list2cs(List);
+api_list2cs(Other) ->
+ mnesia:abort({badarg, Other}).
list2cs(List) when is_list(List) ->
Name = pick(unknown, name, List, must),
@@ -667,10 +708,7 @@ list2cs(List) when is_list(List) ->
Frag = pick(Name, frag_properties, List, []),
verify({alt, [nil, list]}, mnesia_lib:etype(Frag),
- {badarg, Name, {frag_properties, Frag}}),
-
- Keys = check_keys(Name, List, record_info(fields, cstruct)),
- check_duplicates(Name, Keys),
+ {badarg, Name, {frag_properties, Frag}}),
#cstruct{name = Name,
ram_copies = Rc,
disc_copies = Dc,
@@ -687,9 +725,7 @@ list2cs(List) when is_list(List) ->
user_properties = lists:sort(UserProps),
frag_properties = lists:sort(Frag),
cookie = Cookie,
- version = Version};
-list2cs(Other) ->
- mnesia:abort({badarg, Other}).
+ version = Version}.
pick(Tab, Key, List, Default) ->
case lists:keysearch(Key, 1, List) of
@@ -708,7 +744,7 @@ attr_tab_to_pos(_Tab, Pos) when is_integer(Pos) ->
Pos;
attr_tab_to_pos(Tab, Attr) ->
attr_to_pos(Attr, val({Tab, attributes})).
-
+
%% Convert attribute name to integer if neccessary
attr_to_pos(Pos, _Attrs) when is_integer(Pos) ->
Pos;
@@ -723,7 +759,7 @@ attr_to_pos(Attr, [_ | Attrs], Pos) ->
attr_to_pos(Attr, Attrs, Pos + 1);
attr_to_pos(Attr, _, _) ->
mnesia:abort({bad_type, Attr}).
-
+
check_keys(Tab, [{Key, _Val} | Tail], Items) ->
case lists:member(Key, Items) of
true -> [Key | check_keys(Tab, Tail, Items)];
@@ -759,7 +795,7 @@ verify_cstruct(Cs) when is_record(Cs, cstruct) ->
{bad_type, Tab, {type, Type}}),
%% Currently ordered_set is not supported for disk_only_copies.
- if
+ if
Type == ordered_set, Cs#cstruct.disc_only_copies /= [] ->
mnesia:abort({bad_type, Tab, {not_supported, Type, disc_only_copies}});
true ->
@@ -776,10 +812,10 @@ verify_cstruct(Cs) when is_record(Cs, cstruct) ->
Arity = length(Attrs) + 1,
verify(true, Arity > 2, {bad_type, Tab, {attributes, Attrs}}),
-
+
lists:foldl(fun(Attr,_Other) when Attr == snmp ->
mnesia:abort({bad_type, Tab, {attributes, [Attr]}});
- (Attr,Other) ->
+ (Attr,Other) ->
verify(atom, mnesia_lib:etype(Attr),
{bad_type, Tab, {attributes, [Attr]}}),
verify(false, lists:member(Attr, Other),
@@ -792,7 +828,7 @@ verify_cstruct(Cs) when is_record(Cs, cstruct) ->
Index = Cs#cstruct.index,
verify({alt, [nil, list]}, mnesia_lib:etype(Index),
{bad_type, Tab, {index, Index}}),
-
+
IxFun =
fun(Pos) ->
verify(true, fun() ->
@@ -807,7 +843,7 @@ verify_cstruct(Cs) when is_record(Cs, cstruct) ->
{bad_type, Tab, {index, [Pos]}})
end,
lists:foreach(IxFun, Index),
-
+
LC = Cs#cstruct.local_content,
verify({alt, [true, false]}, LC,
{bad_type, Tab, {local_content, LC}}),
@@ -834,7 +870,7 @@ verify_cstruct(Cs) when is_record(Cs, cstruct) ->
lists:foreach(CheckProp, Cs#cstruct.user_properties),
case Cs#cstruct.cookie of
- {{MegaSecs, Secs, MicroSecs}, _Node}
+ {{MegaSecs, Secs, MicroSecs}, _Node}
when is_integer(MegaSecs), is_integer(Secs),
is_integer(MicroSecs), is_atom(node) ->
ok;
@@ -870,15 +906,15 @@ verify_nodes(Cs) ->
end,
verify(integer, mnesia_lib:etype(LoadOrder),
{bad_type, Tab, {load_order, LoadOrder}}),
-
+
Nodes = Ram ++ Disc ++ DiscOnly,
verify(list, mnesia_lib:etype(Nodes),
{combine_error, Tab,
[{ram_copies, []}, {disc_copies, []}, {disc_only_copies, []}]}),
verify(false, has_duplicates(Nodes), {combine_error, Tab, Nodes}),
- AtomCheck = fun(N) -> verify(atom, mnesia_lib:etype(N), {bad_type, Tab, N}) end,
+ AtomCheck = fun(N) -> verify(atom, mnesia_lib:etype(N), {bad_type, Tab, N}) end,
lists:foreach(AtomCheck, Nodes).
-
+
verify(Expected, Fun, Error) when is_function(Fun) ->
do_verify(Expected, catch Fun(), Error);
verify(Expected, Actual, Error) ->
@@ -909,7 +945,7 @@ ensure_active(Cs, What) ->
W = {Tab, What},
ensure_non_empty(W),
Nodes = mnesia_lib:intersect(val({schema, disc_copies}),
- mnesia_lib:cs_to_nodes(Cs)),
+ mnesia_lib:cs_to_nodes(Cs)),
case Nodes -- val(W) of
[] ->
ok;
@@ -936,7 +972,7 @@ ensure_non_empty({Tab, Vhat}) ->
ensure_not_active(Tab = schema, Node) ->
Active = val({Tab, active_replicas}),
- case lists:member(Node, Active) of
+ case lists:member(Node, Active) of
false when Active =/= [] ->
ok;
false ->
@@ -970,7 +1006,7 @@ create_table(TabDef) ->
do_multi_create_table(TabDef) ->
get_tid_ts_and_lock(schema, write),
ensure_writable(schema),
- Cs = list2cs(TabDef),
+ Cs = api_list2cs(TabDef),
case Cs#cstruct.frag_properties of
[] ->
do_create_table(Cs);
@@ -999,7 +1035,7 @@ unsafe_make_create_table(Cs) ->
{_Mod, Tid, Ts} = get_tid_ts_and_lock(schema, none),
verify_cstruct(Cs),
Tab = Cs#cstruct.name,
-
+
%% Check that we have all disc replica nodes running
DiscNodes = Cs#cstruct.disc_copies ++ Cs#cstruct.disc_only_copies,
RunningNodes = val({current, db_nodes}),
@@ -1017,7 +1053,7 @@ unsafe_make_create_table(Cs) ->
check_if_exists(Tab) ->
TidTs = get_tid_ts_and_lock(schema, write),
{_, _, Ts} = TidTs,
- Store = Ts#tidstore.store,
+ Store = Ts#tidstore.store,
ets:foldl(
fun({op, create_table, [{name, T}|_]}, _Acc) when T==Tab ->
true;
@@ -1054,7 +1090,7 @@ make_delete_table(Tab, Mode) ->
%% nodes etc.
TidTs = get_tid_ts_and_lock(schema, write),
{_, _, Ts} = TidTs,
- Store = Ts#tidstore.store,
+ Store = Ts#tidstore.store,
Deleted = ets:select_delete(
Store, [{{op,'$1',[{name,Tab}|'_']},
[{'or',
@@ -1077,9 +1113,9 @@ make_delete_table(Tab, Mode) ->
[] ->
[make_delete_table2(Tab)];
_Props ->
- %% Check if it is a base table
- mnesia_frag:lookup_frag_hash(Tab),
-
+ %% Check if it is a base table
+ mnesia_frag:lookup_frag_hash(Tab),
+
%% Check for foreigners
F = mnesia_frag:lookup_foreigners(Tab),
verify([], F, {combine_error,
@@ -1101,7 +1137,7 @@ make_delete_table2(Tab) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% Change fragmentation of a table
-
+
change_table_frag(Tab, Change) ->
schema_transaction(fun() -> do_change_table_frag(Tab, Change) end).
@@ -1112,7 +1148,7 @@ do_change_table_frag(Tab, Change) when is_atom(Tab), Tab /= schema ->
ok;
do_change_table_frag(Tab, _Change) ->
mnesia:abort({bad_type, Tab}).
-
+
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% Clear a table
@@ -1150,7 +1186,7 @@ make_add_table_copy(Tab, Node, Storage) ->
verify(false, lists:member(Node, Ns), {already_exists, Tab, Node}),
Cs2 = new_cs(Cs, Node, Storage, add),
verify_cstruct(Cs2),
-
+
%% Check storage and if node is running
IsRunning = lists:member(Node, val({current, db_nodes})),
if
@@ -1177,21 +1213,21 @@ del_table_copy(Tab, Node) ->
do_del_table_copy(Tab, Node) when is_atom(Node) ->
TidTs = get_tid_ts_and_lock(schema, write),
-%% get_tid_ts_and_lock(Tab, write),
+%% get_tid_ts_and_lock(Tab, write),
insert_schema_ops(TidTs, make_del_table_copy(Tab, Node));
do_del_table_copy(Tab, Node) ->
mnesia:abort({badarg, Tab, Node}).
-
+
make_del_table_copy(Tab, Node) ->
ensure_writable(schema),
Cs = incr_version(val({Tab, cstruct})),
Storage = mnesia_lib:schema_cs_to_storage_type(Node, Cs),
- Cs2 = new_cs(Cs, Node, Storage, del),
+ Cs2 = new_cs(Cs, Node, Storage, del),
case mnesia_lib:cs_to_nodes(Cs2) of
[] when Tab == schema ->
mnesia:abort({combine_error, Tab, "Last replica"});
[] ->
- ensure_active(Cs),
+ ensure_active(Cs),
dbg_out("Last replica deleted in table ~p~n", [Tab]),
make_delete_table(Tab, whole_table);
_ when Tab == schema ->
@@ -1210,14 +1246,14 @@ remove_node_from_tabs([], _Node) ->
[];
remove_node_from_tabs([schema|Rest], Node) ->
remove_node_from_tabs(Rest, Node);
-remove_node_from_tabs([Tab|Rest], Node) ->
- {Cs, IsFragModified} =
+remove_node_from_tabs([Tab|Rest], Node) ->
+ {Cs, IsFragModified} =
mnesia_frag:remove_node(Node, incr_version(val({Tab, cstruct}))),
case mnesia_lib:schema_cs_to_storage_type(Node, Cs) of
unknown ->
case IsFragModified of
true ->
- [{op, change_table_frag, {del_node, Node}, cs2list(Cs)} |
+ [{op, change_table_frag, {del_node, Node}, cs2list(Cs)} |
remove_node_from_tabs(Rest, Node)];
false ->
remove_node_from_tabs(Rest, Node)
@@ -1246,7 +1282,7 @@ new_cs(Cs, Node, ram_copies, del) ->
new_cs(Cs, Node, disc_copies, del) ->
Cs#cstruct{disc_copies = lists:delete(Node , Cs#cstruct.disc_copies)};
new_cs(Cs, Node, disc_only_copies, del) ->
- Cs#cstruct{disc_only_copies =
+ Cs#cstruct{disc_only_copies =
lists:delete(Node , Cs#cstruct.disc_only_copies)};
new_cs(Cs, _Node, Storage, _Op) ->
mnesia:abort({badarg, Cs#cstruct.name, Storage}).
@@ -1278,7 +1314,7 @@ make_move_table(Tab, FromNode, ToNode) ->
Running = val({current, db_nodes}),
Storage = mnesia_lib:schema_cs_to_storage_type(FromNode, Cs),
verify(true, lists:member(ToNode, Running), {not_active, schema, ToNode}),
-
+
Cs2 = new_cs(Cs, ToNode, Storage, add),
Cs3 = new_cs(Cs2, FromNode, Storage, del),
verify_cstruct(Cs3),
@@ -1306,7 +1342,7 @@ make_change_table_copy_type(Tab, Node, unknown) ->
make_change_table_copy_type(Tab, Node, ToS) ->
ensure_writable(schema),
Cs = incr_version(val({Tab, cstruct})),
- FromS = mnesia_lib:storage_type_at_node(Node, Tab),
+ FromS = mnesia_lib:storage_type_at_node(Node, Tab),
case compare_storage_type(false, FromS, ToS) of
{same, _} ->
@@ -1320,12 +1356,12 @@ make_change_table_copy_type(Tab, Node, ToS) ->
Cs2 = new_cs(Cs, Node, FromS, del),
Cs3 = new_cs(Cs2, Node, ToS, add),
verify_cstruct(Cs3),
-
+
[{op, change_table_copy_type, Node, FromS, ToS, cs2list(Cs3)}].
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% change index functions ....
-%% Pos is allready added by 1 in both of these functions
+%% Pos is allready added by 1 in both of these functions
add_table_index(Tab, Pos) ->
schema_transaction(fun() -> do_add_table_index(Tab, Pos) end).
@@ -1412,14 +1448,14 @@ make_del_snmp(Tab) ->
[{op, del_snmp, cs2list(Cs2)}].
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
-%%
+%%
-transform_table(Tab, Fun, NewAttrs, NewRecName)
- when is_function(Fun), is_list(NewAttrs), is_atom(NewRecName) ->
+transform_table(Tab, Fun, NewAttrs, NewRecName)
+ when is_function(Fun), is_list(NewAttrs), is_atom(NewRecName) ->
schema_transaction(fun() -> do_transform_table(Tab, Fun, NewAttrs, NewRecName) end);
-transform_table(Tab, ignore, NewAttrs, NewRecName)
- when is_list(NewAttrs), is_atom(NewRecName) ->
+transform_table(Tab, ignore, NewAttrs, NewRecName)
+ when is_list(NewAttrs), is_atom(NewRecName) ->
schema_transaction(fun() -> do_transform_table(Tab, ignore, NewAttrs, NewRecName) end);
transform_table(Tab, Fun, NewAttrs, NewRecName) ->
@@ -1438,7 +1474,7 @@ make_transform(Tab, Fun, NewAttrs, NewRecName) ->
ensure_active(Cs),
ensure_writable(Tab),
case mnesia_lib:val({Tab, index}) of
- [] ->
+ [] ->
Cs2 = Cs#cstruct{attributes = NewAttrs, record_name = NewRecName},
verify_cstruct(Cs2),
[{op, transform, Fun, cs2list(Cs2)}];
@@ -1464,7 +1500,7 @@ make_transform(Tab, Fun, NewAttrs, NewRecName) ->
end.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
-%%
+%%
change_table_access_mode(Tab, Mode) ->
schema_transaction(fun() -> do_change_table_access_mode(Tab, Mode) end).
@@ -1598,9 +1634,9 @@ change_prop_in_existing_op(Tab, Prop, How, Store) ->
false ->
false
end.
-
-update_existing_op([{op, Op, L = [{name,Tab}|_], _OldProp}|Ops],
- Tab, Prop, How, Acc) when Op == write_property;
+
+update_existing_op([{op, Op, L = [{name,Tab}|_], _OldProp}|Ops],
+ Tab, Prop, How, Acc) when Op == write_property;
Op == delete_property ->
%% Apparently, mnesia_dumper doesn't care about OldProp here -- just L,
%% so we will throw away OldProp (not that it matters...) and insert Prop.
@@ -1625,7 +1661,7 @@ update_existing_op([], _, _, _, _) ->
do_read_table_property(Tab, Key) ->
TidTs = get_tid_ts_and_lock(schema, read),
{_, _, Ts} = TidTs,
- Store = Ts#tidstore.store,
+ Store = Ts#tidstore.store,
Props = ets:foldl(
fun({op, create_table, [{name, T}|Opts]}, _Acc)
when T==Tab ->
@@ -1689,7 +1725,7 @@ do_delete_table_property(Tab, PropKey) ->
[Tab,PropKey]),
%% this must be an existing table
get_tid_ts_and_lock(Tab, none),
- insert_schema_ops(TidTs,
+ insert_schema_ops(TidTs,
make_delete_table_properties(Tab, [PropKey]))
end.
@@ -1711,17 +1747,17 @@ make_delete_table_properties(_Tab, [], _Cs) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
-%% Ensure that the transaction can be committed even
+%% Ensure that the transaction can be committed even
%% if the node crashes and Mnesia is restarted
prepare_commit(Tid, Commit, WaitFor) ->
case Commit#commit.schema_ops of
[] ->
{false, Commit, optional};
OrigOps ->
- {Modified, Ops, DumperMode} =
+ {Modified, Ops, DumperMode} =
prepare_ops(Tid, OrigOps, WaitFor, false, [], optional),
InitBy = schema_prepare,
- GoodRes = {Modified,
+ GoodRes = {Modified,
Commit#commit{schema_ops = lists:reverse(Ops)},
DumperMode},
case DumperMode of
@@ -1737,7 +1773,7 @@ prepare_commit(Tid, Commit, WaitFor) ->
end
end,
case Ops of
- [] ->
+ [] ->
ignore;
_ ->
%% We need to grab a dumper lock here, the log may not
@@ -1749,20 +1785,20 @@ prepare_commit(Tid, Commit, WaitFor) ->
prepare_ops(Tid, [Op | Ops], WaitFor, Changed, Acc, DumperMode) ->
case prepare_op(Tid, Op, WaitFor) of
- {true, mandatory} ->
+ {true, mandatory} ->
prepare_ops(Tid, Ops, WaitFor, Changed, [Op | Acc], mandatory);
- {true, optional} ->
+ {true, optional} ->
prepare_ops(Tid, Ops, WaitFor, Changed, [Op | Acc], DumperMode);
- {true, Ops2, mandatory} ->
+ {true, Ops2, mandatory} ->
prepare_ops(Tid, Ops, WaitFor, true, Ops2 ++ Acc, mandatory);
- {true, Ops2, optional} ->
+ {true, Ops2, optional} ->
prepare_ops(Tid, Ops, WaitFor, true, Ops2 ++ Acc, DumperMode);
- {false, optional} ->
+ {false, optional} ->
prepare_ops(Tid, Ops, WaitFor, true, Acc, DumperMode)
end;
prepare_ops(_Tid, [], _WaitFor, Changed, Acc, DumperMode) ->
{Changed, Acc, DumperMode}.
-
+
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% Prepare for commit
%% returns true if Op should be included, i.e. unmodified
@@ -1781,8 +1817,8 @@ prepare_op(_Tid, {op, rec, unknown, Rec}, _WaitFor) ->
prepare_op(_Tid, {op, announce_im_running, Node, SchemaDef, Running, RemoteRunning}, _WaitFor) ->
SchemaCs = list2cs(SchemaDef),
- if
- Node == node() -> %% Announce has already run on local node
+ if
+ Node == node() -> %% Announce has already run on local node
ignore; %% from do_merge_schema
true ->
%% If a node has restarted it may still linger in db_nodes,
@@ -1794,9 +1830,9 @@ prepare_op(_Tid, {op, announce_im_running, Node, SchemaDef, Running, RemoteRunni
end,
{false, optional};
-prepare_op(_Tid, {op, sync_trans}, {part, CoordPid}) ->
+prepare_op(_Tid, {op, sync_trans}, {part, CoordPid}) ->
CoordPid ! {sync_trans, self()},
- receive
+ receive
{sync_trans, CoordPid} ->
{false, optional};
{mnesia_down, _Node} = Else ->
@@ -1807,7 +1843,7 @@ prepare_op(_Tid, {op, sync_trans}, {part, CoordPid}) ->
mnesia:abort(Else)
end;
-prepare_op(_Tid, {op, sync_trans}, {coord, Nodes}) ->
+prepare_op(_Tid, {op, sync_trans}, {coord, Nodes}) ->
case receive_sync(Nodes, []) of
{abort, Reason} ->
mnesia_lib:verbose("sync_op terminated due to ~p~n", [Reason]),
@@ -1838,7 +1874,7 @@ prepare_op(Tid, {op, create_table, TabDef}, _WaitFor) ->
create_ram_table(Tab, Cs#cstruct.type),
create_disc_table(Tab),
insert_cstruct(Tid, Cs, false),
- {true, optional};
+ {true, optional};
disc_only_copies ->
mnesia_lib:set({Tab, create_table},true),
create_disc_only_table(Tab,Cs#cstruct.type),
@@ -1857,15 +1893,15 @@ prepare_op(Tid, {op, add_table_copy, Storage, Node, TabDef}, _WaitFor) ->
if
Tab == schema ->
{true, optional};
-
+
Node == node() ->
- case mnesia_lib:val({schema, storage_type}) of
- ram_copies when Storage /= ram_copies ->
+ case mnesia_lib:val({schema, storage_type}) of
+ ram_copies when Storage /= ram_copies ->
Error = {combine_error, Tab, "has no disc", Node},
mnesia:abort(Error);
_ ->
ok
- end,
+ end,
%% Tables are created by mnesia_loader get_network code
insert_cstruct(Tid, Cs, true),
case mnesia_controller:get_network_copy(Tab, Cs) of
@@ -1902,22 +1938,22 @@ prepare_op(Tid, {op, add_table_copy, Storage, Node, TabDef}, _WaitFor) ->
prepare_op(Tid, {op, del_table_copy, _Storage, Node, TabDef}, _WaitFor) ->
Cs = list2cs(TabDef),
Tab = Cs#cstruct.name,
-
+
if
%% Schema table lock is always required to run a schema op.
%% No need to look it.
- node(Tid#tid.pid) == node(), Tab /= schema ->
+ node(Tid#tid.pid) == node(), Tab /= schema ->
Self = self(),
Pid = spawn_link(fun() -> lock_del_table(Tab, Node, Cs, Self) end),
put(mnesia_lock, Pid),
- receive
- {Pid, updated} ->
+ receive
+ {Pid, updated} ->
{true, optional};
{Pid, FailReason} ->
mnesia:abort(FailReason);
{'EXIT', Pid, Reason} ->
mnesia:abort(Reason)
- end;
+ end;
true ->
{true, optional}
end;
@@ -1928,12 +1964,12 @@ prepare_op(_Tid, {op, change_table_copy_type, N, FromS, ToS, TabDef}, _WaitFor)
Tab = Cs#cstruct.name,
NotActive = mnesia_lib:not_active_here(Tab),
-
- if
+
+ if
NotActive == true ->
mnesia:abort({not_active, Tab, node()});
-
- Tab == schema ->
+
+ Tab == schema ->
case {FromS, ToS} of
{ram_copies, disc_copies} ->
case mnesia:system_info(schema_location) of
@@ -1943,7 +1979,7 @@ prepare_op(_Tid, {op, change_table_copy_type, N, FromS, ToS, TabDef}, _WaitFor)
mnesia:abort({combine_error, Tab, node(),
"schema_location must be opt_disc"})
end,
- Dir = mnesia_lib:dir(),
+ Dir = mnesia_lib:dir(),
case opt_create_dir(true, Dir) of
ok ->
purge_dir(Dir, []),
@@ -1967,18 +2003,18 @@ prepare_op(_Tid, {op, change_table_copy_type, N, FromS, ToS, TabDef}, _WaitFor)
_ ->
mnesia:abort({combine_error, Tab, ToS})
end;
-
- FromS == ram_copies ->
+
+ FromS == ram_copies ->
case mnesia_monitor:use_dir() of
- true ->
+ true ->
Dat = mnesia_lib:tab2dcd(Tab),
case mnesia_lib:exists(Dat) of
true ->
mnesia:abort({combine_error, Tab, node(),
"Table dump exists"});
false ->
- case ToS of
- disc_copies ->
+ case ToS of
+ disc_copies ->
mnesia_log:ets2dcd(Tab, dmp);
disc_only_copies ->
mnesia_dumper:raw_named_dump_table(Tab, dmp)
@@ -1988,7 +2024,7 @@ prepare_op(_Tid, {op, change_table_copy_type, N, FromS, ToS, TabDef}, _WaitFor)
false ->
mnesia:abort({has_no_disc, node()})
end;
-
+
FromS == disc_copies, ToS == disc_only_copies ->
mnesia_dumper:raw_named_dump_table(Tab, dmp);
FromS == disc_only_copies ->
@@ -2020,7 +2056,7 @@ prepare_op(_Tid, {op, dump_table, unknown, TabDef}, _WaitFor) ->
case lists:member(node(), Cs#cstruct.ram_copies) of
true ->
case mnesia_monitor:use_dir() of
- true ->
+ true ->
mnesia_log:ets2dcd(Tab, dmp),
Size = mnesia:table_info(Tab, size),
{true, [{op, dump_table, Size, TabDef}], optional};
@@ -2058,7 +2094,7 @@ prepare_op(_Tid, {op, transform, Fun, TabDef}, _WaitFor) ->
mnesia_lib:db_fixtable(Storage, Tab, true),
Key = mnesia_lib:db_first(Tab),
Op = {op, transform, Fun, TabDef},
- case catch transform_objs(Fun, Tab, RecName,
+ case catch transform_objs(Fun, Tab, RecName,
Key, NewArity, Storage, Type, [Op]) of
{'EXIT', Reason} ->
mnesia_lib:db_fixtable(Storage, Tab, false),
@@ -2072,7 +2108,7 @@ prepare_op(_Tid, {op, transform, Fun, TabDef}, _WaitFor) ->
prepare_op(_Tid, {op, merge_schema, TabDef}, _WaitFor) ->
Cs = list2cs(TabDef),
case verify_merge(Cs) of
- ok ->
+ ok ->
{true, optional};
Error ->
verbose("Merge_Schema ~p failed on ~p: ~p~n", [_Tid,node(),Error]),
@@ -2093,7 +2129,7 @@ create_ram_table(Tab, Type) ->
create_disc_table(Tab) ->
File = mnesia_lib:tab2dcd(Tab),
file:delete(File),
- FArg = [{file, File}, {name, {mnesia,create}},
+ FArg = [{file, File}, {name, {mnesia,create}},
{repair, false}, {mode, read_write}],
case mnesia_monitor:open_log(FArg) of
{ok,Log} ->
@@ -2124,7 +2160,7 @@ receive_sync([], Pids) ->
receive_sync(Nodes, Pids) ->
receive
{sync_trans, Pid} ->
- Node = node(Pid),
+ Node = node(Pid),
receive_sync(lists:delete(Node, Nodes), [Pid | Pids]);
Else ->
{abort, Else}
@@ -2140,16 +2176,16 @@ lock_del_table(Tab, Node, Cs, Father) ->
false;
({badrpc, {'EXIT', {undef, _}}}) ->
%% This will be the case we talks with elder nodes
- %% than 3.8.2, they will set where_to_read without
- %% getting a lock.
+ %% than 3.8.2, they will set where_to_read without
+ %% getting a lock.
false;
(_) ->
true
end,
case lists:filter(Filter, Res) of
- [] ->
+ [] ->
Father ! {self(), updated},
- %% When transaction is commited the process dies
+ %% When transaction is commited the process dies
%% and the lock is released.
receive _ -> ok end;
Err ->
@@ -2166,7 +2202,7 @@ lock_del_table(Tab, Node, Cs, Father) ->
exit(normal).
set_where_to_read(Tab, Node, Cs) ->
- case mnesia_lib:val({Tab, where_to_read}) of
+ case mnesia_lib:val({Tab, where_to_read}) of
Node ->
case Cs#cstruct.local_content of
true ->
@@ -2185,16 +2221,16 @@ transform_objs(_Fun, _Tab, _RT, '$end_of_table', _NewArity, _Storage, _Type, Acc
transform_objs(Fun, Tab, RecName, Key, A, Storage, Type, Acc) ->
Objs = mnesia_lib:db_get(Tab, Key),
NextKey = mnesia_lib:db_next_key(Tab, Key),
- Oid = {Tab, Key},
+ Oid = {Tab, Key},
NewObjs = {Ws, Ds} = transform_obj(Tab, RecName, Key, Fun, Objs, A, Type, [], []),
- if
- NewObjs == {[], []} ->
+ if
+ NewObjs == {[], []} ->
transform_objs(Fun, Tab, RecName, NextKey, A, Storage, Type, Acc);
- Type == bag ->
+ Type == bag ->
transform_objs(Fun, Tab, RecName, NextKey, A, Storage, Type,
[{op, rec, Storage, {Oid, Ws, write}},
{op, rec, Storage, {Oid, [Oid], delete}} | Acc]);
- Ds == [] ->
+ Ds == [] ->
%% Type is set or ordered_set, no need to delete the record first
transform_objs(Fun, Tab, RecName, NextKey, A, Storage, Type,
[{op, rec, Storage, {Oid, Ws, write}} | Acc]);
@@ -2215,15 +2251,15 @@ transform_obj(Tab, RecName, Key, Fun, [Obj|Rest], NewArity, Type, Ws, Ds) ->
NewObj == Obj ->
transform_obj(Tab, RecName, Key, Fun, Rest, NewArity, Type, Ws, Ds);
RecName == element(1, NewObj), Key == element(2, NewObj) ->
- transform_obj(Tab, RecName, Key, Fun, Rest, NewArity,
+ transform_obj(Tab, RecName, Key, Fun, Rest, NewArity,
Type, [NewObj | Ws], Ds);
- NewObj == delete ->
- case Type of
+ NewObj == delete ->
+ case Type of
bag -> %% Just don't write that object
- transform_obj(Tab, RecName, Key, Fun, Rest,
- NewArity, Type, Ws, Ds);
+ transform_obj(Tab, RecName, Key, Fun, Rest,
+ NewArity, Type, Ws, Ds);
_ ->
- transform_obj(Tab, RecName, Key, Fun, Rest, NewArity,
+ transform_obj(Tab, RecName, Key, Fun, Rest, NewArity,
Type, Ws, [NewObj | Ds])
end;
true ->
@@ -2247,7 +2283,7 @@ undo_prepare_commit(Tid, Commit) ->
%% Undo in reverse order
undo_prepare_ops(Tid, [Op | Ops]) ->
- case element(1, Op) of
+ case element(1, Op) of
TheOp when TheOp /= op, TheOp /= restore_op ->
undo_prepare_ops(Tid, Ops);
_ ->
@@ -2274,7 +2310,7 @@ undo_prepare_op(Tid, {op, create_table, TabDef}) ->
mnesia_lib:unset({Tab, create_table}),
delete_cstruct(Tid, Cs),
case mnesia_lib:cs_to_storage_type(node(), Cs) of
- unknown ->
+ unknown ->
ok;
ram_copies ->
ram_delete_table(Tab, ram_copies);
@@ -2289,7 +2325,7 @@ undo_prepare_op(Tid, {op, create_table, TabDef}) ->
%% disc_delete_table(Tab, Storage),
file:delete(Dat)
end;
-
+
undo_prepare_op(Tid, {op, add_table_copy, Storage, Node, TabDef}) ->
Cs = list2cs(TabDef),
Tab = Cs#cstruct.name,
@@ -2314,21 +2350,21 @@ undo_prepare_op(Tid, {op, add_table_copy, Storage, Node, TabDef}) ->
Cs2 = new_cs(Cs, Node, Storage, del),
insert_cstruct(Tid, Cs2, true) % Don't care about the version
end;
-
-undo_prepare_op(_Tid, {op, del_table_copy, _, Node, TabDef})
+
+undo_prepare_op(_Tid, {op, del_table_copy, _, Node, TabDef})
when Node == node() ->
Cs = list2cs(TabDef),
Tab = Cs#cstruct.name,
mnesia_lib:set({Tab, where_to_read}, Node);
-undo_prepare_op(_Tid, {op, change_table_copy_type, N, FromS, ToS, TabDef})
+undo_prepare_op(_Tid, {op, change_table_copy_type, N, FromS, ToS, TabDef})
when N == node() ->
Cs = list2cs(TabDef),
Tab = Cs#cstruct.name,
mnesia_checkpoint:tm_change_table_copy_type(Tab, ToS, FromS),
Dmp = mnesia_lib:tab2dmp(Tab),
-
+
case {FromS, ToS} of
{ram_copies, disc_copies} when Tab == schema ->
file:delete(Dmp),
@@ -2382,9 +2418,9 @@ ram_delete_table(Tab, Storage) ->
ignore;
disc_only_copies ->
ignore;
- _Else ->
+ _Else ->
%% delete possible index files and data .....
- %% Got to catch this since if no info has been set in the
+ %% Got to catch this since if no info has been set in the
%% mnesia_gvar it will crash
catch mnesia_index:del_transient(Tab, Storage),
case ?catch_val({Tab, {index, snmp}}) of
@@ -2454,7 +2490,7 @@ has_known_suffix(File, [Suffix | Tail], false) ->
has_known_suffix(File, Tail, lists:suffix(Suffix, File));
has_known_suffix(_File, [], Bool) ->
Bool.
-
+
known_suffixes() -> real_suffixes() ++ tmp_suffixes().
real_suffixes() -> [".DAT", ".LOG", ".BUP", ".DCL", ".DCD"].
@@ -2477,11 +2513,11 @@ info2(Tab, [{frag_hash, _V} | Tail]) -> % Ignore frag_hash
info2(Tab, [{P, V} | Tail]) ->
io:format("~-20w -> ~p~n",[P,V]),
info2(Tab, Tail);
-info2(_, []) ->
+info2(_, []) ->
io:format("~n", []).
get_table_properties(Tab) ->
- case catch mnesia_lib:db_match_object(ram_copies,
+ case catch mnesia_lib:db_match_object(ram_copies,
mnesia_gvar, {{Tab, '_'}, '_'}) of
{'EXIT', _} ->
mnesia:abort({no_exists, Tab, all});
@@ -2509,9 +2545,9 @@ get_table_properties(Tab) ->
recs = error_recs
}).
-restore(Opaque) ->
+restore(Opaque) ->
restore(Opaque, [], mnesia_monitor:get_env(backup_module)).
-restore(Opaque, Args) when is_list(Args) ->
+restore(Opaque, Args) when is_list(Args) ->
restore(Opaque, Args, mnesia_monitor:get_env(backup_module));
restore(_Opaque, BadArg) ->
{aborted, {badarg, BadArg}}.
@@ -2522,7 +2558,7 @@ restore(Opaque, Args, Module) when is_list(Args), is_atom(Module) ->
case mnesia_bup:read_schema(R#r.module, Opaque) of
{error, Reason} ->
{aborted, Reason};
- BupSchema ->
+ BupSchema ->
schema_transaction(fun() -> do_restore(R, BupSchema) end)
end;
{'EXIT', Reason} ->
@@ -2556,8 +2592,8 @@ check_restore_arg({keep_tables, List}, R) when is_list(List) ->
check_restore_arg({skip_tables, List}, R) when is_list(List) ->
TableList = [{Tab, skip_tables} || Tab <- List],
R#r{table_options = R#r.table_options ++ TableList};
-check_restore_arg({default_op, Op}, R) ->
- case Op of
+check_restore_arg({default_op, Op}, R) ->
+ case Op of
clear_tables -> ok;
recreate_tables -> ok;
keep_tables -> ok;
@@ -2588,12 +2624,12 @@ restore_items([Rec | Recs], Header, Schema, R) ->
case lists:keysearch(Tab, 1, R#r.tables) of
{value, {Tab, Where0, Snmp, RecName}} ->
Where = case Where0 of
- undefined ->
+ undefined ->
val({Tab, where_to_commit});
_ ->
Where0
end,
- {Rest, NRecs} = restore_tab_items([Rec | Recs], Tab,
+ {Rest, NRecs} = restore_tab_items([Rec | Recs], Tab,
RecName, Where, Snmp,
R#r.recs, R#r.insert_op),
restore_items(Rest, Header, Schema, R#r{recs = NRecs});
@@ -2601,12 +2637,12 @@ restore_items([Rec | Recs], Header, Schema, R) ->
Rest = skip_tab_items(Recs, Tab),
restore_items(Rest, Header, Schema, R)
end;
-
+
restore_items([], _Header, _Schema, R) ->
R.
restore_func(Tab, R) ->
- case lists:keysearch(Tab, 1, R#r.table_options) of
+ case lists:keysearch(Tab, 1, R#r.table_options) of
{value, {Tab, OP}} ->
OP;
false ->
@@ -2618,24 +2654,24 @@ where_to_commit(Tab, CsList) ->
Disc = [{N, disc_copies} || N <- pick(Tab, disc_copies, CsList, [])],
DiscO = [{N, disc_only_copies} || N <- pick(Tab, disc_only_copies, CsList, [])],
Ram ++ Disc ++ DiscO.
-
+
%% Changes of the Meta info of schema itself is not allowed
restore_schema([{schema, schema, _List} | Schema], R) ->
restore_schema(Schema, R);
restore_schema([{schema, Tab, List} | Schema], R) ->
case restore_func(Tab, R) of
- clear_tables ->
+ clear_tables ->
do_clear_table(Tab),
- Snmp = val({Tab, snmp}),
- RecName = val({Tab, record_name}),
+ Snmp = val({Tab, snmp}),
+ RecName = val({Tab, record_name}),
R2 = R#r{tables = [{Tab, undefined, Snmp, RecName} | R#r.tables]},
restore_schema(Schema, R2);
- recreate_tables ->
+ recreate_tables ->
case ?catch_val({Tab, cstruct}) of
- {'EXIT', _} ->
+ {'EXIT', _} ->
TidTs = {_Mod, Tid, Ts} = get(mnesia_activity_state),
RunningNodes = val({current, db_nodes}),
- Nodes = mnesia_lib:intersect(mnesia_lib:cs_to_nodes(list2cs(List)),
+ Nodes = mnesia_lib:intersect(mnesia_lib:cs_to_nodes(list2cs(List)),
RunningNodes),
mnesia_locker:wlock_no_exist(Tid, Ts#tidstore.store, Tab, Nodes),
TidTs;
@@ -2643,20 +2679,20 @@ restore_schema([{schema, Tab, List} | Schema], R) ->
TidTs = get_tid_ts_and_lock(Tab, write)
end,
NC = {cookie, ?unique_cookie},
- List2 = lists:keyreplace(cookie, 1, List, NC),
+ List2 = lists:keyreplace(cookie, 1, List, NC),
Where = where_to_commit(Tab, List2),
Snmp = pick(Tab, snmp, List2, []),
RecName = pick(Tab, record_name, List2, Tab),
insert_schema_ops(TidTs, [{op, restore_recreate, List2}]),
R2 = R#r{tables = [{Tab, Where, Snmp, RecName} | R#r.tables]},
restore_schema(Schema, R2);
- keep_tables ->
+ keep_tables ->
get_tid_ts_and_lock(Tab, write),
Snmp = val({Tab, snmp}),
- RecName = val({Tab, record_name}),
+ RecName = val({Tab, record_name}),
R2 = R#r{tables = [{Tab, undefined, Snmp, RecName} | R#r.tables]},
restore_schema(Schema, R2);
- skip_tables ->
+ skip_tables ->
restore_schema(Schema, R)
end;
@@ -2667,7 +2703,7 @@ restore_schema([{schema, Tab} | Schema], R) ->
restore_schema([], R) ->
R.
-restore_tab_items([Rec | Rest], Tab, RecName, Where, Snmp, Recs, Op)
+restore_tab_items([Rec | Rest], Tab, RecName, Where, Snmp, Recs, Op)
when element(1, Rec) == Tab ->
NewRecs = Op(Rec, Recs, RecName, Where, Snmp),
restore_tab_items(Rest, Tab, RecName, Where, Snmp, NewRecs, Op);
@@ -2675,7 +2711,7 @@ restore_tab_items([Rec | Rest], Tab, RecName, Where, Snmp, Recs, Op)
restore_tab_items(Rest, _Tab, _RecName, _Where, _Snmp, Recs, _Op) ->
{Rest, Recs}.
-skip_tab_items([Rec| Rest], Tab)
+skip_tab_items([Rec| Rest], Tab)
when element(1, Rec) == Tab ->
skip_tab_items(Rest, Tab);
skip_tab_items(Recs, _) ->
@@ -2710,7 +2746,6 @@ merge_schema() ->
merge_schema(UserFun) ->
schema_transaction(fun() -> UserFun(fun(Arg) -> do_merge_schema(Arg) end) end).
-
do_merge_schema(LockTabs0) ->
{_Mod, Tid, Ts} = get_tid_ts_and_lock(schema, write),
LockTabs = [{T, tab_to_nodes(T)} || T <- LockTabs0],
@@ -2732,14 +2767,14 @@ do_merge_schema(LockTabs0) ->
[mnesia_locker:wlock_no_exist(
Tid, Store, T, mnesia_lib:intersect(Ns, OtherNodes))
|| {T,Ns} <- LockTabs],
- case rpc:call(Node, mnesia_controller, get_cstructs, []) of
+ case fetch_cstructs(Node) of
{cstructs, Cstructs, RemoteRunning1} ->
LockedAlready = Running ++ [Node],
{New, Old} = mnesia_recover:connect_nodes(RemoteRunning1),
RemoteRunning = mnesia_lib:intersect(New ++ Old, RemoteRunning1),
- if
+ if
RemoteRunning /= RemoteRunning1 ->
- mnesia_lib:error("Mnesia on ~p could not connect to node(s) ~p~n",
+ mnesia_lib:error("Mnesia on ~p could not connect to node(s) ~p~n",
[node(), RemoteRunning1 -- RemoteRunning]),
mnesia:abort({node_not_running, RemoteRunning1 -- RemoteRunning});
true -> ok
@@ -2749,24 +2784,24 @@ do_merge_schema(LockTabs0) ->
[mnesia_locker:wlock_no_exist(Tid, Store, T,
mnesia_lib:intersect(Ns,NeedsLock))
|| {T,Ns} <- LockTabs],
- {value, SchemaCs} =
- lists:keysearch(schema, #cstruct.name, Cstructs),
+ NeedsConversion = need_old_cstructs(NeedsLock ++ LockedAlready),
+ {value, SchemaCs} = lists:keysearch(schema, #cstruct.name, Cstructs),
+ SchemaDef = cs2list(NeedsConversion, SchemaCs),
%% Announce that Node is running
- A = [{op, announce_im_running, node(),
- cs2list(SchemaCs), Running, RemoteRunning}],
+ A = [{op, announce_im_running, node(), SchemaDef, Running, RemoteRunning}],
do_insert_schema_ops(Store, A),
-
+
%% Introduce remote tables to local node
- do_insert_schema_ops(Store, make_merge_schema(Node, Cstructs)),
-
+ do_insert_schema_ops(Store, make_merge_schema(Node, NeedsConversion, Cstructs)),
+
%% Introduce local tables to remote nodes
Tabs = val({schema, tables}),
Ops = [{op, merge_schema, get_create_list(T)}
|| T <- Tabs,
not lists:keymember(T, #cstruct.name, Cstructs)],
do_insert_schema_ops(Store, Ops),
-
+
%% Ensure that the txn will be committed on all nodes
NewNodes = RemoteRunning -- Running,
mnesia_lib:set(prepare_op, {announce_im_running,NewNodes}),
@@ -2782,19 +2817,49 @@ do_merge_schema(LockTabs0) ->
not_merged
end.
+fetch_cstructs(Node) ->
+ case mnesia_monitor:needs_protocol_conversion(Node) of
+ true ->
+ case rpc:call(Node, mnesia_controller, get_cstructs, []) of
+ {cstructs, Cs0, RR} ->
+ {cstructs, [list2cs(cs2list(Cs)) || Cs <- Cs0], RR};
+ Err -> Err
+ end;
+ false ->
+ rpc:call(Node, mnesia_controller, get_remote_cstructs, [])
+ end.
+
+need_old_cstructs(Nodes) ->
+ Filter = fun(Node) -> not mnesia_monitor:needs_protocol_conversion(Node) end,
+ case lists:dropwhile(Filter, Nodes) of
+ [] -> false;
+ [Node|_] ->
+ case rpc:call(Node, mnesia_lib, val, [{schema,cstruct}]) of
+ #cstruct{} ->
+ %% mnesia_lib:warning("Mnesia on ~p do not need to convert cstruct (~p)~n",
+ %% [node(), Node]),
+ false;
+ {badrpc, _} ->
+ need_old_cstructs(lists:delete(Node,Nodes));
+ Cs when element(1, Cs) == cstruct, tuple_size(Cs) == 17 ->
+ ver4_4_18; % Without majority
+ Cs when element(1, Cs) == cstruct, tuple_size(Cs) == 18 ->
+ ver4_4_19 % With majority
+ end
+ end.
+
tab_to_nodes(Tab) when is_atom(Tab) ->
Cs = val({Tab, cstruct}),
mnesia_lib:cs_to_nodes(Cs).
-make_merge_schema(Node, [Cs | Cstructs]) ->
- Ops = do_make_merge_schema(Node, Cs),
- Ops ++ make_merge_schema(Node, Cstructs);
-make_merge_schema(_Node, []) ->
+make_merge_schema(Node, NeedsConv, [Cs | Cstructs]) ->
+ Ops = do_make_merge_schema(Node, NeedsConv, Cs),
+ Ops ++ make_merge_schema(Node, NeedsConv, Cstructs);
+make_merge_schema(_Node, _, []) ->
[].
%% Merge definitions of schema table
-do_make_merge_schema(Node, RemoteCs)
- when RemoteCs#cstruct.name == schema ->
+do_make_merge_schema(Node, NeedsConv, RemoteCs = #cstruct{name = schema}) ->
Cs = val({schema, cstruct}),
Masters = mnesia_recover:get_master_nodes(schema),
HasRemoteMaster = lists:member(Node, Masters),
@@ -2804,15 +2869,15 @@ do_make_merge_schema(Node, RemoteCs)
StCsLocal = mnesia_lib:cs_to_storage_type(node(), Cs),
StRcsLocal = mnesia_lib:cs_to_storage_type(node(), RemoteCs),
StCsRemote = mnesia_lib:cs_to_storage_type(Node, Cs),
- StRcsRemote = mnesia_lib:cs_to_storage_type(Node, RemoteCs),
-
+ StRcsRemote = mnesia_lib:cs_to_storage_type(Node, RemoteCs),
+
if
Cs#cstruct.cookie == RemoteCs#cstruct.cookie,
Cs#cstruct.version == RemoteCs#cstruct.version ->
%% Great, we have the same cookie and version
%% and do not need to merge cstructs
[];
-
+
Cs#cstruct.cookie /= RemoteCs#cstruct.cookie,
Cs#cstruct.disc_copies /= [],
RemoteCs#cstruct.disc_copies /= [] ->
@@ -2823,14 +2888,14 @@ do_make_merge_schema(Node, RemoteCs)
HasRemoteMaster == false ->
%% Choose local cstruct,
%% since it's the master
- [{op, merge_schema, cs2list(Cs)}];
+ [{op, merge_schema, cs2list(NeedsConv, Cs)}];
HasRemoteMaster == true,
HasLocalMaster == false ->
%% Choose remote cstruct,
%% since it's the master
- [{op, merge_schema, cs2list(RemoteCs)}];
-
+ [{op, merge_schema, cs2list(NeedsConv, RemoteCs)}];
+
true ->
Str = io_lib:format("Incompatible schema cookies. "
"Please, restart from old backup."
@@ -2838,12 +2903,12 @@ do_make_merge_schema(Node, RemoteCs)
[Node, cs2list(RemoteCs), node(), cs2list(Cs)]),
throw(Str)
end;
-
+
StCsLocal /= StRcsLocal, StRcsLocal /= unknown, StCsLocal /= ram_copies ->
Str = io_lib:format("Incompatible schema storage types (local). "
"on ~w storage ~w, on ~w storage ~w~n",
[node(), StCsLocal, Node, StRcsLocal]),
- throw(Str);
+ throw(Str);
StCsRemote /= StRcsRemote, StCsRemote /= unknown, StRcsRemote /= ram_copies ->
Str = io_lib:format("Incompatible schema storage types (remote). "
"on ~w cs ~w, on ~w rcs ~w~n",
@@ -2854,27 +2919,27 @@ do_make_merge_schema(Node, RemoteCs)
%% Choose local cstruct,
%% since it involves disc nodes
MergedCs = merge_cstructs(Cs, RemoteCs, Force),
- [{op, merge_schema, cs2list(MergedCs)}];
-
+ [{op, merge_schema, cs2list(NeedsConv, MergedCs)}];
+
RemoteCs#cstruct.disc_copies /= [] ->
%% Choose remote cstruct,
%% since it involves disc nodes
MergedCs = merge_cstructs(RemoteCs, Cs, Force),
- [{op, merge_schema, cs2list(MergedCs)}];
+ [{op, merge_schema, cs2list(NeedsConv, MergedCs)}];
Cs > RemoteCs ->
%% Choose remote cstruct
MergedCs = merge_cstructs(RemoteCs, Cs, Force),
- [{op, merge_schema, cs2list(MergedCs)}];
-
+ [{op, merge_schema, cs2list(NeedsConv, MergedCs)}];
+
true ->
%% Choose local cstruct
MergedCs = merge_cstructs(Cs, RemoteCs, Force),
- [{op, merge_schema, cs2list(MergedCs)}]
+ [{op, merge_schema, cs2list(NeedsConv, MergedCs)}]
end;
%% Merge definitions of normal table
-do_make_merge_schema(Node, RemoteCs) ->
+do_make_merge_schema(Node, NeedsConv, RemoteCs = #cstruct{}) ->
Tab = RemoteCs#cstruct.name,
Masters = mnesia_recover:get_master_nodes(schema),
HasRemoteMaster = lists:member(Node, Masters),
@@ -2883,27 +2948,27 @@ do_make_merge_schema(Node, RemoteCs) ->
case ?catch_val({Tab, cstruct}) of
{'EXIT', _} ->
%% A completely new table, created while Node was down
- [{op, merge_schema, cs2list(RemoteCs)}];
+ [{op, merge_schema, cs2list(NeedsConv, RemoteCs)}];
Cs when Cs#cstruct.cookie == RemoteCs#cstruct.cookie ->
if
Cs#cstruct.version == RemoteCs#cstruct.version ->
%% We have exactly the same version of the
%% table def
[];
-
+
Cs#cstruct.version > RemoteCs#cstruct.version ->
%% Oops, we have different versions
%% of the table def, lets merge them.
%% The only changes that may have occurred
%% is that new replicas may have been added.
MergedCs = merge_cstructs(Cs, RemoteCs, Force),
- [{op, merge_schema, cs2list(MergedCs)}];
-
+ [{op, merge_schema, cs2list(NeedsConv, MergedCs)}];
+
Cs#cstruct.version < RemoteCs#cstruct.version ->
%% Oops, we have different versions
%% of the table def, lets merge them
MergedCs = merge_cstructs(RemoteCs, Cs, Force),
- [{op, merge_schema, cs2list(MergedCs)}]
+ [{op, merge_schema, cs2list(NeedsConv, MergedCs)}]
end;
Cs ->
%% Different cookies, not possible to merge
@@ -2912,14 +2977,14 @@ do_make_merge_schema(Node, RemoteCs) ->
HasRemoteMaster == false ->
%% Choose local cstruct,
%% since it's the master
- [{op, merge_schema, cs2list(Cs)}];
+ [{op, merge_schema, cs2list(NeedsConv, Cs)}];
HasRemoteMaster == true,
HasLocalMaster == false ->
%% Choose remote cstruct,
%% since it's the master
- [{op, merge_schema, cs2list(RemoteCs)}];
-
+ [{op, merge_schema, cs2list(NeedsConv, RemoteCs)}];
+
true ->
Str = io_lib:format("Bad cookie in table definition"
" ~w: ~w = ~w, ~w = ~w~n",
@@ -2989,7 +3054,7 @@ compare_storage_type(true, One, Another) ->
compare_storage_type(false, Another, One);
compare_storage_type(false, _One, _Another) ->
incompatible.
-
+
change_storage_type(N, ram_copies, Cs) ->
Nodes = [N | Cs#cstruct.ram_copies],
Cs#cstruct{ram_copies = mnesia_lib:uniq(Nodes)};
@@ -3071,14 +3136,14 @@ verify_merge(RemoteCs) ->
if
StCsLocal == StRcsLocal -> ok;
StCsLocal == unknown -> ok;
- (StRcsLocal == unknown), (HasRemoteMaster == false) ->
+ (StRcsLocal == unknown), (HasRemoteMaster == false) ->
{merge_error, Cs, RemoteCs};
%% Trust the merger
true -> ok
end
end.
-announce_im_running([N | Ns], SchemaCs) ->
+announce_im_running([N | Ns], SchemaCs) ->
{L1, L2} = mnesia_recover:connect_nodes([N]),
case lists:member(N, L1) or lists:member(N, L2) of
true ->
@@ -3095,7 +3160,7 @@ announce_im_running([], _) ->
unannounce_im_running([N | Ns]) ->
mnesia_lib:del({current, db_nodes}, N),
- mnesia_controller:del_active_replica(schema, N),
+ mnesia_controller:del_active_replica(schema, N),
unannounce_im_running(Ns);
unannounce_im_running([]) ->
ok.
diff --git a/lib/observer/src/Makefile b/lib/observer/src/Makefile
index 2d06cb6bc4..3875b62101 100644
--- a/lib/observer/src/Makefile
+++ b/lib/observer/src/Makefile
@@ -56,13 +56,16 @@ TARGET_FILES= $(MODULES:%=$(EBIN)/%.$(EMULATOR)) $(APP_TARGET) $(APPUP_TARGET)
PRIVDIR= ../priv
WEBTOOLFILES= $(PRIVDIR)/crashdump_viewer.tool
BINDIR= $(PRIVDIR)/bin
+ifeq ($(findstring win32,$(TARGET)),win32)
+WIN32_EXECUTABLES= $(BINDIR)/etop.bat $(BINDIR)/getop.bat $(BINDIR)/cdv.bat
+else
+WIN32_EXECUTABLES=
+endif
EXECUTABLES= \
$(BINDIR)/etop \
$(BINDIR)/getop \
$(BINDIR)/cdv \
- $(BINDIR)/etop.bat \
- $(BINDIR)/getop.bat \
- $(BINDIR)/cdv.bat
+ $(WIN32_EXECUTABLES)
CDVDIR= $(PRIVDIR)/crashdump_viewer
GIF_FILES= \
$(CDVDIR)/collapsd.gif \
diff --git a/lib/odbc/c_src/odbcserver.c b/lib/odbc/c_src/odbcserver.c
index d61ce940c3..ab2d7fe210 100644
--- a/lib/odbc/c_src/odbcserver.c
+++ b/lib/odbc/c_src/odbcserver.c
@@ -90,7 +90,7 @@
Datatype - USER_INT | USER_SMALL_INT | {USER_DECIMAL, Precision, Scale} |
{USER_NMERIC, Precision, Scale} | {USER_CHAR, Max} | {USER_VARCHAR, Max} |
{USER_WVARCHAR, Max} | {USER_FLOAT, Precision} | USER_REAL | USER_DOUBLE |
- USER_TIMESTAMP
+ USER_TIMESTAMP | {USER_WLONGVARCHAR, Max}
Scale - integer
Precision - integer
Max - integer
@@ -173,7 +173,7 @@ static db_result_msg encode_row_count(SQLINTEGER num_of_rows,
db_state *state);
static void encode_column_dyn(db_column column, int column_nr,
db_state *state);
-static void encode_data_type(SQLINTEGER sql_type, SQLINTEGER size,
+static void encode_data_type(SQLSMALLINT sql_type, SQLINTEGER size,
SQLSMALLINT decimal_digits, db_state *state);
static Boolean decode_params(db_state *state, byte *buffer, int *index, param_array **params,
int i, int j);
@@ -221,7 +221,7 @@ static void init_param_column(param_array *params, byte *buffer, int *index,
int num_param_values, db_state* state);
static void init_param_statement(int cols,
- int num_param_values,
+ SQLLEN num_param_values,
db_state *state,
param_status *status);
@@ -435,7 +435,7 @@ static db_result_msg db_connect(byte *args, db_state *state)
diagnos diagnos;
byte *connStrIn;
int erl_auto_commit_mode, erl_trace_driver,
- use_srollable_cursors, tuple_row_state, binary_strings;
+ use_srollable_cursors, tuple_row_state, binary_strings;
erl_auto_commit_mode = args[0];
erl_trace_driver = args[1];
@@ -757,8 +757,9 @@ static db_result_msg db_select(byte *args, db_state *state)
static db_result_msg db_param_query(byte *buffer, db_state *state)
{
byte *sql;
- db_result_msg msg;
- int i, num_param_values, ver = 0,
+ db_result_msg msg;
+ SQLLEN num_param_values;
+ int i, ver = 0,
erl_type = 0, index = 0, size = 0, cols = 0;
long long_num_param_values;
param_status param_status;
@@ -771,6 +772,7 @@ static db_result_msg db_param_query(byte *buffer, db_state *state)
}
associated_result_set(state) = FALSE;
param_query(state) = TRUE;
+ out_params(state) = FALSE;
msg = encode_empty_message();
@@ -785,7 +787,7 @@ static db_result_msg db_param_query(byte *buffer, db_state *state)
ei_decode_long(buffer, &index, &long_num_param_values);
- num_param_values = (int)long_num_param_values;
+ num_param_values = (SQLLEN)long_num_param_values;
ei_decode_list_header(buffer, &index, &cols);
@@ -1002,12 +1004,16 @@ static db_result_msg encode_result(db_state *state)
db_result_msg msg;
int elements, update, num_of_rows = 0;
char *atom;
+ diagnos diagnos;
msg = encode_empty_message();
if(!sql_success(SQLNumResultCols(statement_handle(state),
&num_of_columns))) {
- DO_EXIT(EXIT_COLS);
+ diagnos = get_diagnos(SQL_HANDLE_STMT, statement_handle(state));
+ msg = encode_error_message(diagnos.error_msg);
+ clean_state(state);
+ return msg;
}
if (num_of_columns == 0) {
@@ -1021,7 +1027,10 @@ static db_result_msg encode_result(db_state *state)
}
if(!sql_success(SQLRowCount(statement_handle(state), &RowCountPtr))) {
- DO_EXIT(EXIT_ROWS);
+ diagnos = get_diagnos(SQL_HANDLE_STMT, statement_handle(state));
+ msg = encode_error_message(diagnos.error_msg);
+ clean_state(state);
+ return msg;
}
if(param_query(state) && update) {
@@ -1220,7 +1229,7 @@ static db_result_msg encode_column_name_list(SQLSMALLINT num_of_columns,
&nullable)))
DO_EXIT(EXIT_DESC);
- if(sql_type == SQL_LONGVARCHAR || sql_type == SQL_LONGVARBINARY)
+ if(sql_type == SQL_LONGVARCHAR || sql_type == SQL_LONGVARBINARY || sql_type == SQL_WLONGVARCHAR)
size = MAXCOLSIZE;
(columns(state)[i]).type.decimal_digits = dec_digits;
@@ -1452,7 +1461,7 @@ static void encode_column_dyn(db_column column, int column_nr,
}
}
-static void encode_data_type(SQLINTEGER sql_type, SQLINTEGER size,
+static void encode_data_type(SQLSMALLINT sql_type, SQLINTEGER size,
SQLSMALLINT decimal_digits, db_state *state)
{
switch(sql_type) {
@@ -1529,6 +1538,11 @@ static void encode_data_type(SQLINTEGER sql_type, SQLINTEGER size,
case SQL_LONGVARCHAR:
ei_x_encode_atom(&dynamic_buffer(state), "SQL_LONGVARCHAR");
break;
+ case SQL_WLONGVARCHAR:
+ ei_x_encode_tuple_header(&dynamic_buffer(state), 2);
+ ei_x_encode_atom(&dynamic_buffer(state), "sql_wlongvarchar");
+ ei_x_encode_long(&dynamic_buffer(state), size);
+ break;
case SQL_VARBINARY:
ei_x_encode_atom(&dynamic_buffer(state), "SQL_VARBINARY");
break;
@@ -2007,7 +2021,7 @@ static void init_driver(int erl_auto_commit_mode, int erl_trace_driver,
db_state *state)
{
- int auto_commit_mode, trace_driver;
+ SQLLEN auto_commit_mode, trace_driver;
if(erl_auto_commit_mode == ON) {
auto_commit_mode = SQL_AUTOCOMMIT_ON;
@@ -2057,7 +2071,7 @@ static void init_param_column(param_array *params, byte *buffer, int *index,
ei_decode_long(buffer, index, &user_type);
- params->type.strlen_or_indptr = (SQLINTEGER)NULL;
+ params->type.strlen_or_indptr = (SQLLEN)NULL;
params->type.strlen_or_indptr_array = NULL;
params->type.decimal_digits = (SQLINTEGER)0;
@@ -2131,10 +2145,14 @@ static void init_param_column(param_array *params, byte *buffer, int *index,
break;
case USER_WCHAR:
case USER_WVARCHAR:
- if(user_type == USER_WCHAR) {
- params->type.sql = SQL_WCHAR;
- } else {
- params->type.sql = SQL_WVARCHAR;
+ case USER_WLONGVARCHAR:
+ switch (user_type) {
+ case USER_WCHAR:
+ params->type.sql = SQL_WCHAR; break;
+ case USER_WVARCHAR:
+ params->type.sql = SQL_WVARCHAR; break;
+ default:
+ params->type.sql = SQL_WLONGVARCHAR; break;
}
ei_decode_long(buffer, index, &length);
/* Max string length + string terminator */
@@ -2206,7 +2224,7 @@ static void init_param_column(param_array *params, byte *buffer, int *index,
}
-static void init_param_statement(int cols, int num_param_values,
+static void init_param_statement(int cols, SQLLEN num_param_values,
db_state *state, param_status *status)
{
int i;
@@ -2234,11 +2252,11 @@ static void init_param_statement(int cols, int num_param_values,
DO_EXIT(EXIT_PARAM_ARRAY);
}
- /* Note the (int *) cast is correct as the API function SQLSetStmtAttr
+ /* Note the (SQLLEN *) cast is correct as the API function SQLSetStmtAttr
takes either an interger or a pointer depending on the attribute */
if(!sql_success(SQLSetStmtAttr(statement_handle(state),
SQL_ATTR_PARAMSET_SIZE,
- (int *)num_param_values,
+ (SQLLEN *)num_param_values,
0))) {
DO_EXIT(EXIT_PARAM_ARRAY);
}
@@ -2300,6 +2318,7 @@ static db_result_msg map_sql_2_c_column(db_column* column)
break;
case SQL_WCHAR:
case SQL_WVARCHAR:
+ case SQL_WLONGVARCHAR:
column -> type.len = (column -> type.col_size + 1)*sizeof(SQLWCHAR);
column -> type.c = SQL_C_WCHAR;
column -> type.strlen_or_indptr = SQL_NTS;
@@ -2308,21 +2327,21 @@ static db_result_msg map_sql_2_c_column(db_column* column)
case SQL_DECIMAL:
map_dec_num_2_c_column(&(column -> type), column -> type.col_size,
column -> type.decimal_digits);
- column -> type.strlen_or_indptr = (SQLINTEGER)NULL;
+ column -> type.strlen_or_indptr = (SQLLEN)NULL;
break;
case SQL_TINYINT:
case SQL_INTEGER:
case SQL_SMALLINT:
column -> type.len = sizeof(SQLINTEGER);
column -> type.c = SQL_C_SLONG;
- column -> type.strlen_or_indptr = (SQLINTEGER)NULL;
+ column -> type.strlen_or_indptr = (SQLLEN)NULL;
break;
case SQL_REAL:
case SQL_FLOAT:
case SQL_DOUBLE:
column -> type.len = sizeof(double);
column -> type.c = SQL_C_DOUBLE;
- column -> type.strlen_or_indptr = (SQLINTEGER)NULL;
+ column -> type.strlen_or_indptr = (SQLLEN)NULL;
break;
case SQL_TYPE_DATE:
case SQL_TYPE_TIME:
@@ -2334,17 +2353,17 @@ static db_result_msg map_sql_2_c_column(db_column* column)
case SQL_TYPE_TIMESTAMP:
column -> type.len = sizeof(TIMESTAMP_STRUCT);
column -> type.c = SQL_C_TYPE_TIMESTAMP;
- column -> type.strlen_or_indptr = (SQLINTEGER)NULL;
+ column -> type.strlen_or_indptr = (SQLLEN)NULL;
break;
case SQL_BIGINT:
column -> type.len = DEC_NUM_LENGTH;
column -> type.c = SQL_C_CHAR;
- column -> type.strlen_or_indptr = (SQLINTEGER)NULL;
+ column -> type.strlen_or_indptr = (SQLLEN)NULL;
break;
case SQL_BIT:
column -> type.len = sizeof(byte);
column -> type.c = SQL_C_BIT;
- column -> type.strlen_or_indptr = (SQLINTEGER)NULL;
+ column -> type.strlen_or_indptr = (SQLLEN)NULL;
break;
case SQL_UNKNOWN_TYPE:
msg = encode_error_message("Unknown column type");
diff --git a/lib/odbc/c_src/odbcserver.h b/lib/odbc/c_src/odbcserver.h
index 3e2b22ab7d..314fbf32c6 100644
--- a/lib/odbc/c_src/odbcserver.h
+++ b/lib/odbc/c_src/odbcserver.h
@@ -115,6 +115,7 @@
#define USER_WCHAR 12
#define USER_WVARCHAR 13
#define USER_TIMESTAMP 14
+#define USER_WLONGVARCHAR 15
/*------------------------ TYPDEFS ----------------------------------*/
diff --git a/lib/odbc/doc/src/databases.xml b/lib/odbc/doc/src/databases.xml
index a6ba0e5245..09f5a5af5b 100644
--- a/lib/odbc/doc/src/databases.xml
+++ b/lib/odbc/doc/src/databases.xml
@@ -205,6 +205,10 @@ when p >= 16 </cell>
<cell align="left" valign="middle">String | Binary (configurable)</cell>
</row>
<row>
+ <cell align="left" valign="middle">SQL_WLONGVARCHAR(size) </cell>
+ <cell align="left" valign="middle">Unicode binary encoded as UTF16 little endian.</cell>
+ </row>
+ <row>
<cell align="left" valign="middle">SQL_BINARY</cell>
<cell align="left" valign="middle">String | Binary (configurable)</cell>
</row>
diff --git a/lib/odbc/doc/src/odbc.xml b/lib/odbc/doc/src/odbc.xml
index 70d8cfbe22..11ca97f743 100644
--- a/lib/odbc/doc/src/odbc.xml
+++ b/lib/odbc/doc/src/odbc.xml
@@ -102,7 +102,7 @@
{sql_decimal, precision(), scale()} |
{sql_numeric, precision(), scale()} |
{sql_char, size()} | {sql_wchar, size()} | {sql_varchar, size()} | {sql_wvarchar, size()}| {sql_float, precision()} |
- {sql_float, precision()} | sql_real | sql_double | sql_bit | atom()
+ {sql_wlongvarchar, size()} | {sql_float, precision()} | sql_real | sql_double | sql_bit | atom()
</code>
<code type="none">
precision() = integer() </code>
diff --git a/lib/odbc/src/odbc.appup.src b/lib/odbc/src/odbc.appup.src
index 2a6667ccd3..f3a3af8c29 100644
--- a/lib/odbc/src/odbc.appup.src
+++ b/lib/odbc/src/odbc.appup.src
@@ -1,8 +1,10 @@
%% -*- erlang -*-
{"%VSN%",
[
- {"2.10.9", [{restart_application, ssl}]}
+ {"2.10.10", [{restart_application, odbc}]},
+ {"2.10.9", [{restart_application, odbc}]}
],
[
- {"2.10.9", [{restart_application, ssl}]}
+ {"2.10.10", [{restart_application, odbc}]},
+ {"2.10.9", [{restart_application, odbc}]}
]}.
diff --git a/lib/odbc/src/odbc.erl b/lib/odbc/src/odbc.erl
index 83d9f33102..68497292db 100644
--- a/lib/odbc/src/odbc.erl
+++ b/lib/odbc/src/odbc.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1999-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1999-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -431,7 +431,7 @@ init(Args) ->
erlang:monitor(process, ClientPid),
- Inet = case gen_tcp:listen(0, [inet6]) of
+ Inet = case gen_tcp:listen(0, [inet6, {ip, loopback}]) of
{ok, Dummyport} ->
gen_tcp:close(Dummyport),
inet6;
@@ -925,6 +925,9 @@ fix_params({{sql_wchar, Max}, InOut, Values}) ->
fix_params({{sql_wvarchar, Max}, InOut, Values}) ->
NewValues = string_terminate(Values),
{?USER_WVARCHAR, Max, fix_inout(InOut), NewValues};
+fix_params({{sql_wlongvarchar, Max}, InOut, Values}) ->
+ NewValues = string_terminate(Values),
+ {?USER_WLONGVARCHAR, Max, fix_inout(InOut), NewValues};
fix_params({{sql_float, Precision}, InOut, Values}) ->
{?USER_FLOAT, Precision, fix_inout(InOut), Values};
fix_params({sql_real, InOut, Values}) ->
diff --git a/lib/odbc/src/odbc_internal.hrl b/lib/odbc/src/odbc_internal.hrl
index aa60120f9a..c0e7d9657b 100644
--- a/lib/odbc/src/odbc_internal.hrl
+++ b/lib/odbc/src/odbc_internal.hrl
@@ -72,6 +72,7 @@
-define(USER_WCHAR, 12).
-define(USER_WVARCHAR, 13).
-define(USER_TIMESTAMP, 14).
+-define(USER_WLONGVARCHAR, 15).
%% INPUT & OUTPUT TYPE
-define(IN, 0).
diff --git a/lib/odbc/test/Makefile b/lib/odbc/test/Makefile
index ec2bcc67b5..bc6449242e 100644
--- a/lib/odbc/test/Makefile
+++ b/lib/odbc/test/Makefile
@@ -34,7 +34,8 @@ MODULES= \
odbc_test_lib \
oracle \
sqlserver \
- postgres
+ postgres \
+ mysql
EBIN = .
diff --git a/lib/odbc/test/mysql.erl b/lib/odbc/test/mysql.erl
new file mode 100644
index 0000000000..c990793213
--- /dev/null
+++ b/lib/odbc/test/mysql.erl
@@ -0,0 +1,277 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2011-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+%%
+
+-module(mysql).
+
+%% Note: This directive should only be used in test suites.
+-compile(export_all).
+
+%-------------------------------------------------------------------------
+connection_string() ->
+ case test_server:os_type() of
+ {unix, linux} ->
+ "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ {unix, sunos} ->
+ solaris_str();
+ {unix, darwin} ->
+ "DSN=MySQLMac;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
+
+solaris_str() ->
+ case erlang:system_info(system_architecture) of
+ "sparc" ++ _ ->
+ "DSN=MySQLSolaris10;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ "i386" ++ _ ->
+ "DSN=MySQLSolaris10i386;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
+
+%-------------------------------------------------------------------------
+insert_result() ->
+ {selected,["ID","DATA"],[{1,"bar"}]}.
+
+update_result() ->
+ {selected,["ID","DATA"],[{1,"foo"}]}.
+
+selected_ID(N, next) ->
+ {selected,["ID"],[{N}]};
+
+selected_ID(_, _) ->
+ {error, driver_does_not_support_function}.
+
+selected_next_N(1)->
+ {selected,["ID"],
+ [{1},
+ {2},
+ {3}]};
+
+selected_next_N(2)->
+ {selected,["ID"],
+ [{4},
+ {5}]}.
+
+selected_relative_N(_)->
+ {error, driver_does_not_support_function}.
+
+selected_absolute_N(_)->
+ {error, driver_does_not_support_function}.
+
+selected_list_rows() ->
+ {selected,["ID", "DATA"],[[1, "bar"],[2,"foo"]]}.
+
+first_list_rows() ->
+ {error, driver_does_not_support_function}.
+last_list_rows() ->
+ {error, driver_does_not_support_function}.
+prev_list_rows() ->
+ {error, driver_does_not_support_function}.
+next_list_rows() ->
+ {selected,["ID","DATA"],[[1,"bar"]]}.
+
+multiple_select()->
+ [{selected,["ID", "DATA"],[{1, "bar"},{2, "foo"}]},
+ {selected,["ID"],[{"foo"}]}].
+
+multiple_mix()->
+ [{updated, 1},{updated, 1},
+ {selected,["ID", "DATA"],[{1, "foobar"},{2, "foo"}]},
+ {updated, 1}, {selected,["DATA"],[{"foo"}]}].
+
+%-------------------------------------------------------------------------
+var_char_min() ->
+ 0.
+var_char_max() ->
+ 65535.
+
+create_var_char_table(Size) ->
+ " (FIELD varchar(" ++ integer_to_list(Size) ++ "))".
+
+%-------------------------------------------------------------------------
+text_min() ->
+ 1.
+text_max() ->
+ 2147483646. % 2147483647. %% 2^31 - 1
+
+create_text_table() ->
+ " (FIELD text)".
+
+%-------------------------------------------------------------------------
+create_timestamp_table() ->
+ " (FIELD TIMESTAMP)".
+
+%-------------------------------------------------------------------------
+tiny_int_min() ->
+ -128.
+tiny_int_max() ->
+ 127.
+
+create_tiny_int_table() ->
+ " (FIELD tinyint)".
+
+tiny_int_min_selected() ->
+ {selected,["FIELD"],[{tiny_int_min()}]}.
+
+tiny_int_max_selected() ->
+ {selected,["FIELD"], [{tiny_int_max()}]}.
+
+%-------------------------------------------------------------------------
+small_int_min() ->
+ -32768.
+small_int_max() ->
+ 32767.
+
+create_small_int_table() ->
+ " (FIELD smallint)".
+
+small_int_min_selected() ->
+ {selected,["FIELD"],[{-32768}]}.
+
+small_int_max_selected() ->
+ {selected,["FIELD"], [{32767}]}.
+
+%-------------------------------------------------------------------------
+int_min() ->
+ -2147483648.
+int_max() ->
+ 2147483647.
+
+create_int_table() ->
+ " (FIELD int)".
+
+int_min_selected() ->
+ {selected,["FIELD"],[{-2147483648}]}.
+
+int_max_selected() ->
+ {selected,["FIELD"], [{2147483647}]}.
+
+%-------------------------------------------------------------------------
+big_int_min() ->
+ -9223372036854775808.
+
+big_int_max() ->
+ 9223372036854775807.
+
+create_big_int_table() ->
+ " (FIELD bigint )".
+
+big_int_min_selected() ->
+ {selected,["FIELD"], [{"-9223372036854775808"}]}.
+
+big_int_max_selected() ->
+ {selected,["FIELD"], [{"9223372036854775807"}]}.
+
+%-------------------------------------------------------------------------
+bit_false() ->
+ 0.
+bit_true() ->
+ 1.
+
+create_bit_table() ->
+ " (FIELD bit)".
+
+bit_false_selected() ->
+ {selected,["FIELD"],[{"0"}]}.
+
+bit_true_selected() ->
+ {selected,["FIELD"], [{"1"}]}.
+
+%-------------------------------------------------------------------------
+
+%% Do not test float min/max as value is only theoretical defined in
+%% mysql and may vary depending on hardware.
+
+create_float_table() ->
+ " (FIELD float)".
+
+float_zero_selected() ->
+ {selected,["FIELD"],[{0.00000e+0}]}.
+
+%-------------------------------------------------------------------------
+real_min() ->
+ -3.40e+38.
+real_max() ->
+ 3.40e+38.
+
+real_underflow() ->
+ "-3.41e+38".
+
+real_overflow() ->
+ "3.41e+38".
+
+create_real_table() ->
+ " (FIELD real)".
+
+real_zero_selected() ->
+ {selected,["FIELD"],[{0.00000e+0}]}.
+
+%-------------------------------------------------------------------------
+param_select_small_int() ->
+ {selected,["FIELD"],[{1}, {2}]}.
+
+param_select_int() ->
+ Int = small_int_max() + 1,
+ {selected,["FIELD"],[{1}, {Int}]}.
+
+param_select_decimal() ->
+ {selected,["FIELD"],[{1},{2}]}.
+
+param_select_numeric() ->
+ {selected,["FIELD"],[{1},{2}]}.
+
+param_select_float() ->
+ {selected,["FIELD"],[{1.30000},{1.20000}]}.
+
+param_select_real() ->
+ {selected,["FIELD"],[{1.30000},{1.20000}]}.
+
+param_select_double() ->
+ {selected,["FIELD"],[{1.30000},{1.20000}]}.
+
+param_select_mix() ->
+ {selected,["ID","DATA"],[{1, "foo"}, {2, "bar"}]}.
+
+param_update() ->
+ {selected,["ID","DATA"],[{1, "foobar"}, {2, "foobar"}, {3, "baz"}]}.
+
+param_delete() ->
+ {selected,["ID","DATA"],[{3, "baz"}]}.
+
+param_select() ->
+ {selected,["ID","DATA"],[{1, "foo"},{3, "foo"}]}.
+
+%-------------------------------------------------------------------------
+describe_integer() ->
+ {ok,[{"myint1",sql_smallint},
+ {"myint2",sql_integer},
+ {"myint3",sql_integer}]}.
+
+describe_string() ->
+ {ok,[{"str1",{sql_char,10}},
+ {"str2",{sql_char,10}},
+ {"str3",{sql_varchar,10}},
+ {"str4",{sql_varchar,10}}]}.
+
+describe_floating() ->
+ {ok,[{"f",sql_real},{"r",sql_double},{"d",sql_double}]}.
+describe_dec_num() ->
+ {ok,[{"mydec",{sql_decimal,9,3}},{"mynum",{sql_decimal,9,2}}]}.
+
+describe_timestamp() ->
+ {ok, [{"FIELD", sql_timestamp}]}.
diff --git a/lib/odbc/test/odbc.dynspec b/lib/odbc/test/odbc.dynspec
deleted file mode 100644
index bb15edceed..0000000000
--- a/lib/odbc/test/odbc.dynspec
+++ /dev/null
@@ -1,31 +0,0 @@
-%% -*- erlang -*-
-%% You can test this file using this command.
-%% file:script("odbc.dynspec", [{'Os',"Unix"}]).
-
-Exists =
-fun() ->
- case code:lib_dir(odbc) of
- {error,bad_name} ->
- false;
- P ->
- %% Make sure that the odbc directory really
- %% contains the application (and not only documentation).
- case filelib:is_file(filename:join(P, "ebin/odbc.beam")) of
- false -> false;
- true ->
- %% We know that we don't have any odbc libraries
- %% installed on this computer.
- {ok,Host} = inet:gethostname(),
- Host =/= "netsim200"
- end
- end
-end,
-case Exists() of
- false ->
- NoOdbc = "No odbc application",
- [{skip, {odbc_connect_SUITE, NoOdbc}},
- {skip, {odbc_data_type_SUITE, NoOdbc}},
- {skip, {odbc_query_SUITE, NoOdbc}}];
- true ->
- []
-end.
diff --git a/lib/odbc/test/odbc.spec b/lib/odbc/test/odbc.spec
index edaf821c91..653f1a780e 100644
--- a/lib/odbc/test/odbc.spec
+++ b/lib/odbc/test/odbc.spec
@@ -1,25 +1 @@
{suites,"../odbc_test",all}.
-{skip_cases,"../odbc_test",odbc_data_type_SUITE,
- [varchar_upper_limit],
- "Known bug in database"}.
-{skip_cases,"../odbc_test",odbc_data_type_SUITE,
- [text_upper_limit],
- "Consumes too much resources"}.
-{skip_cases,"../odbc_test",odbc_data_type_SUITE,
- [bit_true],
- "Not supported by driver"}.
-{skip_cases,"../odbc_test",odbc_data_type_SUITE,
- [bit_false],
- "Not supported by driver"}.
-{skip_cases,"../odbc_test",odbc_query_SUITE,
- [multiple_select_result_sets],
- "Not supported by driver"}.
-{skip_cases,"../odbc_test",odbc_query_SUITE,
- [multiple_mix_result_sets],
- "Not supported by driver"}.
-{skip_cases,"../odbc_test",odbc_query_SUITE,
- [multiple_result_sets_error],
- "Not supported by driver"}.
-{skip_cases,"../odbc_test",odbc_query_SUITE,
- [param_insert_tiny_int],
- "Not supported by driver"}.
diff --git a/lib/odbc/test/odbc.spec.win b/lib/odbc/test/odbc.spec.win
deleted file mode 100644
index 1fd349d2c3..0000000000
--- a/lib/odbc/test/odbc.spec.win
+++ /dev/null
@@ -1,5 +0,0 @@
-{topcase, {dir, "../odbc_test"}}.
-{skip, {odbc_data_type_SUITE, big_int_lower_limit, "Not supported by sqlserver 7.0"}}.
-{skip, {odbc_data_type_SUITE, big_int_upper_limit, "Not supported by sqlserver7.0"}}.
-{skip, {odbc_data_type_SUITE, text_upper_limit, "Consumes too much resources"}}.
-
diff --git a/lib/odbc/test/odbc_connect_SUITE.erl b/lib/odbc/test/odbc_connect_SUITE.erl
index 6a2268f40e..a076c4dfff 100644
--- a/lib/odbc/test/odbc_connect_SUITE.erl
+++ b/lib/odbc/test/odbc_connect_SUITE.erl
@@ -76,16 +76,26 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- application:start(odbc),
- case catch odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]) of
- {ok, Ref} ->
- odbc:disconnect(Ref),
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC is not properly setup"}
- end.
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ case catch odbc:connect(?RDBMS:connection_string(),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
+ {ok, Ref} ->
+ odbc:disconnect(Ref),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config];
+ _ ->
+ {skip, "ODBC is not properly setup"}
+ end;
+ _ ->
+ {skip,"ODBC not startable"}
+ end
+ end.
+
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
@@ -93,8 +103,7 @@ init_per_suite(Config) ->
%% Description: Cleanup after the whole suite
%%--------------------------------------------------------------------
end_per_suite(_Config) ->
- application:stop(odbc),
- ok.
+ application:stop(odbc).
%%--------------------------------------------------------------------
%% Function: init_per_testcase(Case, Config) -> Config
@@ -124,15 +133,13 @@ init_per_testcase(_TestCase, Config) ->
%% Description: Cleanup after each test case
%%--------------------------------------------------------------------
end_per_testcase(_TestCase, Config) ->
- %% Clean up if needed
Table = ?config(tableName, Config),
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
- Result = odbc:sql_query(Ref, "DROP TABLE " ++ Table),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
+ Result = odbc:sql_query(Ref, "DROP TABLE " ++ Table),
io:format("Drop table: ~p ~p~n", [Table, Result]),
odbc:disconnect(Ref),
Dog = ?config(watchdog, Config),
- test_server:timetrap_cancel(Dog),
- ok.
+ test_server:timetrap_cancel(Dog).
%%-------------------------------------------------------------------------
%% Test cases starts here.
@@ -142,13 +149,15 @@ commit(doc)->
commit(suite) -> [];
commit(Config) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
+ TransStr = transaction_support_str(?RDBMS),
+
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (ID integer, DATA varchar(10))"),
+ " (ID integer, DATA varchar(10))" ++ TransStr),
{updated, 1} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(1,'bar')"),
@@ -173,50 +182,47 @@ commit(Config) ->
{'EXIT', {function_clause, _}} =
(catch odbc:commit(Ref, commit, -1)),
- ok = odbc:disconnect(Ref),
-
- ok.
+ ok = odbc:disconnect(Ref).
%%-------------------------------------------------------------------------
rollback(doc)->
["Test the use of explicit rollback"];
rollback(suite) -> [];
rollback(Config) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
- {updated, _} =
- odbc:sql_query(Ref,
+ TransStr = transaction_support_str(?RDBMS),
+
+ {updated, _} =
+ odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (ID integer, DATA varchar(10))"),
- {updated, 1} =
+ " (ID integer, DATA varchar(10))" ++ TransStr),
+ {updated, 1} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++ " VALUES(1,'bar')"),
ok = odbc:commit(Ref, commit),
- {updated, 1} =
+ {updated, 1} =
odbc:sql_query(Ref, "UPDATE " ++ Table ++
- " SET DATA = 'foo' WHERE ID = 1"),
+ " SET DATA = 'foo' WHERE ID = 1"),
ok = odbc:commit(Ref, rollback),
InsertResult = ?RDBMS:insert_result(),
- InsertResult =
+ InsertResult =
odbc:sql_query(Ref, "SELECT * FROM " ++ Table),
-
- {updated, 1} =
+ {updated, 1} =
odbc:sql_query(Ref, "UPDATE " ++ Table ++
- " SET DATA = 'foo' WHERE ID = 1"),
+ " SET DATA = 'foo' WHERE ID = 1"),
ok = odbc:commit(Ref, rollback, ?TIMEOUT),
InsertResult = ?RDBMS:insert_result(),
- InsertResult =
+ InsertResult =
odbc:sql_query(Ref, "SELECT * FROM " ++ Table),
+ {'EXIT', {function_clause, _}} =
+ (catch odbc:commit(Ref, rollback, -1)),
- {'EXIT', {function_clause, _}} =
- (catch odbc:commit(Ref, rollback, -1)),
-
- ok = odbc:disconnect(Ref),
- ok.
+ ok = odbc:disconnect(Ref).
%%-------------------------------------------------------------------------
not_explicit_commit(doc) ->
@@ -224,20 +230,20 @@ not_explicit_commit(doc) ->
not_explicit_commit(suite) -> [];
not_explicit_commit(_Config) ->
{ok, Ref} =
- odbc:connect(?RDBMS:connection_string(), [{auto_commit, on}]),
+ odbc:connect(?RDBMS:connection_string(), [{auto_commit, on}] ++
+ odbc_test_lib:platform_options()),
{error, _} = odbc:commit(Ref, commit),
- ok = odbc:disconnect(Ref),
- ok.
+ ok = odbc:disconnect(Ref).
%%-------------------------------------------------------------------------
not_exist_db(doc) ->
["Tests valid data format but invalid data in the connection parameters."];
not_exist_db(suite) -> [];
not_exist_db(_Config) ->
- {error, _} = odbc:connect("DSN=foo;UID=bar;PWD=foobar", []),
+ {error, _} = odbc:connect("DSN=foo;UID=bar;PWD=foobar",
+ odbc_test_lib:platform_options()),
%% So that the odbc control server can be stoped "in the correct way"
- test_server:sleep(100),
- ok.
+ test_server:sleep(100).
%%-------------------------------------------------------------------------
no_c_node(doc) ->
@@ -252,7 +258,8 @@ no_c_node(_Config) ->
FileName2 = filename:nativename(filename:join(Dir, "odbcsrv")),
ok = file:rename(FileName1, FileName2),
Result =
- case catch odbc:connect(?RDBMS:connection_string(), []) of
+ case catch odbc:connect(?RDBMS:connection_string(),
+ odbc_test_lib:platform_options()) of
{error, port_program_executable_not_found} ->
ok;
Else ->
@@ -267,7 +274,7 @@ port_dies(doc) ->
"Tests what happens if the port program dies";
port_dies(suite) -> [];
port_dies(_Config) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
{status, _} = process_info(Ref, status),
process_flag(trap_exit, true),
Port = lists:last(erlang:ports()),
@@ -275,26 +282,23 @@ port_dies(_Config) ->
%% Wait for exit_status from port 5000 ms (will not get a exit
%% status in this case), then wait a little longer to make sure
%% the port and the controlprocess has had time to terminate.
- test_server:sleep(7000),
- undefined = process_info(Ref, status),
- ok.
+ test_server:sleep(10000),
+ undefined = process_info(Ref, status).
%%-------------------------------------------------------------------------
control_process_dies(doc) ->
"Tests what happens if the Erlang control process dies";
control_process_dies(suite) -> [];
control_process_dies(_Config) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
process_flag(trap_exit, true),
Port = lists:last(erlang:ports()),
{connected, Ref} = erlang:port_info(Port, connected),
exit(Ref, kill),
- test_server:sleep(100),
- undefined = erlang:port_info(Port, connected),
+ test_server:sleep(500),
+ undefined = erlang:port_info(Port, connected).
%% Check for c-program still running, how?
- ok.
-%%-------------------------------------------------------------------------
%%-------------------------------------------------------------------------
client_dies_normal(doc) ->
@@ -319,7 +323,7 @@ client_dies_normal(Config) when is_list(Config) ->
end.
client_normal(Pid) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
Pid ! {dbRef, Ref},
receive
continue ->
@@ -351,7 +355,7 @@ client_dies_timeout(Config) when is_list(Config) ->
end.
client_timeout(Pid) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
Pid ! {dbRef, Ref},
receive
continue ->
@@ -383,7 +387,7 @@ client_dies_error(Config) when is_list(Config) ->
end.
client_error(Pid) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
Pid ! {dbRef, Ref},
receive
continue ->
@@ -398,7 +402,10 @@ connect_timeout(doc) ->
connect_timeout(suite) -> [];
connect_timeout(Config) when is_list(Config) ->
{'EXIT',timeout} = (catch odbc:connect(?RDBMS:connection_string(),
- [{timeout, 0}])),
+ [{timeout, 0}] ++
+ odbc_test_lib:platform_options())),
+ %% Need to return ok here "{'EXIT',timeout} return value" will
+ %% be interpreted as that the testcase has timed out.
ok.
%%-------------------------------------------------------------------------
timeout(doc) ->
@@ -411,10 +418,12 @@ timeout(Config) when is_list(Config) ->
[{auto_commit, off}]),
Table = ?config(tableName, Config),
+ TransStr = transaction_support_str(?RDBMS),
+
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (ID integer, DATA varchar(10), PRIMARY KEY(ID))"),
+ " (ID integer, DATA varchar(10), PRIMARY KEY(ID))" ++ TransStr),
{updated, 1} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++ " VALUES(1,'bar')"),
@@ -446,14 +455,12 @@ timeout(Config) when is_list(Config) ->
["DATA"] = odbc_test_lib:to_upper(Fields),
ok = odbc:commit(Ref, commit),
- ok = odbc:disconnect(Ref),
- ok.
-
+ ok = odbc:disconnect(Ref).
update_table_timeout(Table, TimeOut, Pid) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
UpdateQuery = "UPDATE " ++ Table ++ " SET DATA = 'foobar' WHERE ID = 1",
case catch odbc:sql_query(Ref, UpdateQuery, TimeOut) of
@@ -474,15 +481,16 @@ update_table_timeout(Table, TimeOut, Pid) ->
odbc:sql_query(Ref, "SELECT DATA FROM " ++ Table ++ " WHERE ID = 2"),
["DATA"] = odbc_test_lib:to_upper(Fields),
- {updated, 1} = odbc:sql_query(Ref, UpdateQuery, TimeOut),
+ %% Do not check {updated, 1} as some drivers will return 0
+ %% even though the update is done, which is checked by the test
+ %% case when the altered message is recived.
+ {updated, _} = odbc:sql_query(Ref, UpdateQuery, TimeOut),
ok = odbc:commit(Ref, commit),
Pid ! altered,
- ok = odbc:disconnect(Ref),
-
- ok.
+ ok = odbc:disconnect(Ref).
%%-------------------------------------------------------------------------
many_timeouts(doc) ->
["Tests that many consecutive timeouts lead to that the connection "
@@ -490,14 +498,15 @@ many_timeouts(doc) ->
many_timeouts(suite) -> [];
many_timeouts(Config) when is_list(Config) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
+ TransStr = transaction_support_str(?RDBMS),
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (ID integer, DATA varchar(10), PRIMARY KEY(ID))"),
+ " (ID integer, DATA varchar(10), PRIMARY KEY(ID))" ++ TransStr),
{updated, 1} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++ " VALUES(1,'bar')"),
@@ -517,22 +526,20 @@ many_timeouts(Config) when is_list(Config) ->
end,
ok = odbc:commit(Ref, commit),
- ok = odbc:disconnect(Ref),
- ok.
+ ok = odbc:disconnect(Ref).
update_table_many_timeouts(Table, TimeOut, Pid) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
UpdateQuery = "UPDATE " ++ Table ++ " SET DATA = 'foobar' WHERE ID = 1",
ok = loop_many_timouts(Ref, UpdateQuery, TimeOut),
Pid ! many_timeouts_occurred,
- ok = odbc:disconnect(Ref),
- ok.
+ ok = odbc:disconnect(Ref).
loop_many_timouts(Ref, UpdateQuery, TimeOut) ->
@@ -546,18 +553,19 @@ loop_many_timouts(Ref, UpdateQuery, TimeOut) ->
end.
%%-------------------------------------------------------------------------
timeout_reset(doc) ->
- ["Check that the number of consecutive timouts is reset to 0 when "
+ ["Check that the number of consecutive timouts is reset to 0 when "
"a successful call to the database is made."];
timeout_reset(suite) -> [];
timeout_reset(Config) when is_list(Config) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
+ TransStr = transaction_support_str(?RDBMS),
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (ID integer, DATA varchar(10), PRIMARY KEY(ID))"),
+ " (ID integer, DATA varchar(10), PRIMARY KEY(ID))" ++ TransStr),
{updated, 1} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++ " VALUES(1,'bar')"),
@@ -593,13 +601,12 @@ timeout_reset(Config) when is_list(Config) ->
["DATA"] = odbc_test_lib:to_upper(Fields),
ok = odbc:commit(Ref, commit),
- ok = odbc:disconnect(Ref),
- ok.
+ ok = odbc:disconnect(Ref).
update_table_timeout_reset(Table, TimeOut, Pid) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
UpdateQuery = "UPDATE " ++ Table ++ " SET DATA = 'foobar' WHERE ID = 1",
ok = loop_timout_reset(Ref, UpdateQuery, TimeOut,
@@ -616,15 +623,16 @@ update_table_timeout_reset(Table, TimeOut, Pid) ->
odbc:sql_query(Ref, "SELECT DATA FROM " ++ Table ++ " WHERE ID = 2"),
["DATA"] = odbc_test_lib:to_upper(Fields),
- {updated,1} = odbc:sql_query(Ref, UpdateQuery, TimeOut),
+ %% Do not check {updated, 1} as some drivers will return 0
+ %% even though the update is done, which is checked by the test
+ %% case when the altered message is recived.
+ {updated, _} = odbc:sql_query(Ref, UpdateQuery, TimeOut),
ok = odbc:commit(Ref, commit),
Pid ! altered,
- ok = odbc:disconnect(Ref),
-
- ok.
+ ok = odbc:disconnect(Ref).
loop_timout_reset(_, _, _, 0) ->
ok;
@@ -648,13 +656,14 @@ disconnect_on_timeout(suite) -> [];
disconnect_on_timeout(Config) when is_list(Config) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
+ TransStr = transaction_support_str(?RDBMS),
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (ID integer, DATA varchar(10), PRIMARY KEY(ID))"),
+ " (ID integer, DATA varchar(10), PRIMARY KEY(ID))" ++ TransStr),
{updated, 1} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++ " VALUES(1,'bar')"),
@@ -678,7 +687,7 @@ disconnect_on_timeout(Config) when is_list(Config) ->
update_table_disconnect_on_timeout(Table, TimeOut, Pid) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}]),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()),
UpdateQuery = "UPDATE " ++ Table ++ " SET DATA = 'foobar' WHERE ID = 1",
case catch odbc:sql_query(Ref, UpdateQuery, TimeOut) of
@@ -695,7 +704,7 @@ connection_closed(doc) ->
" use a connection that has been closed"];
connection_closed(suite) -> [];
connection_closed(Config) when is_list(Config) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
{updated, _} =
@@ -714,8 +723,7 @@ connection_closed(Config) when is_list(Config) ->
{error, connection_closed} = odbc:next(Ref),
{error, connection_closed} = odbc:prev(Ref),
{error, connection_closed} = odbc:select(Ref, next, 3),
- {error, connection_closed} = odbc:commit(Ref, commit),
- ok.
+ {error, connection_closed} = odbc:commit(Ref, commit).
%%-------------------------------------------------------------------------
disable_scrollable_cursors(doc) ->
@@ -753,8 +761,7 @@ disable_scrollable_cursors(Config) when is_list(Config) ->
{error, scrollable_cursors_disabled} =
odbc:select(Ref, {absolute, 2}, 5),
- {selected, _ColNames,[]} = odbc:select(Ref, next, 1),
- ok.
+ {selected, _ColNames,[]} = odbc:select(Ref, next, 1).
%%-------------------------------------------------------------------------
return_rows_as_lists(doc)->
@@ -763,7 +770,7 @@ return_rows_as_lists(doc)->
return_rows_as_lists(suite) -> [];
return_rows_as_lists(Config) when is_list(Config) ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{tuple_row, off}]),
+ [{tuple_row, off}] ++ odbc_test_lib:platform_options()),
Table = ?config(tableName, Config),
@@ -784,16 +791,21 @@ return_rows_as_lists(Config) when is_list(Config) ->
{ok, _} = odbc:select_count(Ref, "SELECT * FROM " ++ Table),
- First = ?RDBMS:first_list_rows(),
- Last = ?RDBMS:last_list_rows(),
- Prev = ?RDBMS:prev_list_rows(),
- Next = ?RDBMS:next_list_rows(),
-
- Last = odbc:last(Ref),
- Prev = odbc:prev(Ref),
- First = odbc:first(Ref),
- Next = odbc:next(Ref),
- ok.
+ case proplists:get_value(scrollable_cursors, odbc_test_lib:platform_options()) of
+ off ->
+ Next = ?RDBMS:next_list_rows(),
+ Next = odbc:next(Ref);
+ _ ->
+ First = ?RDBMS:first_list_rows(),
+ Last = ?RDBMS:last_list_rows(),
+ Prev = ?RDBMS:prev_list_rows(),
+ Next = ?RDBMS:next_list_rows(),
+
+ Last = odbc:last(Ref),
+ Prev = odbc:prev(Ref),
+ First = odbc:first(Ref),
+ Next = odbc:next(Ref)
+ end.
%%-------------------------------------------------------------------------
@@ -802,22 +814,27 @@ api_missuse(doc)->
api_missuse(suite) -> [];
api_missuse(Config) when is_list(Config)->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
%% Serious programming fault, connetion will be shut down
gen_server:call(Ref, {self(), foobar, 10}, infinity),
test_server:sleep(10),
undefined = process_info(Ref, status),
- {ok, Ref2} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref2} = odbc:connect(?RDBMS:connection_string(),
+ odbc_test_lib:platform_options()),
%% Serious programming fault, connetion will be shut down
gen_server:cast(Ref2, {self(), foobar, 10}),
test_server:sleep(10),
undefined = process_info(Ref2, status),
- {ok, Ref3} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref3} = odbc:connect(?RDBMS:connection_string(),
+ odbc_test_lib:platform_options()),
%% Could be an innocent misstake the connection lives.
Ref3 ! foobar,
test_server:sleep(10),
- {status, _} = process_info(Ref3, status),
- ok.
+ {status, _} = process_info(Ref3, status).
+transaction_support_str(mysql) ->
+ "ENGINE = InnoDB";
+transaction_support_str(_) ->
+ "".
diff --git a/lib/odbc/test/odbc_data_type_SUITE.erl b/lib/odbc/test/odbc_data_type_SUITE.erl
index bfb1e4b329..d61a91f973 100644
--- a/lib/odbc/test/odbc_data_type_SUITE.erl
+++ b/lib/odbc/test/odbc_data_type_SUITE.erl
@@ -44,24 +44,29 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
case odbc_test_lib:odbc_check() of
ok ->
- [{group, char}, {group, int}, {group, floats},
+ [{group, char},{group, fixed_char}, {group, binary_char},
+ {group, fixed_binary_char}, {group, unicode},
+ {group, int}, {group, floats},
{group, dec_and_num}, timestamp];
Other -> {skip, Other}
end.
groups() ->
[{char, [],
- [char_fixed_lower_limit, char_fixed_upper_limit,
- char_fixed_padding, varchar_lower_limit,
+ [varchar_lower_limit,
varchar_upper_limit, varchar_no_padding,
- text_lower_limit, text_upper_limit, unicode]},
+ text_lower_limit, text_upper_limit]},
+ {fixed_char, [],
+ [char_fixed_lower_limit, char_fixed_upper_limit,
+ char_fixed_padding]},
{binary_char, [],
- [binary_char_fixed_lower_limit,
- binary_char_fixed_upper_limit,
- binary_char_fixed_padding, binary_varchar_lower_limit,
+ [binary_varchar_lower_limit,
binary_varchar_upper_limit, binary_varchar_no_padding,
- binary_text_lower_limit, binary_text_upper_limit,
- unicode]},
+ binary_text_lower_limit, binary_text_upper_limit]},
+ {fixed_binary_char, [], [binary_char_fixed_lower_limit,
+ binary_char_fixed_upper_limit,
+ binary_char_fixed_padding]},
+ {unicode, [], [utf8, nchar, nvarchar]},
{int, [],
[tiny_int_lower_limit, tiny_int_upper_limit,
small_int_lower_limit, small_int_upper_limit,
@@ -74,14 +79,31 @@ groups() ->
[dec_long, dec_double, dec_bignum, num_long, num_double,
num_bignum]}].
+init_per_group(GroupName, Config) when GroupName == fixed_char;
+ GroupName == fixed_binary_char ->
+ case ?RDBMS of
+ mysql ->
+ {skip, "No supported by MYSQL"};
+ _ ->
+ Config
+ end;
+
+init_per_group(unicode, Config) ->
+ case {os:type(), erlang:system_info({wordsize, external})} of
+ {{unix, _}, 4} ->
+ Config;
+ {{unix, _}, _} ->
+ {skip, "Postgres drivers pre version psqlODBC 08.04.0200 have utf8-problems"};
+ _ ->
+ Config
+ end;
+
init_per_group(_GroupName, Config) ->
Config.
end_per_group(_GroupName, Config) ->
Config.
-
-
%%--------------------------------------------------------------------
%% Function: init_per_suite(Config) -> Config
%% Config - [tuple()]
@@ -91,10 +113,18 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- application:start(odbc),
- [{tableName, odbc_test_lib:unique_table_name()} | Config].
-
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
+ end.
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
@@ -117,22 +147,81 @@ end_per_suite(_Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
+init_per_testcase(Case, Config) when Case == varchar_upper_limit;
+ Case == binary_varchar_upper_limit;
+ Case == varchar_no_padding;
+ Case == binary_varchar_no_padding ->
+ case is_fixed_upper_limit(?RDBMS) of
+ true ->
+ common_init_per_testcase(Case, Config);
+ false ->
+ {skip, "Upper limit is not fixed in" ++ atom_to_list(?RDBMS)}
+ end;
+
+init_per_testcase(text_upper_limit, _Config) ->
+ {skip, "Consumes too much resources"};
+
+init_per_testcase(Case, Config) when Case == bit_true; Case == bit_false ->
+ case is_supported_bit(?RDBMS) of
+ true ->
+ common_init_per_testcase(Case, Config);
+ false ->
+ {skip, "Not supported by driver"}
+ end;
+
+init_per_testcase(param_insert_tiny_int = Case, Config) ->
+ case is_supported_tinyint(?RDBMS) of
+ true ->
+ common_init_per_testcase(Case, Config);
+ false ->
+ {skip, "Not supported by driver"}
+ end;
+
+init_per_testcase(Case, Config) when Case == nchar;
+ Case == nvarchar ->
+ case ?RDBMS of
+ sqlserver ->
+ common_init_per_testcase(Case, Config);
+ _ ->
+ {skip, "Not supported by driver"}
+ end;
+
init_per_testcase(Case, Config) ->
+ common_init_per_testcase(Case, Config).
+
+common_init_per_testcase(Case, Config) ->
+ PlatformOptions = odbc_test_lib:platform_options(),
case atom_to_list(Case) of
"binary" ++ _ ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{binary_strings, on}]);
- "unicode" ->
+ [{binary_strings, on}] ++ PlatformOptions);
+ LCase when LCase == "utf8";
+ LCase == "nchar";
+ LCase == "nvarchar" ->
{ok, Ref} = odbc:connect(?RDBMS:connection_string(),
- [{binary_strings, on}]);
+ [{binary_strings, on}] ++ PlatformOptions);
_ ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), [])
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), PlatformOptions)
end,
+ odbc_test_lib:strict(Ref, ?RDBMS),
Dog = test_server:timetrap(?default_timeout),
Temp = lists:keydelete(connection_ref, 1, Config),
NewConfig = lists:keydelete(watchdog, 1, Temp),
[{watchdog, Dog}, {connection_ref, Ref} | NewConfig].
+is_fixed_upper_limit(mysql) ->
+ false;
+is_fixed_upper_limit(_) ->
+ true.
+is_supported_tinyint(sqlserver) ->
+ true;
+is_supported_tinyint(_) ->
+ false.
+is_supported_bit(sqlserver) ->
+ true;
+is_supported_bit(_) ->
+ false.
+
%%--------------------------------------------------------------------
%% Function: end_per_testcase(Case, Config) -> _
%% Case - atom()
@@ -146,7 +235,7 @@ end_per_testcase(_TestCase, Config) ->
ok = odbc:disconnect(Ref),
%% Clean up if needed
Table = ?config(tableName, Config),
- {ok, NewRef} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, NewRef} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
odbc:sql_query(NewRef, "DROP TABLE " ++ Table),
odbc:disconnect(NewRef),
Dog = ?config(watchdog, Config),
@@ -169,18 +258,18 @@ char_fixed_lower_limit(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- ?RDBMS:create_fixed_char_table(
+ ?RDBMS:create_fixed_char_table(
(?RDBMS:fixed_char_min() - 1))),
%% Lower limit
{updated, _} = % Value == 0 || -1 driver dependent!
odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_fixed_char_table(
- ?RDBMS:fixed_char_min())),
+ ?RDBMS:create_fixed_char_table(
+ ?RDBMS:fixed_char_min())),
%% Right length data
{updated, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a, ?RDBMS:fixed_char_min())
+ "'" ++ string:chars($a, ?RDBMS:fixed_char_min())
++ "')"),
%% Select data
{selected, Fields,[{"a"}]} =
@@ -191,11 +280,11 @@ char_fixed_lower_limit(Config) when is_list(Config) ->
%% Too long data
{error, _} =
odbc:sql_query(Ref,"INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a,
- (?RDBMS:fixed_char_min()
- + 1))
- ++ "')"),
- ok.
+ "'" ++ string:chars($a,
+ (?RDBMS:fixed_char_min()
+ + 1))
+ ++ "')").
+
%%-------------------------------------------------------------------------
char_fixed_upper_limit(doc) ->
@@ -243,8 +332,7 @@ char_fixed_upper_limit(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
?RDBMS:create_fixed_char_table(
- (?RDBMS:fixed_char_max() + 1))),
- ok
+ (?RDBMS:fixed_char_max() + 1)))
end.
%%-------------------------------------------------------------------------
@@ -261,20 +349,20 @@ char_fixed_padding(Config) when is_list(Config) ->
%% Data should be padded with blanks
{updated, _} = % Value == 0 || -1 driver dependent!
odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_fixed_char_table(
- ?RDBMS:fixed_char_max())),
+ ?RDBMS:create_fixed_char_table(
+ ?RDBMS:fixed_char_max())),
- {updated, _} =
+ {updated, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a,
- ?RDBMS:fixed_char_min())
+ "'" ++ string:chars($a,
+ ?RDBMS:fixed_char_min())
++ "')"),
{selected, Fields, [{CharStr}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
true = length(CharStr) == ?RDBMS:fixed_char_max(),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
+
%%-------------------------------------------------------------------------
varchar_lower_limit(doc) ->
@@ -287,33 +375,33 @@ varchar_lower_limit(Config) when is_list(Config) ->
%% Below limit
{error, _} =
- odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_var_char_table(
- ?RDBMS:var_char_min() - 1)),
+ odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
+ ?RDBMS:create_var_char_table(
+ ?RDBMS:var_char_min() - 1)),
%% Lower limit
{updated, _} = % Value == 0 || -1 driver dependent!
odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_var_char_table(
- ?RDBMS:var_char_min())),
+ ?RDBMS:create_var_char_table(
+ ?RDBMS:var_char_min())),
+
+ Str = string:chars($a, ?RDBMS:var_char_min()),
%% Right length data
{updated, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a, ?RDBMS:var_char_min())
- ++ "')"),
+ "'" ++ Str ++ "')"),
%% Select data
- {selected, Fields, [{"a"}]} =
+ {selected, Fields, [{Str}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
["FIELD"] = odbc_test_lib:to_upper(Fields),
- %% Too long data
- {error, _} =
- odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a,
- (?RDBMS:var_char_min()+1))
- ++ "')"),
- ok.
+ %% Too long datae
+ {error, _} =
+ odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
+ "'" ++ string:chars($a,
+ (?RDBMS:var_char_min()+1))
+ ++ "')").
%%-------------------------------------------------------------------------
@@ -389,8 +477,7 @@ varchar_no_padding(Config) when is_list(Config) ->
{selected, Fields, [{CharStr}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
true = length(CharStr) /= ?RDBMS:var_char_max(),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
%%-------------------------------------------------------------------------
@@ -413,8 +500,7 @@ text_lower_limit(Config) when is_list(Config) ->
{selected, Fields, [{"a"}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
%%-------------------------------------------------------------------------
@@ -444,8 +530,7 @@ text_upper_limit(Config) when is_list(Config) ->
%% {error, _} =
%% odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
%% "'" ++ string:chars($a, (?RDBMS:text_max()+1))
-%% ++ "')"),
-%% ok.
+%% ++ "')").
%%-------------------------------------------------------------------------
@@ -469,13 +554,18 @@ binary_char_fixed_lower_limit(Config) when is_list(Config) ->
?RDBMS:create_fixed_char_table(
?RDBMS:fixed_char_min())),
+ Str = string:chars($a, ?RDBMS:fixed_char_min()),
+
%% Right length data
{updated, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a, ?RDBMS:fixed_char_min())
+ "'" ++ Str
++ "')"),
+
+ Bin = list_to_binary(Str),
+
%% Select data
- {selected, Fields,[{<<"a">>}]} =
+ {selected, Fields,[{Bin}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
["FIELD"] = odbc_test_lib:to_upper(Fields),
@@ -486,8 +576,7 @@ binary_char_fixed_lower_limit(Config) when is_list(Config) ->
"'" ++ string:chars($a,
(?RDBMS:fixed_char_min()
+ 1))
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
binary_char_fixed_upper_limit(doc) ->
@@ -565,8 +654,8 @@ binary_char_fixed_padding(Config) when is_list(Config) ->
{selected, Fields, [{CharBin}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
true = size(CharBin) == ?RDBMS:fixed_char_max(),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
+
%%-------------------------------------------------------------------------
binary_varchar_lower_limit(doc) ->
@@ -588,13 +677,17 @@ binary_varchar_lower_limit(Config) when is_list(Config) ->
?RDBMS:create_var_char_table(
?RDBMS:var_char_min())),
+ Str = string:chars($a, ?RDBMS:var_char_min()),
+
%% Right length data
{updated, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ string:chars($a, ?RDBMS:var_char_min())
+ "'" ++ Str
++ "')"),
+ BinStr = list_to_binary(Str),
+
%% Select data
- {selected, Fields, [{<<"a">>}]} =
+ {selected, Fields, [{BinStr}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
["FIELD"] = odbc_test_lib:to_upper(Fields),
@@ -604,8 +697,7 @@ binary_varchar_lower_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ string:chars($a,
(?RDBMS:var_char_min()+1))
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
@@ -654,8 +746,7 @@ binary_varchar_upper_limit(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
?RDBMS:create_var_char_table(
- (?RDBMS:var_char_max() + 1))),
- ok
+ (?RDBMS:var_char_max() + 1)))
end.
%%-------------------------------------------------------------------------
@@ -681,8 +772,7 @@ binary_varchar_no_padding(Config) when is_list(Config) ->
{selected, Fields, [{CharBin}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
true = size(CharBin) /= ?RDBMS:var_char_max(),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
%%-------------------------------------------------------------------------
@@ -705,8 +795,7 @@ binary_text_lower_limit(Config) when is_list(Config) ->
{selected, Fields, [{<<"a">>}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
%%-------------------------------------------------------------------------
@@ -736,11 +825,7 @@ binary_text_upper_limit(Config) when is_list(Config) ->
%% {error, _} =
%% odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
%% "'" ++ string:chars($a, (?RDBMS:text_max()+1))
-%% ++ "')"),
-%% ok.
-
-
-%%-------------------------------------------------------------------------
+%% ++ "')").
%%-------------------------------------------------------------------------
@@ -774,8 +859,7 @@ tiny_int_lower_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:tiny_int_min()
- 1)
- ++ "')"),
- ok
+ ++ "')")
end.
%%-------------------------------------------------------------------------
@@ -809,8 +893,7 @@ tiny_int_upper_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:tiny_int_max()
+ 1)
- ++ "')"),
- ok
+ ++ "')")
end.
%%-------------------------------------------------------------------------
@@ -840,8 +923,7 @@ small_int_lower_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:small_int_min()
- 1)
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
@@ -870,8 +952,7 @@ small_int_upper_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref,"INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:small_int_max()
+ 1)
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
int_lower_limit(doc) ->
@@ -898,8 +979,7 @@ int_lower_limit(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:int_min() - 1)
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
@@ -927,8 +1007,7 @@ int_upper_limit(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:int_max() + 1)
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
@@ -957,8 +1036,7 @@ big_int_lower_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:big_int_min()
- 1)
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
@@ -987,8 +1065,7 @@ big_int_upper_limit(Config) when is_list(Config) ->
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(?RDBMS:big_int_max()
+ 1)
- ++ "')"),
- ok.
+ ++ "')").
%%-------------------------------------------------------------------------
bit_false(doc) ->
@@ -1020,8 +1097,7 @@ bit_false(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(-1)
- ++ "')"),
- ok
+ ++ "')")
end.
%%-------------------------------------------------------------------------
@@ -1056,14 +1132,10 @@ bit_true(Config) when is_list(Config) ->
{error, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
"'" ++ integer_to_list(-1)
- ++ "')"),
- ok
+ ++ "')")
end.
%%-------------------------------------------------------------------------
-
-
-%%-------------------------------------------------------------------------
float_lower_limit(doc) ->
[""];
float_lower_limit(suite) ->
@@ -1073,44 +1145,45 @@ float_lower_limit(Config) when is_list(Config) ->
Ref = ?config(connection_ref, Config),
Table = ?config(tableName, Config),
- {updated, _} = % Value == 0 || -1 driver dependent!
- odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_float_table()),
-
- {updated, _} =
- odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ float_to_list(
- ?RDBMS:float_min())
- ++ "')"),
- {selected,[_ColName],[{MinFloat}]} =
- odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
-
- true = ?RDBMS:float_min() == MinFloat,
-
case ?RDBMS of
- oracle ->
- {updated, _} = % Value == 0 || -1 driver dependent!
- odbc:sql_query(Ref, "DROP TABLE " ++ Table),
-
+ mysql ->
+ {skip, "Not clearly defined in MYSQL"};
+ _ ->
{updated, _} = % Value == 0 || -1 driver dependent!
odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_float_table()),
+ ?RDBMS:create_float_table()),
{updated, _} =
- odbc:sql_query(Ref,
- "INSERT INTO " ++ Table ++" VALUES(" ++
- ?RDBMS:float_underflow() ++ ")"),
-
- SelectResult = ?RDBMS:float_zero_selected(),
- SelectResult =
- odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table);
- _ ->
- {error, _} =
odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- ?RDBMS:float_underflow() ++ ")")
- end,
- ok.
+ "'" ++ float_to_list(
+ ?RDBMS:float_min())
+ ++ "')"),
+ {selected,[_ColName],[{MinFloat}]} =
+ odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
+ true = ?RDBMS:float_min() == MinFloat,
+
+ case ?RDBMS of
+ oracle ->
+ {updated, _} = % Value == 0 || -1 driver dependent!
+ odbc:sql_query(Ref, "DROP TABLE " ++ Table),
+
+ {updated, _} = % Value == 0 || -1 driver dependent!
+ odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
+ ?RDBMS:create_float_table()),
+ {updated, _} =
+ odbc:sql_query(Ref,
+ "INSERT INTO " ++ Table ++" VALUES(" ++
+ ?RDBMS:float_underflow() ++ ")"),
+ SelectResult = ?RDBMS:float_zero_selected(),
+ SelectResult =
+ odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table);
+ _ ->
+ {error, _} =
+ odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
+ ?RDBMS:float_underflow() ++ ")")
+ end
+ end.
%%-------------------------------------------------------------------------
float_upper_limit(doc) ->
@@ -1121,26 +1194,28 @@ float_upper_limit(Config) when is_list(Config) ->
Ref = ?config(connection_ref, Config),
Table = ?config(tableName, Config),
- {updated, _} = % Value == 0 || -1 driver dependent!
- odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_float_table()),
-
- {updated, _} =
- odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- "'" ++ float_to_list(
- ?RDBMS:float_max())
- ++ "')"),
-
+ case ?RDBMS of
+ mysql ->
+ {skip, "Not clearly defined in MYSQL"};
+ _->
+ {updated, _} = % Value == 0 || -1 driver dependent!
+ odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
+ ?RDBMS:create_float_table()),
- {selected,[_ColName],[{MaxFloat}]}
- = odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
+ {updated, _} =
+ odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
+ "'" ++ float_to_list(
+ ?RDBMS:float_max())
+ ++ "')"),
+ {selected,[_ColName],[{MaxFloat}]}
+ = odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- true = ?RDBMS:float_max() == MaxFloat,
+ true = ?RDBMS:float_max() == MaxFloat,
- {error, _} =
- odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
- ?RDBMS:float_overflow() ++ ")"),
- ok.
+ {error, _} =
+ odbc:sql_query(Ref, "INSERT INTO " ++ Table ++" VALUES(" ++
+ ?RDBMS:float_overflow() ++ ")")
+ end.
%%-------------------------------------------------------------------------
float_zero(doc) ->
@@ -1160,8 +1235,7 @@ float_zero(Config) when is_list(Config) ->
SelectResult = ?RDBMS:float_zero_selected(),
SelectResult =
- odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ok.
+ odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table).
%%-------------------------------------------------------------------------
real_zero(doc) ->
["Test the real value zero."];
@@ -1185,10 +1259,8 @@ real_zero(Config) when is_list(Config) ->
SelectResult = ?RDBMS:real_zero_selected(),
SelectResult =
- odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ok
+ odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table)
end.
-%%-------------------------------------------------------------------------
%%------------------------------------------------------------------------
dec_long(doc) ->
[""];
@@ -1207,8 +1279,7 @@ dec_long(Config) when is_list(Config) ->
{selected, Fields, [{2}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
%%------------------------------------------------------------------------
dec_double(doc) ->
[""];
@@ -1255,8 +1326,7 @@ dec_double(Config) when is_list(Config) ->
{selected, Fields2, [{1.60000}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields2),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields2).
%%------------------------------------------------------------------------
dec_bignum(doc) ->
@@ -1289,8 +1359,7 @@ dec_bignum(Config) when is_list(Config) ->
{selected, Fields1, [{"1.6"}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields1),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields1).
%%------------------------------------------------------------------------
num_long(doc) ->
[""];
@@ -1309,8 +1378,7 @@ num_long(Config) when is_list(Config) ->
{selected, Fields, [{2}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields).
%%------------------------------------------------------------------------
num_double(doc) ->
[""];
@@ -1356,8 +1424,7 @@ num_double(Config) when is_list(Config) ->
{selected, Fields2, [{1.6000}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields2),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields2).
%%------------------------------------------------------------------------
num_bignum(doc) ->
[""];
@@ -1389,21 +1456,19 @@ num_bignum(Config) when is_list(Config) ->
{selected, Fields1, [{"1.6"}]} =
odbc:sql_query(Ref,"SELECT FIELD FROM " ++ Table),
- ["FIELD"] = odbc_test_lib:to_upper(Fields1),
- ok.
+ ["FIELD"] = odbc_test_lib:to_upper(Fields1).
%%------------------------------------------------------------------------
-unicode(doc) ->
+utf8(doc) ->
["Test unicode support"];
-unicode(suit) ->
+utf8(suit) ->
[];
-unicode(Config) when is_list(Config) ->
+utf8(Config) when is_list(Config) ->
Ref = ?config(connection_ref, Config),
Table = ?config(tableName, Config),
- {updated, _} = % Value == 0 || -1 driver dependent!
- odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
- ?RDBMS:create_unicode_table()),
+ odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++ "(FIELD text)"),
+
Latin1Data = ["���������",
"testasdf",
"Row 3",
@@ -1416,39 +1481,7 @@ unicode(Config) when is_list(Config) ->
"Row 10",
"Row 11",
"Row 12"],
-
- case ?RDBMS of
- sqlserver ->
- w_char_support_win(Ref, Table, Latin1Data);
- postgres ->
- direct_utf8(Ref, Table, Latin1Data);
- oracle ->
- {skip, "not currently supported"}
- end.
-
-w_char_support_win(Ref, Table, Latin1Data) ->
- UnicodeIn = lists:map(fun(S) ->
- unicode:characters_to_binary(S,latin1,{utf16,little})
- end,
- Latin1Data),
-
- test_server:format("UnicodeIn (utf 16): ~p ~n",[UnicodeIn]),
- {updated, _} = odbc:param_query(Ref, "INSERT INTO " ++ Table ++ "(FIELD) values(?)",
- [{{sql_wvarchar,50},UnicodeIn}]),
-
- {selected,_,UnicodeOut} = odbc:sql_query(Ref,"SELECT * FROM " ++ Table),
-
- test_server:format("UnicodeOut: ~p~n", [UnicodeOut]),
-
- Result = lists:map(fun({Unicode}) ->
- unicode:characters_to_list(Unicode,{utf16,little})
- end,
- UnicodeOut),
- Latin1Data = Result.
-
-
-direct_utf8(Ref, Table, Latin1Data) ->
UnicodeIn = lists:map(fun(String) ->
unicode:characters_to_binary(String,latin1,utf8)
end,
@@ -1469,6 +1502,37 @@ direct_utf8(Ref, Table, Latin1Data) ->
test_server:format("Result: ~p ~n", [Result]),
Latin1Data = Result.
+%%------------------------------------------------------------------------
+
+nchar(doc) ->
+ ["Test unicode nchar support in sqlserver"];
+nchar(suit) ->
+ [];
+nchar(Config) when is_list(Config) ->
+ Ref = ?config(connection_ref, Config),
+ Table = ?config(tableName, Config),
+
+ {updated, _} = % Value == 0 || -1 driver dependent!
+ odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
+ "(FIELD nchar(50))"),
+
+ w_char_support(Ref, Table, sql_wvarchar, 50).
+
+%%------------------------------------------------------------------------
+
+nvarchar(doc) ->
+ ["Test 'unicode' nvarchar support"];
+nvarchar(suit) ->
+ [];
+nvarchar(Config) when is_list(Config) ->
+ Ref = ?config(connection_ref, Config),
+ Table = ?config(tableName, Config),
+
+ {updated, _} = % Value == 0 || -1 driver dependent!
+ odbc:sql_query(Ref, "CREATE TABLE " ++ Table ++
+ "(FIELD nvarchar(50))"),
+
+ w_char_support(Ref, Table, sql_wlongvarchar, 50).
%%------------------------------------------------------------------------
timestamp(doc) ->
@@ -1497,3 +1561,43 @@ timestamp(Config) when is_list(Config) ->
TimeStamps = lists:map(fun(Value) -> {Value} end, Data),
{selected,_, TimeStamps} = odbc:sql_query(Ref, "SELECT * FROM " ++ Table).
+%%------------------------------------------------------------------------
+
+w_char_support(Ref, Table, CharType, Size) ->
+ Latin1Data = ["���������",
+ "testasdf",
+ "Row 3",
+ "Row 4",
+ "Row 5",
+ "Row 6",
+ "Row 7",
+ "Row 8",
+ "Row 9",
+ "Row 10",
+ "Row 11",
+ "Row 12"],
+
+ UnicodeIn = lists:map(fun(S) ->
+ unicode:characters_to_binary(S,latin1,{utf16,little})
+ end,
+ Latin1Data),
+
+ test_server:format("UnicodeIn (utf 16): ~p ~n",[UnicodeIn]),
+
+ {updated, _} = odbc:param_query(Ref, "INSERT INTO " ++ Table ++ "(FIELD) values(?)",
+ [{{CharType, Size},UnicodeIn}]),
+
+ {selected,_,UnicodeOut} = odbc:sql_query(Ref,"SELECT * FROM " ++ Table),
+
+ test_server:format("UnicodeOut: ~p~n", [UnicodeOut]),
+
+ PadResult = lists:map(fun({Unicode}) ->
+ unicode:characters_to_list(Unicode,{utf16,little})
+ end,
+ UnicodeOut),
+
+ test_server:format("Result: ~p~n", [PadResult]),
+
+ Result = lists:map(fun(Str) -> string:strip(Str) end, PadResult),
+
+ Latin1Data = Result.
diff --git a/lib/odbc/test/odbc_query_SUITE.erl b/lib/odbc/test/odbc_query_SUITE.erl
index 8b8d1e7a40..1852678b4b 100644
--- a/lib/odbc/test/odbc_query_SUITE.erl
+++ b/lib/odbc/test/odbc_query_SUITE.erl
@@ -43,19 +43,22 @@ suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
case odbc_test_lib:odbc_check() of
ok ->
- [sql_query, first, last, next, prev, select_count,
+ [sql_query, next, {group, scrollable_cursors}, select_count,
select_next, select_relative, select_absolute,
create_table_twice, delete_table_twice, duplicate_key,
not_connection_owner, no_result_set, query_error,
- multiple_select_result_sets, multiple_mix_result_sets,
- multiple_result_sets_error,
+ {group, multiple_result_sets},
{group, parameterized_queries}, {group, describe_table},
delete_nonexisting_row];
Other -> {skip, Other}
end.
groups() ->
- [{parameterized_queries, [],
+ [{multiple_result_sets, [], [multiple_select_result_sets,
+ multiple_mix_result_sets,
+ multiple_result_sets_error]},
+ {scrollable_cursors, [], [first, last, prev]},
+ {parameterized_queries, [],
[{group, param_integers}, param_insert_decimal,
param_insert_numeric, {group, param_insert_string},
param_insert_float, param_insert_real,
@@ -72,15 +75,27 @@ groups() ->
[describe_integer, describe_string, describe_floating,
describe_dec_num, describe_no_such_table]}].
-init_per_group(_GroupName, Config) ->
+init_per_group(multiple_result_sets, Config) ->
+ case is_supported_multiple_resultsets(?RDBMS) of
+ true ->
+ Config;
+ false ->
+ {skip, "Not supported by " ++ atom_to_list(?RDBMS) ++ "driver"}
+ end;
+init_per_group(scrollable_cursors, Config) ->
+ case proplists:get_value(scrollable_cursors, odbc_test_lib:platform_options()) of
+ off ->
+ {skip, "Not supported by driver"};
+ _ ->
+ Config
+ end;
+
+init_per_group(_,Config) ->
Config.
end_per_group(_GroupName, Config) ->
Config.
-
-
-
%%--------------------------------------------------------------------
%% Function: init_per_suite(Config) -> Config
%% Config - [tuple()]
@@ -91,8 +106,17 @@ end_per_group(_GroupName, Config) ->
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) when is_list(Config) ->
- application:start(odbc),
- [{tableName, odbc_test_lib:unique_table_name()}| Config].
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
+ end.
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
@@ -117,7 +141,8 @@ end_per_suite(_Config) ->
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_testcase(_Case, Config) ->
- {ok, Ref} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, Ref} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
+ odbc_test_lib:strict(Ref, ?RDBMS),
Dog = test_server:timetrap(?default_timeout),
Temp = lists:keydelete(connection_ref, 1, Config),
NewConfig = lists:keydelete(watchdog, 1, Temp),
@@ -136,7 +161,7 @@ end_per_testcase(_Case, Config) ->
ok = odbc:disconnect(Ref),
%% Clean up if needed
Table = ?config(tableName, Config),
- {ok, NewRef} = odbc:connect(?RDBMS:connection_string(), []),
+ {ok, NewRef} = odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()),
odbc:sql_query(NewRef, "DROP TABLE " ++ Table),
odbc:disconnect(NewRef),
Dog = ?config(watchdog, Config),
@@ -663,9 +688,6 @@ multiple_result_sets_error(Config) when is_list(Config) ->
end.
%%-------------------------------------------------------------------------
-
-%%-------------------------------------------------------------------------
-%%-------------------------------------------------------------------------
param_insert_tiny_int(doc)->
["Test insertion of tiny ints by parameterized queries."];
param_insert_tiny_int(suite) ->
@@ -901,8 +923,6 @@ param_insert_numeric(Config) when is_list(Config) ->
ok.
%%-------------------------------------------------------------------------
-
-%%-------------------------------------------------------------------------
param_insert_char(doc)->
["Test insertion of fixed length string by parameterized queries."];
param_insert_char(suite) ->
@@ -1325,8 +1345,6 @@ param_select(Config) when is_list(Config) ->
ok.
%%-------------------------------------------------------------------------
-
-%%-------------------------------------------------------------------------
describe_integer(doc) ->
["Test describe_table/[2,3] for integer columns."];
describe_integer(suite) ->
@@ -1338,7 +1356,7 @@ describe_integer(Config) when is_list(Config) ->
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (int1 SMALLINT, int2 INT, int3 INTEGER)"),
+ " (myint1 SMALLINT, myint2 INT, myint3 INTEGER)"),
Decs = ?RDBMS:describe_integer(),
%% Make sure to test timeout clause
@@ -1399,7 +1417,7 @@ describe_dec_num(Config) when is_list(Config) ->
{updated, _} =
odbc:sql_query(Ref,
"CREATE TABLE " ++ Table ++
- " (dec DECIMAL(9,3), num NUMERIC(9,2))"),
+ " (mydec DECIMAL(9,3), mynum NUMERIC(9,2))"),
Decs = ?RDBMS:describe_dec_num(),
@@ -1451,3 +1469,7 @@ is_driver_error(Error) ->
false ->
test_server:fail(Error)
end.
+is_supported_multiple_resultsets(sqlserver) ->
+ true;
+is_supported_multiple_resultsets(_) ->
+ false.
diff --git a/lib/odbc/test/odbc_start_SUITE.erl b/lib/odbc/test/odbc_start_SUITE.erl
index 65b990133f..e3a3440559 100644
--- a/lib/odbc/test/odbc_start_SUITE.erl
+++ b/lib/odbc/test/odbc_start_SUITE.erl
@@ -39,11 +39,18 @@
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) ->
- case code:which(odbc) of
- non_existing ->
- {skip, "No ODBC built"};
- _ ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case code:which(odbc) of
+ non_existing ->
+ {skip, "No ODBC built"};
+ _ ->
+ %% Make sure odbc is not already started
+ odbc:stop(),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ end
end.
%%--------------------------------------------------------------------
@@ -125,14 +132,16 @@ start(doc) ->
start(suite) ->
[];
start(Config) when is_list(Config) ->
- {error,odbc_not_started} = odbc:connect(?RDBMS:connection_string(), []),
+ PlatformOptions = odbc_test_lib:platform_options(),
+ {error,odbc_not_started} = odbc:connect(?RDBMS:connection_string(),
+ PlatformOptions),
odbc:start(),
- case odbc:connect(?RDBMS:connection_string(), []) of
+ case odbc:connect(?RDBMS:connection_string(), PlatformOptions) of
{ok, Ref0} ->
ok = odbc:disconnect(Ref0),
odbc:stop(),
{error,odbc_not_started} =
- odbc:connect(?RDBMS:connection_string(), []),
+ odbc:connect(?RDBMS:connection_string(), PlatformOptions),
start_odbc(transient),
start_odbc(permanent);
{error, odbc_not_started} ->
@@ -144,7 +153,7 @@ start(Config) when is_list(Config) ->
start_odbc(Type) ->
ok = odbc:start(Type),
- case odbc:connect(?RDBMS:connection_string(), []) of
+ case odbc:connect(?RDBMS:connection_string(), odbc_test_lib:platform_options()) of
{ok, Ref} ->
ok = odbc:disconnect(Ref),
odbc:stop();
diff --git a/lib/odbc/test/odbc_test.hrl b/lib/odbc/test/odbc_test.hrl
index 87f50043db..f7bb338a7f 100644
--- a/lib/odbc/test/odbc_test.hrl
+++ b/lib/odbc/test/odbc_test.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2002-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2002-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -25,9 +25,16 @@
-define(RDBMS, case os:type() of
{unix, sunos} ->
- postgres;
+ mysql;
{unix,linux} ->
- postgres;
+ case erlang:system_info({wordsize, external}) of
+ 4 ->
+ mysql;
+ _ ->
+ postgres
+ end;
+ {unix, darwin} ->
+ mysql;
{win32, _} ->
sqlserver
end).
diff --git a/lib/odbc/test/odbc_test_lib.erl b/lib/odbc/test/odbc_test_lib.erl
index 012eb96e43..4d7d1ae2fa 100644
--- a/lib/odbc/test/odbc_test_lib.erl
+++ b/lib/odbc/test/odbc_test_lib.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2002-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2002-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -36,20 +36,9 @@ match_float(Float, Match, Delta) ->
(Float < Match + Delta) and (Float > Match - Delta).
odbc_check() ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
- case test_server:os_type() of
- {unix, sunos} ->
- ok;
- {unix, linux} ->
- ok;
- {win32, _} ->
- ok;
- Other ->
- lists:flatten(
- io_lib:format("Platform not supported: ~w",
- [Other]))
- end;
+ ok;
Other ->
case os:type() of
{unix, linux} ->
@@ -75,3 +64,46 @@ check_row_count(Expected, Count) ->
to_upper(List) ->
lists:map(fun(Str) -> string:to_upper(Str) end, List).
+
+strict(Ref, mysql) ->
+ odbc:sql_query(Ref, "SET sql_mode='STRICT_ALL_TABLES,STRICT_TRANS_TABLES';");
+strict(_,_) ->
+ ok.
+
+platform_options() ->
+ [].
+
+skip() ->
+ case os:type() of
+ {unix, linux} ->
+ Issue = linux_issue(),
+ is_sles9(Issue);
+ {unix, sunos} ->
+ not supported_solaris();
+ _ ->
+ false
+ end.
+
+supported_solaris() ->
+ case os:version() of
+ {_,10,_} ->
+ true;
+ _ ->
+ false
+ end.
+
+linux_issue() ->
+ {ok, Binary} = file:read_file("/etc/issue"),
+ string:tokens(binary_to_list(Binary), " ").
+
+is_sles11(IssueTokens) ->
+ lists:member("11", IssueTokens).
+
+is_sles10(IssueTokens) ->
+ lists:member("10", IssueTokens).
+
+is_sles9(IssueTokens) ->
+ lists:member("9", IssueTokens).
+
+is_ubuntu(IssueTokens) ->
+ lists:member("Ubuntu", IssueTokens).
diff --git a/lib/odbc/test/oracle.erl b/lib/odbc/test/oracle.erl
index ebf6dbb6bf..d74863d8c1 100644
--- a/lib/odbc/test/oracle.erl
+++ b/lib/odbc/test/oracle.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2002-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2002-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -108,10 +108,6 @@ create_text_table() ->
" (FIELD long)". %Oracle long is variable length char data
%-------------------------------------------------------------------------
-create_unicode_table() ->
- " (FIELD nvarchar(50))".
-
-%-------------------------------------------------------------------------
create_timestamp_table() ->
" (FIELD DATETIME)".
@@ -231,8 +227,8 @@ param_select() ->
%-------------------------------------------------------------------------
describe_integer() ->
- {ok,[{"INT1",{sql_decimal,38,0}},{"INT2",{sql_decimal,38,0}},
- {"INT3",{sql_decimal,38,0}}]}.
+ {ok,[{"MYINT1",{sql_decimal,38,0}},{"MYINT2",{sql_decimal,38,0}},
+ {"MYINT3",{sql_decimal,38,0}}]}.
describe_string() ->
{ok,[{"STR1",{sql_char,10}},
@@ -243,4 +239,4 @@ describe_string() ->
describe_floating() ->
{ok,[{"F",sql_double},{"R",sql_double},{"D",sql_double}]}.
describe_dec_num() ->
- {ok,[{"DEC",{sql_decimal,9,3}},{"NUM",{sql_decimal,9,2}}]}.
+ {ok,[{"MYDEC",{sql_decimal,9,3}},{"MYNUM",{sql_decimal,9,2}}]}.
diff --git a/lib/odbc/test/postgres.erl b/lib/odbc/test/postgres.erl
index 169ca26e43..d564dbd5ff 100644
--- a/lib/odbc/test/postgres.erl
+++ b/lib/odbc/test/postgres.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2006-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2006-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -30,7 +30,7 @@ connection_string() ->
{unix, sunos} ->
"DSN=Postgres;UID=odbctest";
{unix, linux} ->
- Size = erlang:system_info(wordsize),
+ Size = erlang:system_info({wordsize, external}),
linux_dist_connection_string(Size)
end.
@@ -43,7 +43,12 @@ linux_dist_connection_string(4) ->
end;
linux_dist_connection_string(_) ->
- "DSN=PostgresLinux64;UID=odbctest".
+ case linux_dist() of
+ "ubuntu" ->
+ "DSN=PostgresLinux64Ubuntu;UID=odbctest";
+ _ ->
+ "DSN=PostgresLinux64;UID=odbctest"
+ end.
linux_dist() ->
case file:read_file("/etc/issue") of
@@ -135,10 +140,6 @@ create_text_table() ->
" (FIELD text)".
%-------------------------------------------------------------------------
-create_unicode_table() ->
- " (FIELD text)".
-
-%-------------------------------------------------------------------------
create_timestamp_table() ->
" (FIELD TIMESTAMP)".
@@ -275,9 +276,9 @@ param_select() ->
%-------------------------------------------------------------------------
describe_integer() ->
- {ok,[{"int1",sql_smallint},
- {"int2",sql_integer},
- {"int3",sql_integer}]}.
+ {ok,[{"myint1",sql_smallint},
+ {"myint2",sql_integer},
+ {"myint3",sql_integer}]}.
describe_string() ->
{ok,[{"str1",{sql_char,10}},
@@ -288,7 +289,7 @@ describe_string() ->
describe_floating() ->
{ok,[{"f",sql_real},{"r",sql_real},{"d",{sql_float,15}}]}.
describe_dec_num() ->
- {ok,[{"dec",{sql_numeric,9,3}},{"num",{sql_numeric,9,2}}]}.
+ {ok,[{"mydec",{sql_numeric,9,3}},{"mynum",{sql_numeric,9,2}}]}.
describe_timestamp() ->
{ok, [{"field", sql_timestamp}]}.
diff --git a/lib/odbc/test/sqlserver.erl b/lib/odbc/test/sqlserver.erl
index e3fe30e0bc..59252d4276 100644
--- a/lib/odbc/test/sqlserver.erl
+++ b/lib/odbc/test/sqlserver.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2002-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2002-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -123,10 +123,6 @@ create_text_table() ->
" (FIELD text)".
%-------------------------------------------------------------------------
-create_unicode_table() ->
- " (FIELD nvarchar(50))".
-
-%-------------------------------------------------------------------------
create_timestamp_table() ->
" (FIELD DATETIME)".
@@ -279,8 +275,8 @@ param_select() ->
%-------------------------------------------------------------------------
describe_integer() ->
- {ok,[{"int1", sql_smallint},{"int2", sql_integer},
- {"int3", sql_integer}]}.
+ {ok,[{"myint1", sql_smallint},{"myint2", sql_integer},
+ {"myint3", sql_integer}]}.
describe_string() ->
{ok,[{"str1",{sql_char,10}},
@@ -292,7 +288,7 @@ describe_floating() ->
{ok,[{"f", sql_real},{"r", sql_real}, {"d", {sql_float, 53}}]}.
describe_dec_num() ->
- {ok,[{"dec",{sql_decimal,9,3}},{"num",{sql_numeric,9,2}}]}.
+ {ok,[{"mydec",{sql_decimal,9,3}},{"mynum",{sql_numeric,9,2}}]}.
describe_timestamp() ->
{ok, [{"field", sql_timestamp}]}.
diff --git a/lib/odbc/vsn.mk b/lib/odbc/vsn.mk
index 42a51be33e..120ed9ee3d 100644
--- a/lib/odbc/vsn.mk
+++ b/lib/odbc/vsn.mk
@@ -1 +1 @@
-ODBC_VSN = 2.10.10
+ODBC_VSN = 2.10.11
diff --git a/lib/orber/include/Makefile b/lib/orber/include/Makefile
deleted file mode 100644
index 219b7085e6..0000000000
--- a/lib/orber/include/Makefile
+++ /dev/null
@@ -1,66 +0,0 @@
-#
-# %CopyrightBegin%
-#
-# Copyright Ericsson AB 1998-2009. All Rights Reserved.
-#
-# The contents of this file are subject to the Erlang Public License,
-# Version 1.1, (the "License"); you may not use this file except in
-# compliance with the License. You should have received a copy of the
-# Erlang Public License along with this software. If not, it can be
-# retrieved online at http://www.erlang.org/.
-#
-# Software distributed under the License is distributed on an "AS IS"
-# basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-# the License for the specific language governing rights and limitations
-# under the License.
-#
-# %CopyrightEnd%
-#
-#
-include $(ERL_TOP)/make/target.mk
-
-include $(ERL_TOP)/make/$(TARGET)/otp.mk
-
-# ----------------------------------------------------
-# Application version
-# ----------------------------------------------------
-include ../vsn.mk
-VSN=$(ORBER_VSN)
-
-# ----------------------------------------------------
-# Release directory specification
-# ----------------------------------------------------
-RELSYSDIR = $(RELEASE_PATH)/lib/orber-$(VSN)
-
-# ----------------------------------------------------
-# Target Specs
-# ----------------------------------------------------
-
-EXTERNAL_HRL_FILES= ../include/corba.hrl \
- ../include/ifr_types.hrl \
- ../include/orber_pi.hrl
-
-# ----------------------------------------------------
-# FLAGS
-# ----------------------------------------------------
-
-# ----------------------------------------------------
-# Targets
-# ----------------------------------------------------
-debug opt clean docs:
-
-
-# ----------------------------------------------------
-# Release Target
-# ----------------------------------------------------
-include $(ERL_TOP)/make/otp_release_targets.mk
-
-
-release_spec: opt
- $(INSTALL_DIR) $(RELSYSDIR)/include
- $(INSTALL_DATA) $(EXTERNAL_HRL_FILES) $(RELSYSDIR)/include
-
-
-release_docs_spec:
-
-
diff --git a/lib/os_mon/c_src/cpu_sup.c b/lib/os_mon/c_src/cpu_sup.c
index fbf318c614..e3bdbd1489 100644
--- a/lib/os_mon/c_src/cpu_sup.c
+++ b/lib/os_mon/c_src/cpu_sup.c
@@ -191,7 +191,10 @@ int main(int argc, char** argv) {
static cpu_t *read_procstat(FILE *fp, cpu_t *cpu) {
char buffer[BUFFERSIZE];
- fgets(buffer, BUFFERSIZE, fp);
+ if (fgets(buffer, BUFFERSIZE, fp) == NULL) {
+ memset(cpu, 0, sizeof(cpu_t));
+ return cpu;
+ }
sscanf(buffer, "cpu%u %Lu %Lu %Lu %Lu %Lu %Lu %Lu %Lu",
&(cpu->id),
&(cpu->user),
@@ -223,7 +226,11 @@ static void util_measure(unsigned int **result_vec, int *result_sz) {
return;
}
- fgets(buffer, BUFFERSIZE, fp); /*ignore read*/
+ /*ignore read*/
+ if (fgets(buffer, BUFFERSIZE, fp) == NULL) {
+ *result_sz = 0;
+ return;
+ }
rv = *result_vec;
rv[0] = no_of_cpus;
rv[1] = CU_VALUES;
@@ -447,8 +454,12 @@ static void sendv(unsigned int data[], int ints) {
}
static void error(char* err_msg) {
- write(FD_ERR, err_msg, strlen(err_msg));
- write(FD_ERR, "\n", 1);
+ /*
+ * if we get error here we have trouble,
+ * silence unnecessary warnings
+ */
+ if(write(FD_ERR, err_msg, strlen(err_msg)));
+ if(write(FD_ERR, "\n", 1));
exit(-1);
}
diff --git a/lib/parsetools/doc/src/leex.xml b/lib/parsetools/doc/src/leex.xml
index 12abfd244f..1fa426a79e 100644
--- a/lib/parsetools/doc/src/leex.xml
+++ b/lib/parsetools/doc/src/leex.xml
@@ -79,6 +79,10 @@ Token = tuple()</code>
<item><p>Causes warnings to be printed as they occur. Default is
<c>true</c>.</p>
</item>
+ <tag><c>warnings_as_errors</c></tag>
+ <item>
+ <p>Causes warnings to be treated as errors.</p>
+ </item>
<tag><c>{report, bool()}</c></tag>
<item><p>This is a short form for both <c>report_errors</c> and
<c>report_warnings</c>.</p>
diff --git a/lib/parsetools/doc/src/yecc.xml b/lib/parsetools/doc/src/yecc.xml
index 81f1550b0a..1d2a985d7d 100644
--- a/lib/parsetools/doc/src/yecc.xml
+++ b/lib/parsetools/doc/src/yecc.xml
@@ -95,6 +95,10 @@
<item>This is a short form for both <c>report_errors</c> and
<c>report_warnings</c>.
</item>
+ <tag><c>warnings_as_errors</c></tag>
+ <item>
+ <p>Causes warnings to be treated as errors.</p>
+ </item>
<tag><c>{return_errors, bool()}</c>.</tag>
<item>If this flag is set, <c>{error, Errors, Warnings}</c>
is returned when there are errors. Default is
@@ -421,9 +425,9 @@ myparser:parse_and_scan({Mod, Tokenizer, Args}) </code>
Nonterminals E T F.
Terminals '+' '*' '(' ')' number.
Rootsymbol E.
-E -> E '+' T: ['$1', '$2', '$3'].
+E -> E '+' T: ['$2', '$1', '$3'].
E -> T : '$1'.
-T -> T '*' F: ['$1', '$2', '$3'].
+T -> T '*' F: ['$2', '$1', '$3'].
T -> F : '$1'.
F -> '(' E ')' : '$2'.
F -> number : '$1'. </code>
@@ -434,8 +438,8 @@ Terminals '+' '*' '(' ')' number.
Rootsymbol E.
Left 100 '+'.
Left 200 '*'.
-E -> E '+' E : ['$1', '$2', '$3'].
-E -> E '*' E : ['$1', '$2', '$3'].
+E -> E '+' E : ['$2', '$1', '$3'].
+E -> E '*' E : ['$2', '$1', '$3'].
E -> '(' E ')' : '$2'.
E -> number : '$1'. </code>
<p>3. An overloaded minus operator:</p>
diff --git a/lib/parsetools/src/leex.erl b/lib/parsetools/src/leex.erl
index d0b4b9efe7..cdf20461d9 100644
--- a/lib/parsetools/src/leex.erl
+++ b/lib/parsetools/src/leex.erl
@@ -35,7 +35,7 @@
-export([compile/3,file/1,file/2,format_error/1]).
-import(lists, [member/2,reverse/1,sort/1,delete/2,
- keysort/2,keydelete/3,keyfind/3,
+ keysort/2,keydelete/3,
map/2,foldl/3,foreach/2,flatmap/2]).
-import(string, [substr/2,substr/3,span/2]).
-import(ordsets, [is_element/2,add_element/2,union/2]).
@@ -58,7 +58,7 @@
gfile=[], % Graph file
module, % Module name
opts=[], % Options
- posix=false, % POSIX regular expressions
+ % posix=false, % POSIX regular expressions
errors=[],
warnings=[]
}).
@@ -73,12 +73,15 @@
%%% Interface to erl_compile.
compile(Input0, Output0,
- #options{warning = WarnLevel, verbose=Verbose, includes=Includes}) ->
+ #options{warning = WarnLevel, verbose=Verbose, includes=Includes,
+ specific=Specific}) ->
Input = assure_extension(shorten_filename(Input0), ".xrl"),
Output = assure_extension(shorten_filename(Output0), ".erl"),
Includefile = lists:sublist(Includes, 1),
+ Werror = proplists:get_bool(warnings_as_errors, Specific),
Opts = [{scannerfile,Output},{includefile,Includefile},{verbose,Verbose},
- {report_errors,true},{report_warnings,WarnLevel > 0}],
+ {report_errors,true},{report_warnings,WarnLevel > 0},
+ {warnings_as_errors, Werror}],
case file(Input, Opts) of
{ok, _} ->
ok;
@@ -107,10 +110,15 @@ file(File, Opts0) ->
St = try
{ok,REAs,Actions,Code,St2} = parse_file(St1),
{DFA,DF} = make_dfa(REAs, St2),
- St3 = out_file(St2, DFA, DF, Actions, Code),
- case lists:member(dfa_graph, St3#leex.opts) of
- true -> out_dfa_graph(St3, DFA, DF);
- false -> St3
+ case werror(St2) of
+ false ->
+ St3 = out_file(St2, DFA, DF, Actions, Code),
+ case lists:member(dfa_graph, St3#leex.opts) of
+ true -> out_dfa_graph(St3, DFA, DF);
+ false -> St3
+ end;
+ true ->
+ St2
end
catch #leex{}=St4 ->
St4
@@ -131,8 +139,8 @@ format_error({regexp,E})->
"unterminated " ++ Cs;
{illegal_char,Cs} ->
"illegal character " ++ Cs;
- {posix_cc,What} ->
- ["illegal POSIX character class ",io_lib:write_string(What)];
+%% {posix_cc,What} ->
+%% ["illegal POSIX character class ",io_lib:write_string(What)];
{char_class,What} ->
["illegal character class ",io_lib:write_string(What)]
end,
@@ -163,7 +171,8 @@ options(Options0) when is_list(Options0) ->
(T) -> [T]
end, Options0),
options(Options, [scannerfile,includefile,report_errors,
- report_warnings,return_errors,return_warnings,
+ report_warnings,warnings_as_errors,
+ return_errors,return_warnings,
verbose,dfa_graph], [])
catch error: _ -> badarg
end;
@@ -217,6 +226,7 @@ default_option(dfa_graph) -> false;
default_option(includefile) -> [];
default_option(report_errors) -> true;
default_option(report_warnings) -> true;
+default_option(warnings_as_errors) -> false;
default_option(return_errors) -> false;
default_option(return_warnings) -> false;
default_option(scannerfile) -> [];
@@ -225,6 +235,7 @@ default_option(verbose) -> false.
atom_option(dfa_graph) -> {dfa_graph,true};
atom_option(report_errors) -> {report_errors,true};
atom_option(report_warnings) -> {report_warnings,true};
+atom_option(warnings_as_errors) -> {warnings_as_errors,true};
atom_option(return_errors) -> {return_errors,true};
atom_option(return_warnings) -> {return_warnings,true};
atom_option(verbose) -> {verbose,true};
@@ -251,19 +262,29 @@ leex_ret(St) ->
report_warnings(St),
Es = pack_errors(St#leex.errors),
Ws = pack_warnings(St#leex.warnings),
+ Werror = werror(St),
if
+ Werror ->
+ do_error_return(St, Es, Ws);
Es =:= [] ->
case member(return_warnings, St#leex.opts) of
true -> {ok, St#leex.efile, Ws};
false -> {ok, St#leex.efile}
end;
- true ->
- case member(return_errors, St#leex.opts) of
- true -> {error, Es, Ws};
- false -> error
- end
+ true ->
+ do_error_return(St, Es, Ws)
+ end.
+
+do_error_return(St, Es, Ws) ->
+ case member(return_errors, St#leex.opts) of
+ true -> {error, Es, Ws};
+ false -> error
end.
+werror(St) ->
+ St#leex.warnings =/= []
+ andalso member(warnings_as_errors, St#leex.opts).
+
pack_errors([{File,_} | _] = Es) ->
[{File, flatmap(fun({_,E}) -> [E] end, sort(Es))}];
pack_errors([]) ->
@@ -286,16 +307,26 @@ report_errors(St) ->
end, report_errors, St#leex.opts).
report_warnings(St) ->
- when_opt(fun () ->
- foreach(fun({File,{none,Mod,W}}) ->
- io:fwrite("~s: Warning: ~s\n",
- [File,Mod:format_error(W)]);
- ({File,{Line,Mod,W}}) ->
- io:fwrite("~s:~w: Warning: ~s\n",
- [File,Line,Mod:format_error(W)])
- end, sort(St#leex.warnings))
- end, report_warnings, St#leex.opts).
-
+ Werror = member(warnings_as_errors, St#leex.opts),
+ Prefix = case Werror of
+ true -> "";
+ false -> "Warning: "
+ end,
+ ReportWerror = Werror andalso member(report_errors, St#leex.opts),
+ ShouldReport = member(report_warnings, St#leex.opts) orelse ReportWerror,
+ when_bool(fun () ->
+ foreach(fun({File,{none,Mod,W}}) ->
+ io:fwrite("~s: ~s~s\n",
+ [File,Prefix,
+ Mod:format_error(W)]);
+ ({File,{Line,Mod,W}}) ->
+ io:fwrite("~s:~w: ~s~s\n",
+ [File,Line,Prefix,
+ Mod:format_error(W)])
+ end, sort(St#leex.warnings))
+ end, ShouldReport).
+
+-spec add_error(_, #leex{}) -> no_return().
add_error(E, St) ->
add_error(St#leex.xfile, E, St).
@@ -341,6 +372,12 @@ when_opt(Do, Opt, Opts) ->
false -> ok
end.
+when_bool(Do, Bool) ->
+ case Bool of
+ true -> Do();
+ false -> ok
+ end.
+
verbose_print(St, Format, Args) ->
when_opt(fun () -> io:fwrite(Format, Args) end, verbose, St#leex.opts).
@@ -644,14 +681,14 @@ re_repeat1([$*|Cs], Sn, S, St) -> re_repeat1(Cs, Sn, {kclosure,S}, St);
re_repeat1([$+|Cs], Sn, S, St) -> re_repeat1(Cs, Sn, {pclosure,S}, St);
re_repeat1([$?|Cs], Sn, S, St) -> re_repeat1(Cs, Sn, {optional,S}, St);
%% { only starts interval when ere is true, otherwise normal character.
-re_repeat1([${|Cs0], Sn, S, #leex{posix=true}=St) -> % $}
- case re_interval_range(Cs0) of
- {Min,Max,[$}|Cs1]} when is_integer(Min), is_integer(Max), Min =< Max ->
- re_repeat1(Cs1, Sn, {interval,S,Min,Max}, St);
- {Min,Max,[$}|Cs1]} when is_integer(Min), is_atom(Max) ->
- re_repeat1(Cs1, Sn, {interval,S,Min,Max}, St);
- {_,_,Cs1} -> parse_error({interval_range,string_between([${|Cs0], Cs1)})
- end;
+%% re_repeat1([${|Cs0], Sn, S, #leex{posix=true}=St) -> % $}
+%% case re_interval_range(Cs0) of
+%% {Min,Max,[$}|Cs1]} when is_integer(Min), is_integer(Max), Min =< Max ->
+%% re_repeat1(Cs1, Sn, {interval,S,Min,Max}, St);
+%% {Min,Max,[$}|Cs1]} when is_integer(Min), is_atom(Max) ->
+%% re_repeat1(Cs1, Sn, {interval,S,Min,Max}, St);
+%% {_,_,Cs1} -> parse_error({interval_range,string_between([${|Cs0], Cs1)})
+%% end;
re_repeat1(Cs, Sn, S, _) -> {S,Sn,Cs}.
%% re_single(Chars, SubNumber, State) -> {RegExp,SubNumber,Chars}.
@@ -733,7 +770,7 @@ special_char($|, _) -> true;
special_char($*, _) -> true;
special_char($+, _) -> true;
special_char($?, _) -> true;
-special_char(${, #leex{posix=true}) -> true; % Only when POSIX set
+%% special_char(${, #leex{posix=true}) -> true; % Only when POSIX set
special_char($\\, _) -> true;
special_char(_, _) -> false.
@@ -744,12 +781,12 @@ re_char_class([$]|Cs], St) -> % Must special case this.
re_char_class(Cs, [$]], St);
re_char_class(Cs, St) -> re_char_class(Cs, [], St).
-re_char_class("[:" ++ Cs0, Cc, #leex{posix=true}=St) ->
- %% POSIX char class only.
- case posix_cc(Cs0) of
- {Pcl,":]" ++ Cs1} -> re_char_class(Cs1, [{posix,Pcl}|Cc], St);
- {_,Cs1} -> parse_error({posix_cc,string_between(Cs0, Cs1)})
- end;
+%% re_char_class("[:" ++ Cs0, Cc, #leex{posix=true}=St) ->
+%% %% POSIX char class only.
+%% case posix_cc(Cs0) of
+%% {Pcl,":]" ++ Cs1} -> re_char_class(Cs1, [{posix,Pcl}|Cc], St);
+%% {_,Cs1} -> parse_error({posix_cc,string_between(Cs0, Cs1)})
+%% end;
re_char_class([C1|Cs0], Cc, St) when C1 =/= $] ->
case re_char(C1, Cs0) of
{Cf,[$-,C2|Cs1]} when C2 =/= $] ->
@@ -766,19 +803,19 @@ re_char_class(Cs, Cc, _) -> {reverse(Cc),Cs}. % Preserve order
%% posix_cc(String) -> {PosixClass,RestString}.
%% Handle POSIX character classes.
-posix_cc("alnum" ++ Cs) -> {alnum,Cs};
-posix_cc("alpha" ++ Cs) -> {alpha,Cs};
-posix_cc("blank" ++ Cs) -> {blank,Cs};
-posix_cc("cntrl" ++ Cs) -> {cntrl,Cs};
-posix_cc("digit" ++ Cs) -> {digit,Cs};
-posix_cc("graph" ++ Cs) -> {graph,Cs};
-posix_cc("lower" ++ Cs) -> {lower,Cs};
-posix_cc("print" ++ Cs) -> {print,Cs};
-posix_cc("punct" ++ Cs) -> {punct,Cs};
-posix_cc("space" ++ Cs) -> {space,Cs};
-posix_cc("upper" ++ Cs) -> {upper,Cs};
-posix_cc("xdigit" ++ Cs) -> {xdigit,Cs};
-posix_cc(Cs) -> parse_error({posix_cc,substr(Cs, 1, 5)}).
+%% posix_cc("alnum" ++ Cs) -> {alnum,Cs};
+%% posix_cc("alpha" ++ Cs) -> {alpha,Cs};
+%% posix_cc("blank" ++ Cs) -> {blank,Cs};
+%% posix_cc("cntrl" ++ Cs) -> {cntrl,Cs};
+%% posix_cc("digit" ++ Cs) -> {digit,Cs};
+%% posix_cc("graph" ++ Cs) -> {graph,Cs};
+%% posix_cc("lower" ++ Cs) -> {lower,Cs};
+%% posix_cc("print" ++ Cs) -> {print,Cs};
+%% posix_cc("punct" ++ Cs) -> {punct,Cs};
+%% posix_cc("space" ++ Cs) -> {space,Cs};
+%% posix_cc("upper" ++ Cs) -> {upper,Cs};
+%% posix_cc("xdigit" ++ Cs) -> {xdigit,Cs};
+%% posix_cc(Cs) -> parse_error({posix_cc,substr(Cs, 1, 5)}).
escape_char($n) -> $\n; % \n = LF
escape_char($r) -> $\r; % \r = CR
@@ -797,24 +834,24 @@ escape_char(C) -> C. % Pass it straight through
%% Int, -> Int,any
%% Int1,Int2 -> Int1,Int2
-re_interval_range(Cs0) ->
- case re_number(Cs0) of
- {none,Cs1} -> {none,none,Cs1};
- {N,[$,|Cs1]} ->
- case re_number(Cs1) of
- {none,Cs2} -> {N,any,Cs2};
- {M,Cs2} -> {N,M,Cs2}
- end;
- {N,Cs1} -> {N,none,Cs1}
- end.
+%% re_interval_range(Cs0) ->
+%% case re_number(Cs0) of
+%% {none,Cs1} -> {none,none,Cs1};
+%% {N,[$,|Cs1]} ->
+%% case re_number(Cs1) of
+%% {none,Cs2} -> {N,any,Cs2};
+%% {M,Cs2} -> {N,M,Cs2}
+%% end;
+%% {N,Cs1} -> {N,none,Cs1}
+%% end.
-re_number([C|Cs]) when C >= $0, C =< $9 ->
- re_number(Cs, C - $0);
-re_number(Cs) -> {none,Cs}.
+%% re_number([C|Cs]) when C >= $0, C =< $9 ->
+%% re_number(Cs, C - $0);
+%% re_number(Cs) -> {none,Cs}.
-re_number([C|Cs], Acc) when C >= $0, C =< $9 ->
- re_number(Cs, 10*Acc + (C - $0));
-re_number(Cs, Acc) -> {Acc,Cs}.
+%% re_number([C|Cs], Acc) when C >= $0, C =< $9 ->
+%% re_number(Cs, 10*Acc + (C - $0));
+%% re_number(Cs, Acc) -> {Acc,Cs}.
string_between(Cs1, Cs2) ->
substr(Cs1, 1, length(Cs1)-length(Cs2)).
diff --git a/lib/parsetools/src/yecc.erl b/lib/parsetools/src/yecc.erl
index 4119e2631b..354d56527d 100644
--- a/lib/parsetools/src/yecc.erl
+++ b/lib/parsetools/src/yecc.erl
@@ -133,12 +133,15 @@
%%% Interface to erl_compile.
compile(Input0, Output0,
- #options{warning = WarnLevel, verbose=Verbose, includes=Includes}) ->
+ #options{warning = WarnLevel, verbose=Verbose, includes=Includes,
+ specific=Specific}) ->
Input = shorten_filename(Input0),
Output = shorten_filename(Output0),
Includefile = lists:sublist(Includes, 1),
+ Werror = proplists:get_bool(warnings_as_errors, Specific),
Opts = [{parserfile,Output}, {includefile,Includefile}, {verbose,Verbose},
- {report_errors, true}, {report_warnings, WarnLevel > 0}],
+ {report_errors, true}, {report_warnings, WarnLevel > 0},
+ {warnings_as_errors, Werror}],
case file(Input, Opts) of
{ok, _OutFile} ->
ok;
@@ -278,8 +281,8 @@ options(Options0) when is_list(Options0) ->
(T) -> [T]
end, Options0),
options(Options, [file_attributes, includefile, parserfile,
- report_errors, report_warnings, return_errors,
- return_warnings, time, verbose], [])
+ report_errors, report_warnings, warnings_as_errors,
+ return_errors, return_warnings, time, verbose], [])
catch error: _ -> badarg
end;
options(Option) ->
@@ -333,6 +336,7 @@ default_option(includefile) -> [];
default_option(parserfile) -> [];
default_option(report_errors) -> true;
default_option(report_warnings) -> true;
+default_option(warnings_as_errors) -> false;
default_option(return_errors) -> false;
default_option(return_warnings) -> false;
default_option(time) -> false;
@@ -341,6 +345,7 @@ default_option(verbose) -> false.
atom_option(file_attributes) -> {file_attributes, true};
atom_option(report_errors) -> {report_errors, true};
atom_option(report_warnings) -> {report_warnings, true};
+atom_option(warnings_as_errors) -> {warnings_as_errors,true};
atom_option(return_errors) -> {return_errors, true};
atom_option(return_warnings) -> {return_warnings, true};
atom_option(time) -> {time, true};
@@ -409,12 +414,16 @@ infile(Parent, Infilex, Options) ->
{error, Reason} ->
add_error(St0#yecc.infile, none, {file_error, Reason}, St0)
end,
- case St#yecc.errors of
- [] -> ok;
+ case {St#yecc.errors, werror(St)} of
+ {[], false} -> ok;
_ -> _ = file:delete(St#yecc.outfile)
end,
Parent ! {self(), yecc_ret(St)}.
+werror(St) ->
+ St#yecc.warnings =/= []
+ andalso member(warnings_as_errors, St#yecc.options).
+
outfile(St0) ->
case file:open(St0#yecc.outfile, [write, delayed_write]) of
{ok, Outport} ->
@@ -777,17 +786,23 @@ yecc_ret(St0) ->
report_warnings(St),
Es = pack_errors(St#yecc.errors),
Ws = pack_warnings(St#yecc.warnings),
+ Werror = werror(St),
if
+ Werror ->
+ do_error_return(St, Es, Ws);
Es =:= [] ->
case member(return_warnings, St#yecc.options) of
true -> {ok, St#yecc.outfile, Ws};
false -> {ok, St#yecc.outfile}
end;
true ->
- case member(return_errors, St#yecc.options) of
- true -> {error, Es, Ws};
- false -> error
- end
+ do_error_return(St, Es, Ws)
+ end.
+
+do_error_return(St, Es, Ws) ->
+ case member(return_errors, St#yecc.options) of
+ true -> {error, Es, Ws};
+ false -> error
end.
check_expected(St0) ->
@@ -837,14 +852,22 @@ report_errors(St) ->
end.
report_warnings(St) ->
- case member(report_warnings, St#yecc.options) of
+ Werror = member(warnings_as_errors, St#yecc.options),
+ Prefix = case Werror of
+ true -> "";
+ false -> "Warning: "
+ end,
+ ReportWerror = Werror andalso member(report_errors, St#yecc.options),
+ case member(report_warnings, St#yecc.options) orelse ReportWerror of
true ->
foreach(fun({File,{none,Mod,W}}) ->
- io:fwrite(<<"~s: Warning: ~s\n">>,
- [File,Mod:format_error(W)]);
+ io:fwrite(<<"~s: ~s~s\n">>,
+ [File,Prefix,
+ Mod:format_error(W)]);
({File,{Line,Mod,W}}) ->
- io:fwrite(<<"~s:~w: Warning: ~s\n">>,
- [File,Line,Mod:format_error(W)])
+ io:fwrite(<<"~s:~w: ~s~s\n">>,
+ [File,Line,Prefix,
+ Mod:format_error(W)])
end, sort(St#yecc.warnings));
false ->
ok
diff --git a/lib/parsetools/test/leex_SUITE.erl b/lib/parsetools/test/leex_SUITE.erl
index 23ad16f98d..1e50aedf07 100644
--- a/lib/parsetools/test/leex_SUITE.erl
+++ b/lib/parsetools/test/leex_SUITE.erl
@@ -152,6 +152,24 @@ file(Config) when is_list(Config) ->
?line writable(Dotfile),
file:delete(Dotfile),
+ ok = file:delete(Scannerfile),
+ Warn = <<"Definitions.1998\n"
+ "D = [0-9]\n"
+ "Rules.\n"
+ "{L}+ : {token,{word,TokenLine,TokenChars}}.\n"
+ "Erlang code.\n">>,
+ ok = file:write_file(Filename, Warn),
+ error = leex:file(Filename, [warnings_as_errors]),
+ false = filelib:is_regular(Scannerfile),
+ error = leex:file(Filename, [return_warnings,warnings_as_errors]),
+ false = filelib:is_regular(Scannerfile),
+ {error,_,[{Filename,[{1,leex,ignored_characters}]}]} =
+ leex:file(Filename, [return_errors,warnings_as_errors]),
+ false = filelib:is_regular(Scannerfile),
+ {ok,Scannerfile,[{Filename,[{1,leex,ignored_characters}]}]} =
+ leex:file(Filename, [return_warnings]),
+ true = filelib:is_regular(Scannerfile),
+
file:delete(Filename),
ok.
@@ -551,7 +569,7 @@ ex2(Config) when is_list(Config) ->
<<"
%%% File : erlang_scan.xrl
%%% Author : Robert Virding
-%%% Purpose : Tkoen definitions for Erlang.
+%%% Purpose : Token definitions for Erlang.
Definitions.
O = [0-7]
diff --git a/lib/parsetools/test/yecc_SUITE.erl b/lib/parsetools/test/yecc_SUITE.erl
index 1de87b3bff..a5f66b48e9 100644
--- a/lib/parsetools/test/yecc_SUITE.erl
+++ b/lib/parsetools/test/yecc_SUITE.erl
@@ -173,6 +173,7 @@ syntax(Config) when is_list(Config) ->
%% Report errors. Very simple test of format_error/1.
Ret = [return, {report, true}],
Filename = filename:join(Dir, "file.yrl"),
+ Parserfile = filename:join(Dir, "file.erl"),
Parserfile1 = filename:join(Dir, "a file"),
?line ok = file:write_file(Filename, <<"">>),
@@ -247,6 +248,19 @@ syntax(Config) when is_list(Config) ->
?line {ok,_,[{_,[{2,yecc,bad_declaration}]}]} =
yecc:file(Filename, Ret),
+ %% Bad declaration with warnings_as_errors.
+ ok = file:delete(Parserfile),
+ error = yecc:file(Filename, [warnings_as_errors]),
+ false = filelib:is_regular(Parserfile),
+ error = yecc:file(Filename, [return_warnings,warnings_as_errors]),
+ false = filelib:is_regular(Parserfile),
+ {error,_,[{_,[{2,yecc,bad_declaration}]}]} =
+ yecc:file(Filename, [return_errors,warnings_as_errors]),
+ false = filelib:is_regular(Parserfile),
+ {ok,_,[{_,[{2,yecc,bad_declaration}]}]} =
+ yecc:file(Filename, [return_warnings]),
+ true = filelib:is_regular(Parserfile),
+
%% Bad declaration.
?line ok = file:write_file(Filename,
<<"Nonterminals nt. Terminals t.
diff --git a/lib/percept/src/percept_db.erl b/lib/percept/src/percept_db.erl
index 52e9afb78f..61b68ce44f 100644
--- a/lib/percept/src/percept_db.erl
+++ b/lib/percept/src/percept_db.erl
@@ -92,7 +92,7 @@ restart(PerceptDB)->
stop_sync(PerceptDB),
do_start().
-%% @spec do_start(pid()) -> pid()
+%% @spec do_start() -> pid()
%% @private
%% @doc starts the percept database.
@@ -131,6 +131,7 @@ stop_sync(Pid)->
{'DOWN', MonitorRef, _Type, Pid, _Info}->
true
after ?STOP_TIMEOUT->
+ erlang:demonitor(MonitorRef, [flush]),
exit(Pid, kill)
end.
@@ -166,14 +167,14 @@ insert(Trace) ->
select(Query) ->
percept_db ! {select, self(), Query},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec select(atom(), list()) -> Result
%% @equiv select({Table,Options})
select(Table, Options) ->
percept_db ! {select, self(), {Table, Options}},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec consolidate() -> Result
%% @doc Checks timestamp and state-flow inconsistencies in the
@@ -213,7 +214,7 @@ loop_percept_db() ->
insert_trace(clean_trace(Trace)),
loop_percept_db();
{select, Pid, Query} ->
- Pid ! select_query(Query),
+ Pid ! {result, select_query(Query)},
loop_percept_db();
{action, stop} ->
stopped;
@@ -222,7 +223,7 @@ loop_percept_db() ->
loop_percept_db();
{operate, Pid, {Table, {Fun, Start}}} ->
Result = ets:foldl(Fun, Start, Table),
- Pid ! Result,
+ Pid ! {result, Result},
loop_percept_db();
Unhandled ->
io:format("loop_percept_db, unhandled query: ~p~n", [Unhandled]),
diff --git a/lib/public_key/asn1/README b/lib/public_key/asn1/README
index 5fb8cf9725..2a880e2d51 100644
--- a/lib/public_key/asn1/README
+++ b/lib/public_key/asn1/README
@@ -46,6 +46,6 @@ diff -r1.1 PKIXAttributeCertificate.asn1
---
> version AttCertVersion, -- version is v2
-4. Defenitions of publuic keys from PKCS-1.asn1 present in
+4. Definitions of public keys from PKCS-1.asn1 present in
PKIX1Algorithms88.asn1 where removed as we take them directly from
PKCS-1.asn1 \ No newline at end of file
diff --git a/lib/public_key/doc/src/public_key.xml b/lib/public_key/doc/src/public_key.xml
index d60d91cd83..b3ce49e2ca 100644
--- a/lib/public_key/doc/src/public_key.xml
+++ b/lib/public_key/doc/src/public_key.xml
@@ -63,7 +63,7 @@
<p><code>pki_asn1_type() = 'Certificate' | 'RSAPrivateKey'| 'RSAPublicKey'
'DSAPrivateKey' | 'DSAPublicKey' | 'DHParameter' | 'SubjectPublicKeyInfo'</code></p>
- <p><code>pem_entry () = {pki_asn1_type(), binary() %% DER or encrypted DER
+ <p><code>pem_entry () = {pki_asn1_type(), binary(), %% DER or encrypted DER
not_encrypted | {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}}.</code></p>
<p><code>rsa_public_key() = #'RSAPublicKey'{}</code></p>
@@ -72,8 +72,6 @@
<p><code>dsa_public_key() = {integer(), #'Dss-Parms'{}} </code></p>
- <p><code>rsa_private_key() = #'RSAPrivateKey'{} </code></p>
-
<p><code>dsa_private_key() = #'DSAPrivateKey'{}</code></p>
<p><code> public_crypt_options() = [{rsa_pad, rsa_padding()}]. </code></p>
@@ -81,7 +79,7 @@
<p><code> rsa_padding() = 'rsa_pkcs1_padding' | 'rsa_pkcs1_oaep_padding'
| 'rsa_no_padding'</code></p>
- <p><code> rsa_digest_type() = 'md5' | 'sha' </code></p>
+ <p><code> rsa_digest_type() = 'md2' | 'md5' | 'sha' </code></p>
<p><code> dss_digest_type() = 'none' | 'sha' </code></p>
@@ -149,7 +147,7 @@
<name>der_decode(Asn1type, Der) -> term()</name>
<fsummary> Decodes a public key asn1 der encoded entity.</fsummary>
<type>
- <v>Asn1Type = atom() -</v>
+ <v>Asn1Type = atom()</v>
<d> ASN.1 type present in the public_key applications
asn1 specifications.</d>
<v>Der = der_encoded()</v>
@@ -166,7 +164,8 @@
<v>Asn1Type = atom()</v>
<d> Asn1 type present in the public_key applications
ASN.1 specifications.</d>
- <v>Entity = term() - The erlang representation of <c> Asn1Type</c></v>
+ <v>Entity = term()</v>
+ <d>The erlang representation of <c>Asn1Type</c></d>
</type>
<desc>
<p> Encodes a public key entity with ASN.1 DER encoding.</p>
@@ -218,12 +217,13 @@
<fsummary> Creates a pem entry that can be fed to pem_encode/1.</fsummary>
<type>
<v>Asn1Type = pki_asn1_type()</v>
- <v>Entity = term() - The Erlang representation of
+ <v>Entity = term()</v>
+ <d>The Erlang representation of
<c>Asn1Type</c>. If <c>Asn1Type</c> is 'SubjectPublicKeyInfo'
then <c>Entity</c> must be either an rsa_public_key() or a
dsa_public_key() and this function will create the appropriate
'SubjectPublicKeyInfo' entry.
- </v>
+ </d>
<v>CipherInfo = {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}</v>
<v>Password = string()</v>
</type>
@@ -281,7 +281,7 @@
<desc>
<p>Der encodes a pkix x509 certificate or part of such a
certificate. This function must be used for encoding certificates or parts of certificates
- that are decoded/created on the otp format, whereas for the plain format this
+ that are decoded/created in the otp format, whereas for the plain format this
function will directly call der_encode/2. </p>
</desc>
</func>
diff --git a/lib/public_key/src/pubkey_cert.erl b/lib/public_key/src/pubkey_cert.erl
index 5ab9642279..61082a1ec5 100644
--- a/lib/public_key/src/pubkey_cert.erl
+++ b/lib/public_key/src/pubkey_cert.erl
@@ -38,7 +38,7 @@
%%====================================================================
%%--------------------------------------------------------------------
--spec verify_data(DER::binary()) -> {md5 | sha, binary(), binary()}.
+-spec verify_data(DER::binary()) -> {md2 | md5 | sha, binary(), binary()}.
%%
%% Description: Extracts data from DerCert needed to call public_key:verify/4.
%%--------------------------------------------------------------------
@@ -378,6 +378,8 @@ digest_type(?sha1WithRSAEncryption) ->
sha;
digest_type(?md5WithRSAEncryption) ->
md5;
+digest_type(?md2WithRSAEncryption) ->
+ md2;
digest_type(?'id-dsa-with-sha1') ->
sha.
diff --git a/lib/public_key/src/public_key.appup.src b/lib/public_key/src/public_key.appup.src
index 4986801dad..18fae54d18 100644
--- a/lib/public_key/src/public_key.appup.src
+++ b/lib/public_key/src/public_key.appup.src
@@ -1,6 +1,12 @@
%% -*- erlang -*-
{"%VSN%",
[
+ {"0.12",
+ [
+ {update, public_key, soft, soft_purge, soft_purge, []},
+ {update, pubkey_cert, soft, soft_purge, soft_purge, []},
+ ]
+ },
{"0.11",
[
{update, public_key, soft, soft_purge, soft_purge, []},
@@ -35,6 +41,12 @@
}
],
[
+ {"0.12",
+ [
+ {update, public_key, soft, soft_purge, soft_purge, []},
+ {update, pubkey_cert, soft, soft_purge, soft_purge, []},
+ ]
+ },
{"0.11",
[
{update, public_key, soft, soft_purge, soft_purge, []},
diff --git a/lib/public_key/src/public_key.erl b/lib/public_key/src/public_key.erl
index 2901020e83..940efffcd0 100644
--- a/lib/public_key/src/public_key.erl
+++ b/lib/public_key/src/public_key.erl
@@ -55,7 +55,7 @@
-type rsa_padding() :: 'rsa_pkcs1_padding' | 'rsa_pkcs1_oaep_padding'
| 'rsa_no_padding'.
-type public_crypt_options() :: [{rsa_pad, rsa_padding()}].
--type rsa_digest_type() :: 'md5' | 'sha'.
+-type rsa_digest_type() :: 'md2' | 'md5' | 'sha'.
-type dss_digest_type() :: 'none' | 'sha'.
-define(UINT32(X), X:32/unsigned-big-integer).
@@ -307,7 +307,8 @@ encrypt_private(PlainText, #'RSAPrivateKey'{modulus = N,
sign(PlainText, DigestType, #'RSAPrivateKey'{modulus = N, publicExponent = E,
privateExponent = D})
when is_binary(PlainText),
- (DigestType == md5 orelse
+ (DigestType == md2 orelse
+ DigestType == md5 orelse
DigestType == sha) ->
crypto:rsa_sign(DigestType, sized_binary(PlainText), [crypto:mpint(E),
@@ -335,7 +336,10 @@ sign(PlainText, sha, #'DSAPrivateKey'{p = P, q = Q, g = G, x = X})
%%--------------------------------------------------------------------
verify(PlainText, DigestType, Signature,
#'RSAPublicKey'{modulus = Mod, publicExponent = Exp})
- when is_binary (PlainText), DigestType == sha; DigestType == md5 ->
+ when is_binary(PlainText),
+ (DigestType == md2 orelse
+ DigestType == md5 orelse
+ DigestType == sha) ->
crypto:rsa_verify(DigestType,
sized_binary(PlainText),
sized_binary(Signature),
@@ -488,9 +492,10 @@ pkix_path_validation(PathErr, [Cert | Chain], Options0) when is_atom(PathErr)->
_:_ ->
{error, Reason}
end;
-pkix_path_validation(TrustedCert, CertChain, Options) when
- is_binary(TrustedCert) -> OtpCert = pkix_decode_cert(TrustedCert,
- otp), pkix_path_validation(OtpCert, CertChain, Options);
+pkix_path_validation(TrustedCert, CertChain, Options)
+ when is_binary(TrustedCert) ->
+ OtpCert = pkix_decode_cert(TrustedCert, otp),
+ pkix_path_validation(OtpCert, CertChain, Options);
pkix_path_validation(#'OTPCertificate'{} = TrustedCert, CertChain, Options)
when is_list(CertChain), is_list(Options) ->
diff --git a/lib/public_key/test/public_key_SUITE.erl b/lib/public_key/test/public_key_SUITE.erl
index b11e4d092a..a9c198c581 100644
--- a/lib/public_key/test/public_key_SUITE.erl
+++ b/lib/public_key/test/public_key_SUITE.erl
@@ -537,7 +537,10 @@ rsa_sign_verify(Config) when is_list(Config) ->
false = public_key:verify(Msg, sha, <<1:8, RSASign/binary>>, PublicRSA),
RSASign1 = public_key:sign(Msg, md5, PrivateRSA),
- true = public_key:verify(Msg, md5, RSASign1, PublicRSA).
+ true = public_key:verify(Msg, md5, RSASign1, PublicRSA),
+
+ RSASign2 = public_key:sign(Msg, md2, PrivateRSA),
+ true = public_key:verify(Msg, md2, RSASign2, PublicRSA).
%%--------------------------------------------------------------------
diff --git a/lib/public_key/vsn.mk b/lib/public_key/vsn.mk
index 3c6b012152..66ac78a65d 100644
--- a/lib/public_key/vsn.mk
+++ b/lib/public_key/vsn.mk
@@ -1 +1 @@
-PUBLIC_KEY_VSN = 0.12
+PUBLIC_KEY_VSN = 0.13
diff --git a/lib/reltool/src/reltool_sys_win.erl b/lib/reltool/src/reltool_sys_win.erl
index 76c064f1e7..8b0f64eb45 100644
--- a/lib/reltool/src/reltool_sys_win.erl
+++ b/lib/reltool/src/reltool_sys_win.erl
@@ -54,7 +54,9 @@
whitelist,
blacklist,
derived,
- fgraph_wins
+ fgraph_wins,
+ app_box,
+ mod_box
}).
-define(WIN_WIDTH, 800).
@@ -86,6 +88,11 @@
-define(blacklist, "Excluded").
-define(derived, "Derived").
+-define(safe_config,{sys,[{incl_cond,exclude},
+ {app,kernel,[{incl_cond,include}]},
+ {app,stdlib,[{incl_cond,include}]},
+ {app,sasl,[{incl_cond,include}]}]}).
+
-record(root_data, {dir}).
-record(lib_data, {dir, tree, item}).
-record(escript_data, {file, tree, item}).
@@ -102,7 +109,7 @@
start_link(Opts) ->
proc_lib:start_link(?MODULE,
init,
- [[{parent, self()} | Opts]],
+ [[{safe_config, false}, {parent, self()} | Opts]],
infinity,
[]).
@@ -126,53 +133,73 @@ init(Options) ->
exit({Reason, erlang:get_stacktrace()})
end.
-do_init([{parent, Parent} | Options]) ->
+do_init([{safe_config, Safe}, {parent, Parent} | Options]) ->
case reltool_server:start_link(Options) of
{ok, ServerPid, C, Sys} ->
process_flag(trap_exit, C#common.trap_exit),
- S = #state{parent_pid = Parent,
- server_pid = ServerPid,
- common = C,
- config_file = filename:absname("config.reltool"),
- target_dir = filename:absname("reltool_target_dir"),
- app_wins = [],
- sys = Sys,
- fgraph_wins = []},
wx:new(),
wx:debug(C#common.wx_debug),
- S2 = create_window(S),
%% wx_misc:beginBusyCursor(),
case reltool_server:get_status(ServerPid) of
{ok, Warnings} ->
exit_dialog(Warnings),
- {ok, Sys2} = reltool_server:get_sys(ServerPid),
- S3 = S2#state{sys = Sys2},
+ {ok, Sys} = reltool_server:get_sys(ServerPid),
+ S = #state{parent_pid = Parent,
+ server_pid = ServerPid,
+ common = C,
+ config_file = filename:absname("config.reltool"),
+ target_dir = filename:absname("reltool_target_dir"),
+ app_wins = [],
+ sys = Sys,
+ fgraph_wins = []},
+ S2 = create_window(S),
S5 = wx:batch(fun() ->
Title = atom_to_list(?APPLICATION),
- wxFrame:setTitle(S3#state.frame,
+ wxFrame:setTitle(S2#state.frame,
Title),
%% wxFrame:setMinSize(Frame,
%% {?WIN_WIDTH, ?WIN_HEIGHT}),
wxStatusBar:setStatusText(
- S3#state.status_bar,
+ S2#state.status_bar,
"Done."),
- S4 = redraw_apps(S3),
- redraw_libs(S4)
+ S3 = redraw_apps(S2),
+ S4 = redraw_libs(S3),
+ redraw_config_page(S4)
end),
%% wx_misc:endBusyCursor(),
%% wxFrame:destroy(Frame),
proc_lib:init_ack(S#state.parent_pid, {ok, self()}),
loop(S5);
{error, Reason} ->
- io:format("~p(~p): <ERROR> ~p\n", [?MODULE, ?LINE, Reason]),
- exit(Reason)
+ restart_server_safe_config(Safe,Parent,Reason)
end;
{error, Reason} ->
io:format("~p(~p): <ERROR> ~p\n", [?MODULE, ?LINE, Reason]),
exit(Reason)
end.
+restart_server_safe_config(true,_Parent,Reason) ->
+ io:format("~p(~p): <ERROR> ~p\n", [?MODULE, ?LINE, Reason]),
+ exit(Reason);
+restart_server_safe_config(false,Parent,Reason) ->
+ Strings =
+ [{?wxBLACK,"Could not start reltool server:\n\n"},
+ {?wxRED,Reason++"\n\n"},
+ {?wxBLACK,
+ io_lib:format(
+ "Resetting the configuration to:~n~n ~p~n~n"
+ "Do you want to continue with this configuration?",
+ [?safe_config])}],
+
+ case question_dialog_2("Reltool server start error", Strings) of
+ ?wxID_OK ->
+ do_init([{safe_config,true},{parent,Parent},?safe_config]);
+ ?wxID_CANCEL ->
+ io:format("~p(~p): <ERROR> ~p\n", [?MODULE, ?LINE, Reason]),
+ exit(Reason)
+ end.
+
exit_dialog([]) ->
ok;
exit_dialog(Warnings) ->
@@ -606,6 +633,13 @@ create_config_page(#state{sys = Sys, book = Book} = S) ->
{proportion, 1}]),
wxPanel:setSizer(Panel, Sizer),
wxNotebook:addPage(Book, Panel, ?SYS_PAGE, []),
+ S#state{app_box = AppBox, mod_box = ModBox}.
+
+redraw_config_page(#state{sys = Sys, app_box = AppBox, mod_box = ModBox} = S) ->
+ AppChoice = reltool_utils:incl_cond_to_index(Sys#sys.incl_cond),
+ wxRadioBox:setSelection(AppBox, AppChoice),
+ ModChoice = reltool_utils:mod_cond_to_index(Sys#sys.mod_cond),
+ wxRadioBox:setSelection(ModBox, ModChoice),
S.
create_main_release_page(#state{book = Book} = S) ->
@@ -640,15 +674,15 @@ create_main_release_page(#state{book = Book} = S) ->
add_release_page(Book, #rel{name = RelName, rel_apps = RelApps}) ->
Panel = wxPanel:new(Book, []),
Sizer = wxBoxSizer:new(?wxHORIZONTAL),
- RelBox = wxRadioBox:new(Panel,
- ?wxID_ANY,
- "Applications included in the release " ++ RelName,
- ?wxDefaultPosition,
- ?wxDefaultSize,
- [atom_to_list(RA#rel_app.name) || RA <- RelApps],
- []),
- %% wxRadioBox:setSelection(RelBox, 2), % mandatory
- wxEvtHandler:connect(RelBox, command_radiobox_selected,
+ AppNames = [kernel, stdlib |
+ [RA#rel_app.name || RA <- RelApps] -- [kernel, stdlib]],
+ RelBox = wxListBox:new(
+ Panel,?wxID_ANY,
+ [{pos,?wxDefaultPosition},
+ {size,?wxDefaultSize},
+ {choices,[[atom_to_list(AppName)] || AppName <- AppNames]},
+ {style,?wxLB_EXTENDED}]),
+ wxEvtHandler:connect(RelBox, command_listbox_selected,
[{userData, {config_rel_cond, RelName}}]),
RelToolTip = "Choose which applications that shall "
"be included in the release resource file.",
@@ -1363,7 +1397,8 @@ refresh(S) ->
[ok = reltool_app_win:refresh(AW#app_win.pid) || AW <- S#state.app_wins],
S2 = S#state{sys = Sys},
S3 = redraw_libs(S2),
- redraw_apps(S3).
+ S4 = redraw_apps(S3),
+ redraw_config_page(S4).
question_dialog(Question, Details) ->
%% Parent = S#state.frame,
@@ -1420,6 +1455,44 @@ display_message(Message, Icon) ->
wxMessageDialog:showModal(Dialog),
wxMessageDialog:destroy(Dialog).
+%% Strings = [{Color,String}]
+question_dialog_2(DialogLabel, Strings) ->
+ %% Parent = S#state.frame,
+ Parent = wx:typeCast(wx:null(), wxWindow),
+ %% [{style, ?wxYES_NO bor ?wxICON_ERROR bor ?wx}]),
+ DialogStyle = ?wxRESIZE_BORDER bor ?wxCAPTION bor ?wxSYSTEM_MENU bor
+ ?wxMINIMIZE_BOX bor ?wxMAXIMIZE_BOX bor ?wxCLOSE_BOX,
+ Dialog = wxDialog:new(Parent, ?wxID_ANY, DialogLabel,
+ [{style, DialogStyle}]),
+ Color = wxWindow:getBackgroundColour(Dialog),
+ TextStyle = ?wxTE_READONLY bor ?wxTE_MULTILINE bor ?wxHSCROLL,
+ Text = wxTextCtrl:new(Dialog, ?wxID_ANY,
+ [{size, {600, 400}}, {style, TextStyle}]),
+ wxWindow:setBackgroundColour(Text, Color),
+ TextAttr = wxTextAttr:new(),
+ add_text(Text,TextAttr,Strings),
+ Sizer = wxBoxSizer:new(?wxVERTICAL),
+ wxSizer:add(Sizer, Text, [{border, 2}, {flag, ?wxEXPAND}, {proportion, 1}]),
+ ButtSizer = wxDialog:createStdDialogButtonSizer(Dialog, ?wxOK bor ?wxCANCEL),
+ wxSizer:add(Sizer, ButtSizer, [{border, 2}, {flag, ?wxEXPAND}]),
+ wxPanel:setSizer(Dialog, Sizer),
+ wxSizer:fit(Sizer, Dialog),
+ wxSizer:setSizeHints(Sizer, Dialog),
+ Answer = wxDialog:showModal(Dialog),
+ wxDialog:destroy(Dialog),
+ Answer.
+
+add_text(Text,Attr,[{Color,String}|Strings]) ->
+ wxTextAttr:setTextColour(Attr, Color),
+ wxTextCtrl:setDefaultStyle(Text, Attr),
+ wxTextCtrl:appendText(Text, String),
+ add_text(Text,Attr,Strings);
+add_text(_,_,[]) ->
+ ok.
+
+
+
+
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%% sys callbacks
diff --git a/lib/runtime_tools/doc/src/dbg.xml b/lib/runtime_tools/doc/src/dbg.xml
index 0e63649c09..4e32bd5c0d 100644
--- a/lib/runtime_tools/doc/src/dbg.xml
+++ b/lib/runtime_tools/doc/src/dbg.xml
@@ -706,7 +706,7 @@ Error: fun containing local erlang function calls ('is_atomm' called in guard) c
value from the last invocation of the fun. The initial value
of the second parameter is specified in the <c>InitialData</c>
part of the <c>HandlerSpec</c>. The <c>HandlerFun</c> may
- chose any appropriate action to take when invoked, and can
+ choose any appropriate action to take when invoked, and can
save a state for the next invocation by returning it.
</p>
<p>If <c>Type</c> is a port, then the second parameter should
@@ -766,7 +766,7 @@ Error: fun containing local erlang function calls ('is_atomm' called in guard) c
<p>This function creates a trace port generating <em>fun</em>.
The <em>fun</em> takes no arguments and returns a newly opened
trace port. The return value from this function is suitable as
- a second parameter to tracer/2, i. e. <c>dbg:tracer(port, dbg:trace_port(ip, 4711))</c>. </p>
+ a second parameter to tracer/2, i.e. <c>dbg:tracer(port, dbg:trace_port(ip, 4711))</c>. </p>
<p>A trace port is an
Erlang port to a dynamically linked in driver that handles
trace messages directly, without the overhead of sending them
@@ -852,9 +852,9 @@ Error: fun containing local erlang function calls ('is_atomm' called in guard) c
<desc>
<p>This function is used to do a control operation on the
active trace port driver on the given node
- (<c>Nodename</c>). Which operations that are allowed as well
- as their return values are depending on which trace driver
- that is used.</p>
+ (<c>Nodename</c>). Which operations are allowed as well
+ as their return values depend on which trace driver
+ is used.</p>
<p>Returns either <c>ok</c> or <c>{ok, Result}</c>
if the operation was successful, or <c>{error, Reason}</c>
if the current tracer is a process
diff --git a/lib/sasl/doc/src/release_handler.xml b/lib/sasl/doc/src/release_handler.xml
index 4a973bc5ed..5ac0dc1acc 100644
--- a/lib/sasl/doc/src/release_handler.xml
+++ b/lib/sasl/doc/src/release_handler.xml
@@ -4,7 +4,7 @@
<erlref>
<header>
<copyright>
- <year>1996</year><year>2009</year>
+ <year>1996</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -159,9 +159,12 @@ old reboot_old permanent
<funcs>
<func>
<name>check_install_release(Vsn) -> {ok, OtherVsn, Descr} | {error, Reason}</name>
+ <name>check_install_release(Vsn,Opts) -> {ok, OtherVsn, Descr} | {error, Reason}</name>
<fsummary>Check installation of a release in the system.</fsummary>
<type>
<v>Vsn = OtherVsn = string()</v>
+ <v>Opts = [Opt]</v>
+ <v>Opt = purge</v>
<v>Descr = term()</v>
<v>Reason = term()</v>
</type>
@@ -179,6 +182,11 @@ old reboot_old permanent
upgrade script.</p>
<p>Returns the same as <c>install_release/1</c>. <c>Descr</c>
defaults to "" if no <c>relup</c> file is found.</p>
+ <p>If the option <c>purge</c> is given, all old code that can
+ be soft purged will be purged after all other checks are
+ successfully completed. This can be useful in order to
+ reduce the time needed by <seealso
+ marker="#install_release/1">install_release</seealso>.</p>
</desc>
</func>
<func>
@@ -299,6 +307,24 @@ release_handler:set_unpacked(RelFile, [{myapp,"1.0","/home/user"},...]).
<c>{update_paths,true}</c>, afterwards
<c>code:lib_dir(myapp)</c> will return
<c>/home/user/myapp-1.0</c>.</p>
+ <note>
+ <p>Installing a new release might be quite time consuming if
+ there are many processes in the system. The reason is that
+ each process must be checked for references to old code
+ before a module can be purged. This check might lead to
+ garbage collections and copying of data.</p>
+ <p>If you wish to speed up the execution of
+ <c>install_release</c>, then you may call <seealso
+ marker="#check_install_release/1">check_install_release</seealso>
+ first, using the option <c>purge</c>. This will do the same
+ check for old code, and then purge all modules that can be
+ soft purged. The purged modules will then no longer have any
+ old code, and <c>install_release</c> will not need to do the
+ checks.</p>
+ <p>Obviously, this will not reduce the overall time for the
+ upgrade, but it will allow checks and purge to be executed
+ in the background before the real upgrade is started.</p>
+ </note>
</desc>
</func>
<func>
diff --git a/lib/sasl/doc/src/systools.xml b/lib/sasl/doc/src/systools.xml
index 883c9c372b..8c1c327d74 100644
--- a/lib/sasl/doc/src/systools.xml
+++ b/lib/sasl/doc/src/systools.xml
@@ -45,7 +45,8 @@
<v>Name = string()</v>
<v>UpFrom = DownTo = [Name | {Name,Descr}]</v>
<v>&nbsp;Descr = term()</v>
- <v>Opt = {path,[Dir]} | restart_emulator | silent | noexec | {outdir,Dir}</v>
+ <v>Opt = {path,[Dir]} | restart_emulator | silent | noexec | {outdir,Dir}
+ | warnings_as_errors</v>
<v>&nbsp;Dir = string()</v>
<v>Result = ok | error | {ok,Relup,Module,Warnings} | {error,Module,Error}</v>
<v>&nbsp;Relup - see relup(4)</v>
@@ -122,6 +123,8 @@
<p>If the option <c>noexec</c> is provided, the function returns
the same values as for <c>silent</c> but no <c>relup</c> file
is created.</p>
+ <p>If the option <c>warnings_as_errors</c> is provided, warnings
+ are treated as errors.</p>
</desc>
</func>
<func>
@@ -130,7 +133,8 @@
<fsummary>Generate a boot script <c>.script/.boot</c>.</fsummary>
<type>
<v>Name = string()</v>
- <v>Opt = src_tests | {path,[Dir]} | local | {variables,[Var]} | exref | {exref,[App]}] | silent | {outdir,Dir}</v>
+ <v>Opt = src_tests | {path,[Dir]} | local | {variables,[Var]} | exref | {exref,[App]}]
+ | silent | {outdir,Dir} | warnings_as_errors</v>
<v>&nbsp;Dir = string()</v>
<v>&nbsp;Var = {VarName,Prefix}</v>
<v>&nbsp;&nbsp;VarName = Prefix = string()</v>
@@ -232,6 +236,8 @@
Warnings and errors can be converted to strings by calling
<c>Module:format_warning(Warnings)</c> or
<c>Module:format_error(Error)</c>.</p>
+ <p>If the option <c>warnings_as_errors</c> is provided, warnings
+ are treated as errors.</p>
</desc>
</func>
<func>
diff --git a/lib/sasl/examples/src/Makefile b/lib/sasl/examples/src/Makefile
index 4a4e04a536..c58f651696 100644
--- a/lib/sasl/examples/src/Makefile
+++ b/lib/sasl/examples/src/Makefile
@@ -66,7 +66,7 @@ release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/examples/src
$(INSTALL_DIR) $(RELSYSDIR)/examples/ebin
(cd ..; tar cf - src ebin | (cd $(RELSYSDIR)/examples; tar xf -))
- chmod -f -R ug+w $(RELSYSDIR)/examples
+ chmod -R ug+w $(RELSYSDIR)/examples
release_docs_spec:
diff --git a/lib/sasl/src/erlsrv.erl b/lib/sasl/src/erlsrv.erl
index f9804c41dc..086dc7c651 100644
--- a/lib/sasl/src/erlsrv.erl
+++ b/lib/sasl/src/erlsrv.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1998-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1998-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -75,14 +75,21 @@ write_all_data(Port,[H|T]) ->
write_all_data(Port,T).
read_all_data(Port) ->
+ lists:reverse(read_all_data(Port,[],[])).
+read_all_data(Port,Line,Lines) ->
receive
+ {Port, {data, {noeol,Data}}} ->
+ read_all_data(Port,Line++Data,Lines);
{Port, {data, {eol,Data}}} ->
- [ Data | read_all_data(Port)];
- _ ->
+ read_all_data(Port,[],[Line++Data|Lines]);
+ {Port,_Other} ->
Port ! {self(), close},
receive
{Port, closed} ->
- []
+ case Line of
+ [] -> Lines;
+ _ -> [Line|Lines]
+ end
end
end.
@@ -208,7 +215,7 @@ store_service(EmulatorVersion,Service) ->
false ->
{error, no_servicename};
{value, {_,Name}} ->
- {Action,Service1} = case get_service(Name) of
+ {Action,Service1} = case get_service(EmulatorVersion,Name) of
{error, no_such_service} ->
{"add",Service};
_ ->
@@ -377,8 +384,14 @@ pick_argument(_,[],Acc) ->
{Acc, ""};
pick_argument(normal,[$ |T],Acc) ->
{Acc,T};
+pick_argument(normal,[$\\|T],Acc) ->
+ pick_argument(normal_escaped,T,[$\\|Acc]);
pick_argument(normal,[$"|T],Acc) ->
pick_argument(quoted,T,[$"|Acc]);
+pick_argument(normal_escaped,[$"|T],Acc) ->
+ pick_argument(bquoted,T,[$"|Acc]);
+pick_argument(normal_escaped,[A|T],Acc) ->
+ pick_argument(normal,T,[A|Acc]);
pick_argument(quoted_escaped,[H|T],Acc) ->
pick_argument(quoted,T,[H|Acc]);
pick_argument(quoted,[$"|T],Acc) ->
@@ -387,6 +400,14 @@ pick_argument(quoted,[$\\|T],Acc) ->
pick_argument(quoted_escaped,T,[$\\|Acc]);
pick_argument(quoted,[H|T],Acc) ->
pick_argument(quoted,T,[H|Acc]);
+pick_argument(bquoted_escaped,[$"|T],Acc) ->
+ pick_argument(normal,T,[$"|Acc]);
+pick_argument(bquoted_escaped,[H|T],Acc) ->
+ pick_argument(bquoted,T,[H|Acc]);
+pick_argument(bquoted,[$\\|T],Acc) ->
+ pick_argument(bquoted_escaped,T,[$\\|Acc]);
+pick_argument(bquoted,[H|T],Acc) ->
+ pick_argument(bquoted,T,[H|Acc]);
pick_argument(normal,[H|T],Acc) ->
pick_argument(normal,T,[H|Acc]).
diff --git a/lib/sasl/src/release_handler.erl b/lib/sasl/src/release_handler.erl
index b60aa847df..bc08f94dff 100644
--- a/lib/sasl/src/release_handler.erl
+++ b/lib/sasl/src/release_handler.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -25,8 +25,8 @@
-export([start_link/0,
create_RELEASES/1, create_RELEASES/2, create_RELEASES/4,
unpack_release/1,
- check_install_release/1, install_release/1, install_release/2,
- remove_release/1,
+ check_install_release/1, check_install_release/2,
+ install_release/1, install_release/2, remove_release/1,
which_releases/0, make_permanent/1, reboot_old_release/1,
set_unpacked/2, set_removed/1, install_file/2]).
-export([upgrade_app/2, downgrade_app/2, downgrade_app/3,
@@ -149,15 +149,35 @@ unpack_release(ReleaseName) ->
%%-----------------------------------------------------------------
%% Purpose: Checks the relup script for the specified version.
%% The release must be unpacked.
+%% Options = [purge] - all old code that can be soft purged
+%% will be purged if all checks succeeds. This can be usefull
+%% in order to reduce time needed in the following call to
+%% install_release.
%% Returns: {ok, FromVsn, Descr} | {error, Reason}
-%% Reason = {already_installed, Vsn} |
+%% Reason = {illegal_option, IllegalOpt} |
+%% {already_installed, Vsn} |
%% {bad_relup_file, RelFile} |
%% {no_such_release, Vsn} |
%% {no_such_from_vsn, Vsn} |
%% exit_reason()
%%-----------------------------------------------------------------
check_install_release(Vsn) ->
- call({check_install_release, Vsn}).
+ check_install_release(Vsn, []).
+
+check_install_release(Vsn, Opts) ->
+ case check_check_install_options(Opts, false) of
+ {ok,Purge} ->
+ call({check_install_release, Vsn, Purge});
+ Error ->
+ Error
+ end.
+
+check_check_install_options([purge|Opts], _) ->
+ check_check_install_options(Opts, true);
+check_check_install_options([Illegal|_],_Purge) ->
+ {error,{illegal_option,Illegal}};
+check_check_install_options([],Purge) ->
+ {ok,Purge}.
%%-----------------------------------------------------------------
@@ -291,7 +311,8 @@ check_script(Script, LibDirs) ->
release_handler_1:check_script(Script, LibDirs).
%%-----------------------------------------------------------------
-%% eval_script(Script, Apps, LibDirs, Opts) -> {ok, UnPurged} |
+%% eval_script(Script, Apps, LibDirs, NewLibs, Opts) ->
+%% {ok, UnPurged} |
%% restart_new_emulator |
%% {error, Error}
%% {'EXIT', Reason}
@@ -299,9 +320,13 @@ check_script(Script, LibDirs) ->
%% net_kernel:monitor_nodes(true) before calling this function.
%% No! No other process than the release_handler can ever call this
%% function, if sync_nodes is used.
-%%-----------------------------------------------------------------
-eval_script(Script, Apps, LibDirs, Opts) ->
- catch release_handler_1:eval_script(Script, Apps, LibDirs, Opts).
+%%
+%% LibDirs is a list of all applications, while NewLibs is a list of
+%% applications that have changed version between the current and the
+%% new release.
+%% -----------------------------------------------------------------
+eval_script(Script, Apps, LibDirs, NewLibs, Opts) ->
+ catch release_handler_1:eval_script(Script, Apps, LibDirs, NewLibs, Opts).
%%-----------------------------------------------------------------
%% Func: create_RELEASES(Root, RelFile, LibDirs) -> ok | {error, Reason}
@@ -405,6 +430,7 @@ eval_appup_script(App, ToVsn, ToDir, Script) ->
Res = release_handler_1:eval_script(Script,
[], % [AppSpec]
[{App, ToVsn, ToDir}],
+ [{App, ToVsn, ToDir}],
[]), % [Opt]
case Res of
{ok, _Unpurged} ->
@@ -535,11 +561,12 @@ handle_call({unpack_release, ReleaseName}, _From, S)
handle_call({unpack_release, _ReleaseName}, _From, S) ->
{reply, {error, client_node}, S};
-handle_call({check_install_release, Vsn}, _From, S) ->
+handle_call({check_install_release, Vsn, Purge}, _From, S) ->
case catch do_check_install_release(S#state.rel_dir,
Vsn,
S#state.releases,
- S#state.masters) of
+ S#state.masters,
+ Purge) of
{ok, CurrentVsn, Descr} ->
{reply, {ok, CurrentVsn, Descr}, S};
{error, Reason} ->
@@ -849,7 +876,7 @@ check_path_response(Path, {ok, _Info}) ->
check_path_response(Path, {error, _Reason}) ->
throw({error, {no_such_directory, Path}}).
-do_check_install_release(RelDir, Vsn, Releases, Masters) ->
+do_check_install_release(RelDir, Vsn, Releases, Masters, Purge) ->
case lists:keysearch(Vsn, #release.vsn, Releases) of
{value, #release{status = current}} ->
{error, {already_installed, Vsn}};
@@ -874,7 +901,20 @@ do_check_install_release(RelDir, Vsn, Releases, Masters) ->
case get_rh_script(LatestRelease, Release, RelDir, Masters) of
{ok, {CurrentVsn, Descr, Script}} ->
case catch check_script(Script, Libs) of
- ok ->
+ {ok,SoftPurgeMods} when Purge=:=true ->
+ %% Get modules with brutal_purge
+ %% instructions, but that can be
+ %% soft purged
+ {ok,BrutalPurgeMods} =
+ release_handler_1:check_old_processes(
+ Script,brutal_purge),
+ lists:foreach(
+ fun(Mod) ->
+ catch erlang:purge_module(Mod)
+ end,
+ SoftPurgeMods ++ BrutalPurgeMods),
+ {ok, CurrentVsn, Descr};
+ {ok,_} ->
{ok, CurrentVsn, Descr};
Else ->
Else
@@ -890,6 +930,7 @@ do_check_install_release(RelDir, Vsn, Releases, Masters) ->
end.
do_install_release(#state{start_prg = StartPrg,
+ root = RootDir,
rel_dir = RelDir, releases = Releases,
masters = Masters,
static_emulator = Static},
@@ -905,7 +946,9 @@ do_install_release(#state{start_prg = StartPrg,
EnvBefore = application_controller:prep_config_change(),
Apps = change_appl_data(RelDir, Release, Masters),
LibDirs = Release#release.libs,
- case eval_script(Script, Apps, LibDirs, Opts) of
+ NewLibs = get_new_libs(LatestRelease#release.libs,
+ Release#release.libs),
+ case eval_script(Script, Apps, LibDirs, NewLibs, Opts) of
{ok, []} ->
application_controller:config_change(EnvBefore),
mon_nodes(false),
@@ -926,8 +969,8 @@ do_install_release(#state{start_prg = StartPrg,
NReleases = set_status(Vsn, current, Releases),
NReleases2 = set_status(Vsn,tmp_current,NReleases),
write_releases(RelDir, NReleases2, Masters),
- prepare_restart_new_emulator(StartPrg, RelDir,
- Release,
+ prepare_restart_new_emulator(StartPrg, RootDir,
+ RelDir, Release,
PermanentRelease,
Masters),
{restart_new_emulator, CurrentVsn, Descr};
@@ -997,7 +1040,7 @@ do_make_services_permanent(PermanentVsn,Vsn, PermanentEVsn, EVsn) ->
throw(Error4)
end
end.
-
+
do_make_permanent(#state{releases = Releases,
rel_dir = RelDir, unpurged = Unpurged,
masters = Masters,
@@ -1409,8 +1452,8 @@ prepare_restart_nt(#release{erts_vsn = EVsn, vsn = Vsn},
FutureServiceName = hd(string:tokens(atom_to_list(node()),"@"))
++ "_" ++ Vsn,
CurrentService = case erlsrv:get_service(PermEVsn,CurrentServiceName) of
- {error, Reason} ->
- throw({error, Reason});
+ {error, _} = Error1 ->
+ throw(Error1);
CS ->
CS
end,
@@ -1425,37 +1468,33 @@ prepare_restart_nt(#release{erts_vsn = EVsn, vsn = Vsn},
CurrentServiceName),
case erlsrv:store_service(EVsn, FutureService) of
- {error, Rison} ->
- throw({error,Rison});
- _ ->
+ {error, _} = Error2 ->
+ throw(Error2);
+ _X ->
erlsrv:disable_service(EVsn, FutureServiceName),
ErlSrv = filename:nativename(erlsrv:erlsrv(EVsn)),
- case heart:set_cmd(ErlSrv ++ " enable " ++ FutureServiceName ++
- " & " ++ ErlSrv ++ " start " ++
- FutureServiceName ++
- " & " ++ ErlSrv ++ " disable " ++
- FutureServiceName) of
+ StartDisabled = ErlSrv ++ " start_disabled " ++ FutureServiceName,
+ case heart:set_cmd(StartDisabled) of
ok ->
ok;
- Error ->
- throw({error, {'heart:set_cmd() error', Error}})
+ Error3 ->
+ throw({error, {'heart:set_cmd() error', Error3}})
end
end.
-
%%-----------------------------------------------------------------
%% Set things up for restarting the new emulator. The actual
%% restart is performed by calling init:reboot() higher up.
%%-----------------------------------------------------------------
-prepare_restart_new_emulator(StartPrg, RelDir,
- Release, PRelease,
- Masters) ->
+prepare_restart_new_emulator(StartPrg, RootDir, RelDir,
+ Release, PRelease, Masters) ->
#release{erts_vsn = EVsn, vsn = Vsn} = Release,
Data = EVsn ++ " " ++ Vsn,
DataFile = write_new_start_erl(Data, RelDir, Masters),
%% Tell heart to use DataFile instead of start_erl.data
case os:type() of
{win32,nt} ->
+ write_ini_file(RootDir,EVsn,Masters),
prepare_restart_nt(Release,PRelease,DataFile);
{unix,_} ->
StartP = check_start_prg(StartPrg, Masters),
@@ -1832,50 +1871,10 @@ write_start(File, Data, false) ->
end;
write_start(File, Data, Masters) ->
all_masters(Masters),
- write_start_m(File, Data, Masters).
+ safe_write_file_m(File, Data, Masters).
%%-----------------------------------------------------------------
-%% Write the "start_erl.data" file at all master nodes.
-%% 1. Save "start_erl.backup" at all nodes.
-%% 2. Write the "start_erl.change" file at all nodes.
-%% 3. Move "start_erl.change" to "start_erl.data".
-%% 4. Remove "start_erl.backup" at all nodes.
-%%
-%% If one of the steps above fails, all steps is recovered from
-%% (as long as possible), except for 4 which is allowed to fail.
-%%-----------------------------------------------------------------
-write_start_m(File, Data, Masters) ->
- Dir = filename:dirname(File),
- Backup = filename:join(Dir, "start_erl.backup"),
- Change = filename:join(Dir, "start_erl.change"),
- case at_all_masters(Masters, ?MODULE, do_copy_files,
- [File, [Backup]]) of
- ok ->
- case at_all_masters(Masters, ?MODULE, do_write_file,
- [Change, Data]) of
- ok ->
- case at_all_masters(Masters, file, rename,
- [Change, File]) of
- ok ->
- remove_files(all, [Backup, Change], Masters),
- ok;
- {error, {Master, R}} ->
- takewhile(Master, Masters, file, rename,
- [Backup, File]),
- remove_files(all, [Backup, Change], Masters),
- throw({error, {Master, R, move_start_erl}})
- end;
- {error, {Master, R}} ->
- remove_files(all, [Backup, Change], Masters),
- throw({error, {Master, R, write_start_erl}})
- end;
- {error, {Master, R}} ->
- remove_files(Master, [Backup], Masters),
- throw({error, {Master, R, backup_start_erl}})
- end.
-
-%%-----------------------------------------------------------------
%% Copy the "start.boot" and "sys.config" from SrcDir to DestDir at all
%% master nodes.
%% 1. Save DestDir/"start.backup" and DestDir/"sys.backup" at all nodes.
@@ -1917,3 +1916,97 @@ set_static_files(SrcDir, DestDir, Masters) ->
remove_files(Master, [BackupBoot, BackupConf], Masters),
throw({error, {Master, R, backup_start_config}})
end.
+
+%%-----------------------------------------------------------------
+%% Write erl.ini
+%% Writes the erl.ini file used by erl.exe when (re)starting the erlang node.
+%% At first installation, this is done by Install.exe, which means that if
+%% the format of this file for some reason is changed, then Install.c must
+%% also be updated (and probably some other c-files which read erl.ini)
+%%-----------------------------------------------------------------
+write_ini_file(RootDir,EVsn,Masters) ->
+ BinDir = filename:join([RootDir,"erts-"++EVsn,"bin"]),
+ Str0 = io_lib:format("[erlang]~n"
+ "Bindir=~s~n"
+ "Progname=erl~n"
+ "Rootdir=~s~n",
+ [filename:nativename(BinDir),
+ filename:nativename(RootDir)]),
+ Str = re:replace(Str0,"\\\\","\\\\\\\\",[{return,list},global]),
+ IniFile = filename:join(BinDir,"erl.ini"),
+ do_write_ini_file(IniFile,Str,Masters).
+
+do_write_ini_file(File,Data,false) ->
+ case do_write_file(File, Data) of
+ ok -> ok;
+ Error -> throw(Error)
+ end;
+do_write_ini_file(File,Data,Masters) ->
+ all_masters(Masters),
+ safe_write_file_m(File, Data, Masters).
+
+
+%%-----------------------------------------------------------------
+%% Write the given file at all master nodes.
+%% 1. Save <File>.backup at all nodes.
+%% 2. Write <File>.change at all nodes.
+%% 3. Move <File>.change to <File>
+%% 4. Remove <File>.backup at all nodes.
+%%
+%% If one of the steps above fails, all steps are recovered from
+%% (as long as possible), except for 4 which is allowed to fail.
+%%-----------------------------------------------------------------
+safe_write_file_m(File, Data, Masters) ->
+ Backup = File ++ ".backup",
+ Change = File ++ ".change",
+ case at_all_masters(Masters, ?MODULE, do_copy_files,
+ [File, [Backup]]) of
+ ok ->
+ case at_all_masters(Masters, ?MODULE, do_write_file,
+ [Change, Data]) of
+ ok ->
+ case at_all_masters(Masters, file, rename,
+ [Change, File]) of
+ ok ->
+ remove_files(all, [Backup, Change], Masters),
+ ok;
+ {error, {Master, R}} ->
+ takewhile(Master, Masters, file, rename,
+ [Backup, File]),
+ remove_files(all, [Backup, Change], Masters),
+ throw({error, {Master, R, rename,
+ filename:basename(Change),
+ filename:basename(File)}})
+ end;
+ {error, {Master, R}} ->
+ remove_files(all, [Backup, Change], Masters),
+ throw({error, {Master, R, write, filename:basename(Change)}})
+ end;
+ {error, {Master, R}} ->
+ remove_files(Master, [Backup], Masters),
+ throw({error, {Master, R, backup,
+ filename:basename(File),
+ filename:basename(Backup)}})
+ end.
+
+%%-----------------------------------------------------------------
+%% Figure out which applications that have changed version between the
+%% two releases. The paths for these applications must always be
+%% updated, even if the relup script does not load any modules. See
+%% OTP-9402.
+%%
+%% A different situation is when the same application version is used
+%% in old and new release, but the path has changed. This is not
+%% handled here - instead it must be explicitely indicated by the
+%% 'update_paths' option to release_handler:install_release/2 if the
+%% code path shall be updated then.
+%% -----------------------------------------------------------------
+get_new_libs([{App,Vsn,_LibDir}|CurrentLibs], NewLibs) ->
+ case lists:keyfind(App,1,NewLibs) of
+ {App,NewVsn,_} = LibInfo when NewVsn =/= Vsn ->
+ [LibInfo | get_new_libs(CurrentLibs,NewLibs)];
+ _ ->
+ get_new_libs(CurrentLibs,NewLibs)
+ end;
+get_new_libs([],_) ->
+ [].
diff --git a/lib/sasl/src/release_handler_1.erl b/lib/sasl/src/release_handler_1.erl
index 8d050fb7b0..8d0baf3ab1 100644
--- a/lib/sasl/src/release_handler_1.erl
+++ b/lib/sasl/src/release_handler_1.erl
@@ -19,8 +19,9 @@
-module(release_handler_1).
%% External exports
--export([eval_script/3, eval_script/4, check_script/2]).
--export([get_current_vsn/1]). %% exported because used in a test case
+-export([eval_script/1, eval_script/5,
+ check_script/2, check_old_processes/2]).
+-export([get_current_vsn/1, get_supervised_procs/0]). %% exported because used in a test case
-record(eval_state, {bins = [], stopped = [], suspended = [], apps = [],
libdirs, unpurged = [], vsns = [], newlibs = [],
@@ -33,11 +34,11 @@
%% libdirs = [{Lib, LibVsn, LibDir}] - Maps Lib to Vsn and Directory
%% unpurged = [{Mod, soft_purge | brutal_purge}]
%% vsns = [{Mod, OldVsn, NewVsn}] - remember the old vsn of a mod
-%% before it is removed/a new vsn is loaded; the new vsn
+%% before a new vsn is loaded; the new vsn
%% is kept in case of a downgrade, where the code_change
%% function receives the vsn of the module to downgrade
%% *to*.
-%% newlibs = [{Lib, Dir}] - list of all new libs; used to change
+%% newlibs = [{Lib, LibVsn, LibDir}] - list of all new libs; used to change
%% the code path
%% opts = [{Tag, Value}] - list of options
%%-----------------------------------------------------------------
@@ -47,34 +48,39 @@
%%% This is a low-level release handler.
%%%-----------------------------------------------------------------
check_script(Script, LibDirs) ->
- case catch check_old_processes(Script) of
- ok ->
+ case catch check_old_processes(Script,soft_purge) of
+ {ok, PurgeMods} ->
{Before, _After} = split_instructions(Script),
case catch lists:foldl(fun(Instruction, EvalState1) ->
eval(Instruction, EvalState1)
end,
#eval_state{libdirs = LibDirs},
Before) of
- EvalState2 when is_record(EvalState2, eval_state) -> ok;
- {error, Error} -> {error, Error};
- Other -> {error, Other}
+ EvalState2 when is_record(EvalState2, eval_state) ->
+ {ok,PurgeMods};
+ {error, Error} ->
+ {error, Error};
+ Other ->
+ {error, Other}
end;
{error, Mod} ->
{error, {old_processes, Mod}}
end.
-eval_script(Script, Apps, LibDirs) ->
- eval_script(Script, Apps, LibDirs, []).
+%% eval_script/1 - For testing only - no apps added, just testing instructions
+eval_script(Script) ->
+ eval_script(Script, [], [], [], []).
-eval_script(Script, Apps, LibDirs, Opts) ->
- case catch check_old_processes(Script) of
- ok ->
+eval_script(Script, Apps, LibDirs, NewLibs, Opts) ->
+ case catch check_old_processes(Script,soft_purge) of
+ {ok,_} ->
{Before, After} = split_instructions(Script),
case catch lists:foldl(fun(Instruction, EvalState1) ->
eval(Instruction, EvalState1)
end,
#eval_state{apps = Apps,
libdirs = LibDirs,
+ newlibs = NewLibs,
opts = Opts},
Before) of
EvalState2 when is_record(EvalState2, eval_state) ->
@@ -110,32 +116,63 @@ split_instructions([], Before) ->
{[], lists:reverse(Before)}.
%%-----------------------------------------------------------------
-%% Func: check_old_processes/1
+%% Func: check_old_processes/2
%% Args: Script = [instruction()]
+%% PrePurgeMethod = soft_purge | brutal_purge
%% Purpose: Check if there is any process that runs an old version
-%% of a module that should be soft_purged, (i.e. not purged
-%% at all if there is any such process). Returns {error, Mod}
-%% if so, ok otherwise.
-%% Returns: ok | {error, Mod}
+%% of a module that should be purged according to PrePurgeMethod.
+%% Returns a list of modules that can be soft_purged.
+%%
+%% If PrePurgeMethod == soft_purge, the function will succeed
+%% only if there is no process running old code of any of the
+%% modules. Else it will throw {error,Mod}, where Mod is the
+%% first module found that can not be soft_purged.
+%%
+%% If PrePurgeMethod == brutal_purge, the function will
+%% always succeed and return a list of all modules that are
+%% specified in the script with PrePurgeMethod brutal_purge,
+%% but that can be soft_purged.
+%%
+%% Returns: {ok,PurgeMods} | {error, Mod}
+%% PurgeMods = [Mod]
%% Mod = atom()
%%-----------------------------------------------------------------
-check_old_processes(Script) ->
- lists:foreach(fun({load, {Mod, soft_purge, _PostPurgeMethod}}) ->
- check_old_code(Mod);
- ({remove, {Mod, soft_purge, _PostPurgeMethod}}) ->
- check_old_code(Mod);
- (_) -> ok
- end,
- Script).
+check_old_processes(Script,PrePurgeMethod) ->
+ Procs = erlang:processes(),
+ {ok,lists:flatmap(
+ fun({load, {Mod, PPM, _PostPurgeMethod}}) when PPM==PrePurgeMethod ->
+ check_old_code(Mod,Procs,PrePurgeMethod);
+ ({remove, {Mod, PPM, _PostPurgeMethod}}) when PPM==PrePurgeMethod ->
+ check_old_code(Mod,Procs,PrePurgeMethod);
+ (_) -> []
+ end,
+ Script)}.
+
+check_old_code(Mod,Procs,PrePurgeMethod) ->
+ case erlang:check_old_code(Mod) of
+ true when PrePurgeMethod==soft_purge ->
+ do_check_old_code(Mod,Procs);
+ true when PrePurgeMethod==brutal_purge ->
+ case catch do_check_old_code(Mod,Procs) of
+ {error,Mod} -> [];
+ R -> R
+ end;
+ false ->
+ []
+ end.
+
+
+do_check_old_code(Mod,Procs) ->
+ lists:foreach(
+ fun(Pid) ->
+ case erlang:check_process_code(Pid, Mod) of
+ false -> ok;
+ true -> throw({error, Mod})
+ end
+ end,
+ Procs),
+ [Mod].
-check_old_code(Mod) ->
- lists:foreach(fun(Pid) ->
- case erlang:check_process_code(Pid, Mod) of
- false -> ok;
- true -> throw({error, Mod})
- end
- end,
- erlang:processes()).
%%-----------------------------------------------------------------
%% An unpurged module is a module for which there exist an old
@@ -214,16 +251,15 @@ check_old_code(Mod) ->
%%-----------------------------------------------------------------
eval({load_object_code, {Lib, LibVsn, Modules}}, EvalState) ->
case lists:keysearch(Lib, 1, EvalState#eval_state.libdirs) of
- {value, {Lib, LibVsn, LibDir}} ->
- Ebin = filename:join(LibDir, "ebin"),
+ {value, {Lib, LibVsn, LibDir} = LibInfo} ->
Ext = code:objfile_extension(),
{NewBins, NewVsns} =
lists:foldl(fun(Mod, {Bins, Vsns}) ->
File = lists:concat([Mod, Ext]),
- FName = filename:join(Ebin, File),
+ FName = filename:join([LibDir, "ebin", File]),
case erl_prim_loader:get_file(FName) of
{ok, Bin, FName2} ->
- NVsns = add_new_vsn(Mod, Bin, Vsns),
+ NVsns = add_vsns(Mod, Bin, Vsns),
{[{Mod, Bin, FName2} | Bins],NVsns};
error ->
throw({error, {no_such_file,FName}})
@@ -232,7 +268,7 @@ eval({load_object_code, {Lib, LibVsn, Modules}}, EvalState) ->
{EvalState#eval_state.bins,
EvalState#eval_state.vsns},
Modules),
- NewLibs = [{Lib, Ebin} | EvalState#eval_state.newlibs],
+ NewLibs = lists:keystore(Lib,1,EvalState#eval_state.newlibs,LibInfo),
EvalState#eval_state{bins = NewBins,
newlibs = NewLibs,
vsns = NewVsns};
@@ -242,15 +278,14 @@ eval({load_object_code, {Lib, LibVsn, Modules}}, EvalState) ->
eval(point_of_no_return, EvalState) ->
Libs = case get_opt(update_paths, EvalState, false) of
false ->
- EvalState#eval_state.newlibs; % [{Lib, Path}]
+ EvalState#eval_state.newlibs;
true ->
- lists:map(fun({Lib, _LibVsn, LibDir}) ->
- Ebin= filename:join(LibDir,"ebin"),
- {Lib, Ebin}
- end,
- EvalState#eval_state.libdirs)
+ EvalState#eval_state.libdirs
end,
- lists:foreach(fun({Lib, Path}) -> code:replace_path(Lib, Path) end,
+ lists:foreach(fun({Lib, _LibVsn, LibDir}) ->
+ Ebin = filename:join(LibDir,"ebin"),
+ code:replace_path(Lib, Ebin)
+ end,
Libs),
EvalState;
eval({load, {Mod, _PrePurgeMethod, PostPurgeMethod}}, EvalState) ->
@@ -258,32 +293,21 @@ eval({load, {Mod, _PrePurgeMethod, PostPurgeMethod}}, EvalState) ->
{value, {_Mod, Bin, File}} = lists:keysearch(Mod, 1, Bins),
% load_binary kills all procs running old code
% if soft_purge, we know that there are no such procs now
- Vsns = EvalState#eval_state.vsns,
- NewVsns = add_old_vsn(Mod, Vsns),
code:load_binary(Mod, File, Bin),
% Now, the prev current is old. There might be procs
% running it. Find them.
Unpurged = do_soft_purge(Mod,PostPurgeMethod,EvalState#eval_state.unpurged),
EvalState#eval_state{bins = lists:keydelete(Mod, 1, Bins),
- unpurged = Unpurged,
- vsns = NewVsns};
+ unpurged = Unpurged};
eval({remove, {Mod, _PrePurgeMethod, PostPurgeMethod}}, EvalState) ->
- % purge kills all procs running old code
- % if soft_purge, we know that there are no such procs now
- Vsns = EvalState#eval_state.vsns,
- NewVsns = add_old_vsn(Mod, Vsns),
+ %% purge kills all procs running old code
+ %% if soft_purge, we know that there are no such procs now
code:purge(Mod),
code:delete(Mod),
- % Now, the prev current is old. There might be procs
- % running it. Find them.
- Unpurged =
- case code:soft_purge(Mod) of
- true -> EvalState#eval_state.unpurged;
- false -> [{Mod, PostPurgeMethod} | EvalState#eval_state.unpurged]
- end,
-%% Bins = EvalState#eval_state.bins,
-%% EvalState#eval_state{bins = lists:keydelete(Mod, 1, Bins),
- EvalState#eval_state{unpurged = Unpurged, vsns = NewVsns};
+ %% Now, the prev current is old. There might be procs
+ %% running it. Find them.
+ Unpurged = do_soft_purge(Mod,PostPurgeMethod,EvalState#eval_state.unpurged),
+ EvalState#eval_state{unpurged = Unpurged};
eval({purge, Modules}, EvalState) ->
% Now, if there are any processes still executing old code, OR
% if some new processes started after suspend but before load,
@@ -469,6 +493,19 @@ start(Procs) ->
%% supervisor module, we should load the new version, and then
%% delete the old. Then we should perform the start changes
%% manually, by adding/deleting children.
+%%
+%% Recent changes to this code cause the upgrade error out and
+%% log the case where a suspended supervisor has which_children
+%% called against it. This retains the behavior of causing a VM
+%% restart to the *old* version of a release but has the
+%% advantage of logging the pid and supervisor that had the
+%% issue.
+%%
+%% A second case where this can occur is if a child spec is
+%% incorrect and get_modules is called against a process that
+%% can't respond to the gen:call. Again an error is logged,
+%% an error returned and a VM restart is issued.
+%%
%% Returns: [{SuperPid, ChildName, ChildPid, Mods}]
%%-----------------------------------------------------------------
%% OTP-3452. For each application the first item contains the pid
@@ -478,49 +515,81 @@ start(Procs) ->
get_supervised_procs() ->
lists:foldl(
fun(Application, Procs) ->
- case application_controller:get_master(Application) of
- Pid when is_pid(Pid) ->
- {Root, _AppMod} = application_master:get_child(Pid),
- case get_supervisor_module(Root) of
- {ok, SupMod} ->
- get_procs(supervisor:which_children(Root),
- Root) ++
- [{undefined, undefined, Root, [SupMod]} |
- Procs];
- {error, _} ->
- error_logger:error_msg("release_handler: "
- "cannot find top "
- "supervisor for "
- "application ~w~n",
- [Application]),
- get_procs(supervisor:which_children(Root),
- Root) ++ Procs
- end;
- _ -> Procs
- end
+ get_master_procs(Application,
+ Procs,
+ application_controller:get_master(Application))
end,
[],
- lists:map(fun({Application, _Name, _Vsn}) ->
- Application
- end,
- application:which_applications())).
+ get_application_names()).
+
+get_supervised_procs(_, Root, Procs, {ok, SupMod}) ->
+ get_procs(maybe_supervisor_which_children(get_proc_state(Root), SupMod, Root), Root) ++
+ [{undefined, undefined, Root, [SupMod]} | Procs];
+get_supervised_procs(Application, Root, Procs, {error, _}) ->
+ error_logger:error_msg("release_handler: cannot find top supervisor for "
+ "application ~w~n", [Application]),
+ get_procs(maybe_supervisor_which_children(get_proc_state(Root), Application, Root), Root) ++ Procs.
+
+get_application_names() ->
+ lists:map(fun({Application, _Name, _Vsn}) ->
+ Application
+ end,
+ application:which_applications()).
+
+get_master_procs(Application, Procs, Pid) when is_pid(Pid) ->
+ {Root, _AppMod} = application_master:get_child(Pid),
+ get_supervised_procs(Application, Root, Procs, get_supervisor_module(Root));
+get_master_procs(_, Procs, _) ->
+ Procs.
get_procs([{Name, Pid, worker, dynamic} | T], Sup) when is_pid(Pid) ->
- Mods = get_dynamic_mods(Pid),
+ Mods = maybe_get_dynamic_mods(Name, Pid),
[{Sup, Name, Pid, Mods} | get_procs(T, Sup)];
get_procs([{Name, Pid, worker, Mods} | T], Sup) when is_pid(Pid), is_list(Mods) ->
[{Sup, Name, Pid, Mods} | get_procs(T, Sup)];
get_procs([{Name, Pid, supervisor, Mods} | T], Sup) when is_pid(Pid) ->
- [{Sup, Name, Pid, Mods} | get_procs(T, Sup)] ++
- get_procs(supervisor:which_children(Pid), Pid);
+ [{Sup, Name, Pid, Mods} | get_procs(T, Sup)] ++
+ get_procs(maybe_supervisor_which_children(get_proc_state(Pid), Name, Pid), Pid);
get_procs([_H | T], Sup) ->
get_procs(T, Sup);
get_procs(_, _Sup) ->
[].
-get_dynamic_mods(Pid) ->
- {ok,Res} = gen:call(Pid, self(), get_modules),
- Res.
+get_proc_state(Proc) ->
+ {status, _, {module, _}, [_, State, _, _, _]} = sys:get_status(Proc),
+ State.
+
+maybe_supervisor_which_children(suspended, Name, Pid) ->
+ error_logger:error_msg("release_handler: a which_children call"
+ " to ~p (~p) was avoided. This supervisor"
+ " is suspended and should likely be upgraded"
+ " differently. Exiting ...~n", [Name, Pid]),
+ error(suspended_supervisor);
+
+maybe_supervisor_which_children(State, Name, Pid) ->
+ case catch supervisor:which_children(Pid) of
+ Res when is_list(Res) ->
+ Res;
+ Other ->
+ error_logger:error_msg("release_handler: ~p~nerror during"
+ " a which_children call to ~p (~p)."
+ " [State: ~p] Exiting ... ~n",
+ [Other, Name, Pid, State]),
+ error(which_children_failed)
+ end.
+
+maybe_get_dynamic_mods(Name, Pid) ->
+ case catch gen:call(Pid, self(), get_modules) of
+ {ok, Res} ->
+ Res;
+ Other ->
+ error_logger:error_msg("release_handler: ~p~nerror during a"
+ " get_modules call to ~p (~p),"
+ " there may be an error in it's"
+ " childspec. Exiting ...~n",
+ [Other, Name, Pid]),
+ error(get_modules_failed)
+ end.
%% XXXX
%% Note: The following is a terrible hack done in order to resolve the
@@ -606,26 +675,20 @@ sync_nodes(Id, Nodes) ->
end,
NNodes).
-add_old_vsn(Mod, Vsns) ->
+add_vsns(Mod, NewBin, Vsns) ->
+ OldVsn = get_current_vsn(Mod),
+ NewVsn = get_vsn(NewBin),
case lists:keysearch(Mod, 1, Vsns) of
- {value, {Mod, undefined, NewVsn}} ->
- OldVsn = get_current_vsn(Mod),
- lists:keyreplace(Mod, 1, Vsns, {Mod, OldVsn, NewVsn});
- {value, {Mod, _OldVsn, _NewVsn}} ->
- Vsns;
+ {value, {Mod, OldVsn0, NewVsn0}} ->
+ lists:keyreplace(Mod, 1, Vsns, {Mod,
+ replace_undefined(OldVsn0,OldVsn),
+ replace_undefined(NewVsn0,NewVsn)});
false ->
- OldVsn = get_current_vsn(Mod),
- [{Mod, OldVsn, undefined} | Vsns]
+ [{Mod, OldVsn, NewVsn} | Vsns]
end.
-add_new_vsn(Mod, Bin, Vsns) ->
- NewVsn = get_vsn(Bin),
- case lists:keysearch(Mod, 1, Vsns) of
- {value, {Mod, OldVsn, undefined}} ->
- lists:keyreplace(Mod, 1, Vsns, {Mod, OldVsn, NewVsn});
- false ->
- [{Mod, undefined, NewVsn} | Vsns]
- end.
+replace_undefined(undefined,Vsn) -> Vsn;
+replace_undefined(Vsn,_) -> Vsn.
%%-----------------------------------------------------------------
%% Func: get_current_vsn/1
@@ -645,7 +708,9 @@ get_current_vsn(Mod) ->
{ok, Bin, _File2} ->
get_vsn(Bin);
error ->
- throw({error, {no_such_file, File}})
+ %% This is the case when a new module is added, there will
+ %% be no current version of it at the time of this call.
+ undefined
end.
%%-----------------------------------------------------------------
diff --git a/lib/sasl/src/systools_lib.erl b/lib/sasl/src/systools_lib.erl
index b652c109fe..1b6ea125d9 100644
--- a/lib/sasl/src/systools_lib.erl
+++ b/lib/sasl/src/systools_lib.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -24,7 +24,7 @@
%%
-export([file_term2binary/2, read_term/1, read_term_from_stream/2,
- get_dirs/1, get_path/1]).
+ get_dirs/1, get_path/1, werror/2]).
-include_lib("kernel/include/file.hrl").
@@ -176,21 +176,26 @@ add_dirs(RegName, Dirs, Root) ->
regexp_match(RegName, D0, Root) ->
case file:list_dir(D0) of
{ok, Files} when length(Files) > 0 ->
- FR = fun(F) ->
- case regexp:match(F, RegName) of
- {match,1,N} when N == length(F) ->
- DirF = join(D0, F, Root),
- case dir_p(DirF) of
- true ->
- {true, DirF};
+ case re:compile(RegName) of
+ {ok, MP} ->
+ FR = fun(F) ->
+ case re:run(F, MP) of
+ {match,[{0,N}]} when N == length(F) ->
+ DirF = join(D0, F, Root),
+ case dir_p(DirF) of
+ true ->
+ {true, DirF};
+ _ ->
+ false
+ end;
_ ->
false
- end;
- _ ->
- false
- end
- end,
- {true,lists:zf(FR, Files)};
+ end
+ end,
+ {true,lists:zf(FR, Files)};
+ _ ->
+ false
+ end;
_ ->
false
end.
@@ -214,6 +219,7 @@ flat([H|T], Ack) ->
flat(T, [H|Ack]);
flat([], Ack) ->
lists:reverse(Ack).
-
-
+
+werror(Options, Warnings) ->
+ lists:member(warnings_as_errors, Options) andalso Warnings =/= [].
diff --git a/lib/sasl/src/systools_make.erl b/lib/sasl/src/systools_make.erl
index 7489ee58d2..7f400f5cce 100644
--- a/lib/sasl/src/systools_make.erl
+++ b/lib/sasl/src/systools_make.erl
@@ -44,10 +44,12 @@
%%-----------------------------------------------------------------
%% Create a boot script from a release file.
-%% Options is a list of {path, Path} | silent | local where path sets
-%% the search path, silent supresses error message printing on console,
-%% local generates a script with references to the directories there
-%% the applications are found.
+%% Options is a list of {path, Path} | silent | local
+%% | warnings_as_errors
+%% where path sets the search path, silent supresses error message
+%% printing on console, local generates a script with references
+%% to the directories there the applications are found,
+%% and warnings_as_errors treats warnings as errors.
%%
%% New options: {path,Path} can contain wildcards
%% src_tests
@@ -85,11 +87,16 @@ make_script(RelName, Output, Flags) when is_list(RelName),
ModTestP = {member(src_tests, Flags),xref_p(Flags)},
case get_release(RelName, Path, ModTestP, machine(Flags)) of
{ok, Release, Appls, Warnings} ->
- case generate_script(Output,Release,Appls,Flags) of
- ok ->
+ case systools_lib:werror(Flags, Warnings) of
+ true ->
return(ok,Warnings,Flags);
- Error ->
- return(Error,Warnings,Flags)
+ false ->
+ case generate_script(Output,Release,Appls,Flags) of
+ ok ->
+ return(ok,Warnings,Flags);
+ Error ->
+ return(Error,Warnings,Flags)
+ end
end;
Error ->
return(Error,[],Flags)
@@ -130,10 +137,21 @@ get_outdir(Flags) ->
return(ok,Warnings,Flags) ->
case member(silent,Flags) of
true ->
- {ok,?MODULE,Warnings};
+ case systools_lib:werror(Flags, Warnings) of
+ true ->
+ error;
+ false ->
+ {ok,?MODULE,Warnings}
+ end;
_ ->
- io:format("~s",[format_warning(Warnings)]),
- ok
+ case member(warnings_as_errors,Flags) of
+ true ->
+ io:format("~s",[format_warning(Warnings, true)]),
+ error;
+ false ->
+ io:format("~s",[format_warning(Warnings)]),
+ ok
+ end
end;
return({error,Mod,Error},_,Flags) ->
case member(silent,Flags) of
@@ -1612,9 +1630,9 @@ var_dir(_Dir, _, _, []) ->
false.
appDir(AppDir) ->
- case reverse(filename:split(AppDir)) of
- ["ebin"|Dir] -> filename:join(reverse(Dir));
- _ -> AppDir
+ case filename:basename(AppDir) of
+ "ebin" -> filename:dirname(AppDir);
+ _ -> AppDir
end.
add_modules(Modules, Tar, AppDir, ToDir, Ext) ->
@@ -1833,78 +1851,89 @@ get_flag(_,_) -> false.
%% Check Options for make_script
check_args_script(Args) ->
cas(Args,
- {undef, undef, undef, undef, undef, undef, undef, undef, []}).
+ {undef, undef, undef, undef, undef, undef, undef, undef,
+ undef, []}).
-cas([], {_Path,_Sil,_Loc,_Test,_Var,_Mach,_Xref,_XrefApps, X}) ->
+cas([], {_Path,_Sil,_Loc,_Test,_Var,_Mach,_Xref,_XrefApps,_Werror, X}) ->
X;
%%% path ---------------------------------------------------------------
-cas([{path, P} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(P) ->
+cas([{path, P} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(P) ->
case check_path(P) of
ok ->
- cas(Args, {P, Sil, Loc, Test, Var, Mach, Xref, XrefApps,X});
+ cas(Args, {P, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
+ Werror, X});
error ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
- X++[{path,P}]})
+ Werror, X++[{path,P}]})
end;
%%% silent -------------------------------------------------------------
-cas([silent | Args], {Path, _Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, silent, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([silent | Args], {Path, _Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, silent, Loc, Test, Var, Mach, Xref, XrefApps,
+ Werror, X});
%%% local --------------------------------------------------------------
-cas([local | Args], {Path, Sil, _Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, local, Test, Var, Mach, Xref, XrefApps, X});
+cas([local | Args], {Path, Sil, _Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, local, Test, Var, Mach, Xref, XrefApps,
+ Werror, X});
%%% src_tests -------------------------------------------------------
-cas([src_tests | Args], {Path, Sil, Loc, _Test, Var, Mach,
- Xref, XrefApps, X}) ->
+cas([src_tests | Args], {Path, Sil, Loc, _Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
cas(Args,
- {Path, Sil, Loc, src_tests, Var, Mach, Xref, XrefApps,X});
+ {Path, Sil, Loc, src_tests, Var, Mach, Xref, Werror, XrefApps,X});
%%% variables ----------------------------------------------------------
-cas([{variables, V} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(V) ->
+cas([{variables, V} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(V) ->
case check_vars(V) of
ok ->
cas(Args,
- {Path, Sil, Loc, Test, V, Mach, Xref, XrefApps, X});
+ {Path, Sil, Loc, Test, V, Mach, Xref, XrefApps, Werror, X});
error ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
- X++[{variables, V}]})
+ Werror, X++[{variables, V}]})
end;
%%% machine ------------------------------------------------------------
-cas([{machine, M} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_atom(M) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([{machine, M} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_atom(M) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
%%% exref --------------------------------------------------------------
-cas([exref | Args], {Path, Sil, Loc, Test, Var, Mach,
- _Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, exref, XrefApps, X});
+cas([exref | Args], {Path, Sil, Loc, Test, Var, Mach, _Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, exref, XrefApps, Werror, X});
%%% exref Apps ---------------------------------------------------------
-cas([{exref, Apps} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(Apps) ->
+cas([{exref, Apps} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(Apps) ->
case check_apps(Apps) of
ok ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach,
- Xref, Apps, X});
+ Xref, Apps, Werror, X});
error ->
cas(Args, {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X++[{exref, Apps}]})
+ Xref, XrefApps, Werror, X++[{exref, Apps}]})
end;
%%% outdir Dir ---------------------------------------------------------
-cas([{outdir, Dir} | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) when is_list(Dir) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([{outdir, Dir} | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) when is_list(Dir) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
%%% otp_build (secret, not documented) ---------------------------------
-cas([otp_build | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X});
+cas([otp_build | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
%%% no_module_tests (kept for backwards compatibility, but ignored) ----
-cas([no_module_tests | Args], {Path, Sil, Loc, Test, Var, Mach,
- Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,X});
+cas([no_module_tests | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror, X});
+%%% warnings_as_errors (kept for backwards compatibility, but ignored) ----
+cas([warnings_as_errors | Args], {Path, Sil, Loc, Test, Var, Mach, Xref,
+ XrefApps, _Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
+ warnings_as_errors, X});
%%% ERROR --------------------------------------------------------------
-cas([Y | Args], {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, X}) ->
- cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,X++[Y]}).
+cas([Y | Args], {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps,
+ Werror, X}) ->
+ cas(Args, {Path, Sil, Loc, Test, Var, Mach, Xref, XrefApps, Werror,
+ X++[Y]}).
@@ -2030,7 +2059,6 @@ check_apps([H|T]) when is_atom(H) ->
check_apps(_) ->
error.
-
%% Format error
format_error(badly_formatted_release) ->
@@ -2144,21 +2172,31 @@ form_tar_err({add, File, Error}) ->
%% Format warning
format_warning(Warnings) ->
- map(fun({warning,W}) -> form_warn(W) end, Warnings).
-
-form_warn({source_not_found,{Mod,_,App,_,_}}) ->
- io_lib:format("*WARNING* ~p: Source code not found: ~p.erl~n",
- [App,Mod]);
-form_warn({{parse_error, File},{_,_,App,_,_}}) ->
- io_lib:format("*WARNING* ~p: Parse error: ~p~n",
- [App,File]);
-form_warn({obj_out_of_date,{Mod,_,App,_,_}}) ->
- io_lib:format("*WARNING* ~p: Object code (~p) out of date~n",[App,Mod]);
-form_warn({exref_undef, Undef}) ->
- F = fun({M,F,A}) ->
- io_lib:format("*WARNING* Undefined function ~p:~p/~p~n",
- [M,F,A])
+ format_warning(Warnings, false).
+
+format_warning(Warnings, Werror) ->
+ Prefix = case Werror of
+ true ->
+ "";
+ false ->
+ "*WARNING* "
+ end,
+ map(fun({warning,W}) -> form_warn(Prefix, W) end, Warnings).
+
+form_warn(Prefix, {source_not_found,{Mod,_,App,_,_}}) ->
+ io_lib:format("~s~p: Source code not found: ~p.erl~n",
+ [Prefix,App,Mod]);
+form_warn(Prefix, {{parse_error, File},{_,_,App,_,_}}) ->
+ io_lib:format("~s~p: Parse error: ~p~n",
+ [Prefix,App,File]);
+form_warn(Prefix, {obj_out_of_date,{Mod,_,App,_,_}}) ->
+ io_lib:format("~s~p: Object code (~p) out of date~n",
+ [Prefix,App,Mod]);
+form_warn(Prefix, {exref_undef, Undef}) ->
+ F = fun({M,F,A}) ->
+ io_lib:format("~sUndefined function ~p:~p/~p~n",
+ [Prefix,M,F,A])
end,
map(F, Undef);
-form_warn(What) ->
- io_lib:format("*WARNING* ~p~n", [What]).
+form_warn(Prefix, What) ->
+ io_lib:format("~s ~p~n", [Prefix,What]).
diff --git a/lib/sasl/src/systools_relup.erl b/lib/sasl/src/systools_relup.erl
index ec5486226c..6d9e922900 100644
--- a/lib/sasl/src/systools_relup.erl
+++ b/lib/sasl/src/systools_relup.erl
@@ -122,7 +122,7 @@
%% rel_filename() = description() = string()
%% Opts = [opt()]
%% opt() = {path, [path()]} | silent | noexec | restart_emulator
-%% | {outdir, string()}
+%% | {outdir, string()} | warnings_as_errors
%% path() = [string()]
%% Ret = ok | error | {ok, Relup, Module, Warnings} | {error, Module, Error}
%%
@@ -139,8 +139,9 @@
%%
%% The option `path' sets search path, `silent' suppresses printing of
%% error messages to the console, `noexec' inhibits the creation of
-%% the output "relup" file, and restart_emulator ensures that the new
-%% emulator is restarted (as the final step).
+%% the output "relup" file, restart_emulator ensures that the new
+%% emulator is restarted (as the final step), and `warnings_as_errors'
+%% treats warnings as errors.
%% ----------------------------------------------------------------
mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs) ->
mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs, []).
@@ -153,14 +154,29 @@ mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs, Opts) ->
{false, false} ->
case R of
{ok, _Res, _Mod, Ws} ->
- print_warnings(Ws),
- ok;
+ print_warnings(Ws, Opts),
+ case systools_lib:werror(Opts, Ws) of
+ true ->
+ error;
+ false ->
+ ok
+ end;
Other ->
print_error(Other),
error
end;
- _ ->
- R
+ _ ->
+ case R of
+ {ok, _Res, _Mod, Ws} ->
+ case systools_lib:werror(Opts, Ws) of
+ true ->
+ error;
+ false ->
+ R
+ end;
+ R ->
+ R
+ end
end;
BadArg ->
erlang:error({badarg, BadArg})
@@ -195,7 +211,12 @@ do_mk_relup(TopRelFile, BaseUpRelDcs, BaseDnRelDcs, Path, Opts) ->
{Dn, Ws2} = foreach_baserel_dn(TopRel, TopApps, BaseDnRelDcs,
Path, Opts, Ws1),
Relup = {TopRel#release.vsn, Up, Dn},
- write_relup_file(Relup, Opts),
+ case systools_lib:werror(Opts, Ws2) of
+ true ->
+ ok;
+ false ->
+ write_relup_file(Relup, Opts)
+ end,
{ok, Relup, ?MODULE, Ws2};
Other ->
throw(Other)
@@ -527,20 +548,29 @@ format_error(Error) ->
io:format("~p~n", [Error]).
-print_warnings(Ws) when is_list(Ws) ->
- lists:foreach(fun(W) -> print_warning(W) end, Ws);
-print_warnings(W) ->
- print_warning(W).
+print_warnings(Ws, Opts) when is_list(Ws) ->
+ lists:foreach(fun(W) -> print_warning(W, Opts) end, Ws);
+print_warnings(W, Opts) ->
+ print_warning(W, Opts).
-print_warning(W) ->
- S = format_warning(W),
+print_warning(W, Opts) ->
+ Prefix = case lists:member(warnings_as_errors, Opts) of
+ true ->
+ "";
+ false ->
+ "*WARNING* "
+ end,
+ S = format_warning(Prefix, W),
io:format("~s", [S]).
-format_warning({erts_vsn_changed, {Rel1, Rel2}}) ->
- io_lib:format("*WARNING* The ERTS version changed between ~p and ~p~n",
- [Rel1, Rel2]);
-format_warning(What) ->
- io_lib:format("*WARNING* ~p~n",[What]).
+format_warning(W) ->
+ format_warning("*WARNING* ", W).
+
+format_warning(Prefix, {erts_vsn_changed, {Rel1, Rel2}}) ->
+ io_lib:format("~sThe ERTS version changed between ~p and ~p~n",
+ [Prefix, Rel1, Rel2]);
+format_warning(Prefix, What) ->
+ io_lib:format("~s~p~n",[Prefix, What]).
get_reason({error, {open, _, _}}) -> open;
diff --git a/lib/sasl/test/Makefile b/lib/sasl/test/Makefile
index ad08c8136b..65be134462 100644
--- a/lib/sasl/test/Makefile
+++ b/lib/sasl/test/Makefile
@@ -31,7 +31,8 @@ MODULES= \
systools_SUITE \
systools_rc_SUITE \
overload_SUITE \
- rb_SUITE
+ rb_SUITE \
+ rh_test_lib
ERL_FILES= $(MODULES:%=%.erl)
@@ -85,7 +86,7 @@ release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) sasl.spec sasl.cover $(EMAKEFILE) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cfh - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/sasl/test/installer.erl b/lib/sasl/test/installer.erl
index a114c4b5c9..f5ceab0dc4 100644
--- a/lib/sasl/test/installer.erl
+++ b/lib/sasl/test/installer.erl
@@ -119,6 +119,7 @@ install_3(TestNode,PrivDir) ->
?print(["install_3 unpack_release P2A ok"]),
?check_release("P2A",unpacked,["a-1.1"]),
{ok, "P1I", [new_emu]} = release_handler:check_install_release("P2A"),
+ ?print(["install_3 check_install_release P2A ok"]),
ok = release_handler:make_permanent("P1I"),
?print(["install_3 make_permanent P1I ok"]),
?check_release("P1I",permanent,["a-1.1"]),
@@ -268,23 +269,30 @@ client1_1(TestNode,PrivDir,MasterDir,ClientSname) ->
erl_boot_server:start([IP]),
ok = net_kernel:monitor_nodes(true),
- Node = start_client(TestNode,ClientSname),
+ Node = start_client(TestNode,client1,ClientSname),
trace_disallowed_calls(Node),
%% Check env var for SASL on client node
SaslEnv = rpc:call(Node, application, get_all_env, [sasl]),
+ ?print([{client1_1,sasl_env},SaslEnv]),
{_,CliDir} = lists:keyfind(client_directory,1,SaslEnv),
{_,[Master]} = lists:keyfind(masters,1,SaslEnv),
{_,StartCli} = lists:keyfind(start_prg,1,SaslEnv),
- Root = code:root_dir(),
- true = (CliDir =:= filename:join([Root,"clients","type1",Node])),
- true = (StartCli =:= filename:join([CliDir,"bin","start"])),
+ NodeStr = atom_to_list(Node),
+ [NodeStr,"type1","clients"|_] = lists:reverse(filename:split(CliDir)),
true = (Master =:= node()),
+ case os:type() of
+ {unix,_} ->
+ true = (StartCli =:= filename:join([CliDir,"bin","start"]));
+ _ ->
+ ok
+ end,
%% Unpack P1H on master
{ok, "P1H"} = unpack_release(PrivDir,"rel1"),
%% Unpack and install P1H on client
+ Root = code:root_dir(),
P1HDir = filename:join([Root, "releases", "P1H"]),
%% The AppDirs argument (last arg to set_unpacked) below is really
@@ -339,6 +347,7 @@ client1_2(TestNode,PrivDir,Node) ->
?check_running_app_client(Node,a,"1.0"),
ok = rpc:call(Node, release_handler, make_permanent, ["P1H"]),
+ ?check_release_client(Node,"P1H",permanent,["a-1.0"]),
check_disallowed_calls(),
reboot(TestNode,Node),
@@ -584,7 +593,7 @@ trace_disallowed_calls(Node) ->
MasterProc = self(),
rpc:call(Node,dbg,tracer,[process,{fun(T,_) -> MasterProc ! T end,[]}]),
rpc:call(Node,dbg,p,[all,call]),
- rpc:call(Node,dbg,tp,[file,[]]).
+ rpc:call(Node,dbg,tp,[file,[{'_',[],[{message,{caller}}]}]]).
check_disallowed_calls() ->
receive
@@ -594,13 +603,12 @@ check_disallowed_calls() ->
ok
end.
-start_client(TestNode,Client) ->
- {Start, Node} = do_start_client(Client,test_host()),
- Cmd = lists:concat(["env NODENAME=",Client," ",
- filename:join(code:root_dir(), Start)]),
- ?print([{start_client,Client},Cmd]),
- Res = os:cmd(Cmd),
- ?print([{start_client,result},Res]),
+start_client(TestNode,Client,Sname) ->
+ Node = list_to_atom(lists:concat([Sname,"@",test_host()])),
+ case os:type() of
+ {unix,_} -> start_client_unix(TestNode,Sname,Node);
+ {win32,_} -> start_client_win32(TestNode,Client,Sname)
+ end,
receive
{nodeup, Node} ->
wait_started(TestNode,Node)
@@ -609,10 +617,34 @@ start_client(TestNode,Client) ->
?fail({"can not start", Node})
end.
-do_start_client(Client, Host) ->
- Node = list_to_atom(lists:concat([Client,"@",Host])),
+start_client_unix(TestNode,Sname,Node) ->
Start = filename:join(["clients", "type1", Node, "bin", "start"]),
- {Start, Node}.
+ Cmd = lists:concat(["env NODENAME=",Sname," ",
+ filename:join(code:root_dir(), Start)]),
+ ?print([{start_client,Sname},Cmd]),
+ Res = os:cmd(Cmd),
+ ?print([{start_client,result},Res]).
+
+start_client_win32(TestNode,Client,ClientSname) ->
+ Name = atom_to_list(ClientSname) ++ "_P1G",
+ RootDir = code:root_dir(),
+ ErtsBinDir = filename:join(RootDir,"erts-4.4/bin"),
+
+ {ClientArgs,RelClientDir} = rh_test_lib:get_client_args(Client,ClientSname,
+ RootDir),
+ StartErlArgs = rh_test_lib:get_start_erl_args(RootDir,RelClientDir,
+ ClientArgs),
+ ServiceArgs = rh_test_lib:get_service_args(RootDir, RelClientDir,
+ ClientSname, StartErlArgs),
+
+ ?print([{start_client,ClientSname},ServiceArgs]),
+ Erlsrv = filename:nativename(filename:join(ErtsBinDir,"erlsrv")),
+ rh_test_lib:erlsrv(Erlsrv,stop,Name),
+ rh_test_lib:erlsrv(Erlsrv,remove,Name),
+ ok = rh_test_lib:erlsrv(Erlsrv,add,Name,ServiceArgs),
+ ok = rh_test_lib:erlsrv(Erlsrv,start,Name),
+ ?print([{start_client,result},ok]),
+ ok.
reboot(TestNode,Node) ->
cover_client(TestNode,Node,stop_cover),
@@ -628,7 +660,7 @@ check_reboot(TestNode,Node) ->
receive
{nodeup, Node} -> wait_started(TestNode,Node)
after 30000 ->
- ?fail({Node, "not rebooted",net_adm:ping(Node)})
+ ?fail({Node, "not rebooted",net_adm:ping(Node)})
end
after 30000 ->
?fail({Node, "not closing down",net_adm:ping(Node)})
@@ -678,22 +710,28 @@ client2(TestNode,PrivDir,ClientSname) ->
release_handler:remove_release("P1H"),
ok = net_kernel:monitor_nodes(true),
- Node = start_client(TestNode,ClientSname),
+ Node = start_client(TestNode,client2,ClientSname),
%% Check env var for SASL on client node
- ?print([{sasl_env, Node}, rpc:call(Node, application, get_all_env, [sasl])]),
SaslEnv = rpc:call(Node, application, get_all_env, [sasl]),
+ ?print([{client1_1,sasl_env},SaslEnv]),
{_,CliDir} = lists:keyfind(client_directory,1,SaslEnv),
{_,[Master,Master2]} = lists:keyfind(masters,1,SaslEnv),
{_,StartCli} = lists:keyfind(start_prg,1,SaslEnv),
- Root = code:root_dir(),
- true = (CliDir =:= filename:join([Root,"clients","type1",Node])),
- true = (StartCli =:= filename:join([CliDir,"bin","start"])),
+ NodeStr = atom_to_list(Node),
+ [NodeStr,"type1","clients"|_] = lists:reverse(filename:split(CliDir)),
true = (Master =:= node()),
true = (Master2 =:= list_to_atom("master2@"++TestHost)),
+ case os:type() of
+ {unix,_} ->
+ true = (StartCli =:= filename:join([CliDir,"bin","start"]));
+ _ ->
+ ok
+ end,
{ok, "P1H"} = unpack_release(PrivDir,"rel1"),
+ Root = code:root_dir(),
{error,{bad_masters,[Master2]}} =
rpc:call(Node, release_handler, set_unpacked,
[filename:join([Root, "releases", "P1H", "rel1.rel"]),[]]),
diff --git a/lib/sasl/test/release_handler_SUITE.erl b/lib/sasl/test/release_handler_SUITE.erl
index efa775f344..af2183bfff 100644
--- a/lib/sasl/test/release_handler_SUITE.erl
+++ b/lib/sasl/test/release_handler_SUITE.erl
@@ -51,11 +51,14 @@ unix_cases() ->
[target_system] ++ RunErlCases ++ cases().
win32_cases() ->
- cases().
+ [{group,release} | cases()].
%% Cases that can be run on all platforms
cases() ->
- [otp_2740, otp_2760, otp_5761, instructions, eval_appup].
+ [otp_2740, otp_2760, otp_5761, otp_9402, otp_9417,
+ otp_9395_check_old_code, otp_9395_check_and_purge,
+ otp_9395_update_many_mods, otp_9395_rm_many_mods,
+ instructions, eval_appup, supervisor_which_children_timeout].
groups() ->
[{release,[],
@@ -148,6 +151,10 @@ init_per_group(release_gg, Config0) ->
end_per_group(release, Config) ->
Dog = ?t:timetrap(?default_timeout),
stop_print_proc(),
+ case os:type() of
+ {win32,_} -> delete_all_services();
+ _ -> ok
+ end,
delete_release(Config),
?t:timetrap_cancel(Dog),
Config;
@@ -169,6 +176,10 @@ end_per_testcase(Case, Config) ->
Dog=?config(watchdog, Config),
test_server:timetrap_cancel(Dog),
+ try apply(?MODULE,Case,[cleanup,Config])
+ catch error:undef -> ok
+ end,
+
%% DEBUG
case ?config(tc_status,Config) of
ok ->
@@ -206,10 +217,6 @@ end_per_testcase(Case, Config) ->
%% immediately restarted by heart and the test cases wait until
%% the node is actually up and running -- see wait_nodes_up/2)
file:delete("sasl_erl_crash.dump"),
-
- try apply(?MODULE,Case,[cleanup,Config])
- catch error:undef -> ok
- end,
ok.
gg_node_snames(Config) ->
@@ -224,7 +231,10 @@ gg_node_snames(Config) ->
no_run_erl(Config) when is_list(Config) ->
{comment, "No run_erl program"}.
-
+break(Config) ->
+ erlang:display(test_break),
+ ?t:break(priv_dir(Config)),
+ ok.
%% Test upgrade and downgrade of erts
upgrade(Conf) when is_list(Conf) ->
@@ -323,7 +333,7 @@ client1(Conf) when is_list(Conf) ->
%% Copy the P1G release to a directory for use in this testcase
ok = copy_installed(Conf,p1g_install,[Master]),
- ok = copy_client(Conf,Master,Client,"start_cli1"),
+ ok = copy_client(Conf,Master,Client,client1),
%% start the master node
[TestNode] = start_nodes(Conf,[Master],"client1"),
@@ -348,7 +358,7 @@ client2(Conf) when is_list(Conf) ->
%% Copy the P1G release to a directory for use in this testcase
ok = copy_installed(Conf,p1g_install,[Master]),
- ok = copy_client(Conf,Master,Client,"start_cli2"),
+ ok = copy_client(Conf,Master,Client,client2),
%% start the master node
[TestNode] = start_nodes(Conf,[Master],"client2"),
@@ -386,7 +396,7 @@ instructions(Conf) when is_list(Conf) ->
{stop, [aa]},
{apply, {?MODULE, no_cc, []}},
{start, [aa]}],
- {ok, _} = release_handler_1:eval_script(S1, [], []),
+ {ok, _} = release_handler_1:eval_script(S1),
case whereis(cc) of
Pid2 when is_pid(Pid2) -> ok;
@@ -396,17 +406,17 @@ instructions(Conf) when is_list(Conf) ->
%% Make bb run old version of b.
S2 = [point_of_no_return,
{remove, {b, soft_purge, soft_purge}}],
- {ok, [{b, soft_purge}]} = release_handler_1:eval_script(S2, [], []),
+ {ok, [{b, soft_purge}]} = release_handler_1:eval_script(S2),
check_bstate("first", [FirstBB]),
false = code:is_loaded(b),
- {error,{old_processes,b}} = release_handler_1:eval_script(S2,[],[]),
+ {error,{old_processes,b}} = release_handler_1:eval_script(S2),
check_bstate("first", [FirstBB]),
%% Let supervisor restart bb with new code
S3 = [point_of_no_return,
{purge, [b]}],
- {ok, []} = release_handler_1:eval_script(S3, [], []),
+ {ok, []} = release_handler_1:eval_script(S3),
ok = wait_for(bb),
check_bstate("second", []),
SecondBB = whereis(bb),
@@ -439,7 +449,7 @@ instructions(Conf) when is_list(Conf) ->
%% Let supervisor restart bb yet another time
S4 = [point_of_no_return,
{remove, {b, brutal_purge, soft_purge}}],
- {ok, HopefullyEmpty} = release_handler_1:eval_script(S4, [], []),
+ {ok, HopefullyEmpty} = release_handler_1:eval_script(S4),
ok = wait_for(bb),
FourthBB = whereis(bb),
@@ -513,6 +523,29 @@ no_cc() ->
%%%-----------------------------------------------------------------
%%-----------------------------------------------------------------
+%% release_handler_1:get_supervised_procs/0 test
+%%-----------------------------------------------------------------
+supervisor_which_children_timeout(Conf) ->
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"supervisor_which_children_timeout"),
+ DataDir = ?config(data_dir,Conf),
+ LibDir = filename:join([DataDir,release_handler_timeouts]),
+
+ Rel1 = create_and_install_fake_first_release(Dir,[{dummy,"0.1",LibDir}]),
+
+ {ok, Node} = t_start_node(supervisor_which_children_timeout, Rel1, []),
+ Proc = rpc:call(Node, erlang, whereis, [dummy_sup_2]),
+ ok = rpc:call(Node, sys, suspend, [Proc]),
+ Result = {badrpc, {'EXIT', {suspended_supervisor, _}}} =
+ rpc:call(Node, release_handler_1, get_supervised_procs, []),
+ ?t:format("release_handler_1:get_supervised_procs/0: ~p~n", [Result]),
+
+ ok.
+
+supervisor_which_children_timeout(cleanup, Conf) ->
+ stop_node(node_name(supervisor_which_children_timeout)).
+
+%%-----------------------------------------------------------------
%% Ticket: OTP-2740
%% Slogan: vsn not numeric doesn't work so good in release_handling
%%-----------------------------------------------------------------
@@ -549,7 +582,7 @@ otp_2760(Conf) ->
LibDir = filename:join([DataDir,app1_app2,lib1]),
Rel1 = create_and_install_fake_first_release(Dir,[{app1,"1.0",LibDir}]),
- Rel2 = create_fake_upgrade_release(Dir,"after",[],{Rel1,Rel1,[LibDir]}),
+ Rel2 = create_fake_upgrade_release(Dir,"after",[],{[Rel1],[Rel1],[LibDir]}),
Rel2Dir = filename:dirname(Rel2),
%% Start a node with Rel1.boot and check that the app1 module is loaded
@@ -559,13 +592,15 @@ otp_2760(Conf) ->
%% Execute the relup script and check that app1 is unloaded
{ok, [{"after", [{_Rel1Vsn, _Descr, Script}], _}]} =
file:consult(filename:join(Rel2Dir, "relup")),
- {ok, []} = rpc:call(Node, release_handler_1, eval_script,
- [Script, [], []]),
+ {ok, []} = rpc:call(Node, release_handler_1, eval_script, [Script]),
false = rpc:call(Node, code, is_loaded, [app1]),
- true = stop_node(Node),
ok.
+otp_2760(cleanup,_Conf) ->
+ stop_node(node_name(otp_2760)).
+
+
%% Test upgrade using other filesystem than the defined in OTP and
%% option {update_paths, true}
otp_5761(Conf) when is_list(Conf) ->
@@ -591,7 +626,7 @@ otp_5761(Conf) when is_list(Conf) ->
"2",
[{app1,"2.0",LibDir2},
{app2,"1.0",LibDir2}],
- {Rel1,Rel1,[LibDir1]}),
+ {[Rel1],[Rel1],[LibDir1]}),
Rel1Dir = filename:dirname(Rel1),
Rel2Dir = filename:dirname(Rel2),
@@ -647,10 +682,410 @@ otp_5761(Conf) when is_list(Conf) ->
App11Dir = rpc:call(Node, code, lib_dir, [app1]),
App2aDir = rpc:call(Node, code, lib_dir, [app2]),
- %% Stop the slave node
- true = stop_node(Node),
ok.
+otp_5761(cleanup,_Conf) ->
+ stop_node(node_name(otp_5761)).
+
+
+%% When a new version of an application is added, but no module is
+%% changed - the path was not updated - i.e. code:priv_dir would point
+%% to the old location.
+otp_9402(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9402"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{a,"1.1",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{a,"1.2",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9402, Rel1, filename:join(Rel1Dir,"sys.config")),
+
+ %% Check path
+ Dir1 = filename:join([LibDir, "a-1.1"]),
+ Dir1 = rpc:call(Node, code, lib_dir, [a]),
+ ABeam = rpc:call(Node, code, which, [a]),
+
+ %% Install second release, with no changed modules
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{a,"1.2",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ {ok, RelVsn1, []} =
+ rpc:call(Node, release_handler, install_release, [RelVsn2]),
+
+ %% Check path
+ Dir2 = filename:join([LibDir, "a-1.2"]),
+ Dir2 = rpc:call(Node, code, lib_dir, [a]),
+ APrivDir2 = rpc:call(Node, code, priv_dir, [a]),
+ true = filelib:is_regular(filename:join(APrivDir2,"file")),
+
+ %% Just to make sure no modules have been re-loaded
+ ABeam = rpc:call(Node, code, which, [a]),
+
+ %% Install RelVsn1 again
+ {ok, _OtherVsn, []} =
+ rpc:call(Node, release_handler, install_release, [RelVsn1]),
+
+ %% Check path
+ Dir1 = rpc:call(Node, code, lib_dir, [a]),
+ APrivDir1 = rpc:call(Node, code, priv_dir, [a]),
+ false = filelib:is_regular(filename:join(APrivDir1,"file")),
+
+ %% Just to make sure no modules have been re-loaded
+ ABeam = rpc:call(Node, code, which, [a]),
+
+ ok.
+
+otp_9402(cleanup,_Conf) ->
+ stop_node(node_name(otp_9402)).
+
+
+%% When a module is deleted in an appup instruction, the upgrade
+%% failed if the module was not loaded.
+otp_9417(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9417"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{b,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{b,"2.0",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9417, Rel1, filename:join(Rel1Dir,"sys.config")),
+
+ %% Check paths
+ Dir1 = filename:join([LibDir, "b-1.0"]),
+ Dir1 = rpc:call(Node, code, lib_dir, [b]),
+ BLibBeam = filename:join([Dir1,"ebin","b_lib.beam"]),
+ BLibBeam = rpc:call(Node,code,which,[b_lib]),
+ false = rpc:call(Node,code,is_loaded,[b_lib]),
+ false = rpc:call(Node,code,is_loaded,[b_server]),
+
+ %% Install second release, which removes b_lib module
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{b,"2.0",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ {ok, _RelVsn1, []} =
+ rpc:call(Node, release_handler, install_release, [RelVsn2]),
+
+ %% Check that the module does no longer exist
+ false = rpc:call(Node, code, is_loaded, [b_lib]),
+ non_existing = rpc:call(Node, code, which, [b_lib]),
+
+ %% And check some paths
+ Dir2 = filename:join([LibDir, "b-2.0"]),
+ Dir2 = rpc:call(Node, code, lib_dir, [b]),
+ BServerBeam = filename:join([Dir2,"ebin","b_server.beam"]),
+ {file,BServerBeam} = rpc:call(Node,code,is_loaded,[b_server]),
+ ok.
+
+otp_9417(cleanup,_Conf) ->
+ stop_node(node_name(otp_9417)).
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Test that the procedure of checking for old code before an upgrade
+%% can be started is "very much faster" when there is no old code in
+%% the system.
+otp_9395_check_old_code(Conf) when is_list(Conf) ->
+
+ NProcs = 1000,
+ MPath = filename:join([?config(data_dir,Conf),"lib","many_mods-1.0","ebin"]),
+ code:add_path(MPath),
+
+ %% Start NProc processes, each referencing each module
+ {Modules,Pids} = m:start(NProcs),
+
+ %% Load each module again in order to get old code
+ [code:load_file(Mod) || Mod <- Modules],
+ true = erlang:check_old_code(m10),
+
+ S = [point_of_no_return |
+ [{remove,{M,soft_purge,soft_purge}} || M <- Modules]],
+
+ %% Do the old code check, then purge, and redo
+ {T1,{ok,PurgeMods}} = timer:tc(release_handler_1,check_script,[S,[]]),
+ true = (lists:sort(PurgeMods) == lists:sort(Modules)),
+ [code:purge(M) || M <- PurgeMods],
+ {T2,{ok,[]}} = timer:tc(release_handler_1,check_script,[S,[]]),
+
+ %% Cleanup
+ lists:foreach(fun(Pid) -> Pid ! stop end, Pids),
+ lists:foreach(fun(Mod) -> code:purge(Mod),
+ code:delete(Mod),
+ code:purge(Mod)
+ end, Modules),
+ code:del_path(MPath),
+
+ %% Test that second run was much faster than the first
+ if T2 > 0 ->
+ X = T1/T2,
+ ct:log("~p procs, ~p mods -> ~n"
+ "\tWith old code: ~.2f sec~n"
+ "\tAfter purge: ~.2f sec~n"
+ "\tT1/T2: ~.2f",
+ [NProcs,length(Modules),T1/1000000,T2/1000000,X]),
+ if X < 1000 ->
+ ct:fail({not_enough_improvement_after_purge,round(X)});
+ true ->
+ ok
+ end;
+ T1 > 0 -> %% Means T1/T2 = infinite
+ ok;
+ true ->
+ ct:fail({unexpected_values,T1,T2})
+ end,
+ ok.
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Added option 'purge' to check_install_release
+otp_9395_check_and_purge(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9395_check_and_purge"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{b,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{b,"2.0",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9395_check_and_purge, Rel1,
+ filename:join(Rel1Dir,"sys.config")),
+
+ %% Make sure there is old code for b_lib and b_server
+ rpc:call(Node,code,load_file,[b_lib]),
+ rpc:call(Node,code,load_file,[b_lib]),
+ rpc:call(Node,code,load_file,[b_server]),
+ rpc:call(Node,code,load_file,[b_server]),
+ true = rpc:call(Node,erlang,check_old_code,[b_lib]),
+ true = rpc:call(Node,erlang,check_old_code,[b_server]),
+
+ %% Unpack second release, which removes b_lib module and loads b_server
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{b,"2.0",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ %% Do check_install_release, and check that old code still exists
+ {ok, _RelVsn1, []} =
+ rpc:call(Node, release_handler, check_install_release, [RelVsn2]),
+ true = rpc:call(Node,erlang,check_old_code,[b_lib]),
+ true = rpc:call(Node,erlang,check_old_code,[b_server]),
+
+ %% Do check_install_release with option 'purge' and check that old
+ %% code is gone
+ {ok, _RelVsn1, []} =
+ rpc:call(Node, release_handler, check_install_release, [RelVsn2,[purge]]),
+ false = rpc:call(Node,erlang,check_old_code,[b_lib]),
+ false = rpc:call(Node,erlang,check_old_code,[b_server]),
+
+ ok.
+
+otp_9395_check_and_purge(cleanup,_Conf) ->
+ stop_node(node_name(otp_9395_check_and_purge)).
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Upgrade which updates many modules (brutal_purge)
+otp_9395_update_many_mods(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9395_update_many_mods"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{many_mods,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{many_mods,"1.1",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9395_update_many_mods, Rel1,
+ filename:join(Rel1Dir,"sys.config")),
+
+ %% Start a lot of processes on the new node, all with refs to each
+ %% module that will be updated
+ NProcs = 1000,
+ {Modules,Pids1} = rpc:call(Node,m,start,[NProcs]),
+
+ %% Then load modules in order to get old code
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Unpack second release, which updates all mX modules
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{many_mods,"1.1",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ %% First, install release directly and check how much time it takes
+ {TInst0,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst0/1000000]),
+
+ %% Restore to old release, spawn processes again and load to get old code
+ {_,RelVsn1} = init:script_id(),
+ {_TInst1,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn1]]),
+% ct:log("install_release: ~.2f",[_TInst1/1000000]),
+
+ [exit(Pid,kill) || Pid <- Pids1],
+ {Modules,_Pids2} = rpc:call(Node,m,start,[NProcs]),
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Run check_install_release with purge before install this time
+ {TCheck,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, check_install_release,
+ [RelVsn2,[purge]]]),
+ ct:log("check_install_release with purge: ~.2f",[TCheck/1000000]),
+
+ %% Finally install release after check and purge, and check that
+ %% this install was faster than the first.
+ {TInst2,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst2/1000000]),
+
+ true = (TInst2 < TInst0),
+
+ ok.
+
+otp_9395_update_many_mods(cleanup,_Conf) ->
+ stop_node(node_name(otp_9395_update_many_mods)).
+
+
+%% OTP-9395 - performance problems when there are MANY processes
+%% Upgrade which removes many modules (brutal_purge)
+otp_9395_rm_many_mods(Conf) when is_list(Conf) ->
+ %% Set some paths
+ PrivDir = priv_dir(Conf),
+ Dir = filename:join(PrivDir,"otp_9395_rm_many_mods"),
+ LibDir = filename:join(?config(data_dir, Conf), "lib"),
+
+ %% Create the releases
+ Rel1 = create_and_install_fake_first_release(Dir,
+ [{many_mods,"1.0",LibDir}]),
+ Rel2 = create_fake_upgrade_release(Dir,
+ "2",
+ [{many_mods,"2.0",LibDir}],
+ {[Rel1],[Rel1],[LibDir]}),
+ Rel1Dir = filename:dirname(Rel1),
+ Rel2Dir = filename:dirname(Rel2),
+
+ %% Start a slave node
+ {ok, Node} = t_start_node(otp_9395_rm_many_mods, Rel1,
+ filename:join(Rel1Dir,"sys.config")),
+
+ %% Start a lot of processes on the new node, all with refs to each
+ %% module that will be updated
+ NProcs = 1000,
+ {Modules,Pids1} = rpc:call(Node,m,start,[NProcs]),
+
+ %% Then load modules in order to get old code
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Unpack second release, which removes all mX modules
+ {ok, RelVsn2} =
+ rpc:call(Node, release_handler, set_unpacked,
+ [Rel2++".rel", [{many_mods,"2.0",LibDir}]]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "relup")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "start.boot")]),
+ ok = rpc:call(Node, release_handler, install_file,
+ [RelVsn2, filename:join(Rel2Dir, "sys.config")]),
+
+ %% First, install release directly and check how much time it takes
+ {TInst0,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst0/1000000]),
+
+ %% Restore to old release, spawn processes again and load to get old code
+ {_,RelVsn1} = init:script_id(),
+ {_TInst1,{ok, _, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn1]]),
+% ct:log("install_release: ~.2f",[_TInst1/1000000]),
+
+ [exit(Pid,kill) || Pid <- Pids1],
+ {Modules,_Pids2} = rpc:call(Node,m,start,[NProcs]),
+ [rpc:call(Node,code,load_file,[Mod]) || Mod <- Modules],
+ true = rpc:call(Node,erlang,check_old_code,[m10]),
+
+ %% Run check_install_release with purge before install this time
+ {TCheck,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, check_install_release,
+ [RelVsn2,[purge]]]),
+ ct:log("check_install_release with purge: ~.2f",[TCheck/1000000]),
+
+ %% Finally install release after check and purge, and check that
+ %% this install was faster than the first.
+ {TInst2,{ok, _RelVsn1, []}} =
+ timer:tc(rpc,call,[Node, release_handler, install_release, [RelVsn2]]),
+ ct:log("install_release: ~.2f",[TInst2/1000000]),
+
+ true = (TInst2 =< TInst0),
+
+ ok.
+
+otp_9395_rm_many_mods(cleanup,_Conf) ->
+ stop_node(node_name(otp_9395_rm_many_mods)).
+
+
+
%% Test upgrade and downgrade of applications
eval_appup(Conf) when is_list(Conf) ->
@@ -983,19 +1418,16 @@ stop_node(Node) ->
?t:stop_node(Node).
-copy_client(Conf,Master,Sname,StartScript) ->
+copy_client(Conf,Master,Sname,Client) ->
io:format("copy_client(Conf)"),
DataDir = ?config(data_dir, Conf),
MasterDir = filename:join(priv_dir(Conf),Master),
- {ok,Host} = inet:gethostname(),
- {ok,IpTuple} = inet:getaddr(Host,inet),
- IpAddr = inet_parse:ntoa(IpTuple),
-
- CliNode = node_name(Sname),
+ {ClientArgs,RelCliDir} = rh_test_lib:get_client_args(Client,Sname,MasterDir,
+ node_name(Master)),
- Cli = filename:join([MasterDir, "clients", "type1", CliNode]),
+ Cli = filename:join([MasterDir, RelCliDir]),
ok = filelib:ensure_dir(filename:join([Cli,"bin","."])),
ok = filelib:ensure_dir(filename:join([Cli,"releases","."])),
ok = filelib:ensure_dir(filename:join([Cli,"log","."])),
@@ -1003,12 +1435,16 @@ copy_client(Conf,Master,Sname,StartScript) ->
P1GOrig = filename:join([MasterDir, "releases", "P1G"]),
ok = copy_tree(Conf,P1GOrig,filename:join(Cli,"releases")),
- ok = subst_file(filename:join([DataDir, "clients", StartScript]),
- filename:join([Cli,"bin","start"]),
- [{"ROOT",MasterDir},
- {"MASTER",atom_to_list(Master)},
- {"IPADDR",IpAddr}],
- [{chmod,8#0755}]),
+ case os:type() of
+ {unix,_} ->
+ ok = subst_file(filename:join([DataDir, "start_client"]),
+ filename:join([Cli,"bin","start"]),
+ [{"ROOT",MasterDir},
+ {"CLIENTARGS",ClientArgs}],
+ [{chmod,8#0755}]);
+ _ ->
+ ok
+ end,
StartErlData = filename:join([MasterDir, "releases", "start_erl.data"]),
CliRelDir = filename:join([Cli, "releases"]),
@@ -1030,21 +1466,32 @@ delete_release(Conf) ->
{ok, Dirs} = file:list_dir(PrivDir),
?t:format("======== deleting ~p~n",[Dirs]),
- ok = delete_release_os(Dirs),
- ?t:format("======== remaining ~p~n",[file:list_dir(PrivDir)]),
+ ok = delete_release_os(Dirs--["save"]),
+ {ok,Remaining} = file:list_dir(PrivDir),
+ ?t:format("======== remaining ~p~n",[Remaining]),
+
+ case Remaining of
+ [] ->
+ ok;
+ _ ->
+ delete_release_os(Remaining),
+ Remaining2 = file:list_dir(PrivDir),
+ ?t:format("======== remaining after second try ~p~n",[Remaining2])
+ end,
+
ok = file:set_cwd(OrigWd),
ok.
delete_release_os(Dirs) ->
case os:type() of
- {unix, _} ->
- delete_release_unix(Dirs);
- {win32, _} ->
- delete_release_win32(Dirs);
- Os ->
- test_server:fail({error, {not_yet_implemented_os, Os}})
- end.
+ {unix, _} ->
+ delete_release_unix(Dirs);
+ {win32, _} ->
+ delete_release_win32(Dirs);
+ Os ->
+ test_server:fail({error, {not_yet_implemented_os, Os}})
+ end.
delete_release_unix([]) ->
@@ -1075,7 +1522,14 @@ delete_release_win32([]) ->
delete_release_win32(["save"|Dirs]) ->
delete_release_win32(Dirs);
delete_release_win32([Dir|Dirs]) ->
- Rm = string:concat("rmdir /s ", Dir),
+ Rm =
+ case filelib:is_dir(Dir) of
+ true ->
+ string:concat("rmdir /s /q ", Dir);
+ false ->
+ string:concat("del /q ", Dir)
+ end,
+ ?t:format("============== COMMAND ~p~n",[Rm]),
[] = os:cmd(Rm),
delete_release_win32(Dirs).
@@ -1200,7 +1654,12 @@ subst_var([], Vars, Result, VarAcc) ->
priv_dir(Conf) ->
- filename:absname(?config(priv_dir, Conf)). % Get rid of trailing slash
+%% filename:absname(?config(priv_dir, Conf)). % Get rid of trailing slash
+ %% Due to problem with long paths on windows => creating a new
+ %% priv_dir under data_dir
+ Dir = filename:absname(filename:join(?config(data_dir, Conf),priv_dir)),
+ filelib:ensure_dir(filename:join(Dir,"*")),
+ Dir.
latest_version(Dir) ->
List = filelib:wildcard(Dir ++ "*"),
@@ -1256,12 +1715,28 @@ do_create_p1g(Conf,TargetDir) ->
ErtsLatest = latest_version(filename:join(code:root_dir(),"erts")),
ok = copy_tree(Conf, ErtsLatest, ErtsDir, TargetDir),
ErtsBinDir = filename:join([TargetDir,ErtsDir,bin]),
- copy_file(filename:join([ErtsBinDir, "epmd"]), BinDir, [preserve]),
- copy_file(filename:join([ErtsBinDir, "run_erl"]), BinDir, [preserve]),
- copy_file(filename:join([ErtsBinDir, "to_erl"]), BinDir, [preserve]),
+
+ case os:type() of
+ {unix, _} ->
+ copy_file(filename:join([ErtsBinDir, "epmd"]), BinDir, [preserve]),
+ copy_file(filename:join([ErtsBinDir, "run_erl"]), BinDir, [preserve]),
+ copy_file(filename:join([ErtsBinDir, "to_erl"]), BinDir, [preserve]),
+
+ %% Create the start_erl shell script
+ ok = subst_file(filename:join([ErtsBinDir,"start_erl.src"]),
+ filename:join([BinDir,"start_erl"]),
+ [{"EMU","beam"}],
+ [{chmod,8#0755}]);
+ {win32,_} ->
+ %% Add a batch file to use as HEART_COMMAND
+ ok = copy_file(filename:join(DataDir, "heart_restart.bat"),
+ ErtsBinDir,[preserve])
+ end,
copy_file(filename:join(DataDir, "../installer.beam"),
filename:join([DataDir,lib,"installer-1.0",ebin])),
+ copy_file(filename:join(DataDir, "../rh_test_lib.beam"),
+ filename:join([DataDir,lib,"installer-1.0",ebin])),
%% Create .rel, .script and .boot files
RelName = "rel0",
@@ -1272,7 +1747,7 @@ do_create_p1g(Conf,TargetDir) ->
ok = filelib:ensure_dir(RelFile),
LibPath = filename:join([DataDir,lib,"*",ebin]),
- TarFile = create_basic_release(RelFile, RelVsn, {ErtsVsn,false},
+ TarFile = create_basic_release(Conf, RelFile, RelVsn, {ErtsVsn,false},
LibPath, [], [], [], []),
%% Extract tar file in target directory (i.e. same directory as erts etc.)
@@ -1286,20 +1761,6 @@ do_create_p1g(Conf,TargetDir) ->
%% Create RELEASES
ok = release_handler:create_RELEASES(TargetDir,ReleasesDir,RelFile,[]),
- %% Create start_erl
- ok = subst_file(filename:join([ErtsBinDir,"start_erl.src"]),
- filename:join([BinDir,"start_erl"]),
- [{"EMU","beam"}],
- [{chmod,8#0755}]),
-
- %% Create start script
- %% Using a customized start script from DataDir where some options
- %% (heart and nodename) are added compared to the start.src in the
- %% erlang distribution.
- ok = subst_file(filename:join(DataDir, "start"),
- filename:join([BinDir, "start"]),
- [{"ROOT",TargetDir}],
- [preserve]),
ok.
%% Create version P1H - which is P1G + a-1.0
@@ -1336,12 +1797,12 @@ create_upgrade_release(Conf,RelName,RelVsn,Erts,Apps,Config,{UpFromName,Descr})
UpFrom = [{filename:join([PrivDir,UpFromName,UpFromName]),Descr}],
- create_basic_release(RelFile, RelVsn, Erts, LibPath,
+ create_basic_release(Conf, RelFile, RelVsn, Erts, LibPath,
Apps, Config, UpFrom, []),
ok.
%% Create .rel, .script, .boot, sys.config and tar
-create_basic_release(RelFile,RelVsn,{ErtsVsn,ErtsDir},LibPath,ExtraApps,Config,UpFrom,DownTo) ->
+create_basic_release(Conf, RelFile,RelVsn,{ErtsVsn,ErtsDir},LibPath,ExtraApps,Config,UpFrom,DownTo) ->
RelDir = filename:dirname(RelFile),
RelFileName = filename:rootname(RelFile),
@@ -1370,7 +1831,14 @@ create_basic_release(RelFile,RelVsn,{ErtsVsn,ErtsDir},LibPath,ExtraApps,Config,U
_ -> [{erts,ErtsDir}]
end]),
- RelFileName ++ ".tar.gz".
+ TarFileName = RelFileName ++ ".tar.gz",
+
+ case os:type() of
+ {win32,_} when ErtsDir=/=false -> modify_tar_win32(Conf, TarFileName);
+ _ -> ok
+ end,
+
+ TarFileName.
%% Create a .rel file
create_installer_rel_file(RelFile,RelVsn,ErtsVsn,ExtraApps) ->
@@ -1470,21 +1938,70 @@ permanent_p1h(Node) ->
copy_installed(Conf,FromNode,ToNodes) ->
PrivDir = priv_dir(Conf),
DataDir = ?config(data_dir,Conf),
+
+ %% Instead of using copy_tree on the complete node directory, I'm
+ %% splitting this in separate tar files per subdirectory so the
+ %% log directory can be completely skipped. The reason for this is
+ %% that the tar file might become faulty if the node is alive and
+ %% writing to the log while the tar is created.
+ FromDir = filename:join(PrivDir,FromNode),
+ {ok,FromDirNames} = file:list_dir(FromDir),
+ TempTarFiles =
+ [begin
+ TempTarFile = filename:join(PrivDir,"temp_" ++ FDN ++ ".tar"),
+ {ok,Tar} = erl_tar:open(TempTarFile,[write]),
+ ok = erl_tar:add(Tar,filename:join(FromDir,FDN),FDN,[]),
+ ok = erl_tar:close(Tar),
+ TempTarFile
+ end || FDN <- FromDirNames, FDN=/="log"],
lists:foreach(
fun(Node) ->
- ok = copy_tree(Conf,filename:join(PrivDir,FromNode),Node,PrivDir),
NodeDir = filename:join(PrivDir,Node),
- ok = subst_file(filename:join(DataDir, "start"),
- filename:join([NodeDir, "bin", "start"]),
- [{"ROOT",NodeDir}]),
- LogDir = filename:join(NodeDir,log),
- {ok,Logs} = file:list_dir(LogDir),
- lists:foreach(fun(Log) ->
- file:delete(filename:join(LogDir,Log))
- end,
- Logs)
+ ok = filelib:ensure_dir(filename:join([NodeDir,"log","*"])),
+ lists:foreach(
+ fun(TempTarFile) ->
+ ok = erl_tar:extract(TempTarFile,[{cwd,NodeDir}])
+ end, TempTarFiles),
+ case os:type() of
+ {unix,_} ->
+ %% Create start script
+ %% Using a customized start script from DataDir
+ %% where some options (heart and nodename) are
+ %% added compared to the start.src in the erlang
+ %% distribution.
+ ok = subst_file(filename:join(DataDir, "start"),
+ filename:join([NodeDir, "bin", "start"]),
+ [{"ROOT",NodeDir}],
+ [preserve]);
+ {win32,_} ->
+ %% Write erl.ini
+ ErtsDirs =
+ filelib:wildcard(filename:join(NodeDir,"erts-*")),
+ lists:foreach(
+ fun(ErtsDir) ->
+ ok = subst_file(
+ filename:join(DataDir, "erl.ini.src"),
+ filename:join([ErtsDir, "bin", "erl.ini"]),
+ [{"ROOTDIR",NodeDir},
+ {"BINDIR",filename:join(ErtsDir,"bin")}])
+ end,
+ ErtsDirs),
+
+ %% The service on windows runs as local
+ %% administrator (not otptest user), so we need
+ %% to chmod the release in order to allow the
+ %% executing node to install releases, write
+ %% logs etc.
+ chmod_release_win32(NodeDir)
+ end
end,
- ToNodes).
+ ToNodes),
+
+ lists:foreach(fun(TempTarFile) -> file:delete(TempTarFile) end, TempTarFiles),
+ ok.
+
+chmod_release_win32(Dir) ->
+ os:cmd("echo y|cacls " ++ Dir ++ " /T /E /G Administrators:F").
start_nodes(Conf,Snames,Tag) ->
PrivDir = priv_dir(Conf),
@@ -1493,19 +2010,42 @@ start_nodes(Conf,Snames,Tag) ->
fun(Sname) ->
NodeDir = filename:join(PrivDir,Sname),
Node = node_name(Sname),
-
- Script = filename:join([NodeDir,"bin","start"]),
- Cmd = "env NODENAME="++atom_to_list(Sname) ++ " " ++ Script,
- %% {ok,StartFile} = file:read_file(Cmd),
- %% io:format("~s:\n~s~n~n",[Start,binary_to_list(StartFile)]),
- Res = os:cmd(Cmd),
- io:format("Start ~p: ~p~n=>\t~p~n", [Sname,Cmd,Res]),
+
+ case os:type() of
+ {unix,_} ->
+ start_node_unix(Sname,NodeDir);
+ {win32,_} ->
+ start_node_win32(Sname,NodeDir)
+ end,
Node
end,
Snames),
wait_nodes_up(Nodes,Tag),
Nodes.
+start_node_unix(Sname,NodeDir) ->
+ Script = filename:join([NodeDir,"bin","start"]),
+ Cmd = "env NODENAME="++atom_to_list(Sname) ++ " " ++ Script,
+ %% {ok,StartFile} = file:read_file(Cmd),
+ %% io:format("~s:\n~s~n~n",[Start,binary_to_list(StartFile)]),
+ Res = os:cmd(Cmd),
+ io:format("Start ~p: ~p~n=>\t~p~n", [Sname,Cmd,Res]).
+
+start_node_win32(Sname,NodeDir) ->
+ Name = atom_to_list(Sname) ++ "_P1G",
+ ErtsBinDir = filename:join(NodeDir,"erts-4.4/bin"),
+
+ StartErlArgs = rh_test_lib:get_start_erl_args(NodeDir),
+ ServiceArgs = rh_test_lib:get_service_args(NodeDir, Sname, StartErlArgs),
+
+ Erlsrv = filename:nativename(filename:join(ErtsBinDir,"erlsrv")),
+ rh_test_lib:erlsrv(Erlsrv,stop,Name),
+ rh_test_lib:erlsrv(Erlsrv,remove,Name),
+ ok = rh_test_lib:erlsrv(Erlsrv,add,Name,ServiceArgs),
+ ok = rh_test_lib:erlsrv(Erlsrv,start,Name),
+ ok.
+
+%% Create a unique node name for each test case
tc_sname(Config) ->
tc_sname(Config,"").
tc_sname(Config,Fix) when is_atom(Fix) ->
@@ -1607,9 +2147,8 @@ create_fake_upgrade_release(Dir,RelVsn,AppDirs,{UpFrom,DownTo,ExtraLibs}) ->
%% And a relup file so it can be upgraded to
RelupPath = Paths ++ [filename:join([Lib,"*","ebin"]) || Lib <- ExtraLibs],
- ok = systools:make_relup(Rel,[UpFrom],[DownTo],
- [{path,RelupPath},
- {outdir,RelDir}]),
+ ok = systools:make_relup(Rel,UpFrom,DownTo,[{path,RelupPath},
+ {outdir,RelDir}]),
Rel.
@@ -1649,3 +2188,32 @@ create_fake_release(Dir,RelName,RelVsn,AppDirs) ->
rpc_inst(Node,Func,Args) ->
rpc:call(Node,installer,Func,[node()|Args]).
+
+delete_all_services() ->
+ ErlSrv = erlsrv:erlsrv(erlang:system_info(version)),
+ [_|Serviceinfo] = string:tokens(os:cmd(ErlSrv ++ " list"),"\n"),
+ Services =
+ [lists:takewhile(fun($\t) -> false; (_) -> true end,S)
+ || S <- Serviceinfo],
+ ?t:format("Services to remove: ~p~n",[Services]),
+ lists:foreach(fun(S) ->
+ rh_test_lib:erlsrv(ErlSrv,stop,S),
+ rh_test_lib:erlsrv(ErlSrv,remove,S)
+ end,
+ Services).
+
+modify_tar_win32(Conf, TarFileName) ->
+ DataDir = ?config(data_dir,Conf),
+ PrivDir = priv_dir(Conf),
+ TmpDir = filename:join(PrivDir,"tmp_modify_tar_win32"),
+ ok = erl_tar:extract(TarFileName,[{cwd,TmpDir},compressed]),
+
+ ErtsBinDir = filelib:wildcard(filename:join([TmpDir,"erts-*","bin"])),
+ ok = copy_file(filename:join(DataDir, "heart_restart.bat"),
+ ErtsBinDir,[preserve]),
+
+ {ok,Fs} = file:list_dir(TmpDir),
+ {ok,T} = erl_tar:open(TarFileName,[write,compressed]),
+ [ok = erl_tar:add(T,filename:join(TmpDir,F),F,[]) || F <- Fs],
+ ok = erl_tar:close(T),
+ ok.
diff --git a/lib/sasl/test/release_handler_SUITE_data/Makefile.src b/lib/sasl/test/release_handler_SUITE_data/Makefile.src
index 85e25fdc2f..edb446413d 100644
--- a/lib/sasl/test/release_handler_SUITE_data/Makefile.src
+++ b/lib/sasl/test/release_handler_SUITE_data/Makefile.src
@@ -1,14 +1,42 @@
EFLAGS=+debug_info
P2B= \
- P2B/a-2.0/ebin/a.beam \
- P2B/a-2.0/ebin/a_sup.beam
+ P2B/a-2.0/ebin/a.@EMULATOR@ \
+ P2B/a-2.0/ebin/a_sup.@EMULATOR@
LIB= \
- lib/a-1.1/ebin/a.beam \
- lib/a-1.1/ebin/a_sup.beam \
- lib/a-1.0/ebin/a.beam \
- lib/a-1.0/ebin/a_sup.beam \
+ lib/a-1.2/ebin/a.@EMULATOR@ \
+ lib/a-1.2/ebin/a_sup.@EMULATOR@ \
+ lib/a-1.1/ebin/a.@EMULATOR@ \
+ lib/a-1.1/ebin/a_sup.@EMULATOR@ \
+ lib/a-1.0/ebin/a.@EMULATOR@ \
+ lib/a-1.0/ebin/a_sup.@EMULATOR@ \
+ lib/b-1.0/ebin/b_server.@EMULATOR@ \
+ lib/b-1.0/ebin/b_lib.@EMULATOR@ \
+ lib/b-2.0/ebin/b_server.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m1.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m2.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m3.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m4.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m5.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m6.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m7.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m8.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m9.@EMULATOR@ \
+ lib/many_mods-1.0/ebin/m10.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m1.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m2.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m3.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m4.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m5.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m6.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m7.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m8.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m9.@EMULATOR@ \
+ lib/many_mods-1.1/ebin/m10.@EMULATOR@ \
+ lib/many_mods-2.0/ebin/m.@EMULATOR@
APP= \
app1_app2/lib1/app1-1.0/ebin/app1_sup.@EMULATOR@ \
@@ -36,8 +64,13 @@ C= \
c/b.@EMULATOR@ \
c/c_sup.@EMULATOR@
+SUP= \
+ release_handler_timeouts/dummy-0.1/ebin/dummy_app.@EMULATOR@ \
+ release_handler_timeouts/dummy-0.1/ebin/dummy_server.@EMULATOR@ \
+ release_handler_timeouts/dummy-0.1/ebin/dummy_sup.@EMULATOR@ \
+ release_handler_timeouts/dummy-0.1/ebin/dummy_sup_2.@EMULATOR@
-all: $(P2B) $(LIB) $(APP) $(OTP2740) $(C)
+all: $(P2B) $(LIB) $(APP) $(OTP2740) $(C) $(SUP)
P2B/a-2.0/ebin/a.@EMULATOR@: P2B/a-2.0/src/a.erl
erlc $(EFLAGS) -oP2B/a-2.0/ebin P2B/a-2.0/src/a.erl
@@ -57,6 +90,67 @@ lib/a-1.1/ebin/a_sup.@EMULATOR@: lib/a-1.1/src/a_sup.erl
erlc $(EFLAGS) -olib/a-1.1/ebin lib/a-1.1/src/a_sup.erl
+lib/a-1.2/ebin/a.@EMULATOR@: lib/a-1.2/src/a.erl
+ erlc $(EFLAGS) -olib/a-1.2/ebin lib/a-1.2/src/a.erl
+lib/a-1.2/ebin/a_sup.@EMULATOR@: lib/a-1.2/src/a_sup.erl
+ erlc $(EFLAGS) -olib/a-1.2/ebin lib/a-1.2/src/a_sup.erl
+
+lib/b-1.0/ebin/b_server.@EMULATOR@: lib/b-1.0/src/b_server.erl
+ erlc $(EFLAGS) -olib/b-1.0/ebin lib/b-1.0/src/b_server.erl
+lib/b-1.0/ebin/b_lib.@EMULATOR@: lib/b-1.0/src/b_lib.erl
+ erlc $(EFLAGS) -olib/b-1.0/ebin lib/b-1.0/src/b_lib.erl
+
+lib/b-2.0/ebin/b_server.@EMULATOR@: lib/b-2.0/src/b_server.erl
+ erlc $(EFLAGS) -olib/b-2.0/ebin lib/b-2.0/src/b_server.erl
+
+lib/many_mods-1.0/ebin/m.@EMULATOR@: lib/many_mods-1.0/src/m.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m.erl
+lib/many_mods-1.0/ebin/m1.@EMULATOR@: lib/many_mods-1.0/src/m1.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m1.erl
+lib/many_mods-1.0/ebin/m2.@EMULATOR@: lib/many_mods-1.0/src/m2.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m2.erl
+lib/many_mods-1.0/ebin/m3.@EMULATOR@: lib/many_mods-1.0/src/m3.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m3.erl
+lib/many_mods-1.0/ebin/m4.@EMULATOR@: lib/many_mods-1.0/src/m4.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m4.erl
+lib/many_mods-1.0/ebin/m5.@EMULATOR@: lib/many_mods-1.0/src/m5.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m5.erl
+lib/many_mods-1.0/ebin/m6.@EMULATOR@: lib/many_mods-1.0/src/m6.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m6.erl
+lib/many_mods-1.0/ebin/m7.@EMULATOR@: lib/many_mods-1.0/src/m7.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m7.erl
+lib/many_mods-1.0/ebin/m8.@EMULATOR@: lib/many_mods-1.0/src/m8.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m8.erl
+lib/many_mods-1.0/ebin/m9.@EMULATOR@: lib/many_mods-1.0/src/m9.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m9.erl
+lib/many_mods-1.0/ebin/m10.@EMULATOR@: lib/many_mods-1.0/src/m10.erl
+ erlc $(EFLAGS) -olib/many_mods-1.0/ebin lib/many_mods-1.0/src/m10.erl
+lib/many_mods-1.1/ebin/m.@EMULATOR@: lib/many_mods-1.1/src/m.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m.erl
+lib/many_mods-1.1/ebin/m1.@EMULATOR@: lib/many_mods-1.1/src/m1.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m1.erl
+lib/many_mods-1.1/ebin/m2.@EMULATOR@: lib/many_mods-1.1/src/m2.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m2.erl
+lib/many_mods-1.1/ebin/m3.@EMULATOR@: lib/many_mods-1.1/src/m3.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m3.erl
+lib/many_mods-1.1/ebin/m4.@EMULATOR@: lib/many_mods-1.1/src/m4.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m4.erl
+lib/many_mods-1.1/ebin/m5.@EMULATOR@: lib/many_mods-1.1/src/m5.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m5.erl
+lib/many_mods-1.1/ebin/m6.@EMULATOR@: lib/many_mods-1.1/src/m6.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m6.erl
+lib/many_mods-1.1/ebin/m7.@EMULATOR@: lib/many_mods-1.1/src/m7.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m7.erl
+lib/many_mods-1.1/ebin/m8.@EMULATOR@: lib/many_mods-1.1/src/m8.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m8.erl
+lib/many_mods-1.1/ebin/m9.@EMULATOR@: lib/many_mods-1.1/src/m9.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m9.erl
+lib/many_mods-1.1/ebin/m10.@EMULATOR@: lib/many_mods-1.1/src/m10.erl
+ erlc $(EFLAGS) -olib/many_mods-1.1/ebin lib/many_mods-1.1/src/m10.erl
+lib/many_mods-2.0/ebin/m.@EMULATOR@: lib/many_mods-2.0/src/m.erl
+ erlc $(EFLAGS) -olib/many_mods-2.0/ebin lib/many_mods-2.0/src/m.erl
+
+
app1_app2/lib1/app1-1.0/ebin/app1_sup.@EMULATOR@: app1_app2/lib1/app1-1.0/src/app1_sup.erl
erlc $(EFLAGS) -oapp1_app2/lib1/app1-1.0/ebin app1_app2/lib1/app1-1.0/src/app1_sup.erl
app1_app2/lib1/app1-1.0/ebin/app1_server.@EMULATOR@: app1_app2/lib1/app1-1.0/src/app1_server.erl
@@ -106,3 +200,12 @@ c/b.@EMULATOR@: c/b.erl
erlc $(EFLAGS) -oc c/b.erl
c/c_sup.@EMULATOR@: c/c_sup.erl
erlc $(EFLAGS) -oc c/c_sup.erl
+
+release_handler_timeouts/dummy-0.1/ebin/dummy_app.@EMULATOR@: release_handler_timeouts/dummy-0.1/src/dummy_app.erl
+ erlc $(EFLAGS) -orelease_handler_timeouts/dummy-0.1/ebin release_handler_timeouts/dummy-0.1/src/dummy_app.erl
+release_handler_timeouts/dummy-0.1/ebin/dummy_server.@EMULATOR@: release_handler_timeouts/dummy-0.1/src/dummy_server.erl
+ erlc $(EFLAGS) -orelease_handler_timeouts/dummy-0.1/ebin release_handler_timeouts/dummy-0.1/src/dummy_server.erl
+release_handler_timeouts/dummy-0.1/ebin/dummy_sup.@EMULATOR@: release_handler_timeouts/dummy-0.1/src/dummy_sup.erl
+ erlc $(EFLAGS) -orelease_handler_timeouts/dummy-0.1/ebin release_handler_timeouts/dummy-0.1/src/dummy_sup.erl
+release_handler_timeouts/dummy-0.1/ebin/dummy_sup_2.@EMULATOR@: release_handler_timeouts/dummy-0.1/src/dummy_sup_2.erl
+ erlc $(EFLAGS) -orelease_handler_timeouts/dummy-0.1/ebin release_handler_timeouts/dummy-0.1/src/dummy_sup_2.erl
diff --git a/lib/sasl/test/release_handler_SUITE_data/clients/start_cli1 b/lib/sasl/test/release_handler_SUITE_data/clients/start_cli1
deleted file mode 100755
index ee3d8c97cf..0000000000
--- a/lib/sasl/test/release_handler_SUITE_data/clients/start_cli1
+++ /dev/null
@@ -1,38 +0,0 @@
-#!/bin/sh
-#
-# This program invokes the erlang emulator by calling run_erl.
-# It should only be used at an embedded target system.
-# It should be modified to give the correct flags to erl (via start_erl),
-# e.g -mode embedded -sname XXX
-#
-# Usage: start [Data]
-#
-
-if [ "x${NODENAME}" = "x" ]
-then
- echo "ERROR: Variable \$NODENAME is not set!!"
- exit 1
-fi
-
-TESTHOST=`hostname | sed 's/[.].*//'`
-IPADDR=%IPADDR%
-
-ROOTDIR=%ROOT%
-CLIENTDIR=$ROOTDIR/clients/type1/$NODENAME@$TESTHOST
-
-RELDIR=$CLIENTDIR/releases
-
-# Note that this scripts is modified an copied to $CLIENTDIR/bin/start
-# in release_handler_SUITE:copy_client - therefore HEART_COMMAND is as follows:
-HEART_COMMAND=$CLIENTDIR/bin/start
-HW_WD_DISABLE=true
-export HW_WD_DISABLE HEART_COMMAND
-
-START_ERL_DATA=${1:-$RELDIR/start_erl.data}
-
-if [ ! -d /tmp/$NODENAME@$TESTHOST ]
-then
- mkdir /tmp/$NODENAME@$TESTHOST
-fi
-
-$ROOTDIR/bin/run_erl /tmp/$NODENAME@$TESTHOST/ $CLIENTDIR/log "exec $ROOTDIR/bin/start_erl $ROOTDIR $RELDIR $START_ERL_DATA -heart -sname $NODENAME -sasl start_prg \\\"$CLIENTDIR/bin/start\\\" masters \[\\'%MASTER%@$TESTHOST\\'\] client_directory \\\"$CLIENTDIR\\\" -loader inet -id $NODENAME -hosts $IPADDR" > $CLIENTDIR/log/run_erl.out 2>&1 &
diff --git a/lib/sasl/test/release_handler_SUITE_data/erl.ini.src b/lib/sasl/test/release_handler_SUITE_data/erl.ini.src
new file mode 100644
index 0000000000..b8791e75a5
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/erl.ini.src
@@ -0,0 +1,4 @@
+[erlang]
+Bindir=%BINDIR%
+Progname=erl
+Rootdir=%ROOTDIR%
diff --git a/lib/sasl/test/release_handler_SUITE_data/heart_restart.bat b/lib/sasl/test/release_handler_SUITE_data/heart_restart.bat
new file mode 100755
index 0000000000..ede1ad4ff3
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/heart_restart.bat
@@ -0,0 +1,3 @@
+@echo off
+%ERLSRV_EXECUTABLE% stop %ERLSRV_SERVICE_NAME%
+%ERLSRV_EXECUTABLE% start %ERLSRV_SERVICE_NAME% \ No newline at end of file
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/README b/lib/sasl/test/release_handler_SUITE_data/lib/README
new file mode 100644
index 0000000000..639a4ca0fb
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/README
@@ -0,0 +1,33 @@
+a-1.0:
+start version
+
+a-1.1:
+can be upgraded to from a-1.0. Module a has changed
+
+a-1.2:
+can be upgraded to from a-1.1.
+No module have changed, but priv dir is added including one 'file'
+
+b-1.0:
+start version, includes b_lib and b_server
+
+b-2.0:
+can be upgraded to from b-1.0.
+Removes b_lib (soft_purge) and updates b_server (brutal_purge)
+* The diff in purge method is important for test "check_and_purge", in
+ order to check that the purge option to check_install_release works
+ for both methods.
+
+many_mods-1.0:
+start version.
+m:start/1 starts N procs, each calling Mod:bar() in all other modules (m1-m10).
+m1-m10: implements bar() which returns a big constant.
+The point is to get many processes with references to many modules,
+and then load the modules again so that old code exists. See tests
+otp_9395_update_many_mods and otp_9395_rm_many_mods.
+
+many_mods-1.1:
+can be upgraded to from many_mods-1.0. Updates modules m1-m10.
+
+many_mods-2.0:
+can be upgraded to from many_mods-1.0. Removes modules m1-m10. \ No newline at end of file
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/a-1.0/src/a.app b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.app
index e938137f67..b38722f06d 100644
--- a/lib/sasl/test/release_handler_SUITE_data/lib/a-1.0/src/a.app
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.app
@@ -1,7 +1,7 @@
{application, a,
[{description, "A CXC 138 11"},
- {vsn, "1.0"},
- {modules, [{a, 1}, {a_sup,1}]},
+ {vsn, "1.2"},
+ {modules, [{a, 2}, {a_sup,1}]},
{registered, [a_sup]},
{applications, [kernel, stdlib]},
{env, [{key1, val1}]},
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.appup b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.appup
new file mode 100644
index 0000000000..3df0546316
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/ebin/a.appup
@@ -0,0 +1,3 @@
+{"1.2",
+ [{"1.1",[]}],
+ [{"1.1",[]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/priv/file b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/priv/file
new file mode 100644
index 0000000000..e69de29bb2
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/priv/file
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a.erl b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a.erl
new file mode 100644
index 0000000000..c082ad5339
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a.erl
@@ -0,0 +1,54 @@
+%% ``The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved via the world wide web at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% The Initial Developer of the Original Code is Ericsson Utvecklings AB.
+%% Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
+%% AB. All Rights Reserved.''
+%%
+%% $Id$
+%%
+-module(a).
+
+
+-behaviour(gen_server).
+
+%% External exports
+-export([start_link/0, a/0, b/0]).
+%% Internal exports
+-export([init/1, handle_call/3, handle_info/2, terminate/2, code_change/3]).
+
+start_link() -> gen_server:start_link({local, aa}, a, [], []).
+
+a() -> gen_server:call(aa, a).
+b() -> gen_server:call(aa, b).
+
+%%-----------------------------------------------------------------
+%% Callback functions from gen_server
+%%-----------------------------------------------------------------
+init([]) ->
+ process_flag(trap_exit, true),
+ {ok, {state, bval}}.
+
+handle_call(a, _From, State) ->
+ X = application:get_all_env(a),
+ {reply, X, State};
+
+handle_call(b, _From, State) ->
+ {reply, {ok, element(2, State)}, State}.
+
+handle_info(_, State) ->
+ {noreply, State}.
+
+terminate(_Reason, _State) ->
+ ok.
+
+code_change(1, Extra, State) ->
+ {ok, {state, bval}}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a_sup.erl b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a_sup.erl
new file mode 100644
index 0000000000..a141c1767b
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/a-1.2/src/a_sup.erl
@@ -0,0 +1,37 @@
+%% ``The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved via the world wide web at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% The Initial Developer of the Original Code is Ericsson Utvecklings AB.
+%% Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
+%% AB. All Rights Reserved.''
+%%
+%% $Id$
+%%
+-module(a_sup).
+
+
+-behaviour(supervisor).
+
+%% External exports
+-export([start/2]).
+
+%% Internal exports
+-export([init/1]).
+
+start(_, _) ->
+ supervisor:start_link({local, a_sup}, a_sup, []).
+
+init([]) ->
+ SupFlags = {one_for_one, 4, 3600},
+ Config = {a,
+ {a, start_link, []},
+ permanent, 2000, worker, [a]},
+ {ok, {SupFlags, [Config]}}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/ebin/b.app b/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/ebin/b.app
new file mode 100644
index 0000000000..00347b2754
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/ebin/b.app
@@ -0,0 +1,7 @@
+%% -*- erlang -*-
+{application, b,
+ [{description, "B CXC 138 12"},
+ {vsn, "1.0"},
+ {modules, [{b_server, 1},{b_lib, 1}]},
+ {registered, [b_server]},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_lib.erl b/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_lib.erl
new file mode 100644
index 0000000000..7e8a308a5e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_lib.erl
@@ -0,0 +1,3 @@
+-module(b_lib).
+-compile(export_all).
+foo() -> ok.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_server.erl b/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_server.erl
new file mode 100644
index 0000000000..e1a80a076f
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-1.0/src/b_server.erl
@@ -0,0 +1,37 @@
+-module(b_server).
+
+-behaviour(gen_server).
+
+%% API
+-export([start_link/0]).
+
+%% gen_server callbacks
+-export([init/1, handle_call/3, handle_cast/2, handle_info/2,
+ terminate/2, code_change/3]).
+
+-define(SERVER, ?MODULE).
+
+-record(state, {}).
+
+start_link() ->
+ gen_server:start_link({local, ?SERVER}, ?MODULE, [], []).
+
+init([]) ->
+ {ok, #state{}}.
+
+handle_call(_Request, _From, State) ->
+ Reply = ok,
+ {reply, Reply, State}.
+
+handle_cast(_Msg, State) ->
+ {noreply, State}.
+
+handle_info(_Info, State) ->
+ {noreply, State}.
+
+terminate(_Reason, _State) ->
+ ok.
+
+code_change(OldVsn, State, Extra) ->
+ file:write_file("/tmp/b_server",io_lib:format("~p~n",[{"1.0",OldVsn,Extra}])),
+ {ok, State}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.app b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.app
new file mode 100644
index 0000000000..73c8e42b32
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.app
@@ -0,0 +1,7 @@
+%% -*- erlang -*-
+{application, b,
+ [{description, "B CXC 138 12"},
+ {vsn, "2.0"},
+ {modules, [{b_server, 1}]},
+ {registered, [b_server]},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup
new file mode 100644
index 0000000000..001255a88c
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/ebin/b.appup
@@ -0,0 +1,6 @@
+%% -*- erlang -*-
+{"2.0",
+ [{"1.0",[{remove_module,b_lib,soft_purge,soft_purge,[]},
+ {update,b_server,{advanced,[]}}]}],
+ [{"1.0",[{add_module,b_lib},
+ {update,b_server,{advanced,[]}}]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_lib.erl b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_lib.erl
new file mode 100644
index 0000000000..7e8a308a5e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_lib.erl
@@ -0,0 +1,3 @@
+-module(b_lib).
+-compile(export_all).
+foo() -> ok.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_server.erl b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_server.erl
new file mode 100644
index 0000000000..f8bfbdaff7
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/b-2.0/src/b_server.erl
@@ -0,0 +1,37 @@
+-module(b_server).
+
+-behaviour(gen_server).
+
+%% API
+-export([start_link/0]).
+
+%% gen_server callbacks
+-export([init/1, handle_call/3, handle_cast/2, handle_info/2,
+ terminate/2, code_change/3]).
+
+-define(SERVER, ?MODULE).
+
+-record(state, {}).
+
+start_link() ->
+ gen_server:start_link({local, ?SERVER}, ?MODULE, [], []).
+
+init([]) ->
+ {ok, #state{}}.
+
+handle_call(_Request, _From, State) ->
+ Reply = ok,
+ {reply, Reply, State}.
+
+handle_cast(_Msg, State) ->
+ {noreply, State}.
+
+handle_info(_Info, State) ->
+ {noreply, State}.
+
+terminate(_Reason, _State) ->
+ ok.
+
+code_change(OldVsn, State, Extra) ->
+ file:write_file("/tmp/b_server",io_lib:format("~p~n",[{"2.0",OldVsn,Extra}])),
+ {ok, State}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/installer-1.0/ebin/installer.app b/lib/sasl/test/release_handler_SUITE_data/lib/installer-1.0/ebin/installer.app
index 6f77317f6a..e1391c0605 100644
--- a/lib/sasl/test/release_handler_SUITE_data/lib/installer-1.0/ebin/installer.app
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/installer-1.0/ebin/installer.app
@@ -1,6 +1,6 @@
{application, installer,
[{description, "Installer application"},
{vsn, "1.0"},
- {modules, [{installer, 1}]},
+ {modules, [installer,rh_test_lib]},
{registered, []},
{applications, [kernel, stdlib, sasl]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app
new file mode 100644
index 0000000000..aa39adfffa
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/ebin/many_mods.app
@@ -0,0 +1,17 @@
+%% -*- erlang -*-
+{application, many_mods,
+ [{description, "Application with many modules CXC 138 11"},
+ {vsn, "1.0"},
+ {modules, [{m, 1},
+ {m1,1},
+ {m2,1},
+ {m3,1},
+ {m4,1},
+ {m5,1},
+ {m6,1},
+ {m7,1},
+ {m8,1},
+ {m9,1},
+ {m10,1}]},
+ {registered, []},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl
new file mode 100644
index 0000000000..418102bebb
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m.erl
@@ -0,0 +1,11 @@
+-module(m).
+-compile(export_all).
+
+start(NProcs) ->
+ Modules = [m1,m2,m3,m4,m5,m6,m7,m8,m9,m10],
+ Pids = [spawn_link(fun() ->
+ Cs = [M:bar() || M <- Modules],
+ receive stop -> Cs end
+ end) ||
+ _ <- lists:seq(1,NProcs)],
+ {Modules,Pids}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl
new file mode 100644
index 0000000000..cacc13f5d7
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m1.erl
@@ -0,0 +1,4 @@
+-module(m1).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl
new file mode 100644
index 0000000000..81e120b891
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m10.erl
@@ -0,0 +1,4 @@
+-module(m10).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl
new file mode 100644
index 0000000000..481276ba7b
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m2.erl
@@ -0,0 +1,4 @@
+-module(m2).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl
new file mode 100644
index 0000000000..9a04ed5fc9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m3.erl
@@ -0,0 +1,4 @@
+-module(m3).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl
new file mode 100644
index 0000000000..90de9a30c9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m4.erl
@@ -0,0 +1,4 @@
+-module(m4).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl
new file mode 100644
index 0000000000..8a9b690dfa
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m5.erl
@@ -0,0 +1,4 @@
+-module(m5).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl
new file mode 100644
index 0000000000..cd0d3977ed
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m6.erl
@@ -0,0 +1,4 @@
+-module(m6).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl
new file mode 100644
index 0000000000..1f79918d6e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m7.erl
@@ -0,0 +1,4 @@
+-module(m7).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl
new file mode 100644
index 0000000000..2ce03a0b7e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m8.erl
@@ -0,0 +1,4 @@
+-module(m8).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl
new file mode 100644
index 0000000000..1c5f72e628
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.0/src/m9.erl
@@ -0,0 +1,4 @@
+-module(m9).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app
new file mode 100644
index 0000000000..36c50caf2f
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.app
@@ -0,0 +1,17 @@
+%% -*- erlang -*-
+{application, many_mods,
+ [{description, "Application with many modules CXC 138 11"},
+ {vsn, "1.1"},
+ {modules, [{m, 1},
+ {m1,1},
+ {m2,1},
+ {m3,1},
+ {m4,1},
+ {m5,1},
+ {m6,1},
+ {m7,1},
+ {m8,1},
+ {m9,1},
+ {m10,1}]},
+ {registered, []},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup
new file mode 100644
index 0000000000..696435e06f
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/ebin/many_mods.appup
@@ -0,0 +1,22 @@
+%% -*- erlang -*-
+{"1.1",
+ [{"1.0",[{update,m1},
+ {update,m2},
+ {update,m3},
+ {update,m4},
+ {update,m5},
+ {update,m6},
+ {update,m7},
+ {update,m8},
+ {update,m9},
+ {update,m10}]}],
+ [{"1.0",[{update,m1},
+ {update,m2},
+ {update,m3},
+ {update,m4},
+ {update,m5},
+ {update,m6},
+ {update,m7},
+ {update,m8},
+ {update,m9},
+ {update,m10}]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl
new file mode 100644
index 0000000000..418102bebb
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m.erl
@@ -0,0 +1,11 @@
+-module(m).
+-compile(export_all).
+
+start(NProcs) ->
+ Modules = [m1,m2,m3,m4,m5,m6,m7,m8,m9,m10],
+ Pids = [spawn_link(fun() ->
+ Cs = [M:bar() || M <- Modules],
+ receive stop -> Cs end
+ end) ||
+ _ <- lists:seq(1,NProcs)],
+ {Modules,Pids}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl
new file mode 100644
index 0000000000..cacc13f5d7
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m1.erl
@@ -0,0 +1,4 @@
+-module(m1).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl
new file mode 100644
index 0000000000..81e120b891
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m10.erl
@@ -0,0 +1,4 @@
+-module(m10).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl
new file mode 100644
index 0000000000..481276ba7b
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m2.erl
@@ -0,0 +1,4 @@
+-module(m2).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl
new file mode 100644
index 0000000000..9a04ed5fc9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m3.erl
@@ -0,0 +1,4 @@
+-module(m3).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl
new file mode 100644
index 0000000000..90de9a30c9
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m4.erl
@@ -0,0 +1,4 @@
+-module(m4).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl
new file mode 100644
index 0000000000..8a9b690dfa
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m5.erl
@@ -0,0 +1,4 @@
+-module(m5).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl
new file mode 100644
index 0000000000..cd0d3977ed
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m6.erl
@@ -0,0 +1,4 @@
+-module(m6).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl
new file mode 100644
index 0000000000..1f79918d6e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m7.erl
@@ -0,0 +1,4 @@
+-module(m7).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl
new file mode 100644
index 0000000000..2ce03a0b7e
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m8.erl
@@ -0,0 +1,4 @@
+-module(m8).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl
new file mode 100644
index 0000000000..1c5f72e628
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-1.1/src/m9.erl
@@ -0,0 +1,4 @@
+-module(m9).
+-compile(export_all).
+%% A module with a big constant...
+bar() -> {now(),[{1,'1',"1"},{2,'2',"2"},{3,'3',"3"},{4,'4',"4"},{5,'5',"5"},{6,'6',"6"},{7,'7',"7"},{8,'8',"8"},{9,'9',"9"},{10,'10',"10"},{11,'11',"11"},{12,'12',"12"},{13,'13',"13"},{14,'14',"14"},{15,'15',"15"},{16,'16',"16"},{17,'17',"17"},{18,'18',"18"},{19,'19',"19"},{20,'20',"20"},{21,'21',"21"},{22,'22',"22"},{23,'23',"23"},{24,'24',"24"},{25,'25',"25"},{26,'26',"26"},{27,'27',"27"},{28,'28',"28"},{29,'29',"29"},{30,'30',"30"},{31,'31',"31"},{32,'32',"32"},{33,'33',"33"},{34,'34',"34"},{35,'35',"35"},{36,'36',"36"},{37,'37',"37"},{38,'38',"38"},{39,'39',"39"},{40,'40',"40"},{41,'41',"41"},{42,'42',"42"},{43,'43',"43"},{44,'44',"44"},{45,'45',"45"},{46,'46',"46"},{47,'47',"47"},{48,'48',"48"},{49,'49',"49"},{50,'50',"50"},{51,'51',"51"},{52,'52',"52"},{53,'53',"53"},{54,'54',"54"},{55,'55',"55"},{56,'56',"56"},{57,'57',"57"},{58,'58',"58"},{59,'59',"59"},{60,'60',"60"},{61,'61',"61"},{62,'62',"62"},{63,'63',"63"},{64,'64',"64"},{65,'65',"65"},{66,'66',"66"},{67,'67',"67"},{68,'68',"68"},{69,'69',"69"},{70,'70',"70"},{71,'71',"71"},{72,'72',"72"},{73,'73',"73"},{74,'74',"74"},{75,'75',"75"},{76,'76',"76"},{77,'77',"77"},{78,'78',"78"},{79,'79',"79"},{80,'80',"80"},{81,'81',"81"},{82,'82',"82"},{83,'83',"83"},{84,'84',"84"},{85,'85',"85"},{86,'86',"86"},{87,'87',"87"},{88,'88',"88"},{89,'89',"89"},{90,'90',"90"},{91,'91',"91"},{92,'92',"92"},{93,'93',"93"},{94,'94',"94"},{95,'95',"95"},{96,'96',"96"},{97,'97',"97"},{98,'98',"98"},{99,'99',"99"},{100,'100',"100"}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app
new file mode 100644
index 0000000000..98f6527750
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.app
@@ -0,0 +1,7 @@
+%% -*- erlang -*-
+{application, many_mods,
+ [{description, "Application with many modules CXC 138 11"},
+ {vsn, "2.0"},
+ {modules, [{m, 1}]},
+ {registered, []},
+ {applications, [kernel, stdlib]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup
new file mode 100644
index 0000000000..3a34db78c1
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/ebin/many_mods.appup
@@ -0,0 +1,24 @@
+%% -*- erlang -*-
+{"2.0",
+ [{"1.0",[{update,m},
+ {delete_module,m1},
+ {delete_module,m2},
+ {delete_module,m3},
+ {delete_module,m4},
+ {delete_module,m5},
+ {delete_module,m6},
+ {delete_module,m7},
+ {delete_module,m8},
+ {delete_module,m9},
+ {delete_module,m10}]}],
+ [{"1.0",[{update,m},
+ {add_module,m1},
+ {add_module,m2},
+ {add_module,m3},
+ {add_module,m4},
+ {add_module,m5},
+ {add_module,m6},
+ {add_module,m7},
+ {add_module,m8},
+ {add_module,m9},
+ {add_module,m10}]}]}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl
new file mode 100644
index 0000000000..2edc1e6be4
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/lib/many_mods-2.0/src/m.erl
@@ -0,0 +1,11 @@
+-module(m).
+-compile(export_all).
+
+start(NProcs) ->
+ Modules = [],
+ Pids = [spawn_link(fun() ->
+ Cs = [M:bar() || M <- Modules],
+ receive stop -> Cs end
+ end) ||
+ _ <- lists:seq(1,NProcs)],
+ {Modules,Pids}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/ebin/dummy.app b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/ebin/dummy.app
new file mode 100644
index 0000000000..9efdc2e5da
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/ebin/dummy.app
@@ -0,0 +1,7 @@
+{application,dummy,
+ [{description,"a dummy app"},
+ {vsn,"0.1"},
+ {registered,[dummy_app]},
+ {mod,{dummy_app,[]}},
+ {applications,[kernel,stdlib,sasl]},
+ {modules,[dummy_app,dummy_server,dummy_sup,dummy_sup_2]}]}. \ No newline at end of file
diff --git a/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_app.erl b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_app.erl
new file mode 100644
index 0000000000..51363b3630
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_app.erl
@@ -0,0 +1,9 @@
+-module(dummy_app).
+-behaviour(application).
+
+-export([start/2, stop/1]).
+
+start(_,_) ->
+ dummy_sup:start_link().
+
+stop(_) -> ok.
diff --git a/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_server.erl b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_server.erl
new file mode 100644
index 0000000000..382251eba7
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_server.erl
@@ -0,0 +1,56 @@
+-module(dummy_server).
+-behaviour(gen_server).
+
+-export([start_link/0, set_state/1, get_state/0]).
+
+-export([init/1,
+ handle_call/3,
+ handle_cast/2,
+ handle_info/2,
+ terminate/2,
+ code_change/3]).
+
+%%
+
+start_link() ->
+ gen_server:start_link({local, ?MODULE}, ?MODULE, [], []).
+
+set_state(What) ->
+ gen_server:call(?MODULE, {set_state, What}).
+
+get_state() ->
+ gen_server:call(?MODULE, get_state).
+
+
+%%
+
+init([]) ->
+ say("init, setting state to 0", []),
+ {ok, 0}.
+
+
+handle_call({set_state, NewState}, _From, _State) ->
+ {reply, {ok, NewState}, NewState};
+
+handle_call(get_state, _From, State) ->
+ {reply, State, State}.
+
+handle_cast('__not_implemented', State) ->
+ {noreply, State}.
+
+handle_info(_Info, State) ->
+ say("info ~p, ~p.", [_Info, State]),
+ {noreply, State}.
+
+terminate(_Reason, _State) ->
+ say("terminate ~p, ~p", [_Reason, _State]),
+ ok.
+
+code_change(_OldVsn, State, _Extra) ->
+ say("code_change ~p, ~p, ~p", [_OldVsn, State, _Extra]),
+ {ok, State}.
+
+%% Internal
+
+say(Format, Data) ->
+ io:format("~p:~p: ~s~n", [?MODULE, self(), io_lib:format(Format, Data)]).
diff --git a/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup.erl b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup.erl
new file mode 100644
index 0000000000..3d7b5060df
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup.erl
@@ -0,0 +1,15 @@
+-module(dummy_sup).
+-behaviour(supervisor).
+
+-export([start_link/0]).
+-export([init/1]).
+
+start_link() ->
+ supervisor:start_link({local, ?MODULE}, ?MODULE, []).
+
+init([]) ->
+ DummySup2 = {dummy_sup_2,
+ {dummy_sup_2, start_link, []},
+ permanent, 5000, supervisor, [dummy_sup_2]},
+
+ {ok, {{one_for_one, 10, 10}, [DummySup2]}}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup_2.erl b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup_2.erl
new file mode 100644
index 0000000000..d936cbcbd6
--- /dev/null
+++ b/lib/sasl/test/release_handler_SUITE_data/release_handler_timeouts/dummy-0.1/src/dummy_sup_2.erl
@@ -0,0 +1,15 @@
+-module(dummy_sup_2).
+-behaviour(supervisor).
+
+-export([start_link/0]).
+-export([init/1]).
+
+start_link() ->
+ supervisor:start_link({local, ?MODULE}, ?MODULE, []).
+
+init([]) ->
+ Dummy = {dummy_server,
+ {dummy_server, start_link, []},
+ permanent, 5000, worker, [dummy_server]},
+
+ {ok, {{one_for_one, 10, 10}, [Dummy]}}.
diff --git a/lib/sasl/test/release_handler_SUITE_data/clients/start_cli2 b/lib/sasl/test/release_handler_SUITE_data/start_client
index 88912cf884..5ea94d6f7c 100755
--- a/lib/sasl/test/release_handler_SUITE_data/clients/start_cli2
+++ b/lib/sasl/test/release_handler_SUITE_data/start_client
@@ -34,4 +34,4 @@ then
mkdir /tmp/$NODENAME@$TESTHOST
fi
-$ROOTDIR/bin/run_erl /tmp/$NODENAME@$TESTHOST/ $CLIENTDIR/log "exec $ROOTDIR/bin/start_erl $ROOTDIR $RELDIR $START_ERL_DATA -heart -sname $NODENAME -sasl start_prg \\\"$CLIENTDIR/bin/start\\\" masters \[\\'%MASTER%@$TESTHOST\\',\\'master2@$TESTHOST\\'\] client_directory \\\"$CLIENTDIR\\\"" > /dev/null 2>&1 &
+$ROOTDIR/bin/run_erl /tmp/$NODENAME@$TESTHOST/ $CLIENTDIR/log "exec $ROOTDIR/bin/start_erl $ROOTDIR $RELDIR $START_ERL_DATA -heart -sname $NODENAME %CLIENTARGS%" > $CLIENTDIR/log/run_erl.out 2>&1 &
diff --git a/lib/sasl/test/rh_test_lib.erl b/lib/sasl/test/rh_test_lib.erl
new file mode 100644
index 0000000000..99a7f919a7
--- /dev/null
+++ b/lib/sasl/test/rh_test_lib.erl
@@ -0,0 +1,100 @@
+-module(rh_test_lib).
+
+-export([erlsrv/3,
+ erlsrv/4]).
+-export([get_service_args/3,
+ get_service_args/4,
+ get_start_erl_args/1,
+ get_start_erl_args/3,
+ get_client_args/3,
+ get_client_args/4]).
+
+
+erlsrv(Erlsrv,Action,Name) ->
+ erlsrv(Erlsrv,Action,Name,"").
+erlsrv(Erlsrv,Action,Name,Rest) ->
+ Cmd = Erlsrv ++ " " ++ atom_to_list(Action) ++ " " ++ Name ++ " " ++ Rest,
+ io:format("erlsrv cmd: ~p~n",[Cmd]),
+ Port = open_port({spawn, Cmd}, [stream, {line, 100}, eof, in]),
+ Res = recv_prog_output(Port),
+ case Res of
+ [] ->
+ failed;
+ _Y ->
+ io:format("erlsrv res: ~p~n",[_Y]),
+ ok
+ end.
+
+recv_prog_output(Port) ->
+ receive
+ {Port, {data, {eol,Data}}} ->
+ %%io:format("Got data: ~s~n", [Data]),
+ [ Data, "\n" | recv_prog_output(Port)];
+ {Port, {data, {noeol,Data}}} ->
+ %%io:format("Got data: ~s~n", [Data]),
+ [ Data | recv_prog_output(Port)];
+ {Port, _Other} ->
+ %%io:format("Got ~p from port~n", [_Other]),
+ Port ! {self(), close},
+ receive
+ {Port,closed} ->
+ []
+ end
+ end.
+
+get_service_args(RootDir, Sname, StartErlArgs) ->
+ get_service_args(RootDir, "", Sname, StartErlArgs).
+get_service_args(RootDir, RelClientDir, Sname, StartErlArgs) ->
+ LogDir = filename:nativename(filename:join([RootDir,RelClientDir,"log"])),
+ %% start_erl.exe will be found since it is in the same directory as erlsrv.exe
+ %% And heart_restart.bat will be found since the erts bin dir is
+ %% always in the path for the erlang virtual machine.
+ " -machine start_erl.exe -workdir " ++ LogDir ++
+ " -debugtype new -sname " ++ atom_to_list(Sname) ++
+ " -env HEART_COMMAND=heart_restart.bat -args \"" ++ StartErlArgs ++ "\"".
+
+get_start_erl_args(RootDir) ->
+ get_start_erl_args(RootDir,"","").
+get_start_erl_args(RootDir,RelClientDir,ExtraArgs) ->
+ Cookie = atom_to_list(erlang:get_cookie()),
+ RelDir = filename:join([RootDir,RelClientDir,"releases"]),
+ ExtraArgs ++ " -setcookie " ++ Cookie ++
+ " -heart ++ -rootdir " ++ filename:nativename(RootDir) ++
+ " -reldir " ++ filename:nativename(RelDir).
+
+%% Must be called on the master node
+get_client_args(Client,Sname,RootDir) ->
+ get_client_args(Client,Sname,RootDir,node()).
+get_client_args(Client,Sname,RootDir,Master) ->
+ {ok,Host} = inet:gethostname(),
+ Node = atom_to_list(Sname) ++ "@" ++ Host,
+ RelClientDir = filename:join(["clients","type1",Node]),
+ ClientDir = filename:join([RootDir,RelClientDir]),
+ StartPrg = filename:join([ClientDir,"bin","start"]),
+ {" -sasl start_prg \\\\\\\"" ++ StartPrg ++ "\\\\\\\" masters \[" ++
+ single_quote() ++ atom_to_list(Master) ++ single_quote() ++
+ get_client_extra_master(Client,Host) ++
+ "\] client_directory \\\\\\\"" ++ ClientDir ++ "\\\\\\\"" ++
+ get_client_loader_args(Client,Sname,Host),
+ RelClientDir}.
+
+get_client_loader_args(client1,Sname,Host) ->
+ {ok,IpTuple} = inet:getaddr(Host,inet),
+ IpAddr = inet_parse:ntoa(IpTuple),
+ " -loader inet -id " ++
+ atom_to_list(Sname) ++ " -hosts " ++ IpAddr;
+get_client_loader_args(_,_,_) ->
+ "".
+
+get_client_extra_master(client2,Host) ->
+ "," ++ single_quote() ++ "master2@" ++ Host ++ single_quote();
+get_client_extra_master(_,_) ->
+ "".
+
+single_quote() ->
+ case os:type() of
+ {win32,_} ->
+ "\'";
+ _ ->
+ "\\'"
+ end.
diff --git a/lib/sasl/test/systools_SUITE.erl b/lib/sasl/test/systools_SUITE.erl
index 9190b111ef..e352247d44 100644
--- a/lib/sasl/test/systools_SUITE.erl
+++ b/lib/sasl/test/systools_SUITE.erl
@@ -48,7 +48,7 @@
included_fail_script/1, included_bug_script/1, exref_script/1]).
-export([ tar_options/1, normal_tar/1, no_mod_vsn_tar/1, variable_tar/1,
src_tests_tar/1, shadow_tar/1, var_tar/1,
- exref_tar/1, link_tar/1]).
+ exref_tar/1, link_tar/1, otp_9507/1]).
-export([ normal_relup/1, abnormal_relup/1, no_appup_relup/1,
bad_appup_relup/1, app_start_type_relup/1, otp_3065/1]).
-export([
@@ -81,7 +81,7 @@ groups() ->
{tar, [],
[tar_options, normal_tar, no_mod_vsn_tar, variable_tar,
src_tests_tar, shadow_tar, var_tar,
- exref_tar, link_tar]},
+ exref_tar, link_tar, otp_9507]},
{relup, [],
[normal_relup, abnormal_relup, no_appup_relup,
bad_appup_relup, app_start_type_relup]},
@@ -396,6 +396,7 @@ src_tests_script(Config) when is_list(Config) ->
?line PSAVE = code:get_path(), % Save path
?line {LatestDir, LatestName} = create_script(latest,Config),
+ ?line BootFile = LatestName ++ ".boot",
?line DataDir = filename:absname(?copydir),
?line LibDir = fname([DataDir, d_missing_src, lib]),
@@ -416,14 +417,32 @@ src_tests_script(Config) when is_list(Config) ->
?line Erl2 = filename:join([P1,"..","src","db2.erl"]),
?line file:delete(Erl2),
- %% Then make script - two warnings should be issued when
- %% src_tests is given
+ %% Then make script
+
+ %% .boot file should not exist
+ ?line ok = file:delete(BootFile),
+ ?line false = filelib:is_regular(BootFile),
+ %% With warnings_as_errors and src_tests option, an error should be issued
+ ?line error =
+ systools:make_script(LatestName, [silent, {path, N}, src_tests,
+ warnings_as_errors]),
+ ?line error =
+ systools:make_script(LatestName, [{path, N}, src_tests,
+ warnings_as_errors]),
+
+ %% due to warnings_as_errors .boot file should still not exist
+ ?line false = filelib:is_regular(BootFile),
+
+ %% Two warnings should be issued when src_tests is given
%% 1. old object code for db1.beam
%% 2. missing source code for db2.beam
?line {ok, _, [{warning,{obj_out_of_date,_}},
{warning,{source_not_found,_}}]} =
systools:make_script(LatestName, [silent, {path, N}, src_tests]),
+ %% .boot file should exist now
+ ?line true = filelib:is_regular(BootFile),
+
%% Without the src_tests option, no warning should be issued
?line {ok, _, []} =
systools:make_script(LatestName, [silent, {path, N}]),
@@ -1066,6 +1085,48 @@ exref_tar(Config) when is_list(Config) ->
?line ok = file:set_cwd(OldDir),
ok.
+
+
+%% otp_9507
+%%
+otp_9507(suite) -> [];
+otp_9507(doc) ->
+ ["make_tar failed when path given as just 'ebin'."];
+otp_9507(Config) when is_list(Config) ->
+ ?line {ok, OldDir} = file:get_cwd(),
+
+ ?line {LatestDir, LatestName} = create_script(latest_small,Config),
+
+ ?line DataDir = filename:absname(?copydir),
+ ?line LibDir = fname([DataDir, d_normal, lib]),
+ ?line FeDir = fname([LibDir, 'fe-3.1']),
+
+ ?line ok = file:set_cwd(FeDir),
+
+ RelName = fname([LatestDir,LatestName]),
+
+ ?line P1 = ["./ebin",
+ fname([DataDir, lib, kernel, ebin]),
+ fname([DataDir, lib, stdlib, ebin])],
+ ?line {ok, _, _} = systools:make_script(RelName, [silent, {path, P1}]),
+ ?line ok = systools:make_tar(RelName, [{path, P1}]),
+ ?line Content1 = tar_contents(RelName),
+
+ ?line P2 = ["ebin",
+ fname([DataDir, lib, kernel, ebin]),
+ fname([DataDir, lib, stdlib, ebin])],
+
+ %% Tickets solves the following line - it used to fail with
+ %% {function_clause,[{filename,join,[[]]},...}
+ ?line ok = systools:make_tar(RelName, [{path, P2}]),
+ ?line Content2 = tar_contents(RelName),
+ true = (Content1 == Content2),
+
+ ?line ok = file:set_cwd(OldDir),
+
+ ok.
+
+
%% The relup stuff.
%%
%%
@@ -1108,6 +1169,21 @@ normal_relup(Config) when is_list(Config) ->
[{path, P}, silent]),
?line ok = check_relup([{db, "2.1"}], [{db, "1.0"}]),
+ %% file should not be written if warnings_as_errors is enabled.
+ %% delete before running tests.
+ ?line ok = file:delete("relup"),
+
+ %% Check that warnings are treated as errors
+ ?line error =
+ systools:make_relup(LatestName, [LatestName2], [LatestName1],
+ [{path, P}, warnings_as_errors]),
+ ?line error =
+ systools:make_relup(LatestName, [LatestName2], [LatestName1],
+ [{path, P}, silent, warnings_as_errors]),
+
+ %% relup file should not exist
+ ?line false = filelib:is_regular("relup"),
+
%% Check that warnings get through
?line ok = systools:make_relup(LatestName, [LatestName2], [LatestName1],
[{path, P}]),
@@ -1117,6 +1193,9 @@ normal_relup(Config) when is_list(Config) ->
[{path, P}, silent]),
?line ok = check_relup([{fe, "3.1"}, {db, "2.1"}], [{db, "1.0"}]),
+ %% relup file should exist now
+ ?line true = filelib:is_regular("relup"),
+
?line ok = file:set_cwd(OldDir),
ok.
diff --git a/lib/snmp/Makefile b/lib/snmp/Makefile
index 20e3d4692a..c55eff04c6 100644
--- a/lib/snmp/Makefile
+++ b/lib/snmp/Makefile
@@ -67,7 +67,7 @@ do_configure: configure
configure: configure.in
autoconf
-.PHONY: info
+.PHONY: info gclean
info:
@echo "OS: $(OS)"
@@ -76,6 +76,9 @@ info:
@echo "SNMP_VSN: $(SNMP_VSN)"
@echo "APP_VSN: $(APP_VSN)"
+gclean:
+ git clean -fXd
+
# ----------------------------------------------------
# Application (source) release targets
diff --git a/lib/snmp/doc/src/Makefile b/lib/snmp/doc/src/Makefile
index 35ed63e103..aa9431477c 100644
--- a/lib/snmp/doc/src/Makefile
+++ b/lib/snmp/doc/src/Makefile
@@ -152,6 +152,7 @@ $(TOP_PDF_FILE): $(XML_FILES)
pdf: $(TOP_PDF_FILE)
html: gifs $(HTML_REF_MAN_FILE)
+html2: html $(INDEX_TARGET)
clean clean_docs: clean_html clean_man clean_pdf
rm -f errs core *~
@@ -228,6 +229,7 @@ clean_man:
clean_html:
@echo "cleaning html:"
rm -rf $(HTMLDIR)/*
+ rm -f $(INDEX_TARGET)
$(MAN7DIR)/%.7: $(MIBSDIR)/%.mib
@echo "processing $*"
@@ -286,7 +288,7 @@ release_docs_spec: docs
$(INSTALL_DATA) $(INFO_FILE) $(RELSYSDIR)
$(INSTALL_DIR) $(RELEASE_PATH)/man/man1
$(INSTALL_DATA) $(MAN1_FILES) $(RELEASE_PATH)/man/man1
- $(INSTALL_DIR) $(RELEASE_PATH)/man/man
+ $(INSTALL_DIR) $(RELEASE_PATH)/man/man3
$(INSTALL_DATA) $(MAN3_FILES) $(RELEASE_PATH)/man/man3
$(INSTALL_DIR) $(RELEASE_PATH)/man/man6
$(INSTALL_DATA) $(MAN6_FILES) $(RELEASE_PATH)/man/man6
diff --git a/lib/snmp/doc/src/notes.xml b/lib/snmp/doc/src/notes.xml
index 6a20d8ee3a..9e1a060dee 100644
--- a/lib/snmp/doc/src/notes.xml
+++ b/lib/snmp/doc/src/notes.xml
@@ -33,6 +33,192 @@
</header>
<section>
+ <title>SNMP Development Toolkit 4.21.1</title>
+ <p>Version 4.21.1 supports code replacement in runtime from/to
+ version 4.20.1, 4.20 and 4.19. </p>
+
+ <section>
+ <title>Improvements and new features</title>
+<!--
+ <p>-</p>
+-->
+ <list type="bulleted">
+ <item>
+ <p>[compiler] Used wrong variable name (for
+ warnings-as-errors variable), which caused the
+ compiler to crash when using the snmpc (e)script. </p>
+ <p>Also added the option
+ <seealso marker="snmpc(command)#option_werror">--Werror</seealso>
+ for the SNMP MIB compiler (escript) frontend (to mimic
+ <seealso marker="erts:erlc">erlc</seealso>),
+ which specifies whether warnings should be treated as errors. </p>
+ <p>Own Id: OTP-9447</p>
+ </item>
+
+ <item>
+ <p>[agent] Some very minor debugging improvements. </p>
+ <p>Own Id: OTP-9446</p>
+ </item>
+ </list>
+
+ </section>
+
+ <section>
+ <title>Fixed Bugs and Malfunctions</title>
+ <p>-</p>
+
+<!--
+ <list type="bulleted">
+ <item>
+ <p>The snmp config tool could not handle (manager) audit trail config
+ because the option seqno was not handled. </p>
+ <p>Own Id: OTP-9354</p>
+ </item>
+
+ </list>
+-->
+ </section>
+
+
+ <section>
+ <title>Incompatibilities</title>
+ <p>-</p>
+ </section>
+
+ </section> <!-- 4.21.1 -->
+
+
+ <section>
+ <title>SNMP Development Toolkit 4.21</title>
+ <p>Version 4.21 supports code replacement in runtime from/to
+ version 4.20.1, 4.20 and 4.19. </p>
+
+ <section>
+ <title>Improvements and new features</title>
+<!--
+ <p>-</p>
+-->
+ <list type="bulleted">
+ <item>
+ <p>[manager] There was no way to specify transport domain.
+ The transport domains was assumed to be IPv4 (transportDomainUdpIpv4).
+ This has now been changed so that it can also be IPv6
+ (transportDomainUdpIpv6).
+ To facilitate this, the transport domain, <c>tdomain</c>,
+ is now a (new) valid option when
+ <seealso marker="snmpm#register_agent">registering</seealso>
+ a new agent (and
+ <seealso marker="snmpm#update_agent_info">updating</seealso>
+ agent info). </p>
+ <p>This also mean that the transport behaviour has changed. </p>
+ <p>Own Id: OTP-9305</p>
+ <p>Aux Id: Seq 11847</p>
+ </item>
+
+ <item>
+ <p>[compiler] Added the option
+ <seealso marker="snmpc#compile">warnings_as_errors</seealso>
+ (for the SNMP MIB compiler (escript) frontend, the option
+ <seealso marker="snmpc(command)#option_wae">--wae</seealso> is used)
+ which specifies whether warnings should be treated as errors. </p>
+ <p>Tuncer Ayaz</p>
+ <p>Own Id: OTP-9437</p>
+ </item>
+ </list>
+
+ </section>
+
+ <section>
+ <title>Fixed Bugs and Malfunctions</title>
+<!--
+ <p>-</p>
+-->
+
+ <list type="bulleted">
+ <item>
+ <p>The snmp config tool could not handle (manager) audit trail config
+ because the option seqno was not handled. </p>
+ <p>Own Id: OTP-9354</p>
+ </item>
+
+ <item>
+ <p>[agent] The SNMP ACM cache was not properly updated when
+ changes where made to the VACM security-to-group, access and
+ view-tree-family tables. </p>
+ <p>Own Id: OTP-9367</p>
+ <p>Aux Id: Seq 11858</p>
+ </item>
+
+ <item>
+ <p>Fixed install directory typo for man3. </p>
+ <p>Peter Lemenkov</p>
+ <p>Hans Ulrich Niedermann</p>
+ <p>Own Id: OTP-9442</p>
+ </item>
+
+ </list>
+ </section>
+
+
+ <section>
+ <title>Incompatibilities</title>
+ <p>-</p>
+ </section>
+
+ </section> <!-- 4.21 -->
+
+
+ <section>
+ <title>SNMP Development Toolkit 4.20.1</title>
+ <p>Version 4.20.1 supports code replacement in runtime from/to
+ version 4.20, 4.19 and 4.18.</p>
+
+ <section>
+ <title>Improvements and new features</title>
+ <p>-</p>
+<!--
+ <list type="bulleted">
+ <item>
+ <p>Added type specs for functions that do not return. </p>
+ <p>Kostis Sagonas</p>
+ <p>Own Id: OTP-9208</p>
+ </item>
+ </list>
+-->
+ </section>
+
+ <section>
+ <title>Fixed Bugs and Malfunctions</title>
+<!--
+ <p>-</p>
+-->
+ <list type="bulleted">
+ <item>
+ <p>[agent] Did not handle transport domains properly in some cases,
+ for instance trap sending. </p>
+ <p>Own Id: OTP-9400</p>
+ </item>
+
+ <item>
+ <p>[agent] Wrong default transport domain, snmpUDPDomain, instead
+ of transportDomainUdpIpv4. </p>
+ <p>Own Id: OTP-9425</p>
+ <p>Aux Id: Seq 11874</p>
+ </item>
+
+ </list>
+ </section>
+
+
+ <section>
+ <title>Incompatibilities</title>
+ <p>-</p>
+ </section>
+
+ </section> <!-- 4.20.1 -->
+
+
+ <section>
<title>SNMP Development Toolkit 4.20</title>
<p>Version 4.20 supports code replacement in runtime from/to
version 4.19 and 4.18.</p>
diff --git a/lib/snmp/doc/src/snmpc.xml b/lib/snmp/doc/src/snmpc.xml
index 771629492d..61d19251c5 100644
--- a/lib/snmp/doc/src/snmpc.xml
+++ b/lib/snmp/doc/src/snmpc.xml
@@ -48,7 +48,11 @@
<type>
<v>File = string()</v>
<v>Options = [opt()]</v>
- <v>opt() = db() | relaxed_row_name_assign_check() | deprecated() | description() | reference() | group_check() | i() | il() | imports() | module() | module_identity() | module_compliance() | agent_capabilities() | outdir() | no_defs() | verbosity() | warnings()</v>
+ <v>opt() = db() | relaxed_row_name_assign_check() | deprecated() |
+ description() | reference() | group_check() | i() | il() |
+ imports() | module() | module_identity() | module_compliance() |
+ agent_capabilities() | outdir() | no_defs() | verbosity() |
+ warnings() | warnings_as_errors()</v>
<v>db() = {db, volatile|persistent|mnesia}</v>
<v>deprecated() = {deprecated, bool()}</v>
<v>relaxed_row_name_assign_check() = relaxed_row_name_assign_check</v>
@@ -66,6 +70,7 @@
<v>outdir() = {outdir, dir()}</v>
<v>verbosity() = {verbosity, silence|warning|info|log|debug|trace}</v>
<v>warnings() = {warnings, bool()}</v>
+ <v>warnings_as_errors() = warnings_as_errors</v>
<v>dir() = string()</v>
<v>BinFileName = string()</v>
</type>
@@ -200,11 +205,17 @@
<item>
<p>The option <c>warnings</c> specifies whether warning
- messages should be shown. </p>
+ messages should be shown. </p>
<p>Default is <c>true</c>. </p>
</item>
+ <item>
+ <p>The option <c>warnings_as_errors</c>, if present, specifies
+ whether warnings should be treated as errors.</p>
+ </item>
+
</list>
+
<p>The MIB compiler understands both SMIv1 and SMIv2 MIBs. It
uses the <c>MODULE-IDENTITY</c> statement to determine if the MIB is
version 1 or 2.
diff --git a/lib/snmp/doc/src/snmpc_cmd.xml b/lib/snmp/doc/src/snmpc_cmd.xml
index 9358382a10..971f8a3cff 100644
--- a/lib/snmp/doc/src/snmpc_cmd.xml
+++ b/lib/snmp/doc/src/snmpc_cmd.xml
@@ -50,6 +50,8 @@
with definitions of Erlang constants for the objects in
the MIB, see
<seealso marker="snmpc#mib_to_hrl">mib_to_hrl/1</seealso>. </p>
+
+ <marker id="options"></marker>
</desc>
</func>
</funcs>
@@ -58,15 +60,18 @@
<title>Compiler options</title>
<p>The following options are supported (note that most of these relate
to the compilation of the MIB file):</p>
+ <marker id="option_help"></marker>
<taglist>
<tag>--help</tag>
<item>
<p>Prints help info.</p>
+ <marker id="option_version"></marker>
</item>
<tag>--version</tag>
<item>
<p>Prints application and mib format version.</p>
+ <marker id="option_verbosity"></marker>
</item>
<tag>--verbosity <em>verbosity</em></tag>
@@ -74,11 +79,22 @@
<p>Print debug info. </p>
<p><c>verbosity</c> = <c>trace</c> | <c>debug</c> | <c>log</c> | <c>info</c> | <c>silence</c></p>
<p>Defaults to <c>silence</c>.</p>
+ <marker id="option_w"></marker>
+ <marker id="option_warnings"></marker>
</item>
- <tag>--warnings</tag>
+ <tag>--warnings | --W</tag>
<item>
<p>Print warning messages. </p>
+ <marker id="option_wae"></marker>
+ <marker id="option_werror"></marker>
+ </item>
+
+ <tag>--wae | --Werror</tag>
+ <item>
+ <p>Warnings as errors.
+ Indicates that warnings shall be treated as errors. </p>
+ <marker id="option_odir"></marker>
</item>
<tag>--o <em>directory</em></tag>
@@ -86,6 +102,7 @@
<p>The directory where the compiler should place the output files.
If not specified, output files will be placed in the current working
directory.</p>
+ <marker id="option_idir"></marker>
</item>
<tag>--i <em>Directory</em></tag>
@@ -94,6 +111,7 @@
By default, the current working directory is always included. </p>
<p>This option can be present several times, each time specifying
<em>one</em> path. </p>
+ <marker id="option_ildir"></marker>
</item>
<tag>--il <em>Directory</em></tag>
@@ -106,6 +124,7 @@
the current version may be in the system). The current directory
and the "snmp-home"/priv/mibs/ are always listed last in the
include path. </p>
+ <marker id="option_sgc"></marker>
</item>
<tag>--sgc</tag>
@@ -114,42 +133,50 @@
group check of the mib compiler.
That is, should the OBJECT-GROUP and the NOTIFICATION-GROUP
macro(s) be checked for correctness or not. </p>
+ <marker id="option_dep"></marker>
</item>
<tag>--dep</tag>
<item>
<p>Keep deprecated definition(s).
If not specified the compiler will ignore deprecated definitions. </p>
+ <marker id="option_desc"></marker>
</item>
<tag>--desc</tag>
<item>
<p>The DESCRIPTION field will be included. </p>
+ <marker id="option_ref"></marker>
</item>
<tag>--ref</tag>
<item>
<p>The REFERENCE field will be included. </p>
+ <marker id="option_imp"></marker>
</item>
<tag>--imp</tag>
<item>
<p>The IMPORTS field will be included. </p>
+ <marker id="option_mi"></marker>
</item>
<tag>--mi</tag>
<item>
<p>The MODULE-IDENTITY field will be included. </p>
+ <marker id="option_mc"></marker>
</item>
<tag>--mc</tag>
<item>
<p>The MODULE-COMPLIANCE field will be included. </p>
+ <marker id="option_ac"></marker>
</item>
<tag>--ac</tag>
<item>
<p>The AGENT-CAPABILITIES field will be included. </p>
+ <marker id="option_mod"></marker>
</item>
<tag>--mod <em>module</em></tag>
@@ -157,6 +184,7 @@
<p>The module which implements all the instrumentation functions. </p>
<p>The name of all instrumentation functions must be the
same as the corresponding managed object it implements. </p>
+ <marker id="option_nd"></marker>
</item>
<tag>--nd</tag>
@@ -165,6 +193,7 @@
used if a managed object have no instrumentation function.
Instead this will be reported as an error, and the compilation
aborts. </p>
+ <marker id="option_rrnac"></marker>
</item>
<tag>--rrnac</tag>
@@ -176,6 +205,7 @@
This means that the error will be converted to a warning. </p>
<p>By default it is not included, but if this option is present
it will be. </p>
+ <marker id="see_also"></marker>
</item>
</taglist>
@@ -183,7 +213,7 @@
<section>
<title>SEE ALSO</title>
- <p><seealso marker="erlc">erlc(1)</seealso>,
+ <p><seealso marker="erts:erlc">erlc(1)</seealso>,
<seealso marker="compiler:compile">compile(3)</seealso>,
<seealso marker="snmp:snmpc">snmpc(3)</seealso></p>
</section>
diff --git a/lib/snmp/doc/src/snmpm.xml b/lib/snmp/doc/src/snmpm.xml
index b527d171b0..c36a1b2a24 100644
--- a/lib/snmp/doc/src/snmpm.xml
+++ b/lib/snmp/doc/src/snmpm.xml
@@ -283,27 +283,27 @@ sec_level = noAuthNoPriv | authNoPriv | authPriv
<v>TargetName = target_name()</v>
<v>Config = [agent_config()]</v>
<v>agent_config() = {Item, Val}</v>
- <v>Item = engine_id | address | port | community | timeout | max_message_size | version | sec_model | sec_name | sec_level</v>
+ <v>Item = engine_id | address | port | community | timeout | max_message_size | version | sec_model | sec_name | sec_level | tdomain</v>
<v>Val = term()</v>
<v>Reason = term()</v>
</type>
<desc>
<p>Explicitly instruct the manager to handle this agent, with
- <c>UserId</c> as the responsible user. </p>
- <p>Called to instruct the manager that this agent
- shall be handled. This function is used when
- the user knows in advance which agents the
- manager shall handle.
- Note that there is an alternate way to do the same thing:
- Add the agent to the manager config files (see
- <seealso marker="snmp_manager_config_files#agents">agents.conf</seealso>).</p>
+ <c>UserId</c> as the responsible user. </p>
+ <p>Called to instruct the manager that this agent shall be handled.
+ This function is used when the user knows in advance which agents
+ the manager shall handle.
+ Note that there is an alternate way to do the same thing:
+ Add the agent to the manager config files (see
+ <seealso marker="snmp_manager_config_files#agents">agents.conf</seealso>).</p>
<p><c>TargetName</c> is a non-empty string,
- uniquely identifying the agent. </p>
- <p>The type of <c>Val</c> depends on <c>Item</c>: </p>
+ uniquely identifying the agent. </p>
+ <p>The type of <c>Val</c> depends on <c>Item</c>: </p>
<code type="none"><![CDATA[
[mandatory] engine_id = string()
[mandatory] address = ip_address()
[optional] port = integer()
+[optional] tdomain = transportDomainUdpIpv4 | transportDomainUdpIpv6
[optional] community = string()
[optional] timeout = integer() | snmp_timer()
[optional] max_message_size = integer()
@@ -312,7 +312,9 @@ sec_level = noAuthNoPriv | authNoPriv | authPriv
[optional] sec_name = string()
[optional] sec_level = noAuthNoPriv | authNoPriv | authPriv
]]></code>
- <p>Note that if no <c>Port</c> is given, the default value is used.</p>
+ <p>Note that if no <c>tdomain</c> is given, the default value,
+ <c>transportDomainUdpIpv4</c>, is used.</p>
+ <p>Note that if no <c>port</c> is given, the default value is used.</p>
<marker id="unregister_agent"></marker>
</desc>
@@ -348,17 +350,25 @@ sec_level = noAuthNoPriv | authNoPriv | authPriv
</func>
<func>
+ <name>update_agent_info(UserId, TargetName, Info) -> ok | {error, Reason}</name>
<name>update_agent_info(UserId, TargetName, Item, Val) -> ok | {error, Reason}</name>
<fsummary>Update agent config</fsummary>
<type>
<v>UserId = term()</v>
<v>TargetName = target_name()</v>
- <v>Item = atom()</v>
- <v>Val = term()</v>
+ <v>Info = [{item(), item_value()}]</v>
+ <v>Item = item()</v>
+ <v>item() = atom()</v>
+ <v>Val = item_value()</v>
+ <v>item_value() = term()</v>
<v>Reason = term()</v>
</type>
<desc>
- <p>Update agent config.</p>
+ <p>Update agent config. The function <c>update_agent_info/3</c>
+ should be used when several values needs to be updated atomically. </p>
+ <p>See function
+ <seealso marker="#register_agent">register_agent</seealso>)
+ for more info about what kind of items are allowed. </p>
<marker id="which_agents"></marker>
</desc>
diff --git a/lib/snmp/src/agent/snmp_target_mib.erl b/lib/snmp/src/agent/snmp_target_mib.erl
index 77910541a2..60bd3e0912 100644
--- a/lib/snmp/src/agent/snmp_target_mib.erl
+++ b/lib/snmp/src/agent/snmp_target_mib.erl
@@ -383,10 +383,18 @@ is_valid_tag(Tag, TDomain, TAddress) ->
is_valid_tag(TDomain, TAddress, Tag, []).
is_valid_tag(TDomain, TAddress, Tag, Key) ->
+ ?vtrace("is_valid_tag -> entry with"
+ "~n TDomain: ~p"
+ "~n TAddress: ~p"
+ "~n Tag: ~p"
+ "~n Key: ~p", [TDomain, TAddress, Tag, Key]),
case table_next(snmpTargetAddrTable, Key) of
endOfTable ->
+ ?vtrace("is_valid_tag -> endOfTable", []),
false;
NextKey ->
+ ?vtrace("is_valid_tag -> next key found"
+ "~n NextKey: ~p", [NextKey]),
case get(snmpTargetAddrTable, NextKey, [?snmpTargetAddrTDomain,
?snmpTargetAddrTAddress,
?snmpTargetAddrTagList,
@@ -395,6 +403,8 @@ is_valid_tag(TDomain, TAddress, Tag, Key) ->
{value, TAddress}, % RFC2576: chapters 5.2.1 & 5.3
{value, TagList},
{value, []}] ->
+ ?vtrace("is_valid_tag -> found with exact match"
+ "~n TagList: ~p", [TagList]),
case snmp_misc:is_tag_member(Tag, TagList) of
true ->
?vtrace("is_valid_tag -> exact: "
@@ -410,9 +420,14 @@ is_valid_tag(TDomain, TAddress, Tag, Key) ->
{value, TAddress2},
{value, TagList},
{value, TMask}] when TMask =/= [] ->
+ ?vtrace("is_valid_tag -> found with exact match"
+ "~n TagList: ~p"
+ "~n TMask: ~p", [TagList, TMask]),
case snmp_misc:is_tmask_match(TAddress, TAddress2,
TMask) of
true ->
+ ?vtrace("is_valid_tag -> "
+ "tmask match - now check tag member", []),
case snmp_misc:is_tag_member(Tag, TagList) of
true ->
?vtrace("is_valid_tag -> masked: "
@@ -425,10 +440,12 @@ is_valid_tag(TDomain, TAddress, Tag, Key) ->
Tag, NextKey)
end;
false ->
+ ?vtrace("is_valid_tag -> tmask NO match", []),
is_valid_tag(TDomain, TAddress,
Tag, NextKey)
end;
_ ->
+ ?vtrace("is_valid_tag -> not found - try next", []),
is_valid_tag(TDomain, TAddress, Tag, NextKey)
end
end.
@@ -591,9 +608,9 @@ snmpTargetAddrTable(print) ->
[Prefix, element(?snmpTargetAddrName, Row),
Prefix, element(?snmpTargetAddrTDomain, Row),
case element(?snmpTargetAddrTDomain, Row) of
- ?snmpUDPDomain -> udp;
- ?transportDomainUdpIpv4 -> udpIpv4;
- ?transportDomainUdpIpv6 -> udpIpv6;
+ ?snmpUDPDomain -> snmpUDPDomain;
+ ?transportDomainUdpIpv4 -> transportDomainUdpIpv4;
+ ?transportDomainUdpIpv6 -> transportDomainUdpIpv6;
_ -> undefined
end,
Prefix, element(?snmpTargetAddrTAddress, Row),
diff --git a/lib/snmp/src/agent/snmp_view_based_acm_mib.erl b/lib/snmp/src/agent/snmp_view_based_acm_mib.erl
index 28469a7b4e..37f6dd3f26 100644
--- a/lib/snmp/src/agent/snmp_view_based_acm_mib.erl
+++ b/lib/snmp/src/agent/snmp_view_based_acm_mib.erl
@@ -247,6 +247,7 @@ add_sec2group(SecModel, SecName, GroupName) ->
Key = [Key1, length(Key2) | Key2],
case table_cre_row(vacmSecurityToGroupTable, Key, Row) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
{ok, Key};
false ->
{error, create_failed}
@@ -260,6 +261,7 @@ add_sec2group(SecModel, SecName, GroupName) ->
delete_sec2group(Key) ->
case table_del_row(vacmSecurityToGroupTable, Key) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
ok;
false ->
{error, delete_failed}
@@ -279,6 +281,7 @@ add_access(GroupName, Prefix, SecModel, SecLevel, Match, RV, WV, NV) ->
Key3 = [SM, SL],
Key = Key1 ++ Key2 ++ Key3,
snmpa_vacm:insert([{Key, Row}], false),
+ snmpa_agent:invalidate_ca_cache(),
{ok, Key};
{error, Reason} ->
{error, Reason};
@@ -287,6 +290,7 @@ add_access(GroupName, Prefix, SecModel, SecLevel, Match, RV, WV, NV) ->
end.
delete_access(Key) ->
+ snmpa_agent:invalidate_ca_cache(),
snmpa_vacm:delete(Key).
@@ -299,6 +303,7 @@ add_view_tree_fam(ViewIndex, SubTree, Status, Mask) ->
Key = [length(Key1) | Key1] ++ [length(Key2) | Key2],
case table_cre_row(vacmViewTreeFamilyTable, Key, Row) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
{ok, Key};
false ->
{error, create_failed}
@@ -312,6 +317,7 @@ add_view_tree_fam(ViewIndex, SubTree, Status, Mask) ->
delete_view_tree_fam(Key) ->
case table_del_row(vacmViewTreeFamilyTable, Key) of
true ->
+ snmpa_agent:invalidate_ca_cache(),
ok;
false ->
{error, delete_failed}
diff --git a/lib/snmp/src/agent/snmpa_agent.erl b/lib/snmp/src/agent/snmpa_agent.erl
index 82a7ec647b..6322f0f21d 100644
--- a/lib/snmp/src/agent/snmpa_agent.erl
+++ b/lib/snmp/src/agent/snmpa_agent.erl
@@ -1626,7 +1626,7 @@ invalidate_ca_cache() ->
MasterAgent ! invalidate_ca_cache;
false ->
%% This is running on a sub-agent node,
- %% so sent skip it
+ %% so skip it
ok
end;
_ -> % Not on this node
diff --git a/lib/snmp/src/agent/snmpa_conf.erl b/lib/snmp/src/agent/snmpa_conf.erl
index 4b88eb69f7..c17a6abbd7 100644
--- a/lib/snmp/src/agent/snmpa_conf.erl
+++ b/lib/snmp/src/agent/snmpa_conf.erl
@@ -424,7 +424,8 @@ target_addr_entry(Name,
EngineId,
TMask) ->
target_addr_entry(Name, Ip, 162, TagList,
- ParamsName, EngineId, TMask, 2048).
+ ParamsName, EngineId,
+ TMask, 2048).
target_addr_entry(Name,
Ip,
@@ -435,7 +436,8 @@ target_addr_entry(Name,
TMask,
MaxMessageSize) ->
target_addr_entry(Name, Ip, Udp, 1500, 3, TagList,
- ParamsName, EngineId, TMask, MaxMessageSize).
+ ParamsName, EngineId,
+ TMask, MaxMessageSize).
target_addr_entry(Name,
Ip,
@@ -448,7 +450,8 @@ target_addr_entry(Name,
TMask,
MaxMessageSize) ->
target_addr_entry(Name, snmp_target_mib:default_domain(), Ip, Udp,
- Timeout, RetryCount, TagList, ParamsName,
+ Timeout, RetryCount, TagList,
+ ParamsName, EngineId,
TMask, MaxMessageSize).
target_addr_entry(Name,
diff --git a/lib/snmp/src/agent/snmpa_mpd.erl b/lib/snmp/src/agent/snmpa_mpd.erl
index 14f62b12f3..4f50b1a674 100644
--- a/lib/snmp/src/agent/snmpa_mpd.erl
+++ b/lib/snmp/src/agent/snmpa_mpd.erl
@@ -32,6 +32,7 @@
-include("SNMP-MPD-MIB.hrl").
-include("SNMPv2-TM.hrl").
-include("SNMP-FRAMEWORK-MIB.hrl").
+-include("TRANSPORT-ADDRESS-MIB.hrl").
-define(VMODULE,"MPD").
-include("snmp_verbosity.hrl").
@@ -981,12 +982,15 @@ generate_discovery_msg2(NoteStore, Pdu,
discovery_note_timeout(Timeout) ->
(Timeout div 100) + 1.
-generate_discovery_msg(NoteStore, {?snmpUDPDomain, [A,B,C,D,U1,U2]},
+generate_discovery_msg(NoteStore, {TDomain, TAddress},
Pdu, ScopedPduBytes,
ContextEngineID, ManagerEngineID,
SecModel, SecName, SecLevelFlag,
InitialUserName,
ContextName, Timeout) ->
+
+ {ok, {_Domain, Address}} = transform_taddr(TDomain, TAddress),
+
%% 7.1.7
?vdebug("generate_discovery_msg -> 7.1.7 (~w)", [ManagerEngineID]),
MsgID = generate_msg_id(),
@@ -1027,7 +1031,7 @@ generate_discovery_msg(NoteStore, {?snmpUDPDomain, [A,B,C,D,U1,U2]},
%% Log(Packet),
inc_snmp_out_vars(Pdu),
?vdebug("generate_discovery_msg -> done", []),
- {Packet, {{A,B,C,D}, U1 bsl 8 + U2}};
+ {Packet, Address};
Error ->
throw(Error)
@@ -1057,6 +1061,34 @@ generate_sec_discovery_msg(Message, SecModule,
end.
+transform_taddr(?snmpUDPDomain, TAddress) ->
+ transform_taddr(?transportDomainUdpIpv4, TAddress);
+transform_taddr(?transportDomainUdpIpv4, [A, B, C, D, P1, P2]) ->
+ Domain = transportDomainUdpIpv4,
+ Addr = {A,B,C,D},
+ Port = P1 bsl 8 + P2,
+ Address = {Addr, Port},
+ {ok, {Domain, Address}};
+transform_taddr(?transportDomainUdpIpv4, BadAddr) ->
+ {error, {bad_transportDomainUdpIpv4_address, BadAddr}};
+transform_taddr(?transportDomainUdpIpv6,
+ [A1, A2, A3, A4, A5, A6, A7, A8, P1, P2]) ->
+ Domain = transportDomainUdpIpv6,
+ Addr = {A1, A2, A3, A4, A5, A6, A7, A8},
+ Port = P1 bsl 8 + P2,
+ Address = {Addr, Port},
+ {ok, {Domain, Address}};
+transform_taddr(?transportDomainUdpIpv6, BadAddr) ->
+ {error, {bad_transportDomainUdpIpv6_address, BadAddr}};
+transform_taddr(BadTDomain, TAddress) ->
+ case lists:member(BadTDomain, snmp_conf:all_tdomains()) of
+ true ->
+ {error, {unsupported_tdomain, BadTDomain, TAddress}};
+ false ->
+ {error, {unknown_tdomain, BadTDomain, TAddress}}
+ end.
+
+
process_taddrs(Dests) ->
?vtrace("process_taddrs -> entry with"
"~n Dests: ~p", [Dests]),
@@ -1066,46 +1098,44 @@ process_taddrs([], Acc) ->
?vtrace("process_taddrs -> entry when done with"
"~n Acc: ~p", [Acc]),
lists:reverse(Acc);
-
+
%% v3
-process_taddrs([{{?snmpUDPDomain, [A,B,C,D,U1,U2]}, SecData} | T], Acc) ->
+process_taddrs([{{TDomain, TAddress}, SecData} | T], Acc) ->
?vtrace("process_taddrs -> entry when v3 with"
- "~n A: ~p"
- "~n B: ~p"
- "~n C: ~p"
- "~n D: ~p"
- "~n U1: ~p"
- "~n U2: ~p"
- "~n SecData: ~p", [A, B, C, D, U1, U2, SecData]),
- Entry = {{snmpUDPDomain, {{A,B,C,D}, U1 bsl 8 + U2}}, SecData},
- process_taddrs(T, [Entry | Acc]);
-%% Bad v3
-process_taddrs([{{TDomain, TAddr}, _SecData} | T], Acc) ->
- ?vtrace("process_taddrs -> entry when bad v3 with"
- "~n TDomain: ~p"
- "~n TAddr: ~p", [TDomain, TAddr]),
- user_err("Bad TDomain/TAddr: ~w/~w", [TDomain, TAddr]),
- process_taddrs(T, Acc);
+ "~n TDomain: ~p"
+ "~n TAddress: ~p"
+ "~n SecData: ~p", [TDomain, TAddress, SecData]),
+ case transform_taddr(TDomain, TAddress) of
+ {ok, DestAddr} ->
+ ?vtrace("process_taddrs -> transformed: "
+ "~n DestAddr: ~p", [DestAddr]),
+ Entry = {DestAddr, SecData},
+ process_taddrs(T, [Entry | Acc]);
+ {error, Reason} ->
+ ?vinfo("Failed transforming v3 domain and address"
+ "~n Reason: ~p", [Reason]),
+ user_err("Bad TDomain/TAddress: ~w/~w", [TDomain, TAddress]),
+ process_taddrs(T, Acc)
+ end;
%% v1 & v2
-process_taddrs([{?snmpUDPDomain, [A,B,C,D,U1,U2]} | T], Acc) ->
+process_taddrs([{TDomain, TAddress} | T], Acc) ->
?vtrace("process_taddrs -> entry when v1/v2 with"
- "~n A: ~p"
- "~n B: ~p"
- "~n C: ~p"
- "~n D: ~p"
- "~n U1: ~p"
- "~n U2: ~p", [A, B, C, D, U1, U2]),
- Entry = {snmpUDPDomain, {{A,B,C,D}, U1 bsl 8 + U2}},
- process_taddrs(T, [Entry | Acc]);
-%% Bad v1 or v2
-process_taddrs([{TDomain, TAddr} | T], Acc) ->
- ?vtrace("process_taddrs -> entry when bad v1/v2 with"
- "~n TDomain: ~p"
- "~n TAddr: ~p", [TDomain, TAddr]),
- user_err("Bad TDomain/TAddr: ~w/~w", [TDomain, TAddr]),
- process_taddrs(T, Acc);
+ "~n TDomain: ~p"
+ "~n TAddress: ~p", [TDomain, TAddress]),
+ case transform_taddr(TDomain, TAddress) of
+ {ok, DestAddr} ->
+ ?vtrace("process_taddrs -> transformed: "
+ "~n DestAddr: ~p", [DestAddr]),
+ Entry = DestAddr,
+ process_taddrs(T, [Entry | Acc]);
+ {error, Reason} ->
+ ?vinfo("Failed transforming v1/v2 domain and address: "
+ "~n Reason: ~p", [Reason]),
+ user_err("Bad TDomain/TAddress: ~w/~w", [TDomain, TAddress]),
+ process_taddrs(T, Acc)
+ end;
process_taddrs(Crap, Acc) ->
- throw({error, {taddrs_crap, Crap, Acc}}).
+ throw({error, {bad_taddrs, Crap, Acc}}).
mk_v1_v2_packet_list(To, Packet, Len, Pdu) ->
diff --git a/lib/snmp/src/app/snmp.appup.src b/lib/snmp/src/app/snmp.appup.src
index 5deb40be0f..0b6ea93231 100644
--- a/lib/snmp/src/app/snmp.appup.src
+++ b/lib/snmp/src/app/snmp.appup.src
@@ -22,82 +22,88 @@
%% ----- U p g r a d e -------------------------------------------------------
[
+ {"4.21",
+ [
+ {load_module, snmp_target_mib, soft_purge, soft_purge, []}
+ ]
+ },
+ {"4.20.1",
+ [
+ {load_module, snmp_target_mib, soft_purge, soft_purge, []},
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
+ {"4.20",
+ [
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmp_target_mib, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
{"4.19",
[
{load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
{load_module, snmpa_usm, soft_purge, soft_purge, []},
{load_module, snmpm_usm, soft_purge, soft_purge, []},
{load_module, snmp_log, soft_purge, soft_purge, []},
{load_module, snmp_pdus, soft_purge, soft_purge, []},
{load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_conf, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
{load_module, snmp_misc, soft_purge, soft_purge, []},
{load_module, snmp_config, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
{load_module, snmpa_trap, soft_purge, soft_purge,
[snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
{load_module, snmpa_acm, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd, snmp_target_mib]},
{load_module, snmpa_conf, soft_purge, soft_purge,
- [snmp_notification_mib]},
+ [snmp_config, snmp_notification_mib]},
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
{load_module, snmp_notification_mib, soft_purge, soft_purge,
[snmp_conf, snmp_target_mib]},
{load_module, snmp_community_mib, soft_purge, soft_purge, []},
{load_module, snmp_target_mib, soft_purge, soft_purge,
[snmp_conf]},
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
- {update, snmpa_net_if, soft, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd]},
- {update, snmpa_agent, soft, soft_purge, soft_purge,
- [snmpa_acm, snmpa_mpd, snmpa_trap]}
- ]
- },
- {"4.18",
- [
- {load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
- {load_module, snmpa_usm, soft_purge, soft_purge, []},
- {load_module, snmpm_usm, soft_purge, soft_purge, []},
- {load_module, snmp_misc, soft_purge, soft_purge, []},
- {load_module, snmp_log, soft_purge, soft_purge, []},
- {load_module, snmp_pdus, soft_purge, soft_purge, []},
- {load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmp_config, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmpa_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmpa_vacm, soft_purge, soft_purge, []},
- {load_module, snmpa_trap, soft_purge, soft_purge,
- [snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
- {load_module, snmpa_acm, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd, snmp_target_mib]},
- {load_module, snmpa, soft_purge, soft_purge,
- [snmp_community_mib,
- snmp_framework_mib,
- snmp_standard_mib,
- snmp_target_mib,
- snmp_user_based_sm_mib,
- snmp_view_based_acm_mib]},
- {load_module, snmp_notification_mib, soft_purge, soft_purge,
- [snmp_conf, snmp_target_mib, snmpa_mib_lib]},
- {load_module, snmp_community_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_framework_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_standard_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_target_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_user_based_sm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib, snmpa_vacm]},
- {load_module, snmpa_mib_lib, soft_purge, soft_purge, []},
-
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
-
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
{update, snmpa_net_if, soft, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd]},
{update, snmpa_agent, soft, soft_purge, soft_purge,
@@ -109,84 +115,88 @@
%% ------D o w n g r a d e ---------------------------------------------------
[
+ {"4.21",
+ [
+ {load_module, snmp_target_mib, soft_purge, soft_purge, []}
+ ]
+ },
+ {"4.20.1",
+ [
+ {load_module, snmp_target_mib, soft_purge, soft_purge, []},
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
+ {"4.20",
+ [
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
+ {load_module, snmp_target_mib, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
+ {load_module, snmp_conf, soft_purge, soft_purge, []},
+ {load_module, snmp_config, soft_purge, soft_purge, []},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_config]},
+ {update, snmpa_agent, soft, soft_purge, soft_purge, [snmpa_mpd]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]}
+ ]
+ },
{"4.19",
[
{load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
+ {load_module, snmpm, soft_purge, soft_purge,
+ [snmpm_server, snmpm_config, snmp_config]},
{load_module, snmpa_usm, soft_purge, soft_purge, []},
{load_module, snmpm_usm, soft_purge, soft_purge, []},
{load_module, snmp_log, soft_purge, soft_purge, []},
{load_module, snmp_pdus, soft_purge, soft_purge, []},
{load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_conf, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
{load_module, snmp_misc, soft_purge, soft_purge, []},
{load_module, snmp_config, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
+ {load_module, snmpa_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config]},
+ {load_module, snmpm_mpd, soft_purge, soft_purge,
+ [snmp_conf, snmp_config, snmpm_config]},
{load_module, snmpa_trap, soft_purge, soft_purge,
[snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
{load_module, snmpa_acm, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd, snmp_target_mib]},
{load_module, snmpa_conf, soft_purge, soft_purge,
- [snmp_notification_mib]},
+ [snmp_config, snmp_notification_mib]},
+ {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge, []},
{load_module, snmp_notification_mib, soft_purge, soft_purge,
[snmp_conf, snmp_target_mib]},
{load_module, snmp_community_mib, soft_purge, soft_purge, []},
{load_module, snmp_target_mib, soft_purge, soft_purge,
[snmp_conf]},
-
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
-
- {update, snmpa_net_if, soft, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd]},
- {update, snmpa_agent, soft, soft_purge, soft_purge,
- [snmpa_acm, snmpa_mpd, snmpa_trap]}
- ]
- },
- {"4.18",
- [
- {load_module, snmpa, soft_purge, soft_purge, []},
- {load_module, snmpm, soft_purge, soft_purge, [snmpm_server]},
- {load_module, snmpa_usm, soft_purge, soft_purge, []},
- {load_module, snmpm_usm, soft_purge, soft_purge, []},
- {load_module, snmp_misc, soft_purge, soft_purge, []},
- {load_module, snmp_log, soft_purge, soft_purge, []},
- {load_module, snmp_pdus, soft_purge, soft_purge, []},
- {load_module, snmp_conf, soft_purge, soft_purge, []},
- {load_module, snmpa_conf, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmp_config, soft_purge, soft_purge, []},
- {load_module, snmpa_mpd, soft_purge, soft_purge, [snmp_conf]},
- {load_module, snmpa_vacm, soft_purge, soft_purge, []},
- {load_module, snmpa_trap, soft_purge, soft_purge,
- [snmpa_mpd, snmp_notification_mib, snmp_target_mib, snmpa_net_if]},
- {load_module, snmpa_acm, soft_purge, soft_purge,
- [snmp_conf, snmpa_mpd, snmp_target_mib]},
- {load_module, snmpa, soft_purge, soft_purge,
- [snmp_community_mib,
- snmp_framework_mib,
- snmp_standard_mib,
- snmp_target_mib,
- snmp_user_based_sm_mib,
- snmp_view_based_acm_mib]},
- {load_module, snmp_notification_mib, soft_purge, soft_purge,
- [snmp_conf, snmp_target_mib, snmpa_mib_lib]},
- {load_module, snmp_community_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_framework_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_standard_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_target_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_user_based_sm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib]},
- {load_module, snmp_view_based_acm_mib, soft_purge, soft_purge,
- [snmpa_mib_lib, snmpa_vacm]},
- {load_module, snmpa_mib_lib, soft_purge, soft_purge, []},
-
- {update, snmpm_net_if, soft, soft_purge, soft_purge, []},
- {update, snmpm_server, soft, soft_purge, soft_purge, [snmpm_net_if]},
-
+ {update, snmpm_net_if, soft, soft_purge, soft_purge,
+ [snmp_conf, snmpm_mpd, snmpm_config]},
+ {update, snmpm_config, soft, soft_purge, soft_purge, [snmp_conf]},
+ {update, snmpm_server, soft, soft_purge, soft_purge,
+ [snmpm_net_if, snmpm_mpd, snmpm_config]},
{update, snmpa_net_if, soft, soft_purge, soft_purge,
[snmp_conf, snmpa_mpd]},
{update, snmpa_agent, soft, soft_purge, soft_purge,
diff --git a/lib/snmp/src/compile/Makefile b/lib/snmp/src/compile/Makefile
index 0ceaf276a6..627af6f185 100644
--- a/lib/snmp/src/compile/Makefile
+++ b/lib/snmp/src/compile/Makefile
@@ -45,11 +45,10 @@ RELSYSDIR = $(RELEASE_PATH)/lib/snmp-$(VSN)
include modules.mk
-ESCRIPT_BIN = $(ESCRIPT_SRC:%.src=$(BIN)/%)
-
-ERL_FILES = $(MODULES:%=%.erl)
-
-TARGET_FILES = $(MODULES:%=$(EBIN)/%.$(EMULATOR)) $(ESCRIPT_BIN)
+ESCRIPT_BIN = $(ESCRIPT_SRC:%.src=$(BIN)/%)
+ERL_FILES = $(MODULES:%=%.erl)
+EBIN_FILES = $(MODULES:%=$(EBIN)/%.$(EMULATOR))
+TARGET_FILES = $(EBIN_FILES) $(ESCRIPT_BIN)
GENERATED_PARSER = $(PARSER_MODULE:%=%.erl)
@@ -125,7 +124,7 @@ release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/src/compiler
$(INSTALL_DATA) $(ESCRIPT_SRC) $(PARSER_SRC) $(ERL_FILES) $(INTERNAL_HRL_FILES) $(RELSYSDIR)/src/compiler
$(INSTALL_DIR) $(RELSYSDIR)/ebin
- $(INSTALL_DATA) $(TARGET_FILES) $(RELSYSDIR)/ebin
+ $(INSTALL_DATA) $(EBIN_FILES) $(RELSYSDIR)/ebin
$(INSTALL_DIR) $(RELSYSDIR)/bin
$(INSTALL_SCRIPT) $(ESCRIPT_BIN) $(RELSYSDIR)/bin
diff --git a/lib/snmp/src/compile/snmpc.erl b/lib/snmp/src/compile/snmpc.erl
index 195c238184..5e6b81f1ec 100644
--- a/lib/snmp/src/compile/snmpc.erl
+++ b/lib/snmp/src/compile/snmpc.erl
@@ -108,6 +108,7 @@ compile(FileName) ->
%% {i, [import_dir_string()]} ["./"]
%% {il, [import_lib_dir_string()]} []
%% {warnings, bool()} true
+%% warnings_as_errors
%% {outdir, string()} "./"
%% description
%% reference
@@ -199,6 +200,8 @@ get_options([reference|Opts], Formats, Args) ->
get_options(Opts, ["~n reference"|Formats], Args);
get_options([{warnings, Val}|Opts], Formats, Args) ->
get_options(Opts, ["~n warnings: ~w"|Formats], [Val|Args]);
+get_options([warnings_as_errors|Opts], Formats, Args) ->
+ get_options(Opts, ["~n warnings_as_errors"|Formats], Args);
get_options([{verbosity, Val}|Opts], Formats, Args) ->
get_options(Opts, ["~n verbosity: ~w"|Formats], [Val|Args]);
get_options([imports|Opts], Formats, Args) ->
@@ -261,6 +264,8 @@ check_options([{group_check, Atom} | T]) when is_atom(Atom) ->
check_options([{warnings, Bool} | T]) ->
check_bool(warnings, Bool),
check_options(T);
+check_options([warnings_as_errors | T]) ->
+ check_options(T);
check_options([{db, volatile} | T]) ->
check_options(T);
check_options([{db, persistent} | T]) ->
@@ -331,6 +336,9 @@ get_agent_capabilities(Options) ->
get_module_compliance(Options) ->
get_bool_option(module_compliance, Options).
+get_warnings_as_errors(Options) ->
+ lists:member(warnings_as_errors, Options).
+
get_relaxed_row_name_assign_check(Options) ->
lists:member(relaxed_row_name_assign_check, Options).
@@ -409,6 +417,7 @@ init(From, MibFileName, Options) ->
put(reference, get_reference(Options)),
put(agent_capabilities, get_agent_capabilities(Options)),
put(module_compliance, get_module_compliance(Options)),
+ put(warnings_as_errors, get_warnings_as_errors(Options)),
File = filename:rootname(MibFileName, ".mib"),
put(filename, filename:basename(File ++ ".mib")),
R = case catch c_impl(File) of
diff --git a/lib/snmp/src/compile/snmpc.src b/lib/snmp/src/compile/snmpc.src
index 5f9b154bfa..f993335b89 100644
--- a/lib/snmp/src/compile/snmpc.src
+++ b/lib/snmp/src/compile/snmpc.src
@@ -46,11 +46,12 @@
agent_capabilities = false,
module,
no_defaults = false,
- relaxed_row_name_assigne_check = false,
+ relaxed_row_name_assign_check = false,
%% The default verbosity (silence) will be filled in
%% during argument processing.
verbosity,
- warnings = false
+ warnings = false,
+ warnings_as_errors = false
}).
@@ -74,6 +75,7 @@
%% --version
%% --verbosity V
%% --warnings
+%% --Werror | --wae | --warnings_as_errors
main(Args) when is_list(Args) ->
case (catch process_args(Args)) of
ok ->
@@ -152,11 +154,12 @@ mk_mib_options(#state{outdir = OutDir,
agent_capabilities = AC,
module = Mod,
no_defaults = ND,
- relaxed_row_name_assigne_check = RRNAC,
+ relaxed_row_name_assign_check = RRNAC,
%% The default verbosity (silence) will be filled in
%% during argument processing.
verbosity = V,
- warnings = W}) ->
+ warnings = W,
+ warnings_as_errors = WAE}) ->
[{outdir, OutDir},
{db, DB},
{i, IDs},
@@ -178,7 +181,8 @@ mk_mib_options(#state{outdir = OutDir,
maybe_option(Imp, imports) ++
maybe_option(MI, module_identity) ++
maybe_option(MC, module_compliance) ++
- maybe_option(AC, agent_capabilities).
+ maybe_option(AC, agent_capabilities) ++
+ maybe_option(WAE, warnings_as_errors).
maybe_option(true, Opt) -> [Opt];
maybe_option(_, _) -> [].
@@ -230,6 +234,8 @@ process_args(["--verbosity", Verbosity0|Args], #state{verbosity = V} = State)
process_args(["--verbosity"|_Args], #state{verbosity = V})
when (V =/= undefined) ->
e(lists:flatten(io_lib:format("Verbosity already set to ~w", [V])));
+process_args(["--w"|Args], State) ->
+ process_args(Args, State#state{warnings = true});
process_args(["--warnings"|Args], State) ->
process_args(Args, State#state{warnings = true});
process_args(["--o", Dir|Args], State) ->
@@ -291,7 +297,13 @@ process_args(["--mod"|_Args], #state{module = M})
process_args(["--nd"|Args], State) ->
process_args(Args, State#state{no_defaults = true});
process_args(["--rrnac"|Args], State) ->
- process_args(Args, State#state{relaxed_row_name_assigne_check = true});
+ process_args(Args, State#state{relaxed_row_name_assign_check = true});
+process_args(["--Werror"|Args], State) ->
+ process_args(Args, State#state{warnings_as_errors = true});
+process_args(["--wae"|Args], State) ->
+ process_args(Args, State#state{warnings_as_errors = true});
+process_args(["--warnings_as_errors"|Args], State) ->
+ process_args(Args, State#state{warnings_as_errors = true});
process_args([MIB], State) ->
Ext = filename:extension(MIB),
if
@@ -326,7 +338,7 @@ usage() ->
"~n --verbosity <verbosity> - Print debug info."
"~n verbosity = trace | debug | log | info | silence"
"~n Defaults to silence."
- "~n --warnings - Print warning messages."
+ "~n --warnings | --W - Print warning messages."
"~n --o <output dir> - The output dir."
"~n Defaults to current working dir."
"~n --i <include dir> - Add this dir to the list of dirs that will be"
@@ -334,16 +346,19 @@ usage() ->
"~n The current workin dir will always be included. "
"~n --il <include_lib dir> - Add this dir to the list of dirs that will be"
"~n searched for imported (compiled) MIB files."
- "~n It assumes that the first element in the dir name"
- "~n correspond to an OTP application. For example snmp/mibs/"
- "~n The current workin dir and the <snmp-home>/priv/mibs "
+ "~n It assumes that the first element in the dir "
+ "~n name correspond to an OTP application. "
+ "~n For example snmp/mibs/ "
+ "~n The current workin dir and the "
+ "~n <snmp-home>/priv/mibs "
"~n are always listed last the includ path. "
"~n --db <DB> - Database to used for the default instrumentation."
"~n Defaults to volatile."
- "~n --sgc - This option (skip group check), if present, disables "
- "~n the \"group check\" of the mib compiler. "
- "~n That is, should the OBJECT-GROUP and the NOTIFICATION-GROUP "
- "~n macro(s) be checked for correctness or not. "
+ "~n --sgc - This option (skip group check), if present, "
+ "~n disables the \"group check\" of the mib compiler. "
+ "~n That is, should the OBJECT-GROUP and the "
+ "~n NOTIFICATION-GROUP macro(s) be checked for "
+ "~n correctness or not. "
"~n By default the check is done. "
"~n --dep - Keep deprecated definition(s)."
"~n If not specified the compiler will ignore"
@@ -354,23 +369,27 @@ usage() ->
"~n --mi - The MODULE-IDENTITY field will be included."
"~n --mc - The MODULE-COMPLIANCE field will be included."
"~n --ac - The AGENT-CAPABILITIES field will be included."
- "~n --mod <module> - The module which implements all the instrumentation"
- "~n functions. "
+ "~n --mod <module> - The module which implements all the "
+ "~n instrumentation functions. "
"~n The name of all instrumentation functions must"
"~n be the same as the corresponding managed object"
"~n it implements."
- "~n --nd - The default instrumentation functions will *not* be used"
- "~n if a managed object have no instrumentation function. "
- "~n Instead this will be reported as an error, and the "
- "~n compilation aborts. "
- "~n --rrnac - This option, if present, specifies that the row name "
- "~n assign check shall not be done strictly according to"
- "~n the SMI (which allows only the value 1). "
- "~n With this option, all values greater than zero is allowed"
- "~n (>= 1). This means that the error will be converted to "
+ "~n --nd - The default instrumentation functions will *not* "
+ "~n be used if a managed object have no "
+ "~n instrumentation function. Instead this will be "
+ "~n reported as an error, and the compilation aborts. "
+ "~n --rrnac - This option, if present, specifies that the row "
+ "~n name assign check shall not be done strictly "
+ "~n according to the SMI (which allows only the "
+ "~n value 1). With this option, all values greater "
+ "~n than zero is allowed (>= 1). "
+ "~n This means that the error will be converted to "
"~n a warning. "
- "~n By default it is not included, but if this option is "
- "~n present it will be. "
+ "~n By default it is not included, but if this "
+ "~n option is present it will be. "
+ "~n --wae | --Werror - Warnings as errors. "
+ "~n Indicates that warnings shall be treated as "
+ "~n errors. "
"~n "
"~n", []),
halt(1).
diff --git a/lib/snmp/src/compile/snmpc_lib.erl b/lib/snmp/src/compile/snmpc_lib.erl
index 4f71c47bfa..a0a35e91c4 100644
--- a/lib/snmp/src/compile/snmpc_lib.erl
+++ b/lib/snmp/src/compile/snmpc_lib.erl
@@ -1754,12 +1754,12 @@ error(FormatStr, Data, Line) when is_list(FormatStr) ->
exit(error).
print_error(FormatStr, Data) when is_list(FormatStr) ->
- ok = io:format("~s: Error: " ++ FormatStr,[get(filename)|Data]),
+ ok = io:format("~s: " ++ FormatStr,[get(filename)|Data]),
put(errors,yes),
io:format("~n").
print_error(FormatStr, Data,Line) when is_list(FormatStr) ->
- ok = io:format("~s: ~w: Error: " ++ FormatStr,[get(filename), Line |Data]),
+ ok = io:format("~s: ~w: " ++ FormatStr,[get(filename), Line |Data]),
put(errors,yes),
io:format("~n").
diff --git a/lib/snmp/src/compile/snmpc_lib.hrl b/lib/snmp/src/compile/snmpc_lib.hrl
index 000486e728..35ec9abd03 100644
--- a/lib/snmp/src/compile/snmpc_lib.hrl
+++ b/lib/snmp/src/compile/snmpc_lib.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2009. All Rights Reserved.
+%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -20,8 +20,17 @@
-ifndef(snmpc_lib).
-define(snmpc_lib, true).
--define(vwarning(F, A), ?verbosity(warning, F, A, ignore)).
--define(vwarning2(F, A, MibLine), ?verbosity(warning, F, A, MibLine)).
+-define(vwarning(F, A),
+ case get(warnings_as_errors) of
+ true -> snmpc_lib:error(F, A);
+ _ -> ?verbosity(warning, F, A, ignore)
+ end).
+
+-define(vwarning2(F, A, MibLine),
+ case get(warnings_as_errors) of
+ true -> snmpc_lib:error(F, A, MibLine);
+ _ -> ?verbosity(warning, F, A, MibLine)
+ end).
-define(vinfo(F, A), ?verbosity(info, F, A, ignore)).
-define(vinfo2(F, A, MibLine), ?verbosity(info, F, A, MibLine)).
-define(vlog(F, A), ?verbosity(log, F, A, ignore)).
diff --git a/lib/snmp/src/manager/snmpm.erl b/lib/snmp/src/manager/snmpm.erl
index 0d084332de..6d2ac8d747 100644
--- a/lib/snmp/src/manager/snmpm.erl
+++ b/lib/snmp/src/manager/snmpm.erl
@@ -50,7 +50,7 @@
register_agent/2, register_agent/3, register_agent/4,
unregister_agent/2, unregister_agent/3,
which_agents/0, which_agents/1,
- agent_info/2, update_agent_info/4,
+ agent_info/2, update_agent_info/3, update_agent_info/4,
register_usm_user/3, unregister_usm_user/2,
which_usm_users/0, which_usm_users/1,
@@ -167,6 +167,7 @@
-include_lib("snmp/include/snmp_types.hrl").
-include("snmpm_atl.hrl").
-include("snmpm_internal.hrl").
+-include("snmp_verbosity.hrl").
-define(DEFAULT_AGENT_PORT, 161).
@@ -447,8 +448,11 @@ agent_info(Addr, Port, Item) ->
Error
end.
+update_agent_info(UserId, TargetName, Info) when is_list(Info) ->
+ snmpm_config:update_agent_info(UserId, TargetName, Info).
+
update_agent_info(UserId, TargetName, Item, Val) ->
- snmpm_config:update_agent_info(UserId, TargetName, Item, Val).
+ update_agent_info(UserId, TargetName, [{Item, Val}]).
%% Backward compatibility functions
update_agent_info(UserId, Addr, Port, Item, Val) ->
diff --git a/lib/snmp/src/manager/snmpm_config.erl b/lib/snmp/src/manager/snmpm_config.erl
index fd6da3e71a..c2e57abddb 100644
--- a/lib/snmp/src/manager/snmpm_config.erl
+++ b/lib/snmp/src/manager/snmpm_config.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -36,7 +36,8 @@
user_info/0, user_info/1, user_info/2,
register_agent/3, unregister_agent/2,
- agent_info/0, agent_info/2, agent_info/3, update_agent_info/4,
+ agent_info/0, agent_info/2, agent_info/3,
+ update_agent_info/3, update_agent_info/4,
which_agents/0, which_agents/1,
is_known_engine_id/2,
@@ -84,7 +85,9 @@
backup/1,
- mk_target_name/3
+ mk_target_name/3,
+
+ default_transport_domain/0
]).
@@ -127,23 +130,24 @@
%% Macros and Constants:
--define(SERVER, ?MODULE).
--define(BACKUP_DB, snmpm_config_backup).
--define(CONFIG_DB, snmpm_config_db).
+-define(SERVER, ?MODULE).
+-define(BACKUP_DB, snmpm_config_backup).
+-define(CONFIG_DB, snmpm_config_db).
-define(DEFAULT_USER, default_user).
-define(DEFAULT_AGENT_PORT, 161).
--define(IRB_DEFAULT, auto).
-%% -define(IRB_DEFAULT, {user, timer:seconds(15)}).
+-define(IRB_DEFAULT, auto).
+%% -define(IRB_DEFAULT, {user, timer:seconds(15)}).
--define(USER_MOD_DEFAULT, snmpm_user_default).
--define(USER_DATA_DEFAULT, undefined).
+-define(USER_MOD_DEFAULT, snmpm_user_default).
+-define(USER_DATA_DEFAULT, undefined).
%% -define(DEF_ADDR_TAG, default_addr_tag).
-define(DEFAULT_TARGETNAME, default_agent).
--define(DEF_PORT_TAG, default_port_tag).
+-define(DEF_PORT_TAG, default_port_tag).
+-define(SUPPORTED_DOMAINS, [transportDomainUdpIpv4, transportDomainUdpIpv6]).
-ifdef(snmp_debug).
-define(GS_START_LINK(Opts),
@@ -159,6 +163,11 @@
%%%-------------------------------------------------------------------
%%% API
%%%-------------------------------------------------------------------
+
+default_transport_domain() ->
+ transportDomainUdpIpv4.
+
+
start_link(Opts) ->
?d("start_link -> entry with"
"~n Opts: ~p", [Opts]),
@@ -269,9 +278,10 @@ do_user_info(_UserId, BadItem) ->
error({not_found, BadItem}).
-%% A target-name constructed in this way is a string with the following
+%% A target-name constructed in this way is a string with the following:
%% <IP-address>:<Port>-<Version>
-%%
+%% This is intended for backward compatibility and therefor has
+%% only support for IPv4 addresses and *no* other transport domain.
mk_target_name(Addr0, Port, Config) when is_list(Config) ->
Version =
case lists:keysearch(version, 1, Config) of
@@ -280,7 +290,6 @@ mk_target_name(Addr0, Port, Config) when is_list(Config) ->
false ->
select_lowest_supported_version()
end,
-%% p("mk_target_name -> Version: ~p", [Version]),
case normalize_address(Addr0) of
{A, B, C, D} ->
lists:flatten(
@@ -308,57 +317,99 @@ select_lowest_supported_version([H|T], Versions) ->
end.
-register_agent(UserId, _TargetName, _Config) when (UserId =:= user_id) ->
+register_agent(UserId, _TargetName, _Config0) when (UserId =:= user_id) ->
{error, {bad_user_id, UserId}};
-register_agent(UserId, TargetName, Config)
+register_agent(UserId, TargetName, Config0)
when (is_list(TargetName) andalso
(length(TargetName) > 0) andalso
- is_list(Config)) ->
+ is_list(Config0)) ->
-%% p("register_agent -> entry with"
-%% "~n UserId: ~p"
-%% "~n TargetName: ~p"
-%% "~n Config: ~p", [UserId, TargetName, Config]),
+ ?vtrace("register_agent -> entry with"
+ "~n UserId: ~p"
+ "~n TargetName: ~p"
+ "~n Config0: ~p", [UserId, TargetName, Config0]),
%% Check:
%% 1) That the mandatory configs are present
- %% 2) That the illegal config user_id (used internally) is
- %% not present
+ %% 2) That no illegal config, e.g. user_id (used internally),
+ %% is not present
%% 3) Check that there are no invalid or erroneous configs
- %% 4) Chack that the manager is capable to use the selected version
- case verify_agent_config(Config) of
- ok ->
+ %% 4) Check that the manager is capable of using the selected version
+ case verify_agent_config(Config0) of
+ {ok, Config} ->
call({register_agent, UserId, TargetName, Config});
Error ->
Error
end.
-verify_agent_config(Conf) ->
- ok = verify_mandatory(Conf, [engine_id, address, reg_type]),
- case verify_invalid(Conf, [user_id]) of
- ok ->
- case verify_agent_config2(Conf) of
- ok ->
- {ok, Vsns} = system_info(versions),
- Vsn =
- case lists:keysearch(version, 1, Conf) of
- {value, {version, V}} ->
- V;
- false ->
- v1
- end,
- case lists:member(Vsn, Vsns) of
- true ->
- ok;
- false ->
- {error, {version_not_supported_by_manager, Vsn, Vsns}}
- end
- end;
- Error ->
+verify_agent_config(Conf0) ->
+ try
+ begin
+ verify_mandatory(Conf0, [engine_id, address, reg_type]),
+ verify_invalid(Conf0, [user_id]),
+ Conf = verify_agent_config3(Conf0),
+ Vsns = versions(),
+ Vsn = which_version(Conf),
+ verify_version(Vsn, Vsns),
+ {ok, Conf}
+ end
+ catch
+ throw:Error ->
Error
end.
+versions() ->
+ case system_info(versions) of
+ {ok, Vsns} ->
+ Vsns;
+ {error, _} = ERROR ->
+ throw(ERROR)
+ end.
+
+which_version(Conf) ->
+ case lists:keysearch(version, 1, Conf) of
+ {value, {version, V}} ->
+ V;
+ false ->
+ v1
+ end.
+
+verify_version(Vsn, Vsns) ->
+ case lists:member(Vsn, Vsns) of
+ true ->
+ ok;
+ false ->
+ Reason = {version_not_supported_by_manager, Vsn, Vsns},
+ throw({error, Reason})
+ end.
+
+verify_agent_config3(Conf0) ->
+ %% Fix (transport) address and domain
+ {TDomain, Conf1} =
+ case lists:keysearch(tdomain, 1, Conf0) of
+ {value, {tdomain, Dom}} ->
+ {Dom, Conf0};
+ false ->
+ Dom = default_transport_domain(),
+ {Dom, [{tdomain, Dom} | Conf0]}
+ end,
+ Conf2 = case lists:keysearch(address, 1, Conf1) of
+ {value, {address, Address}} ->
+ lists:keyreplace(address, 1, Conf1,
+ {address, {TDomain, Address}});
+ false ->
+ %% This is a mandatory config option,
+ %% a later test will detect this
+ Conf1
+ end,
+ case verify_agent2(Conf2) of
+ {ok, Conf} ->
+ Conf;
+ {error, _} = ERROR ->
+ throw(ERROR)
+ end.
+
verify_agent_config2(Conf) ->
verify_agent2(Conf).
@@ -366,6 +417,7 @@ verify_agent_config2(Conf) ->
unregister_agent(UserId, TargetName) ->
call({unregister_agent, UserId, TargetName}).
+%% This is the old style agent unregistration (using Addr and Port).
unregister_agent(UserId, Addr0, Port) ->
Addr = normalize_address(Addr0),
case do_agent_info(Addr, Port, target_name) of
@@ -421,17 +473,51 @@ which_agents(UserId) ->
Agents = ets:match(snmpm_agent_table, Pat),
[TargetName || [TargetName] <- Agents].
-
-update_agent_info(UserId, TargetName, Item, Val0)
- when (Item =/= user_id) ->
- case (catch verify_val(Item, Val0)) of
- {ok, Val} ->
- call({update_agent_info, UserId, TargetName, Item, Val});
- Error ->
+
+verify_agent_info(TargetName, Info0) ->
+ try
+ begin
+ verify_invalid(Info0, [user_id]),
+ %% Check if address is part of the list and
+ %% if so update it with the domain info.
+ Info =
+ case lists:keysearch(address, 1, Info0) of
+ {value, {address, Addr}} ->
+ %% If domain is part of the info, then use it.
+ %% If not, lookup what is already stored for
+ %% this agent and use that.
+ Domain =
+ case lists:keysearch(tdomain, 1, Info0) of
+ {value, {tdomain, Dom}} ->
+ Dom;
+ false ->
+ {ok, Dom} =
+ agent_info(TargetName, tdomain),
+ Dom
+ end,
+ Addr2 = {Domain, Addr},
+ lists:keyreplace(address, 1, Info0, {address, Addr2});
+ false ->
+ Info0
+ end,
+ verify_agent2(Info)
+ end
+ catch
+ throw:Error ->
Error
end.
-%% Backward compatibillity
+update_agent_info(UserId, TargetName, Info) ->
+ call({update_agent_info, UserId, TargetName, Info}).
+
+%% <BACKWARD-COMPAT-2>
+%% This is wrapped in the interface module, so this function is
+%% only here to catch code-upgrade problems.
+update_agent_info(UserId, TargetName, Item, Val) ->
+ update_agent_info(UserId, TargetName, [{Item, Val}]).
+%% </BACKWARD-COMPAT-2>
+
+%% <BACKWARD-COMPAT-1>
update_agent_info(UserId, Addr, Port, Item, Val) ->
case agent_info(Addr, Port, target_name) of
{ok, TargetName} ->
@@ -439,6 +525,7 @@ update_agent_info(UserId, Addr, Port, Item, Val) ->
Error ->
Error
end.
+%% </BACKWARD-COMPAT-1>
is_known_engine_id(EngineID, TargetName) ->
case agent_info(TargetName, engine_id) of
@@ -650,22 +737,14 @@ unregister_usm_user(EngineID, Name)
call({unregister_usm_user, EngineID, Name}).
verify_usm_user_config(EngineID, Name, Config) ->
- %% case verify_mandatory(Config, []) of
- %% ok ->
- %% case verify_invalid(Config, [engine_id, name]) of
- %% ok ->
- %% verify_usm_user_config2(EngineID, Name, Config);
- %% Error ->
- %% Error
- %% end;
- %% Error ->
- %% Error
- %% end.
- ok = verify_mandatory(Config, []),
- case verify_invalid(Config, [engine_id, name]) of
- ok ->
- verify_usm_user_config2(EngineID, Name, Config);
- Error ->
+ try
+ begin
+ verify_mandatory(Config, []),
+ verify_invalid(Config, [engine_id, name]),
+ verify_usm_user_config2(EngineID, Name, Config)
+ end
+ catch
+ throw:Error ->
Error
end.
@@ -1590,6 +1669,7 @@ check_agent_config2(Agent) ->
throw(Err)
end.
+%% For backward compatibility
check_agent_config({UserId,
TargetName,
Community,
@@ -1597,10 +1677,27 @@ check_agent_config({UserId,
EngineId,
Timeout, MaxMessageSize,
Version, SecModel, SecName, SecLevel}) ->
+ TDomain = default_transport_domain(),
+ check_agent_config({UserId,
+ TargetName,
+ Community,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MaxMessageSize,
+ Version, SecModel, SecName, SecLevel});
+
+check_agent_config({UserId,
+ TargetName,
+ Community,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MaxMessageSize,
+ Version, SecModel, SecName, SecLevel}) ->
?vtrace("check_agent_config -> entry with"
"~n UserId: ~p"
"~n TargetName: ~p"
"~n Community: ~p"
+ "~n TDomain: ~p"
"~n Ip: ~p"
"~n Port: ~p"
"~n EngineId: ~p"
@@ -1610,15 +1707,16 @@ check_agent_config({UserId,
"~n SecModel: ~p"
"~n SecName: ~p"
"~n SecLevel: ~p",
- [UserId, TargetName, Community, Ip, Port,
+ [UserId, TargetName, Community,
+ TDomain, Ip, Port,
EngineId, Timeout, MaxMessageSize,
Version, SecModel, SecName, SecLevel]),
- Addr = normalize_address(Ip),
+ Addr = normalize_address(TDomain, Ip),
?vtrace("check_agent_config -> Addr: ~p", [Addr]),
Agent = {UserId,
TargetName,
Community,
- Addr, Port,
+ TDomain, Addr, Port,
EngineId,
Timeout, MaxMessageSize,
Version, SecModel, SecName, SecLevel},
@@ -1644,6 +1742,7 @@ init_agent_config({UserId, TargetName, Config}) ->
end.
+%% For backward compatibility
verify_agent({UserId,
TargetName,
Comm,
@@ -1651,48 +1750,68 @@ verify_agent({UserId,
EngineId,
Timeout, MMS,
Version, SecModel, SecName, SecLevel}) ->
- ?vtrace("verify_agent -> entry with"
+ TDomain = default_transport_domain(),
+ verify_agent({UserId,
+ TargetName,
+ Comm,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MMS,
+ Version, SecModel, SecName, SecLevel});
+
+verify_agent({UserId,
+ TargetName,
+ Comm,
+ TDomain, Ip, Port,
+ EngineId,
+ Timeout, MMS,
+ Version, SecModel, SecName, SecLevel}) ->
+ ?vdebug("verify_agent -> entry with"
"~n UserId: ~p"
"~n TargetName: ~p", [UserId, TargetName]),
snmp_conf:check_string(TargetName, {gt, 0}),
- case verify_val(address, Ip) of
- {ok, Addr} ->
- snmp_conf:check_integer(Port, {gt, 0}),
- Conf =
- [{reg_type, target_name},
- {address, Addr},
- {port, Port},
- {community, Comm},
- {engine_id, EngineId},
- {timeout, Timeout},
- {max_message_size, MMS},
- {version, Version},
- {sec_model, SecModel},
- {sec_name, SecName},
- {sec_level, SecLevel}
- ],
- case verify_agent2(Conf) of
- ok ->
- {UserId, TargetName, Conf, Version};
- Err ->
- throw(Err)
- end;
-
- Error ->
- ?vlog("verify_agent -> failed: ~n ~p", [Error]),
- throw(Error)
+ snmp_conf:check_integer(Port, {gt, 0}),
+ %% Note that the order of Conf *is* important.
+ %% Some properties may depend on others, so that
+ %% in order to verify one property, another must
+ %% be already verified (and present). An example
+ %% of this is the property 'address', for which
+ %% the property tdomain is needed.
+ Conf0 =
+ [{reg_type, target_name},
+ {tdomain, TDomain},
+ %% This should be taddress, but what the*...
+ {address, {TDomain, Ip}},
+ {port, Port},
+ {community, Comm},
+ {engine_id, EngineId},
+ {timeout, Timeout},
+ {max_message_size, MMS},
+ {version, Version},
+ {sec_model, SecModel},
+ {sec_name, SecName},
+ {sec_level, SecLevel}
+ ],
+ case verify_agent2(Conf0) of
+ {ok, Conf} ->
+ {UserId, TargetName, Conf, Version};
+ Err ->
+ throw(Err)
end.
-verify_agent2([]) ->
- ok;
-verify_agent2([{Item, Val}|Items]) ->
- case verify_val(Item, Val) of
- {ok, _Val} ->
- verify_agent2(Items);
+verify_agent2(Conf) ->
+ verify_agent2(Conf, []).
+
+verify_agent2([], VerifiedConf) ->
+ {ok, VerifiedConf};
+verify_agent2([{Item, Val0}|Items], VerifiedConf) ->
+ case verify_val(Item, Val0) of
+ {ok, Val} ->
+ verify_agent2(Items, [{Item, Val} | VerifiedConf]);
Err ->
Err
end;
-verify_agent2([Bad|_]) ->
+verify_agent2([Bad|_], _VerifiedConf) ->
{error, {bad_agent_config, Bad}}.
@@ -1708,14 +1827,28 @@ read_users_config_file(Dir) ->
check_user_config({Id, Mod, Data}) ->
+ ?vtrace("check_user_config -> entry with"
+ "~n Id: ~p"
+ "~n Mod: ~p"
+ "~n Data: ~p", [Id, Mod, Data]),
check_user_config({Id, Mod, Data, []});
-check_user_config({Id, Mod, _Data, DefaultAgentConfig} = User)
+check_user_config({Id, Mod, Data, DefaultAgentConfig} = _User)
when (Id =/= ?DEFAULT_USER) andalso is_list(DefaultAgentConfig) ->
+ ?vtrace("check_user_config -> entry with"
+ "~n Id: ~p"
+ "~n Mod: ~p"
+ "~n Data: ~p"
+ "~n DefaultAgentConfig: ~p",
+ [Id, Mod, Data, DefaultAgentConfig]),
case (catch verify_user_behaviour(Mod)) of
ok ->
+ ?vtrace("check_user_config -> user behaviour verified", []),
case verify_user_agent_config(DefaultAgentConfig) of
- ok ->
- {ok, User};
+ {ok, DefAgentConf} ->
+ ?vtrace("check_user_config -> "
+ "user agent (default) config verified", []),
+ User2 = {Id, Mod, Data, DefAgentConf},
+ {ok, User2};
{error, Reason} ->
error({bad_default_agent_config, Reason})
end;
@@ -1756,16 +1889,16 @@ verify_user({Id, UserMod, UserData}) ->
verify_user({Id, UserMod, UserData, DefaultAgentConfig})
when (Id =/= ?DEFAULT_USER) andalso is_list(DefaultAgentConfig) ->
?d("verify_user -> entry with"
- "~n Id: ~p"
- "~n UserMod: ~p"
- "~n UserData: ~p"
+ "~n Id: ~p"
+ "~n UserMod: ~p"
+ "~n UserData: ~p"
"~n DefaultAgentConfig: ~p",
[Id, UserMod, UserData, DefaultAgentConfig]),
case (catch verify_user_behaviour(UserMod)) of
ok ->
case verify_user_agent_config(DefaultAgentConfig) of
- ok ->
- Config = default_agent_config(DefaultAgentConfig),
+ {ok, DefAgentConf} ->
+ Config = default_agent_config(DefAgentConf),
{ok, #user{id = Id,
mod = UserMod,
data = UserData,
@@ -1783,10 +1916,15 @@ verify_user({Id, _, _, _}) ->
{error, {bad_user_id, Id}}.
verify_user_agent_config(Conf) ->
- case verify_invalid(Conf, [user_id, engine_id, address]) of
- ok ->
- verify_agent_config2(Conf);
- Error ->
+ try
+ begin
+ verify_invalid(Conf, [user_id, engine_id, address]),
+ verify_agent_config2(Conf)
+ end
+ catch
+ throw:Error ->
+ ?vdebug("verify_user_agent_config -> throw"
+ "~n Error: ~p", [Error]),
Error
end.
@@ -2147,6 +2285,16 @@ handle_call({unregister_agent, UserId, TargetName}, _From, State) ->
Reply = handle_unregister_agent(UserId, TargetName),
{reply, Reply, State};
+handle_call({update_agent_info, UserId, TargetName, Info},
+ _From, State) ->
+ ?vlog("received update_agent_info request: "
+ "~n UserId: ~p"
+ "~n TargetName: ~p"
+ "~n Info: ~p", [UserId, TargetName, Info]),
+ Reply = handle_update_agent_info(UserId, TargetName, Info),
+ {reply, Reply, State};
+
+%% <BACKWARD-COMPAT>
handle_call({update_agent_info, UserId, TargetName, Item, Val},
_From, State) ->
?vlog("received update_agent_info request: "
@@ -2156,6 +2304,7 @@ handle_call({update_agent_info, UserId, TargetName, Item, Val},
"~n Val: ~p", [UserId, TargetName, Item, Val]),
Reply = handle_update_agent_info(UserId, TargetName, Item, Val),
{reply, Reply, State};
+%% </BACKWARD-COMPAT>
handle_call({register_usm_user, User}, _From, State) ->
?vlog("received register_usm_user request: "
@@ -2517,16 +2666,27 @@ handle_register_agent(UserId, TargetName, Config) ->
"~n Config: ~p", [UserId, TargetName, Config]),
case (catch agent_info(TargetName, user_id)) of
{error, _} ->
+ ?vtrace("handle_register_agent -> user_id not found in config", []),
case ets:lookup(snmpm_user_table, UserId) of
[#user{default_agent_config = DefConfig}] ->
+ ?vtrace("handle_register_agent -> "
+ "~n DefConfig: ~p", [DefConfig]),
+ %% First, insert this users default config
+ ?vtrace("handle_register_agent -> store default config", []),
do_handle_register_agent(TargetName, DefConfig),
+ %% Second, insert the config for this agent
+ ?vtrace("handle_register_agent -> store config", []),
do_handle_register_agent(TargetName,
[{user_id, UserId}|Config]),
%% <DIRTY-BACKWARD-COMPATIBILLITY>
%% And now for some (backward compatibillity)
%% dirty crossref stuff
+ ?vtrace("handle_register_agent -> lookup address", []),
{ok, Addr} = agent_info(TargetName, address),
+ ?vtrace("handle_register_agent -> Addr: ~p, lookup Port",
+ [Addr]),
{ok, Port} = agent_info(TargetName, port),
+ ?vtrace("handle_register_agent -> register cross-ref fix", []),
ets:insert(snmpm_agent_table,
{{Addr, Port, target_name}, TargetName}),
%% </DIRTY-BACKWARD-COMPATIBILLITY>
@@ -2551,10 +2711,18 @@ handle_register_agent(UserId, TargetName, Config) ->
do_handle_register_agent(_TargetName, []) ->
ok;
do_handle_register_agent(TargetName, [{Item, Val}|Rest]) ->
+ ?vtrace("handle_register_agent -> entry with"
+ "~n TargetName: ~p"
+ "~n Item: ~p"
+ "~n Val: ~p"
+ "~n Rest: ~p", [TargetName, Item, Val, Rest]),
case (catch do_update_agent_info(TargetName, Item, Val)) of
ok ->
do_handle_register_agent(TargetName, Rest);
{error, Reason} ->
+ ?vtrace("handle_register_agent -> failed updating ~p"
+ "~n Item: ~p"
+ "~n Reason: ~p", [Item, Reason]),
ets:match_delete(snmpm_agent_table, {TargetName, '_'}),
{error, Reason}
end;
@@ -2589,41 +2757,61 @@ handle_unregister_agent(UserId, TargetName) ->
end.
-handle_update_agent_info(UserId, TargetName, Item, Val) ->
+handle_update_agent_info(UserId, TargetName, Info) ->
?vdebug("handle_update_agent_info -> entry with"
"~n UserId: ~p"
"~n TargetName: ~p"
- "~n Item: ~p"
- "~n Val: ~p", [UserId, TargetName, Item, Val]),
+ "~n Info: ~p", [UserId, TargetName, Info]),
+ %% Verify ownership
case (catch agent_info(TargetName, user_id)) of
- {ok, UserId} ->
- do_update_agent_info(TargetName, Item, Val);
+ {ok, UserId} ->
+ handle_update_agent_info(TargetName, Info);
{ok, OtherUserId} ->
{error, {not_owner, OtherUserId}};
Error ->
Error
end.
-do_update_agent_info(TargetName, Item, Val0) ->
-%% p("do_update_agent_info -> entry with"
-%% "~n TargetName: ~p"
-%% "~n Item: ~p"
-%% "~n Val0: ~p", [TargetName, Item, Val0]),
- case verify_val(Item, Val0) of
- {ok, Val} ->
-%% p("do_update_agent_info -> verified value"
-%% "~n Val: ~p", [Val]),
- ets:insert(snmpm_agent_table, {{TargetName, Item}, Val}),
- ok;
+handle_update_agent_info(TargetName, Info0) ->
+ ?vtrace("handle_update_agent_info -> entry with"
+ "~n TargetName: ~p"
+ "~n Info0: ~p", [TargetName, Info0]),
+ %% Verify info
+ try verify_agent_info(TargetName, Info0) of
+ {ok, Info} ->
+ do_update_agent_info(TargetName, Info);
Error ->
- ?vlog("do_update_agent_info -> verify value failed: "
- "~n TargetName: ~p"
- "~n Item: ~p"
- "~n Val0: ~p"
- "~n Error: ~p", [TargetName, Item, Val0, Error]),
- {error, {bad_agent_val, TargetName, Item, Val0}}
+ Error
+ catch
+ throw:Error ->
+ Error;
+ T:E ->
+ {error, {failed_info_verification, Info0, T, E}}
end.
+handle_update_agent_info(UserId, TargetName, Item, Val) ->
+ ?vdebug("handle_update_agent_info -> entry with"
+ "~n UserId: ~p"
+ "~n TargetName: ~p"
+ "~n Item: ~p"
+ "~n Val: ~p", [UserId, TargetName, Item, Val]),
+ handle_update_agent_info(TargetName, [{Item, Val}]).
+
+do_update_agent_info(TargetName, Info) ->
+ InsertItem =
+ fun({Item, Val}) ->
+ ets:insert(snmpm_agent_table, {{TargetName, Item}, Val})
+ end,
+ lists:foreach(InsertItem, Info).
+
+do_update_agent_info(TargetName, Item, Val) ->
+ ?vtrace("do_update_agent_info -> entry with"
+ "~n TargetName: ~p"
+ "~n Item: ~p"
+ "~n Val: ~p", [TargetName, Item, Val]),
+ ets:insert(snmpm_agent_table, {{TargetName, Item}, Val}),
+ ok.
+
handle_register_usm_user(#usm_user{engine_id = EngineID,
name = Name} = User) ->
@@ -2791,7 +2979,7 @@ verify_mandatory(Conf, [Mand|Mands]) ->
true ->
verify_mandatory(Conf, Mands);
false ->
- {error, {missing_mandatory_config, Mand}}
+ throw({error, {missing_mandatory_config, Mand}})
end.
verify_invalid(_, []) ->
@@ -2801,7 +2989,7 @@ verify_invalid(Conf, [Inv|Invs]) ->
false ->
verify_invalid(Conf, Invs);
true ->
- {error, {illegal_config, Inv}}
+ throw({error, {illegal_config, Inv}})
end.
@@ -2810,10 +2998,26 @@ verify_val(user_id, UserId) ->
verify_val(reg_type, RegType)
when (RegType =:= addr_port) orelse (RegType =:= target_name) ->
{ok, RegType};
-verify_val(address, Addr0) ->
- case normalize_address(Addr0) of
+verify_val(tdomain = Item, snmpUDPDomain = _Domain) ->
+ verify_val(Item, transportDomainUdpIpv4);
+verify_val(tdomain, Domain) ->
+ case lists:member(Domain, ?SUPPORTED_DOMAINS) of
+ true ->
+ {ok, Domain};
+ false ->
+ case lists:member(Domain, snmp_conf:all_domains()) of
+ true ->
+ error({unsupported_domain, Domain});
+ false ->
+ error({unknown_domain, Domain})
+ end
+ end;
+verify_val(address, {Domain, Addr0}) ->
+ case normalize_address(Domain, Addr0) of
{_A1, _A2, _A3, _A4} = Addr ->
{ok, Addr};
+ {_A1, _A2, _A3, _A4, _A5, _A6, _A7, _A8} = Addr ->
+ {ok, Addr};
_ when is_list(Addr0) ->
case (catch snmp_conf:check_ip(Addr0)) of
ok ->
@@ -2824,6 +3028,8 @@ verify_val(address, Addr0) ->
_ ->
error({bad_address, Addr0})
end;
+verify_val(address, BadAddress) ->
+ error({bad_address, BadAddress});
verify_val(port, Port) ->
case (catch snmp_conf:check_integer(Port, {gt, 0})) of
ok ->
@@ -2875,7 +3081,7 @@ verify_val(sec_name, BadName) ->
verify_val(sec_level, Level) ->
(catch snmp_conf:check_sec_level(Level));
verify_val(Item, _) ->
- {error, {no_such_item, Item}}.
+ {error, {unknown_item, Item}}.
%%%-------------------------------------------------------------------
@@ -3034,11 +3240,17 @@ init_mini_mib_elems(MibName, [_|T], Res) ->
%%----------------------------------------------------------------------
normalize_address(Addr) ->
- case inet:getaddr(Addr, inet) of
+ normalize_address(snmpUDPDomain, Addr).
+
+normalize_address(snmpUDPDomain, Addr) ->
+ normalize_address(transportDomainUdpIpv4, Addr);
+
+normalize_address(Domain, Addr) ->
+ case inet:getaddr(Addr, td2fam(Domain)) of
{ok, Addr2} ->
Addr2;
_ when is_list(Addr) ->
- case (catch snmp_conf:check_ip(Addr)) of
+ case (catch snmp_conf:check_ip(Domain, Addr)) of
ok ->
list_to_tuple(Addr);
_ ->
@@ -3048,6 +3260,9 @@ normalize_address(Addr) ->
Addr
end.
+td2fam(transportDomainUdpIpv4) -> inet;
+td2fam(transportDomainUdpIpv6) -> inet6.
+
%%----------------------------------------------------------------------
diff --git a/lib/snmp/src/manager/snmpm_mpd.erl b/lib/snmp/src/manager/snmpm_mpd.erl
index 7712370d28..627838e3d4 100644
--- a/lib/snmp/src/manager/snmpm_mpd.erl
+++ b/lib/snmp/src/manager/snmpm_mpd.erl
@@ -92,7 +92,7 @@ reset(#state{v3 = V3}) ->
%% Purpose: This is the main Message Dispatching function. (see
%% section 4.2.1 in rfc2272)
%%-----------------------------------------------------------------
-process_msg(Msg, TDomain, Addr, Port, State, NoteStore, Logger) ->
+process_msg(Msg, Domain, Addr, Port, State, NoteStore, Logger) ->
inc(snmpInPkts),
@@ -102,18 +102,18 @@ process_msg(Msg, TDomain, Addr, Port, State, NoteStore, Logger) ->
#message{version = 'version-1', vsn_hdr = Community, data = Data}
when State#state.v1 =:= true ->
HS = ?empty_msg_size + length(Community),
- process_v1_v2c_msg('version-1', NoteStore, Msg, TDomain,
- Addr, Port,
+ process_v1_v2c_msg('version-1', NoteStore, Msg,
+ Domain, Addr, Port,
Community, Data, HS, Logger);
%% Version 2
#message{version = 'version-2', vsn_hdr = Community, data = Data}
when State#state.v2c =:= true ->
HS = ?empty_msg_size + length(Community),
- process_v1_v2c_msg('version-2', NoteStore, Msg, TDomain,
- Addr, Port,
- Community, Data, HS, Logger);
-
+ (catch process_v1_v2c_msg('version-2', NoteStore, Msg,
+ Domain, Addr, Port,
+ Community, Data, HS, Logger));
+
%% Version 3
#message{version = 'version-3', vsn_hdr = H, data = Data}
when State#state.v3 =:= true ->
@@ -148,17 +148,30 @@ process_msg(Msg, TDomain, Addr, Port, State, NoteStore, Logger) ->
%%-----------------------------------------------------------------
%% Handles a Community based message (v1 or v2c).
%%-----------------------------------------------------------------
-process_v1_v2c_msg(Vsn, _NoteStore, Msg, snmpUDPDomain,
+process_v1_v2c_msg(Vsn, _NoteStore, Msg, Domain,
Addr, Port,
Community, Data, HS, Log) ->
?vdebug("process_v1_v2c_msg -> entry with"
"~n Vsn: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
"~n Port: ~p"
"~n Community: ~p"
- "~n HS: ~p", [Vsn, Addr, Port, Community, HS]),
+ "~n HS: ~p", [Vsn, Domain, Addr, Port, Community, HS]),
+ {TDomain, TAddress} =
+ try
+ begin
+ TD = snmp_conf:mk_tdomain(Domain),
+ TA = snmp_conf:mk_taddress(Domain, Addr, Port),
+ {TD, TA}
+ end
+ catch
+ throw:{error, TReason} ->
+ throw({discarded, {badarg, Domain, TReason}})
+ end,
+
Max = get_max_message_size(),
AgentMax = get_agent_max_message_size(Addr, Port),
PduMS = pdu_ms(Max, AgentMax, HS),
@@ -170,14 +183,14 @@ process_v1_v2c_msg(Vsn, _NoteStore, Msg, snmpUDPDomain,
?vtrace("process_v1_v2c_msg -> was a pdu", []),
Log(Msg),
inc_snmp_in(Pdu),
- MsgData = {Community, sec_model(Vsn)},
+ MsgData = {Community, sec_model(Vsn), TDomain, TAddress},
{ok, Vsn, Pdu, PduMS, MsgData};
Trap when is_record(Trap, trappdu) ->
?vtrace("process_v1_v2c_msg -> was a trap", []),
Log(Msg),
inc_snmp_in(Trap),
- MsgData = {Community, sec_model(Vsn)},
+ MsgData = {Community, sec_model(Vsn), TDomain, TAddress},
{ok, Vsn, Trap, PduMS, MsgData};
{'EXIT', Reason} ->
@@ -185,11 +198,7 @@ process_v1_v2c_msg(Vsn, _NoteStore, Msg, snmpUDPDomain,
"~n Reason: ~p", [Reason]),
inc(snmpInASNParseErrs),
{discarded, Reason}
- end;
-process_v1_v2c_msg(_Vsn, _NoteStore, _Msg, TDomain,
- _Addr, _Port,
- _Comm, _HS, _Data, _Log) ->
- {discarded, {badarg, TDomain}}.
+ end.
pdu_ms(MgrMMS, AgentMMS, HS) when AgentMMS < MgrMMS ->
AgentMMS - HS;
@@ -482,8 +491,8 @@ generate_msg('version-3', NoteStore, Pdu,
generate_v3_msg(NoteStore, Pdu,
SecModel, SecName, SecLevel, CtxEngineID, CtxName,
TargetName, Log);
-generate_msg(Vsn, _NoteStore, Pdu, {Community, _SecModel}, Log) ->
- generate_v1_v2c_msg(Vsn, Pdu, Community, Log).
+generate_msg(Vsn, _NoteStore, Pdu, {Comm, _SecModel}, Log) ->
+ generate_v1_v2c_msg(Vsn, Pdu, Comm, Log).
generate_v3_msg(NoteStore, Pdu,
@@ -627,6 +636,8 @@ generate_response_msg('version-3', Pdu,
generate_v3_response_msg(Pdu, MsgID, SecModel, SecName, SecLevel,
CtxEngineID, CtxName, SecData, Log);
generate_response_msg(Vsn, Pdu, {Comm, _SecModel}, Log) ->
+ generate_v1_v2c_response_msg(Vsn, Pdu, Comm, Log);
+generate_response_msg(Vsn, Pdu, {Comm, _SecModel, _TDomain, _TAddress}, Log) ->
generate_v1_v2c_response_msg(Vsn, Pdu, Comm, Log).
diff --git a/lib/snmp/src/manager/snmpm_net_if.erl b/lib/snmp/src/manager/snmpm_net_if.erl
index a116c9f26b..4d6bd9aa33 100644
--- a/lib/snmp/src/manager/snmpm_net_if.erl
+++ b/lib/snmp/src/manager/snmpm_net_if.erl
@@ -28,7 +28,8 @@
start_link/2,
stop/1,
send_pdu/6, % Backward compatibillity
- send_pdu/7,
+ send_pdu/7, % Backward compatibillity
+ send_pdu/8,
inform_response/4,
@@ -101,16 +102,21 @@ stop(Pid) ->
send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port) ->
send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port, ?DEFAULT_EXTRA_INFO).
-send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo)
+send_pdu(Pid, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo) ->
+ Domain = snmpm_config:default_transport_domain(),
+ send_pdu(Pid, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo).
+
+send_pdu(Pid, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo)
when is_record(Pdu, pdu) ->
?d("send_pdu -> entry with"
"~n Pid: ~p"
"~n Pdu: ~p"
"~n Vsn: ~p"
"~n MsgData: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
- "~n Port: ~p", [Pid, Pdu, Vsn, MsgData, Addr, Port]),
- cast(Pid, {send_pdu, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo}).
+ "~n Port: ~p", [Pid, Pdu, Vsn, MsgData, Domain, Addr, Port]),
+ cast(Pid, {send_pdu, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo}).
note_store(Pid, NoteStore) ->
call(Pid, {note_store, NoteStore}).
@@ -380,15 +386,17 @@ handle_call(Req, From, State) ->
%% {noreply, State, Timeout} |
%% {stop, Reason, State} (terminate/2 is called)
%%--------------------------------------------------------------------
-handle_cast({send_pdu, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo}, State) ->
+handle_cast({send_pdu, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo},
+ State) ->
?vlog("received send_pdu message with"
"~n Pdu: ~p"
"~n Vsn: ~p"
"~n MsgData: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
- "~n Port: ~p", [Pdu, Vsn, MsgData, Addr, Port]),
+ "~n Port: ~p", [Pdu, Vsn, MsgData, Domain, Addr, Port]),
maybe_process_extra_info(ExtraInfo),
- maybe_handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port, State),
+ maybe_handle_send_pdu(Pdu, Vsn, MsgData, Domain, Addr, Port, State),
{noreply, State};
handle_cast({inform_response, Ref, Addr, Port}, State) ->
@@ -545,8 +553,9 @@ handle_recv_msg(Addr, Port, Bytes,
mpd_state = MpdState,
sock = Sock,
log = Log} = State) ->
+ Domain = snmp_conf:which_domain(Addr), % What the ****...
Logger = logger(Log, read, Addr, Port),
- case (catch snmpm_mpd:process_msg(Bytes, snmpUDPDomain, Addr, Port,
+ case (catch snmpm_mpd:process_msg(Bytes, Domain, Addr, Port,
MpdState, NoteStore, Logger)) of
{ok, Vsn, Pdu, MS, ACM} ->
@@ -734,17 +743,17 @@ irgc_stop(Ref) ->
(catch erlang:cancel_timer(Ref)).
-maybe_handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port,
+maybe_handle_send_pdu(Pdu, Vsn, MsgData, Domain, Addr, Port,
#state{filter = FilterMod} = State) ->
case (catch FilterMod:accept_send_pdu(Addr, Port, pdu_type_of(Pdu))) of
false ->
inc(netIfPduOutDrops),
ok;
_ ->
- handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port, State)
+ handle_send_pdu(Pdu, Vsn, MsgData, Domain, Addr, Port, State)
end.
-handle_send_pdu(Pdu, Vsn, MsgData, Addr, Port,
+handle_send_pdu(Pdu, Vsn, MsgData, _Domain, Addr, Port,
#state{server = Pid,
note_store = NoteStore,
sock = Sock,
diff --git a/lib/snmp/src/manager/snmpm_server.erl b/lib/snmp/src/manager/snmpm_server.erl
index 58a58507d6..484954addb 100644
--- a/lib/snmp/src/manager/snmpm_server.erl
+++ b/lib/snmp/src/manager/snmpm_server.erl
@@ -161,7 +161,8 @@
{id,
user_id,
reg_type,
- target,
+ target,
+ domain,
addr,
port,
type,
@@ -1175,11 +1176,12 @@ handle_sync_get(Pid, UserId, TargetName, Oids, SendOpts, From, State) ->
"~n From: ~p",
[Pid, UserId, TargetName, Oids, SendOpts, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_get -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_get_request(Oids, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_sync_get -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
Timeout = ?SYNC_GET_TIMEOUT(SendOpts),
@@ -1190,6 +1192,7 @@ handle_sync_get(Pid, UserId, TargetName, Oids, SendOpts, From, State) ->
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get,
@@ -1227,11 +1230,12 @@ handle_sync_get_next(Pid, UserId, TargetName, Oids, SendOpts,
"~n From: ~p",
[Pid, UserId, TargetName, Oids, SendOpts, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_get_next -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_get_next_request(Oids, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_sync_get_next -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
Timeout = ?SYNC_GET_NEXT_TIMEOUT(SendOpts),
@@ -1242,6 +1246,7 @@ handle_sync_get_next(Pid, UserId, TargetName, Oids, SendOpts,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_next,
@@ -1285,10 +1290,11 @@ handle_sync_get_bulk(Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts,
"~n From: ~p",
[Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_get_bulk -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
- ReqId = send_get_bulk_request(Oids, Vsn, MsgData, Addr, Port,
+ ReqId = send_get_bulk_request(Oids, Vsn, MsgData,
+ Domain, Addr, Port,
NonRep, MaxRep, Extra, State),
?vdebug("handle_sync_get_bulk -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
@@ -1300,6 +1306,7 @@ handle_sync_get_bulk(Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_bulk,
@@ -1339,11 +1346,12 @@ handle_sync_set(Pid, UserId, TargetName, VarsAndVals, SendOpts, From, State) ->
"~n From: ~p",
[Pid, UserId, TargetName, VarsAndVals, From]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_sync_set -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_set_request(VarsAndVals, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_sync_set -> ReqId: ~p", [ReqId]),
Msg = {sync_timeout, ReqId, From},
Timeout = ?SYNC_SET_TIMEOUT(SendOpts),
@@ -1354,6 +1362,7 @@ handle_sync_set(Pid, UserId, TargetName, VarsAndVals, SendOpts, From, State) ->
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = set,
@@ -1391,10 +1400,11 @@ handle_async_get(Pid, UserId, TargetName, Oids, SendOpts, State) ->
"~n SendOpts: ~p",
[Pid, UserId, TargetName, Oids, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_get -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
- ReqId = send_get_request(Oids, Vsn, MsgData, Addr, Port,
+ ReqId = send_get_request(Oids, Vsn, MsgData,
+ Domain, Addr, Port,
Extra, State),
?vdebug("handle_async_get -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_GET_TIMEOUT(SendOpts),
@@ -1402,6 +1412,7 @@ handle_async_get(Pid, UserId, TargetName, Oids, SendOpts, State) ->
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get,
@@ -1439,17 +1450,19 @@ handle_async_get_next(Pid, UserId, TargetName, Oids, SendOpts, State) ->
"~n SendOpts: ~p",
[Pid, UserId, TargetName, Oids, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_get_next -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_get_next_request(Oids, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_async_get_next -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_GET_NEXT_TIMEOUT(SendOpts),
Req = #request{id = ReqId,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_next,
@@ -1494,10 +1507,11 @@ handle_async_get_bulk(Pid,
"~n SendOpts: ~p",
[Pid, UserId, TargetName, NonRep, MaxRep, Oids, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_get_bulk -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
- ReqId = send_get_bulk_request(Oids, Vsn, MsgData, Addr, Port,
+ ReqId = send_get_bulk_request(Oids, Vsn, MsgData,
+ Domain, Addr, Port,
NonRep, MaxRep, Extra, State),
?vdebug("handle_async_get_bulk -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_GET_BULK_TIMEOUT(SendOpts),
@@ -1505,6 +1519,7 @@ handle_async_get_bulk(Pid,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = get_bulk,
@@ -1541,17 +1556,19 @@ handle_async_set(Pid, UserId, TargetName, VarsAndVals, SendOpts, State) ->
"~n SendOpts: ~p",
[Pid, UserId, TargetName, VarsAndVals, SendOpts]),
case agent_data(TargetName, SendOpts) of
- {ok, RegType, Addr, Port, Vsn, MsgData} ->
+ {ok, RegType, Domain, Addr, Port, Vsn, MsgData} ->
?vtrace("handle_async_set -> send a ~p message", [Vsn]),
Extra = ?GET_EXTRA(SendOpts),
ReqId = send_set_request(VarsAndVals, Vsn, MsgData,
- Addr, Port, Extra, State),
+ Domain, Addr, Port,
+ Extra, State),
?vdebug("handle_async_set -> ReqId: ~p", [ReqId]),
Expire = ?ASYNC_SET_TIMEOUT(SendOpts),
Req = #request{id = ReqId,
user_id = UserId,
reg_type = RegType,
target = TargetName,
+ domain = Domain,
addr = Addr,
port = Port,
type = set,
@@ -2907,7 +2924,7 @@ do_gc(Key, Now) ->
%%
%%----------------------------------------------------------------------
-send_get_request(Oids, Vsn, MsgData, Addr, Port, ExtraInfo,
+send_get_request(Oids, Vsn, MsgData, Domain, Addr, Port, ExtraInfo,
#state{net_if = NetIf,
net_if_mod = Mod,
mini_mib = MiniMIB}) ->
@@ -2918,34 +2935,39 @@ send_get_request(Oids, Vsn, MsgData, Addr, Port, ExtraInfo,
"~n Pdu: ~p"
"~n Vsn: ~p"
"~n MsgData: ~p"
+ "~n Domain: ~p"
"~n Addr: ~p"
- "~n Port: ~p", [Mod, NetIf, Pdu, Vsn, MsgData, Addr, Port]),
- (catch Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo)),
+ "~n Port: ~p",
+ [Mod, NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port]),
+ Res = (catch Mod:send_pdu(NetIf, Pdu, Vsn, MsgData,
+ Domain, Addr, Port, ExtraInfo)),
+ ?vtrace("send_get_request -> send result:"
+ "~n ~p", [Res]),
Pdu#pdu.request_id.
-send_get_next_request(Oids, Vsn, MsgData, Addr, Port, ExtraInfo,
+send_get_next_request(Oids, Vsn, MsgData, Domain, Addr, Port, ExtraInfo,
#state{mini_mib = MiniMIB,
net_if = NetIf,
net_if_mod = Mod}) ->
Pdu = make_pdu(get_next, Oids, MiniMIB),
- Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo),
+ Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo),
Pdu#pdu.request_id.
-send_get_bulk_request(Oids, Vsn, MsgData, Addr, Port,
+send_get_bulk_request(Oids, Vsn, MsgData, Domain, Addr, Port,
NonRep, MaxRep, ExtraInfo,
#state{mini_mib = MiniMIB,
net_if = NetIf,
net_if_mod = Mod}) ->
Pdu = make_pdu(bulk, {NonRep, MaxRep, Oids}, MiniMIB),
- Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo),
+ Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo),
Pdu#pdu.request_id.
-send_set_request(VarsAndVals, Vsn, MsgData, Addr, Port, ExtraInfo,
+send_set_request(VarsAndVals, Vsn, MsgData, Domain, Addr, Port, ExtraInfo,
#state{mini_mib = MiniMIB,
net_if = NetIf,
net_if_mod = Mod}) ->
Pdu = make_pdu(set, VarsAndVals, MiniMIB),
- Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Addr, Port, ExtraInfo),
+ Mod:send_pdu(NetIf, Pdu, Vsn, MsgData, Domain, Addr, Port, ExtraInfo),
Pdu#pdu.request_id.
%% send_discovery(Vsn, MsgData, Addr, Port, ExtraInfo,
@@ -3181,10 +3203,11 @@ agent_data(TargetName, SendOpts) ->
{Comm, SecModel}
end,
+ Domain = agent_data_item(tdomain, Info),
Addr = agent_data_item(address, Info),
Port = agent_data_item(port, Info),
RegType = agent_data_item(reg_type, Info),
- {ok, RegType, Addr, Port, version(Version), MsgData};
+ {ok, RegType, Domain, Addr, Port, version(Version), MsgData};
Error ->
Error
end.
diff --git a/lib/snmp/src/misc/snmp_conf.erl b/lib/snmp/src/misc/snmp_conf.erl
index 20f4455d10..7249def24e 100644
--- a/lib/snmp/src/misc/snmp_conf.erl
+++ b/lib/snmp/src/misc/snmp_conf.erl
@@ -37,7 +37,9 @@
check_timer/1,
+ all_domains/0,
check_domain/1,
+ all_tdomains/0,
check_tdomain/1,
mk_tdomain/1,
which_domain/1,
@@ -345,6 +347,25 @@ check_sec_level(BadSecLevel) ->
%% ---------
+all_tdomains() ->
+ [
+ ?transportDomainUdpIpv4,
+ ?transportDomainUdpIpv6,
+ ?transportDomainUdpIpv4z,
+ ?transportDomainUdpIpv6z,
+ ?transportDomainTcpIpv4,
+ ?transportDomainTcpIpv6,
+ ?transportDomainTcpIpv4z,
+ ?transportDomainTcpIpv6z,
+ ?transportDomainSctpIpv4,
+ ?transportDomainSctpIpv6,
+ ?transportDomainSctpIpv4z,
+ ?transportDomainSctpIpv6z,
+ ?transportDomainLocal,
+ ?transportDomainUdpDns,
+ ?transportDomainTcpDns,
+ ?transportDomainSctpDns
+ ].
check_tdomain(TDomain) ->
SupportedTDomains =
@@ -353,25 +374,7 @@ check_tdomain(TDomain) ->
?transportDomainUdpIpv4,
?transportDomainUdpIpv6
],
- AllTDomains =
- [
- ?transportDomainUdpIpv4,
- ?transportDomainUdpIpv6,
- ?transportDomainUdpIpv4z,
- ?transportDomainUdpIpv6z,
- ?transportDomainTcpIpv4,
- ?transportDomainTcpIpv6,
- ?transportDomainTcpIpv4z,
- ?transportDomainTcpIpv6z,
- ?transportDomainSctpIpv4,
- ?transportDomainSctpIpv6,
- ?transportDomainSctpIpv4z,
- ?transportDomainSctpIpv6z,
- ?transportDomainLocal,
- ?transportDomainUdpDns,
- ?transportDomainTcpDns,
- ?transportDomainSctpDns
- ],
+ AllTDomains = all_tdomains(),
case lists:member(TDomain, SupportedTDomains) of
true ->
ok;
@@ -388,7 +391,7 @@ check_tdomain(TDomain) ->
%% ---------
mk_tdomain(snmpUDPDomain) ->
- ?snmpUDPDomain;
+ mk_tdomain(transportDomainUdpIpv4);
mk_tdomain(transportDomainUdpIpv4) ->
?transportDomainUdpIpv4;
mk_tdomain(transportDomainUdpIpv6) ->
@@ -474,6 +477,26 @@ do_check_timer(WaitFor, Factor, Incr, Retry) ->
%% ---------
+all_domains() ->
+ [
+ transportDomainUdpIpv4,
+ transportDomainUdpIpv6,
+ transportDomainUdpIpv4z,
+ transportDomainUdpIpv6z,
+ transportDomainTcpIpv4,
+ transportDomainTcpIpv6,
+ transportDomainTcpIpv4z,
+ transportDomainTcpIpv6z,
+ transportDomainSctpIpv4,
+ transportDomainSctpIpv6,
+ transportDomainSctpIpv4z,
+ transportDomainSctpIpv6z,
+ transportDomainLocal,
+ transportDomainUdpDns,
+ transportDomainTcpDns,
+ transportDomainSctpDns
+ ].
+
check_domain(Domain) ->
SupportedDomains =
[
@@ -481,25 +504,7 @@ check_domain(Domain) ->
transportDomainUdpIpv4,
transportDomainUdpIpv6
],
- AllDomains =
- [
- transportDomainUdpIpv4,
- transportDomainUdpIpv6,
- transportDomainUdpIpv4z,
- transportDomainUdpIpv6z,
- transportDomainTcpIpv4,
- transportDomainTcpIpv6,
- transportDomainTcpIpv4z,
- transportDomainTcpIpv6z,
- transportDomainSctpIpv4,
- transportDomainSctpIpv6,
- transportDomainSctpIpv4z,
- transportDomainSctpIpv6z,
- transportDomainLocal,
- transportDomainUdpDns,
- transportDomainTcpDns,
- transportDomainSctpDns
- ],
+ AllDomains = all_domains(),
case lists:member(Domain, SupportedDomains) of
true ->
ok;
diff --git a/lib/snmp/src/misc/snmp_config.erl b/lib/snmp/src/misc/snmp_config.erl
index fcbc6a88c9..6ab20e3e48 100644
--- a/lib/snmp/src/misc/snmp_config.erl
+++ b/lib/snmp/src/misc/snmp_config.erl
@@ -337,7 +337,7 @@ config_agent_sys() ->
{dir, ATLDir},
{size, ATLSize},
{repair, ATLRepair},
- {seqno, ATLSeqNo}]}];
+ {seqno, ATLSeqNo}]}];
no ->
[]
end,
@@ -568,7 +568,7 @@ config_agent_snmp(Dir, Vsns) ->
false ->
ok
end,
- i("The following agent files were written: agent.conf, "
+ i("The following agent files where written: agent.conf, "
"community.conf,~n"
"standard.conf, target_addr.conf, "
"target_params.conf, ~n"
@@ -776,7 +776,7 @@ config_manager_snmp(Dir, Vsns) ->
Users, Agents, Usms)) of
ok ->
i("~n- - - - - - - - - - - - -"),
- i("The following manager files were written: "
+ i("The following manager files where written: "
"manager.conf, agents.conf " ++
case lists:member(v3, Vsns) of
true ->
@@ -2350,7 +2350,9 @@ write_sys_config_file_manager_atl_opt(Fid, {type, Type}) ->
write_sys_config_file_manager_atl_opt(Fid, {size, Size}) ->
ok = io:format(Fid, "{size, ~w}", [Size]);
write_sys_config_file_manager_atl_opt(Fid, {repair, Rep}) ->
- ok = io:format(Fid, "{repair, ~w}", [Rep]).
+ ok = io:format(Fid, "{repair, ~w}", [Rep]);
+write_sys_config_file_manager_atl_opt(Fid, {seqno, SeqNo}) ->
+ ok = io:format(Fid, "{seqno, ~w}", [SeqNo]).
header() ->
diff --git a/lib/snmp/test/snmp_compiler_test.erl b/lib/snmp/test/snmp_compiler_test.erl
index 2e6020ae7a..c964b08168 100644
--- a/lib/snmp/test/snmp_compiler_test.erl
+++ b/lib/snmp/test/snmp_compiler_test.erl
@@ -47,6 +47,7 @@
module_identity/1,
agent_capabilities/1,
module_compliance/1,
+ warnings_as_errors/1,
otp_6150/1,
otp_8574/1,
@@ -97,9 +98,10 @@ all() ->
description,
oid_conflicts,
imports,
- module_identity,
- agent_capabilities,
- module_compliance,
+ module_identity,
+ agent_capabilities,
+ module_compliance,
+ warnings_as_errors,
{group, tickets}
].
@@ -152,6 +154,8 @@ description(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
oid_conflicts(suite) -> [];
oid_conflicts(Config) when is_list(Config) ->
put(tname,oid_conflicts),
@@ -165,18 +169,24 @@ oid_conflicts(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
imports(suite) ->
[];
imports(Config) when is_list(Config) ->
?SKIP(not_yet_implemented).
+%%======================================================================
+
module_identity(suite) ->
[];
module_identity(Config) when is_list(Config) ->
?SKIP(not_yet_implemented).
+%%======================================================================
+
agent_capabilities(suite) ->
[];
agent_capabilities(Config) when is_list(Config) ->
@@ -218,6 +228,8 @@ agent_capabilities(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
module_compliance(suite) ->
[];
module_compliance(Config) when is_list(Config) ->
@@ -259,6 +271,32 @@ module_compliance(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
+warnings_as_errors(suite) ->
+ ["OTP-9437"];
+warnings_as_errors(Config) when is_list(Config) ->
+ put(tname,warnings_as_errors),
+ p("starting with Config: ~p~n", [Config]),
+ Dir = ?config(comp_dir, Config),
+ MibDir = ?config(mib_dir, Config),
+ MibFile = join(MibDir, "OTP8574-MIB.mib"),
+ OutFile = join(Dir, "OTP8574-MIB.bin"),
+ Opts = [{group_check, false},
+ {outdir, Dir},
+ {verbosity, trace},
+ relaxed_row_name_assign_check],
+ {error, compilation_failed} =
+ snmpc:compile(MibFile, [warnings_as_errors|Opts]),
+ false = filelib:is_regular(OutFile),
+ {ok, _} = snmpc:compile(MibFile, Opts),
+ true = filelib:is_regular(OutFile),
+ ok = file:delete(OutFile),
+ ok.
+
+
+%%======================================================================
+
otp_6150(suite) ->
[];
otp_6150(Config) when is_list(Config) ->
@@ -273,6 +311,8 @@ otp_6150(Config) when is_list(Config) ->
ok.
+%%======================================================================
+
otp_8574(suite) ->
[];
otp_8574(Config) when is_list(Config) ->
@@ -304,6 +344,8 @@ otp_8574(Config) when is_list(Config) ->
end.
+%%======================================================================
+
otp_8595(suite) ->
[];
otp_8595(Config) when is_list(Config) ->
diff --git a/lib/snmp/test/snmp_manager_test.erl b/lib/snmp/test/snmp_manager_test.erl
index 0b536748fb..d18f20d359 100644
--- a/lib/snmp/test/snmp_manager_test.erl
+++ b/lib/snmp/test/snmp_manager_test.erl
@@ -61,6 +61,7 @@
register_agent1/1,
register_agent2/1,
+ register_agent3/1,
info/1,
@@ -383,12 +384,12 @@ end_per_testcase2(Case, Config) ->
all() ->
[
{group, start_and_stop_tests},
- {group, misc_tests},
+ {group, misc_tests},
{group, user_tests},
- {group, agent_tests},
+ {group, agent_tests},
{group, request_tests},
{group, event_tests},
- discovery,
+ discovery,
{group, tickets}
].
@@ -417,7 +418,8 @@ groups() ->
{agent_tests, [],
[
register_agent1,
- register_agent2
+ register_agent2,
+ register_agent3
]
},
{request_tests, [],
@@ -477,14 +479,14 @@ groups() ->
},
{event_tests, [],
[
- trap1,
- trap2,
- inform1,
- inform2,
- inform3,
- inform4,
- inform_swarm,
- report
+ trap1%% ,
+ %% trap2,
+ %% inform1,
+ %% inform2,
+ %% inform3,
+ %% inform4,
+ %% inform_swarm,
+ %% report
]
},
{tickets, [],
@@ -1134,6 +1136,7 @@ register_agent1(suite) ->
register_agent1(Config) when is_list(Config) ->
process_flag(trap_exit, true),
put(tname,ra1),
+
p("starting with Config: ~p~n", [Config]),
ManagerNode = start_manager_node(),
@@ -1164,7 +1167,7 @@ register_agent1(Config) when is_list(Config) ->
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
- p("register user(s) calvin & hobbe"),
+ p("register user(s) user_alfa & user_beta"),
?line ok = mgr_register_user(ManagerNode, user_alfa, snmpm_user_default, []),
?line ok = mgr_register_user(ManagerNode, user_beta, snmpm_user_default, []),
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
@@ -1293,7 +1296,7 @@ register_agent2(Config) when is_list(Config) ->
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
- p("register user(s) calvin & hobbe"),
+ p("register user(s) user_alfa & user_beta"),
?line ok = mgr_register_user(ManagerNode, user_alfa, snmpm_user_default, []),
?line ok = mgr_register_user(ManagerNode, user_beta, snmpm_user_default, []),
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
@@ -1348,7 +1351,7 @@ register_agent2(Config) when is_list(Config) ->
end,
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
-
+
p("unregister user user_alfa"),
?line ok = mgr_unregister_user(ManagerNode, user_alfa),
@@ -1377,7 +1380,157 @@ register_agent2(Config) when is_list(Config) ->
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
- p("unregister user hobbe"),
+ p("unregister user user_beta"),
+ ?line ok = mgr_unregister_user(ManagerNode, user_beta),
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ ?SLEEP(1000),
+
+ p("stop snmp application (with only manager)"),
+ ?line ok = stop_snmp(ManagerNode),
+
+ ?SLEEP(1000),
+
+ stop_node(ManagerNode),
+
+ ?SLEEP(1000),
+
+ p("end"),
+ ok.
+
+
+%%======================================================================
+
+register_agent3(doc) ->
+ ["Test registration of agents with the NEW interface functions "
+ "and specifying transport domain"];
+register_agent3(suite) ->
+ [];
+register_agent3(Config) when is_list(Config) ->
+ process_flag(trap_exit, true),
+ put(tname, ra3),
+ p("starting with Config: ~p~n", [Config]),
+
+ ManagerNode = start_manager_node(),
+
+ ConfDir = ?config(manager_conf_dir, Config),
+ DbDir = ?config(manager_db_dir, Config),
+ LocalHost = snmp_test_lib:localhost(),
+
+
+ write_manager_conf(ConfDir),
+
+ Opts = [{server, [{verbosity, trace}]},
+ {net_if, [{verbosity, trace}]},
+ {note_store, [{verbosity, trace}]},
+ {config, [{verbosity, trace}, {dir, ConfDir}, {db_dir, DbDir}]}],
+
+
+ p("load snmp application"),
+ ?line ok = load_snmp(ManagerNode),
+
+ p("set manager env for the snmp application"),
+ ?line ok = set_mgr_env(ManagerNode, Opts),
+
+ p("starting snmp application (with only manager)"),
+ ?line ok = start_snmp(ManagerNode),
+
+ p("started"),
+
+ ?SLEEP(1000),
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("register user(s) user_alfa & user_beta"),
+ ?line ok = mgr_register_user(ManagerNode, user_alfa, snmpm_user_default, []),
+ ?line ok = mgr_register_user(ManagerNode, user_beta, snmpm_user_default, []),
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("register agent(s)"),
+ TargetName1 = "agent2",
+ ?line ok = mgr_register_agent(ManagerNode, user_alfa, TargetName1,
+ [{tdomain, transportDomainUdpIpv4},
+ {address, LocalHost},
+ {port, 5001},
+ {engine_id, "agentEngineId-1"}]),
+ TargetName2 = "agent3",
+ ?line ok = mgr_register_agent(ManagerNode, user_alfa, TargetName2,
+ [{tdomain, transportDomainUdpIpv6},
+ {address, LocalHost},
+ {port, 5002},
+ {engine_id, "agentEngineId-2"}]),
+ TargetName3 = "agent4",
+ ?line {error, {unsupported_domain, _} = Reason4} =
+ mgr_register_agent(ManagerNode, user_beta, TargetName3,
+ [{tdomain, transportDomainTcpIpv4},
+ {address, LocalHost},
+ {port, 5003},
+ {engine_id, "agentEngineId-3"}]),
+ p("Expected registration failure: ~p", [Reason4]),
+ TargetName4 = "agent5",
+ ?line {error, {unknown_domain, _} = Reason5} =
+ mgr_register_agent(ManagerNode, user_beta, TargetName4,
+ [{tdomain, transportDomainUdpIpv4_bad},
+ {address, LocalHost},
+ {port, 5004},
+ {engine_id, "agentEngineId-4"}]),
+ p("Expected registration failure: ~p", [Reason5]),
+
+ p("verify all agent(s): expect 2"),
+ case mgr_which_agents(ManagerNode) of
+ Agents1 when length(Agents1) =:= 2 ->
+ p("all agents: ~p~n", [Agents1]),
+ ok;
+ Agents1 ->
+ ?FAIL({agent_registration_failure, Agents1})
+ end,
+
+ p("verify user_alfa agent(s)"),
+ case mgr_which_agents(ManagerNode, user_alfa) of
+ Agents2 when length(Agents2) =:= 2 ->
+ p("calvin agents: ~p~n", [Agents2]),
+ ok;
+ Agents2 ->
+ ?FAIL({agent_registration_failure, Agents2})
+ end,
+
+ p("verify user_beta agent(s)"),
+ case mgr_which_agents(ManagerNode, user_beta) of
+ Agents3 when length(Agents3) =:= 0 ->
+ p("hobbe agents: ~p~n", [Agents3]),
+ ok;
+ Agents3 ->
+ ?FAIL({agent_registration_failure, Agents3})
+ end,
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("unregister user user_alfa"),
+ ?line ok = mgr_unregister_user(ManagerNode, user_alfa),
+
+ p("verify all agent(s): expect 0"),
+ case mgr_which_agents(ManagerNode) of
+ Agents4 when length(Agents4) =:= 0 ->
+ p("all agents: ~p~n", [Agents4]),
+ ok;
+ Agents4 ->
+ ?FAIL({agent_unregistration_failure, Agents4})
+ end,
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("verify all agent(s): expect 0"),
+ case mgr_which_agents(ManagerNode) of
+ [] ->
+ ok;
+ Agents5 ->
+ p("all agents: ~p~n", [Agents5]),
+ ?FAIL({agent_unregistration_failure, Agents5})
+ end,
+
+ p("manager info: ~p~n", [mgr_info(ManagerNode)]),
+
+ p("unregister user user_beta"),
?line ok = mgr_unregister_user(ManagerNode, user_beta),
p("manager info: ~p~n", [mgr_info(ManagerNode)]),
diff --git a/lib/snmp/test/test_config/Makefile b/lib/snmp/test/test_config/Makefile
index d7bebbc431..d65bb8abe2 100644
--- a/lib/snmp/test/test_config/Makefile
+++ b/lib/snmp/test/test_config/Makefile
@@ -155,23 +155,23 @@ release_spec:
release_tests_spec: clean opt
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DIR) $(RELSYSDIR)/agent
- chmod -f -R u+w $(RELSYSDIR)/agent
+ chmod -R u+w $(RELSYSDIR)/agent
$(INSTALL_DIR) $(RELSYSDIR)/agent/conf
- chmod -f -R u+w $(RELSYSDIR)/agent/conf
+ chmod -R u+w $(RELSYSDIR)/agent/conf
$(INSTALL_DIR) $(RELSYSDIR)/agent/db
- chmod -f -R u+w $(RELSYSDIR)/agent/db
+ chmod -R u+w $(RELSYSDIR)/agent/db
$(INSTALL_DIR) $(RELSYSDIR)/agent/log
- chmod -f -R u+w $(RELSYSDIR)/agent/log
+ chmod -R u+w $(RELSYSDIR)/agent/log
$(INSTALL_DIR) $(RELSYSDIR)/manager
- chmod -f -R u+w $(RELSYSDIR)/manager
+ chmod -R u+w $(RELSYSDIR)/manager
$(INSTALL_DIR) $(RELSYSDIR)/manager/conf
- chmod -f -R u+w $(RELSYSDIR)/manager/conf
+ chmod -R u+w $(RELSYSDIR)/manager/conf
$(INSTALL_DIR) $(RELSYSDIR)/manager/db
- chmod -f -R u+w $(RELSYSDIR)/manager/db
+ chmod -R u+w $(RELSYSDIR)/manager/db
$(INSTALL_DIR) $(RELSYSDIR)/manager/log
- chmod -f -R u+w $(RELSYSDIR)/manager/log
+ chmod -R u+w $(RELSYSDIR)/manager/log
$(INSTALL_DATA) $(SYS_CONFIG_FILES) $(RELSYSDIR)
$(INSTALL_DATA) $(AGENT_CONFIG_FILES) $(RELSYSDIR)/agent/conf
$(INSTALL_DATA) $(MANAGER_CONFIG_FILES) $(RELSYSDIR)/manager/conf
diff --git a/lib/snmp/vsn.mk b/lib/snmp/vsn.mk
index 29228fc59b..c95e0a22d1 100644
--- a/lib/snmp/vsn.mk
+++ b/lib/snmp/vsn.mk
@@ -17,6 +17,6 @@
#
# %CopyrightEnd%
-SNMP_VSN = 4.20
+SNMP_VSN = 4.21.1
PRE_VSN =
APP_VSN = "snmp-$(SNMP_VSN)$(PRE_VSN)"
diff --git a/lib/ssh/doc/src/notes.xml b/lib/ssh/doc/src/notes.xml
index 71f3941577..6fc4fdc43d 100644
--- a/lib/ssh/doc/src/notes.xml
+++ b/lib/ssh/doc/src/notes.xml
@@ -29,6 +29,20 @@
<file>notes.xml</file>
</header>
+<section><title>Ssh 2.0.8</title>
+ <section><title>Fixed Bugs and Malfunctions</title>
+ <list>
+ <item>
+ <p>
+ Calling ssh_sftp:stop_channel/1 resulted in that the trap_exit flag was
+ set to true for the invoking process.</p>
+ <p>
+ Own Id: OTP-9386 Aux Id: seq11865</p>
+ </item>
+ </list>
+ </section>
+</section>
+
<section><title>Ssh 2.0.7</title>
<section><title>Fixed Bugs and Malfunctions</title>
<list>
diff --git a/lib/ssh/src/ssh.appup.src b/lib/ssh/src/ssh.appup.src
index 974145836c..150b7d86dd 100644
--- a/lib/ssh/src/ssh.appup.src
+++ b/lib/ssh/src/ssh.appup.src
@@ -19,13 +19,19 @@
{"%VSN%",
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
],
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
]
}.
diff --git a/lib/ssh/src/ssh_sftp.erl b/lib/ssh/src/ssh_sftp.erl
index 59e09fdd0f..f000558100 100755
--- a/lib/ssh/src/ssh_sftp.erl
+++ b/lib/ssh/src/ssh_sftp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2005-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2005-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -130,9 +130,9 @@ start_channel(Host, Port, Opts) ->
end.
stop_channel(Pid) ->
- case process_info(Pid, [trap_exit]) of
- [{trap_exit, Bool}] ->
- process_flag(trap_exit, true),
+ case is_process_alive(Pid) of
+ true ->
+ OldValue = process_flag(trap_exit, true),
link(Pid),
exit(Pid, ssh_sftp_stop_channel),
receive
@@ -145,9 +145,9 @@ stop_channel(Pid) ->
ok
end
end,
- process_flag(trap_exit, Bool),
+ process_flag(trap_exit, OldValue),
ok;
- undefined ->
+ false ->
ok
end.
diff --git a/lib/ssh/test/Makefile b/lib/ssh/test/Makefile
index 5a2a6de24a..1820924ed6 100644
--- a/lib/ssh/test/Makefile
+++ b/lib/ssh/test/Makefile
@@ -115,7 +115,7 @@ release_tests_spec: opt
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) ssh.spec ssh.cover $(RELSYSDIR)
$(INSTALL_DATA) $(HRL_FILES_NEEDED_IN_TEST) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/ssh/vsn.mk b/lib/ssh/vsn.mk
index d79038df29..fe2b915d17 100644
--- a/lib/ssh/vsn.mk
+++ b/lib/ssh/vsn.mk
@@ -1,5 +1,5 @@
#-*-makefile-*- ; force emacs to enter makefile-mode
-SSH_VSN = 2.0.7
+SSH_VSN = 2.0.8
APP_VSN = "ssh-$(SSH_VSN)"
diff --git a/lib/ssl/c_src/esock_openssl.c b/lib/ssl/c_src/esock_openssl.c
index 2621c9934e..0bc42958f0 100644
--- a/lib/ssl/c_src/esock_openssl.c
+++ b/lib/ssl/c_src/esock_openssl.c
@@ -1024,7 +1024,7 @@ static void info_callback(const SSL *ssl, int where, int ret)
}
}
-/* This function is called whenever a SSL_CTX *ctx structure is
+/* This function is called whenever an SSL_CTX *ctx structure is
* freed.
*/
static void callback_data_free(void *parent, void *ptr, CRYPTO_EX_DATA *ad,
diff --git a/lib/ssl/doc/src/notes.xml b/lib/ssl/doc/src/notes.xml
index b2d17925fd..e090b4e1ef 100644
--- a/lib/ssl/doc/src/notes.xml
+++ b/lib/ssl/doc/src/notes.xml
@@ -554,7 +554,7 @@
Own Id: OTP-8224</p>
</item>
<item>
- <p>A ssl:ssl_accept/3 could crash a connection if the
+ <p>An ssl:ssl_accept/3 could crash a connection if the
timing was wrong.</p> <p>Removed info message if the
socket closed without a proper disconnect from the ssl
layer. </p> <p>ssl:send/2 is now blocking until the
@@ -770,7 +770,7 @@
<item>
<p>
The new ssl implementation released as a alfa in this
- version supports upgrading of a tcp connection to a ssl
+ version supports upgrading of a tcp connection to an ssl
connection so that http client and servers may implement
RFC 2817.</p>
<p>
@@ -789,7 +789,7 @@
very crippled as the control of the ssl-socket was deep
down in openssl making it hard if not impossible to
support all inet options, ipv6 and upgrade of a tcp
- connection to a ssl connection. The alfa version has a
+ connection to an ssl connection. The alfa version has a
few limitations that will be removed before the ssl-4.0
release. Main differences and limitations in the alfa are
listed below.</p>
diff --git a/lib/ssl/doc/src/ssl.xml b/lib/ssl/doc/src/ssl.xml
index 0da6bbee5b..0c4c8796be 100644
--- a/lib/ssl/doc/src/ssl.xml
+++ b/lib/ssl/doc/src/ssl.xml
@@ -35,7 +35,7 @@
<title>SSL</title>
<list type="bulleted">
- <item>ssl requires the crypto an public_key applications.</item>
+ <item>ssl requires the crypto and public_key applications.</item>
<item>Supported SSL/TLS-versions are SSL-3.0 and TLS-1.0 </item>
<item>For security reasons sslv2 is not supported.</item>
<item>Ephemeral Diffie-Hellman cipher suites are supported
@@ -216,7 +216,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
application is encountered. Additionally it will be called
when a certificate is considered valid by the path validation
to allow access to each certificate in the path to the user
- application. Note that the it will differentiate between the
+ application. Note that it will differentiate between the
peer certificate and CA certificates by using valid_peer or
valid as the second argument to the verify fun. See <seealso
marker="public_key:cert_records">the public_key User's
@@ -326,10 +326,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</item>
<tag>{fail_if_no_peer_cert, boolean()}</tag>
- <item>Used together with {verify, verify_peer} by a ssl server.
+ <item>Used together with {verify, verify_peer} by an ssl server.
If set to true, the server will fail if the client does not have
a certificate to send, i.e. sends a empty certificate, if set to
- false it will only fail if the client sends a invalid
+ false it will only fail if the client sends an invalid
certificate (an empty certificate is considered valid).
</item>
@@ -343,10 +343,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
PeerCert, Compression, CipherSuite) -> boolean()}</tag>
<item>Enables the ssl server to have a local policy
for deciding if a session should be reused or not,
- only meaning full if <c>reuse_sessions</c> is set to true.
+ only meaningful if <c>reuse_sessions</c> is set to true.
SuggestedSessionId is a binary(), PeerCert is a DER encoded
certificate, Compression is an enumeration integer
- and CipherSuite of type ciphersuite().
+ and CipherSuite is of type ciphersuite().
</item>
</taglist>
@@ -355,7 +355,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<section>
<title>General</title>
- <p>When a ssl socket is in active mode (the default), data from the
+ <p>When an ssl socket is in active mode (the default), data from the
socket is delivered to the owner of the socket in the form of
messages:
</p>
@@ -396,7 +396,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<name>connect(Socket, SslOptions, Timeout) -> {ok, SslSocket}
| {error, Reason}</name>
<fsummary> Upgrades a gen_tcp, or
- equivalent, connected socket to a ssl socket. </fsummary>
+ equivalent, connected socket to an ssl socket. </fsummary>
<type>
<v>Socket = socket()</v>
<v>SslOptions = [ssloption()]</v>
@@ -405,7 +405,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc> <p>Upgrades a gen_tcp, or equivalent,
- connected socket to a ssl socket i.e. performs the
+ connected socket to an ssl socket i.e. performs the
client-side ssl handshake.</p>
</desc>
</func>
@@ -428,12 +428,12 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>close(SslSocket) -> ok | {error, Reason}</name>
- <fsummary>Close a ssl connection</fsummary>
+ <fsummary>Close an ssl connection</fsummary>
<type>
<v>SslSocket = sslsocket()</v>
<v>Reason = term()</v>
</type>
- <desc><p>Close a ssl connection.</p>
+ <desc><p>Close an ssl connection.</p>
</desc>
</func>
@@ -450,7 +450,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc><p>Assigns a new controlling process to the ssl-socket. A
- controlling process is the owner of a ssl-socket, and receives
+ controlling process is the owner of an ssl-socket, and receives
all messages from the socket.</p>
</desc>
</func>
@@ -480,7 +480,6 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</func>
<func>
- <name>getopts(Socket) -> </name>
<name>getopts(Socket, OptionNames) ->
{ok, [socketoption()]} | {error, Reason}</name>
<fsummary>Get the value of the specified options.</fsummary>
@@ -489,8 +488,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>OptionNames = [atom()]</v>
</type>
<desc>
- <p>Get the value of the specified socket options, if no
- options are specified all options are returned.
+ <p>Get the value of the specified socket options.
</p>
</desc>
</func>
@@ -498,14 +496,14 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>listen(Port, Options) ->
{ok, ListenSocket} | {error, Reason}</name>
- <fsummary>Creates a ssl listen socket.</fsummary>
+ <fsummary>Creates an ssl listen socket.</fsummary>
<type>
<v>Port = integer()</v>
<v>Options = options()</v>
<v>ListenSocket = sslsocket()</v>
</type>
<desc>
- <p>Creates a ssl listen socket.</p>
+ <p>Creates an ssl listen socket.</p>
</desc>
</func>
@@ -589,6 +587,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
the socket is closed.</p>
</desc>
</func>
+
<func>
<name>setopts(Socket, Options) -> ok | {error, Reason}</name>
<fsummary>Set socket options.</fsummary>
@@ -648,7 +647,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</type>
<desc>
<p> Upgrades a gen_tcp, or
- equivalent, socket to a ssl socket i.e. performs the
+ equivalent, socket to an ssl socket i.e. performs the
ssl server-side handshake.</p>
<p><warning>Note that the listen socket should be in {active, false} mode
before telling the client that the server is ready to upgrade
diff --git a/lib/ssl/doc/src/ssl_protocol.xml b/lib/ssl/doc/src/ssl_protocol.xml
index 6936408881..ca5cc8bc7a 100644
--- a/lib/ssl/doc/src/ssl_protocol.xml
+++ b/lib/ssl/doc/src/ssl_protocol.xml
@@ -31,11 +31,11 @@
</p>
<p>By default erlang ssl is run over the TCP/IP protocol even
- though you could plug in an other reliable transport protocol
+ though you could plug in any other reliable transport protocol
with the same API as gen_tcp.</p>
<p>If a client and server wants to use an upgrade mechanism, such as
- defined by RFC2817, to upgrade a regular TCP/IP connection to a ssl
+ defined by RFC2817, to upgrade a regular TCP/IP connection to an ssl
connection the erlang ssl API supports this. This can be useful for
things such as supporting HTTP and HTTPS on the same port and
implementing virtual hosting.
diff --git a/lib/ssl/doc/src/using_ssl.xml b/lib/ssl/doc/src/using_ssl.xml
index 605290b6f9..ab837a156a 100644
--- a/lib/ssl/doc/src/using_ssl.xml
+++ b/lib/ssl/doc/src/using_ssl.xml
@@ -56,7 +56,7 @@
<code type="erl">1 server> ssl:start().
ok</code>
- <p>Create a ssl listen socket</p>
+ <p>Create an ssl listen socket</p>
<code type="erl">2 server> {ok, ListenSocket} =
ssl:listen(9999, [{certfile, "cert.pem"}, {keyfile, "key.pem"},{reuseaddr, true}]).
{ok,{sslsocket, [...]}}</code>
@@ -90,7 +90,7 @@ ok</code>
<section>
<title>Upgrade example</title>
- <note><p> To upgrade a TCP/IP connection to a ssl connection the
+ <note><p> To upgrade a TCP/IP connection to an ssl connection the
client and server have to aggre to do so. Agreement
may be accompliced by using a protocol such the one used by HTTP
specified in RFC 2817.</p> </note>
@@ -114,7 +114,7 @@ ok</code>
<code type="erl">2 client> {ok, Socket} = gen_tcp:connect("localhost", 9999, [], infinity).</code>
<p>Make sure active is set to false before trying
- to upgrade a connection to a ssl connection, otherwhise
+ to upgrade a connection to an ssl connection, otherwhise
ssl handshake messages may be deliverd to the wrong process.</p>
<code type="erl">4 server> inet:setopts(Socket, [{active, false}]).
ok</code>
@@ -124,7 +124,7 @@ ok</code>
{certfile, "cert.pem"}, {keyfile, "key.pem"}]).
{ok,{sslsocket,[...]}}</code>
- <p> Upgrade to a ssl connection. Note that the client and server
+ <p> Upgrade to an ssl connection. Note that the client and server
must agree upon the upgrade and the server must call
ssl:accept/2 before the client calls ssl:connect/3.</p>
<code type="erl">3 client>{ok, SSLSocket} = ssl:connect(Socket, [{cacertfile, "cacerts.pem"},
diff --git a/lib/ssl/src/ssl.appup.src b/lib/ssl/src/ssl.appup.src
index cf8867245b..29674f30da 100644
--- a/lib/ssl/src/ssl.appup.src
+++ b/lib/ssl/src/ssl.appup.src
@@ -1,6 +1,7 @@
%% -*- erlang -*-
{"%VSN%",
[
+ {"4.1.5", [{restart_application, ssl}]},
{"4.1.4", [{restart_application, ssl}]},
{"4.1.3", [{restart_application, ssl}]},
{"4.1.2", [{restart_application, ssl}]},
@@ -9,6 +10,7 @@
{"4.0.1", [{restart_application, ssl}]}
],
[
+ {"4.1.5", [{restart_application, ssl}]},
{"4.1.4", [{restart_application, ssl}]},
{"4.1.3", [{restart_application, ssl}]},
{"4.1.2", [{restart_application, ssl}]},
diff --git a/lib/ssl/src/ssl.erl b/lib/ssl/src/ssl.erl
index a5e8e7e5c2..d1ec0c141e 100644
--- a/lib/ssl/src/ssl.erl
+++ b/lib/ssl/src/ssl.erl
@@ -49,9 +49,12 @@
inet_ssl, %% inet options for internal ssl socket
cb %% Callback info
}).
--type option() :: socketoption() | ssloption() | transportoption().
--type socketoption() :: term(). %% See gen_tcp and inet, import spec later when there is one to import
--type ssloption() :: {verify, verify_type()} |
+-type connect_option() :: socket_connect_option() | ssl_option() | transport_option().
+-type socket_connect_option() :: gen_tcp:connect_option().
+-type listen_option() :: socket_listen_option() | ssl_option() | transport_option().
+-type socket_listen_option() :: gen_tcp:listen_option().
+
+-type ssl_option() :: {verify, verify_type()} |
{verify_fun, {fun(), InitialUserState::term()}} |
{fail_if_no_peer_cert, boolean()} | {depth, integer()} |
{cert, Der::binary()} | {certfile, path()} | {key, Der::binary()} |
@@ -66,7 +69,7 @@
string(). % (according to old API)
-type ssl_imp() :: new | old.
--type transportoption() :: {CallbackModule::atom(), DataTag::atom(), ClosedTag::atom()}.
+-type transport_option() :: {cb_info, {CallbackModule::atom(), DataTag::atom(), ClosedTag::atom()}}.
%%--------------------------------------------------------------------
@@ -96,15 +99,15 @@ stop() ->
application:stop(ssl).
%%--------------------------------------------------------------------
--spec connect(host() | port(), [option()]) -> {ok, #sslsocket{}} |
+-spec connect(host() | port(), [connect_option()]) -> {ok, #sslsocket{}} |
{error, reason()}.
--spec connect(host() | port(), [option()] | port_num(), timeout() | list()) ->
+-spec connect(host() | port(), [connect_option()] | inet:port_number(), timeout() | list()) ->
{ok, #sslsocket{}} | {error, reason()}.
--spec connect(host() | port(), port_num(), list(), timeout()) ->
+-spec connect(host() | port(), inet:port_number(), list(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Socket, SslOptions) when is_port(Socket) ->
connect(Socket, SslOptions, infinity).
@@ -112,7 +115,7 @@ connect(Socket, SslOptions) when is_port(Socket) ->
connect(Socket, SslOptions0, Timeout) when is_port(Socket) ->
EmulatedOptions = emulated_options(),
{ok, InetValues} = inet:getopts(Socket, EmulatedOptions),
- inet:setopts(Socket, internal_inet_values()),
+ ok = inet:setopts(Socket, internal_inet_values()),
try handle_options(SslOptions0 ++ InetValues, client) of
{ok, #config{cb=CbInfo, ssl=SslOptions, emulated=EmOpts}} ->
case inet:peername(Socket) of
@@ -148,10 +151,10 @@ connect(Host, Port, Options0, Timeout) ->
end.
%%--------------------------------------------------------------------
--spec listen(port_num(), [option()]) ->{ok, #sslsocket{}} | {error, reason()}.
+-spec listen(inet:port_number(), [listen_option()]) ->{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Creates a ssl listen socket.
+%% Description: Creates an ssl listen socket.
%%--------------------------------------------------------------------
listen(_Port, []) ->
{error, enooptions};
@@ -177,7 +180,7 @@ listen(Port, Options0) ->
-spec transport_accept(#sslsocket{}, timeout()) -> {ok, #sslsocket{}} |
{error, reason()}.
%%
-%% Description: Performs transport accept on a ssl listen socket
+%% Description: Performs transport accept on an ssl listen socket
%%--------------------------------------------------------------------
transport_accept(ListenSocket) ->
transport_accept(ListenSocket, infinity).
@@ -214,11 +217,11 @@ transport_accept(#sslsocket{} = ListenSocket, Timeout) ->
%%--------------------------------------------------------------------
-spec ssl_accept(#sslsocket{}) -> ok | {error, reason()}.
--spec ssl_accept(#sslsocket{} | port(), timeout()| [option()]) ->
+-spec ssl_accept(#sslsocket{} | port(), timeout()| [ssl_option() | transport_option()]) ->
ok | {ok, #sslsocket{}} | {error, reason()}.
--spec ssl_accept(port(), [option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
+-spec ssl_accept(port(), [ssl_option()| transport_option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(ListenSocket) ->
@@ -238,7 +241,7 @@ ssl_accept(#sslsocket{} = Socket, Timeout) ->
ssl_accept(Socket, SslOptions, Timeout) when is_port(Socket) ->
EmulatedOptions = emulated_options(),
{ok, InetValues} = inet:getopts(Socket, EmulatedOptions),
- inet:setopts(Socket, internal_inet_values()),
+ ok = inet:setopts(Socket, internal_inet_values()),
try handle_options(SslOptions ++ InetValues, server) of
{ok, #config{cb=CbInfo,ssl=SslOpts, emulated=EmOpts}} ->
{ok, Port} = inet:port(Socket),
@@ -252,7 +255,7 @@ ssl_accept(Socket, SslOptions, Timeout) when is_port(Socket) ->
%%--------------------------------------------------------------------
-spec close(#sslsocket{}) -> term().
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(#sslsocket{pid = {ListenSocket, #config{cb={CbMod,_, _, _}}}, fd = new_ssl}) ->
CbMod:close(ListenSocket);
@@ -373,7 +376,7 @@ select_part(plain, Cert, Opts) ->
end.
%%--------------------------------------------------------------------
--spec peername(#sslsocket{}) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec peername(#sslsocket{}) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: same as inet:peername/1.
%%--------------------------------------------------------------------
@@ -402,29 +405,56 @@ cipher_suites(openssl) ->
[ssl_cipher:openssl_suite_name(S) || S <- ssl_cipher:suites(Version)].
%%--------------------------------------------------------------------
--spec getopts(#sslsocket{}, [atom()]) -> {ok, [{atom(), term()}]} | {error, reason()}.
+-spec getopts(#sslsocket{}, [gen_tcp:option_name()]) ->
+ {ok, [gen_tcp:option()]} | {error, reason()}.
%%
%% Description: Gets options
%%--------------------------------------------------------------------
-getopts(#sslsocket{fd = new_ssl, pid = Pid}, OptTags) when is_pid(Pid) ->
- ssl_connection:get_opts(Pid, OptTags);
-getopts(#sslsocket{fd = new_ssl, pid = {ListenSocket, _}}, OptTags) ->
- inet:getopts(ListenSocket, OptTags);
-getopts(#sslsocket{} = Socket, Options) ->
+getopts(#sslsocket{fd = new_ssl, pid = Pid}, OptionTags) when is_pid(Pid), is_list(OptionTags) ->
+ ssl_connection:get_opts(Pid, OptionTags);
+getopts(#sslsocket{fd = new_ssl, pid = {ListenSocket, _}}, OptionTags) when is_list(OptionTags) ->
+ try inet:getopts(ListenSocket, OptionTags) of
+ {ok, _} = Result ->
+ Result;
+ {error, InetError} ->
+ {error, {eoptions, {inet_options, OptionTags, InetError}}}
+ catch
+ _:_ ->
+ {error, {eoptions, {inet_options, OptionTags}}}
+ end;
+getopts(#sslsocket{fd = new_ssl}, OptionTags) ->
+ {error, {eoptions, {inet_options, OptionTags}}};
+getopts(#sslsocket{} = Socket, OptionTags) ->
ensure_old_ssl_started(),
- ssl_broker:getopts(Socket, Options).
+ ssl_broker:getopts(Socket, OptionTags).
%%--------------------------------------------------------------------
--spec setopts(#sslsocket{}, [proplists:property()]) -> ok | {error, reason()}.
+-spec setopts(#sslsocket{}, [gen_tcp:option()]) -> ok | {error, reason()}.
%%
%% Description: Sets options
%%--------------------------------------------------------------------
-setopts(#sslsocket{fd = new_ssl, pid = Pid}, Opts0) when is_pid(Pid) ->
- Opts = proplists:expand([{binary, [{mode, binary}]},
- {list, [{mode, list}]}], Opts0),
- ssl_connection:set_opts(Pid, Opts);
-setopts(#sslsocket{fd = new_ssl, pid = {ListenSocket, _}}, OptTags) ->
- inet:setopts(ListenSocket, OptTags);
+setopts(#sslsocket{fd = new_ssl, pid = Pid}, Options0) when is_pid(Pid), is_list(Options0) ->
+ try proplists:expand([{binary, [{mode, binary}]},
+ {list, [{mode, list}]}], Options0) of
+ Options ->
+ ssl_connection:set_opts(Pid, Options)
+ catch
+ _:_ ->
+ {error, {eoptions, {not_a_proplist, Options0}}}
+ end;
+
+setopts(#sslsocket{fd = new_ssl, pid = {ListenSocket, _}}, Options) when is_list(Options) ->
+ try inet:setopts(ListenSocket, Options) of
+ ok ->
+ ok;
+ {error, InetError} ->
+ {error, {eoptions, {inet_options, Options, InetError}}}
+ catch
+ _:Error ->
+ {error, {eoptions, {inet_options, Options, Error}}}
+ end;
+setopts(#sslsocket{fd = new_ssl}, Options) ->
+ {error, {eoptions,{not_a_proplist, Options}}};
setopts(#sslsocket{} = Socket, Options) ->
ensure_old_ssl_started(),
ssl_broker:setopts(Socket, Options).
@@ -440,7 +470,7 @@ shutdown(#sslsocket{pid = Pid, fd = new_ssl}, How) ->
ssl_connection:shutdown(Pid, How).
%%--------------------------------------------------------------------
--spec sockname(#sslsocket{}) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec sockname(#sslsocket{}) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:sockname/1
%%--------------------------------------------------------------------
@@ -977,7 +1007,7 @@ version() ->
%% Only used to remove exit messages from old ssl
%% First is a nonsense clause to provide some
-%% backward compability for orber that uses this
+%% backward compatibility for orber that uses this
%% function in a none recommended way, but will
%% work correctly if a valid pid is returned.
pid(#sslsocket{fd = new_ssl}) ->
diff --git a/lib/ssl/src/ssl_certificate.erl b/lib/ssl/src/ssl_certificate.erl
index 8c0c2bfa5d..422ea6404b 100644
--- a/lib/ssl/src/ssl_certificate.erl
+++ b/lib/ssl/src/ssl_certificate.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2007-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2007-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -30,9 +30,9 @@
-include("ssl_internal.hrl").
-include_lib("public_key/include/public_key.hrl").
--export([trusted_cert_and_path/2,
- certificate_chain/2,
- file_to_certificats/1,
+-export([trusted_cert_and_path/3,
+ certificate_chain/3,
+ file_to_certificats/2,
validate_extension/3,
is_valid_extkey_usage/2,
is_valid_key_usage/2,
@@ -46,14 +46,14 @@
%%====================================================================
%%--------------------------------------------------------------------
--spec trusted_cert_and_path([der_cert()], certdb_ref()) ->
+-spec trusted_cert_and_path([der_cert()], db_handle(), certdb_ref()) ->
{der_cert() | unknown_ca, [der_cert()]}.
%%
%% Description: Extracts the root cert (if not presents tries to
%% look it up, if not found {bad_cert, unknown_ca} will be added verification
%% errors. Returns {RootCert, Path, VerifyErrors}
%%--------------------------------------------------------------------
-trusted_cert_and_path(CertChain, CertDbRef) ->
+trusted_cert_and_path(CertChain, CertDbHandle, CertDbRef) ->
Path = [Cert | _] = lists:reverse(CertChain),
OtpCert = public_key:pkix_decode_cert(Cert, otp),
SignedAndIssuerID =
@@ -66,7 +66,7 @@ trusted_cert_and_path(CertChain, CertDbRef) ->
{ok, IssuerId} ->
{other, IssuerId};
{error, issuer_not_found} ->
- case find_issuer(OtpCert, no_candidate) of
+ case find_issuer(OtpCert, no_candidate, CertDbHandle) of
{ok, IssuerId} ->
{other, IssuerId};
Other ->
@@ -82,7 +82,7 @@ trusted_cert_and_path(CertChain, CertDbRef) ->
{self, _} when length(Path) == 1 ->
{selfsigned_peer, Path};
{_ ,{SerialNr, Issuer}} ->
- case ssl_manager:lookup_trusted_cert(CertDbRef, SerialNr, Issuer) of
+ case ssl_manager:lookup_trusted_cert(CertDbHandle, CertDbRef, SerialNr, Issuer) of
{ok, {BinCert,_}} ->
{BinCert, Path};
_ ->
@@ -92,23 +92,23 @@ trusted_cert_and_path(CertChain, CertDbRef) ->
end.
%%--------------------------------------------------------------------
--spec certificate_chain(undefined | binary(), certdb_ref()) ->
+-spec certificate_chain(undefined | binary(), db_handle(), certdb_ref()) ->
{error, no_cert} | {ok, [der_cert()]}.
%%
%% Description: Return the certificate chain to send to peer.
%%--------------------------------------------------------------------
-certificate_chain(undefined, _CertsDbRef) ->
+certificate_chain(undefined, _, _) ->
{error, no_cert};
-certificate_chain(OwnCert, CertsDbRef) ->
+certificate_chain(OwnCert, CertDbHandle, CertsDbRef) ->
ErlCert = public_key:pkix_decode_cert(OwnCert, otp),
- certificate_chain(ErlCert, OwnCert, CertsDbRef, [OwnCert]).
+ certificate_chain(ErlCert, OwnCert, CertDbHandle, CertsDbRef, [OwnCert]).
%%--------------------------------------------------------------------
--spec file_to_certificats(string()) -> [der_cert()].
+-spec file_to_certificats(string(), term()) -> [der_cert()].
%%
%% Description: Return list of DER encoded certificates.
%%--------------------------------------------------------------------
-file_to_certificats(File) ->
- {ok, List} = ssl_manager:cache_pem_file(File),
+file_to_certificats(File, DbHandle) ->
+ {ok, List} = ssl_manager:cache_pem_file(File, DbHandle),
[Bin || {'Certificate', Bin, not_encrypted} <- List].
%%--------------------------------------------------------------------
-spec validate_extension(term(), #'Extension'{} | {bad_cert, atom()} | valid,
@@ -180,7 +180,7 @@ signature_type(?'id-dsa-with-sha1') ->
%%--------------------------------------------------------------------
%%% Internal functions
%%--------------------------------------------------------------------
-certificate_chain(OtpCert, _Cert, CertsDbRef, Chain) ->
+certificate_chain(OtpCert, _Cert, CertDbHandle, CertsDbRef, Chain) ->
IssuerAndSelfSigned =
case public_key:pkix_is_self_signed(OtpCert) of
true ->
@@ -191,11 +191,11 @@ certificate_chain(OtpCert, _Cert, CertsDbRef, Chain) ->
case IssuerAndSelfSigned of
{_, true = SelfSigned} ->
- certificate_chain(CertsDbRef, Chain, ignore, ignore, SelfSigned);
+ certificate_chain(CertDbHandle, CertsDbRef, Chain, ignore, ignore, SelfSigned);
{{error, issuer_not_found}, SelfSigned} ->
- case find_issuer(OtpCert, no_candidate) of
+ case find_issuer(OtpCert, no_candidate, CertDbHandle) of
{ok, {SerialNr, Issuer}} ->
- certificate_chain(CertsDbRef, Chain,
+ certificate_chain(CertDbHandle, CertsDbRef, Chain,
SerialNr, Issuer, SelfSigned);
_ ->
%% Guess the the issuer must be the root
@@ -205,19 +205,19 @@ certificate_chain(OtpCert, _Cert, CertsDbRef, Chain) ->
{ok, lists:reverse(Chain)}
end;
{{ok, {SerialNr, Issuer}}, SelfSigned} ->
- certificate_chain(CertsDbRef, Chain, SerialNr, Issuer, SelfSigned)
+ certificate_chain(CertDbHandle, CertsDbRef, Chain, SerialNr, Issuer, SelfSigned)
end.
-certificate_chain(_CertsDbRef, Chain, _SerialNr, _Issuer, true) ->
+certificate_chain(_,_, Chain, _SerialNr, _Issuer, true) ->
{ok, lists:reverse(Chain)};
-certificate_chain(CertsDbRef, Chain, SerialNr, Issuer, _SelfSigned) ->
- case ssl_manager:lookup_trusted_cert(CertsDbRef,
+certificate_chain(CertDbHandle, CertsDbRef, Chain, SerialNr, Issuer, _SelfSigned) ->
+ case ssl_manager:lookup_trusted_cert(CertDbHandle, CertsDbRef,
SerialNr, Issuer) of
{ok, {IssuerCert, ErlCert}} ->
ErlCert = public_key:pkix_decode_cert(IssuerCert, otp),
certificate_chain(ErlCert, IssuerCert,
- CertsDbRef, [IssuerCert | Chain]);
+ CertDbHandle, CertsDbRef, [IssuerCert | Chain]);
_ ->
%% The trusted cert may be obmitted from the chain as the
%% counter part needs to have it anyway to be able to
@@ -227,8 +227,8 @@ certificate_chain(CertsDbRef, Chain, SerialNr, Issuer, _SelfSigned) ->
{ok, lists:reverse(Chain)}
end.
-find_issuer(OtpCert, PrevCandidateKey) ->
- case ssl_manager:issuer_candidate(PrevCandidateKey) of
+find_issuer(OtpCert, PrevCandidateKey, CertDbHandle) ->
+ case ssl_manager:issuer_candidate(PrevCandidateKey, CertDbHandle) of
no_more_candidates ->
{error, issuer_not_found};
{Key, {_Cert, ErlCertCandidate}} ->
@@ -236,7 +236,7 @@ find_issuer(OtpCert, PrevCandidateKey) ->
true ->
public_key:pkix_issuer_id(ErlCertCandidate, self);
false ->
- find_issuer(OtpCert, Key)
+ find_issuer(OtpCert, Key, CertDbHandle)
end
end.
diff --git a/lib/ssl/src/ssl_certificate_db.erl b/lib/ssl/src/ssl_certificate_db.erl
index 3eceefa304..0560a02110 100644
--- a/lib/ssl/src/ssl_certificate_db.erl
+++ b/lib/ssl/src/ssl_certificate_db.erl
@@ -26,8 +26,8 @@
-include_lib("public_key/include/public_key.hrl").
-export([create/0, remove/1, add_trusted_certs/3,
- remove_trusted_certs/2, lookup_trusted_cert/3, issuer_candidate/1,
- lookup_cached_certs/1, cache_pem_file/4, uncache_pem_file/2, lookup/2]).
+ remove_trusted_certs/2, lookup_trusted_cert/4, issuer_candidate/2,
+ lookup_cached_certs/2, cache_pem_file/4, uncache_pem_file/2, lookup/2]).
-type time() :: {non_neg_integer(), non_neg_integer(), non_neg_integer()}.
@@ -36,19 +36,19 @@
%%====================================================================
%%--------------------------------------------------------------------
--spec create() -> certdb_ref().
+-spec create() -> [db_handle()].
%%
%% Description: Creates a new certificate db.
-%% Note: lookup_trusted_cert/3 may be called from any process but only
+%% Note: lookup_trusted_cert/4 may be called from any process but only
%% the process that called create may call the other functions.
%%--------------------------------------------------------------------
create() ->
- [ets:new(certificate_db_name(), [named_table, set, protected]),
- ets:new(ssl_file_to_ref, [named_table, set, protected]),
+ [ets:new(ssl_otp_certificate_db, [set, protected]),
+ ets:new(ssl_file_to_ref, [set, protected]),
ets:new(ssl_pid_to_file, [bag, private])].
%%--------------------------------------------------------------------
--spec remove(certdb_ref()) -> term().
+-spec remove([db_handle()]) -> term().
%%
%% Description: Removes database db
%%--------------------------------------------------------------------
@@ -56,7 +56,7 @@ remove(Dbs) ->
lists:foreach(fun(Db) -> true = ets:delete(Db) end, Dbs).
%%--------------------------------------------------------------------
--spec lookup_trusted_cert(reference(), serialnumber(), issuer()) ->
+-spec lookup_trusted_cert(db_handle(), certdb_ref(), serialnumber(), issuer()) ->
undefined | {ok, {der_cert(), #'OTPCertificate'{}}}.
%%
@@ -64,19 +64,19 @@ remove(Dbs) ->
%% <SerialNumber, Issuer>. Ref is used as it is specified
%% for each connection which certificates are trusted.
%%--------------------------------------------------------------------
-lookup_trusted_cert(Ref, SerialNumber, Issuer) ->
- case lookup({Ref, SerialNumber, Issuer}, certificate_db_name()) of
+lookup_trusted_cert(DbHandle, Ref, SerialNumber, Issuer) ->
+ case lookup({Ref, SerialNumber, Issuer}, DbHandle) of
undefined ->
undefined;
[Certs] ->
{ok, Certs}
end.
-lookup_cached_certs(File) ->
- ets:lookup(certificate_db_name(), {file, File}).
+lookup_cached_certs(DbHandle, File) ->
+ ets:lookup(DbHandle, {file, File}).
%%--------------------------------------------------------------------
--spec add_trusted_certs(pid(), string() | {der, list()}, certdb_ref()) -> {ok, certdb_ref()}.
+-spec add_trusted_certs(pid(), string() | {der, list()}, [db_handle()]) -> {ok, [db_handle()]}.
%%
%% Description: Adds the trusted certificates from file <File> to the
%% runtime database. Returns Ref that should be handed to lookup_trusted_cert
@@ -100,7 +100,7 @@ add_trusted_certs(Pid, File, [CertsDb, FileToRefDb, PidToFileDb]) ->
insert(Pid, File, PidToFileDb),
{ok, Ref}.
%%--------------------------------------------------------------------
--spec cache_pem_file(pid(), string(), time(), certdb_ref()) -> term().
+-spec cache_pem_file(pid(), string(), time(), [db_handle()]) -> term().
%%
%% Description: Cache file as binary in DB
%%--------------------------------------------------------------------
@@ -112,7 +112,7 @@ cache_pem_file(Pid, File, Time, [CertsDb, _FileToRefDb, PidToFileDb]) ->
{ok, Content}.
%--------------------------------------------------------------------
--spec uncache_pem_file(string(), certdb_ref()) -> no_return().
+-spec uncache_pem_file(string(), [db_handle()]) -> no_return().
%%
%% Description: If a cached file is no longer valid (changed on disk)
%% we must terminate the connections using the old file content, and
@@ -130,7 +130,7 @@ uncache_pem_file(File, [_CertsDb, _FileToRefDb, PidToFileDb]) ->
%%--------------------------------------------------------------------
--spec remove_trusted_certs(pid(), certdb_ref()) -> term().
+-spec remove_trusted_certs(pid(), [db_handle()]) -> term().
%%
%% Description: Removes trusted certs originating from
@@ -161,7 +161,7 @@ remove_trusted_certs(Pid, [CertsDb, FileToRefDb, PidToFileDb]) ->
end.
%%--------------------------------------------------------------------
--spec issuer_candidate(no_candidate | cert_key() | {file, term()}) ->
+-spec issuer_candidate(no_candidate | cert_key() | {file, term()}, term()) ->
{cert_key(),{der_cert(), #'OTPCertificate'{}}} | no_more_candidates.
%%
%% Description: If a certificat does not define its issuer through
@@ -169,32 +169,30 @@ remove_trusted_certs(Pid, [CertsDb, FileToRefDb, PidToFileDb]) ->
%% try to find the issuer in the database over known
%% certificates.
%%--------------------------------------------------------------------
-issuer_candidate(no_candidate) ->
- Db = certificate_db_name(),
+issuer_candidate(no_candidate, Db) ->
case ets:first(Db) of
'$end_of_table' ->
no_more_candidates;
{file, _} = Key ->
- issuer_candidate(Key);
+ issuer_candidate(Key, Db);
Key ->
[Cert] = lookup(Key, Db),
{Key, Cert}
end;
-issuer_candidate(PrevCandidateKey) ->
- Db = certificate_db_name(),
+issuer_candidate(PrevCandidateKey, Db) ->
case ets:next(Db, PrevCandidateKey) of
'$end_of_table' ->
no_more_candidates;
{file, _} = Key ->
- issuer_candidate(Key);
+ issuer_candidate(Key, Db);
Key ->
[Cert] = lookup(Key, Db),
{Key, Cert}
end.
%%--------------------------------------------------------------------
--spec lookup(term(), term()) -> term() | undefined.
+-spec lookup(term(), db_handle()) -> term() | undefined.
%%
%% Description: Looks up an element in a certificat <Db>.
%%--------------------------------------------------------------------
@@ -212,9 +210,6 @@ lookup(Key, Db) ->
%%--------------------------------------------------------------------
%%% Internal functions
%%--------------------------------------------------------------------
-certificate_db_name() ->
- ssl_otp_certificate_db.
-
insert(Key, Data, Db) ->
true = ets:insert(Db, {Key, Data}).
diff --git a/lib/ssl/src/ssl_connection.erl b/lib/ssl/src/ssl_connection.erl
index 2c452837f8..cec81d551b 100644
--- a/lib/ssl/src/ssl_connection.erl
+++ b/lib/ssl/src/ssl_connection.erl
@@ -70,6 +70,7 @@
%% {{md5_hash, sha_hash}, {prev_md5, prev_sha}} (binary())
tls_handshake_hashes, % see above
tls_cipher_texts, % list() received but not deciphered yet
+ cert_db, %
session, % #session{} from ssl_handshake.hrl
session_cache, %
session_cache_cb, %
@@ -126,11 +127,11 @@ send(Pid, Data) ->
recv(Pid, Length, Timeout) ->
sync_send_all_state_event(Pid, {recv, Length}, Timeout).
%%--------------------------------------------------------------------
--spec connect(host(), port_num(), port(), {#ssl_options{}, #socket_options{}},
+-spec connect(host(), inet:port_number(), port(), {#ssl_options{}, #socket_options{}},
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
try start_fsm(client, Host, Port, Socket, Options, User, CbInfo,
@@ -140,11 +141,11 @@ connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
{error, ssl_not_started}
end.
%%--------------------------------------------------------------------
--spec ssl_accept(port_num(), port(), {#ssl_options{}, #socket_options{}},
+-spec ssl_accept(inet:port_number(), port(), {#ssl_options{}, #socket_options{}},
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(Port, Socket, Opts, User, CbInfo, Timeout) ->
@@ -184,7 +185,7 @@ socket_control(Socket, Pid, CbModule) ->
%%--------------------------------------------------------------------
-spec close(pid()) -> ok | {error, reason()}.
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(ConnectionPid) ->
case sync_send_all_state_event(ConnectionPid, close) of
@@ -211,14 +212,14 @@ shutdown(ConnectionPid, How) ->
new_user(ConnectionPid, User) ->
sync_send_all_state_event(ConnectionPid, {new_user, User}).
%%--------------------------------------------------------------------
--spec sockname(pid()) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec sockname(pid()) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:sockname/1
%%--------------------------------------------------------------------
sockname(ConnectionPid) ->
sync_send_all_state_event(ConnectionPid, sockname).
%%--------------------------------------------------------------------
--spec peername(pid()) -> {ok, {tuple(), port_num()}} | {error, reason()}.
+-spec peername(pid()) -> {ok, {inet:ip_address(), inet:port_number()}} | {error, reason()}.
%%
%% Description: Same as inet:peername/1
%%--------------------------------------------------------------------
@@ -276,7 +277,7 @@ renegotiation(ConnectionPid) ->
%%====================================================================
%%--------------------------------------------------------------------
--spec start_link(atom(), host(), port_num(), port(), list(), pid(), tuple()) ->
+-spec start_link(atom(), host(), inet:port_number(), port(), list(), pid(), tuple()) ->
{ok, pid()} | ignore | {error, reason()}.
%%
%% Description: Creates a gen_fsm process which calls Module:init/1 to
@@ -305,12 +306,13 @@ init([Role, Host, Port, Socket, {SSLOpts0, _} = Options,
Hashes0 = ssl_handshake:init_hashes(),
try ssl_init(SSLOpts0, Role) of
- {ok, Ref, CacheRef, OwnCert, Key, DHParams} ->
+ {ok, Ref, CertDbHandle, CacheHandle, OwnCert, Key, DHParams} ->
Session = State0#state.session,
State = State0#state{tls_handshake_hashes = Hashes0,
session = Session#session{own_certificate = OwnCert},
cert_db_ref = Ref,
- session_cache = CacheRef,
+ cert_db = CertDbHandle,
+ session_cache = CacheHandle,
private_key = Key,
diffie_hellman_params = DHParams},
{ok, hello, State, get_timeout(State)}
@@ -500,9 +502,10 @@ certify(#certificate{asn1_certificates = []},
certify(#certificate{} = Cert,
#state{negotiated_version = Version,
role = Role,
+ cert_db = CertDbHandle,
cert_db_ref = CertDbRef,
ssl_options = Opts} = State) ->
- case ssl_handshake:certify(Cert, CertDbRef, Opts#ssl_options.depth,
+ case ssl_handshake:certify(Cert, CertDbHandle, CertDbRef, Opts#ssl_options.depth,
Opts#ssl_options.verify,
Opts#ssl_options.verify_fun, Role) of
{PeerCert, PublicKeyInfo} ->
@@ -859,23 +862,23 @@ handle_sync_event({set_opts, Opts0}, _From, StateName,
#state{socket_options = Opts1,
socket = Socket,
user_data_buffer = Buffer} = State0) ->
- Opts = set_socket_opts(Socket, Opts0, Opts1, []),
+ {Reply, Opts} = set_socket_opts(Socket, Opts0, Opts1, []),
State1 = State0#state{socket_options = Opts},
if
Opts#socket_options.active =:= false ->
- {reply, ok, StateName, State1, get_timeout(State1)};
+ {reply, Reply, StateName, State1, get_timeout(State1)};
Buffer =:= <<>>, Opts1#socket_options.active =:= false ->
%% Need data, set active once
{Record, State2} = next_record_if_active(State1),
case next_state(StateName, Record, State2) of
{next_state, StateName, State, Timeout} ->
- {reply, ok, StateName, State, Timeout};
+ {reply, Reply, StateName, State, Timeout};
{stop, Reason, State} ->
{stop, Reason, State}
end;
Buffer =:= <<>> ->
%% Active once already set
- {reply, ok, StateName, State1, get_timeout(State1)};
+ {reply, Reply, StateName, State1, get_timeout(State1)};
true ->
case application_data(<<>>, State1) of
Stop = {stop,_,_} ->
@@ -883,7 +886,7 @@ handle_sync_event({set_opts, Opts0}, _From, StateName,
{Record, State2} ->
case next_state(StateName, Record, State2) of
{next_state, StateName, State, Timeout} ->
- {reply, ok, StateName, State, Timeout};
+ {reply, Reply, StateName, State, Timeout};
{stop, Reason, State} ->
{stop, Reason, State}
end
@@ -1044,19 +1047,19 @@ start_fsm(Role, Host, Port, Socket, Opts, User, {CbModule, _,_, _} = CbInfo,
end.
ssl_init(SslOpts, Role) ->
- {ok, CertDbRef, CacheRef, OwnCert} = init_certificates(SslOpts, Role),
+ {ok, CertDbRef, CertDbHandle, CacheHandle, OwnCert} = init_certificates(SslOpts, Role),
PrivateKey =
- init_private_key(SslOpts#ssl_options.key, SslOpts#ssl_options.keyfile,
+ init_private_key(CertDbHandle, SslOpts#ssl_options.key, SslOpts#ssl_options.keyfile,
SslOpts#ssl_options.password, Role),
- DHParams = init_diffie_hellman(SslOpts#ssl_options.dh, SslOpts#ssl_options.dhfile, Role),
- {ok, CertDbRef, CacheRef, OwnCert, PrivateKey, DHParams}.
+ DHParams = init_diffie_hellman(CertDbHandle, SslOpts#ssl_options.dh, SslOpts#ssl_options.dhfile, Role),
+ {ok, CertDbRef, CertDbHandle, CacheHandle, OwnCert, PrivateKey, DHParams}.
init_certificates(#ssl_options{cacerts = CaCerts,
cacertfile = CACertFile,
certfile = CertFile,
cert = Cert}, Role) ->
- {ok, CertDbRef, CacheRef} =
+ {ok, CertDbRef, CertDbHandle, CacheHandle} =
try
Certs = case CaCerts of
undefined ->
@@ -1064,44 +1067,44 @@ init_certificates(#ssl_options{cacerts = CaCerts,
_ ->
{der, CaCerts}
end,
- {ok, _, _} = ssl_manager:connection_init(Certs, Role)
+ {ok, _, _, _} = ssl_manager:connection_init(Certs, Role)
catch
Error:Reason ->
handle_file_error(?LINE, Error, Reason, CACertFile, ecacertfile,
erlang:get_stacktrace())
end,
- init_certificates(Cert, CertDbRef, CacheRef, CertFile, Role).
+ init_certificates(Cert, CertDbRef, CertDbHandle, CacheHandle, CertFile, Role).
-init_certificates(undefined, CertDbRef, CacheRef, "", _) ->
- {ok, CertDbRef, CacheRef, undefined};
+init_certificates(undefined, CertDbRef, CertDbHandle, CacheHandle, "", _) ->
+ {ok, CertDbRef, CertDbHandle, CacheHandle, undefined};
-init_certificates(undefined, CertDbRef, CacheRef, CertFile, client) ->
+init_certificates(undefined, CertDbRef, CertDbHandle, CacheHandle, CertFile, client) ->
try
- [OwnCert] = ssl_certificate:file_to_certificats(CertFile),
- {ok, CertDbRef, CacheRef, OwnCert}
+ [OwnCert] = ssl_certificate:file_to_certificats(CertFile, CertDbHandle),
+ {ok, CertDbRef, CertDbHandle, CacheHandle, OwnCert}
catch _Error:_Reason ->
- {ok, CertDbRef, CacheRef, undefined}
+ {ok, CertDbRef, CertDbHandle, CacheHandle, undefined}
end;
-init_certificates(undefined, CertDbRef, CacheRef, CertFile, server) ->
+init_certificates(undefined, CertDbRef, CertDbHandle, CacheRef, CertFile, server) ->
try
- [OwnCert] = ssl_certificate:file_to_certificats(CertFile),
- {ok, CertDbRef, CacheRef, OwnCert}
+ [OwnCert] = ssl_certificate:file_to_certificats(CertFile, CertDbHandle),
+ {ok, CertDbRef, CertDbHandle, CacheRef, OwnCert}
catch
Error:Reason ->
handle_file_error(?LINE, Error, Reason, CertFile, ecertfile,
erlang:get_stacktrace())
end;
-init_certificates(Cert, CertDbRef, CacheRef, _, _) ->
- {ok, CertDbRef, CacheRef, Cert}.
+init_certificates(Cert, CertDbRef, CertDbHandle, CacheRef, _, _) ->
+ {ok, CertDbRef, CertDbHandle, CacheRef, Cert}.
-init_private_key(undefined, "", _Password, _Client) ->
+init_private_key(_, undefined, "", _Password, _Client) ->
undefined;
-init_private_key(undefined, KeyFile, Password, _) ->
+init_private_key(DbHandle, undefined, KeyFile, Password, _) ->
try
- {ok, List} = ssl_manager:cache_pem_file(KeyFile),
+ {ok, List} = ssl_manager:cache_pem_file(KeyFile, DbHandle),
[PemEntry] = [PemEntry || PemEntry = {PKey, _ , _} <- List,
- PKey =:= 'RSAPrivateKey' orelse
+ PKey =:= 'RSAPrivateKey' orelse
PKey =:= 'DSAPrivateKey'],
public_key:pem_entry_decode(PemEntry, Password)
catch
@@ -1110,9 +1113,9 @@ init_private_key(undefined, KeyFile, Password, _) ->
erlang:get_stacktrace())
end;
-init_private_key({rsa, PrivateKey}, _, _,_) ->
+init_private_key(_,{rsa, PrivateKey}, _, _,_) ->
public_key:der_decode('RSAPrivateKey', PrivateKey);
-init_private_key({dsa, PrivateKey},_,_,_) ->
+init_private_key(_,{dsa, PrivateKey},_,_,_) ->
public_key:der_decode('DSAPrivateKey', PrivateKey).
-spec(handle_file_error(_,_,_,_,_,_) -> no_return()).
@@ -1128,15 +1131,15 @@ file_error(Line, Error, Reason, File, Throw, Stack) ->
error_logger:error_report(Report),
throw(Throw).
-init_diffie_hellman(Params, _,_) when is_binary(Params)->
+init_diffie_hellman(_,Params, _,_) when is_binary(Params)->
public_key:der_decode('DHParameter', Params);
-init_diffie_hellman(_,_, client) ->
+init_diffie_hellman(_,_,_, client) ->
undefined;
-init_diffie_hellman(_,undefined, _) ->
+init_diffie_hellman(_,_,undefined, _) ->
?DEFAULT_DIFFIE_HELLMAN_PARAMS;
-init_diffie_hellman(_, DHParamFile, server) ->
+init_diffie_hellman(DbHandle,_, DHParamFile, server) ->
try
- {ok, List} = ssl_manager:cache_pem_file(DHParamFile),
+ {ok, List} = ssl_manager:cache_pem_file(DHParamFile,DbHandle),
case [Entry || Entry = {'DHParameter', _ , _} <- List] of
[Entry] ->
public_key:pem_entry_decode(Entry);
@@ -1180,11 +1183,12 @@ certify_client(#state{client_certificate_requested = true, role = client,
connection_states = ConnectionStates0,
transport_cb = Transport,
negotiated_version = Version,
+ cert_db = CertDbHandle,
cert_db_ref = CertDbRef,
session = #session{own_certificate = OwnCert},
socket = Socket,
tls_handshake_hashes = Hashes0} = State) ->
- Certificate = ssl_handshake:certificate(OwnCert, CertDbRef, client),
+ Certificate = ssl_handshake:certificate(OwnCert, CertDbHandle, CertDbRef, client),
{BinCert, ConnectionStates1, Hashes1} =
encode_handshake(Certificate, Version, ConnectionStates0, Hashes0),
Transport:send(Socket, BinCert),
@@ -1365,9 +1369,10 @@ certify_server(#state{transport_cb = Transport,
negotiated_version = Version,
connection_states = ConnectionStates,
tls_handshake_hashes = Hashes,
+ cert_db = CertDbHandle,
cert_db_ref = CertDbRef,
session = #session{own_certificate = OwnCert}} = State) ->
- case ssl_handshake:certificate(OwnCert, CertDbRef, server) of
+ case ssl_handshake:certificate(OwnCert, CertDbHandle, CertDbRef, server) of
CertMsg = #certificate{} ->
{BinCertMsg, NewConnectionStates, NewHashes} =
encode_handshake(CertMsg, Version, ConnectionStates, Hashes),
@@ -1454,12 +1459,13 @@ rsa_key_exchange(_, _) ->
request_client_cert(#state{ssl_options = #ssl_options{verify = verify_peer},
connection_states = ConnectionStates0,
+ cert_db = CertDbHandle,
cert_db_ref = CertDbRef,
tls_handshake_hashes = Hashes0,
negotiated_version = Version,
socket = Socket,
transport_cb = Transport} = State) ->
- Msg = ssl_handshake:certificate_request(ConnectionStates0, CertDbRef),
+ Msg = ssl_handshake:certificate_request(ConnectionStates0, CertDbHandle, CertDbRef),
{BinMsg, ConnectionStates1, Hashes1} =
encode_handshake(Msg, Version, ConnectionStates0, Hashes0),
Transport:send(Socket, BinMsg),
@@ -1772,7 +1778,8 @@ format_reply(binary, _, N, Data) when N > 0 -> % Header mode
format_reply(binary, _, _, Data) ->
Data;
format_reply(list, Packet, _, Data)
- when Packet == http; Packet == {http, headers}; Packet == http_bin; Packet == {http_bin, headers} ->
+ when Packet == http; Packet == {http, headers}; Packet == http_bin; Packet == {http_bin, headers}; Packet == httph;
+ Packet == httph_bin->
Data;
format_reply(list, _,_, Data) ->
binary_to_list(Data).
@@ -2040,31 +2047,69 @@ get_socket_opts(Socket, [active | Tags], SockOpts, Acc) ->
get_socket_opts(Socket, Tags, SockOpts,
[{active, SockOpts#socket_options.active} | Acc]);
get_socket_opts(Socket, [Tag | Tags], SockOpts, Acc) ->
- case inet:getopts(Socket, [Tag]) of
+ try inet:getopts(Socket, [Tag]) of
{ok, [Opt]} ->
get_socket_opts(Socket, Tags, SockOpts, [Opt | Acc]);
{error, Error} ->
- {error, Error}
- end.
+ {error, {eoptions, {inet_option, Tag, Error}}}
+ catch
+ %% So that inet behavior does not crash our process
+ _:Error -> {error, {eoptions, {inet_option, Tag, Error}}}
+ end;
+get_socket_opts(_,Opts, _,_) ->
+ {error, {eoptions, {inet_option, Opts, function_clause}}}.
set_socket_opts(_, [], SockOpts, []) ->
- SockOpts;
+ {ok, SockOpts};
set_socket_opts(Socket, [], SockOpts, Other) ->
%% Set non emulated options
- inet:setopts(Socket, Other),
- SockOpts;
-set_socket_opts(Socket, [{mode, Mode}| Opts], SockOpts, Other) ->
+ try inet:setopts(Socket, Other) of
+ ok ->
+ {ok, SockOpts};
+ {error, InetError} ->
+ {{error, {eoptions, {inet_options, Other, InetError}}}, SockOpts}
+ catch
+ _:Error ->
+ %% So that inet behavior does not crash our process
+ {{error, {eoptions, {inet_options, Other, Error}}}, SockOpts}
+ end;
+
+set_socket_opts(Socket, [{mode, Mode}| Opts], SockOpts, Other) when Mode == list; Mode == binary ->
set_socket_opts(Socket, Opts,
SockOpts#socket_options{mode = Mode}, Other);
-set_socket_opts(Socket, [{packet, Packet}| Opts], SockOpts, Other) ->
+set_socket_opts(_, [{mode, _} = Opt| _], SockOpts, _) ->
+ {{error, {eoptions, {inet_opt, Opt}}}, SockOpts};
+set_socket_opts(Socket, [{packet, Packet}| Opts], SockOpts, Other) when Packet == raw;
+ Packet == 0;
+ Packet == 1;
+ Packet == 2;
+ Packet == 4;
+ Packet == asn1;
+ Packet == cdr;
+ Packet == sunrm;
+ Packet == fcgi;
+ Packet == tpkt;
+ Packet == line;
+ Packet == http;
+ Packet == httph;
+ Packet == http_bin;
+ Packet == httph_bin ->
set_socket_opts(Socket, Opts,
SockOpts#socket_options{packet = Packet}, Other);
-set_socket_opts(Socket, [{header, Header}| Opts], SockOpts, Other) ->
+set_socket_opts(_, [{packet, _} = Opt| _], SockOpts, _) ->
+ {{error, {eoptions, {inet_opt, Opt}}}, SockOpts};
+set_socket_opts(Socket, [{header, Header}| Opts], SockOpts, Other) when is_integer(Header) ->
set_socket_opts(Socket, Opts,
SockOpts#socket_options{header = Header}, Other);
-set_socket_opts(Socket, [{active, Active}| Opts], SockOpts, Other) ->
+set_socket_opts(_, [{header, _} = Opt| _], SockOpts, _) ->
+ {{error,{eoptions, {inet_opt, Opt}}}, SockOpts};
+set_socket_opts(Socket, [{active, Active}| Opts], SockOpts, Other) when Active == once;
+ Active == true;
+ Active == false ->
set_socket_opts(Socket, Opts,
SockOpts#socket_options{active = Active}, Other);
+set_socket_opts(_, [{active, _} = Opt| _], SockOpts, _) ->
+ {{error, {eoptions, {inet_opt, Opt}} }, SockOpts};
set_socket_opts(Socket, [Opt | Opts], SockOpts, Other) ->
set_socket_opts(Socket, Opts, SockOpts, [Opt | Other]).
diff --git a/lib/ssl/src/ssl_handshake.erl b/lib/ssl/src/ssl_handshake.erl
index 1f4c44d115..453ea20f99 100644
--- a/lib/ssl/src/ssl_handshake.erl
+++ b/lib/ssl/src/ssl_handshake.erl
@@ -31,9 +31,9 @@
-include_lib("public_key/include/public_key.hrl").
-export([master_secret/4, client_hello/6, server_hello/4, hello/4,
- hello_request/0, certify/6, certificate/3,
+ hello_request/0, certify/7, certificate/4,
client_certificate_verify/5, certificate_verify/5,
- certificate_request/2, key_exchange/2, server_key_exchange_hash/2,
+ certificate_request/3, key_exchange/2, server_key_exchange_hash/2,
finished/4, verify_connection/5, get_tls_handshake/2,
decode_client_key/3, server_hello_done/0,
encode_handshake/2, init_hashes/0, update_hashes/2,
@@ -48,7 +48,7 @@
%% Internal application API
%%====================================================================
%%--------------------------------------------------------------------
--spec client_hello(host(), port_num(), #connection_states{},
+-spec client_hello(host(), inet:port_number(), #connection_states{},
#ssl_options{}, boolean(), der_cert()) -> #client_hello{}.
%%
%% Description: Creates a client hello message.
@@ -106,7 +106,7 @@ hello_request() ->
%%--------------------------------------------------------------------
-spec hello(#server_hello{} | #client_hello{}, #ssl_options{},
- #connection_states{} | {port_num(), #session{}, cache_ref(),
+ #connection_states{} | {inet:port_number(), #session{}, db_handle(),
atom(), #connection_states{}, binary()},
boolean()) -> {tls_version(), session_id(), #connection_states{}}|
{tls_version(), {resumed | new, #session{}},
@@ -173,13 +173,13 @@ hello(#client_hello{client_version = ClientVersion, random = Random,
end.
%%--------------------------------------------------------------------
--spec certify(#certificate{}, term(), integer() | nolimit,
+-spec certify(#certificate{}, db_handle(), certdb_ref(), integer() | nolimit,
verify_peer | verify_none, {fun(), term},
client | server) -> {der_cert(), public_key_info()} | #alert{}.
%%
%% Description: Handles a certificate handshake message
%%--------------------------------------------------------------------
-certify(#certificate{asn1_certificates = ASN1Certs}, CertDbRef,
+certify(#certificate{asn1_certificates = ASN1Certs}, CertDbHandle, CertDbRef,
MaxPathLen, _Verify, VerifyFunAndState, Role) ->
[PeerCert | _] = ASN1Certs,
@@ -208,7 +208,7 @@ certify(#certificate{asn1_certificates = ASN1Certs}, CertDbRef,
end,
{TrustedErlCert, CertPath} =
- ssl_certificate:trusted_cert_and_path(ASN1Certs, CertDbRef),
+ ssl_certificate:trusted_cert_and_path(ASN1Certs, CertDbHandle, CertDbRef),
case public_key:pkix_path_validation(TrustedErlCert,
CertPath,
@@ -222,13 +222,13 @@ certify(#certificate{asn1_certificates = ASN1Certs}, CertDbRef,
end.
%%--------------------------------------------------------------------
--spec certificate(der_cert(), term(), client | server) -> #certificate{} | #alert{}.
+-spec certificate(der_cert(), db_handle(), certdb_ref(), client | server) -> #certificate{} | #alert{}.
%%
%% Description: Creates a certificate message.
%%--------------------------------------------------------------------
-certificate(OwnCert, CertDbRef, client) ->
+certificate(OwnCert, CertDbHandle, CertDbRef, client) ->
Chain =
- case ssl_certificate:certificate_chain(OwnCert, CertDbRef) of
+ case ssl_certificate:certificate_chain(OwnCert, CertDbHandle, CertDbRef) of
{ok, CertChain} ->
CertChain;
{error, _} ->
@@ -239,8 +239,8 @@ certificate(OwnCert, CertDbRef, client) ->
end,
#certificate{asn1_certificates = Chain};
-certificate(OwnCert, CertDbRef, server) ->
- case ssl_certificate:certificate_chain(OwnCert, CertDbRef) of
+certificate(OwnCert, CertDbHandle, CertDbRef, server) ->
+ case ssl_certificate:certificate_chain(OwnCert, CertDbHandle, CertDbRef) of
{ok, Chain} ->
#certificate{asn1_certificates = Chain};
{error, _} ->
@@ -302,17 +302,17 @@ certificate_verify(Signature, {?'id-dsa' = Algorithm, PublicKey, PublicKeyParams
%%--------------------------------------------------------------------
--spec certificate_request(#connection_states{}, certdb_ref()) ->
+-spec certificate_request(#connection_states{}, db_handle(), certdb_ref()) ->
#certificate_request{}.
%%
%% Description: Creates a certificate_request message, called by the server.
%%--------------------------------------------------------------------
-certificate_request(ConnectionStates, CertDbRef) ->
+certificate_request(ConnectionStates, CertDbHandle, CertDbRef) ->
#connection_state{security_parameters =
#security_parameters{cipher_suite = CipherSuite}} =
ssl_record:pending_connection_state(ConnectionStates, read),
Types = certificate_types(CipherSuite),
- Authorities = certificate_authorities(CertDbRef),
+ Authorities = certificate_authorities(CertDbHandle, CertDbRef),
#certificate_request{
certificate_types = Types,
certificate_authorities = Authorities
@@ -383,8 +383,9 @@ master_secret(Version, #session{master_secret = Mastersecret},
ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Key calculation failed due to ~p",
- [Reason]),
+ Report = io_lib:format("Key calculation failed due to ~p",
+ [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end;
@@ -400,8 +401,9 @@ master_secret(Version, PremasterSecret, ConnectionStates, Role) ->
SecParams, ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Master secret calculation failed"
- " due to ~p", [Reason]),
+ Report = io_lib:format("Master secret calculation failed"
+ " due to ~p", [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end.
@@ -1071,8 +1073,8 @@ certificate_types({KeyExchange, _, _, _})
certificate_types(_) ->
<<?BYTE(?RSA_SIGN)>>.
-certificate_authorities(CertDbRef) ->
- Authorities = certificate_authorities_from_db(CertDbRef),
+certificate_authorities(CertDbHandle, CertDbRef) ->
+ Authorities = certificate_authorities_from_db(CertDbHandle, CertDbRef),
Enc = fun(#'OTPCertificate'{tbsCertificate=TBSCert}) ->
OTPSubj = TBSCert#'OTPTBSCertificate'.subject,
DNEncodedBin = public_key:pkix_encode('Name', OTPSubj, otp),
@@ -1084,18 +1086,18 @@ certificate_authorities(CertDbRef) ->
end,
list_to_binary([Enc(Cert) || {_, Cert} <- Authorities]).
-certificate_authorities_from_db(CertDbRef) ->
- certificate_authorities_from_db(CertDbRef, no_candidate, []).
+certificate_authorities_from_db(CertDbHandle, CertDbRef) ->
+ certificate_authorities_from_db(CertDbHandle, CertDbRef, no_candidate, []).
-certificate_authorities_from_db(CertDbRef, PrevKey, Acc) ->
- case ssl_manager:issuer_candidate(PrevKey) of
+certificate_authorities_from_db(CertDbHandle,CertDbRef, PrevKey, Acc) ->
+ case ssl_manager:issuer_candidate(PrevKey, CertDbHandle) of
no_more_candidates ->
lists:reverse(Acc);
{{CertDbRef, _, _} = Key, Cert} ->
- certificate_authorities_from_db(CertDbRef, Key, [Cert|Acc]);
+ certificate_authorities_from_db(CertDbHandle, CertDbRef, Key, [Cert|Acc]);
{Key, _Cert} ->
%% skip certs not from this ssl connection
- certificate_authorities_from_db(CertDbRef, Key, Acc)
+ certificate_authorities_from_db(CertDbHandle, CertDbRef, Key, Acc)
end.
digitally_signed(Hash, #'RSAPrivateKey'{} = Key) ->
diff --git a/lib/ssl/src/ssl_internal.hrl b/lib/ssl/src/ssl_internal.hrl
index c28daa271e..6bf1edc452 100644
--- a/lib/ssl/src/ssl_internal.hrl
+++ b/lib/ssl/src/ssl_internal.hrl
@@ -28,13 +28,12 @@
-type reply() :: term().
-type msg() :: term().
-type from() :: term().
--type host() :: string() | tuple().
--type port_num() :: integer().
+-type host() :: inet:ip_address() | inet:hostname().
-type session_id() :: 0 | binary().
-type tls_version() :: {integer(), integer()}.
-type tls_atom_version() :: sslv3 | tlsv1.
--type cache_ref() :: term().
--type certdb_ref() :: term().
+-type certdb_ref() :: reference().
+-type db_handle() :: term().
-type key_algo() :: null | rsa | dhe_rsa | dhe_dss | dh_anon.
-type der_cert() :: binary().
-type private_key() :: #'RSAPrivateKey'{} | #'DSAPrivateKey'{}.
diff --git a/lib/ssl/src/ssl_manager.erl b/lib/ssl/src/ssl_manager.erl
index 1bbb03bdde..725a085d1f 100644
--- a/lib/ssl/src/ssl_manager.erl
+++ b/lib/ssl/src/ssl_manager.erl
@@ -28,8 +28,8 @@
%% Internal application API
-export([start_link/1,
- connection_init/2, cache_pem_file/1,
- lookup_trusted_cert/3, issuer_candidate/1, client_session_id/4,
+ connection_init/2, cache_pem_file/2,
+ lookup_trusted_cert/4, issuer_candidate/2, client_session_id/4,
server_session_id/4,
register_session/2, register_session/3, invalidate_session/2,
invalidate_session/3]).
@@ -50,7 +50,8 @@
session_cache_cb,
session_lifetime,
certificate_db,
- session_validation_timer
+ session_validation_timer,
+ last_delay_timer %% Keep for testing purposes
}).
-define('24H_in_msec', 8640000).
@@ -72,47 +73,47 @@ start_link(Opts) ->
%%--------------------------------------------------------------------
-spec connection_init(string()| {der, list()}, client | server) ->
- {ok, reference(), cache_ref()}.
+ {ok, certdb_ref(), db_handle(), db_handle()}.
%%
%% Description: Do necessary initializations for a new connection.
%%--------------------------------------------------------------------
connection_init(Trustedcerts, Role) ->
call({connection_init, Trustedcerts, Role}).
%%--------------------------------------------------------------------
--spec cache_pem_file(string()) -> {ok, term()} | {error, reason()}.
+-spec cache_pem_file(string(), term()) -> {ok, term()} | {error, reason()}.
%%
%% Description: Cach a pem file and return its content.
%%--------------------------------------------------------------------
-cache_pem_file(File) ->
+cache_pem_file(File, DbHandle) ->
try file:read_file_info(File) of
{ok, #file_info{mtime = LastWrite}} ->
- cache_pem_file(File, LastWrite)
+ cache_pem_file(File, LastWrite, DbHandle)
catch
_:Reason ->
{error, Reason}
end.
%%--------------------------------------------------------------------
--spec lookup_trusted_cert(reference(), serialnumber(), issuer()) ->
+-spec lookup_trusted_cert(term(), reference(), serialnumber(), issuer()) ->
undefined |
{ok, {der_cert(), #'OTPCertificate'{}}}.
%%
%% Description: Lookup the trusted cert with Key = {reference(),
%% serialnumber(), issuer()}.
%% --------------------------------------------------------------------
-lookup_trusted_cert(Ref, SerialNumber, Issuer) ->
- ssl_certificate_db:lookup_trusted_cert(Ref, SerialNumber, Issuer).
+lookup_trusted_cert(DbHandle, Ref, SerialNumber, Issuer) ->
+ ssl_certificate_db:lookup_trusted_cert(DbHandle, Ref, SerialNumber, Issuer).
%%--------------------------------------------------------------------
--spec issuer_candidate(cert_key() | no_candidate) ->
+-spec issuer_candidate(cert_key() | no_candidate, term()) ->
{cert_key(),
{der_cert(),
#'OTPCertificate'{}}} | no_more_candidates.
%%
%% Description: Return next issuer candidate.
%%--------------------------------------------------------------------
-issuer_candidate(PrevCandidateKey) ->
- ssl_certificate_db:issuer_candidate(PrevCandidateKey).
+issuer_candidate(PrevCandidateKey, DbHandle) ->
+ ssl_certificate_db:issuer_candidate(PrevCandidateKey, DbHandle).
%%--------------------------------------------------------------------
--spec client_session_id(host(), port_num(), #ssl_options{},
+-spec client_session_id(host(), inet:port_number(), #ssl_options{},
der_cert() | undefined) -> session_id().
%%
%% Description: Select a session id for the client.
@@ -121,7 +122,7 @@ client_session_id(Host, Port, SslOpts, OwnCert) ->
call({client_session_id, Host, Port, SslOpts, OwnCert}).
%%--------------------------------------------------------------------
--spec server_session_id(host(), port_num(), #ssl_options{},
+-spec server_session_id(host(), inet:port_number(), #ssl_options{},
der_cert()) -> session_id().
%%
%% Description: Select a session id for the server.
@@ -130,8 +131,8 @@ server_session_id(Port, SuggestedSessionId, SslOpts, OwnCert) ->
call({server_session_id, Port, SuggestedSessionId, SslOpts, OwnCert}).
%%--------------------------------------------------------------------
--spec register_session(port_num(), #session{}) -> ok.
--spec register_session(host(), port_num(), #session{}) -> ok.
+-spec register_session(inet:port_number(), #session{}) -> ok.
+-spec register_session(host(), inet:port_number(), #session{}) -> ok.
%%
%% Description: Make the session available for reuse.
%%--------------------------------------------------------------------
@@ -141,8 +142,8 @@ register_session(Host, Port, Session) ->
register_session(Port, Session) ->
cast({register_session, Port, Session}).
%%--------------------------------------------------------------------
--spec invalidate_session(port_num(), #session{}) -> ok.
--spec invalidate_session(host(), port_num(), #session{}) -> ok.
+-spec invalidate_session(inet:port_number(), #session{}) -> ok.
+-spec invalidate_session(host(), inet:port_number(), #session{}) -> ok.
%%
%% Description: Make the session unavailable for reuse. After
%% a the session has been marked "is_resumable = false" for some while
@@ -192,19 +193,20 @@ init([Opts]) ->
%% Description: Handling call messages
%%--------------------------------------------------------------------
handle_call({{connection_init, "", _Role}, Pid}, _From,
- #state{session_cache = Cache} = State) ->
+ #state{certificate_db = [CertDb |_],
+ session_cache = Cache} = State) ->
erlang:monitor(process, Pid),
- Result = {ok, make_ref(), Cache},
+ Result = {ok, make_ref(),CertDb, Cache},
{reply, Result, State};
handle_call({{connection_init, Trustedcerts, _Role}, Pid}, _From,
- #state{certificate_db = Db,
+ #state{certificate_db = [CertDb|_] =Db,
session_cache = Cache} = State) ->
erlang:monitor(process, Pid),
Result =
try
{ok, Ref} = ssl_certificate_db:add_trusted_certs(Pid, Trustedcerts, Db),
- {ok, Ref, Cache}
+ {ok, Ref, CertDb, Cache}
catch
_:Reason ->
{error, Reason}
@@ -265,20 +267,25 @@ handle_cast({register_session, Port, Session},
CacheCb:update(Cache, {Port, NewSession#session.session_id}, NewSession),
{noreply, State};
-handle_cast({invalidate_session, Host, Port,
+%%% When a session is invalidated we need to wait a while before deleting
+%%% it as there might be pending connections that rightfully needs to look
+%%% up the session data but new connections should not get to use this session.
+handle_cast({invalidate_session, Host, Port,
#session{session_id = ID} = Session},
#state{session_cache = Cache,
session_cache_cb = CacheCb} = State) ->
CacheCb:update(Cache, {{Host, Port}, ID}, Session#session{is_resumable = false}),
- timer:apply_after(?CLEAN_SESSION_DB, CacheCb, delete, [{{Host, Port}, ID}]),
- {noreply, State};
+ TRef =
+ erlang:send_after(delay_time(), self(), {delayed_clean_session, {{Host, Port}, ID}}),
+ {noreply, State#state{last_delay_timer = TRef}};
handle_cast({invalidate_session, Port, #session{session_id = ID} = Session},
#state{session_cache = Cache,
session_cache_cb = CacheCb} = State) ->
CacheCb:update(Cache, {Port, ID}, Session#session{is_resumable = false}),
- timer:apply_after(?CLEAN_SESSION_DB, CacheCb, delete, [{Port, ID}]),
- {noreply, State};
+ TRef =
+ erlang:send_after(delay_time(), self(), {delayed_clean_session, {Port, ID}}),
+ {noreply, State#state{last_delay_timer = TRef}};
handle_cast({recache_pem, File, LastWrite, Pid, From},
#state{certificate_db = [_, FileToRefDb, _]} = State0) ->
@@ -312,6 +319,12 @@ handle_info(validate_sessions, #state{session_cache_cb = CacheCb,
start_session_validator(Cache, CacheCb, LifeTime),
{noreply, State#state{session_validation_timer = Timer}};
+handle_info({delayed_clean_session, Key}, #state{session_cache = Cache,
+ session_cache_cb = CacheCb
+ } = State) ->
+ CacheCb:delete(Cache, Key),
+ {noreply, State};
+
handle_info({'EXIT', _, _}, State) ->
%% Session validator died!! Do we need to take any action?
%% maybe error log
@@ -399,8 +412,8 @@ session_validation({{Port, _}, Session}, LifeTime) ->
validate_session(Port, Session, LifeTime),
LifeTime.
-cache_pem_file(File, LastWrite) ->
- case ssl_certificate_db:lookup_cached_certs(File) of
+cache_pem_file(File, LastWrite, DbHandle) ->
+ case ssl_certificate_db:lookup_cached_certs(DbHandle,File) of
[{_, {Mtime, Content}}] ->
case LastWrite of
Mtime ->
@@ -411,3 +424,11 @@ cache_pem_file(File, LastWrite) ->
[] ->
call({cache_pem, File, LastWrite})
end.
+
+delay_time() ->
+ case application:get_env(ssl, session_delay_cleanup_time) of
+ {ok, Time} when is_integer(Time) ->
+ Time;
+ _ ->
+ ?CLEAN_SESSION_DB
+ end.
diff --git a/lib/ssl/src/ssl_record.erl b/lib/ssl/src/ssl_record.erl
index f1c0073965..72091fdd5f 100644
--- a/lib/ssl/src/ssl_record.erl
+++ b/lib/ssl/src/ssl_record.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2007-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2007-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -62,6 +62,8 @@
-compile(inline).
+-define(INITIAL_BYTES, 5).
+
%%====================================================================
%% Internal application API
%%====================================================================
@@ -340,7 +342,7 @@ get_tls_records_aux(<<?BYTE(?CHANGE_CIPHER_SPEC),?BYTE(MajVer),?BYTE(MinVer),
get_tls_records_aux(Rest, [#ssl_tls{type = ?CHANGE_CIPHER_SPEC,
version = {MajVer, MinVer},
fragment = Data} | Acc]);
-%% Matches a ssl v2 client hello message.
+%% Matches an ssl v2 client hello message.
%% The server must be able to receive such messages, from clients that
%% are willing to use ssl v3 or higher, but have ssl v2 compatibility.
get_tls_records_aux(<<1:1, Length0:15, Data0:Length0/binary, Rest/binary>>,
@@ -360,16 +362,20 @@ get_tls_records_aux(<<1:1, Length0:15, Data0:Length0/binary, Rest/binary>>,
get_tls_records_aux(<<0:1, _CT:7, ?BYTE(_MajVer), ?BYTE(_MinVer),
?UINT16(Length), _/binary>>,
- _Acc) when Length > ?MAX_CIPHER_TEXT_LENGTH->
+ _Acc) when Length > ?MAX_CIPHER_TEXT_LENGTH ->
?ALERT_REC(?FATAL, ?RECORD_OVERFLOW);
get_tls_records_aux(<<1:1, Length0:15, _/binary>>,_Acc)
- when Length0 > ?MAX_CIPHER_TEXT_LENGTH->
+ when Length0 > ?MAX_CIPHER_TEXT_LENGTH ->
?ALERT_REC(?FATAL, ?RECORD_OVERFLOW);
get_tls_records_aux(Data, Acc) ->
- {lists:reverse(Acc), Data}.
-
+ case size(Data) =< ?MAX_CIPHER_TEXT_LENGTH + ?INITIAL_BYTES of
+ true ->
+ {lists:reverse(Acc), Data};
+ false ->
+ ?ALERT_REC(?FATAL, ?UNEXPECTED_MESSAGE)
+ end.
%%--------------------------------------------------------------------
-spec protocol_version(tls_atom_version() | tls_version()) ->
tls_version() | tls_atom_version().
diff --git a/lib/ssl/src/ssl_session.erl b/lib/ssl/src/ssl_session.erl
index dc4b7a711c..bf738649f6 100644
--- a/lib/ssl/src/ssl_session.erl
+++ b/lib/ssl/src/ssl_session.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2007-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2007-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -48,7 +48,7 @@ is_new(_ClientSuggestion, _ServerDecision) ->
true.
%%--------------------------------------------------------------------
--spec id({host(), port_num(), #ssl_options{}}, cache_ref(), atom(),
+-spec id({host(), inet:port_number(), #ssl_options{}}, db_handle(), atom(),
undefined | binary()) -> binary().
%%
%% Description: Should be called by the client side to get an id
@@ -63,7 +63,7 @@ id(ClientInfo, Cache, CacheCb, OwnCert) ->
end.
%%--------------------------------------------------------------------
--spec id(port_num(), binary(), #ssl_options{}, cache_ref(),
+-spec id(inet:port_number(), binary(), #ssl_options{}, db_handle(),
atom(), seconds(), binary()) -> binary().
%%
%% Description: Should be called by the server side to get an id
diff --git a/lib/ssl/src/ssl_session_cache.erl b/lib/ssl/src/ssl_session_cache.erl
index 823bf7acfa..93969f628f 100644
--- a/lib/ssl/src/ssl_session_cache.erl
+++ b/lib/ssl/src/ssl_session_cache.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -28,10 +28,10 @@
-export([init/1, terminate/1, lookup/2, update/3, delete/2, foldl/3,
select_session/2]).
--type key() :: {{host(), port_num()}, session_id()} | {port_num(), session_id()}.
+-type key() :: {{host(), inet:port_number()}, session_id()} | {inet:port_number(), session_id()}.
%%--------------------------------------------------------------------
--spec init(list()) -> cache_ref(). %% Returns reference to the cache (opaque)
+-spec init(list()) -> db_handle(). %% Returns reference to the cache (opaque)
%%
%% Description: Return table reference. Called by ssl_manager process.
%%--------------------------------------------------------------------
@@ -39,7 +39,7 @@ init(_) ->
ets:new(cache_name(), [set, protected]).
%%--------------------------------------------------------------------
--spec terminate(cache_ref()) -> any(). %%
+-spec terminate(db_handle()) -> any().
%%
%% Description: Handles cache table at termination of ssl manager.
%%--------------------------------------------------------------------
@@ -47,7 +47,7 @@ terminate(Cache) ->
ets:delete(Cache).
%%--------------------------------------------------------------------
--spec lookup(cache_ref(), key()) -> #session{} | undefined.
+-spec lookup(db_handle(), key()) -> #session{} | undefined.
%%
%% Description: Looks up a cach entry. Should be callable from any
%% process.
@@ -61,7 +61,7 @@ lookup(Cache, Key) ->
end.
%%--------------------------------------------------------------------
--spec update(cache_ref(), key(), #session{}) -> any().
+-spec update(db_handle(), key(), #session{}) -> any().
%%
%% Description: Caches a new session or updates a already cached one.
%% Will only be called from the ssl_manager process.
@@ -70,7 +70,7 @@ update(Cache, Key, Session) ->
ets:insert(Cache, {Key, Session}).
%%--------------------------------------------------------------------
--spec delete(cache_ref(), key()) -> any().
+-spec delete(db_handle(), key()) -> any().
%%
%% Description: Delets a cache entry.
%% Will only be called from the ssl_manager process.
@@ -79,7 +79,7 @@ delete(Cache, Key) ->
ets:delete(Cache, Key).
%%--------------------------------------------------------------------
--spec foldl(fun(), term(), cache_ref()) -> term().
+-spec foldl(fun(), term(), db_handle()) -> term().
%%
%% Description: Calls Fun(Elem, AccIn) on successive elements of the
%% cache, starting with AccIn == Acc0. Fun/2 must return a new
@@ -91,7 +91,7 @@ foldl(Fun, Acc0, Cache) ->
ets:foldl(Fun, Acc0, Cache).
%%--------------------------------------------------------------------
--spec select_session(cache_ref(), {host(), port_num()} | port_num()) -> [#session{}].
+-spec select_session(db_handle(), {host(), inet:port_number()} | inet:port_number()) -> [#session{}].
%%
%% Description: Selects a session that could be reused. Should be callable
%% from any process.
diff --git a/lib/ssl/src/ssl_ssl2.erl b/lib/ssl/src/ssl_ssl2.erl
index b1005b1acb..30a3a5fc98 100644
--- a/lib/ssl/src/ssl_ssl2.erl
+++ b/lib/ssl/src/ssl_ssl2.erl
@@ -20,7 +20,7 @@
%%
%%----------------------------------------------------------------------
%% Purpose: Handles sslv2 hello as clients supporting sslv2 and higher
-%% will send a sslv2 hello.
+%% will send an sslv2 hello.
%%----------------------------------------------------------------------
-module(ssl_ssl2).
diff --git a/lib/ssl/test/Makefile b/lib/ssl/test/Makefile
index 53b2223035..5be07cad2c 100644
--- a/lib/ssl/test/Makefile
+++ b/lib/ssl/test/Makefile
@@ -61,8 +61,10 @@ HRL_FILES = ssl_test_MACHINE.hrl
HRL_FILES_SRC = \
ssl_int.hrl \
+ ssl_internal.hrl\
ssl_alert.hrl \
- ssl_handshake.hrl
+ ssl_handshake.hrl \
+ ssl_record.hrl
HRL_FILES_INC =
diff --git a/lib/ssl/test/ssl_basic_SUITE.erl b/lib/ssl/test/ssl_basic_SUITE.erl
index 4f0907027f..8da1d947d3 100644
--- a/lib/ssl/test/ssl_basic_SUITE.erl
+++ b/lib/ssl/test/ssl_basic_SUITE.erl
@@ -25,11 +25,12 @@
-compile(export_all).
-include_lib("common_test/include/ct.hrl").
--include("test_server_line.hrl").
-include_lib("public_key/include/public_key.hrl").
-include("ssl_alert.hrl").
-include("ssl_int.hrl").
+-include("ssl_internal.hrl").
+-include("ssl_record.hrl").
-define('24H_in_sec', 86400).
-define(TIMEOUT, 60000).
@@ -208,8 +209,12 @@ all() ->
empty_protocol_versions, controlling_process,
controller_dies, client_closes_socket, peercert,
connect_dist, peername, sockname, socket_options,
+ invalid_inet_get_option, invalid_inet_get_option_not_list,
+ invalid_inet_get_option_improper_list,
+ invalid_inet_set_option, invalid_inet_set_option_not_list,
+ invalid_inet_set_option_improper_list,
misc_ssl_options, versions, cipher_suites, upgrade,
- upgrade_with_timeout, tcp_connect, ipv6, ekeyfile,
+ upgrade_with_timeout, tcp_connect, tcp_connect_big, ipv6, ekeyfile,
ecertfile, ecacertfile, eoptions, shutdown,
shutdown_write, shutdown_both, shutdown_error,
ciphers_rsa_signed_certs, ciphers_rsa_signed_certs_ssl3,
@@ -248,11 +253,11 @@ all() ->
unknown_server_ca_fail, der_input,
unknown_server_ca_accept_verify_none,
unknown_server_ca_accept_verify_peer,
- unknown_server_ca_accept_backwardscompatibilty,
+ unknown_server_ca_accept_backwardscompatibility,
%%different_ca_peer_sign,
no_reuses_session_server_restart_new_cert,
no_reuses_session_server_restart_new_cert_file, reuseaddr,
- hibernate
+ hibernate, connect_twice
].
groups() ->
@@ -808,8 +813,218 @@ socket_options_result(Socket, Options, DefaultValues, NewOptions, NewValues) ->
{ok,[{nodelay,false}]} = ssl:getopts(Socket, [nodelay]),
ssl:setopts(Socket, [{nodelay, true}]),
{ok,[{nodelay, true}]} = ssl:getopts(Socket, [nodelay]),
+ {ok, All} = ssl:getopts(Socket, []),
+ test_server:format("All opts ~p~n", [All]),
ok.
+
+
+%%--------------------------------------------------------------------
+invalid_inet_get_option(doc) ->
+ ["Test handling of invalid inet options in getopts"];
+
+invalid_inet_get_option(suite) ->
+ [];
+
+invalid_inet_get_option(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, get_invalid_inet_option, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, ClientOpts}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+
+ ssl_test_lib:check_result(Server, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+
+get_invalid_inet_option(Socket) ->
+ {error, {eoptions, {inet_option, foo, _}}} = ssl:getopts(Socket, [foo]),
+ ok.
+
+%%--------------------------------------------------------------------
+invalid_inet_get_option_not_list(doc) ->
+ ["Test handling of invalid type in getopts"];
+
+invalid_inet_get_option_not_list(suite) ->
+ [];
+
+invalid_inet_get_option_not_list(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, get_invalid_inet_option_not_list, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, ClientOpts}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+ ssl_test_lib:check_result(Server, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+
+get_invalid_inet_option_not_list(Socket) ->
+ {error, {eoptions, {inet_options, some_invalid_atom_here}}}
+ = ssl:getopts(Socket, some_invalid_atom_here),
+ ok.
+
+%%--------------------------------------------------------------------
+invalid_inet_get_option_improper_list(doc) ->
+ ["Test handling of invalid type in getopts"];
+
+invalid_inet_get_option_improper_list(suite) ->
+ [];
+
+invalid_inet_get_option_improper_list(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, get_invalid_inet_option_improper_list, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, ClientOpts}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+
+ ssl_test_lib:check_result(Server, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+
+get_invalid_inet_option_improper_list(Socket) ->
+ {error, {eoptions, {inet_option, foo,_}}} = ssl:getopts(Socket, [packet | foo]),
+ ok.
+
+%%--------------------------------------------------------------------
+invalid_inet_set_option(doc) ->
+ ["Test handling of invalid inet options in setopts"];
+
+invalid_inet_set_option(suite) ->
+ [];
+
+invalid_inet_set_option(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, set_invalid_inet_option, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, ClientOpts}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+
+ ssl_test_lib:check_result(Server, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+set_invalid_inet_option(Socket) ->
+ {error, {eoptions, {inet_opt, {packet, foo}}}} = ssl:setopts(Socket, [{packet, foo}]),
+ {error, {eoptions, {inet_opt, {header, foo}}}} = ssl:setopts(Socket, [{header, foo}]),
+ {error, {eoptions, {inet_opt, {active, foo}}}} = ssl:setopts(Socket, [{active, foo}]),
+ {error, {eoptions, {inet_opt, {mode, foo}}}} = ssl:setopts(Socket, [{mode, foo}]),
+ ok.
+%%--------------------------------------------------------------------
+invalid_inet_set_option_not_list(doc) ->
+ ["Test handling of invalid type in setopts"];
+
+invalid_inet_set_option_not_list(suite) ->
+ [];
+
+invalid_inet_set_option_not_list(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, set_invalid_inet_option_not_list, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, ClientOpts}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+
+ ssl_test_lib:check_result(Server, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+
+set_invalid_inet_option_not_list(Socket) ->
+ {error, {eoptions, {not_a_proplist, some_invalid_atom_here}}}
+ = ssl:setopts(Socket, some_invalid_atom_here),
+ ok.
+
+%%--------------------------------------------------------------------
+invalid_inet_set_option_improper_list(doc) ->
+ ["Test handling of invalid tye in setopts"];
+
+invalid_inet_set_option_improper_list(suite) ->
+ [];
+
+invalid_inet_set_option_improper_list(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ Server = ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, set_invalid_inet_option_improper_list, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {options, ClientOpts}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+
+ ssl_test_lib:check_result(Server, ok),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+set_invalid_inet_option_improper_list(Socket) ->
+ {error, {eoptions, {not_a_proplist, [{packet, 0} | {foo, 2}]}}} =
+ ssl:setopts(Socket, [{packet, 0} | {foo, 2}]),
+ ok.
+
%%--------------------------------------------------------------------
misc_ssl_options(doc) ->
["Test what happens when we give valid options"];
@@ -1097,6 +1312,41 @@ tcp_connect(Config) when is_list(Config) ->
end
end.
+tcp_connect_big(doc) ->
+ ["Test what happens when a tcp tries to connect, i,e. a bad big (ssl) packet is sent first"];
+
+tcp_connect_big(suite) ->
+ [];
+
+tcp_connect_big(Config) when is_list(Config) ->
+ ServerOpts = ?config(server_opts, Config),
+ {_, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+ TcpOpts = [binary, {reuseaddr, true}],
+
+ Server = ssl_test_lib:start_upgrade_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {timeout, 5000},
+ {mfa, {?MODULE, dummy, []}},
+ {tcp_options, TcpOpts},
+ {ssl_options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+
+ {ok, Socket} = gen_tcp:connect(Hostname, Port, [binary, {packet, 0}]),
+ test_server:format("Testcase ~p connected to Server ~p ~n", [self(), Server]),
+
+ Rand = crypto:rand_bytes(?MAX_CIPHER_TEXT_LENGTH+1),
+ gen_tcp:send(Socket, <<?BYTE(0),
+ ?BYTE(3), ?BYTE(1), ?UINT16(?MAX_CIPHER_TEXT_LENGTH), Rand/binary>>),
+
+ receive
+ {tcp_closed, Socket} ->
+ receive
+ {Server, {error, timeout}} ->
+ test_server:fail("hangs");
+ {Server, {error, Error}} ->
+ test_server:format("Error ~p", [Error])
+ end
+ end.
dummy(_Socket) ->
%% Should not happen as the ssl connection will not be established
@@ -1659,7 +1909,7 @@ reuse_session(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
Client0 =
@@ -1681,7 +1931,7 @@ reuse_session(Config) when is_list(Config) ->
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
@@ -1697,7 +1947,7 @@ reuse_session(Config) when is_list(Config) ->
Client2 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, [{reuse_sessions, false}
| ClientOpts]}]),
receive
@@ -1713,7 +1963,7 @@ reuse_session(Config) when is_list(Config) ->
Server1 =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{options, [{reuse_sessions, false} | ServerOpts]}]),
Port1 = ssl_test_lib:inet_port(Server1),
@@ -1737,7 +1987,7 @@ reuse_session(Config) when is_list(Config) ->
Client4 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port1}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
@@ -1756,9 +2006,6 @@ reuse_session(Config) when is_list(Config) ->
ssl_test_lib:close(Client3),
ssl_test_lib:close(Client4).
-session_info_result(Socket) ->
- ssl:session_info(Socket).
-
%%--------------------------------------------------------------------
reuse_session_expired(doc) ->
["Test sessions is not reused when it has expired"];
@@ -1774,7 +2021,7 @@ reuse_session_expired(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
Client0 =
@@ -1796,7 +2043,7 @@ reuse_session_expired(Config) when is_list(Config) ->
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
@@ -1815,7 +2062,7 @@ reuse_session_expired(Config) when is_list(Config) ->
Client2 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
{Client2, SessionInfo} ->
@@ -1844,7 +2091,7 @@ server_does_not_want_to_reuse_session(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{options, [{reuse_session, fun(_,_,_,_) ->
false
end} |
@@ -1870,7 +2117,7 @@ server_does_not_want_to_reuse_session(Config) when is_list(Config) ->
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
@@ -3035,11 +3282,11 @@ unknown_server_ca_accept_verify_peer(Config) when is_list(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
-unknown_server_ca_accept_backwardscompatibilty(doc) ->
+unknown_server_ca_accept_backwardscompatibility(doc) ->
["Test that old style verify_funs will work"];
-unknown_server_ca_accept_backwardscompatibilty(suite) ->
+unknown_server_ca_accept_backwardscompatibility(suite) ->
[];
-unknown_server_ca_accept_backwardscompatibilty(Config) when is_list(Config) ->
+unknown_server_ca_accept_backwardscompatibility(Config) when is_list(Config) ->
ClientOpts = ?config(client_opts, Config),
ServerOpts = ?config(server_opts, Config),
{ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
@@ -3179,7 +3426,7 @@ no_reuses_session_server_restart_new_cert(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{options, ServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
Client0 =
@@ -3207,7 +3454,7 @@ no_reuses_session_server_restart_new_cert(Config) when is_list(Config) ->
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
@@ -3238,7 +3485,7 @@ no_reuses_session_server_restart_new_cert_file(Config) when is_list(Config) ->
Server =
ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
{from, self()},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{options, NewServerOpts}]),
Port = ssl_test_lib:inet_port(Server),
Client0 =
@@ -3268,7 +3515,7 @@ no_reuses_session_server_restart_new_cert_file(Config) when is_list(Config) ->
Client1 =
ssl_test_lib:start_client([{node, ClientNode},
{port, Port}, {host, Hostname},
- {mfa, {?MODULE, session_info_result, []}},
+ {mfa, {ssl_test_lib, session_info_result, []}},
{from, self()}, {options, ClientOpts}]),
receive
{Client1, SessionInfo} ->
@@ -3304,6 +3551,7 @@ reuseaddr(Config) when is_list(Config) ->
{options, [{active, false} | ClientOpts]}]),
test_server:sleep(?SLEEP),
ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client),
Server1 =
ssl_test_lib:start_server([{node, ServerNode}, {port, Port},
@@ -3361,6 +3609,54 @@ hibernate(Config) ->
ssl_test_lib:close(Client).
%%--------------------------------------------------------------------
+
+connect_twice(doc) ->
+ [""];
+connect_twice(suite) ->
+ [];
+connect_twice(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, send_recv_result, []}},
+ {options, [{keepalive, true},{active, false}
+ | ServerOpts]}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client =
+ ssl_test_lib:start_client([{node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, send_recv_result, []}},
+ {options, [{keepalive, true},{active, false}
+ | ClientOpts]}]),
+ Server ! listen,
+
+ {Client1, #sslsocket{}} =
+ ssl_test_lib:start_client([return_socket,
+ {node, ClientNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, send_recv_result, []}},
+ {options, [{keepalive, true},{active, false}
+ | ClientOpts]}]),
+
+ test_server:format("Testcase ~p, Client ~p Server ~p ~n",
+ [self(), Client, Server]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+ ssl_test_lib:check_result(Server, ok, Client1, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client),
+ ssl_test_lib:close(Client1).
+
+
+%%--------------------------------------------------------------------
%%% Internal functions
%%--------------------------------------------------------------------
send_recv_result(Socket) ->
@@ -3438,7 +3734,7 @@ session_cache_process_mnesia(suite) ->
session_cache_process_mnesia(Config) when is_list(Config) ->
session_cache_process(mnesia,Config).
-session_cache_process(Type,Config) when is_list(Config) ->
+session_cache_process(_Type,Config) when is_list(Config) ->
reuse_session(Config).
init([Type]) ->
diff --git a/lib/ssl/test/ssl_packet_SUITE.erl b/lib/ssl/test/ssl_packet_SUITE.erl
index d22d5d2954..9d2599b778 100644
--- a/lib/ssl/test/ssl_packet_SUITE.erl
+++ b/lib/ssl/test/ssl_packet_SUITE.erl
@@ -151,6 +151,9 @@ all() ->
packet_cdr_decode, packet_cdr_decode_list,
packet_http_decode, packet_http_decode_list,
packet_http_bin_decode_multi, packet_http_error_passive,
+ packet_httph_active, packet_httph_bin_active,
+ packet_httph_active_once, packet_httph_bin_active_once,
+ packet_httph_passive, packet_httph_bin_passive,
packet_line_decode, packet_line_decode_list,
packet_asn1_decode, packet_asn1_decode_list,
packet_tpkt_decode, packet_tpkt_decode_list,
@@ -1594,7 +1597,7 @@ client_http_decode(Socket, HttpRequest) ->
%%--------------------------------------------------------------------
packet_http_decode_list(doc) ->
["Test setting the packet option {packet, http}, {mode, list}"
- "(Body will be litst too)"];
+ "(Body will be list too)"];
packet_http_decode_list(suite) ->
[];
packet_http_decode_list(Config) when is_list(Config) ->
@@ -1804,7 +1807,304 @@ server_http_decode_error(Socket, HttpResponse) ->
assert_packet_opt(Socket, http),
ok = ssl:send(Socket, HttpResponse),
ok.
+%%--------------------------------------------------------------------
+packet_httph_active(doc) ->
+ ["Test setting the packet option {packet, httph}"];
+packet_httph_active(suite) ->
+ [];
+packet_httph_active(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_active,
+ []}},
+ {options, [{active, true},
+ {packet, httph},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+server_send_trailer(Socket, Trailer)->
+ ssl:send(Socket, Trailer),
+ ok.
+
+client_http_decode_trailer_active(Socket) ->
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined,"gzip"}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+
+%%--------------------------------------------------------------------
+packet_httph_bin_active(doc) ->
+ ["Test setting the packet option {packet, httph_bin}"];
+packet_httph_bin_active(suite) ->
+ [];
+packet_httph_bin_active(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_bin_active,
+ []}},
+ {options, [{active, true},
+ {packet, httph_bin},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_bin_active(Socket) ->
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined, <<"gzip">>}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+%%--------------------------------------------------------------------
+packet_httph_active_once(doc) ->
+ ["Test setting the packet option {packet, httph}"];
+packet_httph_active_once(suite) ->
+ [];
+packet_httph_active_once(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_active_once,
+ []}},
+ {options, [{active, false},
+ {packet, httph},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+
+client_http_decode_trailer_active_once(Socket) ->
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined,"gzip"}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+%%--------------------------------------------------------------------
+packet_httph_bin_active_once(doc) ->
+ ["Test setting the packet option {packet, httph_bin}"];
+packet_httph_bin_active_once(suite) ->
+ [];
+packet_httph_bin_active_once(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_bin_active_once,
+ []}},
+ {options, [{active, false},
+ {packet, httph_bin},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_bin_active_once(Socket) ->
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket,
+ {http_header,36,'Content-Encoding',undefined, <<"gzip">>}} ->
+ ok;
+ Other1 ->
+ exit({?LINE, Other1})
+ end,
+ ssl:setopts(Socket, [{active, once}]),
+ receive
+ {ssl, Socket, http_eoh} ->
+ ok;
+ Other2 ->
+ exit({?LINE, Other2})
+ end,
+ ok.
+
+%%--------------------------------------------------------------------
+
+packet_httph_passive(doc) ->
+ ["Test setting the packet option {packet, httph}"];
+packet_httph_passive(suite) ->
+ [];
+packet_httph_passive(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_passive,
+ []}},
+ {options, [{active, false},
+ {packet, httph},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_passive(Socket) ->
+ {ok,{http_header,36,'Content-Encoding',undefined,"gzip"}} = ssl:recv(Socket, 0),
+ {ok, http_eoh} = ssl:recv(Socket, 0),
+ ok.
+
+%%--------------------------------------------------------------------
+packet_httph_bin_passive(doc) ->
+ ["Test setting the packet option {packet, httph_bin}"];
+packet_httph_bin_passive(suite) ->
+ [];
+packet_httph_bin_passive(Config) when is_list(Config) ->
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Trailer = "Content-Encoding: gzip\r\n"
+ "\r\n",
+
+ Server = ssl_test_lib:start_server([{node, ClientNode}, {port, 0},
+ {from, self()},
+ {mfa, {?MODULE, server_send_trailer,
+ [Trailer]}},
+ {options, [{active, true}, binary |
+ ServerOpts]}]),
+
+ Port = ssl_test_lib:inet_port(Server),
+ Client = ssl_test_lib:start_client([{node, ServerNode}, {port, Port},
+ {host, Hostname},
+ {from, self()},
+ {mfa, {?MODULE, client_http_decode_trailer_bin_passive,
+ []}},
+ {options, [{active, false},
+ {packet, httph_bin},
+ list |
+ ClientOpts]}]),
+
+ ssl_test_lib:check_result(Server, ok, Client, ok),
+
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+client_http_decode_trailer_bin_passive(Socket) ->
+ {ok,{http_header,36,'Content-Encoding',undefined,<<"gzip">>}} = ssl:recv(Socket, 0),
+ {ok, http_eoh} = ssl:recv(Socket, 0),
+ ok.
%%--------------------------------------------------------------------
packet_line_decode(doc) ->
diff --git a/lib/ssl/test/ssl_session_cache_SUITE.erl b/lib/ssl/test/ssl_session_cache_SUITE.erl
index a43b9ab586..5ea45018e6 100644
--- a/lib/ssl/test/ssl_session_cache_SUITE.erl
+++ b/lib/ssl/test/ssl_session_cache_SUITE.erl
@@ -26,9 +26,11 @@
-include_lib("common_test/include/ct.hrl").
+-define(DELAY, 500).
-define(SLEEP, 500).
-define(TIMEOUT, 60000).
-define(LONG_TIMEOUT, 600000).
+
-behaviour(ssl_session_cache_api).
%% For the session cache tests
@@ -95,6 +97,16 @@ init_per_testcase(session_cache_process_mnesia, Config) ->
mnesia:start(),
init_customized_session_cache(mnesia, Config);
+init_per_testcase(session_cleanup, Config0) ->
+ Config = lists:keydelete(watchdog, 1, Config0),
+ Dog = test_server:timetrap(?TIMEOUT),
+ ssl:stop(),
+ application:load(ssl),
+ application:set_env(ssl, session_lifetime, 5),
+ application:set_env(ssl, session_delay_cleanup_time, ?DELAY),
+ ssl:start(),
+ [{watchdog, Dog} | Config];
+
init_per_testcase(_TestCase, Config0) ->
Config = lists:keydelete(watchdog, 1, Config0),
Dog = test_server:timetrap(?TIMEOUT),
@@ -128,6 +140,10 @@ end_per_testcase(session_cache_process_mnesia, Config) ->
ssl:stop(),
ssl:start(),
end_per_testcase(default_action, Config);
+end_per_testcase(session_cleanup, Config) ->
+ application:unset_env(ssl, session_delay_cleanup_time),
+ application:unset_env(ssl, session_lifetime),
+ end_per_testcase(default_action, Config);
end_per_testcase(_TestCase, Config) ->
Dog = ?config(watchdog, Config),
case Dog of
@@ -148,7 +164,8 @@ end_per_testcase(_TestCase, Config) ->
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- [session_cache_process_list,
+ [session_cleanup,
+ session_cache_process_list,
session_cache_process_mnesia].
groups() ->
@@ -159,7 +176,95 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
+%%--------------------------------------------------------------------
+session_cleanup(doc) ->
+ ["Test that sessions are cleand up eventually, so that the session table "
+ "does not grow and grow ..."];
+session_cleanup(suite) ->
+ [];
+session_cleanup(Config)when is_list(Config) ->
+ process_flag(trap_exit, true),
+ ClientOpts = ?config(client_opts, Config),
+ ServerOpts = ?config(server_opts, Config),
+ {ClientNode, ServerNode, Hostname} = ssl_test_lib:run_where(Config),
+
+ Server =
+ ssl_test_lib:start_server([{node, ServerNode}, {port, 0},
+ {from, self()},
+ {mfa, {ssl_test_lib, session_info_result, []}},
+ {options, ServerOpts}]),
+ Port = ssl_test_lib:inet_port(Server),
+ Client =
+ ssl_test_lib:start_client([{node, ClientNode},
+ {port, Port}, {host, Hostname},
+ {mfa, {ssl_test_lib, no_result, []}},
+ {from, self()}, {options, ClientOpts}]),
+ SessionInfo =
+ receive
+ {Server, Info} ->
+ Info
+ end,
+
+ %% Make sure session is registered
+ test_server:sleep(?SLEEP),
+
+ {status, _, _, StatusInfo} = sys:get_status(whereis(ssl_manager)),
+ [_, _,_, _, Prop] = StatusInfo,
+ State = state(Prop),
+ Cache = element(2, State),
+ SessionTimer = element(6, State),
+
+ Id = proplists:get_value(session_id, SessionInfo),
+ CSession = ssl_session_cache:lookup(Cache, {{Hostname, Port}, Id}),
+ SSession = ssl_session_cache:lookup(Cache, {Port, Id}),
+
+ true = CSession =/= undefined,
+ true = SSession =/= undefined,
+
+ %% Make sure session has expired and been cleaned up
+ check_timer(SessionTimer),
+ test_server:sleep(?DELAY *2), %% Delay time + some extra time
+
+ DelayTimer = get_delay_timer(),
+
+ check_timer(DelayTimer),
+
+ test_server:sleep(?SLEEP), %% Make sure clean has had to run
+
+ undefined = ssl_session_cache:lookup(Cache, {{Hostname, Port}, Id}),
+ undefined = ssl_session_cache:lookup(Cache, {Port, Id}),
+
+ process_flag(trap_exit, false),
+ ssl_test_lib:close(Server),
+ ssl_test_lib:close(Client).
+
+state([{data,[{"State", State}]} | _]) ->
+ State;
+state([_ | Rest]) ->
+ state(Rest).
+
+check_timer(Timer) ->
+ case erlang:read_timer(Timer) of
+ false ->
+ {status, _, _, _} = sys:get_status(whereis(ssl_manager)),
+ ok;
+ Int ->
+ test_server:sleep(Int),
+ check_timer(Timer)
+ end.
+get_delay_timer() ->
+ {status, _, _, StatusInfo} = sys:get_status(whereis(ssl_manager)),
+ [_, _,_, _, Prop] = StatusInfo,
+ State = state(Prop),
+ case element(7, State) of
+ undefined ->
+ test_server:sleep(?SLEEP),
+ get_delay_timer();
+ DelayTimer ->
+ DelayTimer
+ end.
+%%--------------------------------------------------------------------
session_cache_process_list(doc) ->
["Test reuse of sessions (short handshake)"];
@@ -176,7 +281,6 @@ session_cache_process_mnesia(suite) ->
session_cache_process_mnesia(Config) when is_list(Config) ->
session_cache_process(mnesia,Config).
-
%%--------------------------------------------------------------------
%%% Session cache API callbacks
%%--------------------------------------------------------------------
diff --git a/lib/ssl/test/ssl_test_lib.erl b/lib/ssl/test/ssl_test_lib.erl
index 40bbdf1dbd..b7916b96eb 100644
--- a/lib/ssl/test/ssl_test_lib.erl
+++ b/lib/ssl/test/ssl_test_lib.erl
@@ -670,3 +670,6 @@ cipher_result(Socket, Result) ->
Other ->
{unexpected, Other}
end.
+
+session_info_result(Socket) ->
+ ssl:session_info(Socket).
diff --git a/lib/ssl/vsn.mk b/lib/ssl/vsn.mk
index 0e80e42637..8286201df4 100644
--- a/lib/ssl/vsn.mk
+++ b/lib/ssl/vsn.mk
@@ -1 +1 @@
-SSL_VSN = 4.1.5
+SSL_VSN = 4.1.6
diff --git a/lib/stdlib/doc/src/calendar.xml b/lib/stdlib/doc/src/calendar.xml
index 4876b37127..f8db48e00c 100644
--- a/lib/stdlib/doc/src/calendar.xml
+++ b/lib/stdlib/doc/src/calendar.xml
@@ -75,13 +75,13 @@
<datatypes>
<datatype>
- <name name="t_datetime"/>
+ <name name="datetime"/>
</datatype>
<datatype>
- <name name="t_datetime1970"/>
+ <name name="datetime1970"/>
</datatype>
<datatype>
- <name name="t_date"/>
+ <name name="date"/>
</datatype>
<datatype>
<name name="year"/>
@@ -100,7 +100,7 @@
<name name="day"/>
</datatype>
<datatype>
- <name name="t_time"/>
+ <name name="time"/>
</datatype>
<datatype>
<name name="hour"/>
@@ -118,12 +118,7 @@
<name name="ldom"/>
</datatype>
<datatype>
- <name name="t_now"/>
- <desc><p>See <seealso marker="erts:erlang#now/0">erlang:now/0</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="t_yearweeknum"/>
+ <name name="yearweeknum"/>
</datatype>
<datatype>
<name name="weeknum"/>
diff --git a/lib/stdlib/doc/src/dets.xml b/lib/stdlib/doc/src/dets.xml
index 2512c84e18..54fefbe2b8 100644
--- a/lib/stdlib/doc/src/dets.xml
+++ b/lib/stdlib/doc/src/dets.xml
@@ -1105,7 +1105,7 @@ fun(X) -> {continue, X} end. </pre>
<p>Terminate the traversal and return <c>[<anno>Value</anno> | Acc]</c>.</p>
</item>
</taglist>
- <p>Any other value returned by <c><anno>Fun</anno></c> terminates the
+ <p>Any other value <c><anno>OtherValue</anno></c> returned by <c><anno>Fun</anno></c> terminates the
traversal and is immediately returned.
</p>
</desc>
diff --git a/lib/stdlib/doc/src/ets.xml b/lib/stdlib/doc/src/ets.xml
index 8c952708c5..f19f92be6f 100644
--- a/lib/stdlib/doc/src/ets.xml
+++ b/lib/stdlib/doc/src/ets.xml
@@ -513,6 +513,9 @@ Error: fun containing local Erlang function calls
the table has been fixed by the process.</p>
<p>If the table never has been fixed, the call returns
<c>false</c>.</p>
+ <item><c>Item=stats, Value=tuple()</c> <br></br>
+ Returns internal statistics about set, bag and duplicate_bag tables on an internal format used by OTP test suites.
+ Not for production use.</item>
</item>
</list>
</desc>
diff --git a/lib/stdlib/doc/src/gen_fsm.xml b/lib/stdlib/doc/src/gen_fsm.xml
index d15383c621..e35b5adace 100644
--- a/lib/stdlib/doc/src/gen_fsm.xml
+++ b/lib/stdlib/doc/src/gen_fsm.xml
@@ -438,7 +438,7 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<fsummary>Initialize process and internal state name and state data.</fsummary>
<type>
<v>Args = term()</v>
- <v>Return = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
+ <v>Result = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
<v>&nbsp;&nbsp;| {ok,StateName,StateData,hibernate}</v>
<v>&nbsp;&nbsp;| {stop,Reason} | ignore</v>
<v>&nbsp;StateName = atom()</v>
@@ -639,9 +639,9 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<v>StateName = atom()</v>
<v>StateData = term()</v>
<v>Result = {next_state,NextStateName,NewStateData}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
- <v>&nbsp;>&nbsp;| {stop,Reason,NewStateData}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
+ <v>&nbsp;&nbsp;| {stop,Reason,NewStateData}</v>
<v>&nbsp;NextStateName = atom()</v>
<v>&nbsp;NewStateData = term()</v>
<v>&nbsp;Timeout = int()>0 | infinity</v>
diff --git a/lib/stdlib/doc/src/io.xml b/lib/stdlib/doc/src/io.xml
index af9c75d546..667d758e29 100644
--- a/lib/stdlib/doc/src/io.xml
+++ b/lib/stdlib/doc/src/io.xml
@@ -439,7 +439,7 @@ ok</pre>
<item>
<p>Prints the argument with the <c>string</c> syntax. The
argument is, if no Unicode translation modifier is present, an
- <seealso marker="erts:erlang#iolist_definition">I/O list</seealso>, a binary, or an atom. If the Unicode translation modifier ('t') is in effect, the argument is unicode:chardata(), meaning that binaries are in UTF-8. The characters
+ iolist(), a binary, or an atom. If the Unicode translation modifier ('t') is in effect, the argument is unicode:chardata(), meaning that binaries are in UTF-8. The characters
are printed without quotes. The string is first truncated
by the given precision and then padded and justified
to the given field width. The default precision is the field width.</p>
diff --git a/lib/stdlib/doc/src/supervisor.xml b/lib/stdlib/doc/src/supervisor.xml
index 009aa60faa..edd119d37a 100644
--- a/lib/stdlib/doc/src/supervisor.xml
+++ b/lib/stdlib/doc/src/supervisor.xml
@@ -150,9 +150,12 @@ child_spec() = {Id,StartFunc,Restart,Shutdown,Type,Modules}
<p><c>Restart</c> defines when a terminated child process
should be restarted. A <c>permanent</c> child process should
always be restarted, a <c>temporary</c> child process should
- never be restarted and a <c>transient</c> child process
- should be restarted only if it terminates abnormally, i.e.
- with another exit reason than <c>normal</c>.</p>
+ never be restarted (even when the supervisor's restart strategy
+ is <c>rest_for_one</c> or <c>one_for_all</c> and a sibling's
+ death causes the temporary process to be terminated) and a
+ <c>transient</c> child process should be restarted only if
+ it terminates abnormally, i.e. with another exit reason
+ than <c>normal</c>.</p>
</item>
<item>
<p><c>Shutdown</c> defines how a child process should be
diff --git a/lib/stdlib/doc/src/unicode_usage.xml b/lib/stdlib/doc/src/unicode_usage.xml
index 416df1f02c..b48ad8c1f3 100644
--- a/lib/stdlib/doc/src/unicode_usage.xml
+++ b/lib/stdlib/doc/src/unicode_usage.xml
@@ -52,7 +52,7 @@
<tag>UCS-4</tag>
<item>Basically the same as UTF-32, but without some Unicode semantics, defined by IEEE and has little use as a separate encoding standard. For all normal (and possibly abnormal) usages, UTF-32 and UCS-4 are interchangeable.</item>
</taglist>
-<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a whole in the Unicode range to cope with backward compatibility.</p>
+<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a hole in the Unicode range to cope with backward compatibility.</p>
<p>Additionally, the codepoint 16#FEFF is used for byte order marks (BOM's) and use of that character is not encouraged in other contexts than that. It actually is valid though, as the character "ZWNBS" (Zero Width Non Breaking Space). BOM's are used to identify encodings and byte order for programs where such parameters are not known in advance. Byte order marks are more seldom used than one could expect, put their use is becoming more widely spread as they provide the means for programs to make educated guesses about the Unicode format of a certain file.</p>
</section>
<section>
diff --git a/lib/stdlib/src/calendar.erl b/lib/stdlib/src/calendar.erl
index 8d1071209e..0320e0cd0e 100644
--- a/lib/stdlib/src/calendar.erl
+++ b/lib/stdlib/src/calendar.erl
@@ -63,7 +63,7 @@
%% Types
%%----------------------------------------------------------------------
--export_type([t_now/0]).
+-export_type([date/0, time/0, datetime/0, datetime1970/0]).
-type year() :: non_neg_integer().
-type year1970() :: 1970..10000. % should probably be 1970..
@@ -76,15 +76,11 @@
-type ldom() :: 28 | 29 | 30 | 31. % last day of month
-type weeknum() :: 1..53.
--type t_now() :: {MegaSecs :: non_neg_integer(),
- Secs :: non_neg_integer(),
- MicroSecs :: non_neg_integer()}.
-
--type t_date() :: {year(),month(),day()}.
--type t_time() :: {hour(),minute(),second()}.
--type t_datetime() :: {t_date(),t_time()}.
--type t_datetime1970() :: {{year1970(),month(),day()},t_time()}.
--type t_yearweeknum() :: {year(),weeknum()}.
+-type date() :: {year(),month(),day()}.
+-type time() :: {hour(),minute(),second()}.
+-type datetime() :: {date(),time()}.
+-type datetime1970() :: {{year1970(),month(),day()},time()}.
+-type yearweeknum() :: {year(),weeknum()}.
%%----------------------------------------------------------------------
@@ -123,7 +119,7 @@ date_to_gregorian_days(Year, Month, Day) when is_integer(Day), Day > 0 ->
end.
-spec date_to_gregorian_days(Date) -> Days when
- Date :: t_date(),
+ Date :: date(),
Days :: non_neg_integer().
date_to_gregorian_days({Year, Month, Day}) ->
date_to_gregorian_days(Year, Month, Day).
@@ -135,7 +131,7 @@ date_to_gregorian_days({Year, Month, Day}) ->
%% January 1st.
%%
-spec datetime_to_gregorian_seconds(DateTime) -> Seconds when
- DateTime :: t_datetime(),
+ DateTime :: datetime(),
Seconds :: non_neg_integer().
datetime_to_gregorian_seconds({Date, Time}) ->
?SECONDS_PER_DAY*date_to_gregorian_days(Date) +
@@ -155,14 +151,14 @@ day_of_the_week(Year, Month, Day) ->
(date_to_gregorian_days(Year, Month, Day) + 5) rem 7 + 1.
-spec day_of_the_week(Date) -> daynum() when
- Date:: t_date().
+ Date:: date().
day_of_the_week({Year, Month, Day}) ->
day_of_the_week(Year, Month, Day).
%% gregorian_days_to_date(Days) = {Year, Month, Day}
%%
--spec gregorian_days_to_date(Days) -> t_date() when
+-spec gregorian_days_to_date(Days) -> date() when
Days :: non_neg_integer().
gregorian_days_to_date(Days) ->
{Year, DayOfYear} = day_to_year(Days),
@@ -172,7 +168,7 @@ gregorian_days_to_date(Days) ->
%% gregorian_seconds_to_datetime(Secs)
%%
--spec gregorian_seconds_to_datetime(Seconds) -> t_datetime() when
+-spec gregorian_seconds_to_datetime(Seconds) -> datetime() when
Seconds :: non_neg_integer().
gregorian_seconds_to_datetime(Secs) when Secs >= 0 ->
Days = Secs div ?SECONDS_PER_DAY,
@@ -198,7 +194,7 @@ is_leap_year1(_) -> false.
%%
%% Calculates the iso week number for the current date.
%%
--spec iso_week_number() -> t_yearweeknum().
+-spec iso_week_number() -> yearweeknum().
iso_week_number() ->
{Date, _} = local_time(),
iso_week_number(Date).
@@ -207,8 +203,8 @@ iso_week_number() ->
%%
%% Calculates the iso week number for the given date.
%%
--spec iso_week_number(Date) -> t_yearweeknum() when
- Date :: t_date().
+-spec iso_week_number(Date) -> yearweeknum() when
+ Date :: date().
iso_week_number({Year, Month, Day}) ->
D = date_to_gregorian_days({Year, Month, Day}),
W01_1_Year = gregorian_days_of_iso_w01_1(Year),
@@ -260,7 +256,7 @@ last_day_of_the_month1(_, M) when is_integer(M), M > 0, M < 13 ->
%% local_time()
%%
%% Returns: {date(), time()}, date() = {Y, M, D}, time() = {H, M, S}.
--spec local_time() -> t_datetime().
+-spec local_time() -> datetime().
local_time() ->
erlang:localtime().
@@ -268,20 +264,20 @@ local_time() ->
%% local_time_to_universal_time(DateTime)
%%
-spec local_time_to_universal_time(DateTime1) -> DateTime2 when
- DateTime1 :: t_datetime1970(),
- DateTime2 :: t_datetime1970().
+ DateTime1 :: datetime1970(),
+ DateTime2 :: datetime1970().
local_time_to_universal_time(DateTime) ->
erlang:localtime_to_universaltime(DateTime).
--spec local_time_to_universal_time(t_datetime1970(),
+-spec local_time_to_universal_time(datetime1970(),
'true' | 'false' | 'undefined') ->
- t_datetime1970().
+ datetime1970().
local_time_to_universal_time(DateTime, IsDst) ->
erlang:localtime_to_universaltime(DateTime, IsDst).
-spec local_time_to_universal_time_dst(DateTime1) -> [DateTime] when
- DateTime1 :: t_datetime1970(),
- DateTime :: t_datetime1970().
+ DateTime1 :: datetime1970(),
+ DateTime :: datetime1970().
local_time_to_universal_time_dst(DateTime) ->
UtDst = erlang:localtime_to_universaltime(DateTime, true),
Ut = erlang:localtime_to_universaltime(DateTime, false),
@@ -309,14 +305,14 @@ local_time_to_universal_time_dst(DateTime) ->
%% = MilliSec = integer()
%% Returns: {date(), time()}, date() = {Y, M, D}, time() = {H, M, S}.
%%
--spec now_to_datetime(Now) -> t_datetime1970() when
- Now :: t_now().
+-spec now_to_datetime(Now) -> datetime1970() when
+ Now :: erlang:timestamp().
now_to_datetime({MSec, Sec, _uSec}) ->
Sec0 = MSec*1000000 + Sec + ?DAYS_FROM_0_TO_1970*?SECONDS_PER_DAY,
gregorian_seconds_to_datetime(Sec0).
--spec now_to_universal_time(Now) -> t_datetime1970() when
- Now :: t_now().
+-spec now_to_universal_time(Now) -> datetime1970() when
+ Now :: erlang:timestamp().
now_to_universal_time(Now) ->
now_to_datetime(Now).
@@ -325,8 +321,8 @@ now_to_universal_time(Now) ->
%%
%% Args: Now = now()
%%
--spec now_to_local_time(Now) -> t_datetime1970() when
- Now :: t_now().
+-spec now_to_local_time(Now) -> datetime1970() when
+ Now :: erlang:timestamp().
now_to_local_time({MSec, Sec, _uSec}) ->
erlang:universaltime_to_localtime(
now_to_universal_time({MSec, Sec, _uSec})).
@@ -338,7 +334,7 @@ now_to_local_time({MSec, Sec, _uSec}) ->
-spec seconds_to_daystime(Seconds) -> {Days, Time} when
Seconds :: integer(),
Days :: integer(),
- Time :: t_time().
+ Time :: time().
seconds_to_daystime(Secs) ->
Days0 = Secs div ?SECONDS_PER_DAY,
Secs0 = Secs rem ?SECONDS_PER_DAY,
@@ -356,7 +352,7 @@ seconds_to_daystime(Secs) ->
%% Wraps.
%%
-type secs_per_day() :: 0..?SECONDS_PER_DAY.
--spec seconds_to_time(Seconds) -> t_time() when
+-spec seconds_to_time(Seconds) -> time() when
Seconds :: secs_per_day().
seconds_to_time(Secs) when Secs >= 0, Secs < ?SECONDS_PER_DAY ->
Secs0 = Secs rem ?SECONDS_PER_DAY,
@@ -375,10 +371,10 @@ seconds_to_time(Secs) when Secs >= 0, Secs < ?SECONDS_PER_DAY ->
%% Year = Month = Day = Hour = Minute = Sec = integer()
%%
-spec time_difference(T1, T2) -> {Days, Time} when
- T1 :: t_datetime(),
- T2 :: t_datetime(),
+ T1 :: datetime(),
+ T2 :: datetime(),
Days :: integer(),
- Time :: t_time().
+ Time :: time().
time_difference({{Y1, Mo1, D1}, {H1, Mi1, S1}},
{{Y2, Mo2, D2}, {H2, Mi2, S2}}) ->
Secs = datetime_to_gregorian_seconds({{Y2, Mo2, D2}, {H2, Mi2, S2}}) -
@@ -390,7 +386,7 @@ time_difference({{Y1, Mo1, D1}, {H1, Mi1, S1}},
%% time_to_seconds(Time)
%%
-spec time_to_seconds(Time) -> secs_per_day() when
- Time :: t_time().
+ Time :: time().
time_to_seconds({H, M, S}) when is_integer(H), is_integer(M), is_integer(S) ->
H * ?SECONDS_PER_HOUR +
M * ?SECONDS_PER_MINUTE + S.
@@ -399,15 +395,15 @@ time_to_seconds({H, M, S}) when is_integer(H), is_integer(M), is_integer(S) ->
%% universal_time()
%%
%% Returns: {date(), time()}, date() = {Y, M, D}, time() = {H, M, S}.
--spec universal_time() -> t_datetime().
+-spec universal_time() -> datetime().
universal_time() ->
erlang:universaltime().
%% universal_time_to_local_time(DateTime)
%%
--spec universal_time_to_local_time(DateTime) -> t_datetime() when
- DateTime :: t_datetime1970().
+-spec universal_time_to_local_time(DateTime) -> datetime() when
+ DateTime :: datetime1970().
universal_time_to_local_time(DateTime) ->
erlang:universaltime_to_localtime(DateTime).
@@ -429,7 +425,7 @@ valid_date1(_, _, _) ->
false.
-spec valid_date(Date) -> boolean() when
- Date :: t_date().
+ Date :: date().
valid_date({Y, M, D}) ->
valid_date(Y, M, D).
diff --git a/lib/stdlib/src/dets.erl b/lib/stdlib/src/dets.erl
index 671b5a9dd4..fa0641ffd9 100644
--- a/lib/stdlib/src/dets.erl
+++ b/lib/stdlib/src/dets.erl
@@ -411,7 +411,8 @@ init_table(Tab, InitFun) ->
InitFun :: fun((Arg) -> Res),
Arg :: read | close,
Res :: end_of_input | {[object()], InitFun} | {Data, InitFun} | term(),
- Options :: [{min_no_slots,no_slots()} | {format,term | bchunk}],
+ Options :: Option | [Option],
+ Option :: {min_no_slots,no_slots()} | {format,term | bchunk},
Reason :: term(),
Data :: binary() | tuple().
@@ -871,11 +872,15 @@ to_ets(DTab, ETab) ->
-spec traverse(Name, Fun) -> Return | {'error', Reason} when
Name :: tab_name(),
Fun :: fun((Object) -> FunReturn),
- FunReturn :: 'continue' | {'continue', Val} | {'done', Value},
+ Object :: object(),
+ FunReturn :: 'continue'
+ | {'continue', Val}
+ | {'done', Value}
+ | OtherValue,
+ Return :: [term()] | OtherValue,
Val :: term(),
Value :: term(),
- Object :: object(),
- Return :: [term()],
+ OtherValue :: term(),
Reason :: term().
traverse(Tab, Fun) ->
diff --git a/lib/stdlib/src/dets_v8.erl b/lib/stdlib/src/dets_v8.erl
index af36958c1c..299b037c28 100644
--- a/lib/stdlib/src/dets_v8.erl
+++ b/lib/stdlib/src/dets_v8.erl
@@ -163,7 +163,7 @@
%% The 8(c) version uses a different hashing algorithm, erlang:phash
%% (former versions use erlang:hash).
%% Version 8(b) files are only converted to version 8(c) if repair is
-%% done, so we need compatability with 8(b) for a _long_ time.
+%% done, so we need compatibility with 8(b) for a _long_ time.
%%
%% There are known bugs due to the fact that keys and objects are
%% sometimes compared (==) and sometimes matched (=:=). The version
diff --git a/lib/stdlib/src/erl_compile.erl b/lib/stdlib/src/erl_compile.erl
index abff37e4bc..d833f626bf 100644
--- a/lib/stdlib/src/erl_compile.erl
+++ b/lib/stdlib/src/erl_compile.erl
@@ -41,7 +41,6 @@ compiler(".idl") -> {ic, compile};
compiler(".asn1") -> {asn1ct, compile_asn1};
compiler(".asn") -> {asn1ct, compile_asn};
compiler(".py") -> {asn1ct, compile_py};
-compiler(".xml") -> {xmerl_scan, process};
compiler(_) -> no.
%% Entry from command line.
diff --git a/lib/stdlib/src/erl_expand_records.erl b/lib/stdlib/src/erl_expand_records.erl
index eada563914..20fd247cea 100644
--- a/lib/stdlib/src/erl_expand_records.erl
+++ b/lib/stdlib/src/erl_expand_records.erl
@@ -35,7 +35,7 @@
trecords=sets:new(), % Typed records
uses_types=false, % Are there -spec or -type in the module
strict_ra=[], % strict record accesses
- checked_ra=[] % succesfully accessed records
+ checked_ra=[] % successfully accessed records
}).
-spec(module(AbsForms, CompileOptions) -> AbsForms when
diff --git a/lib/stdlib/src/erl_internal.erl b/lib/stdlib/src/erl_internal.erl
index 478f05e792..3073fc0fb5 100644
--- a/lib/stdlib/src/erl_internal.erl
+++ b/lib/stdlib/src/erl_internal.erl
@@ -262,6 +262,7 @@ bif(bitsize, 1) -> true;
bif(bit_size, 1) -> true;
bif(bitstring_to_list, 1) -> true;
bif(byte_size, 1) -> true;
+bif(check_old_code, 1) -> true;
bif(check_process_code, 2) -> true;
bif(concat_binary, 1) -> true;
bif(date, 0) -> true;
diff --git a/lib/stdlib/src/erl_scan.erl b/lib/stdlib/src/erl_scan.erl
index 718ca2e91a..10b2ed2e49 100644
--- a/lib/stdlib/src/erl_scan.erl
+++ b/lib/stdlib/src/erl_scan.erl
@@ -408,7 +408,12 @@ set_attr(line, {Line,Column}, Fun) when ?ALINE(Line), ?COLUMN(Column) ->
end;
set_attr(line=Tag, Attrs, Fun) when is_list(Attrs) ->
{line,Line} = lists:keyfind(Tag, 1, Attrs),
- lists:keyreplace(Tag, 1, Attrs, {line,Fun(Line)});
+ case lists:keyreplace(Tag, 1, Attrs, {line,Fun(Line)}) of
+ [{line,Ln}] when ?ALINE(Ln) ->
+ Ln;
+ As ->
+ As
+ end;
set_attr(T1, T2, T3) ->
erlang:error(badarg, [T1,T2,T3]).
diff --git a/lib/stdlib/src/erl_tar.erl b/lib/stdlib/src/erl_tar.erl
index fd85c7aef5..306834e845 100644
--- a/lib/stdlib/src/erl_tar.erl
+++ b/lib/stdlib/src/erl_tar.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -798,30 +798,10 @@ set_extracted_file_info(Name, #tar_header{mode=Mode, mtime=Mtime}) ->
%% Makes all directories leading up to the file.
-make_dirs(Name, Type) ->
- make_dirs1(filename:split(Name), Type).
-
-make_dirs1([Dir, Next|Rest], Type) ->
- case file:read_file_info(Dir) of
- {ok, #file_info{type=directory}} ->
- make_dirs1([filename:join(Dir, Next)|Rest], Type);
- {ok, #file_info{}} ->
- throw({error, enotdir});
- {error, _} ->
- case file:make_dir(Dir) of
- ok ->
- make_dirs1([filename:join(Dir, Next)|Rest], Type);
- {error, Reason} ->
- throw({error, Reason})
- end
- end;
-make_dirs1([_], file) -> ok;
-make_dirs1([Dir], dir) ->
- file:make_dir(Dir);
-make_dirs1([], _) ->
- %% There must be something wrong here. The list was not supposed
- %% to be empty.
- throw({error, enoent}).
+make_dirs(Name, file) ->
+ filelib:ensure_dir(Name);
+make_dirs(Name, dir) ->
+ filelib:ensure_dir(filename:join(Name,"*")).
%% Prints the message on if the verbose option is given (for reading).
diff --git a/lib/stdlib/src/escript.erl b/lib/stdlib/src/escript.erl
index d67617260e..cd1bacd2f5 100644
--- a/lib/stdlib/src/escript.erl
+++ b/lib/stdlib/src/escript.erl
@@ -62,10 +62,10 @@
-type zip_create_option() :: term().
-type section() ::
shebang
- | {shebang, shebang()}
+ | {shebang, shebang() | default | undefined}
| comment
- | {comment, comment()}
- | {emu_args, emu_args()}
+ | {comment, comment() | default | undefined}
+ | {emu_args, emu_args() | undefined}
| {source, file:filename() | binary()}
| {beam, file:filename() | binary()}
| {archive, file:filename() | binary()}
diff --git a/lib/stdlib/src/eval_bits.erl b/lib/stdlib/src/eval_bits.erl
index 2cbd6cdae7..2c7192a7e7 100644
--- a/lib/stdlib/src/eval_bits.erl
+++ b/lib/stdlib/src/eval_bits.erl
@@ -34,12 +34,12 @@
%% @type matchfun(). A closure which performs a match given a value, a
%% pattern and an environment
%%
-%% @type field() represents a field in a "bin"
+%% @type field(). Represents a field in a "bin".
%%% Part 1: expression evaluation (binary construction)
%% @spec expr_grp(Fields::[field()], Bindings::bindings(),
-%% EvalFun::evalfun()) ->
+%% EvalFun::evalfun(), term(), term()) ->
%% {value, binary(), bindings()}
%%
%% @doc Returns a tuple with {value,Bin,Bs} where Bin is the binary
@@ -192,9 +192,9 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
end.
%%% Part 3: binary pattern matching
-%% @spec match_bits(Fields::[field()], Bin::binary()
+%% @spec match_bits(Fields::[field()], Bin::binary(),
%% GlobalEnv::bindings(), LocalEnv::bindings(),
-%% MatchFun::matchfun(),EvalFun::evalfun()) ->
+%% MatchFun::matchfun(),EvalFun::evalfun(), term()) ->
%% {match, bindings()}
%% @doc Used to perform matching. If the match succeeds a new
%% environment is returned. If the match have some syntactic or
diff --git a/lib/stdlib/src/io_lib.erl b/lib/stdlib/src/io_lib.erl
index 54c7283abf..0252cdf742 100644
--- a/lib/stdlib/src/io_lib.erl
+++ b/lib/stdlib/src/io_lib.erl
@@ -100,7 +100,7 @@ fwrite(Format, Args) ->
-spec fread(Format, String) -> Result when
Format :: string(),
String :: string(),
- Result :: {'ok', InputList :: chars(), LeftOverChars :: string()}
+ Result :: {'ok', InputList :: [term()], LeftOverChars :: string()}
| {'more', RestFormat :: string(),
Nchars :: non_neg_integer(),
InputStack :: chars()}
@@ -109,13 +109,13 @@ fwrite(Format, Args) ->
fread(Chars, Format) ->
io_lib_fread:fread(Chars, Format).
--spec fread(Continuation, String, Format) -> Return when
+-spec fread(Continuation, CharSpec, Format) -> Return when
Continuation :: continuation() | [],
- String :: string(),
+ CharSpec :: string() | eof,
Format :: string(),
Return :: {'more', Continuation1 :: continuation()}
| {'done', Result, LeftOverChars :: string()},
- Result :: {'ok', InputList :: chars()}
+ Result :: {'ok', InputList :: [term()]}
| 'eof'
| {'error', What :: term()}.
diff --git a/lib/stdlib/src/io_lib_fread.erl b/lib/stdlib/src/io_lib_fread.erl
index 52aa4d073c..ded1346097 100644
--- a/lib/stdlib/src/io_lib_fread.erl
+++ b/lib/stdlib/src/io_lib_fread.erl
@@ -24,6 +24,10 @@
-import(lists, [reverse/1,reverse/2]).
+-define(is_whitespace(C),
+ ((C) =:= $\s orelse (C) =:= $\t
+ orelse (C) =:= $\r orelse (C) =:= $\n)).
+
%%-----------------------------------------------------------------------
%% fread(Continuation, CharList, FormatString)
@@ -106,31 +110,27 @@ fread_line(Format0, Line, N0, Results0, More, Newline) ->
fread(Format, Line) ->
fread(Format, Line, 0, []).
-fread([$~|Format0], Line, N, Results) ->
+fread([$~|Format0]=AllFormat, Line, N, Results) ->
{Format,F,Sup,Unicode} = fread_field(Format0),
- fread1(Format, F, Sup, Unicode, Line, N, Results, Format0);
-fread([$\s|Format], Line, N, Results) ->
- fread_skip_white(Format, Line, N, Results);
-fread([$\t|Format], Line, N, Results) ->
- fread_skip_white(Format, Line, N, Results);
-fread([$\r|Format], Line, N, Results) ->
- fread_skip_white(Format, Line, N, Results);
-fread([$\n|Format], Line, N, Results) ->
+ fread1(Format, F, Sup, Unicode, Line, N, Results, AllFormat);
+fread([C|Format], Line, N, Results) when ?is_whitespace(C) ->
fread_skip_white(Format, Line, N, Results);
fread([C|Format], [C|Line], N, Results) ->
fread(Format, Line, N+1, Results);
fread([_F|_Format], [_C|_Line], _N, _Results) ->
fread_error(input);
+fread([_|_]=Format, [], N, Results) ->
+ {more,Format,N,Results};
+fread([_|_], eof, 0, []) ->
+ %% This is at start of input so no error.
+ eof;
+fread([_|_], eof, _N, _Results) ->
+ %% This is an error as there is no more input.
+ fread_error(input);
fread([], Line, _N, Results) ->
{ok,reverse(Results),Line}.
-fread_skip_white(Format, [$\s|Line], N, Results) ->
- fread_skip_white(Format, Line, N+1, Results);
-fread_skip_white(Format, [$\t|Line], N, Results) ->
- fread_skip_white(Format, Line, N+1, Results);
-fread_skip_white(Format, [$\r|Line], N, Results) ->
- fread_skip_white(Format, Line, N+1, Results);
-fread_skip_white(Format, [$\n|Line], N, Results) ->
+fread_skip_white(Format, [C|Line], N, Results) when ?is_whitespace(C) ->
fread_skip_white(Format, Line, N+1, Results);
fread_skip_white(Format, Line, N, Results) ->
fread(Format, Line, N, Results).
@@ -166,9 +166,9 @@ fread1([$l|Format], _F, Sup, _U, Line, N, Res, _AllFormat) ->
fread(Format, Line, N, fread_result(Sup, N, Res));
fread1(_Format, _F, _Sup, _U, [], N, Res, AllFormat) ->
%% Need more input here.
- {more,[$~|AllFormat],N,Res};
-fread1(_Format, _F, _Sup, _U, eof, _N, [], _AllFormat) ->
- %% This is at start of format string so no error.
+ {more,AllFormat,N,Res};
+fread1(_Format, _F, _Sup, _U, eof, 0, [], _AllFormat) ->
+ %% This is at start of input so no error.
eof;
fread1(_Format, _F, _Sup, _U, eof, _N, _Res, _AllFormat) ->
%% This is an error as there is no more input.
@@ -386,26 +386,16 @@ fread_string_cs(Line0, N0, true) ->
%% fread_digits(Line, N, Base, Characters)
%% Read segments of things, return "thing" characters in reverse order.
-fread_skip_white([$\s|Line]) -> fread_skip_white(Line);
-fread_skip_white([$\t|Line]) -> fread_skip_white(Line);
-fread_skip_white([$\r|Line]) -> fread_skip_white(Line);
-fread_skip_white([$\n|Line]) -> fread_skip_white(Line);
+fread_skip_white([C|Line]) when ?is_whitespace(C) ->
+ fread_skip_white(Line);
fread_skip_white(Line) -> Line.
-fread_skip_white([$\s|Line], N) ->
- fread_skip_white(Line, N+1);
-fread_skip_white([$\t|Line], N) ->
- fread_skip_white(Line, N+1);
-fread_skip_white([$\r|Line], N) ->
- fread_skip_white(Line, N+1);
-fread_skip_white([$\n|Line], N) ->
+fread_skip_white([C|Line], N) when ?is_whitespace(C) ->
fread_skip_white(Line, N+1);
fread_skip_white(Line, N) -> {Line,N}.
-fread_skip_latin1_nonwhite([$\s|Line], N, Cs) -> {[$\s|Line],N,Cs};
-fread_skip_latin1_nonwhite([$\t|Line], N, Cs) -> {[$\t|Line],N,Cs};
-fread_skip_latin1_nonwhite([$\r|Line], N, Cs) -> {[$\r|Line],N,Cs};
-fread_skip_latin1_nonwhite([$\n|Line], N, Cs) -> {[$\n|Line],N,Cs};
+fread_skip_latin1_nonwhite([C|Line], N, Cs) when ?is_whitespace(C) ->
+ {[C|Line],N,Cs};
fread_skip_latin1_nonwhite([C|Line], N, []) when C > 255 ->
{[C|Line],N,error};
fread_skip_latin1_nonwhite([C|Line], N, Cs) when C > 255 ->
@@ -414,10 +404,8 @@ fread_skip_latin1_nonwhite([C|Line], N, Cs) ->
fread_skip_latin1_nonwhite(Line, N+1, [C|Cs]);
fread_skip_latin1_nonwhite([], N, Cs) -> {[],N,Cs}.
-fread_skip_nonwhite([$\s|Line], N, Cs) -> {[$\s|Line],N,Cs};
-fread_skip_nonwhite([$\t|Line], N, Cs) -> {[$\t|Line],N,Cs};
-fread_skip_nonwhite([$\r|Line], N, Cs) -> {[$\r|Line],N,Cs};
-fread_skip_nonwhite([$\n|Line], N, Cs) -> {[$\n|Line],N,Cs};
+fread_skip_nonwhite([C|Line], N, Cs) when ?is_whitespace(C) ->
+ {[C|Line],N,Cs};
fread_skip_nonwhite([C|Line], N, Cs) ->
fread_skip_nonwhite(Line, N+1, [C|Cs]);
fread_skip_nonwhite([], N, Cs) -> {[],N,Cs}.
diff --git a/lib/stdlib/src/otp_internal.erl b/lib/stdlib/src/otp_internal.erl
index 39d017d430..5129ba5074 100644
--- a/lib/stdlib/src/otp_internal.erl
+++ b/lib/stdlib/src/otp_internal.erl
@@ -461,6 +461,14 @@ obsolete_1(public_key, pem_to_der, 1) ->
obsolete_1(public_key, decode_private_key, A) when A =:= 1; A =:= 2 ->
{deprecated,{public_key,pem_entry_decode,1},"R15A"};
+%% Added in R14B03.
+obsolete_1(docb_gen, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+obsolete_1(docb_transform, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+obsolete_1(docb_xml_check, _, _) ->
+ {deprecated,"the DocBuilder application is deprecated (will be removed in R15B)"};
+
obsolete_1(_, _, _) ->
no.
diff --git a/lib/stdlib/src/proplists.erl b/lib/stdlib/src/proplists.erl
index 68697d0da2..e3eda5d932 100644
--- a/lib/stdlib/src/proplists.erl
+++ b/lib/stdlib/src/proplists.erl
@@ -49,9 +49,10 @@
%% ---------------------------------------------------------------------
--export_type([property/0]).
+-export_type([property/0, proplist/0]).
-type property() :: atom() | tuple().
+-type proplist() :: [property()].
%% ---------------------------------------------------------------------
diff --git a/lib/stdlib/src/queue.erl b/lib/stdlib/src/queue.erl
index 4c6b4d710b..afe917b151 100644
--- a/lib/stdlib/src/queue.erl
+++ b/lib/stdlib/src/queue.erl
@@ -56,16 +56,14 @@
new() -> {[],[]}. %{RearList,FrontList}
%% O(1)
--spec is_queue(Term) -> boolean() when
- Term :: term().
+-spec is_queue(Term :: term()) -> boolean().
is_queue({R,F}) when is_list(R), is_list(F) ->
true;
is_queue(_) ->
false.
%% O(1)
--spec is_empty(Q) -> boolean() when
- Q :: queue().
+-spec is_empty(Q :: queue()) -> boolean().
is_empty({[],[]}) ->
true;
is_empty({In,Out}) when is_list(In), is_list(Out) ->
@@ -74,16 +72,14 @@ is_empty(Q) ->
erlang:error(badarg, [Q]).
%% O(len(Q))
--spec len(Q) -> non_neg_integer() when
- Q :: queue().
+-spec len(Q :: queue()) -> non_neg_integer().
len({R,F}) when is_list(R), is_list(F) ->
length(R)+length(F);
len(Q) ->
erlang:error(badarg, [Q]).
%% O(len(Q))
--spec to_list(Q) -> list() when
- Q :: queue().
+-spec to_list(Q :: queue()) -> list().
to_list({In,Out}) when is_list(In), is_list(Out) ->
Out++lists:reverse(In, []);
to_list(Q) ->
@@ -92,8 +88,7 @@ to_list(Q) ->
%% Create queue from list
%%
%% O(length(L))
--spec from_list(L) -> queue() when
- L :: list().
+-spec from_list(L :: list()) -> queue().
from_list(L) when is_list(L) ->
f2r(L);
from_list(L) ->
@@ -102,9 +97,7 @@ from_list(L) ->
%% Return true or false depending on if element is in queue
%%
%% O(length(Q)) worst case
--spec member(Item, Q) -> boolean() when
- Item :: term(),
- Q :: queue().
+-spec member(Item :: term(), Q :: queue()) -> boolean().
member(X, {R,F}) when is_list(R), is_list(F) ->
lists:member(X, R) orelse lists:member(X, F);
member(X, Q) ->
@@ -117,10 +110,7 @@ member(X, Q) ->
%% Put at least one element in each list, if it is cheap
%%
%% O(1)
--spec in(Item, Q1) -> Q2 when
- Item :: term(),
- Q1 :: queue(),
- Q2 :: queue().
+-spec in(Item :: term(), Q1 :: queue()) -> Q2 :: queue().
in(X, {[_]=In,[]}) ->
{[X], In};
in(X, {In,Out}) when is_list(In), is_list(Out) ->
@@ -132,10 +122,7 @@ in(X, Q) ->
%% Put at least one element in each list, if it is cheap
%%
%% O(1)
--spec in_r(Item, Q1) -> Q2 when
- Item :: term(),
- Q1 :: queue(),
- Q2 :: queue().
+-spec in_r(Item :: term(), Q1 :: queue()) -> Q2 :: queue().
in_r(X, {[],[_]=F}) ->
{F,[X]};
in_r(X, {R,F}) when is_list(R), is_list(F) ->
@@ -146,10 +133,9 @@ in_r(X, Q) ->
%% Take from head/front
%%
%% O(1) amortized, O(len(Q)) worst case
--spec out(Q1) -> Result when
- Q1 :: queue(),
- Q2 :: queue(),
- Result :: {{value, Item :: term()}, Q2} | {empty, Q1}.
+-spec out(Q1 :: queue()) ->
+ {{value, Item :: term()}, Q2 :: queue()} |
+ {empty, Q1 :: queue()}.
out({[],[]}=Q) ->
{empty,Q};
out({[V],[]}) ->
@@ -167,10 +153,9 @@ out(Q) ->
%% Take from tail/rear
%%
%% O(1) amortized, O(len(Q)) worst case
--spec out_r(Q1) -> Result when
- Q1 :: queue(),
- Q2 :: queue(),
- Result :: {{value, Item :: term()}, Q2} | {empty, Q1}.
+-spec out_r(Q1 :: queue()) ->
+ {{value, Item :: term()}, Q2 :: queue()} |
+ {empty, Q1 :: queue()}.
out_r({[],[]}=Q) ->
{empty,Q};
out_r({[],[V]}) ->
@@ -191,9 +176,7 @@ out_r(Q) ->
%% Return the first element in the queue
%%
%% O(1) since the queue is supposed to be well formed
--spec get(Q) -> Item when
- Q :: queue(),
- Item :: term().
+-spec get(Q :: queue()) -> Item :: term().
get({[],[]}=Q) ->
erlang:error(empty, [Q]);
get({R,F}) when is_list(R), is_list(F) ->
@@ -212,9 +195,7 @@ get([_|R], []) -> % malformed queue -> O(len(Q))
%% Return the last element in the queue
%%
%% O(1) since the queue is supposed to be well formed
--spec get_r(Q) -> Item when
- Q :: queue(),
- Item :: term().
+-spec get_r(Q :: queue()) -> Item :: term().
get_r({[],[]}=Q) ->
erlang:error(empty, [Q]);
get_r({[H|_],F}) when is_list(F) ->
@@ -229,9 +210,7 @@ get_r(Q) ->
%% Return the first element in the queue
%%
%% O(1) since the queue is supposed to be well formed
--spec peek(Q) -> 'empty' | {'value',Item} when
- Q :: queue(),
- Item :: term().
+-spec peek(Q :: queue()) -> empty | {value,Item :: term()}.
peek({[],[]}) ->
empty;
peek({R,[H|_]}) when is_list(R) ->
@@ -246,9 +225,7 @@ peek(Q) ->
%% Return the last element in the queue
%%
%% O(1) since the queue is supposed to be well formed
--spec peek_r(Q) -> 'empty' | {'value',Item} when
- Q :: queue(),
- Item :: term().
+-spec peek_r(Q :: queue()) -> empty | {value,Item :: term()}.
peek_r({[],[]}) ->
empty;
peek_r({[H|_],F}) when is_list(F) ->
@@ -263,9 +240,7 @@ peek_r(Q) ->
%% Remove the first element and return resulting queue
%%
%% O(1) amortized
--spec drop(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec drop(Q1 :: queue()) -> Q2 :: queue().
drop({[],[]}=Q) ->
erlang:error(empty, [Q]);
drop({[_],[]}) ->
@@ -283,9 +258,7 @@ drop(Q) ->
%% Remove the last element and return resulting queue
%%
%% O(1) amortized
--spec drop_r(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec drop_r(Q1 :: queue()) -> Q2 :: queue().
drop_r({[],[]}=Q) ->
erlang:error(empty, [Q]);
drop_r({[],[_]}) ->
@@ -306,9 +279,7 @@ drop_r(Q) ->
%% Return reversed queue
%%
%% O(1)
--spec reverse(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec reverse(Q1 :: queue()) -> Q2 :: queue().
reverse({R,F}) when is_list(R), is_list(F) ->
{F,R};
reverse(Q) ->
@@ -318,10 +289,7 @@ reverse(Q) ->
%%
%% Q2 empty: O(1)
%% else: O(len(Q1))
--spec join(Q1, Q2) -> Q3 when
- Q1 :: queue(),
- Q2 :: queue(),
- Q3 :: queue().
+-spec join(Q1 :: queue(), Q2 :: queue()) -> Q3 :: queue().
join({R,F}=Q, {[],[]}) when is_list(R), is_list(F) ->
Q;
join({[],[]}, {R,F}=Q) when is_list(R), is_list(F) ->
@@ -335,11 +303,8 @@ join(Q1, Q2) ->
%%
%% N = 0..len(Q)
%% O(max(N, len(Q)))
--spec split(N, Q1) -> {Q2,Q3} when
- N :: non_neg_integer(),
- Q1 :: queue(),
- Q2 :: queue(),
- Q3 :: queue().
+-spec split(N :: non_neg_integer(), Q1 :: queue()) ->
+ {Q2 :: queue(),Q3 :: queue()}.
split(0, {R,F}=Q) when is_list(R), is_list(F) ->
{{[],[]},Q};
split(N, {R,F}=Q) when is_integer(N), N >= 1, is_list(R), is_list(F) ->
@@ -380,10 +345,8 @@ split_r1_to_f2(N, [X|R1], F1, R2, F2) ->
%%
%% Fun(_) -> List: O(length(List) * len(Q))
%% else: O(len(Q)
--spec filter(Fun, Q1) -> Q2 when
- Fun :: fun((Item :: term()) -> boolean() | list()),
- Q1 :: queue(),
- Q2 :: queue().
+-spec filter(Fun, Q1 :: queue()) -> Q2 :: queue() when
+ Fun :: fun((Item :: term()) -> boolean() | list()).
filter(Fun, {R0,F0}) when is_function(Fun, 1), is_list(R0), is_list(F0) ->
F = filter_f(Fun, F0),
R = filter_r(Fun, R0),
@@ -459,10 +422,7 @@ filter_r(Fun, [X|R0]) ->
%% Cons to head
%%
--spec cons(Item, Q1) -> Q2 when
- Item :: term(),
- Q1 :: queue(),
- Q2 :: queue().
+-spec cons(Item :: term(), Q1 :: queue()) -> Q2 :: queue().
cons(X, Q) ->
in_r(X, Q).
@@ -471,9 +431,7 @@ cons(X, Q) ->
%% Return the first element in the queue
%%
%% O(1) since the queue is supposed to be well formed
--spec head(Q) -> Item when
- Q :: queue(),
- Item :: term().
+-spec head(Q :: queue()) -> Item :: term().
head({[],[]}=Q) ->
erlang:error(empty, [Q]);
head({R,F}) when is_list(R), is_list(F) ->
@@ -483,9 +441,7 @@ head(Q) ->
%% Remove head element and return resulting queue
%%
--spec tail(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec tail(Q1 :: queue()) -> Q2 :: queue().
tail(Q) ->
drop(Q).
@@ -493,35 +449,22 @@ tail(Q) ->
%% Cons to tail
%%
--spec snoc(Q1, Item) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue(),
- Item :: term().
+-spec snoc(Q1 :: queue(), Item :: term()) -> Q2 :: queue().
snoc(Q, X) ->
in(X, Q).
%% Return last element
--spec daeh(Q) -> Item when
- Q :: queue(),
- Item :: term().
+-spec daeh(Q :: queue()) -> Item :: term().
daeh(Q) -> get_r(Q).
--spec last(Q) -> Item when
- Q :: queue(),
- Item :: term().
+-spec last(Q :: queue()) -> Item :: term().
last(Q) -> get_r(Q).
%% Remove last element and return resulting queue
--spec liat(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec liat(Q1 :: queue()) -> Q2 :: queue().
liat(Q) -> drop_r(Q).
--spec lait(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec lait(Q1 :: queue()) -> Q2 :: queue().
lait(Q) -> drop_r(Q). %% Oops, mis-spelled 'tail' reversed. Forget this one.
--spec init(Q1) -> Q2 when
- Q1 :: queue(),
- Q2 :: queue().
+-spec init(Q1 :: queue()) -> Q2 :: queue().
init(Q) -> drop_r(Q).
%%--------------------------------------------------------------------------
diff --git a/lib/stdlib/src/sofs.erl b/lib/stdlib/src/sofs.erl
index d38b8ab37a..34eb224647 100644
--- a/lib/stdlib/src/sofs.erl
+++ b/lib/stdlib/src/sofs.erl
@@ -81,7 +81,8 @@
-define(ORDTAG, 'OrdSet').
-record(?TAG, {data = [] :: list(), type = type :: term()}).
--record(?ORDTAG, {orddata = {} :: tuple(), ordtype = type :: term()}).
+-record(?ORDTAG, {orddata = {} :: tuple() | atom(),
+ ordtype = type :: term()}).
-define(LIST(S), (S)#?TAG.data).
-define(TYPE(S), (S)#?TAG.type).
@@ -375,7 +376,7 @@ to_sets(S) when ?IS_ORDSET(S) ->
-spec(no_elements(ASet) -> NoElements when
ASet :: a_set() | ordset(),
- NoElements :: pos_integer()).
+ NoElements :: non_neg_integer()).
no_elements(S) when ?IS_SET(S) ->
length(?LIST(S));
no_elements(S) when ?IS_ORDSET(S), is_tuple(?ORDTYPE(S)) ->
diff --git a/lib/stdlib/src/supervisor.erl b/lib/stdlib/src/supervisor.erl
index e60706ed05..dc31647eb5 100644
--- a/lib/stdlib/src/supervisor.erl
+++ b/lib/stdlib/src/supervisor.erl
@@ -735,6 +735,13 @@ restart(one_for_all, Child, State) ->
terminate_children(Children, SupName) ->
terminate_children(Children, SupName, []).
+%% Temporary children should not be restarted and thus should
+%% be skipped when building the list of terminated children, although
+%% we do want them to be shut down as many functions from this module
+%% use this function to just clear everything.
+terminate_children([Child = #child{restart_type=temporary} | Children], SupName, Res) ->
+ do_terminate(Child, SupName),
+ terminate_children(Children, SupName, Res);
terminate_children([Child | Children], SupName, Res) ->
NChild = do_terminate(Child, SupName),
terminate_children(Children, SupName, [NChild | Res]);
diff --git a/lib/stdlib/src/sys.erl b/lib/stdlib/src/sys.erl
index 8ab72c9b50..f34201604c 100644
--- a/lib/stdlib/src/sys.erl
+++ b/lib/stdlib/src/sys.erl
@@ -154,7 +154,7 @@ log_to_file(Name, FileName, Timeout) ->
-spec statistics(Name, Flag) -> 'ok' | {'ok', Statistics} when
Name :: name(),
Flag :: 'true' | 'false' | 'get',
- Statistics :: [StatisticsTuple],
+ Statistics :: [StatisticsTuple] | no_statistics,
StatisticsTuple :: {'start_time', DateTime1}
| {'current_time', DateTime2}
| {'reductions', non_neg_integer()}
@@ -168,7 +168,7 @@ statistics(Name, Flag) ->
-spec statistics(Name, Flag, Timeout) -> 'ok' | {'ok', Statistics} when
Name :: name(),
Flag :: 'true' | 'false' | 'get',
- Statistics :: [StatisticsTuple],
+ Statistics :: [StatisticsTuple] | no_statistics,
StatisticsTuple :: {'start_time', DateTime1}
| {'current_time', DateTime2}
| {'reductions', non_neg_integer()}
diff --git a/lib/stdlib/src/timer.erl b/lib/stdlib/src/timer.erl
index 89fae05e4f..689e42051f 100644
--- a/lib/stdlib/src/timer.erl
+++ b/lib/stdlib/src/timer.erl
@@ -199,9 +199,9 @@ tc(M, F, A) ->
%% Calculate the time difference (in microseconds) of two
%% erlang:now() timestamps, T2-T1.
%%
--spec now_diff(T1, T2) -> Tdiff when
- T1 :: calendar:t_now(),
- T2 :: calendar:t_now(),
+-spec now_diff(T2, T1) -> Tdiff when
+ T1 :: erlang:timestamp(),
+ T2 :: erlang:timestamp(),
Tdiff :: integer().
now_diff({A2, B2, C2}, {A1, B1, C1}) ->
((A2-A1)*1000000 + B2-B1)*1000000 + C2-C1.
diff --git a/lib/stdlib/src/zip.erl b/lib/stdlib/src/zip.erl
index 524d709431..c82c8159b6 100644
--- a/lib/stdlib/src/zip.erl
+++ b/lib/stdlib/src/zip.erl
@@ -223,7 +223,7 @@ openzip_open(F, Options) ->
do_openzip_open(F, Options) ->
Opts = get_openzip_options(Options),
#openzip_opts{output = Output, open_opts = OpO, cwd = CWD} = Opts,
- Input = get_zip_input(F),
+ Input = get_input(F),
In0 = Input({open, F, OpO -- [write]}, []),
{[#zip_comment{comment = C} | Files], In1} =
get_central_dir(In0, fun raw_file_info_etc/5, Input),
@@ -489,7 +489,7 @@ do_list_dir(F, Options) ->
%% Print zip directory in short form
-spec(t(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
t(F) when is_pid(F) -> zip_t(F);
@@ -513,7 +513,7 @@ do_t(F, RawPrint) ->
%% Print zip directory in long form (like ls -l)
-spec(tt(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
tt(F) when is_pid(F) -> zip_tt(F);
@@ -1174,7 +1174,7 @@ zip_get(Pid) when is_pid(Pid) ->
zip_close(Pid) when is_pid(Pid) ->
request(self(), Pid, close).
--spec(zip_get(FileName, ZipHandle) -> {ok, [Result]} | {error, Reason} when
+-spec(zip_get(FileName, ZipHandle) -> {ok, Result} | {error, Reason} when
FileName :: file:name(),
ZipHandle :: pid(),
Result :: file:name() | {file:name(), binary()},
@@ -1183,7 +1183,7 @@ zip_close(Pid) when is_pid(Pid) ->
zip_get(FileName, Pid) when is_pid(Pid) ->
request(self(), Pid, {get, FileName}).
--spec(zip_list_dir(ZipHandle) -> Result | {error, Reason} when
+-spec(zip_list_dir(ZipHandle) -> {ok, Result} | {error, Reason} when
Result :: [zip_comment() | zip_file()],
ZipHandle :: pid(),
Reason :: term()).
diff --git a/lib/stdlib/test/beam_lib_SUITE.erl b/lib/stdlib/test/beam_lib_SUITE.erl
index 4ccc863795..91fff3cee4 100644
--- a/lib/stdlib/test/beam_lib_SUITE.erl
+++ b/lib/stdlib/test/beam_lib_SUITE.erl
@@ -242,8 +242,8 @@ cmp(doc) -> ["Compare contents of BEAM files and directories"];
cmp(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, dir1),
- ?line Dir2 = filename:join(PrivDir, dir2),
+ ?line Dir1 = filename:join(PrivDir, "dir1"),
+ ?line Dir2 = filename:join(PrivDir, "dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -292,8 +292,8 @@ cmp_literals(doc) -> ["Compare contents of BEAM files having literals"];
cmp_literals(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, dir1),
- ?line Dir2 = filename:join(PrivDir, dir2),
+ ?line Dir1 = filename:join(PrivDir, "dir1"),
+ ?line Dir2 = filename:join(PrivDir, "dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -381,7 +381,7 @@ otp_6711(Conf) when is_list(Conf) ->
(catch {a, beam_lib:strip_files([3])}),
?line PrivDir = ?privdir,
- ?line Dir = filename:join(PrivDir, dir),
+ ?line Dir = filename:join(PrivDir, "dir"),
?line Lib = filename:join(Dir, "lib"),
?line App = filename:join(Lib, "app"),
?line EBin = filename:join(App, "ebin"),
@@ -417,8 +417,8 @@ building(doc) -> "Testing building of BEAM files.";
building(Conf) when is_list(Conf) ->
?line PrivDir = ?privdir,
- ?line Dir1 = filename:join(PrivDir, b_dir1),
- ?line Dir2 = filename:join(PrivDir, b_dir2),
+ ?line Dir1 = filename:join(PrivDir, "b_dir1"),
+ ?line Dir2 = filename:join(PrivDir, "b_dir2"),
ok = file:make_dir(Dir1),
ok = file:make_dir(Dir2),
@@ -688,7 +688,7 @@ chunk_info(File) ->
Chunks.
make_beam(Dir, Module, F) ->
- ?line FileBase = filename:join(Dir, Module),
+ ?line FileBase = filename:join(Dir, atom_to_list(Module)),
?line Source = FileBase ++ ".erl",
?line BeamFile = FileBase ++ ".beam",
?line simple_file(Source, Module, F),
diff --git a/lib/stdlib/test/dets_SUITE.erl b/lib/stdlib/test/dets_SUITE.erl
index 698070368f..22a9d4a7ff 100644
--- a/lib/stdlib/test/dets_SUITE.erl
+++ b/lib/stdlib/test/dets_SUITE.erl
@@ -1516,7 +1516,7 @@ repair(Config, V) ->
if
V =:= 8 ->
%% first estimated number of objects is wrong, repair once more
- ?line {ok, Fd} = file:open(Fname, read_write),
+ ?line {ok, Fd} = file:open(Fname, [read,write]),
NoPos = HeadSize - 8, % no_objects
?line file:pwrite(Fd, NoPos, <<0:32>>), % NoItems
ok = file:close(Fd),
@@ -3247,7 +3247,7 @@ otp_5402(suite) ->
[];
otp_5402(Config) when is_list(Config) ->
Tab = otp_5402,
- ?line File = filename:join([cannot, write, this, file]),
+ ?line File = filename:join(["cannot", "write", "this", "file"]),
%% close
?line{ok, T} = dets:open_file(Tab, [{ram_file,true},
@@ -3887,7 +3887,7 @@ crash(File, Where) ->
crash(File, Where, 10).
crash(File, Where, What) when is_integer(What) ->
- ?line {ok, Fd} = file:open(File, read_write),
+ ?line {ok, Fd} = file:open(File, [read,write]),
?line file:position(Fd, Where),
?line ok = file:write(Fd, [What]),
?line ok = file:close(Fd).
@@ -4031,7 +4031,7 @@ writable(Fname) ->
?line file:write_file_info(Fname, Info#file_info{mode = Mode}).
truncate(File, Where) ->
- ?line {ok, Fd} = file:open(File, read_write),
+ ?line {ok, Fd} = file:open(File, [read,write]),
?line file:position(Fd, Where),
?line ok = file:truncate(Fd),
?line ok = file:close(Fd).
diff --git a/lib/stdlib/test/epp_SUITE.erl b/lib/stdlib/test/epp_SUITE.erl
index 9b024a5b49..57f3f4eddb 100644
--- a/lib/stdlib/test/epp_SUITE.erl
+++ b/lib/stdlib/test/epp_SUITE.erl
@@ -1280,7 +1280,7 @@ eval_tests(Config, Fun, Tests) ->
check_test(Config, Test) ->
- Filename = 'epp_test.erl',
+ Filename = "epp_test.erl",
?line PrivDir = ?config(priv_dir, Config),
?line File = filename:join(PrivDir, Filename),
?line ok = file:write_file(File, Test),
@@ -1293,7 +1293,7 @@ check_test(Config, Test) ->
compile_test(Config, Test0) ->
Test = [<<"-module(epp_test). -compile(export_all). ">>, Test0],
- Filename = 'epp_test.erl',
+ Filename = "epp_test.erl",
?line PrivDir = ?config(priv_dir, Config),
?line File = filename:join(PrivDir, Filename),
?line ok = file:write_file(File, Test),
diff --git a/lib/stdlib/test/erl_eval_SUITE.erl b/lib/stdlib/test/erl_eval_SUITE.erl
index 0bcf3c5b71..784c7cb86e 100644
--- a/lib/stdlib/test/erl_eval_SUITE.erl
+++ b/lib/stdlib/test/erl_eval_SUITE.erl
@@ -1189,7 +1189,7 @@ lfh() ->
{eval, fun(F, As, Bs) -> local_func(F, As, Bs) end}.
local_func(F, As0, Bs0) when is_atom(F) ->
- {As,Bs} = erl_eval:expr_list(As0, Bs0, {eval,lfh()}),
+ {As,Bs} = erl_eval:expr_list(As0, Bs0, lfh()),
case erlang:function_exported(?MODULE, F, length(As)) of
true ->
{value,apply(?MODULE, F, As),Bs};
diff --git a/lib/stdlib/test/erl_lint_SUITE.erl b/lib/stdlib/test/erl_lint_SUITE.erl
index f980d52e4e..9041adbe5c 100644
--- a/lib/stdlib/test/erl_lint_SUITE.erl
+++ b/lib/stdlib/test/erl_lint_SUITE.erl
@@ -2981,7 +2981,7 @@ run_test(Conf, Test0, Warnings0) ->
run_test2(Conf, Test, Warnings0).
run_test2(Conf, Test, Warnings0) ->
- Filename = 'lint_test.erl',
+ Filename = "lint_test.erl",
DataDir = ?privdir,
File = filename:join(DataDir, Filename),
Opts = case Warnings0 of
diff --git a/lib/stdlib/test/erl_scan_SUITE.erl b/lib/stdlib/test/erl_scan_SUITE.erl
index 31a4f94294..4298b2c701 100644
--- a/lib/stdlib/test/erl_scan_SUITE.erl
+++ b/lib/stdlib/test/erl_scan_SUITE.erl
@@ -737,6 +737,10 @@ set_attribute() ->
(catch {foo, erl_scan:set_attribute(line, [], F2)}), % type error
?line {'EXIT',{badarg,_}} =
(catch {foo, erl_scan:set_attribute(column, [], F2)}), % type error
+
+ %% OTP-9412
+ ?line 8 = erl_scan:set_attribute(line, [{line,{nos,'X',8}}],
+ fun({nos,_V,VL}) -> VL end),
ok.
column_errors() ->
diff --git a/lib/stdlib/test/ets_SUITE.erl b/lib/stdlib/test/ets_SUITE.erl
index 9d348b5f1a..57df963ae2 100644
--- a/lib/stdlib/test/ets_SUITE.erl
+++ b/lib/stdlib/test/ets_SUITE.erl
@@ -72,6 +72,7 @@
exit_many_many_tables_owner/1]).
-export([write_concurrency/1, heir/1, give_away/1, setopts/1]).
-export([bad_table/1, types/1]).
+-export([otp_9423/1]).
-export([init_per_testcase/2, end_per_testcase/2]).
%% Convenience for manual testing
@@ -143,7 +144,8 @@ all() ->
otp_8166, exit_large_table_owner,
exit_many_large_table_owner, exit_many_tables_owner,
exit_many_many_tables_owner, write_concurrency, heir,
- give_away, setopts, bad_table, types].
+ give_away, setopts, bad_table, types,
+ otp_9423].
groups() ->
[{new, [],
@@ -817,6 +819,14 @@ t_delete_all_objects(Config) when is_list(Config) ->
repeat_for_opts(t_delete_all_objects_do),
?line verify_etsmem(EtsMem).
+get_kept_objects(T) ->
+ case ets:info(T,stats) of
+ false ->
+ 0;
+ {_,_,_,_,_,_,KO} ->
+ KO
+ end.
+
t_delete_all_objects_do(Opts) ->
?line T=ets_new(x,Opts),
?line filltabint(T,4000),
@@ -826,10 +836,10 @@ t_delete_all_objects_do(Opts) ->
?line true = ets:delete_all_objects(T),
?line '$end_of_table' = ets:next(T,O),
?line 0 = ets:info(T,size),
- ?line 4000 = ets:info(T,kept_objects),
+ ?line 4000 = get_kept_objects(T),
?line ets:safe_fixtable(T,false),
?line 0 = ets:info(T,size),
- ?line 0 = ets:info(T,kept_objects),
+ ?line 0 = get_kept_objects(T),
?line filltabint(T,4000),
?line 4000 = ets:info(T,size),
?line true = ets:delete_all_objects(T),
@@ -859,10 +869,10 @@ t_delete_object_do(Opts) ->
?line ets:delete_object(T,{First, integer_to_list(First)}),
?line Next = ets:next(T,First),
?line 3999 = ets:info(T,size),
- ?line 1 = ets:info(T,kept_objects),
+ ?line 1 = get_kept_objects(T),
?line ets:safe_fixtable(T,false),
?line 3999 = ets:info(T,size),
- ?line 0 = ets:info(T,kept_objects),
+ ?line 0 = get_kept_objects(T),
?line ets:delete(T),
?line T1 = ets_new(x,[ordered_set | Opts]),
?line filltabint(T1,4000),
@@ -2715,7 +2725,8 @@ ordered_do(Opts) ->
9,10,11,12,
1,2,3,4,
17,18,19,20,
- 13,14,15,16
+ 13,14,15,16,
+ 1 bsl 33
],
?line lists:foreach(fun(X) ->
ets:insert(T,{X,integer_to_list(X)})
@@ -2730,13 +2741,14 @@ ordered_do(Opts) ->
?line S2 = L2,
?line [{1,"1"}] = ets:slot(T,0),
?line [{28,"28"}] = ets:slot(T,27),
+ ?line [{1 bsl 33,_}] = ets:slot(T,28),
?line 27 = ets:prev(T,28),
?line [{7,"7"}] = ets:slot(T,6),
- ?line '$end_of_table' = ets:next(T,28),
+ ?line '$end_of_table' = ets:next(T,1 bsl 33),
?line [{12,"12"}] = ets:slot(T,11),
- ?line '$end_of_table' = ets:slot(T,28),
+ ?line '$end_of_table' = ets:slot(T,29),
?line [{1,"1"}] = ets:slot(T,0),
- ?line 28 = ets:prev(T,29),
+ ?line 28 = ets:prev(T,1 bsl 33),
?line 1 = ets:next(T,0),
?line pick_all_forward(T),
?line [{7,"7"}] = ets:slot(T,6),
@@ -4967,7 +4979,7 @@ grow_pseudo_deleted_do(Type) ->
[true]}]),
Left = Mult*(Mod-1),
?line Left = ets:info(T,size),
- ?line Mult = ets:info(T,kept_objects),
+ ?line Mult = get_kept_objects(T),
filltabstr(T,Mult),
spawn_opt(fun()-> ?line true = ets:info(T,fixed),
Self ! start,
@@ -4981,7 +4993,7 @@ grow_pseudo_deleted_do(Type) ->
?line true = ets:safe_fixtable(T,false),
io:format("Unfix table done. ~p nitems=~p\n",[now(),ets:info(T,size)]),
?line false = ets:info(T,fixed),
- ?line 0 = ets:info(T,kept_objects),
+ ?line 0 = get_kept_objects(T),
?line done = receive_any(),
%%verify_table_load(T), % may fail if concurrency is poor (genny)
ets:delete(T),
@@ -5008,7 +5020,7 @@ shrink_pseudo_deleted_do(Type) ->
[{'>', '$1', Half}],
[true]}]),
?line Half = ets:info(T,size),
- ?line Half = ets:info(T,kept_objects),
+ ?line Half = get_kept_objects(T),
spawn_opt(fun()-> ?line true = ets:info(T,fixed),
Self ! start,
io:format("Starting to delete... ~p\n",[now()]),
@@ -5021,7 +5033,7 @@ shrink_pseudo_deleted_do(Type) ->
?line true = ets:safe_fixtable(T,false),
io:format("Unfix table done. ~p nitems=~p\n",[now(),ets:info(T,size)]),
?line false = ets:info(T,fixed),
- ?line 0 = ets:info(T,kept_objects),
+ ?line 0 = get_kept_objects(T),
?line done = receive_any(),
%%verify_table_load(T), % may fail if concurrency is poor (genny)
ets:delete(T),
@@ -5137,7 +5149,7 @@ smp_fixed_delete_do() ->
?line 0 = ets:info(T,size),
?line true = ets:info(T,fixed),
?line Buckets = num_of_buckets(T),
- ?line NumOfObjs = ets:info(T,kept_objects),
+ ?line NumOfObjs = get_kept_objects(T),
ets:safe_fixtable(T,false),
%% Will fail as unfix does not shrink the table:
%%?line Mem = ets:info(T,memory),
@@ -5169,7 +5181,7 @@ smp_unfix_fix_do() ->
Left = NumOfObjs - Deleted,
?line Left = ets:info(T,size),
?line true = ets:info(T,fixed),
- ?line Deleted = ets:info(T,kept_objects),
+ ?line Deleted = get_kept_objects(T),
{Child, Mref} =
spawn_opt(fun()-> ?line true = ets:info(T,fixed),
@@ -5186,7 +5198,7 @@ smp_unfix_fix_do() ->
end,
Deleted),
?line 0 = ets:info(T,size),
- ?line true = ets:info(T,kept_objects) >= Left,
+ ?line true = get_kept_objects(T) >= Left,
?line done = receive_any()
end,
[link, monitor, {scheduler,2}]),
@@ -5199,7 +5211,7 @@ smp_unfix_fix_do() ->
Child ! done,
{'DOWN', Mref, process, Child, normal} = receive_any(),
?line false = ets:info(T,fixed),
- ?line 0 = ets:info(T,kept_objects),
+ ?line 0 = get_kept_objects(T),
%%verify_table_load(T),
ets:delete(T),
process_flag(scheduler,0).
@@ -5237,7 +5249,7 @@ otp_8166_do(WC) ->
ZombieCrPid ! quit,
{'DOWN', ZombieCrMref, process, ZombieCrPid, normal} = receive_any(),
?line false = ets:info(T,fixed),
- ?line 0 = ets:info(T,kept_objects),
+ ?line 0 = get_kept_objects(T),
%%verify_table_load(T),
ets:delete(T),
process_flag(scheduler,0).
@@ -5304,7 +5316,7 @@ otp_8166_zombie_creator(T,Deleted) ->
verify_table_load(T) ->
?line Stats = ets:info(T,stats),
- ?line {Buckets,AvgLen,StdDev,ExpSD,_MinLen,_MaxLen} = Stats,
+ ?line {Buckets,AvgLen,StdDev,ExpSD,_MinLen,_MaxLen,_} = Stats,
?line ok = if
AvgLen > 7 ->
io:format("Table overloaded: Stats=~p\n~p\n",
@@ -5420,7 +5432,39 @@ types_do(Opts) ->
?line verify_etsmem(EtsMem).
-
+otp_9423(doc) -> ["vm-deadlock caused by race between ets:delete and others on write_concurrency table"];
+otp_9423(Config) when is_list(Config) ->
+ InitF = fun(_) -> {0,0} end,
+ ExecF = fun({S,F}) ->
+ receive
+ stop ->
+ io:format("~p got stop\n", [self()]),
+ [end_of_work | {"Succeded=",S,"Failed=",F}]
+ after 0 ->
+ %%io:format("~p (~p) doing lookup\n", [self(), {S,F}]),
+ try ets:lookup(otp_9423, key) of
+ [] -> {S+1,F}
+ catch
+ error:badarg -> {S,F+1}
+ end
+ end
+ end,
+ FiniF = fun(R) -> R end,
+ case run_workers(InitF, ExecF, FiniF, infinite, 1) of
+ Pids when is_list(Pids) ->
+ %%[P ! start || P <- Pids],
+ repeat(fun() -> ets:new(otp_9423, [named_table, public, {write_concurrency,true}]),
+ ets:delete(otp_9423)
+ end, 10000),
+ [P ! stop || P <- Pids],
+ wait_pids(Pids),
+ ok;
+
+ Skipped -> Skipped
+ end.
+
+
+
%
% Utility functions:
@@ -5434,21 +5478,30 @@ add_lists([E1|T1], [E2|T2], Acc) ->
add_lists(T1, T2, [E1+E2 | Acc]).
run_workers(InitF,ExecF,FiniF,Laps) ->
+ run_workers(InitF,ExecF,FiniF,Laps, 0).
+run_workers(InitF,ExecF,FiniF,Laps, Exclude) ->
case erlang:system_info(smp_support) of
true ->
- run_workers_do(InitF,ExecF,FiniF,Laps);
+ run_workers_do(InitF,ExecF,FiniF,Laps, Exclude);
false ->
{skipped,"No smp support"}
end.
-
+
run_workers_do(InitF,ExecF,FiniF,Laps) ->
- NumOfProcs = erlang:system_info(schedulers),
+ run_workers_do(InitF,ExecF,FiniF,Laps, 0).
+run_workers_do(InitF,ExecF,FiniF,Laps, Exclude) ->
+ ?line NumOfProcs = case erlang:system_info(schedulers) of
+ N when (N > Exclude) -> N - Exclude
+ end,
io:format("smp starting ~p workers\n",[NumOfProcs]),
Seeds = [{ProcN,random:uniform(9999)} || ProcN <- lists:seq(1,NumOfProcs)],
Parent = self(),
Pids = [spawn_link(fun()-> worker(Seed,InitF,ExecF,FiniF,Laps,Parent,NumOfProcs) end)
|| Seed <- Seeds],
- wait_pids(Pids).
+ case Laps of
+ infinite -> Pids;
+ _ -> wait_pids(Pids)
+ end.
worker({ProcN,Seed}, InitF, ExecF, FiniF, Laps, Parent, NumOfProcs) ->
io:format("smp worker ~p, seed=~p~n",[self(),Seed]),
@@ -5463,6 +5516,8 @@ worker_loop(0, _, State) ->
State;
worker_loop(_, _, [end_of_work|State]) ->
State;
+worker_loop(infinite, ExecF, State) ->
+ worker_loop(infinite,ExecF,ExecF(State));
worker_loop(N, ExecF, State) ->
worker_loop(N-1,ExecF,ExecF(State)).
@@ -5517,20 +5572,21 @@ etsmem() ->
case erlang:system_info({allocator,ets_alloc}) of
false -> undefined;
MemInfo ->
- MSBCS = lists:foldl(
- fun ({instance, _, L}, Acc) ->
- {value,{_,MBCS}} = lists:keysearch(mbcs, 1, L),
- {value,{_,SBCS}} = lists:keysearch(sbcs, 1, L),
- [MBCS,SBCS | Acc]
- end,
- [],
- MemInfo),
+ CS = lists:foldl(
+ fun ({instance, _, L}, Acc) ->
+ {value,{_,SBMBCS}} = lists:keysearch(sbmbcs, 1, L),
+ {value,{_,MBCS}} = lists:keysearch(mbcs, 1, L),
+ {value,{_,SBCS}} = lists:keysearch(sbcs, 1, L),
+ [SBMBCS,MBCS,SBCS | Acc]
+ end,
+ [],
+ MemInfo),
lists:foldl(
fun(L, {Bl0,BlSz0}) ->
{value,{_,Bl,_,_}} = lists:keysearch(blocks, 1, L),
{value,{_,BlSz,_,_}} = lists:keysearch(blocks_size, 1, L),
{Bl0+Bl,BlSz0+BlSz}
- end, {0,0}, MSBCS)
+ end, {0,0}, CS)
end},
{Mem,AllTabs}.
@@ -5872,7 +5928,7 @@ very_big_num(0, Result) ->
?line Result.
make_port() ->
- ?line open_port({spawn, efile}, [eof]).
+ ?line open_port({spawn, "efile"}, [eof]).
make_pid() ->
?line spawn_link(?MODULE, sleeper, []).
diff --git a/lib/stdlib/test/file_sorter_SUITE.erl b/lib/stdlib/test/file_sorter_SUITE.erl
index 80d4ea5fdc..74c08912be 100644
--- a/lib/stdlib/test/file_sorter_SUITE.erl
+++ b/lib/stdlib/test/file_sorter_SUITE.erl
@@ -89,7 +89,7 @@ basic(suite) ->
basic(Config) when is_list(Config) ->
Fmt = binary,
Arg = {format,Fmt},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
P0 = pps(),
?line F1s = [F1] = to_files([[]], Fmt, Config),
@@ -455,7 +455,7 @@ inout(suite) ->
[];
inout(Config) when is_list(Config) ->
BTF = {format, binary_term},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is fun.
End = fun(read) -> end_of_input end,
@@ -522,7 +522,7 @@ many(doc) ->
many(suite) ->
[];
many(Config) when is_list(Config) ->
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
PrivDir = ?privdir(Config),
P0 = pps(),
@@ -587,7 +587,7 @@ misc(suite) ->
[];
misc(Config) when is_list(Config) ->
BTF = {format, binary_term},
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
FFoo = filename:absname(Foo),
P0 = pps(),
@@ -704,7 +704,7 @@ misc(Config) when is_list(Config) ->
sort(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,5} | XArgs]),
TmpArgs = [{tmpdir,?privdir(Config)} | Args],
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is a fun. Output is a fun.
?line [] = file_sorter:sort(input([], 2, Fmt), output([], Fmt), Args),
@@ -777,7 +777,7 @@ sort(Fmt, XArgs, Config) ->
keysort(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,50}, {no_files, 2} | XArgs]),
TmpArgs = Args ++ [{tmpdir,?privdir(Config)}],
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is files. Output is a file.
?line ok = file_sorter:keysort(2, [], Foo, Args),
@@ -836,7 +836,7 @@ keysort(Fmt, XArgs, Config) ->
merge(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,5} | XArgs]),
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is a file. Output is a fun.
?line [] = file_sorter:merge([], output([], Fmt), Args),
@@ -873,7 +873,7 @@ merge(Fmt, XArgs, Config) ->
keymerge(Fmt, XArgs, Config) ->
Args = make_args(Fmt, [{size,50}, {no_files, 2} | XArgs]),
- Foo = outfile(foo, Config),
+ Foo = outfile("foo", Config),
%% Input is files. Output is a file.
?line ok = file_sorter:keymerge(2, [], Foo, Args),
diff --git a/lib/stdlib/test/filelib_SUITE.erl b/lib/stdlib/test/filelib_SUITE.erl
index a355097fe2..3010f5e760 100644
--- a/lib/stdlib/test/filelib_SUITE.erl
+++ b/lib/stdlib/test/filelib_SUITE.erl
@@ -243,7 +243,7 @@ otp_5960(doc) ->
["Test that filelib:ensure_dir/1 returns ok or {error,Reason}"];
otp_5960(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
- ?line Dir = filename:join(PrivDir, otp_5960_dir),
+ ?line Dir = filename:join(PrivDir, "otp_5960_dir"),
?line Name1 = filename:join(Dir, name1),
?line Name2 = filename:join(Dir, name2),
?line ok = filelib:ensure_dir(Name1), % parent is created
@@ -268,7 +268,7 @@ otp_5960(Config) when is_list(Config) ->
ensure_dir_eexist(Config) when is_list(Config) ->
?line PrivDir = ?config(priv_dir, Config),
- ?line Dir = filename:join(PrivDir, ensure_dir_eexist),
+ ?line Dir = filename:join(PrivDir, "ensure_dir_eexist"),
?line Name = filename:join(Dir, "same_name_as_file_and_dir"),
?line ok = filelib:ensure_dir(Name),
?line ok = file:write_file(Name, <<"some string\n">>),
diff --git a/lib/stdlib/test/io_SUITE.erl b/lib/stdlib/test/io_SUITE.erl
index 54a98985cd..bb02a879c2 100644
--- a/lib/stdlib/test/io_SUITE.erl
+++ b/lib/stdlib/test/io_SUITE.erl
@@ -27,7 +27,7 @@
otp_6282/1, otp_6354/1, otp_6495/1, otp_6517/1, otp_6502/1,
manpage/1, otp_6708/1, otp_7084/1, otp_7421/1,
io_lib_collect_line_3_wb/1, cr_whitespace_in_string/1,
- io_fread_newlines/1, otp_8989/1]).
+ io_fread_newlines/1, otp_8989/1, io_lib_fread_literal/1]).
%-define(debug, true).
@@ -62,7 +62,7 @@ all() ->
otp_6282, otp_6354, otp_6495, otp_6517, otp_6502,
manpage, otp_6708, otp_7084, otp_7421,
io_lib_collect_line_3_wb, cr_whitespace_in_string,
- io_fread_newlines, otp_8989].
+ io_fread_newlines, otp_8989, io_lib_fread_literal].
groups() ->
[].
@@ -1995,3 +1995,29 @@ otp_8989(Suite) when is_list(Suite) ->
?line "Hel " = fmt("~-4.*s", [3,Hello]),
?line "Hel " = fmt("~*.*s", [-4,3,Hello]),
ok.
+
+io_lib_fread_literal(doc) ->
+ "OTP-9439 io_lib:fread bug for literate at end";
+io_lib_fread_literal(Suite) when is_list(Suite) ->
+ ?line {more,"~d",0,""} = io_lib:fread("~d", ""),
+ ?line {error,{fread,integer}} = io_lib:fread("~d", " "),
+ ?line {more,"~d",1,""} = io_lib:fread(" ~d", " "),
+ ?line {ok,[17],"X"} = io_lib:fread(" ~d", " 17X"),
+ %%
+ ?line {more,"d",0,""} = io_lib:fread("d", ""),
+ ?line {error,{fread,input}} = io_lib:fread("d", " "),
+ ?line {more,"d",1,""} = io_lib:fread(" d", " "),
+ ?line {ok,[],"X"} = io_lib:fread(" d", " dX"),
+ %%
+ ?line {done,eof,_} = io_lib:fread([], eof, "~d"),
+ ?line {done,eof,_} = io_lib:fread([], eof, " ~d"),
+ ?line {more,C1} = io_lib:fread([], " \n", " ~d"),
+ ?line {done,{error,{fread,input}},_} = io_lib:fread(C1, eof, " ~d"),
+ ?line {done,{ok,[18]},""} = io_lib:fread(C1, "18\n", " ~d"),
+ %%
+ ?line {done,eof,_} = io_lib:fread([], eof, "d"),
+ ?line {done,eof,_} = io_lib:fread([], eof, " d"),
+ ?line {more,C2} = io_lib:fread([], " \n", " d"),
+ ?line {done,{error,{fread,input}},_} = io_lib:fread(C2, eof, " d"),
+ ?line {done,{ok,[]},[]} = io_lib:fread(C2, "d\n", " d"),
+ ok.
diff --git a/lib/stdlib/test/string_SUITE.erl b/lib/stdlib/test/string_SUITE.erl
index 1dcd4be21e..6969c095a0 100644
--- a/lib/stdlib/test/string_SUITE.erl
+++ b/lib/stdlib/test/string_SUITE.erl
@@ -273,9 +273,9 @@ words(Config) when is_list(Config) ->
?line 2 = string:words("2.35", $.),
?line 100 = string:words(string:copies(". ", 100)),
%% invalid arg type
- ?line {'EXIT',_} = (catch string:chars(hej)),
+ ?line {'EXIT',_} = (catch string:chars(hej, 1)),
%% invalid arg type
- ?line {'EXIT',_} = (catch string:chars("hej", " ")),
+ ?line {'EXIT',_} = (catch string:chars("hej", 1, " ")),
ok.
diff --git a/lib/stdlib/test/supervisor_SUITE.erl b/lib/stdlib/test/supervisor_SUITE.erl
index c79a5002fb..b48450c151 100644
--- a/lib/stdlib/test/supervisor_SUITE.erl
+++ b/lib/stdlib/test/supervisor_SUITE.erl
@@ -42,7 +42,7 @@
-export([ permanent_normal/1, transient_normal/1,
temporary_normal/1,
permanent_abnormal/1, transient_abnormal/1,
- temporary_abnormal/1]).
+ temporary_abnormal/1, temporary_bystander/1]).
%% Restart strategy tests
-export([ one_for_one/1,
@@ -74,7 +74,7 @@ all() ->
{group, abnormal_termination}, child_unlink, tree,
count_children_memory, do_not_save_start_parameters_for_temporary_children,
do_not_save_child_specs_for_temporary_children,
- simple_one_for_one_scale_many_temporary_children].
+ simple_one_for_one_scale_many_temporary_children, temporary_bystander].
groups() ->
[{sup_start, [],
@@ -114,10 +114,9 @@ end_per_group(_GroupName, Config) ->
Config.
init_per_testcase(count_children_memory, Config) ->
- MemoryState = erlang:system_info(allocator),
- case count_children_allocator_test(MemoryState) of
- true -> Config;
- false ->
+ try erlang:memory() of
+ _ -> Config
+ catch error:notsup ->
{skip, "+Meamin used during test; erlang:memory/1 not available"}
end;
init_per_testcase(_Case, Config) ->
@@ -608,6 +607,37 @@ temporary_abnormal(Config) when is_list(Config) ->
[0,0,0,0] = get_child_counts(sup_test).
%%-------------------------------------------------------------------------
+temporary_bystander(doc) ->
+ ["A temporary process killed as part of a rest_for_one or one_for_all "
+ "restart strategy should not be restarted given its args are not "
+ " saved. Otherwise the supervisor hits its limit and crashes."];
+temporary_bystander(suite) -> [];
+temporary_bystander(_Config) ->
+ Child1 = {child1, {supervisor_1, start_child, []}, permanent, 100,
+ worker, []},
+ Child2 = {child2, {supervisor_1, start_child, []}, temporary, 100,
+ worker, []},
+ {ok, SupPid1} = supervisor:start_link(?MODULE, {ok, {{one_for_all, 2, 300}, []}}),
+ {ok, SupPid2} = supervisor:start_link(?MODULE, {ok, {{rest_for_one, 2, 300}, []}}),
+ unlink(SupPid1), % otherwise we crash with it
+ unlink(SupPid2), % otherwise we crash with it
+ {ok, CPid1} = supervisor:start_child(SupPid1, Child1),
+ {ok, _CPid2} = supervisor:start_child(SupPid1, Child2),
+ {ok, CPid3} = supervisor:start_child(SupPid2, Child1),
+ {ok, _CPid4} = supervisor:start_child(SupPid2, Child2),
+ terminate(SupPid1, CPid1, child1, normal),
+ terminate(SupPid2, CPid3, child1, normal),
+ timer:sleep(350),
+ catch link(SupPid1),
+ catch link(SupPid2),
+ %% The supervisor would die attempting to restart child2
+ true = erlang:is_process_alive(SupPid1),
+ true = erlang:is_process_alive(SupPid2),
+ %% Child2 has not been restarted
+ [{child1, _, _, _}] = supervisor:which_children(SupPid1),
+ [{child1, _, _, _}] = supervisor:which_children(SupPid2).
+
+%%-------------------------------------------------------------------------
one_for_one(doc) ->
["Test the one_for_one base case."];
one_for_one(suite) -> [];
@@ -1032,17 +1062,6 @@ count_children_memory(Config) when is_list(Config) ->
[terminate(SupPid, Pid, child, kill) || {undefined, Pid, worker, _Modules} <- Children3],
[1,0,0,0] = get_child_counts(sup_test).
-count_children_allocator_test(MemoryState) ->
- Allocators = [temp_alloc, eheap_alloc, binary_alloc, ets_alloc,
- driver_alloc, sl_alloc, ll_alloc, fix_alloc, std_alloc,
- sys_alloc],
- MemoryStateList = element(4, MemoryState),
- AllocTypes = [lists:keyfind(Alloc, 1, MemoryStateList)
- || Alloc <- Allocators],
- AllocStates = [lists:keyfind(e, 1, AllocValue)
- || {_Type, AllocValue} <- AllocTypes],
- lists:all(fun(State) -> State == {e, true} end, AllocStates).
-
%%-------------------------------------------------------------------------
do_not_save_start_parameters_for_temporary_children(doc) ->
["Temporary children shall not be restarted so they should not "
diff --git a/lib/stdlib/test/supervisor_bridge_SUITE.erl b/lib/stdlib/test/supervisor_bridge_SUITE.erl
index f2dbad0b3b..c4d696564d 100644
--- a/lib/stdlib/test/supervisor_bridge_SUITE.erl
+++ b/lib/stdlib/test/supervisor_bridge_SUITE.erl
@@ -158,7 +158,7 @@ internal_loop(State) ->
terminate(Reason,{Parent,Worker}) ->
%% This func knows about supervisor_bridge
io:format("Terminating bridge...\n"),
- exit(kill,Worker),
+ exit(Worker,kill),
Parent ! {dying,Reason},
anything.
diff --git a/lib/stdlib/test/sys_SUITE.erl b/lib/stdlib/test/sys_SUITE.erl
index 72b089aa3f..fe039e8bcc 100644
--- a/lib/stdlib/test/sys_SUITE.erl
+++ b/lib/stdlib/test/sys_SUITE.erl
@@ -71,7 +71,7 @@ log_to_file(Config) when is_list(Config) ->
?line ok = sys:log_to_file(?server,TempName),
?line {ok,-44} = public_call(44),
?line ok = sys:log_to_file(?server,false),
- ?line {ok,Fd} = file:open(TempName,read),
+ ?line {ok,Fd} = file:open(TempName,[read]),
?line Msg1 = io:get_line(Fd,''),
?line Msg2 = io:get_line(Fd,''),
?line file:close(Fd),
diff --git a/lib/stdlib/test/tar_SUITE.erl b/lib/stdlib/test/tar_SUITE.erl
index e32704ca65..9ad3936928 100644
--- a/lib/stdlib/test/tar_SUITE.erl
+++ b/lib/stdlib/test/tar_SUITE.erl
@@ -65,7 +65,7 @@ borderline(Config) when is_list(Config) ->
?line {ok, Cwd} = file:get_cwd(),
?line RootDir = ?config(priv_dir, Config),
- ?line TempDir = remove_prefix(Cwd++"/", filename:join(RootDir, borderline)),
+ ?line TempDir = remove_prefix(Cwd++"/", filename:join(RootDir, "borderline")),
?line ok = file:make_dir(TempDir),
?line Record = 512,
@@ -283,17 +283,16 @@ long_names(doc) ->
long_names(Config) when is_list(Config) ->
?line DataDir = ?config(data_dir, Config),
?line Long = filename:join(DataDir, "long_names.tar"),
+ run_in_short_tempdir(Config,
+ fun() -> do_long_names(Long) end).
+do_long_names(Long) ->
%% Try table/2 and extract/2.
?line case erl_tar:table(Long, [verbose]) of
{ok,List} when is_list(List) ->
?line io:format("~p\n", [List])
end,
-
- %% To avoid getting too long paths for Windows to handle, extract into
- %% the current directory (which is the test_server directory). Its path
- %% is quite a bit shorter than the path to priv_dir.
?line {ok,Cwd} = file:get_cwd(),
?line ok = erl_tar:extract(Long),
?line Base = filename:join([Cwd, "original_software", "written_by",
@@ -312,29 +311,28 @@ long_names(Config) when is_list(Config) ->
?line "Here"++_ = binary_to_list(First),
?line "And"++_ = binary_to_list(Second),
- %% Clean up.
- ?line delete_files([filename:join(Cwd, "original_software"),EmptyDir]),
-
ok.
create_long_names(doc) ->
["Creates a tar file from a deep directory structure (filenames are ",
"longer than 100 characters)."];
create_long_names(Config) when is_list(Config) ->
- ?line PrivDir = ?config(priv_dir, Config),
- ?line ok = file:set_cwd(PrivDir),
- Dirs = [aslfjkshjkhliuf,
- asdhjfehnbfsky,
- sahajfskdfhsz,
- asldfkdlfy4y8rchg,
- f7nafhjgffagkhsfkhsjk,
- dfjasldkfjsdkfjashbv],
+ run_in_short_tempdir(Config, fun create_long_names/0).
+
+create_long_names() ->
+ ?line {ok,Dir} = file:get_cwd(),
+ Dirs = ["aslfjkshjkhliuf",
+ "asdhjfehnbfsky",
+ "sahajfskdfhsz",
+ "asldfkdlfy4y8rchg",
+ "f7nafhjgffagkhsfkhsjk",
+ "dfjasldkfjsdkfjashbv"],
?line DeepDir = make_dirs(Dirs, []),
?line AFile = filename:join(DeepDir, "a_file"),
?line Hello = "hello, world\n",
?line ok = file:write_file(AFile, Hello),
- ?line TarName = filename:join(PrivDir, "my_tar_with_long_names.tar"),
+ ?line TarName = filename:join(Dir, "my_tar_with_long_names.tar"),
?line ok = erl_tar:create(TarName, [AFile]),
%% Print contents.
@@ -347,9 +345,6 @@ create_long_names(Config) when is_list(Config) ->
?line {ok, Bin} = file:read_file(filename:join(ExtractDir, AFile)),
?line Hello = binary_to_list(Bin),
- %% Clean up.
- ?line delete_files([ExtractDir,TarName,hd(Dirs)]),
-
ok.
make_dirs([Dir|Rest], []) ->
@@ -487,7 +482,7 @@ extract_from_binary_compressed(Config) when is_list(Config) ->
%% Trying extracting from a binary.
?line ok = erl_tar:extract({binary,Bin}, [compressed,{cwd,ExtractDir}]),
- ?line {ok,List} = file:list_dir(filename:join(ExtractDir, ddll_SUITE_data)),
+ ?line {ok,List} = file:list_dir(filename:join(ExtractDir, "ddll_SUITE_data")),
?line io:format("~p\n", [List]),
?line 19 = length(List),
@@ -676,7 +671,7 @@ cooked_compressed(Config) when is_list(Config) ->
end, List),
%% Clean up.
- ?line delete_files([filename:join(PrivDir, ddll_SUITE_data)]),
+ ?line delete_files([filename:join(PrivDir, "ddll_SUITE_data")]),
ok.
memory(doc) ->
@@ -734,3 +729,42 @@ delete_files([Item|Rest]) ->
end,
delete_files(Rest).
+%% Move to a temporary directory with as short name as possible and
+%% execute Fun. Remove the directory and any files in it afterwards.
+%% This is necessary because pathnames on Windows may be limited to
+%% 260 characters.
+run_in_short_tempdir(Config, Fun) ->
+ {ok,Cwd} = file:get_cwd(),
+ PrivDir0 = ?config(priv_dir, Config),
+
+ %% Normalize name to make sure that there is no slash at the end.
+ PrivDir = filename:absname(PrivDir0),
+
+ %% We need a base directory with a much shorter pathname than
+ %% priv_dir. We KNOW that priv_dir is located four levels below
+ %% the directory that common_test puts the ct_run.* directories
+ %% in. That fact is not documented, but an usually reliable source
+ %% assured me that the directory structure is unlikely to change
+ %% in future versions of common_test because of backward
+ %% compatibility (tools developed by users of common_test depend
+ %% on the current directory layout).
+ Base = lists:foldl(fun(_, D) ->
+ filename:dirname(D)
+ end, PrivDir, [1,2,3,4]),
+
+ Dir = make_temp_dir(Base, 0),
+ ok = file:set_cwd(Dir),
+ io:format("Running test in ~s\n", [Dir]),
+ try
+ Fun()
+ after
+ file:set_cwd(Cwd),
+ delete_files([Dir])
+ end.
+
+make_temp_dir(Base, I) ->
+ Name = filename:join(Base, integer_to_list(I, 36)),
+ case file:make_dir(Name) of
+ ok -> Name;
+ {error,eexist} -> make_temp_dir(Base, I+1)
+ end.
diff --git a/lib/stdlib/test/zip_SUITE.erl b/lib/stdlib/test/zip_SUITE.erl
index d5f2cd52d4..7233c061ef 100644
--- a/lib/stdlib/test/zip_SUITE.erl
+++ b/lib/stdlib/test/zip_SUITE.erl
@@ -375,7 +375,8 @@ zip_options(Config) when is_list(Config) ->
ok = file:set_cwd(?config(data_dir, Config)),
%% Create a zip archive
- {ok, Zip} = zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
+ {ok, {_,Zip}} =
+ zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
%% Open archive
{ok, ZipSrv} = zip:zip_open(Zip, [memory]),
diff --git a/lib/stdlib/vsn.mk b/lib/stdlib/vsn.mk
index c0956030cf..9d4ed17774 100644
--- a/lib/stdlib/vsn.mk
+++ b/lib/stdlib/vsn.mk
@@ -1 +1 @@
-STDLIB_VSN = 1.17.4
+STDLIB_VSN = 1.17.5
diff --git a/lib/test_server/src/test_server_ctrl.erl b/lib/test_server/src/test_server_ctrl.erl
index de9b962dfc..f3445b742b 100644
--- a/lib/test_server/src/test_server_ctrl.erl
+++ b/lib/test_server/src/test_server_ctrl.erl
@@ -4674,13 +4674,13 @@ collect_subcases(Mod, Case, MFA, St, Suite) ->
[] when Case == all -> {ok,[],St};
[] when element(1, Case) == conf -> {ok,[],St};
[] -> {ok,[MFA],St};
-%%%! --- START Kept for backwards compatibilty ---
+%%%! --- START Kept for backwards compatibility ---
%%%! Requirements are not used
{req,ReqList} ->
collect_case_deny(Mod, Case, MFA, ReqList, [], St);
{req,ReqList,SubCases} ->
collect_case_deny(Mod, Case, MFA, ReqList, SubCases, St);
-%%%! --- END Kept for backwards compatibilty ---
+%%%! --- END Kept for backwards compatibility ---
{Skip,Reason} when Skip==skip; Skip==skipped ->
{ok,[{skip_case,{MFA,Reason}}],St};
{error,Reason} ->
diff --git a/lib/test_server/src/ts.config b/lib/test_server/src/ts.config
index f021f5958b..cf3d269616 100644
--- a/lib/test_server/src/ts.config
+++ b/lib/test_server/src/ts.config
@@ -12,7 +12,7 @@
% "10.10.0.1", %IP string
% {10,10,0,1}, %IP tuple
% ["my_ip4_host"], %Any aliases
-% "::ffff:10.10.0.1", %IPv6 string (compatibilty addr)
+% "::ffff:10.10.0.1", %IPv6 string (compatibility addr)
% {0,0,0,0,0,65535,2570,1} %IPv6 tuple
% }}.
diff --git a/lib/test_server/src/ts_install_cth.erl b/lib/test_server/src/ts_install_cth.erl
index c5444a342f..a41916fd0a 100644
--- a/lib/test_server/src/ts_install_cth.erl
+++ b/lib/test_server/src/ts_install_cth.erl
@@ -49,8 +49,7 @@
-include_lib("kernel/include/file.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -65,19 +64,19 @@ id(_Opts) ->
?MODULE.
%% @doc Always called before any other callback function.
--spec init(Id :: term(), Opts :: proplist()) ->
- State :: #state{}.
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
+ {ok, State :: #state{}}.
init(_Id, Opts) ->
Nodenames = proplists:get_value(nodenames, Opts, 0),
Nodes = proplists:get_value(nodes, Opts, 0),
TSConfDir = proplists:get_value(ts_conf_dir, Opts),
TargetSystem = proplists:get_value(target_system, Opts, install_local),
InstallOpts = proplists:get_value(install_opts, Opts, []),
- #state{ nodenames = Nodenames,
- nodes = Nodes,
- ts_conf_dir = TSConfDir,
- target_system = TargetSystem,
- install_opts = InstallOpts }.
+ {ok, #state{ nodenames = Nodenames,
+ nodes = Nodes,
+ ts_conf_dir = TSConfDir,
+ target_system = TargetSystem,
+ install_opts = InstallOpts } }.
%% @doc Called before init_per_suite is called.
-spec pre_init_per_suite(Suite :: atom(),
diff --git a/lib/test_server/test/Makefile b/lib/test_server/test/Makefile
index ab72a9d579..198440bb17 100644
--- a/lib/test_server/test/Makefile
+++ b/lib/test_server/test/Makefile
@@ -85,7 +85,7 @@ release_spec: opt
release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(EMAKEFILE) $(ERL_FILES) $(COVERFILE) $(RELSYSDIR)
- $(INSTALL_DATA) test_server.spec test_server.cover $(RELSYSDIR)
+ $(INSTALL_DATA) test_server_test_lib.hrl test_server.spec test_server.cover $(RELSYSDIR)
chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
diff --git a/lib/toolbar/src/toolbar_toolconfig.erl b/lib/toolbar/src/toolbar_toolconfig.erl
index 7d8f2b4d21..693a7b4570 100644
--- a/lib/toolbar/src/toolbar_toolconfig.erl
+++ b/lib/toolbar/src/toolbar_toolconfig.erl
@@ -126,7 +126,7 @@ loop(S,Window) ->
show_info(Window,Info),
move_focus(Window,file);
- %% Erronous version number -- Notify user
+ %% Erroneous version number -- Notify user
{error,version} ->
Win = Window#tfwindow.window,
tool_utils:notify(Win,[FileName,
@@ -136,7 +136,7 @@ loop(S,Window) ->
_Error ->
Win = Window#tfwindow.window,
tool_utils:notify(Win,[FileName,
- "File is on erronous format"])
+ "File is in erroneous format"])
end;
%% The file can not be read, show default values
diff --git a/lib/tools/doc/src/instrument.xml b/lib/tools/doc/src/instrument.xml
index 12877994de..a7c62c8770 100644
--- a/lib/tools/doc/src/instrument.xml
+++ b/lib/tools/doc/src/instrument.xml
@@ -342,7 +342,7 @@
<p>Stores the current memory allocation map on the file
<c>File</c>. Returns <c>true</c> if the emulator has been
started with the "<c>+Mim true</c>" command-line argument, and
- the map was successfuly stored; otherwise, <c>false</c>. The
+ the map was successfully stored; otherwise, <c>false</c>. The
contents of the file can later be read using
<seealso marker="#read_memory_data/1">read_memory_data/1</seealso>.
<em>NOTE:</em><c>store_memory_data/0</c> blocks execution of
@@ -360,7 +360,7 @@
<p>Stores the current memory status on the file
<c>File</c>. Returns <c>true</c> if the emulator has been
started with the "<c>+Mis true</c>", or "<c>+Mim true</c>"
- command-line arguments, and the data was successfuly stored;
+ command-line arguments, and the data was successfully stored;
otherwise, <c>false</c>. The contents of the file can later be
read using
<seealso marker="#read_memory_status/1">read_memory_status/1</seealso>.</p>
diff --git a/lib/tools/doc/src/xref.xml b/lib/tools/doc/src/xref.xml
index 75ffa25311..17de66bb22 100644
--- a/lib/tools/doc/src/xref.xml
+++ b/lib/tools/doc/src/xref.xml
@@ -4,7 +4,7 @@
<erlref>
<header>
<copyright>
- <year>2000</year><year>2010</year>
+ <year>2000</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -1465,8 +1465,8 @@ Evaluates a predefined analysis.
<name>start(NameOrOptions) -> Return</name>
<fsummary>Create an Xref server.</fsummary>
<type>
- <v>Name = atom()()</v>
- <v>XrefOrOptions = Xref | Options</v>
+ <v>NameOrOptions = Name | Options</v>
+ <v>Name = atom()</v>
<v>Options = [Option] | Option</v>
<v>Option = {xref_mode, mode()} | term()</v>
<v>Return = {ok, pid()} | {error, {already_started, pid()}}</v>
@@ -1483,7 +1483,7 @@ Evaluates a predefined analysis.
<name>start(Name, Options) -> Return</name>
<fsummary>Create an Xref server.</fsummary>
<type>
- <v>Name = atom()()</v>
+ <v>Name = atom()</v>
<v>Options = [Option] | Option</v>
<v>Option = {xref_mode, mode()} | term()</v>
<v>Return = {ok, pid()} | {error, {already_started, pid()}}</v>
diff --git a/lib/tools/emacs/erlang.el b/lib/tools/emacs/erlang.el
index 6728bef2a4..bc7a190fb4 100644
--- a/lib/tools/emacs/erlang.el
+++ b/lib/tools/emacs/erlang.el
@@ -523,6 +523,32 @@ This is an elisp list of options. Each option can be either:
- a string
Example: '(bin_opt_info (i . \"/path1/include\") (i . \"/path2/include\"))")
+(defvar erlang-compile-command-function-alist
+ '((".erl\\'" . inferior-erlang-compute-erl-compile-command)
+ (".xrl\\'" . inferior-erlang-compute-leex-compile-command)
+ (".yrl\\'" . inferior-erlang-compute-yecc-compile-command)
+ ("." . inferior-erlang-compute-erl-compile-command))
+ "*Alist of filename patterns vs corresponding compilation functions.
+Each element looks like (REGEXP . FUNCTION). Compiling a file whose name
+matches REGEXP specifies FUNCTION to use to compute the compilation
+command. The FUNCTION will be called with two arguments: module name and
+default compilation options, like output directory. The FUNCTION
+is expected to return a string.")
+
+(defvar erlang-leex-compile-opts '()
+ "*Options to pass to leex when compiling xrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
+(defvar erlang-yecc-compile-opts '()
+ "*Options to pass to yecc when compiling yrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
(eval-and-compile
(defvar erlang-regexp-modern-p
(if (> erlang-emacs-major-version 21) t nil)
@@ -1199,7 +1225,7 @@ Lock syntax table. The effect is that `apply' in the atom
`( (char-after (1- (or ,pos (point)))))))
;; defvar some obsolete variables, which we still support for
-;; backwardscompatibility reasons.
+;; backwards compatibility reasons.
(eval-when-compile
(defvar comment-indent-hook)
(defvar dabbrev-case-fold-search)
@@ -5276,6 +5302,22 @@ unless the optional NO-DISPLAY is non-nil."
(file-name-as-directory buffer-dir))))
(defun inferior-erlang-compute-compile-command (module-name opts)
+ (let ((ccfn erlang-compile-command-function-alist)
+ (res (inferior-erlang-compute-erl-compile-command module-name opts))
+ ccfn-entry
+ done)
+ (if (not (null (buffer-file-name)))
+ (while (and (not done) (not (null ccfn)))
+ (setq ccfn-entry (car ccfn))
+ (setq ccfn (cdr ccfn))
+ (if (string-match (car ccfn-entry) (buffer-file-name))
+ (let ((c-fn (cdr ccfn-entry)))
+ (setq done t)
+ (if (not (null c-fn))
+ (setq result (funcall c-fn module-name opts)))))))
+ result))
+
+(defun inferior-erlang-compute-erl-compile-command (module-name opts)
(let* ((out-dir-opt (assoc 'outdir opts))
(out-dir (cdr out-dir-opt)))
(if erlang-compile-use-outdir
@@ -5299,6 +5341,48 @@ unless the optional NO-DISPLAY is non-nil."
(remq out-dir-opt opts))
tmpvar tmpvar tmpvar2)))))
+(defun inferior-erlang-compute-leex-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(LErr1__), f(LErr2__), "
+ "case case leex:file(\"%s\", [%s]) of"
+ " ok -> ok;"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " LErr1__ -> LErr1__ "
+ "end of"
+ " ok -> %s;"
+ " LErr2__ -> LErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-leex-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-compute-yecc-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(YErr1__), f(YErr2__), "
+ "case case yecc:file(\"%s\", [%s]) of"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " YErr1__ -> YErr1__ "
+ "end of"
+ " ok -> %s;"
+ " YErr2__ -> YErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-yecc-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-remove-any-trailing-dot (str)
+ (if (string= (substring str -1) ".")
+ (substring str 0 (1- (length str)))
+ str))
+
(defun inferior-erlang-format-comma-opts (opts)
(if (null opts)
""
diff --git a/lib/tools/src/cover.erl b/lib/tools/src/cover.erl
index 905ad895c9..fb9744d759 100644
--- a/lib/tools/src/cover.erl
+++ b/lib/tools/src/cover.erl
@@ -55,14 +55,14 @@
%% compiled module. This is necessary so that the code can be loaded
%% on remote nodes that are started after the compilation.
%%
-%% PARELLALISM
+%% PARALLELISM
%% To take advantage of SMP when doing the cover analysis both the data
%% collection and analysis has been parallelized. One process is spawned for
%% each node when collecting data, and on the remote node when collecting data
%% one process is spawned per module.
%%
%% When analyzing data it is possible to issue multiple analyse(_to_file)/X
-%% calls at once. They are however all calls (for backwardscompatability
+%% calls at once. They are however all calls (for backwards compatibility
%% reasons) so the user of cover will have to spawn several processes to to the
%% calls ( or use async_analyse_to_file ).
%%
diff --git a/lib/typer/src/typer.erl b/lib/typer/src/typer.erl
index e40c4f39cd..fd906c8c46 100644
--- a/lib/typer/src/typer.erl
+++ b/lib/typer/src/typer.erl
@@ -539,7 +539,7 @@ get_type_string(F, A, Info, Mode) ->
case {Mode, Type} of
{file, {contract, _}} -> "";
_ ->
- Prefix = lists:concat(["-spec ", F]),
+ Prefix = lists:concat(["-spec ", erl_types:atom_to_string(F)]),
lists:concat([Prefix, TypeStr, "."])
end;
true ->
diff --git a/lib/webtool/priv/Makefile b/lib/webtool/priv/Makefile
index 56ab772c45..6e1c6606fe 100644
--- a/lib/webtool/priv/Makefile
+++ b/lib/webtool/priv/Makefile
@@ -39,8 +39,12 @@ HTDOCS_FILES = root/doc/index.html \
root/doc/tool_management.html \
root/doc/start_info.html
-SCRIPTS = bin/start_webtool \
- bin/start_webtool.bat
+ifeq ($(findstring win32,$(TARGET)),win32)
+WIN32_SCRIPTS= bin/start_webtool.bat
+else
+WIN32_SCRIPTS=
+endif
+SCRIPTS = bin/start_webtool $(WIN32_SCRIPTS)
# ----------------------------------------------------
# FLAGS
diff --git a/lib/wx/api_gen/gen_util.erl b/lib/wx/api_gen/gen_util.erl
index b53f817ce0..df5b4c3405 100644
--- a/lib/wx/api_gen/gen_util.erl
+++ b/lib/wx/api_gen/gen_util.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -43,23 +43,27 @@ strip_name(String,[]) -> String.
get_hook(_Type, undefined) -> ignore;
get_hook(Type, List) -> proplists:get_value(Type, List, ignore).
-
+
+get_taylor_made(Str, Name) ->
+ re:run(Str, "<<"++Name++"(.*)"++Name++">>",
+ [dotall, {capture, all_but_first, list}]).
+
open_write(File) ->
%% io:format("Generating ~s~n",[File]),
{ok, Fd} = file:open(File++".temp", [write]),
put(current_file, {Fd,File}).
-
+
close() ->
case get(current_file) of
- undefined ->
+ undefined ->
ok;
{closed, File} ->
io:format("Closing twice ~s~n",[File]);
{Fd,File} ->
file:close(Fd),
case os:cmd("diff " ++ File ++ " " ++ File ++ ".temp" ++ "| head -30") of
- [] ->
+ [] ->
ok = file:delete(File ++ ".temp"),
%% So that make understands that we have made this
%% case os:getenv("CLEARCASE_ROOT") of
@@ -71,11 +75,11 @@ close() ->
case check_diff(Diff) of
copyright -> %% We ignore copyright changes only
ok = file:delete(File ++ ".temp");
- _ ->
+ _ ->
io:format("Diff in ~s~n~s ~n", [File, Diff]),
case file:rename(File ++ ".temp", File) of
ok -> ok;
- _ ->
+ _ ->
io:format("***** Failed to save file ~p ~n",[File])
end
end
@@ -85,9 +89,9 @@ close() ->
check_diff(Diff) ->
- try
+ try
[_,D1,_,D2|Tail] = re:split(Diff, "\n"),
- case Tail of
+ case Tail of
[] -> ok;
[<<>>] -> ok;
_ -> throw(diff)
@@ -117,29 +121,29 @@ args(Fun, Limit, List, Max) ->
args(Fun, Limit, List, Max, 0).
args(_Fun, _Limit, [], _Max, _) -> ""; %% No args
-args(Fun, _Limit, [Last], _Max, _Pos) ->
- case Fun(Last) of
+args(Fun, _Limit, [Last], _Max, _Pos) ->
+ case Fun(Last) of
skip -> ""; %% FIXME bug if last skips
Str -> Str
end;
args(Fun, Limit, [H|R], Max, Pos) ->
- case Fun(H) of
+ case Fun(H) of
skip -> args(Fun,Limit,R, Max, Pos);
- Str ->
- {NL, NewPos} =
+ Str ->
+ {NL, NewPos} =
case length(Str) + Pos of
Curr when Curr > Max ->
{"\n ", 0};
- Curr ->
+ Curr ->
{"", Curr}
end,
- case args(Fun,Limit,R, Max, NewPos) of
+ case args(Fun,Limit,R, Max, NewPos) of
"" -> Str;
End -> Str ++ Limit ++ NL ++ End
end
end.
-
+
tokens(S) ->
@@ -167,11 +171,11 @@ replace_and_remove([E|R], Acc) when is_list(E) -> %% Keep everything that is a w
replace_and_remove(R, [E|Acc]);
replace_and_remove([$\n | R], Acc) -> %% It is semi line oriented so keep eol
replace_and_remove(R, [eol|Acc]);
-replace_and_remove([$( | R], Acc) ->
+replace_and_remove([$( | R], Acc) ->
replace_and_remove(R, ["("|Acc]);
replace_and_remove([$) | R], Acc) ->
replace_and_remove(R, [")"|Acc]);
-replace_and_remove([${ | R], Acc) ->
+replace_and_remove([${ | R], Acc) ->
replace_and_remove(R, ["{"|Acc]);
replace_and_remove([$} | R], Acc) ->
replace_and_remove(R, ["}"|Acc]);
@@ -187,7 +191,7 @@ replace_and_remove([$, | R], Acc) ->
replace_and_remove(R, [cont|Acc]);
replace_and_remove([$; | R], Acc) ->
replace_and_remove(R, [eoe|Acc]);
-replace_and_remove([$@ | R], Acc) ->
+replace_and_remove([$@ | R], Acc) ->
replace_and_remove(R, [directive|Acc]);
replace_and_remove([_E|R], Acc) -> %% Ignore everthing else
@@ -213,7 +217,7 @@ erl_copyright() ->
w("%%~n",[]),
w("%% %CopyrightBegin%~n",[]),
w("%%~n",[]),
- w("%% Copyright Ericsson AB ~p-2010. All Rights Reserved.~n",
+ w("%% Copyright Ericsson AB ~p-2011. All Rights Reserved.~n",
[StartYear]),
w("%%~n",[]),
w("%% The contents of this file are subject to the Erlang Public License,~n",[]),
@@ -229,11 +233,11 @@ erl_copyright() ->
w("%%~n",[]),
w("%% %CopyrightEnd%~n",[]).
-c_copyright() ->
+c_copyright() ->
w("/*~n",[]),
w(" * %CopyrightBegin%~n",[]),
w(" *~n",[]),
- w(" * Copyright Ericsson AB 2008-2010. All Rights Reserved.~n",[]),
+ w(" * Copyright Ericsson AB 2008-2011. All Rights Reserved.~n",[]),
w(" *~n",[]),
w(" * The contents of this file are subject to the Erlang Public License,~n",[]),
w(" * Version 1.1, (the \"License\"); you may not use this file except in~n",[]),
diff --git a/lib/wx/api_gen/gl_gen.erl b/lib/wx/api_gen/gl_gen.erl
index 374e0bd12b..b665d949b3 100644
--- a/lib/wx/api_gen/gl_gen.erl
+++ b/lib/wx/api_gen/gl_gen.erl
@@ -44,7 +44,7 @@ devcode() -> spawn(fun() -> safe(fun gen_code/0,false) end).
safe(What, QuitOnErr) ->
try
What(),
- io:format("Completed succesfully~n~n", []),
+ io:format("Completed successfully~n~n", []),
QuitOnErr andalso gen_util:halt(0)
catch Err:Reason ->
io:format("Error ~p: ~p:~p~n ~p~n",
diff --git a/lib/wx/api_gen/wx_extra/wxListCtrl.c_src b/lib/wx/api_gen/wx_extra/wxListCtrl.c_src
index cd3074e481..54d6fafd01 100644
--- a/lib/wx/api_gen/wx_extra/wxListCtrl.c_src
+++ b/lib/wx/api_gen/wx_extra/wxListCtrl.c_src
@@ -1,3 +1,161 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+
+<<wxListCtrl_class
+class EwxListCtrl : public wxListCtrl {
+ public: ~EwxListCtrl();
+ EwxListCtrl(wxWindow * parent,wxWindowID winid,const wxPoint& pos,const wxSize& size,long style,const wxValidator& validator) : wxListCtrl(parent,winid,pos,size,style,validator) {};
+ EwxListCtrl() : wxListCtrl() {};
+
+ int onGetItemText;
+ int onGetItemAttr;
+ int onGetItemColumnImage;
+ ErlDrvPort port;
+
+ private:
+ virtual wxString OnGetItemText(long item, long col) const;
+ virtual wxListItemAttr* OnGetItemAttr(long item) const;
+ virtual int OnGetItemImage(long item) const;
+ virtual int OnGetItemColumnImage(long item, long column) const;
+};
+wxListCtrl_class>>
+
+<<wxListCtrl_new_0
+case ~s: { // wxListCtrl::wxListCtrl
+ wxListCtrl * Result = new EwxListCtrl();
+ newPtr((void *) Result, 0, memenv);
+ rt.addRef(getRef((void *)Result,memenv), "wxListCtrl");
+ break;
+}
+wxListCtrl_new_0>>
+
+<<wxListCtrl_new_2
+case ~s: { // wxListCtrl::wxListCtrl
+ wxWindowID winid=wxID_ANY;
+ wxPoint pos= wxDefaultPosition;
+ wxSize size= wxDefaultSize;
+ long style=wxLC_ICON;
+ const wxValidator * validator= &wxDefaultValidator;
+ wxWindow *parent = (wxWindow *) getPtr(bp,memenv); bp += 4;
+ int onGetItemText = 0, onGetItemAttr = 0, onGetItemColumnImage = 0;
+
+ bp += 4; /* Align */
+ while( * (int*) bp) { switch (* (int*) bp) {
+ case 1: {bp += 4;
+ winid = (wxWindowID)*(int *) bp; bp += 4;
+ } break;
+ case 2: {bp += 4;
+ int * posX = (int *) bp; bp += 4;
+ int * posY = (int *) bp; bp += 4;
+ pos = wxPoint(*posX,*posY);
+ bp += 4; /* Align */
+ } break;
+ case 3: {bp += 4;
+ int * sizeW = (int *) bp; bp += 4;
+ int * sizeH = (int *) bp; bp += 4;
+ size = wxSize(*sizeW,*sizeH);
+ bp += 4; /* Align */
+ } break;
+ case 4: {bp += 4;
+ style = (long)*(int *) bp; bp += 4;
+ } break;
+ case 5: {bp += 4;
+validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
+ } break;
+ case 6: {bp += 4;
+ onGetItemText = *(int *) bp; bp += 4;
+ } break;
+ case 7: {bp += 4;
+ onGetItemAttr = *(int *) bp; bp += 4;
+ } break;
+ case 8: {bp += 4;
+ onGetItemColumnImage = *(int *) bp; bp += 4;
+ } break;
+ }};
+ EwxListCtrl * Result = new EwxListCtrl(parent,winid,pos,size,style,*validator);
+ Result->onGetItemText = onGetItemText;
+ Result->onGetItemAttr = onGetItemAttr;
+ Result->onGetItemColumnImage = onGetItemColumnImage;
+ Result->port = Ecmd.port;
+ newPtr((void *) Result, 0, memenv);
+ rt.addRef(getRef((void *)Result,memenv), "wxListCtrl");
+ break;
+}
+wxListCtrl_new_2>>
+
+<<Create
+case ~s: { // wxListCtrl::Create
+ wxWindowID winid=wxID_ANY;
+ wxPoint pos= wxDefaultPosition;
+ wxSize size= wxDefaultSize;
+ long style=wxLC_ICON;
+ const wxValidator * validator= &wxDefaultValidator;
+ EwxListCtrl *This = (EwxListCtrl *) getPtr(bp,memenv); bp += 4;
+ wxWindow *parent = (wxWindow *) getPtr(bp,memenv); bp += 4;
+ int onGetItemText = 0, onGetItemAttr = 0, onGetItemColumnImage = 0;
+
+ bp += 4; /* Align */
+ while( * (int*) bp) { switch (* (int*) bp) {
+ case 1: {bp += 4;
+ winid = (wxWindowID)*(int *) bp; bp += 4;
+ } break;
+ case 2: {bp += 4;
+ int * posX = (int *) bp; bp += 4;
+ int * posY = (int *) bp; bp += 4;
+ pos = wxPoint(*posX,*posY);
+ bp += 4; /* Align */
+ } break;
+ case 3: {bp += 4;
+ int * sizeW = (int *) bp; bp += 4;
+ int * sizeH = (int *) bp; bp += 4;
+ size = wxSize(*sizeW,*sizeH);
+ bp += 4; /* Align */
+ } break;
+ case 4: {bp += 4;
+ style = (long)*(int *) bp; bp += 4;
+ } break;
+ case 5: {bp += 4;
+validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
+ } break;
+ case 6: {bp += 4;
+ onGetItemText = *(int *) bp; bp += 4;
+ } break;
+ case 7: {bp += 4;
+ onGetItemAttr = *(int *) bp; bp += 4;
+ } break;
+ case 8: {bp += 4;
+ onGetItemColumnImage = *(int *) bp; bp += 4;
+ } break;
+ }};
+ if(!This) throw wxe_badarg(0);
+ bool Result = This->Create(parent,winid,pos,size,style,*validator);
+ This->onGetItemText = onGetItemText;
+ This->onGetItemAttr = onGetItemAttr;
+ This->onGetItemColumnImage = onGetItemColumnImage;
+ This->port = Ecmd.port;
+
+ rt.addBool(Result);
+ break;
+}
+Create>>
+
<<SortItems
case ~s: { // wxListCtrl::SortItems taylormade
wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
@@ -22,3 +180,6 @@ case ~s: { // wxListCtrl::SortItems taylormade
break;
}
SortItems>>
+
+
+
diff --git a/lib/wx/api_gen/wx_extra/wxListCtrl.erl b/lib/wx/api_gen/wx_extra/wxListCtrl.erl
index e6470182cb..99255bc53f 100644
--- a/lib/wx/api_gen/wx_extra/wxListCtrl.erl
+++ b/lib/wx/api_gen/wx_extra/wxListCtrl.erl
@@ -1,32 +1,33 @@
%%
%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2009. All Rights Reserved.
-%%
+%%
+%% Copyright Ericsson AB 2011. All Rights Reserved.
+%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
%% compliance with the License. You should have received a copy of the
%% Erlang Public License along with this software. If not, it can be
%% retrieved online at http://www.erlang.org/.
-%%
+%%
%% Software distributed under the License is distributed on an "AS IS"
%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
%% the License for the specific language governing rights and limitations
%% under the License.
-%%
+%%
%% %CopyrightEnd%
%%
+
<<EXPORT:SortItems sortItems/2 SortItems:EXPORT>>
<<SortItems
%% @spec (This::wxListCtrl(), SortCallBack::function()) -> boolean()
%% @doc Sort the items in the list control<br />
-%% <pre>SortCalBack(Item1,Item2) -> integer()</pre>
+%% <pre>SortCallBack(Item1,Item2) -> integer()</pre>
%% <br /> SortCallBack receives the client data associated with two items
%% to compare, and should return 0 if the items are equal, a negative
%% value if the first item is less than the second one and a positive
%% value if the first item is greater than the second one.
-%% <br /> NOTE: The callback may not call other processes.
+%% <br /> NOTE: The callback may not call other (wx) processes.
sortItems(#wx_ref{type=ThisT,ref=ThisRef}, SortCallBack)
when is_function(SortCallBack, 2) ->
?CLASS(ThisT,wxListCtrl),
@@ -37,3 +38,100 @@ sortItems(#wx_ref{type=ThisT,ref=ThisRef}, SortCallBack)
SortId = wxe_util:get_cbId(Sort),
wxe_util:call(~s, <<ThisRef:32/?UI,SortId:32/?UI>>).
SortItems>>
+
+<<EXPORT:wxListCtrl new/0, new/1, new/2 wxListCtrl:EXPORT>>
+
+<<wxListCtrl_new_0
+%% @spec () -> wxListCtrl()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistctrl.html#wxlistctrlwxlistctrl">external documentation</a>.
+new() ->
+ wxe_util:construct(~s, <<>>).
+wxListCtrl_new_0>>
+
+<<wxListCtrl_new_2
+%% @spec (Parent::wxWindow:wxWindow()) -> wxListCtrl()
+%% @equiv new(Parent, [])
+new(Parent)
+ when is_record(Parent, wx_ref) ->
+ new(Parent, []).
+
+%% @spec (Parent::wxWindow:wxWindow(), [Option]) -> wxListCtrl()
+%% Option = {winid, integer()} |
+%% {pos, {X::integer(),Y::integer()}} |
+%% {size, {W::integer(),H::integer()}} |
+%% {style, integer()} |
+%% {validator, wx:wx()} |
+%% {onGetItemText, OnGetItemText} |
+%% {onGetItemAttr, OnGetItemAttr} |
+%% {onGetItemColumnImage, OnGetItemColumnImage}
+%%
+%% OnGetItemText = (This, Item, Column) -> wxString()
+%% OnGetItemAttr = (This, Item) -> wxListItemAttr()
+%% OnGetItemColumnImage = (This, Item, Column) -> integer()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistctrl.html#wxlistctrlwxlistctrl">external documentation</a>.
+
+new(#wx_ref{type=ParentT,ref=ParentRef}, Options)
+ when is_list(Options)->
+ ?CLASS(ParentT,wxWindow),
+ MOpts = fun({winid, Winid}, Acc) -> [<<1:32/?UI,Winid:32/?UI>>|Acc];
+ ({pos, {PosX,PosY}}, Acc) -> [<<2:32/?UI,PosX:32/?UI,PosY:32/?UI,0:32>>|Acc];
+ ({size, {SizeW,SizeH}}, Acc) -> [<<3:32/?UI,SizeW:32/?UI,SizeH:32/?UI,0:32>>|Acc];
+ ({style, Style}, Acc) -> [<<4:32/?UI,Style:32/?UI>>|Acc];
+ ({validator, #wx_ref{type=ValidatorT,ref=ValidatorRef}}, Acc) ->
+ ?CLASS(ValidatorT,wx),[<<5:32/?UI,ValidatorRef:32/?UI>>|Acc];
+ ({onGetItemText, F}, Acc) when is_function(F) ->
+ Fun = fun([This,Item,Col]) -> unicode:characters_to_binary([F(This,Item,Col),0]) end,
+ [<<6:32/?UI,(wxe_util:get_cbId(Fun)):32/?UI>>|Acc];
+ ({onGetItemAttr, F}, Acc) when is_function(F) ->
+ Fun = fun([This,Item]) ->
+ #wx_ref{type=wxListItemAttr,ref=ThisRef} = F(This,Item),
+ <<ThisRef:32/?UI>>
+ end,
+ [<<7:32/?UI,(wxe_util:get_cbId(Fun)):32/?UI>>|Acc];
+ ({onGetItemColumnImage, F}, Acc) when is_function(F) ->
+ Fun = fun([This,Item, Col]) -> <<(F(This,Item,Col)):32/?I>> end,
+ [<<8:32/?UI,(wxe_util:get_cbId(Fun)):32/?UI>>|Acc];
+ (BadOpt, _) -> erlang:error({badoption, BadOpt}) end,
+ BinOpt = list_to_binary(lists:foldl(MOpts, [<<0:32>>], Options)),
+ wxe_util:construct(~s, <<ParentRef:32/?UI, 0:32,BinOpt/binary>>).
+
+wxListCtrl_new_2>>
+
+<<EXPORT:Create create/2, create/3 Create:EXPORT>>
+
+<<Create
+%% @spec (This::wxListCtrl(), Parent::wxWindow:wxWindow()) -> bool()
+%% @equiv create(This,Parent, [])
+create(This,Parent)
+ when is_record(This, wx_ref),is_record(Parent, wx_ref) ->
+ create(This,Parent, []).
+
+%% @spec (This::wxListCtrl(), Parent::wxWindow:wxWindow(), [Option]) -> bool()
+%% Option = {winid, integer()} |
+%% {pos, {X::integer(),Y::integer()}} |
+%% {size, {W::integer(),H::integer()}} |
+%% {style, integer()} |
+%% {validator, wx:wx()} |
+%% {onGetItemText, OnGetItemText} |
+%% {onGetItemAttr, OnGetItemAttr} |
+%% {onGetItemColumnImage, OnGetItemColumnImage}
+%%
+%% OnGetItemText = (This, Item, Column) -> wxString()
+%% OnGetItemAttr = (This, Item) -> wxListItemAttr()
+%% OnGetItemColumnImage = (This, Item, Column) -> integer()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistctrl.html#wxlistctrlcreate">external documentation</a>.
+create(#wx_ref{type=ThisT,ref=ThisRef},#wx_ref{type=ParentT,ref=ParentRef}, Options)
+ when is_list(Options) ->
+ ?CLASS(ThisT,wxListCtrl),
+ ?CLASS(ParentT,wxWindow),
+ MOpts = fun({winid, Winid}, Acc) -> [<<1:32/?UI,Winid:32/?UI>>|Acc];
+ ({pos, {PosX,PosY}}, Acc) -> [<<2:32/?UI,PosX:32/?UI,PosY:32/?UI,0:32>>|Acc];
+ ({size, {SizeW,SizeH}}, Acc) -> [<<3:32/?UI,SizeW:32/?UI,SizeH:32/?UI,0:32>>|Acc];
+ ({style, Style}, Acc) -> [<<4:32/?UI,Style:32/?UI>>|Acc];
+ ({validator, #wx_ref{type=ValidatorT,ref=ValidatorRef}}, Acc) -> ?CLASS(ValidatorT,wx),[<<5:32/?UI,ValidatorRef:32/?UI>>|Acc];
+ (BadOpt, _) -> erlang:error({badoption, BadOpt}) end,
+ BinOpt = list_to_binary(lists:foldl(MOpts, [<<0:32>>], Options)),
+ wxe_util:call(~s,
+ <<ThisRef:32/?UI,ParentRef:32/?UI, BinOpt/binary>>).
+
+Create>>
diff --git a/lib/wx/api_gen/wx_gen.erl b/lib/wx/api_gen/wx_gen.erl
index 2f20c42a5d..b36653c570 100644
--- a/lib/wx/api_gen/wx_gen.erl
+++ b/lib/wx/api_gen/wx_gen.erl
@@ -38,7 +38,7 @@ devcode() -> erase(),safe(fun gen_code/0,false).
safe(What, QuitOnErr) ->
try
What(),
- io:format("Completed succesfully~n~n", []),
+ io:format("Completed successfully~n~n", []),
QuitOnErr andalso gen_util:halt(0)
catch Err:Reason ->
io:format("Error in ~p ~p~n", [get(current_class),get(current_func)]),
diff --git a/lib/wx/api_gen/wx_gen_cpp.erl b/lib/wx/api_gen/wx_gen_cpp.erl
index 4b33068d8f..4632fdbffe 100644
--- a/lib/wx/api_gen/wx_gen_cpp.erl
+++ b/lib/wx/api_gen/wx_gen_cpp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -19,7 +19,7 @@
%%%-------------------------------------------------------------------
%%% File : wx_gen_cpp.erl
%%% Author : Dan Gudmundsson <[email protected]>
-%%% Description :
+%%% Description :
%%%
%%% Created : 19 Feb 2007 by Dan Gudmundsson <[email protected]>
%%%-------------------------------------------------------------------
@@ -35,7 +35,7 @@
args/3, strip_name/2]).
-import(wx_gen, [next_id/1]).
-gen(Defs) ->
+gen(Defs) ->
open_write("../c_src/gen/wxe_derived_dest.h"),
c_copyright(),
w("~n/***** This file is generated do not edit ****/~n~n", []),
@@ -49,48 +49,26 @@ gen(Defs) ->
open_write("../c_src/gen/wxe_macros.h"),
c_copyright(),
- gen_macros(),
+ gen_macros(),
close(),
open_write("../c_src/gen/wxe_init.cpp"),
c_copyright(),
build_enums(),
close(),
-
+
build_events(),
Res.
-
+
gen_derived_dest(Defs) ->
[gen_derived_dest_2(Class) || Class <- Defs],
-
- UglySkipList = ["wxCaret", "wxCalendarDateAttr",
- "wxFileDataObject", "wxTextDataObject", "wxBitmapDataObject"
- ],
-
- ?WTC("gen_derived_dest"),
- w("void WxeApp::delete_object(void *ptr, wxeRefData *refd) {~n", []),
- w(" switch(refd->type) {~n", []),
- Case = fun(#class{name=Class, id=Id, abstract=IsAbs, parent=P}) when P /= "static" ->
- UglyWorkaround = lists:member(Class, UglySkipList),
- case hd(reverse(wx_gen_erl:parents(Class))) of
- root when IsAbs == false, UglyWorkaround == false ->
- w(" case ~p: delete (~s *) ptr; break;~n", [Id, Class]);
- root when IsAbs == false, UglyWorkaround == true ->
- w(" case ~p: /* delete (~s *) ptr;"
- "These objects must be deleted by owner object */ "
- "break;~n", [Id, Class]);
- _ -> ok
- end;
- (_) -> ok
- end,
- [Case(Class) || Class <- Defs],
- w(" default: delete (wxObject *) ptr;~n", []),
- w("}}~n~n", []).
+ ok.
gen_derived_dest_2(C=#class{name=Class}) ->
- case is_derived(C) of
- true ->
- ?WTC("gen_derived_dest_2"),
+ ?WTC("gen_derived_dest_2"),
+ Derived = is_derived(C),
+ TaylorMade = taylormade_class(C),
+ if Derived andalso (TaylorMade =:= false) ->
w("class E~s : public ~s {~n",[Class,Class]),
case Class of
"wxGLCanvas" -> %% Special for cleaning up gl context
@@ -101,15 +79,32 @@ gen_derived_dest_2(C=#class{name=Class}) ->
end,
gen_constructors(C),
w("};~n~n", []);
- false ->
+ TaylorMade /= false ->
+ w("~s~n", [TaylorMade]);
+ true ->
ignore
end.
+taylormade_class(#class{name=CName, methods=Ms}) ->
+ TaylorMade = lists:any(fun([#method{where=taylormade}|_]) -> true;
+ (_) -> false
+ end, Ms),
+ case TaylorMade of
+ false -> false;
+ true ->
+ {ok, Bin} = file:read_file(filename:join([wx_extra, CName ++".c_src"])),
+ Src = binary_to_list(Bin),
+ case gen_util:get_taylor_made(Src, CName ++ "_class") of
+ nomatch -> false;
+ {match, [Str0]} -> Str0
+ end
+ end.
+
gen_constructors(#class{name=Class, methods=Ms0}) ->
Ms = lists:append(Ms0),
Cs = lists:filter(fun(#method{method_type=MT}) -> MT =:= constructor end, Ms),
[gen_constructor(Class, Const) || Const <- Cs].
-
+
gen_constructor(_Class, #method{where=merged_c}) -> ok;
gen_constructor(_Class, #method{where=erl_no_opt}) -> ok;
gen_constructor(Class, _M=#method{params=Ps}) ->
@@ -119,7 +114,7 @@ gen_constructor(Class, _M=#method{params=Ps}) ->
HaveMergedType = fun(#param{type={merged,_,_,_,_,_,_}}) -> true; (_) -> false end,
?WTC("gen_constructor"),
case lists:any(HaveMergedType, Ps) of
- false ->
+ false ->
w(" E~s(~s) : ~s(~s) {};~n",
[Class,args(Gen1,",",Ps),Class,args(CallA,",",Ps)]);
true ->
@@ -141,9 +136,9 @@ gen_type(#type{name=Type, ref=undefined, single=array, mod=Mod},_) ->
mods(Mod) ++ to_string(Type) ++ " * ";
gen_type(#type{name=Type, ref=undefined, mod=Mod},_) ->
mods(Mod) ++ to_string(Type) ++ " ";
-gen_type({merged, _, T1, _,_, _T2,_}, 1) ->
+gen_type({merged, _, T1, _,_, _T2,_}, 1) ->
gen_type(T1,error);
-gen_type({merged, _, _T1,_, _, T2,_}, 2) ->
+gen_type({merged, _, _T1,_, _, T2,_}, 2) ->
gen_type(T2,error).
gen_funcs(Defs) ->
@@ -168,7 +163,7 @@ gen_funcs(Defs) ->
%% w(" case WXE_REMOVE_PORT:~n", []),
%% w(" { destroyMemEnv(Ecmd.port); } break;~n", []),
w(" case DESTROY_OBJECT: {~n"),
- w(" wxObject *This = (wxObject *) getPtr(bp,memenv); "),
+ w(" wxObject *This = (wxObject *) getPtr(bp,memenv); "),
w(" if(This) {"),
w(" ((WxeApp *) wxTheApp)->clearPtr((void *) This);~n"),
w(" delete This; }~n } break;~n"),
@@ -203,16 +198,39 @@ gen_funcs(Defs) ->
w(" error.addTupleCount(2);~n"),
w(" error.addTupleCount(3);~n"),
w(" error.send();~n"),
- w("}} /* The End */~n"),
+ w("}} /* The End */~n~n~n"),
+
+ UglySkipList = ["wxCaret", "wxCalendarDateAttr",
+ "wxFileDataObject", "wxTextDataObject", "wxBitmapDataObject"
+ ],
+
+ w("void WxeApp::delete_object(void *ptr, wxeRefData *refd) {~n", []),
+ w(" switch(refd->type) {~n", []),
+ Case = fun(#class{name=Class, id=Id, abstract=IsAbs, parent=P}) when P /= "static" ->
+ UglyWorkaround = lists:member(Class, UglySkipList),
+ case hd(reverse(wx_gen_erl:parents(Class))) of
+ root when IsAbs == false, UglyWorkaround == false ->
+ w(" case ~p: delete (~s *) ptr; break;~n", [Id, Class]);
+ root when IsAbs == false, UglyWorkaround == true ->
+ w(" case ~p: /* delete (~s *) ptr;"
+ "These objects must be deleted by owner object */ "
+ "break;~n", [Id, Class]);
+ _ -> ok
+ end;
+ (_) -> ok
+ end,
+ [Case(Class) || Class <- Defs],
+ w(" default: delete (wxObject *) ptr;~n", []),
+ w("}}~n~n", []),
Res.
-
+
gen_class(C=#class{name=Name,methods=Ms,options=Opts}) ->
put(current_class, Name),
- NewMs =
+ NewMs =
case lists:member(taylormade, Opts) of
true ->
{ok, Bin} = file:read_file(filename:join([wx_extra,Name++".c_src"])),
- ?WTC("gen_class"),
+ ?WTC("gen_class"),
w("~s~n", [binary_to_list(Bin)]),
Ms;
false ->
@@ -220,13 +238,13 @@ gen_class(C=#class{name=Name,methods=Ms,options=Opts}) ->
{value, {ifdef, What}} ->
w("#if ~p~n",[What]),
Methods = lists:flatten(Ms),
- MsR = [gen_method(Name,M) ||
+ MsR = [gen_method(Name,M) ||
M <- lists:keysort(#method.id, Methods)],
w("#endif // ~p~n",[What]),
MsR;
false ->
Methods = lists:flatten(Ms),
- [gen_method(Name,M) ||
+ [gen_method(Name,M) ||
M <- lists:keysort(#method.id, Methods)]
end
end,
@@ -234,15 +252,19 @@ gen_class(C=#class{name=Name,methods=Ms,options=Opts}) ->
C#class{methods=NewMs}.
gen_method(_CName, M=#method{where=erl_no_opt}) -> M;
-gen_method(CName, M=#method{where=taylormade, name=Name, id=Id}) ->
+gen_method(CName, M=#method{where=taylormade, name=Name, id=Id}) ->
{ok, Bin} = file:read_file(filename:join([wx_extra, CName ++".c_src"])),
- Str0 = binary_to_list(Bin),
+ Src = binary_to_list(Bin),
%% io:format("C++ Class ~p ~p~n", [CName, Name]),
-
- {match, [Str1]} = re:run(Str0, "<<"++Name++"(.*)"++Name++">>",
- [dotall, {capture, all_but_first, list}]),
+ Str = case gen_util:get_taylor_made(Src, Name) of
+ nomatch ->
+ {match, [Str0]} = gen_util:get_taylor_made(Src, wx_gen_erl:get_unique_name(Id)),
+ Str0;
+ {match, [Str0]} ->
+ Str0
+ end,
?WTC("gen_method"),
- w(Str1, [wx_gen_erl:get_unique_name(Id)]),
+ w(Str, [wx_gen_erl:get_unique_name(Id)]),
M;
gen_method(CName, M=#method{name=N,params=[Ps],method_type=destructor,id=MethodId}) ->
case hd(reverse(wx_gen_erl:parents(CName))) of
@@ -253,7 +275,7 @@ gen_method(CName, M=#method{name=N,params=[Ps],method_type=destructor,id=MethodI
w(" if(This) {", []),
w(" ((WxeApp *) wxTheApp)->clearPtr((void *) This);~n", []),
w(" delete This;}~n", []),
- free_args(),
+ free_args(),
w(" break;~n}~n", []);
object -> %% Use default
ignore
@@ -266,7 +288,7 @@ gen_method(CName, M=#method{name=N,params=Ps0,type=T,method_type=MT,id=MethodId
w("case ~s: { // ~s::~s~n", [wx_gen_erl:get_unique_name(MethodId),CName,N]),
Ps1 = declare_variables(void, Ps0),
{Ps2,Align} = decode_arguments(Ps1),
- Opts = [Opt || Opt = #param{def=Def,in=In,where=Where} <- Ps2,
+ Opts = [Opt || Opt = #param{def=Def,in=In,where=Where} <- Ps2,
Def =/= none, In =/= false, Where =/= c],
decode_options(Opts, Align),
case gen_util:get_hook(c, M#method.pre_hook) of
@@ -292,7 +314,7 @@ declare_variables(T, Ps) ->
declare_var(P = #param{where=erl}) -> P;
declare_var(P = #param{where=this}) -> P;
-declare_var(P = #param{name=Name,def=Def,type=Type,in=true}) when Def =/= none ->
+declare_var(P = #param{name=Name,def=Def,type=Type,in=true}) when Def =/= none ->
declare_type(Name, true, Def, Type),
P;
declare_var(P = #param{in=In}) when In =/= false -> P;
@@ -304,7 +326,7 @@ declare_type(N,false,_,#type{name="wxArrayInt"}) ->
w(" wxArrayInt ~s;~n", [N]);
declare_type(N,false,_,#type{name="wxArrayString"}) ->
w(" wxArrayString ~s;~n", [N]);
-declare_type(N,false,_,#type{base=Base,single=true,name=Type,by_val=false,mod=Mod})
+declare_type(N,false,_,#type{base=Base,single=true,name=Type,by_val=false,mod=Mod})
when Base =:= int; Base =:= long; Base =:= float; Base =:= double ->
w(" ~s~s ~s;~n", [mods(Mod),Type,N]);
declare_type(N,false,_,#type{base={enum,_},single=true,name=Type,by_val=false,mod=Mod}) ->
@@ -315,7 +337,7 @@ declare_type(N,false,_,#type{name="wxDateTime"}) ->
w(" wxDateTime ~s;~n", [N]);
declare_type(N,false,_,#type{name=Type, base=int64, ref=reference}) ->
w(" ~s ~s;~n", [Type,N]);
-declare_type(N,true,Def,#type{base=Base,single=true,name=Type,by_val=true})
+declare_type(N,true,Def,#type{base=Base,single=true,name=Type,by_val=true})
when Base =:= int; Base =:= long; Base =:= float; Base =:= double; Base =:= bool ->
w(" ~s ~s=~s;~n", [Type,N,Def]);
declare_type(N,true,Def,#type{base={comp,_,_},single=true,name=Type,mod=Mod,ref={pointer,1}}) ->
@@ -328,7 +350,7 @@ declare_type(N,true,Def,#type{base={class,_},single=true,name=Type,ref={pointer,
w(" ~s~s * ~s=~s;~n", [mods(Mod),Type,N,Def]);
declare_type(N,true,Def,#type{base={class,_},single=true,name=Type,ref=reference,mod=Mod}) ->
w(" ~s~s * ~s= &~s;~n", [mods(Mod),Type,N,Def]);
-declare_type(N,true,Def,#type{base=Base,single=true,name=Type,by_val=false,ref={pointer,1}})
+declare_type(N,true,Def,#type{base=Base,single=true,name=Type,by_val=false,ref={pointer,1}})
when Base =:= int; Base =:= long; Base =:= float; Base =:= double; Base =:= bool ->
w(" ~s *~s=~s;~n", [Type,N,Def]);
declare_type(N,true,Def,#type{single=true,name="wxArtClient"}) ->
@@ -345,7 +367,7 @@ declare_type(N,true,Def,#type{name=Type, ref={pointer,2}}) ->
%% xxxx
w(" ~s ** ~s = ~s;~n", [Type,N,Def]);
declare_type(N,true,Def,#type{name=Type, single=array, ref={pointer,1}}) ->
- w(" int * ~sLen = 0;~n", [N]),
+ w(" int * ~sLen = 0;~n", [N]),
w(" ~s * ~s = ~s;~n", [Type,N,Def]);
declare_type(N,true,"",#type{name="wxArrayString", single=array, ref=reference}) ->
w(" wxArrayString ~s;~n", [N]);
@@ -363,12 +385,12 @@ decode_options(Opts, Align) ->
decode_opt(#param{name=Name,type=Type}, N) ->
w(" case ~p: {bp += 4;~n", [N]),
- Align = decode_arg(Name,Type,opt,1),
+ Align = decode_arg(Name,Type,opt,1),
align(Align, 64),
w(" } break;~n", []),
N+1.
-decode_arguments(Ps0) ->
+decode_arguments(Ps0) ->
lists:mapfoldl(fun decode_arg/2,0,Ps0).
store_free(N) ->
@@ -380,7 +402,7 @@ store_free(N) ->
free_args() ->
case get(free_args) of
undefined -> ignore;
- List ->
+ List ->
erase(free_args),
[w(" driver_free(~s);~n", [Arg]) || Arg <- List]
end.
@@ -388,7 +410,7 @@ free_args() ->
decode_arg(P = #param{where=erl},A) -> {P,A};
decode_arg(P = #param{where=c},A) -> {P,A};
decode_arg(P = #param{in=false},A) -> {P,A};
-decode_arg(P = #param{def=Def},A) when Def =/= none -> {P,A};
+decode_arg(P = #param{def=Def},A) when Def =/= none -> {P,A};
decode_arg(P = #param{name=Name,type=Type},A0) ->
A = decode_arg(Name, Type, arg, A0),
{P, A}.
@@ -426,22 +448,22 @@ decode_arg(N,#type{base=float,single=true,name=Type},arg,A0) ->
align(A0,32);
decode_arg(N,#type{base=double,single=true,name=Type},Arg,A0) ->
A = align(A0,64),
- case Arg of
+ case Arg of
arg -> w(" ~s * ~s = (~s *) bp; bp += 8;~n", [Type,N,Type]);
opt -> w(" ~s = * (~s *) bp; bp += 8;~n", [N,Type])
end,
A;
decode_arg(N,#type{base=bool,single=true,name=Type},Arg,A0) ->
- case Arg of
+ case Arg of
arg -> w(" bool * ~s = (~s *) bp; bp += 4;~n", [N,Type]);
opt -> w(" ~s = *(~s *) bp; bp += 4;~n", [N,Type])
end,
align(A0,32);
decode_arg(N,#type{base={enum,Type},single=true},Arg,A0) ->
- wa(" ~s ", [enum_type(Type)], "~s = *(~s *) bp; bp += 4;;~n",[N, enum_type(Type)], Arg),
+ wa(" ~s ", [enum_type(Type)], "~s = *(~s *) bp; bp += 4;;~n",[N, enum_type(Type)], Arg),
align(A0,32);
decode_arg(N,#type{base={comp,"wxDateTime",List},single=true,name=Type,ref=Ref},Arg,A0) ->
- Decl = fun({int,Spec}) ->
+ Decl = fun({int,Spec}) ->
w(" int * ~s~s = (int *) bp; bp += 4;~n", [N,Spec])
end,
align(A0,32),
@@ -452,15 +474,15 @@ decode_arg(N,#type{base={comp,"wxDateTime",List},single=true,name=Type,ref=Ref},
end,
case Arg of
arg -> w(" ~s ~s = ~s(~s);~n", [Type,N,Type,args(Name, ",", List)]);
- opt when Ref =:= {pointer,1} ->
- w(" ~sTmp = ~s(~s); ~s = & ~sTmp;~n",
+ opt when Ref =:= {pointer,1} ->
+ w(" ~sTmp = ~s(~s); ~s = & ~sTmp;~n",
[N,Type,args(Name, ",", List), N,N]);
opt ->
w(" ~s = ~s(~s);~n", [N,Type,args(Name, ",", List)])
end,
(A0+length(List)) rem 2;
decode_arg(N,#type{base={comp,_,List},single=true,name=Type,ref=Ref},Arg,A0) ->
- Decl = fun({int,Spec}) ->
+ Decl = fun({int,Spec}) ->
w(" int * ~s~s = (int *) bp; bp += 4;~n", [N,Spec]);
({double, Spec}) ->
w(" wxDouble * ~s~s = (wxDouble *) bp; bp += 8;~n", [N,Spec])
@@ -473,8 +495,8 @@ decode_arg(N,#type{base={comp,_,List},single=true,name=Type,ref=Ref},Arg,A0) ->
Name = fun({_,Spec}) -> "*"++N++Spec end,
case Arg of
arg -> w(" ~s ~s = ~s(~s);~n", [Type,N,Type,args(Name, ",", List)]);
- opt when Ref =:= {pointer,1} ->
- w(" ~sTmp = ~s(~s); ~s = & ~sTmp;~n",
+ opt when Ref =:= {pointer,1} ->
+ w(" ~sTmp = ~s(~s); ~s = & ~sTmp;~n",
[N,Type,args(Name, ",", List), N,N]);
opt ->
w(" ~s = ~s(~s);~n", [N,Type,args(Name, ",", List)])
@@ -483,7 +505,7 @@ decode_arg(N,#type{base={comp,_,List},single=true,name=Type,ref=Ref},Arg,A0) ->
{int, _} -> (A0+length(List)) rem 2;
{double, _} -> 0
end;
-
+
decode_arg(N,#type{name=Class="wxTreeItemId",single=true},Arg,A0) ->
A = align(A0,64),
wa(" ~s ",[Class],"~s = wxTreeItemId((void *) *(wxUint64 *) bp); bp += 8;~n",[N],Arg),
@@ -492,7 +514,7 @@ decode_arg(N,#type{name=Class="wxTreeItemIdValue",single=true},Arg,A0) ->
A = align(A0,64),
wa(" ~s ",[Class],"~s = (~s) * (wxUint64 *) bp; bp += 8;~n",[N,Class],Arg),
A;
-decode_arg(N,#type{name="wxChar", single=S},Arg,A0)
+decode_arg(N,#type{name="wxChar", single=S},Arg,A0)
when S =/= true ->
w(" int * ~sLen = (int *) bp; bp += 4;~n", [N]),
wa(" wxString", []," ~s = wxString(bp, wxConvUTF8);~n", [N],Arg),
@@ -501,7 +523,7 @@ decode_arg(N,#type{name="wxChar", single=S},Arg,A0)
decode_arg(N,#type{base=string, name="wxFileName"},Arg,A0) ->
w(" int * ~sLen = (int *) bp; bp += 4;~n", [N]),
wa(" wxString", []," ~sStr = wxString(bp, wxConvUTF8);~n", [N],Arg),
- w(" bp += *~sLen+((8-((~p+ *~sLen) & 7)) & 7);~n", [N,4*((A0+1) rem 2),N]),
+ w(" bp += *~sLen+((8-((~p+ *~sLen) & 7)) & 7);~n", [N,4*((A0+1) rem 2),N]),
w(" wxFileName ~s = wxFileName(~sStr);~n",[N,N]),
0;
decode_arg(N,#type{base=string},Arg,A0) ->
@@ -541,7 +563,7 @@ decode_arg(N,#type{name="wxArrayDouble"},arg,A0) ->
decode_arg(_N,#type{base=eventType},_Arg,A0) ->
%% w(" int * ~sLen = (int *) bp; bp += 4;~n", [N]),
%% case Arg of
-%% arg ->
+%% arg ->
%% w(" int ~s = wxeEventTypeFromAtom(bp);bp += *~sLen;~n",[N,N]),
%% w(" char *class_name = bp;~n", []),
%% w(" wxeCallbackData * Evt_cb = new wxeCallbackData(Ecmd.caller,This,class_name);~n",
@@ -551,7 +573,7 @@ decode_arg(_N,#type{base=eventType},_Arg,A0) ->
decode_arg(N,#type{name=Type,base=binary,mod=Mod0},Arg,A0) ->
Mod = mods([M || M <- Mod0]),
case Arg of
- arg ->
+ arg ->
w(" ~s~s * ~s = (~s~s*) Ecmd.bin[~p]->base;~n",
[Mod,Type,N,Mod,Type, next_id(bin_count)]);
opt ->
@@ -564,10 +586,10 @@ decode_arg(N,#type{base={term,"wxTreeItemData"},mod=Mod0},Arg,A0) ->
Type = "wxETreeItemData",
BinCnt = next_id(bin_count),
case Arg of
- arg ->
+ arg ->
w(" ~s~s * ~s = new ~s(Ecmd.bin[~p]->size, Ecmd.bin[~p]->base);~n",
[Mod,Type,N,Type,BinCnt,BinCnt]);
- opt ->
+ opt ->
w(" ~s = new ~s(Ecmd.bin[~p]->size, Ecmd.bin[~p]->base);~n",
[N,Type,BinCnt,BinCnt])
end,
@@ -576,10 +598,10 @@ decode_arg(N,#type{name=Type,base={term,_},mod=Mod0},Arg,A0) ->
Mod = mods([M || M <- Mod0]),
BinCnt = next_id(bin_count),
case Arg of
- arg ->
+ arg ->
w(" ~s~s * ~s = new ~s(Ecmd.bin[~p]);~n",
[Mod,Type,N,Type,BinCnt]);
- opt ->
+ opt ->
w(" ~s = new ~s(Ecmd.bin[~p]);~n",
[N,Type,BinCnt])
end,
@@ -588,17 +610,17 @@ decode_arg(N,#type{single=array,base=int},Arg,A0) ->
case Arg of
arg ->
w(" int * ~sLen = (int *) bp; bp += 4;~n", [N]),
- w(" int * ~s = (int *) bp; bp += *~sLen*4+((~p+ *~sLen)%2 )*4;~n",
+ w(" int * ~s = (int *) bp; bp += *~sLen*4+((~p+ *~sLen)%2 )*4;~n",
[N,N,(A0+1) rem 2,N]);
- opt ->
+ opt ->
w(" ~sLen = (int *) bp; bp += 4;~n", [N]),
- w(" ~s = (int *) bp; bp += *~sLen*4+((~p+ *~sLen)%2 )*4;~n",
+ w(" ~s = (int *) bp; bp += *~sLen*4+((~p+ *~sLen)%2 )*4;~n",
[N,N,(A0+1) rem 2,N])
end,
0;
decode_arg(N,#type{by_val=true,single=array,base={comp,Class="wxPoint",_}},arg,A0) ->
- w(" int * ~sLen = (int *) bp; bp += 4;~n", [N]),
- w(" ~s *~s;~n",[Class,N]),
+ w(" int * ~sLen = (int *) bp; bp += 4;~n", [N]),
+ w(" ~s *~s;~n",[Class,N]),
w(" ~s = (~s *) driver_alloc(sizeof(~s) * *~sLen);~n",[N,Class,Class,N]),
store_free(N),
w(" for(int i=0; i < *~sLen; i++) {~n", [N]),
@@ -629,13 +651,13 @@ decode_arg(Name,T, Arg,_A) ->
align(0, 32) -> 1;
align(1, 32) -> 0;
align(0, 64) -> 0;
-align(1, 64) ->
+align(1, 64) ->
w(" bp += 4; /* Align */~n"),
0;
align(N,Sz) ->
align(N rem 2, Sz).
-call_wx(_N,{constructor,_},#type{base={class,RClass}},Ps) ->
+call_wx(_N,{constructor,_},#type{base={class,RClass}},Ps) ->
#class{id=Id} = ClassDef = get({class,RClass}),
Class = case is_derived(ClassDef) of
true -> "E" ++ RClass;
@@ -648,8 +670,8 @@ call_wx(_N,{constructor,_},#type{base={class,RClass}},Ps) ->
case is_dialog(RClass) of
true -> 2; %% Dialogs must be closed first event before windows
false -> 0
- end;
- false ->
+ end;
+ false ->
case hd(reverse(wx_gen_erl:parents(RClass))) of
root -> Id;
_ -> 1
@@ -682,10 +704,10 @@ call_wx(N,{static,Class},Type,Ps) ->
return_res(void) -> {"", ""};
return_res(Type = #type{mod=Mod}) ->
case lists:member(const, Mod) of
- true ->
- {Beg, End} = return_res1(Type),
+ true ->
+ {Beg, End} = return_res1(Type),
{"const " ++ Beg, End};
- _ ->
+ _ ->
return_res1(Type)
end.
@@ -695,8 +717,8 @@ return_res1(#type{name=Type,ref={pointer,_}}) ->
{Type ++ " * Result = (" ++ Type ++ "*)", ""};
return_res1(#type{name=Type,single=true,ref=reference}) ->
{Type ++ " * Result = &", ""};
-return_res1(#type{name=Type,single=true,by_val=true})
- when is_atom(Type) ->
+return_res1(#type{name=Type,single=true,by_val=true})
+ when is_atom(Type) ->
{atom_to_list(Type) ++ " Result = ", ""};
return_res1(#type{name=Type="wxArrayInt"}) ->
{Type ++ " Result = ", ""};
@@ -705,19 +727,19 @@ return_res1(#type{name=Type,base={class,_},single=list,ref=reference}) ->
return_res1(#type{name=Type,base={comp,_,_},single=array,by_val=true}) ->
{Type ++ " Result = ", ""};
return_res1(#type{name=Type,single=true,by_val=true, base={class, _}}) ->
- %% Memory leak !!!!!! XXXX BUGBUG FIXME or doument!!
- case Type of
+ %% Memory leak !!!!!! XXXX BUGBUG FIXME or doument!!
+ case Type of
"wxImage" -> ok;
"wxFont" -> ok;
"wxBitmap" -> ok;
"wxIcon" -> ok;
"wxGraphics" ++ _ -> ok;
_ ->
- io:format("~s::~s Building return value of temp ~s~n",
+ io:format("~s::~s Building return value of temp ~s~n",
[get(current_class),get(current_func),Type])
end,
%% #class{id=Id} = get({class,Type}),
- {Type ++ " * Result = new " ++ Type ++ "(", "); newPtr((void *) Result,"
+ {Type ++ " * Result = new " ++ Type ++ "(", "); newPtr((void *) Result,"
++ "3, memenv);"};
return_res1(#type{base={enum,_Type},single=true,by_val=true}) ->
{"int Result = " , ""};
@@ -730,7 +752,7 @@ return_res1(#type{name=Type,single=true,by_val=true}) ->
filter(Ps) ->
lists:filter(fun filter_arg/1, Ps).
-filter_arg(#param{where=erl}) -> false;
+filter_arg(#param{where=erl}) -> false;
filter_arg(#param{where=this}) -> false;
filter_arg(#param{}) -> true.
%%filter_arg(#param{def=Def, in=In}) -> Def =:= none orelse In =:= false.
@@ -739,20 +761,20 @@ filter_arg(#param{}) -> true.
call_arg(#param{where=c, alt={length,Alt}}) when is_list(Alt) ->
"*" ++ Alt ++ "Len";
call_arg(#param{where=c, alt={size,Id}}) when is_integer(Id) ->
- %% It's a binary
+ %% It's a binary
"Ecmd.bin["++ integer_to_list(Id) ++ "]->size";
-call_arg(#param{name=N,def=Def,type=#type{name=Type,by_val=true,single=true,base=Base}})
- when Base =:= int; Base =:= long; Base =:= float; Base =:= double; Base =:= bool ->
+call_arg(#param{name=N,def=Def,type=#type{name=Type,by_val=true,single=true,base=Base}})
+ when Base =:= int; Base =:= long; Base =:= float; Base =:= double; Base =:= bool ->
case Def of
none -> "(" ++ to_string(Type) ++ ") *" ++ N;
_ -> N
end;
-call_arg(#param{name=N,type=#type{base={enum,Type}, by_val=true,single=true}}) ->
+call_arg(#param{name=N,type=#type{base={enum,Type}, by_val=true,single=true}}) ->
"(" ++ enum_type(Type) ++") " ++ N;
call_arg(#param{name=N,type=#type{base={class,_},by_val=true,single=true}}) -> "*" ++ N;
call_arg(#param{name=N,type=#type{base={class,_},ref=reference,single=true}}) -> "*" ++ N;
-call_arg(#param{name=N,type=#type{base=eventType}}) ->
+call_arg(#param{name=N,type=#type{base=eventType}}) ->
N ++ ", (wxObjectEventFunction)(wxEventFunction) &WxeApp::handle_evt, Evt_cb, this";
call_arg(#param{name=N,type=#type{by_val=true, single=_False}}) -> N;
call_arg(#param{name=N,def=Def,type=#type{by_val=false, ref={pointer,2}}})
@@ -760,20 +782,20 @@ call_arg(#param{name=N,def=Def,type=#type{by_val=false, ref={pointer,2}}})
call_arg(#param{name=N,type=#type{by_val=false, ref={pointer,2}}}) -> "&" ++ N;
call_arg(#param{name=N,in=false,type=#type{ref=reference, single=true}}) -> N;
call_arg(#param{name=N,in=false,type=#type{by_val=false, single=true}}) -> "&" ++ N;
-call_arg(#param{name=N,def=Def,type=#type{base={comp,_,_},ref={pointer,1},single=true}})
+call_arg(#param{name=N,def=Def,type=#type{base={comp,_,_},ref={pointer,1},single=true}})
when Def =:= none ->
"&" ++N;
call_arg(#param{name=N,type=#type{by_val=false}}) -> N;
call_arg(#param{name=N,type={merged,_,#type{base={class,_},single=true,
by_val=ByVal,
- ref=Ref},_,_,_,_}})
- when ByVal =:= true; Ref =:= reference ->
+ ref=Ref},_,_,_,_}})
+ when ByVal =:= true; Ref =:= reference ->
"*" ++ N;
-call_arg(#param{def=Def, type=void}) when Def =/= none -> Def;
+call_arg(#param{def=Def, type=void}) when Def =/= none -> Def;
call_arg(#param{name=N,type=#type{base={ref,_},by_val=true,single=true}}) -> N;
call_arg(#param{name=N,type={merged,_,_,_,_,_,_}}) -> N.
-%% call_arg(#param{name=N,type=#type{base=Tuple,ref=reference}})
+%% call_arg(#param{name=N,type=#type{base=Tuple,ref=reference}})
%% when is_tuple(Tuple) -> "&" ++ N;
to_string(Type) when is_atom(Type) -> atom_to_list(Type);
@@ -781,19 +803,19 @@ to_string(Type) when is_list(Type) -> Type.
virtual_dest(#class{abstract=true, parent="root"}) -> false;
virtual_dest(#class{abstract=true, parent="object"}) -> true;
-virtual_dest(#class{abstract=true, parent=Parent}) ->
+virtual_dest(#class{abstract=true, parent=Parent}) ->
virtual_dest(get({class,Parent}));
virtual_dest(#class{methods=Ms, parent=Parent}) ->
case lists:keysearch(destructor,#method.method_type, lists:append(Ms)) of
{value, #method{method_type=destructor, virtual=Virtual}} ->
case Virtual of
- undefined ->
+ undefined ->
case get({class,Parent}) of
- undefined ->
+ undefined ->
case Parent of
- "object" ->
+ "object" ->
true;
- "root" ->
+ "root" ->
false;
_ ->
io:format("Error: ~p~n",[Parent]),
@@ -802,10 +824,10 @@ virtual_dest(#class{methods=Ms, parent=Parent}) ->
PClass ->
virtual_dest(PClass)
end;
- _ ->
+ _ ->
Virtual
end;
- false ->
+ false ->
false
end.
@@ -819,24 +841,24 @@ is_derived(#class{abstract=true}) -> false;
is_derived(C = #class{}) -> virtual_dest(C).
is_window(Class) ->
- lists:member("wxWindow", wx_gen_erl:parents(Class)).
+ lists:member("wxWindow", wx_gen_erl:parents(Class)).
is_dialog(Class) ->
lists:member("wxDialog", wx_gen_erl:parents(Class)).
-
+
build_return_vals(Type,Ps) ->
HaveType = case Type of void -> 0; _ -> 1 end,
NoOut = lists:sum([1 || #param{in=In} <- Ps, In =/= true]) + HaveType,
OutTupSz = if NoOut > 1 -> NoOut; true -> 0 end,
-
+
build_ret_types(Type,Ps),
- if
+ if
OutTupSz > 1 -> w(" rt.addTupleCount(~p);~n",[OutTupSz]);
true -> ignore
- end,
+ end,
Ps.
-build_ret_types(void,Ps) ->
+build_ret_types(void,Ps) ->
Calc = fun(#param{name=N,in=False,type=T}, Free) when False =/= true ->
case build_ret(N, False, T) of
ok -> Free;
@@ -845,7 +867,7 @@ build_ret_types(void,Ps) ->
(_, Free) -> Free
end,
lists:foldl(Calc, [], Ps);
-build_ret_types(Type,Ps) ->
+build_ret_types(Type,Ps) ->
Free = case build_ret("Result", out, Type) of
ok -> [];
FreeStr -> [FreeStr]
@@ -854,8 +876,8 @@ build_ret_types(Type,Ps) ->
case build_ret(N, False, T) of
ok -> FreeAcc;
FreeMe -> [FreeMe|FreeAcc]
- end;
- (_, FreeAcc) -> FreeAcc
+ end;
+ (_, FreeAcc) -> FreeAcc
end,
lists:foldl(Calc, Free, Ps).
@@ -898,17 +920,17 @@ build_ret(Name,_,#type{name="wxArrayInt"}) ->
build_ret(Name,_,#type{base={comp,_,_},single=array}) ->
w(" for(unsigned int i=0; i < ~s.GetCount(); i++) {~n", [Name]),
w(" rt.add(~s[i]);~n }~n",[Name]),
- w(" rt.endList(~s.GetCount());~n",[Name]);
+ w(" rt.endList(~s.GetCount());~n",[Name]);
build_ret(Name,_,#type{name=List,single=list,base={class,Class}}) ->
w(" int i=0;~n"),
w(" for(~s::const_iterator it = ~s.begin(); it != ~s.end(); ++it) {~n",
[List, Name, Name]),
w(" ~s * ~sTmp = *it;~n", [Class,Name]),
w(" rt.addRef(getRef((void *)~sTmp,memenv), \"~s\"); i++;}~n",[Name,Class]),
- w(" rt.endList(~s.GetCount());~n",[Name]);
-
+ w(" rt.endList(~s.GetCount());~n",[Name]);
+
build_ret(Name,_,#type{name="wxArrayTreeItemIds"}) ->
- w(" for(unsigned int i=0; i < ~s.GetCount(); i++) {~n", [Name]),
+ w(" for(unsigned int i=0; i < ~s.GetCount(); i++) {~n", [Name]),
w(" rt.add((wxUIntPtr *)~s[i].m_pItem);}~n",[Name]),
w(" rt.endList(~s.GetCount());~n",[Name]);
@@ -923,10 +945,10 @@ build_ret(Name,_,#type{name="wxArrayString", single=array}) ->
w(" rt.add(~s);~n", [Name]);
build_ret(Name,In,T) ->
?error({nyi, Name,In, T}).
-
+
mods([const|R]) -> "const " ++ mods(R);
mods([unsigned|R]) -> "unsigned " ++ mods(R);
-mods([]) -> "".
+mods([]) -> "".
build_enums() ->
Tree = get(consts),
@@ -935,13 +957,13 @@ build_enums() ->
w("#include \"../wxe_impl.h\"~n"),
w("#include \"wxe_macros.h\"~n"),
w("#include \"../wxe_return.h\"~n"),
- w("void WxeApp::init_nonconsts(wxeMemEnv *memenv, ErlDrvTermData caller) {~n"),
+ w("void WxeApp::init_nonconsts(wxeMemEnv *memenv, ErlDrvTermData caller) {~n"),
NotConsts = [NC || NC = #const{is_const=false} <- gb_trees:values(Tree)],
Size = length(NotConsts),
GVars = get(gvars),
GSize = length(GVars),
w(" wxeReturn rt = wxeReturn(WXE_DRV_PORT, caller);~n"),
- w(" rt.addAtom((char*)\"wx_consts\");~n"),
+ w(" rt.addAtom((char*)\"wx_consts\");~n"),
[build_enum(NConst) || NConst <- lists:keysort(#const.val, NotConsts)],
_Cnt = foldl(fun(Gvar, I) -> build_gvar(Gvar,I) end, 0, lists:sort(GVars)),
w(" rt.endList(~p);~n", [Size+GSize]),
@@ -968,9 +990,9 @@ build_gvar({Name, Class, _Id}, Cnt) ->
Cnt+1.
gen_macros() ->
- w("#include <wx/caret.h>~n"), %% Arrg wxw forgot?? some files
- w("#include <wx/tooltip.h>~n"),
- w("#include <wx/gbsizer.h>~n"),
+ w("#include <wx/caret.h>~n"), %% Arrg wxw forgot?? some files
+ w("#include <wx/tooltip.h>~n"),
+ w("#include <wx/gbsizer.h>~n"),
w("#include <wx/splash.h>~n"),
w("#include <wx/grid.h>~n"),
w("#include <wx/image.h>~n"),
@@ -995,15 +1017,15 @@ gen_macros() ->
w("#include <wx/stc/stc.h>~n"),
w("#include <wx/minifram.h>~n"),
w("#include <wx/sashwin.h>~n"),
- w("#include <wx/laywin.h>~n"),
- w("#include <wx/graphics.h>~n"),
- w("#include <wx/aui/aui.h>~n"),
- w("#include <wx/datectrl.h>~n"),
- w("#include <wx/filepicker.h>~n"),
- w("#include <wx/fontpicker.h>~n"),
- w("#include <wx/clrpicker.h>~n"),
- w("#include <wx/statline.h>~n"),
- w("#include <wx/clipbrd.h>~n"),
+ w("#include <wx/laywin.h>~n"),
+ w("#include <wx/graphics.h>~n"),
+ w("#include <wx/aui/aui.h>~n"),
+ w("#include <wx/datectrl.h>~n"),
+ w("#include <wx/filepicker.h>~n"),
+ w("#include <wx/fontpicker.h>~n"),
+ w("#include <wx/clrpicker.h>~n"),
+ w("#include <wx/statline.h>~n"),
+ w("#include <wx/clipbrd.h>~n"),
w("#include <wx/splitter.h>~n"),
w("#include <wx/choicebk.h>~n"),
w("#include <wx/toolbook.h>~n"),
@@ -1012,14 +1034,14 @@ gen_macros() ->
w("#include <wx/html/htmlwin.h>~n"),
w("#include <wx/html/htmlcell.h>~n"),
w("#include <wx/filename.h>~n"),
-
+
w("~n~n", []),
w("#ifndef wxICON_DEFAULT_BITMAP_TYPE~n",[]),
w(" #define wxICON_DEFAULT_BITMAP_TYPE wxBITMAP_TYPE_ICO_RESOURCE~n",[]),
w("#endif~n", []),
w("~n~n", []),
- [w("#define ~s_~s ~p~n", [Class,Name,Id]) ||
+ [w("#define ~s_~s ~p~n", [Class,Name,Id]) ||
{Class,Name,_,Id} <- wx_gen_erl:get_unique_names()],
w("~n~n").
@@ -1032,29 +1054,29 @@ build_events() ->
w("#include \"wxe_macros.h\"~n"),
w("#include \"../wxe_events.h\"~n~n"),
w("#include \"../wxe_return.h\"~n~n"),
-
+
w("wxeEtype::wxeEtype(const char *name, int Id) {eName = name;cID = Id;}~n~n"),
w("WX_DECLARE_HASH_MAP(int, wxeEtype*, wxIntegerHash, wxIntegerEqual, wxeETmap );~n~n"),
-
+
w("wxeETmap etmap;~n~n"),
-
+
w(
"int wxeEventTypeFromAtom(char *etype_atom) {
wxeETmap::iterator it;
for(it = etmap.begin(); it != etmap.end(); ++it) {
wxeEtype * value = it->second;
- if(strcmp(value->eName, etype_atom) == 0) {
- if(it->first > wxEVT_USER_FIRST) {
+ if(strcmp(value->eName, etype_atom) == 0) {
+ if(it->first > wxEVT_USER_FIRST) {
return it->first - wxEVT_USER_FIRST;
} else {
return it->first;
}
}
- }
- return -1;
+ }
+ return -1;
}
-"),
+"),
Evs0 = [C || {_,C=#class{event=Evs}} <- get(), Evs =/= false],
Evs = lists:keysort(#class.id, Evs0),
@@ -1067,7 +1089,7 @@ initEventTable(Evs) ->
w(" struct { ",[]),
w("int ev_type; int class_id; const char * ev_name;} event_types[] =~n {~n",[]),
- lists:foreach(fun(Ev) -> init_event_classes(Ev) end,
+ lists:foreach(fun(Ev) -> init_event_classes(Ev) end,
[#class{id=0,event=[wxEVT_NULL]}|Evs]),
w(" {-1, 0, ""}~n };~n",[]),
w(" for(int i=0; event_types[i].ev_type != -1; i++) {~n",[]),
@@ -1085,7 +1107,7 @@ initEventTable(Evs) ->
" }~n"
" }~n", []),
w("}~n~n").
-
+
init_event_classes(#class{event=ETs, id=Id}) ->
F = fun({Eev, Cev, OtherClass}) ->
w(" {~w + wxEVT_USER_FIRST, ~w, ~p},~n",
@@ -1105,7 +1127,7 @@ find_id(OtherClass) ->
Class = get({class,atom_to_list(OtherClass)}),
%%{value, Class} = lists:keysearch(atom_to_list(OtherClass), #class.name, All),
Class#class.id.
-
+
encode_events(Evs) ->
?WTC("encode_events"),
w("void wxeEvtListener::forward(wxEvent& event)~n"
@@ -1132,7 +1154,7 @@ encode_events(Evs) ->
" wxeMemEnv *memenv = app->getMemEnv(port);~n"
" if(!memenv) return 0;~n~n"
" wxeReturn rt = wxeReturn(port, cb->listener);~n"),
-
+
w("~n rt.addAtom((char*)\"wx\");~n"
" rt.addInt((int) event->GetId());~n"
" rt.addRef(getRef((void *)(cb->obj), memenv), cb->class_name);~n"
@@ -1155,15 +1177,15 @@ encode_events(Evs) ->
w(" app->clearPtr((void *) event);~n"),
w(" } else {~n"),
w(" send_res = rt.send();~n"),
- w(" if(cb->skip) event->Skip();~n"),
+ w(" if(cb->skip) event->Skip();~n"),
w(" };~n"),
w(" return send_res;~n"),
w(" }~n").
encode_event(C = #class{name=Class, id=Id, options=Opts}) ->
?WTC("encode_event"),
- case proplists:get_value("mixed_event", Opts) of
- undefined ->
+ case proplists:get_value("mixed_event", Opts) of
+ undefined ->
w("case ~p: {// ~s~n", [Id,Class]),
encode_event2(C),
ok;
@@ -1189,10 +1211,10 @@ encode_event2(Class = #class{name=Name}) ->
build_event_attrs(ClassRec = #class{name=Class}) ->
Attrs0 = wx_gen_erl:filter_attrs(ClassRec),
- Rename =
- fun(Att = #param{name=Name,prot=public,acc=undefined}, {All,Use}) ->
+ Rename =
+ fun(Att = #param{name=Name,prot=public,acc=undefined}, {All,Use}) ->
{[Att#param{name= "ev->" ++ Name}|All],Use};
- (Att = #param{acc=Acc}, {All,_}) ->
+ (Att = #param{acc=Acc}, {All,_}) ->
{[Att#param{name= "ev->" ++ Acc}|All], true}
end,
case foldr(Rename,{[],false},Attrs0) of
@@ -1202,9 +1224,9 @@ build_event_attrs(ClassRec = #class{name=Class}) ->
%% Attrs;
{Attrs,_} ->
w(" ~s * ev = (~s *) event;~n",[Class,Class]),
- FixClass =
+ FixClass =
fun(P=#param{name=N,acc=Acc,type=#type{single=Single,by_val=ByVal,
- base={class,C}}})
+ base={class,C}}})
when Acc =/= undefined ->
Var = var_name(N),
if Single, ByVal ->
@@ -1215,17 +1237,17 @@ build_event_attrs(ClassRec = #class{name=Class}) ->
end,
P#param{name=Var};
(P) -> P
- end,
+ end,
lists:map(FixClass, Attrs)
end.
-var_name("ev->" ++ Name0) ->
+var_name("ev->" ++ Name0) ->
case reverse(Name0) of
")(" ++ Name -> reverse(Name);
_ -> Name0
end;
var_name(Name) -> Name.
-
+
enum_name({Class,Type}) ->
uppercase_all(Class ++ "_" ++ Type);
enum_name(Type) ->
diff --git a/lib/wx/api_gen/wx_gen_erl.erl b/lib/wx/api_gen/wx_gen_erl.erl
index e1201ab0d4..e882ae87ca 100644
--- a/lib/wx/api_gen/wx_gen_erl.erl
+++ b/lib/wx/api_gen/wx_gen_erl.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -19,7 +19,7 @@
%%%-------------------------------------------------------------------
%%% File : wx_gen_erl.erl
%%% Author : Dan Gudmundsson <[email protected]>
-%%% Description :
+%%% Description :
%%%
%%% Created : 25 Jan 2007 by Dan Gudmundsson <[email protected]>
%%%-------------------------------------------------------------------
@@ -32,7 +32,7 @@
-import(lists, [foldl/3,foldr/3,reverse/1, keysearch/3, map/2, filter/2]).
-import(gen_util, [lowercase/1, lowercase_all/1, uppercase/1, uppercase_all/1,
- open_write/1, close/0, erl_copyright/0, w/2,
+ open_write/1, close/0, erl_copyright/0, w/2,
args/3, args/4, strip_name/2]).
gen(Defs) ->
@@ -42,9 +42,9 @@ gen(Defs) ->
gen_enums_ints(),
[gen_class(Class) || Class <- Defs],
gen_funcnames().
-
+
gen_class(Class) ->
- try
+ try
gen_class1(Class)
catch throw:skipped ->
Class
@@ -52,10 +52,10 @@ gen_class(Class) ->
gen_class1(C=#class{name=Name,parent="static",methods=Ms,options=_Opts}) ->
open_write("../src/gen/wx_misc.erl"),
- put(current_class, Name),
+ put(current_class, Name),
erl_copyright(),
w("", []),
- w("%% This file is generated DO NOT EDIT~n~n", []),
+ w("%% This file is generated DO NOT EDIT~n~n", []),
w("%% @doc See external documentation: "
"<a href=\"http://www.wxwidgets.org/manuals/stable/wx_miscellany.html\">Misc</a>.\n\n",[]),
@@ -67,8 +67,8 @@ gen_class1(C=#class{name=Name,parent="static",methods=Ms,options=_Opts}) ->
Exp = fun(M) -> gen_export(C,M) end,
ExportList = lists:usort(lists:append(lists:map(Exp,reverse(Ms)))),
w("-export([~s]).~n~n", [args(fun(EF) -> EF end, ",", ExportList, 60)]),
-
-
+
+
Gen = fun(M) -> gen_method(Name,M) end,
NewMs = lists:map(Gen,reverse(Ms)),
close(),
@@ -79,13 +79,13 @@ gen_class1(C=#class{name=Name,parent=Parent,methods=Ms,options=Opts}) ->
case Opts of
["ignore"] -> throw(skipped);
_ -> ok
- end,
+ end,
open_write("../src/gen/"++Name++".erl"),
- put(current_class, Name),
+ put(current_class, Name),
erl_copyright(),
w("", []),
- w("%% This file is generated DO NOT EDIT~n~n", []),
-
+ w("%% This file is generated DO NOT EDIT~n~n", []),
+
case lists:member(taylormade, Opts) of
true ->
{ok, Bin} = file:read_file(filename:join([wx_extra, Name++".erl"])),
@@ -95,33 +95,33 @@ gen_class1(C=#class{name=Name,parent=Parent,methods=Ms,options=Opts}) ->
w("%% @doc See external documentation: "
"<a href=\"http://www.wxwidgets.org/manuals/stable/wx_~s.html\">~s</a>.\n",
[lowercase_all(Name), Name]),
-
+
case C#class.doc of
undefined -> ignore;
Str -> w("%%~n%% ~s~n~n%%~n", [Str])
end,
-
+
case C#class.event of
false -> ignore;
Evs ->
EvTypes = [event_type_name(Ev) || Ev <- Evs],
EvStr = args(fun(Ev) -> "<em>"++Ev++"</em>" end, ", ", EvTypes),
-
+
w("%% <dl><dt>Use {@link wxEvtHandler:connect/3.} with EventType:</dt>~n",[]),
w("%% <dd>~s</dd></dl>~n", [EvStr]),
- w("%% See also the message variant {@link wxEvtHandler:~s(). #~s{}} event record type.~n",
+ w("%% See also the message variant {@link wxEvtHandler:~s(). #~s{}} event record type.~n",
[event_rec_name(Name),event_rec_name(Name)]),
w("%%~n",[]),
ok
end,
-
+
Parents = parents(Parent),
case [P || P <- Parents, P =/= root, P =/= object] of
[] -> ignore;
- Ps ->
+ Ps ->
w("%% <p>This class is derived (and can use functions) from:~n", []),
[w("%% <br />{@link ~s}~n", [P]) || P <- Ps],
- w("%% </p>~n",[])
+ w("%% </p>~n",[])
end,
w("%% @type ~s(). An object reference, The representation is internal~n",[Name]),
w("%% and can be changed without notice. It can't be used for comparsion~n", []),
@@ -137,17 +137,17 @@ gen_class1(C=#class{name=Name,parent=Parent,methods=Ms,options=Opts}) ->
Done0 = ["Destroy", "New", "Create", "destroy", "new", "create"],
Done = gb_sets:from_list(Done0 ++ [M|| #method{name=M} <- lists:append(Ms)]),
{_, InExported} = gen_inherited(Parents, Done, []),
- w("-export([~s]).~n~n", [args(fun(EF) -> EF end, ",",
- lists:usort(["parent_class/1"|InExported]),
+ w("-export([~s]).~n~n", [args(fun(EF) -> EF end, ",",
+ lists:usort(["parent_class/1"|InExported]),
60)]),
-
+
w("%% @hidden~n", []),
parents_check(Parents),
-
+
Gen = fun(M) -> gen_method(Name,M) end,
NewMs = lists:map(Gen,reverse(Ms)),
- gen_dest(C, Ms),
-
+ gen_dest(C, Ms),
+
gen_inherited(Parents, Done, true)
end,
@@ -203,26 +203,26 @@ gen_export(#class{name=Class,abstract=Abs},Ms0) ->
[] -> [];
[M=#method{where=taylormade}|_] ->
[taylormade_export(Class, M)];
- Ms ->
+ Ms ->
GetF = fun(#method{method_type=constructor,where=W,params=Ps}) ->
{Args,Opts} = split_optional(Ps),
- OptLen = case Opts of
- [] -> 0;
+ OptLen = case Opts of
+ [] -> 0;
_ when W =:= erl_no_opt -> 0;
- _ -> 1
+ _ -> 1
end,
"new/" ++ integer_to_list(length(Args)+OptLen);
(#method{method_type=destructor}) ->
- case Abs of
- true -> [];
+ case Abs of
+ true -> [];
_ -> "destroy/1"
end;
(#method{name=N,alias=A,where=W, params=Ps}) ->
{Args,Opts} = split_optional(Ps),
- OptLen = case Opts of
- [] -> 0;
+ OptLen = case Opts of
+ [] -> 0;
_ when W =:= erl_no_opt -> 0;
- _ -> 1
+ _ -> 1
end,
erl_func_name(N,A) ++ "/" ++ integer_to_list(length(Args) + OptLen)
end,
@@ -235,10 +235,10 @@ gen_method(Class,Ms0) ->
Res = filter(RemoveC, Ms0),
case Res of
[] -> Ms0;
- [M=#method{where=taylormade}|_] ->
- taylormade_func(Class, M),
+ [#method{where=taylormade}|_] ->
+ taylormade_func(Class, Res),
Ms0;
- Ms ->
+ Ms ->
gen_doc(Class,Ms),
gen_method1(Ms),
Ms0
@@ -279,22 +279,22 @@ gen_method2(M=#method{name=N,alias=A,params=Ps,type=T,method_type=MT,id=MethodId
ignore -> skip;
_ -> w(" _Result =", [])
end,
-
+
case have_return_vals(T, Ps) of
_ when MT =:= constructor ->
w(" wxe_util:construct(~s,~n <<~s~s>>)", [MId, MArgs,MOpts]);
true ->
w(" wxe_util:call(~s,~n <<~s~s>>)", [MId, MArgs,MOpts]);
- false ->
+ false ->
w(" wxe_util:cast(~s,~n <<~s~s>>)", [MId, MArgs,MOpts])
end,
case gen_util:get_hook(erl, M#method.post_hook) of
ignore -> skip;
- Post ->
+ Post ->
w(",~n ~s~n", [Post]),
w(" _Result", [])
end,
-
+
erase(current_func),
M.
@@ -306,9 +306,9 @@ gen_dest(#class{name=CName,abstract=Abs}, Ms) ->
case lists:keysearch(destructor,#method.method_type, lists:append(Ms)) of
{value, #method{method_type=destructor, id=Id}} ->
case hd(reverse(parents(CName))) of
- object ->
+ object ->
gen_dest2(CName, object);
- root ->
+ root ->
gen_dest2(CName, Id)
end;
false ->
@@ -320,7 +320,7 @@ gen_dest2(Class, Id) ->
w("%% @spec (This::~s()) -> ok~n", [Class]),
w("%% @doc Destroys this object, do not use object again~n", []),
w("destroy(Obj=#wx_ref{type=Type}) ->~n", []),
- w(" ?CLASS(Type,~s),~n",[Class]),
+ w(" ?CLASS(Type,~s),~n",[Class]),
case Id of
object ->
w(" wxe_util:destroy(?DESTROY_OBJECT,Obj),~n ok.~n", []);
@@ -341,14 +341,14 @@ gen_inherited([Parent|Ps], Done0, Exported0) ->
gen_inherited(Ps, gb_sets:union(Done,Done0), Exported).
gen_inherited_ms([[#method{name=Name,alias=A,params=Ps0,where=W,method_type=MT}|_]|R],
- Class,Skip,Done, Exported)
- when W =/= merged_c ->
+ Class,Skip,Done, Exported)
+ when W =/= merged_c ->
case gb_sets:is_member(Name,Skip) of
false when MT =:= member, Exported =:= true ->
Ps = [patch_param(P,all) || P <- Ps0],
Opts = if W =:= erl_no_opt -> [];
- true ->
- [Opt || Opt = #param{def=Def,in=In, where=Where} <- Ps,
+ true ->
+ [Opt || Opt = #param{def=Def,in=In, where=Where} <- Ps,
Def =/= none, In =/= false, Where =/= c]
end,
w("%% @hidden~n", []),
@@ -359,10 +359,10 @@ gen_inherited_ms([[#method{name=Name,alias=A,params=Ps0,where=W,method_type=MT}|
gen_inherited_ms(R,Class, Skip, gb_sets:add(Name,Done), Exported);
false when MT =:= member, is_list(Exported) ->
{Args,Opts} = split_optional(Ps0),
- OptLen = case Opts of
- [] -> 0;
+ OptLen = case Opts of
+ [] -> 0;
_ when W =:= erl_no_opt -> 0;
- _ -> 1
+ _ -> 1
end,
Export = erl_func_name(Name,A) ++ "/" ++ integer_to_list(length(Args) + OptLen),
gen_inherited_ms(R,Class,Skip, gb_sets:add(Name,Done), [Export|Exported]);
@@ -374,17 +374,21 @@ gen_inherited_ms([[_|Check]|R],Class,Skip, Done0,Exp) ->
gen_inherited_ms([[]|R],Class,Skip,Done0,Exp) ->
gen_inherited_ms(R,Class,Skip,Done0,Exp);
gen_inherited_ms([], _, _Skip, Done,Exp) -> {Done,Exp}.
-
+
%%%%%%%%%%%%%%%
-taylormade_func(Class, #method{name=Name, id=Id}) ->
+taylormade_func(Class, [#method{name=Name, id=Id}|_]) ->
{ok, Bin} = file:read_file(filename:join([wx_extra, Class ++".erl"])),
- Str0 = binary_to_list(Bin),
- {match, [Str1]} = re:run(Str0, "<<"++Name++"(.*)"++Name++">>",
- [dotall, {capture, all_but_first, list}]),
-
- w(Str1, ["?" ++ get_unique_name(Id)]),
+ Src = binary_to_list(Bin),
+ Str = case gen_util:get_taylor_made(Src, Name) of
+ nomatch ->
+ {match, [Str0]} = gen_util:get_taylor_made(Src, get_unique_name(Id)),
+ Str0;
+ {match, [Str0]} ->
+ Str0
+ end,
+ w(Str, ["?" ++ get_unique_name(Id)]),
ok.
taylormade_export(Class, #method{name=Name}) ->
@@ -398,12 +402,12 @@ taylormade_export(Class, #method{name=Name}) ->
arg_type_tests([P|Ps], Mid0) ->
case arg_type_test(P,"\n",Mid0) of
- Mid0 ->
+ Mid0 ->
arg_type_tests(Ps, Mid0);
Mid -> %% Already checked the other args
Mid
end;
-arg_type_tests([],Mid) -> Mid.
+arg_type_tests([],Mid) -> Mid.
arg_type_test(#param{where=c}, _, Acc) ->
Acc;
@@ -412,7 +416,7 @@ arg_type_test(#param{name=Name0,in=In,type=#type{base={class,T},single=true},def
Name = erl_arg_name(Name0),
w(" ?CLASS(~sT,~s),~s", [Name,T,EOS]),
Acc;
-arg_type_test(#param{name=Name0,in=In,type=#type{base={class,T}}, def=none},EOS,Acc)
+arg_type_test(#param{name=Name0,in=In,type=#type{base={class,T}}, def=none},EOS,Acc)
when In =/= false ->
Name = erl_arg_name(Name0),
w(" [?CLASS(~sT,~s) || #wx_ref{type=~sT} <- ~s],~s", [Name,T,Name,Name,EOS]),
@@ -420,35 +424,35 @@ arg_type_test(#param{name=Name0,in=In,type=#type{base={class,T}}, def=none},EOS,
arg_type_test(#param{name=Name0,def=none,in=In,
type={merged,
M1, #type{base={class,T1},single=true},Ps1,
- M2, #type{base={class,T2},single=true},Ps2}}, EOS, _Acc)
+ M2, #type{base={class,T2},single=true},Ps2}}, EOS, _Acc)
when In =/= false ->
Name = erl_arg_name(Name0),
Opname = Name++"OP",
w(" ~s = case ?CLASS_T(~sT,~s) of~n true ->\n ", [Opname,Name,T1]),
- lists:foreach(fun(Param) -> arg_type_test(Param,"\n ", ignore) end,
+ lists:foreach(fun(Param) -> arg_type_test(Param,"\n ", ignore) end,
element(1,split_optional(Ps1))),
w("?~s;~n",[get_unique_name(M1)]),
w(" _ -> ?CLASS(~sT,~s),\n ",[Name,T2]),
{Ps21,_} = split_optional(patchArgName(Ps2,Ps1)),
- lists:foreach(fun(Param) -> arg_type_test(Param,"\n ", ignore) end,
+ lists:foreach(fun(Param) -> arg_type_test(Param,"\n ", ignore) end,
Ps21),
w("?~s\n end,~s",[get_unique_name(M2),EOS]),
Opname;
-arg_type_test(#param{name=Name0, type=#type{base=eventType}}, EOS, Acc) ->
+arg_type_test(#param{name=Name0, type=#type{base=eventType}}, EOS, Acc) ->
Name = erl_arg_name(Name0),
w(" ~sBin = list_to_binary([atom_to_list(~s)|[0]]),~s", [Name,Name,EOS]),
w(" ThisTypeBin = list_to_binary([atom_to_list(ThisT)|[0]]),~s", [EOS]),
Acc;
-arg_type_test(#param{name=Name0,def=none,type=#type{base={term,_}}}, EOS, Acc) ->
+arg_type_test(#param{name=Name0,def=none,type=#type{base={term,_}}}, EOS, Acc) ->
Name = erl_arg_name(Name0),
w(" wxe_util:send_bin(term_to_binary(~s)),~s", [Name,EOS]),
Acc;
-arg_type_test(#param{name=Name0,type=#type{base=binary}},EOS,Acc) ->
+arg_type_test(#param{name=Name0,type=#type{base=binary}},EOS,Acc) ->
Name = erl_arg_name(Name0),
w(" wxe_util:send_bin(~s),~s", [Name,EOS]),
Acc;
-arg_type_test(#param{name=Name0,type=#type{name=Type,base=Base,single=Single}},EOS,Acc) ->
- if
+arg_type_test(#param{name=Name0,type=#type{name=Type,base=Base,single=Single}},EOS,Acc) ->
+ if
Type =:= "wxArtClient", Single =:= true ->
Name = erl_arg_name(Name0),
w(" ~s_UC = unicode:characters_to_binary([~s, $_, $C,0]),~s",
@@ -458,11 +462,11 @@ arg_type_test(#param{name=Name0,type=#type{name=Type,base=Base,single=Single}},E
w(" ~s_UC = unicode:characters_to_binary([~s,0]),~s", [Name,Name,EOS]);
Type =:= "wxArrayString" ->
Name = erl_arg_name(Name0),
- w(" ~s_UCA = [unicode:characters_to_binary([~sTemp,0]) || ~s",
+ w(" ~s_UCA = [unicode:characters_to_binary([~sTemp,0]) || ~s",
[Name,Name, EOS]),
w(" ~sTemp <- ~s],~s", [Name,Name,EOS]);
true -> %% Not a string
- ignore
+ ignore
end,
Acc;
arg_type_test(_,_,Acc) -> Acc.
@@ -476,10 +480,10 @@ have_return_vals(void, Ps) ->
have_return_vals(#type{}, _) -> true.
gen_function_clause(Name0,MT,Ps,Optional,Variant) ->
- PArg = fun(Arg) ->
+ PArg = fun(Arg) ->
case lists:member(name_only, Variant) of
true -> func_arg_name(Arg);
- false ->
+ false ->
case lists:member(name_type, Variant) of
true ->
Name = func_arg_name(Arg),
@@ -495,17 +499,17 @@ gen_function_clause(Name0,MT,Ps,Optional,Variant) ->
Args = args(PArg, ",", Ps),
Name = case MT of constructor -> "new"; _ -> Name0 end,
w("~s(~s",[Name,Args]),
- Opts = case Optional of
+ Opts = case Optional of
[] -> "";
empty_list when Args =:= [] -> "[]";
empty_list -> ", []";
_ when Args =:= [] -> "Options";
- _ -> ", Options"
+ _ -> ", Options"
end,
w("~s)", [Opts]),
case lists:member(no_guards, Variant) of
true -> ok;
- false ->
+ false ->
Guards = args(fun guard_test/1, ",", Ps),
if
Guards =:= [], Opts =:= "" -> w(" ->~n", []);
@@ -517,10 +521,10 @@ gen_function_clause(Name0,MT,Ps,Optional,Variant) ->
split_optional(Ps) ->
split_optional(Ps, [], []).
-split_optional([P=#param{def=Def,in=In, where=Where}|Ps], Standard, Opts)
+split_optional([P=#param{def=Def,in=In, where=Where}|Ps], Standard, Opts)
when Def =/= none, In =/= false, Where =/= c ->
split_optional(Ps, Standard, [P|Opts]);
-split_optional([P=#param{def=Def,in=In, where=Where}|Ps], Standard, Opts)
+split_optional([P=#param{def=Def,in=In, where=Where}|Ps], Standard, Opts)
when Def =:= none, In =/= false, Where =/= c ->
split_optional(Ps, [P|Standard], Opts);
split_optional([_|Ps], Standard, Opts) ->
@@ -532,24 +536,24 @@ patch_param(P=#param{type=#type{base=Tuple}}, all) when is_tuple(Tuple) ->
P#param{type={class,ignore}};
patch_param(P=#param{type={merged,_,_,_,_,_,_}}, _) ->
P#param{type={class,ignore}};
-patch_param(P=#param{type=#type{base={class,_}}},_) ->
+patch_param(P=#param{type=#type{base={class,_}}},_) ->
P#param{type={class,ignore}};
-patch_param(P=#param{type=#type{base={ref,_}}},_) ->
+patch_param(P=#param{type=#type{base={ref,_}}},_) ->
P#param{type={class,ignore}};
patch_param(P,_) -> P.
func_arg_name(#param{def=Def}) when Def =/= none -> skip;
func_arg_name(#param{in=false}) -> skip;
func_arg_name(#param{where=c}) -> skip;
-func_arg_name(#param{name=Name}) ->
+func_arg_name(#param{name=Name}) ->
erl_arg_name(Name).
func_arg(#param{def=Def}) when Def =/= none -> skip;
func_arg(#param{in=false}) -> skip;
func_arg(#param{where=c}) -> skip;
-func_arg(#param{name=Name,type=#type{base=string}}) ->
+func_arg(#param{name=Name,type=#type{base=string}}) ->
erl_arg_name(Name);
-func_arg(#param{name=Name,type=#type{name="wxArrayString"}}) ->
+func_arg(#param{name=Name,type=#type{name="wxArrayString"}}) ->
erl_arg_name(Name);
func_arg(#param{name=Name0,type=#type{base={class,_CN}, single=true}}) ->
Name = erl_arg_name(Name0),
@@ -570,7 +574,7 @@ func_arg(#param{name=Name,type=#type{base={comp,"wxDateTime",_Tup}, single=true}
func_arg(#param{name=Name,type=#type{name="wxArtClient", single=true}}) ->
erl_arg_name(Name);
func_arg(#param{name=Name,type=#type{base={comp,_,Tup}, single=true}}) ->
- N = erl_arg_name(Name),
+ N = erl_arg_name(Name),
Doc = fun({_,V}) -> erl_arg_name(N)++V end,
"{" ++ args(Doc, ",", Tup) ++ "}";
func_arg(#param{name=Name}) ->
@@ -587,7 +591,7 @@ guard_test(#param{name=N, type=#type{name="wxArtClient"}}) ->
"is_list(" ++ erl_arg_name(N) ++")";
guard_test(#param{name=N, type=#type{name="wxArrayString"}}) ->
"is_list(" ++ erl_arg_name(N) ++")";
-guard_test(#param{name=Name,type=#type{single=Single}})
+guard_test(#param{name=Name,type=#type{single=Single}})
when Single =/= true->
"is_list(" ++ erl_arg_name(Name) ++ ")";
guard_test(#param{name=N,type=#type{base=int}}) ->
@@ -637,42 +641,42 @@ gen_doc(_Class,[#method{name=N,alias=A,params=Ps,type=T,where=erl_no_opt,method_
gen_function_clause(erl_func_name(N,A),MT,Ps,empty_list,[no_guards,name_only]);
gen_doc(Class,[#method{name=N,params=Ps,type=T}])->
{_, Optional} = split_optional(Ps),
- NonDef = [Arg || Arg = #param{def=Def,in=In, where=Where} <- Ps,
+ NonDef = [Arg || Arg = #param{def=Def,in=In, where=Where} <- Ps,
Def =:= none, In =/= false, Where =/= c],
OptsType = case Optional of
[] -> "";
_ when NonDef =:= [] -> "[Option]";
- _ -> ", [Option]"
+ _ -> ", [Option]"
end,
w("%% @spec (~s~s) -> ~s~n",
[doc_arg_types(Ps),OptsType,doc_return_types(T,Ps)]),
doc_optional(Optional, normal),
- DocEnum = doc_enum(T,Ps, normal),
+ DocEnum = doc_enum(T,Ps, normal),
case Class of
"utils" ->
w("%% @doc See <a href=\"http://www.wxwidgets.org/manuals/stable/wx_miscellany.html#~s\">"
- "external documentation</a>.~n",
+ "external documentation</a>.~n",
[lowercase_all(N)]);
_ ->
w("%% @doc See <a href=\"http://www.wxwidgets.org/manuals/stable/wx_~s.html#~s~s\">"
- "external documentation</a>.~n",
+ "external documentation</a>.~n",
[lowercase_all(Class),lowercase_all(Class),lowercase_all(N)])
end,
doc_enum_desc(DocEnum);
gen_doc(Class, Cs = [#method{name=N, alias=A,method_type=MT}|_]) ->
- GetRet = fun(#method{params=Ps,type=T}) ->
+ GetRet = fun(#method{params=Ps,type=T}) ->
doc_return_types(T,Ps)
end,
- GetArgs = fun(#method{params=Ps, where=Where}) ->
+ GetArgs = fun(#method{params=Ps, where=Where}) ->
Opt = case Where of
erl_no_opt -> [];
- _ ->
+ _ ->
case split_optional(Ps) of
{_, []} -> [];
_ -> ["[Option]"]
end
end,
- [doc_arg_type(P) ||
+ [doc_arg_type(P) ||
P=#param{in=In,def=none,where=W} <- Ps,
In =/= false, W =/= c] ++ Opt
end,
@@ -682,16 +686,16 @@ gen_doc(Class, Cs = [#method{name=N, alias=A,method_type=MT}|_]) ->
case Class of
"utils" ->
w("%% @doc See <a href=\"http://www.wxwidgets.org/manuals/stable/wx_miscellany.html#~s\">"
- "external documentation</a>.~n",
+ "external documentation</a>.~n",
[lowercase_all(N)]);
_ ->
w("%% @doc See <a href=\"http://www.wxwidgets.org/manuals/stable/wx_~s.html#~s~s\">"
- "external documentation</a>.~n",
+ "external documentation</a>.~n",
[lowercase_all(Class),lowercase_all(Class),lowercase_all(N)])
end,
Name = case MT of constructor -> "new"; _ -> erl_func_name(N,A) end,
w("%% <br /> Alternatives:~n",[]),
- [gen_doc2(Name, Clause) || Clause <- Cs],
+ [gen_doc2(Name, Clause) || Clause <- Cs],
ok.
gen_doc2(Name,#method{params=Ps,where=erl_no_opt,method_type=MT}) ->
@@ -704,11 +708,11 @@ gen_doc2(Name,#method{params=Ps,type=T}) ->
OptsType = case Optional of
[] -> "";
_ when NonDef =:= [] -> "[Option]";
- _ -> ", [Option]"
+ _ -> ", [Option]"
end,
w("%% <p><c>~n",[]),
w("%% ~s(~s~s) -> ~s </c>~n",
- [Name,doc_arg_types(Ps),OptsType,doc_return_types(T,Ps)]),
+ [Name,doc_arg_types(Ps),OptsType,doc_return_types(T,Ps)]),
doc_optional(Optional, xhtml),
DocEnum = doc_enum(T,Ps, xhtml),
doc_enum_desc(DocEnum),
@@ -717,7 +721,7 @@ gen_doc2(Name,#method{params=Ps,type=T}) ->
doc_arg(ArgList) ->
case all_eq(ArgList) of
true -> hd(ArgList);
- false ->
+ false ->
Get = fun(Str) ->
[_Name|Types] = string:tokens(Str, ":"),
case Types of
@@ -734,12 +738,12 @@ doc_arg(ArgList) ->
doc_ret(ArgList) ->
case all_eq(ArgList) of
true -> hd(ArgList);
- false ->
+ false ->
args(fun(A) -> A end, "|", ArgList)
end.
unique([], U) -> reverse(U);
-unique([H|R], U) ->
+unique([H|R], U) ->
case lists:member(H,U) of
false -> unique(R,[H|U]);
true -> unique(R,U)
@@ -756,7 +760,7 @@ zip(List) ->
zip([[F|L1]|List], Rest, AccL, Acc) ->
zip(List, [L1|Rest], [F|AccL], Acc);
-zip(Empty, Rest, AccL, Acc) ->
+zip(Empty, Rest, AccL, Acc) ->
true = empty(Empty),
case empty(Rest) andalso empty(AccL) of
true -> reverse(Acc);
@@ -779,7 +783,7 @@ doc_arg_type(_) -> skip.
doc_arg_type2(T=#type{single=Single}) when Single =:= array; Single =:= list ->
"[" ++ doc_arg_type3(T) ++ "]";
-doc_arg_type2(T) ->
+doc_arg_type2(T) ->
doc_arg_type3(T).
doc_arg_type3(#type{base=string}) -> "string()";
@@ -799,8 +803,8 @@ doc_arg_type3(#type{base={binary,_}}) -> "binary()";
doc_arg_type3(#type{base=eventType}) -> "atom()";
doc_arg_type3(#type{base={ref,N}}) -> N++"()";
doc_arg_type3(#type{base={term,_N}}) -> "term()";
-doc_arg_type3(T=#type{base={class,N}}) ->
- check_class(T),
+doc_arg_type3(T=#type{base={class,N}}) ->
+ check_class(T),
case get(current_class) of
N -> N ++ "()";
_ -> N++":" ++ N++"()"
@@ -809,7 +813,7 @@ doc_arg_type3({merged,_,T1=#type{base={class,N1}},_,_,T2=#type{base={class,N2}},
check_class(T1),
check_class(T2),
Curr = get(current_class),
- if
+ if
N1 =:= Curr, N2 =:= Curr -> N1++"() | "++ N2++"()";
N1 =:= Curr -> N1++"() | "++ N2++":" ++ N2++"()";
N2 =:= Curr -> N1++":" ++ N1++"() | "++ N2++"()";
@@ -824,7 +828,7 @@ doc_arg_type3(#type{base={comp,_,{record,Name}}}) ->
"wx:" ++ atom_to_list(Name) ++ "()";
doc_arg_type3(#type{base={comp,_,Tup}}) ->
Doc = fun({int,V}) -> V ++ "::integer()";
- ({double,V}) -> V ++ "::float()"
+ ({double,V}) -> V ++ "::float()"
end,
"{" ++ args(Doc, ",", Tup) ++ "}";
doc_arg_type3(T) -> ?error({unknown_type,T}).
@@ -834,7 +838,7 @@ doc_return_types(T, Ps) ->
doc_return_types2(void, []) -> "ok";
doc_return_types2(void, [#param{type=T}]) -> doc_arg_type2(T);
doc_return_types2(T, []) -> doc_arg_type2(T);
-doc_return_types2(void, Ps) ->
+doc_return_types2(void, Ps) ->
"{" ++ args(fun doc_arg_type/1,",",Ps) ++ "}";
doc_return_types2(T, Ps) ->
"{" ++ doc_arg_type2(T) ++ "," ++ args(fun doc_arg_type/1,",",Ps) ++ "}".
@@ -887,7 +891,7 @@ check_name(Name) -> Name.
marshal_opts([], _,_) -> ""; %% No opts skip this!
marshal_opts(Opts, Align, Args) ->
- w(" MOpts = fun", []),
+ w(" MOpts = fun", []),
marshal_opts1(Opts,1),
w(";~n (BadOpt, _) -> erlang:error({badoption, BadOpt}) end,~n", []),
w(" BinOpt = list_to_binary(lists:foldl(MOpts, [<<0:32>>], Options)),~n", []),
@@ -896,7 +900,7 @@ marshal_opts(Opts, Align, Args) ->
[] -> Str; % All Args are optional
_ -> ", " ++ Str
end.
-
+
marshal_opts1([P],N) ->
marshal_opt(P,N);
marshal_opts1([P|R],N) ->
@@ -909,15 +913,15 @@ marshal_opt(P0=#param{name=Name,type=Type},N) ->
{Arg,Align} = marshal_arg(Type,erl_arg_name(Name),1),
AStr = if Align =:= 0 -> "";
Align =:= 1 -> ",0:32"
- end,
- w("({~s, ~s}, Acc) -> ", [erl_option_name(Name), func_arg(P)]),
+ end,
+ w("({~s, ~s}, Acc) -> ", [erl_option_name(Name), func_arg(P)]),
arg_type_test(P,"",[]),
case Arg of
- skip ->
+ skip ->
w("[<<~p:32/?UI~s>>|Acc]", [N, AStr]);
- _ ->
+ _ ->
w("[<<~p:32/?UI,~s~s>>|Acc]", [N, Arg,AStr])
- end.
+ end.
marshal_args(Ps) ->
marshal_args(Ps, [], 0).
@@ -957,23 +961,23 @@ marshal_arg(#type{single=true,base={enum,_Enum}}, Name, Align) ->
marshal_arg(#type{single=true,base=bool}, Name, Align) ->
align(32, Align, "(wxe_util:from_bool(" ++ Name ++ ")):32/?UI");
-marshal_arg(#type{name="wxChar", single=Single}, Name, Align0)
+marshal_arg(#type{name="wxChar", single=Single}, Name, Align0)
when Single =/= true ->
- {Str,Align} =
+ {Str,Align} =
align(32,Align0, "(byte_size("++Name++"_UC)):32/?UI,(" ++ Name ++ "_UC)/binary"),
MsgSize = "(" ++ integer_to_list(Align*4)++"+byte_size("++Name++"_UC))",
{Str++", 0:(((8- (" ++ MsgSize ++" band 16#7)) band 16#7))/unit:8",0};
marshal_arg(#type{base=string}, Name, Align0) ->
- {Str,Align} =
+ {Str,Align} =
align(32,Align0, "(byte_size("++Name++"_UC)):32/?UI,(" ++ Name ++ "_UC)/binary"),
MsgSize = "(" ++ integer_to_list(Align*4)++"+byte_size("++Name++"_UC))",
{Str++", 0:(((8- (" ++ MsgSize ++" band 16#7)) band 16#7))/unit:8",0};
marshal_arg(#type{name="wxArrayString"}, Name, Align0) ->
- InnerBin = "<<(byte_size(UC_Str)):32/?UI, UC_Str/binary>>",
+ InnerBin = "<<(byte_size(UC_Str)):32/?UI, UC_Str/binary>>",
Outer = "(<< " ++ InnerBin ++ "|| UC_Str <- "++ Name ++"_UCA>>)/binary",
Str0 = "(length("++Name++"_UCA)):32/?UI, " ++ Outer,
{Str,Align} = align(32,Align0,Str0),
- MsgSize = "("++integer_to_list(Align*4) ++
+ MsgSize = "("++integer_to_list(Align*4) ++
" + lists:sum([byte_size(S)+4||S<-" ++ Name ++"_UCA]))",
AStr = ", 0:(((8- (" ++ MsgSize ++" band 16#7)) band 16#7))/unit:8",
{Str ++ AStr, 0};
@@ -997,15 +1001,15 @@ marshal_arg(#type{base={term,_}}, _Name, Align0) ->
{skip,Align0};
marshal_arg(#type{base=binary}, _Name, Align0) ->
{skip,Align0};
-marshal_arg(#type{base=Base, single=Single}, Name, Align0)
+marshal_arg(#type{base=Base, single=Single}, Name, Align0)
when Single =/= true ->
- case Base of
- int ->
+ case Base of
+ int ->
Str0 = "(length("++Name++")):32/?UI,\n"
" (<< <<C:32/?I>> || C <- "++Name++">>)/binary",
{Str,Align} = align(32,Align0, Str0),
{Str ++ ", 0:((("++integer_to_list(Align)++"+length("++Name++ ")) rem 2)*32)", 0};
- {ObjRef,_} when ObjRef =:= class; ObjRef =:= ref ->
+ {ObjRef,_} when ObjRef =:= class; ObjRef =:= ref ->
Str0 = "(length("++Name++")):32/?UI,",
Str1 = "\n (<< <<(C#wx_ref.ref):32/?UI>> || C <- "++Name++">>)/binary",
{Str2,Align} = align(32, Align0, Str1),
@@ -1033,7 +1037,7 @@ align(64, 0, Str) -> {Str, 0};
align(64, 1, Str) -> {"0:32," ++ Str,0};
align(Sz, W, Str) -> align(Sz, W rem 2, Str).
-enum_name(Name) ->
+enum_name(Name) ->
case string:tokens(Name, ":") of
[Name] -> Name;
[C,N] -> C ++ "_" ++ N
@@ -1053,10 +1057,10 @@ gen_enums_ints() ->
" }).~n", []),
w("~n%% Hardcoded Defines~n", []),
Enums = [E || {{enum,_},E = #enum{as_atom=false}} <- get()],
- w("-define(wxDefaultSize, {-1,-1}).~n", []),
- w("-define(wxDefaultPosition, {-1,-1}).~n", []),
+ w("-define(wxDefaultSize, {-1,-1}).~n", []),
+ w("-define(wxDefaultPosition, {-1,-1}).~n", []),
w("~n%% Global Variables~n", []),
- [w("-define(~s, wxe_util:get_const(~s)).~n", [Gvar, Gvar]) ||
+ [w("-define(~s, wxe_util:get_const(~s)).~n", [Gvar, Gvar]) ||
{Gvar,_,_Id} <- get(gvars)],
w("~n%% Enum and defines~n", []),
foldl(fun(Enum= #enum{vals=Vals}, Done) when Vals =/= [] ->
@@ -1076,7 +1080,7 @@ build_enum_ints(#enum{from=From, vals=Vals},Done) ->
{_File, Class, Name} ->
w("% From class ~s::~s~n",[Class, Name])
end,
-
+
Format = fun(#const{name="wxEVT_" ++ _}) ->
ignore; %% Ignore event macros they are not valid in our event model
(#const{name=Name,val=Value,is_const=true}) when is_integer(Value) ->
@@ -1100,12 +1104,12 @@ build_enum_ints(#enum{from=From, vals=Vals},Done) ->
Consts = get(consts),
Write = fun({Name,_What}, Skip) ->
case gb_sets:is_member(Name,Skip) of
- true ->
+ true ->
Skip;
false ->
case gb_trees:lookup(Name, Consts) of
{value, Const} ->
- Format(Const),
+ Format(Const),
gb_sets:add(Name,Skip);
none -> Skip
end
@@ -1119,8 +1123,8 @@ gen_event_recs() ->
w("", []),
w("%% This file is generated DO NOT EDIT~n~n", []),
w("%% All event messages are encapsulated in a wx record~n"
- "%% they contain the widget id and a specialized event record.~n"
- "%% Each event record may be sent for one or more event types.~n"
+ "%% they contain the widget id and a specialized event record.~n"
+ "%% Each event record may be sent for one or more event types.~n"
"%% The mapping to wxWidgets is one record per class.~n~n",[]),
w("%% @type wx() = #wx{id=integer(), obj=wx:wxObject(), userData=term(), event=Rec}. Rec is a event record.~n",[]),
w("-record(wx, {id, %% Integer Identity of object.~n"
@@ -1130,7 +1134,7 @@ gen_event_recs() ->
w("%% Here comes the definitions of all event records.~n"
"%% they contain the event type and possible some extra information.~n~n",[]),
Types = [build_event_rec(C) || {_,C=#class{event=Evs}} <- get(), Evs =/= false],
- w("%% @type wxEventType() = ~s.~n",
+ w("%% @type wxEventType() = ~s.~n",
[args(fun(Ev) -> Ev end, " | ", lists:sort(lists:append(Types)))]),
%% close(), closed in gen_enums_ints
ok.
@@ -1145,22 +1149,22 @@ find_inherited_attr(Param = {PName,_}, Name) ->
end.
filter_attrs(#class{name=Name, parent=Parent,attributes=Attrs}) ->
- Attr1 = lists:foldl(fun(#param{acc=skip},Acc) -> Acc;
+ Attr1 = lists:foldl(fun(#param{acc=skip},Acc) -> Acc;
(P=#param{prot=public},Acc) -> [P|Acc];
- (#param{acc=undefined},Acc) -> Acc;
+ (#param{acc=undefined},Acc) -> Acc;
({inherited, PName},Acc) ->
case find_inherited_attr(PName, Parent) of
- undefined ->
+ undefined ->
io:format("~p:~p: Missing Event Attr ~p in ~p~n",
[?MODULE,?LINE, PName, Name]),
Acc;
- P ->
+ P ->
[P|Acc]
end;
(P, Acc) -> [P|Acc]
end, [], Attrs),
lists:reverse(Attr1).
-
+
build_event_rec(Class=#class{name=Name, event=Evs}) ->
EvTypes = [event_type_name(Ev) || Ev <- Evs],
Str = args(fun(Ev) -> "<em>"++Ev++"</em>" end, ", ", EvTypes),
@@ -1168,26 +1172,26 @@ build_event_rec(Class=#class{name=Name, event=Evs}) ->
Rec = event_rec_name(Name),
GetName = fun(#param{name=N}) ->event_attr_name(N) end,
GetType = fun(#param{name=N,type=T}) ->
- event_attr_name(N) ++ "=" ++ doc_arg_type2(T)
+ event_attr_name(N) ++ "=" ++ doc_arg_type2(T)
end,
case Attr =:= [] of
- true ->
+ true ->
w("%% @type ~s() = #~s{type=wxEventType()}.~n", [Rec,Rec]),
w("%% <dl><dt>EventType:</dt> <dd>~s</dd></dl>~n",[Str]),
-%% case is_command_event(Name) of
+%% case is_command_event(Name) of
%% true -> w("%% This event skips other event handlers.~n",[]);
%% false -> w("%% This event will be handled by other handlers~n",[])
%% end,
w("%% Callback event: {@link ~s}~n", [Name]),
w("-record(~s, {type}).~n~n", [Rec]);
false ->
- w("%% @type ~s() = #~s{type=wxEventType(),~s}.~n",
+ w("%% @type ~s() = #~s{type=wxEventType(),~s}.~n",
[Rec,Rec,args(GetType,",",Attr)]),
w("%% <dl><dt>EventType:</dt> <dd>~s</dd></dl>~n",[Str]),
-%% case is_command_event(Name) of
+%% case is_command_event(Name) of
%% true -> w("%% This event skips other event handlers.~n",[]);
%% false -> w("%% This event will be handled by other handlers~n",[])
-%% end,
+%% end,
w("%% Callback event: {@link ~s}~n", [Name]),
w("-record(~s,{type, ~s}).~n~n", [Rec,args(GetName,",",Attr)])
end,
@@ -1198,7 +1202,7 @@ is_command_event(Name) ->
true -> true;
false -> false
end.
-
+
event_rec_name(Name0 = "wx" ++ _) ->
"tnevE" ++ Name1 = reverse(Name0),
reverse(Name1).
@@ -1215,7 +1219,7 @@ event_attr_name(Attr) ->
lowercase(Attr).
-gen_funcnames() ->
+gen_funcnames() ->
open_write("../src/gen/wxe_debug.hrl"),
erl_copyright(),
w("%% This file is generated DO NOT EDIT~n~n", []),
@@ -1257,7 +1261,7 @@ unique_names(Ms0, Class) ->
Ms = split_list(fun(#method{name=N}, M) -> {N =:= M, N} end, undefined, Ms2),
unique_names2(Ms,Class).
%% by Names
-unique_names2([[#method{id=Id, name=Method,alias=Alias, max_arity=A}]|Ms], Class) ->
+unique_names2([[#method{id=Id, name=Method,alias=Alias, max_arity=A}]|Ms], Class) ->
[{Class,uname(alias(Method,Alias),Class),A,Id} | unique_names2(Ms,Class)];
unique_names2([Ms0|RMs], Class) ->
Split = fun(#method{max_arity=A}, P) -> {A =:= P, A} end,
@@ -1278,11 +1282,11 @@ unique_names4([], _, _Class) -> [].
alias(Method, undefined) -> Method;
alias(_, Alias) -> Alias.
-
+
uname(Class,Class) -> "new";
uname([$~ | _], _ ) -> "destruct";
uname(Name, _) -> Name.
-
+
split_list(F, Keep, List) ->
split_list(F, Keep, List, []).
@@ -1297,5 +1301,5 @@ split_list(F, Keep, [M|Ms], Acc) ->
end;
split_list(_, _, [], []) -> [];
split_list(_, _, [], Acc) -> [lists:reverse(Acc)].
-
+
diff --git a/lib/wx/api_gen/wxapi.conf b/lib/wx/api_gen/wxapi.conf
index aec8a4944a..8ee4451057 100644
--- a/lib/wx/api_gen/wxapi.conf
+++ b/lib/wx/api_gen/wxapi.conf
@@ -2,7 +2,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -756,7 +756,9 @@
'SetFirstItem']}.
{class, wxListCtrl, wxControl, [],
- ['wxListCtrl','~wxListCtrl','Arrange','AssignImageList','ClearAll','Create',
+ [{'wxListCtrl', [{where, taylormade}]},
+ '~wxListCtrl','Arrange','AssignImageList','ClearAll',
+ {'Create',[{where, taylormade}]},
'DeleteAllItems','DeleteColumn','DeleteItem',
{'EditLabel',[{"textControlClass",nowhere}]},
'EnsureVisible',
@@ -788,6 +790,13 @@
'SetFont','SetId','SetImage','SetMask','SetState',
'SetStateMask','SetText','SetTextColour','SetWidth']}.
+{class, wxListItemAttr, root, [],
+ ['wxListItemAttr','~wxListItemAttr',
+ 'GetBackgroundColour', 'GetFont',
+ 'GetTextColour', 'HasBackgroundColour', 'HasFont',
+ 'HasTextColour', 'SetBackgroundColour', 'SetFont', 'SetTextColour'
+ ]}.
+
{class, wxImageList, object, [{skip, [{'Create',1}]}], %% No create/0 on windows
['wxImageList','~wxImageList','Add','Create','Draw','GetBitmap','GetIcon','GetImageCount',
'GetSize','Remove','RemoveAll','Replace']}.
diff --git a/lib/wx/c_src/gen/wxe_derived_dest.h b/lib/wx/c_src/gen/wxe_derived_dest.h
index ad46a98c90..4e4aea098d 100644
--- a/lib/wx/c_src/gen/wxe_derived_dest.h
+++ b/lib/wx/c_src/gen/wxe_derived_dest.h
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2010. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
@@ -362,10 +362,22 @@ class EwxListBox : public wxListBox {
EwxListBox() : wxListBox() {};
};
+
class EwxListCtrl : public wxListCtrl {
- public: ~EwxListCtrl() {((WxeApp *)wxTheApp)->clearPtr(this);};
+ public: ~EwxListCtrl();
EwxListCtrl(wxWindow * parent,wxWindowID winid,const wxPoint& pos,const wxSize& size,long style,const wxValidator& validator) : wxListCtrl(parent,winid,pos,size,style,validator) {};
EwxListCtrl() : wxListCtrl() {};
+
+ int onGetItemText;
+ int onGetItemAttr;
+ int onGetItemColumnImage;
+ ErlDrvPort port;
+
+ private:
+ virtual wxString OnGetItemText(long item, long col) const;
+ virtual wxListItemAttr* OnGetItemAttr(long item) const;
+ virtual int OnGetItemImage(long item) const;
+ virtual int OnGetItemColumnImage(long item, long column) const;
};
class EwxListItem : public wxListItem {
@@ -715,28 +727,3 @@ class EwxHtmlWindow : public wxHtmlWindow {
EwxHtmlWindow() : wxHtmlWindow() {};
};
-void WxeApp::delete_object(void *ptr, wxeRefData *refd) {
- switch(refd->type) {
- case 24: delete (wxGridCellBoolRenderer *) ptr; break;
- case 25: delete (wxGridCellBoolEditor *) ptr; break;
- case 26: delete (wxGridCellFloatRenderer *) ptr; break;
- case 27: delete (wxGridCellFloatEditor *) ptr; break;
- case 28: delete (wxGridCellStringRenderer *) ptr; break;
- case 29: delete (wxGridCellTextEditor *) ptr; break;
- case 30: delete (wxGridCellChoiceEditor *) ptr; break;
- case 31: delete (wxGridCellNumberRenderer *) ptr; break;
- case 32: delete (wxGridCellNumberEditor *) ptr; break;
- case 61: delete (wxIconBundle *) ptr; break;
- case 69: delete (wxAcceleratorEntry *) ptr; break;
- case 70: /* delete (wxCaret *) ptr;These objects must be deleted by owner object */ break;
- case 72: delete (wxSizerFlags *) ptr; break;
- case 88: /* delete (wxCalendarDateAttr *) ptr;These objects must be deleted by owner object */ break;
- case 102: delete (wxTextAttr *) ptr; break;
- case 154: delete (wxAuiPaneInfo *) ptr; break;
- case 211: /* delete (wxFileDataObject *) ptr;These objects must be deleted by owner object */ break;
- case 212: /* delete (wxTextDataObject *) ptr;These objects must be deleted by owner object */ break;
- case 213: /* delete (wxBitmapDataObject *) ptr;These objects must be deleted by owner object */ break;
- case 223: delete (wxLogNull *) ptr; break;
- default: delete (wxObject *) ptr;
-}}
-
diff --git a/lib/wx/c_src/gen/wxe_events.cpp b/lib/wx/c_src/gen/wxe_events.cpp
index 692eef858c..b9769318af 100644
--- a/lib/wx/c_src/gen/wxe_events.cpp
+++ b/lib/wx/c_src/gen/wxe_events.cpp
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2010. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
@@ -37,15 +37,15 @@ int wxeEventTypeFromAtom(char *etype_atom) {
wxeETmap::iterator it;
for(it = etmap.begin(); it != etmap.end(); ++it) {
wxeEtype * value = it->second;
- if(strcmp(value->eName, etype_atom) == 0) {
- if(it->first > wxEVT_USER_FIRST) {
+ if(strcmp(value->eName, etype_atom) == 0) {
+ if(it->first > wxEVT_USER_FIRST) {
return it->first - wxEVT_USER_FIRST;
} else {
return it->first;
}
}
- }
- return -1;
+ }
+ return -1;
}
void initEventTable()
@@ -53,254 +53,254 @@ void initEventTable()
struct { int ev_type; int class_id; const char * ev_name;} event_types[] =
{
{wxEVT_NULL, 0, "null"},
- {wxEVT_COMMAND_BUTTON_CLICKED, 163, "command_button_clicked"},
- {wxEVT_COMMAND_CHECKBOX_CLICKED, 163, "command_checkbox_clicked"},
- {wxEVT_COMMAND_CHOICE_SELECTED, 163, "command_choice_selected"},
- {wxEVT_COMMAND_LISTBOX_SELECTED, 163, "command_listbox_selected"},
- {wxEVT_COMMAND_LISTBOX_DOUBLECLICKED, 163, "command_listbox_doubleclicked"},
- {wxEVT_COMMAND_TEXT_UPDATED, 163, "command_text_updated"},
- {wxEVT_COMMAND_TEXT_ENTER, 163, "command_text_enter"},
- {wxEVT_COMMAND_MENU_SELECTED, 163, "command_menu_selected"},
- {wxEVT_COMMAND_SLIDER_UPDATED, 163, "command_slider_updated"},
- {wxEVT_COMMAND_RADIOBOX_SELECTED, 163, "command_radiobox_selected"},
- {wxEVT_COMMAND_RADIOBUTTON_SELECTED, 163, "command_radiobutton_selected"},
- {wxEVT_COMMAND_SCROLLBAR_UPDATED, 163, "command_scrollbar_updated"},
- {wxEVT_COMMAND_VLBOX_SELECTED, 163, "command_vlbox_selected"},
- {wxEVT_COMMAND_COMBOBOX_SELECTED, 163, "command_combobox_selected"},
- {wxEVT_COMMAND_TOOL_RCLICKED, 163, "command_tool_rclicked"},
- {wxEVT_COMMAND_TOOL_ENTER, 163, "command_tool_enter"},
- {wxEVT_COMMAND_CHECKLISTBOX_TOGGLED, 163, "command_checklistbox_toggled"},
- {wxEVT_COMMAND_TOGGLEBUTTON_CLICKED, 163, "command_togglebutton_clicked"},
- {wxEVT_COMMAND_LEFT_CLICK, 163, "command_left_click"},
- {wxEVT_COMMAND_LEFT_DCLICK, 163, "command_left_dclick"},
- {wxEVT_COMMAND_RIGHT_CLICK, 163, "command_right_click"},
- {wxEVT_COMMAND_SET_FOCUS, 163, "command_set_focus"},
- {wxEVT_COMMAND_KILL_FOCUS, 163, "command_kill_focus"},
- {wxEVT_COMMAND_ENTER, 163, "command_enter"},
- {wxEVT_SCROLL_TOP, 164, "scroll_top"},
- {wxEVT_SCROLL_BOTTOM, 164, "scroll_bottom"},
- {wxEVT_SCROLL_LINEUP, 164, "scroll_lineup"},
- {wxEVT_SCROLL_LINEDOWN, 164, "scroll_linedown"},
- {wxEVT_SCROLL_PAGEUP, 164, "scroll_pageup"},
- {wxEVT_SCROLL_PAGEDOWN, 164, "scroll_pagedown"},
- {wxEVT_SCROLL_THUMBTRACK, 164, "scroll_thumbtrack"},
- {wxEVT_SCROLL_THUMBRELEASE, 164, "scroll_thumbrelease"},
- {wxEVT_SCROLL_CHANGED, 164, "scroll_changed"},
- {wxEVT_SCROLLWIN_TOP, 165, "scrollwin_top"},
- {wxEVT_SCROLLWIN_BOTTOM, 165, "scrollwin_bottom"},
- {wxEVT_SCROLLWIN_LINEUP, 165, "scrollwin_lineup"},
- {wxEVT_SCROLLWIN_LINEDOWN, 165, "scrollwin_linedown"},
- {wxEVT_SCROLLWIN_PAGEUP, 165, "scrollwin_pageup"},
- {wxEVT_SCROLLWIN_PAGEDOWN, 165, "scrollwin_pagedown"},
- {wxEVT_SCROLLWIN_THUMBTRACK, 165, "scrollwin_thumbtrack"},
- {wxEVT_SCROLLWIN_THUMBRELEASE, 165, "scrollwin_thumbrelease"},
- {wxEVT_LEFT_DOWN, 166, "left_down"},
- {wxEVT_LEFT_UP, 166, "left_up"},
- {wxEVT_MIDDLE_DOWN, 166, "middle_down"},
- {wxEVT_MIDDLE_UP, 166, "middle_up"},
- {wxEVT_RIGHT_DOWN, 166, "right_down"},
- {wxEVT_RIGHT_UP, 166, "right_up"},
- {wxEVT_MOTION, 166, "motion"},
- {wxEVT_ENTER_WINDOW, 166, "enter_window"},
- {wxEVT_LEAVE_WINDOW, 166, "leave_window"},
- {wxEVT_LEFT_DCLICK, 166, "left_dclick"},
- {wxEVT_MIDDLE_DCLICK, 166, "middle_dclick"},
- {wxEVT_RIGHT_DCLICK, 166, "right_dclick"},
- {wxEVT_MOUSEWHEEL, 166, "mousewheel"},
- {wxEVT_NC_LEFT_DOWN, 166, "nc_left_down"},
- {wxEVT_NC_LEFT_UP, 166, "nc_left_up"},
- {wxEVT_NC_MIDDLE_DOWN, 166, "nc_middle_down"},
- {wxEVT_NC_MIDDLE_UP, 166, "nc_middle_up"},
- {wxEVT_NC_RIGHT_DOWN, 166, "nc_right_down"},
- {wxEVT_NC_RIGHT_UP, 166, "nc_right_up"},
- {wxEVT_NC_MOTION, 166, "nc_motion"},
- {wxEVT_NC_ENTER_WINDOW, 166, "nc_enter_window"},
- {wxEVT_NC_LEAVE_WINDOW, 166, "nc_leave_window"},
- {wxEVT_NC_LEFT_DCLICK, 166, "nc_left_dclick"},
- {wxEVT_NC_MIDDLE_DCLICK, 166, "nc_middle_dclick"},
- {wxEVT_NC_RIGHT_DCLICK, 166, "nc_right_dclick"},
- {wxEVT_SET_CURSOR, 167, "set_cursor"},
- {wxEVT_CHAR, 168, "char"},
- {wxEVT_CHAR_HOOK, 168, "char_hook"},
- {wxEVT_KEY_DOWN, 168, "key_down"},
- {wxEVT_KEY_UP, 168, "key_up"},
- {wxEVT_SIZE, 169, "size"},
- {wxEVT_MOVE, 170, "move"},
- {wxEVT_PAINT, 171, "paint"},
- {wxEVT_PAINT_ICON, 171, "paint_icon"},
- {wxEVT_NC_PAINT, 172, "nc_paint"},
- {wxEVT_ERASE_BACKGROUND, 173, "erase_background"},
- {wxEVT_SET_FOCUS, 174, "set_focus"},
- {wxEVT_KILL_FOCUS, 174, "kill_focus"},
- {wxEVT_CHILD_FOCUS, 175, "child_focus"},
- {wxEVT_MENU_OPEN, 176, "menu_open"},
- {wxEVT_MENU_CLOSE, 176, "menu_close"},
- {wxEVT_MENU_HIGHLIGHT, 176, "menu_highlight"},
- {wxEVT_CLOSE_WINDOW, 177, "close_window"},
- {wxEVT_END_SESSION, 177, "end_session"},
- {wxEVT_QUERY_END_SESSION, 177, "query_end_session"},
- {wxEVT_SHOW, 178, "show"},
- {wxEVT_ICONIZE, 179, "iconize"},
- {wxEVT_MAXIMIZE, 180, "maximize"},
- {wxEVT_JOY_BUTTON_DOWN, 181, "joy_button_down"},
- {wxEVT_JOY_BUTTON_UP, 181, "joy_button_up"},
- {wxEVT_JOY_MOVE, 181, "joy_move"},
- {wxEVT_JOY_ZMOVE, 181, "joy_zmove"},
- {wxEVT_UPDATE_UI, 182, "update_ui"},
- {wxEVT_SYS_COLOUR_CHANGED, 183, "sys_colour_changed"},
- {wxEVT_MOUSE_CAPTURE_CHANGED, 184, "mouse_capture_changed"},
- {wxEVT_DISPLAY_CHANGED, 185, "display_changed"},
- {wxEVT_PALETTE_CHANGED, 186, "palette_changed"},
- {wxEVT_QUERY_NEW_PALETTE, 187, "query_new_palette"},
- {wxEVT_NAVIGATION_KEY, 188, "navigation_key"},
- {wxEVT_CREATE, 189, "create"},
- {wxEVT_DESTROY, 190, "destroy"},
- {wxEVT_HELP, 191, "help"},
- {wxEVT_DETAILED_HELP, 191, "detailed_help"},
- {wxEVT_CONTEXT_MENU, 192, "context_menu"},
- {wxEVT_IDLE, 193, "idle"},
- {wxEVT_GRID_CELL_LEFT_CLICK, 194, "grid_cell_left_click"},
- {wxEVT_GRID_CELL_RIGHT_CLICK, 194, "grid_cell_right_click"},
- {wxEVT_GRID_CELL_LEFT_DCLICK, 194, "grid_cell_left_dclick"},
- {wxEVT_GRID_CELL_RIGHT_DCLICK, 194, "grid_cell_right_dclick"},
- {wxEVT_GRID_LABEL_LEFT_CLICK, 194, "grid_label_left_click"},
- {wxEVT_GRID_LABEL_RIGHT_CLICK, 194, "grid_label_right_click"},
- {wxEVT_GRID_LABEL_LEFT_DCLICK, 194, "grid_label_left_dclick"},
- {wxEVT_GRID_LABEL_RIGHT_DCLICK, 194, "grid_label_right_dclick"},
- {wxEVT_GRID_ROW_SIZE, 194, "grid_row_size"},
- {wxEVT_GRID_COL_SIZE, 194, "grid_col_size"},
- {wxEVT_GRID_RANGE_SELECT, 194, "grid_range_select"},
- {wxEVT_GRID_CELL_CHANGE, 194, "grid_cell_change"},
- {wxEVT_GRID_SELECT_CELL, 194, "grid_select_cell"},
- {wxEVT_GRID_EDITOR_SHOWN, 194, "grid_editor_shown"},
- {wxEVT_GRID_EDITOR_HIDDEN, 194, "grid_editor_hidden"},
- {wxEVT_GRID_EDITOR_CREATED, 194, "grid_editor_created"},
- {wxEVT_GRID_CELL_BEGIN_DRAG, 194, "grid_cell_begin_drag"},
- {wxEVT_SASH_DRAGGED, 196, "sash_dragged"},
- {wxEVT_COMMAND_LIST_BEGIN_DRAG, 197, "command_list_begin_drag"},
- {wxEVT_COMMAND_LIST_BEGIN_RDRAG, 197, "command_list_begin_rdrag"},
- {wxEVT_COMMAND_LIST_BEGIN_LABEL_EDIT, 197, "command_list_begin_label_edit"},
- {wxEVT_COMMAND_LIST_END_LABEL_EDIT, 197, "command_list_end_label_edit"},
- {wxEVT_COMMAND_LIST_DELETE_ITEM, 197, "command_list_delete_item"},
- {wxEVT_COMMAND_LIST_DELETE_ALL_ITEMS, 197, "command_list_delete_all_items"},
- {wxEVT_COMMAND_LIST_KEY_DOWN, 197, "command_list_key_down"},
- {wxEVT_COMMAND_LIST_INSERT_ITEM, 197, "command_list_insert_item"},
- {wxEVT_COMMAND_LIST_COL_CLICK, 197, "command_list_col_click"},
- {wxEVT_COMMAND_LIST_COL_RIGHT_CLICK, 197, "command_list_col_right_click"},
- {wxEVT_COMMAND_LIST_COL_BEGIN_DRAG, 197, "command_list_col_begin_drag"},
- {wxEVT_COMMAND_LIST_COL_DRAGGING, 197, "command_list_col_dragging"},
- {wxEVT_COMMAND_LIST_COL_END_DRAG, 197, "command_list_col_end_drag"},
- {wxEVT_COMMAND_LIST_ITEM_SELECTED, 197, "command_list_item_selected"},
- {wxEVT_COMMAND_LIST_ITEM_DESELECTED, 197, "command_list_item_deselected"},
- {wxEVT_COMMAND_LIST_ITEM_RIGHT_CLICK, 197, "command_list_item_right_click"},
- {wxEVT_COMMAND_LIST_ITEM_MIDDLE_CLICK, 197, "command_list_item_middle_click"},
- {wxEVT_COMMAND_LIST_ITEM_ACTIVATED, 197, "command_list_item_activated"},
- {wxEVT_COMMAND_LIST_ITEM_FOCUSED, 197, "command_list_item_focused"},
- {wxEVT_COMMAND_LIST_CACHE_HINT, 197, "command_list_cache_hint"},
- {wxEVT_DATE_CHANGED, 198, "date_changed"},
- {wxEVT_CALENDAR_SEL_CHANGED, 199, "calendar_sel_changed"},
- {wxEVT_CALENDAR_DAY_CHANGED, 199, "calendar_day_changed"},
- {wxEVT_CALENDAR_MONTH_CHANGED, 199, "calendar_month_changed"},
- {wxEVT_CALENDAR_YEAR_CHANGED, 199, "calendar_year_changed"},
- {wxEVT_CALENDAR_DOUBLECLICKED, 199, "calendar_doubleclicked"},
- {wxEVT_CALENDAR_WEEKDAY_CLICKED, 199, "calendar_weekday_clicked"},
- {wxEVT_COMMAND_FILEPICKER_CHANGED, 200, "command_filepicker_changed"},
- {wxEVT_COMMAND_DIRPICKER_CHANGED, 200, "command_dirpicker_changed"},
- {wxEVT_COMMAND_COLOURPICKER_CHANGED, 201, "command_colourpicker_changed"},
- {wxEVT_COMMAND_FONTPICKER_CHANGED, 202, "command_fontpicker_changed"},
- {wxEVT_STC_CHANGE, 203, "stc_change"},
- {wxEVT_STC_STYLENEEDED, 203, "stc_styleneeded"},
- {wxEVT_STC_CHARADDED, 203, "stc_charadded"},
- {wxEVT_STC_SAVEPOINTREACHED, 203, "stc_savepointreached"},
- {wxEVT_STC_SAVEPOINTLEFT, 203, "stc_savepointleft"},
- {wxEVT_STC_ROMODIFYATTEMPT, 203, "stc_romodifyattempt"},
- {wxEVT_STC_KEY, 203, "stc_key"},
- {wxEVT_STC_DOUBLECLICK, 203, "stc_doubleclick"},
- {wxEVT_STC_UPDATEUI, 203, "stc_updateui"},
- {wxEVT_STC_MODIFIED, 203, "stc_modified"},
- {wxEVT_STC_MACRORECORD, 203, "stc_macrorecord"},
- {wxEVT_STC_MARGINCLICK, 203, "stc_marginclick"},
- {wxEVT_STC_NEEDSHOWN, 203, "stc_needshown"},
- {wxEVT_STC_PAINTED, 203, "stc_painted"},
- {wxEVT_STC_USERLISTSELECTION, 203, "stc_userlistselection"},
- {wxEVT_STC_URIDROPPED, 203, "stc_uridropped"},
- {wxEVT_STC_DWELLSTART, 203, "stc_dwellstart"},
- {wxEVT_STC_DWELLEND, 203, "stc_dwellend"},
- {wxEVT_STC_START_DRAG, 203, "stc_start_drag"},
- {wxEVT_STC_DRAG_OVER, 203, "stc_drag_over"},
- {wxEVT_STC_DO_DROP, 203, "stc_do_drop"},
- {wxEVT_STC_ZOOM, 203, "stc_zoom"},
- {wxEVT_STC_HOTSPOT_CLICK, 203, "stc_hotspot_click"},
- {wxEVT_STC_HOTSPOT_DCLICK, 203, "stc_hotspot_dclick"},
- {wxEVT_STC_CALLTIP_CLICK, 203, "stc_calltip_click"},
- {wxEVT_STC_AUTOCOMP_SELECTION, 203, "stc_autocomp_selection"},
- {wxEVT_COMMAND_TREE_BEGIN_DRAG, 208, "command_tree_begin_drag"},
- {wxEVT_COMMAND_TREE_BEGIN_RDRAG, 208, "command_tree_begin_rdrag"},
- {wxEVT_COMMAND_TREE_BEGIN_LABEL_EDIT, 208, "command_tree_begin_label_edit"},
- {wxEVT_COMMAND_TREE_END_LABEL_EDIT, 208, "command_tree_end_label_edit"},
- {wxEVT_COMMAND_TREE_DELETE_ITEM, 208, "command_tree_delete_item"},
- {wxEVT_COMMAND_TREE_GET_INFO, 208, "command_tree_get_info"},
- {wxEVT_COMMAND_TREE_SET_INFO, 208, "command_tree_set_info"},
- {wxEVT_COMMAND_TREE_ITEM_EXPANDED, 208, "command_tree_item_expanded"},
- {wxEVT_COMMAND_TREE_ITEM_EXPANDING, 208, "command_tree_item_expanding"},
- {wxEVT_COMMAND_TREE_ITEM_COLLAPSED, 208, "command_tree_item_collapsed"},
- {wxEVT_COMMAND_TREE_ITEM_COLLAPSING, 208, "command_tree_item_collapsing"},
- {wxEVT_COMMAND_TREE_SEL_CHANGED, 208, "command_tree_sel_changed"},
- {wxEVT_COMMAND_TREE_SEL_CHANGING, 208, "command_tree_sel_changing"},
- {wxEVT_COMMAND_TREE_KEY_DOWN, 208, "command_tree_key_down"},
- {wxEVT_COMMAND_TREE_ITEM_ACTIVATED, 208, "command_tree_item_activated"},
- {wxEVT_COMMAND_TREE_ITEM_RIGHT_CLICK, 208, "command_tree_item_right_click"},
- {wxEVT_COMMAND_TREE_ITEM_MIDDLE_CLICK, 208, "command_tree_item_middle_click"},
- {wxEVT_COMMAND_TREE_END_DRAG, 208, "command_tree_end_drag"},
- {wxEVT_COMMAND_TREE_STATE_IMAGE_CLICK, 208, "command_tree_state_image_click"},
- {wxEVT_COMMAND_TREE_ITEM_GETTOOLTIP, 208, "command_tree_item_gettooltip"},
- {wxEVT_COMMAND_TREE_ITEM_MENU, 208, "command_tree_item_menu"},
- {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGED, 209, "command_notebook_page_changed"},
- {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGING, 209, "command_notebook_page_changing"},
- {wxEVT_COMMAND_SPINCTRL_UPDATED, 215, "command_spinctrl_updated"},
- {wxEVT_SCROLL_LINEUP + wxEVT_USER_FIRST, 164, "spin_up"},
- {wxEVT_SCROLL_LINEDOWN + wxEVT_USER_FIRST, 164, "spin_down"},
- {wxEVT_SCROLL_THUMBTRACK + wxEVT_USER_FIRST, 164, "spin"},
- {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGED, 217, "command_splitter_sash_pos_changed"},
- {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGING, 217, "command_splitter_sash_pos_changing"},
- {wxEVT_COMMAND_SPLITTER_DOUBLECLICKED, 217, "command_splitter_doubleclicked"},
- {wxEVT_COMMAND_SPLITTER_UNSPLIT, 217, "command_splitter_unsplit"},
- {wxEVT_COMMAND_HTML_LINK_CLICKED, 219, "command_html_link_clicked"},
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSE, 221, "command_auinotebook_page_close"},
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGED, 221, "command_auinotebook_page_changed"},
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGING, 221, "command_auinotebook_page_changing"},
- {wxEVT_COMMAND_AUINOTEBOOK_BUTTON, 221, "command_auinotebook_button"},
- {wxEVT_COMMAND_AUINOTEBOOK_BEGIN_DRAG, 221, "command_auinotebook_begin_drag"},
- {wxEVT_COMMAND_AUINOTEBOOK_END_DRAG, 221, "command_auinotebook_end_drag"},
- {wxEVT_COMMAND_AUINOTEBOOK_DRAG_MOTION, 221, "command_auinotebook_drag_motion"},
- {wxEVT_COMMAND_AUINOTEBOOK_ALLOW_DND, 221, "command_auinotebook_allow_dnd"},
+ {wxEVT_COMMAND_BUTTON_CLICKED, 164, "command_button_clicked"},
+ {wxEVT_COMMAND_CHECKBOX_CLICKED, 164, "command_checkbox_clicked"},
+ {wxEVT_COMMAND_CHOICE_SELECTED, 164, "command_choice_selected"},
+ {wxEVT_COMMAND_LISTBOX_SELECTED, 164, "command_listbox_selected"},
+ {wxEVT_COMMAND_LISTBOX_DOUBLECLICKED, 164, "command_listbox_doubleclicked"},
+ {wxEVT_COMMAND_TEXT_UPDATED, 164, "command_text_updated"},
+ {wxEVT_COMMAND_TEXT_ENTER, 164, "command_text_enter"},
+ {wxEVT_COMMAND_MENU_SELECTED, 164, "command_menu_selected"},
+ {wxEVT_COMMAND_SLIDER_UPDATED, 164, "command_slider_updated"},
+ {wxEVT_COMMAND_RADIOBOX_SELECTED, 164, "command_radiobox_selected"},
+ {wxEVT_COMMAND_RADIOBUTTON_SELECTED, 164, "command_radiobutton_selected"},
+ {wxEVT_COMMAND_SCROLLBAR_UPDATED, 164, "command_scrollbar_updated"},
+ {wxEVT_COMMAND_VLBOX_SELECTED, 164, "command_vlbox_selected"},
+ {wxEVT_COMMAND_COMBOBOX_SELECTED, 164, "command_combobox_selected"},
+ {wxEVT_COMMAND_TOOL_RCLICKED, 164, "command_tool_rclicked"},
+ {wxEVT_COMMAND_TOOL_ENTER, 164, "command_tool_enter"},
+ {wxEVT_COMMAND_CHECKLISTBOX_TOGGLED, 164, "command_checklistbox_toggled"},
+ {wxEVT_COMMAND_TOGGLEBUTTON_CLICKED, 164, "command_togglebutton_clicked"},
+ {wxEVT_COMMAND_LEFT_CLICK, 164, "command_left_click"},
+ {wxEVT_COMMAND_LEFT_DCLICK, 164, "command_left_dclick"},
+ {wxEVT_COMMAND_RIGHT_CLICK, 164, "command_right_click"},
+ {wxEVT_COMMAND_SET_FOCUS, 164, "command_set_focus"},
+ {wxEVT_COMMAND_KILL_FOCUS, 164, "command_kill_focus"},
+ {wxEVT_COMMAND_ENTER, 164, "command_enter"},
+ {wxEVT_SCROLL_TOP, 165, "scroll_top"},
+ {wxEVT_SCROLL_BOTTOM, 165, "scroll_bottom"},
+ {wxEVT_SCROLL_LINEUP, 165, "scroll_lineup"},
+ {wxEVT_SCROLL_LINEDOWN, 165, "scroll_linedown"},
+ {wxEVT_SCROLL_PAGEUP, 165, "scroll_pageup"},
+ {wxEVT_SCROLL_PAGEDOWN, 165, "scroll_pagedown"},
+ {wxEVT_SCROLL_THUMBTRACK, 165, "scroll_thumbtrack"},
+ {wxEVT_SCROLL_THUMBRELEASE, 165, "scroll_thumbrelease"},
+ {wxEVT_SCROLL_CHANGED, 165, "scroll_changed"},
+ {wxEVT_SCROLLWIN_TOP, 166, "scrollwin_top"},
+ {wxEVT_SCROLLWIN_BOTTOM, 166, "scrollwin_bottom"},
+ {wxEVT_SCROLLWIN_LINEUP, 166, "scrollwin_lineup"},
+ {wxEVT_SCROLLWIN_LINEDOWN, 166, "scrollwin_linedown"},
+ {wxEVT_SCROLLWIN_PAGEUP, 166, "scrollwin_pageup"},
+ {wxEVT_SCROLLWIN_PAGEDOWN, 166, "scrollwin_pagedown"},
+ {wxEVT_SCROLLWIN_THUMBTRACK, 166, "scrollwin_thumbtrack"},
+ {wxEVT_SCROLLWIN_THUMBRELEASE, 166, "scrollwin_thumbrelease"},
+ {wxEVT_LEFT_DOWN, 167, "left_down"},
+ {wxEVT_LEFT_UP, 167, "left_up"},
+ {wxEVT_MIDDLE_DOWN, 167, "middle_down"},
+ {wxEVT_MIDDLE_UP, 167, "middle_up"},
+ {wxEVT_RIGHT_DOWN, 167, "right_down"},
+ {wxEVT_RIGHT_UP, 167, "right_up"},
+ {wxEVT_MOTION, 167, "motion"},
+ {wxEVT_ENTER_WINDOW, 167, "enter_window"},
+ {wxEVT_LEAVE_WINDOW, 167, "leave_window"},
+ {wxEVT_LEFT_DCLICK, 167, "left_dclick"},
+ {wxEVT_MIDDLE_DCLICK, 167, "middle_dclick"},
+ {wxEVT_RIGHT_DCLICK, 167, "right_dclick"},
+ {wxEVT_MOUSEWHEEL, 167, "mousewheel"},
+ {wxEVT_NC_LEFT_DOWN, 167, "nc_left_down"},
+ {wxEVT_NC_LEFT_UP, 167, "nc_left_up"},
+ {wxEVT_NC_MIDDLE_DOWN, 167, "nc_middle_down"},
+ {wxEVT_NC_MIDDLE_UP, 167, "nc_middle_up"},
+ {wxEVT_NC_RIGHT_DOWN, 167, "nc_right_down"},
+ {wxEVT_NC_RIGHT_UP, 167, "nc_right_up"},
+ {wxEVT_NC_MOTION, 167, "nc_motion"},
+ {wxEVT_NC_ENTER_WINDOW, 167, "nc_enter_window"},
+ {wxEVT_NC_LEAVE_WINDOW, 167, "nc_leave_window"},
+ {wxEVT_NC_LEFT_DCLICK, 167, "nc_left_dclick"},
+ {wxEVT_NC_MIDDLE_DCLICK, 167, "nc_middle_dclick"},
+ {wxEVT_NC_RIGHT_DCLICK, 167, "nc_right_dclick"},
+ {wxEVT_SET_CURSOR, 168, "set_cursor"},
+ {wxEVT_CHAR, 169, "char"},
+ {wxEVT_CHAR_HOOK, 169, "char_hook"},
+ {wxEVT_KEY_DOWN, 169, "key_down"},
+ {wxEVT_KEY_UP, 169, "key_up"},
+ {wxEVT_SIZE, 170, "size"},
+ {wxEVT_MOVE, 171, "move"},
+ {wxEVT_PAINT, 172, "paint"},
+ {wxEVT_PAINT_ICON, 172, "paint_icon"},
+ {wxEVT_NC_PAINT, 173, "nc_paint"},
+ {wxEVT_ERASE_BACKGROUND, 174, "erase_background"},
+ {wxEVT_SET_FOCUS, 175, "set_focus"},
+ {wxEVT_KILL_FOCUS, 175, "kill_focus"},
+ {wxEVT_CHILD_FOCUS, 176, "child_focus"},
+ {wxEVT_MENU_OPEN, 177, "menu_open"},
+ {wxEVT_MENU_CLOSE, 177, "menu_close"},
+ {wxEVT_MENU_HIGHLIGHT, 177, "menu_highlight"},
+ {wxEVT_CLOSE_WINDOW, 178, "close_window"},
+ {wxEVT_END_SESSION, 178, "end_session"},
+ {wxEVT_QUERY_END_SESSION, 178, "query_end_session"},
+ {wxEVT_SHOW, 179, "show"},
+ {wxEVT_ICONIZE, 180, "iconize"},
+ {wxEVT_MAXIMIZE, 181, "maximize"},
+ {wxEVT_JOY_BUTTON_DOWN, 182, "joy_button_down"},
+ {wxEVT_JOY_BUTTON_UP, 182, "joy_button_up"},
+ {wxEVT_JOY_MOVE, 182, "joy_move"},
+ {wxEVT_JOY_ZMOVE, 182, "joy_zmove"},
+ {wxEVT_UPDATE_UI, 183, "update_ui"},
+ {wxEVT_SYS_COLOUR_CHANGED, 184, "sys_colour_changed"},
+ {wxEVT_MOUSE_CAPTURE_CHANGED, 185, "mouse_capture_changed"},
+ {wxEVT_DISPLAY_CHANGED, 186, "display_changed"},
+ {wxEVT_PALETTE_CHANGED, 187, "palette_changed"},
+ {wxEVT_QUERY_NEW_PALETTE, 188, "query_new_palette"},
+ {wxEVT_NAVIGATION_KEY, 189, "navigation_key"},
+ {wxEVT_CREATE, 190, "create"},
+ {wxEVT_DESTROY, 191, "destroy"},
+ {wxEVT_HELP, 192, "help"},
+ {wxEVT_DETAILED_HELP, 192, "detailed_help"},
+ {wxEVT_CONTEXT_MENU, 193, "context_menu"},
+ {wxEVT_IDLE, 194, "idle"},
+ {wxEVT_GRID_CELL_LEFT_CLICK, 195, "grid_cell_left_click"},
+ {wxEVT_GRID_CELL_RIGHT_CLICK, 195, "grid_cell_right_click"},
+ {wxEVT_GRID_CELL_LEFT_DCLICK, 195, "grid_cell_left_dclick"},
+ {wxEVT_GRID_CELL_RIGHT_DCLICK, 195, "grid_cell_right_dclick"},
+ {wxEVT_GRID_LABEL_LEFT_CLICK, 195, "grid_label_left_click"},
+ {wxEVT_GRID_LABEL_RIGHT_CLICK, 195, "grid_label_right_click"},
+ {wxEVT_GRID_LABEL_LEFT_DCLICK, 195, "grid_label_left_dclick"},
+ {wxEVT_GRID_LABEL_RIGHT_DCLICK, 195, "grid_label_right_dclick"},
+ {wxEVT_GRID_ROW_SIZE, 195, "grid_row_size"},
+ {wxEVT_GRID_COL_SIZE, 195, "grid_col_size"},
+ {wxEVT_GRID_RANGE_SELECT, 195, "grid_range_select"},
+ {wxEVT_GRID_CELL_CHANGE, 195, "grid_cell_change"},
+ {wxEVT_GRID_SELECT_CELL, 195, "grid_select_cell"},
+ {wxEVT_GRID_EDITOR_SHOWN, 195, "grid_editor_shown"},
+ {wxEVT_GRID_EDITOR_HIDDEN, 195, "grid_editor_hidden"},
+ {wxEVT_GRID_EDITOR_CREATED, 195, "grid_editor_created"},
+ {wxEVT_GRID_CELL_BEGIN_DRAG, 195, "grid_cell_begin_drag"},
+ {wxEVT_SASH_DRAGGED, 197, "sash_dragged"},
+ {wxEVT_COMMAND_LIST_BEGIN_DRAG, 198, "command_list_begin_drag"},
+ {wxEVT_COMMAND_LIST_BEGIN_RDRAG, 198, "command_list_begin_rdrag"},
+ {wxEVT_COMMAND_LIST_BEGIN_LABEL_EDIT, 198, "command_list_begin_label_edit"},
+ {wxEVT_COMMAND_LIST_END_LABEL_EDIT, 198, "command_list_end_label_edit"},
+ {wxEVT_COMMAND_LIST_DELETE_ITEM, 198, "command_list_delete_item"},
+ {wxEVT_COMMAND_LIST_DELETE_ALL_ITEMS, 198, "command_list_delete_all_items"},
+ {wxEVT_COMMAND_LIST_KEY_DOWN, 198, "command_list_key_down"},
+ {wxEVT_COMMAND_LIST_INSERT_ITEM, 198, "command_list_insert_item"},
+ {wxEVT_COMMAND_LIST_COL_CLICK, 198, "command_list_col_click"},
+ {wxEVT_COMMAND_LIST_COL_RIGHT_CLICK, 198, "command_list_col_right_click"},
+ {wxEVT_COMMAND_LIST_COL_BEGIN_DRAG, 198, "command_list_col_begin_drag"},
+ {wxEVT_COMMAND_LIST_COL_DRAGGING, 198, "command_list_col_dragging"},
+ {wxEVT_COMMAND_LIST_COL_END_DRAG, 198, "command_list_col_end_drag"},
+ {wxEVT_COMMAND_LIST_ITEM_SELECTED, 198, "command_list_item_selected"},
+ {wxEVT_COMMAND_LIST_ITEM_DESELECTED, 198, "command_list_item_deselected"},
+ {wxEVT_COMMAND_LIST_ITEM_RIGHT_CLICK, 198, "command_list_item_right_click"},
+ {wxEVT_COMMAND_LIST_ITEM_MIDDLE_CLICK, 198, "command_list_item_middle_click"},
+ {wxEVT_COMMAND_LIST_ITEM_ACTIVATED, 198, "command_list_item_activated"},
+ {wxEVT_COMMAND_LIST_ITEM_FOCUSED, 198, "command_list_item_focused"},
+ {wxEVT_COMMAND_LIST_CACHE_HINT, 198, "command_list_cache_hint"},
+ {wxEVT_DATE_CHANGED, 199, "date_changed"},
+ {wxEVT_CALENDAR_SEL_CHANGED, 200, "calendar_sel_changed"},
+ {wxEVT_CALENDAR_DAY_CHANGED, 200, "calendar_day_changed"},
+ {wxEVT_CALENDAR_MONTH_CHANGED, 200, "calendar_month_changed"},
+ {wxEVT_CALENDAR_YEAR_CHANGED, 200, "calendar_year_changed"},
+ {wxEVT_CALENDAR_DOUBLECLICKED, 200, "calendar_doubleclicked"},
+ {wxEVT_CALENDAR_WEEKDAY_CLICKED, 200, "calendar_weekday_clicked"},
+ {wxEVT_COMMAND_FILEPICKER_CHANGED, 201, "command_filepicker_changed"},
+ {wxEVT_COMMAND_DIRPICKER_CHANGED, 201, "command_dirpicker_changed"},
+ {wxEVT_COMMAND_COLOURPICKER_CHANGED, 202, "command_colourpicker_changed"},
+ {wxEVT_COMMAND_FONTPICKER_CHANGED, 203, "command_fontpicker_changed"},
+ {wxEVT_STC_CHANGE, 204, "stc_change"},
+ {wxEVT_STC_STYLENEEDED, 204, "stc_styleneeded"},
+ {wxEVT_STC_CHARADDED, 204, "stc_charadded"},
+ {wxEVT_STC_SAVEPOINTREACHED, 204, "stc_savepointreached"},
+ {wxEVT_STC_SAVEPOINTLEFT, 204, "stc_savepointleft"},
+ {wxEVT_STC_ROMODIFYATTEMPT, 204, "stc_romodifyattempt"},
+ {wxEVT_STC_KEY, 204, "stc_key"},
+ {wxEVT_STC_DOUBLECLICK, 204, "stc_doubleclick"},
+ {wxEVT_STC_UPDATEUI, 204, "stc_updateui"},
+ {wxEVT_STC_MODIFIED, 204, "stc_modified"},
+ {wxEVT_STC_MACRORECORD, 204, "stc_macrorecord"},
+ {wxEVT_STC_MARGINCLICK, 204, "stc_marginclick"},
+ {wxEVT_STC_NEEDSHOWN, 204, "stc_needshown"},
+ {wxEVT_STC_PAINTED, 204, "stc_painted"},
+ {wxEVT_STC_USERLISTSELECTION, 204, "stc_userlistselection"},
+ {wxEVT_STC_URIDROPPED, 204, "stc_uridropped"},
+ {wxEVT_STC_DWELLSTART, 204, "stc_dwellstart"},
+ {wxEVT_STC_DWELLEND, 204, "stc_dwellend"},
+ {wxEVT_STC_START_DRAG, 204, "stc_start_drag"},
+ {wxEVT_STC_DRAG_OVER, 204, "stc_drag_over"},
+ {wxEVT_STC_DO_DROP, 204, "stc_do_drop"},
+ {wxEVT_STC_ZOOM, 204, "stc_zoom"},
+ {wxEVT_STC_HOTSPOT_CLICK, 204, "stc_hotspot_click"},
+ {wxEVT_STC_HOTSPOT_DCLICK, 204, "stc_hotspot_dclick"},
+ {wxEVT_STC_CALLTIP_CLICK, 204, "stc_calltip_click"},
+ {wxEVT_STC_AUTOCOMP_SELECTION, 204, "stc_autocomp_selection"},
+ {wxEVT_COMMAND_TREE_BEGIN_DRAG, 209, "command_tree_begin_drag"},
+ {wxEVT_COMMAND_TREE_BEGIN_RDRAG, 209, "command_tree_begin_rdrag"},
+ {wxEVT_COMMAND_TREE_BEGIN_LABEL_EDIT, 209, "command_tree_begin_label_edit"},
+ {wxEVT_COMMAND_TREE_END_LABEL_EDIT, 209, "command_tree_end_label_edit"},
+ {wxEVT_COMMAND_TREE_DELETE_ITEM, 209, "command_tree_delete_item"},
+ {wxEVT_COMMAND_TREE_GET_INFO, 209, "command_tree_get_info"},
+ {wxEVT_COMMAND_TREE_SET_INFO, 209, "command_tree_set_info"},
+ {wxEVT_COMMAND_TREE_ITEM_EXPANDED, 209, "command_tree_item_expanded"},
+ {wxEVT_COMMAND_TREE_ITEM_EXPANDING, 209, "command_tree_item_expanding"},
+ {wxEVT_COMMAND_TREE_ITEM_COLLAPSED, 209, "command_tree_item_collapsed"},
+ {wxEVT_COMMAND_TREE_ITEM_COLLAPSING, 209, "command_tree_item_collapsing"},
+ {wxEVT_COMMAND_TREE_SEL_CHANGED, 209, "command_tree_sel_changed"},
+ {wxEVT_COMMAND_TREE_SEL_CHANGING, 209, "command_tree_sel_changing"},
+ {wxEVT_COMMAND_TREE_KEY_DOWN, 209, "command_tree_key_down"},
+ {wxEVT_COMMAND_TREE_ITEM_ACTIVATED, 209, "command_tree_item_activated"},
+ {wxEVT_COMMAND_TREE_ITEM_RIGHT_CLICK, 209, "command_tree_item_right_click"},
+ {wxEVT_COMMAND_TREE_ITEM_MIDDLE_CLICK, 209, "command_tree_item_middle_click"},
+ {wxEVT_COMMAND_TREE_END_DRAG, 209, "command_tree_end_drag"},
+ {wxEVT_COMMAND_TREE_STATE_IMAGE_CLICK, 209, "command_tree_state_image_click"},
+ {wxEVT_COMMAND_TREE_ITEM_GETTOOLTIP, 209, "command_tree_item_gettooltip"},
+ {wxEVT_COMMAND_TREE_ITEM_MENU, 209, "command_tree_item_menu"},
+ {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGED, 210, "command_notebook_page_changed"},
+ {wxEVT_COMMAND_NOTEBOOK_PAGE_CHANGING, 210, "command_notebook_page_changing"},
+ {wxEVT_COMMAND_SPINCTRL_UPDATED, 216, "command_spinctrl_updated"},
+ {wxEVT_SCROLL_LINEUP + wxEVT_USER_FIRST, 165, "spin_up"},
+ {wxEVT_SCROLL_LINEDOWN + wxEVT_USER_FIRST, 165, "spin_down"},
+ {wxEVT_SCROLL_THUMBTRACK + wxEVT_USER_FIRST, 165, "spin"},
+ {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGED, 218, "command_splitter_sash_pos_changed"},
+ {wxEVT_COMMAND_SPLITTER_SASH_POS_CHANGING, 218, "command_splitter_sash_pos_changing"},
+ {wxEVT_COMMAND_SPLITTER_DOUBLECLICKED, 218, "command_splitter_doubleclicked"},
+ {wxEVT_COMMAND_SPLITTER_UNSPLIT, 218, "command_splitter_unsplit"},
+ {wxEVT_COMMAND_HTML_LINK_CLICKED, 220, "command_html_link_clicked"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSE, 222, "command_auinotebook_page_close"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGED, 222, "command_auinotebook_page_changed"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CHANGING, 222, "command_auinotebook_page_changing"},
+ {wxEVT_COMMAND_AUINOTEBOOK_BUTTON, 222, "command_auinotebook_button"},
+ {wxEVT_COMMAND_AUINOTEBOOK_BEGIN_DRAG, 222, "command_auinotebook_begin_drag"},
+ {wxEVT_COMMAND_AUINOTEBOOK_END_DRAG, 222, "command_auinotebook_end_drag"},
+ {wxEVT_COMMAND_AUINOTEBOOK_DRAG_MOTION, 222, "command_auinotebook_drag_motion"},
+ {wxEVT_COMMAND_AUINOTEBOOK_ALLOW_DND, 222, "command_auinotebook_allow_dnd"},
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_DOWN, 221, "command_auinotebook_tab_middle_down"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_DOWN, 222, "command_auinotebook_tab_middle_down"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_UP, 221, "command_auinotebook_tab_middle_up"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_MIDDLE_UP, 222, "command_auinotebook_tab_middle_up"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_DOWN, 221, "command_auinotebook_tab_right_down"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_DOWN, 222, "command_auinotebook_tab_right_down"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_UP, 221, "command_auinotebook_tab_right_up"},
+ {wxEVT_COMMAND_AUINOTEBOOK_TAB_RIGHT_UP, 222, "command_auinotebook_tab_right_up"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSED, 221, "command_auinotebook_page_closed"},
+ {wxEVT_COMMAND_AUINOTEBOOK_PAGE_CLOSED, 222, "command_auinotebook_page_closed"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_DRAG_DONE, 221, "command_auinotebook_drag_done"},
+ {wxEVT_COMMAND_AUINOTEBOOK_DRAG_DONE, 222, "command_auinotebook_drag_done"},
#endif
#if wxCHECK_VERSION(2,8,5)
- {wxEVT_COMMAND_AUINOTEBOOK_BG_DCLICK, 221, "command_auinotebook_bg_dclick"},
+ {wxEVT_COMMAND_AUINOTEBOOK_BG_DCLICK, 222, "command_auinotebook_bg_dclick"},
#endif
- {wxEVT_AUI_PANE_BUTTON, 222, "aui_pane_button"},
- {wxEVT_AUI_PANE_CLOSE, 222, "aui_pane_close"},
- {wxEVT_AUI_PANE_MAXIMIZE, 222, "aui_pane_maximize"},
- {wxEVT_AUI_PANE_RESTORE, 222, "aui_pane_restore"},
- {wxEVT_AUI_RENDER, 222, "aui_render"},
- {wxEVT_AUI_FIND_MANAGER, 222, "aui_find_manager"},
+ {wxEVT_AUI_PANE_BUTTON, 223, "aui_pane_button"},
+ {wxEVT_AUI_PANE_CLOSE, 223, "aui_pane_close"},
+ {wxEVT_AUI_PANE_MAXIMIZE, 223, "aui_pane_maximize"},
+ {wxEVT_AUI_PANE_RESTORE, 223, "aui_pane_restore"},
+ {wxEVT_AUI_RENDER, 223, "aui_render"},
+ {wxEVT_AUI_FIND_MANAGER, 223, "aui_find_manager"},
{-1, 0, }
};
for(int i=0; event_types[i].ev_type != -1; i++) {
@@ -353,7 +353,7 @@ bool sendevent(wxEvent *event, ErlDrvPort port)
rt.addRef(getRef((void *)(cb->obj), memenv), cb->class_name);
rt.addExt2Term(cb->user_data);
switch(Etype->cID) {
-case 163: {// wxCommandEvent
+case 164: {// wxCommandEvent
wxCommandEvent * ev = (wxCommandEvent *) event;
evClass = (char*)"wxCommandEvent";
rt.addAtom((char*)"wxCommand");
@@ -364,7 +364,7 @@ case 163: {// wxCommandEvent
rt.addTupleCount(5);
break;
}
-case 164: {// wxScrollEvent or wxSpinEvent
+case 165: {// wxScrollEvent or wxSpinEvent
if(event->IsKindOf(CLASSINFO(wxScrollEvent))) {
wxScrollEvent * ev = (wxScrollEvent *) event;
evClass = (char*)"wxScrollEvent";
@@ -384,14 +384,14 @@ case 164: {// wxScrollEvent or wxSpinEvent
}
break;
}
-case 165: {// wxScrollWinEvent
+case 166: {// wxScrollWinEvent
evClass = (char*)"wxScrollWinEvent";
rt.addAtom((char*)"wxScrollWin");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 166: {// wxMouseEvent
+case 167: {// wxMouseEvent
wxMouseEvent * ev = (wxMouseEvent *) event;
evClass = (char*)"wxMouseEvent";
rt.addAtom((char*)"wxMouse");
@@ -411,14 +411,14 @@ case 166: {// wxMouseEvent
rt.addTupleCount(14);
break;
}
-case 167: {// wxSetCursorEvent
+case 168: {// wxSetCursorEvent
evClass = (char*)"wxSetCursorEvent";
rt.addAtom((char*)"wxSetCursor");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 168: {// wxKeyEvent
+case 169: {// wxKeyEvent
wxKeyEvent * ev = (wxKeyEvent *) event;
evClass = (char*)"wxKeyEvent";
rt.addAtom((char*)"wxKey");
@@ -437,7 +437,7 @@ case 168: {// wxKeyEvent
rt.addTupleCount(13);
break;
}
-case 169: {// wxSizeEvent
+case 170: {// wxSizeEvent
wxSizeEvent * ev = (wxSizeEvent *) event;
evClass = (char*)"wxSizeEvent";
rt.addAtom((char*)"wxSize");
@@ -447,28 +447,28 @@ case 169: {// wxSizeEvent
rt.addTupleCount(4);
break;
}
-case 170: {// wxMoveEvent
+case 171: {// wxMoveEvent
evClass = (char*)"wxMoveEvent";
rt.addAtom((char*)"wxMove");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 171: {// wxPaintEvent
+case 172: {// wxPaintEvent
evClass = (char*)"wxPaintEvent";
rt.addAtom((char*)"wxPaint");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 172: {// wxNcPaintEvent
+case 173: {// wxNcPaintEvent
evClass = (char*)"wxNcPaintEvent";
rt.addAtom((char*)"wxNcPaint");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 173: {// wxEraseEvent
+case 174: {// wxEraseEvent
wxEraseEvent * ev = (wxEraseEvent *) event;
wxDC * GetDC = ev->GetDC();
evClass = (char*)"wxEraseEvent";
@@ -478,105 +478,105 @@ case 173: {// wxEraseEvent
rt.addTupleCount(3);
break;
}
-case 174: {// wxFocusEvent
+case 175: {// wxFocusEvent
evClass = (char*)"wxFocusEvent";
rt.addAtom((char*)"wxFocus");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 175: {// wxChildFocusEvent
+case 176: {// wxChildFocusEvent
evClass = (char*)"wxChildFocusEvent";
rt.addAtom((char*)"wxChildFocus");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 176: {// wxMenuEvent
+case 177: {// wxMenuEvent
evClass = (char*)"wxMenuEvent";
rt.addAtom((char*)"wxMenu");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 177: {// wxCloseEvent
+case 178: {// wxCloseEvent
evClass = (char*)"wxCloseEvent";
rt.addAtom((char*)"wxClose");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 178: {// wxShowEvent
+case 179: {// wxShowEvent
evClass = (char*)"wxShowEvent";
rt.addAtom((char*)"wxShow");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 179: {// wxIconizeEvent
+case 180: {// wxIconizeEvent
evClass = (char*)"wxIconizeEvent";
rt.addAtom((char*)"wxIconize");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 180: {// wxMaximizeEvent
+case 181: {// wxMaximizeEvent
evClass = (char*)"wxMaximizeEvent";
rt.addAtom((char*)"wxMaximize");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 181: {// wxJoystickEvent
+case 182: {// wxJoystickEvent
evClass = (char*)"wxJoystickEvent";
rt.addAtom((char*)"wxJoystick");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 182: {// wxUpdateUIEvent
+case 183: {// wxUpdateUIEvent
evClass = (char*)"wxUpdateUIEvent";
rt.addAtom((char*)"wxUpdateUI");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 183: {// wxSysColourChangedEvent
+case 184: {// wxSysColourChangedEvent
evClass = (char*)"wxSysColourChangedEvent";
rt.addAtom((char*)"wxSysColourChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 184: {// wxMouseCaptureChangedEvent
+case 185: {// wxMouseCaptureChangedEvent
evClass = (char*)"wxMouseCaptureChangedEvent";
rt.addAtom((char*)"wxMouseCaptureChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 185: {// wxDisplayChangedEvent
+case 186: {// wxDisplayChangedEvent
evClass = (char*)"wxDisplayChangedEvent";
rt.addAtom((char*)"wxDisplayChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 186: {// wxPaletteChangedEvent
+case 187: {// wxPaletteChangedEvent
evClass = (char*)"wxPaletteChangedEvent";
rt.addAtom((char*)"wxPaletteChanged");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 187: {// wxQueryNewPaletteEvent
+case 188: {// wxQueryNewPaletteEvent
evClass = (char*)"wxQueryNewPaletteEvent";
rt.addAtom((char*)"wxQueryNewPalette");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 188: {// wxNavigationKeyEvent
+case 189: {// wxNavigationKeyEvent
wxNavigationKeyEvent * ev = (wxNavigationKeyEvent *) event;
evClass = (char*)"wxNavigationKeyEvent";
rt.addAtom((char*)"wxNavigationKey");
@@ -586,42 +586,42 @@ case 188: {// wxNavigationKeyEvent
rt.addTupleCount(4);
break;
}
-case 189: {// wxWindowCreateEvent
+case 190: {// wxWindowCreateEvent
evClass = (char*)"wxWindowCreateEvent";
rt.addAtom((char*)"wxWindowCreate");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 190: {// wxWindowDestroyEvent
+case 191: {// wxWindowDestroyEvent
evClass = (char*)"wxWindowDestroyEvent";
rt.addAtom((char*)"wxWindowDestroy");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 191: {// wxHelpEvent
+case 192: {// wxHelpEvent
evClass = (char*)"wxHelpEvent";
rt.addAtom((char*)"wxHelp");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 192: {// wxContextMenuEvent
+case 193: {// wxContextMenuEvent
evClass = (char*)"wxContextMenuEvent";
rt.addAtom((char*)"wxContextMenu");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 193: {// wxIdleEvent
+case 194: {// wxIdleEvent
evClass = (char*)"wxIdleEvent";
rt.addAtom((char*)"wxIdle");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 194: {// wxGridEvent
+case 195: {// wxGridEvent
wxGridEvent * ev = (wxGridEvent *) event;
evClass = (char*)"wxGridEvent";
rt.addAtom((char*)"wxGrid");
@@ -638,7 +638,7 @@ case 194: {// wxGridEvent
rt.addTupleCount(11);
break;
}
-case 196: {// wxSashEvent
+case 197: {// wxSashEvent
wxSashEvent * ev = (wxSashEvent *) event;
evClass = (char*)"wxSashEvent";
rt.addAtom((char*)"wxSash");
@@ -649,7 +649,7 @@ case 196: {// wxSashEvent
rt.addTupleCount(5);
break;
}
-case 197: {// wxListEvent
+case 198: {// wxListEvent
wxListEvent * ev = (wxListEvent *) event;
evClass = (char*)"wxListEvent";
rt.addAtom((char*)"wxList");
@@ -662,7 +662,7 @@ case 197: {// wxListEvent
rt.addTupleCount(7);
break;
}
-case 198: {// wxDateEvent
+case 199: {// wxDateEvent
wxDateEvent * ev = (wxDateEvent *) event;
evClass = (char*)"wxDateEvent";
rt.addAtom((char*)"wxDate");
@@ -671,14 +671,14 @@ case 198: {// wxDateEvent
rt.addTupleCount(3);
break;
}
-case 199: {// wxCalendarEvent
+case 200: {// wxCalendarEvent
evClass = (char*)"wxCalendarEvent";
rt.addAtom((char*)"wxCalendar");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 200: {// wxFileDirPickerEvent
+case 201: {// wxFileDirPickerEvent
wxFileDirPickerEvent * ev = (wxFileDirPickerEvent *) event;
evClass = (char*)"wxFileDirPickerEvent";
rt.addAtom((char*)"wxFileDirPicker");
@@ -687,7 +687,7 @@ case 200: {// wxFileDirPickerEvent
rt.addTupleCount(3);
break;
}
-case 201: {// wxColourPickerEvent
+case 202: {// wxColourPickerEvent
wxColourPickerEvent * ev = (wxColourPickerEvent *) event;
evClass = (char*)"wxColourPickerEvent";
rt.addAtom((char*)"wxColourPicker");
@@ -696,7 +696,7 @@ case 201: {// wxColourPickerEvent
rt.addTupleCount(3);
break;
}
-case 202: {// wxFontPickerEvent
+case 203: {// wxFontPickerEvent
wxFontPickerEvent * ev = (wxFontPickerEvent *) event;
wxFont * GetFont = new wxFont(ev->GetFont());
app->newPtr((void *) GetFont,3, memenv);
@@ -707,7 +707,7 @@ case 202: {// wxFontPickerEvent
rt.addTupleCount(3);
break;
}
-case 203: {// wxStyledTextEvent
+case 204: {// wxStyledTextEvent
wxStyledTextEvent * ev = (wxStyledTextEvent *) event;
evClass = (char*)"wxStyledTextEvent";
rt.addAtom((char*)"wxStyledText");
@@ -735,7 +735,7 @@ case 203: {// wxStyledTextEvent
rt.addTupleCount(22);
break;
}
-case 208: {// wxTreeEvent
+case 209: {// wxTreeEvent
wxTreeEvent * ev = (wxTreeEvent *) event;
evClass = (char*)"wxTreeEvent";
rt.addAtom((char*)"wxTree");
@@ -746,14 +746,14 @@ case 208: {// wxTreeEvent
rt.addTupleCount(5);
break;
}
-case 209: {// wxNotebookEvent
+case 210: {// wxNotebookEvent
evClass = (char*)"wxNotebookEvent";
rt.addAtom((char*)"wxNotebook");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 215: {// wxSpinEvent
+case 216: {// wxSpinEvent
wxSpinEvent * ev = (wxSpinEvent *) event;
evClass = (char*)"wxSpinEvent";
rt.addAtom((char*)"wxSpin");
@@ -762,14 +762,14 @@ case 215: {// wxSpinEvent
rt.addTupleCount(3);
break;
}
-case 217: {// wxSplitterEvent
+case 218: {// wxSplitterEvent
evClass = (char*)"wxSplitterEvent";
rt.addAtom((char*)"wxSplitter");
rt.addAtom(Etype->eName);
rt.addTupleCount(2);
break;
}
-case 219: {// wxHtmlLinkEvent
+case 220: {// wxHtmlLinkEvent
wxHtmlLinkEvent * ev = (wxHtmlLinkEvent *) event;
evClass = (char*)"wxHtmlLinkEvent";
rt.addAtom((char*)"wxHtmlLink");
@@ -778,7 +778,7 @@ case 219: {// wxHtmlLinkEvent
rt.addTupleCount(3);
break;
}
-case 221: {// wxAuiNotebookEvent
+case 222: {// wxAuiNotebookEvent
wxAuiNotebookEvent * ev = (wxAuiNotebookEvent *) event;
wxAuiNotebook * GetDragSource = ev->GetDragSource();
evClass = (char*)"wxAuiNotebookEvent";
@@ -790,7 +790,7 @@ case 221: {// wxAuiNotebookEvent
rt.addTupleCount(5);
break;
}
-case 222: {// wxAuiManagerEvent
+case 223: {// wxAuiManagerEvent
wxAuiManagerEvent * ev = (wxAuiManagerEvent *) event;
wxAuiManager * GetManager = ev->GetManager();
wxAuiPaneInfo * GetPane = ev->GetPane();
diff --git a/lib/wx/c_src/gen/wxe_funcs.cpp b/lib/wx/c_src/gen/wxe_funcs.cpp
index 479d7679a4..afef2990b4 100644
--- a/lib/wx/c_src/gen/wxe_funcs.cpp
+++ b/lib/wx/c_src/gen/wxe_funcs.cpp
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2010. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
@@ -4486,7 +4486,7 @@ case wxGridCellBoolEditor_IsTrueValue: { // wxGridCellBoolEditor::IsTrueValue
break;
}
case wxGridCellBoolEditor_UseStringValues: { // wxGridCellBoolEditor::UseStringValues
- wxString valueTrue= _T("1");
+ wxString valueTrue= wxT("1");
wxString valueFalse= wxEmptyString;
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
@@ -15143,12 +15143,14 @@ case wxListBox_SetFirstItem_1_1: { // wxListBox::SetFirstItem
This->SetFirstItem(s);
break;
}
+
case wxListCtrl_new_0: { // wxListCtrl::wxListCtrl
wxListCtrl * Result = new EwxListCtrl();
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxListCtrl");
break;
}
+
case wxListCtrl_new_2: { // wxListCtrl::wxListCtrl
wxWindowID winid=wxID_ANY;
wxPoint pos= wxDefaultPosition;
@@ -15156,6 +15158,8 @@ case wxListCtrl_new_2: { // wxListCtrl::wxListCtrl
long style=wxLC_ICON;
const wxValidator * validator= &wxDefaultValidator;
wxWindow *parent = (wxWindow *) getPtr(bp,memenv); bp += 4;
+ int onGetItemText = 0, onGetItemAttr = 0, onGetItemColumnImage = 0;
+
bp += 4; /* Align */
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
@@ -15179,8 +15183,21 @@ case wxListCtrl_new_2: { // wxListCtrl::wxListCtrl
case 5: {bp += 4;
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
+ case 6: {bp += 4;
+ onGetItemText = *(int *) bp; bp += 4;
+ } break;
+ case 7: {bp += 4;
+ onGetItemAttr = *(int *) bp; bp += 4;
+ } break;
+ case 8: {bp += 4;
+ onGetItemColumnImage = *(int *) bp; bp += 4;
+ } break;
}};
- wxListCtrl * Result = new EwxListCtrl(parent,winid,pos,size,style,*validator);
+ EwxListCtrl * Result = new EwxListCtrl(parent,winid,pos,size,style,*validator);
+ Result->onGetItemText = onGetItemText;
+ Result->onGetItemAttr = onGetItemAttr;
+ Result->onGetItemColumnImage = onGetItemColumnImage;
+ Result->port = Ecmd.port;
newPtr((void *) Result, 0, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxListCtrl");
break;
@@ -15213,14 +15230,18 @@ case wxListCtrl_ClearAll: { // wxListCtrl::ClearAll
This->ClearAll();
break;
}
+
case wxListCtrl_Create: { // wxListCtrl::Create
wxWindowID winid=wxID_ANY;
wxPoint pos= wxDefaultPosition;
wxSize size= wxDefaultSize;
long style=wxLC_ICON;
const wxValidator * validator= &wxDefaultValidator;
- wxListCtrl *This = (wxListCtrl *) getPtr(bp,memenv); bp += 4;
+ EwxListCtrl *This = (EwxListCtrl *) getPtr(bp,memenv); bp += 4;
wxWindow *parent = (wxWindow *) getPtr(bp,memenv); bp += 4;
+ int onGetItemText = 0, onGetItemAttr = 0, onGetItemColumnImage = 0;
+
+ bp += 4; /* Align */
while( * (int*) bp) { switch (* (int*) bp) {
case 1: {bp += 4;
winid = (wxWindowID)*(int *) bp; bp += 4;
@@ -15243,9 +15264,23 @@ case wxListCtrl_Create: { // wxListCtrl::Create
case 5: {bp += 4;
validator = (wxValidator *) getPtr(bp,memenv); bp += 4;
} break;
+ case 6: {bp += 4;
+ onGetItemText = *(int *) bp; bp += 4;
+ } break;
+ case 7: {bp += 4;
+ onGetItemAttr = *(int *) bp; bp += 4;
+ } break;
+ case 8: {bp += 4;
+ onGetItemColumnImage = *(int *) bp; bp += 4;
+ } break;
}};
if(!This) throw wxe_badarg(0);
bool Result = This->Create(parent,winid,pos,size,style,*validator);
+ This->onGetItemText = onGetItemText;
+ This->onGetItemAttr = onGetItemAttr;
+ This->onGetItemColumnImage = onGetItemColumnImage;
+ This->port = Ecmd.port;
+
rt.addBool(Result);
break;
}
@@ -16095,6 +16130,106 @@ case wxListItem_SetWidth: { // wxListItem::SetWidth
This->SetWidth((int) *width);
break;
}
+case wxListItemAttr_new_0: { // wxListItemAttr::wxListItemAttr
+ wxListItemAttr * Result = new wxListItemAttr();
+ newPtr((void *) Result, 101, memenv);
+ rt.addRef(getRef((void *)Result,memenv), "wxListItemAttr");
+ break;
+}
+case wxListItemAttr_new_3: { // wxListItemAttr::wxListItemAttr
+ int * colTextR = (int *) bp; bp += 4;
+ int * colTextG = (int *) bp; bp += 4;
+ int * colTextB = (int *) bp; bp += 4;
+ int * colTextA = (int *) bp; bp += 4;
+ wxColour colText = wxColour(*colTextR,*colTextG,*colTextB,*colTextA);
+ int * colBackR = (int *) bp; bp += 4;
+ int * colBackG = (int *) bp; bp += 4;
+ int * colBackB = (int *) bp; bp += 4;
+ int * colBackA = (int *) bp; bp += 4;
+ wxColour colBack = wxColour(*colBackR,*colBackG,*colBackB,*colBackA);
+ wxFont *font = (wxFont *) getPtr(bp,memenv); bp += 4;
+ wxListItemAttr * Result = new wxListItemAttr(colText,colBack,*font);
+ newPtr((void *) Result, 101, memenv);
+ rt.addRef(getRef((void *)Result,memenv), "wxListItemAttr");
+ break;
+}
+case wxListItemAttr_GetBackgroundColour: { // wxListItemAttr::GetBackgroundColour
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ const wxColour * Result = &This->GetBackgroundColour();
+ rt.add((*Result));
+ break;
+}
+case wxListItemAttr_GetFont: { // wxListItemAttr::GetFont
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ const wxFont * Result = &This->GetFont();
+ rt.addRef(getRef((void *)Result,memenv), "wxFont");
+ break;
+}
+case wxListItemAttr_GetTextColour: { // wxListItemAttr::GetTextColour
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ const wxColour * Result = &This->GetTextColour();
+ rt.add((*Result));
+ break;
+}
+case wxListItemAttr_HasBackgroundColour: { // wxListItemAttr::HasBackgroundColour
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ bool Result = This->HasBackgroundColour();
+ rt.addBool(Result);
+ break;
+}
+case wxListItemAttr_HasFont: { // wxListItemAttr::HasFont
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ bool Result = This->HasFont();
+ rt.addBool(Result);
+ break;
+}
+case wxListItemAttr_HasTextColour: { // wxListItemAttr::HasTextColour
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ bool Result = This->HasTextColour();
+ rt.addBool(Result);
+ break;
+}
+case wxListItemAttr_SetBackgroundColour: { // wxListItemAttr::SetBackgroundColour
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ int * colBackR = (int *) bp; bp += 4;
+ int * colBackG = (int *) bp; bp += 4;
+ int * colBackB = (int *) bp; bp += 4;
+ int * colBackA = (int *) bp; bp += 4;
+ wxColour colBack = wxColour(*colBackR,*colBackG,*colBackB,*colBackA);
+ if(!This) throw wxe_badarg(0);
+ This->SetBackgroundColour(colBack);
+ break;
+}
+case wxListItemAttr_SetFont: { // wxListItemAttr::SetFont
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ wxFont *font = (wxFont *) getPtr(bp,memenv); bp += 4;
+ if(!This) throw wxe_badarg(0);
+ This->SetFont(*font);
+ break;
+}
+case wxListItemAttr_SetTextColour: { // wxListItemAttr::SetTextColour
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ int * colTextR = (int *) bp; bp += 4;
+ int * colTextG = (int *) bp; bp += 4;
+ int * colTextB = (int *) bp; bp += 4;
+ int * colTextA = (int *) bp; bp += 4;
+ wxColour colText = wxColour(*colTextR,*colTextG,*colTextB,*colTextA);
+ if(!This) throw wxe_badarg(0);
+ This->SetTextColour(colText);
+ break;
+}
+case wxListItemAttr_destroy: { // wxListItemAttr::destroy
+ wxListItemAttr *This = (wxListItemAttr *) getPtr(bp,memenv); bp += 4;
+ if(This) { ((WxeApp *) wxTheApp)->clearPtr((void *) This);
+ delete This;}
+ break;
+}
case wxImageList_new_0: { // wxImageList::wxImageList
wxImageList * Result = new EwxImageList();
newPtr((void *) Result, 1, memenv);
@@ -16263,7 +16398,7 @@ case wxImageList_Replace_3: { // wxImageList::Replace
}
case wxTextAttr_new_0: { // wxTextAttr::wxTextAttr
wxTextAttr * Result = new wxTextAttr();
- newPtr((void *) Result, 102, memenv);
+ newPtr((void *) Result, 103, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTextAttr");
break;
}
@@ -16293,7 +16428,7 @@ alignment = *(wxTextAttrAlignment *) bp; bp += 4;;
} break;
}};
wxTextAttr * Result = new wxTextAttr(colText,colBack,*font,(wxTextAttrAlignment) alignment);
- newPtr((void *) Result, 102, memenv);
+ newPtr((void *) Result, 103, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTextAttr");
break;
}
@@ -22711,7 +22846,7 @@ case wxPreviewFrame_new: { // wxPreviewFrame::wxPreviewFrame
wxString title= wxT("Print Preview");
wxPoint pos= wxDefaultPosition;
wxSize size= wxDefaultSize;
- long style=wxDEFAULT_FRAME_STYLE;
+ long style=wxDEFAULT_FRAME_STYLE|wxFRAME_FLOAT_ON_PARENT;
wxPrintPreview *preview = (wxPrintPreview *) getPtr(bp,memenv); bp += 4;
wxWindow *parent = (wxWindow *) getPtr(bp,memenv); bp += 4;
while( * (int*) bp) { switch (* (int*) bp) {
@@ -23742,14 +23877,14 @@ case wxAuiManager_Update: { // wxAuiManager::Update
#if wxUSE_AUI
case wxAuiPaneInfo_new_0: { // wxAuiPaneInfo::wxAuiPaneInfo
wxAuiPaneInfo * Result = new wxAuiPaneInfo();
- newPtr((void *) Result, 154, memenv);
+ newPtr((void *) Result, 155, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
case wxAuiPaneInfo_new_1: { // wxAuiPaneInfo::wxAuiPaneInfo
wxAuiPaneInfo *c = (wxAuiPaneInfo *) getPtr(bp,memenv); bp += 4;
wxAuiPaneInfo * Result = new wxAuiPaneInfo(*c);
- newPtr((void *) Result, 154, memenv);
+ newPtr((void *) Result, 155, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxAuiPaneInfo");
break;
}
@@ -30292,7 +30427,7 @@ case wxNotebookEvent_SetSelection: { // wxNotebookEvent::SetSelection
}
case wxFileDataObject_new: { // wxFileDataObject::wxFileDataObject
wxFileDataObject * Result = new wxFileDataObject();
- newPtr((void *) Result, 211, memenv);
+ newPtr((void *) Result, 212, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxFileDataObject");
break;
}
@@ -30328,7 +30463,7 @@ case wxTextDataObject_new: { // wxTextDataObject::wxTextDataObject
} break;
}};
wxTextDataObject * Result = new wxTextDataObject(text);
- newPtr((void *) Result, 212, memenv);
+ newPtr((void *) Result, 213, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxTextDataObject");
break;
}
@@ -30364,7 +30499,7 @@ case wxTextDataObject_destroy: { // wxTextDataObject::destroy
case wxBitmapDataObject_new_1_1: { // wxBitmapDataObject::wxBitmapDataObject
wxBitmap *bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
wxBitmapDataObject * Result = new wxBitmapDataObject(*bitmap);
- newPtr((void *) Result, 213, memenv);
+ newPtr((void *) Result, 214, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmapDataObject");
break;
}
@@ -30376,7 +30511,7 @@ bitmap = (wxBitmap *) getPtr(bp,memenv); bp += 4;
} break;
}};
wxBitmapDataObject * Result = new wxBitmapDataObject(*bitmap);
- newPtr((void *) Result, 213, memenv);
+ newPtr((void *) Result, 214, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxBitmapDataObject");
break;
}
@@ -31159,7 +31294,7 @@ case wxAuiManagerEvent_CanVeto: { // wxAuiManagerEvent::CanVeto
}
case wxLogNull_new: { // wxLogNull::wxLogNull
wxLogNull * Result = new wxLogNull();
- newPtr((void *) Result, 223, memenv);
+ newPtr((void *) Result, 224, memenv);
rt.addRef(getRef((void *)Result,memenv), "wxLogNull");
break;
}
@@ -31188,3 +31323,31 @@ case wxLogNull_destroy: { // wxLogNull::destroy
error.addTupleCount(3);
error.send();
}} /* The End */
+
+
+void WxeApp::delete_object(void *ptr, wxeRefData *refd) {
+ switch(refd->type) {
+ case 24: delete (wxGridCellBoolRenderer *) ptr; break;
+ case 25: delete (wxGridCellBoolEditor *) ptr; break;
+ case 26: delete (wxGridCellFloatRenderer *) ptr; break;
+ case 27: delete (wxGridCellFloatEditor *) ptr; break;
+ case 28: delete (wxGridCellStringRenderer *) ptr; break;
+ case 29: delete (wxGridCellTextEditor *) ptr; break;
+ case 30: delete (wxGridCellChoiceEditor *) ptr; break;
+ case 31: delete (wxGridCellNumberRenderer *) ptr; break;
+ case 32: delete (wxGridCellNumberEditor *) ptr; break;
+ case 61: delete (wxIconBundle *) ptr; break;
+ case 69: delete (wxAcceleratorEntry *) ptr; break;
+ case 70: /* delete (wxCaret *) ptr;These objects must be deleted by owner object */ break;
+ case 72: delete (wxSizerFlags *) ptr; break;
+ case 88: /* delete (wxCalendarDateAttr *) ptr;These objects must be deleted by owner object */ break;
+ case 101: delete (wxListItemAttr *) ptr; break;
+ case 103: delete (wxTextAttr *) ptr; break;
+ case 155: delete (wxAuiPaneInfo *) ptr; break;
+ case 212: /* delete (wxFileDataObject *) ptr;These objects must be deleted by owner object */ break;
+ case 213: /* delete (wxTextDataObject *) ptr;These objects must be deleted by owner object */ break;
+ case 214: /* delete (wxBitmapDataObject *) ptr;These objects must be deleted by owner object */ break;
+ case 224: delete (wxLogNull *) ptr; break;
+ default: delete (wxObject *) ptr;
+}}
+
diff --git a/lib/wx/c_src/gen/wxe_init.cpp b/lib/wx/c_src/gen/wxe_init.cpp
index bab3261be4..a75298392b 100644
--- a/lib/wx/c_src/gen/wxe_init.cpp
+++ b/lib/wx/c_src/gen/wxe_init.cpp
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2010. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
diff --git a/lib/wx/c_src/gen/wxe_macros.h b/lib/wx/c_src/gen/wxe_macros.h
index 4fb76f960b..be0481564f 100644
--- a/lib/wx/c_src/gen/wxe_macros.h
+++ b/lib/wx/c_src/gen/wxe_macros.h
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2010. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
@@ -1648,1683 +1648,1695 @@
#define wxListItem_SetText 1754
#define wxListItem_SetTextColour 1755
#define wxListItem_SetWidth 1756
-#define wxImageList_new_0 1757
-#define wxImageList_new_3 1758
-#define wxImageList_Add_1 1759
-#define wxImageList_Add_2_0 1760
-#define wxImageList_Add_2_1 1761
-#define wxImageList_Create 1762
-#define wxImageList_Draw 1764
-#define wxImageList_GetBitmap 1765
-#define wxImageList_GetIcon 1766
-#define wxImageList_GetImageCount 1767
-#define wxImageList_GetSize 1768
-#define wxImageList_Remove 1769
-#define wxImageList_RemoveAll 1770
-#define wxImageList_Replace_2 1771
-#define wxImageList_Replace_3 1772
-#define wxImageList_destroy 1773
-#define wxTextAttr_new_0 1774
-#define wxTextAttr_new_2 1775
-#define wxTextAttr_GetAlignment 1776
-#define wxTextAttr_GetBackgroundColour 1777
-#define wxTextAttr_GetFont 1778
-#define wxTextAttr_GetLeftIndent 1779
-#define wxTextAttr_GetLeftSubIndent 1780
-#define wxTextAttr_GetRightIndent 1781
-#define wxTextAttr_GetTabs 1782
-#define wxTextAttr_GetTextColour 1783
-#define wxTextAttr_HasBackgroundColour 1784
-#define wxTextAttr_HasFont 1785
-#define wxTextAttr_HasTextColour 1786
-#define wxTextAttr_GetFlags 1787
-#define wxTextAttr_IsDefault 1788
-#define wxTextAttr_SetAlignment 1789
-#define wxTextAttr_SetBackgroundColour 1790
-#define wxTextAttr_SetFlags 1791
-#define wxTextAttr_SetFont 1792
-#define wxTextAttr_SetLeftIndent 1793
-#define wxTextAttr_SetRightIndent 1794
-#define wxTextAttr_SetTabs 1795
-#define wxTextAttr_SetTextColour 1796
-#define wxTextAttr_destroy 1797
-#define wxTextCtrl_new_3 1799
-#define wxTextCtrl_new_0 1800
-#define wxTextCtrl_destruct 1802
-#define wxTextCtrl_AppendText 1803
-#define wxTextCtrl_CanCopy 1804
-#define wxTextCtrl_CanCut 1805
-#define wxTextCtrl_CanPaste 1806
-#define wxTextCtrl_CanRedo 1807
-#define wxTextCtrl_CanUndo 1808
-#define wxTextCtrl_Clear 1809
-#define wxTextCtrl_Copy 1810
-#define wxTextCtrl_Create 1811
-#define wxTextCtrl_Cut 1812
-#define wxTextCtrl_DiscardEdits 1813
-#define wxTextCtrl_EmulateKeyPress 1814
-#define wxTextCtrl_GetDefaultStyle 1815
-#define wxTextCtrl_GetInsertionPoint 1816
-#define wxTextCtrl_GetLastPosition 1817
-#define wxTextCtrl_GetLineLength 1818
-#define wxTextCtrl_GetLineText 1819
-#define wxTextCtrl_GetNumberOfLines 1820
-#define wxTextCtrl_GetRange 1821
-#define wxTextCtrl_GetSelection 1822
-#define wxTextCtrl_GetStringSelection 1823
-#define wxTextCtrl_GetStyle 1824
-#define wxTextCtrl_GetValue 1825
-#define wxTextCtrl_IsEditable 1826
-#define wxTextCtrl_IsModified 1827
-#define wxTextCtrl_IsMultiLine 1828
-#define wxTextCtrl_IsSingleLine 1829
-#define wxTextCtrl_LoadFile 1830
-#define wxTextCtrl_MarkDirty 1831
-#define wxTextCtrl_Paste 1832
-#define wxTextCtrl_PositionToXY 1833
-#define wxTextCtrl_Redo 1834
-#define wxTextCtrl_Remove 1835
-#define wxTextCtrl_Replace 1836
-#define wxTextCtrl_SaveFile 1837
-#define wxTextCtrl_SetDefaultStyle 1838
-#define wxTextCtrl_SetEditable 1839
-#define wxTextCtrl_SetInsertionPoint 1840
-#define wxTextCtrl_SetInsertionPointEnd 1841
-#define wxTextCtrl_SetMaxLength 1843
-#define wxTextCtrl_SetSelection 1844
-#define wxTextCtrl_SetStyle 1845
-#define wxTextCtrl_SetValue 1846
-#define wxTextCtrl_ShowPosition 1847
-#define wxTextCtrl_Undo 1848
-#define wxTextCtrl_WriteText 1849
-#define wxTextCtrl_XYToPosition 1850
-#define wxNotebook_new_0 1853
-#define wxNotebook_new_3 1854
-#define wxNotebook_destruct 1855
-#define wxNotebook_AddPage 1856
-#define wxNotebook_AdvanceSelection 1857
-#define wxNotebook_AssignImageList 1858
-#define wxNotebook_Create 1859
-#define wxNotebook_DeleteAllPages 1860
-#define wxNotebook_DeletePage 1861
-#define wxNotebook_RemovePage 1862
-#define wxNotebook_GetCurrentPage 1863
-#define wxNotebook_GetImageList 1864
-#define wxNotebook_GetPage 1866
-#define wxNotebook_GetPageCount 1867
-#define wxNotebook_GetPageImage 1868
-#define wxNotebook_GetPageText 1869
-#define wxNotebook_GetRowCount 1870
-#define wxNotebook_GetSelection 1871
-#define wxNotebook_GetThemeBackgroundColour 1872
-#define wxNotebook_HitTest 1874
-#define wxNotebook_InsertPage 1876
-#define wxNotebook_SetImageList 1877
-#define wxNotebook_SetPadding 1878
-#define wxNotebook_SetPageSize 1879
-#define wxNotebook_SetPageImage 1880
-#define wxNotebook_SetPageText 1881
-#define wxNotebook_SetSelection 1882
-#define wxNotebook_ChangeSelection 1883
-#define wxChoicebook_new_0 1884
-#define wxChoicebook_new_3 1885
-#define wxChoicebook_AddPage 1886
-#define wxChoicebook_AdvanceSelection 1887
-#define wxChoicebook_AssignImageList 1888
-#define wxChoicebook_Create 1889
-#define wxChoicebook_DeleteAllPages 1890
-#define wxChoicebook_DeletePage 1891
-#define wxChoicebook_RemovePage 1892
-#define wxChoicebook_GetCurrentPage 1893
-#define wxChoicebook_GetImageList 1894
-#define wxChoicebook_GetPage 1896
-#define wxChoicebook_GetPageCount 1897
-#define wxChoicebook_GetPageImage 1898
-#define wxChoicebook_GetPageText 1899
-#define wxChoicebook_GetSelection 1900
-#define wxChoicebook_HitTest 1901
-#define wxChoicebook_InsertPage 1902
-#define wxChoicebook_SetImageList 1903
-#define wxChoicebook_SetPageSize 1904
-#define wxChoicebook_SetPageImage 1905
-#define wxChoicebook_SetPageText 1906
-#define wxChoicebook_SetSelection 1907
-#define wxChoicebook_ChangeSelection 1908
-#define wxChoicebook_destroy 1909
-#define wxToolbook_new_0 1910
-#define wxToolbook_new_3 1911
-#define wxToolbook_AddPage 1912
-#define wxToolbook_AdvanceSelection 1913
-#define wxToolbook_AssignImageList 1914
-#define wxToolbook_Create 1915
-#define wxToolbook_DeleteAllPages 1916
-#define wxToolbook_DeletePage 1917
-#define wxToolbook_RemovePage 1918
-#define wxToolbook_GetCurrentPage 1919
-#define wxToolbook_GetImageList 1920
-#define wxToolbook_GetPage 1922
-#define wxToolbook_GetPageCount 1923
-#define wxToolbook_GetPageImage 1924
-#define wxToolbook_GetPageText 1925
-#define wxToolbook_GetSelection 1926
-#define wxToolbook_HitTest 1928
-#define wxToolbook_InsertPage 1929
-#define wxToolbook_SetImageList 1930
-#define wxToolbook_SetPageSize 1931
-#define wxToolbook_SetPageImage 1932
-#define wxToolbook_SetPageText 1933
-#define wxToolbook_SetSelection 1934
-#define wxToolbook_ChangeSelection 1935
-#define wxToolbook_destroy 1936
-#define wxListbook_new_0 1937
-#define wxListbook_new_3 1938
-#define wxListbook_AddPage 1939
-#define wxListbook_AdvanceSelection 1940
-#define wxListbook_AssignImageList 1941
-#define wxListbook_Create 1942
-#define wxListbook_DeleteAllPages 1943
-#define wxListbook_DeletePage 1944
-#define wxListbook_RemovePage 1945
-#define wxListbook_GetCurrentPage 1946
-#define wxListbook_GetImageList 1947
-#define wxListbook_GetPage 1949
-#define wxListbook_GetPageCount 1950
-#define wxListbook_GetPageImage 1951
-#define wxListbook_GetPageText 1952
-#define wxListbook_GetSelection 1953
-#define wxListbook_HitTest 1955
-#define wxListbook_InsertPage 1956
-#define wxListbook_SetImageList 1957
-#define wxListbook_SetPageSize 1958
-#define wxListbook_SetPageImage 1959
-#define wxListbook_SetPageText 1960
-#define wxListbook_SetSelection 1961
-#define wxListbook_ChangeSelection 1962
-#define wxListbook_destroy 1963
-#define wxTreebook_new_0 1964
-#define wxTreebook_new_3 1965
-#define wxTreebook_AddPage 1966
-#define wxTreebook_AdvanceSelection 1967
-#define wxTreebook_AssignImageList 1968
-#define wxTreebook_Create 1969
-#define wxTreebook_DeleteAllPages 1970
-#define wxTreebook_DeletePage 1971
-#define wxTreebook_RemovePage 1972
-#define wxTreebook_GetCurrentPage 1973
-#define wxTreebook_GetImageList 1974
-#define wxTreebook_GetPage 1976
-#define wxTreebook_GetPageCount 1977
-#define wxTreebook_GetPageImage 1978
-#define wxTreebook_GetPageText 1979
-#define wxTreebook_GetSelection 1980
-#define wxTreebook_ExpandNode 1981
-#define wxTreebook_IsNodeExpanded 1982
-#define wxTreebook_HitTest 1984
-#define wxTreebook_InsertPage 1985
-#define wxTreebook_InsertSubPage 1986
-#define wxTreebook_SetImageList 1987
-#define wxTreebook_SetPageSize 1988
-#define wxTreebook_SetPageImage 1989
-#define wxTreebook_SetPageText 1990
-#define wxTreebook_SetSelection 1991
-#define wxTreebook_ChangeSelection 1992
-#define wxTreebook_destroy 1993
-#define wxTreeCtrl_new_2 1996
-#define wxTreeCtrl_new_0 1997
-#define wxTreeCtrl_destruct 1999
-#define wxTreeCtrl_AddRoot 2000
-#define wxTreeCtrl_AppendItem 2001
-#define wxTreeCtrl_AssignImageList 2002
-#define wxTreeCtrl_AssignStateImageList 2003
-#define wxTreeCtrl_Collapse 2004
-#define wxTreeCtrl_CollapseAndReset 2005
-#define wxTreeCtrl_Create 2006
-#define wxTreeCtrl_Delete 2007
-#define wxTreeCtrl_DeleteAllItems 2008
-#define wxTreeCtrl_DeleteChildren 2009
-#define wxTreeCtrl_EditLabel 2010
-#define wxTreeCtrl_EnsureVisible 2011
-#define wxTreeCtrl_Expand 2012
-#define wxTreeCtrl_GetBoundingRect 2013
-#define wxTreeCtrl_GetChildrenCount 2015
-#define wxTreeCtrl_GetCount 2016
-#define wxTreeCtrl_GetEditControl 2017
-#define wxTreeCtrl_GetFirstChild 2018
-#define wxTreeCtrl_GetNextChild 2019
-#define wxTreeCtrl_GetFirstVisibleItem 2020
-#define wxTreeCtrl_GetImageList 2021
-#define wxTreeCtrl_GetIndent 2022
-#define wxTreeCtrl_GetItemBackgroundColour 2023
-#define wxTreeCtrl_GetItemData 2024
-#define wxTreeCtrl_GetItemFont 2025
-#define wxTreeCtrl_GetItemImage_1 2026
-#define wxTreeCtrl_GetItemImage_2 2027
-#define wxTreeCtrl_GetItemText 2028
-#define wxTreeCtrl_GetItemTextColour 2029
-#define wxTreeCtrl_GetLastChild 2030
-#define wxTreeCtrl_GetNextSibling 2031
-#define wxTreeCtrl_GetNextVisible 2032
-#define wxTreeCtrl_GetItemParent 2033
-#define wxTreeCtrl_GetPrevSibling 2034
-#define wxTreeCtrl_GetPrevVisible 2035
-#define wxTreeCtrl_GetRootItem 2036
-#define wxTreeCtrl_GetSelection 2037
-#define wxTreeCtrl_GetSelections 2038
-#define wxTreeCtrl_GetStateImageList 2039
-#define wxTreeCtrl_HitTest 2040
-#define wxTreeCtrl_InsertItem 2042
-#define wxTreeCtrl_IsBold 2043
-#define wxTreeCtrl_IsExpanded 2044
-#define wxTreeCtrl_IsSelected 2045
-#define wxTreeCtrl_IsVisible 2046
-#define wxTreeCtrl_ItemHasChildren 2047
-#define wxTreeCtrl_PrependItem 2048
-#define wxTreeCtrl_ScrollTo 2049
-#define wxTreeCtrl_SelectItem_1 2050
-#define wxTreeCtrl_SelectItem_2 2051
-#define wxTreeCtrl_SetIndent 2052
-#define wxTreeCtrl_SetImageList 2053
-#define wxTreeCtrl_SetItemBackgroundColour 2054
-#define wxTreeCtrl_SetItemBold 2055
-#define wxTreeCtrl_SetItemData 2056
-#define wxTreeCtrl_SetItemDropHighlight 2057
-#define wxTreeCtrl_SetItemFont 2058
-#define wxTreeCtrl_SetItemHasChildren 2059
-#define wxTreeCtrl_SetItemImage_2 2060
-#define wxTreeCtrl_SetItemImage_3 2061
-#define wxTreeCtrl_SetItemText 2062
-#define wxTreeCtrl_SetItemTextColour 2063
-#define wxTreeCtrl_SetStateImageList 2064
-#define wxTreeCtrl_SetWindowStyle 2065
-#define wxTreeCtrl_SortChildren 2066
-#define wxTreeCtrl_Toggle 2067
-#define wxTreeCtrl_ToggleItemSelection 2068
-#define wxTreeCtrl_Unselect 2069
-#define wxTreeCtrl_UnselectAll 2070
-#define wxTreeCtrl_UnselectItem 2071
-#define wxScrollBar_new_0 2072
-#define wxScrollBar_new_3 2073
-#define wxScrollBar_destruct 2074
-#define wxScrollBar_Create 2075
-#define wxScrollBar_GetRange 2076
-#define wxScrollBar_GetPageSize 2077
-#define wxScrollBar_GetThumbPosition 2078
-#define wxScrollBar_GetThumbSize 2079
-#define wxScrollBar_SetThumbPosition 2080
-#define wxScrollBar_SetScrollbar 2081
-#define wxSpinButton_new_2 2083
-#define wxSpinButton_new_0 2084
-#define wxSpinButton_Create 2085
-#define wxSpinButton_GetMax 2086
-#define wxSpinButton_GetMin 2087
-#define wxSpinButton_GetValue 2088
-#define wxSpinButton_SetRange 2089
-#define wxSpinButton_SetValue 2090
-#define wxSpinButton_destroy 2091
-#define wxSpinCtrl_new_0 2092
-#define wxSpinCtrl_new_2 2093
-#define wxSpinCtrl_Create 2095
-#define wxSpinCtrl_SetValue_1_1 2098
-#define wxSpinCtrl_SetValue_1_0 2099
-#define wxSpinCtrl_GetValue 2101
-#define wxSpinCtrl_SetRange 2103
-#define wxSpinCtrl_SetSelection 2104
-#define wxSpinCtrl_GetMin 2106
-#define wxSpinCtrl_GetMax 2108
-#define wxSpinCtrl_destroy 2109
-#define wxStaticText_new_0 2110
-#define wxStaticText_new_4 2111
-#define wxStaticText_Create 2112
-#define wxStaticText_GetLabel 2113
-#define wxStaticText_SetLabel 2114
-#define wxStaticText_Wrap 2115
-#define wxStaticText_destroy 2116
-#define wxStaticBitmap_new_0 2117
-#define wxStaticBitmap_new_4 2118
-#define wxStaticBitmap_Create 2119
-#define wxStaticBitmap_GetBitmap 2120
-#define wxStaticBitmap_SetBitmap 2121
-#define wxStaticBitmap_destroy 2122
-#define wxRadioBox_new 2123
-#define wxRadioBox_destruct 2125
-#define wxRadioBox_Create 2126
-#define wxRadioBox_Enable_2 2127
-#define wxRadioBox_Enable_1 2128
-#define wxRadioBox_GetSelection 2129
-#define wxRadioBox_GetString 2130
-#define wxRadioBox_SetSelection 2131
-#define wxRadioBox_Show_2 2132
-#define wxRadioBox_Show_1 2133
-#define wxRadioBox_GetColumnCount 2134
-#define wxRadioBox_GetItemHelpText 2135
-#define wxRadioBox_GetItemToolTip 2136
-#define wxRadioBox_GetItemFromPoint 2138
-#define wxRadioBox_GetRowCount 2139
-#define wxRadioBox_IsItemEnabled 2140
-#define wxRadioBox_IsItemShown 2141
-#define wxRadioBox_SetItemHelpText 2142
-#define wxRadioBox_SetItemToolTip 2143
-#define wxRadioButton_new_0 2144
-#define wxRadioButton_new_4 2145
-#define wxRadioButton_Create 2146
-#define wxRadioButton_GetValue 2147
-#define wxRadioButton_SetValue 2148
-#define wxRadioButton_destroy 2149
-#define wxSlider_new_6 2151
-#define wxSlider_new_0 2152
-#define wxSlider_Create 2153
-#define wxSlider_GetLineSize 2154
-#define wxSlider_GetMax 2155
-#define wxSlider_GetMin 2156
-#define wxSlider_GetPageSize 2157
-#define wxSlider_GetThumbLength 2158
-#define wxSlider_GetValue 2159
-#define wxSlider_SetLineSize 2160
-#define wxSlider_SetPageSize 2161
-#define wxSlider_SetRange 2162
-#define wxSlider_SetThumbLength 2163
-#define wxSlider_SetValue 2164
-#define wxSlider_destroy 2165
-#define wxDialog_new_4 2167
-#define wxDialog_new_0 2168
-#define wxDialog_destruct 2170
-#define wxDialog_Create 2171
-#define wxDialog_CreateButtonSizer 2172
-#define wxDialog_CreateStdDialogButtonSizer 2173
-#define wxDialog_EndModal 2174
-#define wxDialog_GetAffirmativeId 2175
-#define wxDialog_GetReturnCode 2176
-#define wxDialog_IsModal 2177
-#define wxDialog_SetAffirmativeId 2178
-#define wxDialog_SetReturnCode 2179
-#define wxDialog_Show 2180
-#define wxDialog_ShowModal 2181
-#define wxColourDialog_new_0 2182
-#define wxColourDialog_new_2 2183
-#define wxColourDialog_destruct 2184
-#define wxColourDialog_Create 2185
-#define wxColourDialog_GetColourData 2186
-#define wxColourData_new_0 2187
-#define wxColourData_new_1 2188
-#define wxColourData_destruct 2189
-#define wxColourData_GetChooseFull 2190
-#define wxColourData_GetColour 2191
-#define wxColourData_GetCustomColour 2193
-#define wxColourData_SetChooseFull 2194
-#define wxColourData_SetColour 2195
-#define wxColourData_SetCustomColour 2196
-#define wxPalette_new_0 2197
-#define wxPalette_new_4 2198
-#define wxPalette_destruct 2200
-#define wxPalette_Create 2201
-#define wxPalette_GetColoursCount 2202
-#define wxPalette_GetPixel 2203
-#define wxPalette_GetRGB 2204
-#define wxPalette_IsOk 2205
-#define wxDirDialog_new 2209
-#define wxDirDialog_destruct 2210
-#define wxDirDialog_GetPath 2211
-#define wxDirDialog_GetMessage 2212
-#define wxDirDialog_SetMessage 2213
-#define wxDirDialog_SetPath 2214
-#define wxFileDialog_new 2218
-#define wxFileDialog_destruct 2219
-#define wxFileDialog_GetDirectory 2220
-#define wxFileDialog_GetFilename 2221
-#define wxFileDialog_GetFilenames 2222
-#define wxFileDialog_GetFilterIndex 2223
-#define wxFileDialog_GetMessage 2224
-#define wxFileDialog_GetPath 2225
-#define wxFileDialog_GetPaths 2226
-#define wxFileDialog_GetWildcard 2227
-#define wxFileDialog_SetDirectory 2228
-#define wxFileDialog_SetFilename 2229
-#define wxFileDialog_SetFilterIndex 2230
-#define wxFileDialog_SetMessage 2231
-#define wxFileDialog_SetPath 2232
-#define wxFileDialog_SetWildcard 2233
-#define wxPickerBase_SetInternalMargin 2234
-#define wxPickerBase_GetInternalMargin 2235
-#define wxPickerBase_SetTextCtrlProportion 2236
-#define wxPickerBase_SetPickerCtrlProportion 2237
-#define wxPickerBase_GetTextCtrlProportion 2238
-#define wxPickerBase_GetPickerCtrlProportion 2239
-#define wxPickerBase_HasTextCtrl 2240
-#define wxPickerBase_GetTextCtrl 2241
-#define wxPickerBase_IsTextCtrlGrowable 2242
-#define wxPickerBase_SetPickerCtrlGrowable 2243
-#define wxPickerBase_SetTextCtrlGrowable 2244
-#define wxPickerBase_IsPickerCtrlGrowable 2245
-#define wxFilePickerCtrl_new_0 2246
-#define wxFilePickerCtrl_new_3 2247
-#define wxFilePickerCtrl_Create 2248
-#define wxFilePickerCtrl_GetPath 2249
-#define wxFilePickerCtrl_SetPath 2250
-#define wxFilePickerCtrl_destroy 2251
-#define wxDirPickerCtrl_new_0 2252
-#define wxDirPickerCtrl_new_3 2253
-#define wxDirPickerCtrl_Create 2254
-#define wxDirPickerCtrl_GetPath 2255
-#define wxDirPickerCtrl_SetPath 2256
-#define wxDirPickerCtrl_destroy 2257
-#define wxColourPickerCtrl_new_0 2258
-#define wxColourPickerCtrl_new_3 2259
-#define wxColourPickerCtrl_Create 2260
-#define wxColourPickerCtrl_GetColour 2261
-#define wxColourPickerCtrl_SetColour_1_1 2262
-#define wxColourPickerCtrl_SetColour_1_0 2263
-#define wxColourPickerCtrl_destroy 2264
-#define wxDatePickerCtrl_new_0 2265
-#define wxDatePickerCtrl_new_3 2266
-#define wxDatePickerCtrl_GetRange 2267
-#define wxDatePickerCtrl_GetValue 2268
-#define wxDatePickerCtrl_SetRange 2269
-#define wxDatePickerCtrl_SetValue 2270
-#define wxDatePickerCtrl_destroy 2271
-#define wxFontPickerCtrl_new_0 2272
-#define wxFontPickerCtrl_new_3 2273
-#define wxFontPickerCtrl_Create 2274
-#define wxFontPickerCtrl_GetSelectedFont 2275
-#define wxFontPickerCtrl_SetSelectedFont 2276
-#define wxFontPickerCtrl_GetMaxPointSize 2277
-#define wxFontPickerCtrl_SetMaxPointSize 2278
-#define wxFontPickerCtrl_destroy 2279
-#define wxFindReplaceDialog_new_0 2282
-#define wxFindReplaceDialog_new_4 2283
-#define wxFindReplaceDialog_destruct 2284
-#define wxFindReplaceDialog_Create 2285
-#define wxFindReplaceDialog_GetData 2286
-#define wxFindReplaceData_new_0 2287
-#define wxFindReplaceData_new_1 2288
-#define wxFindReplaceData_GetFindString 2289
-#define wxFindReplaceData_GetReplaceString 2290
-#define wxFindReplaceData_GetFlags 2291
-#define wxFindReplaceData_SetFlags 2292
-#define wxFindReplaceData_SetFindString 2293
-#define wxFindReplaceData_SetReplaceString 2294
-#define wxFindReplaceData_destroy 2295
-#define wxMultiChoiceDialog_new_0 2296
-#define wxMultiChoiceDialog_new_5 2298
-#define wxMultiChoiceDialog_GetSelections 2299
-#define wxMultiChoiceDialog_SetSelections 2300
-#define wxMultiChoiceDialog_destroy 2301
-#define wxSingleChoiceDialog_new_0 2302
-#define wxSingleChoiceDialog_new_5 2304
-#define wxSingleChoiceDialog_GetSelection 2305
-#define wxSingleChoiceDialog_GetStringSelection 2306
-#define wxSingleChoiceDialog_SetSelection 2307
-#define wxSingleChoiceDialog_destroy 2308
-#define wxTextEntryDialog_new 2309
-#define wxTextEntryDialog_GetValue 2310
-#define wxTextEntryDialog_SetValue 2311
-#define wxTextEntryDialog_destroy 2312
-#define wxPasswordEntryDialog_new 2313
-#define wxPasswordEntryDialog_destroy 2314
-#define wxFontData_new_0 2315
-#define wxFontData_new_1 2316
-#define wxFontData_destruct 2317
-#define wxFontData_EnableEffects 2318
-#define wxFontData_GetAllowSymbols 2319
-#define wxFontData_GetColour 2320
-#define wxFontData_GetChosenFont 2321
-#define wxFontData_GetEnableEffects 2322
-#define wxFontData_GetInitialFont 2323
-#define wxFontData_GetShowHelp 2324
-#define wxFontData_SetAllowSymbols 2325
-#define wxFontData_SetChosenFont 2326
-#define wxFontData_SetColour 2327
-#define wxFontData_SetInitialFont 2328
-#define wxFontData_SetRange 2329
-#define wxFontData_SetShowHelp 2330
-#define wxFontDialog_new_0 2334
-#define wxFontDialog_new_2 2336
-#define wxFontDialog_Create 2338
-#define wxFontDialog_GetFontData 2339
-#define wxFontDialog_destroy 2341
-#define wxProgressDialog_new 2342
-#define wxProgressDialog_destruct 2343
-#define wxProgressDialog_Resume 2344
-#define wxProgressDialog_Update_2 2345
-#define wxProgressDialog_Update_0 2346
-#define wxMessageDialog_new 2347
-#define wxMessageDialog_destruct 2348
-#define wxPageSetupDialog_new 2349
-#define wxPageSetupDialog_destruct 2350
-#define wxPageSetupDialog_GetPageSetupData 2351
-#define wxPageSetupDialog_ShowModal 2352
-#define wxPageSetupDialogData_new_0 2353
-#define wxPageSetupDialogData_new_1_0 2354
-#define wxPageSetupDialogData_new_1_1 2355
-#define wxPageSetupDialogData_destruct 2356
-#define wxPageSetupDialogData_EnableHelp 2357
-#define wxPageSetupDialogData_EnableMargins 2358
-#define wxPageSetupDialogData_EnableOrientation 2359
-#define wxPageSetupDialogData_EnablePaper 2360
-#define wxPageSetupDialogData_EnablePrinter 2361
-#define wxPageSetupDialogData_GetDefaultMinMargins 2362
-#define wxPageSetupDialogData_GetEnableMargins 2363
-#define wxPageSetupDialogData_GetEnableOrientation 2364
-#define wxPageSetupDialogData_GetEnablePaper 2365
-#define wxPageSetupDialogData_GetEnablePrinter 2366
-#define wxPageSetupDialogData_GetEnableHelp 2367
-#define wxPageSetupDialogData_GetDefaultInfo 2368
-#define wxPageSetupDialogData_GetMarginTopLeft 2369
-#define wxPageSetupDialogData_GetMarginBottomRight 2370
-#define wxPageSetupDialogData_GetMinMarginTopLeft 2371
-#define wxPageSetupDialogData_GetMinMarginBottomRight 2372
-#define wxPageSetupDialogData_GetPaperId 2373
-#define wxPageSetupDialogData_GetPaperSize 2374
-#define wxPageSetupDialogData_GetPrintData 2376
-#define wxPageSetupDialogData_IsOk 2377
-#define wxPageSetupDialogData_SetDefaultInfo 2378
-#define wxPageSetupDialogData_SetDefaultMinMargins 2379
-#define wxPageSetupDialogData_SetMarginTopLeft 2380
-#define wxPageSetupDialogData_SetMarginBottomRight 2381
-#define wxPageSetupDialogData_SetMinMarginTopLeft 2382
-#define wxPageSetupDialogData_SetMinMarginBottomRight 2383
-#define wxPageSetupDialogData_SetPaperId 2384
-#define wxPageSetupDialogData_SetPaperSize_1_1 2385
-#define wxPageSetupDialogData_SetPaperSize_1_0 2386
-#define wxPageSetupDialogData_SetPrintData 2387
-#define wxPrintDialog_new_2_0 2388
-#define wxPrintDialog_new_2_1 2389
-#define wxPrintDialog_destruct 2390
-#define wxPrintDialog_GetPrintDialogData 2391
-#define wxPrintDialog_GetPrintDC 2392
-#define wxPrintDialogData_new_0 2393
-#define wxPrintDialogData_new_1_1 2394
-#define wxPrintDialogData_new_1_0 2395
-#define wxPrintDialogData_destruct 2396
-#define wxPrintDialogData_EnableHelp 2397
-#define wxPrintDialogData_EnablePageNumbers 2398
-#define wxPrintDialogData_EnablePrintToFile 2399
-#define wxPrintDialogData_EnableSelection 2400
-#define wxPrintDialogData_GetAllPages 2401
-#define wxPrintDialogData_GetCollate 2402
-#define wxPrintDialogData_GetFromPage 2403
-#define wxPrintDialogData_GetMaxPage 2404
-#define wxPrintDialogData_GetMinPage 2405
-#define wxPrintDialogData_GetNoCopies 2406
-#define wxPrintDialogData_GetPrintData 2407
-#define wxPrintDialogData_GetPrintToFile 2408
-#define wxPrintDialogData_GetSelection 2409
-#define wxPrintDialogData_GetToPage 2410
-#define wxPrintDialogData_IsOk 2411
-#define wxPrintDialogData_SetCollate 2412
-#define wxPrintDialogData_SetFromPage 2413
-#define wxPrintDialogData_SetMaxPage 2414
-#define wxPrintDialogData_SetMinPage 2415
-#define wxPrintDialogData_SetNoCopies 2416
-#define wxPrintDialogData_SetPrintData 2417
-#define wxPrintDialogData_SetPrintToFile 2418
-#define wxPrintDialogData_SetSelection 2419
-#define wxPrintDialogData_SetToPage 2420
-#define wxPrintData_new_0 2421
-#define wxPrintData_new_1 2422
-#define wxPrintData_destruct 2423
-#define wxPrintData_GetCollate 2424
-#define wxPrintData_GetBin 2425
-#define wxPrintData_GetColour 2426
-#define wxPrintData_GetDuplex 2427
-#define wxPrintData_GetNoCopies 2428
-#define wxPrintData_GetOrientation 2429
-#define wxPrintData_GetPaperId 2430
-#define wxPrintData_GetPrinterName 2431
-#define wxPrintData_GetQuality 2432
-#define wxPrintData_IsOk 2433
-#define wxPrintData_SetBin 2434
-#define wxPrintData_SetCollate 2435
-#define wxPrintData_SetColour 2436
-#define wxPrintData_SetDuplex 2437
-#define wxPrintData_SetNoCopies 2438
-#define wxPrintData_SetOrientation 2439
-#define wxPrintData_SetPaperId 2440
-#define wxPrintData_SetPrinterName 2441
-#define wxPrintData_SetQuality 2442
-#define wxPrintPreview_new_2 2445
-#define wxPrintPreview_new_3 2446
-#define wxPrintPreview_destruct 2448
-#define wxPrintPreview_GetCanvas 2449
-#define wxPrintPreview_GetCurrentPage 2450
-#define wxPrintPreview_GetFrame 2451
-#define wxPrintPreview_GetMaxPage 2452
-#define wxPrintPreview_GetMinPage 2453
-#define wxPrintPreview_GetPrintout 2454
-#define wxPrintPreview_GetPrintoutForPrinting 2455
-#define wxPrintPreview_IsOk 2456
-#define wxPrintPreview_PaintPage 2457
-#define wxPrintPreview_Print 2458
-#define wxPrintPreview_RenderPage 2459
-#define wxPrintPreview_SetCanvas 2460
-#define wxPrintPreview_SetCurrentPage 2461
-#define wxPrintPreview_SetFrame 2462
-#define wxPrintPreview_SetPrintout 2463
-#define wxPrintPreview_SetZoom 2464
-#define wxPreviewFrame_new 2465
-#define wxPreviewFrame_destruct 2466
-#define wxPreviewFrame_CreateControlBar 2467
-#define wxPreviewFrame_CreateCanvas 2468
-#define wxPreviewFrame_Initialize 2469
-#define wxPreviewFrame_OnCloseWindow 2470
-#define wxPreviewControlBar_new 2471
-#define wxPreviewControlBar_destruct 2472
-#define wxPreviewControlBar_CreateButtons 2473
-#define wxPreviewControlBar_GetPrintPreview 2474
-#define wxPreviewControlBar_GetZoomControl 2475
-#define wxPreviewControlBar_SetZoomControl 2476
-#define wxPrinter_new 2478
-#define wxPrinter_CreateAbortWindow 2479
-#define wxPrinter_GetAbort 2480
-#define wxPrinter_GetLastError 2481
-#define wxPrinter_GetPrintDialogData 2482
-#define wxPrinter_Print 2483
-#define wxPrinter_PrintDialog 2484
-#define wxPrinter_ReportError 2485
-#define wxPrinter_Setup 2486
-#define wxPrinter_destroy 2487
-#define wxXmlResource_new_1 2488
-#define wxXmlResource_new_2 2489
-#define wxXmlResource_destruct 2490
-#define wxXmlResource_AttachUnknownControl 2491
-#define wxXmlResource_ClearHandlers 2492
-#define wxXmlResource_CompareVersion 2493
-#define wxXmlResource_Get 2494
-#define wxXmlResource_GetFlags 2495
-#define wxXmlResource_GetVersion 2496
-#define wxXmlResource_GetXRCID 2497
-#define wxXmlResource_InitAllHandlers 2498
-#define wxXmlResource_Load 2499
-#define wxXmlResource_LoadBitmap 2500
-#define wxXmlResource_LoadDialog_2 2501
-#define wxXmlResource_LoadDialog_3 2502
-#define wxXmlResource_LoadFrame_2 2503
-#define wxXmlResource_LoadFrame_3 2504
-#define wxXmlResource_LoadIcon 2505
-#define wxXmlResource_LoadMenu 2506
-#define wxXmlResource_LoadMenuBar_2 2507
-#define wxXmlResource_LoadMenuBar_1 2508
-#define wxXmlResource_LoadPanel_2 2509
-#define wxXmlResource_LoadPanel_3 2510
-#define wxXmlResource_LoadToolBar 2511
-#define wxXmlResource_Set 2512
-#define wxXmlResource_SetFlags 2513
-#define wxXmlResource_Unload 2514
-#define wxXmlResource_xrcctrl 2515
-#define wxHtmlEasyPrinting_new 2516
-#define wxHtmlEasyPrinting_destruct 2517
-#define wxHtmlEasyPrinting_GetPrintData 2518
-#define wxHtmlEasyPrinting_GetPageSetupData 2519
-#define wxHtmlEasyPrinting_PreviewFile 2520
-#define wxHtmlEasyPrinting_PreviewText 2521
-#define wxHtmlEasyPrinting_PrintFile 2522
-#define wxHtmlEasyPrinting_PrintText 2523
-#define wxHtmlEasyPrinting_PageSetup 2524
-#define wxHtmlEasyPrinting_SetFonts 2525
-#define wxHtmlEasyPrinting_SetHeader 2526
-#define wxHtmlEasyPrinting_SetFooter 2527
-#define wxGLCanvas_new_2 2529
-#define wxGLCanvas_new_3_1 2530
-#define wxGLCanvas_new_3_0 2531
-#define wxGLCanvas_GetContext 2532
-#define wxGLCanvas_SetCurrent 2534
-#define wxGLCanvas_SwapBuffers 2535
-#define wxGLCanvas_destroy 2536
-#define wxAuiManager_new 2537
-#define wxAuiManager_destruct 2538
-#define wxAuiManager_AddPane_2_1 2539
-#define wxAuiManager_AddPane_3 2540
-#define wxAuiManager_AddPane_2_0 2541
-#define wxAuiManager_DetachPane 2542
-#define wxAuiManager_GetAllPanes 2543
-#define wxAuiManager_GetArtProvider 2544
-#define wxAuiManager_GetDockSizeConstraint 2545
-#define wxAuiManager_GetFlags 2546
-#define wxAuiManager_GetManagedWindow 2547
-#define wxAuiManager_GetManager 2548
-#define wxAuiManager_GetPane_1_1 2549
-#define wxAuiManager_GetPane_1_0 2550
-#define wxAuiManager_HideHint 2551
-#define wxAuiManager_InsertPane 2552
-#define wxAuiManager_LoadPaneInfo 2553
-#define wxAuiManager_LoadPerspective 2554
-#define wxAuiManager_SavePaneInfo 2555
-#define wxAuiManager_SavePerspective 2556
-#define wxAuiManager_SetArtProvider 2557
-#define wxAuiManager_SetDockSizeConstraint 2558
-#define wxAuiManager_SetFlags 2559
-#define wxAuiManager_SetManagedWindow 2560
-#define wxAuiManager_ShowHint 2561
-#define wxAuiManager_UnInit 2562
-#define wxAuiManager_Update 2563
-#define wxAuiPaneInfo_new_0 2564
-#define wxAuiPaneInfo_new_1 2565
-#define wxAuiPaneInfo_destruct 2566
-#define wxAuiPaneInfo_BestSize_1 2567
-#define wxAuiPaneInfo_BestSize_2 2568
-#define wxAuiPaneInfo_Bottom 2569
-#define wxAuiPaneInfo_BottomDockable 2570
-#define wxAuiPaneInfo_Caption 2571
-#define wxAuiPaneInfo_CaptionVisible 2572
-#define wxAuiPaneInfo_Centre 2573
-#define wxAuiPaneInfo_CentrePane 2574
-#define wxAuiPaneInfo_CloseButton 2575
-#define wxAuiPaneInfo_DefaultPane 2576
-#define wxAuiPaneInfo_DestroyOnClose 2577
-#define wxAuiPaneInfo_Direction 2578
-#define wxAuiPaneInfo_Dock 2579
-#define wxAuiPaneInfo_Dockable 2580
-#define wxAuiPaneInfo_Fixed 2581
-#define wxAuiPaneInfo_Float 2582
-#define wxAuiPaneInfo_Floatable 2583
-#define wxAuiPaneInfo_FloatingPosition_1 2584
-#define wxAuiPaneInfo_FloatingPosition_2 2585
-#define wxAuiPaneInfo_FloatingSize_1 2586
-#define wxAuiPaneInfo_FloatingSize_2 2587
-#define wxAuiPaneInfo_Gripper 2588
-#define wxAuiPaneInfo_GripperTop 2589
-#define wxAuiPaneInfo_HasBorder 2590
-#define wxAuiPaneInfo_HasCaption 2591
-#define wxAuiPaneInfo_HasCloseButton 2592
-#define wxAuiPaneInfo_HasFlag 2593
-#define wxAuiPaneInfo_HasGripper 2594
-#define wxAuiPaneInfo_HasGripperTop 2595
-#define wxAuiPaneInfo_HasMaximizeButton 2596
-#define wxAuiPaneInfo_HasMinimizeButton 2597
-#define wxAuiPaneInfo_HasPinButton 2598
-#define wxAuiPaneInfo_Hide 2599
-#define wxAuiPaneInfo_IsBottomDockable 2600
-#define wxAuiPaneInfo_IsDocked 2601
-#define wxAuiPaneInfo_IsFixed 2602
-#define wxAuiPaneInfo_IsFloatable 2603
-#define wxAuiPaneInfo_IsFloating 2604
-#define wxAuiPaneInfo_IsLeftDockable 2605
-#define wxAuiPaneInfo_IsMovable 2606
-#define wxAuiPaneInfo_IsOk 2607
-#define wxAuiPaneInfo_IsResizable 2608
-#define wxAuiPaneInfo_IsRightDockable 2609
-#define wxAuiPaneInfo_IsShown 2610
-#define wxAuiPaneInfo_IsToolbar 2611
-#define wxAuiPaneInfo_IsTopDockable 2612
-#define wxAuiPaneInfo_Layer 2613
-#define wxAuiPaneInfo_Left 2614
-#define wxAuiPaneInfo_LeftDockable 2615
-#define wxAuiPaneInfo_MaxSize_1 2616
-#define wxAuiPaneInfo_MaxSize_2 2617
-#define wxAuiPaneInfo_MaximizeButton 2618
-#define wxAuiPaneInfo_MinSize_1 2619
-#define wxAuiPaneInfo_MinSize_2 2620
-#define wxAuiPaneInfo_MinimizeButton 2621
-#define wxAuiPaneInfo_Movable 2622
-#define wxAuiPaneInfo_Name 2623
-#define wxAuiPaneInfo_PaneBorder 2624
-#define wxAuiPaneInfo_PinButton 2625
-#define wxAuiPaneInfo_Position 2626
-#define wxAuiPaneInfo_Resizable 2627
-#define wxAuiPaneInfo_Right 2628
-#define wxAuiPaneInfo_RightDockable 2629
-#define wxAuiPaneInfo_Row 2630
-#define wxAuiPaneInfo_SafeSet 2631
-#define wxAuiPaneInfo_SetFlag 2632
-#define wxAuiPaneInfo_Show 2633
-#define wxAuiPaneInfo_ToolbarPane 2634
-#define wxAuiPaneInfo_Top 2635
-#define wxAuiPaneInfo_TopDockable 2636
-#define wxAuiPaneInfo_Window 2637
-#define wxAuiNotebook_new_0 2638
-#define wxAuiNotebook_new_2 2639
-#define wxAuiNotebook_AddPage 2640
-#define wxAuiNotebook_Create 2641
-#define wxAuiNotebook_DeletePage 2642
-#define wxAuiNotebook_GetArtProvider 2643
-#define wxAuiNotebook_GetPage 2644
-#define wxAuiNotebook_GetPageBitmap 2645
-#define wxAuiNotebook_GetPageCount 2646
-#define wxAuiNotebook_GetPageIndex 2647
-#define wxAuiNotebook_GetPageText 2648
-#define wxAuiNotebook_GetSelection 2649
-#define wxAuiNotebook_InsertPage 2650
-#define wxAuiNotebook_RemovePage 2651
-#define wxAuiNotebook_SetArtProvider 2652
-#define wxAuiNotebook_SetFont 2653
-#define wxAuiNotebook_SetPageBitmap 2654
-#define wxAuiNotebook_SetPageText 2655
-#define wxAuiNotebook_SetSelection 2656
-#define wxAuiNotebook_SetTabCtrlHeight 2657
-#define wxAuiNotebook_SetUniformBitmapSize 2658
-#define wxAuiNotebook_destroy 2659
-#define wxMDIParentFrame_new_0 2660
-#define wxMDIParentFrame_new_4 2661
-#define wxMDIParentFrame_destruct 2662
-#define wxMDIParentFrame_ActivateNext 2663
-#define wxMDIParentFrame_ActivatePrevious 2664
-#define wxMDIParentFrame_ArrangeIcons 2665
-#define wxMDIParentFrame_Cascade 2666
-#define wxMDIParentFrame_Create 2667
-#define wxMDIParentFrame_GetActiveChild 2668
-#define wxMDIParentFrame_GetClientWindow 2669
-#define wxMDIParentFrame_Tile 2670
-#define wxMDIChildFrame_new_0 2671
-#define wxMDIChildFrame_new_4 2672
-#define wxMDIChildFrame_destruct 2673
-#define wxMDIChildFrame_Activate 2674
-#define wxMDIChildFrame_Create 2675
-#define wxMDIChildFrame_Maximize 2676
-#define wxMDIChildFrame_Restore 2677
-#define wxMDIClientWindow_new_0 2678
-#define wxMDIClientWindow_new_2 2679
-#define wxMDIClientWindow_destruct 2680
-#define wxMDIClientWindow_CreateClient 2681
-#define wxLayoutAlgorithm_new 2682
-#define wxLayoutAlgorithm_LayoutFrame 2683
-#define wxLayoutAlgorithm_LayoutMDIFrame 2684
-#define wxLayoutAlgorithm_LayoutWindow 2685
-#define wxLayoutAlgorithm_destroy 2686
-#define wxEvent_GetId 2687
-#define wxEvent_GetSkipped 2688
-#define wxEvent_GetTimestamp 2689
-#define wxEvent_IsCommandEvent 2690
-#define wxEvent_ResumePropagation 2691
-#define wxEvent_ShouldPropagate 2692
-#define wxEvent_Skip 2693
-#define wxEvent_StopPropagation 2694
-#define wxCommandEvent_getClientData 2695
-#define wxCommandEvent_GetExtraLong 2696
-#define wxCommandEvent_GetInt 2697
-#define wxCommandEvent_GetSelection 2698
-#define wxCommandEvent_GetString 2699
-#define wxCommandEvent_IsChecked 2700
-#define wxCommandEvent_IsSelection 2701
-#define wxCommandEvent_SetInt 2702
-#define wxCommandEvent_SetString 2703
-#define wxScrollEvent_GetOrientation 2704
-#define wxScrollEvent_GetPosition 2705
-#define wxScrollWinEvent_GetOrientation 2706
-#define wxScrollWinEvent_GetPosition 2707
-#define wxMouseEvent_AltDown 2708
-#define wxMouseEvent_Button 2709
-#define wxMouseEvent_ButtonDClick 2710
-#define wxMouseEvent_ButtonDown 2711
-#define wxMouseEvent_ButtonUp 2712
-#define wxMouseEvent_CmdDown 2713
-#define wxMouseEvent_ControlDown 2714
-#define wxMouseEvent_Dragging 2715
-#define wxMouseEvent_Entering 2716
-#define wxMouseEvent_GetButton 2717
-#define wxMouseEvent_GetPosition 2720
-#define wxMouseEvent_GetLogicalPosition 2721
-#define wxMouseEvent_GetLinesPerAction 2722
-#define wxMouseEvent_GetWheelRotation 2723
-#define wxMouseEvent_GetWheelDelta 2724
-#define wxMouseEvent_GetX 2725
-#define wxMouseEvent_GetY 2726
-#define wxMouseEvent_IsButton 2727
-#define wxMouseEvent_IsPageScroll 2728
-#define wxMouseEvent_Leaving 2729
-#define wxMouseEvent_LeftDClick 2730
-#define wxMouseEvent_LeftDown 2731
-#define wxMouseEvent_LeftIsDown 2732
-#define wxMouseEvent_LeftUp 2733
-#define wxMouseEvent_MetaDown 2734
-#define wxMouseEvent_MiddleDClick 2735
-#define wxMouseEvent_MiddleDown 2736
-#define wxMouseEvent_MiddleIsDown 2737
-#define wxMouseEvent_MiddleUp 2738
-#define wxMouseEvent_Moving 2739
-#define wxMouseEvent_RightDClick 2740
-#define wxMouseEvent_RightDown 2741
-#define wxMouseEvent_RightIsDown 2742
-#define wxMouseEvent_RightUp 2743
-#define wxMouseEvent_ShiftDown 2744
-#define wxSetCursorEvent_GetCursor 2745
-#define wxSetCursorEvent_GetX 2746
-#define wxSetCursorEvent_GetY 2747
-#define wxSetCursorEvent_HasCursor 2748
-#define wxSetCursorEvent_SetCursor 2749
-#define wxKeyEvent_AltDown 2750
-#define wxKeyEvent_CmdDown 2751
-#define wxKeyEvent_ControlDown 2752
-#define wxKeyEvent_GetKeyCode 2753
-#define wxKeyEvent_GetModifiers 2754
-#define wxKeyEvent_GetPosition 2757
-#define wxKeyEvent_GetRawKeyCode 2758
-#define wxKeyEvent_GetRawKeyFlags 2759
-#define wxKeyEvent_GetUnicodeKey 2760
-#define wxKeyEvent_GetX 2761
-#define wxKeyEvent_GetY 2762
-#define wxKeyEvent_HasModifiers 2763
-#define wxKeyEvent_MetaDown 2764
-#define wxKeyEvent_ShiftDown 2765
-#define wxSizeEvent_GetSize 2766
-#define wxMoveEvent_GetPosition 2767
-#define wxEraseEvent_GetDC 2768
-#define wxFocusEvent_GetWindow 2769
-#define wxChildFocusEvent_GetWindow 2770
-#define wxMenuEvent_GetMenu 2771
-#define wxMenuEvent_GetMenuId 2772
-#define wxMenuEvent_IsPopup 2773
-#define wxCloseEvent_CanVeto 2774
-#define wxCloseEvent_GetLoggingOff 2775
-#define wxCloseEvent_SetCanVeto 2776
-#define wxCloseEvent_SetLoggingOff 2777
-#define wxCloseEvent_Veto 2778
-#define wxShowEvent_SetShow 2779
-#define wxShowEvent_GetShow 2780
-#define wxIconizeEvent_Iconized 2781
-#define wxJoystickEvent_ButtonDown 2782
-#define wxJoystickEvent_ButtonIsDown 2783
-#define wxJoystickEvent_ButtonUp 2784
-#define wxJoystickEvent_GetButtonChange 2785
-#define wxJoystickEvent_GetButtonState 2786
-#define wxJoystickEvent_GetJoystick 2787
-#define wxJoystickEvent_GetPosition 2788
-#define wxJoystickEvent_GetZPosition 2789
-#define wxJoystickEvent_IsButton 2790
-#define wxJoystickEvent_IsMove 2791
-#define wxJoystickEvent_IsZMove 2792
-#define wxUpdateUIEvent_CanUpdate 2793
-#define wxUpdateUIEvent_Check 2794
-#define wxUpdateUIEvent_Enable 2795
-#define wxUpdateUIEvent_Show 2796
-#define wxUpdateUIEvent_GetChecked 2797
-#define wxUpdateUIEvent_GetEnabled 2798
-#define wxUpdateUIEvent_GetShown 2799
-#define wxUpdateUIEvent_GetSetChecked 2800
-#define wxUpdateUIEvent_GetSetEnabled 2801
-#define wxUpdateUIEvent_GetSetShown 2802
-#define wxUpdateUIEvent_GetSetText 2803
-#define wxUpdateUIEvent_GetText 2804
-#define wxUpdateUIEvent_GetMode 2805
-#define wxUpdateUIEvent_GetUpdateInterval 2806
-#define wxUpdateUIEvent_ResetUpdateTime 2807
-#define wxUpdateUIEvent_SetMode 2808
-#define wxUpdateUIEvent_SetText 2809
-#define wxUpdateUIEvent_SetUpdateInterval 2810
-#define wxMouseCaptureChangedEvent_GetCapturedWindow 2811
-#define wxPaletteChangedEvent_SetChangedWindow 2812
-#define wxPaletteChangedEvent_GetChangedWindow 2813
-#define wxQueryNewPaletteEvent_SetPaletteRealized 2814
-#define wxQueryNewPaletteEvent_GetPaletteRealized 2815
-#define wxNavigationKeyEvent_GetDirection 2816
-#define wxNavigationKeyEvent_SetDirection 2817
-#define wxNavigationKeyEvent_IsWindowChange 2818
-#define wxNavigationKeyEvent_SetWindowChange 2819
-#define wxNavigationKeyEvent_IsFromTab 2820
-#define wxNavigationKeyEvent_SetFromTab 2821
-#define wxNavigationKeyEvent_GetCurrentFocus 2822
-#define wxNavigationKeyEvent_SetCurrentFocus 2823
-#define wxHelpEvent_GetOrigin 2824
-#define wxHelpEvent_GetPosition 2825
-#define wxHelpEvent_SetOrigin 2826
-#define wxHelpEvent_SetPosition 2827
-#define wxContextMenuEvent_GetPosition 2828
-#define wxContextMenuEvent_SetPosition 2829
-#define wxIdleEvent_CanSend 2830
-#define wxIdleEvent_GetMode 2831
-#define wxIdleEvent_RequestMore 2832
-#define wxIdleEvent_MoreRequested 2833
-#define wxIdleEvent_SetMode 2834
-#define wxGridEvent_AltDown 2835
-#define wxGridEvent_ControlDown 2836
-#define wxGridEvent_GetCol 2837
-#define wxGridEvent_GetPosition 2838
-#define wxGridEvent_GetRow 2839
-#define wxGridEvent_MetaDown 2840
-#define wxGridEvent_Selecting 2841
-#define wxGridEvent_ShiftDown 2842
-#define wxNotifyEvent_Allow 2843
-#define wxNotifyEvent_IsAllowed 2844
-#define wxNotifyEvent_Veto 2845
-#define wxSashEvent_GetEdge 2846
-#define wxSashEvent_GetDragRect 2847
-#define wxSashEvent_GetDragStatus 2848
-#define wxListEvent_GetCacheFrom 2849
-#define wxListEvent_GetCacheTo 2850
-#define wxListEvent_GetKeyCode 2851
-#define wxListEvent_GetIndex 2852
-#define wxListEvent_GetColumn 2853
-#define wxListEvent_GetPoint 2854
-#define wxListEvent_GetLabel 2855
-#define wxListEvent_GetText 2856
-#define wxListEvent_GetImage 2857
-#define wxListEvent_GetData 2858
-#define wxListEvent_GetMask 2859
-#define wxListEvent_GetItem 2860
-#define wxListEvent_IsEditCancelled 2861
-#define wxDateEvent_GetDate 2862
-#define wxCalendarEvent_GetWeekDay 2863
-#define wxFileDirPickerEvent_GetPath 2864
-#define wxColourPickerEvent_GetColour 2865
-#define wxFontPickerEvent_GetFont 2866
-#define wxStyledTextEvent_GetPosition 2867
-#define wxStyledTextEvent_GetKey 2868
-#define wxStyledTextEvent_GetModifiers 2869
-#define wxStyledTextEvent_GetModificationType 2870
-#define wxStyledTextEvent_GetText 2871
-#define wxStyledTextEvent_GetLength 2872
-#define wxStyledTextEvent_GetLinesAdded 2873
-#define wxStyledTextEvent_GetLine 2874
-#define wxStyledTextEvent_GetFoldLevelNow 2875
-#define wxStyledTextEvent_GetFoldLevelPrev 2876
-#define wxStyledTextEvent_GetMargin 2877
-#define wxStyledTextEvent_GetMessage 2878
-#define wxStyledTextEvent_GetWParam 2879
-#define wxStyledTextEvent_GetLParam 2880
-#define wxStyledTextEvent_GetListType 2881
-#define wxStyledTextEvent_GetX 2882
-#define wxStyledTextEvent_GetY 2883
-#define wxStyledTextEvent_GetDragText 2884
-#define wxStyledTextEvent_GetDragAllowMove 2885
-#define wxStyledTextEvent_GetDragResult 2886
-#define wxStyledTextEvent_GetShift 2887
-#define wxStyledTextEvent_GetControl 2888
-#define wxStyledTextEvent_GetAlt 2889
-#define utils_wxGetKeyState 2890
-#define utils_wxGetMousePosition 2891
-#define utils_wxGetMouseState 2892
-#define utils_wxSetDetectableAutoRepeat 2893
-#define utils_wxBell 2894
-#define utils_wxFindMenuItemId 2895
-#define utils_wxGenericFindWindowAtPoint 2896
-#define utils_wxFindWindowAtPoint 2897
-#define utils_wxBeginBusyCursor 2898
-#define utils_wxEndBusyCursor 2899
-#define utils_wxIsBusy 2900
-#define utils_wxShutdown 2901
-#define utils_wxShell 2902
-#define utils_wxLaunchDefaultBrowser 2903
-#define utils_wxGetEmailAddress 2904
-#define utils_wxGetUserId 2905
-#define utils_wxGetHomeDir 2906
-#define utils_wxNewId 2907
-#define utils_wxRegisterId 2908
-#define utils_wxGetCurrentId 2909
-#define utils_wxGetOsDescription 2910
-#define utils_wxIsPlatformLittleEndian 2911
-#define utils_wxIsPlatform64Bit 2912
-#define wxPrintout_new 2913
-#define wxPrintout_destruct 2914
-#define wxPrintout_GetDC 2915
-#define wxPrintout_GetPageSizeMM 2916
-#define wxPrintout_GetPageSizePixels 2917
-#define wxPrintout_GetPaperRectPixels 2918
-#define wxPrintout_GetPPIPrinter 2919
-#define wxPrintout_GetPPIScreen 2920
-#define wxPrintout_GetTitle 2921
-#define wxPrintout_IsPreview 2922
-#define wxPrintout_FitThisSizeToPaper 2923
-#define wxPrintout_FitThisSizeToPage 2924
-#define wxPrintout_FitThisSizeToPageMargins 2925
-#define wxPrintout_MapScreenSizeToPaper 2926
-#define wxPrintout_MapScreenSizeToPage 2927
-#define wxPrintout_MapScreenSizeToPageMargins 2928
-#define wxPrintout_MapScreenSizeToDevice 2929
-#define wxPrintout_GetLogicalPaperRect 2930
-#define wxPrintout_GetLogicalPageRect 2931
-#define wxPrintout_GetLogicalPageMarginsRect 2932
-#define wxPrintout_SetLogicalOrigin 2933
-#define wxPrintout_OffsetLogicalOrigin 2934
-#define wxStyledTextCtrl_new_2 2935
-#define wxStyledTextCtrl_new_0 2936
-#define wxStyledTextCtrl_destruct 2937
-#define wxStyledTextCtrl_Create 2938
-#define wxStyledTextCtrl_AddText 2939
-#define wxStyledTextCtrl_AddStyledText 2940
-#define wxStyledTextCtrl_InsertText 2941
-#define wxStyledTextCtrl_ClearAll 2942
-#define wxStyledTextCtrl_ClearDocumentStyle 2943
-#define wxStyledTextCtrl_GetLength 2944
-#define wxStyledTextCtrl_GetCharAt 2945
-#define wxStyledTextCtrl_GetCurrentPos 2946
-#define wxStyledTextCtrl_GetAnchor 2947
-#define wxStyledTextCtrl_GetStyleAt 2948
-#define wxStyledTextCtrl_Redo 2949
-#define wxStyledTextCtrl_SetUndoCollection 2950
-#define wxStyledTextCtrl_SelectAll 2951
-#define wxStyledTextCtrl_SetSavePoint 2952
-#define wxStyledTextCtrl_GetStyledText 2953
-#define wxStyledTextCtrl_CanRedo 2954
-#define wxStyledTextCtrl_MarkerLineFromHandle 2955
-#define wxStyledTextCtrl_MarkerDeleteHandle 2956
-#define wxStyledTextCtrl_GetUndoCollection 2957
-#define wxStyledTextCtrl_GetViewWhiteSpace 2958
-#define wxStyledTextCtrl_SetViewWhiteSpace 2959
-#define wxStyledTextCtrl_PositionFromPoint 2960
-#define wxStyledTextCtrl_PositionFromPointClose 2961
-#define wxStyledTextCtrl_GotoLine 2962
-#define wxStyledTextCtrl_GotoPos 2963
-#define wxStyledTextCtrl_SetAnchor 2964
-#define wxStyledTextCtrl_GetCurLine 2965
-#define wxStyledTextCtrl_GetEndStyled 2966
-#define wxStyledTextCtrl_ConvertEOLs 2967
-#define wxStyledTextCtrl_GetEOLMode 2968
-#define wxStyledTextCtrl_SetEOLMode 2969
-#define wxStyledTextCtrl_StartStyling 2970
-#define wxStyledTextCtrl_SetStyling 2971
-#define wxStyledTextCtrl_GetBufferedDraw 2972
-#define wxStyledTextCtrl_SetBufferedDraw 2973
-#define wxStyledTextCtrl_SetTabWidth 2974
-#define wxStyledTextCtrl_GetTabWidth 2975
-#define wxStyledTextCtrl_SetCodePage 2976
-#define wxStyledTextCtrl_MarkerDefine 2977
-#define wxStyledTextCtrl_MarkerSetForeground 2978
-#define wxStyledTextCtrl_MarkerSetBackground 2979
-#define wxStyledTextCtrl_MarkerAdd 2980
-#define wxStyledTextCtrl_MarkerDelete 2981
-#define wxStyledTextCtrl_MarkerDeleteAll 2982
-#define wxStyledTextCtrl_MarkerGet 2983
-#define wxStyledTextCtrl_MarkerNext 2984
-#define wxStyledTextCtrl_MarkerPrevious 2985
-#define wxStyledTextCtrl_MarkerDefineBitmap 2986
-#define wxStyledTextCtrl_MarkerAddSet 2987
-#define wxStyledTextCtrl_MarkerSetAlpha 2988
-#define wxStyledTextCtrl_SetMarginType 2989
-#define wxStyledTextCtrl_GetMarginType 2990
-#define wxStyledTextCtrl_SetMarginWidth 2991
-#define wxStyledTextCtrl_GetMarginWidth 2992
-#define wxStyledTextCtrl_SetMarginMask 2993
-#define wxStyledTextCtrl_GetMarginMask 2994
-#define wxStyledTextCtrl_SetMarginSensitive 2995
-#define wxStyledTextCtrl_GetMarginSensitive 2996
-#define wxStyledTextCtrl_StyleClearAll 2997
-#define wxStyledTextCtrl_StyleSetForeground 2998
-#define wxStyledTextCtrl_StyleSetBackground 2999
-#define wxStyledTextCtrl_StyleSetBold 3000
-#define wxStyledTextCtrl_StyleSetItalic 3001
-#define wxStyledTextCtrl_StyleSetSize 3002
-#define wxStyledTextCtrl_StyleSetFaceName 3003
-#define wxStyledTextCtrl_StyleSetEOLFilled 3004
-#define wxStyledTextCtrl_StyleResetDefault 3005
-#define wxStyledTextCtrl_StyleSetUnderline 3006
-#define wxStyledTextCtrl_StyleSetCase 3007
-#define wxStyledTextCtrl_StyleSetHotSpot 3008
-#define wxStyledTextCtrl_SetSelForeground 3009
-#define wxStyledTextCtrl_SetSelBackground 3010
-#define wxStyledTextCtrl_GetSelAlpha 3011
-#define wxStyledTextCtrl_SetSelAlpha 3012
-#define wxStyledTextCtrl_SetCaretForeground 3013
-#define wxStyledTextCtrl_CmdKeyAssign 3014
-#define wxStyledTextCtrl_CmdKeyClear 3015
-#define wxStyledTextCtrl_CmdKeyClearAll 3016
-#define wxStyledTextCtrl_SetStyleBytes 3017
-#define wxStyledTextCtrl_StyleSetVisible 3018
-#define wxStyledTextCtrl_GetCaretPeriod 3019
-#define wxStyledTextCtrl_SetCaretPeriod 3020
-#define wxStyledTextCtrl_SetWordChars 3021
-#define wxStyledTextCtrl_BeginUndoAction 3022
-#define wxStyledTextCtrl_EndUndoAction 3023
-#define wxStyledTextCtrl_IndicatorSetStyle 3024
-#define wxStyledTextCtrl_IndicatorGetStyle 3025
-#define wxStyledTextCtrl_IndicatorSetForeground 3026
-#define wxStyledTextCtrl_IndicatorGetForeground 3027
-#define wxStyledTextCtrl_SetWhitespaceForeground 3028
-#define wxStyledTextCtrl_SetWhitespaceBackground 3029
-#define wxStyledTextCtrl_GetStyleBits 3030
-#define wxStyledTextCtrl_SetLineState 3031
-#define wxStyledTextCtrl_GetLineState 3032
-#define wxStyledTextCtrl_GetMaxLineState 3033
-#define wxStyledTextCtrl_GetCaretLineVisible 3034
-#define wxStyledTextCtrl_SetCaretLineVisible 3035
-#define wxStyledTextCtrl_GetCaretLineBackground 3036
-#define wxStyledTextCtrl_SetCaretLineBackground 3037
-#define wxStyledTextCtrl_AutoCompShow 3038
-#define wxStyledTextCtrl_AutoCompCancel 3039
-#define wxStyledTextCtrl_AutoCompActive 3040
-#define wxStyledTextCtrl_AutoCompPosStart 3041
-#define wxStyledTextCtrl_AutoCompComplete 3042
-#define wxStyledTextCtrl_AutoCompStops 3043
-#define wxStyledTextCtrl_AutoCompSetSeparator 3044
-#define wxStyledTextCtrl_AutoCompGetSeparator 3045
-#define wxStyledTextCtrl_AutoCompSelect 3046
-#define wxStyledTextCtrl_AutoCompSetCancelAtStart 3047
-#define wxStyledTextCtrl_AutoCompGetCancelAtStart 3048
-#define wxStyledTextCtrl_AutoCompSetFillUps 3049
-#define wxStyledTextCtrl_AutoCompSetChooseSingle 3050
-#define wxStyledTextCtrl_AutoCompGetChooseSingle 3051
-#define wxStyledTextCtrl_AutoCompSetIgnoreCase 3052
-#define wxStyledTextCtrl_AutoCompGetIgnoreCase 3053
-#define wxStyledTextCtrl_UserListShow 3054
-#define wxStyledTextCtrl_AutoCompSetAutoHide 3055
-#define wxStyledTextCtrl_AutoCompGetAutoHide 3056
-#define wxStyledTextCtrl_AutoCompSetDropRestOfWord 3057
-#define wxStyledTextCtrl_AutoCompGetDropRestOfWord 3058
-#define wxStyledTextCtrl_RegisterImage 3059
-#define wxStyledTextCtrl_ClearRegisteredImages 3060
-#define wxStyledTextCtrl_AutoCompGetTypeSeparator 3061
-#define wxStyledTextCtrl_AutoCompSetTypeSeparator 3062
-#define wxStyledTextCtrl_AutoCompSetMaxWidth 3063
-#define wxStyledTextCtrl_AutoCompGetMaxWidth 3064
-#define wxStyledTextCtrl_AutoCompSetMaxHeight 3065
-#define wxStyledTextCtrl_AutoCompGetMaxHeight 3066
-#define wxStyledTextCtrl_SetIndent 3067
-#define wxStyledTextCtrl_GetIndent 3068
-#define wxStyledTextCtrl_SetUseTabs 3069
-#define wxStyledTextCtrl_GetUseTabs 3070
-#define wxStyledTextCtrl_SetLineIndentation 3071
-#define wxStyledTextCtrl_GetLineIndentation 3072
-#define wxStyledTextCtrl_GetLineIndentPosition 3073
-#define wxStyledTextCtrl_GetColumn 3074
-#define wxStyledTextCtrl_SetUseHorizontalScrollBar 3075
-#define wxStyledTextCtrl_GetUseHorizontalScrollBar 3076
-#define wxStyledTextCtrl_SetIndentationGuides 3077
-#define wxStyledTextCtrl_GetIndentationGuides 3078
-#define wxStyledTextCtrl_SetHighlightGuide 3079
-#define wxStyledTextCtrl_GetHighlightGuide 3080
-#define wxStyledTextCtrl_GetLineEndPosition 3081
-#define wxStyledTextCtrl_GetCodePage 3082
-#define wxStyledTextCtrl_GetCaretForeground 3083
-#define wxStyledTextCtrl_GetReadOnly 3084
-#define wxStyledTextCtrl_SetCurrentPos 3085
-#define wxStyledTextCtrl_SetSelectionStart 3086
-#define wxStyledTextCtrl_GetSelectionStart 3087
-#define wxStyledTextCtrl_SetSelectionEnd 3088
-#define wxStyledTextCtrl_GetSelectionEnd 3089
-#define wxStyledTextCtrl_SetPrintMagnification 3090
-#define wxStyledTextCtrl_GetPrintMagnification 3091
-#define wxStyledTextCtrl_SetPrintColourMode 3092
-#define wxStyledTextCtrl_GetPrintColourMode 3093
-#define wxStyledTextCtrl_FindText 3094
-#define wxStyledTextCtrl_FormatRange 3095
-#define wxStyledTextCtrl_GetFirstVisibleLine 3096
-#define wxStyledTextCtrl_GetLine 3097
-#define wxStyledTextCtrl_GetLineCount 3098
-#define wxStyledTextCtrl_SetMarginLeft 3099
-#define wxStyledTextCtrl_GetMarginLeft 3100
-#define wxStyledTextCtrl_SetMarginRight 3101
-#define wxStyledTextCtrl_GetMarginRight 3102
-#define wxStyledTextCtrl_GetModify 3103
-#define wxStyledTextCtrl_SetSelection 3104
-#define wxStyledTextCtrl_GetSelectedText 3105
-#define wxStyledTextCtrl_GetTextRange 3106
-#define wxStyledTextCtrl_HideSelection 3107
-#define wxStyledTextCtrl_LineFromPosition 3108
-#define wxStyledTextCtrl_PositionFromLine 3109
-#define wxStyledTextCtrl_LineScroll 3110
-#define wxStyledTextCtrl_EnsureCaretVisible 3111
-#define wxStyledTextCtrl_ReplaceSelection 3112
-#define wxStyledTextCtrl_SetReadOnly 3113
-#define wxStyledTextCtrl_CanPaste 3114
-#define wxStyledTextCtrl_CanUndo 3115
-#define wxStyledTextCtrl_EmptyUndoBuffer 3116
-#define wxStyledTextCtrl_Undo 3117
-#define wxStyledTextCtrl_Cut 3118
-#define wxStyledTextCtrl_Copy 3119
-#define wxStyledTextCtrl_Paste 3120
-#define wxStyledTextCtrl_Clear 3121
-#define wxStyledTextCtrl_SetText 3122
-#define wxStyledTextCtrl_GetText 3123
-#define wxStyledTextCtrl_GetTextLength 3124
-#define wxStyledTextCtrl_GetOvertype 3125
-#define wxStyledTextCtrl_SetCaretWidth 3126
-#define wxStyledTextCtrl_GetCaretWidth 3127
-#define wxStyledTextCtrl_SetTargetStart 3128
-#define wxStyledTextCtrl_GetTargetStart 3129
-#define wxStyledTextCtrl_SetTargetEnd 3130
-#define wxStyledTextCtrl_GetTargetEnd 3131
-#define wxStyledTextCtrl_ReplaceTarget 3132
-#define wxStyledTextCtrl_SearchInTarget 3133
-#define wxStyledTextCtrl_SetSearchFlags 3134
-#define wxStyledTextCtrl_GetSearchFlags 3135
-#define wxStyledTextCtrl_CallTipShow 3136
-#define wxStyledTextCtrl_CallTipCancel 3137
-#define wxStyledTextCtrl_CallTipActive 3138
-#define wxStyledTextCtrl_CallTipPosAtStart 3139
-#define wxStyledTextCtrl_CallTipSetHighlight 3140
-#define wxStyledTextCtrl_CallTipSetBackground 3141
-#define wxStyledTextCtrl_CallTipSetForeground 3142
-#define wxStyledTextCtrl_CallTipSetForegroundHighlight 3143
-#define wxStyledTextCtrl_CallTipUseStyle 3144
-#define wxStyledTextCtrl_VisibleFromDocLine 3145
-#define wxStyledTextCtrl_DocLineFromVisible 3146
-#define wxStyledTextCtrl_WrapCount 3147
-#define wxStyledTextCtrl_SetFoldLevel 3148
-#define wxStyledTextCtrl_GetFoldLevel 3149
-#define wxStyledTextCtrl_GetLastChild 3150
-#define wxStyledTextCtrl_GetFoldParent 3151
-#define wxStyledTextCtrl_ShowLines 3152
-#define wxStyledTextCtrl_HideLines 3153
-#define wxStyledTextCtrl_GetLineVisible 3154
-#define wxStyledTextCtrl_SetFoldExpanded 3155
-#define wxStyledTextCtrl_GetFoldExpanded 3156
-#define wxStyledTextCtrl_ToggleFold 3157
-#define wxStyledTextCtrl_EnsureVisible 3158
-#define wxStyledTextCtrl_SetFoldFlags 3159
-#define wxStyledTextCtrl_EnsureVisibleEnforcePolicy 3160
-#define wxStyledTextCtrl_SetTabIndents 3161
-#define wxStyledTextCtrl_GetTabIndents 3162
-#define wxStyledTextCtrl_SetBackSpaceUnIndents 3163
-#define wxStyledTextCtrl_GetBackSpaceUnIndents 3164
-#define wxStyledTextCtrl_SetMouseDwellTime 3165
-#define wxStyledTextCtrl_GetMouseDwellTime 3166
-#define wxStyledTextCtrl_WordStartPosition 3167
-#define wxStyledTextCtrl_WordEndPosition 3168
-#define wxStyledTextCtrl_SetWrapMode 3169
-#define wxStyledTextCtrl_GetWrapMode 3170
-#define wxStyledTextCtrl_SetWrapVisualFlags 3171
-#define wxStyledTextCtrl_GetWrapVisualFlags 3172
-#define wxStyledTextCtrl_SetWrapVisualFlagsLocation 3173
-#define wxStyledTextCtrl_GetWrapVisualFlagsLocation 3174
-#define wxStyledTextCtrl_SetWrapStartIndent 3175
-#define wxStyledTextCtrl_GetWrapStartIndent 3176
-#define wxStyledTextCtrl_SetLayoutCache 3177
-#define wxStyledTextCtrl_GetLayoutCache 3178
-#define wxStyledTextCtrl_SetScrollWidth 3179
-#define wxStyledTextCtrl_GetScrollWidth 3180
-#define wxStyledTextCtrl_TextWidth 3181
-#define wxStyledTextCtrl_GetEndAtLastLine 3182
-#define wxStyledTextCtrl_TextHeight 3183
-#define wxStyledTextCtrl_SetUseVerticalScrollBar 3184
-#define wxStyledTextCtrl_GetUseVerticalScrollBar 3185
-#define wxStyledTextCtrl_AppendText 3186
-#define wxStyledTextCtrl_GetTwoPhaseDraw 3187
-#define wxStyledTextCtrl_SetTwoPhaseDraw 3188
-#define wxStyledTextCtrl_TargetFromSelection 3189
-#define wxStyledTextCtrl_LinesJoin 3190
-#define wxStyledTextCtrl_LinesSplit 3191
-#define wxStyledTextCtrl_SetFoldMarginColour 3192
-#define wxStyledTextCtrl_SetFoldMarginHiColour 3193
-#define wxStyledTextCtrl_LineDown 3194
-#define wxStyledTextCtrl_LineDownExtend 3195
-#define wxStyledTextCtrl_LineUp 3196
-#define wxStyledTextCtrl_LineUpExtend 3197
-#define wxStyledTextCtrl_CharLeft 3198
-#define wxStyledTextCtrl_CharLeftExtend 3199
-#define wxStyledTextCtrl_CharRight 3200
-#define wxStyledTextCtrl_CharRightExtend 3201
-#define wxStyledTextCtrl_WordLeft 3202
-#define wxStyledTextCtrl_WordLeftExtend 3203
-#define wxStyledTextCtrl_WordRight 3204
-#define wxStyledTextCtrl_WordRightExtend 3205
-#define wxStyledTextCtrl_Home 3206
-#define wxStyledTextCtrl_HomeExtend 3207
-#define wxStyledTextCtrl_LineEnd 3208
-#define wxStyledTextCtrl_LineEndExtend 3209
-#define wxStyledTextCtrl_DocumentStart 3210
-#define wxStyledTextCtrl_DocumentStartExtend 3211
-#define wxStyledTextCtrl_DocumentEnd 3212
-#define wxStyledTextCtrl_DocumentEndExtend 3213
-#define wxStyledTextCtrl_PageUp 3214
-#define wxStyledTextCtrl_PageUpExtend 3215
-#define wxStyledTextCtrl_PageDown 3216
-#define wxStyledTextCtrl_PageDownExtend 3217
-#define wxStyledTextCtrl_EditToggleOvertype 3218
-#define wxStyledTextCtrl_Cancel 3219
-#define wxStyledTextCtrl_DeleteBack 3220
-#define wxStyledTextCtrl_Tab 3221
-#define wxStyledTextCtrl_BackTab 3222
-#define wxStyledTextCtrl_NewLine 3223
-#define wxStyledTextCtrl_FormFeed 3224
-#define wxStyledTextCtrl_VCHome 3225
-#define wxStyledTextCtrl_VCHomeExtend 3226
-#define wxStyledTextCtrl_ZoomIn 3227
-#define wxStyledTextCtrl_ZoomOut 3228
-#define wxStyledTextCtrl_DelWordLeft 3229
-#define wxStyledTextCtrl_DelWordRight 3230
-#define wxStyledTextCtrl_LineCut 3231
-#define wxStyledTextCtrl_LineDelete 3232
-#define wxStyledTextCtrl_LineTranspose 3233
-#define wxStyledTextCtrl_LineDuplicate 3234
-#define wxStyledTextCtrl_LowerCase 3235
-#define wxStyledTextCtrl_UpperCase 3236
-#define wxStyledTextCtrl_LineScrollDown 3237
-#define wxStyledTextCtrl_LineScrollUp 3238
-#define wxStyledTextCtrl_DeleteBackNotLine 3239
-#define wxStyledTextCtrl_HomeDisplay 3240
-#define wxStyledTextCtrl_HomeDisplayExtend 3241
-#define wxStyledTextCtrl_LineEndDisplay 3242
-#define wxStyledTextCtrl_LineEndDisplayExtend 3243
-#define wxStyledTextCtrl_HomeWrapExtend 3244
-#define wxStyledTextCtrl_LineEndWrap 3245
-#define wxStyledTextCtrl_LineEndWrapExtend 3246
-#define wxStyledTextCtrl_VCHomeWrap 3247
-#define wxStyledTextCtrl_VCHomeWrapExtend 3248
-#define wxStyledTextCtrl_LineCopy 3249
-#define wxStyledTextCtrl_MoveCaretInsideView 3250
-#define wxStyledTextCtrl_LineLength 3251
-#define wxStyledTextCtrl_BraceHighlight 3252
-#define wxStyledTextCtrl_BraceBadLight 3253
-#define wxStyledTextCtrl_BraceMatch 3254
-#define wxStyledTextCtrl_GetViewEOL 3255
-#define wxStyledTextCtrl_SetViewEOL 3256
-#define wxStyledTextCtrl_SetModEventMask 3257
-#define wxStyledTextCtrl_GetEdgeColumn 3258
-#define wxStyledTextCtrl_SetEdgeColumn 3259
-#define wxStyledTextCtrl_GetEdgeMode 3260
-#define wxStyledTextCtrl_GetEdgeColour 3261
-#define wxStyledTextCtrl_SetEdgeColour 3262
-#define wxStyledTextCtrl_SearchAnchor 3263
-#define wxStyledTextCtrl_SearchNext 3264
-#define wxStyledTextCtrl_SearchPrev 3265
-#define wxStyledTextCtrl_LinesOnScreen 3266
-#define wxStyledTextCtrl_UsePopUp 3267
-#define wxStyledTextCtrl_SelectionIsRectangle 3268
-#define wxStyledTextCtrl_SetZoom 3269
-#define wxStyledTextCtrl_GetZoom 3270
-#define wxStyledTextCtrl_GetModEventMask 3271
-#define wxStyledTextCtrl_SetSTCFocus 3272
-#define wxStyledTextCtrl_GetSTCFocus 3273
-#define wxStyledTextCtrl_SetStatus 3274
-#define wxStyledTextCtrl_GetStatus 3275
-#define wxStyledTextCtrl_SetMouseDownCaptures 3276
-#define wxStyledTextCtrl_GetMouseDownCaptures 3277
-#define wxStyledTextCtrl_SetSTCCursor 3278
-#define wxStyledTextCtrl_GetSTCCursor 3279
-#define wxStyledTextCtrl_SetControlCharSymbol 3280
-#define wxStyledTextCtrl_GetControlCharSymbol 3281
-#define wxStyledTextCtrl_WordPartLeft 3282
-#define wxStyledTextCtrl_WordPartLeftExtend 3283
-#define wxStyledTextCtrl_WordPartRight 3284
-#define wxStyledTextCtrl_WordPartRightExtend 3285
-#define wxStyledTextCtrl_SetVisiblePolicy 3286
-#define wxStyledTextCtrl_DelLineLeft 3287
-#define wxStyledTextCtrl_DelLineRight 3288
-#define wxStyledTextCtrl_GetXOffset 3289
-#define wxStyledTextCtrl_ChooseCaretX 3290
-#define wxStyledTextCtrl_SetXCaretPolicy 3291
-#define wxStyledTextCtrl_SetYCaretPolicy 3292
-#define wxStyledTextCtrl_GetPrintWrapMode 3293
-#define wxStyledTextCtrl_SetHotspotActiveForeground 3294
-#define wxStyledTextCtrl_SetHotspotActiveBackground 3295
-#define wxStyledTextCtrl_SetHotspotActiveUnderline 3296
-#define wxStyledTextCtrl_SetHotspotSingleLine 3297
-#define wxStyledTextCtrl_ParaDownExtend 3298
-#define wxStyledTextCtrl_ParaUp 3299
-#define wxStyledTextCtrl_ParaUpExtend 3300
-#define wxStyledTextCtrl_PositionBefore 3301
-#define wxStyledTextCtrl_PositionAfter 3302
-#define wxStyledTextCtrl_CopyRange 3303
-#define wxStyledTextCtrl_CopyText 3304
-#define wxStyledTextCtrl_SetSelectionMode 3305
-#define wxStyledTextCtrl_GetSelectionMode 3306
-#define wxStyledTextCtrl_LineDownRectExtend 3307
-#define wxStyledTextCtrl_LineUpRectExtend 3308
-#define wxStyledTextCtrl_CharLeftRectExtend 3309
-#define wxStyledTextCtrl_CharRightRectExtend 3310
-#define wxStyledTextCtrl_HomeRectExtend 3311
-#define wxStyledTextCtrl_VCHomeRectExtend 3312
-#define wxStyledTextCtrl_LineEndRectExtend 3313
-#define wxStyledTextCtrl_PageUpRectExtend 3314
-#define wxStyledTextCtrl_PageDownRectExtend 3315
-#define wxStyledTextCtrl_StutteredPageUp 3316
-#define wxStyledTextCtrl_StutteredPageUpExtend 3317
-#define wxStyledTextCtrl_StutteredPageDown 3318
-#define wxStyledTextCtrl_StutteredPageDownExtend 3319
-#define wxStyledTextCtrl_WordLeftEnd 3320
-#define wxStyledTextCtrl_WordLeftEndExtend 3321
-#define wxStyledTextCtrl_WordRightEnd 3322
-#define wxStyledTextCtrl_WordRightEndExtend 3323
-#define wxStyledTextCtrl_SetWhitespaceChars 3324
-#define wxStyledTextCtrl_SetCharsDefault 3325
-#define wxStyledTextCtrl_AutoCompGetCurrent 3326
-#define wxStyledTextCtrl_Allocate 3327
-#define wxStyledTextCtrl_FindColumn 3328
-#define wxStyledTextCtrl_GetCaretSticky 3329
-#define wxStyledTextCtrl_SetCaretSticky 3330
-#define wxStyledTextCtrl_ToggleCaretSticky 3331
-#define wxStyledTextCtrl_SetPasteConvertEndings 3332
-#define wxStyledTextCtrl_GetPasteConvertEndings 3333
-#define wxStyledTextCtrl_SelectionDuplicate 3334
-#define wxStyledTextCtrl_SetCaretLineBackAlpha 3335
-#define wxStyledTextCtrl_GetCaretLineBackAlpha 3336
-#define wxStyledTextCtrl_StartRecord 3337
-#define wxStyledTextCtrl_StopRecord 3338
-#define wxStyledTextCtrl_SetLexer 3339
-#define wxStyledTextCtrl_GetLexer 3340
-#define wxStyledTextCtrl_Colourise 3341
-#define wxStyledTextCtrl_SetProperty 3342
-#define wxStyledTextCtrl_SetKeyWords 3343
-#define wxStyledTextCtrl_SetLexerLanguage 3344
-#define wxStyledTextCtrl_GetProperty 3345
-#define wxStyledTextCtrl_GetStyleBitsNeeded 3346
-#define wxStyledTextCtrl_GetCurrentLine 3347
-#define wxStyledTextCtrl_StyleSetSpec 3348
-#define wxStyledTextCtrl_StyleSetFont 3349
-#define wxStyledTextCtrl_StyleSetFontAttr 3350
-#define wxStyledTextCtrl_StyleSetCharacterSet 3351
-#define wxStyledTextCtrl_StyleSetFontEncoding 3352
-#define wxStyledTextCtrl_CmdKeyExecute 3353
-#define wxStyledTextCtrl_SetMargins 3354
-#define wxStyledTextCtrl_GetSelection 3355
-#define wxStyledTextCtrl_PointFromPosition 3356
-#define wxStyledTextCtrl_ScrollToLine 3357
-#define wxStyledTextCtrl_ScrollToColumn 3358
-#define wxStyledTextCtrl_SendMsg 3359
-#define wxStyledTextCtrl_SetVScrollBar 3360
-#define wxStyledTextCtrl_SetHScrollBar 3361
-#define wxStyledTextCtrl_GetLastKeydownProcessed 3362
-#define wxStyledTextCtrl_SetLastKeydownProcessed 3363
-#define wxStyledTextCtrl_SaveFile 3364
-#define wxStyledTextCtrl_LoadFile 3365
-#define wxStyledTextCtrl_DoDragOver 3366
-#define wxStyledTextCtrl_DoDropText 3367
-#define wxStyledTextCtrl_GetUseAntiAliasing 3368
-#define wxStyledTextCtrl_AddTextRaw 3369
-#define wxStyledTextCtrl_InsertTextRaw 3370
-#define wxStyledTextCtrl_GetCurLineRaw 3371
-#define wxStyledTextCtrl_GetLineRaw 3372
-#define wxStyledTextCtrl_GetSelectedTextRaw 3373
-#define wxStyledTextCtrl_GetTextRangeRaw 3374
-#define wxStyledTextCtrl_SetTextRaw 3375
-#define wxStyledTextCtrl_GetTextRaw 3376
-#define wxStyledTextCtrl_AppendTextRaw 3377
-#define wxArtProvider_GetBitmap 3378
-#define wxArtProvider_GetIcon 3379
-#define wxTreeEvent_GetKeyCode 3380
-#define wxTreeEvent_GetItem 3381
-#define wxTreeEvent_GetKeyEvent 3382
-#define wxTreeEvent_GetLabel 3383
-#define wxTreeEvent_GetOldItem 3384
-#define wxTreeEvent_GetPoint 3385
-#define wxTreeEvent_IsEditCancelled 3386
-#define wxTreeEvent_SetToolTip 3387
-#define wxNotebookEvent_GetOldSelection 3388
-#define wxNotebookEvent_GetSelection 3389
-#define wxNotebookEvent_SetOldSelection 3390
-#define wxNotebookEvent_SetSelection 3391
-#define wxFileDataObject_new 3392
-#define wxFileDataObject_AddFile 3393
-#define wxFileDataObject_GetFilenames 3394
-#define wxFileDataObject_destroy 3395
-#define wxTextDataObject_new 3396
-#define wxTextDataObject_GetTextLength 3397
-#define wxTextDataObject_GetText 3398
-#define wxTextDataObject_SetText 3399
-#define wxTextDataObject_destroy 3400
-#define wxBitmapDataObject_new_1_1 3401
-#define wxBitmapDataObject_new_1_0 3402
-#define wxBitmapDataObject_GetBitmap 3403
-#define wxBitmapDataObject_SetBitmap 3404
-#define wxBitmapDataObject_destroy 3405
-#define wxClipboard_new 3407
-#define wxClipboard_destruct 3408
-#define wxClipboard_AddData 3409
-#define wxClipboard_Clear 3410
-#define wxClipboard_Close 3411
-#define wxClipboard_Flush 3412
-#define wxClipboard_GetData 3413
-#define wxClipboard_IsOpened 3414
-#define wxClipboard_Open 3415
-#define wxClipboard_SetData 3416
-#define wxClipboard_UsePrimarySelection 3418
-#define wxClipboard_IsSupported 3419
-#define wxClipboard_Get 3420
-#define wxSpinEvent_GetPosition 3421
-#define wxSpinEvent_SetPosition 3422
-#define wxSplitterWindow_new_0 3423
-#define wxSplitterWindow_new_2 3424
-#define wxSplitterWindow_destruct 3425
-#define wxSplitterWindow_Create 3426
-#define wxSplitterWindow_GetMinimumPaneSize 3427
-#define wxSplitterWindow_GetSashGravity 3428
-#define wxSplitterWindow_GetSashPosition 3429
-#define wxSplitterWindow_GetSplitMode 3430
-#define wxSplitterWindow_GetWindow1 3431
-#define wxSplitterWindow_GetWindow2 3432
-#define wxSplitterWindow_Initialize 3433
-#define wxSplitterWindow_IsSplit 3434
-#define wxSplitterWindow_ReplaceWindow 3435
-#define wxSplitterWindow_SetSashGravity 3436
-#define wxSplitterWindow_SetSashPosition 3437
-#define wxSplitterWindow_SetSashSize 3438
-#define wxSplitterWindow_SetMinimumPaneSize 3439
-#define wxSplitterWindow_SetSplitMode 3440
-#define wxSplitterWindow_SplitHorizontally 3441
-#define wxSplitterWindow_SplitVertically 3442
-#define wxSplitterWindow_Unsplit 3443
-#define wxSplitterWindow_UpdateSize 3444
-#define wxSplitterEvent_GetSashPosition 3445
-#define wxSplitterEvent_GetX 3446
-#define wxSplitterEvent_GetY 3447
-#define wxSplitterEvent_GetWindowBeingRemoved 3448
-#define wxSplitterEvent_SetSashPosition 3449
-#define wxHtmlWindow_new_0 3450
-#define wxHtmlWindow_new_2 3451
-#define wxHtmlWindow_AppendToPage 3452
-#define wxHtmlWindow_GetOpenedAnchor 3453
-#define wxHtmlWindow_GetOpenedPage 3454
-#define wxHtmlWindow_GetOpenedPageTitle 3455
-#define wxHtmlWindow_GetRelatedFrame 3456
-#define wxHtmlWindow_HistoryBack 3457
-#define wxHtmlWindow_HistoryCanBack 3458
-#define wxHtmlWindow_HistoryCanForward 3459
-#define wxHtmlWindow_HistoryClear 3460
-#define wxHtmlWindow_HistoryForward 3461
-#define wxHtmlWindow_LoadFile 3462
-#define wxHtmlWindow_LoadPage 3463
-#define wxHtmlWindow_SelectAll 3464
-#define wxHtmlWindow_SelectionToText 3465
-#define wxHtmlWindow_SelectLine 3466
-#define wxHtmlWindow_SelectWord 3467
-#define wxHtmlWindow_SetBorders 3468
-#define wxHtmlWindow_SetFonts 3469
-#define wxHtmlWindow_SetPage 3470
-#define wxHtmlWindow_SetRelatedFrame 3471
-#define wxHtmlWindow_SetRelatedStatusBar 3472
-#define wxHtmlWindow_ToText 3473
-#define wxHtmlWindow_destroy 3474
-#define wxHtmlLinkEvent_GetLinkInfo 3475
-#define wxSystemSettings_GetColour 3476
-#define wxSystemSettings_GetFont 3477
-#define wxSystemSettings_GetMetric 3478
-#define wxSystemSettings_GetScreenType 3479
-#define wxAuiNotebookEvent_SetSelection 3480
-#define wxAuiNotebookEvent_GetSelection 3481
-#define wxAuiNotebookEvent_SetOldSelection 3482
-#define wxAuiNotebookEvent_GetOldSelection 3483
-#define wxAuiNotebookEvent_SetDragSource 3484
-#define wxAuiNotebookEvent_GetDragSource 3485
-#define wxAuiManagerEvent_SetManager 3486
-#define wxAuiManagerEvent_GetManager 3487
-#define wxAuiManagerEvent_SetPane 3488
-#define wxAuiManagerEvent_GetPane 3489
-#define wxAuiManagerEvent_SetButton 3490
-#define wxAuiManagerEvent_GetButton 3491
-#define wxAuiManagerEvent_SetDC 3492
-#define wxAuiManagerEvent_GetDC 3493
-#define wxAuiManagerEvent_Veto 3494
-#define wxAuiManagerEvent_GetVeto 3495
-#define wxAuiManagerEvent_SetCanVeto 3496
-#define wxAuiManagerEvent_CanVeto 3497
-#define wxLogNull_new 3498
-#define wxLogNull_destroy 3499
+#define wxListItemAttr_new_0 1757
+#define wxListItemAttr_new_3 1758
+#define wxListItemAttr_GetBackgroundColour 1759
+#define wxListItemAttr_GetFont 1760
+#define wxListItemAttr_GetTextColour 1761
+#define wxListItemAttr_HasBackgroundColour 1762
+#define wxListItemAttr_HasFont 1763
+#define wxListItemAttr_HasTextColour 1764
+#define wxListItemAttr_SetBackgroundColour 1765
+#define wxListItemAttr_SetFont 1766
+#define wxListItemAttr_SetTextColour 1767
+#define wxListItemAttr_destroy 1768
+#define wxImageList_new_0 1769
+#define wxImageList_new_3 1770
+#define wxImageList_Add_1 1771
+#define wxImageList_Add_2_0 1772
+#define wxImageList_Add_2_1 1773
+#define wxImageList_Create 1774
+#define wxImageList_Draw 1776
+#define wxImageList_GetBitmap 1777
+#define wxImageList_GetIcon 1778
+#define wxImageList_GetImageCount 1779
+#define wxImageList_GetSize 1780
+#define wxImageList_Remove 1781
+#define wxImageList_RemoveAll 1782
+#define wxImageList_Replace_2 1783
+#define wxImageList_Replace_3 1784
+#define wxImageList_destroy 1785
+#define wxTextAttr_new_0 1786
+#define wxTextAttr_new_2 1787
+#define wxTextAttr_GetAlignment 1788
+#define wxTextAttr_GetBackgroundColour 1789
+#define wxTextAttr_GetFont 1790
+#define wxTextAttr_GetLeftIndent 1791
+#define wxTextAttr_GetLeftSubIndent 1792
+#define wxTextAttr_GetRightIndent 1793
+#define wxTextAttr_GetTabs 1794
+#define wxTextAttr_GetTextColour 1795
+#define wxTextAttr_HasBackgroundColour 1796
+#define wxTextAttr_HasFont 1797
+#define wxTextAttr_HasTextColour 1798
+#define wxTextAttr_GetFlags 1799
+#define wxTextAttr_IsDefault 1800
+#define wxTextAttr_SetAlignment 1801
+#define wxTextAttr_SetBackgroundColour 1802
+#define wxTextAttr_SetFlags 1803
+#define wxTextAttr_SetFont 1804
+#define wxTextAttr_SetLeftIndent 1805
+#define wxTextAttr_SetRightIndent 1806
+#define wxTextAttr_SetTabs 1807
+#define wxTextAttr_SetTextColour 1808
+#define wxTextAttr_destroy 1809
+#define wxTextCtrl_new_3 1811
+#define wxTextCtrl_new_0 1812
+#define wxTextCtrl_destruct 1814
+#define wxTextCtrl_AppendText 1815
+#define wxTextCtrl_CanCopy 1816
+#define wxTextCtrl_CanCut 1817
+#define wxTextCtrl_CanPaste 1818
+#define wxTextCtrl_CanRedo 1819
+#define wxTextCtrl_CanUndo 1820
+#define wxTextCtrl_Clear 1821
+#define wxTextCtrl_Copy 1822
+#define wxTextCtrl_Create 1823
+#define wxTextCtrl_Cut 1824
+#define wxTextCtrl_DiscardEdits 1825
+#define wxTextCtrl_EmulateKeyPress 1826
+#define wxTextCtrl_GetDefaultStyle 1827
+#define wxTextCtrl_GetInsertionPoint 1828
+#define wxTextCtrl_GetLastPosition 1829
+#define wxTextCtrl_GetLineLength 1830
+#define wxTextCtrl_GetLineText 1831
+#define wxTextCtrl_GetNumberOfLines 1832
+#define wxTextCtrl_GetRange 1833
+#define wxTextCtrl_GetSelection 1834
+#define wxTextCtrl_GetStringSelection 1835
+#define wxTextCtrl_GetStyle 1836
+#define wxTextCtrl_GetValue 1837
+#define wxTextCtrl_IsEditable 1838
+#define wxTextCtrl_IsModified 1839
+#define wxTextCtrl_IsMultiLine 1840
+#define wxTextCtrl_IsSingleLine 1841
+#define wxTextCtrl_LoadFile 1842
+#define wxTextCtrl_MarkDirty 1843
+#define wxTextCtrl_Paste 1844
+#define wxTextCtrl_PositionToXY 1845
+#define wxTextCtrl_Redo 1846
+#define wxTextCtrl_Remove 1847
+#define wxTextCtrl_Replace 1848
+#define wxTextCtrl_SaveFile 1849
+#define wxTextCtrl_SetDefaultStyle 1850
+#define wxTextCtrl_SetEditable 1851
+#define wxTextCtrl_SetInsertionPoint 1852
+#define wxTextCtrl_SetInsertionPointEnd 1853
+#define wxTextCtrl_SetMaxLength 1855
+#define wxTextCtrl_SetSelection 1856
+#define wxTextCtrl_SetStyle 1857
+#define wxTextCtrl_SetValue 1858
+#define wxTextCtrl_ShowPosition 1859
+#define wxTextCtrl_Undo 1860
+#define wxTextCtrl_WriteText 1861
+#define wxTextCtrl_XYToPosition 1862
+#define wxNotebook_new_0 1865
+#define wxNotebook_new_3 1866
+#define wxNotebook_destruct 1867
+#define wxNotebook_AddPage 1868
+#define wxNotebook_AdvanceSelection 1869
+#define wxNotebook_AssignImageList 1870
+#define wxNotebook_Create 1871
+#define wxNotebook_DeleteAllPages 1872
+#define wxNotebook_DeletePage 1873
+#define wxNotebook_RemovePage 1874
+#define wxNotebook_GetCurrentPage 1875
+#define wxNotebook_GetImageList 1876
+#define wxNotebook_GetPage 1878
+#define wxNotebook_GetPageCount 1879
+#define wxNotebook_GetPageImage 1880
+#define wxNotebook_GetPageText 1881
+#define wxNotebook_GetRowCount 1882
+#define wxNotebook_GetSelection 1883
+#define wxNotebook_GetThemeBackgroundColour 1884
+#define wxNotebook_HitTest 1886
+#define wxNotebook_InsertPage 1888
+#define wxNotebook_SetImageList 1889
+#define wxNotebook_SetPadding 1890
+#define wxNotebook_SetPageSize 1891
+#define wxNotebook_SetPageImage 1892
+#define wxNotebook_SetPageText 1893
+#define wxNotebook_SetSelection 1894
+#define wxNotebook_ChangeSelection 1895
+#define wxChoicebook_new_0 1896
+#define wxChoicebook_new_3 1897
+#define wxChoicebook_AddPage 1898
+#define wxChoicebook_AdvanceSelection 1899
+#define wxChoicebook_AssignImageList 1900
+#define wxChoicebook_Create 1901
+#define wxChoicebook_DeleteAllPages 1902
+#define wxChoicebook_DeletePage 1903
+#define wxChoicebook_RemovePage 1904
+#define wxChoicebook_GetCurrentPage 1905
+#define wxChoicebook_GetImageList 1906
+#define wxChoicebook_GetPage 1908
+#define wxChoicebook_GetPageCount 1909
+#define wxChoicebook_GetPageImage 1910
+#define wxChoicebook_GetPageText 1911
+#define wxChoicebook_GetSelection 1912
+#define wxChoicebook_HitTest 1913
+#define wxChoicebook_InsertPage 1914
+#define wxChoicebook_SetImageList 1915
+#define wxChoicebook_SetPageSize 1916
+#define wxChoicebook_SetPageImage 1917
+#define wxChoicebook_SetPageText 1918
+#define wxChoicebook_SetSelection 1919
+#define wxChoicebook_ChangeSelection 1920
+#define wxChoicebook_destroy 1921
+#define wxToolbook_new_0 1922
+#define wxToolbook_new_3 1923
+#define wxToolbook_AddPage 1924
+#define wxToolbook_AdvanceSelection 1925
+#define wxToolbook_AssignImageList 1926
+#define wxToolbook_Create 1927
+#define wxToolbook_DeleteAllPages 1928
+#define wxToolbook_DeletePage 1929
+#define wxToolbook_RemovePage 1930
+#define wxToolbook_GetCurrentPage 1931
+#define wxToolbook_GetImageList 1932
+#define wxToolbook_GetPage 1934
+#define wxToolbook_GetPageCount 1935
+#define wxToolbook_GetPageImage 1936
+#define wxToolbook_GetPageText 1937
+#define wxToolbook_GetSelection 1938
+#define wxToolbook_HitTest 1940
+#define wxToolbook_InsertPage 1941
+#define wxToolbook_SetImageList 1942
+#define wxToolbook_SetPageSize 1943
+#define wxToolbook_SetPageImage 1944
+#define wxToolbook_SetPageText 1945
+#define wxToolbook_SetSelection 1946
+#define wxToolbook_ChangeSelection 1947
+#define wxToolbook_destroy 1948
+#define wxListbook_new_0 1949
+#define wxListbook_new_3 1950
+#define wxListbook_AddPage 1951
+#define wxListbook_AdvanceSelection 1952
+#define wxListbook_AssignImageList 1953
+#define wxListbook_Create 1954
+#define wxListbook_DeleteAllPages 1955
+#define wxListbook_DeletePage 1956
+#define wxListbook_RemovePage 1957
+#define wxListbook_GetCurrentPage 1958
+#define wxListbook_GetImageList 1959
+#define wxListbook_GetPage 1961
+#define wxListbook_GetPageCount 1962
+#define wxListbook_GetPageImage 1963
+#define wxListbook_GetPageText 1964
+#define wxListbook_GetSelection 1965
+#define wxListbook_HitTest 1967
+#define wxListbook_InsertPage 1968
+#define wxListbook_SetImageList 1969
+#define wxListbook_SetPageSize 1970
+#define wxListbook_SetPageImage 1971
+#define wxListbook_SetPageText 1972
+#define wxListbook_SetSelection 1973
+#define wxListbook_ChangeSelection 1974
+#define wxListbook_destroy 1975
+#define wxTreebook_new_0 1976
+#define wxTreebook_new_3 1977
+#define wxTreebook_AddPage 1978
+#define wxTreebook_AdvanceSelection 1979
+#define wxTreebook_AssignImageList 1980
+#define wxTreebook_Create 1981
+#define wxTreebook_DeleteAllPages 1982
+#define wxTreebook_DeletePage 1983
+#define wxTreebook_RemovePage 1984
+#define wxTreebook_GetCurrentPage 1985
+#define wxTreebook_GetImageList 1986
+#define wxTreebook_GetPage 1988
+#define wxTreebook_GetPageCount 1989
+#define wxTreebook_GetPageImage 1990
+#define wxTreebook_GetPageText 1991
+#define wxTreebook_GetSelection 1992
+#define wxTreebook_ExpandNode 1993
+#define wxTreebook_IsNodeExpanded 1994
+#define wxTreebook_HitTest 1996
+#define wxTreebook_InsertPage 1997
+#define wxTreebook_InsertSubPage 1998
+#define wxTreebook_SetImageList 1999
+#define wxTreebook_SetPageSize 2000
+#define wxTreebook_SetPageImage 2001
+#define wxTreebook_SetPageText 2002
+#define wxTreebook_SetSelection 2003
+#define wxTreebook_ChangeSelection 2004
+#define wxTreebook_destroy 2005
+#define wxTreeCtrl_new_2 2008
+#define wxTreeCtrl_new_0 2009
+#define wxTreeCtrl_destruct 2011
+#define wxTreeCtrl_AddRoot 2012
+#define wxTreeCtrl_AppendItem 2013
+#define wxTreeCtrl_AssignImageList 2014
+#define wxTreeCtrl_AssignStateImageList 2015
+#define wxTreeCtrl_Collapse 2016
+#define wxTreeCtrl_CollapseAndReset 2017
+#define wxTreeCtrl_Create 2018
+#define wxTreeCtrl_Delete 2019
+#define wxTreeCtrl_DeleteAllItems 2020
+#define wxTreeCtrl_DeleteChildren 2021
+#define wxTreeCtrl_EditLabel 2022
+#define wxTreeCtrl_EnsureVisible 2023
+#define wxTreeCtrl_Expand 2024
+#define wxTreeCtrl_GetBoundingRect 2025
+#define wxTreeCtrl_GetChildrenCount 2027
+#define wxTreeCtrl_GetCount 2028
+#define wxTreeCtrl_GetEditControl 2029
+#define wxTreeCtrl_GetFirstChild 2030
+#define wxTreeCtrl_GetNextChild 2031
+#define wxTreeCtrl_GetFirstVisibleItem 2032
+#define wxTreeCtrl_GetImageList 2033
+#define wxTreeCtrl_GetIndent 2034
+#define wxTreeCtrl_GetItemBackgroundColour 2035
+#define wxTreeCtrl_GetItemData 2036
+#define wxTreeCtrl_GetItemFont 2037
+#define wxTreeCtrl_GetItemImage_1 2038
+#define wxTreeCtrl_GetItemImage_2 2039
+#define wxTreeCtrl_GetItemText 2040
+#define wxTreeCtrl_GetItemTextColour 2041
+#define wxTreeCtrl_GetLastChild 2042
+#define wxTreeCtrl_GetNextSibling 2043
+#define wxTreeCtrl_GetNextVisible 2044
+#define wxTreeCtrl_GetItemParent 2045
+#define wxTreeCtrl_GetPrevSibling 2046
+#define wxTreeCtrl_GetPrevVisible 2047
+#define wxTreeCtrl_GetRootItem 2048
+#define wxTreeCtrl_GetSelection 2049
+#define wxTreeCtrl_GetSelections 2050
+#define wxTreeCtrl_GetStateImageList 2051
+#define wxTreeCtrl_HitTest 2052
+#define wxTreeCtrl_InsertItem 2054
+#define wxTreeCtrl_IsBold 2055
+#define wxTreeCtrl_IsExpanded 2056
+#define wxTreeCtrl_IsSelected 2057
+#define wxTreeCtrl_IsVisible 2058
+#define wxTreeCtrl_ItemHasChildren 2059
+#define wxTreeCtrl_PrependItem 2060
+#define wxTreeCtrl_ScrollTo 2061
+#define wxTreeCtrl_SelectItem_1 2062
+#define wxTreeCtrl_SelectItem_2 2063
+#define wxTreeCtrl_SetIndent 2064
+#define wxTreeCtrl_SetImageList 2065
+#define wxTreeCtrl_SetItemBackgroundColour 2066
+#define wxTreeCtrl_SetItemBold 2067
+#define wxTreeCtrl_SetItemData 2068
+#define wxTreeCtrl_SetItemDropHighlight 2069
+#define wxTreeCtrl_SetItemFont 2070
+#define wxTreeCtrl_SetItemHasChildren 2071
+#define wxTreeCtrl_SetItemImage_2 2072
+#define wxTreeCtrl_SetItemImage_3 2073
+#define wxTreeCtrl_SetItemText 2074
+#define wxTreeCtrl_SetItemTextColour 2075
+#define wxTreeCtrl_SetStateImageList 2076
+#define wxTreeCtrl_SetWindowStyle 2077
+#define wxTreeCtrl_SortChildren 2078
+#define wxTreeCtrl_Toggle 2079
+#define wxTreeCtrl_ToggleItemSelection 2080
+#define wxTreeCtrl_Unselect 2081
+#define wxTreeCtrl_UnselectAll 2082
+#define wxTreeCtrl_UnselectItem 2083
+#define wxScrollBar_new_0 2084
+#define wxScrollBar_new_3 2085
+#define wxScrollBar_destruct 2086
+#define wxScrollBar_Create 2087
+#define wxScrollBar_GetRange 2088
+#define wxScrollBar_GetPageSize 2089
+#define wxScrollBar_GetThumbPosition 2090
+#define wxScrollBar_GetThumbSize 2091
+#define wxScrollBar_SetThumbPosition 2092
+#define wxScrollBar_SetScrollbar 2093
+#define wxSpinButton_new_2 2095
+#define wxSpinButton_new_0 2096
+#define wxSpinButton_Create 2097
+#define wxSpinButton_GetMax 2098
+#define wxSpinButton_GetMin 2099
+#define wxSpinButton_GetValue 2100
+#define wxSpinButton_SetRange 2101
+#define wxSpinButton_SetValue 2102
+#define wxSpinButton_destroy 2103
+#define wxSpinCtrl_new_0 2104
+#define wxSpinCtrl_new_2 2105
+#define wxSpinCtrl_Create 2107
+#define wxSpinCtrl_SetValue_1_1 2110
+#define wxSpinCtrl_SetValue_1_0 2111
+#define wxSpinCtrl_GetValue 2113
+#define wxSpinCtrl_SetRange 2115
+#define wxSpinCtrl_SetSelection 2116
+#define wxSpinCtrl_GetMin 2118
+#define wxSpinCtrl_GetMax 2120
+#define wxSpinCtrl_destroy 2121
+#define wxStaticText_new_0 2122
+#define wxStaticText_new_4 2123
+#define wxStaticText_Create 2124
+#define wxStaticText_GetLabel 2125
+#define wxStaticText_SetLabel 2126
+#define wxStaticText_Wrap 2127
+#define wxStaticText_destroy 2128
+#define wxStaticBitmap_new_0 2129
+#define wxStaticBitmap_new_4 2130
+#define wxStaticBitmap_Create 2131
+#define wxStaticBitmap_GetBitmap 2132
+#define wxStaticBitmap_SetBitmap 2133
+#define wxStaticBitmap_destroy 2134
+#define wxRadioBox_new 2135
+#define wxRadioBox_destruct 2137
+#define wxRadioBox_Create 2138
+#define wxRadioBox_Enable_2 2139
+#define wxRadioBox_Enable_1 2140
+#define wxRadioBox_GetSelection 2141
+#define wxRadioBox_GetString 2142
+#define wxRadioBox_SetSelection 2143
+#define wxRadioBox_Show_2 2144
+#define wxRadioBox_Show_1 2145
+#define wxRadioBox_GetColumnCount 2146
+#define wxRadioBox_GetItemHelpText 2147
+#define wxRadioBox_GetItemToolTip 2148
+#define wxRadioBox_GetItemFromPoint 2150
+#define wxRadioBox_GetRowCount 2151
+#define wxRadioBox_IsItemEnabled 2152
+#define wxRadioBox_IsItemShown 2153
+#define wxRadioBox_SetItemHelpText 2154
+#define wxRadioBox_SetItemToolTip 2155
+#define wxRadioButton_new_0 2156
+#define wxRadioButton_new_4 2157
+#define wxRadioButton_Create 2158
+#define wxRadioButton_GetValue 2159
+#define wxRadioButton_SetValue 2160
+#define wxRadioButton_destroy 2161
+#define wxSlider_new_6 2163
+#define wxSlider_new_0 2164
+#define wxSlider_Create 2165
+#define wxSlider_GetLineSize 2166
+#define wxSlider_GetMax 2167
+#define wxSlider_GetMin 2168
+#define wxSlider_GetPageSize 2169
+#define wxSlider_GetThumbLength 2170
+#define wxSlider_GetValue 2171
+#define wxSlider_SetLineSize 2172
+#define wxSlider_SetPageSize 2173
+#define wxSlider_SetRange 2174
+#define wxSlider_SetThumbLength 2175
+#define wxSlider_SetValue 2176
+#define wxSlider_destroy 2177
+#define wxDialog_new_4 2179
+#define wxDialog_new_0 2180
+#define wxDialog_destruct 2182
+#define wxDialog_Create 2183
+#define wxDialog_CreateButtonSizer 2184
+#define wxDialog_CreateStdDialogButtonSizer 2185
+#define wxDialog_EndModal 2186
+#define wxDialog_GetAffirmativeId 2187
+#define wxDialog_GetReturnCode 2188
+#define wxDialog_IsModal 2189
+#define wxDialog_SetAffirmativeId 2190
+#define wxDialog_SetReturnCode 2191
+#define wxDialog_Show 2192
+#define wxDialog_ShowModal 2193
+#define wxColourDialog_new_0 2194
+#define wxColourDialog_new_2 2195
+#define wxColourDialog_destruct 2196
+#define wxColourDialog_Create 2197
+#define wxColourDialog_GetColourData 2198
+#define wxColourData_new_0 2199
+#define wxColourData_new_1 2200
+#define wxColourData_destruct 2201
+#define wxColourData_GetChooseFull 2202
+#define wxColourData_GetColour 2203
+#define wxColourData_GetCustomColour 2205
+#define wxColourData_SetChooseFull 2206
+#define wxColourData_SetColour 2207
+#define wxColourData_SetCustomColour 2208
+#define wxPalette_new_0 2209
+#define wxPalette_new_4 2210
+#define wxPalette_destruct 2212
+#define wxPalette_Create 2213
+#define wxPalette_GetColoursCount 2214
+#define wxPalette_GetPixel 2215
+#define wxPalette_GetRGB 2216
+#define wxPalette_IsOk 2217
+#define wxDirDialog_new 2221
+#define wxDirDialog_destruct 2222
+#define wxDirDialog_GetPath 2223
+#define wxDirDialog_GetMessage 2224
+#define wxDirDialog_SetMessage 2225
+#define wxDirDialog_SetPath 2226
+#define wxFileDialog_new 2230
+#define wxFileDialog_destruct 2231
+#define wxFileDialog_GetDirectory 2232
+#define wxFileDialog_GetFilename 2233
+#define wxFileDialog_GetFilenames 2234
+#define wxFileDialog_GetFilterIndex 2235
+#define wxFileDialog_GetMessage 2236
+#define wxFileDialog_GetPath 2237
+#define wxFileDialog_GetPaths 2238
+#define wxFileDialog_GetWildcard 2239
+#define wxFileDialog_SetDirectory 2240
+#define wxFileDialog_SetFilename 2241
+#define wxFileDialog_SetFilterIndex 2242
+#define wxFileDialog_SetMessage 2243
+#define wxFileDialog_SetPath 2244
+#define wxFileDialog_SetWildcard 2245
+#define wxPickerBase_SetInternalMargin 2246
+#define wxPickerBase_GetInternalMargin 2247
+#define wxPickerBase_SetTextCtrlProportion 2248
+#define wxPickerBase_SetPickerCtrlProportion 2249
+#define wxPickerBase_GetTextCtrlProportion 2250
+#define wxPickerBase_GetPickerCtrlProportion 2251
+#define wxPickerBase_HasTextCtrl 2252
+#define wxPickerBase_GetTextCtrl 2253
+#define wxPickerBase_IsTextCtrlGrowable 2254
+#define wxPickerBase_SetPickerCtrlGrowable 2255
+#define wxPickerBase_SetTextCtrlGrowable 2256
+#define wxPickerBase_IsPickerCtrlGrowable 2257
+#define wxFilePickerCtrl_new_0 2258
+#define wxFilePickerCtrl_new_3 2259
+#define wxFilePickerCtrl_Create 2260
+#define wxFilePickerCtrl_GetPath 2261
+#define wxFilePickerCtrl_SetPath 2262
+#define wxFilePickerCtrl_destroy 2263
+#define wxDirPickerCtrl_new_0 2264
+#define wxDirPickerCtrl_new_3 2265
+#define wxDirPickerCtrl_Create 2266
+#define wxDirPickerCtrl_GetPath 2267
+#define wxDirPickerCtrl_SetPath 2268
+#define wxDirPickerCtrl_destroy 2269
+#define wxColourPickerCtrl_new_0 2270
+#define wxColourPickerCtrl_new_3 2271
+#define wxColourPickerCtrl_Create 2272
+#define wxColourPickerCtrl_GetColour 2273
+#define wxColourPickerCtrl_SetColour_1_1 2274
+#define wxColourPickerCtrl_SetColour_1_0 2275
+#define wxColourPickerCtrl_destroy 2276
+#define wxDatePickerCtrl_new_0 2277
+#define wxDatePickerCtrl_new_3 2278
+#define wxDatePickerCtrl_GetRange 2279
+#define wxDatePickerCtrl_GetValue 2280
+#define wxDatePickerCtrl_SetRange 2281
+#define wxDatePickerCtrl_SetValue 2282
+#define wxDatePickerCtrl_destroy 2283
+#define wxFontPickerCtrl_new_0 2284
+#define wxFontPickerCtrl_new_3 2285
+#define wxFontPickerCtrl_Create 2286
+#define wxFontPickerCtrl_GetSelectedFont 2287
+#define wxFontPickerCtrl_SetSelectedFont 2288
+#define wxFontPickerCtrl_GetMaxPointSize 2289
+#define wxFontPickerCtrl_SetMaxPointSize 2290
+#define wxFontPickerCtrl_destroy 2291
+#define wxFindReplaceDialog_new_0 2294
+#define wxFindReplaceDialog_new_4 2295
+#define wxFindReplaceDialog_destruct 2296
+#define wxFindReplaceDialog_Create 2297
+#define wxFindReplaceDialog_GetData 2298
+#define wxFindReplaceData_new_0 2299
+#define wxFindReplaceData_new_1 2300
+#define wxFindReplaceData_GetFindString 2301
+#define wxFindReplaceData_GetReplaceString 2302
+#define wxFindReplaceData_GetFlags 2303
+#define wxFindReplaceData_SetFlags 2304
+#define wxFindReplaceData_SetFindString 2305
+#define wxFindReplaceData_SetReplaceString 2306
+#define wxFindReplaceData_destroy 2307
+#define wxMultiChoiceDialog_new_0 2308
+#define wxMultiChoiceDialog_new_5 2310
+#define wxMultiChoiceDialog_GetSelections 2311
+#define wxMultiChoiceDialog_SetSelections 2312
+#define wxMultiChoiceDialog_destroy 2313
+#define wxSingleChoiceDialog_new_0 2314
+#define wxSingleChoiceDialog_new_5 2316
+#define wxSingleChoiceDialog_GetSelection 2317
+#define wxSingleChoiceDialog_GetStringSelection 2318
+#define wxSingleChoiceDialog_SetSelection 2319
+#define wxSingleChoiceDialog_destroy 2320
+#define wxTextEntryDialog_new 2321
+#define wxTextEntryDialog_GetValue 2322
+#define wxTextEntryDialog_SetValue 2323
+#define wxTextEntryDialog_destroy 2324
+#define wxPasswordEntryDialog_new 2325
+#define wxPasswordEntryDialog_destroy 2326
+#define wxFontData_new_0 2327
+#define wxFontData_new_1 2328
+#define wxFontData_destruct 2329
+#define wxFontData_EnableEffects 2330
+#define wxFontData_GetAllowSymbols 2331
+#define wxFontData_GetColour 2332
+#define wxFontData_GetChosenFont 2333
+#define wxFontData_GetEnableEffects 2334
+#define wxFontData_GetInitialFont 2335
+#define wxFontData_GetShowHelp 2336
+#define wxFontData_SetAllowSymbols 2337
+#define wxFontData_SetChosenFont 2338
+#define wxFontData_SetColour 2339
+#define wxFontData_SetInitialFont 2340
+#define wxFontData_SetRange 2341
+#define wxFontData_SetShowHelp 2342
+#define wxFontDialog_new_0 2346
+#define wxFontDialog_new_2 2348
+#define wxFontDialog_Create 2350
+#define wxFontDialog_GetFontData 2351
+#define wxFontDialog_destroy 2353
+#define wxProgressDialog_new 2354
+#define wxProgressDialog_destruct 2355
+#define wxProgressDialog_Resume 2356
+#define wxProgressDialog_Update_2 2357
+#define wxProgressDialog_Update_0 2358
+#define wxMessageDialog_new 2359
+#define wxMessageDialog_destruct 2360
+#define wxPageSetupDialog_new 2361
+#define wxPageSetupDialog_destruct 2362
+#define wxPageSetupDialog_GetPageSetupData 2363
+#define wxPageSetupDialog_ShowModal 2364
+#define wxPageSetupDialogData_new_0 2365
+#define wxPageSetupDialogData_new_1_0 2366
+#define wxPageSetupDialogData_new_1_1 2367
+#define wxPageSetupDialogData_destruct 2368
+#define wxPageSetupDialogData_EnableHelp 2369
+#define wxPageSetupDialogData_EnableMargins 2370
+#define wxPageSetupDialogData_EnableOrientation 2371
+#define wxPageSetupDialogData_EnablePaper 2372
+#define wxPageSetupDialogData_EnablePrinter 2373
+#define wxPageSetupDialogData_GetDefaultMinMargins 2374
+#define wxPageSetupDialogData_GetEnableMargins 2375
+#define wxPageSetupDialogData_GetEnableOrientation 2376
+#define wxPageSetupDialogData_GetEnablePaper 2377
+#define wxPageSetupDialogData_GetEnablePrinter 2378
+#define wxPageSetupDialogData_GetEnableHelp 2379
+#define wxPageSetupDialogData_GetDefaultInfo 2380
+#define wxPageSetupDialogData_GetMarginTopLeft 2381
+#define wxPageSetupDialogData_GetMarginBottomRight 2382
+#define wxPageSetupDialogData_GetMinMarginTopLeft 2383
+#define wxPageSetupDialogData_GetMinMarginBottomRight 2384
+#define wxPageSetupDialogData_GetPaperId 2385
+#define wxPageSetupDialogData_GetPaperSize 2386
+#define wxPageSetupDialogData_GetPrintData 2388
+#define wxPageSetupDialogData_IsOk 2389
+#define wxPageSetupDialogData_SetDefaultInfo 2390
+#define wxPageSetupDialogData_SetDefaultMinMargins 2391
+#define wxPageSetupDialogData_SetMarginTopLeft 2392
+#define wxPageSetupDialogData_SetMarginBottomRight 2393
+#define wxPageSetupDialogData_SetMinMarginTopLeft 2394
+#define wxPageSetupDialogData_SetMinMarginBottomRight 2395
+#define wxPageSetupDialogData_SetPaperId 2396
+#define wxPageSetupDialogData_SetPaperSize_1_1 2397
+#define wxPageSetupDialogData_SetPaperSize_1_0 2398
+#define wxPageSetupDialogData_SetPrintData 2399
+#define wxPrintDialog_new_2_0 2400
+#define wxPrintDialog_new_2_1 2401
+#define wxPrintDialog_destruct 2402
+#define wxPrintDialog_GetPrintDialogData 2403
+#define wxPrintDialog_GetPrintDC 2404
+#define wxPrintDialogData_new_0 2405
+#define wxPrintDialogData_new_1_1 2406
+#define wxPrintDialogData_new_1_0 2407
+#define wxPrintDialogData_destruct 2408
+#define wxPrintDialogData_EnableHelp 2409
+#define wxPrintDialogData_EnablePageNumbers 2410
+#define wxPrintDialogData_EnablePrintToFile 2411
+#define wxPrintDialogData_EnableSelection 2412
+#define wxPrintDialogData_GetAllPages 2413
+#define wxPrintDialogData_GetCollate 2414
+#define wxPrintDialogData_GetFromPage 2415
+#define wxPrintDialogData_GetMaxPage 2416
+#define wxPrintDialogData_GetMinPage 2417
+#define wxPrintDialogData_GetNoCopies 2418
+#define wxPrintDialogData_GetPrintData 2419
+#define wxPrintDialogData_GetPrintToFile 2420
+#define wxPrintDialogData_GetSelection 2421
+#define wxPrintDialogData_GetToPage 2422
+#define wxPrintDialogData_IsOk 2423
+#define wxPrintDialogData_SetCollate 2424
+#define wxPrintDialogData_SetFromPage 2425
+#define wxPrintDialogData_SetMaxPage 2426
+#define wxPrintDialogData_SetMinPage 2427
+#define wxPrintDialogData_SetNoCopies 2428
+#define wxPrintDialogData_SetPrintData 2429
+#define wxPrintDialogData_SetPrintToFile 2430
+#define wxPrintDialogData_SetSelection 2431
+#define wxPrintDialogData_SetToPage 2432
+#define wxPrintData_new_0 2433
+#define wxPrintData_new_1 2434
+#define wxPrintData_destruct 2435
+#define wxPrintData_GetCollate 2436
+#define wxPrintData_GetBin 2437
+#define wxPrintData_GetColour 2438
+#define wxPrintData_GetDuplex 2439
+#define wxPrintData_GetNoCopies 2440
+#define wxPrintData_GetOrientation 2441
+#define wxPrintData_GetPaperId 2442
+#define wxPrintData_GetPrinterName 2443
+#define wxPrintData_GetQuality 2444
+#define wxPrintData_IsOk 2445
+#define wxPrintData_SetBin 2446
+#define wxPrintData_SetCollate 2447
+#define wxPrintData_SetColour 2448
+#define wxPrintData_SetDuplex 2449
+#define wxPrintData_SetNoCopies 2450
+#define wxPrintData_SetOrientation 2451
+#define wxPrintData_SetPaperId 2452
+#define wxPrintData_SetPrinterName 2453
+#define wxPrintData_SetQuality 2454
+#define wxPrintPreview_new_2 2457
+#define wxPrintPreview_new_3 2458
+#define wxPrintPreview_destruct 2460
+#define wxPrintPreview_GetCanvas 2461
+#define wxPrintPreview_GetCurrentPage 2462
+#define wxPrintPreview_GetFrame 2463
+#define wxPrintPreview_GetMaxPage 2464
+#define wxPrintPreview_GetMinPage 2465
+#define wxPrintPreview_GetPrintout 2466
+#define wxPrintPreview_GetPrintoutForPrinting 2467
+#define wxPrintPreview_IsOk 2468
+#define wxPrintPreview_PaintPage 2469
+#define wxPrintPreview_Print 2470
+#define wxPrintPreview_RenderPage 2471
+#define wxPrintPreview_SetCanvas 2472
+#define wxPrintPreview_SetCurrentPage 2473
+#define wxPrintPreview_SetFrame 2474
+#define wxPrintPreview_SetPrintout 2475
+#define wxPrintPreview_SetZoom 2476
+#define wxPreviewFrame_new 2477
+#define wxPreviewFrame_destruct 2478
+#define wxPreviewFrame_CreateControlBar 2479
+#define wxPreviewFrame_CreateCanvas 2480
+#define wxPreviewFrame_Initialize 2481
+#define wxPreviewFrame_OnCloseWindow 2482
+#define wxPreviewControlBar_new 2483
+#define wxPreviewControlBar_destruct 2484
+#define wxPreviewControlBar_CreateButtons 2485
+#define wxPreviewControlBar_GetPrintPreview 2486
+#define wxPreviewControlBar_GetZoomControl 2487
+#define wxPreviewControlBar_SetZoomControl 2488
+#define wxPrinter_new 2490
+#define wxPrinter_CreateAbortWindow 2491
+#define wxPrinter_GetAbort 2492
+#define wxPrinter_GetLastError 2493
+#define wxPrinter_GetPrintDialogData 2494
+#define wxPrinter_Print 2495
+#define wxPrinter_PrintDialog 2496
+#define wxPrinter_ReportError 2497
+#define wxPrinter_Setup 2498
+#define wxPrinter_destroy 2499
+#define wxXmlResource_new_1 2500
+#define wxXmlResource_new_2 2501
+#define wxXmlResource_destruct 2502
+#define wxXmlResource_AttachUnknownControl 2503
+#define wxXmlResource_ClearHandlers 2504
+#define wxXmlResource_CompareVersion 2505
+#define wxXmlResource_Get 2506
+#define wxXmlResource_GetFlags 2507
+#define wxXmlResource_GetVersion 2508
+#define wxXmlResource_GetXRCID 2509
+#define wxXmlResource_InitAllHandlers 2510
+#define wxXmlResource_Load 2511
+#define wxXmlResource_LoadBitmap 2512
+#define wxXmlResource_LoadDialog_2 2513
+#define wxXmlResource_LoadDialog_3 2514
+#define wxXmlResource_LoadFrame_2 2515
+#define wxXmlResource_LoadFrame_3 2516
+#define wxXmlResource_LoadIcon 2517
+#define wxXmlResource_LoadMenu 2518
+#define wxXmlResource_LoadMenuBar_2 2519
+#define wxXmlResource_LoadMenuBar_1 2520
+#define wxXmlResource_LoadPanel_2 2521
+#define wxXmlResource_LoadPanel_3 2522
+#define wxXmlResource_LoadToolBar 2523
+#define wxXmlResource_Set 2524
+#define wxXmlResource_SetFlags 2525
+#define wxXmlResource_Unload 2526
+#define wxXmlResource_xrcctrl 2527
+#define wxHtmlEasyPrinting_new 2528
+#define wxHtmlEasyPrinting_destruct 2529
+#define wxHtmlEasyPrinting_GetPrintData 2530
+#define wxHtmlEasyPrinting_GetPageSetupData 2531
+#define wxHtmlEasyPrinting_PreviewFile 2532
+#define wxHtmlEasyPrinting_PreviewText 2533
+#define wxHtmlEasyPrinting_PrintFile 2534
+#define wxHtmlEasyPrinting_PrintText 2535
+#define wxHtmlEasyPrinting_PageSetup 2536
+#define wxHtmlEasyPrinting_SetFonts 2537
+#define wxHtmlEasyPrinting_SetHeader 2538
+#define wxHtmlEasyPrinting_SetFooter 2539
+#define wxGLCanvas_new_2 2541
+#define wxGLCanvas_new_3_1 2542
+#define wxGLCanvas_new_3_0 2543
+#define wxGLCanvas_GetContext 2544
+#define wxGLCanvas_SetCurrent 2546
+#define wxGLCanvas_SwapBuffers 2547
+#define wxGLCanvas_destroy 2548
+#define wxAuiManager_new 2549
+#define wxAuiManager_destruct 2550
+#define wxAuiManager_AddPane_2_1 2551
+#define wxAuiManager_AddPane_3 2552
+#define wxAuiManager_AddPane_2_0 2553
+#define wxAuiManager_DetachPane 2554
+#define wxAuiManager_GetAllPanes 2555
+#define wxAuiManager_GetArtProvider 2556
+#define wxAuiManager_GetDockSizeConstraint 2557
+#define wxAuiManager_GetFlags 2558
+#define wxAuiManager_GetManagedWindow 2559
+#define wxAuiManager_GetManager 2560
+#define wxAuiManager_GetPane_1_1 2561
+#define wxAuiManager_GetPane_1_0 2562
+#define wxAuiManager_HideHint 2563
+#define wxAuiManager_InsertPane 2564
+#define wxAuiManager_LoadPaneInfo 2565
+#define wxAuiManager_LoadPerspective 2566
+#define wxAuiManager_SavePaneInfo 2567
+#define wxAuiManager_SavePerspective 2568
+#define wxAuiManager_SetArtProvider 2569
+#define wxAuiManager_SetDockSizeConstraint 2570
+#define wxAuiManager_SetFlags 2571
+#define wxAuiManager_SetManagedWindow 2572
+#define wxAuiManager_ShowHint 2573
+#define wxAuiManager_UnInit 2574
+#define wxAuiManager_Update 2575
+#define wxAuiPaneInfo_new_0 2576
+#define wxAuiPaneInfo_new_1 2577
+#define wxAuiPaneInfo_destruct 2578
+#define wxAuiPaneInfo_BestSize_1 2579
+#define wxAuiPaneInfo_BestSize_2 2580
+#define wxAuiPaneInfo_Bottom 2581
+#define wxAuiPaneInfo_BottomDockable 2582
+#define wxAuiPaneInfo_Caption 2583
+#define wxAuiPaneInfo_CaptionVisible 2584
+#define wxAuiPaneInfo_Centre 2585
+#define wxAuiPaneInfo_CentrePane 2586
+#define wxAuiPaneInfo_CloseButton 2587
+#define wxAuiPaneInfo_DefaultPane 2588
+#define wxAuiPaneInfo_DestroyOnClose 2589
+#define wxAuiPaneInfo_Direction 2590
+#define wxAuiPaneInfo_Dock 2591
+#define wxAuiPaneInfo_Dockable 2592
+#define wxAuiPaneInfo_Fixed 2593
+#define wxAuiPaneInfo_Float 2594
+#define wxAuiPaneInfo_Floatable 2595
+#define wxAuiPaneInfo_FloatingPosition_1 2596
+#define wxAuiPaneInfo_FloatingPosition_2 2597
+#define wxAuiPaneInfo_FloatingSize_1 2598
+#define wxAuiPaneInfo_FloatingSize_2 2599
+#define wxAuiPaneInfo_Gripper 2600
+#define wxAuiPaneInfo_GripperTop 2601
+#define wxAuiPaneInfo_HasBorder 2602
+#define wxAuiPaneInfo_HasCaption 2603
+#define wxAuiPaneInfo_HasCloseButton 2604
+#define wxAuiPaneInfo_HasFlag 2605
+#define wxAuiPaneInfo_HasGripper 2606
+#define wxAuiPaneInfo_HasGripperTop 2607
+#define wxAuiPaneInfo_HasMaximizeButton 2608
+#define wxAuiPaneInfo_HasMinimizeButton 2609
+#define wxAuiPaneInfo_HasPinButton 2610
+#define wxAuiPaneInfo_Hide 2611
+#define wxAuiPaneInfo_IsBottomDockable 2612
+#define wxAuiPaneInfo_IsDocked 2613
+#define wxAuiPaneInfo_IsFixed 2614
+#define wxAuiPaneInfo_IsFloatable 2615
+#define wxAuiPaneInfo_IsFloating 2616
+#define wxAuiPaneInfo_IsLeftDockable 2617
+#define wxAuiPaneInfo_IsMovable 2618
+#define wxAuiPaneInfo_IsOk 2619
+#define wxAuiPaneInfo_IsResizable 2620
+#define wxAuiPaneInfo_IsRightDockable 2621
+#define wxAuiPaneInfo_IsShown 2622
+#define wxAuiPaneInfo_IsToolbar 2623
+#define wxAuiPaneInfo_IsTopDockable 2624
+#define wxAuiPaneInfo_Layer 2625
+#define wxAuiPaneInfo_Left 2626
+#define wxAuiPaneInfo_LeftDockable 2627
+#define wxAuiPaneInfo_MaxSize_1 2628
+#define wxAuiPaneInfo_MaxSize_2 2629
+#define wxAuiPaneInfo_MaximizeButton 2630
+#define wxAuiPaneInfo_MinSize_1 2631
+#define wxAuiPaneInfo_MinSize_2 2632
+#define wxAuiPaneInfo_MinimizeButton 2633
+#define wxAuiPaneInfo_Movable 2634
+#define wxAuiPaneInfo_Name 2635
+#define wxAuiPaneInfo_PaneBorder 2636
+#define wxAuiPaneInfo_PinButton 2637
+#define wxAuiPaneInfo_Position 2638
+#define wxAuiPaneInfo_Resizable 2639
+#define wxAuiPaneInfo_Right 2640
+#define wxAuiPaneInfo_RightDockable 2641
+#define wxAuiPaneInfo_Row 2642
+#define wxAuiPaneInfo_SafeSet 2643
+#define wxAuiPaneInfo_SetFlag 2644
+#define wxAuiPaneInfo_Show 2645
+#define wxAuiPaneInfo_ToolbarPane 2646
+#define wxAuiPaneInfo_Top 2647
+#define wxAuiPaneInfo_TopDockable 2648
+#define wxAuiPaneInfo_Window 2649
+#define wxAuiNotebook_new_0 2650
+#define wxAuiNotebook_new_2 2651
+#define wxAuiNotebook_AddPage 2652
+#define wxAuiNotebook_Create 2653
+#define wxAuiNotebook_DeletePage 2654
+#define wxAuiNotebook_GetArtProvider 2655
+#define wxAuiNotebook_GetPage 2656
+#define wxAuiNotebook_GetPageBitmap 2657
+#define wxAuiNotebook_GetPageCount 2658
+#define wxAuiNotebook_GetPageIndex 2659
+#define wxAuiNotebook_GetPageText 2660
+#define wxAuiNotebook_GetSelection 2661
+#define wxAuiNotebook_InsertPage 2662
+#define wxAuiNotebook_RemovePage 2663
+#define wxAuiNotebook_SetArtProvider 2664
+#define wxAuiNotebook_SetFont 2665
+#define wxAuiNotebook_SetPageBitmap 2666
+#define wxAuiNotebook_SetPageText 2667
+#define wxAuiNotebook_SetSelection 2668
+#define wxAuiNotebook_SetTabCtrlHeight 2669
+#define wxAuiNotebook_SetUniformBitmapSize 2670
+#define wxAuiNotebook_destroy 2671
+#define wxMDIParentFrame_new_0 2672
+#define wxMDIParentFrame_new_4 2673
+#define wxMDIParentFrame_destruct 2674
+#define wxMDIParentFrame_ActivateNext 2675
+#define wxMDIParentFrame_ActivatePrevious 2676
+#define wxMDIParentFrame_ArrangeIcons 2677
+#define wxMDIParentFrame_Cascade 2678
+#define wxMDIParentFrame_Create 2679
+#define wxMDIParentFrame_GetActiveChild 2680
+#define wxMDIParentFrame_GetClientWindow 2681
+#define wxMDIParentFrame_Tile 2682
+#define wxMDIChildFrame_new_0 2683
+#define wxMDIChildFrame_new_4 2684
+#define wxMDIChildFrame_destruct 2685
+#define wxMDIChildFrame_Activate 2686
+#define wxMDIChildFrame_Create 2687
+#define wxMDIChildFrame_Maximize 2688
+#define wxMDIChildFrame_Restore 2689
+#define wxMDIClientWindow_new_0 2690
+#define wxMDIClientWindow_new_2 2691
+#define wxMDIClientWindow_destruct 2692
+#define wxMDIClientWindow_CreateClient 2693
+#define wxLayoutAlgorithm_new 2694
+#define wxLayoutAlgorithm_LayoutFrame 2695
+#define wxLayoutAlgorithm_LayoutMDIFrame 2696
+#define wxLayoutAlgorithm_LayoutWindow 2697
+#define wxLayoutAlgorithm_destroy 2698
+#define wxEvent_GetId 2699
+#define wxEvent_GetSkipped 2700
+#define wxEvent_GetTimestamp 2701
+#define wxEvent_IsCommandEvent 2702
+#define wxEvent_ResumePropagation 2703
+#define wxEvent_ShouldPropagate 2704
+#define wxEvent_Skip 2705
+#define wxEvent_StopPropagation 2706
+#define wxCommandEvent_getClientData 2707
+#define wxCommandEvent_GetExtraLong 2708
+#define wxCommandEvent_GetInt 2709
+#define wxCommandEvent_GetSelection 2710
+#define wxCommandEvent_GetString 2711
+#define wxCommandEvent_IsChecked 2712
+#define wxCommandEvent_IsSelection 2713
+#define wxCommandEvent_SetInt 2714
+#define wxCommandEvent_SetString 2715
+#define wxScrollEvent_GetOrientation 2716
+#define wxScrollEvent_GetPosition 2717
+#define wxScrollWinEvent_GetOrientation 2718
+#define wxScrollWinEvent_GetPosition 2719
+#define wxMouseEvent_AltDown 2720
+#define wxMouseEvent_Button 2721
+#define wxMouseEvent_ButtonDClick 2722
+#define wxMouseEvent_ButtonDown 2723
+#define wxMouseEvent_ButtonUp 2724
+#define wxMouseEvent_CmdDown 2725
+#define wxMouseEvent_ControlDown 2726
+#define wxMouseEvent_Dragging 2727
+#define wxMouseEvent_Entering 2728
+#define wxMouseEvent_GetButton 2729
+#define wxMouseEvent_GetPosition 2732
+#define wxMouseEvent_GetLogicalPosition 2733
+#define wxMouseEvent_GetLinesPerAction 2734
+#define wxMouseEvent_GetWheelRotation 2735
+#define wxMouseEvent_GetWheelDelta 2736
+#define wxMouseEvent_GetX 2737
+#define wxMouseEvent_GetY 2738
+#define wxMouseEvent_IsButton 2739
+#define wxMouseEvent_IsPageScroll 2740
+#define wxMouseEvent_Leaving 2741
+#define wxMouseEvent_LeftDClick 2742
+#define wxMouseEvent_LeftDown 2743
+#define wxMouseEvent_LeftIsDown 2744
+#define wxMouseEvent_LeftUp 2745
+#define wxMouseEvent_MetaDown 2746
+#define wxMouseEvent_MiddleDClick 2747
+#define wxMouseEvent_MiddleDown 2748
+#define wxMouseEvent_MiddleIsDown 2749
+#define wxMouseEvent_MiddleUp 2750
+#define wxMouseEvent_Moving 2751
+#define wxMouseEvent_RightDClick 2752
+#define wxMouseEvent_RightDown 2753
+#define wxMouseEvent_RightIsDown 2754
+#define wxMouseEvent_RightUp 2755
+#define wxMouseEvent_ShiftDown 2756
+#define wxSetCursorEvent_GetCursor 2757
+#define wxSetCursorEvent_GetX 2758
+#define wxSetCursorEvent_GetY 2759
+#define wxSetCursorEvent_HasCursor 2760
+#define wxSetCursorEvent_SetCursor 2761
+#define wxKeyEvent_AltDown 2762
+#define wxKeyEvent_CmdDown 2763
+#define wxKeyEvent_ControlDown 2764
+#define wxKeyEvent_GetKeyCode 2765
+#define wxKeyEvent_GetModifiers 2766
+#define wxKeyEvent_GetPosition 2769
+#define wxKeyEvent_GetRawKeyCode 2770
+#define wxKeyEvent_GetRawKeyFlags 2771
+#define wxKeyEvent_GetUnicodeKey 2772
+#define wxKeyEvent_GetX 2773
+#define wxKeyEvent_GetY 2774
+#define wxKeyEvent_HasModifiers 2775
+#define wxKeyEvent_MetaDown 2776
+#define wxKeyEvent_ShiftDown 2777
+#define wxSizeEvent_GetSize 2778
+#define wxMoveEvent_GetPosition 2779
+#define wxEraseEvent_GetDC 2780
+#define wxFocusEvent_GetWindow 2781
+#define wxChildFocusEvent_GetWindow 2782
+#define wxMenuEvent_GetMenu 2783
+#define wxMenuEvent_GetMenuId 2784
+#define wxMenuEvent_IsPopup 2785
+#define wxCloseEvent_CanVeto 2786
+#define wxCloseEvent_GetLoggingOff 2787
+#define wxCloseEvent_SetCanVeto 2788
+#define wxCloseEvent_SetLoggingOff 2789
+#define wxCloseEvent_Veto 2790
+#define wxShowEvent_SetShow 2791
+#define wxShowEvent_GetShow 2792
+#define wxIconizeEvent_Iconized 2793
+#define wxJoystickEvent_ButtonDown 2794
+#define wxJoystickEvent_ButtonIsDown 2795
+#define wxJoystickEvent_ButtonUp 2796
+#define wxJoystickEvent_GetButtonChange 2797
+#define wxJoystickEvent_GetButtonState 2798
+#define wxJoystickEvent_GetJoystick 2799
+#define wxJoystickEvent_GetPosition 2800
+#define wxJoystickEvent_GetZPosition 2801
+#define wxJoystickEvent_IsButton 2802
+#define wxJoystickEvent_IsMove 2803
+#define wxJoystickEvent_IsZMove 2804
+#define wxUpdateUIEvent_CanUpdate 2805
+#define wxUpdateUIEvent_Check 2806
+#define wxUpdateUIEvent_Enable 2807
+#define wxUpdateUIEvent_Show 2808
+#define wxUpdateUIEvent_GetChecked 2809
+#define wxUpdateUIEvent_GetEnabled 2810
+#define wxUpdateUIEvent_GetShown 2811
+#define wxUpdateUIEvent_GetSetChecked 2812
+#define wxUpdateUIEvent_GetSetEnabled 2813
+#define wxUpdateUIEvent_GetSetShown 2814
+#define wxUpdateUIEvent_GetSetText 2815
+#define wxUpdateUIEvent_GetText 2816
+#define wxUpdateUIEvent_GetMode 2817
+#define wxUpdateUIEvent_GetUpdateInterval 2818
+#define wxUpdateUIEvent_ResetUpdateTime 2819
+#define wxUpdateUIEvent_SetMode 2820
+#define wxUpdateUIEvent_SetText 2821
+#define wxUpdateUIEvent_SetUpdateInterval 2822
+#define wxMouseCaptureChangedEvent_GetCapturedWindow 2823
+#define wxPaletteChangedEvent_SetChangedWindow 2824
+#define wxPaletteChangedEvent_GetChangedWindow 2825
+#define wxQueryNewPaletteEvent_SetPaletteRealized 2826
+#define wxQueryNewPaletteEvent_GetPaletteRealized 2827
+#define wxNavigationKeyEvent_GetDirection 2828
+#define wxNavigationKeyEvent_SetDirection 2829
+#define wxNavigationKeyEvent_IsWindowChange 2830
+#define wxNavigationKeyEvent_SetWindowChange 2831
+#define wxNavigationKeyEvent_IsFromTab 2832
+#define wxNavigationKeyEvent_SetFromTab 2833
+#define wxNavigationKeyEvent_GetCurrentFocus 2834
+#define wxNavigationKeyEvent_SetCurrentFocus 2835
+#define wxHelpEvent_GetOrigin 2836
+#define wxHelpEvent_GetPosition 2837
+#define wxHelpEvent_SetOrigin 2838
+#define wxHelpEvent_SetPosition 2839
+#define wxContextMenuEvent_GetPosition 2840
+#define wxContextMenuEvent_SetPosition 2841
+#define wxIdleEvent_CanSend 2842
+#define wxIdleEvent_GetMode 2843
+#define wxIdleEvent_RequestMore 2844
+#define wxIdleEvent_MoreRequested 2845
+#define wxIdleEvent_SetMode 2846
+#define wxGridEvent_AltDown 2847
+#define wxGridEvent_ControlDown 2848
+#define wxGridEvent_GetCol 2849
+#define wxGridEvent_GetPosition 2850
+#define wxGridEvent_GetRow 2851
+#define wxGridEvent_MetaDown 2852
+#define wxGridEvent_Selecting 2853
+#define wxGridEvent_ShiftDown 2854
+#define wxNotifyEvent_Allow 2855
+#define wxNotifyEvent_IsAllowed 2856
+#define wxNotifyEvent_Veto 2857
+#define wxSashEvent_GetEdge 2858
+#define wxSashEvent_GetDragRect 2859
+#define wxSashEvent_GetDragStatus 2860
+#define wxListEvent_GetCacheFrom 2861
+#define wxListEvent_GetCacheTo 2862
+#define wxListEvent_GetKeyCode 2863
+#define wxListEvent_GetIndex 2864
+#define wxListEvent_GetColumn 2865
+#define wxListEvent_GetPoint 2866
+#define wxListEvent_GetLabel 2867
+#define wxListEvent_GetText 2868
+#define wxListEvent_GetImage 2869
+#define wxListEvent_GetData 2870
+#define wxListEvent_GetMask 2871
+#define wxListEvent_GetItem 2872
+#define wxListEvent_IsEditCancelled 2873
+#define wxDateEvent_GetDate 2874
+#define wxCalendarEvent_GetWeekDay 2875
+#define wxFileDirPickerEvent_GetPath 2876
+#define wxColourPickerEvent_GetColour 2877
+#define wxFontPickerEvent_GetFont 2878
+#define wxStyledTextEvent_GetPosition 2879
+#define wxStyledTextEvent_GetKey 2880
+#define wxStyledTextEvent_GetModifiers 2881
+#define wxStyledTextEvent_GetModificationType 2882
+#define wxStyledTextEvent_GetText 2883
+#define wxStyledTextEvent_GetLength 2884
+#define wxStyledTextEvent_GetLinesAdded 2885
+#define wxStyledTextEvent_GetLine 2886
+#define wxStyledTextEvent_GetFoldLevelNow 2887
+#define wxStyledTextEvent_GetFoldLevelPrev 2888
+#define wxStyledTextEvent_GetMargin 2889
+#define wxStyledTextEvent_GetMessage 2890
+#define wxStyledTextEvent_GetWParam 2891
+#define wxStyledTextEvent_GetLParam 2892
+#define wxStyledTextEvent_GetListType 2893
+#define wxStyledTextEvent_GetX 2894
+#define wxStyledTextEvent_GetY 2895
+#define wxStyledTextEvent_GetDragText 2896
+#define wxStyledTextEvent_GetDragAllowMove 2897
+#define wxStyledTextEvent_GetDragResult 2898
+#define wxStyledTextEvent_GetShift 2899
+#define wxStyledTextEvent_GetControl 2900
+#define wxStyledTextEvent_GetAlt 2901
+#define utils_wxGetKeyState 2902
+#define utils_wxGetMousePosition 2903
+#define utils_wxGetMouseState 2904
+#define utils_wxSetDetectableAutoRepeat 2905
+#define utils_wxBell 2906
+#define utils_wxFindMenuItemId 2907
+#define utils_wxGenericFindWindowAtPoint 2908
+#define utils_wxFindWindowAtPoint 2909
+#define utils_wxBeginBusyCursor 2910
+#define utils_wxEndBusyCursor 2911
+#define utils_wxIsBusy 2912
+#define utils_wxShutdown 2913
+#define utils_wxShell 2914
+#define utils_wxLaunchDefaultBrowser 2915
+#define utils_wxGetEmailAddress 2916
+#define utils_wxGetUserId 2917
+#define utils_wxGetHomeDir 2918
+#define utils_wxNewId 2919
+#define utils_wxRegisterId 2920
+#define utils_wxGetCurrentId 2921
+#define utils_wxGetOsDescription 2922
+#define utils_wxIsPlatformLittleEndian 2923
+#define utils_wxIsPlatform64Bit 2924
+#define wxPrintout_new 2925
+#define wxPrintout_destruct 2926
+#define wxPrintout_GetDC 2927
+#define wxPrintout_GetPageSizeMM 2928
+#define wxPrintout_GetPageSizePixels 2929
+#define wxPrintout_GetPaperRectPixels 2930
+#define wxPrintout_GetPPIPrinter 2931
+#define wxPrintout_GetPPIScreen 2932
+#define wxPrintout_GetTitle 2933
+#define wxPrintout_IsPreview 2934
+#define wxPrintout_FitThisSizeToPaper 2935
+#define wxPrintout_FitThisSizeToPage 2936
+#define wxPrintout_FitThisSizeToPageMargins 2937
+#define wxPrintout_MapScreenSizeToPaper 2938
+#define wxPrintout_MapScreenSizeToPage 2939
+#define wxPrintout_MapScreenSizeToPageMargins 2940
+#define wxPrintout_MapScreenSizeToDevice 2941
+#define wxPrintout_GetLogicalPaperRect 2942
+#define wxPrintout_GetLogicalPageRect 2943
+#define wxPrintout_GetLogicalPageMarginsRect 2944
+#define wxPrintout_SetLogicalOrigin 2945
+#define wxPrintout_OffsetLogicalOrigin 2946
+#define wxStyledTextCtrl_new_2 2947
+#define wxStyledTextCtrl_new_0 2948
+#define wxStyledTextCtrl_destruct 2949
+#define wxStyledTextCtrl_Create 2950
+#define wxStyledTextCtrl_AddText 2951
+#define wxStyledTextCtrl_AddStyledText 2952
+#define wxStyledTextCtrl_InsertText 2953
+#define wxStyledTextCtrl_ClearAll 2954
+#define wxStyledTextCtrl_ClearDocumentStyle 2955
+#define wxStyledTextCtrl_GetLength 2956
+#define wxStyledTextCtrl_GetCharAt 2957
+#define wxStyledTextCtrl_GetCurrentPos 2958
+#define wxStyledTextCtrl_GetAnchor 2959
+#define wxStyledTextCtrl_GetStyleAt 2960
+#define wxStyledTextCtrl_Redo 2961
+#define wxStyledTextCtrl_SetUndoCollection 2962
+#define wxStyledTextCtrl_SelectAll 2963
+#define wxStyledTextCtrl_SetSavePoint 2964
+#define wxStyledTextCtrl_GetStyledText 2965
+#define wxStyledTextCtrl_CanRedo 2966
+#define wxStyledTextCtrl_MarkerLineFromHandle 2967
+#define wxStyledTextCtrl_MarkerDeleteHandle 2968
+#define wxStyledTextCtrl_GetUndoCollection 2969
+#define wxStyledTextCtrl_GetViewWhiteSpace 2970
+#define wxStyledTextCtrl_SetViewWhiteSpace 2971
+#define wxStyledTextCtrl_PositionFromPoint 2972
+#define wxStyledTextCtrl_PositionFromPointClose 2973
+#define wxStyledTextCtrl_GotoLine 2974
+#define wxStyledTextCtrl_GotoPos 2975
+#define wxStyledTextCtrl_SetAnchor 2976
+#define wxStyledTextCtrl_GetCurLine 2977
+#define wxStyledTextCtrl_GetEndStyled 2978
+#define wxStyledTextCtrl_ConvertEOLs 2979
+#define wxStyledTextCtrl_GetEOLMode 2980
+#define wxStyledTextCtrl_SetEOLMode 2981
+#define wxStyledTextCtrl_StartStyling 2982
+#define wxStyledTextCtrl_SetStyling 2983
+#define wxStyledTextCtrl_GetBufferedDraw 2984
+#define wxStyledTextCtrl_SetBufferedDraw 2985
+#define wxStyledTextCtrl_SetTabWidth 2986
+#define wxStyledTextCtrl_GetTabWidth 2987
+#define wxStyledTextCtrl_SetCodePage 2988
+#define wxStyledTextCtrl_MarkerDefine 2989
+#define wxStyledTextCtrl_MarkerSetForeground 2990
+#define wxStyledTextCtrl_MarkerSetBackground 2991
+#define wxStyledTextCtrl_MarkerAdd 2992
+#define wxStyledTextCtrl_MarkerDelete 2993
+#define wxStyledTextCtrl_MarkerDeleteAll 2994
+#define wxStyledTextCtrl_MarkerGet 2995
+#define wxStyledTextCtrl_MarkerNext 2996
+#define wxStyledTextCtrl_MarkerPrevious 2997
+#define wxStyledTextCtrl_MarkerDefineBitmap 2998
+#define wxStyledTextCtrl_MarkerAddSet 2999
+#define wxStyledTextCtrl_MarkerSetAlpha 3000
+#define wxStyledTextCtrl_SetMarginType 3001
+#define wxStyledTextCtrl_GetMarginType 3002
+#define wxStyledTextCtrl_SetMarginWidth 3003
+#define wxStyledTextCtrl_GetMarginWidth 3004
+#define wxStyledTextCtrl_SetMarginMask 3005
+#define wxStyledTextCtrl_GetMarginMask 3006
+#define wxStyledTextCtrl_SetMarginSensitive 3007
+#define wxStyledTextCtrl_GetMarginSensitive 3008
+#define wxStyledTextCtrl_StyleClearAll 3009
+#define wxStyledTextCtrl_StyleSetForeground 3010
+#define wxStyledTextCtrl_StyleSetBackground 3011
+#define wxStyledTextCtrl_StyleSetBold 3012
+#define wxStyledTextCtrl_StyleSetItalic 3013
+#define wxStyledTextCtrl_StyleSetSize 3014
+#define wxStyledTextCtrl_StyleSetFaceName 3015
+#define wxStyledTextCtrl_StyleSetEOLFilled 3016
+#define wxStyledTextCtrl_StyleResetDefault 3017
+#define wxStyledTextCtrl_StyleSetUnderline 3018
+#define wxStyledTextCtrl_StyleSetCase 3019
+#define wxStyledTextCtrl_StyleSetHotSpot 3020
+#define wxStyledTextCtrl_SetSelForeground 3021
+#define wxStyledTextCtrl_SetSelBackground 3022
+#define wxStyledTextCtrl_GetSelAlpha 3023
+#define wxStyledTextCtrl_SetSelAlpha 3024
+#define wxStyledTextCtrl_SetCaretForeground 3025
+#define wxStyledTextCtrl_CmdKeyAssign 3026
+#define wxStyledTextCtrl_CmdKeyClear 3027
+#define wxStyledTextCtrl_CmdKeyClearAll 3028
+#define wxStyledTextCtrl_SetStyleBytes 3029
+#define wxStyledTextCtrl_StyleSetVisible 3030
+#define wxStyledTextCtrl_GetCaretPeriod 3031
+#define wxStyledTextCtrl_SetCaretPeriod 3032
+#define wxStyledTextCtrl_SetWordChars 3033
+#define wxStyledTextCtrl_BeginUndoAction 3034
+#define wxStyledTextCtrl_EndUndoAction 3035
+#define wxStyledTextCtrl_IndicatorSetStyle 3036
+#define wxStyledTextCtrl_IndicatorGetStyle 3037
+#define wxStyledTextCtrl_IndicatorSetForeground 3038
+#define wxStyledTextCtrl_IndicatorGetForeground 3039
+#define wxStyledTextCtrl_SetWhitespaceForeground 3040
+#define wxStyledTextCtrl_SetWhitespaceBackground 3041
+#define wxStyledTextCtrl_GetStyleBits 3042
+#define wxStyledTextCtrl_SetLineState 3043
+#define wxStyledTextCtrl_GetLineState 3044
+#define wxStyledTextCtrl_GetMaxLineState 3045
+#define wxStyledTextCtrl_GetCaretLineVisible 3046
+#define wxStyledTextCtrl_SetCaretLineVisible 3047
+#define wxStyledTextCtrl_GetCaretLineBackground 3048
+#define wxStyledTextCtrl_SetCaretLineBackground 3049
+#define wxStyledTextCtrl_AutoCompShow 3050
+#define wxStyledTextCtrl_AutoCompCancel 3051
+#define wxStyledTextCtrl_AutoCompActive 3052
+#define wxStyledTextCtrl_AutoCompPosStart 3053
+#define wxStyledTextCtrl_AutoCompComplete 3054
+#define wxStyledTextCtrl_AutoCompStops 3055
+#define wxStyledTextCtrl_AutoCompSetSeparator 3056
+#define wxStyledTextCtrl_AutoCompGetSeparator 3057
+#define wxStyledTextCtrl_AutoCompSelect 3058
+#define wxStyledTextCtrl_AutoCompSetCancelAtStart 3059
+#define wxStyledTextCtrl_AutoCompGetCancelAtStart 3060
+#define wxStyledTextCtrl_AutoCompSetFillUps 3061
+#define wxStyledTextCtrl_AutoCompSetChooseSingle 3062
+#define wxStyledTextCtrl_AutoCompGetChooseSingle 3063
+#define wxStyledTextCtrl_AutoCompSetIgnoreCase 3064
+#define wxStyledTextCtrl_AutoCompGetIgnoreCase 3065
+#define wxStyledTextCtrl_UserListShow 3066
+#define wxStyledTextCtrl_AutoCompSetAutoHide 3067
+#define wxStyledTextCtrl_AutoCompGetAutoHide 3068
+#define wxStyledTextCtrl_AutoCompSetDropRestOfWord 3069
+#define wxStyledTextCtrl_AutoCompGetDropRestOfWord 3070
+#define wxStyledTextCtrl_RegisterImage 3071
+#define wxStyledTextCtrl_ClearRegisteredImages 3072
+#define wxStyledTextCtrl_AutoCompGetTypeSeparator 3073
+#define wxStyledTextCtrl_AutoCompSetTypeSeparator 3074
+#define wxStyledTextCtrl_AutoCompSetMaxWidth 3075
+#define wxStyledTextCtrl_AutoCompGetMaxWidth 3076
+#define wxStyledTextCtrl_AutoCompSetMaxHeight 3077
+#define wxStyledTextCtrl_AutoCompGetMaxHeight 3078
+#define wxStyledTextCtrl_SetIndent 3079
+#define wxStyledTextCtrl_GetIndent 3080
+#define wxStyledTextCtrl_SetUseTabs 3081
+#define wxStyledTextCtrl_GetUseTabs 3082
+#define wxStyledTextCtrl_SetLineIndentation 3083
+#define wxStyledTextCtrl_GetLineIndentation 3084
+#define wxStyledTextCtrl_GetLineIndentPosition 3085
+#define wxStyledTextCtrl_GetColumn 3086
+#define wxStyledTextCtrl_SetUseHorizontalScrollBar 3087
+#define wxStyledTextCtrl_GetUseHorizontalScrollBar 3088
+#define wxStyledTextCtrl_SetIndentationGuides 3089
+#define wxStyledTextCtrl_GetIndentationGuides 3090
+#define wxStyledTextCtrl_SetHighlightGuide 3091
+#define wxStyledTextCtrl_GetHighlightGuide 3092
+#define wxStyledTextCtrl_GetLineEndPosition 3093
+#define wxStyledTextCtrl_GetCodePage 3094
+#define wxStyledTextCtrl_GetCaretForeground 3095
+#define wxStyledTextCtrl_GetReadOnly 3096
+#define wxStyledTextCtrl_SetCurrentPos 3097
+#define wxStyledTextCtrl_SetSelectionStart 3098
+#define wxStyledTextCtrl_GetSelectionStart 3099
+#define wxStyledTextCtrl_SetSelectionEnd 3100
+#define wxStyledTextCtrl_GetSelectionEnd 3101
+#define wxStyledTextCtrl_SetPrintMagnification 3102
+#define wxStyledTextCtrl_GetPrintMagnification 3103
+#define wxStyledTextCtrl_SetPrintColourMode 3104
+#define wxStyledTextCtrl_GetPrintColourMode 3105
+#define wxStyledTextCtrl_FindText 3106
+#define wxStyledTextCtrl_FormatRange 3107
+#define wxStyledTextCtrl_GetFirstVisibleLine 3108
+#define wxStyledTextCtrl_GetLine 3109
+#define wxStyledTextCtrl_GetLineCount 3110
+#define wxStyledTextCtrl_SetMarginLeft 3111
+#define wxStyledTextCtrl_GetMarginLeft 3112
+#define wxStyledTextCtrl_SetMarginRight 3113
+#define wxStyledTextCtrl_GetMarginRight 3114
+#define wxStyledTextCtrl_GetModify 3115
+#define wxStyledTextCtrl_SetSelection 3116
+#define wxStyledTextCtrl_GetSelectedText 3117
+#define wxStyledTextCtrl_GetTextRange 3118
+#define wxStyledTextCtrl_HideSelection 3119
+#define wxStyledTextCtrl_LineFromPosition 3120
+#define wxStyledTextCtrl_PositionFromLine 3121
+#define wxStyledTextCtrl_LineScroll 3122
+#define wxStyledTextCtrl_EnsureCaretVisible 3123
+#define wxStyledTextCtrl_ReplaceSelection 3124
+#define wxStyledTextCtrl_SetReadOnly 3125
+#define wxStyledTextCtrl_CanPaste 3126
+#define wxStyledTextCtrl_CanUndo 3127
+#define wxStyledTextCtrl_EmptyUndoBuffer 3128
+#define wxStyledTextCtrl_Undo 3129
+#define wxStyledTextCtrl_Cut 3130
+#define wxStyledTextCtrl_Copy 3131
+#define wxStyledTextCtrl_Paste 3132
+#define wxStyledTextCtrl_Clear 3133
+#define wxStyledTextCtrl_SetText 3134
+#define wxStyledTextCtrl_GetText 3135
+#define wxStyledTextCtrl_GetTextLength 3136
+#define wxStyledTextCtrl_GetOvertype 3137
+#define wxStyledTextCtrl_SetCaretWidth 3138
+#define wxStyledTextCtrl_GetCaretWidth 3139
+#define wxStyledTextCtrl_SetTargetStart 3140
+#define wxStyledTextCtrl_GetTargetStart 3141
+#define wxStyledTextCtrl_SetTargetEnd 3142
+#define wxStyledTextCtrl_GetTargetEnd 3143
+#define wxStyledTextCtrl_ReplaceTarget 3144
+#define wxStyledTextCtrl_SearchInTarget 3145
+#define wxStyledTextCtrl_SetSearchFlags 3146
+#define wxStyledTextCtrl_GetSearchFlags 3147
+#define wxStyledTextCtrl_CallTipShow 3148
+#define wxStyledTextCtrl_CallTipCancel 3149
+#define wxStyledTextCtrl_CallTipActive 3150
+#define wxStyledTextCtrl_CallTipPosAtStart 3151
+#define wxStyledTextCtrl_CallTipSetHighlight 3152
+#define wxStyledTextCtrl_CallTipSetBackground 3153
+#define wxStyledTextCtrl_CallTipSetForeground 3154
+#define wxStyledTextCtrl_CallTipSetForegroundHighlight 3155
+#define wxStyledTextCtrl_CallTipUseStyle 3156
+#define wxStyledTextCtrl_VisibleFromDocLine 3157
+#define wxStyledTextCtrl_DocLineFromVisible 3158
+#define wxStyledTextCtrl_WrapCount 3159
+#define wxStyledTextCtrl_SetFoldLevel 3160
+#define wxStyledTextCtrl_GetFoldLevel 3161
+#define wxStyledTextCtrl_GetLastChild 3162
+#define wxStyledTextCtrl_GetFoldParent 3163
+#define wxStyledTextCtrl_ShowLines 3164
+#define wxStyledTextCtrl_HideLines 3165
+#define wxStyledTextCtrl_GetLineVisible 3166
+#define wxStyledTextCtrl_SetFoldExpanded 3167
+#define wxStyledTextCtrl_GetFoldExpanded 3168
+#define wxStyledTextCtrl_ToggleFold 3169
+#define wxStyledTextCtrl_EnsureVisible 3170
+#define wxStyledTextCtrl_SetFoldFlags 3171
+#define wxStyledTextCtrl_EnsureVisibleEnforcePolicy 3172
+#define wxStyledTextCtrl_SetTabIndents 3173
+#define wxStyledTextCtrl_GetTabIndents 3174
+#define wxStyledTextCtrl_SetBackSpaceUnIndents 3175
+#define wxStyledTextCtrl_GetBackSpaceUnIndents 3176
+#define wxStyledTextCtrl_SetMouseDwellTime 3177
+#define wxStyledTextCtrl_GetMouseDwellTime 3178
+#define wxStyledTextCtrl_WordStartPosition 3179
+#define wxStyledTextCtrl_WordEndPosition 3180
+#define wxStyledTextCtrl_SetWrapMode 3181
+#define wxStyledTextCtrl_GetWrapMode 3182
+#define wxStyledTextCtrl_SetWrapVisualFlags 3183
+#define wxStyledTextCtrl_GetWrapVisualFlags 3184
+#define wxStyledTextCtrl_SetWrapVisualFlagsLocation 3185
+#define wxStyledTextCtrl_GetWrapVisualFlagsLocation 3186
+#define wxStyledTextCtrl_SetWrapStartIndent 3187
+#define wxStyledTextCtrl_GetWrapStartIndent 3188
+#define wxStyledTextCtrl_SetLayoutCache 3189
+#define wxStyledTextCtrl_GetLayoutCache 3190
+#define wxStyledTextCtrl_SetScrollWidth 3191
+#define wxStyledTextCtrl_GetScrollWidth 3192
+#define wxStyledTextCtrl_TextWidth 3193
+#define wxStyledTextCtrl_GetEndAtLastLine 3194
+#define wxStyledTextCtrl_TextHeight 3195
+#define wxStyledTextCtrl_SetUseVerticalScrollBar 3196
+#define wxStyledTextCtrl_GetUseVerticalScrollBar 3197
+#define wxStyledTextCtrl_AppendText 3198
+#define wxStyledTextCtrl_GetTwoPhaseDraw 3199
+#define wxStyledTextCtrl_SetTwoPhaseDraw 3200
+#define wxStyledTextCtrl_TargetFromSelection 3201
+#define wxStyledTextCtrl_LinesJoin 3202
+#define wxStyledTextCtrl_LinesSplit 3203
+#define wxStyledTextCtrl_SetFoldMarginColour 3204
+#define wxStyledTextCtrl_SetFoldMarginHiColour 3205
+#define wxStyledTextCtrl_LineDown 3206
+#define wxStyledTextCtrl_LineDownExtend 3207
+#define wxStyledTextCtrl_LineUp 3208
+#define wxStyledTextCtrl_LineUpExtend 3209
+#define wxStyledTextCtrl_CharLeft 3210
+#define wxStyledTextCtrl_CharLeftExtend 3211
+#define wxStyledTextCtrl_CharRight 3212
+#define wxStyledTextCtrl_CharRightExtend 3213
+#define wxStyledTextCtrl_WordLeft 3214
+#define wxStyledTextCtrl_WordLeftExtend 3215
+#define wxStyledTextCtrl_WordRight 3216
+#define wxStyledTextCtrl_WordRightExtend 3217
+#define wxStyledTextCtrl_Home 3218
+#define wxStyledTextCtrl_HomeExtend 3219
+#define wxStyledTextCtrl_LineEnd 3220
+#define wxStyledTextCtrl_LineEndExtend 3221
+#define wxStyledTextCtrl_DocumentStart 3222
+#define wxStyledTextCtrl_DocumentStartExtend 3223
+#define wxStyledTextCtrl_DocumentEnd 3224
+#define wxStyledTextCtrl_DocumentEndExtend 3225
+#define wxStyledTextCtrl_PageUp 3226
+#define wxStyledTextCtrl_PageUpExtend 3227
+#define wxStyledTextCtrl_PageDown 3228
+#define wxStyledTextCtrl_PageDownExtend 3229
+#define wxStyledTextCtrl_EditToggleOvertype 3230
+#define wxStyledTextCtrl_Cancel 3231
+#define wxStyledTextCtrl_DeleteBack 3232
+#define wxStyledTextCtrl_Tab 3233
+#define wxStyledTextCtrl_BackTab 3234
+#define wxStyledTextCtrl_NewLine 3235
+#define wxStyledTextCtrl_FormFeed 3236
+#define wxStyledTextCtrl_VCHome 3237
+#define wxStyledTextCtrl_VCHomeExtend 3238
+#define wxStyledTextCtrl_ZoomIn 3239
+#define wxStyledTextCtrl_ZoomOut 3240
+#define wxStyledTextCtrl_DelWordLeft 3241
+#define wxStyledTextCtrl_DelWordRight 3242
+#define wxStyledTextCtrl_LineCut 3243
+#define wxStyledTextCtrl_LineDelete 3244
+#define wxStyledTextCtrl_LineTranspose 3245
+#define wxStyledTextCtrl_LineDuplicate 3246
+#define wxStyledTextCtrl_LowerCase 3247
+#define wxStyledTextCtrl_UpperCase 3248
+#define wxStyledTextCtrl_LineScrollDown 3249
+#define wxStyledTextCtrl_LineScrollUp 3250
+#define wxStyledTextCtrl_DeleteBackNotLine 3251
+#define wxStyledTextCtrl_HomeDisplay 3252
+#define wxStyledTextCtrl_HomeDisplayExtend 3253
+#define wxStyledTextCtrl_LineEndDisplay 3254
+#define wxStyledTextCtrl_LineEndDisplayExtend 3255
+#define wxStyledTextCtrl_HomeWrapExtend 3256
+#define wxStyledTextCtrl_LineEndWrap 3257
+#define wxStyledTextCtrl_LineEndWrapExtend 3258
+#define wxStyledTextCtrl_VCHomeWrap 3259
+#define wxStyledTextCtrl_VCHomeWrapExtend 3260
+#define wxStyledTextCtrl_LineCopy 3261
+#define wxStyledTextCtrl_MoveCaretInsideView 3262
+#define wxStyledTextCtrl_LineLength 3263
+#define wxStyledTextCtrl_BraceHighlight 3264
+#define wxStyledTextCtrl_BraceBadLight 3265
+#define wxStyledTextCtrl_BraceMatch 3266
+#define wxStyledTextCtrl_GetViewEOL 3267
+#define wxStyledTextCtrl_SetViewEOL 3268
+#define wxStyledTextCtrl_SetModEventMask 3269
+#define wxStyledTextCtrl_GetEdgeColumn 3270
+#define wxStyledTextCtrl_SetEdgeColumn 3271
+#define wxStyledTextCtrl_GetEdgeMode 3272
+#define wxStyledTextCtrl_GetEdgeColour 3273
+#define wxStyledTextCtrl_SetEdgeColour 3274
+#define wxStyledTextCtrl_SearchAnchor 3275
+#define wxStyledTextCtrl_SearchNext 3276
+#define wxStyledTextCtrl_SearchPrev 3277
+#define wxStyledTextCtrl_LinesOnScreen 3278
+#define wxStyledTextCtrl_UsePopUp 3279
+#define wxStyledTextCtrl_SelectionIsRectangle 3280
+#define wxStyledTextCtrl_SetZoom 3281
+#define wxStyledTextCtrl_GetZoom 3282
+#define wxStyledTextCtrl_GetModEventMask 3283
+#define wxStyledTextCtrl_SetSTCFocus 3284
+#define wxStyledTextCtrl_GetSTCFocus 3285
+#define wxStyledTextCtrl_SetStatus 3286
+#define wxStyledTextCtrl_GetStatus 3287
+#define wxStyledTextCtrl_SetMouseDownCaptures 3288
+#define wxStyledTextCtrl_GetMouseDownCaptures 3289
+#define wxStyledTextCtrl_SetSTCCursor 3290
+#define wxStyledTextCtrl_GetSTCCursor 3291
+#define wxStyledTextCtrl_SetControlCharSymbol 3292
+#define wxStyledTextCtrl_GetControlCharSymbol 3293
+#define wxStyledTextCtrl_WordPartLeft 3294
+#define wxStyledTextCtrl_WordPartLeftExtend 3295
+#define wxStyledTextCtrl_WordPartRight 3296
+#define wxStyledTextCtrl_WordPartRightExtend 3297
+#define wxStyledTextCtrl_SetVisiblePolicy 3298
+#define wxStyledTextCtrl_DelLineLeft 3299
+#define wxStyledTextCtrl_DelLineRight 3300
+#define wxStyledTextCtrl_GetXOffset 3301
+#define wxStyledTextCtrl_ChooseCaretX 3302
+#define wxStyledTextCtrl_SetXCaretPolicy 3303
+#define wxStyledTextCtrl_SetYCaretPolicy 3304
+#define wxStyledTextCtrl_GetPrintWrapMode 3305
+#define wxStyledTextCtrl_SetHotspotActiveForeground 3306
+#define wxStyledTextCtrl_SetHotspotActiveBackground 3307
+#define wxStyledTextCtrl_SetHotspotActiveUnderline 3308
+#define wxStyledTextCtrl_SetHotspotSingleLine 3309
+#define wxStyledTextCtrl_ParaDownExtend 3310
+#define wxStyledTextCtrl_ParaUp 3311
+#define wxStyledTextCtrl_ParaUpExtend 3312
+#define wxStyledTextCtrl_PositionBefore 3313
+#define wxStyledTextCtrl_PositionAfter 3314
+#define wxStyledTextCtrl_CopyRange 3315
+#define wxStyledTextCtrl_CopyText 3316
+#define wxStyledTextCtrl_SetSelectionMode 3317
+#define wxStyledTextCtrl_GetSelectionMode 3318
+#define wxStyledTextCtrl_LineDownRectExtend 3319
+#define wxStyledTextCtrl_LineUpRectExtend 3320
+#define wxStyledTextCtrl_CharLeftRectExtend 3321
+#define wxStyledTextCtrl_CharRightRectExtend 3322
+#define wxStyledTextCtrl_HomeRectExtend 3323
+#define wxStyledTextCtrl_VCHomeRectExtend 3324
+#define wxStyledTextCtrl_LineEndRectExtend 3325
+#define wxStyledTextCtrl_PageUpRectExtend 3326
+#define wxStyledTextCtrl_PageDownRectExtend 3327
+#define wxStyledTextCtrl_StutteredPageUp 3328
+#define wxStyledTextCtrl_StutteredPageUpExtend 3329
+#define wxStyledTextCtrl_StutteredPageDown 3330
+#define wxStyledTextCtrl_StutteredPageDownExtend 3331
+#define wxStyledTextCtrl_WordLeftEnd 3332
+#define wxStyledTextCtrl_WordLeftEndExtend 3333
+#define wxStyledTextCtrl_WordRightEnd 3334
+#define wxStyledTextCtrl_WordRightEndExtend 3335
+#define wxStyledTextCtrl_SetWhitespaceChars 3336
+#define wxStyledTextCtrl_SetCharsDefault 3337
+#define wxStyledTextCtrl_AutoCompGetCurrent 3338
+#define wxStyledTextCtrl_Allocate 3339
+#define wxStyledTextCtrl_FindColumn 3340
+#define wxStyledTextCtrl_GetCaretSticky 3341
+#define wxStyledTextCtrl_SetCaretSticky 3342
+#define wxStyledTextCtrl_ToggleCaretSticky 3343
+#define wxStyledTextCtrl_SetPasteConvertEndings 3344
+#define wxStyledTextCtrl_GetPasteConvertEndings 3345
+#define wxStyledTextCtrl_SelectionDuplicate 3346
+#define wxStyledTextCtrl_SetCaretLineBackAlpha 3347
+#define wxStyledTextCtrl_GetCaretLineBackAlpha 3348
+#define wxStyledTextCtrl_StartRecord 3349
+#define wxStyledTextCtrl_StopRecord 3350
+#define wxStyledTextCtrl_SetLexer 3351
+#define wxStyledTextCtrl_GetLexer 3352
+#define wxStyledTextCtrl_Colourise 3353
+#define wxStyledTextCtrl_SetProperty 3354
+#define wxStyledTextCtrl_SetKeyWords 3355
+#define wxStyledTextCtrl_SetLexerLanguage 3356
+#define wxStyledTextCtrl_GetProperty 3357
+#define wxStyledTextCtrl_GetStyleBitsNeeded 3358
+#define wxStyledTextCtrl_GetCurrentLine 3359
+#define wxStyledTextCtrl_StyleSetSpec 3360
+#define wxStyledTextCtrl_StyleSetFont 3361
+#define wxStyledTextCtrl_StyleSetFontAttr 3362
+#define wxStyledTextCtrl_StyleSetCharacterSet 3363
+#define wxStyledTextCtrl_StyleSetFontEncoding 3364
+#define wxStyledTextCtrl_CmdKeyExecute 3365
+#define wxStyledTextCtrl_SetMargins 3366
+#define wxStyledTextCtrl_GetSelection 3367
+#define wxStyledTextCtrl_PointFromPosition 3368
+#define wxStyledTextCtrl_ScrollToLine 3369
+#define wxStyledTextCtrl_ScrollToColumn 3370
+#define wxStyledTextCtrl_SendMsg 3371
+#define wxStyledTextCtrl_SetVScrollBar 3372
+#define wxStyledTextCtrl_SetHScrollBar 3373
+#define wxStyledTextCtrl_GetLastKeydownProcessed 3374
+#define wxStyledTextCtrl_SetLastKeydownProcessed 3375
+#define wxStyledTextCtrl_SaveFile 3376
+#define wxStyledTextCtrl_LoadFile 3377
+#define wxStyledTextCtrl_DoDragOver 3378
+#define wxStyledTextCtrl_DoDropText 3379
+#define wxStyledTextCtrl_GetUseAntiAliasing 3380
+#define wxStyledTextCtrl_AddTextRaw 3381
+#define wxStyledTextCtrl_InsertTextRaw 3382
+#define wxStyledTextCtrl_GetCurLineRaw 3383
+#define wxStyledTextCtrl_GetLineRaw 3384
+#define wxStyledTextCtrl_GetSelectedTextRaw 3385
+#define wxStyledTextCtrl_GetTextRangeRaw 3386
+#define wxStyledTextCtrl_SetTextRaw 3387
+#define wxStyledTextCtrl_GetTextRaw 3388
+#define wxStyledTextCtrl_AppendTextRaw 3389
+#define wxArtProvider_GetBitmap 3390
+#define wxArtProvider_GetIcon 3391
+#define wxTreeEvent_GetKeyCode 3392
+#define wxTreeEvent_GetItem 3393
+#define wxTreeEvent_GetKeyEvent 3394
+#define wxTreeEvent_GetLabel 3395
+#define wxTreeEvent_GetOldItem 3396
+#define wxTreeEvent_GetPoint 3397
+#define wxTreeEvent_IsEditCancelled 3398
+#define wxTreeEvent_SetToolTip 3399
+#define wxNotebookEvent_GetOldSelection 3400
+#define wxNotebookEvent_GetSelection 3401
+#define wxNotebookEvent_SetOldSelection 3402
+#define wxNotebookEvent_SetSelection 3403
+#define wxFileDataObject_new 3404
+#define wxFileDataObject_AddFile 3405
+#define wxFileDataObject_GetFilenames 3406
+#define wxFileDataObject_destroy 3407
+#define wxTextDataObject_new 3408
+#define wxTextDataObject_GetTextLength 3409
+#define wxTextDataObject_GetText 3410
+#define wxTextDataObject_SetText 3411
+#define wxTextDataObject_destroy 3412
+#define wxBitmapDataObject_new_1_1 3413
+#define wxBitmapDataObject_new_1_0 3414
+#define wxBitmapDataObject_GetBitmap 3415
+#define wxBitmapDataObject_SetBitmap 3416
+#define wxBitmapDataObject_destroy 3417
+#define wxClipboard_new 3419
+#define wxClipboard_destruct 3420
+#define wxClipboard_AddData 3421
+#define wxClipboard_Clear 3422
+#define wxClipboard_Close 3423
+#define wxClipboard_Flush 3424
+#define wxClipboard_GetData 3425
+#define wxClipboard_IsOpened 3426
+#define wxClipboard_Open 3427
+#define wxClipboard_SetData 3428
+#define wxClipboard_UsePrimarySelection 3430
+#define wxClipboard_IsSupported 3431
+#define wxClipboard_Get 3432
+#define wxSpinEvent_GetPosition 3433
+#define wxSpinEvent_SetPosition 3434
+#define wxSplitterWindow_new_0 3435
+#define wxSplitterWindow_new_2 3436
+#define wxSplitterWindow_destruct 3437
+#define wxSplitterWindow_Create 3438
+#define wxSplitterWindow_GetMinimumPaneSize 3439
+#define wxSplitterWindow_GetSashGravity 3440
+#define wxSplitterWindow_GetSashPosition 3441
+#define wxSplitterWindow_GetSplitMode 3442
+#define wxSplitterWindow_GetWindow1 3443
+#define wxSplitterWindow_GetWindow2 3444
+#define wxSplitterWindow_Initialize 3445
+#define wxSplitterWindow_IsSplit 3446
+#define wxSplitterWindow_ReplaceWindow 3447
+#define wxSplitterWindow_SetSashGravity 3448
+#define wxSplitterWindow_SetSashPosition 3449
+#define wxSplitterWindow_SetSashSize 3450
+#define wxSplitterWindow_SetMinimumPaneSize 3451
+#define wxSplitterWindow_SetSplitMode 3452
+#define wxSplitterWindow_SplitHorizontally 3453
+#define wxSplitterWindow_SplitVertically 3454
+#define wxSplitterWindow_Unsplit 3455
+#define wxSplitterWindow_UpdateSize 3456
+#define wxSplitterEvent_GetSashPosition 3457
+#define wxSplitterEvent_GetX 3458
+#define wxSplitterEvent_GetY 3459
+#define wxSplitterEvent_GetWindowBeingRemoved 3460
+#define wxSplitterEvent_SetSashPosition 3461
+#define wxHtmlWindow_new_0 3462
+#define wxHtmlWindow_new_2 3463
+#define wxHtmlWindow_AppendToPage 3464
+#define wxHtmlWindow_GetOpenedAnchor 3465
+#define wxHtmlWindow_GetOpenedPage 3466
+#define wxHtmlWindow_GetOpenedPageTitle 3467
+#define wxHtmlWindow_GetRelatedFrame 3468
+#define wxHtmlWindow_HistoryBack 3469
+#define wxHtmlWindow_HistoryCanBack 3470
+#define wxHtmlWindow_HistoryCanForward 3471
+#define wxHtmlWindow_HistoryClear 3472
+#define wxHtmlWindow_HistoryForward 3473
+#define wxHtmlWindow_LoadFile 3474
+#define wxHtmlWindow_LoadPage 3475
+#define wxHtmlWindow_SelectAll 3476
+#define wxHtmlWindow_SelectionToText 3477
+#define wxHtmlWindow_SelectLine 3478
+#define wxHtmlWindow_SelectWord 3479
+#define wxHtmlWindow_SetBorders 3480
+#define wxHtmlWindow_SetFonts 3481
+#define wxHtmlWindow_SetPage 3482
+#define wxHtmlWindow_SetRelatedFrame 3483
+#define wxHtmlWindow_SetRelatedStatusBar 3484
+#define wxHtmlWindow_ToText 3485
+#define wxHtmlWindow_destroy 3486
+#define wxHtmlLinkEvent_GetLinkInfo 3487
+#define wxSystemSettings_GetColour 3488
+#define wxSystemSettings_GetFont 3489
+#define wxSystemSettings_GetMetric 3490
+#define wxSystemSettings_GetScreenType 3491
+#define wxAuiNotebookEvent_SetSelection 3492
+#define wxAuiNotebookEvent_GetSelection 3493
+#define wxAuiNotebookEvent_SetOldSelection 3494
+#define wxAuiNotebookEvent_GetOldSelection 3495
+#define wxAuiNotebookEvent_SetDragSource 3496
+#define wxAuiNotebookEvent_GetDragSource 3497
+#define wxAuiManagerEvent_SetManager 3498
+#define wxAuiManagerEvent_GetManager 3499
+#define wxAuiManagerEvent_SetPane 3500
+#define wxAuiManagerEvent_GetPane 3501
+#define wxAuiManagerEvent_SetButton 3502
+#define wxAuiManagerEvent_GetButton 3503
+#define wxAuiManagerEvent_SetDC 3504
+#define wxAuiManagerEvent_GetDC 3505
+#define wxAuiManagerEvent_Veto 3506
+#define wxAuiManagerEvent_GetVeto 3507
+#define wxAuiManagerEvent_SetCanVeto 3508
+#define wxAuiManagerEvent_CanVeto 3509
+#define wxLogNull_new 3510
+#define wxLogNull_destroy 3511
diff --git a/lib/wx/c_src/wxePrintout.cpp b/lib/wx/c_src/wxePrintout.cpp
index ea1c76edcc..90959df379 100644
--- a/lib/wx/c_src/wxePrintout.cpp
+++ b/lib/wx/c_src/wxePrintout.cpp
@@ -1,41 +1,62 @@
/*
* %CopyrightBegin%
- *
- * Copyright Ericsson AB 2008-2009. All Rights Reserved.
- *
+ *
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
+ *
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
* compliance with the License. You should have received a copy of the
* Erlang Public License along with this software. If not, it can be
* retrieved online at http://www.erlang.org/.
- *
+ *
* Software distributed under the License is distributed on an "AS IS"
* basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
* the License for the specific language governing rights and limitations
* under the License.
- *
- * %CopyrightEnd%
+ *
+ * %CopyrightEnd%
*/
#include <wx/wx.h>
#include "wxe_impl.h"
#include "wxe_return.h"
+#include "gen/wxe_macros.h"
+#include "gen/wxe_derived_dest.h"
/* *****************************************************************/
/* Special Class impls */
+#define INVOKE_CALLBACK_INIT(port, callback, class_str) \
+ { \
+ wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port); \
+ wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false); \
+ rt.addInt(callback); \
+ rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), class_str);
+
+#define INVOKE_CALLBACK_END(port, args) \
+ rt.endList(1 + (args)); \
+ rt.addAtom("_wx_invoke_cb_"); \
+ rt.addTupleCount(3); \
+ rt.send(); \
+ handle_event_callback(port, memenv->owner); \
+ }
+
+#define INVOKE_CALLBACK(port, callback, class_str) \
+ INVOKE_CALLBACK_INIT(port, callback, class_str); \
+ INVOKE_CALLBACK_END(port, 0)
+/* *****************************************************************/
/* Printing special */
wxEPrintout::~wxEPrintout() {
- clear_cb(onPrintPage);
- clear_cb(onPreparePrinting);
- clear_cb(onBeginPrinting);
- clear_cb(onEndPrinting);
- clear_cb(onBeginDocument);
- clear_cb(onEndDocument);
- clear_cb(hasPage);
- clear_cb(getPageInfo);
+ clear_cb(port, onPrintPage);
+ clear_cb(port, onPreparePrinting);
+ clear_cb(port, onBeginPrinting);
+ clear_cb(port, onEndPrinting);
+ clear_cb(port, onBeginDocument);
+ clear_cb(port, onEndDocument);
+ clear_cb(port, hasPage);
+ clear_cb(port, getPageInfo);
((WxeApp *)wxTheApp)->clearPtr(this);
}
@@ -43,73 +64,44 @@ wxEPrintout::~wxEPrintout() {
bool wxEPrintout::OnBeginDocument(int startPage, int endPage)
{
if(onBeginDocument) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- char * bp = ((WxeApp *) wxTheApp)->cb_buff;
-
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(onBeginDocument);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
+ INVOKE_CALLBACK_INIT(port, onBeginDocument, "wxPrintout");
rt.addInt(startPage);
rt.addInt(endPage);
- rt.endList(3);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
- return *(int*) bp;
- } else {
- return wxPrintout::OnBeginDocument(startPage,endPage);
- }
+ INVOKE_CALLBACK_END(port, 2);
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ int res = * (int*) ((WxeApp *) wxTheApp)->cb_buff;
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return res;
+ }
+ }
+ return wxPrintout::OnBeginDocument(startPage,endPage);
}
-void wxEPrintout::OnEndDocument()
+void wxEPrintout::OnEndDocument()
{
if(onEndDocument) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(onEndDocument);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
- rt.endList(1);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
+ INVOKE_CALLBACK(port, onEndDocument, "wxPrintout");
} else {
wxPrintout::OnEndDocument();
- }
+ }
}
-void wxEPrintout::OnBeginPrinting()
+void wxEPrintout::OnBeginPrinting()
{
if(onBeginPrinting) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(onBeginPrinting);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
- rt.endList(1);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
+ INVOKE_CALLBACK(port, onBeginPrinting, "wxPrintout");
} else {
wxPrintout::OnBeginPrinting();
- }
+ }
}
-void wxEPrintout::OnEndPrinting()
+void wxEPrintout::OnEndPrinting()
{
if(onEndPrinting) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(onEndPrinting);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
- rt.endList(1);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
+ INVOKE_CALLBACK(port, onEndPrinting, "wxPrintout");
} else {
wxPrintout::OnEndPrinting();
}
@@ -119,92 +111,133 @@ void wxEPrintout::OnPreparePrinting()
{
if(onPreparePrinting) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(onPreparePrinting);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
- rt.endList(1);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
+ INVOKE_CALLBACK(port, onPreparePrinting, "wxPrintout");
} else {
wxPrintout::OnPreparePrinting();
- }
+ }
}
-bool wxEPrintout::HasPage(int page)
+bool wxEPrintout::HasPage(int page)
{
if(hasPage) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(hasPage);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
+ INVOKE_CALLBACK_INIT(port, hasPage, "wxPrintout");
rt.addInt(page);
- rt.endList(2);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- char * bp = ((WxeApp *) wxTheApp)->cb_buff;
- handle_callback_batch(port);
- return *(int*) bp;
- } else {
- return wxPrintout::HasPage(page);
- }
+ INVOKE_CALLBACK_END(port, 1);
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ int res = * (int*) ((WxeApp *) wxTheApp)->cb_buff;
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return res;
+ }
+ }
+ return wxPrintout::HasPage(page);
}
bool wxEPrintout::OnPrintPage(int page)
{
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(onPrintPage);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
+ INVOKE_CALLBACK_INIT(port, onPrintPage, "wxPrintout");
rt.addInt(page);
- rt.endList(2);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
- //fprintf(stderr,"%d ", __LINE__);handle_callback_batch(port); fprintf(stderr,"%d\r\n", __LINE__);
- char * bp = ((WxeApp *) wxTheApp)->cb_buff;
- return *(int*) bp;
+ INVOKE_CALLBACK_END(port, 1);
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ int res = * (int*) ((WxeApp *) wxTheApp)->cb_buff;
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return res;
+ }
+ return FALSE;
}
-
+
void wxEPrintout::GetPageInfo(int *minPage, int *maxPage, int *pageFrom, int *pageTo)
{
if(getPageInfo) {
- wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
- wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- rt.addInt(getPageInfo);
- rt.addRef(((WxeApp *) wxTheApp)->getRef((void *)this, memenv), "wxPrintout");
- rt.endList(1);
- rt.addAtom("_wx_invoke_cb_");
- rt.addTupleCount(3);
- rt.send();
- handle_callback_batch(port);
- //fprintf(stderr,"%d ", __LINE__);handle_callback_batch(port); fprintf(stderr,"%d\r\n", __LINE__);
+ INVOKE_CALLBACK(port, getPageInfo, "wxPrintout");
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ char * bp = ((WxeApp *) wxTheApp)->cb_buff;
+ *minPage = *(int *) bp; bp += 4;
+ *maxPage = *(int *) bp; bp += 4;
+ *pageFrom = *(int *) bp; bp += 4;
+ *pageTo = *(int *) bp; bp += 4;
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ }
+ }
+ wxPrintout::GetPageInfo(minPage, maxPage, pageFrom, pageTo);
+}
+
+/* *****************************************************************/
+// ListCtrl with callbacks for VIRTUAL_TABLES
+
+wxString EwxListCtrl::OnGetItemText(long item, long col) const {
+ if(onGetItemText) {
+ INVOKE_CALLBACK_INIT(port, onGetItemText, "wxListCtrl");
+ rt.addInt(item);
+ rt.addInt(col);
+ INVOKE_CALLBACK_END(port, 2);
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ char * bp = ((WxeApp *) wxTheApp)->cb_buff;
+ wxString str = wxString(bp, wxConvUTF8);
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return str;
+ }
+ }
+ return wxT("OnGetItemText not correctly defined");
+}
+wxListItemAttr* EwxListCtrl::OnGetItemAttr(long item) const {
+ if(onGetItemAttr) {
+ INVOKE_CALLBACK_INIT(port, onGetItemAttr, "wxListCtrl");
+ rt.addInt(item);
+ INVOKE_CALLBACK_END(port, 1);
char * bp = ((WxeApp *) wxTheApp)->cb_buff;
- *minPage = *(int *) bp; bp += 4;
- *maxPage = *(int *) bp; bp += 4;
- *pageFrom = *(int *) bp; bp += 4;
- *pageTo = *(int *) bp; bp += 4;
- } else {
- wxPrintout::GetPageInfo(minPage, maxPage, pageFrom, pageTo);
+ wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
+ if(bp) {
+ wxListItemAttr * result = (wxListItemAttr *)((WxeApp *) wxTheApp)->getPtr(bp, memenv);
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return result;
+ }
}
+ return NULL;
+}
+
+int EwxListCtrl::OnGetItemImage(long item) const {
+ return OnGetItemColumnImage(item, 0);
}
-void wxEPrintout::clear_cb(int callback)
+int EwxListCtrl::OnGetItemColumnImage(long item, long col) const {
+ if(onGetItemColumnImage) {
+ INVOKE_CALLBACK_INIT(port, onGetItemColumnImage, "wxListCtrl");
+ rt.addInt(item);
+ rt.addInt(col);
+ INVOKE_CALLBACK_END(port, 2);
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ int res = * (int*) ((WxeApp *) wxTheApp)->cb_buff;
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return res;
+ }
+ }
+ return -1;
+}
+
+EwxListCtrl::~EwxListCtrl() {
+ clear_cb(port, onGetItemText);
+ clear_cb(port, onGetItemAttr);
+ clear_cb(port, onGetItemColumnImage);
+ ((WxeApp *)wxTheApp)->clearPtr(this);
+}
+// tools
+
+void clear_cb(ErlDrvPort port, int callback)
{
if(callback > 0) {
wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(port);
wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
- // NOTE: Remove this later when changing from funs to gen_server
rt.addAtom("wx_delete_cb");
rt.addInt(callback);
rt.addTupleCount(2);
rt.send();
}
}
-
diff --git a/lib/wx/c_src/wxe_impl.cpp b/lib/wx/c_src/wxe_impl.cpp
index 365fb691a1..95755978f1 100644
--- a/lib/wx/c_src/wxe_impl.cpp
+++ b/lib/wx/c_src/wxe_impl.cpp
@@ -270,6 +270,7 @@ bool WxeApp::OnInit()
global_me = new wxeMemEnv();
wxe_batch = new wxList;
wxe_batch_cb_saved = new wxList;
+ cb_buff = NULL;
wxIdleEvent::SetMode(wxIDLE_PROCESS_SPECIFIED);
@@ -330,24 +331,14 @@ void handle_event_callback(ErlDrvPort port, ErlDrvTermData process)
driver_monitor_process(port, process, &monitor);
// Should we be able to handle commands when recursing? probably
erl_drv_mutex_lock(wxe_batch_locker_m);
- //fprintf(stderr, "\r\nCB Start ");fflush(stderr);
+ // fprintf(stderr, "\r\nCB EV Start ");fflush(stderr);
app->dispatch_cb(wxe_batch, wxe_batch_cb_saved, process);
- //fprintf(stderr, ".. done \r\n");fflush(stderr);
+ // fprintf(stderr, ".. done \r\n");fflush(stderr);
wxe_batch_caller = 0;
erl_drv_mutex_unlock(wxe_batch_locker_m);
driver_demonitor_process(port, &monitor);
}
-void handle_callback_batch(ErlDrvPort port)
-{
- WxeApp * app = (WxeApp *) wxTheApp;
- // Should we be able to handle commands when recursing? probably
- erl_drv_mutex_lock(wxe_batch_locker_m);
- app->dispatch(wxe_batch, 0, WXE_CALLBACK);
- wxe_batch_caller = 0;
- erl_drv_mutex_unlock(wxe_batch_locker_m);
-}
-
// Called by wx thread
void WxeApp::idle(wxIdleEvent& event) {
dispatch_cmds();
@@ -394,7 +385,10 @@ int WxeApp::dispatch(wxList * batch, int blevel, int list_type)
case WXE_CB_RETURN:
// erl_drv_mutex_unlock(wxe_batch_locker_m); should be called after
// whatever cleaning is necessary
- memcpy(cb_buff, event->buffer, event->len);
+ if(event->len > 0) {
+ cb_buff = (char *) driver_alloc(event->len);
+ memcpy(cb_buff, event->buffer, event->len);
+ }
return blevel;
default:
erl_drv_mutex_unlock(wxe_batch_locker_m);
@@ -447,7 +441,10 @@ void WxeApp::dispatch_cb(wxList * batch, wxList * temp, ErlDrvTermData process)
case WXE_DEBUG_PING:
break;
case WXE_CB_RETURN:
- memcpy(cb_buff, event->buffer, event->len);
+ if(event->len > 0) {
+ cb_buff = (char *) driver_alloc(event->len);
+ memcpy(cb_buff, event->buffer, event->len);
+ }
callback_returned = 1;
return;
case WXE_CB_START:
@@ -469,7 +466,7 @@ void WxeApp::dispatch_cb(wxList * batch, wxList * temp, ErlDrvTermData process)
}
delete event;
} else {
- // fprintf(stderr, " sav %d \r\n", event->op);
+ // fprintf(stderr, " save %d \r\n", event->op);
temp->Append(event);
}
}
@@ -893,8 +890,6 @@ int wxCALLBACK wxEListCtrlCompare(long item1, long item2, long callbackInfoPtr)
{
callbackInfo * cb = (callbackInfo *)callbackInfoPtr;
wxeMemEnv * memenv = ((WxeApp *) wxTheApp)->getMemEnv(cb->port);
- char * bp = ((WxeApp *) wxTheApp)->cb_buff;
-
wxeReturn rt = wxeReturn(WXE_DRV_PORT, memenv->owner, false);
rt.addInt(cb->callbackID);
rt.addInt(item1);
@@ -903,6 +898,13 @@ int wxCALLBACK wxEListCtrlCompare(long item1, long item2, long callbackInfoPtr)
rt.addAtom("_wx_invoke_cb_");
rt.addTupleCount(3);
rt.send();
- handle_callback_batch(cb->port);
- return *(int*) bp;
+ handle_event_callback(cb->port, memenv->owner);
+
+ if(((WxeApp *) wxTheApp)->cb_buff) {
+ int res = * (int*) ((WxeApp *) wxTheApp)->cb_buff;
+ driver_free(((WxeApp *) wxTheApp)->cb_buff);
+ ((WxeApp *) wxTheApp)->cb_buff = NULL;
+ return res;
+ }
+ return 0;
}
diff --git a/lib/wx/c_src/wxe_impl.h b/lib/wx/c_src/wxe_impl.h
index 39c02f8c1a..ee31068d5d 100644
--- a/lib/wx/c_src/wxe_impl.h
+++ b/lib/wx/c_src/wxe_impl.h
@@ -1,7 +1,7 @@
/*
* %CopyrightBegin%
*
- * Copyright Ericsson AB 2008-2010. All Rights Reserved.
+ * Copyright Ericsson AB 2008-2011. All Rights Reserved.
*
* The contents of this file are subject to the Erlang Public License,
* Version 1.1, (the "License"); you may not use this file except in
@@ -178,7 +178,8 @@ public:
wxeMemEnv * global_me;
// Temp container for callbacks
- char cb_buff[256];
+ char *cb_buff;
+ int cb_len;
};
class wxETreeItemData : public wxTreeItemData
@@ -194,7 +195,6 @@ class wxETreeItemData : public wxTreeItemData
bool sendevent(wxEvent * event, ErlDrvPort port);
void pre_callback();
-void handle_callback_batch(ErlDrvPort port); // For wxePrintout
void handle_event_callback(ErlDrvPort port, ErlDrvTermData process);
void activateGL(ErlDrvTermData caller);
@@ -232,8 +232,6 @@ class wxEPrintout : public wxPrintout
bool OnPrintPage(int page);
void GetPageInfo(int *minPage, int *maxPage, int *pageFrom, int *pageTo);
- void clear_cb(int callback);
-
int onPrintPage;
int onPreparePrinting;
int onBeginPrinting;
@@ -246,6 +244,9 @@ class wxEPrintout : public wxPrintout
ErlDrvPort port;
};
+void clear_cb(ErlDrvPort port, int callback);
+
+
// Implementation of wxListCtrlCompare
struct callbackInfo {
ErlDrvPort port;
diff --git a/lib/wx/examples/demo/ex_listCtrl.erl b/lib/wx/examples/demo/ex_listCtrl.erl
index c574c7247a..3faec4e229 100644
--- a/lib/wx/examples/demo/ex_listCtrl.erl
+++ b/lib/wx/examples/demo/ex_listCtrl.erl
@@ -1,19 +1,19 @@
%%
%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2009. All Rights Reserved.
-%%
+%%
+%% Copyright Ericsson AB 2009-2011. All Rights Reserved.
+%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
%% compliance with the License. You should have received a copy of the
%% Erlang Public License along with this software. If not, it can be
%% retrieved online at http://www.erlang.org/.
-%%
+%%
%% Software distributed under the License is distributed on an "AS IS"
%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
%% the License for the specific language governing rights and limitations
%% under the License.
-%%
+%%
%% %CopyrightEnd%
-module(ex_listCtrl).
@@ -25,7 +25,7 @@
-export([start/1, init/1, terminate/2, code_change/3,
handle_info/2, handle_call/3, handle_event/2]).
--record(state,
+-record(state,
{
parent,
config,
@@ -40,11 +40,11 @@ init(Config) ->
wx:batch(fun() -> do_init(Config) end).
do_init(Config) ->
- Parent = proplists:get_value(parent, Config),
+ Parent = proplists:get_value(parent, Config),
Panel = wxPanel:new(Parent, []),
%% Setup sizers
- MainSizer = wxStaticBoxSizer:new(?wxVERTICAL, Panel,
+ MainSizer = wxStaticBoxSizer:new(?wxVERTICAL, Panel,
[{label, "wxListCtrl"}]),
Notebook = wxNotebook:new(Panel, 1, [{style, ?wxBK_DEFAULT}]),
@@ -81,14 +81,46 @@ do_init(Config) ->
wxListCtrl:setItemBackgroundColour(ListCtrl3,3,?wxGREEN),
wxListCtrl:setItemBackgroundColour(ListCtrl3,0,?wxCYAN),
+ IA = wxListItemAttr:new(),
+ wxListItemAttr:setTextColour(IA, {190, 25, 25}),
+ LC4Opts = [{style, ?wxLC_REPORT bor ?wxLC_VIRTUAL},
+ {onGetItemText, fun(_This, Item, 0) ->
+ "Row " ++ integer_to_list(Item);
+ (_, Item, 1) when Item rem 5 == 0 ->
+ "Column 2";
+ (_, _, _) -> ""
+ end},
+ {onGetItemAttr, fun(_This, Item) when Item rem 3 == 0 ->
+ IA;
+ (_This, _Item) ->
+ wx:typeCast(wx:null(), wxListItemAttr)
+ end},
+ {onGetItemColumnImage, fun(_This, Item, 1) ->
+ Item rem 4;
+ (_, _, _) ->
+ -1
+ end}
+ ],
+ ListCtrl4 = wxListCtrl:new(Notebook, LC4Opts),
+ wxListCtrl:setImageList(ListCtrl4, IL, ?wxIMAGE_LIST_SMALL),
+
+ wxListCtrl:insertColumn(ListCtrl4, 0, "Column 1"),
+ wxListCtrl:insertColumn(ListCtrl4, 1, "Column 2"),
+ wxListCtrl:setColumnWidth(ListCtrl4, 0, 200),
+ wxListCtrl:setColumnWidth(ListCtrl4, 1, 200),
+ wxListCtrl:setItemCount(ListCtrl4, 1000000),
+
+
wxListCtrl:connect(ListCtrl1, command_list_item_selected, []),
wxListCtrl:connect(ListCtrl2, command_list_item_selected, []),
wxListCtrl:connect(ListCtrl3, command_list_item_selected, []),
+ wxListCtrl:connect(ListCtrl4, command_list_item_selected, []),
%% Add to sizers
wxNotebook:addPage(Notebook, ListCtrl1, "List", []),
wxNotebook:addPage(Notebook, ListCtrl2, "Report", []),
wxNotebook:addPage(Notebook, ListCtrl3, "Colored multiselect", []),
+ wxNotebook:addPage(Notebook, ListCtrl4, "Virtual Report", []),
wxSizer:add(MainSizer, Notebook, [{proportion, 1},
{flag, ?wxEXPAND}]),
@@ -145,4 +177,4 @@ create_list_ctrl(Win, Options) ->
ListCtrl.
-
+
diff --git a/lib/wx/include/gl.hrl b/lib/wx/include/gl.hrl
index 52f2635af9..54eb551285 100644
--- a/lib/wx/include/gl.hrl
+++ b/lib/wx/include/gl.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -21,32 +21,22 @@
%% This file is generated DO NOT EDIT
-define(GL_VERSION_1_1, 1).
--define(GL_CURRENT_BIT, 16#1).
--define(GL_POINT_BIT, 16#2).
--define(GL_LINE_BIT, 16#4).
--define(GL_POLYGON_BIT, 16#8).
--define(GL_POLYGON_STIPPLE_BIT, 16#10).
--define(GL_PIXEL_MODE_BIT, 16#20).
--define(GL_LIGHTING_BIT, 16#40).
--define(GL_FOG_BIT, 16#80).
--define(GL_DEPTH_BUFFER_BIT, 16#100).
--define(GL_ACCUM_BUFFER_BIT, 16#200).
--define(GL_STENCIL_BUFFER_BIT, 16#400).
--define(GL_VIEWPORT_BIT, 16#800).
--define(GL_TRANSFORM_BIT, 16#1000).
--define(GL_ENABLE_BIT, 16#2000).
--define(GL_COLOR_BUFFER_BIT, 16#4000).
--define(GL_HINT_BIT, 16#8000).
--define(GL_EVAL_BIT, 16#10000).
--define(GL_LIST_BIT, 16#20000).
--define(GL_TEXTURE_BIT, 16#40000).
--define(GL_SCISSOR_BIT, 16#80000).
--define(GL_ALL_ATTRIB_BITS, 16#FFFFFFFF).
--define(GL_CLIENT_PIXEL_STORE_BIT, 16#1).
--define(GL_CLIENT_VERTEX_ARRAY_BIT, 16#2).
--define(GL_CLIENT_ALL_ATTRIB_BITS, 16#FFFFFFFF).
--define(GL_FALSE, 0).
--define(GL_TRUE, 1).
+-define(GL_VERSION_1_2, 1).
+-define(GL_VERSION_1_3, 1).
+-define(GL_ARB_imaging, 1).
+-define(GL_FALSE, 16#0).
+-define(GL_TRUE, 16#1).
+-define(GL_BYTE, 16#1400).
+-define(GL_UNSIGNED_BYTE, 16#1401).
+-define(GL_SHORT, 16#1402).
+-define(GL_UNSIGNED_SHORT, 16#1403).
+-define(GL_INT, 16#1404).
+-define(GL_UNSIGNED_INT, 16#1405).
+-define(GL_FLOAT, 16#1406).
+-define(GL_2_BYTES, 16#1407).
+-define(GL_3_BYTES, 16#1408).
+-define(GL_4_BYTES, 16#1409).
+-define(GL_DOUBLE, 16#140A).
-define(GL_POINTS, 16#0).
-define(GL_LINES, 16#1).
-define(GL_LINE_LOOP, 16#2).
@@ -57,11 +47,85 @@
-define(GL_QUADS, 16#7).
-define(GL_QUAD_STRIP, 16#8).
-define(GL_POLYGON, 16#9).
--define(GL_ACCUM, 16#100).
--define(GL_LOAD, 16#101).
--define(GL_RETURN, 16#102).
--define(GL_MULT, 16#103).
--define(GL_ADD, 16#104).
+-define(GL_VERTEX_ARRAY, 16#8074).
+-define(GL_NORMAL_ARRAY, 16#8075).
+-define(GL_COLOR_ARRAY, 16#8076).
+-define(GL_INDEX_ARRAY, 16#8077).
+-define(GL_TEXTURE_COORD_ARRAY, 16#8078).
+-define(GL_EDGE_FLAG_ARRAY, 16#8079).
+-define(GL_VERTEX_ARRAY_SIZE, 16#807A).
+-define(GL_VERTEX_ARRAY_TYPE, 16#807B).
+-define(GL_VERTEX_ARRAY_STRIDE, 16#807C).
+-define(GL_NORMAL_ARRAY_TYPE, 16#807E).
+-define(GL_NORMAL_ARRAY_STRIDE, 16#807F).
+-define(GL_COLOR_ARRAY_SIZE, 16#8081).
+-define(GL_COLOR_ARRAY_TYPE, 16#8082).
+-define(GL_COLOR_ARRAY_STRIDE, 16#8083).
+-define(GL_INDEX_ARRAY_TYPE, 16#8085).
+-define(GL_INDEX_ARRAY_STRIDE, 16#8086).
+-define(GL_TEXTURE_COORD_ARRAY_SIZE, 16#8088).
+-define(GL_TEXTURE_COORD_ARRAY_TYPE, 16#8089).
+-define(GL_TEXTURE_COORD_ARRAY_STRIDE, 16#808A).
+-define(GL_EDGE_FLAG_ARRAY_STRIDE, 16#808C).
+-define(GL_VERTEX_ARRAY_POINTER, 16#808E).
+-define(GL_NORMAL_ARRAY_POINTER, 16#808F).
+-define(GL_COLOR_ARRAY_POINTER, 16#8090).
+-define(GL_INDEX_ARRAY_POINTER, 16#8091).
+-define(GL_TEXTURE_COORD_ARRAY_POINTER, 16#8092).
+-define(GL_EDGE_FLAG_ARRAY_POINTER, 16#8093).
+-define(GL_V2F, 16#2A20).
+-define(GL_V3F, 16#2A21).
+-define(GL_C4UB_V2F, 16#2A22).
+-define(GL_C4UB_V3F, 16#2A23).
+-define(GL_C3F_V3F, 16#2A24).
+-define(GL_N3F_V3F, 16#2A25).
+-define(GL_C4F_N3F_V3F, 16#2A26).
+-define(GL_T2F_V3F, 16#2A27).
+-define(GL_T4F_V4F, 16#2A28).
+-define(GL_T2F_C4UB_V3F, 16#2A29).
+-define(GL_T2F_C3F_V3F, 16#2A2A).
+-define(GL_T2F_N3F_V3F, 16#2A2B).
+-define(GL_T2F_C4F_N3F_V3F, 16#2A2C).
+-define(GL_T4F_C4F_N3F_V4F, 16#2A2D).
+-define(GL_MATRIX_MODE, 16#BA0).
+-define(GL_MODELVIEW, 16#1700).
+-define(GL_PROJECTION, 16#1701).
+-define(GL_TEXTURE, 16#1702).
+-define(GL_POINT_SMOOTH, 16#B10).
+-define(GL_POINT_SIZE, 16#B11).
+-define(GL_POINT_SIZE_GRANULARITY, 16#B13).
+-define(GL_POINT_SIZE_RANGE, 16#B12).
+-define(GL_LINE_SMOOTH, 16#B20).
+-define(GL_LINE_STIPPLE, 16#B24).
+-define(GL_LINE_STIPPLE_PATTERN, 16#B25).
+-define(GL_LINE_STIPPLE_REPEAT, 16#B26).
+-define(GL_LINE_WIDTH, 16#B21).
+-define(GL_LINE_WIDTH_GRANULARITY, 16#B23).
+-define(GL_LINE_WIDTH_RANGE, 16#B22).
+-define(GL_POINT, 16#1B00).
+-define(GL_LINE, 16#1B01).
+-define(GL_FILL, 16#1B02).
+-define(GL_CW, 16#900).
+-define(GL_CCW, 16#901).
+-define(GL_FRONT, 16#404).
+-define(GL_BACK, 16#405).
+-define(GL_POLYGON_MODE, 16#B40).
+-define(GL_POLYGON_SMOOTH, 16#B41).
+-define(GL_POLYGON_STIPPLE, 16#B42).
+-define(GL_EDGE_FLAG, 16#B43).
+-define(GL_CULL_FACE, 16#B44).
+-define(GL_CULL_FACE_MODE, 16#B45).
+-define(GL_FRONT_FACE, 16#B46).
+-define(GL_POLYGON_OFFSET_FACTOR, 16#8038).
+-define(GL_POLYGON_OFFSET_UNITS, 16#2A00).
+-define(GL_POLYGON_OFFSET_POINT, 16#2A01).
+-define(GL_POLYGON_OFFSET_LINE, 16#2A02).
+-define(GL_POLYGON_OFFSET_FILL, 16#8037).
+-define(GL_COMPILE, 16#1300).
+-define(GL_COMPILE_AND_EXECUTE, 16#1301).
+-define(GL_LIST_BASE, 16#B32).
+-define(GL_LIST_INDEX, 16#B33).
+-define(GL_LIST_MODE, 16#B30).
-define(GL_NEVER, 16#200).
-define(GL_LESS, 16#201).
-define(GL_EQUAL, 16#202).
@@ -70,8 +134,71 @@
-define(GL_NOTEQUAL, 16#205).
-define(GL_GEQUAL, 16#206).
-define(GL_ALWAYS, 16#207).
--define(GL_ZERO, 0).
--define(GL_ONE, 1).
+-define(GL_DEPTH_TEST, 16#B71).
+-define(GL_DEPTH_BITS, 16#D56).
+-define(GL_DEPTH_CLEAR_VALUE, 16#B73).
+-define(GL_DEPTH_FUNC, 16#B74).
+-define(GL_DEPTH_RANGE, 16#B70).
+-define(GL_DEPTH_WRITEMASK, 16#B72).
+-define(GL_DEPTH_COMPONENT, 16#1902).
+-define(GL_LIGHTING, 16#B50).
+-define(GL_LIGHT0, 16#4000).
+-define(GL_LIGHT1, 16#4001).
+-define(GL_LIGHT2, 16#4002).
+-define(GL_LIGHT3, 16#4003).
+-define(GL_LIGHT4, 16#4004).
+-define(GL_LIGHT5, 16#4005).
+-define(GL_LIGHT6, 16#4006).
+-define(GL_LIGHT7, 16#4007).
+-define(GL_SPOT_EXPONENT, 16#1205).
+-define(GL_SPOT_CUTOFF, 16#1206).
+-define(GL_CONSTANT_ATTENUATION, 16#1207).
+-define(GL_LINEAR_ATTENUATION, 16#1208).
+-define(GL_QUADRATIC_ATTENUATION, 16#1209).
+-define(GL_AMBIENT, 16#1200).
+-define(GL_DIFFUSE, 16#1201).
+-define(GL_SPECULAR, 16#1202).
+-define(GL_SHININESS, 16#1601).
+-define(GL_EMISSION, 16#1600).
+-define(GL_POSITION, 16#1203).
+-define(GL_SPOT_DIRECTION, 16#1204).
+-define(GL_AMBIENT_AND_DIFFUSE, 16#1602).
+-define(GL_COLOR_INDEXES, 16#1603).
+-define(GL_LIGHT_MODEL_TWO_SIDE, 16#B52).
+-define(GL_LIGHT_MODEL_LOCAL_VIEWER, 16#B51).
+-define(GL_LIGHT_MODEL_AMBIENT, 16#B53).
+-define(GL_FRONT_AND_BACK, 16#408).
+-define(GL_SHADE_MODEL, 16#B54).
+-define(GL_FLAT, 16#1D00).
+-define(GL_SMOOTH, 16#1D01).
+-define(GL_COLOR_MATERIAL, 16#B57).
+-define(GL_COLOR_MATERIAL_FACE, 16#B55).
+-define(GL_COLOR_MATERIAL_PARAMETER, 16#B56).
+-define(GL_NORMALIZE, 16#BA1).
+-define(GL_CLIP_PLANE0, 16#3000).
+-define(GL_CLIP_PLANE1, 16#3001).
+-define(GL_CLIP_PLANE2, 16#3002).
+-define(GL_CLIP_PLANE3, 16#3003).
+-define(GL_CLIP_PLANE4, 16#3004).
+-define(GL_CLIP_PLANE5, 16#3005).
+-define(GL_ACCUM_RED_BITS, 16#D58).
+-define(GL_ACCUM_GREEN_BITS, 16#D59).
+-define(GL_ACCUM_BLUE_BITS, 16#D5A).
+-define(GL_ACCUM_ALPHA_BITS, 16#D5B).
+-define(GL_ACCUM_CLEAR_VALUE, 16#B80).
+-define(GL_ACCUM, 16#100).
+-define(GL_ADD, 16#104).
+-define(GL_LOAD, 16#101).
+-define(GL_MULT, 16#103).
+-define(GL_RETURN, 16#102).
+-define(GL_ALPHA_TEST, 16#BC0).
+-define(GL_ALPHA_TEST_REF, 16#BC2).
+-define(GL_ALPHA_TEST_FUNC, 16#BC1).
+-define(GL_BLEND, 16#BE2).
+-define(GL_BLEND_SRC, 16#BE1).
+-define(GL_BLEND_DST, 16#BE0).
+-define(GL_ZERO, 16#0).
+-define(GL_ONE, 16#1).
-define(GL_SRC_COLOR, 16#300).
-define(GL_ONE_MINUS_SRC_COLOR, 16#301).
-define(GL_SRC_ALPHA, 16#302).
@@ -81,121 +208,58 @@
-define(GL_DST_COLOR, 16#306).
-define(GL_ONE_MINUS_DST_COLOR, 16#307).
-define(GL_SRC_ALPHA_SATURATE, 16#308).
--define(GL_NONE, 0).
--define(GL_FRONT_LEFT, 16#400).
--define(GL_FRONT_RIGHT, 16#401).
--define(GL_BACK_LEFT, 16#402).
--define(GL_BACK_RIGHT, 16#403).
--define(GL_FRONT, 16#404).
--define(GL_BACK, 16#405).
--define(GL_LEFT, 16#406).
--define(GL_RIGHT, 16#407).
--define(GL_FRONT_AND_BACK, 16#408).
--define(GL_AUX0, 16#409).
--define(GL_AUX1, 16#40A).
--define(GL_AUX2, 16#40B).
--define(GL_AUX3, 16#40C).
--define(GL_NO_ERROR, 0).
--define(GL_INVALID_ENUM, 16#500).
--define(GL_INVALID_VALUE, 16#501).
--define(GL_INVALID_OPERATION, 16#502).
--define(GL_STACK_OVERFLOW, 16#503).
--define(GL_STACK_UNDERFLOW, 16#504).
--define(GL_OUT_OF_MEMORY, 16#505).
--define(GL_TABLE_TOO_LARGE, 16#8031).
+-define(GL_FEEDBACK, 16#1C01).
+-define(GL_RENDER, 16#1C00).
+-define(GL_SELECT, 16#1C02).
-define(GL_2D, 16#600).
-define(GL_3D, 16#601).
-define(GL_3D_COLOR, 16#602).
-define(GL_3D_COLOR_TEXTURE, 16#603).
-define(GL_4D_COLOR_TEXTURE, 16#604).
--define(GL_PASS_THROUGH_TOKEN, 16#700).
-define(GL_POINT_TOKEN, 16#701).
-define(GL_LINE_TOKEN, 16#702).
+-define(GL_LINE_RESET_TOKEN, 16#707).
-define(GL_POLYGON_TOKEN, 16#703).
-define(GL_BITMAP_TOKEN, 16#704).
-define(GL_DRAW_PIXEL_TOKEN, 16#705).
-define(GL_COPY_PIXEL_TOKEN, 16#706).
--define(GL_LINE_RESET_TOKEN, 16#707).
--define(GL_EXP, 16#800).
--define(GL_EXP2, 16#801).
--define(GL_CW, 16#900).
--define(GL_CCW, 16#901).
--define(GL_COEFF, 16#A00).
--define(GL_ORDER, 16#A01).
--define(GL_DOMAIN, 16#A02).
--define(GL_PIXEL_MAP_I_TO_I, 16#C70).
--define(GL_PIXEL_MAP_S_TO_S, 16#C71).
--define(GL_PIXEL_MAP_I_TO_R, 16#C72).
--define(GL_PIXEL_MAP_I_TO_G, 16#C73).
--define(GL_PIXEL_MAP_I_TO_B, 16#C74).
--define(GL_PIXEL_MAP_I_TO_A, 16#C75).
--define(GL_PIXEL_MAP_R_TO_R, 16#C76).
--define(GL_PIXEL_MAP_G_TO_G, 16#C77).
--define(GL_PIXEL_MAP_B_TO_B, 16#C78).
--define(GL_PIXEL_MAP_A_TO_A, 16#C79).
--define(GL_VERTEX_ARRAY_POINTER, 16#808E).
--define(GL_NORMAL_ARRAY_POINTER, 16#808F).
--define(GL_COLOR_ARRAY_POINTER, 16#8090).
--define(GL_INDEX_ARRAY_POINTER, 16#8091).
--define(GL_TEXTURE_COORD_ARRAY_POINTER, 16#8092).
--define(GL_EDGE_FLAG_ARRAY_POINTER, 16#8093).
--define(GL_CURRENT_COLOR, 16#B00).
--define(GL_CURRENT_INDEX, 16#B01).
--define(GL_CURRENT_NORMAL, 16#B02).
--define(GL_CURRENT_TEXTURE_COORDS, 16#B03).
--define(GL_CURRENT_RASTER_COLOR, 16#B04).
--define(GL_CURRENT_RASTER_INDEX, 16#B05).
--define(GL_CURRENT_RASTER_TEXTURE_COORDS, 16#B06).
--define(GL_CURRENT_RASTER_POSITION, 16#B07).
--define(GL_CURRENT_RASTER_POSITION_VALID, 16#B08).
--define(GL_CURRENT_RASTER_DISTANCE, 16#B09).
--define(GL_POINT_SMOOTH, 16#B10).
--define(GL_POINT_SIZE, 16#B11).
--define(GL_SMOOTH_POINT_SIZE_RANGE, 16#B12).
--define(GL_SMOOTH_POINT_SIZE_GRANULARITY, 16#B13).
--define(GL_POINT_SIZE_RANGE, ?GL_SMOOTH_POINT_SIZE_RANGE).
--define(GL_POINT_SIZE_GRANULARITY, ?GL_SMOOTH_POINT_SIZE_GRANULARITY).
--define(GL_LINE_SMOOTH, 16#B20).
--define(GL_LINE_WIDTH, 16#B21).
--define(GL_SMOOTH_LINE_WIDTH_RANGE, 16#B22).
--define(GL_SMOOTH_LINE_WIDTH_GRANULARITY, 16#B23).
--define(GL_LINE_WIDTH_RANGE, ?GL_SMOOTH_LINE_WIDTH_RANGE).
--define(GL_LINE_WIDTH_GRANULARITY, ?GL_SMOOTH_LINE_WIDTH_GRANULARITY).
--define(GL_LINE_STIPPLE, 16#B24).
--define(GL_LINE_STIPPLE_PATTERN, 16#B25).
--define(GL_LINE_STIPPLE_REPEAT, 16#B26).
--define(GL_LIST_MODE, 16#B30).
--define(GL_MAX_LIST_NESTING, 16#B31).
--define(GL_LIST_BASE, 16#B32).
--define(GL_LIST_INDEX, 16#B33).
--define(GL_POLYGON_MODE, 16#B40).
--define(GL_POLYGON_SMOOTH, 16#B41).
--define(GL_POLYGON_STIPPLE, 16#B42).
--define(GL_EDGE_FLAG, 16#B43).
--define(GL_CULL_FACE, 16#B44).
--define(GL_CULL_FACE_MODE, 16#B45).
--define(GL_FRONT_FACE, 16#B46).
--define(GL_LIGHTING, 16#B50).
--define(GL_LIGHT_MODEL_LOCAL_VIEWER, 16#B51).
--define(GL_LIGHT_MODEL_TWO_SIDE, 16#B52).
--define(GL_LIGHT_MODEL_AMBIENT, 16#B53).
--define(GL_SHADE_MODEL, 16#B54).
--define(GL_COLOR_MATERIAL_FACE, 16#B55).
--define(GL_COLOR_MATERIAL_PARAMETER, 16#B56).
--define(GL_COLOR_MATERIAL, 16#B57).
+-define(GL_PASS_THROUGH_TOKEN, 16#700).
+-define(GL_FEEDBACK_BUFFER_POINTER, 16#DF0).
+-define(GL_FEEDBACK_BUFFER_SIZE, 16#DF1).
+-define(GL_FEEDBACK_BUFFER_TYPE, 16#DF2).
+-define(GL_SELECTION_BUFFER_POINTER, 16#DF3).
+-define(GL_SELECTION_BUFFER_SIZE, 16#DF4).
-define(GL_FOG, 16#B60).
--define(GL_FOG_INDEX, 16#B61).
+-define(GL_FOG_MODE, 16#B65).
-define(GL_FOG_DENSITY, 16#B62).
+-define(GL_FOG_COLOR, 16#B66).
+-define(GL_FOG_INDEX, 16#B61).
-define(GL_FOG_START, 16#B63).
-define(GL_FOG_END, 16#B64).
--define(GL_FOG_MODE, 16#B65).
--define(GL_FOG_COLOR, 16#B66).
--define(GL_DEPTH_RANGE, 16#B70).
--define(GL_DEPTH_TEST, 16#B71).
--define(GL_DEPTH_WRITEMASK, 16#B72).
--define(GL_DEPTH_CLEAR_VALUE, 16#B73).
--define(GL_DEPTH_FUNC, 16#B74).
--define(GL_ACCUM_CLEAR_VALUE, 16#B80).
+-define(GL_LINEAR, 16#2601).
+-define(GL_EXP, 16#800).
+-define(GL_EXP2, 16#801).
+-define(GL_LOGIC_OP, 16#BF1).
+-define(GL_INDEX_LOGIC_OP, 16#BF1).
+-define(GL_COLOR_LOGIC_OP, 16#BF2).
+-define(GL_LOGIC_OP_MODE, 16#BF0).
+-define(GL_CLEAR, 16#1500).
+-define(GL_SET, 16#150F).
+-define(GL_COPY, 16#1503).
+-define(GL_COPY_INVERTED, 16#150C).
+-define(GL_NOOP, 16#1505).
+-define(GL_INVERT, 16#150A).
+-define(GL_AND, 16#1501).
+-define(GL_NAND, 16#150E).
+-define(GL_OR, 16#1507).
+-define(GL_NOR, 16#1508).
+-define(GL_XOR, 16#1506).
+-define(GL_EQUIV, 16#1509).
+-define(GL_AND_REVERSE, 16#1502).
+-define(GL_AND_INVERTED, 16#1504).
+-define(GL_OR_REVERSE, 16#150B).
+-define(GL_OR_INVERTED, 16#150D).
+-define(GL_STENCIL_BITS, 16#D57).
-define(GL_STENCIL_TEST, 16#B90).
-define(GL_STENCIL_CLEAR_VALUE, 16#B91).
-define(GL_STENCIL_FUNC, 16#B92).
@@ -205,89 +269,48 @@
-define(GL_STENCIL_PASS_DEPTH_PASS, 16#B96).
-define(GL_STENCIL_REF, 16#B97).
-define(GL_STENCIL_WRITEMASK, 16#B98).
--define(GL_MATRIX_MODE, 16#BA0).
--define(GL_NORMALIZE, 16#BA1).
--define(GL_VIEWPORT, 16#BA2).
--define(GL_MODELVIEW_STACK_DEPTH, 16#BA3).
--define(GL_PROJECTION_STACK_DEPTH, 16#BA4).
--define(GL_TEXTURE_STACK_DEPTH, 16#BA5).
--define(GL_MODELVIEW_MATRIX, 16#BA6).
--define(GL_PROJECTION_MATRIX, 16#BA7).
--define(GL_TEXTURE_MATRIX, 16#BA8).
--define(GL_ATTRIB_STACK_DEPTH, 16#BB0).
--define(GL_CLIENT_ATTRIB_STACK_DEPTH, 16#BB1).
--define(GL_ALPHA_TEST, 16#BC0).
--define(GL_ALPHA_TEST_FUNC, 16#BC1).
--define(GL_ALPHA_TEST_REF, 16#BC2).
--define(GL_DITHER, 16#BD0).
--define(GL_BLEND_DST, 16#BE0).
--define(GL_BLEND_SRC, 16#BE1).
--define(GL_BLEND, 16#BE2).
--define(GL_LOGIC_OP_MODE, 16#BF0).
--define(GL_INDEX_LOGIC_OP, 16#BF1).
--define(GL_LOGIC_OP, ?GL_INDEX_LOGIC_OP).
--define(GL_COLOR_LOGIC_OP, 16#BF2).
+-define(GL_STENCIL_INDEX, 16#1901).
+-define(GL_KEEP, 16#1E00).
+-define(GL_REPLACE, 16#1E01).
+-define(GL_INCR, 16#1E02).
+-define(GL_DECR, 16#1E03).
+-define(GL_NONE, 16#0).
+-define(GL_LEFT, 16#406).
+-define(GL_RIGHT, 16#407).
+-define(GL_FRONT_LEFT, 16#400).
+-define(GL_FRONT_RIGHT, 16#401).
+-define(GL_BACK_LEFT, 16#402).
+-define(GL_BACK_RIGHT, 16#403).
+-define(GL_AUX0, 16#409).
+-define(GL_AUX1, 16#40A).
+-define(GL_AUX2, 16#40B).
+-define(GL_AUX3, 16#40C).
+-define(GL_COLOR_INDEX, 16#1900).
+-define(GL_RED, 16#1903).
+-define(GL_GREEN, 16#1904).
+-define(GL_BLUE, 16#1905).
+-define(GL_ALPHA, 16#1906).
+-define(GL_LUMINANCE, 16#1909).
+-define(GL_LUMINANCE_ALPHA, 16#190A).
+-define(GL_ALPHA_BITS, 16#D55).
+-define(GL_RED_BITS, 16#D52).
+-define(GL_GREEN_BITS, 16#D53).
+-define(GL_BLUE_BITS, 16#D54).
+-define(GL_INDEX_BITS, 16#D51).
+-define(GL_SUBPIXEL_BITS, 16#D50).
-define(GL_AUX_BUFFERS, 16#C00).
--define(GL_DRAW_BUFFER, 16#C01).
-define(GL_READ_BUFFER, 16#C02).
--define(GL_SCISSOR_BOX, 16#C10).
--define(GL_SCISSOR_TEST, 16#C11).
--define(GL_INDEX_CLEAR_VALUE, 16#C20).
--define(GL_INDEX_WRITEMASK, 16#C21).
--define(GL_COLOR_CLEAR_VALUE, 16#C22).
--define(GL_COLOR_WRITEMASK, 16#C23).
--define(GL_INDEX_MODE, 16#C30).
--define(GL_RGBA_MODE, 16#C31).
+-define(GL_DRAW_BUFFER, 16#C01).
-define(GL_DOUBLEBUFFER, 16#C32).
-define(GL_STEREO, 16#C33).
--define(GL_RENDER_MODE, 16#C40).
--define(GL_PERSPECTIVE_CORRECTION_HINT, 16#C50).
--define(GL_POINT_SMOOTH_HINT, 16#C51).
--define(GL_LINE_SMOOTH_HINT, 16#C52).
--define(GL_POLYGON_SMOOTH_HINT, 16#C53).
--define(GL_FOG_HINT, 16#C54).
--define(GL_TEXTURE_GEN_S, 16#C60).
--define(GL_TEXTURE_GEN_T, 16#C61).
--define(GL_TEXTURE_GEN_R, 16#C62).
--define(GL_TEXTURE_GEN_Q, 16#C63).
--define(GL_PIXEL_MAP_I_TO_I_SIZE, 16#CB0).
--define(GL_PIXEL_MAP_S_TO_S_SIZE, 16#CB1).
--define(GL_PIXEL_MAP_I_TO_R_SIZE, 16#CB2).
--define(GL_PIXEL_MAP_I_TO_G_SIZE, 16#CB3).
--define(GL_PIXEL_MAP_I_TO_B_SIZE, 16#CB4).
--define(GL_PIXEL_MAP_I_TO_A_SIZE, 16#CB5).
--define(GL_PIXEL_MAP_R_TO_R_SIZE, 16#CB6).
--define(GL_PIXEL_MAP_G_TO_G_SIZE, 16#CB7).
--define(GL_PIXEL_MAP_B_TO_B_SIZE, 16#CB8).
--define(GL_PIXEL_MAP_A_TO_A_SIZE, 16#CB9).
--define(GL_UNPACK_SWAP_BYTES, 16#CF0).
--define(GL_UNPACK_LSB_FIRST, 16#CF1).
--define(GL_UNPACK_ROW_LENGTH, 16#CF2).
--define(GL_UNPACK_SKIP_ROWS, 16#CF3).
--define(GL_UNPACK_SKIP_PIXELS, 16#CF4).
--define(GL_UNPACK_ALIGNMENT, 16#CF5).
--define(GL_PACK_SWAP_BYTES, 16#D00).
--define(GL_PACK_LSB_FIRST, 16#D01).
--define(GL_PACK_ROW_LENGTH, 16#D02).
--define(GL_PACK_SKIP_ROWS, 16#D03).
--define(GL_PACK_SKIP_PIXELS, 16#D04).
--define(GL_PACK_ALIGNMENT, 16#D05).
--define(GL_MAP_COLOR, 16#D10).
--define(GL_MAP_STENCIL, 16#D11).
--define(GL_INDEX_SHIFT, 16#D12).
--define(GL_INDEX_OFFSET, 16#D13).
--define(GL_RED_SCALE, 16#D14).
--define(GL_RED_BIAS, 16#D15).
--define(GL_ZOOM_X, 16#D16).
--define(GL_ZOOM_Y, 16#D17).
--define(GL_GREEN_SCALE, 16#D18).
--define(GL_GREEN_BIAS, 16#D19).
--define(GL_BLUE_SCALE, 16#D1A).
--define(GL_BLUE_BIAS, 16#D1B).
--define(GL_ALPHA_SCALE, 16#D1C).
--define(GL_ALPHA_BIAS, 16#D1D).
--define(GL_DEPTH_SCALE, 16#D1E).
--define(GL_DEPTH_BIAS, 16#D1F).
+-define(GL_BITMAP, 16#1A00).
+-define(GL_COLOR, 16#1800).
+-define(GL_DEPTH, 16#1801).
+-define(GL_STENCIL, 16#1802).
+-define(GL_DITHER, 16#BD0).
+-define(GL_RGB, 16#1907).
+-define(GL_RGBA, 16#1908).
+-define(GL_MAX_LIST_NESTING, 16#B31).
-define(GL_MAX_EVAL_ORDER, 16#D30).
-define(GL_MAX_LIGHTS, 16#D31).
-define(GL_MAX_CLIP_PLANES, 16#D32).
@@ -300,19 +323,33 @@
-define(GL_MAX_TEXTURE_STACK_DEPTH, 16#D39).
-define(GL_MAX_VIEWPORT_DIMS, 16#D3A).
-define(GL_MAX_CLIENT_ATTRIB_STACK_DEPTH, 16#D3B).
--define(GL_SUBPIXEL_BITS, 16#D50).
--define(GL_INDEX_BITS, 16#D51).
--define(GL_RED_BITS, 16#D52).
--define(GL_GREEN_BITS, 16#D53).
--define(GL_BLUE_BITS, 16#D54).
--define(GL_ALPHA_BITS, 16#D55).
--define(GL_DEPTH_BITS, 16#D56).
--define(GL_STENCIL_BITS, 16#D57).
--define(GL_ACCUM_RED_BITS, 16#D58).
--define(GL_ACCUM_GREEN_BITS, 16#D59).
--define(GL_ACCUM_BLUE_BITS, 16#D5A).
--define(GL_ACCUM_ALPHA_BITS, 16#D5B).
+-define(GL_ATTRIB_STACK_DEPTH, 16#BB0).
+-define(GL_CLIENT_ATTRIB_STACK_DEPTH, 16#BB1).
+-define(GL_COLOR_CLEAR_VALUE, 16#C22).
+-define(GL_COLOR_WRITEMASK, 16#C23).
+-define(GL_CURRENT_INDEX, 16#B01).
+-define(GL_CURRENT_COLOR, 16#B00).
+-define(GL_CURRENT_NORMAL, 16#B02).
+-define(GL_CURRENT_RASTER_COLOR, 16#B04).
+-define(GL_CURRENT_RASTER_DISTANCE, 16#B09).
+-define(GL_CURRENT_RASTER_INDEX, 16#B05).
+-define(GL_CURRENT_RASTER_POSITION, 16#B07).
+-define(GL_CURRENT_RASTER_TEXTURE_COORDS, 16#B06).
+-define(GL_CURRENT_RASTER_POSITION_VALID, 16#B08).
+-define(GL_CURRENT_TEXTURE_COORDS, 16#B03).
+-define(GL_INDEX_CLEAR_VALUE, 16#C20).
+-define(GL_INDEX_MODE, 16#C30).
+-define(GL_INDEX_WRITEMASK, 16#C21).
+-define(GL_MODELVIEW_MATRIX, 16#BA6).
+-define(GL_MODELVIEW_STACK_DEPTH, 16#BA3).
-define(GL_NAME_STACK_DEPTH, 16#D70).
+-define(GL_PROJECTION_MATRIX, 16#BA7).
+-define(GL_PROJECTION_STACK_DEPTH, 16#BA4).
+-define(GL_RENDER_MODE, 16#C40).
+-define(GL_RGBA_MODE, 16#C31).
+-define(GL_TEXTURE_MATRIX, 16#BA8).
+-define(GL_TEXTURE_STACK_DEPTH, 16#BA5).
+-define(GL_VIEWPORT, 16#BA2).
-define(GL_AUTO_NORMAL, 16#D80).
-define(GL_MAP1_COLOR_4, 16#D90).
-define(GL_MAP1_INDEX, 16#D91).
@@ -336,166 +373,149 @@
-define(GL_MAP1_GRID_SEGMENTS, 16#DD1).
-define(GL_MAP2_GRID_DOMAIN, 16#DD2).
-define(GL_MAP2_GRID_SEGMENTS, 16#DD3).
+-define(GL_COEFF, 16#A00).
+-define(GL_ORDER, 16#A01).
+-define(GL_DOMAIN, 16#A02).
+-define(GL_PERSPECTIVE_CORRECTION_HINT, 16#C50).
+-define(GL_POINT_SMOOTH_HINT, 16#C51).
+-define(GL_LINE_SMOOTH_HINT, 16#C52).
+-define(GL_POLYGON_SMOOTH_HINT, 16#C53).
+-define(GL_FOG_HINT, 16#C54).
+-define(GL_DONT_CARE, 16#1100).
+-define(GL_FASTEST, 16#1101).
+-define(GL_NICEST, 16#1102).
+-define(GL_SCISSOR_BOX, 16#C10).
+-define(GL_SCISSOR_TEST, 16#C11).
+-define(GL_MAP_COLOR, 16#D10).
+-define(GL_MAP_STENCIL, 16#D11).
+-define(GL_INDEX_SHIFT, 16#D12).
+-define(GL_INDEX_OFFSET, 16#D13).
+-define(GL_RED_SCALE, 16#D14).
+-define(GL_RED_BIAS, 16#D15).
+-define(GL_GREEN_SCALE, 16#D18).
+-define(GL_GREEN_BIAS, 16#D19).
+-define(GL_BLUE_SCALE, 16#D1A).
+-define(GL_BLUE_BIAS, 16#D1B).
+-define(GL_ALPHA_SCALE, 16#D1C).
+-define(GL_ALPHA_BIAS, 16#D1D).
+-define(GL_DEPTH_SCALE, 16#D1E).
+-define(GL_DEPTH_BIAS, 16#D1F).
+-define(GL_PIXEL_MAP_S_TO_S_SIZE, 16#CB1).
+-define(GL_PIXEL_MAP_I_TO_I_SIZE, 16#CB0).
+-define(GL_PIXEL_MAP_I_TO_R_SIZE, 16#CB2).
+-define(GL_PIXEL_MAP_I_TO_G_SIZE, 16#CB3).
+-define(GL_PIXEL_MAP_I_TO_B_SIZE, 16#CB4).
+-define(GL_PIXEL_MAP_I_TO_A_SIZE, 16#CB5).
+-define(GL_PIXEL_MAP_R_TO_R_SIZE, 16#CB6).
+-define(GL_PIXEL_MAP_G_TO_G_SIZE, 16#CB7).
+-define(GL_PIXEL_MAP_B_TO_B_SIZE, 16#CB8).
+-define(GL_PIXEL_MAP_A_TO_A_SIZE, 16#CB9).
+-define(GL_PIXEL_MAP_S_TO_S, 16#C71).
+-define(GL_PIXEL_MAP_I_TO_I, 16#C70).
+-define(GL_PIXEL_MAP_I_TO_R, 16#C72).
+-define(GL_PIXEL_MAP_I_TO_G, 16#C73).
+-define(GL_PIXEL_MAP_I_TO_B, 16#C74).
+-define(GL_PIXEL_MAP_I_TO_A, 16#C75).
+-define(GL_PIXEL_MAP_R_TO_R, 16#C76).
+-define(GL_PIXEL_MAP_G_TO_G, 16#C77).
+-define(GL_PIXEL_MAP_B_TO_B, 16#C78).
+-define(GL_PIXEL_MAP_A_TO_A, 16#C79).
+-define(GL_PACK_ALIGNMENT, 16#D05).
+-define(GL_PACK_LSB_FIRST, 16#D01).
+-define(GL_PACK_ROW_LENGTH, 16#D02).
+-define(GL_PACK_SKIP_PIXELS, 16#D04).
+-define(GL_PACK_SKIP_ROWS, 16#D03).
+-define(GL_PACK_SWAP_BYTES, 16#D00).
+-define(GL_UNPACK_ALIGNMENT, 16#CF5).
+-define(GL_UNPACK_LSB_FIRST, 16#CF1).
+-define(GL_UNPACK_ROW_LENGTH, 16#CF2).
+-define(GL_UNPACK_SKIP_PIXELS, 16#CF4).
+-define(GL_UNPACK_SKIP_ROWS, 16#CF3).
+-define(GL_UNPACK_SWAP_BYTES, 16#CF0).
+-define(GL_ZOOM_X, 16#D16).
+-define(GL_ZOOM_Y, 16#D17).
+-define(GL_TEXTURE_ENV, 16#2300).
+-define(GL_TEXTURE_ENV_MODE, 16#2200).
-define(GL_TEXTURE_1D, 16#DE0).
-define(GL_TEXTURE_2D, 16#DE1).
--define(GL_FEEDBACK_BUFFER_POINTER, 16#DF0).
--define(GL_FEEDBACK_BUFFER_SIZE, 16#DF1).
--define(GL_FEEDBACK_BUFFER_TYPE, 16#DF2).
--define(GL_SELECTION_BUFFER_POINTER, 16#DF3).
--define(GL_SELECTION_BUFFER_SIZE, 16#DF4).
--define(GL_POLYGON_OFFSET_UNITS, 16#2A00).
--define(GL_POLYGON_OFFSET_POINT, 16#2A01).
--define(GL_POLYGON_OFFSET_LINE, 16#2A02).
--define(GL_POLYGON_OFFSET_FILL, 16#8037).
--define(GL_POLYGON_OFFSET_FACTOR, 16#8038).
--define(GL_TEXTURE_BINDING_1D, 16#8068).
--define(GL_TEXTURE_BINDING_2D, 16#8069).
--define(GL_TEXTURE_BINDING_3D, 16#806A).
--define(GL_VERTEX_ARRAY, 16#8074).
--define(GL_NORMAL_ARRAY, 16#8075).
--define(GL_COLOR_ARRAY, 16#8076).
--define(GL_INDEX_ARRAY, 16#8077).
--define(GL_TEXTURE_COORD_ARRAY, 16#8078).
--define(GL_EDGE_FLAG_ARRAY, 16#8079).
--define(GL_VERTEX_ARRAY_SIZE, 16#807A).
--define(GL_VERTEX_ARRAY_TYPE, 16#807B).
--define(GL_VERTEX_ARRAY_STRIDE, 16#807C).
--define(GL_NORMAL_ARRAY_TYPE, 16#807E).
--define(GL_NORMAL_ARRAY_STRIDE, 16#807F).
--define(GL_COLOR_ARRAY_SIZE, 16#8081).
--define(GL_COLOR_ARRAY_TYPE, 16#8082).
--define(GL_COLOR_ARRAY_STRIDE, 16#8083).
--define(GL_INDEX_ARRAY_TYPE, 16#8085).
--define(GL_INDEX_ARRAY_STRIDE, 16#8086).
--define(GL_TEXTURE_COORD_ARRAY_SIZE, 16#8088).
--define(GL_TEXTURE_COORD_ARRAY_TYPE, 16#8089).
--define(GL_TEXTURE_COORD_ARRAY_STRIDE, 16#808A).
--define(GL_EDGE_FLAG_ARRAY_STRIDE, 16#808C).
+-define(GL_TEXTURE_WRAP_S, 16#2802).
+-define(GL_TEXTURE_WRAP_T, 16#2803).
+-define(GL_TEXTURE_MAG_FILTER, 16#2800).
+-define(GL_TEXTURE_MIN_FILTER, 16#2801).
+-define(GL_TEXTURE_ENV_COLOR, 16#2201).
+-define(GL_TEXTURE_GEN_S, 16#C60).
+-define(GL_TEXTURE_GEN_T, 16#C61).
+-define(GL_TEXTURE_GEN_MODE, 16#2500).
+-define(GL_TEXTURE_BORDER_COLOR, 16#1004).
-define(GL_TEXTURE_WIDTH, 16#1000).
-define(GL_TEXTURE_HEIGHT, 16#1001).
--define(GL_TEXTURE_INTERNAL_FORMAT, 16#1003).
--define(GL_TEXTURE_COMPONENTS, ?GL_TEXTURE_INTERNAL_FORMAT).
--define(GL_TEXTURE_BORDER_COLOR, 16#1004).
-define(GL_TEXTURE_BORDER, 16#1005).
+-define(GL_TEXTURE_COMPONENTS, 16#1003).
-define(GL_TEXTURE_RED_SIZE, 16#805C).
-define(GL_TEXTURE_GREEN_SIZE, 16#805D).
-define(GL_TEXTURE_BLUE_SIZE, 16#805E).
-define(GL_TEXTURE_ALPHA_SIZE, 16#805F).
-define(GL_TEXTURE_LUMINANCE_SIZE, 16#8060).
-define(GL_TEXTURE_INTENSITY_SIZE, 16#8061).
--define(GL_TEXTURE_PRIORITY, 16#8066).
--define(GL_TEXTURE_RESIDENT, 16#8067).
--define(GL_DONT_CARE, 16#1100).
--define(GL_FASTEST, 16#1101).
--define(GL_NICEST, 16#1102).
--define(GL_AMBIENT, 16#1200).
--define(GL_DIFFUSE, 16#1201).
--define(GL_SPECULAR, 16#1202).
--define(GL_POSITION, 16#1203).
--define(GL_SPOT_DIRECTION, 16#1204).
--define(GL_SPOT_EXPONENT, 16#1205).
--define(GL_SPOT_CUTOFF, 16#1206).
--define(GL_CONSTANT_ATTENUATION, 16#1207).
--define(GL_LINEAR_ATTENUATION, 16#1208).
--define(GL_QUADRATIC_ATTENUATION, 16#1209).
--define(GL_COMPILE, 16#1300).
--define(GL_COMPILE_AND_EXECUTE, 16#1301).
--define(GL_BYTE, 16#1400).
--define(GL_UNSIGNED_BYTE, 16#1401).
--define(GL_SHORT, 16#1402).
--define(GL_UNSIGNED_SHORT, 16#1403).
--define(GL_INT, 16#1404).
--define(GL_UNSIGNED_INT, 16#1405).
--define(GL_FLOAT, 16#1406).
--define(GL_2_BYTES, 16#1407).
--define(GL_3_BYTES, 16#1408).
--define(GL_4_BYTES, 16#1409).
--define(GL_DOUBLE, 16#140A).
--define(GL_DOUBLE_EXT, 16#140A).
--define(GL_CLEAR, 16#1500).
--define(GL_AND, 16#1501).
--define(GL_AND_REVERSE, 16#1502).
--define(GL_COPY, 16#1503).
--define(GL_AND_INVERTED, 16#1504).
--define(GL_NOOP, 16#1505).
--define(GL_XOR, 16#1506).
--define(GL_OR, 16#1507).
--define(GL_NOR, 16#1508).
--define(GL_EQUIV, 16#1509).
--define(GL_INVERT, 16#150A).
--define(GL_OR_REVERSE, 16#150B).
--define(GL_COPY_INVERTED, 16#150C).
--define(GL_OR_INVERTED, 16#150D).
--define(GL_NAND, 16#150E).
--define(GL_SET, 16#150F).
--define(GL_EMISSION, 16#1600).
--define(GL_SHININESS, 16#1601).
--define(GL_AMBIENT_AND_DIFFUSE, 16#1602).
--define(GL_COLOR_INDEXES, 16#1603).
--define(GL_MODELVIEW, 16#1700).
--define(GL_PROJECTION, 16#1701).
--define(GL_TEXTURE, 16#1702).
--define(GL_COLOR, 16#1800).
--define(GL_DEPTH, 16#1801).
--define(GL_STENCIL, 16#1802).
--define(GL_COLOR_INDEX, 16#1900).
--define(GL_STENCIL_INDEX, 16#1901).
--define(GL_DEPTH_COMPONENT, 16#1902).
--define(GL_RED, 16#1903).
--define(GL_GREEN, 16#1904).
--define(GL_BLUE, 16#1905).
--define(GL_ALPHA, 16#1906).
--define(GL_RGB, 16#1907).
--define(GL_RGBA, 16#1908).
--define(GL_LUMINANCE, 16#1909).
--define(GL_LUMINANCE_ALPHA, 16#190A).
--define(GL_BITMAP, 16#1A00).
--define(GL_POINT, 16#1B00).
--define(GL_LINE, 16#1B01).
--define(GL_FILL, 16#1B02).
--define(GL_RENDER, 16#1C00).
--define(GL_FEEDBACK, 16#1C01).
--define(GL_SELECT, 16#1C02).
--define(GL_FLAT, 16#1D00).
--define(GL_SMOOTH, 16#1D01).
--define(GL_KEEP, 16#1E00).
--define(GL_REPLACE, 16#1E01).
--define(GL_INCR, 16#1E02).
--define(GL_DECR, 16#1E03).
--define(GL_VENDOR, 16#1F00).
--define(GL_RENDERER, 16#1F01).
--define(GL_VERSION, 16#1F02).
--define(GL_EXTENSIONS, 16#1F03).
--define(GL_S, 16#2000).
--define(GL_T, 16#2001).
--define(GL_R, 16#2002).
--define(GL_Q, 16#2003).
--define(GL_MODULATE, 16#2100).
--define(GL_DECAL, 16#2101).
--define(GL_TEXTURE_ENV_MODE, 16#2200).
--define(GL_TEXTURE_ENV_COLOR, 16#2201).
--define(GL_TEXTURE_ENV, 16#2300).
--define(GL_EYE_LINEAR, 16#2400).
+-define(GL_NEAREST_MIPMAP_NEAREST, 16#2700).
+-define(GL_NEAREST_MIPMAP_LINEAR, 16#2702).
+-define(GL_LINEAR_MIPMAP_NEAREST, 16#2701).
+-define(GL_LINEAR_MIPMAP_LINEAR, 16#2703).
-define(GL_OBJECT_LINEAR, 16#2401).
--define(GL_SPHERE_MAP, 16#2402).
--define(GL_TEXTURE_GEN_MODE, 16#2500).
-define(GL_OBJECT_PLANE, 16#2501).
+-define(GL_EYE_LINEAR, 16#2400).
-define(GL_EYE_PLANE, 16#2502).
+-define(GL_SPHERE_MAP, 16#2402).
+-define(GL_DECAL, 16#2101).
+-define(GL_MODULATE, 16#2100).
-define(GL_NEAREST, 16#2600).
--define(GL_LINEAR, 16#2601).
--define(GL_NEAREST_MIPMAP_NEAREST, 16#2700).
--define(GL_LINEAR_MIPMAP_NEAREST, 16#2701).
--define(GL_NEAREST_MIPMAP_LINEAR, 16#2702).
--define(GL_LINEAR_MIPMAP_LINEAR, 16#2703).
--define(GL_TEXTURE_MAG_FILTER, 16#2800).
--define(GL_TEXTURE_MIN_FILTER, 16#2801).
--define(GL_TEXTURE_WRAP_S, 16#2802).
--define(GL_TEXTURE_WRAP_T, 16#2803).
+-define(GL_REPEAT, 16#2901).
+-define(GL_CLAMP, 16#2900).
+-define(GL_S, 16#2000).
+-define(GL_T, 16#2001).
+-define(GL_R, 16#2002).
+-define(GL_Q, 16#2003).
+-define(GL_TEXTURE_GEN_R, 16#C62).
+-define(GL_TEXTURE_GEN_Q, 16#C63).
+-define(GL_VENDOR, 16#1F00).
+-define(GL_RENDERER, 16#1F01).
+-define(GL_VERSION, 16#1F02).
+-define(GL_EXTENSIONS, 16#1F03).
+-define(GL_NO_ERROR, 16#0).
+-define(GL_INVALID_ENUM, 16#500).
+-define(GL_INVALID_VALUE, 16#501).
+-define(GL_INVALID_OPERATION, 16#502).
+-define(GL_STACK_OVERFLOW, 16#503).
+-define(GL_STACK_UNDERFLOW, 16#504).
+-define(GL_OUT_OF_MEMORY, 16#505).
+-define(GL_CURRENT_BIT, 16#1).
+-define(GL_POINT_BIT, 16#2).
+-define(GL_LINE_BIT, 16#4).
+-define(GL_POLYGON_BIT, 16#8).
+-define(GL_POLYGON_STIPPLE_BIT, 16#10).
+-define(GL_PIXEL_MODE_BIT, 16#20).
+-define(GL_LIGHTING_BIT, 16#40).
+-define(GL_FOG_BIT, 16#80).
+-define(GL_DEPTH_BUFFER_BIT, 16#100).
+-define(GL_ACCUM_BUFFER_BIT, 16#200).
+-define(GL_STENCIL_BUFFER_BIT, 16#400).
+-define(GL_VIEWPORT_BIT, 16#800).
+-define(GL_TRANSFORM_BIT, 16#1000).
+-define(GL_ENABLE_BIT, 16#2000).
+-define(GL_COLOR_BUFFER_BIT, 16#4000).
+-define(GL_HINT_BIT, 16#8000).
+-define(GL_EVAL_BIT, 16#10000).
+-define(GL_LIST_BIT, 16#20000).
+-define(GL_TEXTURE_BIT, 16#40000).
+-define(GL_SCISSOR_BIT, 16#80000).
+-define(GL_ALL_ATTRIB_BITS, 16#FFFFF).
-define(GL_PROXY_TEXTURE_1D, 16#8063).
-define(GL_PROXY_TEXTURE_2D, 16#8064).
--define(GL_CLAMP, 16#2900).
--define(GL_REPEAT, 16#2901).
--define(GL_R3_G3_B2, 16#2A10).
+-define(GL_TEXTURE_PRIORITY, 16#8066).
+-define(GL_TEXTURE_RESIDENT, 16#8067).
+-define(GL_TEXTURE_BINDING_1D, 16#8068).
+-define(GL_TEXTURE_BINDING_2D, 16#8069).
+-define(GL_TEXTURE_INTERNAL_FORMAT, 16#1003).
-define(GL_ALPHA4, 16#803B).
-define(GL_ALPHA8, 16#803C).
-define(GL_ALPHA12, 16#803D).
@@ -515,6 +535,7 @@
-define(GL_INTENSITY8, 16#804B).
-define(GL_INTENSITY12, 16#804C).
-define(GL_INTENSITY16, 16#804D).
+-define(GL_R3_G3_B2, 16#2A10).
-define(GL_RGB4, 16#804F).
-define(GL_RGB5, 16#8050).
-define(GL_RGB8, 16#8051).
@@ -528,51 +549,14 @@
-define(GL_RGB10_A2, 16#8059).
-define(GL_RGBA12, 16#805A).
-define(GL_RGBA16, 16#805B).
--define(GL_V2F, 16#2A20).
--define(GL_V3F, 16#2A21).
--define(GL_C4UB_V2F, 16#2A22).
--define(GL_C4UB_V3F, 16#2A23).
--define(GL_C3F_V3F, 16#2A24).
--define(GL_N3F_V3F, 16#2A25).
--define(GL_C4F_N3F_V3F, 16#2A26).
--define(GL_T2F_V3F, 16#2A27).
--define(GL_T4F_V4F, 16#2A28).
--define(GL_T2F_C4UB_V3F, 16#2A29).
--define(GL_T2F_C3F_V3F, 16#2A2A).
--define(GL_T2F_N3F_V3F, 16#2A2B).
--define(GL_T2F_C4F_N3F_V3F, 16#2A2C).
--define(GL_T4F_C4F_N3F_V4F, 16#2A2D).
--define(GL_CLIP_PLANE0, 16#3000).
--define(GL_CLIP_PLANE1, 16#3001).
--define(GL_CLIP_PLANE2, 16#3002).
--define(GL_CLIP_PLANE3, 16#3003).
--define(GL_CLIP_PLANE4, 16#3004).
--define(GL_CLIP_PLANE5, 16#3005).
--define(GL_LIGHT0, 16#4000).
--define(GL_LIGHT1, 16#4001).
--define(GL_LIGHT2, 16#4002).
--define(GL_LIGHT3, 16#4003).
--define(GL_LIGHT4, 16#4004).
--define(GL_LIGHT5, 16#4005).
--define(GL_LIGHT6, 16#4006).
--define(GL_LIGHT7, 16#4007).
--define(GL_ABGR_EXT, 16#8000).
--define(GL_FUNC_SUBTRACT_EXT, 16#800A).
--define(GL_FUNC_REVERSE_SUBTRACT_EXT, 16#800B).
--define(GL_UNSIGNED_BYTE_3_3_2_EXT, 16#8032).
--define(GL_UNSIGNED_SHORT_4_4_4_4_EXT, 16#8033).
--define(GL_UNSIGNED_SHORT_5_5_5_1_EXT, 16#8034).
--define(GL_UNSIGNED_INT_8_8_8_8_EXT, 16#8035).
--define(GL_UNSIGNED_INT_10_10_10_2_EXT, 16#8036).
--define(GL_PACK_SKIP_IMAGES, 16#806B).
--define(GL_PACK_IMAGE_HEIGHT, 16#806C).
--define(GL_UNPACK_SKIP_IMAGES, 16#806D).
--define(GL_UNPACK_IMAGE_HEIGHT, 16#806E).
--define(GL_TEXTURE_3D, 16#806F).
--define(GL_PROXY_TEXTURE_3D, 16#8070).
--define(GL_TEXTURE_DEPTH, 16#8071).
--define(GL_TEXTURE_WRAP_R, 16#8072).
--define(GL_MAX_3D_TEXTURE_SIZE, 16#8073).
+-define(GL_CLIENT_PIXEL_STORE_BIT, 16#1).
+-define(GL_CLIENT_VERTEX_ARRAY_BIT, 16#2).
+-define(GL_ALL_CLIENT_ATTRIB_BITS, 16#FFFFFFFF).
+-define(GL_CLIENT_ALL_ATTRIB_BITS, 16#FFFFFFFF).
+-define(GL_RESCALE_NORMAL, 16#803A).
+-define(GL_CLAMP_TO_EDGE, 16#812F).
+-define(GL_MAX_ELEMENTS_VERTICES, 16#80E8).
+-define(GL_MAX_ELEMENTS_INDICES, 16#80E9).
-define(GL_BGR, 16#80E0).
-define(GL_BGRA, 16#80E1).
-define(GL_UNSIGNED_BYTE_3_3_2, 16#8032).
@@ -587,22 +571,104 @@
-define(GL_UNSIGNED_INT_8_8_8_8_REV, 16#8367).
-define(GL_UNSIGNED_INT_10_10_10_2, 16#8036).
-define(GL_UNSIGNED_INT_2_10_10_10_REV, 16#8368).
--define(GL_RESCALE_NORMAL, 16#803A).
-define(GL_LIGHT_MODEL_COLOR_CONTROL, 16#81F8).
-define(GL_SINGLE_COLOR, 16#81F9).
-define(GL_SEPARATE_SPECULAR_COLOR, 16#81FA).
--define(GL_CLAMP_TO_EDGE, 16#812F).
-define(GL_TEXTURE_MIN_LOD, 16#813A).
-define(GL_TEXTURE_MAX_LOD, 16#813B).
-define(GL_TEXTURE_BASE_LEVEL, 16#813C).
-define(GL_TEXTURE_MAX_LEVEL, 16#813D).
--define(GL_MAX_ELEMENTS_VERTICES, 16#80E8).
--define(GL_MAX_ELEMENTS_INDICES, 16#80E9).
+-define(GL_SMOOTH_POINT_SIZE_RANGE, 16#B12).
+-define(GL_SMOOTH_POINT_SIZE_GRANULARITY, 16#B13).
+-define(GL_SMOOTH_LINE_WIDTH_RANGE, 16#B22).
+-define(GL_SMOOTH_LINE_WIDTH_GRANULARITY, 16#B23).
-define(GL_ALIASED_POINT_SIZE_RANGE, 16#846D).
-define(GL_ALIASED_LINE_WIDTH_RANGE, 16#846E).
--define(GL_ACTIVE_TEXTURE, 16#84E0).
--define(GL_CLIENT_ACTIVE_TEXTURE, 16#84E1).
--define(GL_MAX_TEXTURE_UNITS, 16#84E2).
+-define(GL_PACK_SKIP_IMAGES, 16#806B).
+-define(GL_PACK_IMAGE_HEIGHT, 16#806C).
+-define(GL_UNPACK_SKIP_IMAGES, 16#806D).
+-define(GL_UNPACK_IMAGE_HEIGHT, 16#806E).
+-define(GL_TEXTURE_3D, 16#806F).
+-define(GL_PROXY_TEXTURE_3D, 16#8070).
+-define(GL_TEXTURE_DEPTH, 16#8071).
+-define(GL_TEXTURE_WRAP_R, 16#8072).
+-define(GL_MAX_3D_TEXTURE_SIZE, 16#8073).
+-define(GL_TEXTURE_BINDING_3D, 16#806A).
+-define(GL_CONSTANT_COLOR, 16#8001).
+-define(GL_ONE_MINUS_CONSTANT_COLOR, 16#8002).
+-define(GL_CONSTANT_ALPHA, 16#8003).
+-define(GL_ONE_MINUS_CONSTANT_ALPHA, 16#8004).
+-define(GL_COLOR_TABLE, 16#80D0).
+-define(GL_POST_CONVOLUTION_COLOR_TABLE, 16#80D1).
+-define(GL_POST_COLOR_MATRIX_COLOR_TABLE, 16#80D2).
+-define(GL_PROXY_COLOR_TABLE, 16#80D3).
+-define(GL_PROXY_POST_CONVOLUTION_COLOR_TABLE, 16#80D4).
+-define(GL_PROXY_POST_COLOR_MATRIX_COLOR_TABLE, 16#80D5).
+-define(GL_COLOR_TABLE_SCALE, 16#80D6).
+-define(GL_COLOR_TABLE_BIAS, 16#80D7).
+-define(GL_COLOR_TABLE_FORMAT, 16#80D8).
+-define(GL_COLOR_TABLE_WIDTH, 16#80D9).
+-define(GL_COLOR_TABLE_RED_SIZE, 16#80DA).
+-define(GL_COLOR_TABLE_GREEN_SIZE, 16#80DB).
+-define(GL_COLOR_TABLE_BLUE_SIZE, 16#80DC).
+-define(GL_COLOR_TABLE_ALPHA_SIZE, 16#80DD).
+-define(GL_COLOR_TABLE_LUMINANCE_SIZE, 16#80DE).
+-define(GL_COLOR_TABLE_INTENSITY_SIZE, 16#80DF).
+-define(GL_CONVOLUTION_1D, 16#8010).
+-define(GL_CONVOLUTION_2D, 16#8011).
+-define(GL_SEPARABLE_2D, 16#8012).
+-define(GL_CONVOLUTION_BORDER_MODE, 16#8013).
+-define(GL_CONVOLUTION_FILTER_SCALE, 16#8014).
+-define(GL_CONVOLUTION_FILTER_BIAS, 16#8015).
+-define(GL_REDUCE, 16#8016).
+-define(GL_CONVOLUTION_FORMAT, 16#8017).
+-define(GL_CONVOLUTION_WIDTH, 16#8018).
+-define(GL_CONVOLUTION_HEIGHT, 16#8019).
+-define(GL_MAX_CONVOLUTION_WIDTH, 16#801A).
+-define(GL_MAX_CONVOLUTION_HEIGHT, 16#801B).
+-define(GL_POST_CONVOLUTION_RED_SCALE, 16#801C).
+-define(GL_POST_CONVOLUTION_GREEN_SCALE, 16#801D).
+-define(GL_POST_CONVOLUTION_BLUE_SCALE, 16#801E).
+-define(GL_POST_CONVOLUTION_ALPHA_SCALE, 16#801F).
+-define(GL_POST_CONVOLUTION_RED_BIAS, 16#8020).
+-define(GL_POST_CONVOLUTION_GREEN_BIAS, 16#8021).
+-define(GL_POST_CONVOLUTION_BLUE_BIAS, 16#8022).
+-define(GL_POST_CONVOLUTION_ALPHA_BIAS, 16#8023).
+-define(GL_CONSTANT_BORDER, 16#8151).
+-define(GL_REPLICATE_BORDER, 16#8153).
+-define(GL_CONVOLUTION_BORDER_COLOR, 16#8154).
+-define(GL_COLOR_MATRIX, 16#80B1).
+-define(GL_COLOR_MATRIX_STACK_DEPTH, 16#80B2).
+-define(GL_MAX_COLOR_MATRIX_STACK_DEPTH, 16#80B3).
+-define(GL_POST_COLOR_MATRIX_RED_SCALE, 16#80B4).
+-define(GL_POST_COLOR_MATRIX_GREEN_SCALE, 16#80B5).
+-define(GL_POST_COLOR_MATRIX_BLUE_SCALE, 16#80B6).
+-define(GL_POST_COLOR_MATRIX_ALPHA_SCALE, 16#80B7).
+-define(GL_POST_COLOR_MATRIX_RED_BIAS, 16#80B8).
+-define(GL_POST_COLOR_MATRIX_GREEN_BIAS, 16#80B9).
+-define(GL_POST_COLOR_MATRIX_BLUE_BIAS, 16#80BA).
+-define(GL_POST_COLOR_MATRIX_ALPHA_BIAS, 16#80BB).
+-define(GL_HISTOGRAM, 16#8024).
+-define(GL_PROXY_HISTOGRAM, 16#8025).
+-define(GL_HISTOGRAM_WIDTH, 16#8026).
+-define(GL_HISTOGRAM_FORMAT, 16#8027).
+-define(GL_HISTOGRAM_RED_SIZE, 16#8028).
+-define(GL_HISTOGRAM_GREEN_SIZE, 16#8029).
+-define(GL_HISTOGRAM_BLUE_SIZE, 16#802A).
+-define(GL_HISTOGRAM_ALPHA_SIZE, 16#802B).
+-define(GL_HISTOGRAM_LUMINANCE_SIZE, 16#802C).
+-define(GL_HISTOGRAM_SINK, 16#802D).
+-define(GL_MINMAX, 16#802E).
+-define(GL_MINMAX_FORMAT, 16#802F).
+-define(GL_MINMAX_SINK, 16#8030).
+-define(GL_TABLE_TOO_LARGE, 16#8031).
+-define(GL_BLEND_EQUATION, 16#8009).
+-define(GL_MIN, 16#8007).
+-define(GL_MAX, 16#8008).
+-define(GL_FUNC_ADD, 16#8006).
+-define(GL_FUNC_SUBTRACT, 16#800A).
+-define(GL_FUNC_REVERSE_SUBTRACT, 16#800B).
+-define(GL_BLEND_COLOR, 16#8005).
-define(GL_TEXTURE0, 16#84C0).
-define(GL_TEXTURE1, 16#84C1).
-define(GL_TEXTURE2, 16#84C2).
@@ -635,6 +701,9 @@
-define(GL_TEXTURE29, 16#84DD).
-define(GL_TEXTURE30, 16#84DE).
-define(GL_TEXTURE31, 16#84DF).
+-define(GL_ACTIVE_TEXTURE, 16#84E0).
+-define(GL_CLIENT_ACTIVE_TEXTURE, 16#84E1).
+-define(GL_MAX_TEXTURE_UNITS, 16#84E2).
-define(GL_NORMAL_MAP, 16#8511).
-define(GL_REFLECTION_MAP, 16#8512).
-define(GL_TEXTURE_CUBE_MAP, 16#8513).
@@ -647,32 +716,6 @@
-define(GL_TEXTURE_CUBE_MAP_NEGATIVE_Z, 16#851A).
-define(GL_PROXY_TEXTURE_CUBE_MAP, 16#851B).
-define(GL_MAX_CUBE_MAP_TEXTURE_SIZE, 16#851C).
--define(GL_COMBINE, 16#8570).
--define(GL_COMBINE_RGB, 16#8571).
--define(GL_COMBINE_ALPHA, 16#8572).
--define(GL_RGB_SCALE, 16#8573).
--define(GL_ADD_SIGNED, 16#8574).
--define(GL_INTERPOLATE, 16#8575).
--define(GL_CONSTANT, 16#8576).
--define(GL_PRIMARY_COLOR, 16#8577).
--define(GL_PREVIOUS, 16#8578).
--define(GL_SOURCE0_RGB, 16#8580).
--define(GL_SOURCE1_RGB, 16#8581).
--define(GL_SOURCE2_RGB, 16#8582).
--define(GL_SOURCE0_ALPHA, 16#8588).
--define(GL_SOURCE1_ALPHA, 16#8589).
--define(GL_SOURCE2_ALPHA, 16#858A).
--define(GL_OPERAND0_RGB, 16#8590).
--define(GL_OPERAND1_RGB, 16#8591).
--define(GL_OPERAND2_RGB, 16#8592).
--define(GL_OPERAND0_ALPHA, 16#8598).
--define(GL_OPERAND1_ALPHA, 16#8599).
--define(GL_OPERAND2_ALPHA, 16#859A).
--define(GL_SUBTRACT, 16#84E7).
--define(GL_TRANSPOSE_MODELVIEW_MATRIX, 16#84E3).
--define(GL_TRANSPOSE_PROJECTION_MATRIX, 16#84E4).
--define(GL_TRANSPOSE_TEXTURE_MATRIX, 16#84E5).
--define(GL_TRANSPOSE_COLOR_MATRIX, 16#84E6).
-define(GL_COMPRESSED_ALPHA, 16#84E9).
-define(GL_COMPRESSED_LUMINANCE, 16#84EA).
-define(GL_COMPRESSED_LUMINANCE_ALPHA, 16#84EB).
@@ -684,9 +727,6 @@
-define(GL_TEXTURE_COMPRESSED, 16#86A1).
-define(GL_NUM_COMPRESSED_TEXTURE_FORMATS, 16#86A2).
-define(GL_COMPRESSED_TEXTURE_FORMATS, 16#86A3).
--define(GL_DOT3_RGB, 16#86AE).
--define(GL_DOT3_RGBA, 16#86AF).
--define(GL_CLAMP_TO_BORDER, 16#812D).
-define(GL_MULTISAMPLE, 16#809D).
-define(GL_SAMPLE_ALPHA_TO_COVERAGE, 16#809E).
-define(GL_SAMPLE_ALPHA_TO_ONE, 16#809F).
@@ -696,57 +736,120 @@
-define(GL_SAMPLE_COVERAGE_VALUE, 16#80AA).
-define(GL_SAMPLE_COVERAGE_INVERT, 16#80AB).
-define(GL_MULTISAMPLE_BIT, 16#20000000).
--define(GL_VERTEX_ARRAY_EXT, 16#8074).
--define(GL_NORMAL_ARRAY_EXT, 16#8075).
--define(GL_COLOR_ARRAY_EXT, 16#8076).
--define(GL_INDEX_ARRAY_EXT, 16#8077).
--define(GL_TEXTURE_COORD_ARRAY_EXT, 16#8078).
--define(GL_EDGE_FLAG_ARRAY_EXT, 16#8079).
--define(GL_VERTEX_ARRAY_SIZE_EXT, 16#807A).
--define(GL_VERTEX_ARRAY_TYPE_EXT, 16#807B).
--define(GL_VERTEX_ARRAY_STRIDE_EXT, 16#807C).
--define(GL_VERTEX_ARRAY_COUNT_EXT, 16#807D).
--define(GL_NORMAL_ARRAY_TYPE_EXT, 16#807E).
--define(GL_NORMAL_ARRAY_STRIDE_EXT, 16#807F).
--define(GL_NORMAL_ARRAY_COUNT_EXT, 16#8080).
--define(GL_COLOR_ARRAY_SIZE_EXT, 16#8081).
--define(GL_COLOR_ARRAY_TYPE_EXT, 16#8082).
--define(GL_COLOR_ARRAY_STRIDE_EXT, 16#8083).
--define(GL_COLOR_ARRAY_COUNT_EXT, 16#8084).
--define(GL_INDEX_ARRAY_TYPE_EXT, 16#8085).
--define(GL_INDEX_ARRAY_STRIDE_EXT, 16#8086).
--define(GL_INDEX_ARRAY_COUNT_EXT, 16#8087).
--define(GL_TEXTURE_COORD_ARRAY_SIZE_EXT, 16#8088).
--define(GL_TEXTURE_COORD_ARRAY_TYPE_EXT, 16#8089).
--define(GL_TEXTURE_COORD_ARRAY_STRIDE_EXT, 16#808A).
--define(GL_TEXTURE_COORD_ARRAY_COUNT_EXT, 16#808B).
--define(GL_EDGE_FLAG_ARRAY_STRIDE_EXT, 16#808C).
--define(GL_EDGE_FLAG_ARRAY_COUNT_EXT, 16#808D).
--define(GL_VERTEX_ARRAY_POINTER_EXT, 16#808E).
--define(GL_NORMAL_ARRAY_POINTER_EXT, 16#808F).
--define(GL_COLOR_ARRAY_POINTER_EXT, 16#8090).
--define(GL_INDEX_ARRAY_POINTER_EXT, 16#8091).
--define(GL_TEXTURE_COORD_ARRAY_POINTER_EXT, 16#8092).
--define(GL_EDGE_FLAG_ARRAY_POINTER_EXT, 16#8093).
--define(GL_TEXTURE_MIN_LOD_SGIS, 16#813A).
--define(GL_TEXTURE_MAX_LOD_SGIS, 16#813B).
--define(GL_TEXTURE_BASE_LEVEL_SGIS, 16#813C).
--define(GL_TEXTURE_MAX_LEVEL_SGIS, 16#813D).
--define(GL_SHARED_TEXTURE_PALETTE_EXT, 16#81FB).
--define(GL_RESCALE_NORMAL_EXT, 16#803A).
--define(GL_TEXTURE_COMPARE_SGIX, 16#819A).
--define(GL_TEXTURE_COMPARE_OPERATOR_SGIX, 16#819B).
--define(GL_TEXTURE_LEQUAL_R_SGIX, 16#819C).
--define(GL_TEXTURE_GEQUAL_R_SGIX, 16#819D).
--define(GL_DEPTH_COMPONENT16_SGIX, 16#81A5).
--define(GL_DEPTH_COMPONENT24_SGIX, 16#81A6).
--define(GL_DEPTH_COMPONENT32_SGIX, 16#81A7).
--define(GL_GENERATE_MIPMAP_SGIS, 16#8191).
--define(GL_GENERATE_MIPMAP_HINT_SGIS, 16#8192).
+-define(GL_TRANSPOSE_MODELVIEW_MATRIX, 16#84E3).
+-define(GL_TRANSPOSE_PROJECTION_MATRIX, 16#84E4).
+-define(GL_TRANSPOSE_TEXTURE_MATRIX, 16#84E5).
+-define(GL_TRANSPOSE_COLOR_MATRIX, 16#84E6).
+-define(GL_COMBINE, 16#8570).
+-define(GL_COMBINE_RGB, 16#8571).
+-define(GL_COMBINE_ALPHA, 16#8572).
+-define(GL_SOURCE0_RGB, 16#8580).
+-define(GL_SOURCE1_RGB, 16#8581).
+-define(GL_SOURCE2_RGB, 16#8582).
+-define(GL_SOURCE0_ALPHA, 16#8588).
+-define(GL_SOURCE1_ALPHA, 16#8589).
+-define(GL_SOURCE2_ALPHA, 16#858A).
+-define(GL_OPERAND0_RGB, 16#8590).
+-define(GL_OPERAND1_RGB, 16#8591).
+-define(GL_OPERAND2_RGB, 16#8592).
+-define(GL_OPERAND0_ALPHA, 16#8598).
+-define(GL_OPERAND1_ALPHA, 16#8599).
+-define(GL_OPERAND2_ALPHA, 16#859A).
+-define(GL_RGB_SCALE, 16#8573).
+-define(GL_ADD_SIGNED, 16#8574).
+-define(GL_INTERPOLATE, 16#8575).
+-define(GL_SUBTRACT, 16#84E7).
+-define(GL_CONSTANT, 16#8576).
+-define(GL_PRIMARY_COLOR, 16#8577).
+-define(GL_PREVIOUS, 16#8578).
+-define(GL_DOT3_RGB, 16#86AE).
+-define(GL_DOT3_RGBA, 16#86AF).
+-define(GL_CLAMP_TO_BORDER, 16#812D).
+-define(GL_ARB_multitexture, 1).
+-define(GL_TEXTURE0_ARB, 16#84C0).
+-define(GL_TEXTURE1_ARB, 16#84C1).
+-define(GL_TEXTURE2_ARB, 16#84C2).
+-define(GL_TEXTURE3_ARB, 16#84C3).
+-define(GL_TEXTURE4_ARB, 16#84C4).
+-define(GL_TEXTURE5_ARB, 16#84C5).
+-define(GL_TEXTURE6_ARB, 16#84C6).
+-define(GL_TEXTURE7_ARB, 16#84C7).
+-define(GL_TEXTURE8_ARB, 16#84C8).
+-define(GL_TEXTURE9_ARB, 16#84C9).
+-define(GL_TEXTURE10_ARB, 16#84CA).
+-define(GL_TEXTURE11_ARB, 16#84CB).
+-define(GL_TEXTURE12_ARB, 16#84CC).
+-define(GL_TEXTURE13_ARB, 16#84CD).
+-define(GL_TEXTURE14_ARB, 16#84CE).
+-define(GL_TEXTURE15_ARB, 16#84CF).
+-define(GL_TEXTURE16_ARB, 16#84D0).
+-define(GL_TEXTURE17_ARB, 16#84D1).
+-define(GL_TEXTURE18_ARB, 16#84D2).
+-define(GL_TEXTURE19_ARB, 16#84D3).
+-define(GL_TEXTURE20_ARB, 16#84D4).
+-define(GL_TEXTURE21_ARB, 16#84D5).
+-define(GL_TEXTURE22_ARB, 16#84D6).
+-define(GL_TEXTURE23_ARB, 16#84D7).
+-define(GL_TEXTURE24_ARB, 16#84D8).
+-define(GL_TEXTURE25_ARB, 16#84D9).
+-define(GL_TEXTURE26_ARB, 16#84DA).
+-define(GL_TEXTURE27_ARB, 16#84DB).
+-define(GL_TEXTURE28_ARB, 16#84DC).
+-define(GL_TEXTURE29_ARB, 16#84DD).
+-define(GL_TEXTURE30_ARB, 16#84DE).
+-define(GL_TEXTURE31_ARB, 16#84DF).
+-define(GL_ACTIVE_TEXTURE_ARB, 16#84E0).
+-define(GL_CLIENT_ACTIVE_TEXTURE_ARB, 16#84E1).
+-define(GL_MAX_TEXTURE_UNITS_ARB, 16#84E2).
+-define(GL_MESA_packed_depth_stencil, 1).
+-define(GL_DEPTH_STENCIL_MESA, 16#8750).
+-define(GL_UNSIGNED_INT_24_8_MESA, 16#8751).
+-define(GL_UNSIGNED_INT_8_24_REV_MESA, 16#8752).
+-define(GL_UNSIGNED_SHORT_15_1_MESA, 16#8753).
+-define(GL_UNSIGNED_SHORT_1_15_REV_MESA, 16#8754).
+-define(GL_MESA_program_debug, 1).
+-define(GL_FRAGMENT_PROGRAM_POSITION_MESA, 16#8BB0).
+-define(GL_FRAGMENT_PROGRAM_CALLBACK_MESA, 16#8BB1).
+-define(GL_FRAGMENT_PROGRAM_CALLBACK_FUNC_MESA, 16#8BB2).
+-define(GL_FRAGMENT_PROGRAM_CALLBACK_DATA_MESA, 16#8BB3).
+-define(GL_VERTEX_PROGRAM_POSITION_MESA, 16#8BB4).
+-define(GL_VERTEX_PROGRAM_CALLBACK_MESA, 16#8BB5).
+-define(GL_VERTEX_PROGRAM_CALLBACK_FUNC_MESA, 16#8BB6).
+-define(GL_VERTEX_PROGRAM_CALLBACK_DATA_MESA, 16#8BB7).
+-define(GL_MESA_texture_array, 1).
+-define(GL_TEXTURE_1D_ARRAY_EXT, 16#8C18).
+-define(GL_PROXY_TEXTURE_1D_ARRAY_EXT, 16#8C19).
+-define(GL_TEXTURE_2D_ARRAY_EXT, 16#8C1A).
+-define(GL_PROXY_TEXTURE_2D_ARRAY_EXT, 16#8C1B).
+-define(GL_TEXTURE_BINDING_1D_ARRAY_EXT, 16#8C1C).
+-define(GL_TEXTURE_BINDING_2D_ARRAY_EXT, 16#8C1D).
+-define(GL_MAX_ARRAY_TEXTURE_LAYERS_EXT, 16#88FF).
+-define(GL_FRAMEBUFFER_ATTACHMENT_TEXTURE_LAYER_EXT, 16#8CD4).
+-define(GL_ATI_blend_equation_separate, 1).
+-define(GL_ALPHA_BLEND_EQUATION_ATI, 16#883D).
+-define(GL_OES_EGL_image, 1).
+-define(GL_GLEXT_VERSION, 66).
+-define(GL_BLEND_DST_RGB, 16#80C8).
+-define(GL_BLEND_SRC_RGB, 16#80C9).
+-define(GL_BLEND_DST_ALPHA, 16#80CA).
+-define(GL_BLEND_SRC_ALPHA, 16#80CB).
+-define(GL_POINT_FADE_THRESHOLD_SIZE, 16#8128).
+-define(GL_DEPTH_COMPONENT16, 16#81A5).
+-define(GL_DEPTH_COMPONENT24, 16#81A6).
+-define(GL_DEPTH_COMPONENT32, 16#81A7).
+-define(GL_MIRRORED_REPEAT, 16#8370).
+-define(GL_MAX_TEXTURE_LOD_BIAS, 16#84FD).
+-define(GL_TEXTURE_LOD_BIAS, 16#8501).
+-define(GL_INCR_WRAP, 16#8507).
+-define(GL_DECR_WRAP, 16#8508).
+-define(GL_TEXTURE_DEPTH_SIZE, 16#884A).
+-define(GL_TEXTURE_COMPARE_MODE, 16#884C).
+-define(GL_TEXTURE_COMPARE_FUNC, 16#884D).
-define(GL_POINT_SIZE_MIN, 16#8126).
-define(GL_POINT_SIZE_MAX, 16#8127).
--define(GL_POINT_FADE_THRESHOLD_SIZE, 16#8128).
-define(GL_POINT_DISTANCE_ATTENUATION, 16#8129).
+-define(GL_GENERATE_MIPMAP, 16#8191).
+-define(GL_GENERATE_MIPMAP_HINT, 16#8192).
-define(GL_FOG_COORDINATE_SOURCE, 16#8450).
-define(GL_FOG_COORDINATE, 16#8451).
-define(GL_FRAGMENT_DEPTH, 16#8452).
@@ -762,101 +865,9 @@
-define(GL_SECONDARY_COLOR_ARRAY_STRIDE, 16#845C).
-define(GL_SECONDARY_COLOR_ARRAY_POINTER, 16#845D).
-define(GL_SECONDARY_COLOR_ARRAY, 16#845E).
--define(GL_INCR_WRAP, 16#8507).
--define(GL_DECR_WRAP, 16#8508).
--define(GL_MAX_TEXTURE_LOD_BIAS, 16#84FD).
-define(GL_TEXTURE_FILTER_CONTROL, 16#8500).
--define(GL_TEXTURE_LOD_BIAS, 16#8501).
--define(GL_GENERATE_MIPMAP, 16#8191).
--define(GL_GENERATE_MIPMAP_HINT, 16#8192).
--define(GL_BLEND_DST_RGB, 16#80C8).
--define(GL_BLEND_SRC_RGB, 16#80C9).
--define(GL_BLEND_DST_ALPHA, 16#80CA).
--define(GL_BLEND_SRC_ALPHA, 16#80CB).
--define(GL_MIRRORED_REPEAT, 16#8370).
--define(GL_DEPTH_COMPONENT16, 16#81A5).
--define(GL_DEPTH_COMPONENT24, 16#81A6).
--define(GL_DEPTH_COMPONENT32, 16#81A7).
--define(GL_TEXTURE_DEPTH_SIZE, 16#884A).
-define(GL_DEPTH_TEXTURE_MODE, 16#884B).
--define(GL_TEXTURE_COMPARE_MODE, 16#884C).
--define(GL_TEXTURE_COMPARE_FUNC, 16#884D).
-define(GL_COMPARE_R_TO_TEXTURE, 16#884E).
--define(GL_GLEXT_VERSION, 65).
--define(GL_CONSTANT_COLOR, 16#8001).
--define(GL_ONE_MINUS_CONSTANT_COLOR, 16#8002).
--define(GL_CONSTANT_ALPHA, 16#8003).
--define(GL_ONE_MINUS_CONSTANT_ALPHA, 16#8004).
--define(GL_BLEND_COLOR, 16#8005).
--define(GL_FUNC_ADD, 16#8006).
--define(GL_MIN, 16#8007).
--define(GL_MAX, 16#8008).
--define(GL_BLEND_EQUATION, 16#8009).
--define(GL_FUNC_SUBTRACT, 16#800A).
--define(GL_FUNC_REVERSE_SUBTRACT, 16#800B).
--define(GL_CONVOLUTION_1D, 16#8010).
--define(GL_CONVOLUTION_2D, 16#8011).
--define(GL_SEPARABLE_2D, 16#8012).
--define(GL_CONVOLUTION_BORDER_MODE, 16#8013).
--define(GL_CONVOLUTION_FILTER_SCALE, 16#8014).
--define(GL_CONVOLUTION_FILTER_BIAS, 16#8015).
--define(GL_REDUCE, 16#8016).
--define(GL_CONVOLUTION_FORMAT, 16#8017).
--define(GL_CONVOLUTION_WIDTH, 16#8018).
--define(GL_CONVOLUTION_HEIGHT, 16#8019).
--define(GL_MAX_CONVOLUTION_WIDTH, 16#801A).
--define(GL_MAX_CONVOLUTION_HEIGHT, 16#801B).
--define(GL_POST_CONVOLUTION_RED_SCALE, 16#801C).
--define(GL_POST_CONVOLUTION_GREEN_SCALE, 16#801D).
--define(GL_POST_CONVOLUTION_BLUE_SCALE, 16#801E).
--define(GL_POST_CONVOLUTION_ALPHA_SCALE, 16#801F).
--define(GL_POST_CONVOLUTION_RED_BIAS, 16#8020).
--define(GL_POST_CONVOLUTION_GREEN_BIAS, 16#8021).
--define(GL_POST_CONVOLUTION_BLUE_BIAS, 16#8022).
--define(GL_POST_CONVOLUTION_ALPHA_BIAS, 16#8023).
--define(GL_HISTOGRAM, 16#8024).
--define(GL_PROXY_HISTOGRAM, 16#8025).
--define(GL_HISTOGRAM_WIDTH, 16#8026).
--define(GL_HISTOGRAM_FORMAT, 16#8027).
--define(GL_HISTOGRAM_RED_SIZE, 16#8028).
--define(GL_HISTOGRAM_GREEN_SIZE, 16#8029).
--define(GL_HISTOGRAM_BLUE_SIZE, 16#802A).
--define(GL_HISTOGRAM_ALPHA_SIZE, 16#802B).
--define(GL_HISTOGRAM_LUMINANCE_SIZE, 16#802C).
--define(GL_HISTOGRAM_SINK, 16#802D).
--define(GL_MINMAX, 16#802E).
--define(GL_MINMAX_FORMAT, 16#802F).
--define(GL_MINMAX_SINK, 16#8030).
--define(GL_COLOR_MATRIX, 16#80B1).
--define(GL_COLOR_MATRIX_STACK_DEPTH, 16#80B2).
--define(GL_MAX_COLOR_MATRIX_STACK_DEPTH, 16#80B3).
--define(GL_POST_COLOR_MATRIX_RED_SCALE, 16#80B4).
--define(GL_POST_COLOR_MATRIX_GREEN_SCALE, 16#80B5).
--define(GL_POST_COLOR_MATRIX_BLUE_SCALE, 16#80B6).
--define(GL_POST_COLOR_MATRIX_ALPHA_SCALE, 16#80B7).
--define(GL_POST_COLOR_MATRIX_RED_BIAS, 16#80B8).
--define(GL_POST_COLOR_MATRIX_GREEN_BIAS, 16#80B9).
--define(GL_POST_COLOR_MATRIX_BLUE_BIAS, 16#80BA).
--define(GL_POST_COLOR_MATRIX_ALPHA_BIAS, 16#80BB).
--define(GL_COLOR_TABLE, 16#80D0).
--define(GL_POST_CONVOLUTION_COLOR_TABLE, 16#80D1).
--define(GL_POST_COLOR_MATRIX_COLOR_TABLE, 16#80D2).
--define(GL_PROXY_COLOR_TABLE, 16#80D3).
--define(GL_PROXY_POST_CONVOLUTION_COLOR_TABLE, 16#80D4).
--define(GL_PROXY_POST_COLOR_MATRIX_COLOR_TABLE, 16#80D5).
--define(GL_COLOR_TABLE_SCALE, 16#80D6).
--define(GL_COLOR_TABLE_BIAS, 16#80D7).
--define(GL_COLOR_TABLE_FORMAT, 16#80D8).
--define(GL_COLOR_TABLE_WIDTH, 16#80D9).
--define(GL_COLOR_TABLE_RED_SIZE, 16#80DA).
--define(GL_COLOR_TABLE_GREEN_SIZE, 16#80DB).
--define(GL_COLOR_TABLE_BLUE_SIZE, 16#80DC).
--define(GL_COLOR_TABLE_ALPHA_SIZE, 16#80DD).
--define(GL_COLOR_TABLE_LUMINANCE_SIZE, 16#80DE).
--define(GL_COLOR_TABLE_INTENSITY_SIZE, 16#80DF).
--define(GL_CONSTANT_BORDER, 16#8151).
--define(GL_REPLICATE_BORDER, 16#8153).
--define(GL_CONVOLUTION_BORDER_COLOR, 16#8154).
-define(GL_BUFFER_SIZE, 16#8764).
-define(GL_BUFFER_USAGE, 16#8765).
-define(GL_QUERY_COUNTER_BITS, 16#8864).
@@ -1184,41 +1195,6 @@
-define(GL_SAMPLER_CUBE_MAP_ARRAY_SHADOW, 16#900D).
-define(GL_INT_SAMPLER_CUBE_MAP_ARRAY, 16#900E).
-define(GL_UNSIGNED_INT_SAMPLER_CUBE_MAP_ARRAY, 16#900F).
--define(GL_TEXTURE0_ARB, 16#84C0).
--define(GL_TEXTURE1_ARB, 16#84C1).
--define(GL_TEXTURE2_ARB, 16#84C2).
--define(GL_TEXTURE3_ARB, 16#84C3).
--define(GL_TEXTURE4_ARB, 16#84C4).
--define(GL_TEXTURE5_ARB, 16#84C5).
--define(GL_TEXTURE6_ARB, 16#84C6).
--define(GL_TEXTURE7_ARB, 16#84C7).
--define(GL_TEXTURE8_ARB, 16#84C8).
--define(GL_TEXTURE9_ARB, 16#84C9).
--define(GL_TEXTURE10_ARB, 16#84CA).
--define(GL_TEXTURE11_ARB, 16#84CB).
--define(GL_TEXTURE12_ARB, 16#84CC).
--define(GL_TEXTURE13_ARB, 16#84CD).
--define(GL_TEXTURE14_ARB, 16#84CE).
--define(GL_TEXTURE15_ARB, 16#84CF).
--define(GL_TEXTURE16_ARB, 16#84D0).
--define(GL_TEXTURE17_ARB, 16#84D1).
--define(GL_TEXTURE18_ARB, 16#84D2).
--define(GL_TEXTURE19_ARB, 16#84D3).
--define(GL_TEXTURE20_ARB, 16#84D4).
--define(GL_TEXTURE21_ARB, 16#84D5).
--define(GL_TEXTURE22_ARB, 16#84D6).
--define(GL_TEXTURE23_ARB, 16#84D7).
--define(GL_TEXTURE24_ARB, 16#84D8).
--define(GL_TEXTURE25_ARB, 16#84D9).
--define(GL_TEXTURE26_ARB, 16#84DA).
--define(GL_TEXTURE27_ARB, 16#84DB).
--define(GL_TEXTURE28_ARB, 16#84DC).
--define(GL_TEXTURE29_ARB, 16#84DD).
--define(GL_TEXTURE30_ARB, 16#84DE).
--define(GL_TEXTURE31_ARB, 16#84DF).
--define(GL_ACTIVE_TEXTURE_ARB, 16#84E0).
--define(GL_CLIENT_ACTIVE_TEXTURE_ARB, 16#84E1).
--define(GL_MAX_TEXTURE_UNITS_ARB, 16#84E2).
-define(GL_TRANSPOSE_MODELVIEW_MATRIX_ARB, 16#84E3).
-define(GL_TRANSPOSE_PROJECTION_MATRIX_ARB, 16#84E4).
-define(GL_TRANSPOSE_TEXTURE_MATRIX_ARB, 16#84E5).
@@ -1956,6 +1932,7 @@
-define(GL_UNKNOWN_CONTEXT_RESET_ARB, 16#8255).
-define(GL_RESET_NOTIFICATION_STRATEGY_ARB, 16#8256).
-define(GL_NO_RESET_NOTIFICATION_ARB, 16#8261).
+-define(GL_ABGR_EXT, 16#8000).
-define(GL_CONSTANT_COLOR_EXT, 16#8001).
-define(GL_ONE_MINUS_CONSTANT_COLOR_EXT, 16#8002).
-define(GL_CONSTANT_ALPHA_EXT, 16#8003).
@@ -2118,6 +2095,15 @@
-define(GL_LINEAR_SHARPEN_ALPHA_SGIS, 16#80AE).
-define(GL_LINEAR_SHARPEN_COLOR_SGIS, 16#80AF).
-define(GL_SHARPEN_TEXTURE_FUNC_POINTS_SGIS, 16#80B0).
+-define(GL_UNSIGNED_BYTE_3_3_2_EXT, 16#8032).
+-define(GL_UNSIGNED_SHORT_4_4_4_4_EXT, 16#8033).
+-define(GL_UNSIGNED_SHORT_5_5_5_1_EXT, 16#8034).
+-define(GL_UNSIGNED_INT_8_8_8_8_EXT, 16#8035).
+-define(GL_UNSIGNED_INT_10_10_10_2_EXT, 16#8036).
+-define(GL_TEXTURE_MIN_LOD_SGIS, 16#813A).
+-define(GL_TEXTURE_MAX_LOD_SGIS, 16#813B).
+-define(GL_TEXTURE_BASE_LEVEL_SGIS, 16#813C).
+-define(GL_TEXTURE_MAX_LEVEL_SGIS, 16#813D).
-define(GL_MULTISAMPLE_SGIS, 16#809D).
-define(GL_SAMPLE_ALPHA_TO_MASK_SGIS, 16#809E).
-define(GL_SAMPLE_ALPHA_TO_ONE_SGIS, 16#809F).
@@ -2134,6 +2120,41 @@
-define(GL_SAMPLE_MASK_VALUE_SGIS, 16#80AA).
-define(GL_SAMPLE_MASK_INVERT_SGIS, 16#80AB).
-define(GL_SAMPLE_PATTERN_SGIS, 16#80AC).
+-define(GL_RESCALE_NORMAL_EXT, 16#803A).
+-define(GL_VERTEX_ARRAY_EXT, 16#8074).
+-define(GL_NORMAL_ARRAY_EXT, 16#8075).
+-define(GL_COLOR_ARRAY_EXT, 16#8076).
+-define(GL_INDEX_ARRAY_EXT, 16#8077).
+-define(GL_TEXTURE_COORD_ARRAY_EXT, 16#8078).
+-define(GL_EDGE_FLAG_ARRAY_EXT, 16#8079).
+-define(GL_VERTEX_ARRAY_SIZE_EXT, 16#807A).
+-define(GL_VERTEX_ARRAY_TYPE_EXT, 16#807B).
+-define(GL_VERTEX_ARRAY_STRIDE_EXT, 16#807C).
+-define(GL_VERTEX_ARRAY_COUNT_EXT, 16#807D).
+-define(GL_NORMAL_ARRAY_TYPE_EXT, 16#807E).
+-define(GL_NORMAL_ARRAY_STRIDE_EXT, 16#807F).
+-define(GL_NORMAL_ARRAY_COUNT_EXT, 16#8080).
+-define(GL_COLOR_ARRAY_SIZE_EXT, 16#8081).
+-define(GL_COLOR_ARRAY_TYPE_EXT, 16#8082).
+-define(GL_COLOR_ARRAY_STRIDE_EXT, 16#8083).
+-define(GL_COLOR_ARRAY_COUNT_EXT, 16#8084).
+-define(GL_INDEX_ARRAY_TYPE_EXT, 16#8085).
+-define(GL_INDEX_ARRAY_STRIDE_EXT, 16#8086).
+-define(GL_INDEX_ARRAY_COUNT_EXT, 16#8087).
+-define(GL_TEXTURE_COORD_ARRAY_SIZE_EXT, 16#8088).
+-define(GL_TEXTURE_COORD_ARRAY_TYPE_EXT, 16#8089).
+-define(GL_TEXTURE_COORD_ARRAY_STRIDE_EXT, 16#808A).
+-define(GL_TEXTURE_COORD_ARRAY_COUNT_EXT, 16#808B).
+-define(GL_EDGE_FLAG_ARRAY_STRIDE_EXT, 16#808C).
+-define(GL_EDGE_FLAG_ARRAY_COUNT_EXT, 16#808D).
+-define(GL_VERTEX_ARRAY_POINTER_EXT, 16#808E).
+-define(GL_NORMAL_ARRAY_POINTER_EXT, 16#808F).
+-define(GL_COLOR_ARRAY_POINTER_EXT, 16#8090).
+-define(GL_INDEX_ARRAY_POINTER_EXT, 16#8091).
+-define(GL_TEXTURE_COORD_ARRAY_POINTER_EXT, 16#8092).
+-define(GL_EDGE_FLAG_ARRAY_POINTER_EXT, 16#8093).
+-define(GL_GENERATE_MIPMAP_SGIS, 16#8191).
+-define(GL_GENERATE_MIPMAP_HINT_SGIS, 16#8192).
-define(GL_LINEAR_CLIPMAP_LINEAR_SGIX, 16#8170).
-define(GL_TEXTURE_CLIPMAP_CENTER_SGIX, 16#8171).
-define(GL_TEXTURE_CLIPMAP_FRAME_SGIX, 16#8172).
@@ -2146,12 +2167,18 @@
-define(GL_NEAREST_CLIPMAP_NEAREST_SGIX, 16#844D).
-define(GL_NEAREST_CLIPMAP_LINEAR_SGIX, 16#844E).
-define(GL_LINEAR_CLIPMAP_NEAREST_SGIX, 16#844F).
+-define(GL_TEXTURE_COMPARE_SGIX, 16#819A).
+-define(GL_TEXTURE_COMPARE_OPERATOR_SGIX, 16#819B).
+-define(GL_TEXTURE_LEQUAL_R_SGIX, 16#819C).
+-define(GL_TEXTURE_GEQUAL_R_SGIX, 16#819D).
-define(GL_CLAMP_TO_EDGE_SGIS, 16#812F).
-define(GL_CLAMP_TO_BORDER_SGIS, 16#812D).
-define(GL_FUNC_ADD_EXT, 16#8006).
-define(GL_MIN_EXT, 16#8007).
-define(GL_MAX_EXT, 16#8008).
-define(GL_BLEND_EQUATION_EXT, 16#8009).
+-define(GL_FUNC_SUBTRACT_EXT, 16#800A).
+-define(GL_FUNC_REVERSE_SUBTRACT_EXT, 16#800B).
-define(GL_INTERLACE_SGIX, 16#8094).
-define(GL_PIXEL_TILE_BEST_ALIGNMENT_SGIX, 16#813E).
-define(GL_PIXEL_TILE_CACHE_INCREMENT_SGIX, 16#813F).
@@ -2216,6 +2243,9 @@
-define(GL_MAX_DEFORMATION_ORDER_SGIX, 16#8197).
-define(GL_REFERENCE_PLANE_SGIX, 16#817D).
-define(GL_REFERENCE_PLANE_EQUATION_SGIX, 16#817E).
+-define(GL_DEPTH_COMPONENT16_SGIX, 16#81A5).
+-define(GL_DEPTH_COMPONENT24_SGIX, 16#81A6).
+-define(GL_DEPTH_COMPONENT32_SGIX, 16#81A7).
-define(GL_FOG_FUNC_SGIS, 16#812A).
-define(GL_FOG_FUNC_POINTS_SGIS, 16#812B).
-define(GL_MAX_FOG_FUNC_POINTS_SGIS, 16#812C).
@@ -2393,6 +2423,7 @@
-define(GL_PIXEL_TRANSFORM_2D_STACK_DEPTH_EXT, 16#8336).
-define(GL_MAX_PIXEL_TRANSFORM_2D_STACK_DEPTH_EXT, 16#8337).
-define(GL_PIXEL_TRANSFORM_2D_MATRIX_EXT, 16#8338).
+-define(GL_SHARED_TEXTURE_PALETTE_EXT, 16#81FB).
-define(GL_LIGHT_MODEL_COLOR_CONTROL_EXT, 16#81F8).
-define(GL_SINGLE_COLOR_EXT, 16#81F9).
-define(GL_SEPARATE_SPECULAR_COLOR_EXT, 16#81FA).
@@ -3387,7 +3418,6 @@
-define(GL_FRAMEBUFFER_ATTACHMENT_LAYERED_EXT, 16#8DA7).
-define(GL_FRAMEBUFFER_INCOMPLETE_LAYER_TARGETS_EXT, 16#8DA8).
-define(GL_FRAMEBUFFER_INCOMPLETE_LAYER_COUNT_EXT, 16#8DA9).
--define(GL_FRAMEBUFFER_ATTACHMENT_TEXTURE_LAYER_EXT, 16#8CD4).
-define(GL_PROGRAM_POINT_SIZE_EXT, 16#8642).
-define(GL_GEOMETRY_SHADER_EXT, 16#8DD9).
-define(GL_MAX_GEOMETRY_VARYING_COMPONENTS_EXT, 16#8DDD).
@@ -3425,13 +3455,6 @@
-define(GL_R11F_G11F_B10F_EXT, 16#8C3A).
-define(GL_UNSIGNED_INT_10F_11F_11F_REV_EXT, 16#8C3B).
-define(GL_RGBA_SIGNED_COMPONENTS_EXT, 16#8C3C).
--define(GL_TEXTURE_1D_ARRAY_EXT, 16#8C18).
--define(GL_PROXY_TEXTURE_1D_ARRAY_EXT, 16#8C19).
--define(GL_TEXTURE_2D_ARRAY_EXT, 16#8C1A).
--define(GL_PROXY_TEXTURE_2D_ARRAY_EXT, 16#8C1B).
--define(GL_TEXTURE_BINDING_1D_ARRAY_EXT, 16#8C1C).
--define(GL_TEXTURE_BINDING_2D_ARRAY_EXT, 16#8C1D).
--define(GL_MAX_ARRAY_TEXTURE_LAYERS_EXT, 16#88FF).
-define(GL_COMPARE_REF_DEPTH_TO_TEXTURE_EXT, 16#884E).
-define(GL_TEXTURE_BUFFER_EXT, 16#8C2A).
-define(GL_MAX_TEXTURE_BUFFER_SIZE_EXT, 16#8C2B).
@@ -3857,396 +3880,5 @@
-define(GL_SURFACE_REGISTERED_NV, 16#86FD).
-define(GL_SURFACE_MAPPED_NV, 16#8700).
-define(GL_WRITE_DISCARD_NV, 16#88BE).
--define(GL_VERSION_1_2, 1).
--define(GL_VERSION_1_2_DEPRECATED, 1).
--define(GL_VERSION_1_3, 1).
--define(GL_VERSION_1_3_DEPRECATED, 1).
--define(GL_VERSION_1_4, 1).
--define(GL_VERSION_1_4_DEPRECATED, 1).
--define(GL_VERSION_1_5, 1).
--define(GL_VERSION_2_0, 1).
--define(GL_VERSION_2_1, 1).
--define(GL_VERSION_3_0, 1).
--define(GL_VERSION_3_1, 1).
--define(GL_VERSION_3_2, 1).
--define(GL_VERSION_3_3, 1).
--define(GL_VERSION_4_0, 1).
--define(GL_VERSION_4_1, 1).
--define(GL_ARB_multitexture, 1).
--define(GL_ARB_transpose_matrix, 1).
--define(GL_ARB_multisample, 1).
--define(GL_ARB_texture_env_add, 1).
--define(GL_ARB_texture_cube_map, 1).
--define(GL_ARB_texture_compression, 1).
--define(GL_ARB_texture_border_clamp, 1).
--define(GL_ARB_point_parameters, 1).
--define(GL_ARB_vertex_blend, 1).
--define(GL_ARB_matrix_palette, 1).
--define(GL_ARB_texture_env_combine, 1).
--define(GL_ARB_texture_env_crossbar, 1).
--define(GL_ARB_texture_env_dot3, 1).
--define(GL_ARB_texture_mirrored_repeat, 1).
--define(GL_ARB_depth_texture, 1).
--define(GL_ARB_shadow, 1).
--define(GL_ARB_shadow_ambient, 1).
--define(GL_ARB_window_pos, 1).
--define(GL_ARB_vertex_program, 1).
--define(GL_ARB_fragment_program, 1).
--define(GL_ARB_vertex_buffer_object, 1).
--define(GL_ARB_occlusion_query, 1).
--define(GL_ARB_shader_objects, 1).
--define(GL_ARB_vertex_shader, 1).
--define(GL_ARB_fragment_shader, 1).
--define(GL_ARB_shading_language_100, 1).
--define(GL_ARB_texture_non_power_of_two, 1).
--define(GL_ARB_point_sprite, 1).
--define(GL_ARB_fragment_program_shadow, 1).
--define(GL_ARB_draw_buffers, 1).
--define(GL_ARB_texture_rectangle, 1).
--define(GL_ARB_color_buffer_float, 1).
--define(GL_ARB_half_float_pixel, 1).
--define(GL_ARB_texture_float, 1).
--define(GL_ARB_pixel_buffer_object, 1).
--define(GL_ARB_depth_buffer_float, 1).
--define(GL_ARB_draw_instanced, 1).
--define(GL_ARB_framebuffer_object, 1).
--define(GL_ARB_framebuffer_sRGB, 1).
--define(GL_ARB_geometry_shader4, 1).
--define(GL_ARB_half_float_vertex, 1).
--define(GL_ARB_instanced_arrays, 1).
--define(GL_ARB_map_buffer_range, 1).
--define(GL_ARB_texture_buffer_object, 1).
--define(GL_ARB_texture_compression_rgtc, 1).
--define(GL_ARB_texture_rg, 1).
--define(GL_ARB_vertex_array_object, 1).
--define(GL_ARB_uniform_buffer_object, 1).
--define(GL_ARB_compatibility, 1).
--define(GL_ARB_copy_buffer, 1).
--define(GL_ARB_shader_texture_lod, 1).
--define(GL_ARB_depth_clamp, 1).
--define(GL_ARB_draw_elements_base_vertex, 1).
--define(GL_ARB_fragment_coord_conventions, 1).
--define(GL_ARB_provoking_vertex, 1).
--define(GL_ARB_seamless_cube_map, 1).
--define(GL_ARB_sync, 1).
--define(GL_ARB_texture_multisample, 1).
--define(GL_ARB_vertex_array_bgra, 1).
--define(GL_ARB_draw_buffers_blend, 1).
--define(GL_ARB_sample_shading, 1).
--define(GL_ARB_texture_cube_map_array, 1).
--define(GL_ARB_texture_gather, 1).
--define(GL_ARB_texture_query_lod, 1).
--define(GL_ARB_shading_language_include, 1).
--define(GL_ARB_texture_compression_bptc, 1).
--define(GL_ARB_blend_func_extended, 1).
--define(GL_ARB_explicit_attrib_location, 1).
--define(GL_ARB_occlusion_query2, 1).
--define(GL_ARB_sampler_objects, 1).
--define(GL_ARB_texture_rgb10_a2ui, 1).
--define(GL_ARB_texture_swizzle, 1).
--define(GL_ARB_timer_query, 1).
--define(GL_ARB_vertex_type_2_10_10_10_rev, 1).
--define(GL_ARB_draw_indirect, 1).
--define(GL_ARB_gpu_shader5, 1).
--define(GL_ARB_gpu_shader_fp64, 1).
--define(GL_ARB_shader_subroutine, 1).
--define(GL_ARB_tessellation_shader, 1).
--define(GL_ARB_texture_buffer_object_rgb32, 1).
--define(GL_ARB_transform_feedback2, 1).
--define(GL_ARB_transform_feedback3, 1).
--define(GL_ARB_ES2_compatibility, 1).
--define(GL_ARB_get_program_binary, 1).
--define(GL_ARB_separate_shader_objects, 1).
--define(GL_ARB_vertex_attrib_64bit, 1).
--define(GL_ARB_viewport_array, 1).
--define(GL_ARB_cl_event, 1).
--define(GL_ARB_debug_output, 1).
--define(GL_ARB_robustness, 1).
--define(GL_ARB_shader_stencil_export, 1).
--define(GL_EXT_abgr, 1).
--define(GL_EXT_blend_color, 1).
--define(GL_EXT_polygon_offset, 1).
--define(GL_EXT_texture, 1).
--define(GL_EXT_texture3D, 1).
--define(GL_SGIS_texture_filter4, 1).
--define(GL_EXT_subtexture, 1).
--define(GL_EXT_copy_texture, 1).
--define(GL_EXT_histogram, 1).
--define(GL_EXT_convolution, 1).
--define(GL_SGI_color_matrix, 1).
--define(GL_SGI_color_table, 1).
--define(GL_SGIX_pixel_texture, 1).
--define(GL_SGIS_pixel_texture, 1).
--define(GL_SGIS_texture4D, 1).
--define(GL_SGI_texture_color_table, 1).
--define(GL_EXT_cmyka, 1).
--define(GL_EXT_texture_object, 1).
--define(GL_SGIS_detail_texture, 1).
--define(GL_SGIS_sharpen_texture, 1).
--define(GL_EXT_packed_pixels, 1).
--define(GL_SGIS_texture_lod, 1).
--define(GL_SGIS_multisample, 1).
--define(GL_EXT_rescale_normal, 1).
--define(GL_EXT_vertex_array, 1).
--define(GL_EXT_misc_attribute, 1).
--define(GL_SGIS_generate_mipmap, 1).
--define(GL_SGIX_clipmap, 1).
--define(GL_SGIX_shadow, 1).
--define(GL_SGIS_texture_edge_clamp, 1).
--define(GL_SGIS_texture_border_clamp, 1).
--define(GL_EXT_blend_minmax, 1).
--define(GL_EXT_blend_subtract, 1).
--define(GL_EXT_blend_logic_op, 1).
--define(GL_SGIX_interlace, 1).
--define(GL_SGIX_pixel_tiles, 1).
--define(GL_SGIX_texture_select, 1).
--define(GL_SGIX_sprite, 1).
--define(GL_SGIX_texture_multi_buffer, 1).
--define(GL_EXT_point_parameters, 1).
--define(GL_SGIS_point_parameters, 1).
--define(GL_SGIX_instruments, 1).
--define(GL_SGIX_texture_scale_bias, 1).
--define(GL_SGIX_framezoom, 1).
--define(GL_SGIX_tag_sample_buffer, 1).
--define(GL_SGIX_polynomial_ffd, 1).
--define(GL_SGIX_reference_plane, 1).
--define(GL_SGIX_flush_raster, 1).
--define(GL_SGIX_depth_texture, 1).
--define(GL_SGIS_fog_function, 1).
--define(GL_SGIX_fog_offset, 1).
--define(GL_HP_image_transform, 1).
--define(GL_HP_convolution_border_modes, 1).
--define(GL_SGIX_texture_add_env, 1).
--define(GL_EXT_color_subtable, 1).
--define(GL_PGI_vertex_hints, 1).
--define(GL_PGI_misc_hints, 1).
--define(GL_EXT_paletted_texture, 1).
--define(GL_EXT_clip_volume_hint, 1).
--define(GL_SGIX_list_priority, 1).
--define(GL_SGIX_ir_instrument1, 1).
--define(GL_SGIX_calligraphic_fragment, 1).
--define(GL_SGIX_texture_lod_bias, 1).
--define(GL_SGIX_shadow_ambient, 1).
--define(GL_EXT_index_texture, 1).
--define(GL_EXT_index_material, 1).
--define(GL_EXT_index_func, 1).
--define(GL_EXT_index_array_formats, 1).
--define(GL_EXT_compiled_vertex_array, 1).
--define(GL_EXT_cull_vertex, 1).
--define(GL_SGIX_ycrcb, 1).
--define(GL_SGIX_fragment_lighting, 1).
--define(GL_IBM_rasterpos_clip, 1).
--define(GL_HP_texture_lighting, 1).
--define(GL_EXT_draw_range_elements, 1).
--define(GL_WIN_phong_shading, 1).
--define(GL_WIN_specular_fog, 1).
--define(GL_EXT_light_texture, 1).
--define(GL_SGIX_blend_alpha_minmax, 1).
--define(GL_EXT_bgra, 1).
--define(GL_SGIX_async, 1).
--define(GL_SGIX_async_pixel, 1).
--define(GL_SGIX_async_histogram, 1).
--define(GL_INTEL_parallel_arrays, 1).
--define(GL_HP_occlusion_test, 1).
--define(GL_EXT_pixel_transform, 1).
--define(GL_EXT_pixel_transform_color_table, 1).
--define(GL_EXT_shared_texture_palette, 1).
--define(GL_EXT_separate_specular_color, 1).
--define(GL_EXT_secondary_color, 1).
--define(GL_EXT_texture_perturb_normal, 1).
--define(GL_EXT_multi_draw_arrays, 1).
--define(GL_EXT_fog_coord, 1).
--define(GL_REND_screen_coordinates, 1).
--define(GL_EXT_coordinate_frame, 1).
--define(GL_EXT_texture_env_combine, 1).
--define(GL_APPLE_specular_vector, 1).
--define(GL_APPLE_transform_hint, 1).
--define(GL_SGIX_fog_scale, 1).
--define(GL_SUNX_constant_data, 1).
--define(GL_SUN_global_alpha, 1).
--define(GL_SUN_triangle_list, 1).
--define(GL_SUN_vertex, 1).
--define(GL_EXT_blend_func_separate, 1).
--define(GL_INGR_blend_func_separate, 1).
--define(GL_INGR_color_clamp, 1).
--define(GL_INGR_interlace_read, 1).
--define(GL_EXT_stencil_wrap, 1).
--define(GL_EXT_422_pixels, 1).
--define(GL_NV_texgen_reflection, 1).
--define(GL_SUN_convolution_border_modes, 1).
--define(GL_EXT_texture_env_add, 1).
--define(GL_EXT_texture_lod_bias, 1).
--define(GL_EXT_texture_filter_anisotropic, 1).
--define(GL_EXT_vertex_weighting, 1).
--define(GL_NV_light_max_exponent, 1).
--define(GL_NV_vertex_array_range, 1).
--define(GL_NV_register_combiners, 1).
--define(GL_NV_fog_distance, 1).
--define(GL_NV_texgen_emboss, 1).
--define(GL_NV_blend_square, 1).
--define(GL_NV_texture_env_combine4, 1).
--define(GL_MESA_resize_buffers, 1).
--define(GL_MESA_window_pos, 1).
--define(GL_IBM_cull_vertex, 1).
--define(GL_IBM_multimode_draw_arrays, 1).
--define(GL_IBM_vertex_array_lists, 1).
--define(GL_SGIX_subsample, 1).
--define(GL_SGIX_ycrcba, 1).
--define(GL_SGIX_ycrcb_subsample, 1).
--define(GL_SGIX_depth_pass_instrument, 1).
--define(GL_3DFX_texture_compression_FXT1, 1).
--define(GL_3DFX_multisample, 1).
--define(GL_3DFX_tbuffer, 1).
--define(GL_EXT_multisample, 1).
--define(GL_SGIX_vertex_preclip, 1).
--define(GL_SGIX_convolution_accuracy, 1).
--define(GL_SGIX_resample, 1).
--define(GL_SGIS_point_line_texgen, 1).
--define(GL_SGIS_texture_color_mask, 1).
--define(GL_SGIX_igloo_interface, 1).
--define(GL_EXT_texture_env_dot3, 1).
--define(GL_ATI_texture_mirror_once, 1).
--define(GL_NV_fence, 1).
--define(GL_NV_evaluators, 1).
--define(GL_NV_packed_depth_stencil, 1).
--define(GL_NV_register_combiners2, 1).
--define(GL_NV_texture_compression_vtc, 1).
--define(GL_NV_texture_rectangle, 1).
--define(GL_NV_texture_shader, 1).
--define(GL_NV_texture_shader2, 1).
--define(GL_NV_vertex_array_range2, 1).
--define(GL_NV_vertex_program, 1).
--define(GL_SGIX_texture_coordinate_clamp, 1).
--define(GL_SGIX_scalebias_hint, 1).
--define(GL_OML_interlace, 1).
--define(GL_OML_subsample, 1).
--define(GL_OML_resample, 1).
--define(GL_NV_copy_depth_to_color, 1).
--define(GL_ATI_envmap_bumpmap, 1).
--define(GL_ATI_fragment_shader, 1).
--define(GL_ATI_pn_triangles, 1).
--define(GL_ATI_vertex_array_object, 1).
--define(GL_EXT_vertex_shader, 1).
--define(GL_ATI_vertex_streams, 1).
--define(GL_ATI_element_array, 1).
--define(GL_SUN_mesh_array, 1).
--define(GL_SUN_slice_accum, 1).
--define(GL_NV_multisample_filter_hint, 1).
--define(GL_NV_depth_clamp, 1).
--define(GL_NV_occlusion_query, 1).
--define(GL_NV_point_sprite, 1).
--define(GL_NV_texture_shader3, 1).
--define(GL_NV_vertex_program1_1, 1).
--define(GL_EXT_shadow_funcs, 1).
--define(GL_EXT_stencil_two_side, 1).
--define(GL_ATI_text_fragment_shader, 1).
--define(GL_APPLE_client_storage, 1).
--define(GL_APPLE_element_array, 1).
--define(GL_APPLE_fence, 1).
--define(GL_APPLE_vertex_array_object, 1).
--define(GL_APPLE_vertex_array_range, 1).
--define(GL_APPLE_ycbcr_422, 1).
--define(GL_S3_s3tc, 1).
--define(GL_ATI_draw_buffers, 1).
--define(GL_ATI_pixel_format_float, 1).
--define(GL_ATI_texture_env_combine3, 1).
--define(GL_ATI_texture_float, 1).
--define(GL_NV_float_buffer, 1).
--define(GL_NV_fragment_program, 1).
--define(GL_NV_half_float, 1).
--define(GL_NV_pixel_data_range, 1).
--define(GL_NV_primitive_restart, 1).
--define(GL_NV_texture_expand_normal, 1).
--define(GL_NV_vertex_program2, 1).
--define(GL_ATI_map_object_buffer, 1).
--define(GL_ATI_separate_stencil, 1).
--define(GL_ATI_vertex_attrib_array_object, 1).
--define(GL_OES_read_format, 1).
--define(GL_EXT_depth_bounds_test, 1).
--define(GL_EXT_texture_mirror_clamp, 1).
--define(GL_EXT_blend_equation_separate, 1).
--define(GL_MESA_pack_invert, 1).
--define(GL_MESA_ycbcr_texture, 1).
--define(GL_EXT_pixel_buffer_object, 1).
--define(GL_NV_fragment_program_option, 1).
--define(GL_NV_fragment_program2, 1).
--define(GL_NV_vertex_program2_option, 1).
--define(GL_NV_vertex_program3, 1).
--define(GL_EXT_framebuffer_object, 1).
--define(GL_GREMEDY_string_marker, 1).
--define(GL_EXT_packed_depth_stencil, 1).
--define(GL_EXT_stencil_clear_tag, 1).
--define(GL_EXT_texture_sRGB, 1).
--define(GL_EXT_framebuffer_blit, 1).
--define(GL_EXT_framebuffer_multisample, 1).
--define(GL_MESAX_texture_stack, 1).
--define(GL_EXT_timer_query, 1).
--define(GL_EXT_gpu_program_parameters, 1).
--define(GL_APPLE_flush_buffer_range, 1).
--define(GL_NV_gpu_program4, 1).
--define(GL_NV_geometry_program4, 1).
--define(GL_EXT_geometry_shader4, 1).
--define(GL_NV_vertex_program4, 1).
--define(GL_EXT_gpu_shader4, 1).
--define(GL_EXT_draw_instanced, 1).
--define(GL_EXT_packed_float, 1).
--define(GL_EXT_texture_array, 1).
--define(GL_EXT_texture_buffer_object, 1).
--define(GL_EXT_texture_compression_latc, 1).
--define(GL_EXT_texture_compression_rgtc, 1).
--define(GL_EXT_texture_shared_exponent, 1).
--define(GL_NV_depth_buffer_float, 1).
--define(GL_NV_fragment_program4, 1).
--define(GL_NV_framebuffer_multisample_coverage, 1).
--define(GL_EXT_framebuffer_sRGB, 1).
--define(GL_NV_geometry_shader4, 1).
--define(GL_NV_parameter_buffer_object, 1).
--define(GL_EXT_draw_buffers2, 1).
--define(GL_NV_transform_feedback, 1).
--define(GL_EXT_bindable_uniform, 1).
--define(GL_EXT_texture_integer, 1).
--define(GL_GREMEDY_frame_terminator, 1).
--define(GL_NV_conditional_render, 1).
--define(GL_NV_present_video, 1).
--define(GL_EXT_transform_feedback, 1).
--define(GL_EXT_direct_state_access, 1).
--define(GL_EXT_vertex_array_bgra, 1).
--define(GL_EXT_texture_swizzle, 1).
--define(GL_NV_explicit_multisample, 1).
--define(GL_NV_transform_feedback2, 1).
--define(GL_ATI_meminfo, 1).
--define(GL_AMD_performance_monitor, 1).
--define(GL_AMD_texture_texture4, 1).
--define(GL_AMD_vertex_shader_tesselator, 1).
--define(GL_EXT_provoking_vertex, 1).
--define(GL_EXT_texture_snorm, 1).
--define(GL_AMD_draw_buffers_blend, 1).
--define(GL_APPLE_texture_range, 1).
--define(GL_APPLE_float_pixels, 1).
--define(GL_APPLE_vertex_program_evaluators, 1).
--define(GL_APPLE_aux_depth_stencil, 1).
--define(GL_APPLE_object_purgeable, 1).
--define(GL_APPLE_row_bytes, 1).
--define(GL_APPLE_rgb_422, 1).
--define(GL_NV_video_capture, 1).
--define(GL_NV_copy_image, 1).
--define(GL_EXT_separate_shader_objects, 1).
--define(GL_NV_parameter_buffer_object2, 1).
--define(GL_NV_shader_buffer_load, 1).
--define(GL_NV_vertex_buffer_unified_memory, 1).
--define(GL_NV_texture_barrier, 1).
--define(GL_AMD_shader_stencil_export, 1).
--define(GL_AMD_seamless_cubemap_per_texture, 1).
--define(GL_AMD_conservative_depth, 1).
--define(GL_EXT_shader_image_load_store, 1).
--define(GL_EXT_vertex_attrib_64bit, 1).
--define(GL_NV_gpu_program5, 1).
--define(GL_NV_gpu_shader5, 1).
--define(GL_NV_shader_buffer_store, 1).
--define(GL_NV_tessellation_program5, 1).
--define(GL_NV_vertex_attrib_integer_64bit, 1).
--define(GL_NV_multisample_coverage, 1).
--define(GL_AMD_name_gen_delete, 1).
--define(GL_AMD_debug_output, 1).
--define(GL_NV_vdpau_interop, 1).
--define(GL_AMD_transform_feedback3_lines_triangles, 1).
+-define(GL_DEPTH_CLAMP_NEAR_AMD, 16#901E).
+-define(GL_DEPTH_CLAMP_FAR_AMD, 16#901F).
diff --git a/lib/wx/src/gen/wxListCtrl.erl b/lib/wx/src/gen/wxListCtrl.erl
index 9c4ba1e5a3..5799206b87 100644
--- a/lib/wx/src/gen/wxListCtrl.erl
+++ b/lib/wx/src/gen/wxListCtrl.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -29,17 +29,17 @@
-module(wxListCtrl).
-include("wxe.hrl").
--export([ sortItems/2 ,arrange/1,arrange/2,assignImageList/3,clearAll/1,create/2,
- create/3,deleteAllItems/1,deleteColumn/2,deleteItem/2,destroy/1,editLabel/2,
- ensureVisible/2,findItem/3,findItem/4,getColumn/3,getColumnCount/1,
- getColumnWidth/2,getCountPerPage/1,getEditControl/1,getImageList/2,
- getItem/2,getItemBackgroundColour/2,getItemCount/1,getItemData/2,
- getItemFont/2,getItemPosition/3,getItemRect/3,getItemRect/4,getItemSpacing/1,
- getItemState/3,getItemText/2,getItemTextColour/2,getNextItem/2,getNextItem/3,
- getSelectedItemCount/1,getTextColour/1,getTopItem/1,getViewRect/1,
- hitTest/2,insertColumn/3,insertColumn/4,insertItem/2,insertItem/3,
- insertItem/4,new/0,new/1,new/2,refreshItem/2,refreshItems/3,scrollList/3,
- setBackgroundColour/2,setColumn/3,setColumnWidth/3,setImageList/3,
+-export([ create/2, create/3 , new/0, new/1, new/2 , sortItems/2 ,arrange/1,
+ arrange/2,assignImageList/3,clearAll/1,deleteAllItems/1,deleteColumn/2,
+ deleteItem/2,destroy/1,editLabel/2,ensureVisible/2,findItem/3,findItem/4,
+ getColumn/3,getColumnCount/1,getColumnWidth/2,getCountPerPage/1,getEditControl/1,
+ getImageList/2,getItem/2,getItemBackgroundColour/2,getItemCount/1,
+ getItemData/2,getItemFont/2,getItemPosition/3,getItemRect/3,getItemRect/4,
+ getItemSpacing/1,getItemState/3,getItemText/2,getItemTextColour/2,
+ getNextItem/2,getNextItem/3,getSelectedItemCount/1,getTextColour/1,
+ getTopItem/1,getViewRect/1,hitTest/2,insertColumn/3,insertColumn/4,
+ insertItem/2,insertItem/3,insertItem/4,refreshItem/2,refreshItems/3,
+ scrollList/3,setBackgroundColour/2,setColumn/3,setColumnWidth/3,setImageList/3,
setItem/2,setItem/4,setItem/5,setItemBackgroundColour/3,setItemColumnImage/4,
setItemCount/2,setItemData/3,setItemFont/3,setItemImage/3,setItemImage/4,
setItemPosition/3,setItemState/4,setItemText/3,setItemTextColour/3,
@@ -89,11 +89,11 @@ parent_class(wxWindow) -> true;
parent_class(wxEvtHandler) -> true;
parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
+
%% @spec () -> wxListCtrl()
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistctrl.html#wxlistctrlwxlistctrl">external documentation</a>.
new() ->
- wxe_util:construct(?wxListCtrl_new_0,
- <<>>).
+ wxe_util:construct(?wxListCtrl_new_0, <<>>).
%% @spec (Parent::wxWindow:wxWindow()) -> wxListCtrl()
%% @equiv new(Parent, [])
@@ -102,20 +102,44 @@ new(Parent)
new(Parent, []).
%% @spec (Parent::wxWindow:wxWindow(), [Option]) -> wxListCtrl()
-%% Option = {winid, integer()} | {pos, {X::integer(),Y::integer()}} | {size, {W::integer(),H::integer()}} | {style, integer()} | {validator, wx:wx()}
+%% Option = {winid, integer()} |
+%% {pos, {X::integer(),Y::integer()}} |
+%% {size, {W::integer(),H::integer()}} |
+%% {style, integer()} |
+%% {validator, wx:wx()} |
+%% {onGetItemText, OnGetItemText} |
+%% {onGetItemAttr, OnGetItemAttr} |
+%% {onGetItemColumnImage, OnGetItemColumnImage}
+%%
+%% OnGetItemText = (This, Item, Column) -> wxString()
+%% OnGetItemAttr = (This, Item) -> wxListItemAttr()
+%% OnGetItemColumnImage = (This, Item, Column) -> integer()
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistctrl.html#wxlistctrlwxlistctrl">external documentation</a>.
+
new(#wx_ref{type=ParentT,ref=ParentRef}, Options)
- when is_list(Options) ->
- ?CLASS(ParentT,wxWindow),
- MOpts = fun({winid, Winid}, Acc) -> [<<1:32/?UI,Winid:32/?UI>>|Acc];
- ({pos, {PosX,PosY}}, Acc) -> [<<2:32/?UI,PosX:32/?UI,PosY:32/?UI,0:32>>|Acc];
- ({size, {SizeW,SizeH}}, Acc) -> [<<3:32/?UI,SizeW:32/?UI,SizeH:32/?UI,0:32>>|Acc];
- ({style, Style}, Acc) -> [<<4:32/?UI,Style:32/?UI>>|Acc];
- ({validator, #wx_ref{type=ValidatorT,ref=ValidatorRef}}, Acc) -> ?CLASS(ValidatorT,wx),[<<5:32/?UI,ValidatorRef:32/?UI>>|Acc];
- (BadOpt, _) -> erlang:error({badoption, BadOpt}) end,
- BinOpt = list_to_binary(lists:foldl(MOpts, [<<0:32>>], Options)),
- wxe_util:construct(?wxListCtrl_new_2,
- <<ParentRef:32/?UI, 0:32,BinOpt/binary>>).
+ when is_list(Options)->
+ ?CLASS(ParentT,wxWindow),
+ MOpts = fun({winid, Winid}, Acc) -> [<<1:32/?UI,Winid:32/?UI>>|Acc];
+ ({pos, {PosX,PosY}}, Acc) -> [<<2:32/?UI,PosX:32/?UI,PosY:32/?UI,0:32>>|Acc];
+ ({size, {SizeW,SizeH}}, Acc) -> [<<3:32/?UI,SizeW:32/?UI,SizeH:32/?UI,0:32>>|Acc];
+ ({style, Style}, Acc) -> [<<4:32/?UI,Style:32/?UI>>|Acc];
+ ({validator, #wx_ref{type=ValidatorT,ref=ValidatorRef}}, Acc) ->
+ ?CLASS(ValidatorT,wx),[<<5:32/?UI,ValidatorRef:32/?UI>>|Acc];
+ ({onGetItemText, F}, Acc) when is_function(F) ->
+ Fun = fun([This,Item,Col]) -> unicode:characters_to_binary([F(This,Item,Col),0]) end,
+ [<<6:32/?UI,(wxe_util:get_cbId(Fun)):32/?UI>>|Acc];
+ ({onGetItemAttr, F}, Acc) when is_function(F) ->
+ Fun = fun([This,Item]) ->
+ #wx_ref{type=wxListItemAttr,ref=ThisRef} = F(This,Item),
+ <<ThisRef:32/?UI>>
+ end,
+ [<<7:32/?UI,(wxe_util:get_cbId(Fun)):32/?UI>>|Acc];
+ ({onGetItemColumnImage, F}, Acc) when is_function(F) ->
+ Fun = fun([This,Item, Col]) -> <<(F(This,Item,Col)):32/?I>> end,
+ [<<8:32/?UI,(wxe_util:get_cbId(Fun)):32/?UI>>|Acc];
+ (BadOpt, _) -> erlang:error({badoption, BadOpt}) end,
+ BinOpt = list_to_binary(lists:foldl(MOpts, [<<0:32>>], Options)),
+ wxe_util:construct(?wxListCtrl_new_2, <<ParentRef:32/?UI, 0:32,BinOpt/binary>>).
%% @spec (This::wxListCtrl()) -> bool()
%% @equiv arrange(This, [])
@@ -151,6 +175,7 @@ clearAll(#wx_ref{type=ThisT,ref=ThisRef}) ->
wxe_util:cast(?wxListCtrl_ClearAll,
<<ThisRef:32/?UI>>).
+
%% @spec (This::wxListCtrl(), Parent::wxWindow:wxWindow()) -> bool()
%% @equiv create(This,Parent, [])
create(This,Parent)
@@ -158,7 +183,18 @@ create(This,Parent)
create(This,Parent, []).
%% @spec (This::wxListCtrl(), Parent::wxWindow:wxWindow(), [Option]) -> bool()
-%% Option = {winid, integer()} | {pos, {X::integer(),Y::integer()}} | {size, {W::integer(),H::integer()}} | {style, integer()} | {validator, wx:wx()}
+%% Option = {winid, integer()} |
+%% {pos, {X::integer(),Y::integer()}} |
+%% {size, {W::integer(),H::integer()}} |
+%% {style, integer()} |
+%% {validator, wx:wx()} |
+%% {onGetItemText, OnGetItemText} |
+%% {onGetItemAttr, OnGetItemAttr} |
+%% {onGetItemColumnImage, OnGetItemColumnImage}
+%%
+%% OnGetItemText = (This, Item, Column) -> wxString()
+%% OnGetItemAttr = (This, Item) -> wxListItemAttr()
+%% OnGetItemColumnImage = (This, Item, Column) -> integer()
%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistctrl.html#wxlistctrlcreate">external documentation</a>.
create(#wx_ref{type=ThisT,ref=ThisRef},#wx_ref{type=ParentT,ref=ParentRef}, Options)
when is_list(Options) ->
@@ -726,12 +762,12 @@ setWindowStyleFlag(#wx_ref{type=ThisT,ref=ThisRef},Style)
%% @spec (This::wxListCtrl(), SortCallBack::function()) -> boolean()
%% @doc Sort the items in the list control<br />
-%% <pre>SortCalBack(Item1,Item2) -> integer()</pre>
+%% <pre>SortCallBack(Item1,Item2) -> integer()</pre>
%% <br /> SortCallBack receives the client data associated with two items
%% to compare, and should return 0 if the items are equal, a negative
%% value if the first item is less than the second one and a positive
%% value if the first item is greater than the second one.
-%% <br /> NOTE: The callback may not call other processes.
+%% <br /> NOTE: The callback may not call other (wx) processes.
sortItems(#wx_ref{type=ThisT,ref=ThisRef}, SortCallBack)
when is_function(SortCallBack, 2) ->
?CLASS(ThisT,wxListCtrl),
diff --git a/lib/wx/src/gen/wxListItemAttr.erl b/lib/wx/src/gen/wxListItemAttr.erl
new file mode 100644
index 0000000000..1a43c71854
--- /dev/null
+++ b/lib/wx/src/gen/wxListItemAttr.erl
@@ -0,0 +1,122 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%% This file is generated DO NOT EDIT
+
+%% @doc See external documentation: <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html">wxListItemAttr</a>.
+%% @type wxListItemAttr(). An object reference, The representation is internal
+%% and can be changed without notice. It can't be used for comparsion
+%% stored on disc or distributed for use on other nodes.
+
+-module(wxListItemAttr).
+-include("wxe.hrl").
+-export([destroy/1,getBackgroundColour/1,getFont/1,getTextColour/1,hasBackgroundColour/1,
+ hasFont/1,hasTextColour/1,new/0,new/3,setBackgroundColour/2,setFont/2,
+ setTextColour/2]).
+
+%% inherited exports
+-export([parent_class/1]).
+
+%% @hidden
+parent_class(_Class) -> erlang:error({badtype, ?MODULE}).
+
+%% @spec () -> wxListItemAttr()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrwxlistitemattr">external documentation</a>.
+new() ->
+ wxe_util:construct(?wxListItemAttr_new_0,
+ <<>>).
+
+%% @spec (ColText::wx:colour(), ColBack::wx:colour(), Font::wxFont:wxFont()) -> wxListItemAttr()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrwxlistitemattr">external documentation</a>.
+new(ColText,ColBack,#wx_ref{type=FontT,ref=FontRef})
+ when tuple_size(ColText) =:= 3; tuple_size(ColText) =:= 4,tuple_size(ColBack) =:= 3; tuple_size(ColBack) =:= 4 ->
+ ?CLASS(FontT,wxFont),
+ wxe_util:construct(?wxListItemAttr_new_3,
+ <<(wxe_util:colour_bin(ColText)):16/binary,(wxe_util:colour_bin(ColBack)):16/binary,FontRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr()) -> wx:colour()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrgetbackgroundcolour">external documentation</a>.
+getBackgroundColour(#wx_ref{type=ThisT,ref=ThisRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:call(?wxListItemAttr_GetBackgroundColour,
+ <<ThisRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr()) -> wxFont:wxFont()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrgetfont">external documentation</a>.
+getFont(#wx_ref{type=ThisT,ref=ThisRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:call(?wxListItemAttr_GetFont,
+ <<ThisRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr()) -> wx:colour()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrgettextcolour">external documentation</a>.
+getTextColour(#wx_ref{type=ThisT,ref=ThisRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:call(?wxListItemAttr_GetTextColour,
+ <<ThisRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr()) -> bool()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrhasbackgroundcolour">external documentation</a>.
+hasBackgroundColour(#wx_ref{type=ThisT,ref=ThisRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:call(?wxListItemAttr_HasBackgroundColour,
+ <<ThisRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr()) -> bool()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrhasfont">external documentation</a>.
+hasFont(#wx_ref{type=ThisT,ref=ThisRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:call(?wxListItemAttr_HasFont,
+ <<ThisRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr()) -> bool()
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrhastextcolour">external documentation</a>.
+hasTextColour(#wx_ref{type=ThisT,ref=ThisRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:call(?wxListItemAttr_HasTextColour,
+ <<ThisRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr(), ColBack::wx:colour()) -> ok
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrsetbackgroundcolour">external documentation</a>.
+setBackgroundColour(#wx_ref{type=ThisT,ref=ThisRef},ColBack)
+ when tuple_size(ColBack) =:= 3; tuple_size(ColBack) =:= 4 ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:cast(?wxListItemAttr_SetBackgroundColour,
+ <<ThisRef:32/?UI,(wxe_util:colour_bin(ColBack)):16/binary>>).
+
+%% @spec (This::wxListItemAttr(), Font::wxFont:wxFont()) -> ok
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrsetfont">external documentation</a>.
+setFont(#wx_ref{type=ThisT,ref=ThisRef},#wx_ref{type=FontT,ref=FontRef}) ->
+ ?CLASS(ThisT,wxListItemAttr),
+ ?CLASS(FontT,wxFont),
+ wxe_util:cast(?wxListItemAttr_SetFont,
+ <<ThisRef:32/?UI,FontRef:32/?UI>>).
+
+%% @spec (This::wxListItemAttr(), ColText::wx:colour()) -> ok
+%% @doc See <a href="http://www.wxwidgets.org/manuals/stable/wx_wxlistitemattr.html#wxlistitemattrsettextcolour">external documentation</a>.
+setTextColour(#wx_ref{type=ThisT,ref=ThisRef},ColText)
+ when tuple_size(ColText) =:= 3; tuple_size(ColText) =:= 4 ->
+ ?CLASS(ThisT,wxListItemAttr),
+ wxe_util:cast(?wxListItemAttr_SetTextColour,
+ <<ThisRef:32/?UI,(wxe_util:colour_bin(ColText)):16/binary>>).
+
+%% @spec (This::wxListItemAttr()) -> ok
+%% @doc Destroys this object, do not use object again
+destroy(Obj=#wx_ref{type=Type}) ->
+ ?CLASS(Type,wxListItemAttr),
+ wxe_util:destroy(?wxListItemAttr_destroy,Obj),
+ ok.
diff --git a/lib/wx/src/gen/wxe_debug.hrl b/lib/wx/src/gen/wxe_debug.hrl
index 3edfa73599..960f67a1f6 100644
--- a/lib/wx/src/gen/wxe_debug.hrl
+++ b/lib/wx/src/gen/wxe_debug.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -1603,1684 +1603,1696 @@ wxdebug_table() ->
{1754, {wxListItem, setText, 1}},
{1755, {wxListItem, setTextColour, 1}},
{1756, {wxListItem, setWidth, 1}},
- {1757, {wxImageList, new_0, 0}},
- {1758, {wxImageList, new_3, 3}},
- {1759, {wxImageList, add_1, 1}},
- {1760, {wxImageList, add_2_0, 2}},
- {1761, {wxImageList, add_2_1, 2}},
- {1762, {wxImageList, create, 3}},
- {1764, {wxImageList, draw, 5}},
- {1765, {wxImageList, getBitmap, 1}},
- {1766, {wxImageList, getIcon, 1}},
- {1767, {wxImageList, getImageCount, 0}},
- {1768, {wxImageList, getSize, 3}},
- {1769, {wxImageList, remove, 1}},
- {1770, {wxImageList, removeAll, 0}},
- {1771, {wxImageList, replace_2, 2}},
- {1772, {wxImageList, replace_3, 3}},
- {1773, {wxImageList, 'Destroy', undefined}},
- {1774, {wxTextAttr, new_0, 0}},
- {1775, {wxTextAttr, new_2, 2}},
- {1776, {wxTextAttr, getAlignment, 0}},
- {1777, {wxTextAttr, getBackgroundColour, 0}},
- {1778, {wxTextAttr, getFont, 0}},
- {1779, {wxTextAttr, getLeftIndent, 0}},
- {1780, {wxTextAttr, getLeftSubIndent, 0}},
- {1781, {wxTextAttr, getRightIndent, 0}},
- {1782, {wxTextAttr, getTabs, 0}},
- {1783, {wxTextAttr, getTextColour, 0}},
- {1784, {wxTextAttr, hasBackgroundColour, 0}},
- {1785, {wxTextAttr, hasFont, 0}},
- {1786, {wxTextAttr, hasTextColour, 0}},
- {1787, {wxTextAttr, getFlags, 0}},
- {1788, {wxTextAttr, isDefault, 0}},
- {1789, {wxTextAttr, setAlignment, 1}},
- {1790, {wxTextAttr, setBackgroundColour, 1}},
- {1791, {wxTextAttr, setFlags, 1}},
- {1792, {wxTextAttr, setFont, 2}},
- {1793, {wxTextAttr, setLeftIndent, 2}},
- {1794, {wxTextAttr, setRightIndent, 1}},
- {1795, {wxTextAttr, setTabs, 1}},
- {1796, {wxTextAttr, setTextColour, 1}},
- {1797, {wxTextAttr, 'Destroy', undefined}},
- {1799, {wxTextCtrl, new_3, 3}},
- {1800, {wxTextCtrl, new_0, 0}},
- {1802, {wxTextCtrl, destruct, 0}},
- {1803, {wxTextCtrl, appendText, 1}},
- {1804, {wxTextCtrl, canCopy, 0}},
- {1805, {wxTextCtrl, canCut, 0}},
- {1806, {wxTextCtrl, canPaste, 0}},
- {1807, {wxTextCtrl, canRedo, 0}},
- {1808, {wxTextCtrl, canUndo, 0}},
- {1809, {wxTextCtrl, clear, 0}},
- {1810, {wxTextCtrl, copy, 0}},
- {1811, {wxTextCtrl, create, 3}},
- {1812, {wxTextCtrl, cut, 0}},
- {1813, {wxTextCtrl, discardEdits, 0}},
- {1814, {wxTextCtrl, emulateKeyPress, 1}},
- {1815, {wxTextCtrl, getDefaultStyle, 0}},
- {1816, {wxTextCtrl, getInsertionPoint, 0}},
- {1817, {wxTextCtrl, getLastPosition, 0}},
- {1818, {wxTextCtrl, getLineLength, 1}},
- {1819, {wxTextCtrl, getLineText, 1}},
- {1820, {wxTextCtrl, getNumberOfLines, 0}},
- {1821, {wxTextCtrl, getRange, 2}},
- {1822, {wxTextCtrl, getSelection, 2}},
- {1823, {wxTextCtrl, getStringSelection, 0}},
- {1824, {wxTextCtrl, getStyle, 2}},
- {1825, {wxTextCtrl, getValue, 0}},
- {1826, {wxTextCtrl, isEditable, 0}},
- {1827, {wxTextCtrl, isModified, 0}},
- {1828, {wxTextCtrl, isMultiLine, 0}},
- {1829, {wxTextCtrl, isSingleLine, 0}},
- {1830, {wxTextCtrl, loadFile, 2}},
- {1831, {wxTextCtrl, markDirty, 0}},
- {1832, {wxTextCtrl, paste, 0}},
- {1833, {wxTextCtrl, positionToXY, 3}},
- {1834, {wxTextCtrl, redo, 0}},
- {1835, {wxTextCtrl, remove, 2}},
- {1836, {wxTextCtrl, replace, 3}},
- {1837, {wxTextCtrl, saveFile, 1}},
- {1838, {wxTextCtrl, setDefaultStyle, 1}},
- {1839, {wxTextCtrl, setEditable, 1}},
- {1840, {wxTextCtrl, setInsertionPoint, 1}},
- {1841, {wxTextCtrl, setInsertionPointEnd, 0}},
- {1843, {wxTextCtrl, setMaxLength, 1}},
- {1844, {wxTextCtrl, setSelection, 2}},
- {1845, {wxTextCtrl, setStyle, 3}},
- {1846, {wxTextCtrl, setValue, 1}},
- {1847, {wxTextCtrl, showPosition, 1}},
- {1848, {wxTextCtrl, undo, 0}},
- {1849, {wxTextCtrl, writeText, 1}},
- {1850, {wxTextCtrl, xYToPosition, 2}},
- {1853, {wxNotebook, new_0, 0}},
- {1854, {wxNotebook, new_3, 3}},
- {1855, {wxNotebook, destruct, 0}},
- {1856, {wxNotebook, addPage, 3}},
- {1857, {wxNotebook, advanceSelection, 1}},
- {1858, {wxNotebook, assignImageList, 1}},
- {1859, {wxNotebook, create, 3}},
- {1860, {wxNotebook, deleteAllPages, 0}},
- {1861, {wxNotebook, deletePage, 1}},
- {1862, {wxNotebook, removePage, 1}},
- {1863, {wxNotebook, getCurrentPage, 0}},
- {1864, {wxNotebook, getImageList, 0}},
- {1866, {wxNotebook, getPage, 1}},
- {1867, {wxNotebook, getPageCount, 0}},
- {1868, {wxNotebook, getPageImage, 1}},
- {1869, {wxNotebook, getPageText, 1}},
- {1870, {wxNotebook, getRowCount, 0}},
- {1871, {wxNotebook, getSelection, 0}},
- {1872, {wxNotebook, getThemeBackgroundColour, 0}},
- {1874, {wxNotebook, hitTest, 2}},
- {1876, {wxNotebook, insertPage, 4}},
- {1877, {wxNotebook, setImageList, 1}},
- {1878, {wxNotebook, setPadding, 1}},
- {1879, {wxNotebook, setPageSize, 1}},
- {1880, {wxNotebook, setPageImage, 2}},
- {1881, {wxNotebook, setPageText, 2}},
- {1882, {wxNotebook, setSelection, 1}},
- {1883, {wxNotebook, changeSelection, 1}},
- {1884, {wxChoicebook, new_0, 0}},
- {1885, {wxChoicebook, new_3, 3}},
- {1886, {wxChoicebook, addPage, 3}},
- {1887, {wxChoicebook, advanceSelection, 1}},
- {1888, {wxChoicebook, assignImageList, 1}},
- {1889, {wxChoicebook, create, 3}},
- {1890, {wxChoicebook, deleteAllPages, 0}},
- {1891, {wxChoicebook, deletePage, 1}},
- {1892, {wxChoicebook, removePage, 1}},
- {1893, {wxChoicebook, getCurrentPage, 0}},
- {1894, {wxChoicebook, getImageList, 0}},
- {1896, {wxChoicebook, getPage, 1}},
- {1897, {wxChoicebook, getPageCount, 0}},
- {1898, {wxChoicebook, getPageImage, 1}},
- {1899, {wxChoicebook, getPageText, 1}},
- {1900, {wxChoicebook, getSelection, 0}},
- {1901, {wxChoicebook, hitTest, 2}},
- {1902, {wxChoicebook, insertPage, 4}},
- {1903, {wxChoicebook, setImageList, 1}},
- {1904, {wxChoicebook, setPageSize, 1}},
- {1905, {wxChoicebook, setPageImage, 2}},
- {1906, {wxChoicebook, setPageText, 2}},
- {1907, {wxChoicebook, setSelection, 1}},
- {1908, {wxChoicebook, changeSelection, 1}},
- {1909, {wxChoicebook, 'Destroy', undefined}},
- {1910, {wxToolbook, new_0, 0}},
- {1911, {wxToolbook, new_3, 3}},
- {1912, {wxToolbook, addPage, 3}},
- {1913, {wxToolbook, advanceSelection, 1}},
- {1914, {wxToolbook, assignImageList, 1}},
- {1915, {wxToolbook, create, 3}},
- {1916, {wxToolbook, deleteAllPages, 0}},
- {1917, {wxToolbook, deletePage, 1}},
- {1918, {wxToolbook, removePage, 1}},
- {1919, {wxToolbook, getCurrentPage, 0}},
- {1920, {wxToolbook, getImageList, 0}},
- {1922, {wxToolbook, getPage, 1}},
- {1923, {wxToolbook, getPageCount, 0}},
- {1924, {wxToolbook, getPageImage, 1}},
- {1925, {wxToolbook, getPageText, 1}},
- {1926, {wxToolbook, getSelection, 0}},
- {1928, {wxToolbook, hitTest, 2}},
- {1929, {wxToolbook, insertPage, 4}},
- {1930, {wxToolbook, setImageList, 1}},
- {1931, {wxToolbook, setPageSize, 1}},
- {1932, {wxToolbook, setPageImage, 2}},
- {1933, {wxToolbook, setPageText, 2}},
- {1934, {wxToolbook, setSelection, 1}},
- {1935, {wxToolbook, changeSelection, 1}},
- {1936, {wxToolbook, 'Destroy', undefined}},
- {1937, {wxListbook, new_0, 0}},
- {1938, {wxListbook, new_3, 3}},
- {1939, {wxListbook, addPage, 3}},
- {1940, {wxListbook, advanceSelection, 1}},
- {1941, {wxListbook, assignImageList, 1}},
- {1942, {wxListbook, create, 3}},
- {1943, {wxListbook, deleteAllPages, 0}},
- {1944, {wxListbook, deletePage, 1}},
- {1945, {wxListbook, removePage, 1}},
- {1946, {wxListbook, getCurrentPage, 0}},
- {1947, {wxListbook, getImageList, 0}},
- {1949, {wxListbook, getPage, 1}},
- {1950, {wxListbook, getPageCount, 0}},
- {1951, {wxListbook, getPageImage, 1}},
- {1952, {wxListbook, getPageText, 1}},
- {1953, {wxListbook, getSelection, 0}},
- {1955, {wxListbook, hitTest, 2}},
- {1956, {wxListbook, insertPage, 4}},
- {1957, {wxListbook, setImageList, 1}},
- {1958, {wxListbook, setPageSize, 1}},
- {1959, {wxListbook, setPageImage, 2}},
- {1960, {wxListbook, setPageText, 2}},
- {1961, {wxListbook, setSelection, 1}},
- {1962, {wxListbook, changeSelection, 1}},
- {1963, {wxListbook, 'Destroy', undefined}},
- {1964, {wxTreebook, new_0, 0}},
- {1965, {wxTreebook, new_3, 3}},
- {1966, {wxTreebook, addPage, 3}},
- {1967, {wxTreebook, advanceSelection, 1}},
- {1968, {wxTreebook, assignImageList, 1}},
- {1969, {wxTreebook, create, 3}},
- {1970, {wxTreebook, deleteAllPages, 0}},
- {1971, {wxTreebook, deletePage, 1}},
- {1972, {wxTreebook, removePage, 1}},
- {1973, {wxTreebook, getCurrentPage, 0}},
- {1974, {wxTreebook, getImageList, 0}},
- {1976, {wxTreebook, getPage, 1}},
- {1977, {wxTreebook, getPageCount, 0}},
- {1978, {wxTreebook, getPageImage, 1}},
- {1979, {wxTreebook, getPageText, 1}},
- {1980, {wxTreebook, getSelection, 0}},
- {1981, {wxTreebook, expandNode, 2}},
- {1982, {wxTreebook, isNodeExpanded, 1}},
- {1984, {wxTreebook, hitTest, 2}},
- {1985, {wxTreebook, insertPage, 4}},
- {1986, {wxTreebook, insertSubPage, 4}},
- {1987, {wxTreebook, setImageList, 1}},
- {1988, {wxTreebook, setPageSize, 1}},
- {1989, {wxTreebook, setPageImage, 2}},
- {1990, {wxTreebook, setPageText, 2}},
- {1991, {wxTreebook, setSelection, 1}},
- {1992, {wxTreebook, changeSelection, 1}},
- {1993, {wxTreebook, 'Destroy', undefined}},
- {1996, {wxTreeCtrl, new_2, 2}},
- {1997, {wxTreeCtrl, new_0, 0}},
- {1999, {wxTreeCtrl, destruct, 0}},
- {2000, {wxTreeCtrl, addRoot, 2}},
- {2001, {wxTreeCtrl, appendItem, 3}},
- {2002, {wxTreeCtrl, assignImageList, 1}},
- {2003, {wxTreeCtrl, assignStateImageList, 1}},
- {2004, {wxTreeCtrl, collapse, 1}},
- {2005, {wxTreeCtrl, collapseAndReset, 1}},
- {2006, {wxTreeCtrl, create, 2}},
- {2007, {wxTreeCtrl, delete, 1}},
- {2008, {wxTreeCtrl, deleteAllItems, 0}},
- {2009, {wxTreeCtrl, deleteChildren, 1}},
- {2010, {wxTreeCtrl, editLabel, 1}},
- {2011, {wxTreeCtrl, ensureVisible, 1}},
- {2012, {wxTreeCtrl, expand, 1}},
- {2013, {wxTreeCtrl, getBoundingRect, 3}},
- {2015, {wxTreeCtrl, getChildrenCount, 2}},
- {2016, {wxTreeCtrl, getCount, 0}},
- {2017, {wxTreeCtrl, getEditControl, 0}},
- {2018, {wxTreeCtrl, getFirstChild, 2}},
- {2019, {wxTreeCtrl, getNextChild, 2}},
- {2020, {wxTreeCtrl, getFirstVisibleItem, 0}},
- {2021, {wxTreeCtrl, getImageList, 0}},
- {2022, {wxTreeCtrl, getIndent, 0}},
- {2023, {wxTreeCtrl, getItemBackgroundColour, 1}},
- {2024, {wxTreeCtrl, getItemData, 1}},
- {2025, {wxTreeCtrl, getItemFont, 1}},
- {2026, {wxTreeCtrl, getItemImage_1, 1}},
- {2027, {wxTreeCtrl, getItemImage_2, 2}},
- {2028, {wxTreeCtrl, getItemText, 1}},
- {2029, {wxTreeCtrl, getItemTextColour, 1}},
- {2030, {wxTreeCtrl, getLastChild, 1}},
- {2031, {wxTreeCtrl, getNextSibling, 1}},
- {2032, {wxTreeCtrl, getNextVisible, 1}},
- {2033, {wxTreeCtrl, getItemParent, 1}},
- {2034, {wxTreeCtrl, getPrevSibling, 1}},
- {2035, {wxTreeCtrl, getPrevVisible, 1}},
- {2036, {wxTreeCtrl, getRootItem, 0}},
- {2037, {wxTreeCtrl, getSelection, 0}},
- {2038, {wxTreeCtrl, getSelections, 1}},
- {2039, {wxTreeCtrl, getStateImageList, 0}},
- {2040, {wxTreeCtrl, hitTest, 1}},
- {2042, {wxTreeCtrl, insertItem, 4}},
- {2043, {wxTreeCtrl, isBold, 1}},
- {2044, {wxTreeCtrl, isExpanded, 1}},
- {2045, {wxTreeCtrl, isSelected, 1}},
- {2046, {wxTreeCtrl, isVisible, 1}},
- {2047, {wxTreeCtrl, itemHasChildren, 1}},
- {2048, {wxTreeCtrl, prependItem, 3}},
- {2049, {wxTreeCtrl, scrollTo, 1}},
- {2050, {wxTreeCtrl, selectItem_1, 1}},
- {2051, {wxTreeCtrl, selectItem_2, 2}},
- {2052, {wxTreeCtrl, setIndent, 1}},
- {2053, {wxTreeCtrl, setImageList, 1}},
- {2054, {wxTreeCtrl, setItemBackgroundColour, 2}},
- {2055, {wxTreeCtrl, setItemBold, 2}},
- {2056, {wxTreeCtrl, setItemData, 2}},
- {2057, {wxTreeCtrl, setItemDropHighlight, 2}},
- {2058, {wxTreeCtrl, setItemFont, 2}},
- {2059, {wxTreeCtrl, setItemHasChildren, 2}},
- {2060, {wxTreeCtrl, setItemImage_2, 2}},
- {2061, {wxTreeCtrl, setItemImage_3, 3}},
- {2062, {wxTreeCtrl, setItemText, 2}},
- {2063, {wxTreeCtrl, setItemTextColour, 2}},
- {2064, {wxTreeCtrl, setStateImageList, 1}},
- {2065, {wxTreeCtrl, setWindowStyle, 1}},
- {2066, {wxTreeCtrl, sortChildren, 1}},
- {2067, {wxTreeCtrl, toggle, 1}},
- {2068, {wxTreeCtrl, toggleItemSelection, 1}},
- {2069, {wxTreeCtrl, unselect, 0}},
- {2070, {wxTreeCtrl, unselectAll, 0}},
- {2071, {wxTreeCtrl, unselectItem, 1}},
- {2072, {wxScrollBar, new_0, 0}},
- {2073, {wxScrollBar, new_3, 3}},
- {2074, {wxScrollBar, destruct, 0}},
- {2075, {wxScrollBar, create, 3}},
- {2076, {wxScrollBar, getRange, 0}},
- {2077, {wxScrollBar, getPageSize, 0}},
- {2078, {wxScrollBar, getThumbPosition, 0}},
- {2079, {wxScrollBar, getThumbSize, 0}},
- {2080, {wxScrollBar, setThumbPosition, 1}},
- {2081, {wxScrollBar, setScrollbar, 5}},
- {2083, {wxSpinButton, new_2, 2}},
- {2084, {wxSpinButton, new_0, 0}},
- {2085, {wxSpinButton, create, 2}},
- {2086, {wxSpinButton, getMax, 0}},
- {2087, {wxSpinButton, getMin, 0}},
- {2088, {wxSpinButton, getValue, 0}},
- {2089, {wxSpinButton, setRange, 2}},
- {2090, {wxSpinButton, setValue, 1}},
- {2091, {wxSpinButton, 'Destroy', undefined}},
- {2092, {wxSpinCtrl, new_0, 0}},
- {2093, {wxSpinCtrl, new_2, 2}},
- {2095, {wxSpinCtrl, create, 2}},
- {2098, {wxSpinCtrl, setValue_1_1, 1}},
- {2099, {wxSpinCtrl, setValue_1_0, 1}},
- {2101, {wxSpinCtrl, getValue, 0}},
- {2103, {wxSpinCtrl, setRange, 2}},
- {2104, {wxSpinCtrl, setSelection, 2}},
- {2106, {wxSpinCtrl, getMin, 0}},
- {2108, {wxSpinCtrl, getMax, 0}},
- {2109, {wxSpinCtrl, 'Destroy', undefined}},
- {2110, {wxStaticText, new_0, 0}},
- {2111, {wxStaticText, new_4, 4}},
- {2112, {wxStaticText, create, 4}},
- {2113, {wxStaticText, getLabel, 0}},
- {2114, {wxStaticText, setLabel, 1}},
- {2115, {wxStaticText, wrap, 1}},
- {2116, {wxStaticText, 'Destroy', undefined}},
- {2117, {wxStaticBitmap, new_0, 0}},
- {2118, {wxStaticBitmap, new_4, 4}},
- {2119, {wxStaticBitmap, create, 4}},
- {2120, {wxStaticBitmap, getBitmap, 0}},
- {2121, {wxStaticBitmap, setBitmap, 1}},
- {2122, {wxStaticBitmap, 'Destroy', undefined}},
- {2123, {wxRadioBox, new, 7}},
- {2125, {wxRadioBox, destruct, 0}},
- {2126, {wxRadioBox, create, 7}},
- {2127, {wxRadioBox, enable_2, 2}},
- {2128, {wxRadioBox, enable_1, 1}},
- {2129, {wxRadioBox, getSelection, 0}},
- {2130, {wxRadioBox, getString, 1}},
- {2131, {wxRadioBox, setSelection, 1}},
- {2132, {wxRadioBox, show_2, 2}},
- {2133, {wxRadioBox, show_1, 1}},
- {2134, {wxRadioBox, getColumnCount, 0}},
- {2135, {wxRadioBox, getItemHelpText, 1}},
- {2136, {wxRadioBox, getItemToolTip, 1}},
- {2138, {wxRadioBox, getItemFromPoint, 1}},
- {2139, {wxRadioBox, getRowCount, 0}},
- {2140, {wxRadioBox, isItemEnabled, 1}},
- {2141, {wxRadioBox, isItemShown, 1}},
- {2142, {wxRadioBox, setItemHelpText, 2}},
- {2143, {wxRadioBox, setItemToolTip, 2}},
- {2144, {wxRadioButton, new_0, 0}},
- {2145, {wxRadioButton, new_4, 4}},
- {2146, {wxRadioButton, create, 4}},
- {2147, {wxRadioButton, getValue, 0}},
- {2148, {wxRadioButton, setValue, 1}},
- {2149, {wxRadioButton, 'Destroy', undefined}},
- {2151, {wxSlider, new_6, 6}},
- {2152, {wxSlider, new_0, 0}},
- {2153, {wxSlider, create, 6}},
- {2154, {wxSlider, getLineSize, 0}},
- {2155, {wxSlider, getMax, 0}},
- {2156, {wxSlider, getMin, 0}},
- {2157, {wxSlider, getPageSize, 0}},
- {2158, {wxSlider, getThumbLength, 0}},
- {2159, {wxSlider, getValue, 0}},
- {2160, {wxSlider, setLineSize, 1}},
- {2161, {wxSlider, setPageSize, 1}},
- {2162, {wxSlider, setRange, 2}},
- {2163, {wxSlider, setThumbLength, 1}},
- {2164, {wxSlider, setValue, 1}},
- {2165, {wxSlider, 'Destroy', undefined}},
- {2167, {wxDialog, new_4, 4}},
- {2168, {wxDialog, new_0, 0}},
- {2170, {wxDialog, destruct, 0}},
- {2171, {wxDialog, create, 4}},
- {2172, {wxDialog, createButtonSizer, 1}},
- {2173, {wxDialog, createStdDialogButtonSizer, 1}},
- {2174, {wxDialog, endModal, 1}},
- {2175, {wxDialog, getAffirmativeId, 0}},
- {2176, {wxDialog, getReturnCode, 0}},
- {2177, {wxDialog, isModal, 0}},
- {2178, {wxDialog, setAffirmativeId, 1}},
- {2179, {wxDialog, setReturnCode, 1}},
- {2180, {wxDialog, show, 1}},
- {2181, {wxDialog, showModal, 0}},
- {2182, {wxColourDialog, new_0, 0}},
- {2183, {wxColourDialog, new_2, 2}},
- {2184, {wxColourDialog, destruct, 0}},
- {2185, {wxColourDialog, create, 2}},
- {2186, {wxColourDialog, getColourData, 0}},
- {2187, {wxColourData, new_0, 0}},
- {2188, {wxColourData, new_1, 1}},
- {2189, {wxColourData, destruct, 0}},
- {2190, {wxColourData, getChooseFull, 0}},
- {2191, {wxColourData, getColour, 0}},
- {2193, {wxColourData, getCustomColour, 1}},
- {2194, {wxColourData, setChooseFull, 1}},
- {2195, {wxColourData, setColour, 1}},
- {2196, {wxColourData, setCustomColour, 2}},
- {2197, {wxPalette, new_0, 0}},
- {2198, {wxPalette, new_4, 4}},
- {2200, {wxPalette, destruct, 0}},
- {2201, {wxPalette, create, 4}},
- {2202, {wxPalette, getColoursCount, 0}},
- {2203, {wxPalette, getPixel, 3}},
- {2204, {wxPalette, getRGB, 4}},
- {2205, {wxPalette, isOk, 0}},
- {2209, {wxDirDialog, new, 2}},
- {2210, {wxDirDialog, destruct, 0}},
- {2211, {wxDirDialog, getPath, 0}},
- {2212, {wxDirDialog, getMessage, 0}},
- {2213, {wxDirDialog, setMessage, 1}},
- {2214, {wxDirDialog, setPath, 1}},
- {2218, {wxFileDialog, new, 2}},
- {2219, {wxFileDialog, destruct, 0}},
- {2220, {wxFileDialog, getDirectory, 0}},
- {2221, {wxFileDialog, getFilename, 0}},
- {2222, {wxFileDialog, getFilenames, 1}},
- {2223, {wxFileDialog, getFilterIndex, 0}},
- {2224, {wxFileDialog, getMessage, 0}},
- {2225, {wxFileDialog, getPath, 0}},
- {2226, {wxFileDialog, getPaths, 1}},
- {2227, {wxFileDialog, getWildcard, 0}},
- {2228, {wxFileDialog, setDirectory, 1}},
- {2229, {wxFileDialog, setFilename, 1}},
- {2230, {wxFileDialog, setFilterIndex, 1}},
- {2231, {wxFileDialog, setMessage, 1}},
- {2232, {wxFileDialog, setPath, 1}},
- {2233, {wxFileDialog, setWildcard, 1}},
- {2234, {wxPickerBase, setInternalMargin, 1}},
- {2235, {wxPickerBase, getInternalMargin, 0}},
- {2236, {wxPickerBase, setTextCtrlProportion, 1}},
- {2237, {wxPickerBase, setPickerCtrlProportion, 1}},
- {2238, {wxPickerBase, getTextCtrlProportion, 0}},
- {2239, {wxPickerBase, getPickerCtrlProportion, 0}},
- {2240, {wxPickerBase, hasTextCtrl, 0}},
- {2241, {wxPickerBase, getTextCtrl, 0}},
- {2242, {wxPickerBase, isTextCtrlGrowable, 0}},
- {2243, {wxPickerBase, setPickerCtrlGrowable, 1}},
- {2244, {wxPickerBase, setTextCtrlGrowable, 1}},
- {2245, {wxPickerBase, isPickerCtrlGrowable, 0}},
- {2246, {wxFilePickerCtrl, new_0, 0}},
- {2247, {wxFilePickerCtrl, new_3, 3}},
- {2248, {wxFilePickerCtrl, create, 3}},
- {2249, {wxFilePickerCtrl, getPath, 0}},
- {2250, {wxFilePickerCtrl, setPath, 1}},
- {2251, {wxFilePickerCtrl, 'Destroy', undefined}},
- {2252, {wxDirPickerCtrl, new_0, 0}},
- {2253, {wxDirPickerCtrl, new_3, 3}},
- {2254, {wxDirPickerCtrl, create, 3}},
- {2255, {wxDirPickerCtrl, getPath, 0}},
- {2256, {wxDirPickerCtrl, setPath, 1}},
- {2257, {wxDirPickerCtrl, 'Destroy', undefined}},
- {2258, {wxColourPickerCtrl, new_0, 0}},
- {2259, {wxColourPickerCtrl, new_3, 3}},
- {2260, {wxColourPickerCtrl, create, 3}},
- {2261, {wxColourPickerCtrl, getColour, 0}},
- {2262, {wxColourPickerCtrl, setColour_1_1, 1}},
- {2263, {wxColourPickerCtrl, setColour_1_0, 1}},
- {2264, {wxColourPickerCtrl, 'Destroy', undefined}},
- {2265, {wxDatePickerCtrl, new_0, 0}},
- {2266, {wxDatePickerCtrl, new_3, 3}},
- {2267, {wxDatePickerCtrl, getRange, 2}},
- {2268, {wxDatePickerCtrl, getValue, 0}},
- {2269, {wxDatePickerCtrl, setRange, 2}},
- {2270, {wxDatePickerCtrl, setValue, 1}},
- {2271, {wxDatePickerCtrl, 'Destroy', undefined}},
- {2272, {wxFontPickerCtrl, new_0, 0}},
- {2273, {wxFontPickerCtrl, new_3, 3}},
- {2274, {wxFontPickerCtrl, create, 3}},
- {2275, {wxFontPickerCtrl, getSelectedFont, 0}},
- {2276, {wxFontPickerCtrl, setSelectedFont, 1}},
- {2277, {wxFontPickerCtrl, getMaxPointSize, 0}},
- {2278, {wxFontPickerCtrl, setMaxPointSize, 1}},
- {2279, {wxFontPickerCtrl, 'Destroy', undefined}},
- {2282, {wxFindReplaceDialog, new_0, 0}},
- {2283, {wxFindReplaceDialog, new_4, 4}},
- {2284, {wxFindReplaceDialog, destruct, 0}},
- {2285, {wxFindReplaceDialog, create, 4}},
- {2286, {wxFindReplaceDialog, getData, 0}},
- {2287, {wxFindReplaceData, new_0, 0}},
- {2288, {wxFindReplaceData, new_1, 1}},
- {2289, {wxFindReplaceData, getFindString, 0}},
- {2290, {wxFindReplaceData, getReplaceString, 0}},
- {2291, {wxFindReplaceData, getFlags, 0}},
- {2292, {wxFindReplaceData, setFlags, 1}},
- {2293, {wxFindReplaceData, setFindString, 1}},
- {2294, {wxFindReplaceData, setReplaceString, 1}},
- {2295, {wxFindReplaceData, 'Destroy', undefined}},
- {2296, {wxMultiChoiceDialog, new_0, 0}},
- {2298, {wxMultiChoiceDialog, new_5, 5}},
- {2299, {wxMultiChoiceDialog, getSelections, 0}},
- {2300, {wxMultiChoiceDialog, setSelections, 1}},
- {2301, {wxMultiChoiceDialog, 'Destroy', undefined}},
- {2302, {wxSingleChoiceDialog, new_0, 0}},
- {2304, {wxSingleChoiceDialog, new_5, 5}},
- {2305, {wxSingleChoiceDialog, getSelection, 0}},
- {2306, {wxSingleChoiceDialog, getStringSelection, 0}},
- {2307, {wxSingleChoiceDialog, setSelection, 1}},
- {2308, {wxSingleChoiceDialog, 'Destroy', undefined}},
- {2309, {wxTextEntryDialog, new, 3}},
- {2310, {wxTextEntryDialog, getValue, 0}},
- {2311, {wxTextEntryDialog, setValue, 1}},
- {2312, {wxTextEntryDialog, 'Destroy', undefined}},
- {2313, {wxPasswordEntryDialog, new, 3}},
- {2314, {wxPasswordEntryDialog, 'Destroy', undefined}},
- {2315, {wxFontData, new_0, 0}},
- {2316, {wxFontData, new_1, 1}},
- {2317, {wxFontData, destruct, 0}},
- {2318, {wxFontData, enableEffects, 1}},
- {2319, {wxFontData, getAllowSymbols, 0}},
- {2320, {wxFontData, getColour, 0}},
- {2321, {wxFontData, getChosenFont, 0}},
- {2322, {wxFontData, getEnableEffects, 0}},
- {2323, {wxFontData, getInitialFont, 0}},
- {2324, {wxFontData, getShowHelp, 0}},
- {2325, {wxFontData, setAllowSymbols, 1}},
- {2326, {wxFontData, setChosenFont, 1}},
- {2327, {wxFontData, setColour, 1}},
- {2328, {wxFontData, setInitialFont, 1}},
- {2329, {wxFontData, setRange, 2}},
- {2330, {wxFontData, setShowHelp, 1}},
- {2334, {wxFontDialog, new_0, 0}},
- {2336, {wxFontDialog, new_2, 2}},
- {2338, {wxFontDialog, create, 2}},
- {2339, {wxFontDialog, getFontData, 0}},
- {2341, {wxFontDialog, 'Destroy', undefined}},
- {2342, {wxProgressDialog, new, 3}},
- {2343, {wxProgressDialog, destruct, 0}},
- {2344, {wxProgressDialog, resume, 0}},
- {2345, {wxProgressDialog, update_2, 2}},
- {2346, {wxProgressDialog, update_0, 0}},
- {2347, {wxMessageDialog, new, 3}},
- {2348, {wxMessageDialog, destruct, 0}},
- {2349, {wxPageSetupDialog, new, 2}},
- {2350, {wxPageSetupDialog, destruct, 0}},
- {2351, {wxPageSetupDialog, getPageSetupData, 0}},
- {2352, {wxPageSetupDialog, showModal, 0}},
- {2353, {wxPageSetupDialogData, new_0, 0}},
- {2354, {wxPageSetupDialogData, new_1_0, 1}},
- {2355, {wxPageSetupDialogData, new_1_1, 1}},
- {2356, {wxPageSetupDialogData, destruct, 0}},
- {2357, {wxPageSetupDialogData, enableHelp, 1}},
- {2358, {wxPageSetupDialogData, enableMargins, 1}},
- {2359, {wxPageSetupDialogData, enableOrientation, 1}},
- {2360, {wxPageSetupDialogData, enablePaper, 1}},
- {2361, {wxPageSetupDialogData, enablePrinter, 1}},
- {2362, {wxPageSetupDialogData, getDefaultMinMargins, 0}},
- {2363, {wxPageSetupDialogData, getEnableMargins, 0}},
- {2364, {wxPageSetupDialogData, getEnableOrientation, 0}},
- {2365, {wxPageSetupDialogData, getEnablePaper, 0}},
- {2366, {wxPageSetupDialogData, getEnablePrinter, 0}},
- {2367, {wxPageSetupDialogData, getEnableHelp, 0}},
- {2368, {wxPageSetupDialogData, getDefaultInfo, 0}},
- {2369, {wxPageSetupDialogData, getMarginTopLeft, 0}},
- {2370, {wxPageSetupDialogData, getMarginBottomRight, 0}},
- {2371, {wxPageSetupDialogData, getMinMarginTopLeft, 0}},
- {2372, {wxPageSetupDialogData, getMinMarginBottomRight, 0}},
- {2373, {wxPageSetupDialogData, getPaperId, 0}},
- {2374, {wxPageSetupDialogData, getPaperSize, 0}},
- {2376, {wxPageSetupDialogData, getPrintData, 0}},
- {2377, {wxPageSetupDialogData, isOk, 0}},
- {2378, {wxPageSetupDialogData, setDefaultInfo, 1}},
- {2379, {wxPageSetupDialogData, setDefaultMinMargins, 1}},
- {2380, {wxPageSetupDialogData, setMarginTopLeft, 1}},
- {2381, {wxPageSetupDialogData, setMarginBottomRight, 1}},
- {2382, {wxPageSetupDialogData, setMinMarginTopLeft, 1}},
- {2383, {wxPageSetupDialogData, setMinMarginBottomRight, 1}},
- {2384, {wxPageSetupDialogData, setPaperId, 1}},
- {2385, {wxPageSetupDialogData, setPaperSize_1_1, 1}},
- {2386, {wxPageSetupDialogData, setPaperSize_1_0, 1}},
- {2387, {wxPageSetupDialogData, setPrintData, 1}},
- {2388, {wxPrintDialog, new_2_0, 2}},
- {2389, {wxPrintDialog, new_2_1, 2}},
- {2390, {wxPrintDialog, destruct, 0}},
- {2391, {wxPrintDialog, getPrintDialogData, 0}},
- {2392, {wxPrintDialog, getPrintDC, 0}},
- {2393, {wxPrintDialogData, new_0, 0}},
- {2394, {wxPrintDialogData, new_1_1, 1}},
- {2395, {wxPrintDialogData, new_1_0, 1}},
- {2396, {wxPrintDialogData, destruct, 0}},
- {2397, {wxPrintDialogData, enableHelp, 1}},
- {2398, {wxPrintDialogData, enablePageNumbers, 1}},
- {2399, {wxPrintDialogData, enablePrintToFile, 1}},
- {2400, {wxPrintDialogData, enableSelection, 1}},
- {2401, {wxPrintDialogData, getAllPages, 0}},
- {2402, {wxPrintDialogData, getCollate, 0}},
- {2403, {wxPrintDialogData, getFromPage, 0}},
- {2404, {wxPrintDialogData, getMaxPage, 0}},
- {2405, {wxPrintDialogData, getMinPage, 0}},
- {2406, {wxPrintDialogData, getNoCopies, 0}},
- {2407, {wxPrintDialogData, getPrintData, 0}},
- {2408, {wxPrintDialogData, getPrintToFile, 0}},
- {2409, {wxPrintDialogData, getSelection, 0}},
- {2410, {wxPrintDialogData, getToPage, 0}},
- {2411, {wxPrintDialogData, isOk, 0}},
- {2412, {wxPrintDialogData, setCollate, 1}},
- {2413, {wxPrintDialogData, setFromPage, 1}},
- {2414, {wxPrintDialogData, setMaxPage, 1}},
- {2415, {wxPrintDialogData, setMinPage, 1}},
- {2416, {wxPrintDialogData, setNoCopies, 1}},
- {2417, {wxPrintDialogData, setPrintData, 1}},
- {2418, {wxPrintDialogData, setPrintToFile, 1}},
- {2419, {wxPrintDialogData, setSelection, 1}},
- {2420, {wxPrintDialogData, setToPage, 1}},
- {2421, {wxPrintData, new_0, 0}},
- {2422, {wxPrintData, new_1, 1}},
- {2423, {wxPrintData, destruct, 0}},
- {2424, {wxPrintData, getCollate, 0}},
- {2425, {wxPrintData, getBin, 0}},
- {2426, {wxPrintData, getColour, 0}},
- {2427, {wxPrintData, getDuplex, 0}},
- {2428, {wxPrintData, getNoCopies, 0}},
- {2429, {wxPrintData, getOrientation, 0}},
- {2430, {wxPrintData, getPaperId, 0}},
- {2431, {wxPrintData, getPrinterName, 0}},
- {2432, {wxPrintData, getQuality, 0}},
- {2433, {wxPrintData, isOk, 0}},
- {2434, {wxPrintData, setBin, 1}},
- {2435, {wxPrintData, setCollate, 1}},
- {2436, {wxPrintData, setColour, 1}},
- {2437, {wxPrintData, setDuplex, 1}},
- {2438, {wxPrintData, setNoCopies, 1}},
- {2439, {wxPrintData, setOrientation, 1}},
- {2440, {wxPrintData, setPaperId, 1}},
- {2441, {wxPrintData, setPrinterName, 1}},
- {2442, {wxPrintData, setQuality, 1}},
- {2445, {wxPrintPreview, new_2, 2}},
- {2446, {wxPrintPreview, new_3, 3}},
- {2448, {wxPrintPreview, destruct, 0}},
- {2449, {wxPrintPreview, getCanvas, 0}},
- {2450, {wxPrintPreview, getCurrentPage, 0}},
- {2451, {wxPrintPreview, getFrame, 0}},
- {2452, {wxPrintPreview, getMaxPage, 0}},
- {2453, {wxPrintPreview, getMinPage, 0}},
- {2454, {wxPrintPreview, getPrintout, 0}},
- {2455, {wxPrintPreview, getPrintoutForPrinting, 0}},
- {2456, {wxPrintPreview, isOk, 0}},
- {2457, {wxPrintPreview, paintPage, 2}},
- {2458, {wxPrintPreview, print, 1}},
- {2459, {wxPrintPreview, renderPage, 1}},
- {2460, {wxPrintPreview, setCanvas, 1}},
- {2461, {wxPrintPreview, setCurrentPage, 1}},
- {2462, {wxPrintPreview, setFrame, 1}},
- {2463, {wxPrintPreview, setPrintout, 1}},
- {2464, {wxPrintPreview, setZoom, 1}},
- {2465, {wxPreviewFrame, new, 3}},
- {2466, {wxPreviewFrame, destruct, 0}},
- {2467, {wxPreviewFrame, createControlBar, 0}},
- {2468, {wxPreviewFrame, createCanvas, 0}},
- {2469, {wxPreviewFrame, initialize, 0}},
- {2470, {wxPreviewFrame, onCloseWindow, 1}},
- {2471, {wxPreviewControlBar, new, 4}},
- {2472, {wxPreviewControlBar, destruct, 0}},
- {2473, {wxPreviewControlBar, createButtons, 0}},
- {2474, {wxPreviewControlBar, getPrintPreview, 0}},
- {2475, {wxPreviewControlBar, getZoomControl, 0}},
- {2476, {wxPreviewControlBar, setZoomControl, 1}},
- {2478, {wxPrinter, new, 1}},
- {2479, {wxPrinter, createAbortWindow, 2}},
- {2480, {wxPrinter, getAbort, 0}},
- {2481, {wxPrinter, getLastError, 0}},
- {2482, {wxPrinter, getPrintDialogData, 0}},
- {2483, {wxPrinter, print, 3}},
- {2484, {wxPrinter, printDialog, 1}},
- {2485, {wxPrinter, reportError, 3}},
- {2486, {wxPrinter, setup, 1}},
- {2487, {wxPrinter, 'Destroy', undefined}},
- {2488, {wxXmlResource, new_1, 1}},
- {2489, {wxXmlResource, new_2, 2}},
- {2490, {wxXmlResource, destruct, 0}},
- {2491, {wxXmlResource, attachUnknownControl, 3}},
- {2492, {wxXmlResource, clearHandlers, 0}},
- {2493, {wxXmlResource, compareVersion, 4}},
- {2494, {wxXmlResource, get, 0}},
- {2495, {wxXmlResource, getFlags, 0}},
- {2496, {wxXmlResource, getVersion, 0}},
- {2497, {wxXmlResource, getXRCID, 2}},
- {2498, {wxXmlResource, initAllHandlers, 0}},
- {2499, {wxXmlResource, load, 1}},
- {2500, {wxXmlResource, loadBitmap, 1}},
- {2501, {wxXmlResource, loadDialog_2, 2}},
- {2502, {wxXmlResource, loadDialog_3, 3}},
- {2503, {wxXmlResource, loadFrame_2, 2}},
- {2504, {wxXmlResource, loadFrame_3, 3}},
- {2505, {wxXmlResource, loadIcon, 1}},
- {2506, {wxXmlResource, loadMenu, 1}},
- {2507, {wxXmlResource, loadMenuBar_2, 2}},
- {2508, {wxXmlResource, loadMenuBar_1, 1}},
- {2509, {wxXmlResource, loadPanel_2, 2}},
- {2510, {wxXmlResource, loadPanel_3, 3}},
- {2511, {wxXmlResource, loadToolBar, 2}},
- {2512, {wxXmlResource, set, 1}},
- {2513, {wxXmlResource, setFlags, 1}},
- {2514, {wxXmlResource, unload, 1}},
- {2515, {wxXmlResource, xrcctrl, 3}},
- {2516, {wxHtmlEasyPrinting, new, 1}},
- {2517, {wxHtmlEasyPrinting, destruct, 0}},
- {2518, {wxHtmlEasyPrinting, getPrintData, 0}},
- {2519, {wxHtmlEasyPrinting, getPageSetupData, 0}},
- {2520, {wxHtmlEasyPrinting, previewFile, 1}},
- {2521, {wxHtmlEasyPrinting, previewText, 2}},
- {2522, {wxHtmlEasyPrinting, printFile, 1}},
- {2523, {wxHtmlEasyPrinting, printText, 2}},
- {2524, {wxHtmlEasyPrinting, pageSetup, 0}},
- {2525, {wxHtmlEasyPrinting, setFonts, 3}},
- {2526, {wxHtmlEasyPrinting, setHeader, 2}},
- {2527, {wxHtmlEasyPrinting, setFooter, 2}},
- {2529, {wxGLCanvas, new_2, 2}},
- {2530, {wxGLCanvas, new_3_1, 3}},
- {2531, {wxGLCanvas, new_3_0, 3}},
- {2532, {wxGLCanvas, getContext, 0}},
- {2534, {wxGLCanvas, setCurrent, 0}},
- {2535, {wxGLCanvas, swapBuffers, 0}},
- {2536, {wxGLCanvas, 'Destroy', undefined}},
- {2537, {wxAuiManager, new, 1}},
- {2538, {wxAuiManager, destruct, 0}},
- {2539, {wxAuiManager, addPane_2_1, 2}},
- {2540, {wxAuiManager, addPane_3, 3}},
- {2541, {wxAuiManager, addPane_2_0, 2}},
- {2542, {wxAuiManager, detachPane, 1}},
- {2543, {wxAuiManager, getAllPanes, 0}},
- {2544, {wxAuiManager, getArtProvider, 0}},
- {2545, {wxAuiManager, getDockSizeConstraint, 2}},
- {2546, {wxAuiManager, getFlags, 0}},
- {2547, {wxAuiManager, getManagedWindow, 0}},
- {2548, {wxAuiManager, getManager, 1}},
- {2549, {wxAuiManager, getPane_1_1, 1}},
- {2550, {wxAuiManager, getPane_1_0, 1}},
- {2551, {wxAuiManager, hideHint, 0}},
- {2552, {wxAuiManager, insertPane, 3}},
- {2553, {wxAuiManager, loadPaneInfo, 2}},
- {2554, {wxAuiManager, loadPerspective, 2}},
- {2555, {wxAuiManager, savePaneInfo, 1}},
- {2556, {wxAuiManager, savePerspective, 0}},
- {2557, {wxAuiManager, setArtProvider, 1}},
- {2558, {wxAuiManager, setDockSizeConstraint, 2}},
- {2559, {wxAuiManager, setFlags, 1}},
- {2560, {wxAuiManager, setManagedWindow, 1}},
- {2561, {wxAuiManager, showHint, 1}},
- {2562, {wxAuiManager, unInit, 0}},
- {2563, {wxAuiManager, update, 0}},
- {2564, {wxAuiPaneInfo, new_0, 0}},
- {2565, {wxAuiPaneInfo, new_1, 1}},
- {2566, {wxAuiPaneInfo, destruct, 0}},
- {2567, {wxAuiPaneInfo, bestSize_1, 1}},
- {2568, {wxAuiPaneInfo, bestSize_2, 2}},
- {2569, {wxAuiPaneInfo, bottom, 0}},
- {2570, {wxAuiPaneInfo, bottomDockable, 1}},
- {2571, {wxAuiPaneInfo, caption, 1}},
- {2572, {wxAuiPaneInfo, captionVisible, 1}},
- {2573, {wxAuiPaneInfo, centre, 0}},
- {2574, {wxAuiPaneInfo, centrePane, 0}},
- {2575, {wxAuiPaneInfo, closeButton, 1}},
- {2576, {wxAuiPaneInfo, defaultPane, 0}},
- {2577, {wxAuiPaneInfo, destroyOnClose, 1}},
- {2578, {wxAuiPaneInfo, direction, 1}},
- {2579, {wxAuiPaneInfo, dock, 0}},
- {2580, {wxAuiPaneInfo, dockable, 1}},
- {2581, {wxAuiPaneInfo, fixed, 0}},
- {2582, {wxAuiPaneInfo, float, 0}},
- {2583, {wxAuiPaneInfo, floatable, 1}},
- {2584, {wxAuiPaneInfo, floatingPosition_1, 1}},
- {2585, {wxAuiPaneInfo, floatingPosition_2, 2}},
- {2586, {wxAuiPaneInfo, floatingSize_1, 1}},
- {2587, {wxAuiPaneInfo, floatingSize_2, 2}},
- {2588, {wxAuiPaneInfo, gripper, 1}},
- {2589, {wxAuiPaneInfo, gripperTop, 1}},
- {2590, {wxAuiPaneInfo, hasBorder, 0}},
- {2591, {wxAuiPaneInfo, hasCaption, 0}},
- {2592, {wxAuiPaneInfo, hasCloseButton, 0}},
- {2593, {wxAuiPaneInfo, hasFlag, 1}},
- {2594, {wxAuiPaneInfo, hasGripper, 0}},
- {2595, {wxAuiPaneInfo, hasGripperTop, 0}},
- {2596, {wxAuiPaneInfo, hasMaximizeButton, 0}},
- {2597, {wxAuiPaneInfo, hasMinimizeButton, 0}},
- {2598, {wxAuiPaneInfo, hasPinButton, 0}},
- {2599, {wxAuiPaneInfo, hide, 0}},
- {2600, {wxAuiPaneInfo, isBottomDockable, 0}},
- {2601, {wxAuiPaneInfo, isDocked, 0}},
- {2602, {wxAuiPaneInfo, isFixed, 0}},
- {2603, {wxAuiPaneInfo, isFloatable, 0}},
- {2604, {wxAuiPaneInfo, isFloating, 0}},
- {2605, {wxAuiPaneInfo, isLeftDockable, 0}},
- {2606, {wxAuiPaneInfo, isMovable, 0}},
- {2607, {wxAuiPaneInfo, isOk, 0}},
- {2608, {wxAuiPaneInfo, isResizable, 0}},
- {2609, {wxAuiPaneInfo, isRightDockable, 0}},
- {2610, {wxAuiPaneInfo, isShown, 0}},
- {2611, {wxAuiPaneInfo, isToolbar, 0}},
- {2612, {wxAuiPaneInfo, isTopDockable, 0}},
- {2613, {wxAuiPaneInfo, layer, 1}},
- {2614, {wxAuiPaneInfo, left, 0}},
- {2615, {wxAuiPaneInfo, leftDockable, 1}},
- {2616, {wxAuiPaneInfo, maxSize_1, 1}},
- {2617, {wxAuiPaneInfo, maxSize_2, 2}},
- {2618, {wxAuiPaneInfo, maximizeButton, 1}},
- {2619, {wxAuiPaneInfo, minSize_1, 1}},
- {2620, {wxAuiPaneInfo, minSize_2, 2}},
- {2621, {wxAuiPaneInfo, minimizeButton, 1}},
- {2622, {wxAuiPaneInfo, movable, 1}},
- {2623, {wxAuiPaneInfo, name, 1}},
- {2624, {wxAuiPaneInfo, paneBorder, 1}},
- {2625, {wxAuiPaneInfo, pinButton, 1}},
- {2626, {wxAuiPaneInfo, position, 1}},
- {2627, {wxAuiPaneInfo, resizable, 1}},
- {2628, {wxAuiPaneInfo, right, 0}},
- {2629, {wxAuiPaneInfo, rightDockable, 1}},
- {2630, {wxAuiPaneInfo, row, 1}},
- {2631, {wxAuiPaneInfo, safeSet, 1}},
- {2632, {wxAuiPaneInfo, setFlag, 2}},
- {2633, {wxAuiPaneInfo, show, 1}},
- {2634, {wxAuiPaneInfo, toolbarPane, 0}},
- {2635, {wxAuiPaneInfo, top, 0}},
- {2636, {wxAuiPaneInfo, topDockable, 1}},
- {2637, {wxAuiPaneInfo, window, 1}},
- {2638, {wxAuiNotebook, new_0, 0}},
- {2639, {wxAuiNotebook, new_2, 2}},
- {2640, {wxAuiNotebook, addPage, 3}},
- {2641, {wxAuiNotebook, create, 2}},
- {2642, {wxAuiNotebook, deletePage, 1}},
- {2643, {wxAuiNotebook, getArtProvider, 0}},
- {2644, {wxAuiNotebook, getPage, 1}},
- {2645, {wxAuiNotebook, getPageBitmap, 1}},
- {2646, {wxAuiNotebook, getPageCount, 0}},
- {2647, {wxAuiNotebook, getPageIndex, 1}},
- {2648, {wxAuiNotebook, getPageText, 1}},
- {2649, {wxAuiNotebook, getSelection, 0}},
- {2650, {wxAuiNotebook, insertPage, 4}},
- {2651, {wxAuiNotebook, removePage, 1}},
- {2652, {wxAuiNotebook, setArtProvider, 1}},
- {2653, {wxAuiNotebook, setFont, 1}},
- {2654, {wxAuiNotebook, setPageBitmap, 2}},
- {2655, {wxAuiNotebook, setPageText, 2}},
- {2656, {wxAuiNotebook, setSelection, 1}},
- {2657, {wxAuiNotebook, setTabCtrlHeight, 1}},
- {2658, {wxAuiNotebook, setUniformBitmapSize, 1}},
- {2659, {wxAuiNotebook, 'Destroy', undefined}},
- {2660, {wxMDIParentFrame, new_0, 0}},
- {2661, {wxMDIParentFrame, new_4, 4}},
- {2662, {wxMDIParentFrame, destruct, 0}},
- {2663, {wxMDIParentFrame, activateNext, 0}},
- {2664, {wxMDIParentFrame, activatePrevious, 0}},
- {2665, {wxMDIParentFrame, arrangeIcons, 0}},
- {2666, {wxMDIParentFrame, cascade, 0}},
- {2667, {wxMDIParentFrame, create, 4}},
- {2668, {wxMDIParentFrame, getActiveChild, 0}},
- {2669, {wxMDIParentFrame, getClientWindow, 0}},
- {2670, {wxMDIParentFrame, tile, 1}},
- {2671, {wxMDIChildFrame, new_0, 0}},
- {2672, {wxMDIChildFrame, new_4, 4}},
- {2673, {wxMDIChildFrame, destruct, 0}},
- {2674, {wxMDIChildFrame, activate, 0}},
- {2675, {wxMDIChildFrame, create, 4}},
- {2676, {wxMDIChildFrame, maximize, 1}},
- {2677, {wxMDIChildFrame, restore, 0}},
- {2678, {wxMDIClientWindow, new_0, 0}},
- {2679, {wxMDIClientWindow, new_2, 2}},
- {2680, {wxMDIClientWindow, destruct, 0}},
- {2681, {wxMDIClientWindow, createClient, 2}},
- {2682, {wxLayoutAlgorithm, new, 0}},
- {2683, {wxLayoutAlgorithm, layoutFrame, 2}},
- {2684, {wxLayoutAlgorithm, layoutMDIFrame, 2}},
- {2685, {wxLayoutAlgorithm, layoutWindow, 2}},
- {2686, {wxLayoutAlgorithm, 'Destroy', undefined}},
- {2687, {wxEvent, getId, 0}},
- {2688, {wxEvent, getSkipped, 0}},
- {2689, {wxEvent, getTimestamp, 0}},
- {2690, {wxEvent, isCommandEvent, 0}},
- {2691, {wxEvent, resumePropagation, 1}},
- {2692, {wxEvent, shouldPropagate, 0}},
- {2693, {wxEvent, skip, 1}},
- {2694, {wxEvent, stopPropagation, 0}},
- {2695, {wxCommandEvent, getClientData, 0}},
- {2696, {wxCommandEvent, getExtraLong, 0}},
- {2697, {wxCommandEvent, getInt, 0}},
- {2698, {wxCommandEvent, getSelection, 0}},
- {2699, {wxCommandEvent, getString, 0}},
- {2700, {wxCommandEvent, isChecked, 0}},
- {2701, {wxCommandEvent, isSelection, 0}},
- {2702, {wxCommandEvent, setInt, 1}},
- {2703, {wxCommandEvent, setString, 1}},
- {2704, {wxScrollEvent, getOrientation, 0}},
- {2705, {wxScrollEvent, getPosition, 0}},
- {2706, {wxScrollWinEvent, getOrientation, 0}},
- {2707, {wxScrollWinEvent, getPosition, 0}},
- {2708, {wxMouseEvent, altDown, 0}},
- {2709, {wxMouseEvent, button, 1}},
- {2710, {wxMouseEvent, buttonDClick, 1}},
- {2711, {wxMouseEvent, buttonDown, 1}},
- {2712, {wxMouseEvent, buttonUp, 1}},
- {2713, {wxMouseEvent, cmdDown, 0}},
- {2714, {wxMouseEvent, controlDown, 0}},
- {2715, {wxMouseEvent, dragging, 0}},
- {2716, {wxMouseEvent, entering, 0}},
- {2717, {wxMouseEvent, getButton, 0}},
- {2720, {wxMouseEvent, getPosition, 0}},
- {2721, {wxMouseEvent, getLogicalPosition, 1}},
- {2722, {wxMouseEvent, getLinesPerAction, 0}},
- {2723, {wxMouseEvent, getWheelRotation, 0}},
- {2724, {wxMouseEvent, getWheelDelta, 0}},
- {2725, {wxMouseEvent, getX, 0}},
- {2726, {wxMouseEvent, getY, 0}},
- {2727, {wxMouseEvent, isButton, 0}},
- {2728, {wxMouseEvent, isPageScroll, 0}},
- {2729, {wxMouseEvent, leaving, 0}},
- {2730, {wxMouseEvent, leftDClick, 0}},
- {2731, {wxMouseEvent, leftDown, 0}},
- {2732, {wxMouseEvent, leftIsDown, 0}},
- {2733, {wxMouseEvent, leftUp, 0}},
- {2734, {wxMouseEvent, metaDown, 0}},
- {2735, {wxMouseEvent, middleDClick, 0}},
- {2736, {wxMouseEvent, middleDown, 0}},
- {2737, {wxMouseEvent, middleIsDown, 0}},
- {2738, {wxMouseEvent, middleUp, 0}},
- {2739, {wxMouseEvent, moving, 0}},
- {2740, {wxMouseEvent, rightDClick, 0}},
- {2741, {wxMouseEvent, rightDown, 0}},
- {2742, {wxMouseEvent, rightIsDown, 0}},
- {2743, {wxMouseEvent, rightUp, 0}},
- {2744, {wxMouseEvent, shiftDown, 0}},
- {2745, {wxSetCursorEvent, getCursor, 0}},
- {2746, {wxSetCursorEvent, getX, 0}},
- {2747, {wxSetCursorEvent, getY, 0}},
- {2748, {wxSetCursorEvent, hasCursor, 0}},
- {2749, {wxSetCursorEvent, setCursor, 1}},
- {2750, {wxKeyEvent, altDown, 0}},
- {2751, {wxKeyEvent, cmdDown, 0}},
- {2752, {wxKeyEvent, controlDown, 0}},
- {2753, {wxKeyEvent, getKeyCode, 0}},
- {2754, {wxKeyEvent, getModifiers, 0}},
- {2757, {wxKeyEvent, getPosition, 0}},
- {2758, {wxKeyEvent, getRawKeyCode, 0}},
- {2759, {wxKeyEvent, getRawKeyFlags, 0}},
- {2760, {wxKeyEvent, getUnicodeKey, 0}},
- {2761, {wxKeyEvent, getX, 0}},
- {2762, {wxKeyEvent, getY, 0}},
- {2763, {wxKeyEvent, hasModifiers, 0}},
- {2764, {wxKeyEvent, metaDown, 0}},
- {2765, {wxKeyEvent, shiftDown, 0}},
- {2766, {wxSizeEvent, getSize, 0}},
- {2767, {wxMoveEvent, getPosition, 0}},
- {2768, {wxEraseEvent, getDC, 0}},
- {2769, {wxFocusEvent, getWindow, 0}},
- {2770, {wxChildFocusEvent, getWindow, 0}},
- {2771, {wxMenuEvent, getMenu, 0}},
- {2772, {wxMenuEvent, getMenuId, 0}},
- {2773, {wxMenuEvent, isPopup, 0}},
- {2774, {wxCloseEvent, canVeto, 0}},
- {2775, {wxCloseEvent, getLoggingOff, 0}},
- {2776, {wxCloseEvent, setCanVeto, 1}},
- {2777, {wxCloseEvent, setLoggingOff, 1}},
- {2778, {wxCloseEvent, veto, 1}},
- {2779, {wxShowEvent, setShow, 1}},
- {2780, {wxShowEvent, getShow, 0}},
- {2781, {wxIconizeEvent, iconized, 0}},
- {2782, {wxJoystickEvent, buttonDown, 1}},
- {2783, {wxJoystickEvent, buttonIsDown, 1}},
- {2784, {wxJoystickEvent, buttonUp, 1}},
- {2785, {wxJoystickEvent, getButtonChange, 0}},
- {2786, {wxJoystickEvent, getButtonState, 0}},
- {2787, {wxJoystickEvent, getJoystick, 0}},
- {2788, {wxJoystickEvent, getPosition, 0}},
- {2789, {wxJoystickEvent, getZPosition, 0}},
- {2790, {wxJoystickEvent, isButton, 0}},
- {2791, {wxJoystickEvent, isMove, 0}},
- {2792, {wxJoystickEvent, isZMove, 0}},
- {2793, {wxUpdateUIEvent, canUpdate, 1}},
- {2794, {wxUpdateUIEvent, check, 1}},
- {2795, {wxUpdateUIEvent, enable, 1}},
- {2796, {wxUpdateUIEvent, show, 1}},
- {2797, {wxUpdateUIEvent, getChecked, 0}},
- {2798, {wxUpdateUIEvent, getEnabled, 0}},
- {2799, {wxUpdateUIEvent, getShown, 0}},
- {2800, {wxUpdateUIEvent, getSetChecked, 0}},
- {2801, {wxUpdateUIEvent, getSetEnabled, 0}},
- {2802, {wxUpdateUIEvent, getSetShown, 0}},
- {2803, {wxUpdateUIEvent, getSetText, 0}},
- {2804, {wxUpdateUIEvent, getText, 0}},
- {2805, {wxUpdateUIEvent, getMode, 0}},
- {2806, {wxUpdateUIEvent, getUpdateInterval, 0}},
- {2807, {wxUpdateUIEvent, resetUpdateTime, 0}},
- {2808, {wxUpdateUIEvent, setMode, 1}},
- {2809, {wxUpdateUIEvent, setText, 1}},
- {2810, {wxUpdateUIEvent, setUpdateInterval, 1}},
- {2811, {wxMouseCaptureChangedEvent, getCapturedWindow, 0}},
- {2812, {wxPaletteChangedEvent, setChangedWindow, 1}},
- {2813, {wxPaletteChangedEvent, getChangedWindow, 0}},
- {2814, {wxQueryNewPaletteEvent, setPaletteRealized, 1}},
- {2815, {wxQueryNewPaletteEvent, getPaletteRealized, 0}},
- {2816, {wxNavigationKeyEvent, getDirection, 0}},
- {2817, {wxNavigationKeyEvent, setDirection, 1}},
- {2818, {wxNavigationKeyEvent, isWindowChange, 0}},
- {2819, {wxNavigationKeyEvent, setWindowChange, 1}},
- {2820, {wxNavigationKeyEvent, isFromTab, 0}},
- {2821, {wxNavigationKeyEvent, setFromTab, 1}},
- {2822, {wxNavigationKeyEvent, getCurrentFocus, 0}},
- {2823, {wxNavigationKeyEvent, setCurrentFocus, 1}},
- {2824, {wxHelpEvent, getOrigin, 0}},
- {2825, {wxHelpEvent, getPosition, 0}},
- {2826, {wxHelpEvent, setOrigin, 1}},
- {2827, {wxHelpEvent, setPosition, 1}},
- {2828, {wxContextMenuEvent, getPosition, 0}},
- {2829, {wxContextMenuEvent, setPosition, 1}},
- {2830, {wxIdleEvent, canSend, 1}},
- {2831, {wxIdleEvent, getMode, 0}},
- {2832, {wxIdleEvent, requestMore, 1}},
- {2833, {wxIdleEvent, moreRequested, 0}},
- {2834, {wxIdleEvent, setMode, 1}},
- {2835, {wxGridEvent, altDown, 0}},
- {2836, {wxGridEvent, controlDown, 0}},
- {2837, {wxGridEvent, getCol, 0}},
- {2838, {wxGridEvent, getPosition, 0}},
- {2839, {wxGridEvent, getRow, 0}},
- {2840, {wxGridEvent, metaDown, 0}},
- {2841, {wxGridEvent, selecting, 0}},
- {2842, {wxGridEvent, shiftDown, 0}},
- {2843, {wxNotifyEvent, allow, 0}},
- {2844, {wxNotifyEvent, isAllowed, 0}},
- {2845, {wxNotifyEvent, veto, 0}},
- {2846, {wxSashEvent, getEdge, 0}},
- {2847, {wxSashEvent, getDragRect, 0}},
- {2848, {wxSashEvent, getDragStatus, 0}},
- {2849, {wxListEvent, getCacheFrom, 0}},
- {2850, {wxListEvent, getCacheTo, 0}},
- {2851, {wxListEvent, getKeyCode, 0}},
- {2852, {wxListEvent, getIndex, 0}},
- {2853, {wxListEvent, getColumn, 0}},
- {2854, {wxListEvent, getPoint, 0}},
- {2855, {wxListEvent, getLabel, 0}},
- {2856, {wxListEvent, getText, 0}},
- {2857, {wxListEvent, getImage, 0}},
- {2858, {wxListEvent, getData, 0}},
- {2859, {wxListEvent, getMask, 0}},
- {2860, {wxListEvent, getItem, 0}},
- {2861, {wxListEvent, isEditCancelled, 0}},
- {2862, {wxDateEvent, getDate, 0}},
- {2863, {wxCalendarEvent, getWeekDay, 0}},
- {2864, {wxFileDirPickerEvent, getPath, 0}},
- {2865, {wxColourPickerEvent, getColour, 0}},
- {2866, {wxFontPickerEvent, getFont, 0}},
- {2867, {wxStyledTextEvent, getPosition, 0}},
- {2868, {wxStyledTextEvent, getKey, 0}},
- {2869, {wxStyledTextEvent, getModifiers, 0}},
- {2870, {wxStyledTextEvent, getModificationType, 0}},
- {2871, {wxStyledTextEvent, getText, 0}},
- {2872, {wxStyledTextEvent, getLength, 0}},
- {2873, {wxStyledTextEvent, getLinesAdded, 0}},
- {2874, {wxStyledTextEvent, getLine, 0}},
- {2875, {wxStyledTextEvent, getFoldLevelNow, 0}},
- {2876, {wxStyledTextEvent, getFoldLevelPrev, 0}},
- {2877, {wxStyledTextEvent, getMargin, 0}},
- {2878, {wxStyledTextEvent, getMessage, 0}},
- {2879, {wxStyledTextEvent, getWParam, 0}},
- {2880, {wxStyledTextEvent, getLParam, 0}},
- {2881, {wxStyledTextEvent, getListType, 0}},
- {2882, {wxStyledTextEvent, getX, 0}},
- {2883, {wxStyledTextEvent, getY, 0}},
- {2884, {wxStyledTextEvent, getDragText, 0}},
- {2885, {wxStyledTextEvent, getDragAllowMove, 0}},
- {2886, {wxStyledTextEvent, getDragResult, 0}},
- {2887, {wxStyledTextEvent, getShift, 0}},
- {2888, {wxStyledTextEvent, getControl, 0}},
- {2889, {wxStyledTextEvent, getAlt, 0}},
- {2890, {utils, getKeyState, 1}},
- {2891, {utils, getMousePosition, 2}},
- {2892, {utils, getMouseState, 0}},
- {2893, {utils, setDetectableAutoRepeat, 1}},
- {2894, {utils, bell, 0}},
- {2895, {utils, findMenuItemId, 3}},
- {2896, {utils, genericFindWindowAtPoint, 1}},
- {2897, {utils, findWindowAtPoint, 1}},
- {2898, {utils, beginBusyCursor, 1}},
- {2899, {utils, endBusyCursor, 0}},
- {2900, {utils, isBusy, 0}},
- {2901, {utils, shutdown, 1}},
- {2902, {utils, shell, 1}},
- {2903, {utils, launchDefaultBrowser, 2}},
- {2904, {utils, getEmailAddress, 0}},
- {2905, {utils, getUserId, 0}},
- {2906, {utils, getHomeDir, 0}},
- {2907, {utils, newId, 0}},
- {2908, {utils, registerId, 1}},
- {2909, {utils, getCurrentId, 0}},
- {2910, {utils, getOsDescription, 0}},
- {2911, {utils, isPlatformLittleEndian, 0}},
- {2912, {utils, isPlatform64Bit, 0}},
- {2913, {wxPrintout, new, 1}},
- {2914, {wxPrintout, destruct, 0}},
- {2915, {wxPrintout, getDC, 0}},
- {2916, {wxPrintout, getPageSizeMM, 2}},
- {2917, {wxPrintout, getPageSizePixels, 2}},
- {2918, {wxPrintout, getPaperRectPixels, 0}},
- {2919, {wxPrintout, getPPIPrinter, 2}},
- {2920, {wxPrintout, getPPIScreen, 2}},
- {2921, {wxPrintout, getTitle, 0}},
- {2922, {wxPrintout, isPreview, 0}},
- {2923, {wxPrintout, fitThisSizeToPaper, 1}},
- {2924, {wxPrintout, fitThisSizeToPage, 1}},
- {2925, {wxPrintout, fitThisSizeToPageMargins, 2}},
- {2926, {wxPrintout, mapScreenSizeToPaper, 0}},
- {2927, {wxPrintout, mapScreenSizeToPage, 0}},
- {2928, {wxPrintout, mapScreenSizeToPageMargins, 1}},
- {2929, {wxPrintout, mapScreenSizeToDevice, 0}},
- {2930, {wxPrintout, getLogicalPaperRect, 0}},
- {2931, {wxPrintout, getLogicalPageRect, 0}},
- {2932, {wxPrintout, getLogicalPageMarginsRect, 1}},
- {2933, {wxPrintout, setLogicalOrigin, 2}},
- {2934, {wxPrintout, offsetLogicalOrigin, 2}},
- {2935, {wxStyledTextCtrl, new_2, 2}},
- {2936, {wxStyledTextCtrl, new_0, 0}},
- {2937, {wxStyledTextCtrl, destruct, 0}},
- {2938, {wxStyledTextCtrl, create, 2}},
- {2939, {wxStyledTextCtrl, addText, 1}},
- {2940, {wxStyledTextCtrl, addStyledText, 1}},
- {2941, {wxStyledTextCtrl, insertText, 2}},
- {2942, {wxStyledTextCtrl, clearAll, 0}},
- {2943, {wxStyledTextCtrl, clearDocumentStyle, 0}},
- {2944, {wxStyledTextCtrl, getLength, 0}},
- {2945, {wxStyledTextCtrl, getCharAt, 1}},
- {2946, {wxStyledTextCtrl, getCurrentPos, 0}},
- {2947, {wxStyledTextCtrl, getAnchor, 0}},
- {2948, {wxStyledTextCtrl, getStyleAt, 1}},
- {2949, {wxStyledTextCtrl, redo, 0}},
- {2950, {wxStyledTextCtrl, setUndoCollection, 1}},
- {2951, {wxStyledTextCtrl, selectAll, 0}},
- {2952, {wxStyledTextCtrl, setSavePoint, 0}},
- {2953, {wxStyledTextCtrl, getStyledText, 2}},
- {2954, {wxStyledTextCtrl, canRedo, 0}},
- {2955, {wxStyledTextCtrl, markerLineFromHandle, 1}},
- {2956, {wxStyledTextCtrl, markerDeleteHandle, 1}},
- {2957, {wxStyledTextCtrl, getUndoCollection, 0}},
- {2958, {wxStyledTextCtrl, getViewWhiteSpace, 0}},
- {2959, {wxStyledTextCtrl, setViewWhiteSpace, 1}},
- {2960, {wxStyledTextCtrl, positionFromPoint, 1}},
- {2961, {wxStyledTextCtrl, positionFromPointClose, 2}},
- {2962, {wxStyledTextCtrl, gotoLine, 1}},
- {2963, {wxStyledTextCtrl, gotoPos, 1}},
- {2964, {wxStyledTextCtrl, setAnchor, 1}},
- {2965, {wxStyledTextCtrl, getCurLine, 1}},
- {2966, {wxStyledTextCtrl, getEndStyled, 0}},
- {2967, {wxStyledTextCtrl, convertEOLs, 1}},
- {2968, {wxStyledTextCtrl, getEOLMode, 0}},
- {2969, {wxStyledTextCtrl, setEOLMode, 1}},
- {2970, {wxStyledTextCtrl, startStyling, 2}},
- {2971, {wxStyledTextCtrl, setStyling, 2}},
- {2972, {wxStyledTextCtrl, getBufferedDraw, 0}},
- {2973, {wxStyledTextCtrl, setBufferedDraw, 1}},
- {2974, {wxStyledTextCtrl, setTabWidth, 1}},
- {2975, {wxStyledTextCtrl, getTabWidth, 0}},
- {2976, {wxStyledTextCtrl, setCodePage, 1}},
- {2977, {wxStyledTextCtrl, markerDefine, 3}},
- {2978, {wxStyledTextCtrl, markerSetForeground, 2}},
- {2979, {wxStyledTextCtrl, markerSetBackground, 2}},
- {2980, {wxStyledTextCtrl, markerAdd, 2}},
- {2981, {wxStyledTextCtrl, markerDelete, 2}},
- {2982, {wxStyledTextCtrl, markerDeleteAll, 1}},
- {2983, {wxStyledTextCtrl, markerGet, 1}},
- {2984, {wxStyledTextCtrl, markerNext, 2}},
- {2985, {wxStyledTextCtrl, markerPrevious, 2}},
- {2986, {wxStyledTextCtrl, markerDefineBitmap, 2}},
- {2987, {wxStyledTextCtrl, markerAddSet, 2}},
- {2988, {wxStyledTextCtrl, markerSetAlpha, 2}},
- {2989, {wxStyledTextCtrl, setMarginType, 2}},
- {2990, {wxStyledTextCtrl, getMarginType, 1}},
- {2991, {wxStyledTextCtrl, setMarginWidth, 2}},
- {2992, {wxStyledTextCtrl, getMarginWidth, 1}},
- {2993, {wxStyledTextCtrl, setMarginMask, 2}},
- {2994, {wxStyledTextCtrl, getMarginMask, 1}},
- {2995, {wxStyledTextCtrl, setMarginSensitive, 2}},
- {2996, {wxStyledTextCtrl, getMarginSensitive, 1}},
- {2997, {wxStyledTextCtrl, styleClearAll, 0}},
- {2998, {wxStyledTextCtrl, styleSetForeground, 2}},
- {2999, {wxStyledTextCtrl, styleSetBackground, 2}},
- {3000, {wxStyledTextCtrl, styleSetBold, 2}},
- {3001, {wxStyledTextCtrl, styleSetItalic, 2}},
- {3002, {wxStyledTextCtrl, styleSetSize, 2}},
- {3003, {wxStyledTextCtrl, styleSetFaceName, 2}},
- {3004, {wxStyledTextCtrl, styleSetEOLFilled, 2}},
- {3005, {wxStyledTextCtrl, styleResetDefault, 0}},
- {3006, {wxStyledTextCtrl, styleSetUnderline, 2}},
- {3007, {wxStyledTextCtrl, styleSetCase, 2}},
- {3008, {wxStyledTextCtrl, styleSetHotSpot, 2}},
- {3009, {wxStyledTextCtrl, setSelForeground, 2}},
- {3010, {wxStyledTextCtrl, setSelBackground, 2}},
- {3011, {wxStyledTextCtrl, getSelAlpha, 0}},
- {3012, {wxStyledTextCtrl, setSelAlpha, 1}},
- {3013, {wxStyledTextCtrl, setCaretForeground, 1}},
- {3014, {wxStyledTextCtrl, cmdKeyAssign, 3}},
- {3015, {wxStyledTextCtrl, cmdKeyClear, 2}},
- {3016, {wxStyledTextCtrl, cmdKeyClearAll, 0}},
- {3017, {wxStyledTextCtrl, setStyleBytes, 2}},
- {3018, {wxStyledTextCtrl, styleSetVisible, 2}},
- {3019, {wxStyledTextCtrl, getCaretPeriod, 0}},
- {3020, {wxStyledTextCtrl, setCaretPeriod, 1}},
- {3021, {wxStyledTextCtrl, setWordChars, 1}},
- {3022, {wxStyledTextCtrl, beginUndoAction, 0}},
- {3023, {wxStyledTextCtrl, endUndoAction, 0}},
- {3024, {wxStyledTextCtrl, indicatorSetStyle, 2}},
- {3025, {wxStyledTextCtrl, indicatorGetStyle, 1}},
- {3026, {wxStyledTextCtrl, indicatorSetForeground, 2}},
- {3027, {wxStyledTextCtrl, indicatorGetForeground, 1}},
- {3028, {wxStyledTextCtrl, setWhitespaceForeground, 2}},
- {3029, {wxStyledTextCtrl, setWhitespaceBackground, 2}},
- {3030, {wxStyledTextCtrl, getStyleBits, 0}},
- {3031, {wxStyledTextCtrl, setLineState, 2}},
- {3032, {wxStyledTextCtrl, getLineState, 1}},
- {3033, {wxStyledTextCtrl, getMaxLineState, 0}},
- {3034, {wxStyledTextCtrl, getCaretLineVisible, 0}},
- {3035, {wxStyledTextCtrl, setCaretLineVisible, 1}},
- {3036, {wxStyledTextCtrl, getCaretLineBackground, 0}},
- {3037, {wxStyledTextCtrl, setCaretLineBackground, 1}},
- {3038, {wxStyledTextCtrl, autoCompShow, 2}},
- {3039, {wxStyledTextCtrl, autoCompCancel, 0}},
- {3040, {wxStyledTextCtrl, autoCompActive, 0}},
- {3041, {wxStyledTextCtrl, autoCompPosStart, 0}},
- {3042, {wxStyledTextCtrl, autoCompComplete, 0}},
- {3043, {wxStyledTextCtrl, autoCompStops, 1}},
- {3044, {wxStyledTextCtrl, autoCompSetSeparator, 1}},
- {3045, {wxStyledTextCtrl, autoCompGetSeparator, 0}},
- {3046, {wxStyledTextCtrl, autoCompSelect, 1}},
- {3047, {wxStyledTextCtrl, autoCompSetCancelAtStart, 1}},
- {3048, {wxStyledTextCtrl, autoCompGetCancelAtStart, 0}},
- {3049, {wxStyledTextCtrl, autoCompSetFillUps, 1}},
- {3050, {wxStyledTextCtrl, autoCompSetChooseSingle, 1}},
- {3051, {wxStyledTextCtrl, autoCompGetChooseSingle, 0}},
- {3052, {wxStyledTextCtrl, autoCompSetIgnoreCase, 1}},
- {3053, {wxStyledTextCtrl, autoCompGetIgnoreCase, 0}},
- {3054, {wxStyledTextCtrl, userListShow, 2}},
- {3055, {wxStyledTextCtrl, autoCompSetAutoHide, 1}},
- {3056, {wxStyledTextCtrl, autoCompGetAutoHide, 0}},
- {3057, {wxStyledTextCtrl, autoCompSetDropRestOfWord, 1}},
- {3058, {wxStyledTextCtrl, autoCompGetDropRestOfWord, 0}},
- {3059, {wxStyledTextCtrl, registerImage, 2}},
- {3060, {wxStyledTextCtrl, clearRegisteredImages, 0}},
- {3061, {wxStyledTextCtrl, autoCompGetTypeSeparator, 0}},
- {3062, {wxStyledTextCtrl, autoCompSetTypeSeparator, 1}},
- {3063, {wxStyledTextCtrl, autoCompSetMaxWidth, 1}},
- {3064, {wxStyledTextCtrl, autoCompGetMaxWidth, 0}},
- {3065, {wxStyledTextCtrl, autoCompSetMaxHeight, 1}},
- {3066, {wxStyledTextCtrl, autoCompGetMaxHeight, 0}},
- {3067, {wxStyledTextCtrl, setIndent, 1}},
- {3068, {wxStyledTextCtrl, getIndent, 0}},
- {3069, {wxStyledTextCtrl, setUseTabs, 1}},
- {3070, {wxStyledTextCtrl, getUseTabs, 0}},
- {3071, {wxStyledTextCtrl, setLineIndentation, 2}},
- {3072, {wxStyledTextCtrl, getLineIndentation, 1}},
- {3073, {wxStyledTextCtrl, getLineIndentPosition, 1}},
- {3074, {wxStyledTextCtrl, getColumn, 1}},
- {3075, {wxStyledTextCtrl, setUseHorizontalScrollBar, 1}},
- {3076, {wxStyledTextCtrl, getUseHorizontalScrollBar, 0}},
- {3077, {wxStyledTextCtrl, setIndentationGuides, 1}},
- {3078, {wxStyledTextCtrl, getIndentationGuides, 0}},
- {3079, {wxStyledTextCtrl, setHighlightGuide, 1}},
- {3080, {wxStyledTextCtrl, getHighlightGuide, 0}},
- {3081, {wxStyledTextCtrl, getLineEndPosition, 1}},
- {3082, {wxStyledTextCtrl, getCodePage, 0}},
- {3083, {wxStyledTextCtrl, getCaretForeground, 0}},
- {3084, {wxStyledTextCtrl, getReadOnly, 0}},
- {3085, {wxStyledTextCtrl, setCurrentPos, 1}},
- {3086, {wxStyledTextCtrl, setSelectionStart, 1}},
- {3087, {wxStyledTextCtrl, getSelectionStart, 0}},
- {3088, {wxStyledTextCtrl, setSelectionEnd, 1}},
- {3089, {wxStyledTextCtrl, getSelectionEnd, 0}},
- {3090, {wxStyledTextCtrl, setPrintMagnification, 1}},
- {3091, {wxStyledTextCtrl, getPrintMagnification, 0}},
- {3092, {wxStyledTextCtrl, setPrintColourMode, 1}},
- {3093, {wxStyledTextCtrl, getPrintColourMode, 0}},
- {3094, {wxStyledTextCtrl, findText, 4}},
- {3095, {wxStyledTextCtrl, formatRange, 7}},
- {3096, {wxStyledTextCtrl, getFirstVisibleLine, 0}},
- {3097, {wxStyledTextCtrl, getLine, 1}},
- {3098, {wxStyledTextCtrl, getLineCount, 0}},
- {3099, {wxStyledTextCtrl, setMarginLeft, 1}},
- {3100, {wxStyledTextCtrl, getMarginLeft, 0}},
- {3101, {wxStyledTextCtrl, setMarginRight, 1}},
- {3102, {wxStyledTextCtrl, getMarginRight, 0}},
- {3103, {wxStyledTextCtrl, getModify, 0}},
- {3104, {wxStyledTextCtrl, setSelection, 2}},
- {3105, {wxStyledTextCtrl, getSelectedText, 0}},
- {3106, {wxStyledTextCtrl, getTextRange, 2}},
- {3107, {wxStyledTextCtrl, hideSelection, 1}},
- {3108, {wxStyledTextCtrl, lineFromPosition, 1}},
- {3109, {wxStyledTextCtrl, positionFromLine, 1}},
- {3110, {wxStyledTextCtrl, lineScroll, 2}},
- {3111, {wxStyledTextCtrl, ensureCaretVisible, 0}},
- {3112, {wxStyledTextCtrl, replaceSelection, 1}},
- {3113, {wxStyledTextCtrl, setReadOnly, 1}},
- {3114, {wxStyledTextCtrl, canPaste, 0}},
- {3115, {wxStyledTextCtrl, canUndo, 0}},
- {3116, {wxStyledTextCtrl, emptyUndoBuffer, 0}},
- {3117, {wxStyledTextCtrl, undo, 0}},
- {3118, {wxStyledTextCtrl, cut, 0}},
- {3119, {wxStyledTextCtrl, copy, 0}},
- {3120, {wxStyledTextCtrl, paste, 0}},
- {3121, {wxStyledTextCtrl, clear, 0}},
- {3122, {wxStyledTextCtrl, setText, 1}},
- {3123, {wxStyledTextCtrl, getText, 0}},
- {3124, {wxStyledTextCtrl, getTextLength, 0}},
- {3125, {wxStyledTextCtrl, getOvertype, 0}},
- {3126, {wxStyledTextCtrl, setCaretWidth, 1}},
- {3127, {wxStyledTextCtrl, getCaretWidth, 0}},
- {3128, {wxStyledTextCtrl, setTargetStart, 1}},
- {3129, {wxStyledTextCtrl, getTargetStart, 0}},
- {3130, {wxStyledTextCtrl, setTargetEnd, 1}},
- {3131, {wxStyledTextCtrl, getTargetEnd, 0}},
- {3132, {wxStyledTextCtrl, replaceTarget, 1}},
- {3133, {wxStyledTextCtrl, searchInTarget, 1}},
- {3134, {wxStyledTextCtrl, setSearchFlags, 1}},
- {3135, {wxStyledTextCtrl, getSearchFlags, 0}},
- {3136, {wxStyledTextCtrl, callTipShow, 2}},
- {3137, {wxStyledTextCtrl, callTipCancel, 0}},
- {3138, {wxStyledTextCtrl, callTipActive, 0}},
- {3139, {wxStyledTextCtrl, callTipPosAtStart, 0}},
- {3140, {wxStyledTextCtrl, callTipSetHighlight, 2}},
- {3141, {wxStyledTextCtrl, callTipSetBackground, 1}},
- {3142, {wxStyledTextCtrl, callTipSetForeground, 1}},
- {3143, {wxStyledTextCtrl, callTipSetForegroundHighlight, 1}},
- {3144, {wxStyledTextCtrl, callTipUseStyle, 1}},
- {3145, {wxStyledTextCtrl, visibleFromDocLine, 1}},
- {3146, {wxStyledTextCtrl, docLineFromVisible, 1}},
- {3147, {wxStyledTextCtrl, wrapCount, 1}},
- {3148, {wxStyledTextCtrl, setFoldLevel, 2}},
- {3149, {wxStyledTextCtrl, getFoldLevel, 1}},
- {3150, {wxStyledTextCtrl, getLastChild, 2}},
- {3151, {wxStyledTextCtrl, getFoldParent, 1}},
- {3152, {wxStyledTextCtrl, showLines, 2}},
- {3153, {wxStyledTextCtrl, hideLines, 2}},
- {3154, {wxStyledTextCtrl, getLineVisible, 1}},
- {3155, {wxStyledTextCtrl, setFoldExpanded, 2}},
- {3156, {wxStyledTextCtrl, getFoldExpanded, 1}},
- {3157, {wxStyledTextCtrl, toggleFold, 1}},
- {3158, {wxStyledTextCtrl, ensureVisible, 1}},
- {3159, {wxStyledTextCtrl, setFoldFlags, 1}},
- {3160, {wxStyledTextCtrl, ensureVisibleEnforcePolicy, 1}},
- {3161, {wxStyledTextCtrl, setTabIndents, 1}},
- {3162, {wxStyledTextCtrl, getTabIndents, 0}},
- {3163, {wxStyledTextCtrl, setBackSpaceUnIndents, 1}},
- {3164, {wxStyledTextCtrl, getBackSpaceUnIndents, 0}},
- {3165, {wxStyledTextCtrl, setMouseDwellTime, 1}},
- {3166, {wxStyledTextCtrl, getMouseDwellTime, 0}},
- {3167, {wxStyledTextCtrl, wordStartPosition, 2}},
- {3168, {wxStyledTextCtrl, wordEndPosition, 2}},
- {3169, {wxStyledTextCtrl, setWrapMode, 1}},
- {3170, {wxStyledTextCtrl, getWrapMode, 0}},
- {3171, {wxStyledTextCtrl, setWrapVisualFlags, 1}},
- {3172, {wxStyledTextCtrl, getWrapVisualFlags, 0}},
- {3173, {wxStyledTextCtrl, setWrapVisualFlagsLocation, 1}},
- {3174, {wxStyledTextCtrl, getWrapVisualFlagsLocation, 0}},
- {3175, {wxStyledTextCtrl, setWrapStartIndent, 1}},
- {3176, {wxStyledTextCtrl, getWrapStartIndent, 0}},
- {3177, {wxStyledTextCtrl, setLayoutCache, 1}},
- {3178, {wxStyledTextCtrl, getLayoutCache, 0}},
- {3179, {wxStyledTextCtrl, setScrollWidth, 1}},
- {3180, {wxStyledTextCtrl, getScrollWidth, 0}},
- {3181, {wxStyledTextCtrl, textWidth, 2}},
- {3182, {wxStyledTextCtrl, getEndAtLastLine, 0}},
- {3183, {wxStyledTextCtrl, textHeight, 1}},
- {3184, {wxStyledTextCtrl, setUseVerticalScrollBar, 1}},
- {3185, {wxStyledTextCtrl, getUseVerticalScrollBar, 0}},
- {3186, {wxStyledTextCtrl, appendText, 1}},
- {3187, {wxStyledTextCtrl, getTwoPhaseDraw, 0}},
- {3188, {wxStyledTextCtrl, setTwoPhaseDraw, 1}},
- {3189, {wxStyledTextCtrl, targetFromSelection, 0}},
- {3190, {wxStyledTextCtrl, linesJoin, 0}},
- {3191, {wxStyledTextCtrl, linesSplit, 1}},
- {3192, {wxStyledTextCtrl, setFoldMarginColour, 2}},
- {3193, {wxStyledTextCtrl, setFoldMarginHiColour, 2}},
- {3194, {wxStyledTextCtrl, lineDown, 0}},
- {3195, {wxStyledTextCtrl, lineDownExtend, 0}},
- {3196, {wxStyledTextCtrl, lineUp, 0}},
- {3197, {wxStyledTextCtrl, lineUpExtend, 0}},
- {3198, {wxStyledTextCtrl, charLeft, 0}},
- {3199, {wxStyledTextCtrl, charLeftExtend, 0}},
- {3200, {wxStyledTextCtrl, charRight, 0}},
- {3201, {wxStyledTextCtrl, charRightExtend, 0}},
- {3202, {wxStyledTextCtrl, wordLeft, 0}},
- {3203, {wxStyledTextCtrl, wordLeftExtend, 0}},
- {3204, {wxStyledTextCtrl, wordRight, 0}},
- {3205, {wxStyledTextCtrl, wordRightExtend, 0}},
- {3206, {wxStyledTextCtrl, home, 0}},
- {3207, {wxStyledTextCtrl, homeExtend, 0}},
- {3208, {wxStyledTextCtrl, lineEnd, 0}},
- {3209, {wxStyledTextCtrl, lineEndExtend, 0}},
- {3210, {wxStyledTextCtrl, documentStart, 0}},
- {3211, {wxStyledTextCtrl, documentStartExtend, 0}},
- {3212, {wxStyledTextCtrl, documentEnd, 0}},
- {3213, {wxStyledTextCtrl, documentEndExtend, 0}},
- {3214, {wxStyledTextCtrl, pageUp, 0}},
- {3215, {wxStyledTextCtrl, pageUpExtend, 0}},
- {3216, {wxStyledTextCtrl, pageDown, 0}},
- {3217, {wxStyledTextCtrl, pageDownExtend, 0}},
- {3218, {wxStyledTextCtrl, editToggleOvertype, 0}},
- {3219, {wxStyledTextCtrl, cancel, 0}},
- {3220, {wxStyledTextCtrl, deleteBack, 0}},
- {3221, {wxStyledTextCtrl, tab, 0}},
- {3222, {wxStyledTextCtrl, backTab, 0}},
- {3223, {wxStyledTextCtrl, newLine, 0}},
- {3224, {wxStyledTextCtrl, formFeed, 0}},
- {3225, {wxStyledTextCtrl, vCHome, 0}},
- {3226, {wxStyledTextCtrl, vCHomeExtend, 0}},
- {3227, {wxStyledTextCtrl, zoomIn, 0}},
- {3228, {wxStyledTextCtrl, zoomOut, 0}},
- {3229, {wxStyledTextCtrl, delWordLeft, 0}},
- {3230, {wxStyledTextCtrl, delWordRight, 0}},
- {3231, {wxStyledTextCtrl, lineCut, 0}},
- {3232, {wxStyledTextCtrl, lineDelete, 0}},
- {3233, {wxStyledTextCtrl, lineTranspose, 0}},
- {3234, {wxStyledTextCtrl, lineDuplicate, 0}},
- {3235, {wxStyledTextCtrl, lowerCase, 0}},
- {3236, {wxStyledTextCtrl, upperCase, 0}},
- {3237, {wxStyledTextCtrl, lineScrollDown, 0}},
- {3238, {wxStyledTextCtrl, lineScrollUp, 0}},
- {3239, {wxStyledTextCtrl, deleteBackNotLine, 0}},
- {3240, {wxStyledTextCtrl, homeDisplay, 0}},
- {3241, {wxStyledTextCtrl, homeDisplayExtend, 0}},
- {3242, {wxStyledTextCtrl, lineEndDisplay, 0}},
- {3243, {wxStyledTextCtrl, lineEndDisplayExtend, 0}},
- {3244, {wxStyledTextCtrl, homeWrapExtend, 0}},
- {3245, {wxStyledTextCtrl, lineEndWrap, 0}},
- {3246, {wxStyledTextCtrl, lineEndWrapExtend, 0}},
- {3247, {wxStyledTextCtrl, vCHomeWrap, 0}},
- {3248, {wxStyledTextCtrl, vCHomeWrapExtend, 0}},
- {3249, {wxStyledTextCtrl, lineCopy, 0}},
- {3250, {wxStyledTextCtrl, moveCaretInsideView, 0}},
- {3251, {wxStyledTextCtrl, lineLength, 1}},
- {3252, {wxStyledTextCtrl, braceHighlight, 2}},
- {3253, {wxStyledTextCtrl, braceBadLight, 1}},
- {3254, {wxStyledTextCtrl, braceMatch, 1}},
- {3255, {wxStyledTextCtrl, getViewEOL, 0}},
- {3256, {wxStyledTextCtrl, setViewEOL, 1}},
- {3257, {wxStyledTextCtrl, setModEventMask, 1}},
- {3258, {wxStyledTextCtrl, getEdgeColumn, 0}},
- {3259, {wxStyledTextCtrl, setEdgeColumn, 1}},
- {3260, {wxStyledTextCtrl, getEdgeMode, 0}},
- {3261, {wxStyledTextCtrl, getEdgeColour, 0}},
- {3262, {wxStyledTextCtrl, setEdgeColour, 1}},
- {3263, {wxStyledTextCtrl, searchAnchor, 0}},
- {3264, {wxStyledTextCtrl, searchNext, 2}},
- {3265, {wxStyledTextCtrl, searchPrev, 2}},
- {3266, {wxStyledTextCtrl, linesOnScreen, 0}},
- {3267, {wxStyledTextCtrl, usePopUp, 1}},
- {3268, {wxStyledTextCtrl, selectionIsRectangle, 0}},
- {3269, {wxStyledTextCtrl, setZoom, 1}},
- {3270, {wxStyledTextCtrl, getZoom, 0}},
- {3271, {wxStyledTextCtrl, getModEventMask, 0}},
- {3272, {wxStyledTextCtrl, setSTCFocus, 1}},
- {3273, {wxStyledTextCtrl, getSTCFocus, 0}},
- {3274, {wxStyledTextCtrl, setStatus, 1}},
- {3275, {wxStyledTextCtrl, getStatus, 0}},
- {3276, {wxStyledTextCtrl, setMouseDownCaptures, 1}},
- {3277, {wxStyledTextCtrl, getMouseDownCaptures, 0}},
- {3278, {wxStyledTextCtrl, setSTCCursor, 1}},
- {3279, {wxStyledTextCtrl, getSTCCursor, 0}},
- {3280, {wxStyledTextCtrl, setControlCharSymbol, 1}},
- {3281, {wxStyledTextCtrl, getControlCharSymbol, 0}},
- {3282, {wxStyledTextCtrl, wordPartLeft, 0}},
- {3283, {wxStyledTextCtrl, wordPartLeftExtend, 0}},
- {3284, {wxStyledTextCtrl, wordPartRight, 0}},
- {3285, {wxStyledTextCtrl, wordPartRightExtend, 0}},
- {3286, {wxStyledTextCtrl, setVisiblePolicy, 2}},
- {3287, {wxStyledTextCtrl, delLineLeft, 0}},
- {3288, {wxStyledTextCtrl, delLineRight, 0}},
- {3289, {wxStyledTextCtrl, getXOffset, 0}},
- {3290, {wxStyledTextCtrl, chooseCaretX, 0}},
- {3291, {wxStyledTextCtrl, setXCaretPolicy, 2}},
- {3292, {wxStyledTextCtrl, setYCaretPolicy, 2}},
- {3293, {wxStyledTextCtrl, getPrintWrapMode, 0}},
- {3294, {wxStyledTextCtrl, setHotspotActiveForeground, 2}},
- {3295, {wxStyledTextCtrl, setHotspotActiveBackground, 2}},
- {3296, {wxStyledTextCtrl, setHotspotActiveUnderline, 1}},
- {3297, {wxStyledTextCtrl, setHotspotSingleLine, 1}},
- {3298, {wxStyledTextCtrl, paraDownExtend, 0}},
- {3299, {wxStyledTextCtrl, paraUp, 0}},
- {3300, {wxStyledTextCtrl, paraUpExtend, 0}},
- {3301, {wxStyledTextCtrl, positionBefore, 1}},
- {3302, {wxStyledTextCtrl, positionAfter, 1}},
- {3303, {wxStyledTextCtrl, copyRange, 2}},
- {3304, {wxStyledTextCtrl, copyText, 2}},
- {3305, {wxStyledTextCtrl, setSelectionMode, 1}},
- {3306, {wxStyledTextCtrl, getSelectionMode, 0}},
- {3307, {wxStyledTextCtrl, lineDownRectExtend, 0}},
- {3308, {wxStyledTextCtrl, lineUpRectExtend, 0}},
- {3309, {wxStyledTextCtrl, charLeftRectExtend, 0}},
- {3310, {wxStyledTextCtrl, charRightRectExtend, 0}},
- {3311, {wxStyledTextCtrl, homeRectExtend, 0}},
- {3312, {wxStyledTextCtrl, vCHomeRectExtend, 0}},
- {3313, {wxStyledTextCtrl, lineEndRectExtend, 0}},
- {3314, {wxStyledTextCtrl, pageUpRectExtend, 0}},
- {3315, {wxStyledTextCtrl, pageDownRectExtend, 0}},
- {3316, {wxStyledTextCtrl, stutteredPageUp, 0}},
- {3317, {wxStyledTextCtrl, stutteredPageUpExtend, 0}},
- {3318, {wxStyledTextCtrl, stutteredPageDown, 0}},
- {3319, {wxStyledTextCtrl, stutteredPageDownExtend, 0}},
- {3320, {wxStyledTextCtrl, wordLeftEnd, 0}},
- {3321, {wxStyledTextCtrl, wordLeftEndExtend, 0}},
- {3322, {wxStyledTextCtrl, wordRightEnd, 0}},
- {3323, {wxStyledTextCtrl, wordRightEndExtend, 0}},
- {3324, {wxStyledTextCtrl, setWhitespaceChars, 1}},
- {3325, {wxStyledTextCtrl, setCharsDefault, 0}},
- {3326, {wxStyledTextCtrl, autoCompGetCurrent, 0}},
- {3327, {wxStyledTextCtrl, allocate, 1}},
- {3328, {wxStyledTextCtrl, findColumn, 2}},
- {3329, {wxStyledTextCtrl, getCaretSticky, 0}},
- {3330, {wxStyledTextCtrl, setCaretSticky, 1}},
- {3331, {wxStyledTextCtrl, toggleCaretSticky, 0}},
- {3332, {wxStyledTextCtrl, setPasteConvertEndings, 1}},
- {3333, {wxStyledTextCtrl, getPasteConvertEndings, 0}},
- {3334, {wxStyledTextCtrl, selectionDuplicate, 0}},
- {3335, {wxStyledTextCtrl, setCaretLineBackAlpha, 1}},
- {3336, {wxStyledTextCtrl, getCaretLineBackAlpha, 0}},
- {3337, {wxStyledTextCtrl, startRecord, 0}},
- {3338, {wxStyledTextCtrl, stopRecord, 0}},
- {3339, {wxStyledTextCtrl, setLexer, 1}},
- {3340, {wxStyledTextCtrl, getLexer, 0}},
- {3341, {wxStyledTextCtrl, colourise, 2}},
- {3342, {wxStyledTextCtrl, setProperty, 2}},
- {3343, {wxStyledTextCtrl, setKeyWords, 2}},
- {3344, {wxStyledTextCtrl, setLexerLanguage, 1}},
- {3345, {wxStyledTextCtrl, getProperty, 1}},
- {3346, {wxStyledTextCtrl, getStyleBitsNeeded, 0}},
- {3347, {wxStyledTextCtrl, getCurrentLine, 0}},
- {3348, {wxStyledTextCtrl, styleSetSpec, 2}},
- {3349, {wxStyledTextCtrl, styleSetFont, 2}},
- {3350, {wxStyledTextCtrl, styleSetFontAttr, 7}},
- {3351, {wxStyledTextCtrl, styleSetCharacterSet, 2}},
- {3352, {wxStyledTextCtrl, styleSetFontEncoding, 2}},
- {3353, {wxStyledTextCtrl, cmdKeyExecute, 1}},
- {3354, {wxStyledTextCtrl, setMargins, 2}},
- {3355, {wxStyledTextCtrl, getSelection, 2}},
- {3356, {wxStyledTextCtrl, pointFromPosition, 1}},
- {3357, {wxStyledTextCtrl, scrollToLine, 1}},
- {3358, {wxStyledTextCtrl, scrollToColumn, 1}},
- {3359, {wxStyledTextCtrl, sendMsg, 2}},
- {3360, {wxStyledTextCtrl, setVScrollBar, 1}},
- {3361, {wxStyledTextCtrl, setHScrollBar, 1}},
- {3362, {wxStyledTextCtrl, getLastKeydownProcessed, 0}},
- {3363, {wxStyledTextCtrl, setLastKeydownProcessed, 1}},
- {3364, {wxStyledTextCtrl, saveFile, 1}},
- {3365, {wxStyledTextCtrl, loadFile, 1}},
- {3366, {wxStyledTextCtrl, doDragOver, 3}},
- {3367, {wxStyledTextCtrl, doDropText, 3}},
- {3368, {wxStyledTextCtrl, getUseAntiAliasing, 0}},
- {3369, {wxStyledTextCtrl, addTextRaw, 1}},
- {3370, {wxStyledTextCtrl, insertTextRaw, 2}},
- {3371, {wxStyledTextCtrl, getCurLineRaw, 1}},
- {3372, {wxStyledTextCtrl, getLineRaw, 1}},
- {3373, {wxStyledTextCtrl, getSelectedTextRaw, 0}},
- {3374, {wxStyledTextCtrl, getTextRangeRaw, 2}},
- {3375, {wxStyledTextCtrl, setTextRaw, 1}},
- {3376, {wxStyledTextCtrl, getTextRaw, 0}},
- {3377, {wxStyledTextCtrl, appendTextRaw, 1}},
- {3378, {wxArtProvider, getBitmap, 2}},
- {3379, {wxArtProvider, getIcon, 2}},
- {3380, {wxTreeEvent, getKeyCode, 0}},
- {3381, {wxTreeEvent, getItem, 0}},
- {3382, {wxTreeEvent, getKeyEvent, 0}},
- {3383, {wxTreeEvent, getLabel, 0}},
- {3384, {wxTreeEvent, getOldItem, 0}},
- {3385, {wxTreeEvent, getPoint, 0}},
- {3386, {wxTreeEvent, isEditCancelled, 0}},
- {3387, {wxTreeEvent, setToolTip, 1}},
- {3388, {wxNotebookEvent, getOldSelection, 0}},
- {3389, {wxNotebookEvent, getSelection, 0}},
- {3390, {wxNotebookEvent, setOldSelection, 1}},
- {3391, {wxNotebookEvent, setSelection, 1}},
- {3392, {wxFileDataObject, new, 0}},
- {3393, {wxFileDataObject, addFile, 1}},
- {3394, {wxFileDataObject, getFilenames, 0}},
- {3395, {wxFileDataObject, 'Destroy', undefined}},
- {3396, {wxTextDataObject, new, 1}},
- {3397, {wxTextDataObject, getTextLength, 0}},
- {3398, {wxTextDataObject, getText, 0}},
- {3399, {wxTextDataObject, setText, 1}},
- {3400, {wxTextDataObject, 'Destroy', undefined}},
- {3401, {wxBitmapDataObject, new_1_1, 1}},
- {3402, {wxBitmapDataObject, new_1_0, 1}},
- {3403, {wxBitmapDataObject, getBitmap, 0}},
- {3404, {wxBitmapDataObject, setBitmap, 1}},
- {3405, {wxBitmapDataObject, 'Destroy', undefined}},
- {3407, {wxClipboard, new, 0}},
- {3408, {wxClipboard, destruct, 0}},
- {3409, {wxClipboard, addData, 1}},
- {3410, {wxClipboard, clear, 0}},
- {3411, {wxClipboard, close, 0}},
- {3412, {wxClipboard, flush, 0}},
- {3413, {wxClipboard, getData, 1}},
- {3414, {wxClipboard, isOpened, 0}},
- {3415, {wxClipboard, open, 0}},
- {3416, {wxClipboard, setData, 1}},
- {3418, {wxClipboard, usePrimarySelection, 1}},
- {3419, {wxClipboard, isSupported, 1}},
- {3420, {wxClipboard, get, 0}},
- {3421, {wxSpinEvent, getPosition, 0}},
- {3422, {wxSpinEvent, setPosition, 1}},
- {3423, {wxSplitterWindow, new_0, 0}},
- {3424, {wxSplitterWindow, new_2, 2}},
- {3425, {wxSplitterWindow, destruct, 0}},
- {3426, {wxSplitterWindow, create, 2}},
- {3427, {wxSplitterWindow, getMinimumPaneSize, 0}},
- {3428, {wxSplitterWindow, getSashGravity, 0}},
- {3429, {wxSplitterWindow, getSashPosition, 0}},
- {3430, {wxSplitterWindow, getSplitMode, 0}},
- {3431, {wxSplitterWindow, getWindow1, 0}},
- {3432, {wxSplitterWindow, getWindow2, 0}},
- {3433, {wxSplitterWindow, initialize, 1}},
- {3434, {wxSplitterWindow, isSplit, 0}},
- {3435, {wxSplitterWindow, replaceWindow, 2}},
- {3436, {wxSplitterWindow, setSashGravity, 1}},
- {3437, {wxSplitterWindow, setSashPosition, 2}},
- {3438, {wxSplitterWindow, setSashSize, 1}},
- {3439, {wxSplitterWindow, setMinimumPaneSize, 1}},
- {3440, {wxSplitterWindow, setSplitMode, 1}},
- {3441, {wxSplitterWindow, splitHorizontally, 3}},
- {3442, {wxSplitterWindow, splitVertically, 3}},
- {3443, {wxSplitterWindow, unsplit, 1}},
- {3444, {wxSplitterWindow, updateSize, 0}},
- {3445, {wxSplitterEvent, getSashPosition, 0}},
- {3446, {wxSplitterEvent, getX, 0}},
- {3447, {wxSplitterEvent, getY, 0}},
- {3448, {wxSplitterEvent, getWindowBeingRemoved, 0}},
- {3449, {wxSplitterEvent, setSashPosition, 1}},
- {3450, {wxHtmlWindow, new_0, 0}},
- {3451, {wxHtmlWindow, new_2, 2}},
- {3452, {wxHtmlWindow, appendToPage, 1}},
- {3453, {wxHtmlWindow, getOpenedAnchor, 0}},
- {3454, {wxHtmlWindow, getOpenedPage, 0}},
- {3455, {wxHtmlWindow, getOpenedPageTitle, 0}},
- {3456, {wxHtmlWindow, getRelatedFrame, 0}},
- {3457, {wxHtmlWindow, historyBack, 0}},
- {3458, {wxHtmlWindow, historyCanBack, 0}},
- {3459, {wxHtmlWindow, historyCanForward, 0}},
- {3460, {wxHtmlWindow, historyClear, 0}},
- {3461, {wxHtmlWindow, historyForward, 0}},
- {3462, {wxHtmlWindow, loadFile, 1}},
- {3463, {wxHtmlWindow, loadPage, 1}},
- {3464, {wxHtmlWindow, selectAll, 0}},
- {3465, {wxHtmlWindow, selectionToText, 0}},
- {3466, {wxHtmlWindow, selectLine, 1}},
- {3467, {wxHtmlWindow, selectWord, 1}},
- {3468, {wxHtmlWindow, setBorders, 1}},
- {3469, {wxHtmlWindow, setFonts, 3}},
- {3470, {wxHtmlWindow, setPage, 1}},
- {3471, {wxHtmlWindow, setRelatedFrame, 2}},
- {3472, {wxHtmlWindow, setRelatedStatusBar, 1}},
- {3473, {wxHtmlWindow, toText, 0}},
- {3474, {wxHtmlWindow, 'Destroy', undefined}},
- {3475, {wxHtmlLinkEvent, getLinkInfo, 0}},
- {3476, {wxSystemSettings, getColour, 1}},
- {3477, {wxSystemSettings, getFont, 1}},
- {3478, {wxSystemSettings, getMetric, 2}},
- {3479, {wxSystemSettings, getScreenType, 0}},
- {3480, {wxAuiNotebookEvent, setSelection, 1}},
- {3481, {wxAuiNotebookEvent, getSelection, 0}},
- {3482, {wxAuiNotebookEvent, setOldSelection, 1}},
- {3483, {wxAuiNotebookEvent, getOldSelection, 0}},
- {3484, {wxAuiNotebookEvent, setDragSource, 1}},
- {3485, {wxAuiNotebookEvent, getDragSource, 0}},
- {3486, {wxAuiManagerEvent, setManager, 1}},
- {3487, {wxAuiManagerEvent, getManager, 0}},
- {3488, {wxAuiManagerEvent, setPane, 1}},
- {3489, {wxAuiManagerEvent, getPane, 0}},
- {3490, {wxAuiManagerEvent, setButton, 1}},
- {3491, {wxAuiManagerEvent, getButton, 0}},
- {3492, {wxAuiManagerEvent, setDC, 1}},
- {3493, {wxAuiManagerEvent, getDC, 0}},
- {3494, {wxAuiManagerEvent, veto, 1}},
- {3495, {wxAuiManagerEvent, getVeto, 0}},
- {3496, {wxAuiManagerEvent, setCanVeto, 1}},
- {3497, {wxAuiManagerEvent, canVeto, 0}},
- {3498, {wxLogNull, new, 0}},
- {3499, {wxLogNull, 'Destroy', undefined}},
+ {1757, {wxListItemAttr, new_0, 0}},
+ {1758, {wxListItemAttr, new_3, 3}},
+ {1759, {wxListItemAttr, getBackgroundColour, 0}},
+ {1760, {wxListItemAttr, getFont, 0}},
+ {1761, {wxListItemAttr, getTextColour, 0}},
+ {1762, {wxListItemAttr, hasBackgroundColour, 0}},
+ {1763, {wxListItemAttr, hasFont, 0}},
+ {1764, {wxListItemAttr, hasTextColour, 0}},
+ {1765, {wxListItemAttr, setBackgroundColour, 1}},
+ {1766, {wxListItemAttr, setFont, 1}},
+ {1767, {wxListItemAttr, setTextColour, 1}},
+ {1768, {wxListItemAttr, 'Destroy', undefined}},
+ {1769, {wxImageList, new_0, 0}},
+ {1770, {wxImageList, new_3, 3}},
+ {1771, {wxImageList, add_1, 1}},
+ {1772, {wxImageList, add_2_0, 2}},
+ {1773, {wxImageList, add_2_1, 2}},
+ {1774, {wxImageList, create, 3}},
+ {1776, {wxImageList, draw, 5}},
+ {1777, {wxImageList, getBitmap, 1}},
+ {1778, {wxImageList, getIcon, 1}},
+ {1779, {wxImageList, getImageCount, 0}},
+ {1780, {wxImageList, getSize, 3}},
+ {1781, {wxImageList, remove, 1}},
+ {1782, {wxImageList, removeAll, 0}},
+ {1783, {wxImageList, replace_2, 2}},
+ {1784, {wxImageList, replace_3, 3}},
+ {1785, {wxImageList, 'Destroy', undefined}},
+ {1786, {wxTextAttr, new_0, 0}},
+ {1787, {wxTextAttr, new_2, 2}},
+ {1788, {wxTextAttr, getAlignment, 0}},
+ {1789, {wxTextAttr, getBackgroundColour, 0}},
+ {1790, {wxTextAttr, getFont, 0}},
+ {1791, {wxTextAttr, getLeftIndent, 0}},
+ {1792, {wxTextAttr, getLeftSubIndent, 0}},
+ {1793, {wxTextAttr, getRightIndent, 0}},
+ {1794, {wxTextAttr, getTabs, 0}},
+ {1795, {wxTextAttr, getTextColour, 0}},
+ {1796, {wxTextAttr, hasBackgroundColour, 0}},
+ {1797, {wxTextAttr, hasFont, 0}},
+ {1798, {wxTextAttr, hasTextColour, 0}},
+ {1799, {wxTextAttr, getFlags, 0}},
+ {1800, {wxTextAttr, isDefault, 0}},
+ {1801, {wxTextAttr, setAlignment, 1}},
+ {1802, {wxTextAttr, setBackgroundColour, 1}},
+ {1803, {wxTextAttr, setFlags, 1}},
+ {1804, {wxTextAttr, setFont, 2}},
+ {1805, {wxTextAttr, setLeftIndent, 2}},
+ {1806, {wxTextAttr, setRightIndent, 1}},
+ {1807, {wxTextAttr, setTabs, 1}},
+ {1808, {wxTextAttr, setTextColour, 1}},
+ {1809, {wxTextAttr, 'Destroy', undefined}},
+ {1811, {wxTextCtrl, new_3, 3}},
+ {1812, {wxTextCtrl, new_0, 0}},
+ {1814, {wxTextCtrl, destruct, 0}},
+ {1815, {wxTextCtrl, appendText, 1}},
+ {1816, {wxTextCtrl, canCopy, 0}},
+ {1817, {wxTextCtrl, canCut, 0}},
+ {1818, {wxTextCtrl, canPaste, 0}},
+ {1819, {wxTextCtrl, canRedo, 0}},
+ {1820, {wxTextCtrl, canUndo, 0}},
+ {1821, {wxTextCtrl, clear, 0}},
+ {1822, {wxTextCtrl, copy, 0}},
+ {1823, {wxTextCtrl, create, 3}},
+ {1824, {wxTextCtrl, cut, 0}},
+ {1825, {wxTextCtrl, discardEdits, 0}},
+ {1826, {wxTextCtrl, emulateKeyPress, 1}},
+ {1827, {wxTextCtrl, getDefaultStyle, 0}},
+ {1828, {wxTextCtrl, getInsertionPoint, 0}},
+ {1829, {wxTextCtrl, getLastPosition, 0}},
+ {1830, {wxTextCtrl, getLineLength, 1}},
+ {1831, {wxTextCtrl, getLineText, 1}},
+ {1832, {wxTextCtrl, getNumberOfLines, 0}},
+ {1833, {wxTextCtrl, getRange, 2}},
+ {1834, {wxTextCtrl, getSelection, 2}},
+ {1835, {wxTextCtrl, getStringSelection, 0}},
+ {1836, {wxTextCtrl, getStyle, 2}},
+ {1837, {wxTextCtrl, getValue, 0}},
+ {1838, {wxTextCtrl, isEditable, 0}},
+ {1839, {wxTextCtrl, isModified, 0}},
+ {1840, {wxTextCtrl, isMultiLine, 0}},
+ {1841, {wxTextCtrl, isSingleLine, 0}},
+ {1842, {wxTextCtrl, loadFile, 2}},
+ {1843, {wxTextCtrl, markDirty, 0}},
+ {1844, {wxTextCtrl, paste, 0}},
+ {1845, {wxTextCtrl, positionToXY, 3}},
+ {1846, {wxTextCtrl, redo, 0}},
+ {1847, {wxTextCtrl, remove, 2}},
+ {1848, {wxTextCtrl, replace, 3}},
+ {1849, {wxTextCtrl, saveFile, 1}},
+ {1850, {wxTextCtrl, setDefaultStyle, 1}},
+ {1851, {wxTextCtrl, setEditable, 1}},
+ {1852, {wxTextCtrl, setInsertionPoint, 1}},
+ {1853, {wxTextCtrl, setInsertionPointEnd, 0}},
+ {1855, {wxTextCtrl, setMaxLength, 1}},
+ {1856, {wxTextCtrl, setSelection, 2}},
+ {1857, {wxTextCtrl, setStyle, 3}},
+ {1858, {wxTextCtrl, setValue, 1}},
+ {1859, {wxTextCtrl, showPosition, 1}},
+ {1860, {wxTextCtrl, undo, 0}},
+ {1861, {wxTextCtrl, writeText, 1}},
+ {1862, {wxTextCtrl, xYToPosition, 2}},
+ {1865, {wxNotebook, new_0, 0}},
+ {1866, {wxNotebook, new_3, 3}},
+ {1867, {wxNotebook, destruct, 0}},
+ {1868, {wxNotebook, addPage, 3}},
+ {1869, {wxNotebook, advanceSelection, 1}},
+ {1870, {wxNotebook, assignImageList, 1}},
+ {1871, {wxNotebook, create, 3}},
+ {1872, {wxNotebook, deleteAllPages, 0}},
+ {1873, {wxNotebook, deletePage, 1}},
+ {1874, {wxNotebook, removePage, 1}},
+ {1875, {wxNotebook, getCurrentPage, 0}},
+ {1876, {wxNotebook, getImageList, 0}},
+ {1878, {wxNotebook, getPage, 1}},
+ {1879, {wxNotebook, getPageCount, 0}},
+ {1880, {wxNotebook, getPageImage, 1}},
+ {1881, {wxNotebook, getPageText, 1}},
+ {1882, {wxNotebook, getRowCount, 0}},
+ {1883, {wxNotebook, getSelection, 0}},
+ {1884, {wxNotebook, getThemeBackgroundColour, 0}},
+ {1886, {wxNotebook, hitTest, 2}},
+ {1888, {wxNotebook, insertPage, 4}},
+ {1889, {wxNotebook, setImageList, 1}},
+ {1890, {wxNotebook, setPadding, 1}},
+ {1891, {wxNotebook, setPageSize, 1}},
+ {1892, {wxNotebook, setPageImage, 2}},
+ {1893, {wxNotebook, setPageText, 2}},
+ {1894, {wxNotebook, setSelection, 1}},
+ {1895, {wxNotebook, changeSelection, 1}},
+ {1896, {wxChoicebook, new_0, 0}},
+ {1897, {wxChoicebook, new_3, 3}},
+ {1898, {wxChoicebook, addPage, 3}},
+ {1899, {wxChoicebook, advanceSelection, 1}},
+ {1900, {wxChoicebook, assignImageList, 1}},
+ {1901, {wxChoicebook, create, 3}},
+ {1902, {wxChoicebook, deleteAllPages, 0}},
+ {1903, {wxChoicebook, deletePage, 1}},
+ {1904, {wxChoicebook, removePage, 1}},
+ {1905, {wxChoicebook, getCurrentPage, 0}},
+ {1906, {wxChoicebook, getImageList, 0}},
+ {1908, {wxChoicebook, getPage, 1}},
+ {1909, {wxChoicebook, getPageCount, 0}},
+ {1910, {wxChoicebook, getPageImage, 1}},
+ {1911, {wxChoicebook, getPageText, 1}},
+ {1912, {wxChoicebook, getSelection, 0}},
+ {1913, {wxChoicebook, hitTest, 2}},
+ {1914, {wxChoicebook, insertPage, 4}},
+ {1915, {wxChoicebook, setImageList, 1}},
+ {1916, {wxChoicebook, setPageSize, 1}},
+ {1917, {wxChoicebook, setPageImage, 2}},
+ {1918, {wxChoicebook, setPageText, 2}},
+ {1919, {wxChoicebook, setSelection, 1}},
+ {1920, {wxChoicebook, changeSelection, 1}},
+ {1921, {wxChoicebook, 'Destroy', undefined}},
+ {1922, {wxToolbook, new_0, 0}},
+ {1923, {wxToolbook, new_3, 3}},
+ {1924, {wxToolbook, addPage, 3}},
+ {1925, {wxToolbook, advanceSelection, 1}},
+ {1926, {wxToolbook, assignImageList, 1}},
+ {1927, {wxToolbook, create, 3}},
+ {1928, {wxToolbook, deleteAllPages, 0}},
+ {1929, {wxToolbook, deletePage, 1}},
+ {1930, {wxToolbook, removePage, 1}},
+ {1931, {wxToolbook, getCurrentPage, 0}},
+ {1932, {wxToolbook, getImageList, 0}},
+ {1934, {wxToolbook, getPage, 1}},
+ {1935, {wxToolbook, getPageCount, 0}},
+ {1936, {wxToolbook, getPageImage, 1}},
+ {1937, {wxToolbook, getPageText, 1}},
+ {1938, {wxToolbook, getSelection, 0}},
+ {1940, {wxToolbook, hitTest, 2}},
+ {1941, {wxToolbook, insertPage, 4}},
+ {1942, {wxToolbook, setImageList, 1}},
+ {1943, {wxToolbook, setPageSize, 1}},
+ {1944, {wxToolbook, setPageImage, 2}},
+ {1945, {wxToolbook, setPageText, 2}},
+ {1946, {wxToolbook, setSelection, 1}},
+ {1947, {wxToolbook, changeSelection, 1}},
+ {1948, {wxToolbook, 'Destroy', undefined}},
+ {1949, {wxListbook, new_0, 0}},
+ {1950, {wxListbook, new_3, 3}},
+ {1951, {wxListbook, addPage, 3}},
+ {1952, {wxListbook, advanceSelection, 1}},
+ {1953, {wxListbook, assignImageList, 1}},
+ {1954, {wxListbook, create, 3}},
+ {1955, {wxListbook, deleteAllPages, 0}},
+ {1956, {wxListbook, deletePage, 1}},
+ {1957, {wxListbook, removePage, 1}},
+ {1958, {wxListbook, getCurrentPage, 0}},
+ {1959, {wxListbook, getImageList, 0}},
+ {1961, {wxListbook, getPage, 1}},
+ {1962, {wxListbook, getPageCount, 0}},
+ {1963, {wxListbook, getPageImage, 1}},
+ {1964, {wxListbook, getPageText, 1}},
+ {1965, {wxListbook, getSelection, 0}},
+ {1967, {wxListbook, hitTest, 2}},
+ {1968, {wxListbook, insertPage, 4}},
+ {1969, {wxListbook, setImageList, 1}},
+ {1970, {wxListbook, setPageSize, 1}},
+ {1971, {wxListbook, setPageImage, 2}},
+ {1972, {wxListbook, setPageText, 2}},
+ {1973, {wxListbook, setSelection, 1}},
+ {1974, {wxListbook, changeSelection, 1}},
+ {1975, {wxListbook, 'Destroy', undefined}},
+ {1976, {wxTreebook, new_0, 0}},
+ {1977, {wxTreebook, new_3, 3}},
+ {1978, {wxTreebook, addPage, 3}},
+ {1979, {wxTreebook, advanceSelection, 1}},
+ {1980, {wxTreebook, assignImageList, 1}},
+ {1981, {wxTreebook, create, 3}},
+ {1982, {wxTreebook, deleteAllPages, 0}},
+ {1983, {wxTreebook, deletePage, 1}},
+ {1984, {wxTreebook, removePage, 1}},
+ {1985, {wxTreebook, getCurrentPage, 0}},
+ {1986, {wxTreebook, getImageList, 0}},
+ {1988, {wxTreebook, getPage, 1}},
+ {1989, {wxTreebook, getPageCount, 0}},
+ {1990, {wxTreebook, getPageImage, 1}},
+ {1991, {wxTreebook, getPageText, 1}},
+ {1992, {wxTreebook, getSelection, 0}},
+ {1993, {wxTreebook, expandNode, 2}},
+ {1994, {wxTreebook, isNodeExpanded, 1}},
+ {1996, {wxTreebook, hitTest, 2}},
+ {1997, {wxTreebook, insertPage, 4}},
+ {1998, {wxTreebook, insertSubPage, 4}},
+ {1999, {wxTreebook, setImageList, 1}},
+ {2000, {wxTreebook, setPageSize, 1}},
+ {2001, {wxTreebook, setPageImage, 2}},
+ {2002, {wxTreebook, setPageText, 2}},
+ {2003, {wxTreebook, setSelection, 1}},
+ {2004, {wxTreebook, changeSelection, 1}},
+ {2005, {wxTreebook, 'Destroy', undefined}},
+ {2008, {wxTreeCtrl, new_2, 2}},
+ {2009, {wxTreeCtrl, new_0, 0}},
+ {2011, {wxTreeCtrl, destruct, 0}},
+ {2012, {wxTreeCtrl, addRoot, 2}},
+ {2013, {wxTreeCtrl, appendItem, 3}},
+ {2014, {wxTreeCtrl, assignImageList, 1}},
+ {2015, {wxTreeCtrl, assignStateImageList, 1}},
+ {2016, {wxTreeCtrl, collapse, 1}},
+ {2017, {wxTreeCtrl, collapseAndReset, 1}},
+ {2018, {wxTreeCtrl, create, 2}},
+ {2019, {wxTreeCtrl, delete, 1}},
+ {2020, {wxTreeCtrl, deleteAllItems, 0}},
+ {2021, {wxTreeCtrl, deleteChildren, 1}},
+ {2022, {wxTreeCtrl, editLabel, 1}},
+ {2023, {wxTreeCtrl, ensureVisible, 1}},
+ {2024, {wxTreeCtrl, expand, 1}},
+ {2025, {wxTreeCtrl, getBoundingRect, 3}},
+ {2027, {wxTreeCtrl, getChildrenCount, 2}},
+ {2028, {wxTreeCtrl, getCount, 0}},
+ {2029, {wxTreeCtrl, getEditControl, 0}},
+ {2030, {wxTreeCtrl, getFirstChild, 2}},
+ {2031, {wxTreeCtrl, getNextChild, 2}},
+ {2032, {wxTreeCtrl, getFirstVisibleItem, 0}},
+ {2033, {wxTreeCtrl, getImageList, 0}},
+ {2034, {wxTreeCtrl, getIndent, 0}},
+ {2035, {wxTreeCtrl, getItemBackgroundColour, 1}},
+ {2036, {wxTreeCtrl, getItemData, 1}},
+ {2037, {wxTreeCtrl, getItemFont, 1}},
+ {2038, {wxTreeCtrl, getItemImage_1, 1}},
+ {2039, {wxTreeCtrl, getItemImage_2, 2}},
+ {2040, {wxTreeCtrl, getItemText, 1}},
+ {2041, {wxTreeCtrl, getItemTextColour, 1}},
+ {2042, {wxTreeCtrl, getLastChild, 1}},
+ {2043, {wxTreeCtrl, getNextSibling, 1}},
+ {2044, {wxTreeCtrl, getNextVisible, 1}},
+ {2045, {wxTreeCtrl, getItemParent, 1}},
+ {2046, {wxTreeCtrl, getPrevSibling, 1}},
+ {2047, {wxTreeCtrl, getPrevVisible, 1}},
+ {2048, {wxTreeCtrl, getRootItem, 0}},
+ {2049, {wxTreeCtrl, getSelection, 0}},
+ {2050, {wxTreeCtrl, getSelections, 1}},
+ {2051, {wxTreeCtrl, getStateImageList, 0}},
+ {2052, {wxTreeCtrl, hitTest, 1}},
+ {2054, {wxTreeCtrl, insertItem, 4}},
+ {2055, {wxTreeCtrl, isBold, 1}},
+ {2056, {wxTreeCtrl, isExpanded, 1}},
+ {2057, {wxTreeCtrl, isSelected, 1}},
+ {2058, {wxTreeCtrl, isVisible, 1}},
+ {2059, {wxTreeCtrl, itemHasChildren, 1}},
+ {2060, {wxTreeCtrl, prependItem, 3}},
+ {2061, {wxTreeCtrl, scrollTo, 1}},
+ {2062, {wxTreeCtrl, selectItem_1, 1}},
+ {2063, {wxTreeCtrl, selectItem_2, 2}},
+ {2064, {wxTreeCtrl, setIndent, 1}},
+ {2065, {wxTreeCtrl, setImageList, 1}},
+ {2066, {wxTreeCtrl, setItemBackgroundColour, 2}},
+ {2067, {wxTreeCtrl, setItemBold, 2}},
+ {2068, {wxTreeCtrl, setItemData, 2}},
+ {2069, {wxTreeCtrl, setItemDropHighlight, 2}},
+ {2070, {wxTreeCtrl, setItemFont, 2}},
+ {2071, {wxTreeCtrl, setItemHasChildren, 2}},
+ {2072, {wxTreeCtrl, setItemImage_2, 2}},
+ {2073, {wxTreeCtrl, setItemImage_3, 3}},
+ {2074, {wxTreeCtrl, setItemText, 2}},
+ {2075, {wxTreeCtrl, setItemTextColour, 2}},
+ {2076, {wxTreeCtrl, setStateImageList, 1}},
+ {2077, {wxTreeCtrl, setWindowStyle, 1}},
+ {2078, {wxTreeCtrl, sortChildren, 1}},
+ {2079, {wxTreeCtrl, toggle, 1}},
+ {2080, {wxTreeCtrl, toggleItemSelection, 1}},
+ {2081, {wxTreeCtrl, unselect, 0}},
+ {2082, {wxTreeCtrl, unselectAll, 0}},
+ {2083, {wxTreeCtrl, unselectItem, 1}},
+ {2084, {wxScrollBar, new_0, 0}},
+ {2085, {wxScrollBar, new_3, 3}},
+ {2086, {wxScrollBar, destruct, 0}},
+ {2087, {wxScrollBar, create, 3}},
+ {2088, {wxScrollBar, getRange, 0}},
+ {2089, {wxScrollBar, getPageSize, 0}},
+ {2090, {wxScrollBar, getThumbPosition, 0}},
+ {2091, {wxScrollBar, getThumbSize, 0}},
+ {2092, {wxScrollBar, setThumbPosition, 1}},
+ {2093, {wxScrollBar, setScrollbar, 5}},
+ {2095, {wxSpinButton, new_2, 2}},
+ {2096, {wxSpinButton, new_0, 0}},
+ {2097, {wxSpinButton, create, 2}},
+ {2098, {wxSpinButton, getMax, 0}},
+ {2099, {wxSpinButton, getMin, 0}},
+ {2100, {wxSpinButton, getValue, 0}},
+ {2101, {wxSpinButton, setRange, 2}},
+ {2102, {wxSpinButton, setValue, 1}},
+ {2103, {wxSpinButton, 'Destroy', undefined}},
+ {2104, {wxSpinCtrl, new_0, 0}},
+ {2105, {wxSpinCtrl, new_2, 2}},
+ {2107, {wxSpinCtrl, create, 2}},
+ {2110, {wxSpinCtrl, setValue_1_1, 1}},
+ {2111, {wxSpinCtrl, setValue_1_0, 1}},
+ {2113, {wxSpinCtrl, getValue, 0}},
+ {2115, {wxSpinCtrl, setRange, 2}},
+ {2116, {wxSpinCtrl, setSelection, 2}},
+ {2118, {wxSpinCtrl, getMin, 0}},
+ {2120, {wxSpinCtrl, getMax, 0}},
+ {2121, {wxSpinCtrl, 'Destroy', undefined}},
+ {2122, {wxStaticText, new_0, 0}},
+ {2123, {wxStaticText, new_4, 4}},
+ {2124, {wxStaticText, create, 4}},
+ {2125, {wxStaticText, getLabel, 0}},
+ {2126, {wxStaticText, setLabel, 1}},
+ {2127, {wxStaticText, wrap, 1}},
+ {2128, {wxStaticText, 'Destroy', undefined}},
+ {2129, {wxStaticBitmap, new_0, 0}},
+ {2130, {wxStaticBitmap, new_4, 4}},
+ {2131, {wxStaticBitmap, create, 4}},
+ {2132, {wxStaticBitmap, getBitmap, 0}},
+ {2133, {wxStaticBitmap, setBitmap, 1}},
+ {2134, {wxStaticBitmap, 'Destroy', undefined}},
+ {2135, {wxRadioBox, new, 7}},
+ {2137, {wxRadioBox, destruct, 0}},
+ {2138, {wxRadioBox, create, 7}},
+ {2139, {wxRadioBox, enable_2, 2}},
+ {2140, {wxRadioBox, enable_1, 1}},
+ {2141, {wxRadioBox, getSelection, 0}},
+ {2142, {wxRadioBox, getString, 1}},
+ {2143, {wxRadioBox, setSelection, 1}},
+ {2144, {wxRadioBox, show_2, 2}},
+ {2145, {wxRadioBox, show_1, 1}},
+ {2146, {wxRadioBox, getColumnCount, 0}},
+ {2147, {wxRadioBox, getItemHelpText, 1}},
+ {2148, {wxRadioBox, getItemToolTip, 1}},
+ {2150, {wxRadioBox, getItemFromPoint, 1}},
+ {2151, {wxRadioBox, getRowCount, 0}},
+ {2152, {wxRadioBox, isItemEnabled, 1}},
+ {2153, {wxRadioBox, isItemShown, 1}},
+ {2154, {wxRadioBox, setItemHelpText, 2}},
+ {2155, {wxRadioBox, setItemToolTip, 2}},
+ {2156, {wxRadioButton, new_0, 0}},
+ {2157, {wxRadioButton, new_4, 4}},
+ {2158, {wxRadioButton, create, 4}},
+ {2159, {wxRadioButton, getValue, 0}},
+ {2160, {wxRadioButton, setValue, 1}},
+ {2161, {wxRadioButton, 'Destroy', undefined}},
+ {2163, {wxSlider, new_6, 6}},
+ {2164, {wxSlider, new_0, 0}},
+ {2165, {wxSlider, create, 6}},
+ {2166, {wxSlider, getLineSize, 0}},
+ {2167, {wxSlider, getMax, 0}},
+ {2168, {wxSlider, getMin, 0}},
+ {2169, {wxSlider, getPageSize, 0}},
+ {2170, {wxSlider, getThumbLength, 0}},
+ {2171, {wxSlider, getValue, 0}},
+ {2172, {wxSlider, setLineSize, 1}},
+ {2173, {wxSlider, setPageSize, 1}},
+ {2174, {wxSlider, setRange, 2}},
+ {2175, {wxSlider, setThumbLength, 1}},
+ {2176, {wxSlider, setValue, 1}},
+ {2177, {wxSlider, 'Destroy', undefined}},
+ {2179, {wxDialog, new_4, 4}},
+ {2180, {wxDialog, new_0, 0}},
+ {2182, {wxDialog, destruct, 0}},
+ {2183, {wxDialog, create, 4}},
+ {2184, {wxDialog, createButtonSizer, 1}},
+ {2185, {wxDialog, createStdDialogButtonSizer, 1}},
+ {2186, {wxDialog, endModal, 1}},
+ {2187, {wxDialog, getAffirmativeId, 0}},
+ {2188, {wxDialog, getReturnCode, 0}},
+ {2189, {wxDialog, isModal, 0}},
+ {2190, {wxDialog, setAffirmativeId, 1}},
+ {2191, {wxDialog, setReturnCode, 1}},
+ {2192, {wxDialog, show, 1}},
+ {2193, {wxDialog, showModal, 0}},
+ {2194, {wxColourDialog, new_0, 0}},
+ {2195, {wxColourDialog, new_2, 2}},
+ {2196, {wxColourDialog, destruct, 0}},
+ {2197, {wxColourDialog, create, 2}},
+ {2198, {wxColourDialog, getColourData, 0}},
+ {2199, {wxColourData, new_0, 0}},
+ {2200, {wxColourData, new_1, 1}},
+ {2201, {wxColourData, destruct, 0}},
+ {2202, {wxColourData, getChooseFull, 0}},
+ {2203, {wxColourData, getColour, 0}},
+ {2205, {wxColourData, getCustomColour, 1}},
+ {2206, {wxColourData, setChooseFull, 1}},
+ {2207, {wxColourData, setColour, 1}},
+ {2208, {wxColourData, setCustomColour, 2}},
+ {2209, {wxPalette, new_0, 0}},
+ {2210, {wxPalette, new_4, 4}},
+ {2212, {wxPalette, destruct, 0}},
+ {2213, {wxPalette, create, 4}},
+ {2214, {wxPalette, getColoursCount, 0}},
+ {2215, {wxPalette, getPixel, 3}},
+ {2216, {wxPalette, getRGB, 4}},
+ {2217, {wxPalette, isOk, 0}},
+ {2221, {wxDirDialog, new, 2}},
+ {2222, {wxDirDialog, destruct, 0}},
+ {2223, {wxDirDialog, getPath, 0}},
+ {2224, {wxDirDialog, getMessage, 0}},
+ {2225, {wxDirDialog, setMessage, 1}},
+ {2226, {wxDirDialog, setPath, 1}},
+ {2230, {wxFileDialog, new, 2}},
+ {2231, {wxFileDialog, destruct, 0}},
+ {2232, {wxFileDialog, getDirectory, 0}},
+ {2233, {wxFileDialog, getFilename, 0}},
+ {2234, {wxFileDialog, getFilenames, 1}},
+ {2235, {wxFileDialog, getFilterIndex, 0}},
+ {2236, {wxFileDialog, getMessage, 0}},
+ {2237, {wxFileDialog, getPath, 0}},
+ {2238, {wxFileDialog, getPaths, 1}},
+ {2239, {wxFileDialog, getWildcard, 0}},
+ {2240, {wxFileDialog, setDirectory, 1}},
+ {2241, {wxFileDialog, setFilename, 1}},
+ {2242, {wxFileDialog, setFilterIndex, 1}},
+ {2243, {wxFileDialog, setMessage, 1}},
+ {2244, {wxFileDialog, setPath, 1}},
+ {2245, {wxFileDialog, setWildcard, 1}},
+ {2246, {wxPickerBase, setInternalMargin, 1}},
+ {2247, {wxPickerBase, getInternalMargin, 0}},
+ {2248, {wxPickerBase, setTextCtrlProportion, 1}},
+ {2249, {wxPickerBase, setPickerCtrlProportion, 1}},
+ {2250, {wxPickerBase, getTextCtrlProportion, 0}},
+ {2251, {wxPickerBase, getPickerCtrlProportion, 0}},
+ {2252, {wxPickerBase, hasTextCtrl, 0}},
+ {2253, {wxPickerBase, getTextCtrl, 0}},
+ {2254, {wxPickerBase, isTextCtrlGrowable, 0}},
+ {2255, {wxPickerBase, setPickerCtrlGrowable, 1}},
+ {2256, {wxPickerBase, setTextCtrlGrowable, 1}},
+ {2257, {wxPickerBase, isPickerCtrlGrowable, 0}},
+ {2258, {wxFilePickerCtrl, new_0, 0}},
+ {2259, {wxFilePickerCtrl, new_3, 3}},
+ {2260, {wxFilePickerCtrl, create, 3}},
+ {2261, {wxFilePickerCtrl, getPath, 0}},
+ {2262, {wxFilePickerCtrl, setPath, 1}},
+ {2263, {wxFilePickerCtrl, 'Destroy', undefined}},
+ {2264, {wxDirPickerCtrl, new_0, 0}},
+ {2265, {wxDirPickerCtrl, new_3, 3}},
+ {2266, {wxDirPickerCtrl, create, 3}},
+ {2267, {wxDirPickerCtrl, getPath, 0}},
+ {2268, {wxDirPickerCtrl, setPath, 1}},
+ {2269, {wxDirPickerCtrl, 'Destroy', undefined}},
+ {2270, {wxColourPickerCtrl, new_0, 0}},
+ {2271, {wxColourPickerCtrl, new_3, 3}},
+ {2272, {wxColourPickerCtrl, create, 3}},
+ {2273, {wxColourPickerCtrl, getColour, 0}},
+ {2274, {wxColourPickerCtrl, setColour_1_1, 1}},
+ {2275, {wxColourPickerCtrl, setColour_1_0, 1}},
+ {2276, {wxColourPickerCtrl, 'Destroy', undefined}},
+ {2277, {wxDatePickerCtrl, new_0, 0}},
+ {2278, {wxDatePickerCtrl, new_3, 3}},
+ {2279, {wxDatePickerCtrl, getRange, 2}},
+ {2280, {wxDatePickerCtrl, getValue, 0}},
+ {2281, {wxDatePickerCtrl, setRange, 2}},
+ {2282, {wxDatePickerCtrl, setValue, 1}},
+ {2283, {wxDatePickerCtrl, 'Destroy', undefined}},
+ {2284, {wxFontPickerCtrl, new_0, 0}},
+ {2285, {wxFontPickerCtrl, new_3, 3}},
+ {2286, {wxFontPickerCtrl, create, 3}},
+ {2287, {wxFontPickerCtrl, getSelectedFont, 0}},
+ {2288, {wxFontPickerCtrl, setSelectedFont, 1}},
+ {2289, {wxFontPickerCtrl, getMaxPointSize, 0}},
+ {2290, {wxFontPickerCtrl, setMaxPointSize, 1}},
+ {2291, {wxFontPickerCtrl, 'Destroy', undefined}},
+ {2294, {wxFindReplaceDialog, new_0, 0}},
+ {2295, {wxFindReplaceDialog, new_4, 4}},
+ {2296, {wxFindReplaceDialog, destruct, 0}},
+ {2297, {wxFindReplaceDialog, create, 4}},
+ {2298, {wxFindReplaceDialog, getData, 0}},
+ {2299, {wxFindReplaceData, new_0, 0}},
+ {2300, {wxFindReplaceData, new_1, 1}},
+ {2301, {wxFindReplaceData, getFindString, 0}},
+ {2302, {wxFindReplaceData, getReplaceString, 0}},
+ {2303, {wxFindReplaceData, getFlags, 0}},
+ {2304, {wxFindReplaceData, setFlags, 1}},
+ {2305, {wxFindReplaceData, setFindString, 1}},
+ {2306, {wxFindReplaceData, setReplaceString, 1}},
+ {2307, {wxFindReplaceData, 'Destroy', undefined}},
+ {2308, {wxMultiChoiceDialog, new_0, 0}},
+ {2310, {wxMultiChoiceDialog, new_5, 5}},
+ {2311, {wxMultiChoiceDialog, getSelections, 0}},
+ {2312, {wxMultiChoiceDialog, setSelections, 1}},
+ {2313, {wxMultiChoiceDialog, 'Destroy', undefined}},
+ {2314, {wxSingleChoiceDialog, new_0, 0}},
+ {2316, {wxSingleChoiceDialog, new_5, 5}},
+ {2317, {wxSingleChoiceDialog, getSelection, 0}},
+ {2318, {wxSingleChoiceDialog, getStringSelection, 0}},
+ {2319, {wxSingleChoiceDialog, setSelection, 1}},
+ {2320, {wxSingleChoiceDialog, 'Destroy', undefined}},
+ {2321, {wxTextEntryDialog, new, 3}},
+ {2322, {wxTextEntryDialog, getValue, 0}},
+ {2323, {wxTextEntryDialog, setValue, 1}},
+ {2324, {wxTextEntryDialog, 'Destroy', undefined}},
+ {2325, {wxPasswordEntryDialog, new, 3}},
+ {2326, {wxPasswordEntryDialog, 'Destroy', undefined}},
+ {2327, {wxFontData, new_0, 0}},
+ {2328, {wxFontData, new_1, 1}},
+ {2329, {wxFontData, destruct, 0}},
+ {2330, {wxFontData, enableEffects, 1}},
+ {2331, {wxFontData, getAllowSymbols, 0}},
+ {2332, {wxFontData, getColour, 0}},
+ {2333, {wxFontData, getChosenFont, 0}},
+ {2334, {wxFontData, getEnableEffects, 0}},
+ {2335, {wxFontData, getInitialFont, 0}},
+ {2336, {wxFontData, getShowHelp, 0}},
+ {2337, {wxFontData, setAllowSymbols, 1}},
+ {2338, {wxFontData, setChosenFont, 1}},
+ {2339, {wxFontData, setColour, 1}},
+ {2340, {wxFontData, setInitialFont, 1}},
+ {2341, {wxFontData, setRange, 2}},
+ {2342, {wxFontData, setShowHelp, 1}},
+ {2346, {wxFontDialog, new_0, 0}},
+ {2348, {wxFontDialog, new_2, 2}},
+ {2350, {wxFontDialog, create, 2}},
+ {2351, {wxFontDialog, getFontData, 0}},
+ {2353, {wxFontDialog, 'Destroy', undefined}},
+ {2354, {wxProgressDialog, new, 3}},
+ {2355, {wxProgressDialog, destruct, 0}},
+ {2356, {wxProgressDialog, resume, 0}},
+ {2357, {wxProgressDialog, update_2, 2}},
+ {2358, {wxProgressDialog, update_0, 0}},
+ {2359, {wxMessageDialog, new, 3}},
+ {2360, {wxMessageDialog, destruct, 0}},
+ {2361, {wxPageSetupDialog, new, 2}},
+ {2362, {wxPageSetupDialog, destruct, 0}},
+ {2363, {wxPageSetupDialog, getPageSetupData, 0}},
+ {2364, {wxPageSetupDialog, showModal, 0}},
+ {2365, {wxPageSetupDialogData, new_0, 0}},
+ {2366, {wxPageSetupDialogData, new_1_0, 1}},
+ {2367, {wxPageSetupDialogData, new_1_1, 1}},
+ {2368, {wxPageSetupDialogData, destruct, 0}},
+ {2369, {wxPageSetupDialogData, enableHelp, 1}},
+ {2370, {wxPageSetupDialogData, enableMargins, 1}},
+ {2371, {wxPageSetupDialogData, enableOrientation, 1}},
+ {2372, {wxPageSetupDialogData, enablePaper, 1}},
+ {2373, {wxPageSetupDialogData, enablePrinter, 1}},
+ {2374, {wxPageSetupDialogData, getDefaultMinMargins, 0}},
+ {2375, {wxPageSetupDialogData, getEnableMargins, 0}},
+ {2376, {wxPageSetupDialogData, getEnableOrientation, 0}},
+ {2377, {wxPageSetupDialogData, getEnablePaper, 0}},
+ {2378, {wxPageSetupDialogData, getEnablePrinter, 0}},
+ {2379, {wxPageSetupDialogData, getEnableHelp, 0}},
+ {2380, {wxPageSetupDialogData, getDefaultInfo, 0}},
+ {2381, {wxPageSetupDialogData, getMarginTopLeft, 0}},
+ {2382, {wxPageSetupDialogData, getMarginBottomRight, 0}},
+ {2383, {wxPageSetupDialogData, getMinMarginTopLeft, 0}},
+ {2384, {wxPageSetupDialogData, getMinMarginBottomRight, 0}},
+ {2385, {wxPageSetupDialogData, getPaperId, 0}},
+ {2386, {wxPageSetupDialogData, getPaperSize, 0}},
+ {2388, {wxPageSetupDialogData, getPrintData, 0}},
+ {2389, {wxPageSetupDialogData, isOk, 0}},
+ {2390, {wxPageSetupDialogData, setDefaultInfo, 1}},
+ {2391, {wxPageSetupDialogData, setDefaultMinMargins, 1}},
+ {2392, {wxPageSetupDialogData, setMarginTopLeft, 1}},
+ {2393, {wxPageSetupDialogData, setMarginBottomRight, 1}},
+ {2394, {wxPageSetupDialogData, setMinMarginTopLeft, 1}},
+ {2395, {wxPageSetupDialogData, setMinMarginBottomRight, 1}},
+ {2396, {wxPageSetupDialogData, setPaperId, 1}},
+ {2397, {wxPageSetupDialogData, setPaperSize_1_1, 1}},
+ {2398, {wxPageSetupDialogData, setPaperSize_1_0, 1}},
+ {2399, {wxPageSetupDialogData, setPrintData, 1}},
+ {2400, {wxPrintDialog, new_2_0, 2}},
+ {2401, {wxPrintDialog, new_2_1, 2}},
+ {2402, {wxPrintDialog, destruct, 0}},
+ {2403, {wxPrintDialog, getPrintDialogData, 0}},
+ {2404, {wxPrintDialog, getPrintDC, 0}},
+ {2405, {wxPrintDialogData, new_0, 0}},
+ {2406, {wxPrintDialogData, new_1_1, 1}},
+ {2407, {wxPrintDialogData, new_1_0, 1}},
+ {2408, {wxPrintDialogData, destruct, 0}},
+ {2409, {wxPrintDialogData, enableHelp, 1}},
+ {2410, {wxPrintDialogData, enablePageNumbers, 1}},
+ {2411, {wxPrintDialogData, enablePrintToFile, 1}},
+ {2412, {wxPrintDialogData, enableSelection, 1}},
+ {2413, {wxPrintDialogData, getAllPages, 0}},
+ {2414, {wxPrintDialogData, getCollate, 0}},
+ {2415, {wxPrintDialogData, getFromPage, 0}},
+ {2416, {wxPrintDialogData, getMaxPage, 0}},
+ {2417, {wxPrintDialogData, getMinPage, 0}},
+ {2418, {wxPrintDialogData, getNoCopies, 0}},
+ {2419, {wxPrintDialogData, getPrintData, 0}},
+ {2420, {wxPrintDialogData, getPrintToFile, 0}},
+ {2421, {wxPrintDialogData, getSelection, 0}},
+ {2422, {wxPrintDialogData, getToPage, 0}},
+ {2423, {wxPrintDialogData, isOk, 0}},
+ {2424, {wxPrintDialogData, setCollate, 1}},
+ {2425, {wxPrintDialogData, setFromPage, 1}},
+ {2426, {wxPrintDialogData, setMaxPage, 1}},
+ {2427, {wxPrintDialogData, setMinPage, 1}},
+ {2428, {wxPrintDialogData, setNoCopies, 1}},
+ {2429, {wxPrintDialogData, setPrintData, 1}},
+ {2430, {wxPrintDialogData, setPrintToFile, 1}},
+ {2431, {wxPrintDialogData, setSelection, 1}},
+ {2432, {wxPrintDialogData, setToPage, 1}},
+ {2433, {wxPrintData, new_0, 0}},
+ {2434, {wxPrintData, new_1, 1}},
+ {2435, {wxPrintData, destruct, 0}},
+ {2436, {wxPrintData, getCollate, 0}},
+ {2437, {wxPrintData, getBin, 0}},
+ {2438, {wxPrintData, getColour, 0}},
+ {2439, {wxPrintData, getDuplex, 0}},
+ {2440, {wxPrintData, getNoCopies, 0}},
+ {2441, {wxPrintData, getOrientation, 0}},
+ {2442, {wxPrintData, getPaperId, 0}},
+ {2443, {wxPrintData, getPrinterName, 0}},
+ {2444, {wxPrintData, getQuality, 0}},
+ {2445, {wxPrintData, isOk, 0}},
+ {2446, {wxPrintData, setBin, 1}},
+ {2447, {wxPrintData, setCollate, 1}},
+ {2448, {wxPrintData, setColour, 1}},
+ {2449, {wxPrintData, setDuplex, 1}},
+ {2450, {wxPrintData, setNoCopies, 1}},
+ {2451, {wxPrintData, setOrientation, 1}},
+ {2452, {wxPrintData, setPaperId, 1}},
+ {2453, {wxPrintData, setPrinterName, 1}},
+ {2454, {wxPrintData, setQuality, 1}},
+ {2457, {wxPrintPreview, new_2, 2}},
+ {2458, {wxPrintPreview, new_3, 3}},
+ {2460, {wxPrintPreview, destruct, 0}},
+ {2461, {wxPrintPreview, getCanvas, 0}},
+ {2462, {wxPrintPreview, getCurrentPage, 0}},
+ {2463, {wxPrintPreview, getFrame, 0}},
+ {2464, {wxPrintPreview, getMaxPage, 0}},
+ {2465, {wxPrintPreview, getMinPage, 0}},
+ {2466, {wxPrintPreview, getPrintout, 0}},
+ {2467, {wxPrintPreview, getPrintoutForPrinting, 0}},
+ {2468, {wxPrintPreview, isOk, 0}},
+ {2469, {wxPrintPreview, paintPage, 2}},
+ {2470, {wxPrintPreview, print, 1}},
+ {2471, {wxPrintPreview, renderPage, 1}},
+ {2472, {wxPrintPreview, setCanvas, 1}},
+ {2473, {wxPrintPreview, setCurrentPage, 1}},
+ {2474, {wxPrintPreview, setFrame, 1}},
+ {2475, {wxPrintPreview, setPrintout, 1}},
+ {2476, {wxPrintPreview, setZoom, 1}},
+ {2477, {wxPreviewFrame, new, 3}},
+ {2478, {wxPreviewFrame, destruct, 0}},
+ {2479, {wxPreviewFrame, createControlBar, 0}},
+ {2480, {wxPreviewFrame, createCanvas, 0}},
+ {2481, {wxPreviewFrame, initialize, 0}},
+ {2482, {wxPreviewFrame, onCloseWindow, 1}},
+ {2483, {wxPreviewControlBar, new, 4}},
+ {2484, {wxPreviewControlBar, destruct, 0}},
+ {2485, {wxPreviewControlBar, createButtons, 0}},
+ {2486, {wxPreviewControlBar, getPrintPreview, 0}},
+ {2487, {wxPreviewControlBar, getZoomControl, 0}},
+ {2488, {wxPreviewControlBar, setZoomControl, 1}},
+ {2490, {wxPrinter, new, 1}},
+ {2491, {wxPrinter, createAbortWindow, 2}},
+ {2492, {wxPrinter, getAbort, 0}},
+ {2493, {wxPrinter, getLastError, 0}},
+ {2494, {wxPrinter, getPrintDialogData, 0}},
+ {2495, {wxPrinter, print, 3}},
+ {2496, {wxPrinter, printDialog, 1}},
+ {2497, {wxPrinter, reportError, 3}},
+ {2498, {wxPrinter, setup, 1}},
+ {2499, {wxPrinter, 'Destroy', undefined}},
+ {2500, {wxXmlResource, new_1, 1}},
+ {2501, {wxXmlResource, new_2, 2}},
+ {2502, {wxXmlResource, destruct, 0}},
+ {2503, {wxXmlResource, attachUnknownControl, 3}},
+ {2504, {wxXmlResource, clearHandlers, 0}},
+ {2505, {wxXmlResource, compareVersion, 4}},
+ {2506, {wxXmlResource, get, 0}},
+ {2507, {wxXmlResource, getFlags, 0}},
+ {2508, {wxXmlResource, getVersion, 0}},
+ {2509, {wxXmlResource, getXRCID, 2}},
+ {2510, {wxXmlResource, initAllHandlers, 0}},
+ {2511, {wxXmlResource, load, 1}},
+ {2512, {wxXmlResource, loadBitmap, 1}},
+ {2513, {wxXmlResource, loadDialog_2, 2}},
+ {2514, {wxXmlResource, loadDialog_3, 3}},
+ {2515, {wxXmlResource, loadFrame_2, 2}},
+ {2516, {wxXmlResource, loadFrame_3, 3}},
+ {2517, {wxXmlResource, loadIcon, 1}},
+ {2518, {wxXmlResource, loadMenu, 1}},
+ {2519, {wxXmlResource, loadMenuBar_2, 2}},
+ {2520, {wxXmlResource, loadMenuBar_1, 1}},
+ {2521, {wxXmlResource, loadPanel_2, 2}},
+ {2522, {wxXmlResource, loadPanel_3, 3}},
+ {2523, {wxXmlResource, loadToolBar, 2}},
+ {2524, {wxXmlResource, set, 1}},
+ {2525, {wxXmlResource, setFlags, 1}},
+ {2526, {wxXmlResource, unload, 1}},
+ {2527, {wxXmlResource, xrcctrl, 3}},
+ {2528, {wxHtmlEasyPrinting, new, 1}},
+ {2529, {wxHtmlEasyPrinting, destruct, 0}},
+ {2530, {wxHtmlEasyPrinting, getPrintData, 0}},
+ {2531, {wxHtmlEasyPrinting, getPageSetupData, 0}},
+ {2532, {wxHtmlEasyPrinting, previewFile, 1}},
+ {2533, {wxHtmlEasyPrinting, previewText, 2}},
+ {2534, {wxHtmlEasyPrinting, printFile, 1}},
+ {2535, {wxHtmlEasyPrinting, printText, 2}},
+ {2536, {wxHtmlEasyPrinting, pageSetup, 0}},
+ {2537, {wxHtmlEasyPrinting, setFonts, 3}},
+ {2538, {wxHtmlEasyPrinting, setHeader, 2}},
+ {2539, {wxHtmlEasyPrinting, setFooter, 2}},
+ {2541, {wxGLCanvas, new_2, 2}},
+ {2542, {wxGLCanvas, new_3_1, 3}},
+ {2543, {wxGLCanvas, new_3_0, 3}},
+ {2544, {wxGLCanvas, getContext, 0}},
+ {2546, {wxGLCanvas, setCurrent, 0}},
+ {2547, {wxGLCanvas, swapBuffers, 0}},
+ {2548, {wxGLCanvas, 'Destroy', undefined}},
+ {2549, {wxAuiManager, new, 1}},
+ {2550, {wxAuiManager, destruct, 0}},
+ {2551, {wxAuiManager, addPane_2_1, 2}},
+ {2552, {wxAuiManager, addPane_3, 3}},
+ {2553, {wxAuiManager, addPane_2_0, 2}},
+ {2554, {wxAuiManager, detachPane, 1}},
+ {2555, {wxAuiManager, getAllPanes, 0}},
+ {2556, {wxAuiManager, getArtProvider, 0}},
+ {2557, {wxAuiManager, getDockSizeConstraint, 2}},
+ {2558, {wxAuiManager, getFlags, 0}},
+ {2559, {wxAuiManager, getManagedWindow, 0}},
+ {2560, {wxAuiManager, getManager, 1}},
+ {2561, {wxAuiManager, getPane_1_1, 1}},
+ {2562, {wxAuiManager, getPane_1_0, 1}},
+ {2563, {wxAuiManager, hideHint, 0}},
+ {2564, {wxAuiManager, insertPane, 3}},
+ {2565, {wxAuiManager, loadPaneInfo, 2}},
+ {2566, {wxAuiManager, loadPerspective, 2}},
+ {2567, {wxAuiManager, savePaneInfo, 1}},
+ {2568, {wxAuiManager, savePerspective, 0}},
+ {2569, {wxAuiManager, setArtProvider, 1}},
+ {2570, {wxAuiManager, setDockSizeConstraint, 2}},
+ {2571, {wxAuiManager, setFlags, 1}},
+ {2572, {wxAuiManager, setManagedWindow, 1}},
+ {2573, {wxAuiManager, showHint, 1}},
+ {2574, {wxAuiManager, unInit, 0}},
+ {2575, {wxAuiManager, update, 0}},
+ {2576, {wxAuiPaneInfo, new_0, 0}},
+ {2577, {wxAuiPaneInfo, new_1, 1}},
+ {2578, {wxAuiPaneInfo, destruct, 0}},
+ {2579, {wxAuiPaneInfo, bestSize_1, 1}},
+ {2580, {wxAuiPaneInfo, bestSize_2, 2}},
+ {2581, {wxAuiPaneInfo, bottom, 0}},
+ {2582, {wxAuiPaneInfo, bottomDockable, 1}},
+ {2583, {wxAuiPaneInfo, caption, 1}},
+ {2584, {wxAuiPaneInfo, captionVisible, 1}},
+ {2585, {wxAuiPaneInfo, centre, 0}},
+ {2586, {wxAuiPaneInfo, centrePane, 0}},
+ {2587, {wxAuiPaneInfo, closeButton, 1}},
+ {2588, {wxAuiPaneInfo, defaultPane, 0}},
+ {2589, {wxAuiPaneInfo, destroyOnClose, 1}},
+ {2590, {wxAuiPaneInfo, direction, 1}},
+ {2591, {wxAuiPaneInfo, dock, 0}},
+ {2592, {wxAuiPaneInfo, dockable, 1}},
+ {2593, {wxAuiPaneInfo, fixed, 0}},
+ {2594, {wxAuiPaneInfo, float, 0}},
+ {2595, {wxAuiPaneInfo, floatable, 1}},
+ {2596, {wxAuiPaneInfo, floatingPosition_1, 1}},
+ {2597, {wxAuiPaneInfo, floatingPosition_2, 2}},
+ {2598, {wxAuiPaneInfo, floatingSize_1, 1}},
+ {2599, {wxAuiPaneInfo, floatingSize_2, 2}},
+ {2600, {wxAuiPaneInfo, gripper, 1}},
+ {2601, {wxAuiPaneInfo, gripperTop, 1}},
+ {2602, {wxAuiPaneInfo, hasBorder, 0}},
+ {2603, {wxAuiPaneInfo, hasCaption, 0}},
+ {2604, {wxAuiPaneInfo, hasCloseButton, 0}},
+ {2605, {wxAuiPaneInfo, hasFlag, 1}},
+ {2606, {wxAuiPaneInfo, hasGripper, 0}},
+ {2607, {wxAuiPaneInfo, hasGripperTop, 0}},
+ {2608, {wxAuiPaneInfo, hasMaximizeButton, 0}},
+ {2609, {wxAuiPaneInfo, hasMinimizeButton, 0}},
+ {2610, {wxAuiPaneInfo, hasPinButton, 0}},
+ {2611, {wxAuiPaneInfo, hide, 0}},
+ {2612, {wxAuiPaneInfo, isBottomDockable, 0}},
+ {2613, {wxAuiPaneInfo, isDocked, 0}},
+ {2614, {wxAuiPaneInfo, isFixed, 0}},
+ {2615, {wxAuiPaneInfo, isFloatable, 0}},
+ {2616, {wxAuiPaneInfo, isFloating, 0}},
+ {2617, {wxAuiPaneInfo, isLeftDockable, 0}},
+ {2618, {wxAuiPaneInfo, isMovable, 0}},
+ {2619, {wxAuiPaneInfo, isOk, 0}},
+ {2620, {wxAuiPaneInfo, isResizable, 0}},
+ {2621, {wxAuiPaneInfo, isRightDockable, 0}},
+ {2622, {wxAuiPaneInfo, isShown, 0}},
+ {2623, {wxAuiPaneInfo, isToolbar, 0}},
+ {2624, {wxAuiPaneInfo, isTopDockable, 0}},
+ {2625, {wxAuiPaneInfo, layer, 1}},
+ {2626, {wxAuiPaneInfo, left, 0}},
+ {2627, {wxAuiPaneInfo, leftDockable, 1}},
+ {2628, {wxAuiPaneInfo, maxSize_1, 1}},
+ {2629, {wxAuiPaneInfo, maxSize_2, 2}},
+ {2630, {wxAuiPaneInfo, maximizeButton, 1}},
+ {2631, {wxAuiPaneInfo, minSize_1, 1}},
+ {2632, {wxAuiPaneInfo, minSize_2, 2}},
+ {2633, {wxAuiPaneInfo, minimizeButton, 1}},
+ {2634, {wxAuiPaneInfo, movable, 1}},
+ {2635, {wxAuiPaneInfo, name, 1}},
+ {2636, {wxAuiPaneInfo, paneBorder, 1}},
+ {2637, {wxAuiPaneInfo, pinButton, 1}},
+ {2638, {wxAuiPaneInfo, position, 1}},
+ {2639, {wxAuiPaneInfo, resizable, 1}},
+ {2640, {wxAuiPaneInfo, right, 0}},
+ {2641, {wxAuiPaneInfo, rightDockable, 1}},
+ {2642, {wxAuiPaneInfo, row, 1}},
+ {2643, {wxAuiPaneInfo, safeSet, 1}},
+ {2644, {wxAuiPaneInfo, setFlag, 2}},
+ {2645, {wxAuiPaneInfo, show, 1}},
+ {2646, {wxAuiPaneInfo, toolbarPane, 0}},
+ {2647, {wxAuiPaneInfo, top, 0}},
+ {2648, {wxAuiPaneInfo, topDockable, 1}},
+ {2649, {wxAuiPaneInfo, window, 1}},
+ {2650, {wxAuiNotebook, new_0, 0}},
+ {2651, {wxAuiNotebook, new_2, 2}},
+ {2652, {wxAuiNotebook, addPage, 3}},
+ {2653, {wxAuiNotebook, create, 2}},
+ {2654, {wxAuiNotebook, deletePage, 1}},
+ {2655, {wxAuiNotebook, getArtProvider, 0}},
+ {2656, {wxAuiNotebook, getPage, 1}},
+ {2657, {wxAuiNotebook, getPageBitmap, 1}},
+ {2658, {wxAuiNotebook, getPageCount, 0}},
+ {2659, {wxAuiNotebook, getPageIndex, 1}},
+ {2660, {wxAuiNotebook, getPageText, 1}},
+ {2661, {wxAuiNotebook, getSelection, 0}},
+ {2662, {wxAuiNotebook, insertPage, 4}},
+ {2663, {wxAuiNotebook, removePage, 1}},
+ {2664, {wxAuiNotebook, setArtProvider, 1}},
+ {2665, {wxAuiNotebook, setFont, 1}},
+ {2666, {wxAuiNotebook, setPageBitmap, 2}},
+ {2667, {wxAuiNotebook, setPageText, 2}},
+ {2668, {wxAuiNotebook, setSelection, 1}},
+ {2669, {wxAuiNotebook, setTabCtrlHeight, 1}},
+ {2670, {wxAuiNotebook, setUniformBitmapSize, 1}},
+ {2671, {wxAuiNotebook, 'Destroy', undefined}},
+ {2672, {wxMDIParentFrame, new_0, 0}},
+ {2673, {wxMDIParentFrame, new_4, 4}},
+ {2674, {wxMDIParentFrame, destruct, 0}},
+ {2675, {wxMDIParentFrame, activateNext, 0}},
+ {2676, {wxMDIParentFrame, activatePrevious, 0}},
+ {2677, {wxMDIParentFrame, arrangeIcons, 0}},
+ {2678, {wxMDIParentFrame, cascade, 0}},
+ {2679, {wxMDIParentFrame, create, 4}},
+ {2680, {wxMDIParentFrame, getActiveChild, 0}},
+ {2681, {wxMDIParentFrame, getClientWindow, 0}},
+ {2682, {wxMDIParentFrame, tile, 1}},
+ {2683, {wxMDIChildFrame, new_0, 0}},
+ {2684, {wxMDIChildFrame, new_4, 4}},
+ {2685, {wxMDIChildFrame, destruct, 0}},
+ {2686, {wxMDIChildFrame, activate, 0}},
+ {2687, {wxMDIChildFrame, create, 4}},
+ {2688, {wxMDIChildFrame, maximize, 1}},
+ {2689, {wxMDIChildFrame, restore, 0}},
+ {2690, {wxMDIClientWindow, new_0, 0}},
+ {2691, {wxMDIClientWindow, new_2, 2}},
+ {2692, {wxMDIClientWindow, destruct, 0}},
+ {2693, {wxMDIClientWindow, createClient, 2}},
+ {2694, {wxLayoutAlgorithm, new, 0}},
+ {2695, {wxLayoutAlgorithm, layoutFrame, 2}},
+ {2696, {wxLayoutAlgorithm, layoutMDIFrame, 2}},
+ {2697, {wxLayoutAlgorithm, layoutWindow, 2}},
+ {2698, {wxLayoutAlgorithm, 'Destroy', undefined}},
+ {2699, {wxEvent, getId, 0}},
+ {2700, {wxEvent, getSkipped, 0}},
+ {2701, {wxEvent, getTimestamp, 0}},
+ {2702, {wxEvent, isCommandEvent, 0}},
+ {2703, {wxEvent, resumePropagation, 1}},
+ {2704, {wxEvent, shouldPropagate, 0}},
+ {2705, {wxEvent, skip, 1}},
+ {2706, {wxEvent, stopPropagation, 0}},
+ {2707, {wxCommandEvent, getClientData, 0}},
+ {2708, {wxCommandEvent, getExtraLong, 0}},
+ {2709, {wxCommandEvent, getInt, 0}},
+ {2710, {wxCommandEvent, getSelection, 0}},
+ {2711, {wxCommandEvent, getString, 0}},
+ {2712, {wxCommandEvent, isChecked, 0}},
+ {2713, {wxCommandEvent, isSelection, 0}},
+ {2714, {wxCommandEvent, setInt, 1}},
+ {2715, {wxCommandEvent, setString, 1}},
+ {2716, {wxScrollEvent, getOrientation, 0}},
+ {2717, {wxScrollEvent, getPosition, 0}},
+ {2718, {wxScrollWinEvent, getOrientation, 0}},
+ {2719, {wxScrollWinEvent, getPosition, 0}},
+ {2720, {wxMouseEvent, altDown, 0}},
+ {2721, {wxMouseEvent, button, 1}},
+ {2722, {wxMouseEvent, buttonDClick, 1}},
+ {2723, {wxMouseEvent, buttonDown, 1}},
+ {2724, {wxMouseEvent, buttonUp, 1}},
+ {2725, {wxMouseEvent, cmdDown, 0}},
+ {2726, {wxMouseEvent, controlDown, 0}},
+ {2727, {wxMouseEvent, dragging, 0}},
+ {2728, {wxMouseEvent, entering, 0}},
+ {2729, {wxMouseEvent, getButton, 0}},
+ {2732, {wxMouseEvent, getPosition, 0}},
+ {2733, {wxMouseEvent, getLogicalPosition, 1}},
+ {2734, {wxMouseEvent, getLinesPerAction, 0}},
+ {2735, {wxMouseEvent, getWheelRotation, 0}},
+ {2736, {wxMouseEvent, getWheelDelta, 0}},
+ {2737, {wxMouseEvent, getX, 0}},
+ {2738, {wxMouseEvent, getY, 0}},
+ {2739, {wxMouseEvent, isButton, 0}},
+ {2740, {wxMouseEvent, isPageScroll, 0}},
+ {2741, {wxMouseEvent, leaving, 0}},
+ {2742, {wxMouseEvent, leftDClick, 0}},
+ {2743, {wxMouseEvent, leftDown, 0}},
+ {2744, {wxMouseEvent, leftIsDown, 0}},
+ {2745, {wxMouseEvent, leftUp, 0}},
+ {2746, {wxMouseEvent, metaDown, 0}},
+ {2747, {wxMouseEvent, middleDClick, 0}},
+ {2748, {wxMouseEvent, middleDown, 0}},
+ {2749, {wxMouseEvent, middleIsDown, 0}},
+ {2750, {wxMouseEvent, middleUp, 0}},
+ {2751, {wxMouseEvent, moving, 0}},
+ {2752, {wxMouseEvent, rightDClick, 0}},
+ {2753, {wxMouseEvent, rightDown, 0}},
+ {2754, {wxMouseEvent, rightIsDown, 0}},
+ {2755, {wxMouseEvent, rightUp, 0}},
+ {2756, {wxMouseEvent, shiftDown, 0}},
+ {2757, {wxSetCursorEvent, getCursor, 0}},
+ {2758, {wxSetCursorEvent, getX, 0}},
+ {2759, {wxSetCursorEvent, getY, 0}},
+ {2760, {wxSetCursorEvent, hasCursor, 0}},
+ {2761, {wxSetCursorEvent, setCursor, 1}},
+ {2762, {wxKeyEvent, altDown, 0}},
+ {2763, {wxKeyEvent, cmdDown, 0}},
+ {2764, {wxKeyEvent, controlDown, 0}},
+ {2765, {wxKeyEvent, getKeyCode, 0}},
+ {2766, {wxKeyEvent, getModifiers, 0}},
+ {2769, {wxKeyEvent, getPosition, 0}},
+ {2770, {wxKeyEvent, getRawKeyCode, 0}},
+ {2771, {wxKeyEvent, getRawKeyFlags, 0}},
+ {2772, {wxKeyEvent, getUnicodeKey, 0}},
+ {2773, {wxKeyEvent, getX, 0}},
+ {2774, {wxKeyEvent, getY, 0}},
+ {2775, {wxKeyEvent, hasModifiers, 0}},
+ {2776, {wxKeyEvent, metaDown, 0}},
+ {2777, {wxKeyEvent, shiftDown, 0}},
+ {2778, {wxSizeEvent, getSize, 0}},
+ {2779, {wxMoveEvent, getPosition, 0}},
+ {2780, {wxEraseEvent, getDC, 0}},
+ {2781, {wxFocusEvent, getWindow, 0}},
+ {2782, {wxChildFocusEvent, getWindow, 0}},
+ {2783, {wxMenuEvent, getMenu, 0}},
+ {2784, {wxMenuEvent, getMenuId, 0}},
+ {2785, {wxMenuEvent, isPopup, 0}},
+ {2786, {wxCloseEvent, canVeto, 0}},
+ {2787, {wxCloseEvent, getLoggingOff, 0}},
+ {2788, {wxCloseEvent, setCanVeto, 1}},
+ {2789, {wxCloseEvent, setLoggingOff, 1}},
+ {2790, {wxCloseEvent, veto, 1}},
+ {2791, {wxShowEvent, setShow, 1}},
+ {2792, {wxShowEvent, getShow, 0}},
+ {2793, {wxIconizeEvent, iconized, 0}},
+ {2794, {wxJoystickEvent, buttonDown, 1}},
+ {2795, {wxJoystickEvent, buttonIsDown, 1}},
+ {2796, {wxJoystickEvent, buttonUp, 1}},
+ {2797, {wxJoystickEvent, getButtonChange, 0}},
+ {2798, {wxJoystickEvent, getButtonState, 0}},
+ {2799, {wxJoystickEvent, getJoystick, 0}},
+ {2800, {wxJoystickEvent, getPosition, 0}},
+ {2801, {wxJoystickEvent, getZPosition, 0}},
+ {2802, {wxJoystickEvent, isButton, 0}},
+ {2803, {wxJoystickEvent, isMove, 0}},
+ {2804, {wxJoystickEvent, isZMove, 0}},
+ {2805, {wxUpdateUIEvent, canUpdate, 1}},
+ {2806, {wxUpdateUIEvent, check, 1}},
+ {2807, {wxUpdateUIEvent, enable, 1}},
+ {2808, {wxUpdateUIEvent, show, 1}},
+ {2809, {wxUpdateUIEvent, getChecked, 0}},
+ {2810, {wxUpdateUIEvent, getEnabled, 0}},
+ {2811, {wxUpdateUIEvent, getShown, 0}},
+ {2812, {wxUpdateUIEvent, getSetChecked, 0}},
+ {2813, {wxUpdateUIEvent, getSetEnabled, 0}},
+ {2814, {wxUpdateUIEvent, getSetShown, 0}},
+ {2815, {wxUpdateUIEvent, getSetText, 0}},
+ {2816, {wxUpdateUIEvent, getText, 0}},
+ {2817, {wxUpdateUIEvent, getMode, 0}},
+ {2818, {wxUpdateUIEvent, getUpdateInterval, 0}},
+ {2819, {wxUpdateUIEvent, resetUpdateTime, 0}},
+ {2820, {wxUpdateUIEvent, setMode, 1}},
+ {2821, {wxUpdateUIEvent, setText, 1}},
+ {2822, {wxUpdateUIEvent, setUpdateInterval, 1}},
+ {2823, {wxMouseCaptureChangedEvent, getCapturedWindow, 0}},
+ {2824, {wxPaletteChangedEvent, setChangedWindow, 1}},
+ {2825, {wxPaletteChangedEvent, getChangedWindow, 0}},
+ {2826, {wxQueryNewPaletteEvent, setPaletteRealized, 1}},
+ {2827, {wxQueryNewPaletteEvent, getPaletteRealized, 0}},
+ {2828, {wxNavigationKeyEvent, getDirection, 0}},
+ {2829, {wxNavigationKeyEvent, setDirection, 1}},
+ {2830, {wxNavigationKeyEvent, isWindowChange, 0}},
+ {2831, {wxNavigationKeyEvent, setWindowChange, 1}},
+ {2832, {wxNavigationKeyEvent, isFromTab, 0}},
+ {2833, {wxNavigationKeyEvent, setFromTab, 1}},
+ {2834, {wxNavigationKeyEvent, getCurrentFocus, 0}},
+ {2835, {wxNavigationKeyEvent, setCurrentFocus, 1}},
+ {2836, {wxHelpEvent, getOrigin, 0}},
+ {2837, {wxHelpEvent, getPosition, 0}},
+ {2838, {wxHelpEvent, setOrigin, 1}},
+ {2839, {wxHelpEvent, setPosition, 1}},
+ {2840, {wxContextMenuEvent, getPosition, 0}},
+ {2841, {wxContextMenuEvent, setPosition, 1}},
+ {2842, {wxIdleEvent, canSend, 1}},
+ {2843, {wxIdleEvent, getMode, 0}},
+ {2844, {wxIdleEvent, requestMore, 1}},
+ {2845, {wxIdleEvent, moreRequested, 0}},
+ {2846, {wxIdleEvent, setMode, 1}},
+ {2847, {wxGridEvent, altDown, 0}},
+ {2848, {wxGridEvent, controlDown, 0}},
+ {2849, {wxGridEvent, getCol, 0}},
+ {2850, {wxGridEvent, getPosition, 0}},
+ {2851, {wxGridEvent, getRow, 0}},
+ {2852, {wxGridEvent, metaDown, 0}},
+ {2853, {wxGridEvent, selecting, 0}},
+ {2854, {wxGridEvent, shiftDown, 0}},
+ {2855, {wxNotifyEvent, allow, 0}},
+ {2856, {wxNotifyEvent, isAllowed, 0}},
+ {2857, {wxNotifyEvent, veto, 0}},
+ {2858, {wxSashEvent, getEdge, 0}},
+ {2859, {wxSashEvent, getDragRect, 0}},
+ {2860, {wxSashEvent, getDragStatus, 0}},
+ {2861, {wxListEvent, getCacheFrom, 0}},
+ {2862, {wxListEvent, getCacheTo, 0}},
+ {2863, {wxListEvent, getKeyCode, 0}},
+ {2864, {wxListEvent, getIndex, 0}},
+ {2865, {wxListEvent, getColumn, 0}},
+ {2866, {wxListEvent, getPoint, 0}},
+ {2867, {wxListEvent, getLabel, 0}},
+ {2868, {wxListEvent, getText, 0}},
+ {2869, {wxListEvent, getImage, 0}},
+ {2870, {wxListEvent, getData, 0}},
+ {2871, {wxListEvent, getMask, 0}},
+ {2872, {wxListEvent, getItem, 0}},
+ {2873, {wxListEvent, isEditCancelled, 0}},
+ {2874, {wxDateEvent, getDate, 0}},
+ {2875, {wxCalendarEvent, getWeekDay, 0}},
+ {2876, {wxFileDirPickerEvent, getPath, 0}},
+ {2877, {wxColourPickerEvent, getColour, 0}},
+ {2878, {wxFontPickerEvent, getFont, 0}},
+ {2879, {wxStyledTextEvent, getPosition, 0}},
+ {2880, {wxStyledTextEvent, getKey, 0}},
+ {2881, {wxStyledTextEvent, getModifiers, 0}},
+ {2882, {wxStyledTextEvent, getModificationType, 0}},
+ {2883, {wxStyledTextEvent, getText, 0}},
+ {2884, {wxStyledTextEvent, getLength, 0}},
+ {2885, {wxStyledTextEvent, getLinesAdded, 0}},
+ {2886, {wxStyledTextEvent, getLine, 0}},
+ {2887, {wxStyledTextEvent, getFoldLevelNow, 0}},
+ {2888, {wxStyledTextEvent, getFoldLevelPrev, 0}},
+ {2889, {wxStyledTextEvent, getMargin, 0}},
+ {2890, {wxStyledTextEvent, getMessage, 0}},
+ {2891, {wxStyledTextEvent, getWParam, 0}},
+ {2892, {wxStyledTextEvent, getLParam, 0}},
+ {2893, {wxStyledTextEvent, getListType, 0}},
+ {2894, {wxStyledTextEvent, getX, 0}},
+ {2895, {wxStyledTextEvent, getY, 0}},
+ {2896, {wxStyledTextEvent, getDragText, 0}},
+ {2897, {wxStyledTextEvent, getDragAllowMove, 0}},
+ {2898, {wxStyledTextEvent, getDragResult, 0}},
+ {2899, {wxStyledTextEvent, getShift, 0}},
+ {2900, {wxStyledTextEvent, getControl, 0}},
+ {2901, {wxStyledTextEvent, getAlt, 0}},
+ {2902, {utils, getKeyState, 1}},
+ {2903, {utils, getMousePosition, 2}},
+ {2904, {utils, getMouseState, 0}},
+ {2905, {utils, setDetectableAutoRepeat, 1}},
+ {2906, {utils, bell, 0}},
+ {2907, {utils, findMenuItemId, 3}},
+ {2908, {utils, genericFindWindowAtPoint, 1}},
+ {2909, {utils, findWindowAtPoint, 1}},
+ {2910, {utils, beginBusyCursor, 1}},
+ {2911, {utils, endBusyCursor, 0}},
+ {2912, {utils, isBusy, 0}},
+ {2913, {utils, shutdown, 1}},
+ {2914, {utils, shell, 1}},
+ {2915, {utils, launchDefaultBrowser, 2}},
+ {2916, {utils, getEmailAddress, 0}},
+ {2917, {utils, getUserId, 0}},
+ {2918, {utils, getHomeDir, 0}},
+ {2919, {utils, newId, 0}},
+ {2920, {utils, registerId, 1}},
+ {2921, {utils, getCurrentId, 0}},
+ {2922, {utils, getOsDescription, 0}},
+ {2923, {utils, isPlatformLittleEndian, 0}},
+ {2924, {utils, isPlatform64Bit, 0}},
+ {2925, {wxPrintout, new, 1}},
+ {2926, {wxPrintout, destruct, 0}},
+ {2927, {wxPrintout, getDC, 0}},
+ {2928, {wxPrintout, getPageSizeMM, 2}},
+ {2929, {wxPrintout, getPageSizePixels, 2}},
+ {2930, {wxPrintout, getPaperRectPixels, 0}},
+ {2931, {wxPrintout, getPPIPrinter, 2}},
+ {2932, {wxPrintout, getPPIScreen, 2}},
+ {2933, {wxPrintout, getTitle, 0}},
+ {2934, {wxPrintout, isPreview, 0}},
+ {2935, {wxPrintout, fitThisSizeToPaper, 1}},
+ {2936, {wxPrintout, fitThisSizeToPage, 1}},
+ {2937, {wxPrintout, fitThisSizeToPageMargins, 2}},
+ {2938, {wxPrintout, mapScreenSizeToPaper, 0}},
+ {2939, {wxPrintout, mapScreenSizeToPage, 0}},
+ {2940, {wxPrintout, mapScreenSizeToPageMargins, 1}},
+ {2941, {wxPrintout, mapScreenSizeToDevice, 0}},
+ {2942, {wxPrintout, getLogicalPaperRect, 0}},
+ {2943, {wxPrintout, getLogicalPageRect, 0}},
+ {2944, {wxPrintout, getLogicalPageMarginsRect, 1}},
+ {2945, {wxPrintout, setLogicalOrigin, 2}},
+ {2946, {wxPrintout, offsetLogicalOrigin, 2}},
+ {2947, {wxStyledTextCtrl, new_2, 2}},
+ {2948, {wxStyledTextCtrl, new_0, 0}},
+ {2949, {wxStyledTextCtrl, destruct, 0}},
+ {2950, {wxStyledTextCtrl, create, 2}},
+ {2951, {wxStyledTextCtrl, addText, 1}},
+ {2952, {wxStyledTextCtrl, addStyledText, 1}},
+ {2953, {wxStyledTextCtrl, insertText, 2}},
+ {2954, {wxStyledTextCtrl, clearAll, 0}},
+ {2955, {wxStyledTextCtrl, clearDocumentStyle, 0}},
+ {2956, {wxStyledTextCtrl, getLength, 0}},
+ {2957, {wxStyledTextCtrl, getCharAt, 1}},
+ {2958, {wxStyledTextCtrl, getCurrentPos, 0}},
+ {2959, {wxStyledTextCtrl, getAnchor, 0}},
+ {2960, {wxStyledTextCtrl, getStyleAt, 1}},
+ {2961, {wxStyledTextCtrl, redo, 0}},
+ {2962, {wxStyledTextCtrl, setUndoCollection, 1}},
+ {2963, {wxStyledTextCtrl, selectAll, 0}},
+ {2964, {wxStyledTextCtrl, setSavePoint, 0}},
+ {2965, {wxStyledTextCtrl, getStyledText, 2}},
+ {2966, {wxStyledTextCtrl, canRedo, 0}},
+ {2967, {wxStyledTextCtrl, markerLineFromHandle, 1}},
+ {2968, {wxStyledTextCtrl, markerDeleteHandle, 1}},
+ {2969, {wxStyledTextCtrl, getUndoCollection, 0}},
+ {2970, {wxStyledTextCtrl, getViewWhiteSpace, 0}},
+ {2971, {wxStyledTextCtrl, setViewWhiteSpace, 1}},
+ {2972, {wxStyledTextCtrl, positionFromPoint, 1}},
+ {2973, {wxStyledTextCtrl, positionFromPointClose, 2}},
+ {2974, {wxStyledTextCtrl, gotoLine, 1}},
+ {2975, {wxStyledTextCtrl, gotoPos, 1}},
+ {2976, {wxStyledTextCtrl, setAnchor, 1}},
+ {2977, {wxStyledTextCtrl, getCurLine, 1}},
+ {2978, {wxStyledTextCtrl, getEndStyled, 0}},
+ {2979, {wxStyledTextCtrl, convertEOLs, 1}},
+ {2980, {wxStyledTextCtrl, getEOLMode, 0}},
+ {2981, {wxStyledTextCtrl, setEOLMode, 1}},
+ {2982, {wxStyledTextCtrl, startStyling, 2}},
+ {2983, {wxStyledTextCtrl, setStyling, 2}},
+ {2984, {wxStyledTextCtrl, getBufferedDraw, 0}},
+ {2985, {wxStyledTextCtrl, setBufferedDraw, 1}},
+ {2986, {wxStyledTextCtrl, setTabWidth, 1}},
+ {2987, {wxStyledTextCtrl, getTabWidth, 0}},
+ {2988, {wxStyledTextCtrl, setCodePage, 1}},
+ {2989, {wxStyledTextCtrl, markerDefine, 3}},
+ {2990, {wxStyledTextCtrl, markerSetForeground, 2}},
+ {2991, {wxStyledTextCtrl, markerSetBackground, 2}},
+ {2992, {wxStyledTextCtrl, markerAdd, 2}},
+ {2993, {wxStyledTextCtrl, markerDelete, 2}},
+ {2994, {wxStyledTextCtrl, markerDeleteAll, 1}},
+ {2995, {wxStyledTextCtrl, markerGet, 1}},
+ {2996, {wxStyledTextCtrl, markerNext, 2}},
+ {2997, {wxStyledTextCtrl, markerPrevious, 2}},
+ {2998, {wxStyledTextCtrl, markerDefineBitmap, 2}},
+ {2999, {wxStyledTextCtrl, markerAddSet, 2}},
+ {3000, {wxStyledTextCtrl, markerSetAlpha, 2}},
+ {3001, {wxStyledTextCtrl, setMarginType, 2}},
+ {3002, {wxStyledTextCtrl, getMarginType, 1}},
+ {3003, {wxStyledTextCtrl, setMarginWidth, 2}},
+ {3004, {wxStyledTextCtrl, getMarginWidth, 1}},
+ {3005, {wxStyledTextCtrl, setMarginMask, 2}},
+ {3006, {wxStyledTextCtrl, getMarginMask, 1}},
+ {3007, {wxStyledTextCtrl, setMarginSensitive, 2}},
+ {3008, {wxStyledTextCtrl, getMarginSensitive, 1}},
+ {3009, {wxStyledTextCtrl, styleClearAll, 0}},
+ {3010, {wxStyledTextCtrl, styleSetForeground, 2}},
+ {3011, {wxStyledTextCtrl, styleSetBackground, 2}},
+ {3012, {wxStyledTextCtrl, styleSetBold, 2}},
+ {3013, {wxStyledTextCtrl, styleSetItalic, 2}},
+ {3014, {wxStyledTextCtrl, styleSetSize, 2}},
+ {3015, {wxStyledTextCtrl, styleSetFaceName, 2}},
+ {3016, {wxStyledTextCtrl, styleSetEOLFilled, 2}},
+ {3017, {wxStyledTextCtrl, styleResetDefault, 0}},
+ {3018, {wxStyledTextCtrl, styleSetUnderline, 2}},
+ {3019, {wxStyledTextCtrl, styleSetCase, 2}},
+ {3020, {wxStyledTextCtrl, styleSetHotSpot, 2}},
+ {3021, {wxStyledTextCtrl, setSelForeground, 2}},
+ {3022, {wxStyledTextCtrl, setSelBackground, 2}},
+ {3023, {wxStyledTextCtrl, getSelAlpha, 0}},
+ {3024, {wxStyledTextCtrl, setSelAlpha, 1}},
+ {3025, {wxStyledTextCtrl, setCaretForeground, 1}},
+ {3026, {wxStyledTextCtrl, cmdKeyAssign, 3}},
+ {3027, {wxStyledTextCtrl, cmdKeyClear, 2}},
+ {3028, {wxStyledTextCtrl, cmdKeyClearAll, 0}},
+ {3029, {wxStyledTextCtrl, setStyleBytes, 2}},
+ {3030, {wxStyledTextCtrl, styleSetVisible, 2}},
+ {3031, {wxStyledTextCtrl, getCaretPeriod, 0}},
+ {3032, {wxStyledTextCtrl, setCaretPeriod, 1}},
+ {3033, {wxStyledTextCtrl, setWordChars, 1}},
+ {3034, {wxStyledTextCtrl, beginUndoAction, 0}},
+ {3035, {wxStyledTextCtrl, endUndoAction, 0}},
+ {3036, {wxStyledTextCtrl, indicatorSetStyle, 2}},
+ {3037, {wxStyledTextCtrl, indicatorGetStyle, 1}},
+ {3038, {wxStyledTextCtrl, indicatorSetForeground, 2}},
+ {3039, {wxStyledTextCtrl, indicatorGetForeground, 1}},
+ {3040, {wxStyledTextCtrl, setWhitespaceForeground, 2}},
+ {3041, {wxStyledTextCtrl, setWhitespaceBackground, 2}},
+ {3042, {wxStyledTextCtrl, getStyleBits, 0}},
+ {3043, {wxStyledTextCtrl, setLineState, 2}},
+ {3044, {wxStyledTextCtrl, getLineState, 1}},
+ {3045, {wxStyledTextCtrl, getMaxLineState, 0}},
+ {3046, {wxStyledTextCtrl, getCaretLineVisible, 0}},
+ {3047, {wxStyledTextCtrl, setCaretLineVisible, 1}},
+ {3048, {wxStyledTextCtrl, getCaretLineBackground, 0}},
+ {3049, {wxStyledTextCtrl, setCaretLineBackground, 1}},
+ {3050, {wxStyledTextCtrl, autoCompShow, 2}},
+ {3051, {wxStyledTextCtrl, autoCompCancel, 0}},
+ {3052, {wxStyledTextCtrl, autoCompActive, 0}},
+ {3053, {wxStyledTextCtrl, autoCompPosStart, 0}},
+ {3054, {wxStyledTextCtrl, autoCompComplete, 0}},
+ {3055, {wxStyledTextCtrl, autoCompStops, 1}},
+ {3056, {wxStyledTextCtrl, autoCompSetSeparator, 1}},
+ {3057, {wxStyledTextCtrl, autoCompGetSeparator, 0}},
+ {3058, {wxStyledTextCtrl, autoCompSelect, 1}},
+ {3059, {wxStyledTextCtrl, autoCompSetCancelAtStart, 1}},
+ {3060, {wxStyledTextCtrl, autoCompGetCancelAtStart, 0}},
+ {3061, {wxStyledTextCtrl, autoCompSetFillUps, 1}},
+ {3062, {wxStyledTextCtrl, autoCompSetChooseSingle, 1}},
+ {3063, {wxStyledTextCtrl, autoCompGetChooseSingle, 0}},
+ {3064, {wxStyledTextCtrl, autoCompSetIgnoreCase, 1}},
+ {3065, {wxStyledTextCtrl, autoCompGetIgnoreCase, 0}},
+ {3066, {wxStyledTextCtrl, userListShow, 2}},
+ {3067, {wxStyledTextCtrl, autoCompSetAutoHide, 1}},
+ {3068, {wxStyledTextCtrl, autoCompGetAutoHide, 0}},
+ {3069, {wxStyledTextCtrl, autoCompSetDropRestOfWord, 1}},
+ {3070, {wxStyledTextCtrl, autoCompGetDropRestOfWord, 0}},
+ {3071, {wxStyledTextCtrl, registerImage, 2}},
+ {3072, {wxStyledTextCtrl, clearRegisteredImages, 0}},
+ {3073, {wxStyledTextCtrl, autoCompGetTypeSeparator, 0}},
+ {3074, {wxStyledTextCtrl, autoCompSetTypeSeparator, 1}},
+ {3075, {wxStyledTextCtrl, autoCompSetMaxWidth, 1}},
+ {3076, {wxStyledTextCtrl, autoCompGetMaxWidth, 0}},
+ {3077, {wxStyledTextCtrl, autoCompSetMaxHeight, 1}},
+ {3078, {wxStyledTextCtrl, autoCompGetMaxHeight, 0}},
+ {3079, {wxStyledTextCtrl, setIndent, 1}},
+ {3080, {wxStyledTextCtrl, getIndent, 0}},
+ {3081, {wxStyledTextCtrl, setUseTabs, 1}},
+ {3082, {wxStyledTextCtrl, getUseTabs, 0}},
+ {3083, {wxStyledTextCtrl, setLineIndentation, 2}},
+ {3084, {wxStyledTextCtrl, getLineIndentation, 1}},
+ {3085, {wxStyledTextCtrl, getLineIndentPosition, 1}},
+ {3086, {wxStyledTextCtrl, getColumn, 1}},
+ {3087, {wxStyledTextCtrl, setUseHorizontalScrollBar, 1}},
+ {3088, {wxStyledTextCtrl, getUseHorizontalScrollBar, 0}},
+ {3089, {wxStyledTextCtrl, setIndentationGuides, 1}},
+ {3090, {wxStyledTextCtrl, getIndentationGuides, 0}},
+ {3091, {wxStyledTextCtrl, setHighlightGuide, 1}},
+ {3092, {wxStyledTextCtrl, getHighlightGuide, 0}},
+ {3093, {wxStyledTextCtrl, getLineEndPosition, 1}},
+ {3094, {wxStyledTextCtrl, getCodePage, 0}},
+ {3095, {wxStyledTextCtrl, getCaretForeground, 0}},
+ {3096, {wxStyledTextCtrl, getReadOnly, 0}},
+ {3097, {wxStyledTextCtrl, setCurrentPos, 1}},
+ {3098, {wxStyledTextCtrl, setSelectionStart, 1}},
+ {3099, {wxStyledTextCtrl, getSelectionStart, 0}},
+ {3100, {wxStyledTextCtrl, setSelectionEnd, 1}},
+ {3101, {wxStyledTextCtrl, getSelectionEnd, 0}},
+ {3102, {wxStyledTextCtrl, setPrintMagnification, 1}},
+ {3103, {wxStyledTextCtrl, getPrintMagnification, 0}},
+ {3104, {wxStyledTextCtrl, setPrintColourMode, 1}},
+ {3105, {wxStyledTextCtrl, getPrintColourMode, 0}},
+ {3106, {wxStyledTextCtrl, findText, 4}},
+ {3107, {wxStyledTextCtrl, formatRange, 7}},
+ {3108, {wxStyledTextCtrl, getFirstVisibleLine, 0}},
+ {3109, {wxStyledTextCtrl, getLine, 1}},
+ {3110, {wxStyledTextCtrl, getLineCount, 0}},
+ {3111, {wxStyledTextCtrl, setMarginLeft, 1}},
+ {3112, {wxStyledTextCtrl, getMarginLeft, 0}},
+ {3113, {wxStyledTextCtrl, setMarginRight, 1}},
+ {3114, {wxStyledTextCtrl, getMarginRight, 0}},
+ {3115, {wxStyledTextCtrl, getModify, 0}},
+ {3116, {wxStyledTextCtrl, setSelection, 2}},
+ {3117, {wxStyledTextCtrl, getSelectedText, 0}},
+ {3118, {wxStyledTextCtrl, getTextRange, 2}},
+ {3119, {wxStyledTextCtrl, hideSelection, 1}},
+ {3120, {wxStyledTextCtrl, lineFromPosition, 1}},
+ {3121, {wxStyledTextCtrl, positionFromLine, 1}},
+ {3122, {wxStyledTextCtrl, lineScroll, 2}},
+ {3123, {wxStyledTextCtrl, ensureCaretVisible, 0}},
+ {3124, {wxStyledTextCtrl, replaceSelection, 1}},
+ {3125, {wxStyledTextCtrl, setReadOnly, 1}},
+ {3126, {wxStyledTextCtrl, canPaste, 0}},
+ {3127, {wxStyledTextCtrl, canUndo, 0}},
+ {3128, {wxStyledTextCtrl, emptyUndoBuffer, 0}},
+ {3129, {wxStyledTextCtrl, undo, 0}},
+ {3130, {wxStyledTextCtrl, cut, 0}},
+ {3131, {wxStyledTextCtrl, copy, 0}},
+ {3132, {wxStyledTextCtrl, paste, 0}},
+ {3133, {wxStyledTextCtrl, clear, 0}},
+ {3134, {wxStyledTextCtrl, setText, 1}},
+ {3135, {wxStyledTextCtrl, getText, 0}},
+ {3136, {wxStyledTextCtrl, getTextLength, 0}},
+ {3137, {wxStyledTextCtrl, getOvertype, 0}},
+ {3138, {wxStyledTextCtrl, setCaretWidth, 1}},
+ {3139, {wxStyledTextCtrl, getCaretWidth, 0}},
+ {3140, {wxStyledTextCtrl, setTargetStart, 1}},
+ {3141, {wxStyledTextCtrl, getTargetStart, 0}},
+ {3142, {wxStyledTextCtrl, setTargetEnd, 1}},
+ {3143, {wxStyledTextCtrl, getTargetEnd, 0}},
+ {3144, {wxStyledTextCtrl, replaceTarget, 1}},
+ {3145, {wxStyledTextCtrl, searchInTarget, 1}},
+ {3146, {wxStyledTextCtrl, setSearchFlags, 1}},
+ {3147, {wxStyledTextCtrl, getSearchFlags, 0}},
+ {3148, {wxStyledTextCtrl, callTipShow, 2}},
+ {3149, {wxStyledTextCtrl, callTipCancel, 0}},
+ {3150, {wxStyledTextCtrl, callTipActive, 0}},
+ {3151, {wxStyledTextCtrl, callTipPosAtStart, 0}},
+ {3152, {wxStyledTextCtrl, callTipSetHighlight, 2}},
+ {3153, {wxStyledTextCtrl, callTipSetBackground, 1}},
+ {3154, {wxStyledTextCtrl, callTipSetForeground, 1}},
+ {3155, {wxStyledTextCtrl, callTipSetForegroundHighlight, 1}},
+ {3156, {wxStyledTextCtrl, callTipUseStyle, 1}},
+ {3157, {wxStyledTextCtrl, visibleFromDocLine, 1}},
+ {3158, {wxStyledTextCtrl, docLineFromVisible, 1}},
+ {3159, {wxStyledTextCtrl, wrapCount, 1}},
+ {3160, {wxStyledTextCtrl, setFoldLevel, 2}},
+ {3161, {wxStyledTextCtrl, getFoldLevel, 1}},
+ {3162, {wxStyledTextCtrl, getLastChild, 2}},
+ {3163, {wxStyledTextCtrl, getFoldParent, 1}},
+ {3164, {wxStyledTextCtrl, showLines, 2}},
+ {3165, {wxStyledTextCtrl, hideLines, 2}},
+ {3166, {wxStyledTextCtrl, getLineVisible, 1}},
+ {3167, {wxStyledTextCtrl, setFoldExpanded, 2}},
+ {3168, {wxStyledTextCtrl, getFoldExpanded, 1}},
+ {3169, {wxStyledTextCtrl, toggleFold, 1}},
+ {3170, {wxStyledTextCtrl, ensureVisible, 1}},
+ {3171, {wxStyledTextCtrl, setFoldFlags, 1}},
+ {3172, {wxStyledTextCtrl, ensureVisibleEnforcePolicy, 1}},
+ {3173, {wxStyledTextCtrl, setTabIndents, 1}},
+ {3174, {wxStyledTextCtrl, getTabIndents, 0}},
+ {3175, {wxStyledTextCtrl, setBackSpaceUnIndents, 1}},
+ {3176, {wxStyledTextCtrl, getBackSpaceUnIndents, 0}},
+ {3177, {wxStyledTextCtrl, setMouseDwellTime, 1}},
+ {3178, {wxStyledTextCtrl, getMouseDwellTime, 0}},
+ {3179, {wxStyledTextCtrl, wordStartPosition, 2}},
+ {3180, {wxStyledTextCtrl, wordEndPosition, 2}},
+ {3181, {wxStyledTextCtrl, setWrapMode, 1}},
+ {3182, {wxStyledTextCtrl, getWrapMode, 0}},
+ {3183, {wxStyledTextCtrl, setWrapVisualFlags, 1}},
+ {3184, {wxStyledTextCtrl, getWrapVisualFlags, 0}},
+ {3185, {wxStyledTextCtrl, setWrapVisualFlagsLocation, 1}},
+ {3186, {wxStyledTextCtrl, getWrapVisualFlagsLocation, 0}},
+ {3187, {wxStyledTextCtrl, setWrapStartIndent, 1}},
+ {3188, {wxStyledTextCtrl, getWrapStartIndent, 0}},
+ {3189, {wxStyledTextCtrl, setLayoutCache, 1}},
+ {3190, {wxStyledTextCtrl, getLayoutCache, 0}},
+ {3191, {wxStyledTextCtrl, setScrollWidth, 1}},
+ {3192, {wxStyledTextCtrl, getScrollWidth, 0}},
+ {3193, {wxStyledTextCtrl, textWidth, 2}},
+ {3194, {wxStyledTextCtrl, getEndAtLastLine, 0}},
+ {3195, {wxStyledTextCtrl, textHeight, 1}},
+ {3196, {wxStyledTextCtrl, setUseVerticalScrollBar, 1}},
+ {3197, {wxStyledTextCtrl, getUseVerticalScrollBar, 0}},
+ {3198, {wxStyledTextCtrl, appendText, 1}},
+ {3199, {wxStyledTextCtrl, getTwoPhaseDraw, 0}},
+ {3200, {wxStyledTextCtrl, setTwoPhaseDraw, 1}},
+ {3201, {wxStyledTextCtrl, targetFromSelection, 0}},
+ {3202, {wxStyledTextCtrl, linesJoin, 0}},
+ {3203, {wxStyledTextCtrl, linesSplit, 1}},
+ {3204, {wxStyledTextCtrl, setFoldMarginColour, 2}},
+ {3205, {wxStyledTextCtrl, setFoldMarginHiColour, 2}},
+ {3206, {wxStyledTextCtrl, lineDown, 0}},
+ {3207, {wxStyledTextCtrl, lineDownExtend, 0}},
+ {3208, {wxStyledTextCtrl, lineUp, 0}},
+ {3209, {wxStyledTextCtrl, lineUpExtend, 0}},
+ {3210, {wxStyledTextCtrl, charLeft, 0}},
+ {3211, {wxStyledTextCtrl, charLeftExtend, 0}},
+ {3212, {wxStyledTextCtrl, charRight, 0}},
+ {3213, {wxStyledTextCtrl, charRightExtend, 0}},
+ {3214, {wxStyledTextCtrl, wordLeft, 0}},
+ {3215, {wxStyledTextCtrl, wordLeftExtend, 0}},
+ {3216, {wxStyledTextCtrl, wordRight, 0}},
+ {3217, {wxStyledTextCtrl, wordRightExtend, 0}},
+ {3218, {wxStyledTextCtrl, home, 0}},
+ {3219, {wxStyledTextCtrl, homeExtend, 0}},
+ {3220, {wxStyledTextCtrl, lineEnd, 0}},
+ {3221, {wxStyledTextCtrl, lineEndExtend, 0}},
+ {3222, {wxStyledTextCtrl, documentStart, 0}},
+ {3223, {wxStyledTextCtrl, documentStartExtend, 0}},
+ {3224, {wxStyledTextCtrl, documentEnd, 0}},
+ {3225, {wxStyledTextCtrl, documentEndExtend, 0}},
+ {3226, {wxStyledTextCtrl, pageUp, 0}},
+ {3227, {wxStyledTextCtrl, pageUpExtend, 0}},
+ {3228, {wxStyledTextCtrl, pageDown, 0}},
+ {3229, {wxStyledTextCtrl, pageDownExtend, 0}},
+ {3230, {wxStyledTextCtrl, editToggleOvertype, 0}},
+ {3231, {wxStyledTextCtrl, cancel, 0}},
+ {3232, {wxStyledTextCtrl, deleteBack, 0}},
+ {3233, {wxStyledTextCtrl, tab, 0}},
+ {3234, {wxStyledTextCtrl, backTab, 0}},
+ {3235, {wxStyledTextCtrl, newLine, 0}},
+ {3236, {wxStyledTextCtrl, formFeed, 0}},
+ {3237, {wxStyledTextCtrl, vCHome, 0}},
+ {3238, {wxStyledTextCtrl, vCHomeExtend, 0}},
+ {3239, {wxStyledTextCtrl, zoomIn, 0}},
+ {3240, {wxStyledTextCtrl, zoomOut, 0}},
+ {3241, {wxStyledTextCtrl, delWordLeft, 0}},
+ {3242, {wxStyledTextCtrl, delWordRight, 0}},
+ {3243, {wxStyledTextCtrl, lineCut, 0}},
+ {3244, {wxStyledTextCtrl, lineDelete, 0}},
+ {3245, {wxStyledTextCtrl, lineTranspose, 0}},
+ {3246, {wxStyledTextCtrl, lineDuplicate, 0}},
+ {3247, {wxStyledTextCtrl, lowerCase, 0}},
+ {3248, {wxStyledTextCtrl, upperCase, 0}},
+ {3249, {wxStyledTextCtrl, lineScrollDown, 0}},
+ {3250, {wxStyledTextCtrl, lineScrollUp, 0}},
+ {3251, {wxStyledTextCtrl, deleteBackNotLine, 0}},
+ {3252, {wxStyledTextCtrl, homeDisplay, 0}},
+ {3253, {wxStyledTextCtrl, homeDisplayExtend, 0}},
+ {3254, {wxStyledTextCtrl, lineEndDisplay, 0}},
+ {3255, {wxStyledTextCtrl, lineEndDisplayExtend, 0}},
+ {3256, {wxStyledTextCtrl, homeWrapExtend, 0}},
+ {3257, {wxStyledTextCtrl, lineEndWrap, 0}},
+ {3258, {wxStyledTextCtrl, lineEndWrapExtend, 0}},
+ {3259, {wxStyledTextCtrl, vCHomeWrap, 0}},
+ {3260, {wxStyledTextCtrl, vCHomeWrapExtend, 0}},
+ {3261, {wxStyledTextCtrl, lineCopy, 0}},
+ {3262, {wxStyledTextCtrl, moveCaretInsideView, 0}},
+ {3263, {wxStyledTextCtrl, lineLength, 1}},
+ {3264, {wxStyledTextCtrl, braceHighlight, 2}},
+ {3265, {wxStyledTextCtrl, braceBadLight, 1}},
+ {3266, {wxStyledTextCtrl, braceMatch, 1}},
+ {3267, {wxStyledTextCtrl, getViewEOL, 0}},
+ {3268, {wxStyledTextCtrl, setViewEOL, 1}},
+ {3269, {wxStyledTextCtrl, setModEventMask, 1}},
+ {3270, {wxStyledTextCtrl, getEdgeColumn, 0}},
+ {3271, {wxStyledTextCtrl, setEdgeColumn, 1}},
+ {3272, {wxStyledTextCtrl, getEdgeMode, 0}},
+ {3273, {wxStyledTextCtrl, getEdgeColour, 0}},
+ {3274, {wxStyledTextCtrl, setEdgeColour, 1}},
+ {3275, {wxStyledTextCtrl, searchAnchor, 0}},
+ {3276, {wxStyledTextCtrl, searchNext, 2}},
+ {3277, {wxStyledTextCtrl, searchPrev, 2}},
+ {3278, {wxStyledTextCtrl, linesOnScreen, 0}},
+ {3279, {wxStyledTextCtrl, usePopUp, 1}},
+ {3280, {wxStyledTextCtrl, selectionIsRectangle, 0}},
+ {3281, {wxStyledTextCtrl, setZoom, 1}},
+ {3282, {wxStyledTextCtrl, getZoom, 0}},
+ {3283, {wxStyledTextCtrl, getModEventMask, 0}},
+ {3284, {wxStyledTextCtrl, setSTCFocus, 1}},
+ {3285, {wxStyledTextCtrl, getSTCFocus, 0}},
+ {3286, {wxStyledTextCtrl, setStatus, 1}},
+ {3287, {wxStyledTextCtrl, getStatus, 0}},
+ {3288, {wxStyledTextCtrl, setMouseDownCaptures, 1}},
+ {3289, {wxStyledTextCtrl, getMouseDownCaptures, 0}},
+ {3290, {wxStyledTextCtrl, setSTCCursor, 1}},
+ {3291, {wxStyledTextCtrl, getSTCCursor, 0}},
+ {3292, {wxStyledTextCtrl, setControlCharSymbol, 1}},
+ {3293, {wxStyledTextCtrl, getControlCharSymbol, 0}},
+ {3294, {wxStyledTextCtrl, wordPartLeft, 0}},
+ {3295, {wxStyledTextCtrl, wordPartLeftExtend, 0}},
+ {3296, {wxStyledTextCtrl, wordPartRight, 0}},
+ {3297, {wxStyledTextCtrl, wordPartRightExtend, 0}},
+ {3298, {wxStyledTextCtrl, setVisiblePolicy, 2}},
+ {3299, {wxStyledTextCtrl, delLineLeft, 0}},
+ {3300, {wxStyledTextCtrl, delLineRight, 0}},
+ {3301, {wxStyledTextCtrl, getXOffset, 0}},
+ {3302, {wxStyledTextCtrl, chooseCaretX, 0}},
+ {3303, {wxStyledTextCtrl, setXCaretPolicy, 2}},
+ {3304, {wxStyledTextCtrl, setYCaretPolicy, 2}},
+ {3305, {wxStyledTextCtrl, getPrintWrapMode, 0}},
+ {3306, {wxStyledTextCtrl, setHotspotActiveForeground, 2}},
+ {3307, {wxStyledTextCtrl, setHotspotActiveBackground, 2}},
+ {3308, {wxStyledTextCtrl, setHotspotActiveUnderline, 1}},
+ {3309, {wxStyledTextCtrl, setHotspotSingleLine, 1}},
+ {3310, {wxStyledTextCtrl, paraDownExtend, 0}},
+ {3311, {wxStyledTextCtrl, paraUp, 0}},
+ {3312, {wxStyledTextCtrl, paraUpExtend, 0}},
+ {3313, {wxStyledTextCtrl, positionBefore, 1}},
+ {3314, {wxStyledTextCtrl, positionAfter, 1}},
+ {3315, {wxStyledTextCtrl, copyRange, 2}},
+ {3316, {wxStyledTextCtrl, copyText, 2}},
+ {3317, {wxStyledTextCtrl, setSelectionMode, 1}},
+ {3318, {wxStyledTextCtrl, getSelectionMode, 0}},
+ {3319, {wxStyledTextCtrl, lineDownRectExtend, 0}},
+ {3320, {wxStyledTextCtrl, lineUpRectExtend, 0}},
+ {3321, {wxStyledTextCtrl, charLeftRectExtend, 0}},
+ {3322, {wxStyledTextCtrl, charRightRectExtend, 0}},
+ {3323, {wxStyledTextCtrl, homeRectExtend, 0}},
+ {3324, {wxStyledTextCtrl, vCHomeRectExtend, 0}},
+ {3325, {wxStyledTextCtrl, lineEndRectExtend, 0}},
+ {3326, {wxStyledTextCtrl, pageUpRectExtend, 0}},
+ {3327, {wxStyledTextCtrl, pageDownRectExtend, 0}},
+ {3328, {wxStyledTextCtrl, stutteredPageUp, 0}},
+ {3329, {wxStyledTextCtrl, stutteredPageUpExtend, 0}},
+ {3330, {wxStyledTextCtrl, stutteredPageDown, 0}},
+ {3331, {wxStyledTextCtrl, stutteredPageDownExtend, 0}},
+ {3332, {wxStyledTextCtrl, wordLeftEnd, 0}},
+ {3333, {wxStyledTextCtrl, wordLeftEndExtend, 0}},
+ {3334, {wxStyledTextCtrl, wordRightEnd, 0}},
+ {3335, {wxStyledTextCtrl, wordRightEndExtend, 0}},
+ {3336, {wxStyledTextCtrl, setWhitespaceChars, 1}},
+ {3337, {wxStyledTextCtrl, setCharsDefault, 0}},
+ {3338, {wxStyledTextCtrl, autoCompGetCurrent, 0}},
+ {3339, {wxStyledTextCtrl, allocate, 1}},
+ {3340, {wxStyledTextCtrl, findColumn, 2}},
+ {3341, {wxStyledTextCtrl, getCaretSticky, 0}},
+ {3342, {wxStyledTextCtrl, setCaretSticky, 1}},
+ {3343, {wxStyledTextCtrl, toggleCaretSticky, 0}},
+ {3344, {wxStyledTextCtrl, setPasteConvertEndings, 1}},
+ {3345, {wxStyledTextCtrl, getPasteConvertEndings, 0}},
+ {3346, {wxStyledTextCtrl, selectionDuplicate, 0}},
+ {3347, {wxStyledTextCtrl, setCaretLineBackAlpha, 1}},
+ {3348, {wxStyledTextCtrl, getCaretLineBackAlpha, 0}},
+ {3349, {wxStyledTextCtrl, startRecord, 0}},
+ {3350, {wxStyledTextCtrl, stopRecord, 0}},
+ {3351, {wxStyledTextCtrl, setLexer, 1}},
+ {3352, {wxStyledTextCtrl, getLexer, 0}},
+ {3353, {wxStyledTextCtrl, colourise, 2}},
+ {3354, {wxStyledTextCtrl, setProperty, 2}},
+ {3355, {wxStyledTextCtrl, setKeyWords, 2}},
+ {3356, {wxStyledTextCtrl, setLexerLanguage, 1}},
+ {3357, {wxStyledTextCtrl, getProperty, 1}},
+ {3358, {wxStyledTextCtrl, getStyleBitsNeeded, 0}},
+ {3359, {wxStyledTextCtrl, getCurrentLine, 0}},
+ {3360, {wxStyledTextCtrl, styleSetSpec, 2}},
+ {3361, {wxStyledTextCtrl, styleSetFont, 2}},
+ {3362, {wxStyledTextCtrl, styleSetFontAttr, 7}},
+ {3363, {wxStyledTextCtrl, styleSetCharacterSet, 2}},
+ {3364, {wxStyledTextCtrl, styleSetFontEncoding, 2}},
+ {3365, {wxStyledTextCtrl, cmdKeyExecute, 1}},
+ {3366, {wxStyledTextCtrl, setMargins, 2}},
+ {3367, {wxStyledTextCtrl, getSelection, 2}},
+ {3368, {wxStyledTextCtrl, pointFromPosition, 1}},
+ {3369, {wxStyledTextCtrl, scrollToLine, 1}},
+ {3370, {wxStyledTextCtrl, scrollToColumn, 1}},
+ {3371, {wxStyledTextCtrl, sendMsg, 2}},
+ {3372, {wxStyledTextCtrl, setVScrollBar, 1}},
+ {3373, {wxStyledTextCtrl, setHScrollBar, 1}},
+ {3374, {wxStyledTextCtrl, getLastKeydownProcessed, 0}},
+ {3375, {wxStyledTextCtrl, setLastKeydownProcessed, 1}},
+ {3376, {wxStyledTextCtrl, saveFile, 1}},
+ {3377, {wxStyledTextCtrl, loadFile, 1}},
+ {3378, {wxStyledTextCtrl, doDragOver, 3}},
+ {3379, {wxStyledTextCtrl, doDropText, 3}},
+ {3380, {wxStyledTextCtrl, getUseAntiAliasing, 0}},
+ {3381, {wxStyledTextCtrl, addTextRaw, 1}},
+ {3382, {wxStyledTextCtrl, insertTextRaw, 2}},
+ {3383, {wxStyledTextCtrl, getCurLineRaw, 1}},
+ {3384, {wxStyledTextCtrl, getLineRaw, 1}},
+ {3385, {wxStyledTextCtrl, getSelectedTextRaw, 0}},
+ {3386, {wxStyledTextCtrl, getTextRangeRaw, 2}},
+ {3387, {wxStyledTextCtrl, setTextRaw, 1}},
+ {3388, {wxStyledTextCtrl, getTextRaw, 0}},
+ {3389, {wxStyledTextCtrl, appendTextRaw, 1}},
+ {3390, {wxArtProvider, getBitmap, 2}},
+ {3391, {wxArtProvider, getIcon, 2}},
+ {3392, {wxTreeEvent, getKeyCode, 0}},
+ {3393, {wxTreeEvent, getItem, 0}},
+ {3394, {wxTreeEvent, getKeyEvent, 0}},
+ {3395, {wxTreeEvent, getLabel, 0}},
+ {3396, {wxTreeEvent, getOldItem, 0}},
+ {3397, {wxTreeEvent, getPoint, 0}},
+ {3398, {wxTreeEvent, isEditCancelled, 0}},
+ {3399, {wxTreeEvent, setToolTip, 1}},
+ {3400, {wxNotebookEvent, getOldSelection, 0}},
+ {3401, {wxNotebookEvent, getSelection, 0}},
+ {3402, {wxNotebookEvent, setOldSelection, 1}},
+ {3403, {wxNotebookEvent, setSelection, 1}},
+ {3404, {wxFileDataObject, new, 0}},
+ {3405, {wxFileDataObject, addFile, 1}},
+ {3406, {wxFileDataObject, getFilenames, 0}},
+ {3407, {wxFileDataObject, 'Destroy', undefined}},
+ {3408, {wxTextDataObject, new, 1}},
+ {3409, {wxTextDataObject, getTextLength, 0}},
+ {3410, {wxTextDataObject, getText, 0}},
+ {3411, {wxTextDataObject, setText, 1}},
+ {3412, {wxTextDataObject, 'Destroy', undefined}},
+ {3413, {wxBitmapDataObject, new_1_1, 1}},
+ {3414, {wxBitmapDataObject, new_1_0, 1}},
+ {3415, {wxBitmapDataObject, getBitmap, 0}},
+ {3416, {wxBitmapDataObject, setBitmap, 1}},
+ {3417, {wxBitmapDataObject, 'Destroy', undefined}},
+ {3419, {wxClipboard, new, 0}},
+ {3420, {wxClipboard, destruct, 0}},
+ {3421, {wxClipboard, addData, 1}},
+ {3422, {wxClipboard, clear, 0}},
+ {3423, {wxClipboard, close, 0}},
+ {3424, {wxClipboard, flush, 0}},
+ {3425, {wxClipboard, getData, 1}},
+ {3426, {wxClipboard, isOpened, 0}},
+ {3427, {wxClipboard, open, 0}},
+ {3428, {wxClipboard, setData, 1}},
+ {3430, {wxClipboard, usePrimarySelection, 1}},
+ {3431, {wxClipboard, isSupported, 1}},
+ {3432, {wxClipboard, get, 0}},
+ {3433, {wxSpinEvent, getPosition, 0}},
+ {3434, {wxSpinEvent, setPosition, 1}},
+ {3435, {wxSplitterWindow, new_0, 0}},
+ {3436, {wxSplitterWindow, new_2, 2}},
+ {3437, {wxSplitterWindow, destruct, 0}},
+ {3438, {wxSplitterWindow, create, 2}},
+ {3439, {wxSplitterWindow, getMinimumPaneSize, 0}},
+ {3440, {wxSplitterWindow, getSashGravity, 0}},
+ {3441, {wxSplitterWindow, getSashPosition, 0}},
+ {3442, {wxSplitterWindow, getSplitMode, 0}},
+ {3443, {wxSplitterWindow, getWindow1, 0}},
+ {3444, {wxSplitterWindow, getWindow2, 0}},
+ {3445, {wxSplitterWindow, initialize, 1}},
+ {3446, {wxSplitterWindow, isSplit, 0}},
+ {3447, {wxSplitterWindow, replaceWindow, 2}},
+ {3448, {wxSplitterWindow, setSashGravity, 1}},
+ {3449, {wxSplitterWindow, setSashPosition, 2}},
+ {3450, {wxSplitterWindow, setSashSize, 1}},
+ {3451, {wxSplitterWindow, setMinimumPaneSize, 1}},
+ {3452, {wxSplitterWindow, setSplitMode, 1}},
+ {3453, {wxSplitterWindow, splitHorizontally, 3}},
+ {3454, {wxSplitterWindow, splitVertically, 3}},
+ {3455, {wxSplitterWindow, unsplit, 1}},
+ {3456, {wxSplitterWindow, updateSize, 0}},
+ {3457, {wxSplitterEvent, getSashPosition, 0}},
+ {3458, {wxSplitterEvent, getX, 0}},
+ {3459, {wxSplitterEvent, getY, 0}},
+ {3460, {wxSplitterEvent, getWindowBeingRemoved, 0}},
+ {3461, {wxSplitterEvent, setSashPosition, 1}},
+ {3462, {wxHtmlWindow, new_0, 0}},
+ {3463, {wxHtmlWindow, new_2, 2}},
+ {3464, {wxHtmlWindow, appendToPage, 1}},
+ {3465, {wxHtmlWindow, getOpenedAnchor, 0}},
+ {3466, {wxHtmlWindow, getOpenedPage, 0}},
+ {3467, {wxHtmlWindow, getOpenedPageTitle, 0}},
+ {3468, {wxHtmlWindow, getRelatedFrame, 0}},
+ {3469, {wxHtmlWindow, historyBack, 0}},
+ {3470, {wxHtmlWindow, historyCanBack, 0}},
+ {3471, {wxHtmlWindow, historyCanForward, 0}},
+ {3472, {wxHtmlWindow, historyClear, 0}},
+ {3473, {wxHtmlWindow, historyForward, 0}},
+ {3474, {wxHtmlWindow, loadFile, 1}},
+ {3475, {wxHtmlWindow, loadPage, 1}},
+ {3476, {wxHtmlWindow, selectAll, 0}},
+ {3477, {wxHtmlWindow, selectionToText, 0}},
+ {3478, {wxHtmlWindow, selectLine, 1}},
+ {3479, {wxHtmlWindow, selectWord, 1}},
+ {3480, {wxHtmlWindow, setBorders, 1}},
+ {3481, {wxHtmlWindow, setFonts, 3}},
+ {3482, {wxHtmlWindow, setPage, 1}},
+ {3483, {wxHtmlWindow, setRelatedFrame, 2}},
+ {3484, {wxHtmlWindow, setRelatedStatusBar, 1}},
+ {3485, {wxHtmlWindow, toText, 0}},
+ {3486, {wxHtmlWindow, 'Destroy', undefined}},
+ {3487, {wxHtmlLinkEvent, getLinkInfo, 0}},
+ {3488, {wxSystemSettings, getColour, 1}},
+ {3489, {wxSystemSettings, getFont, 1}},
+ {3490, {wxSystemSettings, getMetric, 2}},
+ {3491, {wxSystemSettings, getScreenType, 0}},
+ {3492, {wxAuiNotebookEvent, setSelection, 1}},
+ {3493, {wxAuiNotebookEvent, getSelection, 0}},
+ {3494, {wxAuiNotebookEvent, setOldSelection, 1}},
+ {3495, {wxAuiNotebookEvent, getOldSelection, 0}},
+ {3496, {wxAuiNotebookEvent, setDragSource, 1}},
+ {3497, {wxAuiNotebookEvent, getDragSource, 0}},
+ {3498, {wxAuiManagerEvent, setManager, 1}},
+ {3499, {wxAuiManagerEvent, getManager, 0}},
+ {3500, {wxAuiManagerEvent, setPane, 1}},
+ {3501, {wxAuiManagerEvent, getPane, 0}},
+ {3502, {wxAuiManagerEvent, setButton, 1}},
+ {3503, {wxAuiManagerEvent, getButton, 0}},
+ {3504, {wxAuiManagerEvent, setDC, 1}},
+ {3505, {wxAuiManagerEvent, getDC, 0}},
+ {3506, {wxAuiManagerEvent, veto, 1}},
+ {3507, {wxAuiManagerEvent, getVeto, 0}},
+ {3508, {wxAuiManagerEvent, setCanVeto, 1}},
+ {3509, {wxAuiManagerEvent, canVeto, 0}},
+ {3510, {wxLogNull, new, 0}},
+ {3511, {wxLogNull, 'Destroy', undefined}},
{-1, {mod, func, -1}}
].
diff --git a/lib/wx/src/gen/wxe_funcs.hrl b/lib/wx/src/gen/wxe_funcs.hrl
index cf672644c6..af74caaa25 100644
--- a/lib/wx/src/gen/wxe_funcs.hrl
+++ b/lib/wx/src/gen/wxe_funcs.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2008-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -1600,1681 +1600,1693 @@
-define(wxListItem_SetText, 1754).
-define(wxListItem_SetTextColour, 1755).
-define(wxListItem_SetWidth, 1756).
--define(wxImageList_new_0, 1757).
--define(wxImageList_new_3, 1758).
--define(wxImageList_Add_1, 1759).
--define(wxImageList_Add_2_0, 1760).
--define(wxImageList_Add_2_1, 1761).
--define(wxImageList_Create, 1762).
--define(wxImageList_Draw, 1764).
--define(wxImageList_GetBitmap, 1765).
--define(wxImageList_GetIcon, 1766).
--define(wxImageList_GetImageCount, 1767).
--define(wxImageList_GetSize, 1768).
--define(wxImageList_Remove, 1769).
--define(wxImageList_RemoveAll, 1770).
--define(wxImageList_Replace_2, 1771).
--define(wxImageList_Replace_3, 1772).
--define(wxImageList_destroy, 1773).
--define(wxTextAttr_new_0, 1774).
--define(wxTextAttr_new_2, 1775).
--define(wxTextAttr_GetAlignment, 1776).
--define(wxTextAttr_GetBackgroundColour, 1777).
--define(wxTextAttr_GetFont, 1778).
--define(wxTextAttr_GetLeftIndent, 1779).
--define(wxTextAttr_GetLeftSubIndent, 1780).
--define(wxTextAttr_GetRightIndent, 1781).
--define(wxTextAttr_GetTabs, 1782).
--define(wxTextAttr_GetTextColour, 1783).
--define(wxTextAttr_HasBackgroundColour, 1784).
--define(wxTextAttr_HasFont, 1785).
--define(wxTextAttr_HasTextColour, 1786).
--define(wxTextAttr_GetFlags, 1787).
--define(wxTextAttr_IsDefault, 1788).
--define(wxTextAttr_SetAlignment, 1789).
--define(wxTextAttr_SetBackgroundColour, 1790).
--define(wxTextAttr_SetFlags, 1791).
--define(wxTextAttr_SetFont, 1792).
--define(wxTextAttr_SetLeftIndent, 1793).
--define(wxTextAttr_SetRightIndent, 1794).
--define(wxTextAttr_SetTabs, 1795).
--define(wxTextAttr_SetTextColour, 1796).
--define(wxTextAttr_destroy, 1797).
--define(wxTextCtrl_new_3, 1799).
--define(wxTextCtrl_new_0, 1800).
--define(wxTextCtrl_destruct, 1802).
--define(wxTextCtrl_AppendText, 1803).
--define(wxTextCtrl_CanCopy, 1804).
--define(wxTextCtrl_CanCut, 1805).
--define(wxTextCtrl_CanPaste, 1806).
--define(wxTextCtrl_CanRedo, 1807).
--define(wxTextCtrl_CanUndo, 1808).
--define(wxTextCtrl_Clear, 1809).
--define(wxTextCtrl_Copy, 1810).
--define(wxTextCtrl_Create, 1811).
--define(wxTextCtrl_Cut, 1812).
--define(wxTextCtrl_DiscardEdits, 1813).
--define(wxTextCtrl_EmulateKeyPress, 1814).
--define(wxTextCtrl_GetDefaultStyle, 1815).
--define(wxTextCtrl_GetInsertionPoint, 1816).
--define(wxTextCtrl_GetLastPosition, 1817).
--define(wxTextCtrl_GetLineLength, 1818).
--define(wxTextCtrl_GetLineText, 1819).
--define(wxTextCtrl_GetNumberOfLines, 1820).
--define(wxTextCtrl_GetRange, 1821).
--define(wxTextCtrl_GetSelection, 1822).
--define(wxTextCtrl_GetStringSelection, 1823).
--define(wxTextCtrl_GetStyle, 1824).
--define(wxTextCtrl_GetValue, 1825).
--define(wxTextCtrl_IsEditable, 1826).
--define(wxTextCtrl_IsModified, 1827).
--define(wxTextCtrl_IsMultiLine, 1828).
--define(wxTextCtrl_IsSingleLine, 1829).
--define(wxTextCtrl_LoadFile, 1830).
--define(wxTextCtrl_MarkDirty, 1831).
--define(wxTextCtrl_Paste, 1832).
--define(wxTextCtrl_PositionToXY, 1833).
--define(wxTextCtrl_Redo, 1834).
--define(wxTextCtrl_Remove, 1835).
--define(wxTextCtrl_Replace, 1836).
--define(wxTextCtrl_SaveFile, 1837).
--define(wxTextCtrl_SetDefaultStyle, 1838).
--define(wxTextCtrl_SetEditable, 1839).
--define(wxTextCtrl_SetInsertionPoint, 1840).
--define(wxTextCtrl_SetInsertionPointEnd, 1841).
--define(wxTextCtrl_SetMaxLength, 1843).
--define(wxTextCtrl_SetSelection, 1844).
--define(wxTextCtrl_SetStyle, 1845).
--define(wxTextCtrl_SetValue, 1846).
--define(wxTextCtrl_ShowPosition, 1847).
--define(wxTextCtrl_Undo, 1848).
--define(wxTextCtrl_WriteText, 1849).
--define(wxTextCtrl_XYToPosition, 1850).
--define(wxNotebook_new_0, 1853).
--define(wxNotebook_new_3, 1854).
--define(wxNotebook_destruct, 1855).
--define(wxNotebook_AddPage, 1856).
--define(wxNotebook_AdvanceSelection, 1857).
--define(wxNotebook_AssignImageList, 1858).
--define(wxNotebook_Create, 1859).
--define(wxNotebook_DeleteAllPages, 1860).
--define(wxNotebook_DeletePage, 1861).
--define(wxNotebook_RemovePage, 1862).
--define(wxNotebook_GetCurrentPage, 1863).
--define(wxNotebook_GetImageList, 1864).
--define(wxNotebook_GetPage, 1866).
--define(wxNotebook_GetPageCount, 1867).
--define(wxNotebook_GetPageImage, 1868).
--define(wxNotebook_GetPageText, 1869).
--define(wxNotebook_GetRowCount, 1870).
--define(wxNotebook_GetSelection, 1871).
--define(wxNotebook_GetThemeBackgroundColour, 1872).
--define(wxNotebook_HitTest, 1874).
--define(wxNotebook_InsertPage, 1876).
--define(wxNotebook_SetImageList, 1877).
--define(wxNotebook_SetPadding, 1878).
--define(wxNotebook_SetPageSize, 1879).
--define(wxNotebook_SetPageImage, 1880).
--define(wxNotebook_SetPageText, 1881).
--define(wxNotebook_SetSelection, 1882).
--define(wxNotebook_ChangeSelection, 1883).
--define(wxChoicebook_new_0, 1884).
--define(wxChoicebook_new_3, 1885).
--define(wxChoicebook_AddPage, 1886).
--define(wxChoicebook_AdvanceSelection, 1887).
--define(wxChoicebook_AssignImageList, 1888).
--define(wxChoicebook_Create, 1889).
--define(wxChoicebook_DeleteAllPages, 1890).
--define(wxChoicebook_DeletePage, 1891).
--define(wxChoicebook_RemovePage, 1892).
--define(wxChoicebook_GetCurrentPage, 1893).
--define(wxChoicebook_GetImageList, 1894).
--define(wxChoicebook_GetPage, 1896).
--define(wxChoicebook_GetPageCount, 1897).
--define(wxChoicebook_GetPageImage, 1898).
--define(wxChoicebook_GetPageText, 1899).
--define(wxChoicebook_GetSelection, 1900).
--define(wxChoicebook_HitTest, 1901).
--define(wxChoicebook_InsertPage, 1902).
--define(wxChoicebook_SetImageList, 1903).
--define(wxChoicebook_SetPageSize, 1904).
--define(wxChoicebook_SetPageImage, 1905).
--define(wxChoicebook_SetPageText, 1906).
--define(wxChoicebook_SetSelection, 1907).
--define(wxChoicebook_ChangeSelection, 1908).
--define(wxChoicebook_destroy, 1909).
--define(wxToolbook_new_0, 1910).
--define(wxToolbook_new_3, 1911).
--define(wxToolbook_AddPage, 1912).
--define(wxToolbook_AdvanceSelection, 1913).
--define(wxToolbook_AssignImageList, 1914).
--define(wxToolbook_Create, 1915).
--define(wxToolbook_DeleteAllPages, 1916).
--define(wxToolbook_DeletePage, 1917).
--define(wxToolbook_RemovePage, 1918).
--define(wxToolbook_GetCurrentPage, 1919).
--define(wxToolbook_GetImageList, 1920).
--define(wxToolbook_GetPage, 1922).
--define(wxToolbook_GetPageCount, 1923).
--define(wxToolbook_GetPageImage, 1924).
--define(wxToolbook_GetPageText, 1925).
--define(wxToolbook_GetSelection, 1926).
--define(wxToolbook_HitTest, 1928).
--define(wxToolbook_InsertPage, 1929).
--define(wxToolbook_SetImageList, 1930).
--define(wxToolbook_SetPageSize, 1931).
--define(wxToolbook_SetPageImage, 1932).
--define(wxToolbook_SetPageText, 1933).
--define(wxToolbook_SetSelection, 1934).
--define(wxToolbook_ChangeSelection, 1935).
--define(wxToolbook_destroy, 1936).
--define(wxListbook_new_0, 1937).
--define(wxListbook_new_3, 1938).
--define(wxListbook_AddPage, 1939).
--define(wxListbook_AdvanceSelection, 1940).
--define(wxListbook_AssignImageList, 1941).
--define(wxListbook_Create, 1942).
--define(wxListbook_DeleteAllPages, 1943).
--define(wxListbook_DeletePage, 1944).
--define(wxListbook_RemovePage, 1945).
--define(wxListbook_GetCurrentPage, 1946).
--define(wxListbook_GetImageList, 1947).
--define(wxListbook_GetPage, 1949).
--define(wxListbook_GetPageCount, 1950).
--define(wxListbook_GetPageImage, 1951).
--define(wxListbook_GetPageText, 1952).
--define(wxListbook_GetSelection, 1953).
--define(wxListbook_HitTest, 1955).
--define(wxListbook_InsertPage, 1956).
--define(wxListbook_SetImageList, 1957).
--define(wxListbook_SetPageSize, 1958).
--define(wxListbook_SetPageImage, 1959).
--define(wxListbook_SetPageText, 1960).
--define(wxListbook_SetSelection, 1961).
--define(wxListbook_ChangeSelection, 1962).
--define(wxListbook_destroy, 1963).
--define(wxTreebook_new_0, 1964).
--define(wxTreebook_new_3, 1965).
--define(wxTreebook_AddPage, 1966).
--define(wxTreebook_AdvanceSelection, 1967).
--define(wxTreebook_AssignImageList, 1968).
--define(wxTreebook_Create, 1969).
--define(wxTreebook_DeleteAllPages, 1970).
--define(wxTreebook_DeletePage, 1971).
--define(wxTreebook_RemovePage, 1972).
--define(wxTreebook_GetCurrentPage, 1973).
--define(wxTreebook_GetImageList, 1974).
--define(wxTreebook_GetPage, 1976).
--define(wxTreebook_GetPageCount, 1977).
--define(wxTreebook_GetPageImage, 1978).
--define(wxTreebook_GetPageText, 1979).
--define(wxTreebook_GetSelection, 1980).
--define(wxTreebook_ExpandNode, 1981).
--define(wxTreebook_IsNodeExpanded, 1982).
--define(wxTreebook_HitTest, 1984).
--define(wxTreebook_InsertPage, 1985).
--define(wxTreebook_InsertSubPage, 1986).
--define(wxTreebook_SetImageList, 1987).
--define(wxTreebook_SetPageSize, 1988).
--define(wxTreebook_SetPageImage, 1989).
--define(wxTreebook_SetPageText, 1990).
--define(wxTreebook_SetSelection, 1991).
--define(wxTreebook_ChangeSelection, 1992).
--define(wxTreebook_destroy, 1993).
--define(wxTreeCtrl_new_2, 1996).
--define(wxTreeCtrl_new_0, 1997).
--define(wxTreeCtrl_destruct, 1999).
--define(wxTreeCtrl_AddRoot, 2000).
--define(wxTreeCtrl_AppendItem, 2001).
--define(wxTreeCtrl_AssignImageList, 2002).
--define(wxTreeCtrl_AssignStateImageList, 2003).
--define(wxTreeCtrl_Collapse, 2004).
--define(wxTreeCtrl_CollapseAndReset, 2005).
--define(wxTreeCtrl_Create, 2006).
--define(wxTreeCtrl_Delete, 2007).
--define(wxTreeCtrl_DeleteAllItems, 2008).
--define(wxTreeCtrl_DeleteChildren, 2009).
--define(wxTreeCtrl_EditLabel, 2010).
--define(wxTreeCtrl_EnsureVisible, 2011).
--define(wxTreeCtrl_Expand, 2012).
--define(wxTreeCtrl_GetBoundingRect, 2013).
--define(wxTreeCtrl_GetChildrenCount, 2015).
--define(wxTreeCtrl_GetCount, 2016).
--define(wxTreeCtrl_GetEditControl, 2017).
--define(wxTreeCtrl_GetFirstChild, 2018).
--define(wxTreeCtrl_GetNextChild, 2019).
--define(wxTreeCtrl_GetFirstVisibleItem, 2020).
--define(wxTreeCtrl_GetImageList, 2021).
--define(wxTreeCtrl_GetIndent, 2022).
--define(wxTreeCtrl_GetItemBackgroundColour, 2023).
--define(wxTreeCtrl_GetItemData, 2024).
--define(wxTreeCtrl_GetItemFont, 2025).
--define(wxTreeCtrl_GetItemImage_1, 2026).
--define(wxTreeCtrl_GetItemImage_2, 2027).
--define(wxTreeCtrl_GetItemText, 2028).
--define(wxTreeCtrl_GetItemTextColour, 2029).
--define(wxTreeCtrl_GetLastChild, 2030).
--define(wxTreeCtrl_GetNextSibling, 2031).
--define(wxTreeCtrl_GetNextVisible, 2032).
--define(wxTreeCtrl_GetItemParent, 2033).
--define(wxTreeCtrl_GetPrevSibling, 2034).
--define(wxTreeCtrl_GetPrevVisible, 2035).
--define(wxTreeCtrl_GetRootItem, 2036).
--define(wxTreeCtrl_GetSelection, 2037).
--define(wxTreeCtrl_GetSelections, 2038).
--define(wxTreeCtrl_GetStateImageList, 2039).
--define(wxTreeCtrl_HitTest, 2040).
--define(wxTreeCtrl_InsertItem, 2042).
--define(wxTreeCtrl_IsBold, 2043).
--define(wxTreeCtrl_IsExpanded, 2044).
--define(wxTreeCtrl_IsSelected, 2045).
--define(wxTreeCtrl_IsVisible, 2046).
--define(wxTreeCtrl_ItemHasChildren, 2047).
--define(wxTreeCtrl_PrependItem, 2048).
--define(wxTreeCtrl_ScrollTo, 2049).
--define(wxTreeCtrl_SelectItem_1, 2050).
--define(wxTreeCtrl_SelectItem_2, 2051).
--define(wxTreeCtrl_SetIndent, 2052).
--define(wxTreeCtrl_SetImageList, 2053).
--define(wxTreeCtrl_SetItemBackgroundColour, 2054).
--define(wxTreeCtrl_SetItemBold, 2055).
--define(wxTreeCtrl_SetItemData, 2056).
--define(wxTreeCtrl_SetItemDropHighlight, 2057).
--define(wxTreeCtrl_SetItemFont, 2058).
--define(wxTreeCtrl_SetItemHasChildren, 2059).
--define(wxTreeCtrl_SetItemImage_2, 2060).
--define(wxTreeCtrl_SetItemImage_3, 2061).
--define(wxTreeCtrl_SetItemText, 2062).
--define(wxTreeCtrl_SetItemTextColour, 2063).
--define(wxTreeCtrl_SetStateImageList, 2064).
--define(wxTreeCtrl_SetWindowStyle, 2065).
--define(wxTreeCtrl_SortChildren, 2066).
--define(wxTreeCtrl_Toggle, 2067).
--define(wxTreeCtrl_ToggleItemSelection, 2068).
--define(wxTreeCtrl_Unselect, 2069).
--define(wxTreeCtrl_UnselectAll, 2070).
--define(wxTreeCtrl_UnselectItem, 2071).
--define(wxScrollBar_new_0, 2072).
--define(wxScrollBar_new_3, 2073).
--define(wxScrollBar_destruct, 2074).
--define(wxScrollBar_Create, 2075).
--define(wxScrollBar_GetRange, 2076).
--define(wxScrollBar_GetPageSize, 2077).
--define(wxScrollBar_GetThumbPosition, 2078).
--define(wxScrollBar_GetThumbSize, 2079).
--define(wxScrollBar_SetThumbPosition, 2080).
--define(wxScrollBar_SetScrollbar, 2081).
--define(wxSpinButton_new_2, 2083).
--define(wxSpinButton_new_0, 2084).
--define(wxSpinButton_Create, 2085).
--define(wxSpinButton_GetMax, 2086).
--define(wxSpinButton_GetMin, 2087).
--define(wxSpinButton_GetValue, 2088).
--define(wxSpinButton_SetRange, 2089).
--define(wxSpinButton_SetValue, 2090).
--define(wxSpinButton_destroy, 2091).
--define(wxSpinCtrl_new_0, 2092).
--define(wxSpinCtrl_new_2, 2093).
--define(wxSpinCtrl_Create, 2095).
--define(wxSpinCtrl_SetValue_1_1, 2098).
--define(wxSpinCtrl_SetValue_1_0, 2099).
--define(wxSpinCtrl_GetValue, 2101).
--define(wxSpinCtrl_SetRange, 2103).
--define(wxSpinCtrl_SetSelection, 2104).
--define(wxSpinCtrl_GetMin, 2106).
--define(wxSpinCtrl_GetMax, 2108).
--define(wxSpinCtrl_destroy, 2109).
--define(wxStaticText_new_0, 2110).
--define(wxStaticText_new_4, 2111).
--define(wxStaticText_Create, 2112).
--define(wxStaticText_GetLabel, 2113).
--define(wxStaticText_SetLabel, 2114).
--define(wxStaticText_Wrap, 2115).
--define(wxStaticText_destroy, 2116).
--define(wxStaticBitmap_new_0, 2117).
--define(wxStaticBitmap_new_4, 2118).
--define(wxStaticBitmap_Create, 2119).
--define(wxStaticBitmap_GetBitmap, 2120).
--define(wxStaticBitmap_SetBitmap, 2121).
--define(wxStaticBitmap_destroy, 2122).
--define(wxRadioBox_new, 2123).
--define(wxRadioBox_destruct, 2125).
--define(wxRadioBox_Create, 2126).
--define(wxRadioBox_Enable_2, 2127).
--define(wxRadioBox_Enable_1, 2128).
--define(wxRadioBox_GetSelection, 2129).
--define(wxRadioBox_GetString, 2130).
--define(wxRadioBox_SetSelection, 2131).
--define(wxRadioBox_Show_2, 2132).
--define(wxRadioBox_Show_1, 2133).
--define(wxRadioBox_GetColumnCount, 2134).
--define(wxRadioBox_GetItemHelpText, 2135).
--define(wxRadioBox_GetItemToolTip, 2136).
--define(wxRadioBox_GetItemFromPoint, 2138).
--define(wxRadioBox_GetRowCount, 2139).
--define(wxRadioBox_IsItemEnabled, 2140).
--define(wxRadioBox_IsItemShown, 2141).
--define(wxRadioBox_SetItemHelpText, 2142).
--define(wxRadioBox_SetItemToolTip, 2143).
--define(wxRadioButton_new_0, 2144).
--define(wxRadioButton_new_4, 2145).
--define(wxRadioButton_Create, 2146).
--define(wxRadioButton_GetValue, 2147).
--define(wxRadioButton_SetValue, 2148).
--define(wxRadioButton_destroy, 2149).
--define(wxSlider_new_6, 2151).
--define(wxSlider_new_0, 2152).
--define(wxSlider_Create, 2153).
--define(wxSlider_GetLineSize, 2154).
--define(wxSlider_GetMax, 2155).
--define(wxSlider_GetMin, 2156).
--define(wxSlider_GetPageSize, 2157).
--define(wxSlider_GetThumbLength, 2158).
--define(wxSlider_GetValue, 2159).
--define(wxSlider_SetLineSize, 2160).
--define(wxSlider_SetPageSize, 2161).
--define(wxSlider_SetRange, 2162).
--define(wxSlider_SetThumbLength, 2163).
--define(wxSlider_SetValue, 2164).
--define(wxSlider_destroy, 2165).
--define(wxDialog_new_4, 2167).
--define(wxDialog_new_0, 2168).
--define(wxDialog_destruct, 2170).
--define(wxDialog_Create, 2171).
--define(wxDialog_CreateButtonSizer, 2172).
--define(wxDialog_CreateStdDialogButtonSizer, 2173).
--define(wxDialog_EndModal, 2174).
--define(wxDialog_GetAffirmativeId, 2175).
--define(wxDialog_GetReturnCode, 2176).
--define(wxDialog_IsModal, 2177).
--define(wxDialog_SetAffirmativeId, 2178).
--define(wxDialog_SetReturnCode, 2179).
--define(wxDialog_Show, 2180).
--define(wxDialog_ShowModal, 2181).
--define(wxColourDialog_new_0, 2182).
--define(wxColourDialog_new_2, 2183).
--define(wxColourDialog_destruct, 2184).
--define(wxColourDialog_Create, 2185).
--define(wxColourDialog_GetColourData, 2186).
--define(wxColourData_new_0, 2187).
--define(wxColourData_new_1, 2188).
--define(wxColourData_destruct, 2189).
--define(wxColourData_GetChooseFull, 2190).
--define(wxColourData_GetColour, 2191).
--define(wxColourData_GetCustomColour, 2193).
--define(wxColourData_SetChooseFull, 2194).
--define(wxColourData_SetColour, 2195).
--define(wxColourData_SetCustomColour, 2196).
--define(wxPalette_new_0, 2197).
--define(wxPalette_new_4, 2198).
--define(wxPalette_destruct, 2200).
--define(wxPalette_Create, 2201).
--define(wxPalette_GetColoursCount, 2202).
--define(wxPalette_GetPixel, 2203).
--define(wxPalette_GetRGB, 2204).
--define(wxPalette_IsOk, 2205).
--define(wxDirDialog_new, 2209).
--define(wxDirDialog_destruct, 2210).
--define(wxDirDialog_GetPath, 2211).
--define(wxDirDialog_GetMessage, 2212).
--define(wxDirDialog_SetMessage, 2213).
--define(wxDirDialog_SetPath, 2214).
--define(wxFileDialog_new, 2218).
--define(wxFileDialog_destruct, 2219).
--define(wxFileDialog_GetDirectory, 2220).
--define(wxFileDialog_GetFilename, 2221).
--define(wxFileDialog_GetFilenames, 2222).
--define(wxFileDialog_GetFilterIndex, 2223).
--define(wxFileDialog_GetMessage, 2224).
--define(wxFileDialog_GetPath, 2225).
--define(wxFileDialog_GetPaths, 2226).
--define(wxFileDialog_GetWildcard, 2227).
--define(wxFileDialog_SetDirectory, 2228).
--define(wxFileDialog_SetFilename, 2229).
--define(wxFileDialog_SetFilterIndex, 2230).
--define(wxFileDialog_SetMessage, 2231).
--define(wxFileDialog_SetPath, 2232).
--define(wxFileDialog_SetWildcard, 2233).
--define(wxPickerBase_SetInternalMargin, 2234).
--define(wxPickerBase_GetInternalMargin, 2235).
--define(wxPickerBase_SetTextCtrlProportion, 2236).
--define(wxPickerBase_SetPickerCtrlProportion, 2237).
--define(wxPickerBase_GetTextCtrlProportion, 2238).
--define(wxPickerBase_GetPickerCtrlProportion, 2239).
--define(wxPickerBase_HasTextCtrl, 2240).
--define(wxPickerBase_GetTextCtrl, 2241).
--define(wxPickerBase_IsTextCtrlGrowable, 2242).
--define(wxPickerBase_SetPickerCtrlGrowable, 2243).
--define(wxPickerBase_SetTextCtrlGrowable, 2244).
--define(wxPickerBase_IsPickerCtrlGrowable, 2245).
--define(wxFilePickerCtrl_new_0, 2246).
--define(wxFilePickerCtrl_new_3, 2247).
--define(wxFilePickerCtrl_Create, 2248).
--define(wxFilePickerCtrl_GetPath, 2249).
--define(wxFilePickerCtrl_SetPath, 2250).
--define(wxFilePickerCtrl_destroy, 2251).
--define(wxDirPickerCtrl_new_0, 2252).
--define(wxDirPickerCtrl_new_3, 2253).
--define(wxDirPickerCtrl_Create, 2254).
--define(wxDirPickerCtrl_GetPath, 2255).
--define(wxDirPickerCtrl_SetPath, 2256).
--define(wxDirPickerCtrl_destroy, 2257).
--define(wxColourPickerCtrl_new_0, 2258).
--define(wxColourPickerCtrl_new_3, 2259).
--define(wxColourPickerCtrl_Create, 2260).
--define(wxColourPickerCtrl_GetColour, 2261).
--define(wxColourPickerCtrl_SetColour_1_1, 2262).
--define(wxColourPickerCtrl_SetColour_1_0, 2263).
--define(wxColourPickerCtrl_destroy, 2264).
--define(wxDatePickerCtrl_new_0, 2265).
--define(wxDatePickerCtrl_new_3, 2266).
--define(wxDatePickerCtrl_GetRange, 2267).
--define(wxDatePickerCtrl_GetValue, 2268).
--define(wxDatePickerCtrl_SetRange, 2269).
--define(wxDatePickerCtrl_SetValue, 2270).
--define(wxDatePickerCtrl_destroy, 2271).
--define(wxFontPickerCtrl_new_0, 2272).
--define(wxFontPickerCtrl_new_3, 2273).
--define(wxFontPickerCtrl_Create, 2274).
--define(wxFontPickerCtrl_GetSelectedFont, 2275).
--define(wxFontPickerCtrl_SetSelectedFont, 2276).
--define(wxFontPickerCtrl_GetMaxPointSize, 2277).
--define(wxFontPickerCtrl_SetMaxPointSize, 2278).
--define(wxFontPickerCtrl_destroy, 2279).
--define(wxFindReplaceDialog_new_0, 2282).
--define(wxFindReplaceDialog_new_4, 2283).
--define(wxFindReplaceDialog_destruct, 2284).
--define(wxFindReplaceDialog_Create, 2285).
--define(wxFindReplaceDialog_GetData, 2286).
--define(wxFindReplaceData_new_0, 2287).
--define(wxFindReplaceData_new_1, 2288).
--define(wxFindReplaceData_GetFindString, 2289).
--define(wxFindReplaceData_GetReplaceString, 2290).
--define(wxFindReplaceData_GetFlags, 2291).
--define(wxFindReplaceData_SetFlags, 2292).
--define(wxFindReplaceData_SetFindString, 2293).
--define(wxFindReplaceData_SetReplaceString, 2294).
--define(wxFindReplaceData_destroy, 2295).
--define(wxMultiChoiceDialog_new_0, 2296).
--define(wxMultiChoiceDialog_new_5, 2298).
--define(wxMultiChoiceDialog_GetSelections, 2299).
--define(wxMultiChoiceDialog_SetSelections, 2300).
--define(wxMultiChoiceDialog_destroy, 2301).
--define(wxSingleChoiceDialog_new_0, 2302).
--define(wxSingleChoiceDialog_new_5, 2304).
--define(wxSingleChoiceDialog_GetSelection, 2305).
--define(wxSingleChoiceDialog_GetStringSelection, 2306).
--define(wxSingleChoiceDialog_SetSelection, 2307).
--define(wxSingleChoiceDialog_destroy, 2308).
--define(wxTextEntryDialog_new, 2309).
--define(wxTextEntryDialog_GetValue, 2310).
--define(wxTextEntryDialog_SetValue, 2311).
--define(wxTextEntryDialog_destroy, 2312).
--define(wxPasswordEntryDialog_new, 2313).
--define(wxPasswordEntryDialog_destroy, 2314).
--define(wxFontData_new_0, 2315).
--define(wxFontData_new_1, 2316).
--define(wxFontData_destruct, 2317).
--define(wxFontData_EnableEffects, 2318).
--define(wxFontData_GetAllowSymbols, 2319).
--define(wxFontData_GetColour, 2320).
--define(wxFontData_GetChosenFont, 2321).
--define(wxFontData_GetEnableEffects, 2322).
--define(wxFontData_GetInitialFont, 2323).
--define(wxFontData_GetShowHelp, 2324).
--define(wxFontData_SetAllowSymbols, 2325).
--define(wxFontData_SetChosenFont, 2326).
--define(wxFontData_SetColour, 2327).
--define(wxFontData_SetInitialFont, 2328).
--define(wxFontData_SetRange, 2329).
--define(wxFontData_SetShowHelp, 2330).
--define(wxFontDialog_new_0, 2334).
--define(wxFontDialog_new_2, 2336).
--define(wxFontDialog_Create, 2338).
--define(wxFontDialog_GetFontData, 2339).
--define(wxFontDialog_destroy, 2341).
--define(wxProgressDialog_new, 2342).
--define(wxProgressDialog_destruct, 2343).
--define(wxProgressDialog_Resume, 2344).
--define(wxProgressDialog_Update_2, 2345).
--define(wxProgressDialog_Update_0, 2346).
--define(wxMessageDialog_new, 2347).
--define(wxMessageDialog_destruct, 2348).
--define(wxPageSetupDialog_new, 2349).
--define(wxPageSetupDialog_destruct, 2350).
--define(wxPageSetupDialog_GetPageSetupData, 2351).
--define(wxPageSetupDialog_ShowModal, 2352).
--define(wxPageSetupDialogData_new_0, 2353).
--define(wxPageSetupDialogData_new_1_0, 2354).
--define(wxPageSetupDialogData_new_1_1, 2355).
--define(wxPageSetupDialogData_destruct, 2356).
--define(wxPageSetupDialogData_EnableHelp, 2357).
--define(wxPageSetupDialogData_EnableMargins, 2358).
--define(wxPageSetupDialogData_EnableOrientation, 2359).
--define(wxPageSetupDialogData_EnablePaper, 2360).
--define(wxPageSetupDialogData_EnablePrinter, 2361).
--define(wxPageSetupDialogData_GetDefaultMinMargins, 2362).
--define(wxPageSetupDialogData_GetEnableMargins, 2363).
--define(wxPageSetupDialogData_GetEnableOrientation, 2364).
--define(wxPageSetupDialogData_GetEnablePaper, 2365).
--define(wxPageSetupDialogData_GetEnablePrinter, 2366).
--define(wxPageSetupDialogData_GetEnableHelp, 2367).
--define(wxPageSetupDialogData_GetDefaultInfo, 2368).
--define(wxPageSetupDialogData_GetMarginTopLeft, 2369).
--define(wxPageSetupDialogData_GetMarginBottomRight, 2370).
--define(wxPageSetupDialogData_GetMinMarginTopLeft, 2371).
--define(wxPageSetupDialogData_GetMinMarginBottomRight, 2372).
--define(wxPageSetupDialogData_GetPaperId, 2373).
--define(wxPageSetupDialogData_GetPaperSize, 2374).
--define(wxPageSetupDialogData_GetPrintData, 2376).
--define(wxPageSetupDialogData_IsOk, 2377).
--define(wxPageSetupDialogData_SetDefaultInfo, 2378).
--define(wxPageSetupDialogData_SetDefaultMinMargins, 2379).
--define(wxPageSetupDialogData_SetMarginTopLeft, 2380).
--define(wxPageSetupDialogData_SetMarginBottomRight, 2381).
--define(wxPageSetupDialogData_SetMinMarginTopLeft, 2382).
--define(wxPageSetupDialogData_SetMinMarginBottomRight, 2383).
--define(wxPageSetupDialogData_SetPaperId, 2384).
--define(wxPageSetupDialogData_SetPaperSize_1_1, 2385).
--define(wxPageSetupDialogData_SetPaperSize_1_0, 2386).
--define(wxPageSetupDialogData_SetPrintData, 2387).
--define(wxPrintDialog_new_2_0, 2388).
--define(wxPrintDialog_new_2_1, 2389).
--define(wxPrintDialog_destruct, 2390).
--define(wxPrintDialog_GetPrintDialogData, 2391).
--define(wxPrintDialog_GetPrintDC, 2392).
--define(wxPrintDialogData_new_0, 2393).
--define(wxPrintDialogData_new_1_1, 2394).
--define(wxPrintDialogData_new_1_0, 2395).
--define(wxPrintDialogData_destruct, 2396).
--define(wxPrintDialogData_EnableHelp, 2397).
--define(wxPrintDialogData_EnablePageNumbers, 2398).
--define(wxPrintDialogData_EnablePrintToFile, 2399).
--define(wxPrintDialogData_EnableSelection, 2400).
--define(wxPrintDialogData_GetAllPages, 2401).
--define(wxPrintDialogData_GetCollate, 2402).
--define(wxPrintDialogData_GetFromPage, 2403).
--define(wxPrintDialogData_GetMaxPage, 2404).
--define(wxPrintDialogData_GetMinPage, 2405).
--define(wxPrintDialogData_GetNoCopies, 2406).
--define(wxPrintDialogData_GetPrintData, 2407).
--define(wxPrintDialogData_GetPrintToFile, 2408).
--define(wxPrintDialogData_GetSelection, 2409).
--define(wxPrintDialogData_GetToPage, 2410).
--define(wxPrintDialogData_IsOk, 2411).
--define(wxPrintDialogData_SetCollate, 2412).
--define(wxPrintDialogData_SetFromPage, 2413).
--define(wxPrintDialogData_SetMaxPage, 2414).
--define(wxPrintDialogData_SetMinPage, 2415).
--define(wxPrintDialogData_SetNoCopies, 2416).
--define(wxPrintDialogData_SetPrintData, 2417).
--define(wxPrintDialogData_SetPrintToFile, 2418).
--define(wxPrintDialogData_SetSelection, 2419).
--define(wxPrintDialogData_SetToPage, 2420).
--define(wxPrintData_new_0, 2421).
--define(wxPrintData_new_1, 2422).
--define(wxPrintData_destruct, 2423).
--define(wxPrintData_GetCollate, 2424).
--define(wxPrintData_GetBin, 2425).
--define(wxPrintData_GetColour, 2426).
--define(wxPrintData_GetDuplex, 2427).
--define(wxPrintData_GetNoCopies, 2428).
--define(wxPrintData_GetOrientation, 2429).
--define(wxPrintData_GetPaperId, 2430).
--define(wxPrintData_GetPrinterName, 2431).
--define(wxPrintData_GetQuality, 2432).
--define(wxPrintData_IsOk, 2433).
--define(wxPrintData_SetBin, 2434).
--define(wxPrintData_SetCollate, 2435).
--define(wxPrintData_SetColour, 2436).
--define(wxPrintData_SetDuplex, 2437).
--define(wxPrintData_SetNoCopies, 2438).
--define(wxPrintData_SetOrientation, 2439).
--define(wxPrintData_SetPaperId, 2440).
--define(wxPrintData_SetPrinterName, 2441).
--define(wxPrintData_SetQuality, 2442).
--define(wxPrintPreview_new_2, 2445).
--define(wxPrintPreview_new_3, 2446).
--define(wxPrintPreview_destruct, 2448).
--define(wxPrintPreview_GetCanvas, 2449).
--define(wxPrintPreview_GetCurrentPage, 2450).
--define(wxPrintPreview_GetFrame, 2451).
--define(wxPrintPreview_GetMaxPage, 2452).
--define(wxPrintPreview_GetMinPage, 2453).
--define(wxPrintPreview_GetPrintout, 2454).
--define(wxPrintPreview_GetPrintoutForPrinting, 2455).
--define(wxPrintPreview_IsOk, 2456).
--define(wxPrintPreview_PaintPage, 2457).
--define(wxPrintPreview_Print, 2458).
--define(wxPrintPreview_RenderPage, 2459).
--define(wxPrintPreview_SetCanvas, 2460).
--define(wxPrintPreview_SetCurrentPage, 2461).
--define(wxPrintPreview_SetFrame, 2462).
--define(wxPrintPreview_SetPrintout, 2463).
--define(wxPrintPreview_SetZoom, 2464).
--define(wxPreviewFrame_new, 2465).
--define(wxPreviewFrame_destruct, 2466).
--define(wxPreviewFrame_CreateControlBar, 2467).
--define(wxPreviewFrame_CreateCanvas, 2468).
--define(wxPreviewFrame_Initialize, 2469).
--define(wxPreviewFrame_OnCloseWindow, 2470).
--define(wxPreviewControlBar_new, 2471).
--define(wxPreviewControlBar_destruct, 2472).
--define(wxPreviewControlBar_CreateButtons, 2473).
--define(wxPreviewControlBar_GetPrintPreview, 2474).
--define(wxPreviewControlBar_GetZoomControl, 2475).
--define(wxPreviewControlBar_SetZoomControl, 2476).
--define(wxPrinter_new, 2478).
--define(wxPrinter_CreateAbortWindow, 2479).
--define(wxPrinter_GetAbort, 2480).
--define(wxPrinter_GetLastError, 2481).
--define(wxPrinter_GetPrintDialogData, 2482).
--define(wxPrinter_Print, 2483).
--define(wxPrinter_PrintDialog, 2484).
--define(wxPrinter_ReportError, 2485).
--define(wxPrinter_Setup, 2486).
--define(wxPrinter_destroy, 2487).
--define(wxXmlResource_new_1, 2488).
--define(wxXmlResource_new_2, 2489).
--define(wxXmlResource_destruct, 2490).
--define(wxXmlResource_AttachUnknownControl, 2491).
--define(wxXmlResource_ClearHandlers, 2492).
--define(wxXmlResource_CompareVersion, 2493).
--define(wxXmlResource_Get, 2494).
--define(wxXmlResource_GetFlags, 2495).
--define(wxXmlResource_GetVersion, 2496).
--define(wxXmlResource_GetXRCID, 2497).
--define(wxXmlResource_InitAllHandlers, 2498).
--define(wxXmlResource_Load, 2499).
--define(wxXmlResource_LoadBitmap, 2500).
--define(wxXmlResource_LoadDialog_2, 2501).
--define(wxXmlResource_LoadDialog_3, 2502).
--define(wxXmlResource_LoadFrame_2, 2503).
--define(wxXmlResource_LoadFrame_3, 2504).
--define(wxXmlResource_LoadIcon, 2505).
--define(wxXmlResource_LoadMenu, 2506).
--define(wxXmlResource_LoadMenuBar_2, 2507).
--define(wxXmlResource_LoadMenuBar_1, 2508).
--define(wxXmlResource_LoadPanel_2, 2509).
--define(wxXmlResource_LoadPanel_3, 2510).
--define(wxXmlResource_LoadToolBar, 2511).
--define(wxXmlResource_Set, 2512).
--define(wxXmlResource_SetFlags, 2513).
--define(wxXmlResource_Unload, 2514).
--define(wxXmlResource_xrcctrl, 2515).
--define(wxHtmlEasyPrinting_new, 2516).
--define(wxHtmlEasyPrinting_destruct, 2517).
--define(wxHtmlEasyPrinting_GetPrintData, 2518).
--define(wxHtmlEasyPrinting_GetPageSetupData, 2519).
--define(wxHtmlEasyPrinting_PreviewFile, 2520).
--define(wxHtmlEasyPrinting_PreviewText, 2521).
--define(wxHtmlEasyPrinting_PrintFile, 2522).
--define(wxHtmlEasyPrinting_PrintText, 2523).
--define(wxHtmlEasyPrinting_PageSetup, 2524).
--define(wxHtmlEasyPrinting_SetFonts, 2525).
--define(wxHtmlEasyPrinting_SetHeader, 2526).
--define(wxHtmlEasyPrinting_SetFooter, 2527).
--define(wxGLCanvas_new_2, 2529).
--define(wxGLCanvas_new_3_1, 2530).
--define(wxGLCanvas_new_3_0, 2531).
--define(wxGLCanvas_GetContext, 2532).
--define(wxGLCanvas_SetCurrent, 2534).
--define(wxGLCanvas_SwapBuffers, 2535).
--define(wxGLCanvas_destroy, 2536).
--define(wxAuiManager_new, 2537).
--define(wxAuiManager_destruct, 2538).
--define(wxAuiManager_AddPane_2_1, 2539).
--define(wxAuiManager_AddPane_3, 2540).
--define(wxAuiManager_AddPane_2_0, 2541).
--define(wxAuiManager_DetachPane, 2542).
--define(wxAuiManager_GetAllPanes, 2543).
--define(wxAuiManager_GetArtProvider, 2544).
--define(wxAuiManager_GetDockSizeConstraint, 2545).
--define(wxAuiManager_GetFlags, 2546).
--define(wxAuiManager_GetManagedWindow, 2547).
--define(wxAuiManager_GetManager, 2548).
--define(wxAuiManager_GetPane_1_1, 2549).
--define(wxAuiManager_GetPane_1_0, 2550).
--define(wxAuiManager_HideHint, 2551).
--define(wxAuiManager_InsertPane, 2552).
--define(wxAuiManager_LoadPaneInfo, 2553).
--define(wxAuiManager_LoadPerspective, 2554).
--define(wxAuiManager_SavePaneInfo, 2555).
--define(wxAuiManager_SavePerspective, 2556).
--define(wxAuiManager_SetArtProvider, 2557).
--define(wxAuiManager_SetDockSizeConstraint, 2558).
--define(wxAuiManager_SetFlags, 2559).
--define(wxAuiManager_SetManagedWindow, 2560).
--define(wxAuiManager_ShowHint, 2561).
--define(wxAuiManager_UnInit, 2562).
--define(wxAuiManager_Update, 2563).
--define(wxAuiPaneInfo_new_0, 2564).
--define(wxAuiPaneInfo_new_1, 2565).
--define(wxAuiPaneInfo_destruct, 2566).
--define(wxAuiPaneInfo_BestSize_1, 2567).
--define(wxAuiPaneInfo_BestSize_2, 2568).
--define(wxAuiPaneInfo_Bottom, 2569).
--define(wxAuiPaneInfo_BottomDockable, 2570).
--define(wxAuiPaneInfo_Caption, 2571).
--define(wxAuiPaneInfo_CaptionVisible, 2572).
--define(wxAuiPaneInfo_Centre, 2573).
--define(wxAuiPaneInfo_CentrePane, 2574).
--define(wxAuiPaneInfo_CloseButton, 2575).
--define(wxAuiPaneInfo_DefaultPane, 2576).
--define(wxAuiPaneInfo_DestroyOnClose, 2577).
--define(wxAuiPaneInfo_Direction, 2578).
--define(wxAuiPaneInfo_Dock, 2579).
--define(wxAuiPaneInfo_Dockable, 2580).
--define(wxAuiPaneInfo_Fixed, 2581).
--define(wxAuiPaneInfo_Float, 2582).
--define(wxAuiPaneInfo_Floatable, 2583).
--define(wxAuiPaneInfo_FloatingPosition_1, 2584).
--define(wxAuiPaneInfo_FloatingPosition_2, 2585).
--define(wxAuiPaneInfo_FloatingSize_1, 2586).
--define(wxAuiPaneInfo_FloatingSize_2, 2587).
--define(wxAuiPaneInfo_Gripper, 2588).
--define(wxAuiPaneInfo_GripperTop, 2589).
--define(wxAuiPaneInfo_HasBorder, 2590).
--define(wxAuiPaneInfo_HasCaption, 2591).
--define(wxAuiPaneInfo_HasCloseButton, 2592).
--define(wxAuiPaneInfo_HasFlag, 2593).
--define(wxAuiPaneInfo_HasGripper, 2594).
--define(wxAuiPaneInfo_HasGripperTop, 2595).
--define(wxAuiPaneInfo_HasMaximizeButton, 2596).
--define(wxAuiPaneInfo_HasMinimizeButton, 2597).
--define(wxAuiPaneInfo_HasPinButton, 2598).
--define(wxAuiPaneInfo_Hide, 2599).
--define(wxAuiPaneInfo_IsBottomDockable, 2600).
--define(wxAuiPaneInfo_IsDocked, 2601).
--define(wxAuiPaneInfo_IsFixed, 2602).
--define(wxAuiPaneInfo_IsFloatable, 2603).
--define(wxAuiPaneInfo_IsFloating, 2604).
--define(wxAuiPaneInfo_IsLeftDockable, 2605).
--define(wxAuiPaneInfo_IsMovable, 2606).
--define(wxAuiPaneInfo_IsOk, 2607).
--define(wxAuiPaneInfo_IsResizable, 2608).
--define(wxAuiPaneInfo_IsRightDockable, 2609).
--define(wxAuiPaneInfo_IsShown, 2610).
--define(wxAuiPaneInfo_IsToolbar, 2611).
--define(wxAuiPaneInfo_IsTopDockable, 2612).
--define(wxAuiPaneInfo_Layer, 2613).
--define(wxAuiPaneInfo_Left, 2614).
--define(wxAuiPaneInfo_LeftDockable, 2615).
--define(wxAuiPaneInfo_MaxSize_1, 2616).
--define(wxAuiPaneInfo_MaxSize_2, 2617).
--define(wxAuiPaneInfo_MaximizeButton, 2618).
--define(wxAuiPaneInfo_MinSize_1, 2619).
--define(wxAuiPaneInfo_MinSize_2, 2620).
--define(wxAuiPaneInfo_MinimizeButton, 2621).
--define(wxAuiPaneInfo_Movable, 2622).
--define(wxAuiPaneInfo_Name, 2623).
--define(wxAuiPaneInfo_PaneBorder, 2624).
--define(wxAuiPaneInfo_PinButton, 2625).
--define(wxAuiPaneInfo_Position, 2626).
--define(wxAuiPaneInfo_Resizable, 2627).
--define(wxAuiPaneInfo_Right, 2628).
--define(wxAuiPaneInfo_RightDockable, 2629).
--define(wxAuiPaneInfo_Row, 2630).
--define(wxAuiPaneInfo_SafeSet, 2631).
--define(wxAuiPaneInfo_SetFlag, 2632).
--define(wxAuiPaneInfo_Show, 2633).
--define(wxAuiPaneInfo_ToolbarPane, 2634).
--define(wxAuiPaneInfo_Top, 2635).
--define(wxAuiPaneInfo_TopDockable, 2636).
--define(wxAuiPaneInfo_Window, 2637).
--define(wxAuiNotebook_new_0, 2638).
--define(wxAuiNotebook_new_2, 2639).
--define(wxAuiNotebook_AddPage, 2640).
--define(wxAuiNotebook_Create, 2641).
--define(wxAuiNotebook_DeletePage, 2642).
--define(wxAuiNotebook_GetArtProvider, 2643).
--define(wxAuiNotebook_GetPage, 2644).
--define(wxAuiNotebook_GetPageBitmap, 2645).
--define(wxAuiNotebook_GetPageCount, 2646).
--define(wxAuiNotebook_GetPageIndex, 2647).
--define(wxAuiNotebook_GetPageText, 2648).
--define(wxAuiNotebook_GetSelection, 2649).
--define(wxAuiNotebook_InsertPage, 2650).
--define(wxAuiNotebook_RemovePage, 2651).
--define(wxAuiNotebook_SetArtProvider, 2652).
--define(wxAuiNotebook_SetFont, 2653).
--define(wxAuiNotebook_SetPageBitmap, 2654).
--define(wxAuiNotebook_SetPageText, 2655).
--define(wxAuiNotebook_SetSelection, 2656).
--define(wxAuiNotebook_SetTabCtrlHeight, 2657).
--define(wxAuiNotebook_SetUniformBitmapSize, 2658).
--define(wxAuiNotebook_destroy, 2659).
--define(wxMDIParentFrame_new_0, 2660).
--define(wxMDIParentFrame_new_4, 2661).
--define(wxMDIParentFrame_destruct, 2662).
--define(wxMDIParentFrame_ActivateNext, 2663).
--define(wxMDIParentFrame_ActivatePrevious, 2664).
--define(wxMDIParentFrame_ArrangeIcons, 2665).
--define(wxMDIParentFrame_Cascade, 2666).
--define(wxMDIParentFrame_Create, 2667).
--define(wxMDIParentFrame_GetActiveChild, 2668).
--define(wxMDIParentFrame_GetClientWindow, 2669).
--define(wxMDIParentFrame_Tile, 2670).
--define(wxMDIChildFrame_new_0, 2671).
--define(wxMDIChildFrame_new_4, 2672).
--define(wxMDIChildFrame_destruct, 2673).
--define(wxMDIChildFrame_Activate, 2674).
--define(wxMDIChildFrame_Create, 2675).
--define(wxMDIChildFrame_Maximize, 2676).
--define(wxMDIChildFrame_Restore, 2677).
--define(wxMDIClientWindow_new_0, 2678).
--define(wxMDIClientWindow_new_2, 2679).
--define(wxMDIClientWindow_destruct, 2680).
--define(wxMDIClientWindow_CreateClient, 2681).
--define(wxLayoutAlgorithm_new, 2682).
--define(wxLayoutAlgorithm_LayoutFrame, 2683).
--define(wxLayoutAlgorithm_LayoutMDIFrame, 2684).
--define(wxLayoutAlgorithm_LayoutWindow, 2685).
--define(wxLayoutAlgorithm_destroy, 2686).
--define(wxEvent_GetId, 2687).
--define(wxEvent_GetSkipped, 2688).
--define(wxEvent_GetTimestamp, 2689).
--define(wxEvent_IsCommandEvent, 2690).
--define(wxEvent_ResumePropagation, 2691).
--define(wxEvent_ShouldPropagate, 2692).
--define(wxEvent_Skip, 2693).
--define(wxEvent_StopPropagation, 2694).
--define(wxCommandEvent_getClientData, 2695).
--define(wxCommandEvent_GetExtraLong, 2696).
--define(wxCommandEvent_GetInt, 2697).
--define(wxCommandEvent_GetSelection, 2698).
--define(wxCommandEvent_GetString, 2699).
--define(wxCommandEvent_IsChecked, 2700).
--define(wxCommandEvent_IsSelection, 2701).
--define(wxCommandEvent_SetInt, 2702).
--define(wxCommandEvent_SetString, 2703).
--define(wxScrollEvent_GetOrientation, 2704).
--define(wxScrollEvent_GetPosition, 2705).
--define(wxScrollWinEvent_GetOrientation, 2706).
--define(wxScrollWinEvent_GetPosition, 2707).
--define(wxMouseEvent_AltDown, 2708).
--define(wxMouseEvent_Button, 2709).
--define(wxMouseEvent_ButtonDClick, 2710).
--define(wxMouseEvent_ButtonDown, 2711).
--define(wxMouseEvent_ButtonUp, 2712).
--define(wxMouseEvent_CmdDown, 2713).
--define(wxMouseEvent_ControlDown, 2714).
--define(wxMouseEvent_Dragging, 2715).
--define(wxMouseEvent_Entering, 2716).
--define(wxMouseEvent_GetButton, 2717).
--define(wxMouseEvent_GetPosition, 2720).
--define(wxMouseEvent_GetLogicalPosition, 2721).
--define(wxMouseEvent_GetLinesPerAction, 2722).
--define(wxMouseEvent_GetWheelRotation, 2723).
--define(wxMouseEvent_GetWheelDelta, 2724).
--define(wxMouseEvent_GetX, 2725).
--define(wxMouseEvent_GetY, 2726).
--define(wxMouseEvent_IsButton, 2727).
--define(wxMouseEvent_IsPageScroll, 2728).
--define(wxMouseEvent_Leaving, 2729).
--define(wxMouseEvent_LeftDClick, 2730).
--define(wxMouseEvent_LeftDown, 2731).
--define(wxMouseEvent_LeftIsDown, 2732).
--define(wxMouseEvent_LeftUp, 2733).
--define(wxMouseEvent_MetaDown, 2734).
--define(wxMouseEvent_MiddleDClick, 2735).
--define(wxMouseEvent_MiddleDown, 2736).
--define(wxMouseEvent_MiddleIsDown, 2737).
--define(wxMouseEvent_MiddleUp, 2738).
--define(wxMouseEvent_Moving, 2739).
--define(wxMouseEvent_RightDClick, 2740).
--define(wxMouseEvent_RightDown, 2741).
--define(wxMouseEvent_RightIsDown, 2742).
--define(wxMouseEvent_RightUp, 2743).
--define(wxMouseEvent_ShiftDown, 2744).
--define(wxSetCursorEvent_GetCursor, 2745).
--define(wxSetCursorEvent_GetX, 2746).
--define(wxSetCursorEvent_GetY, 2747).
--define(wxSetCursorEvent_HasCursor, 2748).
--define(wxSetCursorEvent_SetCursor, 2749).
--define(wxKeyEvent_AltDown, 2750).
--define(wxKeyEvent_CmdDown, 2751).
--define(wxKeyEvent_ControlDown, 2752).
--define(wxKeyEvent_GetKeyCode, 2753).
--define(wxKeyEvent_GetModifiers, 2754).
--define(wxKeyEvent_GetPosition, 2757).
--define(wxKeyEvent_GetRawKeyCode, 2758).
--define(wxKeyEvent_GetRawKeyFlags, 2759).
--define(wxKeyEvent_GetUnicodeKey, 2760).
--define(wxKeyEvent_GetX, 2761).
--define(wxKeyEvent_GetY, 2762).
--define(wxKeyEvent_HasModifiers, 2763).
--define(wxKeyEvent_MetaDown, 2764).
--define(wxKeyEvent_ShiftDown, 2765).
--define(wxSizeEvent_GetSize, 2766).
--define(wxMoveEvent_GetPosition, 2767).
--define(wxEraseEvent_GetDC, 2768).
--define(wxFocusEvent_GetWindow, 2769).
--define(wxChildFocusEvent_GetWindow, 2770).
--define(wxMenuEvent_GetMenu, 2771).
--define(wxMenuEvent_GetMenuId, 2772).
--define(wxMenuEvent_IsPopup, 2773).
--define(wxCloseEvent_CanVeto, 2774).
--define(wxCloseEvent_GetLoggingOff, 2775).
--define(wxCloseEvent_SetCanVeto, 2776).
--define(wxCloseEvent_SetLoggingOff, 2777).
--define(wxCloseEvent_Veto, 2778).
--define(wxShowEvent_SetShow, 2779).
--define(wxShowEvent_GetShow, 2780).
--define(wxIconizeEvent_Iconized, 2781).
--define(wxJoystickEvent_ButtonDown, 2782).
--define(wxJoystickEvent_ButtonIsDown, 2783).
--define(wxJoystickEvent_ButtonUp, 2784).
--define(wxJoystickEvent_GetButtonChange, 2785).
--define(wxJoystickEvent_GetButtonState, 2786).
--define(wxJoystickEvent_GetJoystick, 2787).
--define(wxJoystickEvent_GetPosition, 2788).
--define(wxJoystickEvent_GetZPosition, 2789).
--define(wxJoystickEvent_IsButton, 2790).
--define(wxJoystickEvent_IsMove, 2791).
--define(wxJoystickEvent_IsZMove, 2792).
--define(wxUpdateUIEvent_CanUpdate, 2793).
--define(wxUpdateUIEvent_Check, 2794).
--define(wxUpdateUIEvent_Enable, 2795).
--define(wxUpdateUIEvent_Show, 2796).
--define(wxUpdateUIEvent_GetChecked, 2797).
--define(wxUpdateUIEvent_GetEnabled, 2798).
--define(wxUpdateUIEvent_GetShown, 2799).
--define(wxUpdateUIEvent_GetSetChecked, 2800).
--define(wxUpdateUIEvent_GetSetEnabled, 2801).
--define(wxUpdateUIEvent_GetSetShown, 2802).
--define(wxUpdateUIEvent_GetSetText, 2803).
--define(wxUpdateUIEvent_GetText, 2804).
--define(wxUpdateUIEvent_GetMode, 2805).
--define(wxUpdateUIEvent_GetUpdateInterval, 2806).
--define(wxUpdateUIEvent_ResetUpdateTime, 2807).
--define(wxUpdateUIEvent_SetMode, 2808).
--define(wxUpdateUIEvent_SetText, 2809).
--define(wxUpdateUIEvent_SetUpdateInterval, 2810).
--define(wxMouseCaptureChangedEvent_GetCapturedWindow, 2811).
--define(wxPaletteChangedEvent_SetChangedWindow, 2812).
--define(wxPaletteChangedEvent_GetChangedWindow, 2813).
--define(wxQueryNewPaletteEvent_SetPaletteRealized, 2814).
--define(wxQueryNewPaletteEvent_GetPaletteRealized, 2815).
--define(wxNavigationKeyEvent_GetDirection, 2816).
--define(wxNavigationKeyEvent_SetDirection, 2817).
--define(wxNavigationKeyEvent_IsWindowChange, 2818).
--define(wxNavigationKeyEvent_SetWindowChange, 2819).
--define(wxNavigationKeyEvent_IsFromTab, 2820).
--define(wxNavigationKeyEvent_SetFromTab, 2821).
--define(wxNavigationKeyEvent_GetCurrentFocus, 2822).
--define(wxNavigationKeyEvent_SetCurrentFocus, 2823).
--define(wxHelpEvent_GetOrigin, 2824).
--define(wxHelpEvent_GetPosition, 2825).
--define(wxHelpEvent_SetOrigin, 2826).
--define(wxHelpEvent_SetPosition, 2827).
--define(wxContextMenuEvent_GetPosition, 2828).
--define(wxContextMenuEvent_SetPosition, 2829).
--define(wxIdleEvent_CanSend, 2830).
--define(wxIdleEvent_GetMode, 2831).
--define(wxIdleEvent_RequestMore, 2832).
--define(wxIdleEvent_MoreRequested, 2833).
--define(wxIdleEvent_SetMode, 2834).
--define(wxGridEvent_AltDown, 2835).
--define(wxGridEvent_ControlDown, 2836).
--define(wxGridEvent_GetCol, 2837).
--define(wxGridEvent_GetPosition, 2838).
--define(wxGridEvent_GetRow, 2839).
--define(wxGridEvent_MetaDown, 2840).
--define(wxGridEvent_Selecting, 2841).
--define(wxGridEvent_ShiftDown, 2842).
--define(wxNotifyEvent_Allow, 2843).
--define(wxNotifyEvent_IsAllowed, 2844).
--define(wxNotifyEvent_Veto, 2845).
--define(wxSashEvent_GetEdge, 2846).
--define(wxSashEvent_GetDragRect, 2847).
--define(wxSashEvent_GetDragStatus, 2848).
--define(wxListEvent_GetCacheFrom, 2849).
--define(wxListEvent_GetCacheTo, 2850).
--define(wxListEvent_GetKeyCode, 2851).
--define(wxListEvent_GetIndex, 2852).
--define(wxListEvent_GetColumn, 2853).
--define(wxListEvent_GetPoint, 2854).
--define(wxListEvent_GetLabel, 2855).
--define(wxListEvent_GetText, 2856).
--define(wxListEvent_GetImage, 2857).
--define(wxListEvent_GetData, 2858).
--define(wxListEvent_GetMask, 2859).
--define(wxListEvent_GetItem, 2860).
--define(wxListEvent_IsEditCancelled, 2861).
--define(wxDateEvent_GetDate, 2862).
--define(wxCalendarEvent_GetWeekDay, 2863).
--define(wxFileDirPickerEvent_GetPath, 2864).
--define(wxColourPickerEvent_GetColour, 2865).
--define(wxFontPickerEvent_GetFont, 2866).
--define(wxStyledTextEvent_GetPosition, 2867).
--define(wxStyledTextEvent_GetKey, 2868).
--define(wxStyledTextEvent_GetModifiers, 2869).
--define(wxStyledTextEvent_GetModificationType, 2870).
--define(wxStyledTextEvent_GetText, 2871).
--define(wxStyledTextEvent_GetLength, 2872).
--define(wxStyledTextEvent_GetLinesAdded, 2873).
--define(wxStyledTextEvent_GetLine, 2874).
--define(wxStyledTextEvent_GetFoldLevelNow, 2875).
--define(wxStyledTextEvent_GetFoldLevelPrev, 2876).
--define(wxStyledTextEvent_GetMargin, 2877).
--define(wxStyledTextEvent_GetMessage, 2878).
--define(wxStyledTextEvent_GetWParam, 2879).
--define(wxStyledTextEvent_GetLParam, 2880).
--define(wxStyledTextEvent_GetListType, 2881).
--define(wxStyledTextEvent_GetX, 2882).
--define(wxStyledTextEvent_GetY, 2883).
--define(wxStyledTextEvent_GetDragText, 2884).
--define(wxStyledTextEvent_GetDragAllowMove, 2885).
--define(wxStyledTextEvent_GetDragResult, 2886).
--define(wxStyledTextEvent_GetShift, 2887).
--define(wxStyledTextEvent_GetControl, 2888).
--define(wxStyledTextEvent_GetAlt, 2889).
--define(utils_wxGetKeyState, 2890).
--define(utils_wxGetMousePosition, 2891).
--define(utils_wxGetMouseState, 2892).
--define(utils_wxSetDetectableAutoRepeat, 2893).
--define(utils_wxBell, 2894).
--define(utils_wxFindMenuItemId, 2895).
--define(utils_wxGenericFindWindowAtPoint, 2896).
--define(utils_wxFindWindowAtPoint, 2897).
--define(utils_wxBeginBusyCursor, 2898).
--define(utils_wxEndBusyCursor, 2899).
--define(utils_wxIsBusy, 2900).
--define(utils_wxShutdown, 2901).
--define(utils_wxShell, 2902).
--define(utils_wxLaunchDefaultBrowser, 2903).
--define(utils_wxGetEmailAddress, 2904).
--define(utils_wxGetUserId, 2905).
--define(utils_wxGetHomeDir, 2906).
--define(utils_wxNewId, 2907).
--define(utils_wxRegisterId, 2908).
--define(utils_wxGetCurrentId, 2909).
--define(utils_wxGetOsDescription, 2910).
--define(utils_wxIsPlatformLittleEndian, 2911).
--define(utils_wxIsPlatform64Bit, 2912).
--define(wxPrintout_new, 2913).
--define(wxPrintout_destruct, 2914).
--define(wxPrintout_GetDC, 2915).
--define(wxPrintout_GetPageSizeMM, 2916).
--define(wxPrintout_GetPageSizePixels, 2917).
--define(wxPrintout_GetPaperRectPixels, 2918).
--define(wxPrintout_GetPPIPrinter, 2919).
--define(wxPrintout_GetPPIScreen, 2920).
--define(wxPrintout_GetTitle, 2921).
--define(wxPrintout_IsPreview, 2922).
--define(wxPrintout_FitThisSizeToPaper, 2923).
--define(wxPrintout_FitThisSizeToPage, 2924).
--define(wxPrintout_FitThisSizeToPageMargins, 2925).
--define(wxPrintout_MapScreenSizeToPaper, 2926).
--define(wxPrintout_MapScreenSizeToPage, 2927).
--define(wxPrintout_MapScreenSizeToPageMargins, 2928).
--define(wxPrintout_MapScreenSizeToDevice, 2929).
--define(wxPrintout_GetLogicalPaperRect, 2930).
--define(wxPrintout_GetLogicalPageRect, 2931).
--define(wxPrintout_GetLogicalPageMarginsRect, 2932).
--define(wxPrintout_SetLogicalOrigin, 2933).
--define(wxPrintout_OffsetLogicalOrigin, 2934).
--define(wxStyledTextCtrl_new_2, 2935).
--define(wxStyledTextCtrl_new_0, 2936).
--define(wxStyledTextCtrl_destruct, 2937).
--define(wxStyledTextCtrl_Create, 2938).
--define(wxStyledTextCtrl_AddText, 2939).
--define(wxStyledTextCtrl_AddStyledText, 2940).
--define(wxStyledTextCtrl_InsertText, 2941).
--define(wxStyledTextCtrl_ClearAll, 2942).
--define(wxStyledTextCtrl_ClearDocumentStyle, 2943).
--define(wxStyledTextCtrl_GetLength, 2944).
--define(wxStyledTextCtrl_GetCharAt, 2945).
--define(wxStyledTextCtrl_GetCurrentPos, 2946).
--define(wxStyledTextCtrl_GetAnchor, 2947).
--define(wxStyledTextCtrl_GetStyleAt, 2948).
--define(wxStyledTextCtrl_Redo, 2949).
--define(wxStyledTextCtrl_SetUndoCollection, 2950).
--define(wxStyledTextCtrl_SelectAll, 2951).
--define(wxStyledTextCtrl_SetSavePoint, 2952).
--define(wxStyledTextCtrl_GetStyledText, 2953).
--define(wxStyledTextCtrl_CanRedo, 2954).
--define(wxStyledTextCtrl_MarkerLineFromHandle, 2955).
--define(wxStyledTextCtrl_MarkerDeleteHandle, 2956).
--define(wxStyledTextCtrl_GetUndoCollection, 2957).
--define(wxStyledTextCtrl_GetViewWhiteSpace, 2958).
--define(wxStyledTextCtrl_SetViewWhiteSpace, 2959).
--define(wxStyledTextCtrl_PositionFromPoint, 2960).
--define(wxStyledTextCtrl_PositionFromPointClose, 2961).
--define(wxStyledTextCtrl_GotoLine, 2962).
--define(wxStyledTextCtrl_GotoPos, 2963).
--define(wxStyledTextCtrl_SetAnchor, 2964).
--define(wxStyledTextCtrl_GetCurLine, 2965).
--define(wxStyledTextCtrl_GetEndStyled, 2966).
--define(wxStyledTextCtrl_ConvertEOLs, 2967).
--define(wxStyledTextCtrl_GetEOLMode, 2968).
--define(wxStyledTextCtrl_SetEOLMode, 2969).
--define(wxStyledTextCtrl_StartStyling, 2970).
--define(wxStyledTextCtrl_SetStyling, 2971).
--define(wxStyledTextCtrl_GetBufferedDraw, 2972).
--define(wxStyledTextCtrl_SetBufferedDraw, 2973).
--define(wxStyledTextCtrl_SetTabWidth, 2974).
--define(wxStyledTextCtrl_GetTabWidth, 2975).
--define(wxStyledTextCtrl_SetCodePage, 2976).
--define(wxStyledTextCtrl_MarkerDefine, 2977).
--define(wxStyledTextCtrl_MarkerSetForeground, 2978).
--define(wxStyledTextCtrl_MarkerSetBackground, 2979).
--define(wxStyledTextCtrl_MarkerAdd, 2980).
--define(wxStyledTextCtrl_MarkerDelete, 2981).
--define(wxStyledTextCtrl_MarkerDeleteAll, 2982).
--define(wxStyledTextCtrl_MarkerGet, 2983).
--define(wxStyledTextCtrl_MarkerNext, 2984).
--define(wxStyledTextCtrl_MarkerPrevious, 2985).
--define(wxStyledTextCtrl_MarkerDefineBitmap, 2986).
--define(wxStyledTextCtrl_MarkerAddSet, 2987).
--define(wxStyledTextCtrl_MarkerSetAlpha, 2988).
--define(wxStyledTextCtrl_SetMarginType, 2989).
--define(wxStyledTextCtrl_GetMarginType, 2990).
--define(wxStyledTextCtrl_SetMarginWidth, 2991).
--define(wxStyledTextCtrl_GetMarginWidth, 2992).
--define(wxStyledTextCtrl_SetMarginMask, 2993).
--define(wxStyledTextCtrl_GetMarginMask, 2994).
--define(wxStyledTextCtrl_SetMarginSensitive, 2995).
--define(wxStyledTextCtrl_GetMarginSensitive, 2996).
--define(wxStyledTextCtrl_StyleClearAll, 2997).
--define(wxStyledTextCtrl_StyleSetForeground, 2998).
--define(wxStyledTextCtrl_StyleSetBackground, 2999).
--define(wxStyledTextCtrl_StyleSetBold, 3000).
--define(wxStyledTextCtrl_StyleSetItalic, 3001).
--define(wxStyledTextCtrl_StyleSetSize, 3002).
--define(wxStyledTextCtrl_StyleSetFaceName, 3003).
--define(wxStyledTextCtrl_StyleSetEOLFilled, 3004).
--define(wxStyledTextCtrl_StyleResetDefault, 3005).
--define(wxStyledTextCtrl_StyleSetUnderline, 3006).
--define(wxStyledTextCtrl_StyleSetCase, 3007).
--define(wxStyledTextCtrl_StyleSetHotSpot, 3008).
--define(wxStyledTextCtrl_SetSelForeground, 3009).
--define(wxStyledTextCtrl_SetSelBackground, 3010).
--define(wxStyledTextCtrl_GetSelAlpha, 3011).
--define(wxStyledTextCtrl_SetSelAlpha, 3012).
--define(wxStyledTextCtrl_SetCaretForeground, 3013).
--define(wxStyledTextCtrl_CmdKeyAssign, 3014).
--define(wxStyledTextCtrl_CmdKeyClear, 3015).
--define(wxStyledTextCtrl_CmdKeyClearAll, 3016).
--define(wxStyledTextCtrl_SetStyleBytes, 3017).
--define(wxStyledTextCtrl_StyleSetVisible, 3018).
--define(wxStyledTextCtrl_GetCaretPeriod, 3019).
--define(wxStyledTextCtrl_SetCaretPeriod, 3020).
--define(wxStyledTextCtrl_SetWordChars, 3021).
--define(wxStyledTextCtrl_BeginUndoAction, 3022).
--define(wxStyledTextCtrl_EndUndoAction, 3023).
--define(wxStyledTextCtrl_IndicatorSetStyle, 3024).
--define(wxStyledTextCtrl_IndicatorGetStyle, 3025).
--define(wxStyledTextCtrl_IndicatorSetForeground, 3026).
--define(wxStyledTextCtrl_IndicatorGetForeground, 3027).
--define(wxStyledTextCtrl_SetWhitespaceForeground, 3028).
--define(wxStyledTextCtrl_SetWhitespaceBackground, 3029).
--define(wxStyledTextCtrl_GetStyleBits, 3030).
--define(wxStyledTextCtrl_SetLineState, 3031).
--define(wxStyledTextCtrl_GetLineState, 3032).
--define(wxStyledTextCtrl_GetMaxLineState, 3033).
--define(wxStyledTextCtrl_GetCaretLineVisible, 3034).
--define(wxStyledTextCtrl_SetCaretLineVisible, 3035).
--define(wxStyledTextCtrl_GetCaretLineBackground, 3036).
--define(wxStyledTextCtrl_SetCaretLineBackground, 3037).
--define(wxStyledTextCtrl_AutoCompShow, 3038).
--define(wxStyledTextCtrl_AutoCompCancel, 3039).
--define(wxStyledTextCtrl_AutoCompActive, 3040).
--define(wxStyledTextCtrl_AutoCompPosStart, 3041).
--define(wxStyledTextCtrl_AutoCompComplete, 3042).
--define(wxStyledTextCtrl_AutoCompStops, 3043).
--define(wxStyledTextCtrl_AutoCompSetSeparator, 3044).
--define(wxStyledTextCtrl_AutoCompGetSeparator, 3045).
--define(wxStyledTextCtrl_AutoCompSelect, 3046).
--define(wxStyledTextCtrl_AutoCompSetCancelAtStart, 3047).
--define(wxStyledTextCtrl_AutoCompGetCancelAtStart, 3048).
--define(wxStyledTextCtrl_AutoCompSetFillUps, 3049).
--define(wxStyledTextCtrl_AutoCompSetChooseSingle, 3050).
--define(wxStyledTextCtrl_AutoCompGetChooseSingle, 3051).
--define(wxStyledTextCtrl_AutoCompSetIgnoreCase, 3052).
--define(wxStyledTextCtrl_AutoCompGetIgnoreCase, 3053).
--define(wxStyledTextCtrl_UserListShow, 3054).
--define(wxStyledTextCtrl_AutoCompSetAutoHide, 3055).
--define(wxStyledTextCtrl_AutoCompGetAutoHide, 3056).
--define(wxStyledTextCtrl_AutoCompSetDropRestOfWord, 3057).
--define(wxStyledTextCtrl_AutoCompGetDropRestOfWord, 3058).
--define(wxStyledTextCtrl_RegisterImage, 3059).
--define(wxStyledTextCtrl_ClearRegisteredImages, 3060).
--define(wxStyledTextCtrl_AutoCompGetTypeSeparator, 3061).
--define(wxStyledTextCtrl_AutoCompSetTypeSeparator, 3062).
--define(wxStyledTextCtrl_AutoCompSetMaxWidth, 3063).
--define(wxStyledTextCtrl_AutoCompGetMaxWidth, 3064).
--define(wxStyledTextCtrl_AutoCompSetMaxHeight, 3065).
--define(wxStyledTextCtrl_AutoCompGetMaxHeight, 3066).
--define(wxStyledTextCtrl_SetIndent, 3067).
--define(wxStyledTextCtrl_GetIndent, 3068).
--define(wxStyledTextCtrl_SetUseTabs, 3069).
--define(wxStyledTextCtrl_GetUseTabs, 3070).
--define(wxStyledTextCtrl_SetLineIndentation, 3071).
--define(wxStyledTextCtrl_GetLineIndentation, 3072).
--define(wxStyledTextCtrl_GetLineIndentPosition, 3073).
--define(wxStyledTextCtrl_GetColumn, 3074).
--define(wxStyledTextCtrl_SetUseHorizontalScrollBar, 3075).
--define(wxStyledTextCtrl_GetUseHorizontalScrollBar, 3076).
--define(wxStyledTextCtrl_SetIndentationGuides, 3077).
--define(wxStyledTextCtrl_GetIndentationGuides, 3078).
--define(wxStyledTextCtrl_SetHighlightGuide, 3079).
--define(wxStyledTextCtrl_GetHighlightGuide, 3080).
--define(wxStyledTextCtrl_GetLineEndPosition, 3081).
--define(wxStyledTextCtrl_GetCodePage, 3082).
--define(wxStyledTextCtrl_GetCaretForeground, 3083).
--define(wxStyledTextCtrl_GetReadOnly, 3084).
--define(wxStyledTextCtrl_SetCurrentPos, 3085).
--define(wxStyledTextCtrl_SetSelectionStart, 3086).
--define(wxStyledTextCtrl_GetSelectionStart, 3087).
--define(wxStyledTextCtrl_SetSelectionEnd, 3088).
--define(wxStyledTextCtrl_GetSelectionEnd, 3089).
--define(wxStyledTextCtrl_SetPrintMagnification, 3090).
--define(wxStyledTextCtrl_GetPrintMagnification, 3091).
--define(wxStyledTextCtrl_SetPrintColourMode, 3092).
--define(wxStyledTextCtrl_GetPrintColourMode, 3093).
--define(wxStyledTextCtrl_FindText, 3094).
--define(wxStyledTextCtrl_FormatRange, 3095).
--define(wxStyledTextCtrl_GetFirstVisibleLine, 3096).
--define(wxStyledTextCtrl_GetLine, 3097).
--define(wxStyledTextCtrl_GetLineCount, 3098).
--define(wxStyledTextCtrl_SetMarginLeft, 3099).
--define(wxStyledTextCtrl_GetMarginLeft, 3100).
--define(wxStyledTextCtrl_SetMarginRight, 3101).
--define(wxStyledTextCtrl_GetMarginRight, 3102).
--define(wxStyledTextCtrl_GetModify, 3103).
--define(wxStyledTextCtrl_SetSelection, 3104).
--define(wxStyledTextCtrl_GetSelectedText, 3105).
--define(wxStyledTextCtrl_GetTextRange, 3106).
--define(wxStyledTextCtrl_HideSelection, 3107).
--define(wxStyledTextCtrl_LineFromPosition, 3108).
--define(wxStyledTextCtrl_PositionFromLine, 3109).
--define(wxStyledTextCtrl_LineScroll, 3110).
--define(wxStyledTextCtrl_EnsureCaretVisible, 3111).
--define(wxStyledTextCtrl_ReplaceSelection, 3112).
--define(wxStyledTextCtrl_SetReadOnly, 3113).
--define(wxStyledTextCtrl_CanPaste, 3114).
--define(wxStyledTextCtrl_CanUndo, 3115).
--define(wxStyledTextCtrl_EmptyUndoBuffer, 3116).
--define(wxStyledTextCtrl_Undo, 3117).
--define(wxStyledTextCtrl_Cut, 3118).
--define(wxStyledTextCtrl_Copy, 3119).
--define(wxStyledTextCtrl_Paste, 3120).
--define(wxStyledTextCtrl_Clear, 3121).
--define(wxStyledTextCtrl_SetText, 3122).
--define(wxStyledTextCtrl_GetText, 3123).
--define(wxStyledTextCtrl_GetTextLength, 3124).
--define(wxStyledTextCtrl_GetOvertype, 3125).
--define(wxStyledTextCtrl_SetCaretWidth, 3126).
--define(wxStyledTextCtrl_GetCaretWidth, 3127).
--define(wxStyledTextCtrl_SetTargetStart, 3128).
--define(wxStyledTextCtrl_GetTargetStart, 3129).
--define(wxStyledTextCtrl_SetTargetEnd, 3130).
--define(wxStyledTextCtrl_GetTargetEnd, 3131).
--define(wxStyledTextCtrl_ReplaceTarget, 3132).
--define(wxStyledTextCtrl_SearchInTarget, 3133).
--define(wxStyledTextCtrl_SetSearchFlags, 3134).
--define(wxStyledTextCtrl_GetSearchFlags, 3135).
--define(wxStyledTextCtrl_CallTipShow, 3136).
--define(wxStyledTextCtrl_CallTipCancel, 3137).
--define(wxStyledTextCtrl_CallTipActive, 3138).
--define(wxStyledTextCtrl_CallTipPosAtStart, 3139).
--define(wxStyledTextCtrl_CallTipSetHighlight, 3140).
--define(wxStyledTextCtrl_CallTipSetBackground, 3141).
--define(wxStyledTextCtrl_CallTipSetForeground, 3142).
--define(wxStyledTextCtrl_CallTipSetForegroundHighlight, 3143).
--define(wxStyledTextCtrl_CallTipUseStyle, 3144).
--define(wxStyledTextCtrl_VisibleFromDocLine, 3145).
--define(wxStyledTextCtrl_DocLineFromVisible, 3146).
--define(wxStyledTextCtrl_WrapCount, 3147).
--define(wxStyledTextCtrl_SetFoldLevel, 3148).
--define(wxStyledTextCtrl_GetFoldLevel, 3149).
--define(wxStyledTextCtrl_GetLastChild, 3150).
--define(wxStyledTextCtrl_GetFoldParent, 3151).
--define(wxStyledTextCtrl_ShowLines, 3152).
--define(wxStyledTextCtrl_HideLines, 3153).
--define(wxStyledTextCtrl_GetLineVisible, 3154).
--define(wxStyledTextCtrl_SetFoldExpanded, 3155).
--define(wxStyledTextCtrl_GetFoldExpanded, 3156).
--define(wxStyledTextCtrl_ToggleFold, 3157).
--define(wxStyledTextCtrl_EnsureVisible, 3158).
--define(wxStyledTextCtrl_SetFoldFlags, 3159).
--define(wxStyledTextCtrl_EnsureVisibleEnforcePolicy, 3160).
--define(wxStyledTextCtrl_SetTabIndents, 3161).
--define(wxStyledTextCtrl_GetTabIndents, 3162).
--define(wxStyledTextCtrl_SetBackSpaceUnIndents, 3163).
--define(wxStyledTextCtrl_GetBackSpaceUnIndents, 3164).
--define(wxStyledTextCtrl_SetMouseDwellTime, 3165).
--define(wxStyledTextCtrl_GetMouseDwellTime, 3166).
--define(wxStyledTextCtrl_WordStartPosition, 3167).
--define(wxStyledTextCtrl_WordEndPosition, 3168).
--define(wxStyledTextCtrl_SetWrapMode, 3169).
--define(wxStyledTextCtrl_GetWrapMode, 3170).
--define(wxStyledTextCtrl_SetWrapVisualFlags, 3171).
--define(wxStyledTextCtrl_GetWrapVisualFlags, 3172).
--define(wxStyledTextCtrl_SetWrapVisualFlagsLocation, 3173).
--define(wxStyledTextCtrl_GetWrapVisualFlagsLocation, 3174).
--define(wxStyledTextCtrl_SetWrapStartIndent, 3175).
--define(wxStyledTextCtrl_GetWrapStartIndent, 3176).
--define(wxStyledTextCtrl_SetLayoutCache, 3177).
--define(wxStyledTextCtrl_GetLayoutCache, 3178).
--define(wxStyledTextCtrl_SetScrollWidth, 3179).
--define(wxStyledTextCtrl_GetScrollWidth, 3180).
--define(wxStyledTextCtrl_TextWidth, 3181).
--define(wxStyledTextCtrl_GetEndAtLastLine, 3182).
--define(wxStyledTextCtrl_TextHeight, 3183).
--define(wxStyledTextCtrl_SetUseVerticalScrollBar, 3184).
--define(wxStyledTextCtrl_GetUseVerticalScrollBar, 3185).
--define(wxStyledTextCtrl_AppendText, 3186).
--define(wxStyledTextCtrl_GetTwoPhaseDraw, 3187).
--define(wxStyledTextCtrl_SetTwoPhaseDraw, 3188).
--define(wxStyledTextCtrl_TargetFromSelection, 3189).
--define(wxStyledTextCtrl_LinesJoin, 3190).
--define(wxStyledTextCtrl_LinesSplit, 3191).
--define(wxStyledTextCtrl_SetFoldMarginColour, 3192).
--define(wxStyledTextCtrl_SetFoldMarginHiColour, 3193).
--define(wxStyledTextCtrl_LineDown, 3194).
--define(wxStyledTextCtrl_LineDownExtend, 3195).
--define(wxStyledTextCtrl_LineUp, 3196).
--define(wxStyledTextCtrl_LineUpExtend, 3197).
--define(wxStyledTextCtrl_CharLeft, 3198).
--define(wxStyledTextCtrl_CharLeftExtend, 3199).
--define(wxStyledTextCtrl_CharRight, 3200).
--define(wxStyledTextCtrl_CharRightExtend, 3201).
--define(wxStyledTextCtrl_WordLeft, 3202).
--define(wxStyledTextCtrl_WordLeftExtend, 3203).
--define(wxStyledTextCtrl_WordRight, 3204).
--define(wxStyledTextCtrl_WordRightExtend, 3205).
--define(wxStyledTextCtrl_Home, 3206).
--define(wxStyledTextCtrl_HomeExtend, 3207).
--define(wxStyledTextCtrl_LineEnd, 3208).
--define(wxStyledTextCtrl_LineEndExtend, 3209).
--define(wxStyledTextCtrl_DocumentStart, 3210).
--define(wxStyledTextCtrl_DocumentStartExtend, 3211).
--define(wxStyledTextCtrl_DocumentEnd, 3212).
--define(wxStyledTextCtrl_DocumentEndExtend, 3213).
--define(wxStyledTextCtrl_PageUp, 3214).
--define(wxStyledTextCtrl_PageUpExtend, 3215).
--define(wxStyledTextCtrl_PageDown, 3216).
--define(wxStyledTextCtrl_PageDownExtend, 3217).
--define(wxStyledTextCtrl_EditToggleOvertype, 3218).
--define(wxStyledTextCtrl_Cancel, 3219).
--define(wxStyledTextCtrl_DeleteBack, 3220).
--define(wxStyledTextCtrl_Tab, 3221).
--define(wxStyledTextCtrl_BackTab, 3222).
--define(wxStyledTextCtrl_NewLine, 3223).
--define(wxStyledTextCtrl_FormFeed, 3224).
--define(wxStyledTextCtrl_VCHome, 3225).
--define(wxStyledTextCtrl_VCHomeExtend, 3226).
--define(wxStyledTextCtrl_ZoomIn, 3227).
--define(wxStyledTextCtrl_ZoomOut, 3228).
--define(wxStyledTextCtrl_DelWordLeft, 3229).
--define(wxStyledTextCtrl_DelWordRight, 3230).
--define(wxStyledTextCtrl_LineCut, 3231).
--define(wxStyledTextCtrl_LineDelete, 3232).
--define(wxStyledTextCtrl_LineTranspose, 3233).
--define(wxStyledTextCtrl_LineDuplicate, 3234).
--define(wxStyledTextCtrl_LowerCase, 3235).
--define(wxStyledTextCtrl_UpperCase, 3236).
--define(wxStyledTextCtrl_LineScrollDown, 3237).
--define(wxStyledTextCtrl_LineScrollUp, 3238).
--define(wxStyledTextCtrl_DeleteBackNotLine, 3239).
--define(wxStyledTextCtrl_HomeDisplay, 3240).
--define(wxStyledTextCtrl_HomeDisplayExtend, 3241).
--define(wxStyledTextCtrl_LineEndDisplay, 3242).
--define(wxStyledTextCtrl_LineEndDisplayExtend, 3243).
--define(wxStyledTextCtrl_HomeWrapExtend, 3244).
--define(wxStyledTextCtrl_LineEndWrap, 3245).
--define(wxStyledTextCtrl_LineEndWrapExtend, 3246).
--define(wxStyledTextCtrl_VCHomeWrap, 3247).
--define(wxStyledTextCtrl_VCHomeWrapExtend, 3248).
--define(wxStyledTextCtrl_LineCopy, 3249).
--define(wxStyledTextCtrl_MoveCaretInsideView, 3250).
--define(wxStyledTextCtrl_LineLength, 3251).
--define(wxStyledTextCtrl_BraceHighlight, 3252).
--define(wxStyledTextCtrl_BraceBadLight, 3253).
--define(wxStyledTextCtrl_BraceMatch, 3254).
--define(wxStyledTextCtrl_GetViewEOL, 3255).
--define(wxStyledTextCtrl_SetViewEOL, 3256).
--define(wxStyledTextCtrl_SetModEventMask, 3257).
--define(wxStyledTextCtrl_GetEdgeColumn, 3258).
--define(wxStyledTextCtrl_SetEdgeColumn, 3259).
--define(wxStyledTextCtrl_GetEdgeMode, 3260).
--define(wxStyledTextCtrl_GetEdgeColour, 3261).
--define(wxStyledTextCtrl_SetEdgeColour, 3262).
--define(wxStyledTextCtrl_SearchAnchor, 3263).
--define(wxStyledTextCtrl_SearchNext, 3264).
--define(wxStyledTextCtrl_SearchPrev, 3265).
--define(wxStyledTextCtrl_LinesOnScreen, 3266).
--define(wxStyledTextCtrl_UsePopUp, 3267).
--define(wxStyledTextCtrl_SelectionIsRectangle, 3268).
--define(wxStyledTextCtrl_SetZoom, 3269).
--define(wxStyledTextCtrl_GetZoom, 3270).
--define(wxStyledTextCtrl_GetModEventMask, 3271).
--define(wxStyledTextCtrl_SetSTCFocus, 3272).
--define(wxStyledTextCtrl_GetSTCFocus, 3273).
--define(wxStyledTextCtrl_SetStatus, 3274).
--define(wxStyledTextCtrl_GetStatus, 3275).
--define(wxStyledTextCtrl_SetMouseDownCaptures, 3276).
--define(wxStyledTextCtrl_GetMouseDownCaptures, 3277).
--define(wxStyledTextCtrl_SetSTCCursor, 3278).
--define(wxStyledTextCtrl_GetSTCCursor, 3279).
--define(wxStyledTextCtrl_SetControlCharSymbol, 3280).
--define(wxStyledTextCtrl_GetControlCharSymbol, 3281).
--define(wxStyledTextCtrl_WordPartLeft, 3282).
--define(wxStyledTextCtrl_WordPartLeftExtend, 3283).
--define(wxStyledTextCtrl_WordPartRight, 3284).
--define(wxStyledTextCtrl_WordPartRightExtend, 3285).
--define(wxStyledTextCtrl_SetVisiblePolicy, 3286).
--define(wxStyledTextCtrl_DelLineLeft, 3287).
--define(wxStyledTextCtrl_DelLineRight, 3288).
--define(wxStyledTextCtrl_GetXOffset, 3289).
--define(wxStyledTextCtrl_ChooseCaretX, 3290).
--define(wxStyledTextCtrl_SetXCaretPolicy, 3291).
--define(wxStyledTextCtrl_SetYCaretPolicy, 3292).
--define(wxStyledTextCtrl_GetPrintWrapMode, 3293).
--define(wxStyledTextCtrl_SetHotspotActiveForeground, 3294).
--define(wxStyledTextCtrl_SetHotspotActiveBackground, 3295).
--define(wxStyledTextCtrl_SetHotspotActiveUnderline, 3296).
--define(wxStyledTextCtrl_SetHotspotSingleLine, 3297).
--define(wxStyledTextCtrl_ParaDownExtend, 3298).
--define(wxStyledTextCtrl_ParaUp, 3299).
--define(wxStyledTextCtrl_ParaUpExtend, 3300).
--define(wxStyledTextCtrl_PositionBefore, 3301).
--define(wxStyledTextCtrl_PositionAfter, 3302).
--define(wxStyledTextCtrl_CopyRange, 3303).
--define(wxStyledTextCtrl_CopyText, 3304).
--define(wxStyledTextCtrl_SetSelectionMode, 3305).
--define(wxStyledTextCtrl_GetSelectionMode, 3306).
--define(wxStyledTextCtrl_LineDownRectExtend, 3307).
--define(wxStyledTextCtrl_LineUpRectExtend, 3308).
--define(wxStyledTextCtrl_CharLeftRectExtend, 3309).
--define(wxStyledTextCtrl_CharRightRectExtend, 3310).
--define(wxStyledTextCtrl_HomeRectExtend, 3311).
--define(wxStyledTextCtrl_VCHomeRectExtend, 3312).
--define(wxStyledTextCtrl_LineEndRectExtend, 3313).
--define(wxStyledTextCtrl_PageUpRectExtend, 3314).
--define(wxStyledTextCtrl_PageDownRectExtend, 3315).
--define(wxStyledTextCtrl_StutteredPageUp, 3316).
--define(wxStyledTextCtrl_StutteredPageUpExtend, 3317).
--define(wxStyledTextCtrl_StutteredPageDown, 3318).
--define(wxStyledTextCtrl_StutteredPageDownExtend, 3319).
--define(wxStyledTextCtrl_WordLeftEnd, 3320).
--define(wxStyledTextCtrl_WordLeftEndExtend, 3321).
--define(wxStyledTextCtrl_WordRightEnd, 3322).
--define(wxStyledTextCtrl_WordRightEndExtend, 3323).
--define(wxStyledTextCtrl_SetWhitespaceChars, 3324).
--define(wxStyledTextCtrl_SetCharsDefault, 3325).
--define(wxStyledTextCtrl_AutoCompGetCurrent, 3326).
--define(wxStyledTextCtrl_Allocate, 3327).
--define(wxStyledTextCtrl_FindColumn, 3328).
--define(wxStyledTextCtrl_GetCaretSticky, 3329).
--define(wxStyledTextCtrl_SetCaretSticky, 3330).
--define(wxStyledTextCtrl_ToggleCaretSticky, 3331).
--define(wxStyledTextCtrl_SetPasteConvertEndings, 3332).
--define(wxStyledTextCtrl_GetPasteConvertEndings, 3333).
--define(wxStyledTextCtrl_SelectionDuplicate, 3334).
--define(wxStyledTextCtrl_SetCaretLineBackAlpha, 3335).
--define(wxStyledTextCtrl_GetCaretLineBackAlpha, 3336).
--define(wxStyledTextCtrl_StartRecord, 3337).
--define(wxStyledTextCtrl_StopRecord, 3338).
--define(wxStyledTextCtrl_SetLexer, 3339).
--define(wxStyledTextCtrl_GetLexer, 3340).
--define(wxStyledTextCtrl_Colourise, 3341).
--define(wxStyledTextCtrl_SetProperty, 3342).
--define(wxStyledTextCtrl_SetKeyWords, 3343).
--define(wxStyledTextCtrl_SetLexerLanguage, 3344).
--define(wxStyledTextCtrl_GetProperty, 3345).
--define(wxStyledTextCtrl_GetStyleBitsNeeded, 3346).
--define(wxStyledTextCtrl_GetCurrentLine, 3347).
--define(wxStyledTextCtrl_StyleSetSpec, 3348).
--define(wxStyledTextCtrl_StyleSetFont, 3349).
--define(wxStyledTextCtrl_StyleSetFontAttr, 3350).
--define(wxStyledTextCtrl_StyleSetCharacterSet, 3351).
--define(wxStyledTextCtrl_StyleSetFontEncoding, 3352).
--define(wxStyledTextCtrl_CmdKeyExecute, 3353).
--define(wxStyledTextCtrl_SetMargins, 3354).
--define(wxStyledTextCtrl_GetSelection, 3355).
--define(wxStyledTextCtrl_PointFromPosition, 3356).
--define(wxStyledTextCtrl_ScrollToLine, 3357).
--define(wxStyledTextCtrl_ScrollToColumn, 3358).
--define(wxStyledTextCtrl_SendMsg, 3359).
--define(wxStyledTextCtrl_SetVScrollBar, 3360).
--define(wxStyledTextCtrl_SetHScrollBar, 3361).
--define(wxStyledTextCtrl_GetLastKeydownProcessed, 3362).
--define(wxStyledTextCtrl_SetLastKeydownProcessed, 3363).
--define(wxStyledTextCtrl_SaveFile, 3364).
--define(wxStyledTextCtrl_LoadFile, 3365).
--define(wxStyledTextCtrl_DoDragOver, 3366).
--define(wxStyledTextCtrl_DoDropText, 3367).
--define(wxStyledTextCtrl_GetUseAntiAliasing, 3368).
--define(wxStyledTextCtrl_AddTextRaw, 3369).
--define(wxStyledTextCtrl_InsertTextRaw, 3370).
--define(wxStyledTextCtrl_GetCurLineRaw, 3371).
--define(wxStyledTextCtrl_GetLineRaw, 3372).
--define(wxStyledTextCtrl_GetSelectedTextRaw, 3373).
--define(wxStyledTextCtrl_GetTextRangeRaw, 3374).
--define(wxStyledTextCtrl_SetTextRaw, 3375).
--define(wxStyledTextCtrl_GetTextRaw, 3376).
--define(wxStyledTextCtrl_AppendTextRaw, 3377).
--define(wxArtProvider_GetBitmap, 3378).
--define(wxArtProvider_GetIcon, 3379).
--define(wxTreeEvent_GetKeyCode, 3380).
--define(wxTreeEvent_GetItem, 3381).
--define(wxTreeEvent_GetKeyEvent, 3382).
--define(wxTreeEvent_GetLabel, 3383).
--define(wxTreeEvent_GetOldItem, 3384).
--define(wxTreeEvent_GetPoint, 3385).
--define(wxTreeEvent_IsEditCancelled, 3386).
--define(wxTreeEvent_SetToolTip, 3387).
--define(wxNotebookEvent_GetOldSelection, 3388).
--define(wxNotebookEvent_GetSelection, 3389).
--define(wxNotebookEvent_SetOldSelection, 3390).
--define(wxNotebookEvent_SetSelection, 3391).
--define(wxFileDataObject_new, 3392).
--define(wxFileDataObject_AddFile, 3393).
--define(wxFileDataObject_GetFilenames, 3394).
--define(wxFileDataObject_destroy, 3395).
--define(wxTextDataObject_new, 3396).
--define(wxTextDataObject_GetTextLength, 3397).
--define(wxTextDataObject_GetText, 3398).
--define(wxTextDataObject_SetText, 3399).
--define(wxTextDataObject_destroy, 3400).
--define(wxBitmapDataObject_new_1_1, 3401).
--define(wxBitmapDataObject_new_1_0, 3402).
--define(wxBitmapDataObject_GetBitmap, 3403).
--define(wxBitmapDataObject_SetBitmap, 3404).
--define(wxBitmapDataObject_destroy, 3405).
--define(wxClipboard_new, 3407).
--define(wxClipboard_destruct, 3408).
--define(wxClipboard_AddData, 3409).
--define(wxClipboard_Clear, 3410).
--define(wxClipboard_Close, 3411).
--define(wxClipboard_Flush, 3412).
--define(wxClipboard_GetData, 3413).
--define(wxClipboard_IsOpened, 3414).
--define(wxClipboard_Open, 3415).
--define(wxClipboard_SetData, 3416).
--define(wxClipboard_UsePrimarySelection, 3418).
--define(wxClipboard_IsSupported, 3419).
--define(wxClipboard_Get, 3420).
--define(wxSpinEvent_GetPosition, 3421).
--define(wxSpinEvent_SetPosition, 3422).
--define(wxSplitterWindow_new_0, 3423).
--define(wxSplitterWindow_new_2, 3424).
--define(wxSplitterWindow_destruct, 3425).
--define(wxSplitterWindow_Create, 3426).
--define(wxSplitterWindow_GetMinimumPaneSize, 3427).
--define(wxSplitterWindow_GetSashGravity, 3428).
--define(wxSplitterWindow_GetSashPosition, 3429).
--define(wxSplitterWindow_GetSplitMode, 3430).
--define(wxSplitterWindow_GetWindow1, 3431).
--define(wxSplitterWindow_GetWindow2, 3432).
--define(wxSplitterWindow_Initialize, 3433).
--define(wxSplitterWindow_IsSplit, 3434).
--define(wxSplitterWindow_ReplaceWindow, 3435).
--define(wxSplitterWindow_SetSashGravity, 3436).
--define(wxSplitterWindow_SetSashPosition, 3437).
--define(wxSplitterWindow_SetSashSize, 3438).
--define(wxSplitterWindow_SetMinimumPaneSize, 3439).
--define(wxSplitterWindow_SetSplitMode, 3440).
--define(wxSplitterWindow_SplitHorizontally, 3441).
--define(wxSplitterWindow_SplitVertically, 3442).
--define(wxSplitterWindow_Unsplit, 3443).
--define(wxSplitterWindow_UpdateSize, 3444).
--define(wxSplitterEvent_GetSashPosition, 3445).
--define(wxSplitterEvent_GetX, 3446).
--define(wxSplitterEvent_GetY, 3447).
--define(wxSplitterEvent_GetWindowBeingRemoved, 3448).
--define(wxSplitterEvent_SetSashPosition, 3449).
--define(wxHtmlWindow_new_0, 3450).
--define(wxHtmlWindow_new_2, 3451).
--define(wxHtmlWindow_AppendToPage, 3452).
--define(wxHtmlWindow_GetOpenedAnchor, 3453).
--define(wxHtmlWindow_GetOpenedPage, 3454).
--define(wxHtmlWindow_GetOpenedPageTitle, 3455).
--define(wxHtmlWindow_GetRelatedFrame, 3456).
--define(wxHtmlWindow_HistoryBack, 3457).
--define(wxHtmlWindow_HistoryCanBack, 3458).
--define(wxHtmlWindow_HistoryCanForward, 3459).
--define(wxHtmlWindow_HistoryClear, 3460).
--define(wxHtmlWindow_HistoryForward, 3461).
--define(wxHtmlWindow_LoadFile, 3462).
--define(wxHtmlWindow_LoadPage, 3463).
--define(wxHtmlWindow_SelectAll, 3464).
--define(wxHtmlWindow_SelectionToText, 3465).
--define(wxHtmlWindow_SelectLine, 3466).
--define(wxHtmlWindow_SelectWord, 3467).
--define(wxHtmlWindow_SetBorders, 3468).
--define(wxHtmlWindow_SetFonts, 3469).
--define(wxHtmlWindow_SetPage, 3470).
--define(wxHtmlWindow_SetRelatedFrame, 3471).
--define(wxHtmlWindow_SetRelatedStatusBar, 3472).
--define(wxHtmlWindow_ToText, 3473).
--define(wxHtmlWindow_destroy, 3474).
--define(wxHtmlLinkEvent_GetLinkInfo, 3475).
--define(wxSystemSettings_GetColour, 3476).
--define(wxSystemSettings_GetFont, 3477).
--define(wxSystemSettings_GetMetric, 3478).
--define(wxSystemSettings_GetScreenType, 3479).
--define(wxAuiNotebookEvent_SetSelection, 3480).
--define(wxAuiNotebookEvent_GetSelection, 3481).
--define(wxAuiNotebookEvent_SetOldSelection, 3482).
--define(wxAuiNotebookEvent_GetOldSelection, 3483).
--define(wxAuiNotebookEvent_SetDragSource, 3484).
--define(wxAuiNotebookEvent_GetDragSource, 3485).
--define(wxAuiManagerEvent_SetManager, 3486).
--define(wxAuiManagerEvent_GetManager, 3487).
--define(wxAuiManagerEvent_SetPane, 3488).
--define(wxAuiManagerEvent_GetPane, 3489).
--define(wxAuiManagerEvent_SetButton, 3490).
--define(wxAuiManagerEvent_GetButton, 3491).
--define(wxAuiManagerEvent_SetDC, 3492).
--define(wxAuiManagerEvent_GetDC, 3493).
--define(wxAuiManagerEvent_Veto, 3494).
--define(wxAuiManagerEvent_GetVeto, 3495).
--define(wxAuiManagerEvent_SetCanVeto, 3496).
--define(wxAuiManagerEvent_CanVeto, 3497).
--define(wxLogNull_new, 3498).
--define(wxLogNull_destroy, 3499).
+-define(wxListItemAttr_new_0, 1757).
+-define(wxListItemAttr_new_3, 1758).
+-define(wxListItemAttr_GetBackgroundColour, 1759).
+-define(wxListItemAttr_GetFont, 1760).
+-define(wxListItemAttr_GetTextColour, 1761).
+-define(wxListItemAttr_HasBackgroundColour, 1762).
+-define(wxListItemAttr_HasFont, 1763).
+-define(wxListItemAttr_HasTextColour, 1764).
+-define(wxListItemAttr_SetBackgroundColour, 1765).
+-define(wxListItemAttr_SetFont, 1766).
+-define(wxListItemAttr_SetTextColour, 1767).
+-define(wxListItemAttr_destroy, 1768).
+-define(wxImageList_new_0, 1769).
+-define(wxImageList_new_3, 1770).
+-define(wxImageList_Add_1, 1771).
+-define(wxImageList_Add_2_0, 1772).
+-define(wxImageList_Add_2_1, 1773).
+-define(wxImageList_Create, 1774).
+-define(wxImageList_Draw, 1776).
+-define(wxImageList_GetBitmap, 1777).
+-define(wxImageList_GetIcon, 1778).
+-define(wxImageList_GetImageCount, 1779).
+-define(wxImageList_GetSize, 1780).
+-define(wxImageList_Remove, 1781).
+-define(wxImageList_RemoveAll, 1782).
+-define(wxImageList_Replace_2, 1783).
+-define(wxImageList_Replace_3, 1784).
+-define(wxImageList_destroy, 1785).
+-define(wxTextAttr_new_0, 1786).
+-define(wxTextAttr_new_2, 1787).
+-define(wxTextAttr_GetAlignment, 1788).
+-define(wxTextAttr_GetBackgroundColour, 1789).
+-define(wxTextAttr_GetFont, 1790).
+-define(wxTextAttr_GetLeftIndent, 1791).
+-define(wxTextAttr_GetLeftSubIndent, 1792).
+-define(wxTextAttr_GetRightIndent, 1793).
+-define(wxTextAttr_GetTabs, 1794).
+-define(wxTextAttr_GetTextColour, 1795).
+-define(wxTextAttr_HasBackgroundColour, 1796).
+-define(wxTextAttr_HasFont, 1797).
+-define(wxTextAttr_HasTextColour, 1798).
+-define(wxTextAttr_GetFlags, 1799).
+-define(wxTextAttr_IsDefault, 1800).
+-define(wxTextAttr_SetAlignment, 1801).
+-define(wxTextAttr_SetBackgroundColour, 1802).
+-define(wxTextAttr_SetFlags, 1803).
+-define(wxTextAttr_SetFont, 1804).
+-define(wxTextAttr_SetLeftIndent, 1805).
+-define(wxTextAttr_SetRightIndent, 1806).
+-define(wxTextAttr_SetTabs, 1807).
+-define(wxTextAttr_SetTextColour, 1808).
+-define(wxTextAttr_destroy, 1809).
+-define(wxTextCtrl_new_3, 1811).
+-define(wxTextCtrl_new_0, 1812).
+-define(wxTextCtrl_destruct, 1814).
+-define(wxTextCtrl_AppendText, 1815).
+-define(wxTextCtrl_CanCopy, 1816).
+-define(wxTextCtrl_CanCut, 1817).
+-define(wxTextCtrl_CanPaste, 1818).
+-define(wxTextCtrl_CanRedo, 1819).
+-define(wxTextCtrl_CanUndo, 1820).
+-define(wxTextCtrl_Clear, 1821).
+-define(wxTextCtrl_Copy, 1822).
+-define(wxTextCtrl_Create, 1823).
+-define(wxTextCtrl_Cut, 1824).
+-define(wxTextCtrl_DiscardEdits, 1825).
+-define(wxTextCtrl_EmulateKeyPress, 1826).
+-define(wxTextCtrl_GetDefaultStyle, 1827).
+-define(wxTextCtrl_GetInsertionPoint, 1828).
+-define(wxTextCtrl_GetLastPosition, 1829).
+-define(wxTextCtrl_GetLineLength, 1830).
+-define(wxTextCtrl_GetLineText, 1831).
+-define(wxTextCtrl_GetNumberOfLines, 1832).
+-define(wxTextCtrl_GetRange, 1833).
+-define(wxTextCtrl_GetSelection, 1834).
+-define(wxTextCtrl_GetStringSelection, 1835).
+-define(wxTextCtrl_GetStyle, 1836).
+-define(wxTextCtrl_GetValue, 1837).
+-define(wxTextCtrl_IsEditable, 1838).
+-define(wxTextCtrl_IsModified, 1839).
+-define(wxTextCtrl_IsMultiLine, 1840).
+-define(wxTextCtrl_IsSingleLine, 1841).
+-define(wxTextCtrl_LoadFile, 1842).
+-define(wxTextCtrl_MarkDirty, 1843).
+-define(wxTextCtrl_Paste, 1844).
+-define(wxTextCtrl_PositionToXY, 1845).
+-define(wxTextCtrl_Redo, 1846).
+-define(wxTextCtrl_Remove, 1847).
+-define(wxTextCtrl_Replace, 1848).
+-define(wxTextCtrl_SaveFile, 1849).
+-define(wxTextCtrl_SetDefaultStyle, 1850).
+-define(wxTextCtrl_SetEditable, 1851).
+-define(wxTextCtrl_SetInsertionPoint, 1852).
+-define(wxTextCtrl_SetInsertionPointEnd, 1853).
+-define(wxTextCtrl_SetMaxLength, 1855).
+-define(wxTextCtrl_SetSelection, 1856).
+-define(wxTextCtrl_SetStyle, 1857).
+-define(wxTextCtrl_SetValue, 1858).
+-define(wxTextCtrl_ShowPosition, 1859).
+-define(wxTextCtrl_Undo, 1860).
+-define(wxTextCtrl_WriteText, 1861).
+-define(wxTextCtrl_XYToPosition, 1862).
+-define(wxNotebook_new_0, 1865).
+-define(wxNotebook_new_3, 1866).
+-define(wxNotebook_destruct, 1867).
+-define(wxNotebook_AddPage, 1868).
+-define(wxNotebook_AdvanceSelection, 1869).
+-define(wxNotebook_AssignImageList, 1870).
+-define(wxNotebook_Create, 1871).
+-define(wxNotebook_DeleteAllPages, 1872).
+-define(wxNotebook_DeletePage, 1873).
+-define(wxNotebook_RemovePage, 1874).
+-define(wxNotebook_GetCurrentPage, 1875).
+-define(wxNotebook_GetImageList, 1876).
+-define(wxNotebook_GetPage, 1878).
+-define(wxNotebook_GetPageCount, 1879).
+-define(wxNotebook_GetPageImage, 1880).
+-define(wxNotebook_GetPageText, 1881).
+-define(wxNotebook_GetRowCount, 1882).
+-define(wxNotebook_GetSelection, 1883).
+-define(wxNotebook_GetThemeBackgroundColour, 1884).
+-define(wxNotebook_HitTest, 1886).
+-define(wxNotebook_InsertPage, 1888).
+-define(wxNotebook_SetImageList, 1889).
+-define(wxNotebook_SetPadding, 1890).
+-define(wxNotebook_SetPageSize, 1891).
+-define(wxNotebook_SetPageImage, 1892).
+-define(wxNotebook_SetPageText, 1893).
+-define(wxNotebook_SetSelection, 1894).
+-define(wxNotebook_ChangeSelection, 1895).
+-define(wxChoicebook_new_0, 1896).
+-define(wxChoicebook_new_3, 1897).
+-define(wxChoicebook_AddPage, 1898).
+-define(wxChoicebook_AdvanceSelection, 1899).
+-define(wxChoicebook_AssignImageList, 1900).
+-define(wxChoicebook_Create, 1901).
+-define(wxChoicebook_DeleteAllPages, 1902).
+-define(wxChoicebook_DeletePage, 1903).
+-define(wxChoicebook_RemovePage, 1904).
+-define(wxChoicebook_GetCurrentPage, 1905).
+-define(wxChoicebook_GetImageList, 1906).
+-define(wxChoicebook_GetPage, 1908).
+-define(wxChoicebook_GetPageCount, 1909).
+-define(wxChoicebook_GetPageImage, 1910).
+-define(wxChoicebook_GetPageText, 1911).
+-define(wxChoicebook_GetSelection, 1912).
+-define(wxChoicebook_HitTest, 1913).
+-define(wxChoicebook_InsertPage, 1914).
+-define(wxChoicebook_SetImageList, 1915).
+-define(wxChoicebook_SetPageSize, 1916).
+-define(wxChoicebook_SetPageImage, 1917).
+-define(wxChoicebook_SetPageText, 1918).
+-define(wxChoicebook_SetSelection, 1919).
+-define(wxChoicebook_ChangeSelection, 1920).
+-define(wxChoicebook_destroy, 1921).
+-define(wxToolbook_new_0, 1922).
+-define(wxToolbook_new_3, 1923).
+-define(wxToolbook_AddPage, 1924).
+-define(wxToolbook_AdvanceSelection, 1925).
+-define(wxToolbook_AssignImageList, 1926).
+-define(wxToolbook_Create, 1927).
+-define(wxToolbook_DeleteAllPages, 1928).
+-define(wxToolbook_DeletePage, 1929).
+-define(wxToolbook_RemovePage, 1930).
+-define(wxToolbook_GetCurrentPage, 1931).
+-define(wxToolbook_GetImageList, 1932).
+-define(wxToolbook_GetPage, 1934).
+-define(wxToolbook_GetPageCount, 1935).
+-define(wxToolbook_GetPageImage, 1936).
+-define(wxToolbook_GetPageText, 1937).
+-define(wxToolbook_GetSelection, 1938).
+-define(wxToolbook_HitTest, 1940).
+-define(wxToolbook_InsertPage, 1941).
+-define(wxToolbook_SetImageList, 1942).
+-define(wxToolbook_SetPageSize, 1943).
+-define(wxToolbook_SetPageImage, 1944).
+-define(wxToolbook_SetPageText, 1945).
+-define(wxToolbook_SetSelection, 1946).
+-define(wxToolbook_ChangeSelection, 1947).
+-define(wxToolbook_destroy, 1948).
+-define(wxListbook_new_0, 1949).
+-define(wxListbook_new_3, 1950).
+-define(wxListbook_AddPage, 1951).
+-define(wxListbook_AdvanceSelection, 1952).
+-define(wxListbook_AssignImageList, 1953).
+-define(wxListbook_Create, 1954).
+-define(wxListbook_DeleteAllPages, 1955).
+-define(wxListbook_DeletePage, 1956).
+-define(wxListbook_RemovePage, 1957).
+-define(wxListbook_GetCurrentPage, 1958).
+-define(wxListbook_GetImageList, 1959).
+-define(wxListbook_GetPage, 1961).
+-define(wxListbook_GetPageCount, 1962).
+-define(wxListbook_GetPageImage, 1963).
+-define(wxListbook_GetPageText, 1964).
+-define(wxListbook_GetSelection, 1965).
+-define(wxListbook_HitTest, 1967).
+-define(wxListbook_InsertPage, 1968).
+-define(wxListbook_SetImageList, 1969).
+-define(wxListbook_SetPageSize, 1970).
+-define(wxListbook_SetPageImage, 1971).
+-define(wxListbook_SetPageText, 1972).
+-define(wxListbook_SetSelection, 1973).
+-define(wxListbook_ChangeSelection, 1974).
+-define(wxListbook_destroy, 1975).
+-define(wxTreebook_new_0, 1976).
+-define(wxTreebook_new_3, 1977).
+-define(wxTreebook_AddPage, 1978).
+-define(wxTreebook_AdvanceSelection, 1979).
+-define(wxTreebook_AssignImageList, 1980).
+-define(wxTreebook_Create, 1981).
+-define(wxTreebook_DeleteAllPages, 1982).
+-define(wxTreebook_DeletePage, 1983).
+-define(wxTreebook_RemovePage, 1984).
+-define(wxTreebook_GetCurrentPage, 1985).
+-define(wxTreebook_GetImageList, 1986).
+-define(wxTreebook_GetPage, 1988).
+-define(wxTreebook_GetPageCount, 1989).
+-define(wxTreebook_GetPageImage, 1990).
+-define(wxTreebook_GetPageText, 1991).
+-define(wxTreebook_GetSelection, 1992).
+-define(wxTreebook_ExpandNode, 1993).
+-define(wxTreebook_IsNodeExpanded, 1994).
+-define(wxTreebook_HitTest, 1996).
+-define(wxTreebook_InsertPage, 1997).
+-define(wxTreebook_InsertSubPage, 1998).
+-define(wxTreebook_SetImageList, 1999).
+-define(wxTreebook_SetPageSize, 2000).
+-define(wxTreebook_SetPageImage, 2001).
+-define(wxTreebook_SetPageText, 2002).
+-define(wxTreebook_SetSelection, 2003).
+-define(wxTreebook_ChangeSelection, 2004).
+-define(wxTreebook_destroy, 2005).
+-define(wxTreeCtrl_new_2, 2008).
+-define(wxTreeCtrl_new_0, 2009).
+-define(wxTreeCtrl_destruct, 2011).
+-define(wxTreeCtrl_AddRoot, 2012).
+-define(wxTreeCtrl_AppendItem, 2013).
+-define(wxTreeCtrl_AssignImageList, 2014).
+-define(wxTreeCtrl_AssignStateImageList, 2015).
+-define(wxTreeCtrl_Collapse, 2016).
+-define(wxTreeCtrl_CollapseAndReset, 2017).
+-define(wxTreeCtrl_Create, 2018).
+-define(wxTreeCtrl_Delete, 2019).
+-define(wxTreeCtrl_DeleteAllItems, 2020).
+-define(wxTreeCtrl_DeleteChildren, 2021).
+-define(wxTreeCtrl_EditLabel, 2022).
+-define(wxTreeCtrl_EnsureVisible, 2023).
+-define(wxTreeCtrl_Expand, 2024).
+-define(wxTreeCtrl_GetBoundingRect, 2025).
+-define(wxTreeCtrl_GetChildrenCount, 2027).
+-define(wxTreeCtrl_GetCount, 2028).
+-define(wxTreeCtrl_GetEditControl, 2029).
+-define(wxTreeCtrl_GetFirstChild, 2030).
+-define(wxTreeCtrl_GetNextChild, 2031).
+-define(wxTreeCtrl_GetFirstVisibleItem, 2032).
+-define(wxTreeCtrl_GetImageList, 2033).
+-define(wxTreeCtrl_GetIndent, 2034).
+-define(wxTreeCtrl_GetItemBackgroundColour, 2035).
+-define(wxTreeCtrl_GetItemData, 2036).
+-define(wxTreeCtrl_GetItemFont, 2037).
+-define(wxTreeCtrl_GetItemImage_1, 2038).
+-define(wxTreeCtrl_GetItemImage_2, 2039).
+-define(wxTreeCtrl_GetItemText, 2040).
+-define(wxTreeCtrl_GetItemTextColour, 2041).
+-define(wxTreeCtrl_GetLastChild, 2042).
+-define(wxTreeCtrl_GetNextSibling, 2043).
+-define(wxTreeCtrl_GetNextVisible, 2044).
+-define(wxTreeCtrl_GetItemParent, 2045).
+-define(wxTreeCtrl_GetPrevSibling, 2046).
+-define(wxTreeCtrl_GetPrevVisible, 2047).
+-define(wxTreeCtrl_GetRootItem, 2048).
+-define(wxTreeCtrl_GetSelection, 2049).
+-define(wxTreeCtrl_GetSelections, 2050).
+-define(wxTreeCtrl_GetStateImageList, 2051).
+-define(wxTreeCtrl_HitTest, 2052).
+-define(wxTreeCtrl_InsertItem, 2054).
+-define(wxTreeCtrl_IsBold, 2055).
+-define(wxTreeCtrl_IsExpanded, 2056).
+-define(wxTreeCtrl_IsSelected, 2057).
+-define(wxTreeCtrl_IsVisible, 2058).
+-define(wxTreeCtrl_ItemHasChildren, 2059).
+-define(wxTreeCtrl_PrependItem, 2060).
+-define(wxTreeCtrl_ScrollTo, 2061).
+-define(wxTreeCtrl_SelectItem_1, 2062).
+-define(wxTreeCtrl_SelectItem_2, 2063).
+-define(wxTreeCtrl_SetIndent, 2064).
+-define(wxTreeCtrl_SetImageList, 2065).
+-define(wxTreeCtrl_SetItemBackgroundColour, 2066).
+-define(wxTreeCtrl_SetItemBold, 2067).
+-define(wxTreeCtrl_SetItemData, 2068).
+-define(wxTreeCtrl_SetItemDropHighlight, 2069).
+-define(wxTreeCtrl_SetItemFont, 2070).
+-define(wxTreeCtrl_SetItemHasChildren, 2071).
+-define(wxTreeCtrl_SetItemImage_2, 2072).
+-define(wxTreeCtrl_SetItemImage_3, 2073).
+-define(wxTreeCtrl_SetItemText, 2074).
+-define(wxTreeCtrl_SetItemTextColour, 2075).
+-define(wxTreeCtrl_SetStateImageList, 2076).
+-define(wxTreeCtrl_SetWindowStyle, 2077).
+-define(wxTreeCtrl_SortChildren, 2078).
+-define(wxTreeCtrl_Toggle, 2079).
+-define(wxTreeCtrl_ToggleItemSelection, 2080).
+-define(wxTreeCtrl_Unselect, 2081).
+-define(wxTreeCtrl_UnselectAll, 2082).
+-define(wxTreeCtrl_UnselectItem, 2083).
+-define(wxScrollBar_new_0, 2084).
+-define(wxScrollBar_new_3, 2085).
+-define(wxScrollBar_destruct, 2086).
+-define(wxScrollBar_Create, 2087).
+-define(wxScrollBar_GetRange, 2088).
+-define(wxScrollBar_GetPageSize, 2089).
+-define(wxScrollBar_GetThumbPosition, 2090).
+-define(wxScrollBar_GetThumbSize, 2091).
+-define(wxScrollBar_SetThumbPosition, 2092).
+-define(wxScrollBar_SetScrollbar, 2093).
+-define(wxSpinButton_new_2, 2095).
+-define(wxSpinButton_new_0, 2096).
+-define(wxSpinButton_Create, 2097).
+-define(wxSpinButton_GetMax, 2098).
+-define(wxSpinButton_GetMin, 2099).
+-define(wxSpinButton_GetValue, 2100).
+-define(wxSpinButton_SetRange, 2101).
+-define(wxSpinButton_SetValue, 2102).
+-define(wxSpinButton_destroy, 2103).
+-define(wxSpinCtrl_new_0, 2104).
+-define(wxSpinCtrl_new_2, 2105).
+-define(wxSpinCtrl_Create, 2107).
+-define(wxSpinCtrl_SetValue_1_1, 2110).
+-define(wxSpinCtrl_SetValue_1_0, 2111).
+-define(wxSpinCtrl_GetValue, 2113).
+-define(wxSpinCtrl_SetRange, 2115).
+-define(wxSpinCtrl_SetSelection, 2116).
+-define(wxSpinCtrl_GetMin, 2118).
+-define(wxSpinCtrl_GetMax, 2120).
+-define(wxSpinCtrl_destroy, 2121).
+-define(wxStaticText_new_0, 2122).
+-define(wxStaticText_new_4, 2123).
+-define(wxStaticText_Create, 2124).
+-define(wxStaticText_GetLabel, 2125).
+-define(wxStaticText_SetLabel, 2126).
+-define(wxStaticText_Wrap, 2127).
+-define(wxStaticText_destroy, 2128).
+-define(wxStaticBitmap_new_0, 2129).
+-define(wxStaticBitmap_new_4, 2130).
+-define(wxStaticBitmap_Create, 2131).
+-define(wxStaticBitmap_GetBitmap, 2132).
+-define(wxStaticBitmap_SetBitmap, 2133).
+-define(wxStaticBitmap_destroy, 2134).
+-define(wxRadioBox_new, 2135).
+-define(wxRadioBox_destruct, 2137).
+-define(wxRadioBox_Create, 2138).
+-define(wxRadioBox_Enable_2, 2139).
+-define(wxRadioBox_Enable_1, 2140).
+-define(wxRadioBox_GetSelection, 2141).
+-define(wxRadioBox_GetString, 2142).
+-define(wxRadioBox_SetSelection, 2143).
+-define(wxRadioBox_Show_2, 2144).
+-define(wxRadioBox_Show_1, 2145).
+-define(wxRadioBox_GetColumnCount, 2146).
+-define(wxRadioBox_GetItemHelpText, 2147).
+-define(wxRadioBox_GetItemToolTip, 2148).
+-define(wxRadioBox_GetItemFromPoint, 2150).
+-define(wxRadioBox_GetRowCount, 2151).
+-define(wxRadioBox_IsItemEnabled, 2152).
+-define(wxRadioBox_IsItemShown, 2153).
+-define(wxRadioBox_SetItemHelpText, 2154).
+-define(wxRadioBox_SetItemToolTip, 2155).
+-define(wxRadioButton_new_0, 2156).
+-define(wxRadioButton_new_4, 2157).
+-define(wxRadioButton_Create, 2158).
+-define(wxRadioButton_GetValue, 2159).
+-define(wxRadioButton_SetValue, 2160).
+-define(wxRadioButton_destroy, 2161).
+-define(wxSlider_new_6, 2163).
+-define(wxSlider_new_0, 2164).
+-define(wxSlider_Create, 2165).
+-define(wxSlider_GetLineSize, 2166).
+-define(wxSlider_GetMax, 2167).
+-define(wxSlider_GetMin, 2168).
+-define(wxSlider_GetPageSize, 2169).
+-define(wxSlider_GetThumbLength, 2170).
+-define(wxSlider_GetValue, 2171).
+-define(wxSlider_SetLineSize, 2172).
+-define(wxSlider_SetPageSize, 2173).
+-define(wxSlider_SetRange, 2174).
+-define(wxSlider_SetThumbLength, 2175).
+-define(wxSlider_SetValue, 2176).
+-define(wxSlider_destroy, 2177).
+-define(wxDialog_new_4, 2179).
+-define(wxDialog_new_0, 2180).
+-define(wxDialog_destruct, 2182).
+-define(wxDialog_Create, 2183).
+-define(wxDialog_CreateButtonSizer, 2184).
+-define(wxDialog_CreateStdDialogButtonSizer, 2185).
+-define(wxDialog_EndModal, 2186).
+-define(wxDialog_GetAffirmativeId, 2187).
+-define(wxDialog_GetReturnCode, 2188).
+-define(wxDialog_IsModal, 2189).
+-define(wxDialog_SetAffirmativeId, 2190).
+-define(wxDialog_SetReturnCode, 2191).
+-define(wxDialog_Show, 2192).
+-define(wxDialog_ShowModal, 2193).
+-define(wxColourDialog_new_0, 2194).
+-define(wxColourDialog_new_2, 2195).
+-define(wxColourDialog_destruct, 2196).
+-define(wxColourDialog_Create, 2197).
+-define(wxColourDialog_GetColourData, 2198).
+-define(wxColourData_new_0, 2199).
+-define(wxColourData_new_1, 2200).
+-define(wxColourData_destruct, 2201).
+-define(wxColourData_GetChooseFull, 2202).
+-define(wxColourData_GetColour, 2203).
+-define(wxColourData_GetCustomColour, 2205).
+-define(wxColourData_SetChooseFull, 2206).
+-define(wxColourData_SetColour, 2207).
+-define(wxColourData_SetCustomColour, 2208).
+-define(wxPalette_new_0, 2209).
+-define(wxPalette_new_4, 2210).
+-define(wxPalette_destruct, 2212).
+-define(wxPalette_Create, 2213).
+-define(wxPalette_GetColoursCount, 2214).
+-define(wxPalette_GetPixel, 2215).
+-define(wxPalette_GetRGB, 2216).
+-define(wxPalette_IsOk, 2217).
+-define(wxDirDialog_new, 2221).
+-define(wxDirDialog_destruct, 2222).
+-define(wxDirDialog_GetPath, 2223).
+-define(wxDirDialog_GetMessage, 2224).
+-define(wxDirDialog_SetMessage, 2225).
+-define(wxDirDialog_SetPath, 2226).
+-define(wxFileDialog_new, 2230).
+-define(wxFileDialog_destruct, 2231).
+-define(wxFileDialog_GetDirectory, 2232).
+-define(wxFileDialog_GetFilename, 2233).
+-define(wxFileDialog_GetFilenames, 2234).
+-define(wxFileDialog_GetFilterIndex, 2235).
+-define(wxFileDialog_GetMessage, 2236).
+-define(wxFileDialog_GetPath, 2237).
+-define(wxFileDialog_GetPaths, 2238).
+-define(wxFileDialog_GetWildcard, 2239).
+-define(wxFileDialog_SetDirectory, 2240).
+-define(wxFileDialog_SetFilename, 2241).
+-define(wxFileDialog_SetFilterIndex, 2242).
+-define(wxFileDialog_SetMessage, 2243).
+-define(wxFileDialog_SetPath, 2244).
+-define(wxFileDialog_SetWildcard, 2245).
+-define(wxPickerBase_SetInternalMargin, 2246).
+-define(wxPickerBase_GetInternalMargin, 2247).
+-define(wxPickerBase_SetTextCtrlProportion, 2248).
+-define(wxPickerBase_SetPickerCtrlProportion, 2249).
+-define(wxPickerBase_GetTextCtrlProportion, 2250).
+-define(wxPickerBase_GetPickerCtrlProportion, 2251).
+-define(wxPickerBase_HasTextCtrl, 2252).
+-define(wxPickerBase_GetTextCtrl, 2253).
+-define(wxPickerBase_IsTextCtrlGrowable, 2254).
+-define(wxPickerBase_SetPickerCtrlGrowable, 2255).
+-define(wxPickerBase_SetTextCtrlGrowable, 2256).
+-define(wxPickerBase_IsPickerCtrlGrowable, 2257).
+-define(wxFilePickerCtrl_new_0, 2258).
+-define(wxFilePickerCtrl_new_3, 2259).
+-define(wxFilePickerCtrl_Create, 2260).
+-define(wxFilePickerCtrl_GetPath, 2261).
+-define(wxFilePickerCtrl_SetPath, 2262).
+-define(wxFilePickerCtrl_destroy, 2263).
+-define(wxDirPickerCtrl_new_0, 2264).
+-define(wxDirPickerCtrl_new_3, 2265).
+-define(wxDirPickerCtrl_Create, 2266).
+-define(wxDirPickerCtrl_GetPath, 2267).
+-define(wxDirPickerCtrl_SetPath, 2268).
+-define(wxDirPickerCtrl_destroy, 2269).
+-define(wxColourPickerCtrl_new_0, 2270).
+-define(wxColourPickerCtrl_new_3, 2271).
+-define(wxColourPickerCtrl_Create, 2272).
+-define(wxColourPickerCtrl_GetColour, 2273).
+-define(wxColourPickerCtrl_SetColour_1_1, 2274).
+-define(wxColourPickerCtrl_SetColour_1_0, 2275).
+-define(wxColourPickerCtrl_destroy, 2276).
+-define(wxDatePickerCtrl_new_0, 2277).
+-define(wxDatePickerCtrl_new_3, 2278).
+-define(wxDatePickerCtrl_GetRange, 2279).
+-define(wxDatePickerCtrl_GetValue, 2280).
+-define(wxDatePickerCtrl_SetRange, 2281).
+-define(wxDatePickerCtrl_SetValue, 2282).
+-define(wxDatePickerCtrl_destroy, 2283).
+-define(wxFontPickerCtrl_new_0, 2284).
+-define(wxFontPickerCtrl_new_3, 2285).
+-define(wxFontPickerCtrl_Create, 2286).
+-define(wxFontPickerCtrl_GetSelectedFont, 2287).
+-define(wxFontPickerCtrl_SetSelectedFont, 2288).
+-define(wxFontPickerCtrl_GetMaxPointSize, 2289).
+-define(wxFontPickerCtrl_SetMaxPointSize, 2290).
+-define(wxFontPickerCtrl_destroy, 2291).
+-define(wxFindReplaceDialog_new_0, 2294).
+-define(wxFindReplaceDialog_new_4, 2295).
+-define(wxFindReplaceDialog_destruct, 2296).
+-define(wxFindReplaceDialog_Create, 2297).
+-define(wxFindReplaceDialog_GetData, 2298).
+-define(wxFindReplaceData_new_0, 2299).
+-define(wxFindReplaceData_new_1, 2300).
+-define(wxFindReplaceData_GetFindString, 2301).
+-define(wxFindReplaceData_GetReplaceString, 2302).
+-define(wxFindReplaceData_GetFlags, 2303).
+-define(wxFindReplaceData_SetFlags, 2304).
+-define(wxFindReplaceData_SetFindString, 2305).
+-define(wxFindReplaceData_SetReplaceString, 2306).
+-define(wxFindReplaceData_destroy, 2307).
+-define(wxMultiChoiceDialog_new_0, 2308).
+-define(wxMultiChoiceDialog_new_5, 2310).
+-define(wxMultiChoiceDialog_GetSelections, 2311).
+-define(wxMultiChoiceDialog_SetSelections, 2312).
+-define(wxMultiChoiceDialog_destroy, 2313).
+-define(wxSingleChoiceDialog_new_0, 2314).
+-define(wxSingleChoiceDialog_new_5, 2316).
+-define(wxSingleChoiceDialog_GetSelection, 2317).
+-define(wxSingleChoiceDialog_GetStringSelection, 2318).
+-define(wxSingleChoiceDialog_SetSelection, 2319).
+-define(wxSingleChoiceDialog_destroy, 2320).
+-define(wxTextEntryDialog_new, 2321).
+-define(wxTextEntryDialog_GetValue, 2322).
+-define(wxTextEntryDialog_SetValue, 2323).
+-define(wxTextEntryDialog_destroy, 2324).
+-define(wxPasswordEntryDialog_new, 2325).
+-define(wxPasswordEntryDialog_destroy, 2326).
+-define(wxFontData_new_0, 2327).
+-define(wxFontData_new_1, 2328).
+-define(wxFontData_destruct, 2329).
+-define(wxFontData_EnableEffects, 2330).
+-define(wxFontData_GetAllowSymbols, 2331).
+-define(wxFontData_GetColour, 2332).
+-define(wxFontData_GetChosenFont, 2333).
+-define(wxFontData_GetEnableEffects, 2334).
+-define(wxFontData_GetInitialFont, 2335).
+-define(wxFontData_GetShowHelp, 2336).
+-define(wxFontData_SetAllowSymbols, 2337).
+-define(wxFontData_SetChosenFont, 2338).
+-define(wxFontData_SetColour, 2339).
+-define(wxFontData_SetInitialFont, 2340).
+-define(wxFontData_SetRange, 2341).
+-define(wxFontData_SetShowHelp, 2342).
+-define(wxFontDialog_new_0, 2346).
+-define(wxFontDialog_new_2, 2348).
+-define(wxFontDialog_Create, 2350).
+-define(wxFontDialog_GetFontData, 2351).
+-define(wxFontDialog_destroy, 2353).
+-define(wxProgressDialog_new, 2354).
+-define(wxProgressDialog_destruct, 2355).
+-define(wxProgressDialog_Resume, 2356).
+-define(wxProgressDialog_Update_2, 2357).
+-define(wxProgressDialog_Update_0, 2358).
+-define(wxMessageDialog_new, 2359).
+-define(wxMessageDialog_destruct, 2360).
+-define(wxPageSetupDialog_new, 2361).
+-define(wxPageSetupDialog_destruct, 2362).
+-define(wxPageSetupDialog_GetPageSetupData, 2363).
+-define(wxPageSetupDialog_ShowModal, 2364).
+-define(wxPageSetupDialogData_new_0, 2365).
+-define(wxPageSetupDialogData_new_1_0, 2366).
+-define(wxPageSetupDialogData_new_1_1, 2367).
+-define(wxPageSetupDialogData_destruct, 2368).
+-define(wxPageSetupDialogData_EnableHelp, 2369).
+-define(wxPageSetupDialogData_EnableMargins, 2370).
+-define(wxPageSetupDialogData_EnableOrientation, 2371).
+-define(wxPageSetupDialogData_EnablePaper, 2372).
+-define(wxPageSetupDialogData_EnablePrinter, 2373).
+-define(wxPageSetupDialogData_GetDefaultMinMargins, 2374).
+-define(wxPageSetupDialogData_GetEnableMargins, 2375).
+-define(wxPageSetupDialogData_GetEnableOrientation, 2376).
+-define(wxPageSetupDialogData_GetEnablePaper, 2377).
+-define(wxPageSetupDialogData_GetEnablePrinter, 2378).
+-define(wxPageSetupDialogData_GetEnableHelp, 2379).
+-define(wxPageSetupDialogData_GetDefaultInfo, 2380).
+-define(wxPageSetupDialogData_GetMarginTopLeft, 2381).
+-define(wxPageSetupDialogData_GetMarginBottomRight, 2382).
+-define(wxPageSetupDialogData_GetMinMarginTopLeft, 2383).
+-define(wxPageSetupDialogData_GetMinMarginBottomRight, 2384).
+-define(wxPageSetupDialogData_GetPaperId, 2385).
+-define(wxPageSetupDialogData_GetPaperSize, 2386).
+-define(wxPageSetupDialogData_GetPrintData, 2388).
+-define(wxPageSetupDialogData_IsOk, 2389).
+-define(wxPageSetupDialogData_SetDefaultInfo, 2390).
+-define(wxPageSetupDialogData_SetDefaultMinMargins, 2391).
+-define(wxPageSetupDialogData_SetMarginTopLeft, 2392).
+-define(wxPageSetupDialogData_SetMarginBottomRight, 2393).
+-define(wxPageSetupDialogData_SetMinMarginTopLeft, 2394).
+-define(wxPageSetupDialogData_SetMinMarginBottomRight, 2395).
+-define(wxPageSetupDialogData_SetPaperId, 2396).
+-define(wxPageSetupDialogData_SetPaperSize_1_1, 2397).
+-define(wxPageSetupDialogData_SetPaperSize_1_0, 2398).
+-define(wxPageSetupDialogData_SetPrintData, 2399).
+-define(wxPrintDialog_new_2_0, 2400).
+-define(wxPrintDialog_new_2_1, 2401).
+-define(wxPrintDialog_destruct, 2402).
+-define(wxPrintDialog_GetPrintDialogData, 2403).
+-define(wxPrintDialog_GetPrintDC, 2404).
+-define(wxPrintDialogData_new_0, 2405).
+-define(wxPrintDialogData_new_1_1, 2406).
+-define(wxPrintDialogData_new_1_0, 2407).
+-define(wxPrintDialogData_destruct, 2408).
+-define(wxPrintDialogData_EnableHelp, 2409).
+-define(wxPrintDialogData_EnablePageNumbers, 2410).
+-define(wxPrintDialogData_EnablePrintToFile, 2411).
+-define(wxPrintDialogData_EnableSelection, 2412).
+-define(wxPrintDialogData_GetAllPages, 2413).
+-define(wxPrintDialogData_GetCollate, 2414).
+-define(wxPrintDialogData_GetFromPage, 2415).
+-define(wxPrintDialogData_GetMaxPage, 2416).
+-define(wxPrintDialogData_GetMinPage, 2417).
+-define(wxPrintDialogData_GetNoCopies, 2418).
+-define(wxPrintDialogData_GetPrintData, 2419).
+-define(wxPrintDialogData_GetPrintToFile, 2420).
+-define(wxPrintDialogData_GetSelection, 2421).
+-define(wxPrintDialogData_GetToPage, 2422).
+-define(wxPrintDialogData_IsOk, 2423).
+-define(wxPrintDialogData_SetCollate, 2424).
+-define(wxPrintDialogData_SetFromPage, 2425).
+-define(wxPrintDialogData_SetMaxPage, 2426).
+-define(wxPrintDialogData_SetMinPage, 2427).
+-define(wxPrintDialogData_SetNoCopies, 2428).
+-define(wxPrintDialogData_SetPrintData, 2429).
+-define(wxPrintDialogData_SetPrintToFile, 2430).
+-define(wxPrintDialogData_SetSelection, 2431).
+-define(wxPrintDialogData_SetToPage, 2432).
+-define(wxPrintData_new_0, 2433).
+-define(wxPrintData_new_1, 2434).
+-define(wxPrintData_destruct, 2435).
+-define(wxPrintData_GetCollate, 2436).
+-define(wxPrintData_GetBin, 2437).
+-define(wxPrintData_GetColour, 2438).
+-define(wxPrintData_GetDuplex, 2439).
+-define(wxPrintData_GetNoCopies, 2440).
+-define(wxPrintData_GetOrientation, 2441).
+-define(wxPrintData_GetPaperId, 2442).
+-define(wxPrintData_GetPrinterName, 2443).
+-define(wxPrintData_GetQuality, 2444).
+-define(wxPrintData_IsOk, 2445).
+-define(wxPrintData_SetBin, 2446).
+-define(wxPrintData_SetCollate, 2447).
+-define(wxPrintData_SetColour, 2448).
+-define(wxPrintData_SetDuplex, 2449).
+-define(wxPrintData_SetNoCopies, 2450).
+-define(wxPrintData_SetOrientation, 2451).
+-define(wxPrintData_SetPaperId, 2452).
+-define(wxPrintData_SetPrinterName, 2453).
+-define(wxPrintData_SetQuality, 2454).
+-define(wxPrintPreview_new_2, 2457).
+-define(wxPrintPreview_new_3, 2458).
+-define(wxPrintPreview_destruct, 2460).
+-define(wxPrintPreview_GetCanvas, 2461).
+-define(wxPrintPreview_GetCurrentPage, 2462).
+-define(wxPrintPreview_GetFrame, 2463).
+-define(wxPrintPreview_GetMaxPage, 2464).
+-define(wxPrintPreview_GetMinPage, 2465).
+-define(wxPrintPreview_GetPrintout, 2466).
+-define(wxPrintPreview_GetPrintoutForPrinting, 2467).
+-define(wxPrintPreview_IsOk, 2468).
+-define(wxPrintPreview_PaintPage, 2469).
+-define(wxPrintPreview_Print, 2470).
+-define(wxPrintPreview_RenderPage, 2471).
+-define(wxPrintPreview_SetCanvas, 2472).
+-define(wxPrintPreview_SetCurrentPage, 2473).
+-define(wxPrintPreview_SetFrame, 2474).
+-define(wxPrintPreview_SetPrintout, 2475).
+-define(wxPrintPreview_SetZoom, 2476).
+-define(wxPreviewFrame_new, 2477).
+-define(wxPreviewFrame_destruct, 2478).
+-define(wxPreviewFrame_CreateControlBar, 2479).
+-define(wxPreviewFrame_CreateCanvas, 2480).
+-define(wxPreviewFrame_Initialize, 2481).
+-define(wxPreviewFrame_OnCloseWindow, 2482).
+-define(wxPreviewControlBar_new, 2483).
+-define(wxPreviewControlBar_destruct, 2484).
+-define(wxPreviewControlBar_CreateButtons, 2485).
+-define(wxPreviewControlBar_GetPrintPreview, 2486).
+-define(wxPreviewControlBar_GetZoomControl, 2487).
+-define(wxPreviewControlBar_SetZoomControl, 2488).
+-define(wxPrinter_new, 2490).
+-define(wxPrinter_CreateAbortWindow, 2491).
+-define(wxPrinter_GetAbort, 2492).
+-define(wxPrinter_GetLastError, 2493).
+-define(wxPrinter_GetPrintDialogData, 2494).
+-define(wxPrinter_Print, 2495).
+-define(wxPrinter_PrintDialog, 2496).
+-define(wxPrinter_ReportError, 2497).
+-define(wxPrinter_Setup, 2498).
+-define(wxPrinter_destroy, 2499).
+-define(wxXmlResource_new_1, 2500).
+-define(wxXmlResource_new_2, 2501).
+-define(wxXmlResource_destruct, 2502).
+-define(wxXmlResource_AttachUnknownControl, 2503).
+-define(wxXmlResource_ClearHandlers, 2504).
+-define(wxXmlResource_CompareVersion, 2505).
+-define(wxXmlResource_Get, 2506).
+-define(wxXmlResource_GetFlags, 2507).
+-define(wxXmlResource_GetVersion, 2508).
+-define(wxXmlResource_GetXRCID, 2509).
+-define(wxXmlResource_InitAllHandlers, 2510).
+-define(wxXmlResource_Load, 2511).
+-define(wxXmlResource_LoadBitmap, 2512).
+-define(wxXmlResource_LoadDialog_2, 2513).
+-define(wxXmlResource_LoadDialog_3, 2514).
+-define(wxXmlResource_LoadFrame_2, 2515).
+-define(wxXmlResource_LoadFrame_3, 2516).
+-define(wxXmlResource_LoadIcon, 2517).
+-define(wxXmlResource_LoadMenu, 2518).
+-define(wxXmlResource_LoadMenuBar_2, 2519).
+-define(wxXmlResource_LoadMenuBar_1, 2520).
+-define(wxXmlResource_LoadPanel_2, 2521).
+-define(wxXmlResource_LoadPanel_3, 2522).
+-define(wxXmlResource_LoadToolBar, 2523).
+-define(wxXmlResource_Set, 2524).
+-define(wxXmlResource_SetFlags, 2525).
+-define(wxXmlResource_Unload, 2526).
+-define(wxXmlResource_xrcctrl, 2527).
+-define(wxHtmlEasyPrinting_new, 2528).
+-define(wxHtmlEasyPrinting_destruct, 2529).
+-define(wxHtmlEasyPrinting_GetPrintData, 2530).
+-define(wxHtmlEasyPrinting_GetPageSetupData, 2531).
+-define(wxHtmlEasyPrinting_PreviewFile, 2532).
+-define(wxHtmlEasyPrinting_PreviewText, 2533).
+-define(wxHtmlEasyPrinting_PrintFile, 2534).
+-define(wxHtmlEasyPrinting_PrintText, 2535).
+-define(wxHtmlEasyPrinting_PageSetup, 2536).
+-define(wxHtmlEasyPrinting_SetFonts, 2537).
+-define(wxHtmlEasyPrinting_SetHeader, 2538).
+-define(wxHtmlEasyPrinting_SetFooter, 2539).
+-define(wxGLCanvas_new_2, 2541).
+-define(wxGLCanvas_new_3_1, 2542).
+-define(wxGLCanvas_new_3_0, 2543).
+-define(wxGLCanvas_GetContext, 2544).
+-define(wxGLCanvas_SetCurrent, 2546).
+-define(wxGLCanvas_SwapBuffers, 2547).
+-define(wxGLCanvas_destroy, 2548).
+-define(wxAuiManager_new, 2549).
+-define(wxAuiManager_destruct, 2550).
+-define(wxAuiManager_AddPane_2_1, 2551).
+-define(wxAuiManager_AddPane_3, 2552).
+-define(wxAuiManager_AddPane_2_0, 2553).
+-define(wxAuiManager_DetachPane, 2554).
+-define(wxAuiManager_GetAllPanes, 2555).
+-define(wxAuiManager_GetArtProvider, 2556).
+-define(wxAuiManager_GetDockSizeConstraint, 2557).
+-define(wxAuiManager_GetFlags, 2558).
+-define(wxAuiManager_GetManagedWindow, 2559).
+-define(wxAuiManager_GetManager, 2560).
+-define(wxAuiManager_GetPane_1_1, 2561).
+-define(wxAuiManager_GetPane_1_0, 2562).
+-define(wxAuiManager_HideHint, 2563).
+-define(wxAuiManager_InsertPane, 2564).
+-define(wxAuiManager_LoadPaneInfo, 2565).
+-define(wxAuiManager_LoadPerspective, 2566).
+-define(wxAuiManager_SavePaneInfo, 2567).
+-define(wxAuiManager_SavePerspective, 2568).
+-define(wxAuiManager_SetArtProvider, 2569).
+-define(wxAuiManager_SetDockSizeConstraint, 2570).
+-define(wxAuiManager_SetFlags, 2571).
+-define(wxAuiManager_SetManagedWindow, 2572).
+-define(wxAuiManager_ShowHint, 2573).
+-define(wxAuiManager_UnInit, 2574).
+-define(wxAuiManager_Update, 2575).
+-define(wxAuiPaneInfo_new_0, 2576).
+-define(wxAuiPaneInfo_new_1, 2577).
+-define(wxAuiPaneInfo_destruct, 2578).
+-define(wxAuiPaneInfo_BestSize_1, 2579).
+-define(wxAuiPaneInfo_BestSize_2, 2580).
+-define(wxAuiPaneInfo_Bottom, 2581).
+-define(wxAuiPaneInfo_BottomDockable, 2582).
+-define(wxAuiPaneInfo_Caption, 2583).
+-define(wxAuiPaneInfo_CaptionVisible, 2584).
+-define(wxAuiPaneInfo_Centre, 2585).
+-define(wxAuiPaneInfo_CentrePane, 2586).
+-define(wxAuiPaneInfo_CloseButton, 2587).
+-define(wxAuiPaneInfo_DefaultPane, 2588).
+-define(wxAuiPaneInfo_DestroyOnClose, 2589).
+-define(wxAuiPaneInfo_Direction, 2590).
+-define(wxAuiPaneInfo_Dock, 2591).
+-define(wxAuiPaneInfo_Dockable, 2592).
+-define(wxAuiPaneInfo_Fixed, 2593).
+-define(wxAuiPaneInfo_Float, 2594).
+-define(wxAuiPaneInfo_Floatable, 2595).
+-define(wxAuiPaneInfo_FloatingPosition_1, 2596).
+-define(wxAuiPaneInfo_FloatingPosition_2, 2597).
+-define(wxAuiPaneInfo_FloatingSize_1, 2598).
+-define(wxAuiPaneInfo_FloatingSize_2, 2599).
+-define(wxAuiPaneInfo_Gripper, 2600).
+-define(wxAuiPaneInfo_GripperTop, 2601).
+-define(wxAuiPaneInfo_HasBorder, 2602).
+-define(wxAuiPaneInfo_HasCaption, 2603).
+-define(wxAuiPaneInfo_HasCloseButton, 2604).
+-define(wxAuiPaneInfo_HasFlag, 2605).
+-define(wxAuiPaneInfo_HasGripper, 2606).
+-define(wxAuiPaneInfo_HasGripperTop, 2607).
+-define(wxAuiPaneInfo_HasMaximizeButton, 2608).
+-define(wxAuiPaneInfo_HasMinimizeButton, 2609).
+-define(wxAuiPaneInfo_HasPinButton, 2610).
+-define(wxAuiPaneInfo_Hide, 2611).
+-define(wxAuiPaneInfo_IsBottomDockable, 2612).
+-define(wxAuiPaneInfo_IsDocked, 2613).
+-define(wxAuiPaneInfo_IsFixed, 2614).
+-define(wxAuiPaneInfo_IsFloatable, 2615).
+-define(wxAuiPaneInfo_IsFloating, 2616).
+-define(wxAuiPaneInfo_IsLeftDockable, 2617).
+-define(wxAuiPaneInfo_IsMovable, 2618).
+-define(wxAuiPaneInfo_IsOk, 2619).
+-define(wxAuiPaneInfo_IsResizable, 2620).
+-define(wxAuiPaneInfo_IsRightDockable, 2621).
+-define(wxAuiPaneInfo_IsShown, 2622).
+-define(wxAuiPaneInfo_IsToolbar, 2623).
+-define(wxAuiPaneInfo_IsTopDockable, 2624).
+-define(wxAuiPaneInfo_Layer, 2625).
+-define(wxAuiPaneInfo_Left, 2626).
+-define(wxAuiPaneInfo_LeftDockable, 2627).
+-define(wxAuiPaneInfo_MaxSize_1, 2628).
+-define(wxAuiPaneInfo_MaxSize_2, 2629).
+-define(wxAuiPaneInfo_MaximizeButton, 2630).
+-define(wxAuiPaneInfo_MinSize_1, 2631).
+-define(wxAuiPaneInfo_MinSize_2, 2632).
+-define(wxAuiPaneInfo_MinimizeButton, 2633).
+-define(wxAuiPaneInfo_Movable, 2634).
+-define(wxAuiPaneInfo_Name, 2635).
+-define(wxAuiPaneInfo_PaneBorder, 2636).
+-define(wxAuiPaneInfo_PinButton, 2637).
+-define(wxAuiPaneInfo_Position, 2638).
+-define(wxAuiPaneInfo_Resizable, 2639).
+-define(wxAuiPaneInfo_Right, 2640).
+-define(wxAuiPaneInfo_RightDockable, 2641).
+-define(wxAuiPaneInfo_Row, 2642).
+-define(wxAuiPaneInfo_SafeSet, 2643).
+-define(wxAuiPaneInfo_SetFlag, 2644).
+-define(wxAuiPaneInfo_Show, 2645).
+-define(wxAuiPaneInfo_ToolbarPane, 2646).
+-define(wxAuiPaneInfo_Top, 2647).
+-define(wxAuiPaneInfo_TopDockable, 2648).
+-define(wxAuiPaneInfo_Window, 2649).
+-define(wxAuiNotebook_new_0, 2650).
+-define(wxAuiNotebook_new_2, 2651).
+-define(wxAuiNotebook_AddPage, 2652).
+-define(wxAuiNotebook_Create, 2653).
+-define(wxAuiNotebook_DeletePage, 2654).
+-define(wxAuiNotebook_GetArtProvider, 2655).
+-define(wxAuiNotebook_GetPage, 2656).
+-define(wxAuiNotebook_GetPageBitmap, 2657).
+-define(wxAuiNotebook_GetPageCount, 2658).
+-define(wxAuiNotebook_GetPageIndex, 2659).
+-define(wxAuiNotebook_GetPageText, 2660).
+-define(wxAuiNotebook_GetSelection, 2661).
+-define(wxAuiNotebook_InsertPage, 2662).
+-define(wxAuiNotebook_RemovePage, 2663).
+-define(wxAuiNotebook_SetArtProvider, 2664).
+-define(wxAuiNotebook_SetFont, 2665).
+-define(wxAuiNotebook_SetPageBitmap, 2666).
+-define(wxAuiNotebook_SetPageText, 2667).
+-define(wxAuiNotebook_SetSelection, 2668).
+-define(wxAuiNotebook_SetTabCtrlHeight, 2669).
+-define(wxAuiNotebook_SetUniformBitmapSize, 2670).
+-define(wxAuiNotebook_destroy, 2671).
+-define(wxMDIParentFrame_new_0, 2672).
+-define(wxMDIParentFrame_new_4, 2673).
+-define(wxMDIParentFrame_destruct, 2674).
+-define(wxMDIParentFrame_ActivateNext, 2675).
+-define(wxMDIParentFrame_ActivatePrevious, 2676).
+-define(wxMDIParentFrame_ArrangeIcons, 2677).
+-define(wxMDIParentFrame_Cascade, 2678).
+-define(wxMDIParentFrame_Create, 2679).
+-define(wxMDIParentFrame_GetActiveChild, 2680).
+-define(wxMDIParentFrame_GetClientWindow, 2681).
+-define(wxMDIParentFrame_Tile, 2682).
+-define(wxMDIChildFrame_new_0, 2683).
+-define(wxMDIChildFrame_new_4, 2684).
+-define(wxMDIChildFrame_destruct, 2685).
+-define(wxMDIChildFrame_Activate, 2686).
+-define(wxMDIChildFrame_Create, 2687).
+-define(wxMDIChildFrame_Maximize, 2688).
+-define(wxMDIChildFrame_Restore, 2689).
+-define(wxMDIClientWindow_new_0, 2690).
+-define(wxMDIClientWindow_new_2, 2691).
+-define(wxMDIClientWindow_destruct, 2692).
+-define(wxMDIClientWindow_CreateClient, 2693).
+-define(wxLayoutAlgorithm_new, 2694).
+-define(wxLayoutAlgorithm_LayoutFrame, 2695).
+-define(wxLayoutAlgorithm_LayoutMDIFrame, 2696).
+-define(wxLayoutAlgorithm_LayoutWindow, 2697).
+-define(wxLayoutAlgorithm_destroy, 2698).
+-define(wxEvent_GetId, 2699).
+-define(wxEvent_GetSkipped, 2700).
+-define(wxEvent_GetTimestamp, 2701).
+-define(wxEvent_IsCommandEvent, 2702).
+-define(wxEvent_ResumePropagation, 2703).
+-define(wxEvent_ShouldPropagate, 2704).
+-define(wxEvent_Skip, 2705).
+-define(wxEvent_StopPropagation, 2706).
+-define(wxCommandEvent_getClientData, 2707).
+-define(wxCommandEvent_GetExtraLong, 2708).
+-define(wxCommandEvent_GetInt, 2709).
+-define(wxCommandEvent_GetSelection, 2710).
+-define(wxCommandEvent_GetString, 2711).
+-define(wxCommandEvent_IsChecked, 2712).
+-define(wxCommandEvent_IsSelection, 2713).
+-define(wxCommandEvent_SetInt, 2714).
+-define(wxCommandEvent_SetString, 2715).
+-define(wxScrollEvent_GetOrientation, 2716).
+-define(wxScrollEvent_GetPosition, 2717).
+-define(wxScrollWinEvent_GetOrientation, 2718).
+-define(wxScrollWinEvent_GetPosition, 2719).
+-define(wxMouseEvent_AltDown, 2720).
+-define(wxMouseEvent_Button, 2721).
+-define(wxMouseEvent_ButtonDClick, 2722).
+-define(wxMouseEvent_ButtonDown, 2723).
+-define(wxMouseEvent_ButtonUp, 2724).
+-define(wxMouseEvent_CmdDown, 2725).
+-define(wxMouseEvent_ControlDown, 2726).
+-define(wxMouseEvent_Dragging, 2727).
+-define(wxMouseEvent_Entering, 2728).
+-define(wxMouseEvent_GetButton, 2729).
+-define(wxMouseEvent_GetPosition, 2732).
+-define(wxMouseEvent_GetLogicalPosition, 2733).
+-define(wxMouseEvent_GetLinesPerAction, 2734).
+-define(wxMouseEvent_GetWheelRotation, 2735).
+-define(wxMouseEvent_GetWheelDelta, 2736).
+-define(wxMouseEvent_GetX, 2737).
+-define(wxMouseEvent_GetY, 2738).
+-define(wxMouseEvent_IsButton, 2739).
+-define(wxMouseEvent_IsPageScroll, 2740).
+-define(wxMouseEvent_Leaving, 2741).
+-define(wxMouseEvent_LeftDClick, 2742).
+-define(wxMouseEvent_LeftDown, 2743).
+-define(wxMouseEvent_LeftIsDown, 2744).
+-define(wxMouseEvent_LeftUp, 2745).
+-define(wxMouseEvent_MetaDown, 2746).
+-define(wxMouseEvent_MiddleDClick, 2747).
+-define(wxMouseEvent_MiddleDown, 2748).
+-define(wxMouseEvent_MiddleIsDown, 2749).
+-define(wxMouseEvent_MiddleUp, 2750).
+-define(wxMouseEvent_Moving, 2751).
+-define(wxMouseEvent_RightDClick, 2752).
+-define(wxMouseEvent_RightDown, 2753).
+-define(wxMouseEvent_RightIsDown, 2754).
+-define(wxMouseEvent_RightUp, 2755).
+-define(wxMouseEvent_ShiftDown, 2756).
+-define(wxSetCursorEvent_GetCursor, 2757).
+-define(wxSetCursorEvent_GetX, 2758).
+-define(wxSetCursorEvent_GetY, 2759).
+-define(wxSetCursorEvent_HasCursor, 2760).
+-define(wxSetCursorEvent_SetCursor, 2761).
+-define(wxKeyEvent_AltDown, 2762).
+-define(wxKeyEvent_CmdDown, 2763).
+-define(wxKeyEvent_ControlDown, 2764).
+-define(wxKeyEvent_GetKeyCode, 2765).
+-define(wxKeyEvent_GetModifiers, 2766).
+-define(wxKeyEvent_GetPosition, 2769).
+-define(wxKeyEvent_GetRawKeyCode, 2770).
+-define(wxKeyEvent_GetRawKeyFlags, 2771).
+-define(wxKeyEvent_GetUnicodeKey, 2772).
+-define(wxKeyEvent_GetX, 2773).
+-define(wxKeyEvent_GetY, 2774).
+-define(wxKeyEvent_HasModifiers, 2775).
+-define(wxKeyEvent_MetaDown, 2776).
+-define(wxKeyEvent_ShiftDown, 2777).
+-define(wxSizeEvent_GetSize, 2778).
+-define(wxMoveEvent_GetPosition, 2779).
+-define(wxEraseEvent_GetDC, 2780).
+-define(wxFocusEvent_GetWindow, 2781).
+-define(wxChildFocusEvent_GetWindow, 2782).
+-define(wxMenuEvent_GetMenu, 2783).
+-define(wxMenuEvent_GetMenuId, 2784).
+-define(wxMenuEvent_IsPopup, 2785).
+-define(wxCloseEvent_CanVeto, 2786).
+-define(wxCloseEvent_GetLoggingOff, 2787).
+-define(wxCloseEvent_SetCanVeto, 2788).
+-define(wxCloseEvent_SetLoggingOff, 2789).
+-define(wxCloseEvent_Veto, 2790).
+-define(wxShowEvent_SetShow, 2791).
+-define(wxShowEvent_GetShow, 2792).
+-define(wxIconizeEvent_Iconized, 2793).
+-define(wxJoystickEvent_ButtonDown, 2794).
+-define(wxJoystickEvent_ButtonIsDown, 2795).
+-define(wxJoystickEvent_ButtonUp, 2796).
+-define(wxJoystickEvent_GetButtonChange, 2797).
+-define(wxJoystickEvent_GetButtonState, 2798).
+-define(wxJoystickEvent_GetJoystick, 2799).
+-define(wxJoystickEvent_GetPosition, 2800).
+-define(wxJoystickEvent_GetZPosition, 2801).
+-define(wxJoystickEvent_IsButton, 2802).
+-define(wxJoystickEvent_IsMove, 2803).
+-define(wxJoystickEvent_IsZMove, 2804).
+-define(wxUpdateUIEvent_CanUpdate, 2805).
+-define(wxUpdateUIEvent_Check, 2806).
+-define(wxUpdateUIEvent_Enable, 2807).
+-define(wxUpdateUIEvent_Show, 2808).
+-define(wxUpdateUIEvent_GetChecked, 2809).
+-define(wxUpdateUIEvent_GetEnabled, 2810).
+-define(wxUpdateUIEvent_GetShown, 2811).
+-define(wxUpdateUIEvent_GetSetChecked, 2812).
+-define(wxUpdateUIEvent_GetSetEnabled, 2813).
+-define(wxUpdateUIEvent_GetSetShown, 2814).
+-define(wxUpdateUIEvent_GetSetText, 2815).
+-define(wxUpdateUIEvent_GetText, 2816).
+-define(wxUpdateUIEvent_GetMode, 2817).
+-define(wxUpdateUIEvent_GetUpdateInterval, 2818).
+-define(wxUpdateUIEvent_ResetUpdateTime, 2819).
+-define(wxUpdateUIEvent_SetMode, 2820).
+-define(wxUpdateUIEvent_SetText, 2821).
+-define(wxUpdateUIEvent_SetUpdateInterval, 2822).
+-define(wxMouseCaptureChangedEvent_GetCapturedWindow, 2823).
+-define(wxPaletteChangedEvent_SetChangedWindow, 2824).
+-define(wxPaletteChangedEvent_GetChangedWindow, 2825).
+-define(wxQueryNewPaletteEvent_SetPaletteRealized, 2826).
+-define(wxQueryNewPaletteEvent_GetPaletteRealized, 2827).
+-define(wxNavigationKeyEvent_GetDirection, 2828).
+-define(wxNavigationKeyEvent_SetDirection, 2829).
+-define(wxNavigationKeyEvent_IsWindowChange, 2830).
+-define(wxNavigationKeyEvent_SetWindowChange, 2831).
+-define(wxNavigationKeyEvent_IsFromTab, 2832).
+-define(wxNavigationKeyEvent_SetFromTab, 2833).
+-define(wxNavigationKeyEvent_GetCurrentFocus, 2834).
+-define(wxNavigationKeyEvent_SetCurrentFocus, 2835).
+-define(wxHelpEvent_GetOrigin, 2836).
+-define(wxHelpEvent_GetPosition, 2837).
+-define(wxHelpEvent_SetOrigin, 2838).
+-define(wxHelpEvent_SetPosition, 2839).
+-define(wxContextMenuEvent_GetPosition, 2840).
+-define(wxContextMenuEvent_SetPosition, 2841).
+-define(wxIdleEvent_CanSend, 2842).
+-define(wxIdleEvent_GetMode, 2843).
+-define(wxIdleEvent_RequestMore, 2844).
+-define(wxIdleEvent_MoreRequested, 2845).
+-define(wxIdleEvent_SetMode, 2846).
+-define(wxGridEvent_AltDown, 2847).
+-define(wxGridEvent_ControlDown, 2848).
+-define(wxGridEvent_GetCol, 2849).
+-define(wxGridEvent_GetPosition, 2850).
+-define(wxGridEvent_GetRow, 2851).
+-define(wxGridEvent_MetaDown, 2852).
+-define(wxGridEvent_Selecting, 2853).
+-define(wxGridEvent_ShiftDown, 2854).
+-define(wxNotifyEvent_Allow, 2855).
+-define(wxNotifyEvent_IsAllowed, 2856).
+-define(wxNotifyEvent_Veto, 2857).
+-define(wxSashEvent_GetEdge, 2858).
+-define(wxSashEvent_GetDragRect, 2859).
+-define(wxSashEvent_GetDragStatus, 2860).
+-define(wxListEvent_GetCacheFrom, 2861).
+-define(wxListEvent_GetCacheTo, 2862).
+-define(wxListEvent_GetKeyCode, 2863).
+-define(wxListEvent_GetIndex, 2864).
+-define(wxListEvent_GetColumn, 2865).
+-define(wxListEvent_GetPoint, 2866).
+-define(wxListEvent_GetLabel, 2867).
+-define(wxListEvent_GetText, 2868).
+-define(wxListEvent_GetImage, 2869).
+-define(wxListEvent_GetData, 2870).
+-define(wxListEvent_GetMask, 2871).
+-define(wxListEvent_GetItem, 2872).
+-define(wxListEvent_IsEditCancelled, 2873).
+-define(wxDateEvent_GetDate, 2874).
+-define(wxCalendarEvent_GetWeekDay, 2875).
+-define(wxFileDirPickerEvent_GetPath, 2876).
+-define(wxColourPickerEvent_GetColour, 2877).
+-define(wxFontPickerEvent_GetFont, 2878).
+-define(wxStyledTextEvent_GetPosition, 2879).
+-define(wxStyledTextEvent_GetKey, 2880).
+-define(wxStyledTextEvent_GetModifiers, 2881).
+-define(wxStyledTextEvent_GetModificationType, 2882).
+-define(wxStyledTextEvent_GetText, 2883).
+-define(wxStyledTextEvent_GetLength, 2884).
+-define(wxStyledTextEvent_GetLinesAdded, 2885).
+-define(wxStyledTextEvent_GetLine, 2886).
+-define(wxStyledTextEvent_GetFoldLevelNow, 2887).
+-define(wxStyledTextEvent_GetFoldLevelPrev, 2888).
+-define(wxStyledTextEvent_GetMargin, 2889).
+-define(wxStyledTextEvent_GetMessage, 2890).
+-define(wxStyledTextEvent_GetWParam, 2891).
+-define(wxStyledTextEvent_GetLParam, 2892).
+-define(wxStyledTextEvent_GetListType, 2893).
+-define(wxStyledTextEvent_GetX, 2894).
+-define(wxStyledTextEvent_GetY, 2895).
+-define(wxStyledTextEvent_GetDragText, 2896).
+-define(wxStyledTextEvent_GetDragAllowMove, 2897).
+-define(wxStyledTextEvent_GetDragResult, 2898).
+-define(wxStyledTextEvent_GetShift, 2899).
+-define(wxStyledTextEvent_GetControl, 2900).
+-define(wxStyledTextEvent_GetAlt, 2901).
+-define(utils_wxGetKeyState, 2902).
+-define(utils_wxGetMousePosition, 2903).
+-define(utils_wxGetMouseState, 2904).
+-define(utils_wxSetDetectableAutoRepeat, 2905).
+-define(utils_wxBell, 2906).
+-define(utils_wxFindMenuItemId, 2907).
+-define(utils_wxGenericFindWindowAtPoint, 2908).
+-define(utils_wxFindWindowAtPoint, 2909).
+-define(utils_wxBeginBusyCursor, 2910).
+-define(utils_wxEndBusyCursor, 2911).
+-define(utils_wxIsBusy, 2912).
+-define(utils_wxShutdown, 2913).
+-define(utils_wxShell, 2914).
+-define(utils_wxLaunchDefaultBrowser, 2915).
+-define(utils_wxGetEmailAddress, 2916).
+-define(utils_wxGetUserId, 2917).
+-define(utils_wxGetHomeDir, 2918).
+-define(utils_wxNewId, 2919).
+-define(utils_wxRegisterId, 2920).
+-define(utils_wxGetCurrentId, 2921).
+-define(utils_wxGetOsDescription, 2922).
+-define(utils_wxIsPlatformLittleEndian, 2923).
+-define(utils_wxIsPlatform64Bit, 2924).
+-define(wxPrintout_new, 2925).
+-define(wxPrintout_destruct, 2926).
+-define(wxPrintout_GetDC, 2927).
+-define(wxPrintout_GetPageSizeMM, 2928).
+-define(wxPrintout_GetPageSizePixels, 2929).
+-define(wxPrintout_GetPaperRectPixels, 2930).
+-define(wxPrintout_GetPPIPrinter, 2931).
+-define(wxPrintout_GetPPIScreen, 2932).
+-define(wxPrintout_GetTitle, 2933).
+-define(wxPrintout_IsPreview, 2934).
+-define(wxPrintout_FitThisSizeToPaper, 2935).
+-define(wxPrintout_FitThisSizeToPage, 2936).
+-define(wxPrintout_FitThisSizeToPageMargins, 2937).
+-define(wxPrintout_MapScreenSizeToPaper, 2938).
+-define(wxPrintout_MapScreenSizeToPage, 2939).
+-define(wxPrintout_MapScreenSizeToPageMargins, 2940).
+-define(wxPrintout_MapScreenSizeToDevice, 2941).
+-define(wxPrintout_GetLogicalPaperRect, 2942).
+-define(wxPrintout_GetLogicalPageRect, 2943).
+-define(wxPrintout_GetLogicalPageMarginsRect, 2944).
+-define(wxPrintout_SetLogicalOrigin, 2945).
+-define(wxPrintout_OffsetLogicalOrigin, 2946).
+-define(wxStyledTextCtrl_new_2, 2947).
+-define(wxStyledTextCtrl_new_0, 2948).
+-define(wxStyledTextCtrl_destruct, 2949).
+-define(wxStyledTextCtrl_Create, 2950).
+-define(wxStyledTextCtrl_AddText, 2951).
+-define(wxStyledTextCtrl_AddStyledText, 2952).
+-define(wxStyledTextCtrl_InsertText, 2953).
+-define(wxStyledTextCtrl_ClearAll, 2954).
+-define(wxStyledTextCtrl_ClearDocumentStyle, 2955).
+-define(wxStyledTextCtrl_GetLength, 2956).
+-define(wxStyledTextCtrl_GetCharAt, 2957).
+-define(wxStyledTextCtrl_GetCurrentPos, 2958).
+-define(wxStyledTextCtrl_GetAnchor, 2959).
+-define(wxStyledTextCtrl_GetStyleAt, 2960).
+-define(wxStyledTextCtrl_Redo, 2961).
+-define(wxStyledTextCtrl_SetUndoCollection, 2962).
+-define(wxStyledTextCtrl_SelectAll, 2963).
+-define(wxStyledTextCtrl_SetSavePoint, 2964).
+-define(wxStyledTextCtrl_GetStyledText, 2965).
+-define(wxStyledTextCtrl_CanRedo, 2966).
+-define(wxStyledTextCtrl_MarkerLineFromHandle, 2967).
+-define(wxStyledTextCtrl_MarkerDeleteHandle, 2968).
+-define(wxStyledTextCtrl_GetUndoCollection, 2969).
+-define(wxStyledTextCtrl_GetViewWhiteSpace, 2970).
+-define(wxStyledTextCtrl_SetViewWhiteSpace, 2971).
+-define(wxStyledTextCtrl_PositionFromPoint, 2972).
+-define(wxStyledTextCtrl_PositionFromPointClose, 2973).
+-define(wxStyledTextCtrl_GotoLine, 2974).
+-define(wxStyledTextCtrl_GotoPos, 2975).
+-define(wxStyledTextCtrl_SetAnchor, 2976).
+-define(wxStyledTextCtrl_GetCurLine, 2977).
+-define(wxStyledTextCtrl_GetEndStyled, 2978).
+-define(wxStyledTextCtrl_ConvertEOLs, 2979).
+-define(wxStyledTextCtrl_GetEOLMode, 2980).
+-define(wxStyledTextCtrl_SetEOLMode, 2981).
+-define(wxStyledTextCtrl_StartStyling, 2982).
+-define(wxStyledTextCtrl_SetStyling, 2983).
+-define(wxStyledTextCtrl_GetBufferedDraw, 2984).
+-define(wxStyledTextCtrl_SetBufferedDraw, 2985).
+-define(wxStyledTextCtrl_SetTabWidth, 2986).
+-define(wxStyledTextCtrl_GetTabWidth, 2987).
+-define(wxStyledTextCtrl_SetCodePage, 2988).
+-define(wxStyledTextCtrl_MarkerDefine, 2989).
+-define(wxStyledTextCtrl_MarkerSetForeground, 2990).
+-define(wxStyledTextCtrl_MarkerSetBackground, 2991).
+-define(wxStyledTextCtrl_MarkerAdd, 2992).
+-define(wxStyledTextCtrl_MarkerDelete, 2993).
+-define(wxStyledTextCtrl_MarkerDeleteAll, 2994).
+-define(wxStyledTextCtrl_MarkerGet, 2995).
+-define(wxStyledTextCtrl_MarkerNext, 2996).
+-define(wxStyledTextCtrl_MarkerPrevious, 2997).
+-define(wxStyledTextCtrl_MarkerDefineBitmap, 2998).
+-define(wxStyledTextCtrl_MarkerAddSet, 2999).
+-define(wxStyledTextCtrl_MarkerSetAlpha, 3000).
+-define(wxStyledTextCtrl_SetMarginType, 3001).
+-define(wxStyledTextCtrl_GetMarginType, 3002).
+-define(wxStyledTextCtrl_SetMarginWidth, 3003).
+-define(wxStyledTextCtrl_GetMarginWidth, 3004).
+-define(wxStyledTextCtrl_SetMarginMask, 3005).
+-define(wxStyledTextCtrl_GetMarginMask, 3006).
+-define(wxStyledTextCtrl_SetMarginSensitive, 3007).
+-define(wxStyledTextCtrl_GetMarginSensitive, 3008).
+-define(wxStyledTextCtrl_StyleClearAll, 3009).
+-define(wxStyledTextCtrl_StyleSetForeground, 3010).
+-define(wxStyledTextCtrl_StyleSetBackground, 3011).
+-define(wxStyledTextCtrl_StyleSetBold, 3012).
+-define(wxStyledTextCtrl_StyleSetItalic, 3013).
+-define(wxStyledTextCtrl_StyleSetSize, 3014).
+-define(wxStyledTextCtrl_StyleSetFaceName, 3015).
+-define(wxStyledTextCtrl_StyleSetEOLFilled, 3016).
+-define(wxStyledTextCtrl_StyleResetDefault, 3017).
+-define(wxStyledTextCtrl_StyleSetUnderline, 3018).
+-define(wxStyledTextCtrl_StyleSetCase, 3019).
+-define(wxStyledTextCtrl_StyleSetHotSpot, 3020).
+-define(wxStyledTextCtrl_SetSelForeground, 3021).
+-define(wxStyledTextCtrl_SetSelBackground, 3022).
+-define(wxStyledTextCtrl_GetSelAlpha, 3023).
+-define(wxStyledTextCtrl_SetSelAlpha, 3024).
+-define(wxStyledTextCtrl_SetCaretForeground, 3025).
+-define(wxStyledTextCtrl_CmdKeyAssign, 3026).
+-define(wxStyledTextCtrl_CmdKeyClear, 3027).
+-define(wxStyledTextCtrl_CmdKeyClearAll, 3028).
+-define(wxStyledTextCtrl_SetStyleBytes, 3029).
+-define(wxStyledTextCtrl_StyleSetVisible, 3030).
+-define(wxStyledTextCtrl_GetCaretPeriod, 3031).
+-define(wxStyledTextCtrl_SetCaretPeriod, 3032).
+-define(wxStyledTextCtrl_SetWordChars, 3033).
+-define(wxStyledTextCtrl_BeginUndoAction, 3034).
+-define(wxStyledTextCtrl_EndUndoAction, 3035).
+-define(wxStyledTextCtrl_IndicatorSetStyle, 3036).
+-define(wxStyledTextCtrl_IndicatorGetStyle, 3037).
+-define(wxStyledTextCtrl_IndicatorSetForeground, 3038).
+-define(wxStyledTextCtrl_IndicatorGetForeground, 3039).
+-define(wxStyledTextCtrl_SetWhitespaceForeground, 3040).
+-define(wxStyledTextCtrl_SetWhitespaceBackground, 3041).
+-define(wxStyledTextCtrl_GetStyleBits, 3042).
+-define(wxStyledTextCtrl_SetLineState, 3043).
+-define(wxStyledTextCtrl_GetLineState, 3044).
+-define(wxStyledTextCtrl_GetMaxLineState, 3045).
+-define(wxStyledTextCtrl_GetCaretLineVisible, 3046).
+-define(wxStyledTextCtrl_SetCaretLineVisible, 3047).
+-define(wxStyledTextCtrl_GetCaretLineBackground, 3048).
+-define(wxStyledTextCtrl_SetCaretLineBackground, 3049).
+-define(wxStyledTextCtrl_AutoCompShow, 3050).
+-define(wxStyledTextCtrl_AutoCompCancel, 3051).
+-define(wxStyledTextCtrl_AutoCompActive, 3052).
+-define(wxStyledTextCtrl_AutoCompPosStart, 3053).
+-define(wxStyledTextCtrl_AutoCompComplete, 3054).
+-define(wxStyledTextCtrl_AutoCompStops, 3055).
+-define(wxStyledTextCtrl_AutoCompSetSeparator, 3056).
+-define(wxStyledTextCtrl_AutoCompGetSeparator, 3057).
+-define(wxStyledTextCtrl_AutoCompSelect, 3058).
+-define(wxStyledTextCtrl_AutoCompSetCancelAtStart, 3059).
+-define(wxStyledTextCtrl_AutoCompGetCancelAtStart, 3060).
+-define(wxStyledTextCtrl_AutoCompSetFillUps, 3061).
+-define(wxStyledTextCtrl_AutoCompSetChooseSingle, 3062).
+-define(wxStyledTextCtrl_AutoCompGetChooseSingle, 3063).
+-define(wxStyledTextCtrl_AutoCompSetIgnoreCase, 3064).
+-define(wxStyledTextCtrl_AutoCompGetIgnoreCase, 3065).
+-define(wxStyledTextCtrl_UserListShow, 3066).
+-define(wxStyledTextCtrl_AutoCompSetAutoHide, 3067).
+-define(wxStyledTextCtrl_AutoCompGetAutoHide, 3068).
+-define(wxStyledTextCtrl_AutoCompSetDropRestOfWord, 3069).
+-define(wxStyledTextCtrl_AutoCompGetDropRestOfWord, 3070).
+-define(wxStyledTextCtrl_RegisterImage, 3071).
+-define(wxStyledTextCtrl_ClearRegisteredImages, 3072).
+-define(wxStyledTextCtrl_AutoCompGetTypeSeparator, 3073).
+-define(wxStyledTextCtrl_AutoCompSetTypeSeparator, 3074).
+-define(wxStyledTextCtrl_AutoCompSetMaxWidth, 3075).
+-define(wxStyledTextCtrl_AutoCompGetMaxWidth, 3076).
+-define(wxStyledTextCtrl_AutoCompSetMaxHeight, 3077).
+-define(wxStyledTextCtrl_AutoCompGetMaxHeight, 3078).
+-define(wxStyledTextCtrl_SetIndent, 3079).
+-define(wxStyledTextCtrl_GetIndent, 3080).
+-define(wxStyledTextCtrl_SetUseTabs, 3081).
+-define(wxStyledTextCtrl_GetUseTabs, 3082).
+-define(wxStyledTextCtrl_SetLineIndentation, 3083).
+-define(wxStyledTextCtrl_GetLineIndentation, 3084).
+-define(wxStyledTextCtrl_GetLineIndentPosition, 3085).
+-define(wxStyledTextCtrl_GetColumn, 3086).
+-define(wxStyledTextCtrl_SetUseHorizontalScrollBar, 3087).
+-define(wxStyledTextCtrl_GetUseHorizontalScrollBar, 3088).
+-define(wxStyledTextCtrl_SetIndentationGuides, 3089).
+-define(wxStyledTextCtrl_GetIndentationGuides, 3090).
+-define(wxStyledTextCtrl_SetHighlightGuide, 3091).
+-define(wxStyledTextCtrl_GetHighlightGuide, 3092).
+-define(wxStyledTextCtrl_GetLineEndPosition, 3093).
+-define(wxStyledTextCtrl_GetCodePage, 3094).
+-define(wxStyledTextCtrl_GetCaretForeground, 3095).
+-define(wxStyledTextCtrl_GetReadOnly, 3096).
+-define(wxStyledTextCtrl_SetCurrentPos, 3097).
+-define(wxStyledTextCtrl_SetSelectionStart, 3098).
+-define(wxStyledTextCtrl_GetSelectionStart, 3099).
+-define(wxStyledTextCtrl_SetSelectionEnd, 3100).
+-define(wxStyledTextCtrl_GetSelectionEnd, 3101).
+-define(wxStyledTextCtrl_SetPrintMagnification, 3102).
+-define(wxStyledTextCtrl_GetPrintMagnification, 3103).
+-define(wxStyledTextCtrl_SetPrintColourMode, 3104).
+-define(wxStyledTextCtrl_GetPrintColourMode, 3105).
+-define(wxStyledTextCtrl_FindText, 3106).
+-define(wxStyledTextCtrl_FormatRange, 3107).
+-define(wxStyledTextCtrl_GetFirstVisibleLine, 3108).
+-define(wxStyledTextCtrl_GetLine, 3109).
+-define(wxStyledTextCtrl_GetLineCount, 3110).
+-define(wxStyledTextCtrl_SetMarginLeft, 3111).
+-define(wxStyledTextCtrl_GetMarginLeft, 3112).
+-define(wxStyledTextCtrl_SetMarginRight, 3113).
+-define(wxStyledTextCtrl_GetMarginRight, 3114).
+-define(wxStyledTextCtrl_GetModify, 3115).
+-define(wxStyledTextCtrl_SetSelection, 3116).
+-define(wxStyledTextCtrl_GetSelectedText, 3117).
+-define(wxStyledTextCtrl_GetTextRange, 3118).
+-define(wxStyledTextCtrl_HideSelection, 3119).
+-define(wxStyledTextCtrl_LineFromPosition, 3120).
+-define(wxStyledTextCtrl_PositionFromLine, 3121).
+-define(wxStyledTextCtrl_LineScroll, 3122).
+-define(wxStyledTextCtrl_EnsureCaretVisible, 3123).
+-define(wxStyledTextCtrl_ReplaceSelection, 3124).
+-define(wxStyledTextCtrl_SetReadOnly, 3125).
+-define(wxStyledTextCtrl_CanPaste, 3126).
+-define(wxStyledTextCtrl_CanUndo, 3127).
+-define(wxStyledTextCtrl_EmptyUndoBuffer, 3128).
+-define(wxStyledTextCtrl_Undo, 3129).
+-define(wxStyledTextCtrl_Cut, 3130).
+-define(wxStyledTextCtrl_Copy, 3131).
+-define(wxStyledTextCtrl_Paste, 3132).
+-define(wxStyledTextCtrl_Clear, 3133).
+-define(wxStyledTextCtrl_SetText, 3134).
+-define(wxStyledTextCtrl_GetText, 3135).
+-define(wxStyledTextCtrl_GetTextLength, 3136).
+-define(wxStyledTextCtrl_GetOvertype, 3137).
+-define(wxStyledTextCtrl_SetCaretWidth, 3138).
+-define(wxStyledTextCtrl_GetCaretWidth, 3139).
+-define(wxStyledTextCtrl_SetTargetStart, 3140).
+-define(wxStyledTextCtrl_GetTargetStart, 3141).
+-define(wxStyledTextCtrl_SetTargetEnd, 3142).
+-define(wxStyledTextCtrl_GetTargetEnd, 3143).
+-define(wxStyledTextCtrl_ReplaceTarget, 3144).
+-define(wxStyledTextCtrl_SearchInTarget, 3145).
+-define(wxStyledTextCtrl_SetSearchFlags, 3146).
+-define(wxStyledTextCtrl_GetSearchFlags, 3147).
+-define(wxStyledTextCtrl_CallTipShow, 3148).
+-define(wxStyledTextCtrl_CallTipCancel, 3149).
+-define(wxStyledTextCtrl_CallTipActive, 3150).
+-define(wxStyledTextCtrl_CallTipPosAtStart, 3151).
+-define(wxStyledTextCtrl_CallTipSetHighlight, 3152).
+-define(wxStyledTextCtrl_CallTipSetBackground, 3153).
+-define(wxStyledTextCtrl_CallTipSetForeground, 3154).
+-define(wxStyledTextCtrl_CallTipSetForegroundHighlight, 3155).
+-define(wxStyledTextCtrl_CallTipUseStyle, 3156).
+-define(wxStyledTextCtrl_VisibleFromDocLine, 3157).
+-define(wxStyledTextCtrl_DocLineFromVisible, 3158).
+-define(wxStyledTextCtrl_WrapCount, 3159).
+-define(wxStyledTextCtrl_SetFoldLevel, 3160).
+-define(wxStyledTextCtrl_GetFoldLevel, 3161).
+-define(wxStyledTextCtrl_GetLastChild, 3162).
+-define(wxStyledTextCtrl_GetFoldParent, 3163).
+-define(wxStyledTextCtrl_ShowLines, 3164).
+-define(wxStyledTextCtrl_HideLines, 3165).
+-define(wxStyledTextCtrl_GetLineVisible, 3166).
+-define(wxStyledTextCtrl_SetFoldExpanded, 3167).
+-define(wxStyledTextCtrl_GetFoldExpanded, 3168).
+-define(wxStyledTextCtrl_ToggleFold, 3169).
+-define(wxStyledTextCtrl_EnsureVisible, 3170).
+-define(wxStyledTextCtrl_SetFoldFlags, 3171).
+-define(wxStyledTextCtrl_EnsureVisibleEnforcePolicy, 3172).
+-define(wxStyledTextCtrl_SetTabIndents, 3173).
+-define(wxStyledTextCtrl_GetTabIndents, 3174).
+-define(wxStyledTextCtrl_SetBackSpaceUnIndents, 3175).
+-define(wxStyledTextCtrl_GetBackSpaceUnIndents, 3176).
+-define(wxStyledTextCtrl_SetMouseDwellTime, 3177).
+-define(wxStyledTextCtrl_GetMouseDwellTime, 3178).
+-define(wxStyledTextCtrl_WordStartPosition, 3179).
+-define(wxStyledTextCtrl_WordEndPosition, 3180).
+-define(wxStyledTextCtrl_SetWrapMode, 3181).
+-define(wxStyledTextCtrl_GetWrapMode, 3182).
+-define(wxStyledTextCtrl_SetWrapVisualFlags, 3183).
+-define(wxStyledTextCtrl_GetWrapVisualFlags, 3184).
+-define(wxStyledTextCtrl_SetWrapVisualFlagsLocation, 3185).
+-define(wxStyledTextCtrl_GetWrapVisualFlagsLocation, 3186).
+-define(wxStyledTextCtrl_SetWrapStartIndent, 3187).
+-define(wxStyledTextCtrl_GetWrapStartIndent, 3188).
+-define(wxStyledTextCtrl_SetLayoutCache, 3189).
+-define(wxStyledTextCtrl_GetLayoutCache, 3190).
+-define(wxStyledTextCtrl_SetScrollWidth, 3191).
+-define(wxStyledTextCtrl_GetScrollWidth, 3192).
+-define(wxStyledTextCtrl_TextWidth, 3193).
+-define(wxStyledTextCtrl_GetEndAtLastLine, 3194).
+-define(wxStyledTextCtrl_TextHeight, 3195).
+-define(wxStyledTextCtrl_SetUseVerticalScrollBar, 3196).
+-define(wxStyledTextCtrl_GetUseVerticalScrollBar, 3197).
+-define(wxStyledTextCtrl_AppendText, 3198).
+-define(wxStyledTextCtrl_GetTwoPhaseDraw, 3199).
+-define(wxStyledTextCtrl_SetTwoPhaseDraw, 3200).
+-define(wxStyledTextCtrl_TargetFromSelection, 3201).
+-define(wxStyledTextCtrl_LinesJoin, 3202).
+-define(wxStyledTextCtrl_LinesSplit, 3203).
+-define(wxStyledTextCtrl_SetFoldMarginColour, 3204).
+-define(wxStyledTextCtrl_SetFoldMarginHiColour, 3205).
+-define(wxStyledTextCtrl_LineDown, 3206).
+-define(wxStyledTextCtrl_LineDownExtend, 3207).
+-define(wxStyledTextCtrl_LineUp, 3208).
+-define(wxStyledTextCtrl_LineUpExtend, 3209).
+-define(wxStyledTextCtrl_CharLeft, 3210).
+-define(wxStyledTextCtrl_CharLeftExtend, 3211).
+-define(wxStyledTextCtrl_CharRight, 3212).
+-define(wxStyledTextCtrl_CharRightExtend, 3213).
+-define(wxStyledTextCtrl_WordLeft, 3214).
+-define(wxStyledTextCtrl_WordLeftExtend, 3215).
+-define(wxStyledTextCtrl_WordRight, 3216).
+-define(wxStyledTextCtrl_WordRightExtend, 3217).
+-define(wxStyledTextCtrl_Home, 3218).
+-define(wxStyledTextCtrl_HomeExtend, 3219).
+-define(wxStyledTextCtrl_LineEnd, 3220).
+-define(wxStyledTextCtrl_LineEndExtend, 3221).
+-define(wxStyledTextCtrl_DocumentStart, 3222).
+-define(wxStyledTextCtrl_DocumentStartExtend, 3223).
+-define(wxStyledTextCtrl_DocumentEnd, 3224).
+-define(wxStyledTextCtrl_DocumentEndExtend, 3225).
+-define(wxStyledTextCtrl_PageUp, 3226).
+-define(wxStyledTextCtrl_PageUpExtend, 3227).
+-define(wxStyledTextCtrl_PageDown, 3228).
+-define(wxStyledTextCtrl_PageDownExtend, 3229).
+-define(wxStyledTextCtrl_EditToggleOvertype, 3230).
+-define(wxStyledTextCtrl_Cancel, 3231).
+-define(wxStyledTextCtrl_DeleteBack, 3232).
+-define(wxStyledTextCtrl_Tab, 3233).
+-define(wxStyledTextCtrl_BackTab, 3234).
+-define(wxStyledTextCtrl_NewLine, 3235).
+-define(wxStyledTextCtrl_FormFeed, 3236).
+-define(wxStyledTextCtrl_VCHome, 3237).
+-define(wxStyledTextCtrl_VCHomeExtend, 3238).
+-define(wxStyledTextCtrl_ZoomIn, 3239).
+-define(wxStyledTextCtrl_ZoomOut, 3240).
+-define(wxStyledTextCtrl_DelWordLeft, 3241).
+-define(wxStyledTextCtrl_DelWordRight, 3242).
+-define(wxStyledTextCtrl_LineCut, 3243).
+-define(wxStyledTextCtrl_LineDelete, 3244).
+-define(wxStyledTextCtrl_LineTranspose, 3245).
+-define(wxStyledTextCtrl_LineDuplicate, 3246).
+-define(wxStyledTextCtrl_LowerCase, 3247).
+-define(wxStyledTextCtrl_UpperCase, 3248).
+-define(wxStyledTextCtrl_LineScrollDown, 3249).
+-define(wxStyledTextCtrl_LineScrollUp, 3250).
+-define(wxStyledTextCtrl_DeleteBackNotLine, 3251).
+-define(wxStyledTextCtrl_HomeDisplay, 3252).
+-define(wxStyledTextCtrl_HomeDisplayExtend, 3253).
+-define(wxStyledTextCtrl_LineEndDisplay, 3254).
+-define(wxStyledTextCtrl_LineEndDisplayExtend, 3255).
+-define(wxStyledTextCtrl_HomeWrapExtend, 3256).
+-define(wxStyledTextCtrl_LineEndWrap, 3257).
+-define(wxStyledTextCtrl_LineEndWrapExtend, 3258).
+-define(wxStyledTextCtrl_VCHomeWrap, 3259).
+-define(wxStyledTextCtrl_VCHomeWrapExtend, 3260).
+-define(wxStyledTextCtrl_LineCopy, 3261).
+-define(wxStyledTextCtrl_MoveCaretInsideView, 3262).
+-define(wxStyledTextCtrl_LineLength, 3263).
+-define(wxStyledTextCtrl_BraceHighlight, 3264).
+-define(wxStyledTextCtrl_BraceBadLight, 3265).
+-define(wxStyledTextCtrl_BraceMatch, 3266).
+-define(wxStyledTextCtrl_GetViewEOL, 3267).
+-define(wxStyledTextCtrl_SetViewEOL, 3268).
+-define(wxStyledTextCtrl_SetModEventMask, 3269).
+-define(wxStyledTextCtrl_GetEdgeColumn, 3270).
+-define(wxStyledTextCtrl_SetEdgeColumn, 3271).
+-define(wxStyledTextCtrl_GetEdgeMode, 3272).
+-define(wxStyledTextCtrl_GetEdgeColour, 3273).
+-define(wxStyledTextCtrl_SetEdgeColour, 3274).
+-define(wxStyledTextCtrl_SearchAnchor, 3275).
+-define(wxStyledTextCtrl_SearchNext, 3276).
+-define(wxStyledTextCtrl_SearchPrev, 3277).
+-define(wxStyledTextCtrl_LinesOnScreen, 3278).
+-define(wxStyledTextCtrl_UsePopUp, 3279).
+-define(wxStyledTextCtrl_SelectionIsRectangle, 3280).
+-define(wxStyledTextCtrl_SetZoom, 3281).
+-define(wxStyledTextCtrl_GetZoom, 3282).
+-define(wxStyledTextCtrl_GetModEventMask, 3283).
+-define(wxStyledTextCtrl_SetSTCFocus, 3284).
+-define(wxStyledTextCtrl_GetSTCFocus, 3285).
+-define(wxStyledTextCtrl_SetStatus, 3286).
+-define(wxStyledTextCtrl_GetStatus, 3287).
+-define(wxStyledTextCtrl_SetMouseDownCaptures, 3288).
+-define(wxStyledTextCtrl_GetMouseDownCaptures, 3289).
+-define(wxStyledTextCtrl_SetSTCCursor, 3290).
+-define(wxStyledTextCtrl_GetSTCCursor, 3291).
+-define(wxStyledTextCtrl_SetControlCharSymbol, 3292).
+-define(wxStyledTextCtrl_GetControlCharSymbol, 3293).
+-define(wxStyledTextCtrl_WordPartLeft, 3294).
+-define(wxStyledTextCtrl_WordPartLeftExtend, 3295).
+-define(wxStyledTextCtrl_WordPartRight, 3296).
+-define(wxStyledTextCtrl_WordPartRightExtend, 3297).
+-define(wxStyledTextCtrl_SetVisiblePolicy, 3298).
+-define(wxStyledTextCtrl_DelLineLeft, 3299).
+-define(wxStyledTextCtrl_DelLineRight, 3300).
+-define(wxStyledTextCtrl_GetXOffset, 3301).
+-define(wxStyledTextCtrl_ChooseCaretX, 3302).
+-define(wxStyledTextCtrl_SetXCaretPolicy, 3303).
+-define(wxStyledTextCtrl_SetYCaretPolicy, 3304).
+-define(wxStyledTextCtrl_GetPrintWrapMode, 3305).
+-define(wxStyledTextCtrl_SetHotspotActiveForeground, 3306).
+-define(wxStyledTextCtrl_SetHotspotActiveBackground, 3307).
+-define(wxStyledTextCtrl_SetHotspotActiveUnderline, 3308).
+-define(wxStyledTextCtrl_SetHotspotSingleLine, 3309).
+-define(wxStyledTextCtrl_ParaDownExtend, 3310).
+-define(wxStyledTextCtrl_ParaUp, 3311).
+-define(wxStyledTextCtrl_ParaUpExtend, 3312).
+-define(wxStyledTextCtrl_PositionBefore, 3313).
+-define(wxStyledTextCtrl_PositionAfter, 3314).
+-define(wxStyledTextCtrl_CopyRange, 3315).
+-define(wxStyledTextCtrl_CopyText, 3316).
+-define(wxStyledTextCtrl_SetSelectionMode, 3317).
+-define(wxStyledTextCtrl_GetSelectionMode, 3318).
+-define(wxStyledTextCtrl_LineDownRectExtend, 3319).
+-define(wxStyledTextCtrl_LineUpRectExtend, 3320).
+-define(wxStyledTextCtrl_CharLeftRectExtend, 3321).
+-define(wxStyledTextCtrl_CharRightRectExtend, 3322).
+-define(wxStyledTextCtrl_HomeRectExtend, 3323).
+-define(wxStyledTextCtrl_VCHomeRectExtend, 3324).
+-define(wxStyledTextCtrl_LineEndRectExtend, 3325).
+-define(wxStyledTextCtrl_PageUpRectExtend, 3326).
+-define(wxStyledTextCtrl_PageDownRectExtend, 3327).
+-define(wxStyledTextCtrl_StutteredPageUp, 3328).
+-define(wxStyledTextCtrl_StutteredPageUpExtend, 3329).
+-define(wxStyledTextCtrl_StutteredPageDown, 3330).
+-define(wxStyledTextCtrl_StutteredPageDownExtend, 3331).
+-define(wxStyledTextCtrl_WordLeftEnd, 3332).
+-define(wxStyledTextCtrl_WordLeftEndExtend, 3333).
+-define(wxStyledTextCtrl_WordRightEnd, 3334).
+-define(wxStyledTextCtrl_WordRightEndExtend, 3335).
+-define(wxStyledTextCtrl_SetWhitespaceChars, 3336).
+-define(wxStyledTextCtrl_SetCharsDefault, 3337).
+-define(wxStyledTextCtrl_AutoCompGetCurrent, 3338).
+-define(wxStyledTextCtrl_Allocate, 3339).
+-define(wxStyledTextCtrl_FindColumn, 3340).
+-define(wxStyledTextCtrl_GetCaretSticky, 3341).
+-define(wxStyledTextCtrl_SetCaretSticky, 3342).
+-define(wxStyledTextCtrl_ToggleCaretSticky, 3343).
+-define(wxStyledTextCtrl_SetPasteConvertEndings, 3344).
+-define(wxStyledTextCtrl_GetPasteConvertEndings, 3345).
+-define(wxStyledTextCtrl_SelectionDuplicate, 3346).
+-define(wxStyledTextCtrl_SetCaretLineBackAlpha, 3347).
+-define(wxStyledTextCtrl_GetCaretLineBackAlpha, 3348).
+-define(wxStyledTextCtrl_StartRecord, 3349).
+-define(wxStyledTextCtrl_StopRecord, 3350).
+-define(wxStyledTextCtrl_SetLexer, 3351).
+-define(wxStyledTextCtrl_GetLexer, 3352).
+-define(wxStyledTextCtrl_Colourise, 3353).
+-define(wxStyledTextCtrl_SetProperty, 3354).
+-define(wxStyledTextCtrl_SetKeyWords, 3355).
+-define(wxStyledTextCtrl_SetLexerLanguage, 3356).
+-define(wxStyledTextCtrl_GetProperty, 3357).
+-define(wxStyledTextCtrl_GetStyleBitsNeeded, 3358).
+-define(wxStyledTextCtrl_GetCurrentLine, 3359).
+-define(wxStyledTextCtrl_StyleSetSpec, 3360).
+-define(wxStyledTextCtrl_StyleSetFont, 3361).
+-define(wxStyledTextCtrl_StyleSetFontAttr, 3362).
+-define(wxStyledTextCtrl_StyleSetCharacterSet, 3363).
+-define(wxStyledTextCtrl_StyleSetFontEncoding, 3364).
+-define(wxStyledTextCtrl_CmdKeyExecute, 3365).
+-define(wxStyledTextCtrl_SetMargins, 3366).
+-define(wxStyledTextCtrl_GetSelection, 3367).
+-define(wxStyledTextCtrl_PointFromPosition, 3368).
+-define(wxStyledTextCtrl_ScrollToLine, 3369).
+-define(wxStyledTextCtrl_ScrollToColumn, 3370).
+-define(wxStyledTextCtrl_SendMsg, 3371).
+-define(wxStyledTextCtrl_SetVScrollBar, 3372).
+-define(wxStyledTextCtrl_SetHScrollBar, 3373).
+-define(wxStyledTextCtrl_GetLastKeydownProcessed, 3374).
+-define(wxStyledTextCtrl_SetLastKeydownProcessed, 3375).
+-define(wxStyledTextCtrl_SaveFile, 3376).
+-define(wxStyledTextCtrl_LoadFile, 3377).
+-define(wxStyledTextCtrl_DoDragOver, 3378).
+-define(wxStyledTextCtrl_DoDropText, 3379).
+-define(wxStyledTextCtrl_GetUseAntiAliasing, 3380).
+-define(wxStyledTextCtrl_AddTextRaw, 3381).
+-define(wxStyledTextCtrl_InsertTextRaw, 3382).
+-define(wxStyledTextCtrl_GetCurLineRaw, 3383).
+-define(wxStyledTextCtrl_GetLineRaw, 3384).
+-define(wxStyledTextCtrl_GetSelectedTextRaw, 3385).
+-define(wxStyledTextCtrl_GetTextRangeRaw, 3386).
+-define(wxStyledTextCtrl_SetTextRaw, 3387).
+-define(wxStyledTextCtrl_GetTextRaw, 3388).
+-define(wxStyledTextCtrl_AppendTextRaw, 3389).
+-define(wxArtProvider_GetBitmap, 3390).
+-define(wxArtProvider_GetIcon, 3391).
+-define(wxTreeEvent_GetKeyCode, 3392).
+-define(wxTreeEvent_GetItem, 3393).
+-define(wxTreeEvent_GetKeyEvent, 3394).
+-define(wxTreeEvent_GetLabel, 3395).
+-define(wxTreeEvent_GetOldItem, 3396).
+-define(wxTreeEvent_GetPoint, 3397).
+-define(wxTreeEvent_IsEditCancelled, 3398).
+-define(wxTreeEvent_SetToolTip, 3399).
+-define(wxNotebookEvent_GetOldSelection, 3400).
+-define(wxNotebookEvent_GetSelection, 3401).
+-define(wxNotebookEvent_SetOldSelection, 3402).
+-define(wxNotebookEvent_SetSelection, 3403).
+-define(wxFileDataObject_new, 3404).
+-define(wxFileDataObject_AddFile, 3405).
+-define(wxFileDataObject_GetFilenames, 3406).
+-define(wxFileDataObject_destroy, 3407).
+-define(wxTextDataObject_new, 3408).
+-define(wxTextDataObject_GetTextLength, 3409).
+-define(wxTextDataObject_GetText, 3410).
+-define(wxTextDataObject_SetText, 3411).
+-define(wxTextDataObject_destroy, 3412).
+-define(wxBitmapDataObject_new_1_1, 3413).
+-define(wxBitmapDataObject_new_1_0, 3414).
+-define(wxBitmapDataObject_GetBitmap, 3415).
+-define(wxBitmapDataObject_SetBitmap, 3416).
+-define(wxBitmapDataObject_destroy, 3417).
+-define(wxClipboard_new, 3419).
+-define(wxClipboard_destruct, 3420).
+-define(wxClipboard_AddData, 3421).
+-define(wxClipboard_Clear, 3422).
+-define(wxClipboard_Close, 3423).
+-define(wxClipboard_Flush, 3424).
+-define(wxClipboard_GetData, 3425).
+-define(wxClipboard_IsOpened, 3426).
+-define(wxClipboard_Open, 3427).
+-define(wxClipboard_SetData, 3428).
+-define(wxClipboard_UsePrimarySelection, 3430).
+-define(wxClipboard_IsSupported, 3431).
+-define(wxClipboard_Get, 3432).
+-define(wxSpinEvent_GetPosition, 3433).
+-define(wxSpinEvent_SetPosition, 3434).
+-define(wxSplitterWindow_new_0, 3435).
+-define(wxSplitterWindow_new_2, 3436).
+-define(wxSplitterWindow_destruct, 3437).
+-define(wxSplitterWindow_Create, 3438).
+-define(wxSplitterWindow_GetMinimumPaneSize, 3439).
+-define(wxSplitterWindow_GetSashGravity, 3440).
+-define(wxSplitterWindow_GetSashPosition, 3441).
+-define(wxSplitterWindow_GetSplitMode, 3442).
+-define(wxSplitterWindow_GetWindow1, 3443).
+-define(wxSplitterWindow_GetWindow2, 3444).
+-define(wxSplitterWindow_Initialize, 3445).
+-define(wxSplitterWindow_IsSplit, 3446).
+-define(wxSplitterWindow_ReplaceWindow, 3447).
+-define(wxSplitterWindow_SetSashGravity, 3448).
+-define(wxSplitterWindow_SetSashPosition, 3449).
+-define(wxSplitterWindow_SetSashSize, 3450).
+-define(wxSplitterWindow_SetMinimumPaneSize, 3451).
+-define(wxSplitterWindow_SetSplitMode, 3452).
+-define(wxSplitterWindow_SplitHorizontally, 3453).
+-define(wxSplitterWindow_SplitVertically, 3454).
+-define(wxSplitterWindow_Unsplit, 3455).
+-define(wxSplitterWindow_UpdateSize, 3456).
+-define(wxSplitterEvent_GetSashPosition, 3457).
+-define(wxSplitterEvent_GetX, 3458).
+-define(wxSplitterEvent_GetY, 3459).
+-define(wxSplitterEvent_GetWindowBeingRemoved, 3460).
+-define(wxSplitterEvent_SetSashPosition, 3461).
+-define(wxHtmlWindow_new_0, 3462).
+-define(wxHtmlWindow_new_2, 3463).
+-define(wxHtmlWindow_AppendToPage, 3464).
+-define(wxHtmlWindow_GetOpenedAnchor, 3465).
+-define(wxHtmlWindow_GetOpenedPage, 3466).
+-define(wxHtmlWindow_GetOpenedPageTitle, 3467).
+-define(wxHtmlWindow_GetRelatedFrame, 3468).
+-define(wxHtmlWindow_HistoryBack, 3469).
+-define(wxHtmlWindow_HistoryCanBack, 3470).
+-define(wxHtmlWindow_HistoryCanForward, 3471).
+-define(wxHtmlWindow_HistoryClear, 3472).
+-define(wxHtmlWindow_HistoryForward, 3473).
+-define(wxHtmlWindow_LoadFile, 3474).
+-define(wxHtmlWindow_LoadPage, 3475).
+-define(wxHtmlWindow_SelectAll, 3476).
+-define(wxHtmlWindow_SelectionToText, 3477).
+-define(wxHtmlWindow_SelectLine, 3478).
+-define(wxHtmlWindow_SelectWord, 3479).
+-define(wxHtmlWindow_SetBorders, 3480).
+-define(wxHtmlWindow_SetFonts, 3481).
+-define(wxHtmlWindow_SetPage, 3482).
+-define(wxHtmlWindow_SetRelatedFrame, 3483).
+-define(wxHtmlWindow_SetRelatedStatusBar, 3484).
+-define(wxHtmlWindow_ToText, 3485).
+-define(wxHtmlWindow_destroy, 3486).
+-define(wxHtmlLinkEvent_GetLinkInfo, 3487).
+-define(wxSystemSettings_GetColour, 3488).
+-define(wxSystemSettings_GetFont, 3489).
+-define(wxSystemSettings_GetMetric, 3490).
+-define(wxSystemSettings_GetScreenType, 3491).
+-define(wxAuiNotebookEvent_SetSelection, 3492).
+-define(wxAuiNotebookEvent_GetSelection, 3493).
+-define(wxAuiNotebookEvent_SetOldSelection, 3494).
+-define(wxAuiNotebookEvent_GetOldSelection, 3495).
+-define(wxAuiNotebookEvent_SetDragSource, 3496).
+-define(wxAuiNotebookEvent_GetDragSource, 3497).
+-define(wxAuiManagerEvent_SetManager, 3498).
+-define(wxAuiManagerEvent_GetManager, 3499).
+-define(wxAuiManagerEvent_SetPane, 3500).
+-define(wxAuiManagerEvent_GetPane, 3501).
+-define(wxAuiManagerEvent_SetButton, 3502).
+-define(wxAuiManagerEvent_GetButton, 3503).
+-define(wxAuiManagerEvent_SetDC, 3504).
+-define(wxAuiManagerEvent_GetDC, 3505).
+-define(wxAuiManagerEvent_Veto, 3506).
+-define(wxAuiManagerEvent_GetVeto, 3507).
+-define(wxAuiManagerEvent_SetCanVeto, 3508).
+-define(wxAuiManagerEvent_CanVeto, 3509).
+-define(wxLogNull_new, 3510).
+-define(wxLogNull_destroy, 3511).
diff --git a/lib/wx/src/wxe_server.erl b/lib/wx/src/wxe_server.erl
index 40412987a5..69e2189fac 100644
--- a/lib/wx/src/wxe_server.erl
+++ b/lib/wx/src/wxe_server.erl
@@ -1,19 +1,19 @@
%%
%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2008-2009. All Rights Reserved.
-%%
+%%
+%% Copyright Ericsson AB 2008-2011. All Rights Reserved.
+%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
%% compliance with the License. You should have received a copy of the
%% Erlang Public License along with this software. If not, it can be
%% retrieved online at http://www.erlang.org/.
-%%
+%%
%% Software distributed under the License is distributed on an "AS IS"
%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
%% the License for the specific language governing rights and limitations
%% under the License.
-%%
+%%
%% %CopyrightEnd%
%%%-------------------------------------------------------------------
%%% File : wxe_server.erl
@@ -24,7 +24,7 @@
%%% Created : 17 Jan 2007 by Dan Gudmundsson <[email protected]>
%%%-------------------------------------------------------------------
-%% @hidden
+%% @hidden
-module(wxe_server).
-behaviour(gen_server).
@@ -65,7 +65,7 @@ start() ->
end;
Env = #wx_env{sv=Pid} ->
case erlang:is_process_alive(Pid) of
- true ->
+ true ->
Env;
false -> %% Ok we got an old wx env, someone forgot
erase(?WXE_IDENTIFIER), %% to call wx:destroy()
@@ -94,7 +94,7 @@ init([]) ->
{ok,#state{port=Port, cb_port=CBPort,
users=gb_trees:empty(), cb=gb_trees:empty(), cb_cnt=1}}.
-%% Register process
+%% Register process
handle_call(register_me, {From,_}, State=#state{users=Users}) ->
erlang:monitor(process, From),
case gb_trees:is_defined(From, Users) of
@@ -147,7 +147,7 @@ handle_cast({debug, Level}, State) ->
put(?WXE_IDENTIFIER, Env#wx_env{debug=Level}),
{noreply, State};
-handle_cast(_Msg, State) ->
+handle_cast(_Msg, State) ->
?log("Unknown message ~p sent to ~p~n",[_Msg, ?MODULE]),
{noreply, State}.
@@ -156,7 +156,7 @@ handle_cast(_Msg, State) ->
%% Callback request from driver
handle_info(Cb = {_, _, '_wx_invoke_cb_'}, State) ->
invoke_cb(Cb, State),
- {noreply, State};
+ {noreply, State};
handle_info({wx_delete_cb, FunId}, State0 = #state{cb=CB}) when is_integer(FunId) ->
case get(FunId) of
undefined ->
@@ -166,7 +166,7 @@ handle_info({wx_delete_cb, FunId}, State0 = #state{cb=CB}) when is_integer(FunId
{noreply, State0#state{cb=gb_trees:delete(Fun, CB)}}
end;
handle_info({'DOWN',_,process,Pid,_}, State=#state{users=Users0,cleaners=Cs}) ->
- try
+ try
User = gb_trees:get(Pid,Users0),
Users = gb_trees:delete(Pid,Users0),
Env = wx:get_env(),
@@ -210,7 +210,7 @@ handle_connect(Object, EvData, From, State0 = #state{users=Users}) ->
case Handler0 of
#wx_ref{} when Callback =:= 0 ->
CBHandler = Handler0,
- Handler = Handler0;
+ Handler = Handler0;
undefined when Callback =:= 0 ->
Handler = new_evt_listener(State0),
CBHandler = Handler;
@@ -225,7 +225,7 @@ handle_connect(Object, EvData, From, State0 = #state{users=Users}) ->
{FunId, State} = attach_fun(Callback,State1),
Res = wxEvtHandler:connect_impl(CBHandler,Object,
wxEvtHandler:replace_fun_with_id(EvData,FunId)),
- case Res of
+ case Res of
ok -> {reply,Res,State};
_Error -> {reply,Res,State0}
end;
@@ -238,11 +238,7 @@ invoke_cb({{Ev=#wx{}, Ref=#wx_ref{}}, FunId,_}, _S) ->
%% Event callbacks
case get(FunId) of
Fun when is_function(Fun) ->
- invoke_callback(fun() ->
- wxe_util:cast(?WXE_CB_START, <<>>),
- Fun(Ev, Ref),
- <<>>
- end);
+ invoke_callback(fun() -> Fun(Ev, Ref), <<>> end);
Err ->
?log("Internal Error ~p~n",[Err])
end;
@@ -254,12 +250,14 @@ invoke_cb({FunId, Args, _}, _S) when is_list(Args), is_integer(FunId) ->
Err ->
?log("Internal Error ~p ~p ~p~n",[Err, FunId, Args])
end.
-
+
invoke_callback(Fun) ->
Env = get(?WXE_IDENTIFIER),
CB = fun() ->
wx:set_env(Env),
- Res = try Return = Fun(),
+ wxe_util:cast(?WXE_CB_START, <<>>),
+ Res = try
+ Return = Fun(),
true = is_binary(Return),
Return
catch _:Reason ->
@@ -278,9 +276,9 @@ new_evt_listener(State) ->
get_result(State).
get_result(_State) ->
- receive
+ receive
{'_wxe_result_', Res} -> Res;
- {'_wxe_error_', Op, Error} ->
+ {'_wxe_error_', Op, Error} ->
erlang:error({Error, {wxEvtHandler, {internal_installer, Op}}})
end.
@@ -289,7 +287,7 @@ attach_fun(Fun, S = #state{cb=CB,cb_cnt=Next}) ->
{value, ID} ->
{ID,S};
none ->
- put(Next,Fun),
+ put(Next,Fun),
{Next,S#state{cb=gb_trees:insert(Fun,Next,CB),cb_cnt=Next+1}}
end.
@@ -297,7 +295,7 @@ handle_disconnect(Object, Evh, From, State0 = #state{users=Users0}) ->
User0 = #user{events=Evs0, evt_handler=PidH} = gb_trees:get(From, Users0),
Fun = wxEvtHandler:get_callback(Evh),
case find_handler(Evs0, Object, Fun) of
- [] ->
+ [] ->
{reply, false, State0};
Handlers ->
case disconnect(Object,Evh, Handlers) of
@@ -310,7 +308,7 @@ handle_disconnect(Object, Evh, From, State0 = #state{users=Users0}) ->
[] when PidH =/= undefined ->
wxEvtHandler:destroy_evt_listener(PidH),
User0#user{events=[], evt_handler=undefined};
- Evs ->
+ Evs ->
User0#user{events=Evs}
end,
{reply, true, State0#state{users=gb_trees:update(From,User,Users0)}};
@@ -345,7 +343,7 @@ find_handler([],_Object,_Fun,Res) ->
%% Cleanup
-%% The server handles callbacks from driver so every other wx call must
+%% The server handles callbacks from driver so every other wx call must
%% be called from another process, therefore the cleaning must be spawned.
%%
cleanup(Env, _Pid, Data) ->
@@ -358,7 +356,7 @@ cleanup(#user{objects=_Os,events=Evs, evt_handler=Handler}) ->
lists:foreach(fun(#event{object=_O, callback=CB, cb_handler=CbH}) ->
%%catch wxEvtHandler:disconnect_impl(CbH,O),
case is_function(CB) of
- true ->
+ true ->
wxEvtHandler:destroy_evt_listener(CbH);
false ->
ignore
diff --git a/lib/wx/test/wx_class_SUITE.erl b/lib/wx/test/wx_class_SUITE.erl
index 79e6833e9b..00ef1289ab 100644
--- a/lib/wx/test/wx_class_SUITE.erl
+++ b/lib/wx/test/wx_class_SUITE.erl
@@ -18,14 +18,14 @@
%%%-------------------------------------------------------------------
%%% File : wx_class_SUITE.erl
%%% Author : Dan Gudmundsson <[email protected]>
-%%% Description :
+%%% Description :
%%%
%%% Created : 13 Nov 2008 by Dan Gudmundsson <[email protected]>
%%%-------------------------------------------------------------------
-module(wx_class_SUITE).
--export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
- init_per_suite/1, end_per_suite/1,
+-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
+ init_per_suite/1, end_per_suite/1,
init_per_testcase/2, end_per_testcase/2]).
-compile(export_all).
@@ -41,18 +41,18 @@ end_per_suite(Config) ->
init_per_testcase(Func,Config) ->
wx_test_lib:init_per_testcase(Func,Config).
-end_per_testcase(Func,Config) ->
+end_per_testcase(Func,Config) ->
wx_test_lib:end_per_testcase(Func,Config).
%% SUITE specification
suite() -> [{ct_hooks,[ts_install_cth]}].
-all() ->
+all() ->
[calendarCtrl, treeCtrl, notebook, staticBoxSizer,
- clipboard, helpFrame, htmlWindow, listCtrlSort,
+ clipboard, helpFrame, htmlWindow, listCtrlSort, listCtrlVirtual,
radioBox, systemSettings].
-groups() ->
+groups() ->
[].
init_per_group(_GroupName, Config) ->
@@ -70,9 +70,9 @@ calendarCtrl(Config) ->
Frame = ?mt(wxFrame, wxFrame:new(Wx, 1, "Calendar", [])),
Panel = wxPanel:new(Frame),
Sz = wxBoxSizer:new(?wxVERTICAL),
-
+
{YMD={_,_,Day},_} = DateTime = calendar:now_to_datetime(erlang:now()),
- Cal = ?mt(wxCalendarCtrl, wxCalendarCtrl:new(Panel, ?wxID_ANY,
+ Cal = ?mt(wxCalendarCtrl, wxCalendarCtrl:new(Panel, ?wxID_ANY,
[{date,DateTime}
])),
wxSizer:add(Sz,Cal),
@@ -91,25 +91,25 @@ calendarCtrl(Config) ->
?m({0,243,0,255}, wxCalendarDateAttr:getBackgroundColour(DateAttr1)),
?m({YMD, _},wxCalendarCtrl:getDate(Cal)),
-
- wxCalendarCtrl:connect(Cal, calendar_weekday_clicked),
- wxCalendarCtrl:connect(Cal, calendar_day_changed),
- wxCalendarCtrl:connect(Cal, calendar_month_changed),
+
+ wxCalendarCtrl:connect(Cal, calendar_weekday_clicked),
+ wxCalendarCtrl:connect(Cal, calendar_day_changed),
+ wxCalendarCtrl:connect(Cal, calendar_month_changed),
wxCalendarCtrl:connect(Cal, calendar_year_changed),
- wxCalendarCtrl:connect(Cal, calendar_doubleclicked),
+ wxCalendarCtrl:connect(Cal, calendar_doubleclicked),
wxCalendarCtrl:connect(Cal, calendar_sel_changed),
-
+
wxWindow:setSizer(Panel,Sz),
wxSizer:setSizeHints(Sz,Frame),
- wxWindow:show(Frame),
-
+ wxWindow:show(Frame),
+
wx_test_lib:wx_destroy(Frame,Config).
treeCtrl(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
treeCtrl(Config) ->
Wx = wx:new(),
-
+
Frame = wxFrame:new(Wx, ?wxID_ANY, "Frame"),
Panel = wxPanel:new(Frame, []),
Tree = ?mt(wxTreeCtrl,wxTreeCtrl:new(Panel, [{style , ?wxTR_HAS_BUTTONS}])),
@@ -122,25 +122,25 @@ treeCtrl(Config) ->
?m(ok, wxTreeCtrl:setItemData(Tree, Item2, {data, item2})),
Item3 = wxTreeCtrl:appendItem(Tree, Root, "Item3", []),
?m(ok, wxTreeCtrl:setItemData(Tree, Item3, {data, item3})),
-
+
Sizer = wxBoxSizer:new(?wxVERTICAL),
wxSizer:add(Sizer, Tree, [{flag, ?wxEXPAND}, {proportion, 1}]),
wxWindow:setSizerAndFit(Panel, Sizer),
wxFrame:show(Frame),
-
+
?m([], wxTreeCtrl:getItemData(Tree, Root)),
?m({data,item1}, wxTreeCtrl:getItemData(Tree, Item1)),
?m({data,item2}, wxTreeCtrl:getItemData(Tree, Item2)),
?m({data,item3}, wxTreeCtrl:getItemData(Tree, Item3)),
-
+
wxFrame:connect(Tree, command_tree_item_expanded),
wxFrame:connect(Tree, command_tree_item_collapsed),
wxFrame:connect(Frame, close_window),
wxTreeCtrl:editLabel(Tree, Root),
-
+
wx_test_lib:wx_destroy(Frame,Config).
notebook(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
@@ -210,13 +210,13 @@ staticBoxSizer(Config) ->
Frame = wxFrame:new(Wx, ?wxID_ANY, "Frame"),
Panel = wxPanel:new(Frame, []),
InclSizer = ?mt(wxStaticBoxSizer,
- wxStaticBoxSizer:new(?wxVERTICAL, Panel,
+ wxStaticBoxSizer:new(?wxVERTICAL, Panel,
[{label, "Module inclusion policy"}])),
Sizer = wxBoxSizer:new(?wxVERTICAL),
wxSizer:add(Sizer, InclSizer,
[{border, 2}, {flag, ?wxALL bor ?wxEXPAND}, {proportion, 1}]),
- wxWindow:setSizerAndFit(Panel, Sizer),
-
+ wxWindow:setSizerAndFit(Panel, Sizer),
+
wxWindow:show(Frame),
wx_test_lib:wx_destroy(Frame,Config).
@@ -263,13 +263,13 @@ clipboard(_Config) ->
wxClipboard:flush(CB),
?log("Stopping ~n",[]),
ok.
-
+
helpFrame(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
helpFrame(Config) ->
Wx = wx:new(),
MFrame = wx:batch(fun() ->
MFrame = wxFrame:new(Wx, ?wxID_ANY, "Main Frame"),
- wxPanel:new(MFrame, [{size, {600,400}}]),
+ wxPanel:new(MFrame, [{size, {600,400}}]),
wxWindow:show(MFrame),
MFrame
end),
@@ -279,11 +279,11 @@ helpFrame(Config) ->
{X, Y, W,H} = wxWindow:getScreenRect(MFrame),
io:format("Pos0: ~p ~p ~p Pos: ~p:~p Size: ~p:~p ~n",
[X0,Y0, wxWindow:clientToScreen(MFrame, {0,0}), X,Y,W,H]),
-
+
Pos = {X+5, Y+(H div 2)},
Size = {W-10, (H div 2) - 5},
- Comp = wxFrame:new(MFrame, ?wxID_ANY, "Completion Window",
+ Comp = wxFrame:new(MFrame, ?wxID_ANY, "Completion Window",
[{pos, Pos}, {size, Size},
{style, ?wxFRAME_FLOAT_ON_PARENT}]),
LB = wxListBox:new(Comp, 42, [{style, ?wxLB_SINGLE},
@@ -301,7 +301,7 @@ htmlWindow(Config) ->
{MFrame,HPanel} =
wx:batch(fun() ->
MFrame = wxFrame:new(Wx, ?wxID_ANY, "Main Frame"),
- HPanel = wxHtmlWindow:new(MFrame, [{size, {600,400}}]),
+ HPanel = wxHtmlWindow:new(MFrame, [{size, {600,400}}]),
wxWindow:show(MFrame),
{MFrame, HPanel}
end),
@@ -310,7 +310,7 @@ htmlWindow(Config) ->
WxMod = code:which(wx),
WxDir = filename:split(filename:dirname(WxMod)) -- ["ebin"],
Html = filename:join(filename:join(WxDir),filename:join("doc", "html")),
-
+
Index = filename:join(Html, "wx.html"),
?m(ok, wxHtmlWindow:connect(HPanel, command_html_link_clicked,
@@ -318,7 +318,7 @@ htmlWindow(Config) ->
fun(Ev,_) ->
io:format("Link clicked: ~p~n",[Ev])
end}])),
-
+
case filelib:is_file(Index) of
true ->
?m(true, wxHtmlWindow:loadFile(HPanel, Index)),
@@ -326,7 +326,7 @@ htmlWindow(Config) ->
false ->
ok
end,
-
+
wx_test_lib:wx_destroy(MFrame,Config).
@@ -334,18 +334,18 @@ listCtrlSort(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
listCtrlSort(Config) ->
Wx = wx:new(),
Frame = wxFrame:new(Wx, ?wxID_ANY, "Frame"),
-
+
LC = wxListCtrl:new(Frame, [{style, ?wxLC_REPORT bor ?wxLC_SORT_ASCENDING}]),
%% must be done crashes in wxwidgets otherwise.
wxListCtrl:insertColumn(LC, 0, "Column"),
-
- Add = fun(Int) ->
+
+ Add = fun(Int) ->
wxListCtrl:insertItem(LC, Int, integer_to_list(Int)),
%% ItemData Can only be integers currently
wxListCtrl:setItemData(LC, Int, abs(2500-Int))
end,
-
+
wx:foreach(Add, lists:seq(0,5000)),
wxWindow:show(Frame),
@@ -360,10 +360,10 @@ listCtrlSort(Config) ->
end
end)
end,
-
+
Time = timer:tc(erlang, apply, [Sort,[]]),
io:format("Sorted ~p ~n",[Time]),
-
+
Item = wxListItem:new(),
_List = wx:map(fun(Int) ->
wxListItem:setId(Item, Int),
@@ -374,6 +374,48 @@ listCtrlSort(Config) ->
wx_test_lib:wx_destroy(Frame,Config).
+listCtrlVirtual(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
+listCtrlVirtual(Config) ->
+ Wx = wx:new(),
+ Frame = wxFrame:new(Wx, ?wxID_ANY, "Frame"),
+ IA = wxListItemAttr:new(),
+ wxListItemAttr:setTextColour(IA, {190, 25, 25}),
+ LC = wxListCtrl:new(Frame,
+ [{style, ?wxLC_REPORT bor ?wxLC_VIRTUAL},
+ {onGetItemText, fun(_This, Item, 0) ->
+ "Row " ++ integer_to_list(Item);
+ (_, Item, 1) when Item rem 5 == 0 ->
+ "Column 2";
+ (_, _, _) -> ""
+ end},
+ {onGetItemAttr, fun(_This, Item) when Item rem 3 == 0 ->
+ IA;
+ (_This, _Item) ->
+ wx:typeCast(wx:null(), wxListItemAttr)
+ end},
+ {onGetItemColumnImage, fun(_This, Item, 1) ->
+ Item rem 4;
+ (_, _, _) ->
+ -1
+ end}
+ ]),
+
+ IL = wxImageList:new(16,16),
+ wxImageList:add(IL, wxArtProvider:getBitmap("wxART_COPY", [{size, {16,16}}])),
+ wxImageList:add(IL, wxArtProvider:getBitmap("wxART_MISSING_IMAGE", [{size, {16,16}}])),
+ wxImageList:add(IL, wxArtProvider:getBitmap("wxART_TICK_MARK", [{size, {16,16}}])),
+ wxImageList:add(IL, wxArtProvider:getBitmap("wxART_CROSS_MARK", [{size, {16,16}}])),
+ wxListCtrl:assignImageList(LC, IL, ?wxIMAGE_LIST_SMALL),
+
+ wxListCtrl:insertColumn(LC, 0, "Column 1"),
+ wxListCtrl:insertColumn(LC, 1, "Column 2"),
+ wxListCtrl:setColumnWidth(LC, 0, 200),
+ wxListCtrl:setColumnWidth(LC, 1, 200),
+ wxListCtrl:setItemCount(LC, 1000000),
+
+ wxWindow:show(Frame),
+ wx_test_lib:wx_destroy(Frame,Config).
+
radioBox(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo);
radioBox(Config) ->
@@ -382,7 +424,7 @@ radioBox(Config) ->
TrSortRadioBox = wxRadioBox:new(Frame, ?wxID_ANY, "Sort by:",
{100, 100},{100, 100}, ["Timestamp"]),
-
+
io:format("TrSortRadioBox ~p ~n", [TrSortRadioBox]),
%% If I uncomment any of these lines, it will crash
@@ -398,7 +440,7 @@ systemSettings(TestInfo) when is_atom(TestInfo) -> wx_test_lib:tc_info(TestInfo)
systemSettings(Config) ->
Wx = wx:new(),
Frame = wxFrame:new(Wx, ?wxID_ANY, "Frame"),
-
+
?m({_,_,_,_}, wxSystemSettings:getColour(?wxSYS_COLOUR_DESKTOP)),
?mt(wxFont, wxSystemSettings:getFont(?wxSYS_SYSTEM_FONT)),
?m(true, is_integer(wxSystemSettings:getMetric(?wxSYS_MOUSE_BUTTONS))),
diff --git a/lib/wx/test/wxt.erl b/lib/wx/test/wxt.erl
index 1f5b1cc3b1..2f52c58f26 100644
--- a/lib/wx/test/wxt.erl
+++ b/lib/wx/test/wxt.erl
@@ -72,7 +72,7 @@ resolve({Suite0, Case}) when is_atom(Suite0), is_atom(Case) ->
{Suite, Case2} ->
{Suite, Case2}
end;
-resolve(List) when list(List) ->
+resolve(List) when is_list(List) ->
[resolve(Case) || Case <- List].
alias(Suite) when is_atom(Suite) ->
@@ -104,7 +104,7 @@ read_config() ->
end.
%% Write new default config file
-write_config(Config) when list(Config) ->
+write_config(Config) when is_list(Config) ->
Fname = config_fname(),
{ok, Fd} = file:open(Fname, write),
write_list(Fd, Config),
diff --git a/lib/xmerl/include/xmerl_xsd.hrl b/lib/xmerl/include/xmerl_xsd.hrl
index b527accc8c..6dad7d8ff0 100644
--- a/lib/xmerl/include/xmerl_xsd.hrl
+++ b/lib/xmerl/include/xmerl_xsd.hrl
@@ -36,6 +36,7 @@
schema_name,
vsn,
schema_preprocessed=false,
+ external_xsd_base=false,
xsd_base,
xml_options=[],
scope=[],
diff --git a/lib/xmerl/src/xmerl_scan.erl b/lib/xmerl/src/xmerl_scan.erl
index 059c8f21b6..e598c5f56d 100644
--- a/lib/xmerl/src/xmerl_scan.erl
+++ b/lib/xmerl/src/xmerl_scan.erl
@@ -2276,7 +2276,7 @@ scan_att_chars([H|T], S0, H, Acc, TmpAcc,AttType,IsNorm) -> % End quote
true ->
normalize(Acc,S,IsNorm)
end,
- {lists:reverse(Acc2), T, S2,IsNorm2};
+ {lists:flatten(lists:reverse(Acc2)), T, S2,IsNorm2};
scan_att_chars("&" ++ T, S0, Delim, Acc, TmpAcc,AT,IsNorm) -> % Reference
?bump_col(1),
{ExpRef, T1, S1} = scan_reference(T, S),
diff --git a/lib/xmerl/src/xmerl_ucs.erl b/lib/xmerl/src/xmerl_ucs.erl
index 7c45c838ab..feb16070a0 100644
--- a/lib/xmerl/src/xmerl_ucs.erl
+++ b/lib/xmerl/src/xmerl_ucs.erl
@@ -1,19 +1,19 @@
%%
%% %CopyrightBegin%
-%%
+%%
%% Copyright Ericsson AB 2005-2009. All Rights Reserved.
-%%
+%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
%% compliance with the License. You should have received a copy of the
%% Erlang Public License along with this software. If not, it can be
%% retrieved online at http://www.erlang.org/.
-%%
+%%
%% Software distributed under the License is distributed on an "AS IS"
%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
%% the License for the specific language governing rights and limitations
%% under the License.
-%%
+%%
%% %CopyrightEnd%
%%
@@ -43,6 +43,7 @@
-export([to_utf16be/1, from_utf16be/1, from_utf16be/2]).
-export([to_utf16le/1, from_utf16le/1, from_utf16le/2]).
-export([to_utf8/1, from_utf8/1]).
+-export([from_latin9/1]).
%%% NB: Non-canonical UTF-8 encodings and incorrectly used
%%% surrogate-pair codes are disallowed by this code. There are
@@ -177,13 +178,27 @@ to_utf8(List) when is_list(List) -> lists:flatmap(fun to_utf8/1, List);
to_utf8(Ch) -> char_to_utf8(Ch).
from_utf8(Bin) when is_binary(Bin) -> from_utf8(binary_to_list(Bin));
-from_utf8(List) ->
+from_utf8(List) ->
case expand_utf8(List) of
{Result,0} -> Result;
{_Res,_NumBadChar} ->
exit({ucs,{bad_utf8_character_code}})
end.
+%%% Latin9 support
+from_latin9(Bin) when is_binary(Bin) -> from_latin9(binary_to_list(Bin));
+from_latin9(List) ->
+ [ latin9_to_ucs4(Char) || Char <- List].
+
+latin9_to_ucs4(16#A4) -> 16#20AC;
+latin9_to_ucs4(16#A6) -> 16#160;
+latin9_to_ucs4(16#A8) -> 16#161;
+latin9_to_ucs4(16#B4) -> 16#17D;
+latin9_to_ucs4(16#B8) -> 16#17E;
+latin9_to_ucs4(16#BC) -> 16#152;
+latin9_to_ucs4(16#BD) -> 16#153;
+latin9_to_ucs4(16#BE) -> 16#178;
+latin9_to_ucs4(Other) -> Other.
@@ -238,7 +253,7 @@ from_ucs4le(Bin,Acc,Tail) ->
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
%%% UCS-2 support
-%%% FIXME! Don't know how to encode UCS-2!!
+%%% FIXME! Don't know how to encode UCS-2!!
%%% Currently I just encode as UCS-4, but strips the 16 higher bits.
char_to_ucs2be(Ch) ->
true = is_iso10646(Ch),
@@ -259,15 +274,15 @@ from_ucs2be(Bin,Acc,Tail) ->
char_to_ucs2le(Ch) ->
true = is_iso10646(Ch),
- [(Ch bsr 16) band 16#FF,
- (Ch bsr 24)].
+ [Ch band 16#FF,
+ (Ch bsr 8) band 16#FF].
from_ucs2le(<<Ch:16/little-signed-integer, Rest/binary>>,Acc,Tail) ->
if Ch < 0; Ch >= 16#D800, Ch < 16#E000; Ch =:= 16#FFFE; Ch =:= 16#FFFF ->
exit({bad_character_code,Ch});
true ->
- from_ucs4le(Rest,[Ch|Acc],Tail)
+ from_ucs2le(Rest,[Ch|Acc],Tail)
end;
from_ucs2le(<<>>,Acc,Tail) ->
lists:reverse(Acc,Tail);
@@ -476,6 +491,8 @@ to_unicode(Input,Cs) when Cs=='iso_8859-1:1987';Cs=='iso-ir-100';
Cs=='l1';Cs=='ibm819';
Cs=='cp819';Cs=='csisolatin1' ->
Input;
+to_unicode(Input,Cs) when Cs=='iso_8859-15';Cs=='iso-8859-15';Cs=='latin9' ->
+ from_latin9(Input);
% to_unicode(Input,Cs) when Cs=='mnemonic';Cs=='"mnemonic+ascii+38';
% Cs=='mnem';Cs=='"mnemonic+ascii+8200' ->
% from_mnemonic(Input);
diff --git a/lib/xmerl/src/xmerl_xsd.erl b/lib/xmerl/src/xmerl_xsd.erl
index e56f1470c0..50c0a79016 100644
--- a/lib/xmerl/src/xmerl_xsd.erl
+++ b/lib/xmerl/src/xmerl_xsd.erl
@@ -287,10 +287,19 @@ process_schema(Schema) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schema(Schema,Options) when is_list(Options) ->
- S = initiate_state(Options,Schema),
- process_schema2(xmerl_scan:file(filename:join(S#xsd_state.xsd_base, Schema)),S,Schema);
-process_schema(Schema,State) when is_record(State,xsd_state) ->
- process_schema2(xmerl_scan:file(filename:join(State#xsd_state.xsd_base, Schema)),State,Schema).
+ State = initiate_state(Options,Schema),
+ process_schema(Schema, State);
+process_schema(Schema, State=#xsd_state{fetch_fun=Fetch})->
+ case Fetch(Schema, State) of
+ {ok,{file,File},_} ->
+ process_schema2(xmerl_scan:file(File), State, Schema);
+ {ok,{string,Str},_} ->
+ process_schema2(xmerl_scan:string(Str), State, Schema);
+ {ok,[],_} ->
+ {error,enoent};
+ Err ->
+ Err
+ end.
process_schema2(Err={error,_},_,_) ->
Err;
@@ -319,12 +328,9 @@ process_schemas(Schemas) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schemas(Schemas=[{_,Schema}|_],Options) when is_list(Options) ->
- process_schemas(Schemas,initiate_state(Options,Schema));
+ State = initiate_state(Options,Schema),
+ process_schemas(Schemas, State);
process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
-%% case process_external_schema_once(Schema,if_list_to_atom(NS),State) of
-%% S when is_record(S,xsd_state) ->
-%% case process_schema(filename:join([State#xsd_state.xsd_base,Schema]),State) of
-%% {ok,S} ->
Res=
case Fetch(Schema,State) of
{ok,{file,File},_} ->
@@ -345,20 +351,20 @@ process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
process_schemas([],S) when is_record(S,xsd_state) ->
{ok,S}.
-
initiate_state(Opts,Schema) ->
XSDBase = filename:dirname(Schema),
{{state,S},RestOpts}=new_state(Opts),
S2 = create_tables(S),
- initiate_state2(S2#xsd_state{schema_name = Schema,
- xsd_base = XSDBase,
- fetch_fun = fun fetch/2},RestOpts).
+ S3 = initiate_state2(S2#xsd_state{schema_name = Schema, xsd_base=XSDBase,
+ fetch_fun = fun fetch/2},
+ RestOpts).
+
initiate_state2(S,[]) ->
S;
initiate_state2(S,[{tab2file,Bool}|T]) ->
initiate_state2(S#xsd_state{tab2file=Bool},T);
-initiate_state2(S,[{xsdbase,XSDBase}|T]) ->
- initiate_state2(S#xsd_state{xsd_base=XSDBase},T);
+initiate_state2(S,[{xsdbase, XSDBase}|T]) ->
+ initiate_state2(S#xsd_state{xsd_base=XSDBase, external_xsd_base=true},T);
initiate_state2(S,[{fetch_fun,FetchFun}|T]) ->
initiate_state2(S#xsd_state{fetch_fun=FetchFun},T);
initiate_state2(S,[{fetch_path,FetchPath}|T]) ->
@@ -736,7 +742,7 @@ element_content({IDC,S},El,Env)
{{IDC,IDConstr},S3};
Err ->
S3 = acc_errs(S2,{error_path(El,El#xmlElement.name),?MODULE,
- {erronous_content_in_identity_constraint,IDC,Err}}),
+ {erroneous_content_in_identity_constraint,IDC,Err}}),
{{IDC,[]},S3}
end;
element_content({selector,S},Sel,_Env) ->
@@ -5232,7 +5238,12 @@ fetch(URI,S) ->
[] -> %% empty systemliteral
[];
_ ->
- filename:join(S#xsd_state.xsd_base, URI)
+ case S#xsd_state.external_xsd_base of
+ true ->
+ filename:join(S#xsd_state.xsd_base, URI);
+ false ->
+ filename:join(S#xsd_state.xsd_base, filename:basename(URI))
+ end
end,
Path = path_locate(S#xsd_state.fetch_path, Filename, Fullname),
?dbg("fetch(~p) -> {file, ~p}.~n", [URI, Path]),
@@ -5560,7 +5571,7 @@ format_error({incomplete_file,_FileName,_Other}) ->
"Schema: The file containing a schema state must be produced by xmerl_xsd:state2file/[1,2].";
format_error({unexpected_content_in_any,A}) ->
io_lib:format("Schema: The any type is considered to have no content besides annotation. ~p was found.",[A]);
-format_error({erronous_content_in_identity_constraint,IDC,Err}) ->
+format_error({erroneous_content_in_identity_constraint,IDC,Err}) ->
io_lib:format("Schema: An ~p identity constraint must have one selector and one or more field in content. This case ~p",[IDC,Err]);
format_error({missing_xpath_attribute,IDCContent}) ->
io_lib:format("Schema: A ~p in a identity constraint must have a xpath attribute.",[IDCContent]);
diff --git a/lib/xmerl/test/Makefile b/lib/xmerl/test/Makefile
index 9715aa054a..5a2a585841 100644
--- a/lib/xmerl/test/Makefile
+++ b/lib/xmerl/test/Makefile
@@ -124,4 +124,4 @@ release_tests_spec: opt
@tar cfh - xmerl_xsd_MS2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_NIST2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_Sun2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/xmerl/test/xmerl_SUITE.erl b/lib/xmerl/test/xmerl_SUITE.erl
index 392b2522e8..0c809dbcb6 100644
--- a/lib/xmerl/test/xmerl_SUITE.erl
+++ b/lib/xmerl/test/xmerl_SUITE.erl
@@ -57,7 +57,8 @@ groups() ->
{eventp_tests, [], [sax_parse_and_export]},
{ticket_tests, [],
[ticket_5998, ticket_7211, ticket_7214, ticket_7430,
- ticket_6873, ticket_7496, ticket_8156, ticket_8697]},
+ ticket_6873, ticket_7496, ticket_8156, ticket_8697,
+ ticket_9411]},
{app_test, [], [{xmerl_app_test, all}]},
{appup_test, [], [{xmerl_appup_test, all}]}].
@@ -575,7 +576,17 @@ ticket_8697(Config) ->
?line [16#545C] = HexEntityText,
ok.
+ticket_9411(suite) -> [];
+ticket_9411(doc) ->
+ ["Test that xmerl_scan handles attribute that contains for example &quot"];
+ticket_9411(Config) ->
+ DataDir = ?config(data_dir,Config),
+ ?line {ok, Schema} = xmerl_xsd:process_schema(filename:join([DataDir,"misc/ticket_9411.xsd"])),
+ ?line {ok, Bin} = file:read_file(filename:join([DataDir,"misc/ticket_9411.xml"])),
+ ?line Xml = erlang:binary_to_list(Bin),
+ ?line {E, _} = xmerl_scan:string(Xml),
+ ?line {E, _} = xmerl_xsd:validate(E, Schema).
diff --git a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
index c48a6f897b..fef7431845 100644
--- a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
+++ b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
Binary files differ
diff --git a/lib/xmerl/test/xmerl_xsd_SUITE.erl b/lib/xmerl/test/xmerl_xsd_SUITE.erl
index a0d3b1e667..421fa48054 100644
--- a/lib/xmerl/test/xmerl_xsd_SUITE.erl
+++ b/lib/xmerl/test/xmerl_xsd_SUITE.erl
@@ -62,7 +62,7 @@ groups() ->
sis2, state2file_file2state, union]},
{ticket_tests, [],
[ticket_6910, ticket_7165, ticket_7190, ticket_7288,
- ticket_7736, ticket_8599]},
+ ticket_7736, ticket_8599, ticket_9410]},
{facets, [],
[length, minLength, maxLength, pattern, enumeration,
whiteSpace, maxInclusive, maxExclusive, minExclusive,
@@ -1146,3 +1146,8 @@ ticket_8599(Config) ->
?line {{xmlElement,persons,persons,_,_,_,_,_,_,_,_,_},_GlobalState} = xmerl_xsd:validate(E, S).
+
+ticket_9410(suite) -> [];
+ticket_9410(Config) ->
+ file:set_cwd(filename:join([?config(data_dir,Config),".."])),
+ ?line {ok, _S} = xmerl_xsd:process_schema("xmerl_xsd_SUITE_data/small.xsd").