aboutsummaryrefslogtreecommitdiffstats
path: root/lib
diff options
context:
space:
mode:
Diffstat (limited to 'lib')
-rw-r--r--lib/Makefile25
-rw-r--r--lib/asn1/c_src/Makefile12
-rw-r--r--lib/asn1/src/asn1ct_gen.erl5
-rw-r--r--lib/asn1/src/asn1rt.erl2
-rw-r--r--lib/asn1/src/asn1rt_ber_bin_v2.erl6
-rw-r--r--lib/asn1/src/asn1rt_check.erl2
-rw-r--r--lib/common_test/include/ct.hrl3
-rw-r--r--lib/common_test/src/Makefile4
-rw-r--r--lib/common_test/src/common_test.app.src1
-rw-r--r--lib/common_test/src/ct_hooks.erl8
-rw-r--r--lib/common_test/src/ct_line.erl266
-rw-r--r--lib/common_test/test/ct_error_SUITE.erl79
-rw-r--r--lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl7
-rw-r--r--lib/common_test/test/ct_repeat_1_SUITE.erl7
-rw-r--r--lib/common_test/test/ct_skip_SUITE.erl9
-rw-r--r--lib/compiler/doc/src/compile.xml8
-rw-r--r--lib/compiler/src/beam_asm.erl61
-rw-r--r--lib/compiler/src/beam_block.erl35
-rw-r--r--lib/compiler/src/beam_bsm.erl9
-rw-r--r--lib/compiler/src/beam_clean.erl26
-rw-r--r--lib/compiler/src/beam_dead.erl10
-rw-r--r--lib/compiler/src/beam_dict.erl53
-rw-r--r--lib/compiler/src/beam_disasm.erl31
-rw-r--r--lib/compiler/src/beam_jump.erl49
-rw-r--r--lib/compiler/src/beam_listing.erl2
-rw-r--r--lib/compiler/src/beam_receive.erl2
-rw-r--r--lib/compiler/src/beam_trim.erl13
-rw-r--r--lib/compiler/src/beam_type.erl1
-rw-r--r--lib/compiler/src/beam_utils.erl16
-rw-r--r--lib/compiler/src/beam_validator.erl15
-rw-r--r--lib/compiler/src/compile.erl6
-rw-r--r--lib/compiler/src/genop.tab4
-rw-r--r--lib/compiler/src/v3_codegen.erl108
-rw-r--r--lib/compiler/src/v3_core.erl38
-rw-r--r--lib/compiler/src/v3_kernel.erl13
-rw-r--r--lib/compiler/src/v3_life.erl4
-rw-r--r--lib/compiler/test/bs_match_SUITE.erl4
-rw-r--r--lib/compiler/test/compile_SUITE.erl1
-rw-r--r--lib/compiler/test/guard_SUITE.erl29
-rw-r--r--lib/compiler/test/inline_SUITE.erl3
-rw-r--r--lib/compiler/test/lc_SUITE.erl4
-rw-r--r--lib/compiler/test/misc_SUITE.erl4
-rw-r--r--lib/compiler/test/trycatch_SUITE.erl16
-rw-r--r--lib/cosEvent/src/Makefile12
-rw-r--r--lib/cosEvent/test/Makefile14
-rw-r--r--lib/cosEventDomain/src/Makefile7
-rw-r--r--lib/cosFileTransfer/src/Makefile7
-rw-r--r--lib/cosNotification/src/Makefile29
-rw-r--r--lib/cosNotification/test/Makefile11
-rw-r--r--lib/cosProperty/src/Makefile6
-rw-r--r--lib/cosTime/src/Makefile11
-rw-r--r--lib/cosTransactions/src/Makefile7
-rw-r--r--lib/cosTransactions/test/Makefile11
-rw-r--r--lib/crypto/c_src/Makefile.in8
-rw-r--r--lib/debugger/doc/src/debugger_chapter.xml42
-rw-r--r--lib/debugger/doc/src/int.xml4
-rw-r--r--lib/debugger/src/Makefile1
-rw-r--r--lib/debugger/src/dbg_debugged.erl15
-rw-r--r--lib/debugger/src/dbg_icmd.erl16
-rw-r--r--lib/debugger/src/dbg_ieval.erl555
-rw-r--r--lib/debugger/src/dbg_ieval.hrl8
-rw-r--r--lib/debugger/src/dbg_iload.erl347
-rw-r--r--lib/debugger/src/dbg_iserver.erl5
-rw-r--r--lib/debugger/src/dbg_istk.erl245
-rw-r--r--lib/debugger/src/debugger.app.src1
-rw-r--r--lib/debugger/test/Makefile1
-rw-r--r--lib/debugger/test/bs_construct_SUITE.erl395
-rw-r--r--lib/debugger/test/bs_match_bin_SUITE.erl141
-rw-r--r--lib/debugger/test/bs_match_int_SUITE.erl206
-rw-r--r--lib/debugger/test/bs_match_misc_SUITE.erl453
-rw-r--r--lib/debugger/test/bs_match_tail_SUITE.erl12
-rw-r--r--lib/debugger/test/bug_SUITE.erl4
-rw-r--r--lib/debugger/test/exception_SUITE.erl264
-rw-r--r--lib/debugger/test/guard_SUITE.erl217
-rw-r--r--lib/debugger/test/int_eval_SUITE.erl47
-rw-r--r--lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl4
-rw-r--r--lib/debugger/test/int_eval_SUITE_data/stacktrace.erl130
-rw-r--r--lib/debugger/test/lc_SUITE.erl119
-rw-r--r--lib/debugger/test/line_number_SUITE.erl220
-rw-r--r--lib/debugger/test/test_lib.erl2
-rw-r--r--lib/debugger/test/trycatch_SUITE.erl17
-rw-r--r--lib/dialyzer/src/dialyzer_dataflow.erl13
-rw-r--r--lib/dialyzer/src/dialyzer_typesig.erl9
-rw-r--r--lib/dialyzer/test/Makefile2
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/asn12
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/inets23
-rw-r--r--lib/dialyzer/test/r9c_SUITE_data/results/mnesia5
-rw-r--r--lib/dialyzer/test/race_SUITE_data/results/extract_translations4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/results/flatten2
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl8
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/codec_can.erl35
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl4
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl21
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl42
-rw-r--r--lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl7
-rw-r--r--lib/diameter/doc/src/diameter_dict.xml9
-rw-r--r--lib/diameter/src/app/Makefile11
-rw-r--r--lib/diameter/src/compiler/diameter_codegen.erl78
-rw-r--r--lib/diameter/src/compiler/diameter_spec_util.erl50
-rw-r--r--lib/diameter/test/Makefile2
-rw-r--r--lib/docbuilder/src/docb_main.erl12
-rw-r--r--lib/edoc/Makefile2
-rw-r--r--lib/edoc/doc/Makefile2
-rw-r--r--lib/edoc/doc/overview.edoc7
-rw-r--r--lib/edoc/doc/src/Makefile2
-rw-r--r--lib/edoc/include/Makefile2
-rw-r--r--lib/edoc/priv/edoc_generate.src3
-rw-r--r--lib/edoc/src/Makefile2
-rw-r--r--lib/edoc/src/edoc.erl19
-rw-r--r--lib/edoc/src/edoc_data.erl2
-rw-r--r--lib/edoc/src/edoc_doclet.erl4
-rw-r--r--lib/edoc/src/edoc_extract.erl10
-rw-r--r--lib/edoc/src/edoc_layout.erl20
-rw-r--r--lib/edoc/src/edoc_lib.erl6
-rw-r--r--lib/edoc/src/edoc_parser.yrl7
-rw-r--r--lib/edoc/src/edoc_report.erl2
-rw-r--r--lib/edoc/src/edoc_run.erl2
-rw-r--r--lib/edoc/src/edoc_scanner.erl2
-rw-r--r--lib/edoc/src/edoc_specs.erl8
-rw-r--r--lib/edoc/src/edoc_tags.erl2
-rw-r--r--lib/edoc/src/edoc_types.erl6
-rw-r--r--lib/edoc/src/edoc_wiki.erl8
-rw-r--r--lib/edoc/src/otpsgml_layout.erl4
-rw-r--r--lib/edoc/test/edoc_SUITE.erl2
-rw-r--r--lib/erl_interface/src/Makefile.in34
-rw-r--r--lib/et/src/et_wx_viewer.erl4
-rw-r--r--lib/eunit/doc/overview.edoc2
-rw-r--r--lib/eunit/include/eunit.hrl102
-rw-r--r--lib/eunit/src/Makefile13
-rw-r--r--lib/eunit/src/eunit.app.src16
-rw-r--r--lib/eunit/src/eunit.erl2
-rw-r--r--lib/eunit/src/eunit_data.erl70
-rw-r--r--lib/eunit/src/eunit_server.erl7
-rw-r--r--lib/eunit/src/eunit_surefire.erl58
-rw-r--r--lib/eunit/src/eunit_test.erl72
-rw-r--r--lib/eunit/src/eunit_tests.erl26
-rw-r--r--lib/eunit/vsn.mk2
-rw-r--r--lib/gs/src/Makefile4
-rw-r--r--lib/hipe/cerl/erl_bif_types.erl13
-rw-r--r--lib/hipe/icode/hipe_beam_to_icode.erl11
-rw-r--r--lib/ic/c_src/Makefile.in8
-rw-r--r--lib/ic/doc/src/notes.xml18
-rw-r--r--lib/ic/examples/pre_post_condition/Makefile7
-rw-r--r--lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf1
-rw-r--r--lib/ic/src/ic_pp.erl472
-rw-r--r--lib/ic/src/ic_pragma.erl19
-rw-r--r--lib/ic/vsn.mk2
-rw-r--r--lib/jinterface/java_src/Makefile16
-rw-r--r--lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile (renamed from lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile.otp)2
-rw-r--r--lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf1
-rw-r--r--lib/kernel/doc/src/gen_sctp.xml144
-rw-r--r--lib/kernel/doc/src/gen_tcp.xml25
-rw-r--r--lib/kernel/doc/src/gen_udp.xml21
-rw-r--r--lib/kernel/doc/src/inet.xml58
-rw-r--r--lib/kernel/src/code_server.erl17
-rw-r--r--lib/kernel/src/error_handler.erl9
-rw-r--r--lib/kernel/src/file.erl7
-rw-r--r--lib/kernel/src/gen_sctp.erl172
-rw-r--r--lib/kernel/src/gen_tcp.erl118
-rw-r--r--lib/kernel/src/gen_udp.erl85
-rw-r--r--lib/kernel/src/inet.erl147
-rw-r--r--lib/kernel/src/inet_res.erl4
-rw-r--r--lib/kernel/test/code_SUITE.erl16
-rw-r--r--lib/kernel/test/gen_udp_SUITE.erl1
-rw-r--r--lib/kernel/test/zlib_SUITE.erl4
-rw-r--r--lib/megaco/src/binary/depend.mk180
-rw-r--r--lib/megaco/src/flex/Makefile.in11
-rw-r--r--lib/mnesia/src/mnesia_lib.erl2
-rw-r--r--lib/mnesia/src/mnesia_loader.erl2
-rw-r--r--lib/odbc/test/mysql.erl17
-rw-r--r--lib/odbc/test/odbc_connect_SUITE.erl34
-rw-r--r--lib/odbc/test/odbc_data_type_SUITE.erl24
-rw-r--r--lib/odbc/test/odbc_query_SUITE.erl16
-rw-r--r--lib/odbc/test/odbc_start_SUITE.erl17
-rw-r--r--lib/odbc/test/odbc_test.hrl6
-rw-r--r--lib/odbc/test/odbc_test_lib.erl33
-rw-r--r--lib/odbc/test/postgres.erl9
-rw-r--r--lib/orber/COSS/CosNaming/Makefile6
-rw-r--r--lib/orber/doc/src/Orber/ignore_config_record.inf1
-rw-r--r--lib/orber/examples/Stack/Makefile10
-rw-r--r--lib/orber/src/Makefile11
-rw-r--r--lib/orber/src/corba.erl4
-rw-r--r--lib/orber/src/orber_diagnostics.erl4
-rw-r--r--lib/orber/src/orber_ifr.erl2
-rw-r--r--lib/orber/test/Makefile26
-rw-r--r--lib/os_mon/c_src/Makefile.in8
-rw-r--r--lib/os_mon/mibs/Makefile3
-rw-r--r--lib/parsetools/doc/src/yecc.xml8
-rw-r--r--lib/parsetools/include/yeccpre.hrl4
-rw-r--r--lib/parsetools/src/yeccparser.erl4
-rw-r--r--lib/percept/src/percept_db.erl11
-rw-r--r--lib/public_key/asn1/Makefile2
-rw-r--r--lib/public_key/asn1/README2
-rw-r--r--lib/public_key/doc/src/public_key.xml16
-rw-r--r--lib/public_key/src/public_key.erl7
-rw-r--r--lib/runtime_tools/c_src/Makefile.in15
-rw-r--r--lib/sasl/examples/src/Makefile2
-rw-r--r--lib/sasl/test/Makefile2
-rw-r--r--lib/snmp/mibs/Makefile.in34
-rw-r--r--lib/snmp/src/agent/snmpa_set_lib.erl8
-rw-r--r--lib/snmp/test/Makefile4
-rw-r--r--lib/snmp/test/test_config/Makefile18
-rw-r--r--lib/ssh/doc/src/notes.xml14
-rw-r--r--lib/ssh/src/Makefile9
-rw-r--r--lib/ssh/src/ssh.appup.src10
-rwxr-xr-xlib/ssh/src/ssh_sftp.erl12
-rw-r--r--lib/ssh/test/Makefile2
-rw-r--r--lib/ssh/vsn.mk2
-rw-r--r--lib/ssl/c_src/Makefile.in8
-rw-r--r--lib/ssl/c_src/esock_openssl.c2
-rw-r--r--lib/ssl/doc/src/notes.xml6
-rw-r--r--lib/ssl/doc/src/ssl.xml31
-rw-r--r--lib/ssl/doc/src/ssl_protocol.xml4
-rw-r--r--lib/ssl/doc/src/using_ssl.xml8
-rw-r--r--lib/ssl/src/ssl.erl10
-rw-r--r--lib/ssl/src/ssl_connection.erl6
-rw-r--r--lib/ssl/src/ssl_handshake.erl10
-rw-r--r--lib/ssl/src/ssl_record.erl2
-rw-r--r--lib/ssl/src/ssl_ssl2.erl2
-rw-r--r--lib/stdlib/doc/src/gen_fsm.xml8
-rw-r--r--lib/stdlib/doc/src/supervisor.xml9
-rw-r--r--lib/stdlib/doc/src/unicode_usage.xml2
-rw-r--r--lib/stdlib/src/beam_lib.erl19
-rw-r--r--lib/stdlib/src/c.erl2
-rw-r--r--lib/stdlib/src/epp.erl9
-rw-r--r--lib/stdlib/src/erl_eval.erl10
-rw-r--r--lib/stdlib/src/escript.erl2
-rw-r--r--lib/stdlib/src/eval_bits.erl47
-rw-r--r--lib/stdlib/src/gen_event.erl8
-rw-r--r--lib/stdlib/src/gen_fsm.erl6
-rw-r--r--lib/stdlib/src/gen_server.erl6
-rw-r--r--lib/stdlib/src/lib.erl46
-rw-r--r--lib/stdlib/src/proplists.erl3
-rw-r--r--lib/stdlib/src/qlc.erl7
-rw-r--r--lib/stdlib/src/re.erl16
-rw-r--r--lib/stdlib/src/shell.erl2
-rw-r--r--lib/stdlib/src/supervisor.erl7
-rw-r--r--lib/stdlib/src/timer.erl2
-rw-r--r--lib/stdlib/src/unicode.erl12
-rw-r--r--lib/stdlib/src/zip.erl10
-rw-r--r--lib/stdlib/test/beam_lib_SUITE.erl21
-rw-r--r--lib/stdlib/test/dets_SUITE.erl95
-rw-r--r--lib/stdlib/test/ets_SUITE.erl10
-rw-r--r--lib/stdlib/test/filelib_SUITE.erl7
-rw-r--r--lib/stdlib/test/proc_lib_SUITE.erl2
-rw-r--r--lib/stdlib/test/re_SUITE.erl92
-rw-r--r--lib/stdlib/test/shell_SUITE.erl6
-rw-r--r--lib/stdlib/test/sofs_SUITE.erl6
-rw-r--r--lib/stdlib/test/supervisor_SUITE.erl35
-rw-r--r--lib/stdlib/test/zip_SUITE.erl3
-rw-r--r--lib/test_server/include/test_server.hrl5
-rw-r--r--lib/test_server/include/test_server_line.hrl3
-rw-r--r--lib/test_server/src/Makefile1
-rw-r--r--lib/test_server/src/test_server.app.src1
-rw-r--r--lib/test_server/src/test_server.erl209
-rw-r--r--lib/test_server/src/test_server_line.erl387
-rw-r--r--lib/test_server/src/test_server_sup.erl11
-rw-r--r--lib/test_server/src/ts_install_cth.erl5
-rw-r--r--lib/tools/emacs/erlang.el84
-rw-r--r--lib/tv/src/tv_main.erl2
-rw-r--r--lib/tv/src/tv_mnesia_rpc.erl2
-rw-r--r--lib/wx/src/wx_object.erl6
-rw-r--r--lib/xmerl/include/xmerl_xsd.hrl1
-rw-r--r--lib/xmerl/src/xmerl.erl2
-rw-r--r--lib/xmerl/src/xmerl_scan.erl2
-rw-r--r--lib/xmerl/src/xmerl_xsd.erl43
-rw-r--r--lib/xmerl/test/Makefile2
-rw-r--r--lib/xmerl/test/xmerl_SUITE.erl13
-rw-r--r--lib/xmerl/test/xmerl_SUITE_data/misc.tar.gzbin47121 -> 47340 bytes
-rw-r--r--lib/xmerl/test/xmerl_xsd_SUITE.erl7
270 files changed, 5532 insertions, 3333 deletions
diff --git a/lib/Makefile b/lib/Makefile
index 7f4c309da9..c443425f8b 100644
--- a/lib/Makefile
+++ b/lib/Makefile
@@ -33,20 +33,6 @@ ifeq ($(findstring vxworks,$(TARGET)),vxworks)
cosFileTransfer cosEventDomain
endif
else
- ifeq ($(findstring ose,$(TARGET)),ose)
- ERTS_SUB_DIRECTORIES = stdlib sasl kernel compiler erl_interface
- OTHER_SUB_DIRECTORIES = \
- snmp otp_mibs appmon tools
-# OTHER_SUB_DIRECTORIES = \
-# appmon os_mon tools runtime_tools
- ifdef BUILD_ALL
- OTHER_SUB_DIRECTORIES += mnesia \
- inets pman tv observer
-# OTHER_SUB_DIRECTORIES += mnesia ic asn1 debugger \
-# inets orber pman tv observer cosTransactions cosEvent \
-# cosTime cosNotification cosProperty cosFileTransfer cosEventDomain
- endif
- else
#
# unix and win32
# --------------
@@ -59,10 +45,11 @@ else
snmp otp_mibs appmon erl_interface asn1 jinterface gs wx inets ic \
mnesia crypto orber os_mon parsetools syntax_tools pman \
public_key ssl toolbar tv observer debugger reltool odbc \
- runtime_tools diameter \
+ diameter \
cosTransactions cosEvent cosTime cosNotification cosProperty \
cosFileTransfer cosEventDomain et megaco webtool \
- xmerl edoc eunit ssh inviso typer docbuilder erl_docgen common_test percept
+ xmerl edoc eunit ssh inviso typer docbuilder erl_docgen \
+ common_test percept dialyzer
# dialyzer
OTHER_SUB_DIRECTORIES += hipe
else # BUILD_ALL on unix
@@ -70,15 +57,15 @@ else
snmp otp_mibs appmon erl_interface asn1 jinterface wx debugger reltool gs inets \
ic mnesia crypto orber os_mon parsetools syntax_tools \
pman public_key ssl toolbar tv observer odbc \
- runtime_tools diameter \
+ diameter \
cosTransactions cosEvent cosTime cosNotification \
cosProperty cosFileTransfer cosEventDomain et megaco webtool \
- xmerl edoc eunit ssh inviso typer docbuilder erl_docgen common_test percept
+ xmerl edoc eunit ssh inviso typer docbuilder erl_docgen \
+ common_test percept dialyzer
# dialyzer
OTHER_SUB_DIRECTORIES += hipe $(TSP_APP)
endif
endif
- endif
endif
ifdef BOOTSTRAP
diff --git a/lib/asn1/c_src/Makefile b/lib/asn1/c_src/Makefile
index 60543df355..f7213b9651 100644
--- a/lib/asn1/c_src/Makefile
+++ b/lib/asn1/c_src/Makefile
@@ -80,7 +80,9 @@ endif
# Targets
# ----------------------------------------------------
-opt: $(OBJDIR) $(LIBDIR) $(NIF_SHARED_OBJ_FILE)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
+
+opt: $(NIF_SHARED_OBJ_FILE)
debug: opt
@@ -102,14 +104,6 @@ $(OBJDIR)/%.o: %.c
$(NIF_SHARED_OBJ_FILE): $(NIF_OBJ_FILES)
$(LD) $(LDFLAGS) -o $(NIF_SHARED_OBJ_FILE) $(NIF_OBJ_FILES) $(CLIB_FLAGS) $(LIBS)
-$(LIBDIR):
- -mkdir -p $(LIBDIR)
-
-$(OBJDIR):
- -mkdir -p $(OBJDIR)
-
-
-
# ----------------------------------------------------
# Release Target
# ----------------------------------------------------
diff --git a/lib/asn1/src/asn1ct_gen.erl b/lib/asn1/src/asn1ct_gen.erl
index e18bc37058..0f8833f716 100644
--- a/lib/asn1/src/asn1ct_gen.erl
+++ b/lib/asn1/src/asn1ct_gen.erl
@@ -1521,8 +1521,9 @@ gen_head(Erules,Mod,Hrl) ->
emit({"-module('",Mod,"').",nl}),
put(currmod,Mod),
%emit({"-compile(export_all).",nl}),
- case Hrl of
- 0 -> true;
+ case {Hrl,lists:member(inline,get(encoding_options))} of
+ {0,_} -> true;
+ {_,true} -> true;
_ ->
emit({"-include(\"",Mod,".hrl\").",nl})
end,
diff --git a/lib/asn1/src/asn1rt.erl b/lib/asn1/src/asn1rt.erl
index e9d3ea9a72..d18f81346a 100644
--- a/lib/asn1/src/asn1rt.erl
+++ b/lib/asn1/src/asn1rt.erl
@@ -21,8 +21,6 @@
%% Runtime functions for ASN.1 (i.e encode, decode)
--include("asn1_records.hrl").
-
-export([encode/2,encode/3,decode/3,load_driver/0,unload_driver/0,info/1]).
-export([utf8_binary_to_list/1,utf8_list_to_binary/1]).
diff --git a/lib/asn1/src/asn1rt_ber_bin_v2.erl b/lib/asn1/src/asn1rt_ber_bin_v2.erl
index bef2216091..17e66f77c9 100644
--- a/lib/asn1/src/asn1rt_ber_bin_v2.erl
+++ b/lib/asn1/src/asn1rt_ber_bin_v2.erl
@@ -56,8 +56,6 @@
-export([decode_primitive_incomplete/2,decode_selective/2]).
-export([is_nif_loadable/0]).
-
--include("asn1_records.hrl").
% the encoding of class of tag bits 8 and 7
-define(UNIVERSAL, 0).
@@ -1058,7 +1056,7 @@ encode_real(C,Val, TagIn) when is_tuple(Val); is_list(Val) ->
encode_real(C,Val) ->
- ?RT_COMMON:encode_real(C,Val).
+ asn1rt_ber_bin:encode_real(C,Val).
%%============================================================================
@@ -1083,7 +1081,7 @@ decode_real_notag(Buffer) ->
{_T,_V} ->
exit({error,{asn1,{real_not_in_primitive_form,Buffer}}})
end,
- {Val,_Rest,Len} = ?RT_COMMON:decode_real(Buffer,Len),
+ {Val,_Rest,Len} = asn1rt_ber_bin:decode_real(Buffer,Len),
Val.
%% exit({error,{asn1, {unimplemented,real}}}).
%% decode_real2(Buffer, Form, size(Buffer)).
diff --git a/lib/asn1/src/asn1rt_check.erl b/lib/asn1/src/asn1rt_check.erl
index 24a2a3802d..d9856901b8 100644
--- a/lib/asn1/src/asn1rt_check.erl
+++ b/lib/asn1/src/asn1rt_check.erl
@@ -19,8 +19,6 @@
%%
-module(asn1rt_check).
--include("asn1_records.hrl").
-
-export([check_bool/2,
check_int/3,
check_bitstring/3,
diff --git a/lib/common_test/include/ct.hrl b/lib/common_test/include/ct.hrl
index aa1cc832cf..5a77108e1a 100644
--- a/lib/common_test/include/ct.hrl
+++ b/lib/common_test/include/ct.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2003-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2003-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -18,5 +18,4 @@
%%
-include_lib("test_server/include/test_server.hrl").
--compile({parse_transform,ct_line}).
diff --git a/lib/common_test/src/Makefile b/lib/common_test/src/Makefile
index 84b122b5e4..5b23558a96 100644
--- a/lib/common_test/src/Makefile
+++ b/lib/common_test/src/Makefile
@@ -40,7 +40,6 @@ RELSYSDIR = $(RELEASE_PATH)/lib/common_test-$(VSN)
# ----------------------------------------------------
MODULES= \
- ct_line \
ct \
ct_logs \
ct_framework \
@@ -72,6 +71,7 @@ MODULES= \
ct_hooks_lock
TARGET_MODULES= $(MODULES:%=$(EBIN)/%)
+BEAM_FILES= $(MODULES:%=$(EBIN)/%.$(EMULATOR))
ERL_FILES= $(MODULES:=.erl)
HRL_FILES = \
@@ -97,7 +97,7 @@ ERL_COMPILE_FLAGS += -pa ../ebin -I../include -I $(ERL_TOP)/lib/snmp/include/ \
# ----------------------------------------------------
TARGET_FILES = \
$(GEN_ERL_FILES:%.erl=$(EBIN)/%.$(EMULATOR)) \
- $(MODULES:%=$(EBIN)/%.$(EMULATOR)) \
+ $(BEAM_FILES) \
$(APP_TARGET) $(APPUP_TARGET)
APP_FILE= common_test.app
diff --git a/lib/common_test/src/common_test.app.src b/lib/common_test/src/common_test.app.src
index b42173f412..57606c01db 100644
--- a/lib/common_test/src/common_test.app.src
+++ b/lib/common_test/src/common_test.app.src
@@ -25,7 +25,6 @@
ct_framework,
ct_ftp,
ct_gen_conn,
- ct_line,
ct_logs,
ct_make,
ct_master,
diff --git a/lib/common_test/src/ct_hooks.erl b/lib/common_test/src/ct_hooks.erl
index 984e04b90f..ebe2d5787d 100644
--- a/lib/common_test/src/ct_hooks.erl
+++ b/lib/common_test/src/ct_hooks.erl
@@ -31,8 +31,6 @@
-export([on_tc_skip/2]).
-export([on_tc_fail/2]).
--type proplist() :: [{atom(),term()}].
-
%% If you change this, remember to update ct_util:look -> stop clause as well.
-define(config_name, ct_hooks).
@@ -59,7 +57,7 @@ terminate(Hooks) ->
%% @doc Called as each test case is started. This includes all configuration
%% tests.
-spec init_tc(Mod :: atom(), Func :: atom(), Args :: list()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()}.
@@ -92,7 +90,7 @@ init_tc(_Mod, TC, Config) ->
Args :: list(),
Result :: term(),
Resturn :: term()) ->
- NewConfig :: proplist() |
+ NewConfig :: proplists:proplist() |
{skip, Reason :: term()} |
{auto_skip, Reason :: term()} |
{fail, Reason :: term()} |
@@ -272,7 +270,7 @@ catch_apply(M,F,A, Default) ->
catch error:Reason ->
case erlang:get_stacktrace() of
%% Return the default if it was the CTH module which did not have the function.
- [{M,F,A}|_] when Reason == undef ->
+ [{M,F,A,_}|_] when Reason == undef ->
Default;
Trace ->
ct_logs:log("Suite Hook","Call to CTH failed: ~p:~p",
diff --git a/lib/common_test/src/ct_line.erl b/lib/common_test/src/ct_line.erl
deleted file mode 100644
index 4af9da5463..0000000000
--- a/lib/common_test/src/ct_line.erl
+++ /dev/null
@@ -1,266 +0,0 @@
-%%
-%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2003-2009. All Rights Reserved.
-%%
-%% The contents of this file are subject to the Erlang Public License,
-%% Version 1.1, (the "License"); you may not use this file except in
-%% compliance with the License. You should have received a copy of the
-%% Erlang Public License along with this software. If not, it can be
-%% retrieved online at http://www.erlang.org/.
-%%
-%% Software distributed under the License is distributed on an "AS IS"
-%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-%% the License for the specific language governing rights and limitations
-%% under the License.
-%%
-%% %CopyrightEnd%
-%%
-
-%%% @doc Parse transform for inserting line numbers
-
--module(ct_line).
-
--record(vars, {module, % atom() Module name
- vsn, % atom()
-
- init_info=[], % [{M,F,A,C,L}]
-
- function, % atom()
- arity, % int()
- clause, % int()
- lines, % [int()]
- depth, % int()
- is_guard=false % boolean
- }).
-
--export([parse_transform/2,
- line/1]).
-
-line(LOC={{Mod,Func},_Line}) ->
- Lines = case get(test_server_loc) of
- [{{Mod,Func},_}|Ls] ->
- Ls;
- Ls when is_list(Ls) ->
- case length(Ls) of
- 10 ->
- [_|T]=lists:reverse(Ls),
- lists:reverse(T);
- _ ->
- Ls
- end;
- _ ->
- []
- end,
- put(test_server_loc,[LOC|Lines]).
-
-parse_transform(Forms, _Options) ->
- transform(Forms, _Options).
-
-%% forms(Fs) -> lists:map(fun (F) -> form(F) end, Fs).
-
-transform(Forms, _Options)->
- Vars0 = #vars{},
- {ok, MungedForms, _Vars} = transform(Forms, [], Vars0),
- MungedForms.
-
-
-transform([Form|Forms], MungedForms, Vars) ->
- case munge(Form, Vars) of
- ignore ->
- transform(Forms, MungedForms, Vars);
- {MungedForm, Vars2} ->
- transform(Forms, [MungedForm|MungedForms], Vars2)
- end;
-transform([], MungedForms, Vars) ->
- {ok, lists:reverse(MungedForms), Vars}.
-
-%% This code traverses the abstract code, stored as the abstract_code
-%% chunk in the BEAM file, as described in absform(3) for Erlang/OTP R8B
-%% (Vsn=abstract_v2).
-%% The abstract format after preprocessing differs slightly from the abstract
-%% format given eg using epp:parse_form, this has been noted in comments.
-munge(Form={attribute,_,module,Module}, Vars) ->
- Vars2 = Vars#vars{module=Module},
- {Form, Vars2};
-
-munge({function,0,module_info,_Arity,_Clauses}, _Vars) ->
- ignore; % module_info will be added again when the forms are recompiled
-munge({function,Line,Function,Arity,Clauses}, Vars) ->
- Vars2 = Vars#vars{function=Function,
- arity=Arity,
- clause=1,
- lines=[],
- depth=1},
- {MungedClauses, Vars3} = munge_clauses(Clauses, Vars2, []),
- {{function,Line,Function,Arity,MungedClauses}, Vars3};
-munge(Form, Vars) -> % attributes
- {Form, Vars}.
-
-munge_clauses([{clause,Line,Pattern,Guards,Body}|Clauses], Vars, MClauses) ->
- {MungedGuards, _Vars} = munge_exprs(Guards, Vars#vars{is_guard=true},[]),
-
- case Vars#vars.depth of
- 1 -> % function clause
- {MungedBody, Vars2} = munge_body(Body, Vars#vars{depth=2}, []),
- ClauseInfo = {Vars2#vars.module,
- Vars2#vars.function,
- Vars2#vars.arity,
- Vars2#vars.clause,
- length(Vars2#vars.lines)},
- InitInfo = [ClauseInfo | Vars2#vars.init_info],
- Vars3 = Vars2#vars{init_info=InitInfo,
- clause=(Vars2#vars.clause)+1,
- lines=[],
- depth=1},
- munge_clauses(Clauses, Vars3,
- [{clause,Line,Pattern,MungedGuards,MungedBody}|
- MClauses]);
-
- 2 -> % receive-, case- or if clause
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- munge_clauses(Clauses, Vars2,
- [{clause,Line,Pattern,MungedGuards,MungedBody}|
- MClauses])
- end;
-munge_clauses([], Vars, MungedClauses) ->
- {lists:reverse(MungedClauses), Vars}.
-
-munge_body([Expr|Body], Vars, MungedBody) ->
- %% Here is the place to add a call to cover:bump/6!
- Line = element(2, Expr),
- Lines = Vars#vars.lines,
- case lists:member(Line,Lines) of
- true -> % already a bump at this line!
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_body(Body, Vars2, [MungedExpr|MungedBody]);
- false ->
- Bump = {call, 0, {remote,0,{atom,0,?MODULE},{atom,0,line}},
- [{tuple,0,[{tuple,0,[{atom,0,Vars#vars.module},
- {atom, 0, Vars#vars.function}]},
- {integer, 0, Line}]}]},
- Lines2 = [Line|Lines],
-
- {MungedExpr, Vars2} = munge_expr(Expr, Vars#vars{lines=Lines2}),
- munge_body(Body, Vars2, [MungedExpr,Bump|MungedBody])
- end;
-munge_body([], Vars, MungedBody) ->
- {lists:reverse(MungedBody), Vars}.
-
-munge_expr({match,Line,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{match,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({tuple,Line,Exprs}, Vars) ->
- {MungedExprs, Vars2} = munge_exprs(Exprs, Vars, []),
- {{tuple,Line,MungedExprs}, Vars2};
-munge_expr({record,Line,Expr,Exprs}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprName, Vars2} = munge_expr(Expr, Vars),
- {MungedExprFields, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{record,Line,MungedExprName,MungedExprFields}, Vars3};
-munge_expr({record_field,Line,ExprL,ExprR}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{record_field,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({cons,Line,ExprH,ExprT}, Vars) ->
- {MungedExprH, Vars2} = munge_expr(ExprH, Vars),
- {MungedExprT, Vars3} = munge_expr(ExprT, Vars2),
- {{cons,Line,MungedExprH,MungedExprT}, Vars3};
-munge_expr({op,Line,Op,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{op,Line,Op,MungedExprL,MungedExprR}, Vars3};
-munge_expr({op,Line,Op,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{op,Line,Op,MungedExpr}, Vars2};
-munge_expr({'catch',Line,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{'catch',Line,MungedExpr}, Vars2};
-munge_expr({call,Line1,{remote,Line2,ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==false->
- {MungedExprM, Vars2} = munge_expr(ExprM, Vars),
- {MungedExprF, Vars3} = munge_expr(ExprF, Vars2),
- {MungedExprs, Vars4} = munge_exprs(Exprs, Vars3, []),
- {{call,Line1,{remote,Line2,MungedExprM,MungedExprF},MungedExprs}, Vars4};
-munge_expr({call,Line1,{remote,_Line2,_ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==true ->
- %% Difference in abstract format after preprocessing: BIF calls in guards
- %% are translated to {remote,...} (which is not allowed as source form)
- %% NOT NECESSARY FOR Vsn=raw_abstract_v1
- munge_expr({call,Line1,ExprF,Exprs}, Vars);
-munge_expr({call,Line,Expr,Exprs}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedExprs, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{call,Line,MungedExpr,MungedExprs}, Vars3};
-munge_expr({lc,Line,Expr,LC}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedLC, Vars3} = munge_lc(LC, Vars2, []),
- {{lc,Line,MungedExpr,MungedLC}, Vars3};
-munge_expr({block,Line,Body}, Vars) ->
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- {{block,Line,MungedBody}, Vars2};
-munge_expr({'if',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'if',Line,MungedClauses}, Vars2};
-munge_expr({'case',Line,Expr,Clauses}, Vars) ->
- {MungedExpr,Vars2} = munge_expr(Expr,Vars),
- {MungedClauses,Vars3} = munge_clauses(Clauses, Vars2, []),
- {{'case',Line,MungedExpr,MungedClauses}, Vars3};
-munge_expr({'receive',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'receive',Line,MungedClauses}, Vars2};
-munge_expr({'receive',Line,Clauses,Expr,Body}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {MungedExpr, Vars3} = munge_expr(Expr, Vars2),
- {MungedBody, Vars4} = munge_body(Body, Vars3, []),
- {{'receive',Line,MungedClauses,MungedExpr,MungedBody}, Vars4};
-munge_expr({'try',Line,Exprs,Clauses,CatchClauses}, Vars) ->
- {MungedExprs, Vars1} = munge_exprs(Exprs, Vars, []),
- {MungedClauses, Vars2} = munge_clauses(Clauses, Vars1, []),
- {MungedCatchClauses, Vars3} = munge_clauses(CatchClauses, Vars2, []),
- {{'try',Line,MungedExprs,MungedClauses,MungedCatchClauses}, Vars3};
-%% Difference in abstract format after preprocessing: Funs get an extra
-%% element Extra.
-%% NOT NECESSARY FOR Vsn=raw_abstract_v1
-munge_expr({'fun',Line,{function,Name,Arity},_Extra}, Vars) ->
- {{'fun',Line,{function,Name,Arity}}, Vars};
-munge_expr({'fun',Line,{clauses,Clauses},_Extra}, Vars) ->
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr({'fun',Line,{clauses,Clauses}}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr(Form, Vars) -> % var|char|integer|float|string|atom|nil|bin|eof
- {Form, Vars}.
-
-munge_exprs([Expr|Exprs], Vars, MungedExprs) when Vars#vars.is_guard==true,
- is_list(Expr) ->
- {MungedExpr, _Vars} = munge_exprs(Expr, Vars, []),
- munge_exprs(Exprs, Vars, [MungedExpr|MungedExprs]);
-munge_exprs([Expr|Exprs], Vars, MungedExprs) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_exprs(Exprs, Vars2, [MungedExpr|MungedExprs]);
-munge_exprs([], Vars, MungedExprs) ->
- {lists:reverse(MungedExprs), Vars}.
-
-munge_lc([{generate,Line,Pattern,Expr}|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [{generate,Line,Pattern,MungedExpr}|MungedLC]);
-munge_lc([Expr|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [MungedExpr|MungedLC]);
-munge_lc([], Vars, MungedLC) ->
- {lists:reverse(MungedLC), Vars}.
-
-
-
-
-
-
-
-
-
-
diff --git a/lib/common_test/test/ct_error_SUITE.erl b/lib/common_test/test/ct_error_SUITE.erl
index 6867e59b60..836443009f 100644
--- a/lib/common_test/test/ct_error_SUITE.erl
+++ b/lib/common_test/test/ct_error_SUITE.erl
@@ -280,41 +280,21 @@ test_events(cfg_error) ->
{?eh,tc_start,{cfg_error_2_SUITE,init_per_suite}},
{?eh,tc_done,
{cfg_error_2_SUITE,init_per_suite,
- {failed,{error,{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {failed,{error,{{badmatch,[1,2]},'_'}}}}},
{?eh,tc_auto_skip,
{cfg_error_2_SUITE,tc1,
{failed,{cfg_error_2_SUITE,init_per_suite,
- {'EXIT',{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,[1,2]},'_'}}}}}},
{?eh,test_stats,{0,0,{0,3}}},
{?eh,tc_auto_skip,
{cfg_error_2_SUITE,tc2,
{failed,{cfg_error_2_SUITE,init_per_suite,
- {'EXIT',{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,[1,2]},'_'}}}}}},
{?eh,test_stats,{0,0,{0,4}}},
{?eh,tc_auto_skip,
{cfg_error_2_SUITE,end_per_suite,
{failed,{cfg_error_2_SUITE,init_per_suite,
- {'EXIT',{{badmatch,[1,2]},
- [{cfg_error_2_SUITE,init_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,[1,2]},'_'}}}}}},
{?eh,tc_start,{cfg_error_3_SUITE,init_per_suite}},
{?eh,tc_done,
@@ -373,12 +353,7 @@ test_events(cfg_error) ->
{?eh,tc_done,{cfg_error_6_SUITE,{end_per_group,g1,[]},ok}}],
{?eh,tc_start,{cfg_error_6_SUITE,end_per_suite}},
{?eh,tc_done,{cfg_error_6_SUITE,end_per_suite,
- {failed,{error,{{badmatch,[1,2]},
- [{cfg_error_6_SUITE,end_per_suite,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {failed,{error,{{badmatch,[1,2]},'_'}}}}},
{?eh,tc_start,{cfg_error_7_SUITE,init_per_suite}},
{?eh,tc_done,{cfg_error_7_SUITE,init_per_suite,ok}},
@@ -427,31 +402,16 @@ test_events(cfg_error) ->
[{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g3,[]}}},
{?eh,tc_done,
{cfg_error_8_SUITE,{init_per_group,g3,[]},
- {failed,{error,{{badmatch,42},
- [{cfg_error_8_SUITE,init_per_group,2},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {failed,{error,{{badmatch,42},'_'}}}}},
{?eh,tc_auto_skip,
{cfg_error_8_SUITE,tc1,
{failed,{cfg_error_8_SUITE,init_per_group,
- {'EXIT',{{badmatch,42},
- [{cfg_error_8_SUITE,init_per_group,2},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {'EXIT',{{badmatch,42},'_'}}}}}},
{?eh,test_stats,{4,0,{0,13}}},
{?eh,tc_auto_skip,
{cfg_error_8_SUITE,end_per_group,
{failed,{cfg_error_8_SUITE,init_per_group,
- {'EXIT',{{badmatch,42},
- [{cfg_error_8_SUITE,init_per_group,2},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}}],
+ {'EXIT',{{badmatch,42},'_'}}}}}}],
[{?eh,tc_start,{cfg_error_8_SUITE,{init_per_group,g4,[]}}},
{?eh,tc_done,{cfg_error_8_SUITE,{init_per_group,g4,[]},ok}},
@@ -520,12 +480,7 @@ test_events(cfg_error) ->
{?eh,tc_start,{cfg_error_9_SUITE,tc3}},
{?eh,tc_done,{cfg_error_9_SUITE,tc3,
{skipped,{failed,{cfg_error_9_SUITE,init_per_testcase,
- {{badmatch,undefined},
- [{cfg_error_9_SUITE,init_per_testcase,2},
- {test_server,my_apply,3},
- {test_server,init_per_testcase,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {{badmatch,undefined},'_'}}}}}},
{?eh,test_stats,{9,0,{0,17}}},
{?eh,tc_start,{cfg_error_9_SUITE,tc4}},
{?eh,tc_done,
@@ -640,13 +595,7 @@ test_events(lib_error) ->
{?eh,tc_done,
{lib_error_1_SUITE,lines_error,{failed,
{error,
- {{badmatch,[1,2]},
- [{lib_lines,do_error,0},
- {lib_error_1_SUITE,lines_error,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {{badmatch,[1,2]},'_'}}}}},
{?eh,test_stats,{0,1,{0,0}}},
{?eh,tc_start,{lib_error_1_SUITE,lines_exit}},
{?eh,tc_done,
@@ -665,13 +614,7 @@ test_events(lib_error) ->
{?eh,tc_done,
{lib_error_1_SUITE,no_lines_error,{failed,
{error,
- {{badmatch,[1,2]},
- [{lib_no_lines,do_error,0},
- {lib_error_1_SUITE,no_lines_error,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {{badmatch,[1,2]},'_'}}}}},
{?eh,test_stats,{0,5,{0,0}}},
{?eh,tc_start,{lib_error_1_SUITE,no_lines_exit}},
{?eh,tc_done,
diff --git a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
index ebebfd18a9..71ed61b4c0 100644
--- a/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
+++ b/lib/common_test/test/ct_hooks_SUITE_data/cth/tests/empty_cth.erl
@@ -59,8 +59,7 @@
-include_lib("common_test/src/ct_util.hrl").
-include_lib("common_test/include/ct_event.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -71,7 +70,7 @@
%% @doc Always called before any other callback function. Use this to initiate
%% any common state. It should return an state for this CTH.
--spec init(Id :: term(), Opts :: proplist()) ->
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
State :: #state{}.
init(Id, Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
@@ -81,7 +80,7 @@ init(Id, Opts) ->
%% @doc The ID is used to uniquly identify an CTH instance, if two CTH's
%% return the same ID the seconds CTH is ignored. This function should NOT
%% have any side effects as it might be called multiple times by common test.
--spec id(Opts :: proplist()) ->
+-spec id(Opts :: proplists:proplist()) ->
Id :: term().
id(Opts) ->
gen_event:notify(?CT_EVMGR_REF, #event{ name = cth, node = node(),
diff --git a/lib/common_test/test/ct_repeat_1_SUITE.erl b/lib/common_test/test/ct_repeat_1_SUITE.erl
index 4e842bd6d6..090002d0c2 100644
--- a/lib/common_test/test/ct_repeat_1_SUITE.erl
+++ b/lib/common_test/test/ct_repeat_1_SUITE.erl
@@ -560,12 +560,7 @@ test_events(repeat_cs_until_any_fail) ->
{repeat_1_SUITE,tc_fail_1,
{failed,
{error,
- {{badmatch,2},
- [{repeat_1_SUITE,tc_fail_1,1},
- {test_server,my_apply,3},
- {test_server,ts_tc,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}},
+ {{badmatch,2},'_'}}}}},
{?eh,test_stats,{5,2,{0,0}}},
{?eh,tc_start,{repeat_1_SUITE,tc_fail_2}},
{?eh,tc_done,
diff --git a/lib/common_test/test/ct_skip_SUITE.erl b/lib/common_test/test/ct_skip_SUITE.erl
index 4ba4479208..b8be55f43a 100644
--- a/lib/common_test/test/ct_skip_SUITE.erl
+++ b/lib/common_test/test/ct_skip_SUITE.erl
@@ -197,7 +197,7 @@ test_events(auto_skip) ->
{?eh,tc_done,
{auto_skip_3_SUITE,tc1,
{skipped,{failed,{auto_skip_3_SUITE,init_per_testcase,
- {init_per_testcase,tc1,failed}}}}}},
+ {{init_per_testcase,tc1,failed},'_'}}}}}},
{?eh,test_stats,{0,0,{0,4}}},
{?eh,tc_start,{auto_skip_3_SUITE,tc2}},
{?eh,tc_done,{auto_skip_3_SUITE,tc2,ok}},
@@ -364,12 +364,7 @@ test_events(auto_skip) ->
{?eh,tc_done,
{auto_skip_9_SUITE,tc8,
{skipped,{failed,{auto_skip_9_SUITE,init_per_testcase,
- {{badmatch,undefined},
- [{auto_skip_9_SUITE,init_per_testcase,2},
- {test_server,my_apply,3},
- {test_server,init_per_testcase,3},
- {test_server,run_test_case_eval1,6},
- {test_server,run_test_case_eval,8}]}}}}}},
+ {{badmatch,undefined},'_'}}}}}},
{?eh,tc_start,
{auto_skip_9_SUITE,{end_per_group,g5,[parallel]}}},
{?eh,tc_done,
diff --git a/lib/compiler/doc/src/compile.xml b/lib/compiler/doc/src/compile.xml
index 830c89ae84..522c1dc411 100644
--- a/lib/compiler/doc/src/compile.xml
+++ b/lib/compiler/doc/src/compile.xml
@@ -395,6 +395,14 @@ module.beam: module.erl \
<code>-compile({no_auto_import,[error/1]}).</code>
</item>
+ <tag><c>no_line_info</c></tag>
+
+ <item>
+ <p>Omit line number information in order to produce a slightly
+ smaller output file.
+ </p>
+ </item>
+
</taglist>
<p>If warnings are turned on (the <c>report_warnings</c> option
diff --git a/lib/compiler/src/beam_asm.erl b/lib/compiler/src/beam_asm.erl
index 89d64834cf..6e63c4d0f2 100644
--- a/lib/compiler/src/beam_asm.erl
+++ b/lib/compiler/src/beam_asm.erl
@@ -23,7 +23,7 @@
-export([module/4]).
-export([encode/2]).
--import(lists, [map/2,member/2,keymember/3,duplicate/2]).
+-import(lists, [map/2,member/2,keymember/3,duplicate/2,splitwith/2]).
-include("beam_opcodes.hrl").
module(Code, Abst, SourceFile, Opts) ->
@@ -31,22 +31,20 @@ module(Code, Abst, SourceFile, Opts) ->
assemble({Mod,Exp,Attr0,Asm0,NumLabels}, Abst, SourceFile, Opts) ->
{1,Dict0} = beam_dict:atom(Mod, beam_dict:new()),
+ {0,Dict1} = beam_dict:fname(atom_to_list(Mod) ++ ".erl", Dict0),
NumFuncs = length(Asm0),
{Asm,Attr} = on_load(Asm0, Attr0),
- {Code,Dict1} = assemble_1(Asm, Exp, Dict0, []),
- build_file(Code, Attr, Dict1, NumLabels, NumFuncs, Abst, SourceFile, Opts).
+ {Code,Dict2} = assemble_1(Asm, Exp, Dict1, []),
+ build_file(Code, Attr, Dict2, NumLabels, NumFuncs, Abst, SourceFile, Opts).
on_load(Fs0, Attr0) ->
case proplists:get_value(on_load, Attr0) of
undefined ->
{Fs0,Attr0};
[{Name,0}] ->
- Fs = map(fun({function,N,0,Entry,Asm0}) when N =:= Name ->
- [{label,_}=L,
- {func_info,_,_,_}=Fi,
- {label,_}=E|Asm1] = Asm0,
- Asm = [L,Fi,E,on_load|Asm1],
- {function,N,0,Entry,Asm};
+ Fs = map(fun({function,N,0,Entry,Is0}) when N =:= Name ->
+ Is = insert_on_load_instruction(Is0, Entry),
+ {function,N,0,Entry,Is};
(F) ->
F
end, Fs0),
@@ -54,6 +52,13 @@ on_load(Fs0, Attr0) ->
{Fs,Attr}
end.
+insert_on_load_instruction(Is0, Entry) ->
+ {Bef,[{label,Entry}=El|Is]} =
+ splitwith(fun({label,L}) when L =:= Entry -> false;
+ (_) -> true
+ end, Is0),
+ Bef ++ [El,on_load|Is].
+
assemble_1([{function,Name,Arity,Entry,Asm}|T], Exp, Dict0, Acc) ->
Dict1 = case member({Name,Arity}, Exp) of
true ->
@@ -132,7 +137,10 @@ build_file(Code, Attr, Dict, NumLabels, NumFuncs, Abst, SourceFile, Opts) ->
LitTab = iolist_to_binary(zlib:compress(LitTab2)),
chunk(<<"LitT">>, <<(byte_size(LitTab2)):32>>, LitTab)
end,
+
+ %% Create the line chunk.
+ LineChunk = chunk(<<"Line">>, build_line_table(Dict)),
%% Create the attributes and compile info chunks.
@@ -150,8 +158,11 @@ build_file(Code, Attr, Dict, NumLabels, NumFuncs, Abst, SourceFile, Opts) ->
%% Create IFF chunk.
Chunks = case member(slim, Opts) of
- true -> [Essentials,AttrChunk,AbstChunk];
- false -> [Essentials,LocChunk,AttrChunk,CompileChunk,AbstChunk]
+ true ->
+ [Essentials,AttrChunk,AbstChunk];
+ false ->
+ [Essentials,LocChunk,AttrChunk,
+ CompileChunk,AbstChunk,LineChunk]
end,
build_form(<<"BEAM">>, Chunks).
@@ -201,6 +212,31 @@ build_attributes(Opts, SourceFile, Attr, Essentials) ->
Compile = [{options,Opts},{version,?COMPILER_VSN}|Misc],
{term_to_binary(calc_vsn(Attr, Essentials)),term_to_binary(Compile)}.
+build_line_table(Dict) ->
+ {NumLineInstrs,NumFnames0,Fnames0,NumLines,Lines0} =
+ beam_dict:line_table(Dict),
+ NumFnames = NumFnames0 - 1,
+ [_|Fnames1] = Fnames0,
+ Fnames2 = [unicode:characters_to_binary(F) || F <- Fnames1],
+ Fnames = << <<(byte_size(F)):16,F/binary>> || F <- Fnames2 >>,
+ Lines1 = encode_line_items(Lines0, 0),
+ Lines = iolist_to_binary(Lines1),
+ Ver = 0,
+ Bits = 0,
+ <<Ver:32,Bits:32,NumLineInstrs:32,NumLines:32,NumFnames:32,
+ Lines/binary,Fnames/binary>>.
+
+%% encode_line_items([{FnameIndex,Line}], PrevFnameIndex)
+%% Encode the line items compactly. Tag the FnameIndex with
+%% an 'a' tag (atom) and only include it when it has changed.
+%% Tag the line numbers with an 'i' (integer) tag.
+
+encode_line_items([{F,L}|T], F) ->
+ [encode(?tag_i, L)|encode_line_items(T, F)];
+encode_line_items([{F,L}|T], _) ->
+ [encode(?tag_a, F),encode(?tag_i, L)|encode_line_items(T, F)];
+encode_line_items([], _) -> [].
+
%%
%% If the attributes contains no 'vsn' attribute, we'll insert one
%% with an MD5 "checksum" calculated on the code as its value.
@@ -243,6 +279,9 @@ bif_type(_, 2) -> bif2.
make_op({'%',_}, Dict) ->
{[],Dict};
+make_op({line,Location}, Dict0) ->
+ {Index,Dict} = beam_dict:line(Location, Dict0),
+ encode_op(line, [Index], Dict);
make_op({bif, Bif, {f,_}, [], Dest}, Dict) ->
%% BIFs without arguments cannot fail.
encode_op(bif0, [{extfunc, erlang, Bif, 0}, Dest], Dict);
diff --git a/lib/compiler/src/beam_block.erl b/lib/compiler/src/beam_block.erl
index c45874597a..432d1e7eea 100644
--- a/lib/compiler/src/beam_block.erl
+++ b/lib/compiler/src/beam_block.erl
@@ -36,13 +36,14 @@ function({function,Name,Arity,CLabel,Is0}, Lc0) ->
%% Collect basic blocks and optimize them.
Is2 = blockify(Is1),
- Is3 = move_allocates(Is2),
- Is4 = beam_utils:live_opt(Is3),
- Is5 = opt_blocks(Is4),
- Is6 = beam_utils:delete_live_annos(Is5),
+ Is3 = embed_lines(Is2),
+ Is4 = move_allocates(Is3),
+ Is5 = beam_utils:live_opt(Is4),
+ Is6 = opt_blocks(Is5),
+ Is7 = beam_utils:delete_live_annos(Is6),
%% Optimize bit syntax.
- {Is,Lc} = bsm_opt(Is6, Lc0),
+ {Is,Lc} = bsm_opt(Is7, Lc0),
%% Done.
{{function,Name,Arity,CLabel,Is},Lc}
@@ -148,6 +149,24 @@ collect(remove_message) -> {set,[],[],remove_message};
collect({'catch',R,L}) -> {set,[R],[],{'catch',L}};
collect(_) -> error.
+%% embed_lines([Instruction]) -> [Instruction]
+%% Combine blocks that would be split by line/1 instructions.
+%% Also move a line instruction before a block into the block,
+%% but leave the line/1 instruction after a block outside.
+
+embed_lines(Is) ->
+ embed_lines(reverse(Is), []).
+
+embed_lines([{block,B2},{line,_}=Line,{block,B1}|T], Acc) ->
+ B = {block,B1++[{set,[],[],Line}]++B2},
+ embed_lines([B|T], Acc);
+embed_lines([{block,B1},{line,_}=Line|T], Acc) ->
+ B = {block,[{set,[],[],Line}|B1]},
+ embed_lines([B|T], Acc);
+embed_lines([I|Is], Acc) ->
+ embed_lines(Is, [I|Acc]);
+embed_lines([], Acc) -> Acc.
+
opt_blocks([{block,Bl0}|Is]) ->
%% The live annotation at the beginning is not useful.
[{'%live',_}|Bl] = Bl0,
@@ -225,10 +244,12 @@ opt([{set,[Dst],As,{bif,Bif,Fail}}=I1,
RevBif -> [{set,[Dst],As,{bif,RevBif,Fail}}|opt(Is)]
end;
opt([{set,[X],[X],move}|Is]) -> opt(Is);
-opt([{set,[D1],[{integer,Idx1},Reg],{bif,element,{f,0}}}=I1,
+opt([{set,_,_,{line,_}}=Line1,
+ {set,[D1],[{integer,Idx1},Reg],{bif,element,{f,0}}}=I1,
+ {set,_,_,{line,_}}=Line2,
{set,[D2],[{integer,Idx2},Reg],{bif,element,{f,0}}}=I2|Is])
when Idx1 < Idx2, D1 =/= D2, D1 =/= Reg, D2 =/= Reg ->
- opt([I2,I1|Is]);
+ opt([Line2,I2,Line1,I1|Is]);
opt([{set,Ds0,Ss,Op}|Is0]) ->
{Ds,Is} = opt_moves(Ds0, Is0),
[{set,Ds,Ss,Op}|opt(Is)];
diff --git a/lib/compiler/src/beam_bsm.erl b/lib/compiler/src/beam_bsm.erl
index 415864b8e9..1217f7f777 100644
--- a/lib/compiler/src/beam_bsm.erl
+++ b/lib/compiler/src/beam_bsm.erl
@@ -20,7 +20,7 @@
-module(beam_bsm).
-export([module/2,format_error/1]).
--import(lists, [member/2,foldl/3,reverse/1,sort/1,all/2]).
+-import(lists, [member/2,foldl/3,reverse/1,sort/1,all/2,dropwhile/2]).
%%%
%%% We optimize bit syntax matching where the tail end of a binary is
@@ -376,6 +376,8 @@ btb_reaches_match_2([{func_info,_,_,Arity}=I|_], Regs0, D) ->
[] -> D;
_ -> {binary_used_in,I}
end;
+btb_reaches_match_2([{line,_}|Is], Regs, D) ->
+ btb_reaches_match_1(Is, Regs, D);
btb_reaches_match_2([I|_], Regs, _) ->
btb_error({btb_context_regs(Regs),I,not_handled}).
@@ -580,7 +582,10 @@ btb_index(Fs) ->
btb_index_1(Fs, []).
btb_index_1([{function,_,_,Entry,Is0}|Fs], Acc0) ->
- [{label,_},{func_info,_,_,_},{label,Entry}|Is] = Is0,
+ [{label,Entry}|Is] =
+ dropwhile(fun({label,L}) when L =:= Entry -> false;
+ (_) -> true
+ end, Is0),
Acc = btb_index_2(Is, Entry, false, Acc0),
btb_index_1(Fs, Acc);
btb_index_1([], Acc) -> gb_trees:from_orddict(sort(Acc)).
diff --git a/lib/compiler/src/beam_clean.erl b/lib/compiler/src/beam_clean.erl
index 64c93e11f7..a7994ab3b3 100644
--- a/lib/compiler/src/beam_clean.erl
+++ b/lib/compiler/src/beam_clean.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2000-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2000-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -23,9 +23,9 @@
-export([module/2]).
-export([bs_clean_saves/1]).
-export([clean_labels/1]).
--import(lists, [map/2,foldl/3,reverse/1]).
+-import(lists, [map/2,foldl/3,reverse/1,filter/2]).
-module({Mod,Exp,Attr,Fs0,_}, _Opt) ->
+module({Mod,Exp,Attr,Fs0,_}, Opts) ->
Order = [Lbl || {function,_,_,Lbl,_} <- Fs0],
All = foldl(fun({function,_,_,Lbl,_}=Func,D) -> dict:store(Lbl, Func, D) end,
dict:new(), Fs0),
@@ -33,7 +33,8 @@ module({Mod,Exp,Attr,Fs0,_}, _Opt) ->
Used = find_all_used(WorkList, All, sets:from_list(WorkList)),
Fs1 = remove_unused(Order, Used, All),
{Fs2,Lc} = clean_labels(Fs1),
- Fs = bs_fix(Fs2),
+ Fs3 = bs_fix(Fs2),
+ Fs = maybe_remove_lines(Fs3, Opts),
{ok,{Mod,Exp,Attr,Fs,Lc}}.
%% Remove all bs_save2/2 instructions not referenced by a bs_restore2/2.
@@ -375,3 +376,20 @@ bs_clean_saves_1([{bs_save2,_,{_,_}=SavePoint}=I|Is], Needed, Acc) ->
bs_clean_saves_1([I|Is], Needed, Acc) ->
bs_clean_saves_1(Is, Needed, [I|Acc]);
bs_clean_saves_1([], _, Acc) -> reverse(Acc).
+
+%%%
+%%% Remove line instructions if requested.
+%%%
+
+maybe_remove_lines(Fs, Opts) ->
+ case proplists:get_bool(no_line_info, Opts) of
+ false -> Fs;
+ true -> remove_lines(Fs)
+ end.
+
+remove_lines([{function,N,A,Lbl,Is0}|T]) ->
+ Is = filter(fun({line,_}) -> false;
+ (_) -> true
+ end, Is0),
+ [{function,N,A,Lbl,Is}|remove_lines(T)];
+remove_lines([]) -> [].
diff --git a/lib/compiler/src/beam_dead.erl b/lib/compiler/src/beam_dead.erl
index 1365f3d20a..9f81a6ab43 100644
--- a/lib/compiler/src/beam_dead.erl
+++ b/lib/compiler/src/beam_dead.erl
@@ -144,9 +144,9 @@ function({function,Name,Arity,CLabel,Is0}, Lc0) ->
%% Initialize label information with the code
%% for the func_info label. Without it, a register
%% may seem to be live when it is not.
- [{label,L},{func_info,_,_,_}=FI|_] = Is1,
+ [{label,L}|FiIs] = Is1,
D0 = beam_utils:empty_label_index(),
- D = beam_utils:index_label(L, [FI], D0),
+ D = beam_utils:index_label(L, FiIs, D0),
%% Optimize away dead code.
{Is2,Lc} = forward(Is1, Lc0),
@@ -185,6 +185,8 @@ split_block([{set,[R],As,{alloc,Live,{gc_bif,N,{f,Lbl}=Fail}}}|Is], Bl, Acc)
split_block(Is, [], [{gc_bif,N,Fail,Live,As,R}|make_block(Bl, Acc)]);
split_block([{set,[R],[],{'catch',L}}|Is], Bl, Acc) ->
split_block(Is, [], [{'catch',R,L}|make_block(Bl, Acc)]);
+split_block([{set,[],[],{line,_}=Line}|Is], Bl, Acc) ->
+ split_block(Is, [], [Line|make_block(Bl, Acc)]);
split_block([I|Is], Bl, Acc) ->
split_block(Is, [I|Bl], Acc);
split_block([], Bl, Acc) -> make_block(Bl, Acc).
@@ -406,7 +408,7 @@ backward([{test,Op,{f,To0},Live,Ops0,Dst}|Is], D, Acc) ->
end,
I = {test,Op,{f,To},Live,Ops0,Dst},
backward(Is, D, [I|Acc]);
-backward([{kill,_}=I|Is], D, [Exit|_]=Acc) ->
+backward([{kill,_}=I|Is], D, [{line,_},Exit|_]=Acc) ->
case beam_jump:is_exit_instruction(Exit) of
false -> backward(Is, D, [I|Acc]);
true -> backward(Is, D, Acc)
@@ -471,7 +473,7 @@ shortcut_fail_label(To0, Reg, Val, D) ->
shortcut_boolean_label(To0, Reg, Bool0, D) when is_boolean(Bool0) ->
case beam_utils:code_at(To0, D) of
- [{bif,'not',_,[Reg],Reg},{jump,{f,To}}|_] ->
+ [{line,_},{bif,'not',_,[Reg],Reg},{jump,{f,To}}|_] ->
Bool = not Bool0,
{shortcut_select_label(To, Reg, Bool, D),Bool};
_ ->
diff --git a/lib/compiler/src/beam_dict.erl b/lib/compiler/src/beam_dict.erl
index c50ed28aa9..ee76623976 100644
--- a/lib/compiler/src/beam_dict.erl
+++ b/lib/compiler/src/beam_dict.erl
@@ -22,9 +22,10 @@
-export([new/0,opcode/2,highest_opcode/1,
atom/2,local/4,export/4,import/4,
- string/2,lambda/5,literal/2,
+ string/2,lambda/5,literal/2,line/2,fname/2,
atom_table/1,local_table/1,export_table/1,import_table/1,
- string_table/1,lambda_table/1,literal_table/1]).
+ string_table/1,lambda_table/1,literal_table/1,
+ line_table/1]).
-type label() :: non_neg_integer().
@@ -36,6 +37,9 @@
strings = <<>> :: binary(), %String pool
lambdas = [], %[{...}]
literals = dict:new() :: dict(), %Format: {Literal,Number}
+ fnames = gb_trees:empty() :: gb_tree(), %{Name,Index}
+ lines = gb_trees:empty() :: gb_tree(), %{{Fname,Line},Index}
+ num_lines = 0 :: non_neg_integer(), %Number of line instructions
next_import = 0 :: non_neg_integer(),
string_offset = 0 :: non_neg_integer(),
next_literal = 0 :: non_neg_integer(),
@@ -152,6 +156,36 @@ literal(Lit, #asm{literals=Tab0,next_literal=NextIndex}=Dict) ->
{NextIndex,Dict#asm{literals=Tab,next_literal=NextIndex+1}}
end.
+%% Returns the index for a line instruction (adding information
+%% to the location information table).
+-spec line(list(), bdict()) -> {non_neg_integer(), bdict()}.
+
+line([], #asm{num_lines=N}=Dict) ->
+ %% No location available. Return the special pre-defined
+ %% index 0.
+ {0,Dict#asm{num_lines=N+1}};
+line([{location,Name,Line}], #asm{lines=Lines0,num_lines=N}=Dict0) ->
+ {FnameIndex,Dict1} = fname(Name, Dict0),
+ case gb_trees:lookup({FnameIndex,Line}, Lines0) of
+ {value,Index} ->
+ {Index,Dict1#asm{num_lines=N+1}};
+ none ->
+ Index = gb_trees:size(Lines0) + 1,
+ Lines = gb_trees:insert({FnameIndex,Line}, Index, Lines0),
+ Dict = Dict1#asm{lines=Lines,num_lines=N+1},
+ {Index,Dict}
+ end.
+
+fname(Name, #asm{fnames=Fnames0}=Dict) ->
+ case gb_trees:lookup(Name, Fnames0) of
+ {value,Index} ->
+ {Index,Dict};
+ none ->
+ Index = gb_trees:size(Fnames0),
+ Fnames = gb_trees:insert(Name, Index, Fnames0),
+ {Index,Dict#asm{fnames=Fnames}}
+ end.
+
%% Returns the atom table.
%% atom_table(Dict) -> {LastIndex,[Length,AtomString...]}
-spec atom_table(bdict()) -> {non_neg_integer(), [[non_neg_integer(),...]]}.
@@ -219,6 +253,21 @@ literal_table(#asm{literals=Tab,next_literal=NumLiterals}) ->
my_term_to_binary(Term) ->
term_to_binary(Term, [{minor_version,1}]).
+%% Return the line table.
+-spec line_table(bdict()) ->
+ {non_neg_integer(), %Number of line instructions.
+ non_neg_integer(),[string()],
+ non_neg_integer(),[{non_neg_integer(),non_neg_integer()}]}.
+
+line_table(#asm{fnames=Fnames0,lines=Lines0,num_lines=NumLineInstrs}) ->
+ NumFnames = gb_trees:size(Fnames0),
+ Fnames1 = lists:keysort(2, gb_trees:to_list(Fnames0)),
+ Fnames = [Name || {Name,_} <- Fnames1],
+ NumLines = gb_trees:size(Lines0),
+ Lines1 = lists:keysort(2, gb_trees:to_list(Lines0)),
+ Lines = [L || {L,_} <- Lines1],
+ {NumLineInstrs,NumFnames,Fnames,NumLines,Lines}.
+
%% Search for binary string Str in the binary string pool Pool.
%% old_string(Str, Pool) -> none | Index
-spec old_string(binary(), binary()) -> 'none' | pos_integer().
diff --git a/lib/compiler/src/beam_disasm.erl b/lib/compiler/src/beam_disasm.erl
index 017ca129b0..410233a0f7 100644
--- a/lib/compiler/src/beam_disasm.erl
+++ b/lib/compiler/src/beam_disasm.erl
@@ -296,6 +296,8 @@ get_function_chunks(Code) ->
labels_r([], R) -> {R, []};
labels_r([{label,_}=I|Is], R) ->
labels_r(Is, [I|R]);
+labels_r([{line,_}=I|Is], R) ->
+ labels_r(Is, [I|R]);
labels_r(Is, R) -> {R, Is}.
get_funs({[],[]}) -> [];
@@ -335,20 +337,17 @@ local_labels(Funs) ->
local_labels_1(function__code(F), R)
end, [], Funs)).
-%% The first clause below attempts to provide some (limited form of)
-%% backwards compatibility; it is not needed for .beam files generated
-%% by the R8 compiler. The clause should one fine day be taken out.
-local_labels_1([{label,_}|[{label,_}|_]=Code], R) ->
- local_labels_1(Code, R);
-local_labels_1([{label,_},{func_info,{atom,M},{atom,F},A}|Code], R)
- when is_atom(M), is_atom(F) ->
- local_labels_2(Code, R, M, F, A);
-local_labels_1(Code, _) ->
- ?exit({'local_labels: no label in code',Code}).
+local_labels_1(Code0, R) ->
+ Code1 = lists:dropwhile(fun({label,_}) -> true;
+ ({line,_}) -> true;
+ ({func_info,_,_,_}) -> false
+ end, Code0),
+ [{func_info,{atom,M},{atom,F},A}|Code] = Code1,
+ local_labels_2(Code, R, {M,F,A}).
-local_labels_2([{label,[{u,L}]}|Code], R, M, F, A) ->
- local_labels_2(Code, [{L,{M,F,A}}|R], M, F, A);
-local_labels_2(_, R, _, _, _) -> R.
+local_labels_2([{label,[{u,L}]}|Code], R, MFA) ->
+ local_labels_2(Code, [{L,MFA}|R], MFA);
+local_labels_2(_, R, _) -> R.
%%-----------------------------------------------------------------------
%% Disassembles a single BEAM instruction; most instructions are handled
@@ -1105,6 +1104,12 @@ resolve_inst({recv_set,[Lbl]},_,_,_) ->
{recv_set,Lbl};
%%
+%% R15A.
+%%
+resolve_inst({line,[Index]},_,_,_) ->
+ {line,resolve_arg(Index)};
+
+%%
%% Catches instructions that are not yet handled.
%%
resolve_inst(X,_,_,_) -> ?exit({resolve_inst,X}).
diff --git a/lib/compiler/src/beam_jump.erl b/lib/compiler/src/beam_jump.erl
index 3cab55c4cb..537f8ca81b 100644
--- a/lib/compiler/src/beam_jump.erl
+++ b/lib/compiler/src/beam_jump.erl
@@ -169,7 +169,7 @@ share_1([{label,L}=Lbl|Is], Dict0, Seq, Acc) ->
share_1(Is, Dict0, [], [Lbl,{jump,{f,Label}}|Acc])
end;
share_1([{func_info,_,_,_}=I|Is], _, [], Acc) ->
- Is++[I|Acc];
+ reverse(Is, [I|Acc]);
share_1([I|Is], Dict, Seq, Acc) ->
case is_unreachable_after(I) of
false ->
@@ -206,25 +206,35 @@ is_label(_) -> false.
move(Is) ->
move_1(Is, [], []).
-move_1([I|Is], End, Acc) ->
+move_1([I|Is], End0, Acc0) ->
case is_exit_instruction(I) of
- false -> move_1(Is, End, [I|Acc]);
- true -> move_2(I, Is, End, Acc)
+ false ->
+ move_1(Is, End0, [I|Acc0]);
+ true ->
+ case extract_seq(Acc0, [I|End0]) of
+ no ->
+ move_1(Is, End0, [I|Acc0]);
+ {yes,End,Acc} ->
+ move_1(Is, End, Acc)
+ end
end;
-move_1([], End, Acc) ->
- reverse(Acc, reverse(End)).
-
-move_2(Exit, Is, End, [{block,_},{label,_},{func_info,_,_,_}|_]=Acc) ->
- move_1(Is, End, [Exit|Acc]);
-move_2(Exit, Is, End, [{block,_}=Blk,{label,_}=Lbl,Unreachable|More]) ->
- move_1([Unreachable|Is], [Exit,Blk,Lbl|End], More);
-move_2(Exit, Is, End, [{bs_context_to_binary,_}=Bs,{label,_}=Lbl,
- Unreachable|More]) ->
- move_1([Unreachable|Is], [Exit,Bs,Lbl|End], More);
-move_2(Exit, Is, End, [{label,_}=Lbl,Unreachable|More]) ->
- move_1([Unreachable|Is], [Exit,Lbl|End], More);
-move_2(Exit, Is, End, Acc) ->
- move_1(Is, End, [Exit|Acc]).
+move_1([], End, Acc) -> reverse(Acc, End).
+
+extract_seq([{line,_}=Line|Is], Acc) ->
+ extract_seq(Is, [Line|Acc]);
+extract_seq([{block,_}=Bl|Is], Acc) ->
+ extract_seq_1(Is, [Bl|Acc]);
+extract_seq([{label,_}|_]=Is, Acc) ->
+ extract_seq_1(Is, Acc);
+extract_seq(_, _) -> no.
+
+extract_seq_1([{line,_}=Line|Is], Acc) ->
+ extract_seq_1(Is, [Line|Acc]);
+extract_seq_1([{label,_},{func_info,_,_,_}|_], _) ->
+ no;
+extract_seq_1([{label,_}=Lbl|Is], Acc) ->
+ {yes,[Lbl|Acc],Is};
+extract_seq_1(_, _) -> no.
%%%
%%% (3) (4) (5) (6) Jump and unreachable code optimizations.
@@ -454,6 +464,7 @@ is_label_used_in_2({set,_,_,Info}, Lbl) ->
{put_tuple,_} -> false;
{get_tuple_element,_} -> false;
{set_tuple_element,_} -> false;
+ {line,_} -> false;
_ when is_atom(Info) -> false
end.
@@ -487,6 +498,8 @@ rem_unused([], _, Acc) -> reverse(Acc).
initial_labels(Is) ->
initial_labels(Is, []).
+initial_labels([{line,_}|Is], Acc) ->
+ initial_labels(Is, Acc);
initial_labels([{label,Lbl}|Is], Acc) ->
initial_labels(Is, [Lbl|Acc]);
initial_labels([{func_info,_,_,_},{label,Lbl}|_], Acc) ->
diff --git a/lib/compiler/src/beam_listing.erl b/lib/compiler/src/beam_listing.erl
index be7b14c3dd..2941f6135c 100644
--- a/lib/compiler/src/beam_listing.erl
+++ b/lib/compiler/src/beam_listing.erl
@@ -61,7 +61,7 @@ print_op(Stream, Label) when element(1, Label) == label ->
print_op(Stream, Op) ->
io:format(Stream, " ~p.\n", [Op]).
-function(File, {function,Name,Arity,Args,Body,Vdb}) ->
+function(File, {function,Name,Arity,Args,Body,Vdb,_Anno}) ->
io:nl(File),
io:format(File, "function ~p/~p.\n", [Name,Arity]),
io:format(File, " ~p.\n", [Args]),
diff --git a/lib/compiler/src/beam_receive.erl b/lib/compiler/src/beam_receive.erl
index 9ed44ad5d7..c483d85a97 100644
--- a/lib/compiler/src/beam_receive.erl
+++ b/lib/compiler/src/beam_receive.erl
@@ -175,6 +175,8 @@ opt_update_regs({label,Lbl}, R, L) ->
end;
opt_update_regs({try_end,_}, R, L) ->
{R,L};
+opt_update_regs({line,_}, R, L) ->
+ {R,L};
opt_update_regs(_I, _R, L) ->
%% Unrecognized instruction. Abort the search.
{regs_init(),L}.
diff --git a/lib/compiler/src/beam_trim.erl b/lib/compiler/src/beam_trim.erl
index 790aba0a9a..25e6ffbb73 100644
--- a/lib/compiler/src/beam_trim.erl
+++ b/lib/compiler/src/beam_trim.erl
@@ -222,7 +222,9 @@ remap([{call_last,Ar,Name,N}|Is], Map, Acc) ->
reverse(Acc, [I|Is]);
remap([{call_ext_last,Ar,Name,N}|Is], Map, Acc) ->
I = {call_ext_last,Ar,Name,Map({frame_size,N})},
- reverse(Acc, [I|Is]).
+ reverse(Acc, [I|Is]);
+remap([{line,_}=I|Is], Map, Acc) ->
+ remap(Is, Map, [I|Acc]).
remap_block([{set,Ds0,Ss0,Info}|Is], Map, Acc) ->
Ds = [Map(D) || D <- Ds0],
@@ -230,14 +232,15 @@ remap_block([{set,Ds0,Ss0,Info}|Is], Map, Acc) ->
remap_block(Is, Map, [{set,Ds,Ss,Info}|Acc]);
remap_block([], _, Acc) -> reverse(Acc).
-safe_labels([{label,L},{badmatch,{Tag,_}}|Is], Acc) when Tag =/= y ->
+safe_labels([{label,L},{line,_},{badmatch,{Tag,_}}|Is], Acc) when Tag =/= y ->
safe_labels(Is, [L|Acc]);
-safe_labels([{label,L},{case_end,{Tag,_}}|Is], Acc) when Tag =/= y ->
+safe_labels([{label,L},{line,_},{case_end,{Tag,_}}|Is], Acc) when Tag =/= y ->
safe_labels(Is, [L|Acc]);
-safe_labels([{label,L},if_end|Is], Acc) ->
+safe_labels([{label,L},{line,_},if_end|Is], Acc) ->
safe_labels(Is, [L|Acc]);
safe_labels([{label,L},
{block,[{set,[{x,0}],[{Tag,_}],move}]},
+ {line,_},
{call_ext,1,{extfunc,erlang,error,1}}|Is], Acc) when Tag =/= y ->
safe_labels(Is, [L|Acc]);
safe_labels([_|Is], Acc) ->
@@ -321,6 +324,8 @@ frame_size([{make_fun2,_,_,_,_}|Is], Safe) ->
frame_size([{deallocate,N}|_], _) -> N;
frame_size([{call_last,_,_,N}|_], _) -> N;
frame_size([{call_ext_last,_,_,N}|_], _) -> N;
+frame_size([{line,_}|Is], Safe) ->
+ frame_size(Is, Safe);
frame_size([_|_], _) -> throw(not_possible).
frame_size_branch(0, Is, Safe) ->
diff --git a/lib/compiler/src/beam_type.erl b/lib/compiler/src/beam_type.erl
index f83f73b224..7fdb8d072a 100644
--- a/lib/compiler/src/beam_type.erl
+++ b/lib/compiler/src/beam_type.erl
@@ -400,6 +400,7 @@ update({call_ext,3,{extfunc,erlang,setelement,3}}, Ts0) ->
update({call,_Arity,_Func}, Ts) -> tdb_kill_xregs(Ts);
update({call_ext,_Arity,_Func}, Ts) -> tdb_kill_xregs(Ts);
update({make_fun2,_,_,_,_}, Ts) -> tdb_kill_xregs(Ts);
+update({line,_}, Ts) -> Ts;
%% The instruction is unknown. Kill all information.
update(_I, _Ts) -> tdb_new().
diff --git a/lib/compiler/src/beam_utils.erl b/lib/compiler/src/beam_utils.erl
index 45cdf8a659..f281ad5eac 100644
--- a/lib/compiler/src/beam_utils.erl
+++ b/lib/compiler/src/beam_utils.erl
@@ -26,7 +26,7 @@
code_at/2,bif_to_test/3,is_pure_test/1,
live_opt/1,delete_live_annos/1,combine_heap_needs/2]).
--import(lists, [member/2,sort/1,reverse/1]).
+-import(lists, [member/2,sort/1,reverse/1,splitwith/2]).
-record(live,
{bl, %Block check fun.
@@ -195,10 +195,14 @@ is_pure_test({test,Op,_,Ops}) ->
%% Also insert {'%live',Live} annotations at the beginning
%% and end of each block.
%%
-live_opt([{label,Fail}=I1,
- {func_info,_,_,Live}=I2|Is]) ->
+live_opt(Is0) ->
+ {[{label,Fail}|_]=Bef,[Fi|Is]} =
+ splitwith(fun({func_info,_,_,_}) -> false;
+ (_) -> true
+ end, Is0),
+ {func_info,_,_,Live} = Fi,
D = gb_trees:insert(Fail, live_call(Live), gb_trees:empty()),
- [I1,I2|live_opt(reverse(Is), 0, D, [])].
+ Bef ++ [Fi|live_opt(reverse(Is), 0, D, [])].
%% delete_live_annos([Instruction]) -> [Instruction].
@@ -499,6 +503,8 @@ check_liveness(R, [{loop_rec,{f,_},{x,0}}|_], St) ->
end;
check_liveness(R, [{loop_rec_end,{f,Fail}}|_], St) ->
check_liveness_at(R, Fail, St);
+check_liveness(R, [{line,_}|Is], St) ->
+ check_liveness(R, Is, St);
check_liveness(_R, Is, St) when is_list(Is) ->
%% case Is of
%% [I|_] ->
@@ -799,6 +805,8 @@ live_opt([{wait,_}=I|Is], Regs, D, Acc) ->
live_opt(Is, Regs, D, [I|Acc]);
live_opt([{wait_timeout,_,{Tag,_}}=I|Is], Regs, D, Acc) when Tag =/= x ->
live_opt(Is, Regs, D, [I|Acc]);
+live_opt([{line,_}=I|Is], Regs, D, Acc) ->
+ live_opt(Is, Regs, D, [I|Acc]);
%% The following instructions can occur if the "compilation" has been
%% started from a .S file using the 'asm' option.
diff --git a/lib/compiler/src/beam_validator.erl b/lib/compiler/src/beam_validator.erl
index fb267b35b6..fe3b1680d9 100644
--- a/lib/compiler/src/beam_validator.erl
+++ b/lib/compiler/src/beam_validator.erl
@@ -166,12 +166,17 @@ validate(Module, Fs) ->
Ft = index_bs_start_match(Fs, []),
validate_0(Module, Fs, Ft).
-index_bs_start_match([{function,_,_,Entry,Code}|Fs], Acc0) ->
+index_bs_start_match([{function,_,_,Entry,Code0}|Fs], Acc0) ->
+ Code = dropwhile(fun({label,L}) when L =:= Entry -> false;
+ (_) -> true
+ end, Code0),
case Code of
- [_,_,{label,Entry}|Is] ->
+ [{label,Entry}|Is] ->
Acc = index_bs_start_match_1(Is, Entry, Acc0),
index_bs_start_match(Fs, Acc);
_ ->
+ %% Something serious is wrong. Ignore it for now.
+ %% It will be detected and diagnosed later.
index_bs_start_match(Fs, Acc0)
end;
index_bs_start_match([], Acc) ->
@@ -292,6 +297,8 @@ labels(Is) ->
labels_1([{label,L}|Is], R) ->
labels_1(Is, [L|R]);
+labels_1([{line,_}|Is], R) ->
+ labels_1(Is, R);
labels_1(Is, R) ->
{lists:reverse(R),Is}.
@@ -433,6 +440,8 @@ valfun_1(remove_message, Vst) ->
Vst;
valfun_1({'%',_}, Vst) ->
Vst;
+valfun_1({line,_}, Vst) ->
+ Vst;
%% Exception generating calls
valfun_1({call_ext,Live,Func}=I, Vst) ->
case return_type(Func, Vst) of
@@ -870,6 +879,8 @@ val_dsetel({set_tuple_element,_,_,_}, #vst{current=#st{setelem=false}}) ->
error(illegal_context_for_set_tuple_element);
val_dsetel({set_tuple_element,_,_,_}, #vst{current=#st{setelem=true}}=Vst) ->
Vst;
+val_dsetel({line,_}, Vst) ->
+ Vst;
val_dsetel(_, #vst{current=#st{setelem=true}=St}=Vst) ->
Vst#vst{current=St#st{setelem=false}};
val_dsetel(_, Vst) -> Vst.
diff --git a/lib/compiler/src/compile.erl b/lib/compiler/src/compile.erl
index ce8a5bf864..29c7ec0dcd 100644
--- a/lib/compiler/src/compile.erl
+++ b/lib/compiler/src/compile.erl
@@ -171,9 +171,9 @@ expand_opt(report, Os) ->
expand_opt(return, Os) ->
[return_errors,return_warnings|Os];
expand_opt(r12, Os) ->
- [no_recv_opt|Os];
+ [no_recv_opt,no_line_info|Os];
expand_opt(r13, Os) ->
- [no_recv_opt|Os];
+ [no_recv_opt,no_line_info|Os];
expand_opt({debug_info_key,_}=O, Os) ->
[encrypt_debug_info,O|Os];
expand_opt(no_float_opt, Os) ->
@@ -1426,6 +1426,8 @@ iofile(File) when is_atom(File) ->
iofile(File) ->
{filename:dirname(File), filename:basename(File, ".erl")}.
+erlfile(".", Base, Suffix) ->
+ Base ++ Suffix;
erlfile(Dir, Base, Suffix) ->
filename:join(Dir, Base ++ Suffix).
diff --git a/lib/compiler/src/genop.tab b/lib/compiler/src/genop.tab
index 63527bda8f..39c1e8297f 100644
--- a/lib/compiler/src/genop.tab
+++ b/lib/compiler/src/genop.tab
@@ -280,3 +280,7 @@ BEAM_FORMAT_NUMBER=0
150: recv_mark/1
151: recv_set/1
152: gc_bif3/7
+
+# R15A
+
+153: line/1
diff --git a/lib/compiler/src/v3_codegen.erl b/lib/compiler/src/v3_codegen.erl
index 55e3c58d2a..e7dae67085 100644
--- a/lib/compiler/src/v3_codegen.erl
+++ b/lib/compiler/src/v3_codegen.erl
@@ -79,9 +79,10 @@ module({Mod,Exp,Attr,Forms}, Options) ->
functions(Forms, AtomMod) ->
mapfoldl(fun (F, St) -> function(F, AtomMod, St) end, #cg{lcount=1}, Forms).
-function({function,Name,Arity,Asm0,Vb,Vdb}, AtomMod, St0) ->
+function({function,Name,Arity,Asm0,Vb,Vdb,Anno}, AtomMod, St0) ->
try
- {Asm,EntryLabel,St} = cg_fun(Vb, Asm0, Vdb, AtomMod, {Name,Arity}, St0),
+ {Asm,EntryLabel,St} = cg_fun(Vb, Asm0, Vdb, AtomMod,
+ {Name,Arity}, Anno, St0),
Func = {function,Name,Arity,EntryLabel,Asm},
{Func,St}
catch
@@ -93,7 +94,7 @@ function({function,Name,Arity,Asm0,Vb,Vdb}, AtomMod, St0) ->
%% cg_fun([Lkexpr], [HeadVar], Vdb, State) -> {[Ainstr],State}
-cg_fun(Les, Hvs, Vdb, AtomMod, NameArity, St0) ->
+cg_fun(Les, Hvs, Vdb, AtomMod, NameArity, Anno, St0) ->
{Fi,St1} = new_label(St0), %FuncInfo label
{Fl,St2} = local_func_label(NameArity, St1),
@@ -129,7 +130,7 @@ cg_fun(Les, Hvs, Vdb, AtomMod, NameArity, St0) ->
ultimate_failure=UltimateMatchFail,
is_top_block=true}),
{Name,Arity} = NameArity,
- Asm = [{label,Fi},{func_info,AtomMod,{atom,Name},Arity},
+ Asm = [{label,Fi},line(Anno),{func_info,AtomMod,{atom,Name},Arity},
{label,Fl}|B++[{label,UltimateMatchFail},if_end]],
{Asm,Fl,St}.
@@ -307,23 +308,23 @@ match_fail_cg({badmatch,Term}, Le, Vdb, Bef, St) ->
R = cg_reg_arg(Term, Bef),
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis ++ [{badmatch,R}],
+ {Sis ++ [line(Le),{badmatch,R}],
Int#sr{reg=clear_regs(Int0#sr.reg)},St};
match_fail_cg({case_clause,Reason}, Le, Vdb, Bef, St) ->
R = cg_reg_arg(Reason, Bef),
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis++[{case_end,R}],
+ {Sis++[line(Le),{case_end,R}],
Int#sr{reg=clear_regs(Bef#sr.reg)},St};
match_fail_cg(if_clause, Le, Vdb, Bef, St) ->
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int1} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis++[if_end],Int1#sr{reg=clear_regs(Int1#sr.reg)},St};
+ {Sis++[line(Le),if_end],Int1#sr{reg=clear_regs(Int1#sr.reg)},St};
match_fail_cg({try_clause,Reason}, Le, Vdb, Bef, St) ->
R = cg_reg_arg(Reason, Bef),
Int0 = clear_dead(Bef, Le#l.i, Vdb),
{Sis,Int} = adjust_stack(Int0, Le#l.i, Le#l.i+1, Vdb),
- {Sis ++ [{try_case_end,R}],
+ {Sis ++ [line(Le),{try_case_end,R}],
Int#sr{reg=clear_regs(Int0#sr.reg)},St}.
%% bsm_rename_ctx([Clause], Var) -> [Clause]
@@ -1047,7 +1048,7 @@ call_cg({var,_V} = Var, As, Rs, Le, Vdb, Bef, St0) ->
%% Build complete code and final stack/register state.
Arity = length(As),
{Frees,Aft} = free_dead(clear_dead(Int#sr{reg=Reg}, Le#l.i, Vdb)),
- {Sis ++ Frees ++ [{call_fun,Arity}],Aft,
+ {Sis ++ Frees ++ [line(Le),{call_fun,Arity}],Aft,
need_stack_frame(St0)};
call_cg({remote,Mod,Name}, As, Rs, Le, Vdb, Bef, St0)
when element(1, Mod) =:= var;
@@ -1057,11 +1058,10 @@ call_cg({remote,Mod,Name}, As, Rs, Le, Vdb, Bef, St0)
Reg = load_vars(Rs, clear_regs(Int#sr.reg)),
%% Build complete code and final stack/register state.
Arity = length(As),
- Call = {apply,Arity},
St = need_stack_frame(St0),
%%{Call,St1} = build_call(Func, Arity, St0),
{Frees,Aft} = free_dead(clear_dead(Int#sr{reg=Reg}, Le#l.i, Vdb)),
- {Sis ++ Frees ++ [Call],Aft,St};
+ {Sis ++ Frees ++ [line(Le),{apply,Arity}],Aft,St};
call_cg(Func, As, Rs, Le, Vdb, Bef, St0) ->
case St0 of
#cg{bfail=Fail} when Fail =/= 0 ->
@@ -1091,7 +1091,7 @@ call_cg(Func, As, Rs, Le, Vdb, Bef, St0) ->
Arity = length(As),
{Call,St1} = build_call(Func, Arity, St0),
{Frees,Aft} = free_dead(clear_dead(Int#sr{reg=Reg}, Le#l.i, Vdb)),
- {Sis ++ Frees ++ Call,Aft,St1}
+ {Sis ++ Frees ++ [line(Le)|Call],Aft,St1}
end.
build_call({remote,{atom,erlang},{atom,'!'}}, 2, St0) ->
@@ -1118,7 +1118,7 @@ enter_cg({var,_V} = Var, As, Le, Vdb, Bef, St0) ->
{Sis,Int} = cg_setup_call(As++[Var], Bef, Le#l.i, Vdb),
%% Build complete code and final stack/register state.
Arity = length(As),
- {Sis ++ [{call_fun,Arity},return],
+ {Sis ++ [line(Le),{call_fun,Arity},return],
clear_dead(Int#sr{reg=clear_regs(Int#sr.reg)}, Le#l.i, Vdb),
need_stack_frame(St0)};
enter_cg({remote,Mod,Name}, As, Le, Vdb, Bef, St0)
@@ -1127,9 +1127,8 @@ enter_cg({remote,Mod,Name}, As, Le, Vdb, Bef, St0)
{Sis,Int} = cg_setup_call(As++[Mod,Name], Bef, Le#l.i, Vdb),
%% Build complete code and final stack/register state.
Arity = length(As),
- Call = {apply_only,Arity},
St = need_stack_frame(St0),
- {Sis ++ [Call],
+ {Sis ++ [line(Le),{apply_only,Arity}],
clear_dead(Int#sr{reg=clear_regs(Int#sr.reg)}, Le#l.i, Vdb),
St};
enter_cg(Func, As, Le, Vdb, Bef, St0) ->
@@ -1137,7 +1136,8 @@ enter_cg(Func, As, Le, Vdb, Bef, St0) ->
%% Build complete code and final stack/register state.
Arity = length(As),
{Call,St1} = build_enter(Func, Arity, St0),
- {Sis ++ Call,
+ Line = enter_line(Func, Arity, Le),
+ {Sis ++ Line ++ Call,
clear_dead(Int#sr{reg=clear_regs(Int#sr.reg)}, Le#l.i, Vdb),
St1}.
@@ -1153,6 +1153,23 @@ build_enter(Name, Arity, St0) when is_atom(Name) ->
{Lbl,St1} = local_func_label(Name, Arity, St0),
{[{call_only,Arity,{f,Lbl}}],St1}.
+enter_line({remote,{atom,Mod},{atom,Name}}, Arity, Le) ->
+ case erl_bifs:is_safe(Mod, Name, Arity) of
+ false ->
+ %% Tail-recursive call, possibly to a BIF.
+ %% We'll need a line instruction in case the
+ %% BIF call fails.
+ [line(Le)];
+ true ->
+ %% Call to a safe BIF. Since it cannot fail,
+ %% we don't need any line instruction here.
+ []
+ end;
+enter_line(_, _, _) ->
+ %% Tail-recursive call to a local function. A line
+ %% instruction will not be useful.
+ [].
+
%% local_func_label(Name, Arity, State) -> {Label,State'}
%% local_func_label({Name,Arity}, State) -> {Label,State'}
%% Get the function entry label for a local function.
@@ -1226,9 +1243,10 @@ bif_cg(Bif, As, [{var,V}], Le, Vdb, Bef, St0) ->
%% Currently, we are somewhat pessimistic in
%% that we save any variable that will be live after this BIF call.
+ MayFail = not erl_bifs:is_safe(erlang, Bif, length(As)),
{Sis,Int0} = case St0#cg.in_catch andalso
St0#cg.bfail =:= 0 andalso
- not erl_bifs:is_safe(erlang, Bif, length(As)) of
+ MayFail of
true -> adjust_stack(Bef, Le#l.i, Le#l.i+1, Vdb);
false -> {[],Bef}
end,
@@ -1237,7 +1255,14 @@ bif_cg(Bif, As, [{var,V}], Le, Vdb, Bef, St0) ->
Int = Int1#sr{reg=Reg},
Dst = fetch_reg(V, Reg),
BifFail = {f,St0#cg.bfail},
- {Sis++[{bif,Bif,BifFail,Ars,Dst}],
+ %% We need a line instructions for BIFs that may fail in a body.
+ Line = case BifFail of
+ {f,0} when MayFail ->
+ [line(Le)];
+ _ ->
+ []
+ end,
+ {Sis++Line++[{bif,Bif,BifFail,Ars,Dst}],
clear_dead(Int, Le#l.i, Vdb), St0}.
@@ -1266,7 +1291,11 @@ gc_bif_cg(Bif, As, [{var,V}], Le, Vdb, Bef, St0) ->
Int = Int1#sr{reg=Reg},
Dst = fetch_reg(V, Reg),
BifFail = {f,St0#cg.bfail},
- {Sis++[{gc_bif,Bif,BifFail,max_reg(Bef#sr.reg),Ars,Dst}],
+ Line = case BifFail of
+ {f,0} -> [line(Le)];
+ {f,_} -> []
+ end,
+ {Sis++Line++[{gc_bif,Bif,BifFail,max_reg(Bef#sr.reg),Ars,Dst}],
clear_dead(Int, Le#l.i, Vdb), St0}.
%% recv_loop_cg(TimeOut, ReceiveVar, ReceiveMatch, TimeOutExprs,
@@ -1284,7 +1313,7 @@ recv_loop_cg(Te, Rvar, Rm, Tes, Rs, Le, Vdb, Bef, St0) ->
{Wis,Taft,St6} = cg_recv_wait(Te, Tes, Le#l.i, Int1, St5),
Int2 = sr_merge(Raft, Taft), %Merge stack/registers
Reg = load_vars(Rs, Int2#sr.reg),
- {Sis ++ Ris ++ [{label,Tl}] ++ Wis ++ [{label,Bl}],
+ {Sis ++ [line(Le)] ++ Ris ++ [{label,Tl}] ++ Wis ++ [{label,Bl}],
clear_dead(Int2#sr{reg=Reg}, Le#l.i, Vdb),
St6#cg{break=St0#cg.break,recv=St0#cg.recv}}.
@@ -1463,12 +1492,13 @@ cg_binary([{bs_put_binary,Fail,{atom,all},U,_Flags,Src}|PutCode],
{bs_append,Fail,Target,0,MaxRegs,U,Src,BinFlags,Target}
end] ++ PutCode,
cg_bin_opt(Code);
-cg_binary(PutCode, Target, Temp, Fail, MaxRegs, _Anno) ->
+cg_binary(PutCode, Target, Temp, Fail, MaxRegs, Anno) ->
+ Line = line(Anno),
Live = cg_live(Target, MaxRegs),
{InitOp,SzCode} = cg_binary_size(PutCode, Target, Temp, Fail, Live),
- Code = SzCode ++ [{InitOp,Fail,Target,0,MaxRegs,
- {field_flags,[]},Target}|PutCode],
+ Code = [Line|SzCode] ++ [{InitOp,Fail,Target,0,MaxRegs,
+ {field_flags,[]},Target}|PutCode],
cg_bin_opt(Code).
cg_live({x,X}, MaxRegs) when X =:= MaxRegs -> MaxRegs+1;
@@ -2052,6 +2082,38 @@ drop_catch(Tag, [Other|Stk]) -> [Other|drop_catch(Tag, Stk)].
new_label(#cg{lcount=Next}=St) ->
{Next,St#cg{lcount=Next+1}}.
+%% line(Le) -> {line,[] | {location,File,Line}}
+%% Create a line instruction, containing information about
+%% the current filename and line number. A line information
+%% instruction should be placed before any operation that could
+%% cause an exception.
+
+line(#l{a=Anno}) ->
+ line(Anno);
+line([Line,{file,Name}]) when is_integer(Line) ->
+ line_1(Name, Line);
+line([_|_]=A) ->
+ {Name,Line} = find_loc(A, no_file, 0),
+ line_1(Name, Line);
+line([]) ->
+ {line,[]}.
+
+line_1(no_file, _) ->
+ {line,[]};
+line_1(_, 0) ->
+ %% Missing line number or line number 0.
+ {line,[]};
+line_1(Name, Line) ->
+ {line,[{location,Name,abs(Line)}]}.
+
+find_loc([Line|T], File, _) when is_integer(Line) ->
+ find_loc(T, File, Line);
+find_loc([{file,File}|T], _, Line) ->
+ find_loc(T, File, Line);
+find_loc([_|T], File, Line) ->
+ find_loc(T, File, Line);
+find_loc([], File, Line) -> {File,Line}.
+
flatmapfoldl(F, Accu0, [Hd|Tail]) ->
{R,Accu1} = F(Hd, Accu0),
{Rs,Accu2} = flatmapfoldl(F, Accu1, Tail),
diff --git a/lib/compiler/src/v3_core.erl b/lib/compiler/src/v3_core.erl
index 87bb5bec25..6f3590b156 100644
--- a/lib/compiler/src/v3_core.erl
+++ b/lib/compiler/src/v3_core.erl
@@ -180,7 +180,7 @@ body(Cs0, Name, Arity, St0) ->
{Args,St1} = new_vars(Anno, Arity, St0),
{Cs1,St2} = clauses(Cs0, St1),
{Ps,St3} = new_vars(Arity, St2), %Need new variables here
- Fc = function_clause(Ps, {Name,Arity}),
+ Fc = function_clause(Ps, Anno, {Name,Arity}),
{#ifun{anno=#a{anno=Anno},id=[],vars=Args,clauses=Cs1,fc=Fc},St3}.
%% clause(Clause, State) -> {Cclause,State} | noclause.
@@ -507,15 +507,15 @@ expr({block,_,Es0}, St0) ->
{E1,Es1 ++ Eps,St2};
expr({'if',L,Cs0}, St0) ->
{Cs1,St1} = clauses(Cs0, St0),
- Fc = fail_clause([], #c_literal{val=if_clause}),
Lanno = lineno_anno(L, St1),
+ Fc = fail_clause([], Lanno, #c_literal{val=if_clause}),
{#icase{anno=#a{anno=Lanno},args=[],clauses=Cs1,fc=Fc},[],St1};
expr({'case',L,E0,Cs0}, St0) ->
{E1,Eps,St1} = novars(E0, St0),
{Cs1,St2} = clauses(Cs0, St1),
{Fpat,St3} = new_var(St2),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=case_clause},Fpat])),
- Lanno = lineno_anno(L, St3),
+ Lanno = lineno_anno(L, St2),
+ Fc = fail_clause([Fpat], Lanno, c_tuple([#c_literal{val=case_clause},Fpat])),
{#icase{anno=#a{anno=Lanno},args=[E1],clauses=Cs1,fc=Fc},Eps,St3};
expr({'receive',L,Cs0}, St0) ->
{Cs1,St1} = clauses(Cs0, St0),
@@ -541,9 +541,10 @@ expr({'try',L,Es0,Cs0,Ecs,[]}, St0) ->
{V,St2} = new_var(St1), %This name should be arbitrary
{Cs1,St3} = clauses(Cs0, St2),
{Fpat,St4} = new_var(St3),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=try_clause},Fpat])),
+ Lanno = lineno_anno(L, St4),
+ Fc = fail_clause([Fpat], Lanno,
+ c_tuple([#c_literal{val=try_clause},Fpat])),
{Evs,Hs,St5} = try_exception(Ecs, St4),
- Lanno = lineno_anno(L, St1),
{#itry{anno=#a{anno=lineno_anno(L, St5)},args=Es1,
vars=[V],body=[#icase{anno=#a{anno=Lanno},args=[V],clauses=Cs1,fc=Fc}],
evars=Evs,handler=Hs},
@@ -607,8 +608,8 @@ expr({match,L,P0,E0}, St0) ->
Thrown
end,
{Fpat,St4} = new_var(St3),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=badmatch},Fpat])),
Lanno = lineno_anno(L, St4),
+ Fc = fail_clause([Fpat], Lanno, c_tuple([#c_literal{val=badmatch},Fpat])),
case P2 of
nomatch ->
St = add_warning(L, nomatch, St4),
@@ -828,8 +829,9 @@ fun_tq({_,_,Name}=Id, Cs0, L, St0) ->
{Cs1,St1} = clauses(Cs0, St0),
{Args,St2} = new_vars(Arity, St1),
{Ps,St3} = new_vars(Arity, St2), %Need new variables here
- Fc = function_clause(Ps, {Name,Arity}),
- Fun = #ifun{anno=#a{anno=lineno_anno(L, St3)},
+ Anno = lineno_anno(L, St3),
+ Fc = function_clause(Ps, Anno, {Name,Arity}),
+ Fun = #ifun{anno=#a{anno=Anno},
id=[{id,Id}], %We KNOW!
vars=Args,clauses=Cs1,fc=Fc},
{Fun,[],St3}.
@@ -929,7 +931,7 @@ lc_tq(Line, E, [{b_generate,Lg,P,G}|Qs0], Mc, St0) ->
[],St};
lc_tq(Line, E, [Fil0|Qs0], Mc, St0) ->
%% Special case sequences guard tests.
- LA = lineno_anno(Line, St0),
+ LA = lineno_anno(element(2, Fil0), St0),
LAnno = #a{anno=LA},
case is_guard_test(Fil0) of
true ->
@@ -945,7 +947,8 @@ lc_tq(Line, E, [Fil0|Qs0], Mc, St0) ->
false ->
{Lc,Lps,St1} = lc_tq(Line, E, Qs0, Mc, St0),
{Fpat,St2} = new_var(St1),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=case_clause},Fpat])),
+ Fc = fail_clause([Fpat], LA,
+ c_tuple([#c_literal{val=case_clause},Fpat])),
%% Do a novars little optimisation here.
{Filc,Fps,St3} = novars(Fil0, St2),
{#icase{anno=LAnno,
@@ -1072,7 +1075,7 @@ bc_tq1(Line, E, [{b_generate,Lg,P,G}|Qs0], AccExpr, St0) ->
[],St};
bc_tq1(Line, E, [Fil0|Qs0], AccVar, St0) ->
%% Special case sequences guard tests.
- LA = lineno_anno(Line, St0),
+ LA = lineno_anno(element(2, Fil0), St0),
LAnno = #a{anno=LA},
case is_guard_test(Fil0) of
true ->
@@ -1089,7 +1092,8 @@ bc_tq1(Line, E, [Fil0|Qs0], AccVar, St0) ->
false ->
{Bc,Bps,St1} = bc_tq1(Line, E, Qs0, AccVar, St0),
{Fpat,St2} = new_var(St1),
- Fc = fail_clause([Fpat], c_tuple([#c_literal{val=case_clause},Fpat])),
+ Fc = fail_clause([Fpat], LA,
+ c_tuple([#c_literal{val=case_clause},Fpat])),
%% Do a novars little optimisation here.
{Filc,Fps,St} = novars(Fil0, St2),
{#icase{anno=LAnno,
@@ -1562,17 +1566,11 @@ new_vars_1(N, Anno, St0, Vs) when N > 0 ->
new_vars_1(N-1, Anno, St1, [V|Vs]);
new_vars_1(0, _, St, Vs) -> {Vs,St}.
-function_clause(Ps, Name) ->
- function_clause(Ps, [], Name).
-
function_clause(Ps, LineAnno, Name) ->
- FcAnno = [{function_name,Name}],
+ FcAnno = [{function_name,Name}|LineAnno],
fail_clause(Ps, FcAnno,
ann_c_tuple(LineAnno, [#c_literal{val=function_clause}|Ps])).
-fail_clause(Pats, Arg) ->
- fail_clause(Pats, [], Arg).
-
fail_clause(Pats, Anno, Arg) ->
#iclause{anno=#a{anno=[compiler_generated]},
pats=Pats,guard=[],
diff --git a/lib/compiler/src/v3_kernel.erl b/lib/compiler/src/v3_kernel.erl
index 3b33a08cf7..4e06b464a4 100644
--- a/lib/compiler/src/v3_kernel.erl
+++ b/lib/compiler/src/v3_kernel.erl
@@ -247,7 +247,7 @@ expr(#c_var{anno=A,name={_Name,Arity}}=Fname, Sub, St) ->
%% instead of one for each occurrence as done now.
Vs = [#c_var{name=list_to_atom("V" ++ integer_to_list(V))} ||
V <- integers(1, Arity)],
- Fun = #c_fun{anno=A,vars=Vs,body=#c_apply{op=Fname,args=Vs}},
+ Fun = #c_fun{anno=A,vars=Vs,body=#c_apply{anno=A,op=Fname,args=Vs}},
expr(Fun, Sub, St);
expr(#c_var{anno=A,name=V}, Sub, St) ->
{#k_var{anno=A,name=get_vsub(V, Sub)},[],St};
@@ -291,7 +291,7 @@ expr(#c_binary{anno=A,segments=Cv}, Sub, St0) ->
Erl = #c_literal{val=erlang},
Name = #c_literal{val=error},
Args = [#c_literal{val=badarg}],
- Error = #c_call{module=Erl,name=Name,args=Args},
+ Error = #c_call{anno=A,module=Erl,name=Name,args=Args},
expr(Error, Sub, St0)
end;
expr(#c_fun{anno=A,vars=Cvs,body=Cb}, Sub0, #kern{ff=OldFF,func=Func}=St0) ->
@@ -1167,9 +1167,7 @@ select_bin_int_1(_, _, _, _) -> throw(not_possible).
select_assert_match_possible(Sz, Val, Fs) ->
EmptyBindings = erl_eval:new_bindings(),
- MatchFun = fun({integer,_,_}, NewV, Bs) when NewV =:= Val ->
- {match,Bs}
- end,
+ MatchFun = match_fun(Val),
EvalFun = fun({integer,_,S}, B) -> {value,S,B} end,
Expr = [{bin_element,0,{integer,0,Val},{integer,0,Sz},[{unit,1}|Fs]}],
{value,Bin,EmptyBindings} = eval_bits:expr_grp(Expr, EmptyBindings, EvalFun),
@@ -1184,6 +1182,11 @@ select_assert_match_possible(Sz, Val, Fs) ->
throw(not_possible)
end.
+match_fun(Val) ->
+ fun(match, {{integer,_,_},NewV,Bs}) when NewV =:= Val ->
+ {match,Bs}
+ end.
+
select_utf8(Val0) ->
try
Bin = <<Val0/utf8>>,
diff --git a/lib/compiler/src/v3_life.erl b/lib/compiler/src/v3_life.erl
index a7a4d4dc91..a1d92af9f8 100644
--- a/lib/compiler/src/v3_life.erl
+++ b/lib/compiler/src/v3_life.erl
@@ -65,7 +65,7 @@ functions([], Acc) -> reverse(Acc).
%% function(Kfunc) -> Func.
-function(#k_fdef{func=F,arity=Ar,vars=Vs,body=Kb}) ->
+function(#k_fdef{anno=#k{a=Anno},func=F,arity=Ar,vars=Vs,body=Kb}) ->
try
As = var_list(Vs),
Vdb0 = foldl(fun ({var,N}, Vdb) -> new_var(N, 0, Vdb) end, [], As),
@@ -80,7 +80,7 @@ function(#k_fdef{func=F,arity=Ar,vars=Vs,body=Kb}) ->
put(guard_refc, 0),
{B1,_,Vdb1} = body(B0, 1, Vdb0),
erase(guard_refc),
- {function,F,Ar,As,B1,Vdb1}
+ {function,F,Ar,As,B1,Vdb1,Anno}
catch
Class:Error ->
Stack = erlang:get_stacktrace(),
diff --git a/lib/compiler/test/bs_match_SUITE.erl b/lib/compiler/test/bs_match_SUITE.erl
index 6a795f6634..f8c71a0257 100644
--- a/lib/compiler/test/bs_match_SUITE.erl
+++ b/lib/compiler/test/bs_match_SUITE.erl
@@ -1028,8 +1028,8 @@ haystack_2(Haystack) ->
fc({'EXIT',{function_clause,_}}) -> ok;
fc({'EXIT',{{case_clause,_},_}}) when ?MODULE =:= bs_match_inline_SUITE -> ok.
-fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Args}|_]}}) -> ok;
-fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Arity}|_]}})
+fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Args,_}|_]}}) -> ok;
+fc(Name, Args, {'EXIT',{function_clause,[{?MODULE,Name,Arity,_}|_]}})
when length(Args) =:= Arity ->
true = test_server:is_native(?MODULE);
fc(_, Args, {'EXIT',{{case_clause,ActualArgs},_}})
diff --git a/lib/compiler/test/compile_SUITE.erl b/lib/compiler/test/compile_SUITE.erl
index b3e5376ffd..8c6a623dfb 100644
--- a/lib/compiler/test/compile_SUITE.erl
+++ b/lib/compiler/test/compile_SUITE.erl
@@ -82,6 +82,7 @@ file_1(Config) when is_list(Config) ->
?line {ok,simple} = compile:file(Simple, [native,report]), %Smoke test.
?line {ok,simple} = compile:file(Target, [native,from_beam]), %Smoke test.
?line {ok,simple} = compile:file(Simple, [debug_info]),
+ ?line {ok,simple} = compile:file(Simple, [no_line_info]), %Coverage
?line ok = file:set_cwd(Cwd),
?line true = exists(Target),
?line passed = run(Target, test, []),
diff --git a/lib/compiler/test/guard_SUITE.erl b/lib/compiler/test/guard_SUITE.erl
index 0e69efba6b..40711783ed 100644
--- a/lib/compiler/test/guard_SUITE.erl
+++ b/lib/compiler/test/guard_SUITE.erl
@@ -32,7 +32,8 @@
t_is_boolean/1,is_function_2/1,
tricky/1,rel_ops/1,literal_type_tests/1,
basic_andalso_orelse/1,traverse_dcd/1,
- check_qlc_hrl/1,andalso_semi/1,t_tuple_size/1,binary_part/1]).
+ check_qlc_hrl/1,andalso_semi/1,t_tuple_size/1,binary_part/1,
+ bad_constants/1]).
suite() -> [{ct_hooks,[ts_install_cth]}].
@@ -44,7 +45,8 @@ all() ->
more_xor_guards, build_in_guard, old_guard_tests, gbif,
t_is_boolean, is_function_2, tricky, rel_ops,
literal_type_tests, basic_andalso_orelse, traverse_dcd,
- check_qlc_hrl, andalso_semi, t_tuple_size, binary_part].
+ check_qlc_hrl, andalso_semi, t_tuple_size, binary_part,
+ bad_constants].
groups() ->
[].
@@ -1517,8 +1519,27 @@ bptest(B,A,C) when erlang:binary_part(B,{A,C}) =:= <<3,3>> ->
bptest(_,_,_) ->
error.
-
-
+-define(FAILING(C),
+ if
+ C -> ?t:fail(should_fail);
+ true -> ok
+ end,
+ if
+ true, C -> ?t:fail(should_fail);
+ true -> ok
+ end).
+
+bad_constants(Config) when is_list(Config) ->
+ ?line ?FAILING(false),
+ ?line ?FAILING([]),
+ ?line ?FAILING([a]),
+ ?line ?FAILING([Config]),
+ ?line ?FAILING({a,b}),
+ ?line ?FAILING({a,Config}),
+ ?line ?FAILING(<<1>>),
+ ?line ?FAILING(42),
+ ?line ?FAILING(3.14),
+ ok.
%% Call this function to turn off constant propagation.
id(I) -> I.
diff --git a/lib/compiler/test/inline_SUITE.erl b/lib/compiler/test/inline_SUITE.erl
index af2b8ec92a..086fba2649 100644
--- a/lib/compiler/test/inline_SUITE.erl
+++ b/lib/compiler/test/inline_SUITE.erl
@@ -263,7 +263,8 @@ my_apply(M, F, A, Init) ->
really_inlined(Config) when is_list(Config) ->
%% Make sure that badarg/2 really gets inlined.
- {'EXIT',{badarg,[{?MODULE,fail_me_now,[]}|_]}} = (catch fail_me_now()),
+ {'EXIT',{badarg,[{?MODULE,fail_me_now,[],_}|_]}} =
+ (catch fail_me_now()),
ok.
fail_me_now() ->
diff --git a/lib/compiler/test/lc_SUITE.erl b/lib/compiler/test/lc_SUITE.erl
index c8908858ba..f5948504b3 100644
--- a/lib/compiler/test/lc_SUITE.erl
+++ b/lib/compiler/test/lc_SUITE.erl
@@ -179,8 +179,8 @@ empty_generator(Config) when is_list(Config) ->
id(I) -> I.
-fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Args}|_]}}) -> ok;
-fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Arity}|_]}})
+fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Args,_}|_]}}) -> ok;
+fc(Args, {'EXIT',{function_clause,[{?MODULE,_,Arity,_}|_]}})
when length(Args) =:= Arity ->
true = test_server:is_native(?MODULE);
fc(Args, {'EXIT',{{case_clause,ActualArgs},_}})
diff --git a/lib/compiler/test/misc_SUITE.erl b/lib/compiler/test/misc_SUITE.erl
index c941a80e61..9b414cade6 100644
--- a/lib/compiler/test/misc_SUITE.erl
+++ b/lib/compiler/test/misc_SUITE.erl
@@ -179,7 +179,7 @@ silly_coverage(Config) when is_list(Config) ->
?line expect_error(fun() -> v3_life:module(BadKernel, []) end),
%% v3_codegen
- CodegenInput = {?MODULE,[{foo,0}],[],[{function,foo,0,[a|b],a,b}]},
+ CodegenInput = {?MODULE,[{foo,0}],[],[{function,foo,0,[a|b],a,b,[]}]},
?line expect_error(fun() -> v3_codegen:module(CodegenInput, []) end),
%% beam_block
@@ -187,7 +187,7 @@ silly_coverage(Config) when is_list(Config) ->
[{function,foo,0,2,
[{label,1},
{func_info,{atom,?MODULE},{atom,foo},0},
- {label,2}|non_proper_list],99}]},
+ {label,2}|non_proper_list]}],99},
?line expect_error(fun() -> beam_block:module(BlockInput, []) end),
%% beam_bool
diff --git a/lib/compiler/test/trycatch_SUITE.erl b/lib/compiler/test/trycatch_SUITE.erl
index c6e0f8d85d..760cf17225 100644
--- a/lib/compiler/test/trycatch_SUITE.erl
+++ b/lib/compiler/test/trycatch_SUITE.erl
@@ -314,19 +314,19 @@ eclectic(Conf) when is_list(Conf) ->
V = {make_ref(),3.1415926535,[[]|{}]},
?line {{value,{value,V},V},V} =
eclectic_1({foo,{value,{value,V}}}, undefined, {value,V}),
- ?line {{'EXIT',{V,[{?MODULE,foo,1}|_]}},V} =
+ ?line {{'EXIT',{V,[{?MODULE,foo,1,_}|_]}},V} =
eclectic_1({catch_foo,{error,V}}, undefined, {value,V}),
?line {{error,{exit,V},{'EXIT',V}},V} =
eclectic_1({foo,{error,{exit,V}}}, error, {value,V}),
?line {{value,{value,V},V},
- {'EXIT',{badarith,[{?MODULE,my_add,2}|_]}}} =
+ {'EXIT',{badarith,[{?MODULE,my_add,2,_}|_]}}} =
eclectic_1({foo,{value,{value,V}}}, undefined, {'add',{0,a}}),
?line {{'EXIT',V},V} =
eclectic_1({catch_foo,{exit,V}}, undefined, {throw,V}),
- ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,2}|_]}}},
+ ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,2,_}|_]}}},
{'EXIT',V}} =
eclectic_1({foo,{error,{'div',{1,0}}}}, error, {exit,V}),
- ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,1}|_]}}},
+ ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,1,_}|_]}}},
{'EXIT',V}} =
eclectic_1({catch_foo,{throw,{error,V}}}, undefined, {exit,V}),
%%
@@ -336,15 +336,15 @@ eclectic(Conf) when is_list(Conf) ->
eclectic_2({throw,{value,V}}, throw, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{value,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1,_}|_]}}},undefined} =
eclectic_2({error,{value,V}}, throw, {error,V}),
- ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V]}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V],_}|_]}}},V} =
eclectic_2({value,{'abs',V}}, undefined, {value,V}),
- ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,2}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,2,_}|_]}}},V} =
eclectic_2({exit,{'add',{0,a}}}, exit, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{error,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,1,_}|_]}}},undefined} =
eclectic_2({throw,{'div',{1,0}}}, throw, {error,V}),
ok.
diff --git a/lib/cosEvent/src/Makefile b/lib/cosEvent/src/Makefile
index a62d47ce74..c774d18380 100644
--- a/lib/cosEvent/src/Makefile
+++ b/lib/cosEvent/src/Makefile
@@ -177,16 +177,18 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES1) $(EXTERNAL_GEN_HRL_FILES1): CosEventChannelAdmin.idl
+
+IDL-GENERATED: CosEventChannelAdmin.idl cosEventApp.idl CosEventComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosEventChannelAdmin.cfg"}' CosEventChannelAdmin.idl
mv $(GEN_HRL_FILES1) $(EXTERNAL_INC_PATH)
-
-$(GEN_ERL_FILES2) $(GEN_HRL_FILES2): cosEventApp.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"cosEventApp.cfg"}' cosEventApp.idl
-
-$(GEN_ERL_FILES3) $(EXTERNAL_GEN_HRL_FILES3): CosEventComm.idl
erlc $(ERL_IDL_FLAGS) CosEventComm.idl
mv $(GEN_HRL_FILES3) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosEvent/test/Makefile b/lib/cosEvent/test/Makefile
index c59c7ee315..c3f07c156f 100644
--- a/lib/cosEvent/test/Makefile
+++ b/lib/cosEvent/test/Makefile
@@ -121,17 +121,13 @@ docs:
# Special Targets
# ----------------------------------------------------
-#
-# Each IDL file produces many target files so no pattern
-# rule can be used.
-#
-TGT_COS = \
- $(GEN_HRL_COS:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_COS:%=$(IDLOUTDIR)/%.erl)
+IDL-GENERATED: event_test_server.idl
+ erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) event_test_server.idl
+ >IDL-GENERATED
+$(GEN_FILES): IDL-GENERATED
-$(TGT_COS): event_test_server.idl
- erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) event_test_server.idl
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/cosEventDomain/src/Makefile b/lib/cosEventDomain/src/Makefile
index 56a67cd225..91bef4e7e6 100644
--- a/lib/cosEventDomain/src/Makefile
+++ b/lib/cosEventDomain/src/Makefile
@@ -150,9 +150,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(EXTERNAL_GEN_HRL_FILES): CosEventDomainAdmin.idl
+IDL-GENERATED: CosEventDomainAdmin.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosEventDomainAdmin.cfg"}' CosEventDomainAdmin.idl
mv $(GEN_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosFileTransfer/src/Makefile b/lib/cosFileTransfer/src/Makefile
index 773ed7f6b7..17e82f9bc2 100644
--- a/lib/cosFileTransfer/src/Makefile
+++ b/lib/cosFileTransfer/src/Makefile
@@ -161,9 +161,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(GEN_HRL_FILES): CosFileTransfer.idl
+IDL-GENERATED: CosFileTransfer.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosFileTransfer.cfg"}' CosFileTransfer.idl
mv $(LOCAL_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosNotification/src/Makefile b/lib/cosNotification/src/Makefile
index 637c633e52..b976ab94f3 100644
--- a/lib/cosNotification/src/Makefile
+++ b/lib/cosNotification/src/Makefile
@@ -242,20 +242,26 @@ GEN_OE_EVENTCOMM_HRL_FILES = \
oe_CosNotificationComm.hrl \
oe_CosNotificationComm_Event.hrl
-GEN_ERL_FILES = \
+IDL_GEN_ERL_FILES = \
$(GEN_NOTIFICATION_ERL_FILES) \
$(GEN_OE_EVENTCOMM_ERL_FILES) \
$(GEN_NOTIFYCOMM_ERL_FILES) \
$(GEN_NOTIFYFILTER_ERL_FILES) \
- $(GEN_CHANNELADMIN_ERL_FILES) \
- $(GEN_YECC_ERL_FILES)
+ $(GEN_CHANNELADMIN_ERL_FILES)
-GEN_HRL_FILES = \
+IDL_GEN_HRL_FILES = \
$(EXTERNAL_GEN_NOTIFICATION_HRL_FILES) \
$(GEN_OE_EVENTCOMM_HRL_FILES) \
$(EXTERNAL_GEN_NOTIFYCOMM_HRL_FILES) \
$(EXTERNAL_GEN_NOTIFYFILTER_HRL_FILES) \
- $(EXTERNAL_GEN_CHANNELADMIN_HRL_FILES) \
+ $(EXTERNAL_GEN_CHANNELADMIN_HRL_FILES)
+
+GEN_ERL_FILES = \
+ $(IDL_GEN_ERL_FILES) \
+ $(GEN_YECC_ERL_FILES)
+
+GEN_HRL_FILES = \
+ $(IDL_GEN_HRL_FILES) \
$(GEN_YECC_HRL_FILES)
@@ -336,20 +342,23 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_NOTIFICATION_ERL_FILES) $(EXTERNAL_GEN_NOTIFICATION_HRL_FILES): CosNotification.idl
+IDL-GENERATED: CosNotification.idl CosNotifyChannelAdmin.idl \
+ CosNotifyFilter.idl cosNotificationAppComm.idl CosNotifyComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotification.cfg"}' CosNotification.idl
mv $(GEN_NOTIFICATION_HRL_FILES) $(EXTERNAL_INC_PATH)
-$(GEN_CHANNELADMIN_ERL_FILES) $(EXTERNAL_GEN_CHANNELADMIN_HRL_FILES): CosNotifyChannelAdmin.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotifyChannelAdmin.cfg"}' CosNotifyChannelAdmin.idl
mv $(GEN_CHANNELADMIN_HRL_FILES) $(EXTERNAL_INC_PATH)
-$(GEN_NOTIFYFILTER_ERL_FILES) $(EXTERNAL_GEN_NOTIFYFILTER_HRL_FILES): CosNotifyFilter.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotifyFilter.cfg"}' CosNotifyFilter.idl
mv $(GEN_NOTIFYFILTER_HRL_FILES) $(EXTERNAL_INC_PATH)
-$(GEN_OE_EVENTCOMM_ERL_FILES) $(GEN_OE_EVENTCOMM_HRL_FILES): cosNotificationAppComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"cosNotificationComm.cfg"}' cosNotificationAppComm.idl
-$(GEN_NOTIFYCOMM_ERL_FILES) $(EXTERNAL_GEN_NOTIFYCOMM_HRL_FILES): CosNotifyComm.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosNotifyComm.cfg"}' CosNotifyComm.idl
mv $(GEN_NOTIFYCOMM_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(IDL_GEN_ERL_FILES) $(IDL_GEN_HRL_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
+
$(GEN_YECC_ERL_FILES) $(GEN_YECC_HRL_FILES): cosNotification_Grammar.yrl
# ----------------------------------------------------
diff --git a/lib/cosNotification/test/Makefile b/lib/cosNotification/test/Makefile
index 43f73addae..f509370430 100644
--- a/lib/cosNotification/test/Makefile
+++ b/lib/cosNotification/test/Makefile
@@ -161,13 +161,14 @@ docs:
# Special Targets
# ----------------------------------------------------
-TGT_TEST = \
- $(GEN_HRL_FILES:%=$(IDLOUTDIR)/%) \
- $(GEN_MODULES:%=$(IDLOUTDIR)/%.erl)
-
-$(TGT_TEST): notify_test_server.idl
+IDL-GENERATED: notify_test_server.idl
erlc $(ERL_COMPILE_FLAGS) -o$(IDLOUTDIR) \
+'{cfgfile,"notify_test_server.cfg"}' notify_test_server.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/cosProperty/src/Makefile b/lib/cosProperty/src/Makefile
index 1d2119dfb3..d12554b18d 100644
--- a/lib/cosProperty/src/Makefile
+++ b/lib/cosProperty/src/Makefile
@@ -161,10 +161,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(GEN_HRL_FILES): CosProperty.idl
+IDL-GENERATED: CosProperty.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosProperty.cfg"}' CosProperty.idl
mv $(LOCAL_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosTime/src/Makefile b/lib/cosTime/src/Makefile
index 3b6f7bae2e..1793822fb6 100644
--- a/lib/cosTime/src/Makefile
+++ b/lib/cosTime/src/Makefile
@@ -176,17 +176,18 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_TIMEBASE_ERL_FILES) $(EXTERNAL_TIMEBASE_HRL_FILES): TimeBase.idl
+IDL-GENERATED: TimeBase.idl CosTime.idl CosTimerEvent.idl
erlc $(ERL_IDL_FLAGS) TimeBase.idl
mv $(GEN_TIMEBASE_HRL_FILES) $(EXTERNAL_INC_PATH)
-
-$(GEN_COSTIME_ERL_FILES) $(EXTERNAL_COSTIME_HRL_FILES): CosTime.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosTime.cfg"}' CosTime.idl
mv $(GEN_COSTIME_HRL_FILES) $(EXTERNAL_INC_PATH)
-
-$(GEN_COSTIMEREVENT_ERL_FILES) $(EXTERNAL_COSTIMEREVENT_HRL_FILES): CosTimerEvent.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosTimerEvent.cfg"}' CosTimerEvent.idl
mv $(GEN_COSTIMEREVENT_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosTransactions/src/Makefile b/lib/cosTransactions/src/Makefile
index 7e10ec175b..4b77251c3c 100644
--- a/lib/cosTransactions/src/Makefile
+++ b/lib/cosTransactions/src/Makefile
@@ -155,9 +155,14 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES) $(EXTERNAL_GEN_HRL_FILES): CosTransactions.idl
+IDL-GENERATED: CosTransactions.idl
erlc $(ERL_IDL_FLAGS) +'{cfgfile,"CosTransactions.cfg"}' CosTransactions.idl
mv $(GEN_HRL_FILES) $(EXTERNAL_INC_PATH)
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/cosTransactions/test/Makefile b/lib/cosTransactions/test/Makefile
index 44c90e8f84..0bc8c007da 100644
--- a/lib/cosTransactions/test/Makefile
+++ b/lib/cosTransactions/test/Makefile
@@ -121,13 +121,14 @@ docs:
# Special Targets
# ----------------------------------------------------
-TGT_TEST = \
- $(GEN_HRL_FILES:%=$(IDLOUTDIR)/%) \
- $(GEN_MODULES:%=$(IDLOUTDIR)/%.erl)
-
-$(TGT_TEST): etrap_test.idl
+IDL-GENERATED: etrap_test.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) \
+'{cfgfile,"etrap_test.cfg"}' etrap_test.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/crypto/c_src/Makefile.in b/lib/crypto/c_src/Makefile.in
index 276c84d601..775e5a9b89 100644
--- a/lib/crypto/c_src/Makefile.in
+++ b/lib/crypto/c_src/Makefile.in
@@ -94,13 +94,9 @@ endif
# Targets
# ----------------------------------------------------
-debug opt valgrind: $(OBJDIR) $(LIBDIR) $(NIF_LIB)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(LIBDIR):
- -@mkdir -p $(LIBDIR)
+debug opt valgrind: $(NIF_LIB)
$(OBJDIR)/%$(TYPEMARKER).o: %.c
$(INSTALL_DIR) $(OBJDIR)
diff --git a/lib/debugger/doc/src/debugger_chapter.xml b/lib/debugger/doc/src/debugger_chapter.xml
index 1f5d4dd5ff..2d812b0236 100644
--- a/lib/debugger/doc/src/debugger_chapter.xml
+++ b/lib/debugger/doc/src/debugger_chapter.xml
@@ -254,19 +254,17 @@ c_break(Bindings) ->
used, for example, if an error occurs:</p>
<pre>
1> <input>catch a+1.</input>
-{'EXIT',{badarith,[{erlang,'+',[a,1]},
- {erl_eval,do_apply,5},
- {erl_eval,expr,5},
- {shell,exprs,6},
- {shell,eval_exprs,6},
- {shell,eval_loop,3}]}}</pre>
-
- <p>In the case above, the stack trace shows that the function called
- last was <c>erl_eval:eval_op/3</c>. See <em>Erlang Reference
- Manual, Errors and Error handling</em>, for more information
- about stack trace.</p>
-
- <p>Debugger emulates the stack trace by keeping track of recently
+{'EXIT',{badarith,[{erlang,'+',[a,1],[]},
+ {erl_eval,do_apply,5,[{file,"erl_eval.erl"},{line,562}]},
+ {erl_eval,expr,5,[{file,"erl_eval.erl"},{line,359}]},
+ {shell,exprs,7,[{file,"shell.erl"},{line,668}]},
+ {shell,eval_exprs,7,[{file,"shell.erl"},{line,623}]},
+ {shell,eval_loop,3,[{file,"shell.erl"},{line,608}]}]}}</pre>
+
+ <p>See the <em>Erlang Reference Manual, Errors and Error handling</em>,
+ for more information about the stack trace.</p>
+
+ <p>The Debugger emulates the stack trace by keeping track of recently
called interpreted functions. (The real stack trace cannot be
used, as it shows which functions of the Debugger have been
called, rather than which interpreted functions).</p>
@@ -276,17 +274,15 @@ c_break(Bindings) ->
<seealso marker="#attach">the Attach Process window</seealso>.
</p>
- <p>By default, the Debugger saves information about all current
+ <p>By default, the Debugger only saves information about recursive
function calls, that is, function calls that have not yet returned
- a value (option 'Stack On, Tail').</p>
-
- <p>This means, however, that information is saved also for tail
- recursive calls. For example, repeated calls to the <c>loop</c>
- function of an Erlang process. This may consume unnecessary
- amounts of memory for debugged processes with long lifetimes and
- many tail recursive calls. It is therefore possible to set
- the option 'Stack On, no tail', in which case information about
- previous calls are discarded when a tail recursive call is made.
+ a value (option 'Stack On, No Tail').</p>
+
+ <p>Sometimes, however, it can be useful to save all calls, even
+ tail-recursive calls. That can be done with the 'Stack On, Tail'
+ option. Note that this option will consume more memory and slow
+ down execution of interpreted functions when there are many
+ tail-recursive calls.
</p>
<p>It is also possible to turn off the Debugger stack trace
diff --git a/lib/debugger/doc/src/int.xml b/lib/debugger/doc/src/int.xml
index 8b55461a44..c9d815755d 100644
--- a/lib/debugger/doc/src/int.xml
+++ b/lib/debugger/doc/src/int.xml
@@ -284,12 +284,12 @@ spawn(Module, Name, [Pid | Args])
<list>
<item><c>all</c> - save information about all current calls,
that is, function calls that have not yet returned a value.
- This is the default.</item>
+ </item>
<item><c>no_tail</c> - save information about current calls,
but discard previous information when a tail recursive call
is made. This option consumes less memory and may be
necessary to use for processes with long lifetimes and many
- tail recursive calls.</item>
+ tail recursive calls. This is the default.</item>
<item><c>false</c> - do not save any information about current
calls.</item>
</list>
diff --git a/lib/debugger/src/Makefile b/lib/debugger/src/Makefile
index 8551fe887d..6dc7d0d783 100644
--- a/lib/debugger/src/Makefile
+++ b/lib/debugger/src/Makefile
@@ -44,6 +44,7 @@ MODULES= \
dbg_ieval \
dbg_iload \
dbg_iserver \
+ dbg_istk \
dbg_ui_break \
dbg_ui_break_win \
dbg_ui_edit \
diff --git a/lib/debugger/src/dbg_debugged.erl b/lib/debugger/src/dbg_debugged.erl
index 3732c40c73..18dcd92ff3 100644
--- a/lib/debugger/src/dbg_debugged.erl
+++ b/lib/debugger/src/dbg_debugged.erl
@@ -76,8 +76,8 @@ msg_loop(Meta, Mref, SaveStacktrace) ->
msg_loop(Meta, Mref, SaveStacktrace);
%% Meta needs something evaluated within context of real process
- {sys, Meta, {command, Command, Stacktrace}} ->
- Reply = handle_command(Command, Stacktrace),
+ {sys, Meta, {command,Command}} ->
+ Reply = handle_command(Command),
Meta ! {sys, self(), Reply},
msg_loop(Meta, Mref, SaveStacktrace);
@@ -93,11 +93,12 @@ msg_loop(Meta, Mref, SaveStacktrace) ->
end
end.
-handle_command(Command, Stacktrace) ->
- try reply(Command)
+handle_command(Command) ->
+ try
+ reply(Command)
catch Class:Reason ->
- Stacktrace2 = stacktrace_f(erlang:get_stacktrace()),
- {exception, {Class,Reason,Stacktrace2++Stacktrace}}
+ Stacktrace = stacktrace_f(erlang:get_stacktrace()),
+ {exception,{Class,Reason,Stacktrace}}
end.
reply({apply,M,F,As}) ->
@@ -116,5 +117,5 @@ demonitor(Mref) ->
%% Fix stacktrace - keep all above call to this module.
%%
stacktrace_f([]) -> [];
-stacktrace_f([{?MODULE,_,_}|_]) -> [];
+stacktrace_f([{?MODULE,_,_,_}|_]) -> [];
stacktrace_f([F|S]) -> [F|stacktrace_f(S)].
diff --git a/lib/debugger/src/dbg_icmd.erl b/lib/debugger/src/dbg_icmd.erl
index e9502eaa2b..b230efaa7a 100644
--- a/lib/debugger/src/dbg_icmd.erl
+++ b/lib/debugger/src/dbg_icmd.erl
@@ -273,7 +273,7 @@ handle_int_msg({old_code,Mod}, Status, Bs,
erase([Mod|db]),
put(cache, []);
true ->
- case dbg_ieval:in_use_p(Mod, M) of
+ case dbg_istk:in_use_p(Mod, M) of
true ->
%% A call to Mod is on the stack (or might be),
%% so we must terminate.
@@ -342,11 +342,11 @@ handle_user_msg({set,stack_trace,Flag}, _Status, _Bs, _Ieval) ->
handle_user_msg({get,bindings,From,SP}, _Status, Bs, _Ieval) ->
reply(From, bindings, bindings(Bs, SP));
handle_user_msg({get,stack_frame,From,{Dir,SP}}, _Status, _Bs,_Ieval) ->
- reply(From, stack_frame, dbg_ieval:stack_frame(Dir, SP));
+ reply(From, stack_frame, dbg_istk:stack_frame(Dir, SP));
handle_user_msg({get,messages,From,_}, _Status, _Bs, _Ieval) ->
reply(From, messages, messages());
-handle_user_msg({get,backtrace,From,N}, _Status, _Bs, _Ieval) ->
- reply(From, backtrace, dbg_ieval:backtrace(N)).
+handle_user_msg({get,backtrace,From,N}, _Status, _Bs, Ieval) ->
+ reply(From, backtrace, dbg_istk:backtrace(N, Ieval)).
set_stack_trace(true) ->
set_stack_trace(all);
@@ -366,11 +366,11 @@ reply(From, Tag, Reply) ->
bindings(Bs, nostack) ->
Bs;
bindings(Bs, SP) ->
- case dbg_ieval:stack_level() of
+ case dbg_istk:stack_level() of
Le when SP > Le ->
Bs;
_ ->
- dbg_ieval:bindings(SP)
+ dbg_istk:bindings(SP)
end.
messages() ->
@@ -422,7 +422,7 @@ eval_nonrestricted({From, _Mod, Cmd, _SP}, Bs,
eval_nonrestricted_1({match,_,{var,_,Var},Expr}, Bs, Ieval) ->
{value,Res,Bs2} =
- dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{last_call=false}),
+ dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{top=false}),
Bs3 = case lists:keyfind(Var, 1, Bs) of
{Var,_Value} ->
lists:keyreplace(Var, 1, Bs2, {Var,Res});
@@ -437,7 +437,7 @@ eval_nonrestricted_1({var,_,Var}, Bs, _Ieval) ->
{Res,Bs};
eval_nonrestricted_1(Expr, Bs, Ieval) ->
{value,Res,Bs2} =
- dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{last_call=false}),
+ dbg_ieval:eval_expr(Expr, Bs, Ieval#ieval{top=false}),
{Res,Bs2}.
mark_running(LineNo, Le) ->
diff --git a/lib/debugger/src/dbg_ieval.erl b/lib/debugger/src/dbg_ieval.erl
index 306323f8ea..df725ed9e5 100644
--- a/lib/debugger/src/dbg_ieval.erl
+++ b/lib/debugger/src/dbg_ieval.erl
@@ -20,8 +20,7 @@
-export([eval/3,exit_info/5]).
-export([eval_expr/3]).
--export([check_exit_msg/3,exception/4,in_use_p/2]).
--export([stack_level/0, bindings/1, stack_frame/2, backtrace/1]).
+-export([check_exit_msg/3,exception/4]).
-include("dbg_ieval.hrl").
@@ -71,13 +70,12 @@ exit_info(Int, AttPid, OrigPid, Reason, ExitInfo) ->
case ExitInfo of
{{Mod,Line},Bs,S} ->
- Stack = binary_to_term(S),
- put(stack, Stack),
- Le = stack_level(Stack),
+ dbg_istk:from_external(S),
+ Le = dbg_istk:stack_level(),
dbg_icmd:tell_attached({exit_at, {Mod, Line}, Reason, Le}),
exit_loop(OrigPid, Reason, Bs,#ieval{module=Mod,line=Line});
{} ->
- put(stack, []),
+ dbg_istk:init(),
dbg_icmd:tell_attached({exit_at, null, Reason, 1}),
exit_loop(OrigPid, Reason, erl_eval:new_bindings(),#ieval{})
end.
@@ -142,12 +140,12 @@ check_exit_msg({'DOWN',_,_,_,Reason}, Bs,
undefined when Le =:= 1 -> % died outside interpreted code
{};
undefined when Le > 1 ->
- StackBin = term_to_binary(get(stack)),
- {{Mod, Li}, Bs, StackBin};
+ StackExternal = (dbg_istk:delayed_to_external())(),
+ {{Mod, Li}, Bs, StackExternal};
%% Debugged has terminated due to an exception
- ExitInfo0 ->
- ExitInfo0
+ ExitInfo0 when is_function(ExitInfo0, 0) ->
+ ExitInfo0()
end,
dbg_iserver:cast(get(int), {set_exit_info,self(),ExitInfo}),
@@ -170,30 +168,26 @@ check_exit_msg(_Msg, _Bs, _Ieval) ->
%% and then raise the exception.
%%--------------------------------------------------------------------
exception(Class, Reason, Bs, Ieval) ->
- exception(Class, Reason, fix_stacktrace(1), Bs, Ieval).
-
-exception(Class, Reason, Stacktrace, Bs, #ieval{module=M, line=Line}) ->
- ExitInfo = {{M,Line}, Bs, term_to_binary(get(stack))},
+ exception(Class, Reason, Bs, Ieval, false).
+
+exception(Class, Reason, Bs, Ieval, false) ->
+ do_exception(Class, Reason,
+ dbg_istk:delayed_stacktrace(no_args, Ieval),
+ Bs, Ieval);
+exception(Class, Reason, Bs, Ieval, true) ->
+ do_exception(Class, Reason,
+ dbg_istk:delayed_stacktrace(include_args, Ieval),
+ Bs, Ieval).
+
+do_exception(Class, Reason, Stacktrace, Bs, #ieval{module=M, line=Line}) ->
+ StackFun = dbg_istk:delayed_to_external(),
+ ExitInfo = fun() ->
+ {{M,Line},Bs,StackFun()}
+ end,
put(exit_info, ExitInfo),
put(stacktrace, Stacktrace),
erlang:Class(Reason).
-%%--------------------------------------------------------------------
-%% in_use_p(Mod, Cm) -> boolean()
-%% Mod = Cm = atom()
-%% Returns true if Mod is found on the stack, otherwise false.
-%%--------------------------------------------------------------------
-in_use_p(Mod, Mod) -> true;
-in_use_p(Mod, _Cm) ->
- case get(trace_stack) of
- false -> true;
- _ -> % all | no_tail
- lists:any(fun({_,{M,_,_,_}}) when M =:= Mod -> true;
- (_) -> false
- end,
- get(stack))
- end.
-
%%====================================================================
%% Internal functions
%%====================================================================
@@ -225,7 +219,7 @@ meta(Int, Debugged, M, F, As) ->
put(cache, []),
put(next_break, Status), % break | running (other values later)
put(self, Debugged), % pid() interpreted process
- put(stack, []),
+ dbg_istk:init(),
put(stacktrace, []),
put(trace_stack, dbg_iserver:call(Int, get_stack_trace)),
put(trace, false), % bool() Trace on/off
@@ -243,8 +237,7 @@ meta(Int, Debugged, M, F, As) ->
debugged_cmd(Cmd, Bs, Ieval) ->
Debugged = get(self),
- Stacktrace = fix_stacktrace(2),
- Debugged ! {sys, self(), {command,Cmd,Stacktrace}},
+ Debugged ! {sys, self(), {command,Cmd}},
meta_loop(Debugged, Bs, Ieval).
meta_loop(Debugged, Bs, #ieval{level=Le} = Ieval) ->
@@ -257,12 +250,17 @@ meta_loop(Debugged, Bs, #ieval{level=Le} = Ieval) ->
{value, Val, Bs};
{sys, Debugged, {value,Val,Bs2}} ->
{value, Val, Bs2};
- {sys, Debugged, {exception,{Class,Reason,Stacktrace}}} ->
+ {sys, Debugged, {exception,{Class,Reason,Stk}}} ->
case get(exit_info) of
- %% Error occured outside interpreted code
+ %% Error occurred outside of interpreted code.
undefined ->
- exception(Class,Reason,Stacktrace,Bs,Ieval);
+ MakeStk0 = dbg_istk:delayed_stacktrace(),
+ MakeStk = fun(Depth0) ->
+ Depth = max(0, Depth0 - length(Stk)),
+ Stk ++ MakeStk0(Depth)
+ end,
+ do_exception(Class, Reason, MakeStk, Bs, Ieval);
%% Error must have occured within a re-entry to
%% interpreted code, simply raise the exception
@@ -275,7 +273,7 @@ meta_loop(Debugged, Bs, #ieval{level=Le} = Ieval) ->
%% Reset process dictionary
%% This is really only necessary if the process left
%% interpreted code at a call level > 1
- put(stack, []),
+ dbg_istk:init(),
put(stacktrace, []),
put(exit_info, undefined),
@@ -313,177 +311,6 @@ exit_loop(OrigPid, Reason, Bs, Ieval) ->
exit_loop(OrigPid, Reason, Bs, Ieval)
end.
-%%--Stack emulation---------------------------------------------------
-
-%% We keep track of a call stack that is used for
-%% 1) saving stack frames that can be inspected from an Attached
-%% Process GUI (using dbg_icmd:get(Meta, stack_frame, {Dir, SP})
-%% 2) generate an approximation of regular stacktrace -- sent to
-%% Debugged when it should raise an exception or evaluate a
-%% function (since it might possible raise an exception)
-%%
-%% Stack = [Entry]
-%% Entry = {Le, {MFA, Where, Bs}}
-%% Le = int() % current call level
-%% MFA = {M,F,Args} % called function (or fun)
-%% | {Fun,Args} %
-%% Where = {M,Li} % from where (module+line) function is called
-%% Bs = bindings() % current variable bindings
-%%
-%% How to push depends on the "Stack Trace" option (value saved in
-%% process dictionary item 'trace_stack').
-%% all - everything is pushed
-%% no_tail - tail recursive push
-%% false - nothing is pushed
-%% Whenever a function returns, the corresponding call frame is popped.
-
-push(MFA, Bs, #ieval{level=Le,module=Cm,line=Li,last_call=Lc}) ->
- Entry = {Le, {MFA, {Cm,Li}, Bs}},
- case get(trace_stack) of
- false -> ignore;
- no_tail when Lc ->
- case get(stack) of
- [] -> put(stack, [Entry]);
- [_Entry|Entries] -> put(stack, [Entry|Entries])
- end;
- _ -> % all | no_tail when Lc =:= false
- put(stack, [Entry|get(stack)])
- end.
-
-pop() ->
- case get(trace_stack) of
- false -> ignore;
- _ -> % all � no_tail
- case get(stack) of
- [_Entry|Entries] ->
- put(stack, Entries);
- [] ->
- ignore
- end
- end.
-
-pop(Le) ->
- case get(trace_stack) of
- false -> ignore;
- _ -> % all | no_tail
- put(stack, pop(Le, get(stack)))
- end.
-
-pop(Level, [{Le, _}|Stack]) when Level=<Le ->
- pop(Level, Stack);
-pop(_Level, Stack) ->
- Stack.
-
-
-%% stack_level() -> Le
-%% stack_level(Stack) -> Le
-%% Top call level
-stack_level() ->
- stack_level(get(stack)).
-
-stack_level([]) -> 1;
-stack_level([{Le,_}|_]) -> Le.
-
-%% fix_stacktrace(Start) -> Stacktrace
-%% Start = 1|2
-%% Stacktrace = [{M,F,Args|Arity} | {Fun,Args}]
-%% Convert internal stack format to imitation of regular stacktrace.
-%% Max three elements, no repeated (recursive) calls to the same
-%% function and convert argument lists to arity for all but topmost
-%% entry (and funs).
-%% 'Start' indicates where at get(stack) to start. This somewhat ugly
-%% solution is because fix_stacktrace has two uses: 1) to imitate
-%% the stacktrace in the case of an exception in the interpreted code,
-%% in which case the current call (top of the stack = first of the list)
-%% should be included, and 2) to send a current stacktrace to Debugged
-%% when evaluation passes into non-interpreted code, in which case
-%% the current call should NOT be included (as it is Debugged which
-%% will make the actual function call).
-fix_stacktrace(Start) ->
- case fix_stacktrace2(sublist(get(stack), Start, 3)) of
- [] ->
- [];
- [H|T] ->
- [H|args2arity(T)]
- end.
-
-sublist([], _Start, _Length) ->
- []; % workaround, lists:sublist([],2,3) fails
-sublist(L, Start, Length) ->
- lists:sublist(L, Start, Length).
-
-fix_stacktrace2([{_,{{M,F,As1},_,_}}, {_,{{M,F,As2},_,_}}|_])
- when length(As1) =:= length(As2) ->
- [{M,F,As1}];
-fix_stacktrace2([{_,{{Fun,As1},_,_}}, {_,{{Fun,As2},_,_}}|_])
- when length(As1) =:= length(As2) ->
- [{Fun,As1}];
-fix_stacktrace2([{_,{MFA,_,_}}|Entries]) ->
- [MFA|fix_stacktrace2(Entries)];
-fix_stacktrace2([]) ->
- [].
-
-args2arity([{M,F,As}|Entries]) when is_list(As) ->
- [{M,F,length(As)}|args2arity(Entries)];
-args2arity([Entry|Entries]) ->
- [Entry|args2arity(Entries)];
-args2arity([]) ->
- [].
-
-%% bindings(SP) -> Bs
-%% SP = Le % stack pointer
-%% Return the bindings for the specified call level
-bindings(SP) ->
- bindings(SP, get(stack)).
-
-bindings(SP, [{SP,{_MFA,_Wh,Bs}}|_]) ->
- Bs;
-bindings(SP, [_Entry|Entries]) ->
- bindings(SP, Entries);
-bindings(_SP, []) ->
- erl_eval:new_bindings().
-
-%% stack_frame(Dir, SP) -> {Le, Where, Bs} | top | bottom
-%% Dir = up | down
-%% Where = {Cm, Li}
-%% Cm = Module | undefined % module
-%% Li = int() | -1 % line number
-%% Bs = bindings()
-%% Return stack frame info one step up/down from given stack pointer
-%% up = to lower call levels
-%% down = to higher call levels
-stack_frame(up, SP) ->
- stack_frame(SP, up, get(stack));
-stack_frame(down, SP) ->
- stack_frame(SP, down, lists:reverse(get(stack))).
-
-stack_frame(SP, up, [{Le, {_MFA,Where,Bs}}|_]) when Le<SP ->
- {Le, Where, Bs};
-stack_frame(SP, down, [{Le, {_MFA,Where,Bs}}|_]) when Le>SP ->
- {Le, Where, Bs};
-stack_frame(SP, Dir, [{SP, _}|Stack]) ->
- case Stack of
- [{Le, {_MFA,Where,Bs}}|_] ->
- {Le, Where, Bs};
- [] when Dir =:= up ->
- top;
- [] when Dir =:= down ->
- bottom
- end;
-stack_frame(SP, Dir, [_Entry|Stack]) ->
- stack_frame(SP, Dir, Stack).
-
-%% backtrace(HowMany) -> Backtrace
-%% HowMany = all | int()
-%% Backtrace = {Le, MFA}
-%% Return all/the last N called functions, in reversed call order
-backtrace(HowMany) ->
- Stack = case HowMany of
- all -> get(stack);
- N -> lists:sublist(get(stack), N)
- end,
- [{Le, MFA} || {Le,{MFA,_Wh,_Bs}} <- Stack].
-
%%--Trace function----------------------------------------------------
%%--------------------------------------------------------------------
@@ -558,7 +385,7 @@ format_args1([]) ->
%% Mimic catch behaviour
catch_value(error, Reason) ->
- {'EXIT',{Reason,get(stacktrace)}};
+ {'EXIT',{Reason,get_stacktrace()}};
catch_value(exit, Reason) ->
{'EXIT',Reason};
catch_value(throw, Reason) ->
@@ -570,11 +397,13 @@ catch_value(throw, Reason) ->
%% Top level function of meta evaluator.
%% Return message to be replied to the target process.
%%--------------------------------------------------------------------
-eval_mfa(Debugged, M, F, As, Ieval) ->
+eval_mfa(Debugged, M, F, As, #ieval{level=Le}=Ieval0) ->
Int = get(int),
Bs = erl_eval:new_bindings(),
- try eval_function(M,F,As,Bs,extern,Ieval#ieval{last_call=true}) of
+ Ieval = Ieval0#ieval{level=Le+1,top=true},
+ try do_eval_function(M, F, As, Bs, extern, Ieval) of
{value, Val, _Bs} ->
+ trace(return, {Le,Val}),
{ready, Val}
catch
exit:{Debugged, Reason} ->
@@ -582,76 +411,68 @@ eval_mfa(Debugged, M, F, As, Ieval) ->
exit:{Int, Reason} ->
exit(Reason);
Class:Reason ->
- {exception, {Class, Reason, get(stacktrace)}}
+ {exception, {Class, Reason, get_stacktrace()}}
+ end.
+
+eval_function(Mod, Name, As, Bs, Called, Ieval0, Lc) ->
+ Tail = Lc andalso get(trace_stack) =:= no_tail,
+ case Tail of
+ false ->
+ Ieval = dbg_istk:push(Bs, Ieval0, Lc),
+ {value,Val,_} = do_eval_function(Mod, Name, As, Bs, Called, Ieval),
+ dbg_istk:pop(),
+ trace(return, {Ieval#ieval.level,Val}),
+ {value,Val,Bs};
+ true ->
+ do_eval_function(Mod, Name, As, Bs, Called, Ieval0)
end.
-eval_function(Mod, Fun, As0, Bs0, _Called, Ieval) when is_function(Fun);
- Mod =:= ?MODULE,
- Fun =:= eval_fun ->
- #ieval{level=Le, line=Li, last_call=Lc} = Ieval,
+do_eval_function(Mod, Fun, As0, Bs0, _, Ieval0) when is_function(Fun);
+ Mod =:= ?MODULE,
+ Fun =:= eval_fun ->
+ #ieval{level=Le,line=Li,top=Top} = Ieval0,
case lambda(Fun, As0) of
- {Cs,Module,Name,As,Bs} ->
- push({Module,Name,As}, Bs0, Ieval),
+ {[{clause,Fc,_,_,_}|_]=Cs,Module,Name,As,Bs} ->
+ Ieval = Ieval0#ieval{module=Module,function=Name,
+ arguments=As0,line=Fc},
trace(call_fun, {Le,Li,Name,As}),
- {value, Val, _Bs} =
- fnk_clauses(Cs, Module, Name, As, Bs,
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ fnk_clauses(Cs, As, Bs, Ieval);
- not_interpreted when Lc -> % We are leaving interpreted code
+ not_interpreted when Top -> % We are leaving interpreted code
trace(call_fun, {Le,Li,Fun,As0}),
{value, {dbg_apply,erlang,apply,[Fun,As0]}, Bs0};
not_interpreted ->
- push({Fun,As0}, Bs0, Ieval),
trace(call_fun, {Le,Li,Fun,As0}),
- {value, Val, _Bs} =
- debugged_cmd({apply,erlang,apply,[Fun,As0]},Bs0,
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ debugged_cmd({apply,erlang,apply,[Fun,As0]}, Bs0, Ieval0);
{error,Reason} ->
%% It's ok not to push anything in this case, the error
%% reason contains information about the culprit
%% ({badarity,{{Mod,Name},As}})
- exception(error, Reason, Bs0, Ieval)
+ exception(error, Reason, Bs0, Ieval0)
end;
%% Common Test adaptation
-eval_function(ct_line, line, As, Bs, extern, #ieval{level=Le}=Ieval) ->
+do_eval_function(ct_line, line, As, Bs, extern, #ieval{level=Le}=Ieval) ->
debugged_cmd({apply,ct_line,line,As}, Bs, Ieval#ieval{level=Le+1}),
{value, ignore, Bs};
-eval_function(Mod, Name, As0, Bs0, Called, Ieval) ->
- #ieval{level=Le, line=Li, last_call=Lc} = Ieval,
-
- push({Mod,Name,As0}, Bs0, Ieval),
+do_eval_function(Mod, Name, As0, Bs0, Called, Ieval0) ->
+ #ieval{level=Le,line=Li,top=Top} = Ieval0,
trace(call, {Called, {Le,Li,Mod,Name,As0}}),
-
+ Ieval = Ieval0#ieval{module=Mod,function=Name,arguments=As0},
case get_function(Mod, Name, As0, Called) of
- Cs when is_list(Cs) ->
- {value, Val, _Bs} =
- fnk_clauses(Cs, Mod, Name, As0, erl_eval:new_bindings(),
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ [{clause,FcLine,_,_,_}|_]=Cs ->
+ fnk_clauses(Cs, As0, erl_eval:new_bindings(),
+ Ieval#ieval{line=FcLine});
- not_interpreted when Lc -> % We are leaving interpreted code
+ not_interpreted when Top -> % We are leaving interpreted code
{value, {dbg_apply,Mod,Name,As0}, Bs0};
not_interpreted ->
- {value, Val, _Bs} =
- debugged_cmd({apply,Mod,Name,As0}, Bs0,
- Ieval#ieval{level=Le+1}),
- pop(),
- trace(return, {Le,Val}),
- {value, Val, Bs0};
+ debugged_cmd({apply,Mod,Name,As0}, Bs0, Ieval);
undef ->
- exception(error, undef, Bs0, Ieval)
+ exception(error, undef, Bs0, Ieval, true)
end.
lambda(eval_fun, [Cs,As,Bs,{Mod,Name}=F]) ->
@@ -752,23 +573,21 @@ cached(Key) ->
%% Try to find a matching function clause
%% #ieval.level is set, the other fields must be set in this function
-fnk_clauses([{clause,Line,Pars,Gs,Body}|Cs], M, F, As, Bs0, Ieval) ->
+fnk_clauses([{clause,Line,Pars,Gs,Body}|Cs], As, Bs0, Ieval) ->
case head_match(Pars, As, [], Bs0) of
{match,Bs1} ->
Bs = add_bindings(Bs1, Bs0),
case guard(Gs, Bs) of
true ->
- seq(Body, Bs,
- Ieval#ieval{line=Line,
- module=M,function=F,arguments=As});
+ seq(Body, Bs, Ieval#ieval{line=Line});
false ->
- fnk_clauses(Cs, M, F, As, Bs0, Ieval)
+ fnk_clauses(Cs, As, Bs0, Ieval)
end;
nomatch ->
- fnk_clauses(Cs, M, F, As, Bs0, Ieval)
+ fnk_clauses(Cs, As, Bs0, Ieval)
end;
-fnk_clauses([], _M, _F, _As, Bs, Ieval) ->
- exception(error, function_clause, Bs, Ieval).
+fnk_clauses([], _As, Bs, Ieval) ->
+ exception(error, function_clause, Bs, Ieval, true).
seq([E], Bs0, Ieval) ->
case dbg_icmd:cmd(E, Bs0, Ieval) of
@@ -782,7 +601,7 @@ seq([E|Es], Bs0, Ieval) ->
{skip,Bs} ->
seq(Es, Bs, Ieval);
Bs1 ->
- {value,_,Bs} = expr(E, Bs1, Ieval#ieval{last_call=false}),
+ {value,_,Bs} = expr(E, Bs1, Ieval#ieval{top=false}),
seq(Es, Bs, Ieval)
end;
seq([], Bs, _) ->
@@ -804,10 +623,9 @@ expr({value,Val}, Bs, _Ieval) -> % Special case straight values
%% List
expr({cons,Line,H0,T0}, Bs0, Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- Ieval1 = Ieval#ieval{last_call=false},
- {value,H,Bs1} = expr(H0,Bs0,Ieval1),
- {value,T,Bs2} = expr(T0,Bs0,Ieval1),
+ Ieval = Ieval0#ieval{line=Line,top=false},
+ {value,H,Bs1} = expr(H0, Bs0, Ieval),
+ {value,T,Bs2} = expr(T0, Bs0, Ieval),
{value,[H|T],merge_bindings(Bs2, Bs1, Ieval)};
%% Tuple
@@ -821,12 +639,12 @@ expr({block,Line,Es},Bs,Ieval) ->
%% Catch statement
expr({'catch',Line,Expr}, Bs0, Ieval) ->
- try expr(Expr, Bs0, Ieval#ieval{line=Line, last_call=false})
+ try expr(Expr, Bs0, Ieval#ieval{line=Line, top=false})
catch
Class:Reason ->
%% Exception caught, reset exit info
put(exit_info, undefined),
- pop(Ieval#ieval.level),
+ dbg_istk:pop(Ieval#ieval.level),
Value = catch_value(Class, Reason),
trace(return, {Ieval#ieval.level,Value}),
{value, Value, Bs0}
@@ -835,7 +653,7 @@ expr({'catch',Line,Expr}, Bs0, Ieval) ->
%% Try-catch statement
expr({'try',Line,Es,CaseCs,CatchCs,[]}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- try seq(Es, Bs0, Ieval#ieval{last_call=false}) of
+ try seq(Es, Bs0, Ieval#ieval{top=false}) of
{value,Val,Bs} = Value ->
case CaseCs of
[] -> Value;
@@ -848,7 +666,7 @@ expr({'try',Line,Es,CaseCs,CatchCs,[]}, Bs0, Ieval0) ->
end;
expr({'try',Line,Es,CaseCs,CatchCs,As}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- try seq(Es, Bs0, Ieval#ieval{last_call=false}) of
+ try seq(Es, Bs0, Ieval#ieval{top=false}) of
{value,Val,Bs} = Value ->
case CaseCs of
[] -> Value;
@@ -859,13 +677,13 @@ expr({'try',Line,Es,CaseCs,CatchCs,As}, Bs0, Ieval0) ->
Class:Reason when CatchCs =/= [] ->
catch_clauses({Class,Reason,[]}, CatchCs, Bs0, Ieval)
after
- seq(As, Bs0, Ieval#ieval{last_call=false})
+ seq(As, Bs0, Ieval#ieval{top=false})
end;
%% Case statement
expr({'case',Line,E,Cs}, Bs0, Ieval) ->
{value,Val,Bs} =
- expr(E, Bs0, Ieval#ieval{line=Line, last_call=false}),
+ expr(E, Bs0, Ieval#ieval{line=Line, top=false}),
case_clauses(Val, Cs, Bs, case_clause, Ieval#ieval{line=Line});
%% If statement
@@ -874,20 +692,20 @@ expr({'if',Line,Cs}, Bs, Ieval) ->
%% Andalso/orelse
expr({'andalso',Line,E1,E2}, Bs, Ieval) ->
- case expr(E1, Bs, Ieval#ieval{line=Line, last_call=false}) of
+ case expr(E1, Bs, Ieval#ieval{line=Line, top=false}) of
{value,false,_}=Res ->
Res;
{value,true,_} ->
- expr(E2, Bs, Ieval#ieval{line=Line, last_call=false});
+ expr(E2, Bs, Ieval#ieval{line=Line, top=false});
{value,Val,Bs} ->
exception(error, {badarg,Val}, Bs, Ieval)
end;
expr({'orelse',Line,E1,E2}, Bs, Ieval) ->
- case expr(E1, Bs, Ieval#ieval{line=Line, last_call=false}) of
+ case expr(E1, Bs, Ieval#ieval{line=Line, top=false}) of
{value,true,_}=Res ->
Res;
{value,false,_} ->
- expr(E2, Bs, Ieval#ieval{line=Line, last_call=false});
+ expr(E2, Bs, Ieval#ieval{line=Line, top=false});
{value,Val,_} ->
exception(error, {badarg,Val}, Bs, Ieval)
end;
@@ -895,7 +713,7 @@ expr({'orelse',Line,E1,E2}, Bs, Ieval) ->
%% Matching expression
expr({match,Line,Lhs,Rhs0}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,Rhs,Bs1} = expr(Rhs0, Bs0, Ieval#ieval{last_call=false}),
+ {value,Rhs,Bs1} = expr(Rhs0, Bs0, Ieval#ieval{top=false}),
case match(Lhs, Rhs, Bs1) of
{match,Bs} ->
{value,Rhs,Bs};
@@ -951,21 +769,21 @@ expr({make_fun,Line,Name,Cs}, Bs, #ieval{module=Module}=Ieval) ->
{value,Fun,Bs};
%% Common test adaptation
-expr({call_remote,0,ct_line,line,As0}, Bs0, Ieval0) ->
+expr({call_remote,0,ct_line,line,As0,Lc}, Bs0, Ieval0) ->
{As,_Bs} = eval_list(As0, Bs0, Ieval0),
- eval_function(ct_line, line, As, Bs0, extern, Ieval0);
+ eval_function(ct_line, line, As, Bs0, extern, Ieval0, Lc);
%% Local function call
-expr({local_call,Line,F,As0}, Bs0, #ieval{module=M} = Ieval0) ->
+expr({local_call,Line,F,As0,Lc}, Bs0, #ieval{module=M} = Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{As,Bs} = eval_list(As0, Bs0, Ieval),
- eval_function(M, F, As, Bs, local, Ieval);
+ eval_function(M, F, As, Bs, local, Ieval, Lc);
%% Remote function call
-expr({call_remote,Line,M,F,As0}, Bs0, Ieval0) ->
+expr({call_remote,Line,M,F,As0,Lc}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{As,Bs} = eval_list(As0, Bs0, Ieval),
- eval_function(M, F, As, Bs, extern, Ieval);
+ eval_function(M, F, As, Bs, extern, Ieval, Lc);
%% Emulated semantics of some BIFs
expr({dbg,Line,self,[]}, Bs, #ieval{level=Le}) ->
@@ -975,9 +793,28 @@ expr({dbg,Line,self,[]}, Bs, #ieval{level=Le}) ->
{value,Self,Bs};
expr({dbg,Line,get_stacktrace,[]}, Bs, #ieval{level=Le}) ->
trace(bif, {Le,Line,erlang,get_stacktrace,[]}),
- Stacktrace = get(stacktrace),
+ Stacktrace = get_stacktrace(),
trace(return, {Le,Stacktrace}),
{value,Stacktrace,Bs};
+expr({dbg,Line,raise,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
+ %% Since erlang:get_stacktrace/0 is emulated, we will
+ %% need to emulate erlang:raise/3 too so that we can
+ %% capture the stacktrace.
+ Ieval = Ieval0#ieval{line=Line},
+ {[Class,Reason,Stk0]=As,Bs} = eval_list(As0, Bs0, Ieval),
+ trace(bif, {Le,Line,erlang,raise,As}),
+ try
+ %% Evaluate raise/3 for error checking and
+ %% truncating of the stacktrace to the correct depth.
+ Error = erlang:raise(Class, Reason, Stk0),
+ trace(return, {Le,Error}),
+ {value,Error,Bs}
+ catch
+ _:_ ->
+ Stk = erlang:get_stacktrace(), %Possibly truncated.
+ StkFun = fun(_) -> Stk end,
+ do_exception(Class, Reason, StkFun, Bs, Ieval)
+ end;
expr({dbg,Line,throw,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{[Term],Bs} = eval_list(As0, Bs0, Ieval),
@@ -988,11 +825,6 @@ expr({dbg,Line,error,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
{[Term],Bs} = eval_list(As0, Bs0, Ieval),
trace(bif, {Le,Line,erlang,error,[Term]}),
exception(error, Term, Bs, Ieval);
-expr({dbg,Line,fault,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {[Term],Bs} = eval_list(As0, Bs0, Ieval),
- trace(bif, {Le,Line,erlang,fault,[Term]}),
- exception(fault, Term, Bs, Ieval);
expr({dbg,Line,exit,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{[Term],Bs} = eval_list(As0, Bs0, Ieval),
@@ -1001,36 +833,26 @@ expr({dbg,Line,exit,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
%% Call to "safe" BIF, ie a BIF that can be executed in Meta process
expr({safe_bif,Line,M,F,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {As,Bs} = eval_list(As0, Bs0, Ieval),
+ Ieval1 = Ieval0#ieval{line=Line},
+ {As,Bs} = eval_list(As0, Bs0, Ieval1),
trace(bif, {Le,Line,M,F,As}),
- push({M,F,As}, Bs0, Ieval),
+ Ieval2 = dbg_istk:push(Bs0, Ieval1, false),
+ Ieval = Ieval2#ieval{module=M,function=F,arguments=As,line=-1},
{_,Value,_} = Res = safe_bif(M, F, As, Bs, Ieval),
trace(return, {Le,Value}),
- pop(),
+ dbg_istk:pop(),
Res;
%% Call to a BIF that must be evaluated in the correct process
expr({bif,Line,M,F,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {As,Bs} = eval_list(As0, Bs0, Ieval),
+ Ieval1 = Ieval0#ieval{line=Line},
+ {As,Bs} = eval_list(As0, Bs0, Ieval1),
trace(bif, {Le,Line,M,F,As}),
- push({M,F,As}, Bs0, Ieval),
- {_,Value,_} =
- Res = debugged_cmd({apply,M,F,As}, Bs, Ieval#ieval{level=Le+1}),
+ Ieval2 = dbg_istk:push(Bs0, Ieval1, false),
+ Ieval = Ieval2#ieval{module=M,function=F,arguments=As,line=-1},
+ {_,Value,_} = Res = debugged_cmd({apply,M,F,As}, Bs, Ieval),
trace(return, {Le,Value}),
- pop(),
- Res;
-
-%% Call to a BIF that spawns a new process
-expr({spawn_bif,Line,M,F,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {As,Bs} = eval_list(As0, Bs0, Ieval),
- trace(bif, {Le,Line,M,F,As}),
- push({M,F,As}, Bs0, Ieval),
- Res = debugged_cmd({apply,M,F,As}, Bs,Ieval#ieval{level=Le+1}),
- trace(return, {Le,Res}),
- pop(),
+ dbg_istk:pop(),
Res;
%% Call to an operation
@@ -1046,7 +868,7 @@ expr({op,Line,Op,As0}, Bs0, Ieval0) ->
end;
%% apply/2 (fun)
-expr({apply_fun,Line,Fun0,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
+expr({apply_fun,Line,Fun0,As0,Lc}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
FunValue = case expr(Fun0, Bs0, Ieval) of
{value,{dbg_apply,Mx,Fx,Asx},Bsx} ->
@@ -1058,31 +880,20 @@ expr({apply_fun,Line,Fun0,As0}, Bs0, #ieval{level=Le}=Ieval0) ->
case FunValue of
{value,Fun,Bs1} when is_function(Fun) ->
{As,Bs} = eval_list(As0, Bs1, Ieval),
- eval_function(undefined, Fun, As, Bs, extern, Ieval);
+ eval_function(undefined, Fun, As, Bs, extern, Ieval, Lc);
{value,{M,F},Bs1} when is_atom(M), is_atom(F) ->
{As,Bs} = eval_list(As0, Bs1, Ieval),
- eval_function(M, F, As, Bs, extern, Ieval);
+ eval_function(M, F, As, Bs, extern, Ieval, Lc);
{value,BadFun,Bs1} ->
exception(error, {badfun,BadFun}, Bs1, Ieval)
end;
%% apply/3
-expr({apply,Line,As0}, Bs0, Ieval0) ->
+expr({apply,Line,As0,Lc}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
{[M,F,As],Bs} = eval_list(As0, Bs0, Ieval),
- eval_function(M, F, As, Bs, extern, Ieval);
+ eval_function(M, F, As, Bs, extern, Ieval, Lc);
-%% Mod:module_info/0,1
-expr({module_info_0,_,Mod}, Bs, _Ieval) ->
- {value,[{compile,module_info(Mod,compile)},
- {attributes,module_info(Mod,attributes)},
- {imports,module_info(Mod,imports)},
- {exports,module_info(Mod,exports)}],Bs};
-expr({module_info_1,Line,Mod,[As0]}, Bs0, Ieval0) ->
- Ieval = Ieval0#ieval{line=Line},
- {value,What,Bs} = expr(As0, Bs0, Ieval),
- {value,module_info(Mod, What),Bs};
-
%% Receive statement
expr({'receive',Line,Cs}, Bs0, #ieval{level=Le}=Ieval) ->
trace(receivex, {Le,false}),
@@ -1091,7 +902,7 @@ expr({'receive',Line,Cs}, Bs0, #ieval{level=Le}=Ieval) ->
%% Receive..after statement
expr({'receive',Line,Cs,To,ToExprs}, Bs0, #ieval{level=Le}=Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,ToVal,ToBs} = expr(To, Bs0, Ieval#ieval{last_call=false}),
+ {value,ToVal,ToBs} = expr(To, Bs0, Ieval#ieval{top=false}),
trace(receivex, {Le,true}),
check_timeoutvalue(ToVal, ToBs, To, Ieval),
{Stamp,_} = statistics(wall_clock),
@@ -1101,7 +912,7 @@ expr({'receive',Line,Cs,To,ToExprs}, Bs0, #ieval{level=Le}=Ieval0) ->
%% Send (!)
expr({send,Line,To0,Msg0}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- Ieval1 = Ieval#ieval{last_call=false},
+ Ieval1 = Ieval#ieval{top=false},
{value,To,Bs1} = expr(To0, Bs0, Ieval1),
{value,Msg,Bs2} = expr(Msg0, Bs0, Ieval1),
Bs = merge_bindings(Bs2, Bs1, Ieval),
@@ -1110,10 +921,15 @@ expr({send,Line,To0,Msg0}, Bs0, Ieval0) ->
%% Binary
expr({bin,Line,Fs}, Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- eval_bits:expr_grp(Fs, Bs0,
- fun (E, B) -> expr(E, B, Ieval) end,
- [],
- false);
+ try
+ eval_bits:expr_grp(Fs, Bs0,
+ fun (E, B) -> expr(E, B, Ieval) end,
+ [],
+ false)
+ catch
+ Class:Reason ->
+ exception(Class, Reason, Bs0, Ieval)
+ end;
%% List comprehension
expr({lc,_Line,E,Qs}, Bs, Ieval) ->
@@ -1138,12 +954,12 @@ eval_lc(E, Qs, Bs, Ieval) ->
eval_lc1(E, [{generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_lc1(E, Qs, NewBs, Ieval) end,
eval_generate(L1, P, Bs1, CompFun, Ieval);
eval_lc1(E, [{b_generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_lc1(E, Qs, NewBs, Ieval) end,
eval_b_generate(Bin, P, Bs0, CompFun, Ieval);
eval_lc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
@@ -1152,13 +968,13 @@ eval_lc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
false -> []
end;
eval_lc1(E, [Q|Qs], Bs0, Ieval) ->
- case expr(Q, Bs0, Ieval#ieval{last_call=false}) of
+ case expr(Q, Bs0, Ieval#ieval{top=false}) of
{value,true,Bs} -> eval_lc1(E, Qs, Bs, Ieval);
{value,false,_Bs} -> [];
{value,V,Bs} -> exception(error, {bad_filter,V}, Bs, Ieval)
end;
eval_lc1(E, [], Bs, Ieval) ->
- {value,V,_} = expr(E, Bs, Ieval#ieval{last_call=false}),
+ {value,V,_} = expr(E, Bs, Ieval#ieval{top=false}),
[V].
%% eval_bc(Expr,[Qualifier],Bindings,IevalState) ->
@@ -1171,12 +987,12 @@ eval_bc(E, Qs, Bs, Ieval) ->
eval_bc1(E, [{generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,L1,Bs1} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_bc1(E, Qs, NewBs, Ieval) end,
eval_generate(L1, P, Bs1, CompFun, Ieval);
eval_bc1(E, [{b_generate,Line,P,L0}|Qs], Bs0, Ieval0) ->
Ieval = Ieval0#ieval{line=Line},
- {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{last_call=false}),
+ {value,Bin,_} = expr(L0, Bs0, Ieval#ieval{top=false}),
CompFun = fun(NewBs) -> eval_bc1(E, Qs, NewBs, Ieval) end,
eval_b_generate(Bin, P, Bs0, CompFun, Ieval);
eval_bc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
@@ -1185,13 +1001,13 @@ eval_bc1(E, [{guard,Q}|Qs], Bs0, Ieval) ->
false -> []
end;
eval_bc1(E, [Q|Qs], Bs0, Ieval) ->
- case expr(Q, Bs0, Ieval#ieval{last_call=false}) of
+ case expr(Q, Bs0, Ieval#ieval{top=false}) of
{value,true,Bs} -> eval_bc1(E, Qs, Bs, Ieval);
{value,false,_Bs} -> [];
{value,V,Bs} -> exception(error, {bad_filter,V}, Bs, Ieval)
end;
eval_bc1(E, [], Bs, Ieval) ->
- {value,V,_} = expr(E, Bs, Ieval#ieval{last_call=false}),
+ {value,V,_} = expr(E, Bs, Ieval#ieval{top=false}),
[V].
eval_generate([V|Rest], P, Bs0, CompFun, Ieval) ->
@@ -1208,7 +1024,7 @@ eval_generate(Term, _P, Bs, _CompFun, Ieval) ->
exception(error, {bad_generator,Term}, Bs, Ieval).
eval_b_generate(<<_/bitstring>>=Bin, P, Bs0, CompFun, Ieval) ->
- Mfun = fun(L, R, Bs) -> match1(L, R, Bs, Bs0) end,
+ Mfun = match_fun(Bs0),
Efun = fun(Exp, Bs) -> expr(Exp, Bs, #ieval{}) end,
case eval_bits:bin_gen(P, Bin, erl_eval:new_bindings(), Bs0, Mfun, Efun) of
{match,Rest,Bs1} ->
@@ -1222,24 +1038,13 @@ eval_b_generate(<<_/bitstring>>=Bin, P, Bs0, CompFun, Ieval) ->
eval_b_generate(Term, _P, Bs, _CompFun, Ieval) ->
exception(error, {bad_generator,Term}, Bs, Ieval).
-module_info(Mod, module) -> Mod;
-module_info(_Mod, compile) -> [];
-module_info(Mod, attributes) ->
- {ok, Attr} = dbg_iserver:call(get(int), {lookup, Mod, attributes}),
- Attr;
-module_info(_Mod, imports) -> [];
-module_info(Mod, exports) ->
- {ok, Exp} = dbg_iserver:call(get(int), {lookup, Mod, exports}),
- Exp;
-module_info(_Mod, functions) -> [].
-
safe_bif(M, F, As, Bs, Ieval) ->
try apply(M, F, As) of
Value ->
{value,Value,Bs}
catch
Class:Reason ->
- exception(Class, Reason, Bs, Ieval)
+ exception(Class, Reason, Bs, Ieval, true)
end.
eval_send(To, Msg, Bs, Ieval) ->
@@ -1408,12 +1213,12 @@ flush_traces(Debugged) ->
%% eval_list(ExpressionList, Bindings, Ieval)
%% Evaluate a list of expressions "in parallel" at the same level.
eval_list(Es, Bs, Ieval) ->
- eval_list(Es, [], Bs, Bs, Ieval).
+ eval_list_1(Es, [], Bs, Bs, Ieval#ieval{top=false}).
-eval_list([E|Es], Vs, BsOrig, Bs0, Ieval) ->
- {value,V,Bs1} = expr(E, BsOrig, Ieval#ieval{last_call=false}),
- eval_list(Es, [V|Vs], BsOrig, merge_bindings(Bs1,Bs0,Ieval), Ieval);
-eval_list([], Vs, _, Bs, _Ieval) ->
+eval_list_1([E|Es], Vs, BsOrig, Bs0, Ieval) ->
+ {value,V,Bs1} = expr(E, BsOrig, Ieval),
+ eval_list_1(Es, [V|Vs], BsOrig, merge_bindings(Bs1, Bs0, Ieval), Ieval);
+eval_list_1([], Vs, _, Bs, _Ieval) ->
{lists:reverse(Vs,[]),Bs}.
%% if_clauses(Clauses, Bindings, Ieval)
@@ -1453,7 +1258,7 @@ catch_clauses(Exception, [{clause,_,[P],G,B}|CatchCs], Bs0, Ieval) ->
true ->
%% Exception caught, reset exit info
put(exit_info, undefined),
- pop(Ieval#ieval.level),
+ dbg_istk:pop(Ieval#ieval.level),
seq(B, Bs, Ieval);
false ->
catch_clauses(Exception, CatchCs, Bs0, Ieval)
@@ -1588,11 +1393,9 @@ match1({cons,_,H,T}, [H1|T1], Bs0, BBs) ->
match1({tuple,_,Elts}, Tuple, Bs, BBs)
when length(Elts) =:= tuple_size(Tuple) ->
match_tuple(Elts, Tuple, 1, Bs, BBs);
-match1({bin,_,Fs}, B, Bs0, BBs0) when is_bitstring(B) ->
- Bs1 = lists:sort(Bs0), %Kludge.
- BBs = lists:sort(BBs0),
- try eval_bits:match_bits(Fs, B, Bs1, BBs,
- fun(L, R, Bs) -> match1(L, R, Bs, BBs) end,
+match1({bin,_,Fs}, B, Bs0, BBs) when is_bitstring(B) ->
+ try eval_bits:match_bits(Fs, B, Bs0, BBs,
+ match_fun(BBs),
fun(E, Bs) -> expr(E, Bs, #ieval{}) end,
false)
catch
@@ -1601,6 +1404,12 @@ match1({bin,_,Fs}, B, Bs0, BBs0) when is_bitstring(B) ->
match1(_,_,_,_) ->
throw(nomatch).
+match_fun(BBs) ->
+ fun(match, {L,R,Bs}) -> match1(L, R, Bs, BBs);
+ (binding, {Name,Bs}) -> binding(Name, Bs);
+ (add_binding, {Name,Val,Bs}) -> add_binding(Name, Val, Bs)
+ end.
+
match_tuple([E|Es], Tuple, I, Bs0, BBs) ->
{match,Bs} = match1(E, element(I, Tuple), Bs0, BBs),
match_tuple(Es, Tuple, I+1, Bs, BBs);
@@ -1731,3 +1540,19 @@ add_binding(N,Val,[B1|Bs]) ->
[B1|add_binding(N,Val,Bs)];
add_binding(N,Val,[]) ->
[{N,Val}].
+
+%% get_stacktrace() -> Stacktrace
+%% Return the latest stacktrace for the process.
+get_stacktrace() ->
+ case get(stacktrace) of
+ MakeStk when is_function(MakeStk, 1) ->
+ %% The stacktrace has not been constructed before.
+ %% Construct it and remember the result.
+ Depth = erlang:system_flag(backtrace_depth, 8),
+ erlang:system_flag(backtrace_depth, Depth),
+ Stk = MakeStk(Depth),
+ put(stacktrace, Stk),
+ Stk;
+ Stk when is_list(Stk) ->
+ Stk
+ end.
diff --git a/lib/debugger/src/dbg_ieval.hrl b/lib/debugger/src/dbg_ieval.hrl
index a344748f48..ea6189ad02 100644
--- a/lib/debugger/src/dbg_ieval.hrl
+++ b/lib/debugger/src/dbg_ieval.hrl
@@ -21,6 +21,8 @@
module, % MFA which called the currently
function, % interpreted function
arguments, %
- last_call = false % True if current expression is
- }). % the VERY last to be evaluated
- % (ie at all, not only in a clause)
+
+ %% True if the current expression is at the top level
+ %% (i.e. the next call will leave interpreted code).
+ top = false
+ }).
diff --git a/lib/debugger/src/dbg_iload.erl b/lib/debugger/src/dbg_iload.erl
index db5a17ad2e..ce5631e45f 100644
--- a/lib/debugger/src/dbg_iload.erl
+++ b/lib/debugger/src/dbg_iload.erl
@@ -62,22 +62,23 @@ load_mod1(Mod, File, Binary, Db) ->
store_module(Mod, File, Binary, Db) ->
{interpreter_module, Exp, Abst, Src, MD5} = binary_to_term(Binary),
Forms = case abstr(Abst) of
- {abstract_v1,Forms0} -> Forms0;
- {abstract_v2,Forms0} -> Forms0;
+ {abstract_v1,_} ->
+ exit({Mod,too_old_beam_file});
+ {abstract_v2,_} ->
+ exit({Mod,too_old_beam_file});
{raw_abstract_v1,Code0} ->
Code = interpret_file_attribute(Code0),
{_,_,Forms0,_} = sys_pre_expand:module(Code, []),
Forms0
end,
dbg_idb:insert(Db, mod_file, File),
- dbg_idb:insert(Db, exports, Exp),
dbg_idb:insert(Db, defs, []),
put(vcount, 0),
put(fun_count, 0),
put(funs, []),
put(mod_md5, MD5),
- Attr = store_forms(Forms, Mod, Db, Exp, []),
+ store_forms(Forms, Mod, Db, Exp),
erase(mod_md5),
erase(current_function),
%% store_funs(Db, Mod),
@@ -85,11 +86,10 @@ store_module(Mod, File, Binary, Db) ->
erase(funs),
erase(fun_count),
- dbg_idb:insert(Db, attributes, Attr),
NewBinary = store_mod_line_no(Mod, Db, binary_to_list(Src)),
dbg_idb:insert(Db, mod_bin, NewBinary),
- dbg_idb:insert(Db, mod_raw, <<Src/binary,0:8>>), %% Add eos
- dbg_idb:insert(Db, module, Mod).
+ dbg_idb:insert(Db, mod_raw, <<Src/binary,0:8>>). %% Add eos
+
%% Adjust line numbers using the file/2 attribute.
%% Also take the absolute value of line numbers.
%% This simple fix will make the marker point at the correct line
@@ -111,27 +111,19 @@ abstr(Term) -> Term.
% store_funs_1(Fs, Db, Mod);
% store_funs_1([], _, _) -> ok.
-store_forms([{function,_,module_info,0,_}|Fs], Mod, Db, Exp, Attr) ->
- Cs = [{clause,0,[],[], [{module_info_0,0,Mod}]}],
- dbg_idb:insert(Db, {Mod,module_info,0,true}, Cs),
- store_forms(Fs, Mod, Db, Exp, Attr);
-store_forms([{function,_,module_info,1,_}|Fs], Mod, Db, Exp, Attr) ->
- Cs = [{clause,0,[{var,0,'What'}],[], [{module_info_1,0,Mod,[{var,0,'What'}]}]}],
- dbg_idb:insert(Db, {Mod,module_info,1,true}, Cs),
- store_forms(Fs, Mod, Db, Exp, Attr);
-store_forms([{function,_,Name,Arity,Cs0}|Fs], Mod, Db, Exp, Attr) ->
+store_forms([{function,_,Name,Arity,Cs0}|Fs], Mod, Db, Exp) ->
FA = {Name,Arity},
put(current_function, FA),
Cs = clauses(Cs0),
Exported = lists:member(FA, Exp),
dbg_idb:insert(Db, {Mod,Name,Arity,Exported}, Cs),
- store_forms(Fs, Mod, Db, Exp, Attr);
-store_forms([{attribute,_,Name,Val}|Fs], Mod, Db, Exp, Attr) ->
- store_forms(Fs, Mod, Db, Exp, [{Name,Val}|Attr]);
-store_forms([F|_], _Mod, _Db, _Exp, _Attr) ->
+ store_forms(Fs, Mod, Db, Exp);
+store_forms([{attribute,_,_Name,_Val}|Fs], Mod, Db, Exp) ->
+ store_forms(Fs, Mod, Db, Exp);
+store_forms([F|_], _Mod, _Db, _Exp) ->
exit({unknown_form,F});
-store_forms([], _, _, _, Attr) ->
- lists:reverse(Attr).
+store_forms([], _, _, _) ->
+ ok.
store_mod_line_no(Mod, Db, Contents) ->
store_mod_line_no(Mod, Db, Contents, 1, 0, []).
@@ -164,14 +156,14 @@ get_nl([],Pos,Head) -> {lists:reverse(Head),[],Pos}.
%%% to interpret.
clauses([C0|Cs]) ->
- C1 = clause(C0),
+ C1 = clause(C0, true),
[C1|clauses(Cs)];
clauses([]) -> [].
-clause({clause,Line,H0,G0,B0}) ->
+clause({clause,Line,H0,G0,B0}, Lc) ->
H1 = head(H0),
G1 = guard(G0),
- B1 = exprs(B0),
+ B1 = exprs(B0, Lc),
{clause,Line,H1,G1,B1}.
head(Ps) -> patterns(Ps).
@@ -219,7 +211,7 @@ pattern({bin,Line,Grp}) ->
{bin,Line,Grp1};
pattern({bin_element,Line,Expr,Size,Type}) ->
Expr1 = pattern(Expr),
- Size1 = expr(Size),
+ Size1 = expr(Size, false),
{bin_element,Line,Expr1,Size1,Type}.
%% These patterns are processed "in parallel" for purposes of variable
@@ -235,8 +227,6 @@ guard([G0|Gs]) ->
[G1|guard(Gs)];
guard([]) -> [].
-and_guard([{atom,_,true}|Gs]) ->
- and_guard(Gs);
and_guard([G0|Gs]) ->
G1 = guard_test(G0),
[G1|and_guard(Gs)];
@@ -244,12 +234,7 @@ and_guard([]) -> [].
guard_test({call,Line,{remote,_,{atom,_,erlang},{atom,_,F}},As0}) ->
As = gexpr_list(As0),
- case map_guard_bif(F, length(As0)) of
- {ok,Name} ->
- {safe_bif,Line,erlang,Name,As};
- error ->
- {safe_bif,Line,erlang,F,As}
- end;
+ {safe_bif,Line,erlang,F,As};
guard_test({op,Line,Op,L0}) ->
true = erl_internal:arith_op(Op, 1) orelse %Assertion.
erl_internal:bool_op(Op, 1),
@@ -266,25 +251,18 @@ guard_test({op,Line,Op,L0,R0}) ->
L1 = gexpr(L0),
R1 = gexpr(R0), %They see the same variables
{safe_bif,Line,erlang,Op,[L1,R1]};
-guard_test({integer,_,_}=I) -> I;
-guard_test({char,_,_}=C) -> C;
-guard_test({float,_,_}=F) -> F;
-guard_test({atom,_,_}=A) -> A;
-guard_test({nil,_}=N) -> N;
-guard_test({var,_,_}=V) ->V. % Boolean var
-
-map_guard_bif(integer, 1) -> {ok,is_integer};
-map_guard_bif(float, 1) -> {ok,is_float};
-map_guard_bif(number, 1) -> {ok,is_number};
-map_guard_bif(atom, 1) -> {ok,is_atom};
-map_guard_bif(list, 1) -> {ok,is_list};
-map_guard_bif(tuple, 1) -> {ok,is_tuple};
-map_guard_bif(pid, 1) -> {ok,is_pid};
-map_guard_bif(reference, 1) -> {ok,is_reference};
-map_guard_bif(port, 1) -> {ok,is_port};
-map_guard_bif(binary, 1) -> {ok,is_binary};
-map_guard_bif(function, 1) -> {ok,is_function};
-map_guard_bif(_, _) -> error.
+guard_test({var,_,_}=V) ->V; % Boolean var
+guard_test({atom,Line,true}) -> {value,Line,true};
+%% All other constants at this level means false.
+guard_test({atom,Line,_}) -> {value,Line,false};
+guard_test({integer,Line,_}) -> {value,Line,false};
+guard_test({char,Line,_}) -> {value,Line,false};
+guard_test({float,Line,_}) -> {value,Line,false};
+guard_test({string,Line,_}) -> {value,Line,false};
+guard_test({nil,Line}) -> {value,Line,false};
+guard_test({cons,Line,_,_}) -> {value,Line,false};
+guard_test({tuple,Line,_}) -> {value,Line,false};
+guard_test({bin,Line,_}) -> {value,Line,false}.
gexpr({var,Line,V}) -> {var,Line,V};
gexpr({integer,Line,I}) -> {value,Line,I};
@@ -341,186 +319,179 @@ gexpr_list([]) -> [].
%% These expressions are processed "sequentially" for purposes of variable
%% definition etc.
-exprs([E0|Es]) ->
- E1 = expr(E0),
- [E1|exprs(Es)];
-exprs([]) -> [].
-
-expr({var,Line,V}) -> {var,Line,V};
-expr({integer,Line,I}) -> {value,Line,I};
-expr({char,Line,I}) -> {value,Line,I};
-expr({float,Line,F}) -> {value,Line,F};
-expr({atom,Line,A}) -> {value,Line,A};
-expr({string,Line,S}) -> {value,Line,S};
-expr({nil,Line}) -> {value,Line,[]};
-expr({cons,Line,H0,T0}) ->
- case {expr(H0),expr(T0)} of
+exprs([E], Lc) ->
+ [expr(E, Lc)];
+exprs([E0|Es], Lc) ->
+ E1 = expr(E0, false),
+ [E1|exprs(Es, Lc)];
+exprs([], _Lc) -> [].
+
+expr({var,Line,V}, _Lc) -> {var,Line,V};
+expr({integer,Line,I}, _Lc) -> {value,Line,I};
+expr({char,Line,I}, _Lc) -> {value,Line,I};
+expr({float,Line,F}, _Lc) -> {value,Line,F};
+expr({atom,Line,A}, _Lc) -> {value,Line,A};
+expr({string,Line,S}, _Lc) -> {value,Line,S};
+expr({nil,Line}, _Lc) -> {value,Line,[]};
+expr({cons,Line,H0,T0}, _Lc) ->
+ case {expr(H0, false),expr(T0, false)} of
{{value,Line,H1},{value,Line,T1}} -> {value,Line,[H1|T1]};
{H1,T1} -> {cons,Line,H1,T1}
end;
-expr({tuple,Line,Es0}) ->
+expr({tuple,Line,Es0}, _Lc) ->
Es1 = expr_list(Es0),
{tuple,Line,Es1};
-expr({block,Line,Es0}) ->
+expr({block,Line,Es0}, Lc) ->
%% Unfold block into a sequence.
- Es1 = exprs(Es0),
+ Es1 = exprs(Es0, Lc),
{block,Line,Es1};
-expr({'if',Line,Cs0}) ->
- Cs1 = icr_clauses(Cs0),
+expr({'if',Line,Cs0}, Lc) ->
+ Cs1 = icr_clauses(Cs0, Lc),
{'if',Line,Cs1};
-expr({'case',Line,E0,Cs0}) ->
- E1 = expr(E0),
- Cs1 = icr_clauses(Cs0),
+expr({'case',Line,E0,Cs0}, Lc) ->
+ E1 = expr(E0, false),
+ Cs1 = icr_clauses(Cs0, Lc),
{'case',Line,E1,Cs1};
-expr({'receive',Line,Cs0}) ->
- Cs1 = icr_clauses(Cs0),
+expr({'receive',Line,Cs0}, Lc) ->
+ Cs1 = icr_clauses(Cs0, Lc),
{'receive',Line,Cs1};
-expr({'receive',Line,Cs0,To0,ToEs0}) ->
- To1 = expr(To0),
- ToEs1 = exprs(ToEs0),
- Cs1 = icr_clauses(Cs0),
+expr({'receive',Line,Cs0,To0,ToEs0}, Lc) ->
+ To1 = expr(To0, false),
+ ToEs1 = exprs(ToEs0, Lc),
+ Cs1 = icr_clauses(Cs0, Lc),
{'receive',Line,Cs1,To1,ToEs1};
-expr({'fun',Line,{clauses,Cs0},{_,_,Name}}) when is_atom(Name) ->
+expr({'fun',Line,{clauses,Cs0},{_,_,Name}}, _Lc) when is_atom(Name) ->
%% New R10B-2 format (abstract_v2).
Cs = fun_clauses(Cs0),
{make_fun,Line,Name,Cs};
-expr({'fun',Line,{clauses,Cs0},{_,_,_,_,Name}}) when is_atom(Name) ->
- %% New R8 format (abstract_v2).
- Cs = fun_clauses(Cs0),
- {make_fun,Line,Name,Cs};
-expr({'fun',Line,{function,F,A},{_Index,_OldUniq,Name}}) ->
+expr({'fun',Line,{function,F,A},{_Index,_OldUniq,Name}}, _Lc) ->
%% New R8 format (abstract_v2).
As = new_vars(A, Line),
- Cs = [{clause,Line,As,[],[{local_call,Line,F,As}]}],
+ Cs = [{clause,Line,As,[],[{local_call,Line,F,As,true}]}],
{make_fun,Line,Name,Cs};
-expr({'fun',_,{clauses,_},{_OldUniq,_Hvss,_Free}}) ->
- %% Old format (abstract_v1).
- exit({?MODULE,old_funs});
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,self}},[]}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,self}},[]}, _Lc) ->
{dbg,Line,self,[]};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,get_stacktrace}},[]}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,get_stacktrace}},[]}, _Lc) ->
{dbg,Line,get_stacktrace,[]};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,throw}},[_]=As}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,throw}},[_]=As}, _Lc) ->
{dbg,Line,throw,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,error}},[_]=As}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,error}},[_]=As}, _Lc) ->
{dbg,Line,error,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,fault}},[_]=As}) ->
- {dbg,Line,fault,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,exit}},[_]=As}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,exit}},[_]=As}, _Lc) ->
{dbg,Line,exit,expr_list(As)};
-expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,apply}},[_,_,_]=As0}) ->
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,raise}},[_,_,_]=As}, _Lc) ->
+ {dbg,Line,raise,expr_list(As)};
+expr({call,Line,{remote,_,{atom,_,erlang},{atom,_,apply}},[_,_,_]=As0}, Lc) ->
As = expr_list(As0),
- {apply,Line,As};
-expr({call,Line,{remote,_,{atom,_,Mod},{atom,_,Func}},As0}) ->
+ {apply,Line,As,Lc};
+expr({call,Line,{remote,_,{atom,_,Mod},{atom,_,Func}},As0}, Lc) ->
As = expr_list(As0),
case erlang:is_builtin(Mod, Func, length(As)) of
false ->
- {call_remote,Line,Mod,Func,As};
+ {call_remote,Line,Mod,Func,As,Lc};
true ->
- case bif_type(Mod, Func) of
+ case bif_type(Mod, Func, length(As0)) of
safe -> {safe_bif,Line,Mod,Func,As};
- spawn -> {spawn_bif,Line,Mod,Func,As};
unsafe ->{bif,Line,Mod,Func,As}
end
end;
-expr({call,Line,{remote,_,Mod0,Func0},As0}) ->
+expr({call,Line,{remote,_,Mod0,Func0},As0}, Lc) ->
%% New R8 format (abstract_v2).
- Mod = expr(Mod0),
- Func = expr(Func0),
+ Mod = expr(Mod0, false),
+ Func = expr(Func0, false),
As = consify(expr_list(As0)),
- {apply,Line,[Mod,Func,As]};
-expr({call,Line,{atom,_,Func},As0}) ->
+ {apply,Line,[Mod,Func,As],Lc};
+expr({call,Line,{atom,_,Func},As0}, Lc) ->
As = expr_list(As0),
- {local_call,Line,Func,As};
-expr({call,Line,Fun0,As0}) ->
- Fun = expr(Fun0),
+ {local_call,Line,Func,As,Lc};
+expr({call,Line,Fun0,As0}, Lc) ->
+ Fun = expr(Fun0, false),
As = expr_list(As0),
- {apply_fun,Line,Fun,As};
-expr({'catch',Line,E0}) ->
+ {apply_fun,Line,Fun,As,Lc};
+expr({'catch',Line,E0}, _Lc) ->
%% No new variables added.
- E1 = expr(E0),
+ E1 = expr(E0, false),
{'catch',Line,E1};
-expr({'try',Line,Es0,CaseCs0,CatchCs0,As0}) ->
+expr({'try',Line,Es0,CaseCs0,CatchCs0,As0}, Lc) ->
%% No new variables added.
Es = expr_list(Es0),
- CaseCs = icr_clauses(CaseCs0),
- CatchCs = icr_clauses(CatchCs0),
+ CaseCs = icr_clauses(CaseCs0, Lc),
+ CatchCs = icr_clauses(CatchCs0, Lc),
As = expr_list(As0),
{'try',Line,Es,CaseCs,CatchCs,As};
-expr({'query', Line, E0}) ->
- E = expr(E0),
- {'query', Line, E};
-expr({lc,Line,E0,Gs0}) -> %R8.
+expr({lc,Line,E0,Gs0}, _Lc) -> %R8.
Gs = lists:map(fun ({generate,L,P0,Qs}) ->
- {generate,L,expr(P0),expr(Qs)};
+ {generate,L,expr(P0, false),expr(Qs, false)};
({b_generate,L,P0,Qs}) -> %R12.
- {b_generate,L,expr(P0),expr(Qs)};
+ {b_generate,L,expr(P0, false),expr(Qs, false)};
(Expr) ->
- case is_guard_test(Expr) of
- true -> {guard,[[guard_test(Expr)]]};
- false -> expr(Expr)
+ case is_guard(Expr) of
+ true -> {guard,guard([[Expr]])};
+ false -> expr(Expr, false)
end
end, Gs0),
- {lc,Line,expr(E0),Gs};
-expr({bc,Line,E0,Gs0}) -> %R12.
+ {lc,Line,expr(E0, false),Gs};
+expr({bc,Line,E0,Gs0}, _Lc) -> %R12.
Gs = lists:map(fun ({generate,L,P0,Qs}) ->
- {generate,L,expr(P0),expr(Qs)};
+ {generate,L,expr(P0, false),expr(Qs, false)};
({b_generate,L,P0,Qs}) -> %R12.
- {b_generate,L,expr(P0),expr(Qs)};
+ {b_generate,L,expr(P0, false),expr(Qs, false)};
(Expr) ->
- case is_guard_test(Expr) of
- true -> {guard,[[guard_test(Expr)]]};
- false -> expr(Expr)
+ case is_guard(Expr) of
+ true -> {guard,guard([[Expr]])};
+ false -> expr(Expr, false)
end
end, Gs0),
- {bc,Line,expr(E0),Gs};
-expr({match,Line,P0,E0}) ->
- E1 = expr(E0),
+ {bc,Line,expr(E0, false),Gs};
+expr({match,Line,P0,E0}, _Lc) ->
+ E1 = expr(E0, false),
P1 = pattern(P0),
{match,Line,P1,E1};
-expr({op,Line,Op,A0}) ->
- A1 = expr(A0),
+expr({op,Line,Op,A0}, _Lc) ->
+ A1 = expr(A0, false),
{op,Line,Op,[A1]};
-expr({op,Line,'++',L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,'++',L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{op,Line,append,[L1,R1]};
-expr({op,Line,'--',L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,'--',L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{op,Line,subtract,[L1,R1]};
-expr({op,Line,'!',L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,'!',L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{send,Line,L1,R1};
-expr({op,Line,Op,L0,R0}) when Op =:= 'andalso'; Op =:= 'orelse' ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,Op,L0,R0}, _Lc) when Op =:= 'andalso'; Op =:= 'orelse' ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{Op,Line,L1,R1};
-expr({op,Line,Op,L0,R0}) ->
- L1 = expr(L0),
- R1 = expr(R0), %They see the same variables
+expr({op,Line,Op,L0,R0}, _Lc) ->
+ L1 = expr(L0, false),
+ R1 = expr(R0, false), %They see the same variables
{op,Line,Op,[L1,R1]};
-expr({bin,Line,Grp}) ->
+expr({bin,Line,Grp}, _Lc) ->
Grp1 = expr_list(Grp),
{bin,Line,Grp1};
-expr({bin_element,Line,Expr,Size,Type}) ->
- Expr1 = expr(Expr),
- Size1 = expr(Size),
+expr({bin_element,Line,Expr,Size,Type}, _Lc) ->
+ Expr1 = expr(Expr, false),
+ Size1 = expr(Size, false),
{bin_element,Line,Expr1,Size1,Type};
-expr(Other) ->
+expr(Other, _Lc) ->
exit({?MODULE,{unknown_expr,Other}}).
-%% is_guard_test(Expression) -> true | false.
-%% Test if a general expression is a guard test. Cannot use erl_lint
-%% here as sys_pre_expand has transformed source.
+%% is_guard(Expression) -> true | false.
+%% Test if a general expression is a guard test or guard BIF.
+%% Cannot use erl_lint here as sys_pre_expand has transformed source.
-is_guard_test({op,_,Op,L,R}) ->
+is_guard({op,_,Op,L,R}) ->
erl_internal:comp_op(Op, 2) andalso is_gexpr_list([L,R]);
-is_guard_test({call,_,{remote,_,{atom,_,erlang},{atom,_,Test}},As}) ->
- erl_internal:type_test(Test, length(As)) andalso is_gexpr_list(As);
-is_guard_test({atom,_,true}) -> true;
-is_guard_test(_) -> false.
+is_guard({call,_,{remote,_,{atom,_,erlang},{atom,_,Test}},As}) ->
+ Arity = length(As),
+ (erl_internal:guard_bif(Test, Arity) orelse
+ erl_internal:old_type_test(Test, Arity)) andalso is_gexpr_list(As);
+is_guard({atom,_,true}) -> true;
+is_guard(_) -> false.
is_gexpr({var,_,_}) -> true;
is_gexpr({atom,_,_}) -> true;
@@ -555,17 +526,17 @@ consify([]) -> {value,0,[]}.
%% definition etc.
expr_list([E0|Es]) ->
- E1 = expr(E0),
+ E1 = expr(E0, false),
[E1|expr_list(Es)];
expr_list([]) -> [].
-icr_clauses([C0|Cs]) ->
- C1 = clause(C0),
- [C1|icr_clauses(Cs)];
-icr_clauses([]) -> [].
+icr_clauses([C0|Cs], Lc) ->
+ C1 = clause(C0, Lc),
+ [C1|icr_clauses(Cs, Lc)];
+icr_clauses([], _) -> [].
fun_clauses([{clause,L,H,G,B}|Cs]) ->
- [{clause,L,head(H),guard(G),exprs(B)}|fun_clauses(Cs)];
+ [{clause,L,head(H),guard(G),exprs(B, true)}|fun_clauses(Cs)];
fun_clauses([]) -> [].
%% new_var_name() -> VarName.
@@ -585,24 +556,21 @@ new_vars(N, L, Vs) when N > 0 ->
new_vars(N-1, L, [V|Vs]);
new_vars(0, _, Vs) -> Vs.
-bif_type(erlang, Name) -> bif_type(Name);
-bif_type(_, _) -> unsafe.
+bif_type(erlang, Name, Arity) ->
+ case erl_internal:guard_bif(Name, Arity) of
+ true ->
+ %% Guard BIFs are safe (except for self/0, but it is
+ %% handled with a special instruction anyway).
+ safe;
+ false ->
+ bif_type(Name)
+ end;
+bif_type(_, _, _) -> unsafe.
bif_type(register) -> safe;
bif_type(unregister) -> safe;
bif_type(whereis) -> safe;
bif_type(registered) -> safe;
-bif_type(abs) -> safe;
-bif_type(float) -> safe;
-bif_type(trunc) -> safe;
-bif_type(round) -> safe;
-bif_type(math) -> safe;
-bif_type(node) -> safe;
-bif_type(length) -> safe;
-bif_type(hd) -> safe;
-bif_type(tl) -> safe;
-bif_type(size) -> safe;
-bif_type(element) -> safe;
bif_type(setelement) -> safe;
bif_type(atom_to_list) -> safe;
bif_type(list_to_atom) -> safe;
@@ -627,21 +595,14 @@ bif_type(list_to_pid) -> safe;
bif_type(module_loaded) -> safe;
bif_type(binary_to_term) -> safe;
bif_type(term_to_binary) -> safe;
-bif_type(alive) -> safe;
-bif_type(notalive) -> safe;
bif_type(nodes) -> safe;
bif_type(is_alive) -> safe;
bif_type(disconnect_node) -> safe;
bif_type(binary_to_list) -> safe;
bif_type(list_to_binary) -> safe;
bif_type(split_binary) -> safe;
-bif_type(term_to_atom) -> safe;
bif_type(hash) -> safe;
bif_type(pre_loaded) -> safe;
-bif_type(info) -> safe;
bif_type(set_cookie) -> safe;
bif_type(get_cookie) -> safe;
-bif_type(spawn) -> spawn;
-bif_type(spawn_link) -> spawn;
-bif_type(spawn_opt) -> spawn;
bif_type(_) -> unsafe.
diff --git a/lib/debugger/src/dbg_iserver.erl b/lib/debugger/src/dbg_iserver.erl
index 212bc2b8ab..1bb73a43b9 100644
--- a/lib/debugger/src/dbg_iserver.erl
+++ b/lib/debugger/src/dbg_iserver.erl
@@ -97,13 +97,10 @@ ensure_started() ->
%%
%% Key Value
%% --- -----
-%% attributes Attr
-%% exports Exp
%% defs []
%% mod_bin Binary
%% mod_raw Raw Binary
%% mod_file File
-%% module Mod
%% {Mod,Name,Arity,Exported} Cs
%% {'fun',Mod,Index,Uniq} {Name,Arity,Cs}
%% Line {Pos,PosNL}
@@ -117,7 +114,7 @@ init([]) ->
process_flag(trap_exit, true),
global:register_name(?MODULE, self()),
Db = ets:new(?MODULE, [ordered_set, protected]),
- {ok, #state{db=Db, auto=false, stack=all}}.
+ {ok, #state{db=Db, auto=false, stack=no_tail}}.
%% Attaching to a process
handle_call({attached, AttPid, Pid}, _From, State) ->
diff --git a/lib/debugger/src/dbg_istk.erl b/lib/debugger/src/dbg_istk.erl
new file mode 100644
index 0000000000..c6922a80e4
--- /dev/null
+++ b/lib/debugger/src/dbg_istk.erl
@@ -0,0 +1,245 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+-module(dbg_istk).
+-export([init/0,delayed_to_external/0,from_external/1,
+ push/3,pop/0,pop/1,stack_level/0,
+ delayed_stacktrace/0,delayed_stacktrace/2,
+ bindings/1,stack_frame/2,backtrace/2,
+ in_use_p/2]).
+
+-include("dbg_ieval.hrl").
+
+-define(STACK, ?MODULE).
+
+-record(e,
+ {level, %Level
+ mfa, %{Mod,Func,Args|Arity}|{Fun,Args}
+ line, %Line called from
+ bindings,
+ lc %Last call (true|false)
+ }).
+
+init() ->
+ init([]).
+
+delayed_to_external() ->
+ Stack = get(?STACK),
+ fun() -> {stack,term_to_binary(Stack)} end.
+
+from_external({stack,Stk}) ->
+ put(?STACK, binary_to_term(Stk)).
+
+init(Stack) ->
+ put(?STACK, Stack).
+
+%% We keep track of a call stack that is used for
+%% 1) saving stack frames that can be inspected from an Attached
+%% Process GUI (using dbg_icmd:get(Meta, stack_frame, {Dir, SP})
+%% 2) generate an approximation of regular stacktrace -- sent to
+%% Debugged when it should raise an exception or evaluate a
+%% function (since it might possible raise an exception)
+%%
+%% How to push depends on the "Stack Trace" option (value saved in
+%% process dictionary item 'trace_stack').
+%% all - everything is pushed
+%% no_tail - tail recursive push
+%% false - nothing is pushed
+%% Whenever a function returns, the corresponding call frame is popped.
+
+push(Bs, #ieval{level=Le,module=Mod,function=Name,
+ arguments=As,line=Li}=Ieval, Lc) ->
+ Entry = #e{level=Le,mfa={Mod,Name,As},line=Li,bindings=Bs,lc=Lc},
+ case get(trace_stack) of
+ false ->
+ Ieval#ieval{level=Le+1};
+ no_tail when Lc ->
+ Ieval;
+ _ -> % all | no_tail when Lc =:= false
+ put(?STACK, [Entry|get(?STACK)]),
+ Ieval#ieval{level=Le+1}
+ end.
+
+pop() ->
+ case get(trace_stack) of
+ false -> ignore;
+ _ -> % all ¦ no_tail
+ case get(?STACK) of
+ [_Entry|Entries] ->
+ put(?STACK, Entries);
+ [] ->
+ ignore
+ end
+ end.
+
+pop(Le) ->
+ case get(trace_stack) of
+ false -> ignore;
+ _ -> % all | no_tail
+ put(?STACK, pop(Le, get(?STACK)))
+ end.
+
+pop(Level, [#e{level=Le}|Stack]) when Level =< Le ->
+ pop(Level, Stack);
+pop(_Level, Stack) ->
+ Stack.
+
+%% stack_level() -> Le
+%% stack_level(Stack) -> Le
+%% Top call level
+stack_level() ->
+ stack_level(get(?STACK)).
+
+stack_level([]) -> 1;
+stack_level([#e{level=Le}|_]) -> Le.
+
+%% delayed_stacktrace() -> CreateStacktraceFun
+%% delayed_stacktrace(ArgFlag, #ieval{}) -> CreateStacktraceFun
+%% ArgFlag = no_args | include_args
+%% CreateStacktraceFun = fun(NumberOfEntries)
+%%
+%% Return a fun that can convert the internal stack format to
+%% an imitation of the regular stacktrace.
+
+delayed_stacktrace() ->
+ Stack0 = get(?STACK),
+ fun(NumEntries) ->
+ Stack = stacktrace(NumEntries, Stack0, []),
+ [finalize(ArityOnly) || {ArityOnly,_} <- Stack]
+ end.
+
+delayed_stacktrace(include_args, Ieval) ->
+ #ieval{module=Mod,function=Name,arguments=As,line=Li} = Ieval,
+ Stack0 = [#e{mfa={Mod,Name,As},line=Li}|get(?STACK)],
+ fun(NumEntries) ->
+ case stacktrace(NumEntries, Stack0, []) of
+ [] ->
+ [];
+ [{_,WithArgs}|Stack] ->
+ [finalize(WithArgs) |
+ [finalize(ArityOnly) || {ArityOnly,_} <- Stack]]
+ end
+ end;
+delayed_stacktrace(no_args, Ieval) ->
+ #ieval{module=Mod,function=Name,arguments=As,line=Li} = Ieval,
+ Stack0 = [#e{mfa={Mod,Name,As},line=Li}|get(?STACK)],
+ fun(NumEntries) ->
+ Stack = stacktrace(NumEntries, Stack0, []),
+ [finalize(ArityOnly) || {ArityOnly,_} <- Stack]
+ end.
+
+stacktrace(N, [#e{lc=true}|T], Acc) ->
+ stacktrace(N, T, Acc);
+stacktrace(N, [E|T], []) ->
+ stacktrace(N-1, T, [normalize(E)]);
+stacktrace(N, [E|T], [{P,_}|_]=Acc) when N > 0 ->
+ case normalize(E) of
+ {P,_} ->
+ stacktrace(N, T, Acc);
+ New ->
+ stacktrace(N-1, T, [New|Acc])
+ end;
+stacktrace(_, _, Acc) ->
+ lists:reverse(Acc).
+
+normalize(#e{mfa={M,Fun,As},line=Li}) when is_function(Fun) ->
+ Loc = {M,Li},
+ {{Fun,length(As),Loc},{Fun,As,Loc}};
+normalize(#e{mfa={M,F,As},line=Li}) ->
+ Loc = {M,Li},
+ {{M,F,length(As),Loc},{M,F,As,Loc}}.
+
+finalize({M,F,A,Loc}) -> {M,F,A,line(Loc)};
+finalize({Fun,A,Loc}) -> {Fun,A,line(Loc)}.
+
+line({Mod,Line}) when Line > 0 ->
+ [{file,atom_to_list(Mod)++".erl"},{line,Line}];
+line(_) -> [].
+
+%% bindings(SP) -> Bs
+%% SP = Le % stack pointer
+%% Return the bindings for the specified call level
+bindings(SP) ->
+ bindings(SP, get(?STACK)).
+
+bindings(SP, [#e{level=SP,bindings=Bs}|_]) ->
+ Bs;
+bindings(SP, [_Entry|Entries]) ->
+ bindings(SP, Entries);
+bindings(_SP, []) ->
+ erl_eval:new_bindings().
+
+%% stack_frame(Dir, SP) -> {Le, Where, Bs} | top | bottom
+%% Dir = up | down
+%% Where = {Cm, Li}
+%% Cm = Module | undefined % module
+%% Li = int() | -1 % line number
+%% Bs = bindings()
+%% Return stack frame info one step up/down from given stack pointer
+%% up = to lower call levels
+%% down = to higher call levels
+stack_frame(up, SP) ->
+ stack_frame(SP, up, get(?STACK));
+stack_frame(down, SP) ->
+ stack_frame(SP, down, lists:reverse(get(?STACK))).
+
+stack_frame(SP, up, [#e{level=Le,mfa={Cm,_,_},line=Li,bindings=Bs}|_])
+ when Le < SP ->
+ {Le,{Cm,Li},Bs};
+stack_frame(SP, down, [#e{level=Le,mfa={Cm,_,_},line=Li,bindings=Bs}|_])
+ when Le > SP ->
+ {Le,{Cm,Li},Bs};
+stack_frame(SP, Dir, [#e{level=SP}|Stack]) ->
+ case Stack of
+ [#e{level=Le,mfa={Cm,_,_},line=Li,bindings=Bs}|_] ->
+ {Le,{Cm,Li},Bs};
+ [] when Dir =:= up ->
+ top;
+ [] when Dir =:= down ->
+ bottom
+ end;
+stack_frame(SP, Dir, [_Entry|Stack]) ->
+ stack_frame(SP, Dir, Stack).
+
+%% backtrace(HowMany) -> Backtrace
+%% HowMany = all | int()
+%% Backtrace = {Le, MFA}
+%% Return all/the last N called functions, in reversed call order
+backtrace(HowMany, Ieval) ->
+ #ieval{level=Level,module=Mod,function=Name,arguments=As} = Ieval,
+ Stack0 = [#e{level=Level,mfa={Mod,Name,As}}|get(?STACK)],
+ Stack = case HowMany of
+ all -> Stack0;
+ N -> lists:sublist(Stack0, N)
+ end,
+ [{Le,MFA} || #e{level=Le,mfa=MFA} <- Stack].
+
+%%--------------------------------------------------------------------
+%% in_use_p(Mod, Cm) -> boolean()
+%% Mod = Cm = atom()
+%% Returns true if Mod is found on the stack, otherwise false.
+%%--------------------------------------------------------------------
+in_use_p(Mod, Mod) -> true;
+in_use_p(Mod, _Cm) ->
+ case get(trace_stack) of
+ false -> true;
+ _ -> % all | no_tail
+ lists:any(fun(#e{mfa={M,_,_}}) when M =:= Mod -> true;
+ (_) -> false
+ end, get(?STACK))
+ end.
diff --git a/lib/debugger/src/debugger.app.src b/lib/debugger/src/debugger.app.src
index 21cf59a2e1..5538f66260 100644
--- a/lib/debugger/src/debugger.app.src
+++ b/lib/debugger/src/debugger.app.src
@@ -26,6 +26,7 @@
dbg_ieval,
dbg_iload,
dbg_iserver,
+ dbg_istk,
dbg_ui_break,
dbg_ui_break_win,
dbg_ui_edit,
diff --git a/lib/debugger/test/Makefile b/lib/debugger/test/Makefile
index 2296bd0ae6..3dfbed31ff 100644
--- a/lib/debugger/test/Makefile
+++ b/lib/debugger/test/Makefile
@@ -43,6 +43,7 @@ MODULES= \
exception_SUITE \
fun_SUITE \
lc_SUITE \
+ line_number_SUITE \
record_SUITE \
trycatch_SUITE \
test_lib \
diff --git a/lib/debugger/test/bs_construct_SUITE.erl b/lib/debugger/test/bs_construct_SUITE.erl
index 5c7d49e951..187c9f53b0 100644
--- a/lib/debugger/test/bs_construct_SUITE.erl
+++ b/lib/debugger/test/bs_construct_SUITE.erl
@@ -19,18 +19,31 @@
-module(bs_construct_SUITE).
+%% Copied from bs_construct_SUITE in the emulator test suite.
+%% The following test cases have been omitted since they don't
+%% make much sense for the debugger:
+%% bs_add
+%% kostis
+
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- test1/1, test2/1, test3/1, test4/1, test5/1, testf/1, not_used/1, in_guard/1,
- coerce_to_float/1]).
+ test1/1, test2/1, test3/1, test4/1, test5/1, testf/1,
+ not_used/1, in_guard/1,
+ mem_leak/1, coerce_to_float/1, bjorn/1,
+ huge_float_field/1, huge_binary/1, system_limit/1, badarg/1,
+ copy_writable_binary/1, dynamic/1,
+ otp_7422/1, zero_width/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [test1, test2, test3, test4, test5, testf, not_used,
+ in_guard, mem_leak, coerce_to_float, bjorn,
+ huge_float_field, huge_binary, system_limit, badarg,
+ copy_writable_binary, dynamic, otp_7422, zero_width].
groups() ->
[].
@@ -41,11 +54,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [test1, test2, test3, test4, test5, testf, not_used,
- in_guard, coerce_to_float].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(1)),
@@ -75,7 +83,9 @@ r(L) ->
-define(T(B, L), {B, ??B, L}).
-define(N(B), {B, ??B, unknown}).
--define(FAIL(Expr), ?line {'EXIT',{badarg,_}} = (catch Expr)).
+-define(FAIL(Expr), ?line fail_check(catch Expr, ??Expr, [])).
+
+-define(FAIL_VARS(Expr, Vars), ?line fail_check(catch Expr, ??Expr, Vars)).
l(I_13, I_big1) ->
[
@@ -143,7 +153,13 @@ l(I_13, I_big1) ->
native_3798()),
?T(<<32978297842987249827298387697777669766334937:128/native-integer>>,
- native_bignum())
+ native_bignum()),
+
+ %% Unit tests.
+ ?T(<<<<5:3>>/bitstring>>, <<5:3>>),
+ ?T(<<42,<<7:4>>/binary-unit:4>>, <<42,7:4>>),
+ ?T(<<<<344:17>>/binary-unit:17>>, <<344:17>>),
+ ?T(<<<<42,3,7656:16>>/binary-unit:16>>, <<42,3,7656:16>>)
].
@@ -179,7 +195,7 @@ eval_list([{C_bin, Str, Bytes} | Rest], Vars) ->
[{C_bin, E_bin, Str, Bytes} | eval_list(Rest, Vars)]
end.
-one_test({C_bin, E_bin, Str, Bytes}) when list(Bytes) ->
+one_test({C_bin, E_bin, Str, Bytes}) when is_list(Bytes) ->
io:format(" ~s, ~p~n", [Str, Bytes]),
Bin = list_to_binary(Bytes),
if
@@ -222,7 +238,7 @@ one_test({C_bin, E_bin, Str, Result}) ->
ok;
%% For situations where the final bits may not matter, like
%% for floats:
- N when integer(N) ->
+ N when is_integer(N) ->
io:format("Info: compiled and interpreted differ in the"
" last bytes:~n ~p, ~p.~n",
[binary_to_list(C_bin), binary_to_list(E_bin)]),
@@ -248,9 +264,22 @@ equal_lists(A, B, R) ->
false
end.
+fail_check({'EXIT',{badarg,_}}, Str, Vars) ->
+ try evaluate(Str, Vars) of
+ Res ->
+ io:format("Interpreted result: ~p", [Res]),
+ ?t:fail(did_not_fail_in_intepreted_code)
+ catch
+ error:badarg ->
+ ok
+ end;
+fail_check(Res, _, _) ->
+ io:format("Compiled result: ~p", [Res]),
+ ?t:fail(did_not_fail_in_compiled_code).
+
%%% Simple working cases
test1(suite) -> [];
-test1(Config) when list(Config) ->
+test1(Config) when is_list(Config) ->
?line I_13 = i(13),
?line I_big1 = big(1),
?line Vars = [{'I_13', I_13},
@@ -272,7 +301,7 @@ gen_l(N, S, A) ->
[?T(<<A:S/little, A:(N-S)/little>>, comp(N, A, S))].
test2(suite) -> [];
-test2(Config) when list(Config) ->
+test2(Config) when is_list(Config) ->
?line test2(0, 8, 2#10101010101010101),
?line test2(0, 8, 2#1111111111).
@@ -300,7 +329,7 @@ t3() ->
].
test3(suite) -> [];
-test3(Config) when list(Config) ->
+test3(Config) when is_list(Config) ->
?line Vars = [],
?line lists:foreach(fun one_test/1, eval_list(t3(), Vars)).
@@ -311,7 +340,7 @@ gen_u_l(N, S, A) ->
[?N(<<A:S/little, A:(N-S)/little>>)].
test4(suite) -> [];
-test4(Config) when list(Config) ->
+test4(Config) when is_list(Config) ->
?line test4(0, 16, 2#10101010101010101),
?line test4(0, 16, 2#1111111111).
@@ -333,7 +362,7 @@ gen_b(N, S, A) ->
test5(suite) -> [];
test5(doc) -> ["OTP-3995"];
-test5(Config) when list(Config) ->
+test5(Config) when is_list(Config) ->
?line test5(0, 8, <<73>>),
?line test5(0, 8, <<68>>).
@@ -350,40 +379,63 @@ test5(S, A) ->
%%% Failure cases
testf(suite) -> [];
-testf(Config) when list(Config) ->
- ?FAIL(<<3.14>>),
- ?FAIL(<<<<1,2>>>>),
-
- ?FAIL(<<2.71/binary>>),
- ?FAIL(<<24334/binary>>),
- ?FAIL(<<24334344294788947129487129487219847/binary>>),
-
- ?FAIL(<<<<1,2,3>>/float>>),
+testf(Config) when is_list(Config) ->
+ ?line ?FAIL(<<3.14>>),
+ ?line ?FAIL(<<<<1,2>>>>),
+
+ ?line ?FAIL(<<2.71/binary>>),
+ ?line ?FAIL(<<24334/binary>>),
+ ?line ?FAIL(<<24334344294788947129487129487219847/binary>>),
+ BigInt = id(24334344294788947129487129487219847),
+ ?line ?FAIL_VARS(<<BigInt/binary>>, [{'BigInt',BigInt}]),
+ ?line ?FAIL_VARS(<<42,BigInt/binary>>, [{'BigInt',BigInt}]),
+ ?line ?FAIL_VARS(<<BigInt:2/binary>>, [{'BigInt',BigInt}]),
+
+ %% One negative field size, but the sum of field sizes will be 1 byte.
+ %% Make sure that we reject that properly.
+ I_minus_777 = id(-777),
+ I_minus_2047 = id(-2047),
+ ?line ?FAIL_VARS(<<I_minus_777:2048/unit:8,57:I_minus_2047/unit:8>>,
+ ordsets:from_list([{'I_minus_777',I_minus_777},
+ {'I_minus_2047',I_minus_2047}])),
+ ?line ?FAIL(<<<<1,2,3>>/float>>),
%% Negative field widths.
- testf_1(-8, <<1,2,3,4,5>>),
-
- ?FAIL(<<42:(-16)>>),
- ?FAIL(<<3.14:(-8)/float>>),
- ?FAIL(<<<<23,56,0,2>>:(-16)/binary>>),
- ?FAIL(<<<<23,56,0,2>>:(2.5)/binary>>),
- ?FAIL(<<<<23,56,0,2>>:(anka)>>),
+ ?line testf_1(-8, <<1,2,3,4,5>>),
+ ?line ?FAIL(<<0:(-(1 bsl 100))>>),
+
+ ?line ?FAIL(<<42:(-16)>>),
+ ?line ?FAIL(<<3.14:(-8)/float>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(-16)/binary>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(2.5)/binary>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(anka)>>),
+ ?line ?FAIL(<<<<23,56,0,2>>:(anka)>>),
+
+ %% Unit failures.
+ ?line ?FAIL(<<<<1:1>>/binary>>),
+ Sz = id(1),
+ ?line ?FAIL_VARS(<<<<1:Sz>>/binary>>, [{'Sz',Sz}]),
+ ?line {'EXIT',{badarg,_}} = (catch <<<<1:(id(1))>>/binary>>),
+ ?line ?FAIL(<<<<7,8,9>>/binary-unit:16>>),
+ ?line ?FAIL(<<<<7,8,9,3:7>>/binary-unit:16>>),
+ ?line ?FAIL(<<<<7,8,9,3:7>>/binary-unit:17>>),
ok.
testf_1(W, B) ->
- ?FAIL(<<42:W>>),
- ?FAIL(<<3.14:W/float>>),
- ?FAIL(<<B:W/binary>>).
+ Vars = [{'W',W}],
+ ?FAIL_VARS(<<42:W>>, Vars),
+ ?FAIL_VARS(<<3.14:W/float>>, Vars),
+ ?FAIL_VARS(<<B:W/binary>>, [{'B',B}|Vars]).
not_used(doc) ->
"Test that constructed binaries that are not used will still give an exception.";
not_used(Config) when is_list(Config) ->
?line ok = not_used1(3, <<"dum">>),
- ?line ?FAIL(not_used1(3, "dum")),
- ?line ?FAIL(not_used2(444, -2)),
- ?line ?FAIL(not_used2(444, anka)),
- ?line ?FAIL(not_used3(444)),
+ ?line {'EXIT',{badarg,_}} = (catch not_used1(3, "dum")),
+ ?line {'EXIT',{badarg,_}} = (catch not_used2(444, -2)),
+ ?line {'EXIT',{badarg,_}} = (catch not_used2(444, anka)),
+ ?line {'EXIT',{badarg,_}} = (catch not_used3(444)),
ok.
not_used1(I, BinString) ->
@@ -398,7 +450,7 @@ not_used3(I) ->
<<I:(-8)>>,
ok.
-in_guard(Config) when list(Config) ->
+in_guard(Config) when is_list(Config) ->
?line 1 = in_guard(<<16#74ad:16>>, 16#e95, 5),
?line 2 = in_guard(<<16#3A,16#F7,"hello">>, 16#3AF7, <<"hello">>),
?line 3 = in_guard(<<16#FBCD:14,3.1415/float,3:2>>, 16#FBCD, 3.1415),
@@ -415,6 +467,36 @@ in_guard(Bin, A, B) when <<A:14,B/float,3:2>> == Bin -> 3;
in_guard(Bin, A, B) when {a,b,<<A:14,B/float,3:2>>} == Bin -> cant_happen;
in_guard(_, _, _) -> nope.
+mem_leak(doc) -> "Make sure that construction has no memory leak";
+mem_leak(Config) when is_list(Config) ->
+ ?line B = make_bin(16, <<0>>),
+ ?line mem_leak(1024, B),
+ ok.
+
+mem_leak(0, _) -> ok;
+mem_leak(N, B) ->
+ ?line big_bin(B, <<23>>),
+ ?line {'EXIT',{badarg,_}} = (catch big_bin(B, bad)),
+ maybe_gc(),
+ mem_leak(N-1, B).
+
+big_bin(B1, B2) ->
+ <<B1/binary,B1/binary,B1/binary,B1/binary,
+ B1/binary,B1/binary,B1/binary,B1/binary,
+ B1/binary,B1/binary,B1/binary,B1/binary,
+ B1/binary,B1/binary,B1/binary,B1/binary,
+ B2/binary>>.
+
+make_bin(0, Acc) -> Acc;
+make_bin(N, Acc) -> make_bin(N-1, <<Acc/binary,Acc/binary>>).
+
+maybe_gc() ->
+ case erlang:system_info(heap_type) of
+ shared -> erlang:garbage_collect();
+ hybrid -> erlang:garbage_collect();
+ private -> ok
+ end.
+
-define(COF(Int0),
?line (fun(Int) ->
true = <<Int:32/float>> =:= <<(float(Int)):32/float>>,
@@ -431,7 +513,7 @@ in_guard(_, _, _) -> nope.
nonliteral(X) -> X.
-coerce_to_float(Config) when list(Config) ->
+coerce_to_float(Config) when is_list(Config) ->
?COF(0),
?COF(-1),
?COF(1),
@@ -444,3 +526,232 @@ coerce_to_float(Config) when list(Config) ->
?COF64(298748888888888888888888888883478264866528467367364766666666666666663),
?COF64(-367546729879999999999947826486652846736736476555566666663),
ok.
+
+bjorn(Config) when is_list(Config) ->
+ ?line error = bjorn_1(),
+ ok.
+
+bjorn_1() ->
+ Bitstr = <<7:13>>,
+ try
+ do_something()
+ catch
+ throw:blurf ->
+ ignore
+ end,
+ do_more(Bitstr, 13).
+
+do_more(Bin, Sz) ->
+ %% Previous bug in the bs_bits_to_bytes instruction: The exeption code
+ %% was not set - the previous exception (throw:blurf) would be used,
+ %% causing the catch to slip.
+ try <<Bin:Sz/binary>> of
+ _V -> ok
+ catch
+ error:_ ->
+ error
+ end.
+
+do_something() ->
+ throw(blurf).
+
+huge_float_field(Config) when is_list(Config) ->
+ ?line {'EXIT',{badarg,_}} = (catch <<0.0:9/float-unit:8>>),
+ ?line huge_float_check(catch <<0.0:67108865/float-unit:64>>),
+ ?line huge_float_check(catch <<0.0:((1 bsl 26)+1)/float-unit:64>>),
+ ?line huge_float_check(catch <<0.0:(id(67108865))/float-unit:64>>),
+%% ?line huge_float_check(catch <<0.0:((1 bsl 60)+1)/float-unit:64>>),
+ ?line huge_float_check(catch <<3839739387439387383739387987347983:((1 bsl 26)+1)/float-unit:64>>),
+%% ?line huge_float_check(catch <<3839739387439387383739387987347983:((1 bsl 60)+1)/float-unit:64>>),
+ ok.
+
+huge_float_check({'EXIT',{system_limit,_}}) -> ok;
+huge_float_check({'EXIT',{badarg,_}}) -> ok.
+
+huge_binary(Config) when is_list(Config) ->
+ ?line 16777216 = size(<<0:(id(1 bsl 26)),(-1):(id(1 bsl 26))>>),
+ ok.
+
+system_limit(Config) when is_list(Config) ->
+ WordSize = erlang:system_info(wordsize),
+ BitsPerWord = WordSize * 8,
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<0:(id(0)),42:(id(1 bsl BitsPerWord))>>),
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<42:(id(1 bsl BitsPerWord)),0:(id(0))>>),
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<(id(<<>>))/binary,0:(id(1 bsl 100))>>),
+
+ case WordSize of
+ 4 ->
+ system_limit_32();
+ 8 ->
+ ok
+ end.
+
+system_limit_32() ->
+ ?line {'EXIT',{badarg,_}} = (catch <<42:(-1)>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<42:(id(-1))>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<42:(id(-389739873536870912))/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<42:536870912/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<42:(id(536870912))/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} = (catch <<0:(id(8)),42:536870912/unit:8>>),
+ ?line {'EXIT',{system_limit,_}} =
+ (catch <<0:(id(8)),42:(id(536870912))/unit:8>>),
+ ok.
+
+badarg(Config) when is_list(Config) ->
+ %% BEAM will generate a badarg exception for:
+ %% <<0:(id(1 bsl 100)),0:(id(-1))>>
+ %% but the debugger will generate a system_limit exception.
+ %% It does not seems worthwhile to fix the debugger.
+
+ ?line {'EXIT',{badarg,_}} =
+ (catch <<(id(<<>>))/binary,0:(id(-(1 bsl 100)))>>),
+
+ ok.
+
+copy_writable_binary(Config) when is_list(Config) ->
+ ?line [copy_writable_binary_1(I) || I <- lists:seq(0, 256)],
+ ok.
+
+copy_writable_binary_1(_) ->
+ ?line Bin0 = <<(id(<<>>))/binary,0,1,2,3,4,5,6,7>>,
+ ?line SubBin = make_sub_bin(Bin0),
+ ?line id(<<42,34,55,Bin0/binary>>), %Make reallocation likelier.
+ ?line Pid = spawn(fun() ->
+ copy_writable_binary_holder(Bin0, SubBin)
+ end),
+ ?line Tab = ets:new(holder, []),
+ ?line ets:insert(Tab, {17,Bin0}),
+ ?line ets:insert(Tab, {42,SubBin}),
+ ?line id(<<Bin0/binary,0:(64*1024*8)>>),
+ ?line Pid ! self(),
+ ?line [{17,Bin0}] = ets:lookup(Tab, 17),
+ ?line [{42,Bin0}] = ets:lookup(Tab, 42),
+ receive
+ {Pid,Bin0,Bin0} -> ok;
+ Other ->
+ io:format("Unexpected message: ~p", [Other]),
+ ?line ?t:fail()
+ end,
+ ok.
+
+copy_writable_binary_holder(Bin, SubBin) ->
+ receive
+ Pid ->
+ Pid ! {self(),Bin,SubBin}
+ end.
+
+make_sub_bin(Bin0) ->
+ N = bit_size(Bin0),
+ <<_:17,Bin:N/bitstring,_:5>> = <<(-1):17,Bin0/bitstring,(-1):5>>,
+ Bin = Bin0, %Assertion.
+ Bin.
+
+%% Test that different ways of using bit syntax instructions
+%% give the same result.
+
+dynamic(Config) when is_list(Config) ->
+ ?line dynamic_1(fun dynamic_big/5),
+ ?line dynamic_1(fun dynamic_little/5),
+ ok.
+
+dynamic_1(Dynamic) ->
+ <<Lpad:128>> = erlang:md5([0]),
+ <<Rpad:128>> = erlang:md5([1]),
+ <<Int:128>> = erlang:md5([2]),
+ 8385 = dynamic_2(0, {Int,Lpad,Rpad,Dynamic}, 0).
+
+dynamic_2(129, _, Count) -> Count;
+dynamic_2(Bef, Data, Count0) ->
+ Count = dynamic_3(Bef, 128-Bef, Data, Count0),
+ dynamic_2(Bef+1, Data, Count).
+
+dynamic_3(_, -1, _, Count) -> Count;
+dynamic_3(Bef, N, {Int0,Lpad,Rpad,Dynamic}=Data, Count) ->
+ Int1 = Int0 band ((1 bsl (N+3))-1),
+ Dynamic(Bef, N, Int1, Lpad, Rpad),
+ Dynamic(Bef, N, -Int1, Lpad, Rpad),
+
+ %% OTP-7085: Test a small number in a wide field.
+ Int2 = Int0 band 16#FFFFFF,
+ Dynamic(Bef, N, Int2, Lpad, Rpad),
+ Dynamic(Bef, N, -Int2, Lpad, Rpad),
+ dynamic_3(Bef, N-1, Data, Count+1).
+
+dynamic_big(Bef, N, Int, Lpad, Rpad) ->
+ NumBin = id(<<Int:N>>),
+ MaskedInt = Int band ((1 bsl N) - 1),
+ <<MaskedInt:N>> = NumBin,
+
+ %% Construct the binary in two different ways.
+ Bin = id(<<Lpad:Bef,NumBin/bitstring,Rpad:(128-Bef-N)>>),
+ Bin = <<Lpad:Bef,Int:N,Rpad:(128-Bef-N)>>,
+
+ %% Further verify the result by matching.
+ LpadMasked = Lpad band ((1 bsl Bef) - 1),
+ RpadMasked = Rpad band ((1 bsl (128-Bef-N)) - 1),
+ Rbits = (128-Bef-N),
+ <<LpadMasked:Bef,MaskedInt:N,RpadMasked:Rbits>> = id(Bin),
+ ok.
+
+dynamic_little(Bef, N, Int, Lpad, Rpad) ->
+ NumBin = id(<<Int:N/little>>),
+ MaskedInt = Int band ((1 bsl N) - 1),
+ <<MaskedInt:N/little>> = NumBin,
+
+ %% Construct the binary in two different ways.
+ Bin = id(<<Lpad:Bef/little,NumBin/bitstring,Rpad:(128-Bef-N)/little>>),
+ Bin = <<Lpad:Bef/little,Int:N/little,Rpad:(128-Bef-N)/little>>,
+
+ %% Further verify the result by matching.
+ LpadMasked = Lpad band ((1 bsl Bef) - 1),
+ RpadMasked = Rpad band ((1 bsl (128-Bef-N)) - 1),
+ Rbits = (128-Bef-N),
+ <<LpadMasked:Bef/little,MaskedInt:N/little,RpadMasked:Rbits/little>> = id(Bin),
+ ok.
+
+otp_7422(Config) when is_list(Config) ->
+ otp_7422_int(0),
+ otp_7422_bin(0).
+
+otp_7422_int(N) when N < 512 ->
+ T = erlang:make_tuple(N, []),
+ spawn_link(fun() ->
+ id(T),
+ %% A size of field 0 would write one byte beyond
+ %% the current position in the binary. It could
+ %% overwrite the continuation pointer stored on
+ %% the stack if HTOP was equal to E (the stack pointer).
+ id(<<0:(id(0))>>)
+ end),
+ otp_7422_int(N+1);
+otp_7422_int(_) -> ok.
+
+otp_7422_bin(N) when N < 512 ->
+ T = erlang:make_tuple(N, []),
+ Z = id(<<>>),
+ spawn_link(fun() ->
+ id(T),
+ id(<<Z:(id(0))/bits>>)
+ end),
+ otp_7422_bin(N+1);
+otp_7422_bin(_) -> ok.
+
+zero_width(Config) when is_list(Config) ->
+ ?line Z = id(0),
+ Small = id(42),
+ Big = id(1 bsl 128),
+ ?line <<>> = <<Small:Z>>,
+ ?line <<>> = <<Small:0>>,
+ ?line <<>> = <<Big:Z>>,
+ ?line <<>> = <<Big:0>>,
+
+ ?line {'EXIT',{badarg,_}} = (catch <<not_a_number:0>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<(id(not_a_number)):Z>>),
+ ?line {'EXIT',{badarg,_}} = (catch <<(id(not_a_number)):0>>),
+
+ ok.
+
+id(I) -> I.
diff --git a/lib/debugger/test/bs_match_bin_SUITE.erl b/lib/debugger/test/bs_match_bin_SUITE.erl
index b42b84aef2..5a7c30f16b 100644
--- a/lib/debugger/test/bs_match_bin_SUITE.erl
+++ b/lib/debugger/test/bs_match_bin_SUITE.erl
@@ -24,14 +24,14 @@
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- byte_split_binary/1,bit_split_binary/1]).
+ byte_split_binary/1,bit_split_binary/1,match_huge_bin/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [byte_split_binary, bit_split_binary, match_huge_bin].
groups() ->
[].
@@ -42,10 +42,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [byte_split_binary, bit_split_binary].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(1)),
@@ -65,11 +61,12 @@ end_per_suite(Config) when is_list(Config) ->
ok.
byte_split_binary(doc) -> "Tries to split a binary at all byte-aligned positions.";
-byte_split_binary(suite) -> [];
-byte_split_binary(Config) when list(Config) ->
+byte_split_binary(Config) when is_list(Config) ->
?line L = lists:seq(0, 57),
?line B = mkbin(L),
- ?line byte_split(L, B, size(B)).
+ ?line byte_split(L, B, size(B)),
+ ?line Unaligned = make_unaligned_sub_binary(B),
+ ?line byte_split(L, Unaligned, size(Unaligned)).
byte_split(L, B, Pos) when Pos >= 0 ->
?line Sz1 = Pos,
@@ -78,18 +75,19 @@ byte_split(L, B, Pos) when Pos >= 0 ->
?line B1 = list_to_binary(lists:sublist(L, 1, Pos)),
?line B2 = list_to_binary(lists:nthtail(Pos, L)),
?line byte_split(L, B, Pos-1);
-byte_split(_L, _B, _) -> ok.
+byte_split(_, _, _) -> ok.
bit_split_binary(doc) -> "Tries to split a binary at all positions.";
-bit_split_binary(suite) -> [];
-bit_split_binary(Config) when list(Config) ->
+bit_split_binary(Config) when is_list(Config) ->
Fun = fun(Bin, List, SkipBef, N) ->
?line SkipAft = 8*size(Bin) - N - SkipBef,
- io:format("~p, ~p, ~p", [SkipBef,N,SkipAft]),
- ?line <<_I1:SkipBef,OutBin:N/binary-unit:1,_I2:SkipAft>> = Bin,
+ %%io:format("~p, ~p, ~p", [SkipBef,N,SkipAft]),
+ ?line <<_:SkipBef,OutBin:N/binary-unit:1,_:SkipAft>> = Bin,
?line OutBin = make_bin_from_list(List, N)
end,
?line bit_split_binary1(Fun, erlang:md5(<<1,2,3>>)),
+ ?line bit_split_binary1(Fun,
+ make_unaligned_sub_binary(erlang:md5(<<1,2,3>>))),
ok.
bit_split_binary1(Action, Bin) ->
@@ -99,24 +97,23 @@ bit_split_binary1(Action, Bin) ->
bit_split_binary2(Action, Bin, [_|T]=List, Bef) ->
bit_split_binary3(Action, Bin, List, Bef, size(Bin)*8),
bit_split_binary2(Action, Bin, T, Bef+1);
-bit_split_binary2(_Action, _Bin, [], _Bef) -> ok.
+bit_split_binary2(_, _, [], _) -> ok.
bit_split_binary3(Action, Bin, List, Bef, Aft) when Bef =< Aft ->
Action(Bin, List, Bef, (Aft-Bef) div 8 * 8),
bit_split_binary3(Action, Bin, List, Bef, Aft-8);
bit_split_binary3(_, _, _, _, _) -> ok.
-make_bin_from_list(_List, 0) ->
- mkbin([]);
+make_bin_from_list(_, 0) -> mkbin([]);
make_bin_from_list(List, N) ->
list_to_binary([make_int(List, 8, 0),
make_bin_from_list(lists:nthtail(8, List), N-8)]).
-make_int(_List, 0, Acc) -> Acc;
+make_int(_, 0, Acc) -> Acc;
make_int([H|T], N, Acc) -> make_int(T, N-1, Acc bsl 1 bor H).
-bits_to_list([_H|T], 0) -> bits_to_list(T, 16#80);
+bits_to_list([_|T], 0) -> bits_to_list(T, 16#80);
bits_to_list([H|_]=List, Mask) ->
[case H band Mask of
0 -> 0;
@@ -124,5 +121,109 @@ bits_to_list([H|_]=List, Mask) ->
end|bits_to_list(List, Mask bsr 1)];
bits_to_list([], _) -> [].
+mkbin(L) when is_list(L) -> list_to_binary(L).
+
+make_unaligned_sub_binary(Bin0) ->
+ Bin1 = <<0:3,Bin0/binary,31:5>>,
+ Sz = size(Bin0),
+ <<0:3,Bin:Sz/binary,31:5>> = id(Bin1),
+ Bin.
+
+id(I) -> I.
+
+match_huge_bin(Config) when is_list(Config) ->
+ ?line Bin = <<0:(1 bsl 27),13:8>>,
+ ?line skip_huge_bin_1(1 bsl 27, Bin),
+ ?line 16777216 = match_huge_bin_1(1 bsl 27, Bin),
+
+ %% Test overflowing the size of a binary field.
+ ?line nomatch = overflow_huge_bin_skip_32(Bin),
+ ?line nomatch = overflow_huge_bin_32(Bin),
+ ?line nomatch = overflow_huge_bin_skip_64(Bin),
+ ?line nomatch = overflow_huge_bin_64(Bin),
+
+ %% Size in variable
+ ?line ok = overflow_huge_bin(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+ ?line ok = overflow_huge_bin_unit128(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+
+ ok.
+
+overflow_huge_bin(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/binary-unit:8,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<NewBin:Sz/binary-unit:8,0,_/binary>> ->
+ {error,Sz,size(NewBin)};
+ _ ->
+ overflow_huge_bin(Bin, Sizes)
+ end
+ end;
+overflow_huge_bin(_, []) -> ok.
+
+overflow_huge_bin_unit128(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/binary-unit:128,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<NewBin:Sz/binary-unit:128,0,_/binary>> ->
+ {error,Sz,size(NewBin)};
+ _ ->
+ overflow_huge_bin_unit128(Bin, Sizes)
+ end
+ end;
+overflow_huge_bin_unit128(_, []) -> ok.
+
+skip_huge_bin_1(I, Bin) ->
+ <<_:I/binary-unit:1,13>> = Bin,
+ ok.
-mkbin(L) when list(L) -> list_to_binary(L).
+match_huge_bin_1(I, Bin) ->
+ case Bin of
+ <<Val:I/binary-unit:1,13>> -> size(Val);
+ _ -> nomatch
+ end.
+
+overflow_huge_bin_skip_32(<<_:4294967296/binary,0,_/binary>>) -> 1; % 1 bsl 32
+overflow_huge_bin_skip_32(<<_:33554432/binary-unit:128,0,_/binary>>) -> 2; % 1 bsl 25
+overflow_huge_bin_skip_32(<<_:67108864/binary-unit:64,0,_/binary>>) -> 3; % 1 bsl 26
+overflow_huge_bin_skip_32(<<_:134217728/binary-unit:32,0,_/binary>>) -> 4; % 1 bsl 27
+overflow_huge_bin_skip_32(<<_:268435456/binary-unit:16,0,_/binary>>) -> 5; % 1 bsl 28
+overflow_huge_bin_skip_32(<<_:536870912/binary-unit:8,0,_/binary>>) -> 6; % 1 bsl 29
+overflow_huge_bin_skip_32(<<_:1073741824/binary-unit:8,0,_/binary>>) -> 7; % 1 bsl 30
+overflow_huge_bin_skip_32(<<_:2147483648/binary-unit:8,0,_/binary>>) -> 8; % 1 bsl 31
+overflow_huge_bin_skip_32(_) -> nomatch.
+
+overflow_huge_bin_32(<<Bin:4294967296/binary,_/binary>>) -> {1,Bin}; % 1 bsl 32
+overflow_huge_bin_32(<<Bin:33554432/binary-unit:128,0,_/binary>>) -> {2,Bin}; % 1 bsl 25
+overflow_huge_bin_32(<<Bin:67108864/binary-unit:128,0,_/binary>>) -> {3,Bin}; % 1 bsl 26
+overflow_huge_bin_32(<<Bin:134217728/binary-unit:128,0,_/binary>>) -> {4,Bin}; % 1 bsl 27
+overflow_huge_bin_32(<<Bin:268435456/binary-unit:128,0,_/binary>>) -> {5,Bin}; % 1 bsl 28
+overflow_huge_bin_32(<<Bin:536870912/binary-unit:128,0,_/binary>>) -> {6,Bin}; % 1 bsl 29
+overflow_huge_bin_32(<<Bin:1073741824/binary-unit:128,0,_/binary>>) -> {7,Bin}; % 1 bsl 30
+overflow_huge_bin_32(<<Bin:2147483648/binary-unit:128,0,_/binary>>) -> {8,Bin}; % 1 bsl 31
+overflow_huge_bin_32(_) -> nomatch.
+
+overflow_huge_bin_skip_64(<<_:18446744073709551616/binary,0,_/binary>>) -> 1; % 1 bsl 64
+overflow_huge_bin_skip_64(<<_:144115188075855872/binary-unit:128,0,_/binary>>) -> 2; % 1 bsl 57
+overflow_huge_bin_skip_64(<<_:288230376151711744/binary-unit:64,0,_/binary>>) -> 3; % 1 bsl 58
+overflow_huge_bin_skip_64(<<_:576460752303423488/binary-unit:32,0,_/binary>>) -> 4; % 1 bsl 59
+overflow_huge_bin_skip_64(<<_:1152921504606846976/binary-unit:16,0,_/binary>>) -> 5; % 1 bsl 60
+overflow_huge_bin_skip_64(<<_:2305843009213693952/binary-unit:8,0,_/binary>>) -> 6; % 1 bsl 61
+overflow_huge_bin_skip_64(<<_:4611686018427387904/binary-unit:8,0,_/binary>>) -> 7; % 1 bsl 62
+overflow_huge_bin_skip_64(<<_:9223372036854775808/binary-unit:8,_/binary>>) -> 8; % 1 bsl 63
+overflow_huge_bin_skip_64(_) -> nomatch.
+
+overflow_huge_bin_64(<<Bin:18446744073709551616/binary,_/binary>>) -> {1,Bin}; % 1 bsl 64
+overflow_huge_bin_64(<<Bin:144115188075855872/binary-unit:128,0,_/binary>>) -> {2,Bin}; % 1 bsl 57
+overflow_huge_bin_64(<<Bin:288230376151711744/binary-unit:128,0,_/binary>>) -> {3,Bin}; % 1 bsl 58
+overflow_huge_bin_64(<<Bin:576460752303423488/binary-unit:128,0,_/binary>>) -> {4,Bin}; % 1 bsl 59
+overflow_huge_bin_64(<<Bin:1152921504606846976/binary-unit:128,0,_/binary>>) -> {5,Bin}; % 1 bsl 60
+overflow_huge_bin_64(<<Bin:2305843009213693952/binary-unit:128,0,_/binary>>) -> {6,Bin}; % 1 bsl 61
+overflow_huge_bin_64(<<Bin:4611686018427387904/binary-unit:128,0,_/binary>>) -> {7,Bin}; % 1 bsl 62
+overflow_huge_bin_64(<<Bin:9223372036854775808/binary-unit:128,0,_/binary>>) -> {8,Bin}; % 1 bsl 63
+overflow_huge_bin_64(_) -> nomatch.
diff --git a/lib/debugger/test/bs_match_int_SUITE.erl b/lib/debugger/test/bs_match_int_SUITE.erl
index 745368fdfc..bff5f8ff65 100644
--- a/lib/debugger/test/bs_match_int_SUITE.erl
+++ b/lib/debugger/test/bs_match_int_SUITE.erl
@@ -19,11 +19,11 @@
-module(bs_match_int_SUITE).
--author('[email protected]').
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- integer/1,signed_integer/1,dynamic/1,more_dynamic/1,mml/1]).
+ integer/1,signed_integer/1,dynamic/1,more_dynamic/1,mml/1,
+ match_huge_int/1,bignum/1,unaligned_32_bit/1]).
-include_lib("test_server/include/test_server.hrl").
@@ -32,7 +32,8 @@
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- [cases()].
+ [integer, signed_integer, dynamic, more_dynamic, mml,
+ match_huge_int, bignum, unaligned_32_bit].
groups() ->
[].
@@ -43,10 +44,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [integer, signed_integer, dynamic, more_dynamic, mml].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(4)),
@@ -65,8 +62,7 @@ init_per_suite(Config) when is_list(Config) ->
end_per_suite(Config) when is_list(Config) ->
ok.
-integer(suite) -> [];
-integer(Config) when list(Config) ->
+integer(Config) when is_list(Config) ->
?line 0 = get_int(mkbin([])),
?line 0 = get_int(mkbin([0])),
?line 42 = get_int(mkbin([42])),
@@ -78,22 +74,33 @@ integer(Config) when list(Config) ->
?line 65534 = get_int(mkbin([255,254])),
?line 16776455 = get_int(mkbin([255,253,7])),
?line 4245492555 = get_int(mkbin([253,13,19,75])),
+ ?line 4294967294 = get_int(mkbin([255,255,255,254])),
+ ?line 4294967295 = get_int(mkbin([255,255,255,255])),
?line Eight = [200,1,19,128,222,42,97,111],
?line cmp128(Eight, uint(Eight)),
?line fun_clause(catch get_int(mkbin(seq(1,5)))),
ok.
-get_int(<<I:0>>) -> I;
-get_int(<<I:8>>) -> I;
-get_int(<<I:16>>) -> I;
-get_int(<<I:24>>) -> I;
-get_int(<<I:32>>) -> I.
+get_int(Bin) ->
+ I = get_int1(Bin),
+ get_int(Bin, I).
+
+get_int(Bin0, I) when size(Bin0) < 4 ->
+ Bin = <<0,Bin0/binary>>,
+ I = get_int1(Bin),
+ get_int(Bin, I);
+get_int(_, I) -> I.
+
+get_int1(<<I:0>>) -> I;
+get_int1(<<I:8>>) -> I;
+get_int1(<<I:16>>) -> I;
+get_int1(<<I:24>>) -> I;
+get_int1(<<I:32>>) -> I.
cmp128(<<I:128>>, I) -> equal;
-cmp128(_B, _I) -> not_equal.
+cmp128(_, _) -> not_equal.
-signed_integer(suite) -> [];
-signed_integer(Config) when list(Config) ->
+signed_integer(Config) when is_list(Config) ->
?line {no_match,_} = sint(mkbin([])),
?line {no_match,_} = sint(mkbin([1,2,3])),
?line 127 = sint(mkbin([127])),
@@ -113,7 +120,7 @@ uint(L) -> uint(L, 0).
uint([H|T], Acc) -> uint(T, Acc bsl 8 bor H);
uint([], Acc) -> Acc.
-dynamic(Config) when list(Config) ->
+dynamic(Config) when is_list(Config) ->
dynamic(mkbin([255]), 8),
dynamic(mkbin([255,255]), 16),
dynamic(mkbin([255,255,255]), 24),
@@ -124,7 +131,7 @@ dynamic(Bin, S1) when S1 >= 0 ->
S2 = size(Bin) * 8 - S1,
dynamic(Bin, S1, S2, (1 bsl S1) - 1, (1 bsl S2) - 1),
dynamic(Bin, S1-1);
-dynamic(_Bin, _) -> ok.
+dynamic(_, _) -> ok.
dynamic(Bin, S1, S2, A, B) ->
% io:format("~p ~p ~p ~p\n", [S1,S2,A,B]),
@@ -132,25 +139,24 @@ dynamic(Bin, S1, S2, A, B) ->
<<A:S1,B:S2>> ->
io:format("~p ~p ~p ~p\n", [S1,S2,A,B]),
ok;
- _Other ->
- erlang:error(badmatch, [Bin,S1,S2,A,B])
+ _Other -> erlang:error(badmatch, [Bin,S1,S2,A,B])
end.
more_dynamic(doc) -> "Extract integers at different alignments and of different sizes.";
-more_dynamic(Config) when list(Config) ->
+more_dynamic(Config) when is_list(Config) ->
% Unsigned big-endian numbers.
Unsigned = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N,_:SkipAft>> = Bin,
Int = make_int(List, N, 0)
end,
?line more_dynamic1(Unsigned, funny_binary(42)),
- % Signed big-endian numbers.
+ %% Signed big-endian numbers.
Signed = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N/signed,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N/signed,_:SkipAft>> = Bin,
case make_signed_int(List, N) of
Int -> ok;
Other ->
@@ -162,18 +168,18 @@ more_dynamic(Config) when list(Config) ->
end,
?line more_dynamic1(Signed, funny_binary(43)),
- % Unsigned little-endian numbers.
+ %% Unsigned little-endian numbers.
UnsLittle = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N/little,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N/little,_:SkipAft>> = Bin,
Int = make_int(big_to_little(List, N), N, 0)
end,
?line more_dynamic1(UnsLittle, funny_binary(44)),
- % Signed little-endian numbers.
+ %% Signed little-endian numbers.
SignLittle = fun(Bin, List, SkipBef, N) ->
SkipAft = 8*size(Bin) - N - SkipBef,
- <<_I1:SkipBef,Int:N/signed-little,_I2:SkipAft>> = Bin,
+ <<_:SkipBef,Int:N/signed-little,_:SkipAft>> = Bin,
Little = big_to_little(List, N),
Int = make_signed_int(Little, N)
end,
@@ -181,11 +187,6 @@ more_dynamic(Config) when list(Config) ->
ok.
-funny_binary(N) ->
- B0 = erlang:md5([N]),
- {B1,_B2} = split_binary(B0, size(B0) div 2),
- B1.
-
more_dynamic1(Action, Bin) ->
BitList = bits_to_list(binary_to_list(Bin), 16#80),
more_dynamic2(Action, Bin, BitList, 0).
@@ -193,7 +194,7 @@ more_dynamic1(Action, Bin) ->
more_dynamic2(Action, Bin, [_|T]=List, Bef) ->
more_dynamic3(Action, Bin, List, Bef, size(Bin)*8),
more_dynamic2(Action, Bin, T, Bef+1);
-more_dynamic2(_Action, _Bin, [], _Bef) -> ok.
+more_dynamic2(_, _, [], _) -> ok.
more_dynamic3(Action, Bin, List, Bef, Aft) when Bef =< Aft ->
%% io:format("~p, ~p", [Bef,Aft-Bef]),
@@ -208,8 +209,8 @@ big_to_little([B0,B1,B2,B3,B4,B5,B6,B7|T], N, Acc) when N >= 8 ->
big_to_little(List, N, Acc) -> lists:sublist(List, 1, N) ++ Acc.
make_signed_int(_List, 0) -> 0;
-make_signed_int([0|_T]=List, N) -> make_int(List, N, 0);
-make_signed_int([1|_T]=List0, N) ->
+make_signed_int([0|_]=List, N) -> make_int(List, N, 0);
+make_signed_int([1|_]=List0, N) ->
List1 = reversed_sublist(List0, N, []),
List2 = two_complement_and_reverse(List1, 1, []),
-make_int(List2, length(List2), 0).
@@ -225,7 +226,7 @@ two_complement_and_reverse([], Carry, Acc) -> [Carry|Acc].
make_int(_List, 0, Acc) -> Acc;
make_int([H|T], N, Acc) -> make_int(T, N-1, Acc bsl 1 bor H).
-bits_to_list([_H|T], 0) -> bits_to_list(T, 16#80);
+bits_to_list([_|T], 0) -> bits_to_list(T, 16#80);
bits_to_list([H|_]=List, Mask) ->
[case H band Mask of
0 -> 0;
@@ -234,11 +235,134 @@ bits_to_list([H|_]=List, Mask) ->
bits_to_list([], _) -> [].
fun_clause({'EXIT',{function_clause,_}}) -> ok.
-mkbin(L) when list(L) -> list_to_binary(L).
+mkbin(L) when is_list(L) -> list_to_binary(L).
+
+funny_binary(N) ->
+ B0 = erlang:md5([N]),
+ {B1,_B2} = split_binary(B0, byte_size(B0) div 3),
+ B1.
-mml(Config) when list(Config) ->
+mml(Config) when is_list(Config) ->
?line single_byte_binary = mml_choose(<<42>>),
?line multi_byte_binary = mml_choose(<<42,43>>).
mml_choose(<<_A:8>>) -> single_byte_binary;
-mml_choose(<<_A:8, _T/binary>>) -> multi_byte_binary.
+mml_choose(<<_A:8,_T/binary>>) -> multi_byte_binary.
+
+match_huge_int(Config) when is_list(Config) ->
+ Sz = 1 bsl 27,
+ ?line Bin = <<0:Sz,13:8>>,
+ ?line skip_huge_int_1(Sz, Bin),
+ ?line 0 = match_huge_int_1(Sz, Bin),
+
+ %% Test overflowing the size of an integer field.
+ ?line nomatch = overflow_huge_int_skip_32(Bin),
+ case erlang:system_info(wordsize) of
+ 4 ->
+ ?line nomatch = overflow_huge_int_32(Bin);
+ 8 ->
+ %% An attempt will be made to allocate heap space for
+ %% the bignum (which will probably fail); only if the
+ %% allocation succeds will the matching fail because
+ %% the binary is too small.
+ ok
+ end,
+ ?line nomatch = overflow_huge_int_skip_64(Bin),
+ ?line nomatch = overflow_huge_int_64(Bin),
+
+ %% Test overflowing the size of an integer field using variables as sizes.
+ ?line Sizes = case erlang:system_info(wordsize) of
+ 4 -> lists:seq(25, 32);
+ 8 -> []
+ end ++ lists:seq(50, 64),
+ ?line ok = overflow_huge_int_unit128(Bin, Sizes),
+
+ ok.
+
+overflow_huge_int_unit128(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/unit:128,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<Var:Sz/unit:128,0,_/binary>> ->
+ {error,Sz,Var};
+ _ ->
+ overflow_huge_int_unit128(Bin, Sizes)
+ end
+ end;
+overflow_huge_int_unit128(_, []) -> ok.
+
+match_huge_int_1(I, Bin) ->
+ <<Int:I,13>> = Bin,
+ Int.
+
+skip_huge_int_1(I, Bin) ->
+ <<_:I,13>> = Bin.
+
+overflow_huge_int_skip_32(<<_:4294967296,0,_/binary>>) -> 1; % 1 bsl 32
+overflow_huge_int_skip_32(<<_:33554432/unit:128,0,_/binary>>) -> 2; % 1 bsl 25
+overflow_huge_int_skip_32(<<_:67108864/unit:64,0,_/binary>>) -> 3; % 1 bsl 26
+overflow_huge_int_skip_32(<<_:134217728/unit:32,0,_/binary>>) -> 4; % 1 bsl 27
+overflow_huge_int_skip_32(<<_:268435456/unit:16,0,_/binary>>) -> 5; % 1 bsl 28
+overflow_huge_int_skip_32(<<_:536870912/unit:8,0,_/binary>>) -> 6; % 1 bsl 29
+overflow_huge_int_skip_32(<<_:1073741824/unit:8,0,_/binary>>) -> 7; % 1 bsl 30
+overflow_huge_int_skip_32(<<_:2147483648/unit:8,0,_/binary>>) -> 8; % 1 bsl 31
+overflow_huge_int_skip_32(_) -> nomatch.
+
+overflow_huge_int_32(<<Int:4294967296,_/binary>>) -> {1,Int}; % 1 bsl 32
+overflow_huge_int_32(<<Int:33554432/unit:128,0,_/binary>>) -> {2,Int}; % 1 bsl 25
+overflow_huge_int_32(<<Int:67108864/unit:128,0,_/binary>>) -> {3,Int}; % 1 bsl 26
+overflow_huge_int_32(<<Int:134217728/unit:128,0,_/binary>>) -> {4,Int}; % 1 bsl 27
+overflow_huge_int_32(<<Int:268435456/unit:128,0,_/binary>>) -> {5,Int}; % 1 bsl 28
+overflow_huge_int_32(<<Int:536870912/unit:128,0,_/binary>>) -> {6,Int}; % 1 bsl 29
+overflow_huge_int_32(<<Int:1073741824/unit:128,0,_/binary>>) -> {7,Int}; % 1 bsl 30
+overflow_huge_int_32(<<Int:2147483648/unit:128,0,_/binary>>) -> {8,Int}; % 1 bsl 31
+overflow_huge_int_32(_) -> nomatch.
+
+overflow_huge_int_skip_64(<<_:18446744073709551616,_/binary>>) -> 1; % 1 bsl 64
+overflow_huge_int_skip_64(<<_:144115188075855872/unit:128,0,_/binary>>) -> 2; % 1 bsl 57
+overflow_huge_int_skip_64(<<_:288230376151711744/unit:64,0,_/binary>>) -> 3; % 1 bsl 58
+overflow_huge_int_skip_64(<<_:576460752303423488/unit:32,0,_/binary>>) -> 4; % 1 bsl 59
+overflow_huge_int_skip_64(<<_:1152921504606846976/unit:16,0,_/binary>>) -> 5; % 1 bsl 60
+overflow_huge_int_skip_64(<<_:2305843009213693952/unit:8,0,_/binary>>) -> 6; % 1 bsl 61
+overflow_huge_int_skip_64(<<_:4611686018427387904/unit:8,0,_/binary>>) -> 7; % 1 bsl 62
+overflow_huge_int_skip_64(<<_:9223372036854775808/unit:8,0,_/binary>>) -> 8; % 1 bsl 63
+overflow_huge_int_skip_64(_) -> nomatch.
+
+overflow_huge_int_64(<<Int:18446744073709551616,_/binary>>) -> {1,Int}; % 1 bsl 64
+overflow_huge_int_64(<<Int:144115188075855872/unit:128,0,_/binary>>) -> {2,Int}; % 1 bsl 57
+overflow_huge_int_64(<<Int:288230376151711744/unit:128,0,_/binary>>) -> {3,Int}; % 1 bsl 58
+overflow_huge_int_64(<<Int:576460752303423488/unit:128,0,_/binary>>) -> {4,Int}; % 1 bsl 59
+overflow_huge_int_64(<<Int:1152921504606846976/unit:128,0,_/binary>>) -> {5,Int}; % 1 bsl 60
+overflow_huge_int_64(<<Int:2305843009213693952/unit:128,0,_/binary>>) -> {6,Int}; % 1 bsl 61
+overflow_huge_int_64(<<Int:4611686018427387904/unit:128,0,_/binary>>) -> {7,Int}; % 1 bsl 62
+overflow_huge_int_64(<<Int:9223372036854775808/unit:128,0,_/binary>>) -> {8,Int}; % 1 bsl 63
+overflow_huge_int_64(_) -> nomatch.
+
+bignum(Config) when is_list(Config) ->
+ ?line Bin = id(<<42,0:1024/unit:8,43>>),
+ ?line <<42:1025/little-integer-unit:8,_:8>> = Bin,
+ ?line <<_:8,43:1025/integer-unit:8>> = Bin,
+
+ ?line BignumBin = id(<<0:512/unit:8,258254417031933722623:9/unit:8>>),
+ ?line <<258254417031933722623:(512+9)/unit:8>> = BignumBin,
+ erlang:garbage_collect(), %Search for holes in debug-build.
+ ok.
+
+unaligned_32_bit(Config) when is_list(Config) ->
+ %% There used to be a risk for heap overflow (fixed in R11B-5).
+ ?line L = unaligned_32_bit_1(<<-1:(64*1024)>>),
+ ?line unaligned_32_bit_verify(L, 1638).
+
+unaligned_32_bit_1(<<1:1,U:32,_:7,T/binary>>) ->
+ [U|unaligned_32_bit_1(T)];
+unaligned_32_bit_1(_) ->
+ [].
+
+unaligned_32_bit_verify([], 0) -> ok;
+unaligned_32_bit_verify([4294967295|T], N) when N > 0 ->
+ unaligned_32_bit_verify(T, N-1).
+
+id(I) -> I.
diff --git a/lib/debugger/test/bs_match_misc_SUITE.erl b/lib/debugger/test/bs_match_misc_SUITE.erl
index 53d11ba179..89fce263f5 100644
--- a/lib/debugger/test/bs_match_misc_SUITE.erl
+++ b/lib/debugger/test/bs_match_misc_SUITE.erl
@@ -19,18 +19,24 @@
-module(bs_match_misc_SUITE).
--author('[email protected]').
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- bound_var/1,bound_tail/1,t_float/1,little_float/1,sean/1]).
+ bound_var/1,bound_tail/1,t_float/1,little_float/1,sean/1,
+ kenneth/1,encode_binary/1,native/1,happi/1,
+ size_var/1,wiger/1,x0_context/1,huge_float_field/1,
+ writable_binary_matched/1,otp_7198/1,
+ unordered_bindings/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [bound_var, bound_tail, t_float, little_float, sean,
+ kenneth, encode_binary, native, happi, size_var, wiger,
+ x0_context, huge_float_field, writable_binary_matched,
+ otp_7198, unordered_bindings].
groups() ->
[].
@@ -41,9 +47,13 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
+init_per_suite(Config) when is_list(Config) ->
+ ?line test_lib:interpret(?MODULE),
+ ?line true = lists:member(?MODULE, int:interpreted()),
+ Config.
-cases() ->
- [bound_var, bound_tail, t_float, little_float, sean].
+end_per_suite(Config) when is_list(Config) ->
+ ok.
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
@@ -55,16 +65,8 @@ end_per_testcase(_Case, Config) ->
?t:timetrap_cancel(Dog),
ok.
-init_per_suite(Config) when is_list(Config) ->
- ?line test_lib:interpret(?MODULE),
- ?line true = lists:member(?MODULE, int:interpreted()),
- Config.
-
-end_per_suite(Config) when is_list(Config) ->
- ok.
-
bound_var(doc) -> "Test matching of bound variables.";
-bound_var(Config) when list(Config) ->
+bound_var(Config) when is_list(Config) ->
?line ok = bound_var(42, 13, <<42,13>>),
?line nope = bound_var(42, 13, <<42,255>>),
?line nope = bound_var(42, 13, <<154,255>>),
@@ -74,7 +76,7 @@ bound_var(A, B, <<A:8,B:8>>) -> ok;
bound_var(_, _, _) -> nope.
bound_tail(doc) -> "Test matching of a bound tail.";
-bound_tail(Config) when list(Config) ->
+bound_tail(Config) when is_list(Config) ->
?line ok = bound_tail(<<>>, <<13,14>>),
?line ok = bound_tail(<<2,3>>, <<1,1,2,3>>),
?line nope = bound_tail(<<2,3>>, <<1,1,2,7>>),
@@ -85,7 +87,7 @@ bound_tail(Config) when list(Config) ->
bound_tail(T, <<_:16,T/binary>>) -> ok;
bound_tail(_, _) -> nope.
-t_float(Config) when list(Config) ->
+t_float(Config) when is_list(Config) ->
F = f1(),
G = f_one(),
@@ -98,6 +100,10 @@ t_float(Config) when list(Config) ->
?line fcmp(F, match_float(<<1:1,F:64/float,127:7>>, 64, 1)),
?line fcmp(F, match_float(<<1:13,F:32/float,127:3>>, 32, 13)),
?line fcmp(F, match_float(<<1:13,F:64/float,127:3>>, 64, 13)),
+
+ ?line {'EXIT',{{badmatch,_},_}} = (catch match_float(<<0,0>>, 16, 0)),
+ ?line {'EXIT',{{badmatch,_},_}} = (catch match_float(<<0,0>>, 16#7fffffff, 0)),
+
ok.
@@ -110,7 +116,7 @@ match_float(Bin0, Fsz, I) ->
<<_:I,F:Fsz/float,_:Tsz>> = Bin,
F.
-little_float(Config) when list(Config) ->
+little_float(Config) when is_list(Config) ->
F = f2(),
G = f_one(),
@@ -149,7 +155,7 @@ f2() ->
f_one() ->
1.0.
-sean(Config) when list(Config) ->
+sean(Config) when is_list(Config) ->
?line small = sean1(<<>>),
?line small = sean1(<<1>>),
?line small = sean1(<<1,2>>),
@@ -162,5 +168,414 @@ sean(Config) when list(Config) ->
?line {'EXIT',{function_clause,_}} = (catch sean1(<<4,5,6,7>>)),
ok.
-sean1(<<B/binary>>) when size(B) < 4 -> small;
+sean1(<<B/binary>>) when byte_size(B) < 4 -> small;
sean1(<<1, _B/binary>>) -> large.
+
+kenneth(Config) when is_list(Config) ->
+ {ok,[145,148,113,129,0,0,0,0]} =
+ msisdn_internal_storage(<<145,148,113,129,0,0,0,0>>, []).
+
+msisdn_internal_storage(<<>>,MSISDN) ->
+ {ok,lists:reverse(MSISDN)};
+msisdn_internal_storage(<<2#11111111:8,_Rest/binary>>,MSISDN) ->
+ {ok,lists:reverse(MSISDN)};
+msisdn_internal_storage(<<2#1111:4,DigitN:4,_Rest/binary>>,MSISDN) when
+ DigitN < 10 ->
+ {ok,lists:reverse([(DigitN bor 2#11110000)|MSISDN])};
+msisdn_internal_storage(<<DigitNplus1:4,DigitN:4,Rest/binary>>,MSISDN) when
+ DigitNplus1 < 10,
+ DigitN < 10 ->
+ NewMSISDN=[((DigitNplus1 bsl 4) bor DigitN)|MSISDN],
+ msisdn_internal_storage(Rest,NewMSISDN);
+msisdn_internal_storage(_Rest,_MSISDN) ->
+ {fault}. %% Mandatory IE incorrect
+
+encode_binary(Config) when is_list(Config) ->
+ "C2J2QiSc" = encodeBinary(<<11,98,118,66,36,156>>, []),
+ ok.
+
+encodeBinary(<<>>, Output) ->
+ lists:reverse(Output);
+encodeBinary(<<Data:1/binary>>, Output) ->
+ <<DChar1:6, DChar2:2>> = Data,
+ Char1 = getBase64Char(DChar1),
+ Char2 = getBase64Char(DChar2),
+ Char3 = "=",
+ Char4 = "=",
+ NewOutput = Char4 ++ Char3 ++ Char2 ++ Char1 ++ Output,
+ encodeBinary(<<>>, NewOutput);
+encodeBinary(<<Data:2/binary>>, Output) ->
+ <<DChar1:6, DChar2:6, DChar3:4>> = Data,
+ Char1 = getBase64Char(DChar1),
+ Char2 = getBase64Char(DChar2),
+ Char3 = getBase64Char(DChar3),
+ Char4 = "=",
+ NewOutput = Char4 ++ Char3 ++ Char2 ++ Char1 ++ Output,
+ encodeBinary(<<>>, NewOutput);
+encodeBinary(<<Data:3/binary, Rest/binary>>, Output) ->
+ <<DChar1:6, DChar2:6, DChar3:6, DChar4:6>> = Data,
+ Char1 = getBase64Char(DChar1),
+ Char2 = getBase64Char(DChar2),
+ Char3 = getBase64Char(DChar3),
+ Char4 = getBase64Char(DChar4),
+ NewOutput = Char4 ++ Char3 ++ Char2 ++ Char1 ++ Output,
+ encodeBinary(Rest, NewOutput);
+encodeBinary(_Data, _) ->
+ error.
+
+getBase64Char(0) -> "A";
+getBase64Char(1) -> "B";
+getBase64Char(2) -> "C";
+getBase64Char(3) -> "D";
+getBase64Char(4) -> "E";
+getBase64Char(5) -> "F";
+getBase64Char(6) -> "G";
+getBase64Char(7) -> "H";
+getBase64Char(8) -> "I";
+getBase64Char(9) -> "J";
+getBase64Char(10) -> "K";
+getBase64Char(11) -> "L";
+getBase64Char(12) -> "M";
+getBase64Char(13) -> "N";
+getBase64Char(14) -> "O";
+getBase64Char(15) -> "P";
+getBase64Char(16) -> "Q";
+getBase64Char(17) -> "R";
+getBase64Char(18) -> "S";
+getBase64Char(19) -> "T";
+getBase64Char(20) -> "U";
+getBase64Char(21) -> "V";
+getBase64Char(22) -> "W";
+getBase64Char(23) -> "X";
+getBase64Char(24) -> "Y";
+getBase64Char(25) -> "Z";
+getBase64Char(26) -> "a";
+getBase64Char(27) -> "b";
+getBase64Char(28) -> "c";
+getBase64Char(29) -> "d";
+getBase64Char(30) -> "e";
+getBase64Char(31) -> "f";
+getBase64Char(32) -> "g";
+getBase64Char(33) -> "h";
+getBase64Char(34) -> "i";
+getBase64Char(35) -> "j";
+getBase64Char(36) -> "k";
+getBase64Char(37) -> "l";
+getBase64Char(38) -> "m";
+getBase64Char(39) -> "n";
+getBase64Char(40) -> "o";
+getBase64Char(41) -> "p";
+getBase64Char(42) -> "q";
+getBase64Char(43) -> "r";
+getBase64Char(44) -> "s";
+getBase64Char(45) -> "t";
+getBase64Char(46) -> "u";
+getBase64Char(47) -> "v";
+getBase64Char(48) -> "w";
+getBase64Char(49) -> "x";
+getBase64Char(50) -> "y";
+getBase64Char(51) -> "z";
+getBase64Char(52) -> "0";
+getBase64Char(53) -> "1";
+getBase64Char(54) -> "2";
+getBase64Char(55) -> "3";
+getBase64Char(56) -> "4";
+getBase64Char(57) -> "5";
+getBase64Char(58) -> "6";
+getBase64Char(59) -> "7";
+getBase64Char(60) -> "8";
+getBase64Char(61) -> "9";
+getBase64Char(62) -> "+";
+getBase64Char(63) -> "/";
+getBase64Char(_Else) ->
+ %% This is an illegal input.
+% cgLogEM:log(error, ?MODULE, getBase64Char, [Else],
+% "illegal input",
+% ?LINE, version()),
+ "**".
+
+-define(M(F), <<F>> = <<F>>).
+
+native(Config) when is_list(Config) ->
+ ?line ?M(3.14:64/native-float),
+ ?line ?M(333:16/native),
+ ?line ?M(38658345:32/native),
+ case <<1:16/native>> of
+ <<0,1>> -> native_big();
+ <<1,0>> -> native_little()
+ end.
+
+native_big() ->
+ ?line <<37.33:64/native-float>> = <<37.33:64/big-float>>,
+ ?line <<3974:16/native-integer>> = <<3974:16/big-integer>>,
+ {comment,"Big endian"}.
+
+native_little() ->
+ ?line <<37869.32343:64/native-float>> = <<37869.32343:64/little-float>>,
+ ?line <<7974:16/native-integer>> = <<7974:16/little-integer>>,
+ {comment,"Little endian"}.
+
+happi(Config) when is_list(Config) ->
+ Bin = <<".123">>,
+ ?line <<"123">> = lex_digits1(Bin, 1, []),
+ ?line <<"123">> = lex_digits2(Bin, 1, []),
+ ok.
+
+lex_digits1(<<$., Rest/binary>>,_Val,_Acc) ->
+ Rest;
+lex_digits1(<<N, Rest/binary>>,Val, Acc) when N >= $0 , N =< $9 ->
+ lex_digits1(Rest,Val*10+dec(N),Acc);
+lex_digits1(_Other,_Val,_Acc) ->
+ not_ok.
+
+lex_digits2(<<N, Rest/binary>>,Val, Acc) when N >= $0 , N =< $9 ->
+ lex_digits2(Rest,Val*10+dec(N),Acc);
+lex_digits2(<<$., Rest/binary>>,_Val,_Acc) ->
+ Rest;
+lex_digits2(_Other,_Val,_Acc) ->
+ not_ok.
+
+dec(A) ->
+ A-$0.
+
+size_var(Config) when is_list(Config) ->
+ ?line {<<45>>,<<>>} = split(<<1:16,45>>),
+ ?line {<<45>>,<<46,47>>} = split(<<1:16,45,46,47>>),
+ ?line {<<45,46>>,<<47>>} = split(<<2:16,45,46,47>>),
+
+ ?line {<<45,46,47>>,<<48>>} = split_2(<<16:8,3:16,45,46,47,48>>),
+
+ ?line {<<45,46>>,<<47>>} = split(2, <<2:16,45,46,47>>),
+ ?line {'EXIT',{function_clause,_}} = (catch split(42, <<2:16,45,46,47>>)),
+
+ ?line <<"cdef">> = skip(<<2:8,"abcdef">>),
+
+ ok.
+
+split(<<N:16,B:N/binary,T/binary>>) ->
+ {B,T}.
+
+split(N, <<N:16,B:N/binary,T/binary>>) ->
+ {B,T}.
+
+split_2(<<N0:8,N:N0,B:N/binary,T/binary>>) ->
+ {B,T}.
+
+skip(<<N:8,_:N/binary,T/binary>>) -> T.
+
+wiger(Config) when is_list(Config) ->
+ ?line ok1 = wcheck(<<3>>),
+ ?line ok2 = wcheck(<<1,2,3>>),
+ ?line ok3 = wcheck(<<4>>),
+ ?line {error,<<1,2,3,4>>} = wcheck(<<1,2,3,4>>),
+ ?line {error,<<>>} = wcheck(<<>>),
+ ok.
+
+wcheck(<<A>>) when A==3->
+ ok1;
+wcheck(<<_,_:2/binary>>) ->
+ ok2;
+wcheck(<<_>>) ->
+ ok3;
+wcheck(Other) ->
+ {error,Other}.
+
+%% Test that having the match context in x(0) works.
+
+x0_context(Config) when is_list(Config) ->
+ x0_0([], <<3.0:64/float,42:16,123456:32>>).
+
+x0_0(_, Bin) ->
+ <<3.0:64/float,42:16,_/binary>> = Bin,
+ x0_1([], Bin, 64, 16, 2).
+
+x0_1(_, Bin, FloatSz, IntSz, BinSz) ->
+ <<_:FloatSz/float,42:IntSz,B:BinSz/binary,C:1/binary,D/binary>> = Bin,
+ id({B,C,D}),
+ <<_:FloatSz/float,42:IntSz,B:BinSz/binary,_/binary>> = Bin,
+ x0_2([], Bin).
+
+x0_2(_, Bin) ->
+ <<_:64,0:7,42:9,_/binary>> = Bin,
+ x0_3([], Bin).
+
+x0_3(_, Bin) ->
+ case Bin of
+ <<_:72,7:8,_/binary>> ->
+ ?line ?t:fail();
+ <<_:64,0:16,_/binary>> ->
+ ?line ?t:fail();
+ <<_:64,42:16,123456:32,_/binary>> ->
+ ok
+ end.
+
+
+huge_float_field(Config) when is_list(Config) ->
+ Sz = 1 bsl 27,
+ ?line Bin = <<0:Sz>>,
+
+ ?line nomatch = overflow_huge_float_skip_32(Bin),
+ ?line nomatch = overflow_huge_float_32(Bin),
+
+ ?line ok = overflow_huge_float(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+ ?line ok = overflow_huge_float_unit128(Bin, lists:seq(25, 32)++lists:seq(50, 64)),
+ ok.
+
+overflow_huge_float_skip_32(<<_:4294967296/float,0,_/binary>>) -> 1; % 1 bsl 32
+overflow_huge_float_skip_32(<<_:33554432/float-unit:128,0,_/binary>>) -> 2; % 1 bsl 25
+overflow_huge_float_skip_32(<<_:67108864/float-unit:64,0,_/binary>>) -> 3; % 1 bsl 26
+overflow_huge_float_skip_32(<<_:134217728/float-unit:32,0,_/binary>>) -> 4; % 1 bsl 27
+overflow_huge_float_skip_32(<<_:268435456/float-unit:16,0,_/binary>>) -> 5; % 1 bsl 28
+overflow_huge_float_skip_32(<<_:536870912/float-unit:8,0,_/binary>>) -> 6; % 1 bsl 29
+overflow_huge_float_skip_32(<<_:1073741824/float-unit:8,0,_/binary>>) -> 7; % 1 bsl 30
+overflow_huge_float_skip_32(<<_:2147483648/float-unit:8,0,_/binary>>) -> 8; % 1 bsl 31
+overflow_huge_float_skip_32(_) -> nomatch.
+
+overflow_huge_float_32(<<F:4294967296/float,_/binary>>) -> {1,F}; % 1 bsl 32
+overflow_huge_float_32(<<F:33554432/float-unit:128,0,_/binary>>) -> {2,F}; % 1 bsl 25
+overflow_huge_float_32(<<F:67108864/float-unit:128,0,_/binary>>) -> {3,F}; % 1 bsl 26
+overflow_huge_float_32(<<F:134217728/float-unit:128,0,_/binary>>) -> {4,F}; % 1 bsl 27
+overflow_huge_float_32(<<F:268435456/float-unit:128,0,_/binary>>) -> {5,F}; % 1 bsl 28
+overflow_huge_float_32(<<F:536870912/float-unit:128,0,_/binary>>) -> {6,F}; % 1 bsl 29
+overflow_huge_float_32(<<F:1073741824/float-unit:128,0,_/binary>>) -> {7,F}; % 1 bsl 30
+overflow_huge_float_32(<<F:2147483648/float-unit:128,0,_/binary>>) -> {8,F}; % 1 bsl 31
+overflow_huge_float_32(_) -> nomatch.
+
+
+overflow_huge_float(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/float-unit:8,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<Var:Sz/float-unit:8,0,_/binary>> ->
+ {error,Sz,Var};
+ _ ->
+ overflow_huge_float(Bin, Sizes)
+ end
+ end;
+overflow_huge_float(_, []) -> ok.
+
+overflow_huge_float_unit128(Bin, [Sz0|Sizes]) ->
+ Sz = id(1 bsl Sz0),
+ case Bin of
+ <<_:Sz/float-unit:128,0,_/binary>> ->
+ {error,Sz};
+ _ ->
+ case Bin of
+ <<Var:Sz/float-unit:128,0,_/binary>> ->
+ {error,Sz,Var};
+ _ ->
+ overflow_huge_float_unit128(Bin, Sizes)
+ end
+ end;
+overflow_huge_float_unit128(_, []) -> ok.
+
+
+%%
+%% Test that a writable binary can be safely matched.
+%%
+
+writable_binary_matched(Config) when is_list(Config) ->
+ ?line WritableBin = create_writeable_binary(),
+ ?line writable_binary_matched(WritableBin, WritableBin, 500).
+
+writable_binary_matched(<<0>>, _, N) ->
+ if
+ N =:= 0 -> ok;
+ true ->
+ put(grow_heap, [N|get(grow_heap)]),
+ ?line WritableBin = create_writeable_binary(),
+ ?line writable_binary_matched(WritableBin, WritableBin, N-1)
+ end;
+writable_binary_matched(<<B:8,T/binary>>, WritableBin0, N) ->
+ ?line WritableBin = writable_binary(WritableBin0, B),
+ writable_binary_matched(T, WritableBin, N).
+
+writable_binary(WritableBin0, B) when is_binary(WritableBin0) ->
+ %% Heavy append to force the binary to move.
+ ?line WritableBin = <<WritableBin0/binary,0:(size(WritableBin0))/unit:8,B>>,
+ ?line id(<<(id(0)):128/unit:8>>),
+ WritableBin.
+
+create_writeable_binary() ->
+ <<(id(<<>>))/binary,1,2,3,4,5,6,0>>.
+
+otp_7198(Config) when is_list(Config) ->
+ %% When a match context was reused, and grown at the same time to
+ %% increase the number of saved positions, the thing word was not updated
+ %% to account for the new size. Therefore, if there was a garbage collection,
+ %% the new slots would be included in the garbage collection.
+ ?line [do_otp_7198(FillerSize) || FillerSize <- lists:seq(0, 256)],
+ ok.
+
+do_otp_7198(FillerSize) ->
+ Filler = erlang:make_tuple(FillerSize, 42),
+ {Pid,Ref} = spawn_monitor(fun() -> do_otp_7198_test(Filler) end),
+ receive
+ {'DOWN',Ref,process,Pid,normal} ->
+ ok;
+ {'DOWN',Ref,process,Pid,Reason} ->
+ io:format("unexpected: ~p", [Reason]),
+ ?line ?t:fail()
+ end.
+
+do_otp_7198_test(_) ->
+ [{'KEYWORD',114},
+ {'KEYWORD',101},
+ {'KEYWORD',103},
+ {'KEYWORD',105},
+ {'KEYWORD',111},
+ {'FIELD',110},
+ {'KEYWORD',119},
+ {'KEYWORD',104},
+ {'KEYWORD',97},
+ {'KEYWORD',116},
+ {'KEYWORD',101},
+ {'KEYWORD',118},
+ {'KEYWORD',101},
+ {'KEYWORD',114},
+ '$thats_all_folks$'] = otp_7198_scan(<<"region:whatever">>, []).
+
+
+otp_7198_scan(<<>>, TokAcc) ->
+ lists:reverse(['$thats_all_folks$' | TokAcc]);
+
+otp_7198_scan(<<D, Z, Rest/binary>>, TokAcc) when
+ (D =:= $D orelse D =:= $d) and
+ ((Z =:= $\s) or (Z =:= $() or (Z =:= $))) ->
+ otp_7198_scan(<<Z, Rest/binary>>, ['AND' | TokAcc]);
+
+otp_7198_scan(<<D>>, TokAcc) when
+ (D =:= $D) or (D =:= $d) ->
+ otp_7198_scan(<<>>, ['AND' | TokAcc]);
+
+otp_7198_scan(<<N, Z, Rest/binary>>, TokAcc) when
+ (N =:= $N orelse N =:= $n) and
+ ((Z =:= $\s) or (Z =:= $() or (Z =:= $))) ->
+ otp_7198_scan(<<Z, Rest/binary>>, ['NOT' | TokAcc]);
+
+otp_7198_scan(<<C, Rest/binary>>, TokAcc) when
+ (C >= $A) and (C =< $Z);
+ (C >= $a) and (C =< $z);
+ (C >= $0) and (C =< $9) ->
+ case Rest of
+ <<$:, R/binary>> ->
+ otp_7198_scan(R, [{'FIELD', C} | TokAcc]);
+ _ ->
+ otp_7198_scan(Rest, [{'KEYWORD', C} | TokAcc])
+ end.
+
+unordered_bindings(Config) when is_list(Config) ->
+ {<<1,2,3,4>>,<<42,42>>,<<3,3,3>>} =
+ unordered_bindings(4, 2, 3, <<1,2,3,4, 42,42, 3,3,3, 3>>),
+ ok.
+
+unordered_bindings(CompressedLength, HashSize, PadLength, T) ->
+ <<Content:CompressedLength/binary,Mac:HashSize/binary,
+ Padding:PadLength/binary,PadLength>> = T,
+ {Content,Mac,Padding}.
+
+
+id(I) -> I.
diff --git a/lib/debugger/test/bs_match_tail_SUITE.erl b/lib/debugger/test/bs_match_tail_SUITE.erl
index 961ccbb599..9f7519cf3a 100644
--- a/lib/debugger/test/bs_match_tail_SUITE.erl
+++ b/lib/debugger/test/bs_match_tail_SUITE.erl
@@ -64,7 +64,7 @@ end_per_suite(Config) when is_list(Config) ->
ok.
aligned(doc) -> "Test aligned tails.";
-aligned(Config) when list(Config) ->
+aligned(Config) when is_list(Config) ->
?line Tail1 = mkbin([]),
?line {258,Tail1} = al_get_tail_used(mkbin([1,2])),
?line Tail2 = mkbin(lists:seq(1, 127)),
@@ -84,10 +84,10 @@ aligned(Config) when list(Config) ->
ok.
al_get_tail_used(<<A:16,T/binary>>) -> {A,T}.
-al_get_tail_unused(<<A:16,_T/binary>>) -> A.
+al_get_tail_unused(<<A:16,_/binary>>) -> A.
unaligned(doc) -> "Test that an non-aligned tail cannot be matched out.";
-unaligned(Config) when list(Config) ->
+unaligned(Config) when is_list(Config) ->
?line {'EXIT',{function_clause,_}} = (catch get_tail_used(mkbin([42]))),
?line {'EXIT',{{badmatch,_},_}} = (catch get_dyn_tail_used(mkbin([137]), 3)),
?line {'EXIT',{function_clause,_}} = (catch get_tail_unused(mkbin([42,33]))),
@@ -103,11 +103,11 @@ get_dyn_tail_used(Bin, Sz) ->
{A,T}.
get_dyn_tail_unused(Bin, Sz) ->
- <<A:Sz,_T/binary>> = Bin,
+ <<A:Sz,_/binary>> = Bin,
A.
zero_tail(doc) -> "Test that zero tails are tested correctly.";
-zero_tail(Config) when list(Config) ->
+zero_tail(Config) when is_list(Config) ->
?line 7 = (catch test_zero_tail(mkbin([7]))),
?line {'EXIT',{function_clause,_}} = (catch test_zero_tail(mkbin([1,2]))),
?line {'EXIT',{function_clause,_}} = (catch test_zero_tail2(mkbin([1,2,3]))),
@@ -117,4 +117,4 @@ test_zero_tail(<<A:8>>) -> A.
test_zero_tail2(<<_A:4,_B:4>>) -> ok.
-mkbin(L) when list(L) -> list_to_binary(L).
+mkbin(L) when is_list(L) -> list_to_binary(L).
diff --git a/lib/debugger/test/bug_SUITE.erl b/lib/debugger/test/bug_SUITE.erl
index a831897dfb..1a7e876329 100644
--- a/lib/debugger/test/bug_SUITE.erl
+++ b/lib/debugger/test/bug_SUITE.erl
@@ -51,7 +51,7 @@ end_per_group(_GroupName, Config) ->
otp2163(doc) -> ["BIF exit reason"];
otp2163(suite) -> [];
-otp2163(Config) when list(Config) ->
+otp2163(Config) when is_list(Config) ->
?line DataDir = ?config(data_dir, Config),
%% First compile and get the expected results:
@@ -74,7 +74,7 @@ otp2163(Config) when list(Config) ->
otp4845(doc) -> ["BIF not loading and not bug compatible, OTP-4845 OTP-4859"];
otp4845(suite) -> [];
-otp4845(Config) when list(Config) ->
+otp4845(Config) when is_list(Config) ->
?line DataDir = ?config(data_dir, Config),
%% First compile and get the expected results:
diff --git a/lib/debugger/test/exception_SUITE.erl b/lib/debugger/test/exception_SUITE.erl
index 8c864e4b5f..86554ab2d4 100644
--- a/lib/debugger/test/exception_SUITE.erl
+++ b/lib/debugger/test/exception_SUITE.erl
@@ -23,7 +23,8 @@
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- badmatch/1,pending_errors/1,nil_arith/1]).
+ badmatch/1,pending_errors/1,nil_arith/1,
+ stacktrace/1,nested_stacktrace/1,raise/1,gunilla/1,per/1]).
-export([bad_guy/2]).
@@ -31,6 +32,19 @@
suite() -> [{ct_hooks,[ts_install_cth]}].
+%% Filler.
+%%
+%%
+%%
+%%
+%% This is line 40.
+even(N) when is_integer(N), N > 1, (N rem 2) == 0 ->
+ odd(N-1)++[N].
+
+odd(N) when is_integer(N), N > 1, (N rem 2) == 1 ->
+ even(N-1)++[N].
+
+
all() ->
cases().
@@ -45,7 +59,8 @@ end_per_group(_GroupName, Config) ->
cases() ->
- [badmatch, pending_errors, nil_arith].
+ [badmatch, pending_errors, nil_arith, stacktrace,
+ nested_stacktrace, raise, gunilla, per].
-define(try_match(E),
catch ?MODULE:bar(),
@@ -69,9 +84,9 @@ init_per_suite(Config) when is_list(Config) ->
end_per_suite(Config) when is_list(Config) ->
ok.
-badmatch(doc) -> "Test that deliberately bad matches are reported correctly.";
-badmatch(suite) -> [];
-badmatch(Config) when list(Config) ->
+%% Test that deliberately bad matches are reported correctly.
+
+badmatch(Config) when is_list(Config) ->
?line ?try_match(a),
?line ?try_match(42),
?line ?try_match({a, b, c}),
@@ -79,11 +94,9 @@ badmatch(Config) when list(Config) ->
?line ?try_match(1.0),
ok.
-pending_errors(doc) ->
- ["Test various exceptions, in the presence of a previous error suppressed ",
- "in a guard."];
-pending_errors(suite) -> [];
-pending_errors(Config) when list(Config) ->
+%% Test various exceptions, in the presence of a previous error suppressed
+%% in a guard.
+pending_errors(Config) when is_list(Config) ->
?line pending(e_badmatch, {badmatch, b}),
?line pending(x, function_clause),
?line pending(e_case, {case_clause, xxx}),
@@ -100,7 +113,7 @@ bad_guy(pe_badarith, Other) when Other+1 == 0 -> % badarith (suppressed)
bad_guy(pe_badarg, Other) when length(Other) > 0 -> % badarg (suppressed)
ok;
bad_guy(_, e_case) ->
- case xxx of
+ case id(xxx) of
ok -> ok
end; % case_clause
bad_guy(_, e_if) ->
@@ -121,7 +134,7 @@ bad_guy(_, e_badarg) ->
bad_guy(_, e_badarg_spawn) ->
spawn({}, {}, {}); % badarg
bad_guy(_, e_badmatch) ->
- a = b. % badmatch
+ a = id(b). % badmatch
pending(Arg, Expected) ->
pending(pe_badarith, Arg, Expected),
@@ -155,28 +168,23 @@ pending_exit_message(Args, Expected) ->
end,
process_flag(trap_exit, false).
-pending({badarg,[{erlang,Bif,BifArgs},{?MODULE,Func,Arity}|_]}, Func, Args, _Code)
- when atom(Bif), list(BifArgs), length(Args) == Arity -> %Threaded code.
- ok;
-pending({badarg,[{erlang,Bif,BifArgs},{?MODULE,Func,Args}|_]}, Func, Args, _Code)
- when atom(Bif), list(BifArgs) -> %From interpreted code.
+pending({badarg, [{erlang,Bif,BifArgs,_},{?MODULE,Func,Arity,_}|_]},
+ Func, Args, _Code)
+ when is_atom(Bif), is_list(BifArgs), length(Args) == Arity ->
ok;
-pending({undef,[{non_existing_module,foo,[]}|_]}, _, _, _) ->
+pending({undef,[{non_existing_module,foo,[],_}|_]}, _, _, _) ->
ok;
-pending({function_clause,[{?MODULE,Func,Args}|_]}, Func, Args, _Code) ->
+pending({function_clause,[{?MODULE,Func,Args,_}|_]}, Func, Args, _Code) ->
ok;
-pending({Code,[{?MODULE,Func,Arity}|_]}, Func, Args, Code) when length(Args) == Arity -> %Threaded code
+pending({Code,[{?MODULE,Func,Arity,_}|_]}, Func, Args, Code)
+ when length(Args) == Arity ->
ok;
-pending({Code,[{?MODULE,Func,Args}|_]}, Func, Args, Code) -> %From interpreted code.
- ok;
-pending(Reason, Func, Args, Code) ->
- test_server:fail({bad_exit_reason,Reason,{Func,Args,Code}}).
-
-nil_arith(doc) ->
- "Test that doing arithmetics on [] gives a badarith EXIT and not a crash.";
-nil_arith(suite) ->
- [];
-nil_arith(Config) when list(Config) ->
+pending(Reason, _Function, _Args, _Code) ->
+ test_server:fail({bad_exit_reason,Reason}).
+
+%% Test that doing arithmetics on [] gives a badarith EXIT and not a crash.
+
+nil_arith(Config) when is_list(Config) ->
?line ba_plus_minus_times([], []),
?line ba_plus_minus_times([], 0),
@@ -268,3 +276,199 @@ ba_shift(A, B) ->
ba_bnot(A) ->
io:format("bnot ~p", [A]),
{'EXIT', {badarith, _}} = (catch bnot A).
+
+stacktrace(Conf) when is_list(Conf) ->
+ Tag = make_ref(),
+ ?line {_,Mref} = spawn_monitor(fun() -> exit({Tag,erlang:get_stacktrace()}) end),
+ ?line {Tag,[]} = receive {'DOWN',Mref,_,_,Info} -> Info end,
+ V = [make_ref()|self()],
+ ?line {value2,{caught1,badarg,[{erlang,abs,[V],_}|_]=St1}} =
+ stacktrace_1({'abs',V}, error, {value,V}),
+ ?line St1 = erase(stacktrace1),
+ ?line St1 = erase(stacktrace2),
+ ?line St1 = erlang:get_stacktrace(),
+ ?line {caught2,{error,badarith},[{?MODULE,my_add,2,_}|_]=St2} =
+ stacktrace_1({'div',{1,0}}, error, {'add',{0,a}}),
+ ?line [{?MODULE,my_div,2,_}|_] = erase(stacktrace1),
+ ?line St2 = erase(stacktrace2),
+ ?line St2 = erlang:get_stacktrace(),
+ ?line {caught2,{error,{try_clause,V}},[{?MODULE,stacktrace_1,3,_}|_]=St3} =
+ stacktrace_1({value,V}, error, {value,V}),
+ ?line St3 = erase(stacktrace1),
+ ?line St3 = erase(stacktrace2),
+ ?line St3 = erlang:get_stacktrace(),
+ ?line {caught2,{throw,V},[{?MODULE,foo,1,_}|_]=St4} =
+ stacktrace_1({value,V}, error, {throw,V}),
+ ?line [{?MODULE,stacktrace_1,3,_}|_] = erase(stacktrace1),
+ ?line St4 = erase(stacktrace2),
+ ?line St4 = erlang:get_stacktrace(),
+ ok.
+
+stacktrace_1(X, C1, Y) ->
+ erase(stacktrace1),
+ erase(stacktrace2),
+ try try foo(X) of
+ C1 -> value1
+ catch
+ C1:D1 -> {caught1,D1,erlang:get_stacktrace()}
+ after
+ put(stacktrace1, erlang:get_stacktrace()),
+ foo(Y)
+ end of
+ V2 -> {value2,V2}
+ catch
+ C2:D2 -> {caught2,{C2,D2},erlang:get_stacktrace()}
+ after
+ put(stacktrace2, erlang:get_stacktrace())
+ end.
+
+
+
+nested_stacktrace(Conf) when is_list(Conf) ->
+ V = [{make_ref()}|[self()]],
+ ?line value1 =
+ nested_stacktrace_1({{value,{V,x1}},void,{V,x1}},
+ {void,void,void}),
+ ?line {caught1,
+ [{?MODULE,my_add,2,_}|_],
+ value2,
+ [{?MODULE,my_add,2,_}|_]} =
+ nested_stacktrace_1({{'add',{V,x1}},error,badarith},
+ {{value,{V,x2}},void,{V,x2}}),
+ ?line {caught1,
+ [{?MODULE,my_add,2,_}|_],
+ {caught2,[{erlang,abs,[V],_}|_]},
+ [{erlang,abs,[V],_}|_]} =
+ nested_stacktrace_1({{'add',{V,x1}},error,badarith},
+ {{'abs',V},error,badarg}),
+ ok.
+
+nested_stacktrace_1({X1,C1,V1}, {X2,C2,V2}) ->
+ try foo(X1) of
+ V1 -> value1
+ catch
+ C1:V1 ->
+ S1 = erlang:get_stacktrace(),
+ T2 =
+ try foo(X2) of
+ V2 -> value2
+ catch
+ C2:V2 -> {caught2,erlang:get_stacktrace()}
+ end,
+ {caught1,S1,T2,erlang:get_stacktrace()}
+ end.
+
+
+
+raise(Conf) when is_list(Conf) ->
+ ?line erase(raise),
+ ?line A =
+ try
+ ?line try foo({'div',{1,0}})
+ catch
+ error:badarith ->
+ put(raise, A0 = erlang:get_stacktrace()),
+ ?line erlang:raise(error, badarith, A0)
+ end
+ catch
+ error:badarith ->
+ ?line A1 = erlang:get_stacktrace(),
+ ?line A1 = get(raise)
+ end,
+ ?line A = erlang:get_stacktrace(),
+ ?line A = get(raise),
+ ?line [{?MODULE,my_div,2,_}|_] = A,
+ %%
+ N = 8, % Must be even
+ ?line N = erlang:system_flag(backtrace_depth, N),
+ ?line try even(N)
+ catch error:function_clause -> ok
+ end,
+ ?line B = odd_even(N, []),
+ ?line B = erlang:get_stacktrace(),
+ %%
+ ?line C0 = odd_even(N+1, []),
+ ?line C = lists:sublist(C0, N),
+ ?line try odd(N+1)
+ catch error:function_clause -> ok
+ end,
+ ?line C = erlang:get_stacktrace(),
+ ?line try erlang:raise(error, function_clause, C0)
+ catch error:function_clause -> ok
+ end,
+ ?line C = erlang:get_stacktrace(),
+ ok.
+
+odd_even(N, R) when is_integer(N), N > 1 ->
+ odd_even(N-1,
+ [if (N rem 2) == 0 ->
+ {?MODULE,even,1,[{file,?MODULE_STRING++".erl"},
+ {line,42}]};
+ true ->
+ {?MODULE,odd,1,[{file,?MODULE_STRING++".erl"},
+ {line,45}]}
+ end|R]);
+odd_even(1, R) ->
+ [{?MODULE,odd,[1],[{file,?MODULE_STRING++".erl"},
+ {line,44}]}|R].
+
+foo({value,Value}) -> Value;
+foo({'div',{A,B}}) ->
+ my_div(A, B);
+foo({'add',{A,B}}) ->
+ my_add(A, B);
+foo({'abs',X}) ->
+ my_abs(X);
+foo({error,Error}) ->
+ erlang:error(Error);
+foo({throw,Throw}) ->
+ erlang:throw(Throw);
+foo({exit,Exit}) ->
+ erlang:exit(Exit);
+foo({raise,{Class,Reason,Stacktrace}}) ->
+ erlang:raise(Class, Reason, Stacktrace).
+%%foo(function_clause) -> % must not be defined!
+
+my_div(A, B) ->
+ A div B.
+
+my_add(A, B) ->
+ A + B.
+
+my_abs(X) -> abs(X).
+
+gunilla(Config) when is_list(Config) ->
+ ?line {throw,kalle} = gunilla_1(),
+ ?line [] = erlang:get_stacktrace(),
+ ok.
+
+gunilla_1() ->
+ try try arne()
+ after
+ pelle
+ end
+ catch
+ C:R ->
+ {C,R}
+ end.
+
+arne() ->
+ %% Empty stack trace used to cause change the error class to 'error'.
+ erlang:raise(throw, kalle, []).
+
+per(Config) when is_list(Config) ->
+ try
+ t1(0,pad,0),
+ t2(0,pad,0)
+ catch
+ error:badarith ->
+ ok
+ end.
+
+t1(_,X,_) ->
+ (1 bsl X) + 1.
+
+t2(_,X,_) ->
+ (X bsl 1) + 1.
+
+id(I) -> I.
diff --git a/lib/debugger/test/guard_SUITE.erl b/lib/debugger/test/guard_SUITE.erl
index 611dcb4dff..bf5fa82749 100644
--- a/lib/debugger/test/guard_SUITE.erl
+++ b/lib/debugger/test/guard_SUITE.erl
@@ -35,7 +35,8 @@
t_is_boolean/1,is_function_2/1,
tricky/1,rel_ops/1,
basic_andalso_orelse/1,traverse_dcd/1,
- check_qlc_hrl/1]).
+ check_qlc_hrl/1,andalso_semi/1,t_tuple_size/1,binary_part/1,
+ bad_constants/1]).
-include_lib("test_server/include/test_server.hrl").
@@ -65,7 +66,8 @@ cases() ->
xor_guard, more_xor_guards, build_in_guard,
old_guard_tests, gbif, t_is_boolean, is_function_2,
tricky, rel_ops, basic_andalso_orelse, traverse_dcd,
- check_qlc_hrl].
+ check_qlc_hrl, andalso_semi, t_tuple_size, binary_part,
+ bad_constants].
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
@@ -294,9 +296,7 @@ try_gbif(Id, X, Y) ->
try_fail_gbif(Id, X, Y) ->
case catch guard_bif(Id, X, Y) of
- {'EXIT', {function_clause,{?MODULE,guard_bif,[Id,X,Y]}}} -> %Jam
- io:format("guard_bif(~p, ~p, ~p) -- ok", [Id,X,Y]);
- {'EXIT', {function_clause,[{?MODULE,guard_bif,[Id,X,Y]}|_]}} -> %Beam
+ {'EXIT', {function_clause,[{?MODULE,guard_bif,[Id,X,Y],_}|_]}} ->
io:format("guard_bif(~p, ~p, ~p) -- ok", [Id,X,Y]);
Other ->
?line ok = io:format("guard_bif(~p, ~p, ~p) -- bad result: ~p\n",
@@ -367,9 +367,8 @@ type_tests(Test, [Type|T], Allowed) ->
end;
false ->
case catch type_test(Test, Value) of
- {'EXIT', {function_clause, {?MODULE, type_test, [Test, Value]}}} ->
- ok;
- {'EXIT', {function_clause,[{?MODULE,type_test,[Test,Value]}|_]}} ->
+ {'EXIT',{function_clause,
+ [{?MODULE,type_test,[Test,Value],_}|_]}} ->
ok;
{'EXIT',Other} ->
?line test_server:fail({unexpected_error_reason,Other});
@@ -1477,7 +1476,207 @@ cqlc(M, F, As, St) ->
St
end.
+%% OTP-7679: Thanks to Hunter Morris.
+andalso_semi(Config) when is_list(Config) ->
+ ?line ok = andalso_semi_foo(0),
+ ?line ok = andalso_semi_foo(1),
+ ?line fc(catch andalso_semi_foo(2)),
+
+ ?line ok = andalso_semi_bar([a,b,c]),
+ ?line ok = andalso_semi_bar(1),
+ ?line fc(catch andalso_semi_bar([a,b])),
+ ok.
+
+andalso_semi_foo(Bar) when is_integer(Bar) andalso Bar =:= 0; Bar =:= 1 ->
+ ok.
+
+andalso_semi_bar(Bar) when is_list(Bar) andalso length(Bar) =:= 3; Bar =:= 1 ->
+ ok.
+
+
+t_tuple_size(Config) when is_list(Config) ->
+ ?line 10 = do_tuple_size({1,2,3,4}),
+ ?line fc(catch do_tuple_size({1,2,3})),
+ ?line fc(catch do_tuple_size(42)),
+ ?line error = ludicrous_tuple_size({a,b,c}),
+ ?line error = ludicrous_tuple_size([a,b,c]),
+
+ ok.
+
+do_tuple_size(T) when tuple_size(T) =:= 4 ->
+ {A,B,C,D} = T,
+ A+B+C+D.
+
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= 16#7777777777777777777777777777777777 -> ok;
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= 16#10000000000000000 -> ok;
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= (1 bsl 64) - 1 -> ok;
+ludicrous_tuple_size(T)
+ when tuple_size(T) =:= 16#FFFFFFFFFFFFFFFF -> ok;
+ludicrous_tuple_size(_) -> error.
+
+%%
+%% The binary_part/2,3 guard BIFs
+%%
+-define(MASK_ERROR(EXPR),mask_error((catch (EXPR)))).
+mask_error({'EXIT',{Err,_}}) ->
+ Err;
+mask_error(Else) ->
+ Else.
+
+binary_part(doc) ->
+ ["Tests the binary_part/2,3 guard (GC) bif's"];
+binary_part(Config) when is_list(Config) ->
+ %% This is more or less a copy of what the guard_SUITE in emulator
+ %% does to cover the guard bif's
+ ?line 1 = bptest(<<1,2,3>>),
+ ?line 2 = bptest(<<2,1,3>>),
+ ?line error = bptest(<<1>>),
+ ?line error = bptest(<<>>),
+ ?line error = bptest(apa),
+ ?line 3 = bptest(<<2,3,3>>),
+ % With one variable (pos)
+ ?line 1 = bptest(<<1,2,3>>,1),
+ ?line 2 = bptest(<<2,1,3>>,1),
+ ?line error = bptest(<<1>>,1),
+ ?line error = bptest(<<>>,1),
+ ?line error = bptest(apa,1),
+ ?line 3 = bptest(<<2,3,3>>,1),
+ % With one variable (length)
+ ?line 1 = bptesty(<<1,2,3>>,1),
+ ?line 2 = bptesty(<<2,1,3>>,1),
+ ?line error = bptesty(<<1>>,1),
+ ?line error = bptesty(<<>>,1),
+ ?line error = bptesty(apa,1),
+ ?line 3 = bptesty(<<2,3,3>>,2),
+ % With one variable (whole tuple)
+ ?line 1 = bptestx(<<1,2,3>>,{1,1}),
+ ?line 2 = bptestx(<<2,1,3>>,{1,1}),
+ ?line error = bptestx(<<1>>,{1,1}),
+ ?line error = bptestx(<<>>,{1,1}),
+ ?line error = bptestx(apa,{1,1}),
+ ?line 3 = bptestx(<<2,3,3>>,{1,2}),
+ % With two variables
+ ?line 1 = bptest(<<1,2,3>>,1,1),
+ ?line 2 = bptest(<<2,1,3>>,1,1),
+ ?line error = bptest(<<1>>,1,1),
+ ?line error = bptest(<<>>,1,1),
+ ?line error = bptest(apa,1,1),
+ ?line 3 = bptest(<<2,3,3>>,1,2),
+ % Direct (autoimported) call, these will be evaluated by the compiler...
+ ?line <<2>> = binary_part(<<1,2,3>>,1,1),
+ ?line <<1>> = binary_part(<<2,1,3>>,1,1),
+ % Compiler warnings due to constant evaluation expected (3)
+ ?line badarg = ?MASK_ERROR(binary_part(<<1>>,1,1)),
+ ?line badarg = ?MASK_ERROR(binary_part(<<>>,1,1)),
+ ?line badarg = ?MASK_ERROR(binary_part(apa,1,1)),
+ ?line <<3,3>> = binary_part(<<2,3,3>>,1,2),
+ % Direct call through apply
+ ?line <<2>> = apply(erlang,binary_part,[<<1,2,3>>,1,1]),
+ ?line <<1>> = apply(erlang,binary_part,[<<2,1,3>>,1,1]),
+ % Compiler warnings due to constant evaluation expected (3)
+ ?line badarg = ?MASK_ERROR(apply(erlang,binary_part,[<<1>>,1,1])),
+ ?line badarg = ?MASK_ERROR(apply(erlang,binary_part,[<<>>,1,1])),
+ ?line badarg = ?MASK_ERROR(apply(erlang,binary_part,[apa,1,1])),
+ ?line <<3,3>> = apply(erlang,binary_part,[<<2,3,3>>,1,2]),
+ % Constant propagation
+ ?line Bin = <<1,2,3>>,
+ ?line ok = if
+ binary_part(Bin,1,1) =:= <<2>> ->
+ ok;
+ %% Compiler warning, clause cannot match (expected)
+ true ->
+ error
+ end,
+ ?line ok = if
+ binary_part(Bin,{1,1}) =:= <<2>> ->
+ ok;
+ %% Compiler warning, clause cannot match (expected)
+ true ->
+ error
+ end,
+ ok.
+
+
+bptest(B) when length(B) =:= 1337 ->
+ 1;
+bptest(B) when binary_part(B,{1,1}) =:= <<2>> ->
+ 1;
+bptest(B) when erlang:binary_part(B,1,1) =:= <<1>> ->
+ 2;
+bptest(B) when erlang:binary_part(B,{1,2}) =:= <<3,3>> ->
+ 3;
+bptest(_) ->
+ error.
+
+bptest(B,A) when length(B) =:= A ->
+ 1;
+bptest(B,A) when binary_part(B,{A,1}) =:= <<2>> ->
+ 1;
+bptest(B,A) when erlang:binary_part(B,A,1) =:= <<1>> ->
+ 2;
+bptest(B,A) when erlang:binary_part(B,{A,2}) =:= <<3,3>> ->
+ 3;
+bptest(_,_) ->
+ error.
+
+bptestx(B,A) when length(B) =:= A ->
+ 1;
+bptestx(B,A) when binary_part(B,A) =:= <<2>> ->
+ 1;
+bptestx(B,A) when erlang:binary_part(B,A) =:= <<1>> ->
+ 2;
+bptestx(B,A) when erlang:binary_part(B,A) =:= <<3,3>> ->
+ 3;
+bptestx(_,_) ->
+ error.
+
+bptesty(B,A) when length(B) =:= A ->
+ 1;
+bptesty(B,A) when binary_part(B,{1,A}) =:= <<2>> ->
+ 1;
+bptesty(B,A) when erlang:binary_part(B,1,A) =:= <<1>> ->
+ 2;
+bptesty(B,A) when erlang:binary_part(B,{1,A}) =:= <<3,3>> ->
+ 3;
+bptesty(_,_) ->
+ error.
+
+bptest(B,A,_C) when length(B) =:= A ->
+ 1;
+bptest(B,A,C) when binary_part(B,{A,C}) =:= <<2>> ->
+ 1;
+bptest(B,A,C) when erlang:binary_part(B,A,C) =:= <<1>> ->
+ 2;
+bptest(B,A,C) when erlang:binary_part(B,{A,C}) =:= <<3,3>> ->
+ 3;
+bptest(_,_,_) ->
+ error.
+
+-define(FAILING(C),
+ if
+ C -> ?t:fail(should_fail);
+ true -> ok
+ end,
+ if
+ true, C -> ?t:fail(should_fail);
+ true -> ok
+ end).
+
+bad_constants(Config) when is_list(Config) ->
+ ?line ?FAILING(false),
+ ?line ?FAILING([]),
+ ?line ?FAILING([a]),
+ ?line ?FAILING([Config]),
+ ?line ?FAILING({a,b}),
+ ?line ?FAILING({a,Config}),
+ ?line ?FAILING(<<1>>),
+ ?line ?FAILING(42),
+ ?line ?FAILING(3.14),
+ ok.
%% Call this function to turn off constant propagation.
id(I) -> I.
@@ -1490,3 +1689,5 @@ check(F, Result) ->
io:format(" Got: ~p\n", [Other]),
test_server:fail()
end.
+
+fc({'EXIT',{function_clause,_}}) -> ok.
diff --git a/lib/debugger/test/int_eval_SUITE.erl b/lib/debugger/test/int_eval_SUITE.erl
index f36ed213d1..4ffcf7888e 100644
--- a/lib/debugger/test/int_eval_SUITE.erl
+++ b/lib/debugger/test/int_eval_SUITE.erl
@@ -28,7 +28,7 @@
bifs_outside_erlang/1, spawning/1, applying/1,
catch_and_throw/1, external_call/1, test_module_info/1,
apply_interpreted_fun/1, apply_uninterpreted_fun/1,
- interpreted_exit/1, otp_8310/1]).
+ interpreted_exit/1, otp_8310/1, stacktrace/1]).
%% Helpers.
-export([applier/3]).
@@ -44,7 +44,7 @@ all() ->
[bifs_outside_erlang, spawning, applying,
catch_and_throw, external_call, test_module_info,
apply_interpreted_fun, apply_uninterpreted_fun,
- interpreted_exit, otp_8310].
+ interpreted_exit, otp_8310, stacktrace].
groups() ->
[].
@@ -191,23 +191,23 @@ apply_interpreted_fun(Config) when is_list(Config) ->
?line {ok,ATerm} = spawn_eval(fun() -> F2() end),
%% Called from uninterpreted code, badarity
- ?line {'EXIT',{{badarity,{F1,[snape]}},[{?MODULE,_,_}|_]}} =
+ ?line {'EXIT',{{badarity,{F1,[snape]}},[{?MODULE,_,_,_}|_]}} =
spawn_eval(fun() -> F1(snape) end),
%% Called from uninterpreted code, error in fun
?line F3 = spawn_eval(fun() -> ?IM:give_me_a_bad_fun() end),
- ?line {'EXIT',{snape,[{?IM,_FunName,_}|_]}} =
+ ?line {'EXIT',{snape,[{?IM,_FunName,_,_}|_]}} =
spawn_eval(fun() -> F3(snape) end),
%% Called from within interpreted code
?line perfectly_alright = spawn_eval(fun() -> ?IM:do_apply(F1) end),
%% Called from within interpreted code, badarity
- ?line {'EXIT',{{badarity,{F1,[snape]}},[{?IM,do_apply,_}|_]}} =
+ ?line {'EXIT',{{badarity,{F1,[snape]}},[{?IM,do_apply,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F1, snape) end),
%% Called from within interpreted code, error in fun
- ?line {'EXIT',{snape,[{?IM,_FunName,_}|_]}} =
+ ?line {'EXIT',{snape,[{?IM,_FunName,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F3, snape) end),
%% Try some more complex funs.
@@ -239,11 +239,11 @@ apply_uninterpreted_fun(Config) when is_list(Config) ->
spawn_eval(fun() -> ?IM:do_apply(F1, any_arg) end),
%% Badarity (evaluated in dbg_debugged, which calls erlang:apply/2)
- ?line {'EXIT',{{badarity,{F1,[]}},[{erlang,apply,_}|_]}} =
+ ?line {'EXIT',{{badarity,{F1,[]}},[{erlang,apply,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F1) end),
%% Error in fun
- ?line {'EXIT',{snape,[{?MODULE,_FunName,_}|_]}} =
+ ?line {'EXIT',{snape,[{?MODULE,_FunName,_,_}|_]}} =
spawn_eval(fun() -> ?IM:do_apply(F1, snape) end),
ok.
@@ -277,6 +277,37 @@ applier(M, F, A) ->
io:format("~p:~p(~p) => ~p\n", [M,F,A,Res]),
Res.
+stacktrace(Config) when is_list(Config) ->
+ ?line {done,Stk} = do_eval(Config, stacktrace),
+ ?line 13 = length(Stk),
+ ?line OldStackTraceFlag = int:stack_trace(),
+ ?line int:stack_trace(no_tail),
+ try
+ ?line Res = spawn_eval(fun() -> stacktrace:stacktrace() end),
+ ?line io:format("\nInterpreted (no_tail):\n~p", [Res]),
+ ?line {done,Stk} = Res
+ after
+ ?line int:stack_trace(OldStackTraceFlag)
+ end,
+ ok.
+
+
+do_eval(Config, Mod) ->
+ ?line DataDir = ?config(data_dir, Config),
+ ?line ok = file:set_cwd(DataDir),
+
+ ?line {ok,Mod} = compile:file(Mod, [report,debug_info]),
+ ?line {module,Mod} = code:load_file(Mod),
+ ?line CompiledRes = Mod:Mod(),
+ ?line ok = io:format("Compiled:\n~p", [CompiledRes]),
+ io:nl(),
+
+ ?line {module,Mod} = int:i(Mod),
+ ?line IntRes = Mod:Mod(),
+ ?line ok = io:format("Interpreted:\n~p", [IntRes]),
+
+ ?line CompiledRes = IntRes.
+
%%
%% Evaluate in another process, to prevent the test_case process to become
%% interpreted.
diff --git a/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl b/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl
index 997ee6e17d..90f83e80e8 100644
--- a/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl
+++ b/lib/debugger/test/int_eval_SUITE_data/my_int_eval_module.erl
@@ -117,7 +117,7 @@ more_nocatch(Fun) ->
%% External calls.
external_call_test(Data) ->
- {'EXIT',{undef,[{?MODULE,not_exported,[42,Data]}|_]}} =
+ {'EXIT',{undef,[{?MODULE,not_exported,[42,Data],_}|_]}} =
(catch ?MODULE:not_exported(42, Data)),
{yes,Data} = i_am_exported(Data),
{yes,Data} = ?MODULE:i_am_exported(Data),
@@ -127,7 +127,7 @@ external_call_test(Data) ->
{ok,Data,[a,b]} = not_exported(Data, [a,b]),
{yes,Data} = i_am_exported(Data),
{ok,Data,[a,b]} = not_exported(Data, [a,b]),
- {'EXIT',{undef,[{?MODULE,not_exported,[7,Data]}|_]}} =
+ {'EXIT',{undef,[{?MODULE,not_exported,[7,Data],_}|_]}} =
(catch ?MODULE:not_exported(7, Data)),
{yes,Data} = ?MODULE:i_am_exported(Data),
ok.
diff --git a/lib/debugger/test/int_eval_SUITE_data/stacktrace.erl b/lib/debugger/test/int_eval_SUITE_data/stacktrace.erl
new file mode 100644
index 0000000000..3380178fdc
--- /dev/null
+++ b/lib/debugger/test/int_eval_SUITE_data/stacktrace.erl
@@ -0,0 +1,130 @@
+-module(stacktrace).
+-export([?MODULE/0]).
+
+?MODULE() ->
+ OldDepth = erlang:system_flag(backtrace_depth, 32),
+ done = (catch do_try()),
+ Stk = trim(erlang:get_stacktrace()),
+ erlang:system_flag(backtrace_depth, OldDepth),
+ {done,Stk}.
+
+trim([{int_eval_SUITE,_,_,_}|_]) ->
+ [];
+trim([H|T]) ->
+ [H|trim(T)];
+trim([]) -> [].
+
+do_try() ->
+ try
+ 0 = id(42)
+ catch
+ error:{badmatch,42} ->
+ do_try2() %Tail-recursive
+ end.
+
+do_try2() ->
+ try
+ 0 = id(42)
+ catch
+ error:{badmatch,42} ->
+ do_try3() %Not tail-recursive
+ end,
+ ?LINE.
+
+do_try3() ->
+ try id(42) of
+ 42 -> do_try4() %Tail-recursive
+ catch
+ error:ignore -> %Should never catch
+ ?LINE
+ end.
+
+do_try4() ->
+ try
+ do_recv() %Not tail-recursive
+ catch
+ error:ignore -> %Should never catch
+ ?LINE
+ end.
+
+do_recv() ->
+ self() ! x,
+ receive
+ x -> do_recv2() %Not tail-recursive
+ end,
+ ?LINE.
+
+do_recv2() ->
+ self() ! y,
+ receive
+ y -> do_recv3() %Tail-recursive
+ end.
+
+do_recv3() ->
+ receive
+ after 0 -> do_recv4() %Tail-recursive
+ end.
+
+do_recv4() ->
+ receive
+ after 0 -> do_if(true) %Not tail-recursive
+ end,
+ ?LINE.
+
+do_if(Bool) ->
+ if
+ Bool -> do_if2(Bool) %Tail-recursive
+ end.
+
+do_if2(Bool) ->
+ if
+ Bool -> do_case(Bool) %Not tail-recursive
+ end,
+ ?LINE.
+
+
+do_case(Bool) ->
+ case Bool of
+ true -> do_case2(Bool) %Tail-recursive
+ end.
+
+do_case2(Bool) ->
+ case Bool of
+ true -> do_fun(Bool) %Not tail-recursive
+ end,
+ ?LINE.
+
+do_fun(Bool) ->
+ F = fun(true) ->
+ do_fun2(Bool) %Tail-recursive
+ end,
+ F(Bool). %Tail-recursive
+
+do_fun2(Bool) ->
+ F = fun(true) ->
+ cons(Bool) %Tail-recursive
+ end,
+ F(Bool), %Not tail-recursive
+ ?LINE.
+
+cons(Bool) ->
+ [Bool|tuple()].
+
+tuple() ->
+ {ok,op()}.
+
+op() ->
+ 1 + lc().
+
+lc() ->
+ [done() || true].
+
+done() ->
+ tail(100),
+ throw(done).
+
+tail(0) -> ok;
+tail(N) -> tail(N-1).
+
+id(I) ->
+ I.
diff --git a/lib/debugger/test/lc_SUITE.erl b/lib/debugger/test/lc_SUITE.erl
index 92a03ef58e..2f05eb7fca 100644
--- a/lib/debugger/test/lc_SUITE.erl
+++ b/lib/debugger/test/lc_SUITE.erl
@@ -17,21 +17,22 @@
%% %CopyrightEnd%
%%
-%%
-module(lc_SUITE).
--author('[email protected]').
+%% Copied from lc_SUITE in the compiler application.
+
-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
init_per_testcase/2,end_per_testcase/2,
init_per_suite/1,end_per_suite/1,
- basic/1]).
+ basic/1,deeply_nested/1,no_generator/1,
+ empty_generator/1]).
-include_lib("test_server/include/test_server.hrl").
suite() -> [{ct_hooks,[ts_install_cth]}].
all() ->
- cases().
+ [basic, deeply_nested, no_generator, empty_generator].
groups() ->
[].
@@ -42,10 +43,6 @@ init_per_group(_GroupName, Config) ->
end_per_group(_GroupName, Config) ->
Config.
-
-cases() ->
- [basic].
-
init_per_testcase(_Case, Config) ->
test_lib:interpret(?MODULE),
Dog = test_server:timetrap(?t:minutes(1)),
@@ -64,7 +61,7 @@ init_per_suite(Config) when is_list(Config) ->
end_per_suite(Config) when is_list(Config) ->
ok.
-basic(Config) when list(Config) ->
+basic(Config) when is_list(Config) ->
?line L0 = lists:seq(1, 10),
?line L1 = my_map(fun(X) -> {x,X} end, L0),
?line L1 = [{x,X} || X <- L0],
@@ -73,16 +70,116 @@ basic(Config) when list(Config) ->
?line [4,5,6] = [X || X <- L0, X > 3, X < 7],
?line [] = [X || X <- L0, X > 32, X < 7],
?line [1,3,5,7,9] = [X || X <- L0, odd(X)],
+ ?line [2,4,6,8,10] = [X || X <- L0, not odd(X)],
+ ?line [1,3,5,9] = [X || X <- L0, odd(X), X =/= 7],
+ ?line [2,4,8,10] = [X || X <- L0, not odd(X), X =/= 6],
+
+ %% Append is specially handled.
+ ?line [1,3,5,9,2,4,8,10] = [X || X <- L0, odd(X), X =/= 7] ++
+ [X || X <- L0, not odd(X), X =/= 6],
+
+ %% Guards BIFs are evaluated in guard context. Weird, but true.
+ ?line [{a,b,true},{x,y,true,true}] = [X || X <- tuple_list(), element(3, X)],
+
+ %% Filter expressions with andalso/orelse.
+ ?line "abc123" = alphanum("?abc123.;"),
%% Error cases.
- ?line [] = [X || X <- L1, X+1 < 2],
?line [] = [{xx,X} || X <- L0, element(2, X) == no_no_no],
- ?line {'EXIT',_} = (catch [X || X <- L1, odd(X)]),
+ ?line {'EXIT',_} = (catch [X || X <- L1, list_to_atom(X) == dum]),
+ ?line [] = [X || X <- L1, X+1 < 2],
+ ?line {'EXIT',_} = (catch [X || X <- L1, odd(X)]),
+ %% A bad generator has a different exception compared to BEAM.
+ ?line {'EXIT',{{bad_generator,x},_}} = (catch [E || E <- id(x)]),
ok.
+tuple_list() ->
+ [{a,b,true},[a,b,c],glurf,{a,b,false,xx},{a,b},{x,y,true,true},{a,b,d,ddd}].
+
my_map(F, L) ->
[F(X) || X <- L].
odd(X) ->
X rem 2 == 1.
+
+alphanum(Str) ->
+ [C || C <- Str, ((C >= $0) andalso (C =< $9))
+ orelse ((C >= $a) andalso (C =< $z))
+ orelse ((C >= $A) andalso (C =< $Z))].
+
+deeply_nested(Config) when is_list(Config) ->
+ [[99,98,97,96,42,17,1764,12,11,10,9,8,7,6,5,4,3,7,2,1]] = deeply_nested_1(),
+ ok.
+
+deeply_nested_1() ->
+ %% This used to compile really, really SLOW before R11B-1...
+ [[X1,X2,X3,X4,X5,X6,X7(),X8,X9,X10,X11,X12,X13,X14,X15,X16,X17,X18(),X19,X20] ||
+ X1 <- [99],X2 <- [98],X3 <- [97],X4 <- [96],X5 <- [42],X6 <- [17],
+ X7 <- [fun() -> X5*X5 end],X8 <- [12],X9 <- [11],X10 <- [10],
+ X11 <- [9],X12 <- [8],X13 <- [7],X14 <- [6],X15 <- [5],
+ X16 <- [4],X17 <- [3],X18 <- [fun() -> X16+X17 end],X19 <- [2],X20 <- [1]].
+
+no_generator(Config) when is_list(Config) ->
+ ?line Seq = lists:seq(-10, 17),
+ ?line [no_gen_verify(no_gen(A, B), A, B) || A <- Seq, B <- Seq],
+
+ %% Literal expression, for coverage.
+ ?line [a] = [a || true],
+ ?line [a,b,c] = [a || true] ++ [b,c],
+ ok.
+
+no_gen(A, B) ->
+ [{A,B} || A+B =:= 0] ++
+ [{A,B} || A*B =:= 0] ++
+ [{A,B} || A rem B =:= 3] ++
+ [{A,B} || A =:= B] ++
+ [{one_more,A,B} || no_gen_one_more(A, B)] ++
+ [A || A =:= 1] ++
+ [A || A =:= 2] ++
+ [A || A =:= 3] ++
+ [A || A =:= 4] ++
+ [A || A =:= 5] ++
+ [A || A =:= 6] ++
+ [A || A =:= 7] ++
+ [A || A =:= 8] ++
+ [A || A =:= 9] ++
+ [B || B =:= 1] ++
+ [B || B =:= 2] ++
+ [B || B =:= 3] ++
+ [B || B =:= 4] ++
+ [B || B =:= 5] ++
+ [B || B =:= 6] ++
+ [B || B =:= 7] ++
+ [B || B =:= 8] ++
+ [B || B =:= 9].
+
+no_gen_verify(Res, A, B) ->
+ Pair = {A,B},
+ ShouldBe = no_gen_eval(fun() -> A+B =:= 0 end, Pair) ++
+ no_gen_eval(fun() -> A*B =:= 0 end, Pair) ++
+ no_gen_eval(fun() -> B =/= 0 andalso A rem B =:= 3 end, Pair) ++
+ no_gen_eval(fun() -> A =:= B end, Pair) ++
+ no_gen_eval(fun() -> A + 1 =:= B end, {one_more,A,B}) ++
+ no_gen_eval(fun() -> 1 =< A andalso A =< 9 end, A) ++
+ no_gen_eval(fun() -> 1 =< B andalso B =< 9 end, B),
+ case Res of
+ ShouldBe -> ok;
+ _ ->
+ io:format("A = ~p; B = ~p; Expected = ~p, actual = ~p", [A,B,ShouldBe,Res]),
+ ?t:fail()
+ end.
+
+no_gen_eval(Fun, Res) ->
+ case Fun() of
+ true -> [Res];
+ false -> []
+ end.
+
+no_gen_one_more(A, B) -> A + 1 =:= B.
+
+empty_generator(Config) when is_list(Config) ->
+ ?line [] = [X || {X} <- [], (false or (X/0 > 3))],
+ ok.
+
+id(I) -> I.
diff --git a/lib/debugger/test/line_number_SUITE.erl b/lib/debugger/test/line_number_SUITE.erl
new file mode 100644
index 0000000000..d1f56d3493
--- /dev/null
+++ b/lib/debugger/test/line_number_SUITE.erl
@@ -0,0 +1,220 @@
+%%
+%% %CopyrightBegin%
+%%
+%% Copyright Ericsson AB 1999-2011. All Rights Reserved.
+%%
+%% The contents of this file are subject to the Erlang Public License,
+%% Version 1.1, (the "License"); you may not use this file except in
+%% compliance with the License. You should have received a copy of the
+%% Erlang Public License along with this software. If not, it can be
+%% retrieved online at http://www.erlang.org/.
+%%
+%% Software distributed under the License is distributed on an "AS IS"
+%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
+%% the License for the specific language governing rights and limitations
+%% under the License.
+%%
+%% %CopyrightEnd%
+%%
+
+-module(line_number_SUITE).
+
+-export([all/0, suite/0,groups/0,init_per_group/2,end_per_group/2,
+ init_per_testcase/2,end_per_testcase/2,
+ init_per_suite/1,end_per_suite/1,
+ line_numbers/1]).
+-export([crash/1]).
+
+-include_lib("test_server/include/test_server.hrl").
+
+suite() -> [{ct_hooks,[ts_install_cth]}].
+
+all() ->
+ cases().
+
+groups() ->
+ [].
+
+init_per_group(_GroupName, Config) ->
+ Config.
+
+end_per_group(_GroupName, Config) ->
+ Config.
+
+cases() ->
+ [line_numbers].
+
+init_per_testcase(_Case, Config) ->
+ test_lib:interpret(?MODULE),
+ Dog = test_server:timetrap(?t:minutes(1)),
+ [{watchdog,Dog}|Config].
+
+end_per_testcase(_Case, Config) ->
+ Dog = ?config(watchdog, Config),
+ ?t:timetrap_cancel(Dog),
+ ok.
+
+init_per_suite(Config) when is_list(Config) ->
+ ?line test_lib:interpret(?MODULE),
+ ?line true = lists:member(?MODULE, int:interpreted()),
+ Config.
+
+end_per_suite(Config) when is_list(Config) ->
+ ok.
+
+
+
+
+
+%%
+%% === Make sure that this is always line 70 ===
+%%
+line1(Tag, X) -> %Line 72
+ case Tag of %Line 73
+ a ->
+ Y = X + 1, %Line 75
+ Res = id({ok,Y}), %Line 76
+ ?MODULE:crash({ok,42} = Res); %Line 77
+ b ->
+ x = id(x), %Line 79
+ ok %Line 80
+ end. %Line 81
+
+crash(_) -> %Line 83
+ erlang:error(crash). %Line 84
+
+close_calls(Where) -> %Line 86
+ put(where_to_crash, Where), %Line 87
+ try
+ call1(), %Line 89
+ call2(), %Line 90
+ call3(), %Line 91
+ no_crash %Line 92
+ catch error:crash ->
+ erlang:get_stacktrace() %Line 94
+ end. %Line 95
+
+call1() -> %Line 97
+ maybe_crash(call1), %Line 98
+ ok. %Line 99
+
+call2() -> %Line 101
+ maybe_crash(call2), %Line 102
+ ok. %Line 103
+
+call3() -> %Line 105
+ maybe_crash(call3), %Line 106
+ ok. %Line 107
+
+maybe_crash(Name) -> %Line 109
+ case get(where_to_crash) of %Line 110
+ Name ->
+ erlang:error(crash); %Line 112
+ _ ->
+ ok %Line 114
+ end. %Line 115
+
+build_binary1(Size) -> %Line 117
+ id(42), %Line 118
+ <<0:Size>>. %Line 119
+
+build_binary2(Size, Bin) -> %Line 121
+ id(0), %Line 122
+ <<7:Size,Bin/binary>>. %Line 123
+
+do_call_abs(x, Arg) -> %Line 125
+ abs(Arg). %Line 126
+
+do_call_unsafe_bif(x, Arg) -> %Line 128
+ link(Arg). %Line 129
+
+
+line_numbers(Config) when is_list(Config) ->
+ File = ?MODULE_STRING ++ ".erl",
+ {'EXIT',{{case_clause,bad_tag},
+ [{?MODULE,line1,2,
+ [{file,File},{line,73}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(bad_tag, 0)),
+ {'EXIT',{badarith,
+ [{?MODULE,line1,2,
+ [{file,File},{line,75}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, not_an_integer)),
+ {'EXIT',{{badmatch,{ok,1}},
+ [{?MODULE,line1,2,
+ [{file,File},{line,77}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, 0)),
+ {'EXIT',{crash,
+ [{?MODULE,crash,1,
+ [{file,File},{line,84}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch line1(a, 41)),
+
+ [{?MODULE,maybe_crash,1,[{file,File},{line,112}]},
+ {?MODULE,call1,0,[{file,File},{line,98}]},
+ {?MODULE,close_calls,1,[{file,File},{line,89}]},
+ {?MODULE,line_numbers,1,[{file,File},{line,_}]}|_] =
+ close_calls(call1),
+ [{?MODULE,maybe_crash,1,[{file,File},{line,112}]},
+ {?MODULE,call2,0,[{file,File},{line,102}]},
+ {?MODULE,close_calls,1,[{file,File},{line,90}]},
+ {?MODULE,line_numbers,1,[{file,File},{line,_}]}|_] =
+ close_calls(call2),
+ [{?MODULE,maybe_crash,1,[{file,File},{line,112}]},
+ {?MODULE,call3,0,[{file,File},{line,106}]},
+ {?MODULE,close_calls,1,[{file,File},{line,91}]},
+ {?MODULE,line_numbers,1,[{file,File},{line,_}]}|_] =
+ close_calls(call3),
+ no_crash = close_calls(other),
+
+ <<0,0>> = build_binary1(16),
+ {'EXIT',{badarg,
+ [{?MODULE,build_binary1,1,
+ [{file,File},{line,119}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary1(bad_size)),
+
+ <<7,1,2,3>> = build_binary2(8, <<1,2,3>>),
+ {'EXIT',{badarg,
+ [{?MODULE,build_binary2,2,
+ [{file,File},{line,123}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary2(bad_size, <<>>)),
+ {'EXIT',{badarg,
+ [%% Beam has an extra here:
+ %% {erlang,bit_size,[bad_binary],[]}
+ %% Since this is an artifact of the implementation,
+ %% we don't attempt to mimic it in the debugger.
+ {?MODULE,build_binary2,2,
+ [{file,File},{line,123}]},
+ {?MODULE,line_numbers,1,
+ [{file,ModFile},{line,_}]}|_]}} =
+ (catch build_binary2(8, bad_binary)),
+
+ {'EXIT',{function_clause,
+ [{?MODULE,do_call_abs,[y,y],
+ [{file,File},{line,125}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_abs(y, y)),
+ {'EXIT',{badarg,
+ [{erlang,abs,[[]],[]},
+ {?MODULE,do_call_abs,2,
+ [{file,File},{line,126}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_abs(x, [])),
+
+ {'EXIT',{badarg,
+ [{erlang,link,[[]],[]},
+ {?MODULE,do_call_unsafe_bif,2,
+ [{file,File},{line,129}]},
+ {?MODULE,line_numbers,1,_}|_]}} =
+ (catch do_call_unsafe_bif(x, [])),
+
+ ok.
+
+id(I) ->
+ I.
diff --git a/lib/debugger/test/test_lib.erl b/lib/debugger/test/test_lib.erl
index 541375e64a..5e4ac7f164 100644
--- a/lib/debugger/test/test_lib.erl
+++ b/lib/debugger/test/test_lib.erl
@@ -22,7 +22,7 @@
-export([interpret/1]).
-interpret(Mod) when atom(Mod) ->
+interpret(Mod) when is_atom(Mod) ->
case lists:member(Mod, int:interpreted()) of
true -> ok;
false -> {module,Mod} = i:ii(Mod)
diff --git a/lib/debugger/test/trycatch_SUITE.erl b/lib/debugger/test/trycatch_SUITE.erl
index a87c5db138..470d46d915 100644
--- a/lib/debugger/test/trycatch_SUITE.erl
+++ b/lib/debugger/test/trycatch_SUITE.erl
@@ -318,17 +318,18 @@ eclectic(Conf) when is_list(Conf) ->
V = {make_ref(),3.1415926535,[[]|{}]},
?line {{value,{value,V},V},V} =
eclectic_1({foo,{value,{value,V}}}, undefined, {value,V}),
- ?line {{'EXIT',{V,[{?MODULE,foo,_}|_]}},V} =
+ ?line {{'EXIT',{V,[{?MODULE,foo,_,_}|_]}},V} =
eclectic_1({catch_foo,{error,V}}, undefined, {value,V}),
?line {{error,{exit,V},{'EXIT',V}},V} =
eclectic_1({foo,{error,{exit,V}}}, error, {value,V}),
- ?line {{value,{value,V},V},{'EXIT',{badarith,[{?MODULE,my_add,_}|_]}}} =
+ ?line {{value,{value,V},V},{'EXIT',{badarith,[{?MODULE,my_add,_,_}|_]}}} =
eclectic_1({foo,{value,{value,V}}}, undefined, {'add',{0,a}}),
?line {{'EXIT',V},V} =
eclectic_1({catch_foo,{exit,V}}, undefined, {throw,V}),
- ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,_}|_]}}}, {'EXIT',V}} =
+ ?line {{error,{'div',{1,0}},{'EXIT',{badarith,[{?MODULE,my_div,_,_}|_]}}},
+ {'EXIT',V}} =
eclectic_1({foo,{error,{'div',{1,0}}}}, error, {exit,V}),
- ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,_}|_]}}},{'EXIT',V}} =
+ ?line {{{error,V},{'EXIT',{V,[{?MODULE,foo,_,_}|_]}}},{'EXIT',V}} =
eclectic_1({catch_foo,{throw,{error,V}}}, undefined, {exit,V}),
%%
?line {{value,{value,{value,V},V}},V} =
@@ -337,15 +338,15 @@ eclectic(Conf) when is_list(Conf) ->
eclectic_2({throw,{value,V}}, throw, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{value,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_,_}|_]}}},undefined} =
eclectic_2({error,{value,V}}, throw, {error,V}),
- ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V]}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarg,[{erlang,abs,[V],_}|_]}}},V} =
eclectic_2({value,{'abs',V}}, undefined, {value,V}),
- ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,_}|_]}}},V} =
+ ?line {{caught,{'EXIT',{badarith,[{?MODULE,my_add,_,_}|_]}}},V} =
eclectic_2({exit,{'add',{0,a}}}, exit, {value,V}),
?line {{caught,{'EXIT',V}},undefined} =
eclectic_2({value,{error,V}}, undefined, {exit,V}),
- ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_}|_]}}},undefined} =
+ ?line {{caught,{'EXIT',{V,[{?MODULE,foo,_,_}|_]}}},undefined} =
eclectic_2({throw,{'div',{1,0}}}, throw, {error,V}),
ok.
diff --git a/lib/dialyzer/src/dialyzer_dataflow.erl b/lib/dialyzer/src/dialyzer_dataflow.erl
index 7137dbc036..8cb16d8f09 100644
--- a/lib/dialyzer/src/dialyzer_dataflow.erl
+++ b/lib/dialyzer/src/dialyzer_dataflow.erl
@@ -1414,6 +1414,17 @@ do_clause(C, Arg, ArgType0, OrigArgType, Map,
false ->
true
end;
+ [Pat0, Pat1] -> % binary comprehension
+ case cerl:is_c_cons(Pat0) of
+ true ->
+ not (cerl:is_c_var(cerl:cons_hd(Pat0)) andalso
+ cerl:is_c_var(cerl:cons_tl(Pat0)) andalso
+ cerl:is_c_var(Pat1) andalso
+ cerl:is_literal(Guard) andalso
+ (cerl:concrete(Guard) =:= true));
+ false ->
+ true
+ end;
_ -> true
end;
false ->
@@ -2915,7 +2926,7 @@ state__get_warnings(#state{tree_map = TreeMap, fun_tab = FunTab,
{Warn, Msg} =
case dialyzer_callgraph:lookup_name(FunLbl, Callgraph) of
error -> {true, {unused_fun, []}};
- {ok, {_M, F, A}} = MFA ->
+ {ok, {_M, F, A} = MFA} ->
{not sets:is_element(MFA, NoWarnUnused),
{unused_fun, [F, A]}}
end,
diff --git a/lib/dialyzer/src/dialyzer_typesig.erl b/lib/dialyzer/src/dialyzer_typesig.erl
index c45615d670..65c2ff76bb 100644
--- a/lib/dialyzer/src/dialyzer_typesig.erl
+++ b/lib/dialyzer/src/dialyzer_typesig.erl
@@ -1684,11 +1684,14 @@ solve_scc(SCC, Map, State, TryingUnit) ->
true ->
?debug("SCC ~w reached fixpoint\n", [SCC]),
NewTypes = unsafe_lookup_type_list(Funs, Map2),
- case lists:all(fun(T) -> t_is_none(t_fun_range(T)) end, NewTypes)
+ case erl_types:any_none([t_fun_range(T) || T <- NewTypes])
andalso TryingUnit =:= false of
true ->
- UnitTypes = [t_fun(state__fun_arity(F, State), t_unit())
- || F <- Funs],
+ UnitTypes =
+ [case t_is_none(t_fun_range(T)) of
+ false -> T;
+ true -> t_fun(t_fun_args(T), t_unit())
+ end || T <- NewTypes],
Map3 = enter_type_lists(Funs, UnitTypes, Map2),
solve_scc(SCC, Map3, State, true);
false ->
diff --git a/lib/dialyzer/test/Makefile b/lib/dialyzer/test/Makefile
index 69a8fd742e..47deb17f1d 100644
--- a/lib/dialyzer/test/Makefile
+++ b/lib/dialyzer/test/Makefile
@@ -26,7 +26,7 @@ include $(ERL_TOP)/make/otp_release_targets.mk
release_tests_spec:
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DATA) $(AUXILIARY_FILES) $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
cd $(RELSYSDIR);\
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/asn1 b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
index ac83366bc8..571e562d0d 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/asn1
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/asn1
@@ -2,7 +2,7 @@
asn1ct.erl:1500: The variable Err can never match since previous clauses completely covered the type #type{}
asn1ct.erl:1596: The variable _ can never match since previous clauses completely covered the type 'ber_bin_v2'
asn1ct.erl:1673: The pattern 'all' can never match the type 'asn1_module' | 'exclusive_decode' | 'partial_decode'
-asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()],[any()]>
+asn1ct.erl:672: The pattern <{'false', Result}, _, _> can never match the type <{'true','true'},atom() | binary() | [atom() | [any()] | char()],[any()]>
asn1ct.erl:909: Guard test is_atom(Ext::[49 | 97 | 98 | 100 | 110 | 115]) can never succeed
asn1ct_check.erl:1698: The pattern {'error', _} can never match the type [any()]
asn1ct_check.erl:2733: The pattern {'type', Tag, _, _, _, _} can never match the type 'ASN1_OPEN_TYPE' | {_,_} | {'fixedtypevaluefield',_,_}
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/inets b/lib/dialyzer/test/r9c_SUITE_data/results/inets
index fd5e36a3cd..6b16dba2ff 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/inets
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/inets
@@ -7,9 +7,6 @@ http_lib.erl:286: The call http_lib:close('ip_comm' | {'ssl',_},any()) will neve
http_lib.erl:424: The variable _ can never match since previous clauses completely covered the type any()
http_lib.erl:438: The variable _ can never match since previous clauses completely covered the type any()
http_lib.erl:99: Function getHeaderValue/2 will never be called
-httpc_handler.erl:322: Function status_continue/2 has no local return
-httpc_handler.erl:37: Function init_connection/2 has no local return
-httpc_handler.erl:65: Function next_response_with_request/2 has no local return
httpc_handler.erl:660: Function exit_session_ok/2 has no local return
httpc_manager.erl:145: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
httpc_manager.erl:160: The pattern {ErrorReply, State2} can never match the type {{'ok',number()},number(),#state{reqid::number()}}
@@ -27,7 +24,7 @@ httpd_manager.erl:933: Function acceptor_status/1 will never be called
httpd_request_handler.erl:374: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 66 | 98 | 100 | 103 | 105 | 111 | 116 | 121,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
httpd_request_handler.erl:378: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
httpd_request_handler.erl:401: The call httpd_response:send_status(Info::#mod{parsed_header::maybe_improper_list()},417,[32 | 77 | 97 | 100 | 101 | 104 | 108 | 110 | 111 | 116 | 119,...]) will never return since it differs in the 2nd argument from the success typing arguments: (#mod{socket_type::'ip_comm' | {'ssl',_}},100 | 301 | 304 | 400 | 401 | 403 | 404 | 412 | 414 | 416 | 500 | 501 | 503,any())
-httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',[[any()]]}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+httpd_request_handler.erl:644: The call lists:reverse(Fields0::{'error',_} | {'ok',_}) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
httpd_request_handler.erl:645: Function will never be called
httpd_sup.erl:63: The variable Else can never match since previous clauses completely covered the type {'error',_} | {'ok',[any()],_,_}
httpd_sup.erl:88: The pattern {'error', Reason} can never match the type {'ok',_,_}
@@ -38,17 +35,17 @@ mod_auth_plain.erl:100: The variable _ can never match since previous clauses co
mod_auth_plain.erl:159: The variable _ can never match since previous clauses completely covered the type [any()]
mod_auth_plain.erl:83: The variable O can never match since previous clauses completely covered the type [any()]
mod_cgi.erl:372: The pattern {'http_response', NewAccResponse} can never match the type 'ok'
-mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+mod_dir.erl:101: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
mod_dir.erl:72: The pattern {'error', Reason} can never match the type {'ok',[[[any()] | char()],...]}
-mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [any()] | char()]>
-mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_get.erl:135: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_head.erl:80: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_htaccess.erl:460: The pattern {'error', BadData} can never match the type {'ok',_}
-mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],maybe_improper_list()}
-mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
-mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]>
+mod_include.erl:193: The pattern {_, Name, {[], []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:195: The pattern {_, Name, {PathInfo, []}} can never match the type {[any()],[any()],string()}
+mod_include.erl:197: The pattern {_, Name, {PathInfo, QueryString}} can never match the type {[any()],[any()],string()}
+mod_include.erl:201: The variable Gurka can never match since previous clauses completely covered the type {[any()],[any()],string()}
+mod_include.erl:692: The pattern <{'read', Reason}, Info, Path> can never match the type <{'open',atom()},#mod{},atom() | binary() | [atom() | [any()] | char()]>
+mod_include.erl:706: The pattern <{'enfile', _}, _Info, Path> can never match the type <atom(),#mod{},atom() | binary() | [atom() | [any()] | char()]>
mod_include.erl:716: Function read_error/3 will never be called
mod_include.erl:719: Function read_error/4 will never be called
mod_security_server.erl:386: The variable O can never match since previous clauses completely covered the type [any()]
diff --git a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
index e199581a0e..b0f4d12ae5 100644
--- a/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
+++ b/lib/dialyzer/test/r9c_SUITE_data/results/mnesia
@@ -6,6 +6,9 @@ mnesia_bup.erl:111: The created fun has no local return
mnesia_bup.erl:574: Function fallback_receiver/2 has no local return
mnesia_bup.erl:967: Function uninstall_fallback_master/2 has no local return
mnesia_checkpoint.erl:1014: The variable Error can never match since previous clauses completely covered the type {'ok',#checkpoint_args{nodes::[any()],retainers::[any(),...]}}
+mnesia_checkpoint.erl:1209: Function system_continue/3 has no local return
+mnesia_checkpoint.erl:792: Function retainer_loop/1 has no local return
+mnesia_checkpoint.erl:894: The call sys:handle_system_msg(Msg::any(),From::any(),'no_parent','mnesia_checkpoint',[],Cp::#checkpoint_args{}) breaks the contract (Msg,From,Parent,Module,Debug,Misc) -> Void when is_subtype(Msg,term()), is_subtype(From,{pid(),Tag::_}), is_subtype(Parent,pid()), is_subtype(Module,module()), is_subtype(Debug,[dbg_opt()]), is_subtype(Misc,term()), is_subtype(Void,term())
mnesia_controller.erl:1666: The variable Tab can never match since previous clauses completely covered the type [any()]
mnesia_controller.erl:1679: The pattern {'stop', Reason, Reply, State2} can never match the type {'noreply',_} | {'reply',_,_} | {'stop','shutdown',#state{}}
mnesia_controller.erl:1685: The pattern {'noreply', State2, _Timeout} can never match the type {'reply',_,_}
@@ -15,6 +18,7 @@ mnesia_frag.erl:294: The call mnesia_frag:remote_collect(Ref::reference(),{'erro
mnesia_frag.erl:304: The call mnesia_frag:remote_collect(Ref::reference(),{'error',{'node_not_running',_}},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_frag.erl:312: The call mnesia_frag:remote_collect(Ref::reference(),LocalRes::{'error',_},[],OldSelectFun::fun(() -> [any()])) will never return since it differs in the 2nd argument from the success typing arguments: (reference(),'ok',[any()],fun(() -> [any()]))
mnesia_index.erl:52: The call mnesia_lib:other_val(Var::{_,'commit_work' | 'index' | 'setorbag' | 'storage_type' | {'index',_}},_ReASoN_::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
+mnesia_lib.erl:1028: The pattern {'EXIT', Reason} can never match the type [any()] | {'error',_}
mnesia_lib.erl:957: The pattern {'ok', {0, _}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_lib.erl:959: The pattern {'ok', {_, Bin}} can never match the type 'eof' | {'error',atom()} | {'ok',binary() | string()}
mnesia_loader.erl:36: The call mnesia_lib:other_val(Var::{_,'access_mode' | 'cstruct' | 'db_nodes' | 'setorbag' | 'snmp' | 'storage_type'},Reason::any()) will never return since it differs in the 1st argument from the success typing arguments: ({_,'active_replicas' | 'where_to_read' | 'where_to_write'},any())
@@ -30,5 +34,6 @@ mnesia_schema.erl:1258: Guard test FromS::'disc_copies' | 'disc_only_copies' | '
mnesia_schema.erl:1639: The pattern {'false', 'mandatory'} can never match the type {'false','optional'}
mnesia_schema.erl:2434: The variable Reason can never match since previous clauses completely covered the type {'error',_} | {'ok',_}
mnesia_schema.erl:451: Guard test UseDirAnyway::'false' == 'true' can never succeed
+mnesia_text.erl:180: The variable T can never match since previous clauses completely covered the type {'error',{integer(),atom() | tuple(),_}} | {'ok',_}
mnesia_tm.erl:1522: Function commit_participant/5 has no local return
mnesia_tm.erl:2169: Function system_terminate/4 has no local return
diff --git a/lib/dialyzer/test/race_SUITE_data/results/extract_translations b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
index f7d5abc6f5..62aa1aa511 100644
--- a/lib/dialyzer/test/race_SUITE_data/results/extract_translations
+++ b/lib/dialyzer/test/race_SUITE_data/results/extract_translations
@@ -1,5 +1,5 @@
-extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 135
+extract_translations.erl:140: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 135
extract_translations.erl:146: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
-extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | binary() | [atom() | binary() | [any()] | char()] | char()]) call in extract_translations.erl on line 148
+extract_translations.erl:152: The call ets:insert('files',{atom() | binary() | [atom() | [any()] | char()]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('files',File::atom() | binary() | [atom() | [any()] | char()]) call in extract_translations.erl on line 148
extract_translations.erl:154: The call ets:insert('translations',{_,[]}) might have an unintended effect due to a possible race condition caused by its combination with the ets:lookup('translations',Str::any()) call in extract_translations.erl on line 126
diff --git a/lib/dialyzer/test/small_SUITE_data/results/flatten b/lib/dialyzer/test/small_SUITE_data/results/flatten
index 4571214e49..8aa44dd002 100644
--- a/lib/dialyzer/test/small_SUITE_data/results/flatten
+++ b/lib/dialyzer/test/small_SUITE_data/results/flatten
@@ -1,2 +1,2 @@
-flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | binary() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
+flatten.erl:17: The call lists:flatten(nonempty_improper_list(atom() | [any()] | char(),atom())) will never return since it differs in the 1st argument from the success typing arguments: ([any()])
diff --git a/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
new file mode 100644
index 0000000000..c1e82bfa59
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/binary_lc_bug.erl
@@ -0,0 +1,8 @@
+-module(test).
+
+-export([bin_compr/0]).
+
+bin_compr() ->
+% [ 0 || {N, V} <- [{a, b}] ]. % Works ok
+ << <<>> || {A, B} <- [{a, b}] >>. % Complains
+% << <<>> || X <- [{a, b}] >>. % Works ok
diff --git a/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
new file mode 100644
index 0000000000..8abf872b37
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/codec_can.erl
@@ -0,0 +1,35 @@
+%%---------------------------------------------------------------------
+%% From: Peer Stritzinger
+%% Date: 1 May 2011
+%% Subject: Dialyzer v2.2.0 crash
+%%
+%% Binaries of the form <<_:N,_:_*M>> in specs resulted in a crash:
+%% dialyzer: Analysis failed with error: {{case_clause,8},
+%% [{erl_types,t_form_to_string,1},
+%% {erl_types,t_form_to_string,1},
+%% {dialyzer_contracts,contract_to_string_1,1},
+%% {dialyzer_contracts,extra_contract_warning,6},
+%% {dialyzer_contracts,picky_contract_check,7},
+%% because function erl_types:t_form_to_string/1 was not the inverse
+%% of erl_types:t_to_string/2.
+%%
+%% Fixed on the same date and send to OTP for inclusion.
+%%---------------------------------------------------------------------
+-module(codec_can).
+
+-export([recv/3, decode/1]).
+
+-record(can_pkt, {id, data :: binary(), timestamp}).
+
+-type can_pkt() :: #can_pkt{}.
+-type channel() :: atom() | pid() | {atom(),_}.
+
+-spec recv(<<_:64,_:_*8>>, fun((can_pkt()) -> R), channel()) -> R.
+recv(Packet, Fun, Chan) ->
+ #can_pkt{id = Can_id, data = Can_data} = P = decode(Packet),
+ Fun(P).
+
+-spec decode(<<_:64,_:_*8>>) -> #can_pkt{id::<<_:11>>,timestamp::char()}.
+decode(<<_:12, Len:4, Timestamp:16, 0:3, Id:11/bitstring, 0:18,
+ Data:Len/binary, _/binary>>) ->
+ #can_pkt{id = Id, data = Data, timestamp = Timestamp}.
diff --git a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
index 4f1268eba8..086df3464b 100644
--- a/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
+++ b/lib/dialyzer/test/small_SUITE_data/src/file_open_encoding.erl
@@ -6,9 +6,7 @@
-export([parse/1]).
--type proplist() :: [{atom(), any()}].
-
--spec parse(string()) -> proplist().
+-spec parse(string()) -> proplists:proplist().
parse(FileName) ->
{ok, IoDevice} = file:open(FileName, [read, binary, {encoding, utf8}]),
do_parse(IoDevice, []).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
new file mode 100644
index 0000000000..2da708cb15
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/list_to_bitstring.erl
@@ -0,0 +1,21 @@
+%%=====================================================================
+%% From: Ken Robinson
+%% Date: 28/04/2011, 17:26
+%%
+%% Program that produced borus "Function has no local return" warnings
+%% due to erlang:list_to_bitstring/1 having erroneous hard coded type
+%% information, namely accepting iolist() instead of bitstrlist().
+%% Fixed 29/04/2011.
+%%=====================================================================
+
+-module(list_to_bitstring).
+
+-export([l2bs/0, l2bs_ok/0]).
+
+%% This function was producing a warning
+l2bs() ->
+ erlang:list_to_bitstring([<<42>>, <<42:13>>]).
+
+%% while this one was ok.
+l2bs_ok() ->
+ erlang:list_to_bitstring([<<42>>, <<42,42>>]).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
new file mode 100644
index 0000000000..5c24902590
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/no_return_bug.erl
@@ -0,0 +1,42 @@
+%% Dialyzer couldn't infer that monitor_diskspace would go in an infinite loop
+%% instead of crashing due to the existence of list comprehensions that have a
+%% normal success typing. These were added to the monitor_diskspace's SCC and
+%% dialyzer_typesig didn't try to assign unit() to monitor_diskspace, as it
+%% required all the members of the SCC to return none().
+%%
+%% Testcase was submitted in erlang-questions mailing list by Prashanth Mundkur
+%% (http://erlang.org/pipermail/erlang-questions/2011-May/058063.html)
+
+-module(no_return_bug).
+-export([diskspace/1, monitor_diskspace/2, refresh_tags/1, monitor_launch/0]).
+
+-type diskinfo() :: {non_neg_integer(), non_neg_integer()}.
+
+-spec diskspace(nonempty_string()) -> {'ok', diskinfo()} | {'error', term()}.
+diskspace(Path) ->
+ case Path of
+ "a" -> {ok, {0,0}};
+ _ -> {error, error}
+ end.
+
+-spec monitor_diskspace(nonempty_string(),
+ [{diskinfo(), nonempty_string()}]) ->
+ no_return().
+monitor_diskspace(Root, Vols) ->
+ Df = fun(VolName) ->
+ diskspace(filename:join([Root, VolName]))
+ end,
+ NewVols = [{Space, VolName}
+ || {VolName, {ok, Space}}
+ <- [{VolName, Df(VolName)}
+ || {_OldSpace, VolName} <- Vols]],
+ monitor_diskspace(Root, NewVols).
+
+-spec refresh_tags(nonempty_string()) -> no_return().
+refresh_tags(Root) ->
+ {ok, _} = diskspace(Root),
+ refresh_tags(Root).
+
+monitor_launch() ->
+ spawn_link(fun() -> refresh_tags("abc") end),
+ spawn_link(fun() -> monitor_diskspace("root", [{{0,0}, "a"}]) end).
diff --git a/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
new file mode 100644
index 0000000000..63daeee9e3
--- /dev/null
+++ b/lib/dialyzer/test/small_SUITE_data/src/nowarnunused.erl
@@ -0,0 +1,7 @@
+-module(nowarnunused).
+
+-compile({nowarn_unused_function, return_error/2}).
+
+-spec return_error(integer(), any()) -> no_return().
+return_error(Line, Message) ->
+ throw({error, {Line, ?MODULE, Message}}).
diff --git a/lib/diameter/doc/src/diameter_dict.xml b/lib/diameter/doc/src/diameter_dict.xml
index a87f59bad5..e7c530f1b8 100644
--- a/lib/diameter/doc/src/diameter_dict.xml
+++ b/lib/diameter/doc/src/diameter_dict.xml
@@ -105,7 +105,7 @@ quantity is insignificant.</p>
<p>
The tags, their arguments and the contents of each corresponding
section are as follows.
-Each section can occur only once unless otherwise specified.
+Each section can occur at most once unless otherwise specified.
The order in which sections are specified is unimportant.</p>
<taglist>
@@ -115,6 +115,7 @@ The order in which sections are specified is unimportant.</p>
<p>
Defines the integer Number as the Diameter Application Id of the
application in question.
+Required if the dictionary defines <c>@messages</c>.
The section has empty content.</p>
<p>
@@ -370,7 +371,11 @@ Integer values can be prefixed with 0x to be interpreted as
hexidecimal.</p>
<p>
-Can occur 0 or more times (with different values of Name).</p>
+Can occur 0 or more times (with different values of Name).
+The AVP in question can be defined in an inherited dictionary in order
+to introduce additional values.
+An AVP so extended must be referenced by in a <c>@messages</c> or
+<c>@grouped</c> section.</p>
<p>
Example:</p>
diff --git a/lib/diameter/src/app/Makefile b/lib/diameter/src/app/Makefile
index 6de220d282..31344fa80b 100644
--- a/lib/diameter/src/app/Makefile
+++ b/lib/diameter/src/app/Makefile
@@ -52,6 +52,14 @@ INCDIR = ../../include
include modules.mk
+diameter_gen_base_accounting.erl: \
+ $(EBIN)/diameter_gen_base_rfc3588.beam
+diameter_gen_relay.erl: \
+ $(EBIN)/diameter_gen_base_rfc3588.beam
+
+SPEC_MODULES = \
+ $(SPEC_FILES:%.dia=%)
+
SPEC_ERL_FILES = \
$(SPEC_FILES:%.dia=%.erl)
@@ -60,7 +68,7 @@ SPEC_HRL_FILES = \
APP_MODULES = \
$(MODULES) \
- $(SPEC_FILES:%.dia=%)
+ $(SPEC_MODULES)
TARGET_FILES = \
$(APP_MODULES:%=$(EBIN)/%.$(EMULATOR)) \
@@ -150,6 +158,7 @@ app: $(APP_TARGET) $(APPUP_TARGET)
diameter_gen_%.erl diameter_gen_%.hrl: diameter_gen_%.dia
../../bin/diameterc -i $(EBIN) -o $(@D) $<
+$(SPEC_MODULES:%=$(EBIN)/%.$(EMULATOR)): $(EBIN)/diameter_exprecs.$(EMULATOR)
# ----------------------------------------------------
# Release Target
diff --git a/lib/diameter/src/compiler/diameter_codegen.erl b/lib/diameter/src/compiler/diameter_codegen.erl
index 213ba0d22c..30caebc544 100644
--- a/lib/diameter/src/compiler/diameter_codegen.erl
+++ b/lib/diameter/src/compiler/diameter_codegen.erl
@@ -250,9 +250,14 @@ f_name(Name) ->
%%% ------------------------------------------------------------------------
f_id(Spec) ->
- Id = orddict:fetch(id, Spec),
{?function, id, 0,
- [{?clause, [], [], [?INTEGER(Id)]}]}.
+ [c_id(orddict:find(id, Spec))]}.
+
+c_id({ok, Id}) ->
+ {?clause, [], [], [?INTEGER(Id)]};
+
+c_id(error) ->
+ ?UNEXPECTED(0).
%%% ------------------------------------------------------------------------
%%% # vendor_id/0
@@ -454,9 +459,10 @@ avp(Spec) ->
Native = get_value(avp_types, Spec),
Custom = get_value(custom_types, Spec),
Imported = get_value(import_avps, Spec),
- avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom).
+ Enums = get_value(enums, Spec),
+ avp([{N,T} || {N,_,T,_,_} <- Native], Imported, Custom, Enums).
-avp(Native, Imported, Custom) ->
+avp(Native, Imported, Custom, Enums) ->
Dict = orddict:from_list(Native),
report(native, Dict),
@@ -470,8 +476,8 @@ avp(Native, Imported, Custom) ->
false == lists:member(N, CustomNames)
end,
Native))
- ++ lists:flatmap(fun c_imported_avp/1, Imported)
- ++ lists:flatmap(fun(C) -> c_custom_avp(C, Dict) end, Custom).
+ ++ lists:flatmap(fun(I) -> cs_imported_avp(I, Enums) end, Imported)
+ ++ lists:flatmap(fun(C) -> cs_custom_avp(C, Dict) end, Custom).
c_base_avp({AvpName, T}) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
@@ -487,23 +493,35 @@ base_avp(AvpName, 'Grouped') ->
base_avp(_, Type) ->
?APPLY(diameter_types, Type, [?VAR('T'), ?VAR('Data')]).
-c_imported_avp({Mod, Avps}) ->
- lists:map(fun(A) -> imported_avp(Mod, A) end, Avps).
+cs_imported_avp({Mod, Avps}, Enums) ->
+ lists:map(fun(A) -> imported_avp(Mod, A, Enums) end, Avps).
-imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}) ->
+imported_avp(_Mod, {AvpName, _, 'Grouped' = T, _, _}, _) ->
c_base_avp({AvpName, T});
-imported_avp(Mod, {AvpName, _, _, _, _}) ->
+imported_avp(Mod, {AvpName, _, 'Enumerated' = T, _, _}, Enums) ->
+ case lists:keymember(AvpName, 1, Enums) of
+ true ->
+ c_base_avp({AvpName, T});
+ false ->
+ c_imported_avp(Mod, AvpName)
+ end;
+
+imported_avp(Mod, {AvpName, _, _, _, _}, _) ->
+ c_imported_avp(Mod, AvpName).
+
+c_imported_avp(Mod, AvpName) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, avp, [?VAR('T'),
?VAR('Data'),
?ATOM(AvpName)])]}.
-c_custom_avp({Mod, Avps}, Dict) ->
- lists:map(fun(N) -> custom_avp(Mod, N, orddict:fetch(N, Dict)) end, Avps).
+cs_custom_avp({Mod, Avps}, Dict) ->
+ lists:map(fun(N) -> c_custom_avp(Mod, N, orddict:fetch(N, Dict)) end,
+ Avps).
-custom_avp(Mod, AvpName, Type) ->
+c_custom_avp(Mod, AvpName, Type) ->
{?clause, [?VAR('T'), ?VAR('Data'), ?ATOM(AvpName)],
[],
[?APPLY(Mod, AvpName, [?VAR('T'), ?ATOM(Type), ?VAR('Data')])]}.
@@ -516,9 +534,25 @@ f_enumerated_avp(Spec) ->
{?function, enumerated_avp, 3, enumerated_avp(Spec) ++ [?UNEXPECTED(3)]}.
enumerated_avp(Spec) ->
- lists:flatmap(fun c_enumerated_avp/1, get_value(enums, Spec)).
+ Enums = get_value(enums, Spec),
+ lists:flatmap(fun cs_enumerated_avp/1, Enums)
+ ++ lists:flatmap(fun({M,Es}) -> enumerated_avp(M, Es, Enums) end,
+ get_value(import_enums, Spec)).
+
+enumerated_avp(Mod, Es, Enums) ->
+ lists:flatmap(fun({N,_}) ->
+ cs_enumerated_avp(lists:keymember(N, 1, Enums),
+ Mod,
+ N)
+ end,
+ Es).
-c_enumerated_avp({AvpName, Values}) ->
+cs_enumerated_avp(true, Mod, Name) ->
+ [c_imported_avp(Mod, Name)];
+cs_enumerated_avp(false, _, _) ->
+ [].
+
+cs_enumerated_avp({AvpName, Values}) ->
lists:flatmap(fun(V) -> c_enumerated_avp(AvpName, V) end, Values).
c_enumerated_avp(AvpName, {I,_}) ->
@@ -537,10 +571,14 @@ f_msg_header(Spec) ->
{?function, msg_header, 1, msg_header(Spec) ++ [?UNEXPECTED(1)]}.
msg_header(Spec) ->
+ msg_header(get_value(messages, Spec), Spec).
+
+msg_header([], _) ->
+ [];
+msg_header(Msgs, Spec) ->
ApplId = orddict:fetch(id, Spec),
- lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end,
- get_value(messages, Spec)).
+ lists:map(fun({M,C,F,_,_}) -> c_msg_header(M, C, F, ApplId) end, Msgs).
%% Note that any application id in the message header spec is ignored.
@@ -616,10 +654,12 @@ f_empty_value(Spec) ->
{?function, empty_value, 1, empty_value(Spec)}.
empty_value(Spec) ->
+ Imported = lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
Groups = get_value(grouped, Spec)
++ lists:flatmap(fun avps/1, get_value(import_groups, Spec)),
- Enums = get_value(enums, Spec)
- ++ lists:flatmap(fun avps/1, get_value(import_enums, Spec)),
+ Enums = [T || {N,_} = T <- get_value(enums, Spec),
+ not lists:keymember(N, 1, Imported)]
+ ++ Imported,
lists:map(fun c_empty_value/1, Groups ++ Enums)
++ [{?clause, [?VAR('Name')], [], [?CALL(empty, [?VAR('Name')])]}].
diff --git a/lib/diameter/src/compiler/diameter_spec_util.erl b/lib/diameter/src/compiler/diameter_spec_util.erl
index 322d53a199..b60886b678 100644
--- a/lib/diameter/src/compiler/diameter_spec_util.erl
+++ b/lib/diameter/src/compiler/diameter_spec_util.erl
@@ -39,11 +39,11 @@ parse(Path, Options) ->
{ok, B} = file:read_file(Path),
Chunks = chunk(B),
Spec = make_spec(Chunks),
- true = enums_defined(Spec), %% sanity checks
- true = groups_defined(Spec), %%
+ true = groups_defined(Spec), %% sanity checks
true = customs_defined(Spec), %%
Full = import_enums(import_groups(import_avps(insert_codes(Spec),
Options))),
+ true = enums_defined(Full), %% sanity checks
true = v_flags_set(Spec),
Full.
@@ -243,35 +243,48 @@ get_value(Key, Spec) ->
%% with an appropriate type.
enums_defined(Spec) ->
- is_defined(Spec, 'Enumerated', enums).
+ Avps = get_value(avp_types, Spec),
+ Import = get_value(import_enums, Spec),
+ lists:all(fun({N,_}) ->
+ true = enum_defined(N, Avps, Import)
+ end,
+ get_value(enums, Spec)).
-groups_defined(Spec) ->
- is_defined(Spec, 'Grouped', grouped).
+enum_defined(Name, Avps, Import) ->
+ case lists:keyfind(Name, 1, Avps) of
+ {Name, _, 'Enumerated', _, _} ->
+ true;
+ {Name, _, T, _, _} ->
+ ?ERROR({avp_has_wrong_type, Name, 'Enumerated', T});
+ false ->
+ lists:any(fun({_,Is}) -> lists:keymember(Name, 1, Is) end, Import)
+ orelse ?ERROR({avp_not_defined, Name, 'Enumerated'})
+ end.
+%% Note that an AVP is imported only if referenced by a message or
+%% grouped AVP, so the final branch will fail if an enum definition is
+%% extended without this being the case.
-is_defined(Spec, Type, Key) ->
+groups_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(T) -> true = is_local(name(Key, T), Type, Avps) end,
- get_value(Key, Spec)).
+ lists:all(fun({N,_,_,_}) -> true = group_defined(N, Avps) end,
+ get_value(grouped, Spec)).
-name(enums, {N,_}) -> N;
-name(grouped, {N,_,_,_}) -> N.
-
-is_local(Name, Type, Avps) ->
+group_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
- {Name, _, Type, _, _} ->
+ {Name, _, 'Grouped', _, _} ->
true;
{Name, _, T, _, _} ->
- ?ERROR({avp_has_wrong_type, Name, Type, T});
+ ?ERROR({avp_has_wrong_type, Name, 'Grouped', T});
false ->
- ?ERROR({avp_not_defined, Name, Type})
+ ?ERROR({avp_not_defined, Name, 'Grouped'})
end.
customs_defined(Spec) ->
Avps = get_value(avp_types, Spec),
- lists:all(fun(A) -> true = is_local(A, Avps) end,
+ lists:all(fun(A) -> true = custom_defined(A, Avps) end,
lists:flatmap(fun last/1, get_value(custom_types, Spec))).
-is_local(Name, Avps) ->
+custom_defined(Name, Avps) ->
case lists:keyfind(Name, 1, Avps) of
{Name, _, T, _, _} when T == 'Grouped';
T == 'Enumerated' ->
@@ -510,6 +523,9 @@ choose(false, _, X) -> X.
%% ------------------------------------------------------------------------
%% import_groups/1
%% import_enums/1
+%%
+%% For each inherited module, store the content of imported AVP's of
+%% type grouped/enumerated in a new key.
import_groups(Spec) ->
orddict:store(import_groups, import(grouped, Spec), Spec).
diff --git a/lib/diameter/test/Makefile b/lib/diameter/test/Makefile
index 823e2f0311..b3648c7bb1 100644
--- a/lib/diameter/test/Makefile
+++ b/lib/diameter/test/Makefile
@@ -404,5 +404,5 @@ release_tests_spec: tests
# $(HRL_FILES) $(ERL_FILES) \
# $(RELSYSDIR)
#
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/docbuilder/src/docb_main.erl b/lib/docbuilder/src/docb_main.erl
index 4f5f035a65..c20cfc8e67 100644
--- a/lib/docbuilder/src/docb_main.erl
+++ b/lib/docbuilder/src/docb_main.erl
@@ -436,11 +436,11 @@ transform(From, To, Opts, File, Tree) ->
case catch Filter:transform(File, Tree, Opts) of
%% R5C
- {'EXIT', {undef, [{Filter, transform, [File, Tree, Opts]}|_]}}->
+ {'EXIT', {undef, [{Filter, transform, [File, Tree, Opts],_}|_]}}->
%% No transformation defined
finish_transform(Tree, File, Opts, Filter);
- {'EXIT', {undef, {Filter, transform, [File, Tree, Opts]}}} ->
+ {'EXIT', {undef, {Filter, transform, [File, Tree, Opts],_}}} ->
%% No transformation defined
finish_transform(Tree, File, Opts, Filter);
@@ -507,16 +507,16 @@ pp({Tag, Optional, Args}, TagPath, Level, Filter, Opts) ->
Rule_3_result =
case catch Filter:rule(TagPath1, {Level,Optional1,Args},Opts) of
%% R5C
- {'EXIT', {undef, [{_, rule, _}|_]}} -> % No rule/3 defined
+ {'EXIT', {undef, [{_, rule, _, _}|_]}} -> % No rule/3 defined
failed;
- {'EXIT', {undef, {_, rule, _}}} -> % No rule/3 defined
+ {'EXIT', {undef, {_, rule, _, _}}} -> % No rule/3 defined
failed;
%% R5C
- {'EXIT', {function_clause, [{_, rule, _}|_]}} -> % No MATCHING rule/3
+ {'EXIT', {function_clause, [{_, rule, _, _}|_]}} -> % No MATCHING rule/3
failed;
- {'EXIT', {function_clause, {_, rule, _}}} -> % No MATCHING rule/3
+ {'EXIT', {function_clause, {_, rule, _, _}}} -> % No MATCHING rule/3
failed;
{'EXIT', What} ->
diff --git a/lib/edoc/Makefile b/lib/edoc/Makefile
index e512e390e3..1add669398 100644
--- a/lib/edoc/Makefile
+++ b/lib/edoc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/Makefile b/lib/edoc/doc/Makefile
index a0f6484382..c5f68b25d0 100644
--- a/lib/edoc/doc/Makefile
+++ b/lib/edoc/doc/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id: Makefile,v 1.1.1.1 2004/10/04 13:53:33 richardc Exp $
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/doc/overview.edoc b/lib/edoc/doc/overview.edoc
index bd603b7a13..fa699c6f08 100644
--- a/lib/edoc/doc/overview.edoc
+++ b/lib/edoc/doc/overview.edoc
@@ -1084,10 +1084,11 @@ Details:
the Erlang programming language.</li>
<li>`boolean()' is the subset of `atom()' consisting
of the atoms `true' and `false'.</li>
- <li>`char()' is a subset of
- `integer()' representing character codes.</li>
+ <li>`char()' is the subset of `integer()' representing
+ Unicode character codes: hex 000000-10FFFF.</li>
<li>`tuple()' is the set of all tuples `{...}'.</li>
- <li>`list(T)' is just an alias for `[T]'.</li>
+ <li>`list(T)' is just an alias for `[T]'; list() is an alias
+ for `list(any())', i.e., `[any()]'.</li>
<li>`nil()' is an alias for the empty list `[]'.</li>
<li>`cons(H,T)' is the list constructor. This is usually not
used directly. It is possible to recursively define `list(T)
diff --git a/lib/edoc/doc/src/Makefile b/lib/edoc/doc/src/Makefile
index 5ee0096f0f..b933094464 100644
--- a/lib/edoc/doc/src/Makefile
+++ b/lib/edoc/doc/src/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/include/Makefile b/lib/edoc/include/Makefile
index 0533c27567..5b2ad38c9d 100644
--- a/lib/edoc/include/Makefile
+++ b/lib/edoc/include/Makefile
@@ -13,8 +13,6 @@
# Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
# AB. All Rights Reserved.''
#
-# $Id$
-#
include $(ERL_TOP)/make/target.mk
include $(ERL_TOP)/make/$(TARGET)/otp.mk
diff --git a/lib/edoc/priv/edoc_generate.src b/lib/edoc/priv/edoc_generate.src
index e87fdbc902..7ec89207b0 100644
--- a/lib/edoc/priv/edoc_generate.src
+++ b/lib/edoc/priv/edoc_generate.src
@@ -14,9 +14,6 @@
# Portions created by Ericsson are Copyright 1999-2000, Ericsson
# Utvecklings AB. All Rights Reserved.''
#
-# $Id$
-#
-#
#EDOC_DIR=/clearcase/otp/internal_tools/edoc
EDOC_DIR=/home/otp/sgml/edoc-%EDOC_VSN%
diff --git a/lib/edoc/src/Makefile b/lib/edoc/src/Makefile
index 9c5a9d30d1..fcb0b61292 100644
--- a/lib/edoc/src/Makefile
+++ b/lib/edoc/src/Makefile
@@ -23,7 +23,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/edoc-$(VSN)
EBIN = ../ebin
XMERL = ../../xmerl
-ERL_COMPILE_FLAGS += -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
+ERL_COMPILE_FLAGS += -pa $(XMERL) -I../include -I$(XMERL)/include +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_deprecated_guard
SOURCES= \
edoc.erl edoc_data.erl edoc_doclet.erl edoc_extract.erl \
diff --git a/lib/edoc/src/edoc.erl b/lib/edoc/src/edoc.erl
index 360f2dbc9e..a279f7dcb3 100644
--- a/lib/edoc/src/edoc.erl
+++ b/lib/edoc/src/edoc.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2007 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @version {@version}
@@ -60,8 +58,6 @@
-compile({no_auto_import,[error/1]}).
--import(edoc_report, [report/2, report/3, error/1, error/3]).
-
-include("edoc.hrl").
@@ -179,8 +175,8 @@ application(App, Options) when is_atom(App) ->
Dir when is_list(Dir) ->
application(App, Dir, Options);
_ ->
- report("cannot find application directory for '~s'.",
- [App]),
+ edoc_report:report("cannot find application directory for '~s'.",
+ [App]),
exit(error)
end.
@@ -663,8 +659,8 @@ read_source(Name, Opts0) ->
check_forms(Forms, Name),
Forms;
{error, R} ->
- error({"error reading file '~s'.",
- [edoc_lib:filename(Name)]}),
+ edoc_report:error({"error reading file '~s'.",
+ [edoc_lib:filename(Name)]}),
exit({error, R})
end.
@@ -688,11 +684,10 @@ check_forms(Fs, Name) ->
error_marker ->
case erl_syntax:error_marker_info(F) of
{L, M, D} ->
- error(L, Name, {format_error, M, D});
-
+ edoc_report:error(L, Name, {format_error, M, D});
Other ->
- report(Name, "unknown error in "
- "source code: ~w.", [Other])
+ edoc_report:report(Name, "unknown error in "
+ "source code: ~w.", [Other])
end,
exit(error);
_ ->
diff --git a/lib/edoc/src/edoc_data.erl b/lib/edoc/src/edoc_data.erl
index 27f43dca5a..e3b5a0d51b 100644
--- a/lib/edoc/src/edoc_data.erl
+++ b/lib/edoc/src/edoc_data.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_doclet.erl b/lib/edoc/src/edoc_doclet.erl
index 30eef3e63a..c66be9d7c7 100644
--- a/lib/edoc/src/edoc_doclet.erl
+++ b/lib/edoc/src/edoc_doclet.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003-2006 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -52,7 +50,7 @@
-define(IMAGE, "erlang.png").
-define(NL, "\n").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
%% Sources is the list of inputs in the order they were found. Packages
%% and Modules are sorted lists of atoms without duplicates. (They
diff --git a/lib/edoc/src/edoc_extract.erl b/lib/edoc/src/edoc_extract.erl
index 5e28762c53..1209d86fe5 100644
--- a/lib/edoc/src/edoc_extract.erl
+++ b/lib/edoc/src/edoc_extract.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -238,8 +236,8 @@ file(File, Context, Env, Opts) ->
case file:read_file(File) of
{ok, Bin} ->
{ok, text(binary_to_list(Bin), Context, Env, Opts, File)};
- {error, _R} = Error ->
- Error
+ {error, _} = Error ->
+ Error
end.
@@ -298,8 +296,8 @@ get_module_info(Forms, File) ->
{Name, Vars} = case lists:keyfind(module, 1, L) of
{module, N} when is_atom(N) ->
{N, none};
- {module, {N, _Vs} = NVs} when is_atom(N) ->
- NVs;
+ {module, {N, _}=Mod} when is_atom(N) ->
+ Mod;
_ ->
report(File, "module name missing.", []),
exit(error)
diff --git a/lib/edoc/src/edoc_layout.erl b/lib/edoc/src/edoc_layout.erl
index 3ec87b7060..1c0841815f 100644
--- a/lib/edoc/src/edoc_layout.erl
+++ b/lib/edoc/src/edoc_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id: $
-%%
%% @author Richard Carlsson <[email protected]>
%% @copyright 2001-2006 Richard Carlsson
%% @see edoc
@@ -33,7 +31,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(HTML_EXPORT, xmerl_html).
-define(DEFAULT_XML_EXPORT, ?HTML_EXPORT).
@@ -959,12 +957,16 @@ local_label(R) ->
xhtml(Title, CSS, Body) ->
[{html, [?NL,
- {head, [?NL,
- {title, Title},
- ?NL] ++ CSS},
- ?NL,
- {body, [{bgcolor, "white"}], Body},
- ?NL]
+ {head, [?NL,
+ {meta, [{'http-equiv',"Content-Type"},
+ {content, "text/html; charset=ISO-8859-1"}],
+ []},
+ ?NL,
+ {title, Title},
+ ?NL] ++ CSS},
+ ?NL,
+ {body, [{bgcolor, "white"}], Body},
+ ?NL]
},
?NL].
diff --git a/lib/edoc/src/edoc_lib.erl b/lib/edoc/src/edoc_lib.erl
index 585e30a2d2..6c698e83ef 100644
--- a/lib/edoc/src/edoc_lib.erl
+++ b/lib/edoc/src/edoc_lib.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
@@ -40,7 +38,7 @@
-import(edoc_report, [report/2, warning/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(FILE_BASE, "/").
@@ -494,7 +492,7 @@ uri_get_file(File0) ->
uri_get_http(URI) ->
%% Try using option full_result=false
case catch {ok, httpc:request(get, {URI,[]}, [],
- [{full_result, false}])} of
+ [{full_result, false}])} of
{'EXIT', _} ->
uri_get_http_r10(URI);
Result ->
diff --git a/lib/edoc/src/edoc_parser.yrl b/lib/edoc/src/edoc_parser.yrl
index 6943f1bdb8..3ce4cde4fb 100644
--- a/lib/edoc/src/edoc_parser.yrl
+++ b/lib/edoc/src/edoc_parser.yrl
@@ -23,9 +23,6 @@
%% USA
%%
%% Author contact: [email protected]
-%%
-%% $Id $
-%%
%% =====================================================================
Nonterminals
@@ -362,10 +359,10 @@ parse_spec(S, L) ->
{ok, Spec} ->
Spec;
{error, E} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end;
{error, E, _} ->
- throw_error(E, L)
+ throw_error({parse_spec, E}, L)
end.
%% ---------------------------------------------------------------------
diff --git a/lib/edoc/src/edoc_report.erl b/lib/edoc/src/edoc_report.erl
index ee54c60c90..f082513bee 100644
--- a/lib/edoc/src/edoc_report.erl
+++ b/lib/edoc/src/edoc_report.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_run.erl b/lib/edoc/src/edoc_run.erl
index 96e5ea4631..1355db840f 100644
--- a/lib/edoc/src/edoc_run.erl
+++ b/lib/edoc/src/edoc_run.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @copyright 2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
%% @see edoc
diff --git a/lib/edoc/src/edoc_scanner.erl b/lib/edoc/src/edoc_scanner.erl
index 9d2e6f3aed..8e895ad1ad 100644
--- a/lib/edoc/src/edoc_scanner.erl
+++ b/lib/edoc/src/edoc_scanner.erl
@@ -13,8 +13,6 @@
%% AB. Portions created by Ericsson are Copyright 1999, Ericsson
%% Utvecklings AB. All Rights Reserved.''
%%
-%% $Id: $
-%%
%% @private
%% @copyright Richard Carlsson 2001-2003. Portions created by Ericsson
%% are Copyright 1999, Ericsson Utvecklings AB. All Rights Reserved.
diff --git a/lib/edoc/src/edoc_specs.erl b/lib/edoc/src/edoc_specs.erl
index 79a5d142bc..5acf8ac0d5 100644
--- a/lib/edoc/src/edoc_specs.erl
+++ b/lib/edoc/src/edoc_specs.erl
@@ -27,7 +27,6 @@
-include("edoc.hrl").
-include("edoc_types.hrl").
--type proplist() :: [proplists:property()].
-type syntaxTree() :: erl_syntax:syntaxTree().
-define(TOP_TYPE, term).
@@ -87,8 +86,9 @@ dummy_spec(Form) ->
#tag{name = spec, line = element(2, hd(TypeSpecs)),
origin = code, data = S}.
--spec docs(Forms::[syntaxTree()], CommentFun) -> dict() when
- CommentFun :: fun(([syntaxTree()], Line :: term()) -> #tag{}).
+-spec docs(Forms::[syntaxTree()],
+ CommentFun :: fun( ([syntaxTree()], Line :: term()) -> #tag{} ))
+ -> dict().
%% @doc Find comments after -type/-opaque declarations.
%% Postcomments "inside" the type are skipped.
@@ -98,7 +98,7 @@ docs(Forms, CommentFun) ->
-type entry() :: #entry{}.
-type module_info() :: #module{}.
-type entries() :: [entry()].
--spec add_data(Entries::entries(), Options::proplist(),
+-spec add_data(Entries::entries(), Options::proplists:proplist(),
File::file:filename(), Module::module_info()) -> entries().
%% @doc Create tags a la EDoc for Erlang specifications and types.
diff --git a/lib/edoc/src/edoc_tags.erl b/lib/edoc/src/edoc_tags.erl
index 8ee8f87b5f..80989428ce 100644
--- a/lib/edoc/src/edoc_tags.erl
+++ b/lib/edoc/src/edoc_tags.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
diff --git a/lib/edoc/src/edoc_types.erl b/lib/edoc/src/edoc_types.erl
index e784b3359a..a54544868c 100644
--- a/lib/edoc/src/edoc_types.erl
+++ b/lib/edoc/src/edoc_types.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -34,13 +32,13 @@
%% @headerfile "edoc_types.hrl"
-include("edoc_types.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
is_predefined(any, 0) -> true;
is_predefined(atom, 0) -> true;
is_predefined(binary, 0) -> true;
-is_predefined(bool, 0) -> true;
+is_predefined(bool, 0) -> true; % kept for backwards compatibility
is_predefined(char, 0) -> true;
is_predefined(cons, 2) -> true;
is_predefined(deep_string, 0) -> true;
diff --git a/lib/edoc/src/edoc_wiki.erl b/lib/edoc/src/edoc_wiki.erl
index ba33198787..2f2d14853c 100644
--- a/lib/edoc/src/edoc_wiki.erl
+++ b/lib/edoc/src/edoc_wiki.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @private
%% @copyright 2001-2003 Richard Carlsson
%% @author Richard Carlsson <[email protected]>
@@ -70,7 +68,7 @@
-export([parse_xml/2, expand_text/2]).
-include("edoc.hrl").
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(BASE_HEADING, 3).
@@ -82,8 +80,8 @@ parse_xml(Data, Line) ->
parse_xml_1(Text, Line) ->
Text1 = "<doc>" ++ Text ++ "</doc>",
- Options = [{line, Line}, {encoding, "iso-8859-1"}],
- case catch {ok, xmerl_scan:string(Text1, Options)} of
+ Opts = [{line, Line}, {encoding, 'iso-8859-1'}],
+ case catch {ok, xmerl_scan:string(Text1, Opts)} of
{ok, {E, _}} ->
E#xmlElement.content;
{'EXIT', {fatal, {Reason, L, _C}}} ->
diff --git a/lib/edoc/src/otpsgml_layout.erl b/lib/edoc/src/otpsgml_layout.erl
index 45f74b299e..d425dc0ed8 100644
--- a/lib/edoc/src/otpsgml_layout.erl
+++ b/lib/edoc/src/otpsgml_layout.erl
@@ -14,8 +14,6 @@
%% Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307
%% USA
%%
-%% $Id$
-%%
%% @author Richard Carlsson <[email protected]>
%% @author Kenneth Lundin <[email protected]>
%% @copyright 2001-2004 Richard Carlsson
@@ -34,7 +32,7 @@
-import(edoc_report, [report/2]).
--include("xmerl.hrl").
+-include_lib("xmerl/include/xmerl.hrl").
-define(SGML_EXPORT, xmerl_otpsgml).
-define(DEFAULT_XML_EXPORT, ?SGML_EXPORT).
diff --git a/lib/edoc/test/edoc_SUITE.erl b/lib/edoc/test/edoc_SUITE.erl
index 0d57591e3e..5b95c35756 100644
--- a/lib/edoc/test/edoc_SUITE.erl
+++ b/lib/edoc/test/edoc_SUITE.erl
@@ -13,8 +13,6 @@
%% Portions created by Ericsson are Copyright 1999, Ericsson Utvecklings
%% AB. All Rights Reserved.''
%%
-%% $Id$
-%%
-module(edoc_SUITE).
-include_lib("test_server/include/test_server.hrl").
diff --git a/lib/erl_interface/src/Makefile.in b/lib/erl_interface/src/Makefile.in
index 8ff142a366..0d841cfa48 100644
--- a/lib/erl_interface/src/Makefile.in
+++ b/lib/erl_interface/src/Makefile.in
@@ -143,7 +143,6 @@ BINDIR = $(ERL_TOP)/lib/erl_interface/bin/$(TARGET)
vpath %.c connect:encode:decode:misc:epmd:legacy:registry
-
###########################################################################
# List targets
###########################################################################
@@ -202,11 +201,6 @@ ifeq ($(USING_VC),yes)
# Windows targets
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(MT_OBJDIR) \
- $(MD_OBJDIR) \
- $(MDD_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -236,9 +230,6 @@ else
ifeq ($USING_MINGW,yes)
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(MD_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -257,10 +248,6 @@ else
ifdef THR_DEFS
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(ST_OBJDIR) \
- $(MT_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -283,9 +270,6 @@ FAKE_TARGETS = \
else
TARGETS = \
- $(BINDIR) \
- $(OBJDIR) \
- $(ST_OBJDIR) \
$(OBJ_TARGETS) \
$(EXE_TARGETS)
@@ -601,23 +585,7 @@ $(MDD_OBJDIR)/%.o: %.c
# Create directories
###########################################################################
-$(BINDIR):
- mkdir -p $(BINDIR)
-
-$(OBJDIR):
- mkdir -p $(OBJDIR)
-
-$(ST_OBJDIR):
- mkdir -p $(ST_OBJDIR)
-
-$(MT_OBJDIR):
- mkdir -p $(MT_OBJDIR)
-
-$(MD_OBJDIR):
- mkdir -p $(MD_OBJDIR)
-
-$(MDD_OBJDIR):
- mkdir -p $(MDD_OBJDIR)
+_create_dirs := $(shell mkdir -p $(BINDIR) $(OBJDIR) $(ST_OBJDIR) $(MT_OBJDIR) $(MD_OBJDIR) $(MDD_OBJDIR))
###########################################################################
# Special rules
diff --git a/lib/et/src/et_wx_viewer.erl b/lib/et/src/et_wx_viewer.erl
index 7d4286ed9d..386f8fc86b 100644
--- a/lib/et/src/et_wx_viewer.erl
+++ b/lib/et/src/et_wx_viewer.erl
@@ -257,10 +257,10 @@ parse_opt([H | T], S, CollectorOpt) ->
Actors = [create_actor(Name) || Name <- ActorNames2],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{include, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, include, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, include, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{exclude, ActorNames} when is_list(ActorNames) ->
- Actors = [opt_create_actor(Name, exclude, S#state.actors) || Name <- ActorNames],
+ Actors = [opt_create_actor(Name, exclude, S) || Name <- ActorNames],
parse_opt(T, S#state{actors = Actors}, CollectorOpt);
{first_event, _FirstKey} ->
%% NYI
diff --git a/lib/eunit/doc/overview.edoc b/lib/eunit/doc/overview.edoc
index be05a13fba..2583f0be25 100644
--- a/lib/eunit/doc/overview.edoc
+++ b/lib/eunit/doc/overview.edoc
@@ -913,7 +913,7 @@ To make the descriptions simpler, we first list some definitions:
<td>`CleanupX'</td><td>`(X::any(), R::any()) -> any()'</td>
</tr>
<tr>
-<td>`Instantiator'</td><td>`((R::any()) -> Tests | {with, [AbstractTestFun::((any()) -> any())]}'</td>
+<td>`Instantiator'</td><td>`((R::any()) -> Tests) | {with, [AbstractTestFun::((any()) -> any())]}'</td>
</tr>
<tr>
<td>`Where'</td><td>`local | spawn | {spawn, Node::atom()}'</td>
diff --git a/lib/eunit/include/eunit.hrl b/lib/eunit/include/eunit.hrl
index 82ba982f03..493ba60a2d 100644
--- a/lib/eunit/include/eunit.hrl
+++ b/lib/eunit/include/eunit.hrl
@@ -39,6 +39,7 @@
-ifndef(EUNIT_HRL).
-define(EUNIT_HRL, true).
+
%% allow defining TEST to override NOTEST
-ifdef(TEST).
-undef(NOTEST).
@@ -164,7 +165,7 @@
%% This is mostly a convenience which gives more detailed reports.
%% Note: Guard is a guarded pattern, and can not be used for value.
-ifdef(NOASSERT).
--define(assertMatch(Guard,Expr),ok).
+-define(assertMatch(Guard, Expr), ok).
-else.
-define(assertMatch(Guard, Expr),
((fun () ->
@@ -174,17 +175,37 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected, (??Guard)},
+ {pattern, (??Guard)},
{value, __V}]})
end
end)())).
-endif.
-define(_assertMatch(Guard, Expr), ?_test(?assertMatch(Guard, Expr))).
+%% This is the inverse case of assertMatch, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotMatch(Guard, Expr), ok).
+-else.
+-define(assertNotMatch(Guard, Expr),
+ ((fun () ->
+ __V = (Expr),
+ case __V of
+ Guard -> .erlang:error({assertNotMatch_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern, (??Guard)},
+ {value, __V}]});
+ _ -> ok
+ end
+ end)())).
+-endif.
+-define(_assertNotMatch(Guard, Expr), ?_test(?assertNotMatch(Guard, Expr))).
+
%% This is a convenience macro which gives more detailed reports when
%% the expected LHS value is not a pattern, but a computed value
-ifdef(NOASSERT).
--define(assertEqual(Expect,Expr),ok).
+-define(assertEqual(Expect, Expr), ok).
-else.
-define(assertEqual(Expect, Expr),
((fun (__X) ->
@@ -201,9 +222,29 @@
-endif.
-define(_assertEqual(Expect, Expr), ?_test(?assertEqual(Expect, Expr))).
+%% This is the inverse case of assertEqual, for convenience.
+-ifdef(NOASSERT).
+-define(assertNotEqual(Unexpected, Expr), ok).
+-else.
+-define(assertNotEqual(Unexpected, Expr),
+ ((fun (__X) ->
+ case (Expr) of
+ __X -> .erlang:error({assertNotEqual_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {value, __X}]});
+ _ -> ok
+ end
+ end)(Unexpected))).
+-endif.
+-define(_assertNotEqual(Unexpected, Expr),
+ ?_test(?assertNotEqual(Unexpected, Expr))).
+
%% Note: Class and Term are patterns, and can not be used for value.
+%% Term can be a guarded pattern, but Class cannot.
-ifdef(NOASSERT).
--define(assertException(Class, Term, Expr),ok).
+-define(assertException(Class, Term, Expr), ok).
-else.
-define(assertException(Class, Term, Expr),
((fun () ->
@@ -212,7 +253,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_success, __V}]})
@@ -223,7 +264,7 @@
[{module, ?MODULE},
{line, ?LINE},
{expression, (??Expr)},
- {expected,
+ {pattern,
"{ "++(??Class)++" , "++(??Term)
++" , [...] }"},
{unexpected_exception,
@@ -243,6 +284,43 @@
-define(_assertExit(Term, Expr), ?_assertException(exit, Term, Expr)).
-define(_assertThrow(Term, Expr), ?_assertException(throw, Term, Expr)).
+%% This is the inverse case of assertException, for convenience.
+%% Note: Class and Term are patterns, and can not be used for value.
+%% Both Class and Term can be guarded patterns.
+-ifdef(NOASSERT).
+-define(assertNotException(Class, Term, Expr), ok).
+-else.
+-define(assertNotException(Class, Term, Expr),
+ ((fun () ->
+ try (Expr) of
+ _ -> ok
+ catch
+ __C:__T ->
+ case __C of
+ Class ->
+ case __T of
+ Term ->
+ .erlang:error({assertNotException_failed,
+ [{module, ?MODULE},
+ {line, ?LINE},
+ {expression, (??Expr)},
+ {pattern,
+ "{ "++(??Class)++" , "
+ ++(??Term)++" , [...] }"},
+ {unexpected_exception,
+ {__C, __T,
+ .erlang:get_stacktrace()
+ }}]});
+ _ -> ok
+ end;
+ _ -> ok
+ end
+ end
+ end)())).
+-endif.
+-define(_assertNotException(Class, Term, Expr),
+ ?_test(?assertNotException(Class, Term, Expr))).
+
%% Macros for running operating system commands. (Note that these
%% require EUnit to be present at runtime, or at least eunit_lib.)
@@ -267,7 +345,7 @@
%% these are only used for testing; they always return 'ok' on success,
%% and have no effect if debugging/testing is turned off
-ifdef(NOASSERT).
--define(assertCmdStatus(N, Cmd),ok).
+-define(assertCmdStatus(N, Cmd), ok).
-else.
-define(assertCmdStatus(N, Cmd),
((fun () ->
@@ -285,7 +363,7 @@
-define(assertCmd(Cmd), ?assertCmdStatus(0, Cmd)).
-ifdef(NOASSERT).
--define(assertCmdOutput(T, Cmd),ok).
+-define(assertCmdOutput(T, Cmd), ok).
-else.
-define(assertCmdOutput(T, Cmd),
((fun () ->
@@ -313,11 +391,12 @@
-define(debugHere, ok).
-define(debugFmt(S, As), ok).
-define(debugVal(E), (E)).
--define(debugTime(S,E), (E)).
+-define(debugTime(S, E), (E)).
-else.
-define(debugMsg(S),
(begin
- .io:fwrite(user, <<"~s:~w: ~s\n">>, [?FILE, ?LINE, S]),
+ .io:fwrite(user, <<"~s:~w:~w: ~s\n">>,
+ [?FILE, ?LINE, self(), S]),
ok
end)).
-define(debugHere, (?debugMsg("<-"))).
@@ -327,7 +406,7 @@
?debugFmt(<<"~s = ~P">>, [(??E), __V, 15]),
__V
end)(E))).
--define(debugTime(S,E),
+-define(debugTime(S, E),
((fun () ->
{__T0, _} = statistics(wall_clock),
__V = (E),
@@ -337,4 +416,5 @@
end)())).
-endif.
+
-endif. % EUNIT_HRL
diff --git a/lib/eunit/src/Makefile b/lib/eunit/src/Makefile
index 4897c20ec1..bec2fdbe0b 100644
--- a/lib/eunit/src/Makefile
+++ b/lib/eunit/src/Makefile
@@ -26,8 +26,9 @@ INCLUDE=../include
ERL_COMPILE_FLAGS += -pa $(EBIN) -I$(INCLUDE) +warn_unused_vars +nowarn_shadow_vars +warn_unused_import +warn_obsolete_guard
+PARSE_TRANSFORM = eunit_autoexport.erl
+
SOURCES= \
- eunit_autoexport.erl \
eunit_striptests.erl \
eunit.erl \
eunit_tests.erl \
@@ -43,6 +44,8 @@ SOURCES= \
INCLUDE_FILES = eunit.hrl
+PARSE_TRANSFORM_BIN = $(PARSE_TRANSFORM:%.erl=$(EBIN)/%.$(EMULATOR))
+
OBJECTS=$(SOURCES:%.erl=$(EBIN)/%.$(EMULATOR)) $(APP_TARGET) $(APPUP_TARGET)
INCLUDE_DELIVERABLES = $(INCLUDE_FILES:%=$(INCLUDE)/%)
@@ -59,7 +62,7 @@ APPUP_TARGET= $(EBIN)/$(APPUP_FILE)
# Targets
# ----------------------------------------------------
-debug opt: $(OBJECTS)
+debug opt: $(PARSE_TRANSFORM_BIN) $(OBJECTS)
docs:
@@ -86,6 +89,8 @@ realclean: clean
$(EBIN)/%.$(EMULATOR):%.erl
erlc -W $(ERL_COMPILE_FLAGS) -o$(EBIN) $<
+$(OBJECTS): $(PARSE_TRANSFORM_BIN)
+
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
@@ -103,9 +108,9 @@ include $(ERL_TOP)/make/otp_release_targets.mk
release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/ebin
- $(INSTALL_DATA) $(OBJECTS) $(RELSYSDIR)/ebin
+ $(INSTALL_DATA) $(PARSE_TRANSFORM_BIN) $(OBJECTS) $(RELSYSDIR)/ebin
$(INSTALL_DIR) $(RELSYSDIR)/src
- $(INSTALL_DATA) $(SOURCES) $(RELSYSDIR)/src
+ $(INSTALL_DATA) $(PARSE_TRANSFORM) $(SOURCES) $(RELSYSDIR)/src
$(INSTALL_DIR) $(RELSYSDIR)/include
$(INSTALL_DATA) $(INCLUDE_DELIVERABLES) $(RELSYSDIR)/include
diff --git a/lib/eunit/src/eunit.app.src b/lib/eunit/src/eunit.app.src
index 4fd76588c3..5e16dfa2ce 100644
--- a/lib/eunit/src/eunit.app.src
+++ b/lib/eunit/src/eunit.app.src
@@ -5,17 +5,17 @@
{vsn, "%VSN%"},
{modules, [eunit,
eunit_autoexport,
- eunit_striptests,
- eunit_server,
+ eunit_data,
+ eunit_lib,
+ eunit_listener,
eunit_proc,
eunit_serial,
+ eunit_server,
+ eunit_striptests,
+ eunit_surefire,
eunit_test,
eunit_tests,
- eunit_lib,
- eunit_listener,
- eunit_data,
- eunit_tty,
- eunit_surefire]},
+ eunit_tty]},
{registered,[]},
- {applications, [stdlib]},
+ {applications, [kernel,stdlib]},
{env, []}]}.
diff --git a/lib/eunit/src/eunit.erl b/lib/eunit/src/eunit.erl
index da35c5c2ec..15fc3bdf32 100644
--- a/lib/eunit/src/eunit.erl
+++ b/lib/eunit/src/eunit.erl
@@ -16,7 +16,7 @@
%% $Id: eunit.erl 339 2009-04-05 14:10:47Z rcarlsson $
%%
%% @copyright 2004-2009 Micka�l R�mond, Richard Carlsson
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% [http://www.process-one.net/]
%% @author Richard Carlsson <[email protected]>
%% [http://user.it.uu.se/~richardc/]
diff --git a/lib/eunit/src/eunit_data.erl b/lib/eunit/src/eunit_data.erl
index 0543b6c543..288dd74ddf 100644
--- a/lib/eunit/src/eunit_data.erl
+++ b/lib/eunit/src/eunit_data.erl
@@ -146,8 +146,10 @@ iter_next(I = #iter{next = [T | Ts]}) ->
iter_prev(#iter{prev = []}) ->
none;
-iter_prev(#iter{prev = [T | Ts], next = Next, pos = Pos} = I) ->
- {T, I#iter{prev = Ts, next = [T | Next], pos = Pos - 1}}.
+iter_prev(#iter{prev = [T | Ts]} = I) ->
+ {T, I#iter{prev = Ts,
+ next = [T | I#iter.next],
+ pos = I#iter.pos - 1}}.
%% ---------------------------------------------------------------------
@@ -363,7 +365,8 @@ parse({file, F} = T) when is_list(F) ->
parse({dir, D}=T) when is_list(D) ->
case eunit_lib:is_string(D) of
true ->
- {data, {"directory \"" ++ D ++ "\"", get_directory_modules(D)}};
+ {data, {"directory \"" ++ D ++ "\"",
+ get_directory_module_tests(D)}};
false ->
bad_test(T)
end;
@@ -385,10 +388,10 @@ parse({S, T1} = T) when is_list(S) ->
end;
parse({S, T1}) when is_binary(S) ->
group(#group{tests = T1, desc = S});
-parse(T) when tuple_size(T) > 2, is_list(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_list(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
-parse(T) when tuple_size(T) > 2, is_binary(element(1, T)) ->
+parse(T) when is_tuple(T), size(T) > 2, is_binary(element(1, T)) ->
[S | Es] = tuple_to_list(T),
parse({S, list_to_tuple(Es)});
parse(M) when is_atom(M) ->
@@ -596,7 +599,7 @@ testfuns(Es, M, TestSuffix, GeneratorSuffix) ->
%% ---------------------------------------------------------------------
-%% Getting a test set from a file
+%% Getting a test set from a file (text file or object file)
%% @throws {file_read_error, {Reason::atom(), Message::string(),
%% fileName()}}
@@ -625,17 +628,23 @@ get_file_tests(F) ->
is_module_filename(F) ->
filename:extension(F) =:= code:objfile_extension().
+objfile_test({M, File}) ->
+ {setup,
+ fun () ->
+ %% TODO: better error/stacktrace for this internal fun
+ code:purge(M),
+ {module,M} = code:load_abs(filename:rootname(File)),
+ ok
+ end,
+ {module, M}};
objfile_test(File) ->
+ objfile_test({objfile_module(File), File}).
+
+objfile_module(File) ->
try
- {module, M} = lists:keyfind(module, 1, beam_lib:info(File)),
- {setup,
- fun () ->
- %% TODO: better error/stacktrace for this internal fun
- code:purge(M),
- {module,M} = code:load_abs(filename:rootname(File)),
- ok
- end,
- {module, M}}
+ {value, {module, M}} = lists:keysearch(module, 1,
+ beam_lib:info(File)),
+ M
catch
_:_ ->
throw({file_read_error,
@@ -644,15 +653,34 @@ objfile_test(File) ->
%% ---------------------------------------------------------------------
-%% Getting a list of module names from object files in a directory
-
-%% @throws {file_read_error, {Reason::atom(), Message::string(),
-%% fileName()}}
+%% Getting a set of module tests from the object files in a directory
+
+%% @throws {file_read_error,
+%% {Reason::atom(), Message::string(), fileName()}}
+
+get_directory_module_tests(D) ->
+ Ms = get_directory_modules(D),
+ %% for all 'm' in the set, remove 'm_tests' if present
+ F = fun ({M,_}, S) ->
+ Name = atom_to_list(M),
+ case lists:suffix(?DEFAULT_TESTMODULE_SUFFIX, Name) of
+ false ->
+ Name1 = Name ++ ?DEFAULT_TESTMODULE_SUFFIX,
+ M1 = list_to_atom(Name1),
+ dict:erase(M1, S);
+ true ->
+ S
+ end
+ end,
+ [objfile_test(Obj)
+ || Obj <- dict:to_list(lists:foldl(F, dict:from_list(Ms), Ms))].
%% TODO: handle packages (recursive search for files)
-
get_directory_modules(D) ->
- [objfile_test(filename:join(D, F))
+ [begin
+ F1 = filename:join(D, F),
+ {objfile_module(F1), F1}
+ end
|| F <- eunit_lib:list_dir(D), is_module_filename(F)].
diff --git a/lib/eunit/src/eunit_server.erl b/lib/eunit/src/eunit_server.erl
index bf1bb9bcef..2cdfef2668 100644
--- a/lib/eunit/src/eunit_server.erl
+++ b/lib/eunit/src/eunit_server.erl
@@ -59,8 +59,9 @@ watch(Server, Module, Opts) when is_atom(Module) ->
watch_path(Server, Path, Opts) ->
command(Server, {watch, {path, filename:flatten(Path)}, Opts}).
+%% note that the user must use $ at the end to match whole paths only
watch_regexp(Server, Regex, Opts) ->
- case regexp:parse(Regex) of
+ case re:compile(Regex,[anchored]) of
{ok, R} ->
command(Server, {watch, {regexp, R}, Opts});
{error, _}=Error ->
@@ -278,8 +279,8 @@ is_watched(Path, St) ->
match_any(sets:to_list(St#state.regexps), Path).
match_any([R | Rs], Str) ->
- case regexp:first_match(Str, R) of
- {match, _, _} -> true;
+ case re:run(Str, R, [{capture,none}]) of
+ match -> true;
_ -> match_any(Rs, Str)
end;
match_any([], _Str) -> false.
diff --git a/lib/eunit/src/eunit_surefire.erl b/lib/eunit/src/eunit_surefire.erl
index dfb08c90b2..6e0a447105 100644
--- a/lib/eunit/src/eunit_surefire.erl
+++ b/lib/eunit/src/eunit_surefire.erl
@@ -15,7 +15,7 @@
%%
%% $Id: $
%%
-%% @author Micka&euml;l R&eacute;mond <[email protected]>
+%% @author Micka�l R�mond <[email protected]>
%% @copyright 2009 Micka�l R�mond, Paul Guyot
%% @see eunit
%% @doc Surefire reports for EUnit (Format used by Maven and Atlassian
@@ -64,6 +64,7 @@
}).
-record(testsuite,
{
+ id = 0 :: integer(),
name = <<>> :: binary(),
time = 0 :: integer(),
output = <<>> :: binary(),
@@ -76,7 +77,7 @@
-record(state, {verbose = false,
indent = 0,
xmldir = ".",
- testsuite = #testsuite{}
+ testsuites = [] :: [#testsuite{}]
}).
start() ->
@@ -89,55 +90,60 @@ init(Options) ->
XMLDir = proplists:get_value(dir, Options, ?XMLDIR),
St = #state{verbose = proplists:get_bool(verbose, Options),
xmldir = XMLDir,
- testsuite = #testsuite{}},
+ testsuites = []},
receive
{start, _Reference} ->
St
end.
terminate({ok, _Data}, St) ->
- TestSuite = St#state.testsuite,
+ TestSuites = St#state.testsuites,
XmlDir = St#state.xmldir,
- write_report(TestSuite, XmlDir),
+ write_reports(TestSuites, XmlDir),
ok;
terminate({error, _Reason}, _St) ->
%% Don't report any errors here, since eunit_tty takes care of that.
%% Just terminate.
ok.
-handle_begin(group, Data, St) ->
+handle_begin(Kind, Data, St) when Kind == group; Kind == test ->
+ %% Run this code both for groups and tests; test is a bit
+ %% surprising: This is a workaround for the fact that we don't get
+ %% a group (handle_begin(group, ...) for testsuites (modules)
+ %% which only have one test case. In that case we get a test case
+ %% with an id comprised of just one integer - the group id.
NewId = proplists:get_value(id, Data),
case NewId of
[] ->
St;
- [_GroupId] ->
+ [GroupId] ->
Desc = proplists:get_value(desc, Data),
- TestSuite = St#state.testsuite,
- NewTestSuite = TestSuite#testsuite{name = Desc},
- St#state{testsuite=NewTestSuite};
+ TestSuite = #testsuite{id = GroupId, name = Desc},
+ St#state{testsuites=store_suite(TestSuite, St#state.testsuites)};
%% Surefire format is not hierarchic: Ignore subgroups:
_ ->
St
- end;
-handle_begin(test, _Data, St) ->
- St.
+ end.
handle_end(group, Data, St) ->
%% Retrieve existing test suite:
case proplists:get_value(id, Data) of
[] ->
St;
- [_GroupId|_] ->
- TestSuite = St#state.testsuite,
+ [GroupId|_] ->
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Update TestSuite data:
Time = proplists:get_value(time, Data),
Output = proplists:get_value(output, Data),
NewTestSuite = TestSuite#testsuite{ time = Time, output = Output },
- St#state{testsuite=NewTestSuite}
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}
end;
handle_end(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -149,7 +155,7 @@ handle_end(test, Data, St) ->
TestCase = #testcase{name = Name, description = Desc,
time = Time,output = Output},
NewTestSuite = add_testcase_to_testsuite(Result, TestCase, TestSuite),
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
%% Cancel group does not give information on the individual cancelled test case
%% We ignore this event
@@ -157,7 +163,9 @@ handle_cancel(group, _Data, St) ->
St;
handle_cancel(test, Data, St) ->
%% Retrieve existing test suite:
- TestSuite = St#state.testsuite,
+ [GroupId|_] = proplists:get_value(id, Data),
+ TestSuites = St#state.testsuites,
+ TestSuite = lookup_suite_by_group_id(GroupId, TestSuites),
%% Create test case:
Name = format_name(proplists:get_value(source, Data),
@@ -171,7 +179,7 @@ handle_cancel(test, Data, St) ->
NewTestSuite = TestSuite#testsuite{
skipped = TestSuite#testsuite.skipped+1,
testcases=[TestCase|TestSuite#testsuite.testcases] },
- St#state{testsuite=NewTestSuite}.
+ St#state{testsuites=store_suite(NewTestSuite, TestSuites)}.
format_name({Module, Function, Arity}, Line) ->
lists:flatten([atom_to_list(Module), ":", atom_to_list(Function), "/",
@@ -183,6 +191,12 @@ format_desc(Desc) when is_binary(Desc) ->
format_desc(Desc) when is_list(Desc) ->
Desc.
+lookup_suite_by_group_id(GroupId, TestSuites) ->
+ #testsuite{} = lists:keyfind(GroupId, #testsuite.id, TestSuites).
+
+store_suite(#testsuite{id=GroupId} = TestSuite, TestSuites) ->
+ lists:keystore(GroupId, #testsuite.id, TestSuites, TestSuite).
+
%% Add testcase to testsuite depending on the result of the test.
add_testcase_to_testsuite(ok, TestCaseTmp, TestSuite) ->
TestCase = TestCaseTmp#testcase{ result = ok },
@@ -214,6 +228,10 @@ add_testcase_to_testsuite({error, Exception}, TestCaseTmp, TestSuite) ->
%% Write a report to the XML directory.
%% This function opens the report file, calls write_report_to/2 and closes the file.
%% ----------------------------------------------------------------------------
+write_reports(TestSuites, XmlDir) ->
+ lists:foreach(fun(TestSuite) -> write_report(TestSuite, XmlDir) end,
+ TestSuites).
+
write_report(#testsuite{name = Name} = TestSuite, XmlDir) ->
Filename = filename:join(XmlDir, lists:flatten(["TEST-", escape_suitename(Name)], ".xml")),
case file:open(Filename, [write, raw]) of
diff --git a/lib/eunit/src/eunit_test.erl b/lib/eunit/src/eunit_test.erl
index d322c4b420..9ac1d1e7d9 100644
--- a/lib/eunit/src/eunit_test.erl
+++ b/lib/eunit/src/eunit_test.erl
@@ -131,12 +131,27 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,"[ _ ]"},
+ {pattern,"[ _ ]"},
{value,[]}]},
_}}
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotMatch(ok, error),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotMatch([_], [42]),
+ {error,{error,{assertNotMatch_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,"[ _ ]"},
+ {value,[42]}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertEqual(ok, ok),
{ok, ok} = run_testfun(F)
end),
@@ -152,6 +167,20 @@ macro_test_() ->
= run_testfun(F)
end),
?_test(begin
+ {?LINE, F} = ?_assertNotEqual(1, 0),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotEqual(2, 1+1),
+ {error,{error,{assertNotEqual_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {value,2}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
{?LINE, F} = ?_assertException(error, badarith,
erlang:error(badarith)),
{ok, ok} = run_testfun(F)
@@ -162,7 +191,7 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
{unexpected_success,ok}]},
_}}
= run_testfun(F)
@@ -174,15 +203,48 @@ macro_test_() ->
[{module,_},
{line,_},
{expression,_},
- {expected,_},
+ {pattern,_},
+ {unexpected_exception,
+ {error,badarith,_}}]},
+ _}}
+ = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertError(badarith,
+ erlang:error(badarith)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertExit(normal, exit(normal)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertThrow(foo, throw(foo)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith, 42),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarg)),
+ {ok, ok} = run_testfun(F)
+ end),
+ ?_test(begin
+ {?LINE, F} = ?_assertNotException(error, badarith,
+ erlang:error(badarith)),
+ {error,{error,{assertNotException_failed,
+ [{module,_},
+ {line,_},
+ {expression,_},
+ {pattern,_},
{unexpected_exception,
{error,badarith,_}}]},
_}}
= run_testfun(F)
end)
]}.
-
-under_eunit_test() -> ?assert(?UNDER_EUNIT).
-endif.
diff --git a/lib/eunit/src/eunit_tests.erl b/lib/eunit/src/eunit_tests.erl
index 37c0b4d6ae..a63d102d98 100644
--- a/lib/eunit/src/eunit_tests.erl
+++ b/lib/eunit/src/eunit_tests.erl
@@ -26,17 +26,17 @@
-include("eunit.hrl").
-ifdef(TEST).
-%% Cause all the other modules to be tested as well as this one.
-full_test_() ->
- %%{application, eunit}. % this currently causes a loop
- %% We use the below until loop detection is implemented
- [eunit_autoexport,
- eunit_striptests,
- eunit_server,
- eunit_proc,
- eunit_serial,
- eunit_test,
- eunit_lib,
- eunit_data,
- eunit_tty].
+id(X) -> X. % for suppressing compiler warnings
-endif.
+
+under_eunit_test() -> ?assert(?UNDER_EUNIT).
+
+let_test() -> ?assertEqual(42, ?LET(X, 17, X+25)).
+
+if_test_() ->
+ [?_assertEqual(17, ?IF(id(1) > 0, 17, 42)),
+ ?_assertEqual(42, ?IF(id(1) < 0, 17, 42))].
+
+matches_test_() ->
+ [?_assert(?MATCHES("hel"++_, "hello")),
+ ?_assertNot(?MATCHES("hal"++_, "hello"))].
diff --git a/lib/eunit/vsn.mk b/lib/eunit/vsn.mk
index d7edd7977b..d933085bbc 100644
--- a/lib/eunit/vsn.mk
+++ b/lib/eunit/vsn.mk
@@ -1 +1 @@
-EUNIT_VSN = 2.1.7
+EUNIT_VSN = 2.2.0
diff --git a/lib/gs/src/Makefile b/lib/gs/src/Makefile
index a648d3cf13..b3f11fb71b 100644
--- a/lib/gs/src/Makefile
+++ b/lib/gs/src/Makefile
@@ -90,7 +90,7 @@ clean:
# Special Build Targets
# ----------------------------------------------------
-gstk_generic.hrl: gs_make.erl
+gstk_generic.hrl: gs_make.erl ../ebin/gs.$(EMULATOR)
$(ERL) -pa $(EBIN) -s gs_make -s erlang halt -noshell
$(APP_TARGET): $(APP_SRC) ../vsn.mk
@@ -99,6 +99,8 @@ $(APP_TARGET): $(APP_SRC) ../vsn.mk
$(APPUP_TARGET): $(APPUP_SRC) ../vsn.mk
sed -e 's;%VSN%;$(VSN);' $< > $@
+$(GSTK_GENERIC_TARGET): gstk_generic.hrl
+
# ----------------------------------------------------
# Release Target
# ----------------------------------------------------
diff --git a/lib/hipe/cerl/erl_bif_types.erl b/lib/hipe/cerl/erl_bif_types.erl
index 64a695129b..43c2ac2615 100644
--- a/lib/hipe/cerl/erl_bif_types.erl
+++ b/lib/hipe/cerl/erl_bif_types.erl
@@ -672,6 +672,9 @@ type(erlang, call_on_load_function, 1, Xs) ->
type(erlang, cancel_timer, 1, Xs) ->
strict(arg_types(erlang, cancel_timer, 1), Xs,
fun (_) -> t_sup(t_integer(), t_atom('false')) end);
+type(erlang, check_old_code, 1, Xs) ->
+ strict(arg_types(erlang, check_old_code, 1), Xs,
+ fun (_) -> t_boolean() end);
type(erlang, check_process_code, 2, Xs) ->
strict(arg_types(erlang, check_process_code, 2), Xs,
fun (_) -> t_boolean() end);
@@ -795,7 +798,8 @@ type(erlang, get_module_info, 2, Xs) ->
end
end);
type(erlang, get_stacktrace, 0, _) ->
- t_list(t_tuple([t_atom(), t_atom(), t_sup([t_arity(), t_list()])]));
+ t_list(t_tuple([t_atom(), t_atom(), t_sup([t_arity(), t_list()]),
+ t_list()]));
type(erlang, group_leader, 0, _) -> t_pid();
type(erlang, group_leader, 2, Xs) ->
strict(arg_types(erlang, group_leader, 2), Xs,
@@ -3393,6 +3397,8 @@ arg_types(erlang, call_on_load_function, 1) ->
[t_atom()];
arg_types(erlang, cancel_timer, 1) ->
[t_reference()];
+arg_types(erlang, check_old_code, 1) ->
+ [t_atom()];
arg_types(erlang, check_process_code, 2) ->
[t_pid(), t_atom()];
arg_types(erlang, crc32, 1) ->
@@ -3707,7 +3713,10 @@ arg_types(erlang, purge_module, 1) ->
arg_types(erlang, put, 2) ->
[t_any(), t_any()];
arg_types(erlang, raise, 3) ->
- [t_raise_errorclass(), t_any(), type(erlang, get_stacktrace, 0, [])];
+ OldStyleType = t_list(t_tuple([t_atom(), t_atom(),
+ t_sup([t_arity(), t_list()])])),
+ NewStyleType = type(erlang, get_stacktrace, 0, []),
+ [t_raise_errorclass(), t_any(), t_sup(OldStyleType, NewStyleType)];
arg_types(erlang, read_timer, 1) ->
[t_reference()];
arg_types(erlang, ref_to_list, 1) ->
diff --git a/lib/hipe/icode/hipe_beam_to_icode.erl b/lib/hipe/icode/hipe_beam_to_icode.erl
index d7eb035551..f557d3419e 100644
--- a/lib/hipe/icode/hipe_beam_to_icode.erl
+++ b/lib/hipe/icode/hipe_beam_to_icode.erl
@@ -281,10 +281,14 @@ needs_redtest(Leafness) ->
%%-----------------------------------------------------------------------
%%--- label & func_info combo ---
+trans_fun([{label,_}=F,{func_info,_,_,_}=FI|Instructions], Env) ->
+ %% Handle old code without a line instruction.
+ trans_fun([F,{line,[]},FI|Instructions], Env);
trans_fun([{label,B},{label,_},
{func_info,M,F,A},{label,L}|Instructions], Env) ->
trans_fun([{label,B},{func_info,M,F,A},{label,L}|Instructions], Env);
trans_fun([{label,B},
+ {line,_},
{func_info,{atom,_M},{atom,_F},_A},
{label,L}|Instructions], Env) ->
%% Emit code to handle function_clause errors. The BEAM test instructions
@@ -1142,6 +1146,11 @@ trans_fun([{trim,N,NY}|Instructions], Env) ->
Moves = trans_trim(N, NY),
Moves ++ trans_fun(Instructions, Env);
%%--------------------------------------------------------------------
+%% New line/1 instruction in R15.
+%%--------------------------------------------------------------------
+trans_fun([{line,_}|Instructions], Env) ->
+ trans_fun(Instructions,Env);
+%%--------------------------------------------------------------------
%%--- ERROR HANDLING ---
%%--------------------------------------------------------------------
trans_fun([X|_], _) ->
@@ -1869,6 +1878,8 @@ patch_make_funs([], FunIndex, Acc) ->
find_mfa([{label,_}|Code]) ->
find_mfa(Code);
+find_mfa([{line,_}|Code]) ->
+ find_mfa(Code);
find_mfa([{func_info,{atom,M},{atom,F},A}|_])
when is_atom(M), is_atom(F), is_integer(A), 0 =< A, A =< 255 ->
{M, F, A}.
diff --git a/lib/ic/c_src/Makefile.in b/lib/ic/c_src/Makefile.in
index 6eef7827b9..28040ca42d 100644
--- a/lib/ic/c_src/Makefile.in
+++ b/lib/ic/c_src/Makefile.in
@@ -125,13 +125,9 @@ docs:
# Special Build Targets
# ----------------------------------------------------
-$(OBJDIR):
- -mkdir -p $(OBJDIR)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
-$(LIBDIR):
- -mkdir -p $(LIBDIR)
-
-$(LIBRARY): $(OBJDIR) $(LIBDIR) $(OBJ_FILES)
+$(LIBRARY): $(OBJ_FILES)
-$(AR) $(AR_OUT) $@ $(OBJ_FILES)
-$(RANLIB) $@
diff --git a/lib/ic/doc/src/notes.xml b/lib/ic/doc/src/notes.xml
index 5f6c31069c..de519d5f84 100644
--- a/lib/ic/doc/src/notes.xml
+++ b/lib/ic/doc/src/notes.xml
@@ -4,7 +4,7 @@
<chapter>
<header>
<copyright>
- <year>1998</year><year>2010</year>
+ <year>1998</year><year>2011</year>
<holder>Ericsson AB. All Rights Reserved.</holder>
</copyright>
<legalnotice>
@@ -31,6 +31,22 @@
</header>
<section>
+ <title>IC 4.2.27</title>
+
+ <section>
+ <title>Improvements and New Features</title>
+ <list type="bulleted">
+ <item>
+ <p>
+ Reduced compile overhead (Thanks to Haitao Li).</p>
+ <p>
+ Own Id: OTP-9460 </p>
+ </item>
+ </list>
+ </section>
+ </section>
+
+ <section>
<title>IC 4.2.26</title>
<section>
diff --git a/lib/ic/examples/pre_post_condition/Makefile b/lib/ic/examples/pre_post_condition/Makefile
index 68e2168e1e..85cbbdb9ff 100644
--- a/lib/ic/examples/pre_post_condition/Makefile
+++ b/lib/ic/examples/pre_post_condition/Makefile
@@ -108,9 +108,14 @@ docs:
test: $(TEST_TARGET_FILES)
-$(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES): ex.idl
+IDL-GENERATED: ex.idl
erlc $(ERL_LOCAL_FLAGS) +'{precond,{tracer,pre}}' \
+'{{postcond,"m::i::f"},{tracer,post}}' ex.idl
+ >IDL-GENERATED
+
+$(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf b/lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf
deleted file mode 100644
index 34e5586175..0000000000
--- a/lib/ic/java_src/com/ericsson/otp/ic/ignore_config_record.inf
+++ /dev/null
@@ -1 +0,0 @@
-Dummy to speed up compilatio
diff --git a/lib/ic/src/ic_pp.erl b/lib/ic/src/ic_pp.erl
index db06118d32..8b53473caa 100644
--- a/lib/ic/src/ic_pp.erl
+++ b/lib/ic/src/ic_pp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1997-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1997-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -92,6 +92,14 @@
%%
%%======================================================================================
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+-record(mio, {valid = true, %% multiple include valid
+ cmacro, %% controlling macro of the current conditional directive
+ depth = 0, %% conditional directive depth
+ included = []}).
@@ -130,7 +138,7 @@ run(FileList, FileName, IncDir, Flags) ->
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
- {Out, Err, War, _Defs, IfCou} = expand(File, FileName, IncDir, Flags),
+ {Out, Err, War, _Defs, _Mio, IfCou} = expand(File, FileName, IncDir, Flags),
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -155,9 +163,9 @@ run(FileList, FileName, IncDir, Flags) ->
%% The entry for all included files
%%
%%
-%% Output {Out, Defs, Err, War}
+%% Output {Out, Err, War, Defs, MultipleIncludeValid}
%%======================================================================================
-run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir) ->
+run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir, Mio) ->
%%----------------------------------------------------------
%% Run the first phase, i.e tokenise the file
@@ -169,18 +177,21 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
%%----------------------------------------------------------
%% Run the second phase, i.e expand macros
%%----------------------------------------------------------
-
- %% Try first pass without file info start/end
- {OutT, ErrT, WarT, DefsT, IfCouT} =
- expand(File, Defs, Err, War, [FileName|IncFile], IncDir),
-
- {Out2, Err2, War2, Defs2, IfCou2} =
- case only_nls(OutT) of
- true -> %% The file is defined before
- {["\n"], ErrT, WarT, DefsT, IfCouT};
- false -> %% The file is not defined before, try second pass
- expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War, [FileName|IncFile], IncDir)
- end,
+ {Out2, Err2, War2, Defs2, Mio2, IfCou2} =
+ expand([FileInfoStart|File]++FileInfoEnd, Defs, Err, War,
+ [FileName|IncFile], IncDir,
+ #mio{included=Mio#mio.included}),
+
+ MergeIncluded = sets:to_list(sets:from_list(Mio#mio.included ++ Mio2#mio.included)),
+
+ Mio3 =
+ case {Mio2#mio.valid, Mio2#mio.cmacro} of
+ {V, Macro} when V == false;
+ Macro == undefined ->
+ update_mio(Mio#mio{included=MergeIncluded});
+ {true, _} ->
+ update_mio({include, FileName}, Mio#mio{included=MergeIncluded})
+ end,
%%----------------------------------------------------------
%% Check if all #if #ifdef #ifndef have a matching #endif
@@ -192,26 +203,7 @@ run_include(FileName, FileList, _Out, Defs, Err, War, IncLine, IncFile, IncDir)
[]
end,
- {Out2, Defs2, Err2++IfError, War2}.
-
-
-
-%% Return true if there is no data
-%% other than new lines
-only_nls([]) ->
- true;
-only_nls(["\n"|Rem]) ->
- only_nls(Rem);
-only_nls(["\r","\n"|Rem]) ->
- only_nls(Rem);
-only_nls([_|_Rem]) ->
- false.
-
-
-
-
-
-
+ {Out2, Defs2, Err2++IfError, War2, Mio3}.
@@ -647,87 +639,86 @@ expand(List, FileName, IncDir, Flags) ->
%% Get all definitions from preprocessor commnads
%% and merge them on top of the file collected.
CLDefs = get_cmd_line_defs(Flags),
- expand(List, [], [], CLDefs, [FileName], IncDir, check_all, [], [], 1, FileName).
-
-expand(List, Defs, Err, War, [FileName|IncFile], IncDir) ->
- expand(List, [], [], Defs, [FileName|IncFile], IncDir, check_all, Err, War, 1, FileName).
+ expand(List, [], [], CLDefs, [FileName], IncDir, #mio{}, check_all, [], [], 1, FileName).
+expand(List, Defs, Err, War, [FileName|IncFile], IncDir, Mio) ->
+ expand(List, [], [], Defs, [FileName|IncFile], IncDir, Mio, check_all, Err, War, 1, FileName).
%%=======================================================
%% Main loop for the expansion
%%=======================================================
-expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, IfCou, Err, War, _L, _FN) ->
+expand([], Out, _SelfRef, Defs, _IncFile, _IncDir, Mio, IfCou, Err, War, _L, _FN) ->
% io:format("~n ===============~n"),
% io:format(" definitions ~p~n",[lists:reverse(Defs)]),
% io:format(" found warnings ~p~n",[lists:reverse(War)]),
% io:format(" found errors ~p~n",[lists:reverse(Err)]),
% io:format(" ===============~n~n~n"),
- {Out, Err, War, Defs, IfCou};
+ {Out, Err, War, Defs, Mio, IfCou};
-expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{file_info, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, Str++Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
%%---------------------------------------
%% Searching for endif,
%% i.e skip all source lines until matching
%% end if is encountered
%%---------------------------------------
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifdef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "ifndef" ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "if" ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{{'if', true}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif+1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Rem2, Err2, War2, Nl} -> Not implemented yet
{{'if', error}, Rem2, Err2, War2, Nl} ->
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN)
end;
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN)
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN)
when Command == "endif" ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
case Endif of
1 ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L+Nl, FN);
_ ->
IfCou2 = {endif, Endif-1, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L+Nl, FN)
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L+Nl, FN)
end;
-expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([{command,_Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, _Nl} = read_to_nl(Rem),
IfCou2 = {endif, Endif, IfLine},
- expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, IfCou2, Err, War, L, FN);
+ expand(Rem2, Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err, War, L, FN);
%% Solves a bug when spaces in front of hashmark !
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+expand([{nl,_Nl} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
-expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN) ->
+expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN) ->
{_Removed, Rem2, Nl} = read_to_nl(Rem),
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine}, Err, War, L, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, {endif, Endif, IfLine}, Err, War, L, FN);
@@ -736,121 +727,132 @@ expand([_X | Rem], Out, SelfRef, Defs, IncFile, IncDir, {endif, Endif, IfLine},
%%---------------------------------------
%% Check all tokens
%%---------------------------------------
-expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+1, FN);
+expand([{nl, _N} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$\n | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L+1, FN);
-expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([space_exp | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [?space | Out], SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN);
-expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN) ->
- case pp_command(Command, Rem, Defs, IncDir, Err, War, L, FN) of
+expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN) ->
+ case pp_command(Command, Rem, Defs, IncDir, Mio, Err, War, L, FN) of
{define, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{undef, Rem2, Defs2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs2, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
{{include, ok}, FileName, FileCont, Rem2, Nl, Err2, War2} ->
- {Out3, Defs3, Err3, War3} =
- run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir),
+ {Out3, Defs3, Err3, War3, Mio2} =
+ run_include(FileName, FileCont, Out, Defs, Err2, War2, L+Nl, IncFile, IncDir, Mio),
Nls = [],
Out4 = Out3++Nls++Out,
- expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, check_all, Err3, War3, L+Nl, FN);
+ expand(Rem2, Out4, SelfRef, Defs3, IncFile, IncDir, Mio2, check_all, Err3, War3, L+Nl, FN);
{{include, error}, Rem2, Nl, Err2, War2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err2, War2, L+Nl, FN);
+
+ {{include, skip}, Rem2} ->
+ Out2 = [$\n|Out],
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+1, FN);
{{ifdef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
{{ifdef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(ifdef, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{ifndef, true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
- {{ifndef, false}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
+ {{ifndef, false}, Macro, Rem2, Err2, War2, Nl} ->
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio({ifndef, Macro}, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{endif, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio(endif, Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{{'if', true}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
IfCou2 = {endif, 1, L},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, IfCou2, Err2, War2, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio, IfCou2, Err2, War2, L+Nl, FN);
%% {{'if', false}, Removed, Rem2, Nl} -> Not implemented at present
{{'if', error}, Rem2, Err2, War2, Nl} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err2, War2, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ Mio2 = update_mio('if', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err2, War2, L+Nl, FN);
{'else', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`else' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('else', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{'elif', {_Removed, Rem2, Nl}} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
Err2 = {FN, L, "`elif' command is not implemented at present"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Mio2 = update_mio('elif', Mio),
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN);
{warning, {WarningText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
War2 = {FileName, L, "warning: #warning "++detokenise(WarningText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, [War2|War], L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, [War2|War], L+Nl, FN);
{error, {ErrorText, Rem2, Nl}} ->
[FileName|_More] = IncFile,
Err2 = {FileName, L, detokenise(ErrorText)},
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
{{line, ok}, {_Removed, Rem2, Nl}, L2, FN2, LineText} ->
Out2 = lists:duplicate(Nl,$\n)++LineText++Out,
[_X|IF] = IncFile,
IncFile2 = [FN2|IF],
- expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, check_all, Err, War, L2, FN2);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile2, IncDir, update_mio(Mio), check_all, Err, War, L2, FN2);
{{line, error}, {_Removed, Rem2, Nl}, Err2} ->
- Out2 = [lists:duplicate(Nl,$\n)|Out],
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN);
+ Out2 = lists:duplicate(Nl,$\n) ++ Out,
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, [Err2|Err], War, L+Nl, FN);
hash_mark ->
- expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L, FN);
+ expand(Rem, Out, SelfRef, Defs, IncFile, IncDir, Mio, check_all, Err, War, L, FN);
{pragma, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{ident, Rem2, Nl, Text} ->
Out2 = lists:duplicate(Nl,$\n)++Text++Out,
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, update_mio(Mio), check_all, Err, War, L+Nl, FN);
{not_recognised, {Removed, Rem2, Nl}} ->
Text = lists:reverse([$#|Command]),
RemovedS = lists:reverse([?space|detokenise(Removed)]),
Out2 = [$\n|RemovedS]++Text++Out,
+ Mio2 = update_mio(Mio),
case Command of
[X|_T] when ?is_upper(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_lower(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
[X|_T] when ?is_underline(X) ->
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, Err, War, L+Nl, FN);
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, Err, War, L+Nl, FN);
_ ->
Err2 = {FN, L, "invalid preprocessing directive name"},
- expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, check_all, [Err2|Err], War, L+Nl, FN)
+ expand(Rem2, Out2, SelfRef, Defs, IncFile, IncDir, Mio2, check_all, [Err2|Err], War, L+Nl, FN)
end;
Else ->
@@ -859,19 +861,19 @@ expand([{command,Command} | Rem], Out, SelfRef, Defs, IncFile, IncDir, check_all
end;
-expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__LINE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
LL = io_lib:format("~p",[L]),
- expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [LL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{var, "__FILE__"}|Rem], Out, SelfRef, Defs, IncFile, Mio, IncDir, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$",FN,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__DATE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{Y,M,D},{_H,_Mi,_S}} = calendar:universal_time(),
Date = io_lib:format("\"~s ~p ~p\"",[month(M),D,Y]),
- expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Date | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{{_Y,_M,_D},{H,Mi,S}} = calendar:universal_time(),
HS = if H < 10 -> "0"++integer_to_list(H);
true -> integer_to_list(H)
@@ -883,40 +885,40 @@ expand([{var, "__TIME__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err,
true -> integer_to_list(S)
end,
Time = io_lib:format("\"~s:~s:~s\"",[HS,MiS,SS]),
- expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [Time | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__INCLUDE_LEVEL__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
IL = io_lib:format("~p",[length(IncFile)-1]),
- expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [IL | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, "__BASE_FILE__"}|Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
[BF|_T] = lists:reverse(IncFile),
- expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, [$",BF,$" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{var, Var} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Out2, Err2, War2, Rem2, SelfRef2} =
source_line(Var, Rem, SelfRef, Defs, Err, War, L, FN),
- expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, IfCou, Err2, War2, L, FN);
+ expand(Rem2, [Out2 | Out], SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err2, War2, L, FN);
-expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{char, Char} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Char | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{number, Number} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Number | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{expanded, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [Str | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{self_ref, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
SelfRef2 = lists:delete(Str,SelfRef),
- expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+ expand(Rem, Out, SelfRef2, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
- expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN);
+expand([{string, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
+ expand(Rem, [$", Str, $" | Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L, FN);
-expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L, FN) ->
+expand([{string_part, Str} | Rem], Out, SelfRef, Defs, IncFile, IncDir, Mio, IfCou, Err, War, L, FN) ->
{Str2, Rem2, Nl} = expand_string_part([$"|Str], Rem),
- expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, IfCou, Err, War, L+Nl, FN).
+ expand(Rem2, [Str2| Out], SelfRef, Defs, IncFile, IncDir, update_mio(Mio), IfCou, Err, War, L+Nl, FN).
@@ -954,13 +956,14 @@ expand_string_part([{string_part, Str_part} | Rem], Str, Nl) ->
get_cmd_line_defs(Flags) ->
Adjusted = parse_cmd_line(Flags,[]),
- {_Out, _Err, _War, Defs, _IfCou} =
+ {_Out, _Err, _War, Defs, _IfCou, _Mio} =
expand(tokenise(Adjusted,""),
[],
[],
[],
[],
[],
+ #mio{},
check_all,
[],
[],
@@ -1030,10 +1033,10 @@ collect_undefine([C|Rest],Found) ->
%%======================================================================================
%%======================================================================================
-pp_command(Command, [space|File], Defs, IncDir, Err, War, L, FN) ->
- pp_command(Command, File, Defs, IncDir, Err, War, L, FN);
+pp_command(Command, [space|File], Defs, IncDir, Mio, Err, War, L, FN) ->
+ pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN);
-pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
+pp_command(Command, File, Defs, IncDir, Mio, Err, War, L, FN) ->
case Command of
%%----------------------------------------
@@ -1081,14 +1084,16 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
%% #include
%%----------------------------------------
"include" ->
- case include(File, IncDir) of
- {error, Rem, Nl, Err2} ->
- {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
- {error, Rem, Nl, Err2, NameNl} ->
- {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
- {ok, FileName, FileCont, Rem, Nl} ->
- {{include, ok}, FileName, FileCont, Rem, Nl, Err, War}
- end;
+ case include(File, IncDir, Mio) of
+ {error, Rem, Nl, Err2} ->
+ {{include, error}, Rem, Nl, [{FN, L, Err2}|Err], War};
+ {error, Rem, Nl, Err2, NameNl} ->
+ {{include, error}, Rem, Nl, [{FN, L+ NameNl, Err2}|Err], War};
+ {ok, FileNamePath, FileCont, Rem, Nl} ->
+ {{include, ok}, FileNamePath, FileCont, Rem, Nl, Err, War};
+ {skip, Rem} ->
+ {{include, skip}, Rem}
+ end;
%%----------------------------------------
%% #ifdef
@@ -1127,14 +1132,14 @@ pp_command(Command, File, Defs, IncDir, Err, War, L, FN) ->
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end;
{ok, Rem, Name, No_of_para, _Parameters, _Macro, Err2, War2, Nl} ->
case is_defined_before(Name, No_of_para, Defs) of
yes ->
{{ifndef, true}, Rem, Err2, War2, Nl};
no ->
- {{ifndef, false}, Rem, Err2, War2, Nl}
+ {{ifndef, false}, Name, Rem, Err2, War2, Nl}
end
end;
@@ -1408,29 +1413,32 @@ undef(_Rem) ->
%%===============================================================
%%===============================================================
-include(File, IncDir) ->
+include(File, IncDir, Mio) ->
case include2(File) of
- {ok, FileName, Rem, Nl, FileType} ->
- %% The error handling is lite strange just to make it compatible to gcc
- case {read_inc_file(FileName, IncDir), Nl, FileType} of
- {{ok, FileList, FileNamePath}, _, _} ->
- {ok, FileNamePath, FileList, Rem, Nl};
- {{error, Text}, _, own_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, Text}, 1, sys_file} ->
- NameNl = count_nl(FileName,0),
- Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
- {error, Rem, Nl, Error, NameNl};
- {{error, _Text}, _, sys_file} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
- end;
-
- {error, {_Removed, Rem, Nl}} ->
- {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ {ok, FileName, Rem, Nl, FileType} ->
+ Result = read_inc_file(FileName, IncDir, Mio),
+ case {Result, Nl, FileType} of
+ {{ok, FileNamePath, FileCont}, _, _} ->
+ {ok, FileNamePath, FileCont, Rem, Nl};
+ {skip, _, _} ->
+ {skip, Rem};
+ {{error, Text}, _, own_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, Text}, 1, sys_file} ->
+ NameNl = count_nl(FileName,0),
+ Error = lists:flatten(io_lib:format("~s: ~s",[FileName,Text])),
+ {error, Rem, Nl, Error, NameNl};
+ {{error, _Text}, _, sys_file} ->
+ {error, Rem, Nl, "`#include' expects \"FILENAME\" or <FILENAME>"}
+ end;
+ {error, {_Removed, Rem, Nl}} ->
+ {error, Rem, Nl, "`#include' expects \#FILENAME\" or <FILENAME>"}
end.
+
+
count_nl([],Nl) ->
Nl;
count_nl([$\n|T],Nl) ->
@@ -1909,18 +1917,37 @@ include_dir(Flags,IncDir) ->
%% Read a included file. Try current dir first then the IncDir list
%%===============================================================
-read_inc_file(FileName, IncDir) ->
- case catch file:read_file(FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, FileName};
+read_inc_file(FileName, IncDir, Mio) ->
+ case find_inc_file(FileName, IncDir) of
+ {ok, AbsFile} ->
+ %% is included before?
+ case lists:member(FileName, Mio#mio.included) of
+ false ->
+ case catch file:read_file(AbsFile) of
+ {ok, Bin} ->
+ FileList = binary_to_list(Bin),
+ {ok, AbsFile, FileList};
+ {error, Text} ->
+ {error, Text}
+ end;
+ true ->
+ skip
+ end;
+ {error, Text} ->
+ {error, Text}
+ end.
+
+find_inc_file(FileName, IncDir) ->
+ case catch file:read_file_info(FileName) of
+ {ok, _} ->
+ {ok, FileName};
{error, _} ->
- read_inc_file2(FileName, IncDir)
+ find_inc_file2(FileName, IncDir)
end.
-read_inc_file2(_FileName, []) ->
+find_inc_file2(_FileName, []) ->
{error, "No such file or directory"};
-read_inc_file2(FileName, [D|Rem]) ->
+find_inc_file2(FileName, [D|Rem]) ->
Dir = case lists:last(D) of
$/ ->
D;
@@ -1928,17 +1955,14 @@ read_inc_file2(FileName, [D|Rem]) ->
D++"/"
end,
- case catch file:read_file(Dir++FileName) of
- {ok, Bin} ->
- FileList = binary_to_list(Bin),
- {ok, FileList, Dir++FileName};
+ case catch file:read_file_info(Dir++FileName) of
+ {ok, _} ->
+ {ok, Dir++FileName};
{error, _} ->
- read_inc_file2(FileName, Rem)
+ find_inc_file2(FileName, Rem)
end.
-
-
%%===============================================================
%% Read parameters of a macro or a variable in a source line
%%===============================================================
@@ -2135,5 +2159,73 @@ month(11) -> "Nov";
month(12) -> "Dec".
+%% Multiple Include Optimization
+%%
+%% Algorithm described at:
+%% http://gcc.gnu.org/onlinedocs/cppinternals/Guard-Macros.html
+update_mio({include, FileName}, #mio{included=Inc}=Mio) ->
+ Mio#mio{valid=false, included=[FileName|Inc]};
+
+%% valid=false & cmacro=undefined indicates it is already decided this file is
+%% not subject to MIO
+update_mio(_, #mio{valid=false, depth=0, cmacro=undefined}=Mio) ->
+ Mio;
+
+%% if valid=true, there is no non-whitespace tokens before this ifndef
+update_mio({'ifndef', Macro}, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, cmacro=Macro, depth=1};
+
+%% detect any tokens before top level #ifndef
+update_mio(_, #mio{valid=true, depth=0, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false};
+
+%% If cmacro is alreay set, this is after the top level #endif
+update_mio({'ifndef', _}, #mio{valid=true, depth=0}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+
+%% non-top level conditional, just update depth
+update_mio({'ifndef', _}, #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{depth=D+1};
+update_mio('ifdef', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+update_mio('if', #mio{depth=D}=Mio) ->
+ Mio#mio{depth=D+1};
+
+%% top level #else #elif invalidates multiple include optimization
+update_mio('else', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('else', Mio) ->
+ Mio;
+update_mio('elif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=false, cmacro=undefined};
+update_mio('elif', Mio) ->
+ Mio;
+
+%% AT exit to top level, if the controlling macro is not set, this could be the
+%% end of a non-ifndef conditional block, or there were tokens before entering
+%% the #ifndef block. In either way, this invalidates the MIO
+%%
+%% It doesn't matter if `valid` is true at the time of exiting, it is set to
+%% true. This will be used to detect if more tokens are following the top
+%% level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=1}=Mio) ->
+ Mio#mio{valid=true, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 1 ->
+ Mio#mio{valid=true, depth=D-1};
+
+%%if more tokens are following the top level #endif.
+update_mio('endif', #mio{depth=1, cmacro=undefined}=Mio) ->
+ Mio#mio{valid=false, depth=0};
+update_mio('endif', #mio{depth=D}=Mio) when D > 0 ->
+ Mio#mio{valid=true, depth=D-1};
+update_mio(_, Mio) ->
+ Mio#mio{valid=false}.
+
+%% clear `valid`, this doesn't matter since #endif will restore it if
+%% appropriate
+update_mio(Mio) ->
+ Mio#mio{valid=false}.
diff --git a/lib/ic/src/ic_pragma.erl b/lib/ic/src/ic_pragma.erl
index 45cb64c9c8..7f2216b9dc 100644
--- a/lib/ic/src/ic_pragma.erl
+++ b/lib/ic/src/ic_pragma.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1998-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1998-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -1600,9 +1600,8 @@ remove_inheriters(S,RS,InheriterList) ->
[_OneOnly] ->
ReducedInhList;
_Other ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits,'_','_'}),
% CodeOptList =
% [X || X <- EtsList, element(1,X) == codeopt],
NoInheriters =remove_inheriters2(S,ReducedInhList,CleanList),
@@ -1648,9 +1647,8 @@ remove_inh([X],[Y],List,EtsList) ->
%%% from others in the list
%%%----------------------------------------------
remove_inherited(S,InheriterList) ->
- EtsList = ets:tab2list(S),
CleanList =
- [X || X <- EtsList, element(1,X) == inherits],
+ ets:match(S, {inherits, '_', '_'}),
remove_inherited(S,InheriterList,CleanList).
@@ -1694,11 +1692,8 @@ remove_inhed([X],[Y],List,EtsList) ->
%% are inherited from scope in the list
%%%----------------------------------------------
get_inherited(S,Scope,OpScopeList) ->
- EtsList = ets:tab2list(S),
- [[element(3,X)] || X <- EtsList,
- element(1,X) == inherits,
- element(2,X) == Scope,
- member([element(3,X)],OpScopeList)].
+ EtsList1 = ets:match(S, {inherits, Scope, '$1'}),
+ [X || X <- EtsList1, member(X, OpScopeList)].
@@ -1771,9 +1766,7 @@ inherits2(_X,Y,Z,EtsList) ->
%% false otherwise
%%
is_inherited_by(Interface1,Interface2,PragmaTab) ->
- FullList = ets:tab2list(PragmaTab),
- InheritsList =
- [X || X <- FullList, element(1,X) == inherits],
+ InheritsList = ets:match(PragmaTab, {inherits, '_', '_'}),
inherits(Interface2,Interface1,InheritsList).
diff --git a/lib/ic/vsn.mk b/lib/ic/vsn.mk
index 6d6c7fa625..6561ccd2a7 100644
--- a/lib/ic/vsn.mk
+++ b/lib/ic/vsn.mk
@@ -1 +1 @@
-IC_VSN = 4.2.26
+IC_VSN = 4.2.27
diff --git a/lib/jinterface/java_src/Makefile b/lib/jinterface/java_src/Makefile
index 755ef46a8b..19f99831eb 100644
--- a/lib/jinterface/java_src/Makefile
+++ b/lib/jinterface/java_src/Makefile
@@ -29,9 +29,7 @@ VSN=$(JINTERFACE_VSN)
# Common Macros
# ----------------------------------------------------
-# call recursive make explicitly below
-# due to separate makefiles for Ronja & OTP
-# SUB_DIRECTORIES = com/ericsson/otp/erlang
+SUB_DIRECTORIES = com/ericsson/otp/erlang
SPECIAL_TARGETS =
@@ -51,15 +49,5 @@ POM_SRC= $(POM_FILE).src
$(POM_TARGET): $(POM_SRC) ../vsn.mk
sed -e 's;%VSN%;$(VSN);' $< > $@
-# ----------------------------------------------------
-# Default Subdir Targets
-# ----------------------------------------------------
-
-.PHONY: debug opt instr release docs release_docs tests release_tests clean depend
-
-debug opt instr release docs release_docs tests release_tests clean depend: $(TARGET_FILES)
- set -e; set -x; \
- case "$(MAKE)" in *clearmake*) tflag="-T";; *) tflag="";; esac; \
- if test -f com/ericsson/otp/erlang/ignore_config_record.inf; then xflag=$$tflag; fi; \
- (cd com/ericsson/otp/erlang && $(MAKE) -f Makefile.otp $$xflag $@)
+include $(ERL_TOP)/make/otp_subdir.mk
diff --git a/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile.otp b/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile
index d0ff9cda34..e772a2b0a5 100644
--- a/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile.otp
+++ b/lib/jinterface/java_src/com/ericsson/otp/erlang/Makefile
@@ -96,7 +96,7 @@ docs:
# include $(ERL_TOP)/make/otp_release_targets.mk
release release_docs release_tests release_html:
- $(MAKE) -f Makefile.otp $(MFLAGS) RELEASE_PATH=$(RELEASE_PATH) $(TARGET_MAKEFILE) $@_spec
+ $(MAKE) $(MFLAGS) RELEASE_PATH=$(RELEASE_PATH) $(TARGET_MAKEFILE) $@_spec
release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/java_src/com/ericsson/otp/erlang
diff --git a/lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf b/lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf
deleted file mode 100644
index 0a5053eba3..0000000000
--- a/lib/jinterface/java_src/com/ericsson/otp/erlang/ignore_config_record.inf
+++ /dev/null
@@ -1 +0,0 @@
-This file makes clearmake use the -T switch for this subdirectory
diff --git a/lib/kernel/doc/src/gen_sctp.xml b/lib/kernel/doc/src/gen_sctp.xml
index b761b6bd83..c0126ed8c1 100644
--- a/lib/kernel/doc/src/gen_sctp.xml
+++ b/lib/kernel/doc/src/gen_sctp.xml
@@ -63,7 +63,6 @@
<item><seealso marker="#options">SCTP SOCKET OPTIONS</seealso></item>
<item><seealso marker="#examples">SCTP EXAMPLES</seealso></item>
<item><seealso marker="#seealso">SEE ALSO</seealso></item>
- <item><seealso marker="#authors">AUTHORS</seealso></item>
</list>
<marker id="types"></marker>
</section>
@@ -80,36 +79,18 @@
</desc>
</datatype>
<datatype>
- <name name="hostname"/>
- </datatype>
- <datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of an SCTP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="sctp_option"/>
+ <name name="option"/>
<desc>
<p>One of the
<seealso marker="#options">SCTP Socket Options.</seealso></p>
- <marker id="type-sctp_socket"></marker>
</desc>
</datatype>
<datatype>
- <name name="sctp_socket"/>
+ <name name="option_name"/>
+ <desc><marker id="type-sctp_socket"></marker></desc>
+ </datatype>
+ <datatype>
+ <name><marker id="type-sctp_socket">sctp_socket()</marker></name>
<desc>
<p>Socket identifier returned from <c>open/*</c>.</p>
<marker id="exports"></marker>
@@ -175,8 +156,8 @@
#sctp_assoc_change{
state = atom(),
error = atom(),
- outbound_streams = int(),
- inbound_streams = int(),
+ outbound_streams = integer(),
+ inbound_streams = integer(),
assoc_id = assoc_id()
} </pre>
<p>The number of outbound and inbound streams can be set by
@@ -300,6 +281,19 @@
The default <c><anno>IP</anno></c> and <c><anno>Port</anno></c> are <c>any</c>
and <c>0</c>, meaning bind to all local addresses on any
one free port.</p>
+
+ <p>Other options are:</p>
+ <taglist>
+ <tag><c>inet6</c></tag>
+ <item>
+ <p>Set up the socket for IPv6.</p>
+ </item>
+ <tag><c>inet</c></tag>
+ <item>
+ <p>Set up the socket for IPv4. This is the default.</p>
+ </item>
+ </taglist>
+
<p>A default set of socket <seealso marker="#options">options</seealso>
is used. In particular, the socket is opened in
<seealso marker="#option-binary">binary</seealso> and
@@ -350,7 +344,7 @@
#sctp_paddr_change{
addr = {ip_address(),port()},
state = atom(),
- error = int(),
+ error = integer(),
assoc_id = assoc_id()
} </pre>
<p>Indicates change of the status of the peer's IP address given by
@@ -387,7 +381,7 @@
<pre>
#sctp_send_failed{
flags = true | false,
- error = int(),
+ error = integer(),
info = #sctp_sndrcvinfo{},
assoc_id = assoc_id()
data = binary()
@@ -407,7 +401,7 @@
<item>
<pre>
#sctp_adaptation_event{
- adaptation_ind = int(),
+ adaptation_ind = integer(),
assoc_id = assoc_id()
} </pre>
<p>Delivered when a peer sends an Adaptation Layer Indication
@@ -505,7 +499,7 @@
</list>
<marker id="option-buffer"></marker>
</item>
- <tag><c>{buffer, int()}</c></tag>
+ <tag><c>{buffer, integer()}</c></tag>
<item>
<p>Determines the size of the user-level software buffer used by
the SCTP driver. Not to be confused with <c>sndbuf</c>
@@ -515,7 +509,7 @@
In fact, the <c>val(buffer)</c> is automatically set to
the above maximum when <c>sndbuf</c> or <c>recbuf</c> values are set.</p>
</item>
- <tag><c>{tos, int()}</c></tag>
+ <tag><c>{tos, integer()}</c></tag>
<item>
<p>Sets the Type-Of-Service field on the IP datagrams being sent,
to the given value, which effectively determines a prioritization
@@ -523,7 +517,7 @@
are system-dependent. TODO: we do not provide
symbolic names for these values yet.</p>
</item>
- <tag><c>{priority, int()}</c></tag>
+ <tag><c>{priority, integer()}</c></tag>
<item>
<p>A protocol-independent equivalent of <c>tos</c> above. Setting
priority implies setting tos as well.</p>
@@ -542,7 +536,7 @@
required for high-throughput servers).</p>
<marker id="option-linger"></marker>
</item>
- <tag><c>{linger, {true|false, int()}</c></tag>
+ <tag><c>{linger, {true|false, integer()}</c></tag>
<item>
<p>Determines the timeout in seconds for flushing unsent data in the
<c>gen_sctp:close/1</c> socket call. If the 1st component of the value
@@ -552,14 +546,14 @@
the flushing time-out in seconds.</p>
<marker id="option-sndbuf"></marker>
</item>
- <tag><c>{sndbuf, int()}</c></tag>
+ <tag><c>{sndbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* send buffer for this socket.
Sending errors would occur for datagrams larger than
<c>val(sndbuf)</c>. Setting this option also adjusts
the size of the driver buffer (see <c>buffer</c> above).</p>
</item>
- <tag><c>{recbuf, int()}</c></tag>
+ <tag><c>{recbuf, integer()}</c></tag>
<item>
<p>The size, in bytes, of the *kernel* recv buffer for this socket.
Sending errors would occur for datagrams larger than
@@ -571,9 +565,9 @@
<pre>
#sctp_rtoinfo{
assoc_id = assoc_id(),
- initial = int(),
- max = int(),
- min = int()
+ initial = integer(),
+ max = integer(),
+ min = integer()
} </pre>
<p>Determines re-transmission time-out parameters, in milliseconds,
for the association(s) given by <c>assoc_id</c>.
@@ -586,11 +580,11 @@
<pre>
#sctp_assocparams{
assoc_id = assoc_id(),
- asocmaxrxt = int(),
- number_peer_destinations = int(),
- peer_rwnd = int(),
- local_rwnd = int(),
- cookie_life = int()
+ asocmaxrxt = integer(),
+ number_peer_destinations = integer(),
+ peer_rwnd = integer(),
+ local_rwnd = integer(),
+ cookie_life = integer()
} </pre>
<p>Determines association parameters for the association(s) given by
<c>assoc_id</c>. <c>assoc_id = 0</c> (default) indicates
@@ -601,10 +595,10 @@
<item>
<pre>
#sctp_initmsg{
- num_ostreams = int(),
- max_instreams = int(),
- max_attempts = int(),
- max_init_timeo = int()
+ num_ostreams = integer(),
+ max_instreams = integer(),
+ max_attempts = integer(),
+ max_init_timeo = integer()
} </pre>
<p>Determines the default parameters which this socket attempts
to negotiate with its peer while establishing an association with it.
@@ -630,10 +624,11 @@
</list>
<p></p>
</item>
- <tag><c>{sctp_autoclose, int()|infinity}</c></tag>
+ <tag><c>{sctp_autoclose, integer() >= 0}</c></tag>
<item>
<p>Determines the time (in seconds) after which an idle association is
- automatically closed.</p>
+ automatically closed. <c>0</c> means that the association is
+ never automatically closed.</p>
</item>
<tag><c>{sctp_nodelay, true|false}</c></tag>
<item>
@@ -655,7 +650,7 @@
<p>Turns on|off automatic mapping of IPv4 addresses into IPv6 ones
(if the socket address family is AF_INET6).</p>
</item>
- <tag><c>{sctp_maxseg, int()}</c></tag>
+ <tag><c>{sctp_maxseg, integer()}</c></tag>
<item>
<p>Determines the maximum chunk size if message fragmentation is used.
If <c>0</c>, the chunk size is limited by the Path MTU only.</p>
@@ -693,7 +688,7 @@
<marker id="record-sctp_setadaptation"></marker>
<pre>
#sctp_setadaptation{
- adaptation_ind = int()
+ adaptation_ind = integer()
} </pre>
<p>When set, requests that the local endpoint uses the value given by
<c>adaptation_ind</c> as the Adaptation Indication parameter for
@@ -707,10 +702,10 @@
#sctp_paddrparams{
assoc_id = assoc_id(),
address = {IP, Port},
- hbinterval = int(),
- pathmaxrxt = int(),
- pathmtu = int(),
- sackdelay = int(),
+ hbinterval = integer(),
+ pathmaxrxt = integer(),
+ pathmtu = integer(),
+ sackdelay = integer(),
flags = list()
}
IP = ip_address()
@@ -771,14 +766,14 @@
<marker id="record-sctp_sndrcvinfo"></marker>
<pre>
#sctp_sndrcvinfo{
- stream = int(),
- ssn = int(),
+ stream = integer(),
+ ssn = integer(),
flags = list(),
- ppid = int(),
- context = int(),
- timetolive = int(),
- tsn = int(),
- cumtsn = int(),
+ ppid = integer(),
+ context = integer(),
+ timetolive = integer(),
+ tsn = integer(),
+ cumtsn = integer(),
assoc_id = assoc_id()
} </pre>
<p><c>#sctp_sndrcvinfo{}</c> is used both in this socket option, and as
@@ -853,7 +848,7 @@
<pre>
#sctp_assoc_value{
assoc_id = assoc_id(),
- assoc_value = int()
+ assoc_value = integer()
} </pre>
<p>Rarely used. Determines the ACK time
(given by <c>assoc_value</c> in milliseconds) for
@@ -866,12 +861,12 @@
#sctp_status{
assoc_id = assoc_id(),
state = atom(),
- rwnd = int(),
- unackdata = int(),
- penddata = int(),
- instrms = int(),
- outstrms = int(),
- fragmentation_point = int(),
+ rwnd = integer(),
+ unackdata = integer(),
+ penddata = integer(),
+ instrms = integer(),
+ outstrms = integer(),
+ fragmentation_point = integer(),
primary = #sctp_paddrinfo{}
} </pre>
<p>This option is read-only. It determines the status of
@@ -946,10 +941,10 @@
assoc_id = assoc_id(),
address = {IP, Port},
state = inactive | active,
- cwnd = int(),
- srtt = int(),
- rto = int(),
- mtu = int()
+ cwnd = integer(),
+ srtt = integer(),
+ rto = integer(),
+ mtu = integer()
}
IP = ip_address()
Port = port_number() </pre>
@@ -1119,7 +1114,6 @@ client_loop(S, Peer1, Port1, AssocId1, Peer2, Port2, AssocId2) -&gt;
<seealso marker="gen_udp">gen_udp(3)</seealso>,
<url href="http://www.rfc-archive.org/getrfc.php?rfc=2960">RFC2960</url> (Stream Control Transmission Protocol),
<url href="http://tools.ietf.org/html/draft-ietf-tsvwg-sctpsocket-13">Sockets API Extensions for SCTP.</url></p>
- <marker id="authors"></marker>
</section>
</erlref>
diff --git a/lib/kernel/doc/src/gen_tcp.xml b/lib/kernel/doc/src/gen_tcp.xml
index f1d42d9faa..8a5d40bb16 100644
--- a/lib/kernel/doc/src/gen_tcp.xml
+++ b/lib/kernel/doc/src/gen_tcp.xml
@@ -37,7 +37,7 @@
binary and closing the connection:</p>
<code type="none">
client() ->
- SomeHostInNet = "localhost" % to make it runnable on one machine
+ SomeHostInNet = "localhost", % to make it runnable on one machine
{ok, Sock} = gen_tcp:connect(SomeHostInNet, 5678,
[binary, {packet, 0}]),
ok = gen_tcp:send(Sock, "Some Data"),
@@ -65,25 +65,16 @@ do_recv(Sock, Bs) ->
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
- <name name="port_number"/>
+ <name name="connect_option"/>
</datatype>
<datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="listen_option"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -122,7 +113,7 @@ do_recv(Sock, Bs) ->
<item>
<p>Specify which local port number to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been connected without using
<c>gen_tcp</c>, use this option to pass the file
@@ -196,6 +187,10 @@ do_recv(Sock, Bs) ->
<p>If the host has several network interfaces, this option
specifies which one to listen on.</p>
</item>
+ <tag><c>{port, Port}</c></tag>
+ <item>
+ <p>Specify which local port number to use.</p>
+ </item>
<tag><c>{fd, Fd}</c></tag>
<item>
<p>If a socket has somehow been connected without using
diff --git a/lib/kernel/doc/src/gen_udp.xml b/lib/kernel/doc/src/gen_udp.xml
index c0e783f508..daa9b7d887 100644
--- a/lib/kernel/doc/src/gen_udp.xml
+++ b/lib/kernel/doc/src/gen_udp.xml
@@ -36,25 +36,10 @@
<datatypes>
<datatype>
- <name name="hostname"/>
+ <name name="option"/>
</datatype>
<datatype>
- <name name="ip_address"/>
- <desc>
- <p>Represents an address of a TCP socket.
- It is a tuple as explained in
- <seealso marker="inet">inet(3)</seealso>.</p>
- </desc>
- </datatype>
- <datatype>
- <name name="port_number"/>
- </datatype>
- <datatype>
- <name name="posix"/>
- <desc>
- <p>See <seealso marker="inet#error_codes">
- inet(3); POSIX Error Codes</seealso>.</p>
- </desc>
+ <name name="option_name"/>
</datatype>
<datatype>
<name><marker id="type-socket">socket()</marker></name>
@@ -87,7 +72,7 @@
<p>If the host has several network interfaces, this option
specifies which one to use.</p>
</item>
- <tag><c>{fd, int()}</c></tag>
+ <tag><c>{fd, integer() >= 0}</c></tag>
<item>
<p>If a socket has somehow been opened without using
<c>gen_udp</c>, use this option to pass the file
diff --git a/lib/kernel/doc/src/inet.xml b/lib/kernel/doc/src/inet.xml
index fd843b00d9..b36c28e027 100644
--- a/lib/kernel/doc/src/inet.xml
+++ b/lib/kernel/doc/src/inet.xml
@@ -105,6 +105,9 @@ fe80::204:acff:fe17:bf38
<name name="ip6_address"/>
</datatype>
<datatype>
+ <name name="port_number"/>
+ </datatype>
+ <datatype>
<name name="posix"/>
<desc><p>An atom which is named from the Posix error codes
used in Unix, and in the runtime libraries of most
@@ -119,7 +122,7 @@ fe80::204:acff:fe17:bf38
</desc>
</datatype>
<datatype>
- <name name="family_option"/>
+ <name name="address_family"/>
</datatype>
</datatypes>
@@ -250,26 +253,15 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getopts(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getopts" arity="2"/>
<fsummary>Get one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt | RawOptReq]</v>
- <v>Opt = atom()</v>
- <v>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueSpec = ValueSize | ValueBin</v>
- <v>ValueSize = integer()</v>
- <v>ValueBin = binary()</v>
- <v>OptionValues = [{Opt, Val} | {raw, Protocol, OptionNum, ValueBin}]</v>
- </type>
<type name="socket_getopt"/>
+ <type name="socket_setopt"/>
<desc>
<p>Gets one or more options for a socket.
See <seealso marker="#setopts/2">setopts/2</seealso>
for a list of available options.</p>
- <p>The number of elements in the returned <c>OptionValues</c>
+ <p>The number of elements in the returned <c><anno>OptionValues</anno></c>
list does not necessarily correspond to the number of options
asked for. If the operating system fails to support an option,
it is simply left out in the returned list. An error tuple is only
@@ -277,12 +269,12 @@ fe80::204:acff:fe17:bf38
(i.e. the socket is closed or the buffer size in a raw request
is too large). This behavior is kept for backward
compatibility reasons.</p>
- <p>A <c>RawOptReq</c> can be used to get information about
+ <p>A raw option request <c>RawOptReq = {raw, Protocol, OptionNum, ValueSpec}</c> can be used to get information about
socket options not (explicitly) supported by the emulator. The
use of raw socket options makes the code non portable, but
allows the Erlang programmer to take advantage of unusual features
present on the current platform.</p>
- <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
+ <p>The <c>RawOptReq</c> consists of the tag <c>raw</c> followed
by the protocol level, the option number and either a binary
or the size, in bytes, of the
buffer in which the option value is to be stored. A binary
@@ -325,19 +317,14 @@ fe80::204:acff:fe17:bf38
</func>
<func>
- <name>getstat(Socket)</name>
- <name>getstat(Socket, Options) -> {ok, OptionValues} | {error, posix()}</name>
+ <name name="getstat" arity="1"/>
+ <name name="getstat" arity="2"/>
<fsummary>Get one or more statistic options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [Opt]</v>
- <v>OptionValues = [{Opt, Val}]</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="stat_option"/>
<desc>
<p>Gets one or more statistic options for a socket.</p>
- <p><c>getstat(Socket)</c> is equivalent to
- <c>getstat(Socket,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
+ <p><c>getstat(<anno>Socket</anno>)</c> is equivalent to
+ <c>getstat(<anno>Socket</anno>,&nbsp;[recv_avg,&nbsp;recv_cnt,&nbsp;recv_dvi,&nbsp;recv_max,&nbsp;recv_oct,&nbsp;send_avg,&nbsp;send_cnt,&nbsp;send_dvi,&nbsp;send_max,&nbsp;send_oct])</c></p>
<p>The following options are available:</p>
<taglist>
<tag><c>recv_avg</c></tag>
@@ -394,12 +381,8 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>port(Socket) -> {ok, Port} | {error, any()}</name>
+ <name name="port" arity="1"/>
<fsummary>Return the local port number for a socket</fsummary>
- <type>
- <v>Socket = socket()</v>
- <v>Port = integer()</v>
- </type>
<desc>
<p>Returns the local port number for a socket.</p>
</desc>
@@ -412,16 +395,9 @@ fe80::204:acff:fe17:bf38
</desc>
</func>
<func>
- <name>setopts(Socket, Options) -> ok | {error, posix()}</name>
+ <name name="setopts" arity="2"/>
<fsummary>Set one or more options for a socket</fsummary>
- <type>
- <v>Socket = term()</v>
- <v>Options = [{Opt, Val} | {raw, Protocol, Option, ValueBin}]</v>
- <v>Protocol = integer()</v>
- <v>OptionNum = integer()</v>
- <v>ValueBin = binary()</v>
- <v>&nbsp;Opt, Val -- see below</v>
- </type>
+ <type name="socket_setopt"/>
<desc>
<p>Sets one or more options for a socket. The following options
are available:</p>
diff --git a/lib/kernel/src/code_server.erl b/lib/kernel/src/code_server.erl
index 4a1fc7df34..85bbff9cc3 100644
--- a/lib/kernel/src/code_server.erl
+++ b/lib/kernel/src/code_server.erl
@@ -1379,8 +1379,12 @@ absname_vr([[X, $:]|Name], _, _AbsBase) ->
%% Kill all processes running code from *old* Module, and then purge the
%% module. Return true if any processes killed, else false.
-do_purge(Mod) ->
- do_purge(processes(), to_atom(Mod), false).
+do_purge(Mod0) ->
+ Mod = to_atom(Mod0),
+ case erlang:check_old_code(Mod) of
+ false -> false;
+ true -> do_purge(processes(), Mod, false)
+ end.
do_purge([P|Ps], Mod, Purged) ->
case erlang:check_process_code(P, Mod) of
@@ -1399,16 +1403,19 @@ do_purge([], Mod, Purged) ->
Purged.
%% do_soft_purge(Module)
-%% Purge old code only if no procs remain that run old code
+%% Purge old code only if no procs remain that run old code.
%% Return true in that case, false if procs remain (in this
%% case old code is not purged)
do_soft_purge(Mod) ->
- catch do_soft_purge(processes(), Mod).
+ case erlang:check_old_code(Mod) of
+ false -> true;
+ true -> do_soft_purge(processes(), Mod)
+ end.
do_soft_purge([P|Ps], Mod) ->
case erlang:check_process_code(P, Mod) of
- true -> throw(false);
+ true -> false;
false -> do_soft_purge(Ps, Mod)
end;
do_soft_purge([], Mod) ->
diff --git a/lib/kernel/src/error_handler.erl b/lib/kernel/src/error_handler.erl
index e1f99bf417..a67b11a888 100644
--- a/lib/kernel/src/error_handler.erl
+++ b/lib/kernel/src/error_handler.erl
@@ -88,12 +88,12 @@ int() -> int.
-spec crash(atom(), [term()]) -> no_return().
crash(Fun, Args) ->
- crash({Fun,Args}).
+ crash({Fun,Args,[]}).
-spec crash(atom(), atom(), arity()) -> no_return().
crash(M, F, A) ->
- crash({M,F,A}).
+ crash({M,F,A,[]}).
-spec crash(tuple()) -> no_return().
@@ -101,7 +101,8 @@ crash(Tuple) ->
try erlang:error(undef)
catch
error:undef ->
- erlang:raise(error, undef, [Tuple|tl(erlang:get_stacktrace())])
+ Stk = [Tuple|tl(erlang:get_stacktrace())],
+ erlang:raise(error, undef, Stk)
end.
%% If the code_server has not been started yet dynamic code loading
@@ -127,7 +128,7 @@ ensure_loaded(Module) ->
-spec stub_function(atom(), atom(), [_]) -> no_return().
stub_function(Mod, Func, Args) ->
- exit({undef,[{Mod,Func,Args}]}).
+ exit({undef,[{Mod,Func,Args,[]}]}).
check_inheritance(Module, Args) ->
Attrs = erlang:get_module_info(Module, attributes),
diff --git a/lib/kernel/src/file.erl b/lib/kernel/src/file.erl
index 5e4e1b0ba8..706c60caaf 100644
--- a/lib/kernel/src/file.erl
+++ b/lib/kernel/src/file.erl
@@ -1163,7 +1163,7 @@ path_open_first([Path|Rest], Name, Mode, LastError) ->
{error, _} = Error ->
Error;
FilePath ->
- FileName = filename:join(FilePath, Name),
+ FileName = fname_join(FilePath, Name),
case open(FileName, Mode) of
{ok, Fd} ->
{ok, Fd, FileName};
@@ -1176,6 +1176,11 @@ path_open_first([Path|Rest], Name, Mode, LastError) ->
path_open_first([], _Name, _Mode, LastError) ->
{error, LastError}.
+fname_join(".", Name) ->
+ Name;
+fname_join(Dir, Name) ->
+ filename:join(Dir, Name).
+
%%%-----------------------------------------------------------------
%%% Utility functions.
diff --git a/lib/kernel/src/gen_sctp.erl b/lib/kernel/src/gen_sctp.erl
index 004f03f231..c9a849eca7 100644
--- a/lib/kernel/src/gen_sctp.erl
+++ b/lib/kernel/src/gen_sctp.erl
@@ -34,54 +34,84 @@
-export([controlling_process/2]).
-opaque assoc_id() :: term().
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
--type sctp_option() ::
- {mode, list | binary} | list | binary
- | {active, true | false | once}
- | {buffer, non_neg_integer()}
- | {tos, integer()}
- | {priority, integer()}
- | {dontroute, boolean()}
- | {reuseaddr, boolean()}
- | {linger, {boolean(), non_neg_integer()}}
- | {sndbuf, non_neg_integer()}
- | {recbuf, non_neg_integer()}
- | {sctp_rtoinfo, #sctp_rtoinfo{}}
- | {sctp_associnfo, #sctp_assocparams{}}
- | {sctp_initmsg, #sctp_initmsg{}}
- | {sctp_autoclose, timeout()}
- | {sctp_nodelay, boolean()}
- | {sctp_disable_fragments, boolean()}
- | {sctp_i_want_mapped_v4_addr, boolean()}
- | {sctp_maxseg, non_neg_integer()}
- | {sctp_primary_addr, #sctp_prim{}}
- | {sctp_set_peer_primary_addr, #sctp_setpeerprim{}}
- | {sctp_adaptation_layer, #sctp_setadaptation{}}
- | {sctp_peer_addr_params, #sctp_paddrparams{}}
- | {sctp_default_send_param, #sctp_sndrcvinfo{}}
- | {sctp_events, #sctp_event_subscribe{}}
- | {sctp_delayed_ack_time, #sctp_assoc_value{}}
- | {sctp_status, #sctp_status{}}
- | {sctp_get_peer_addr_info, #sctp_paddrinfo{}}.
--opaque sctp_socket() :: port().
-
--spec open() -> {ok, Socket} | {error, posix()} when
+-type option() ::
+ {active, true | false | once} |
+ {buffer, non_neg_integer()} |
+ {dontroute, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {mode, list | binary} | list | binary |
+ {priority, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sctp_adaptation_layer, #sctp_setadaptation{}} |
+ {sctp_associnfo, #sctp_assocparams{}} |
+ {sctp_autoclose, non_neg_integer()} |
+ {sctp_default_send_param, #sctp_sndrcvinfo{}} |
+ {sctp_delayed_ack_time, #sctp_assoc_value{}} |
+ {sctp_disable_fragments, boolean()} |
+ {sctp_events, #sctp_event_subscribe{}} |
+ {sctp_get_peer_addr_info, #sctp_paddrinfo{}} |
+ {sctp_i_want_mapped_v4_addr, boolean()} |
+ {sctp_initmsg, #sctp_initmsg{}} |
+ {sctp_maxseg, non_neg_integer()} |
+ {sctp_nodelay, boolean()} |
+ {sctp_peer_addr_params, #sctp_paddrparams{}} |
+ {sctp_primary_addr, #sctp_prim{}} |
+ {sctp_rtoinfo, #sctp_rtoinfo{}} |
+ {sctp_set_peer_primary_addr, #sctp_setpeerprim{}} |
+ {sctp_status, #sctp_status{}} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ buffer |
+ dontroute |
+ linger |
+ mode |
+ priority |
+ recbuf |
+ reuseaddr |
+ sctp_adaptation_layer |
+ sctp_associnfo |
+ sctp_autoclose |
+ sctp_default_send_param |
+ sctp_delayed_ack_time |
+ sctp_disable_fragments |
+ sctp_events |
+ sctp_get_peer_addr_info |
+ sctp_i_want_mapped_v4_addr |
+ sctp_initmsg |
+ sctp_maxseg |
+ sctp_nodelay |
+ sctp_peer_addr_params |
+ sctp_primary_addr |
+ sctp_rtoinfo |
+ sctp_set_peer_primary_addr |
+ sctp_status |
+ sndbuf |
+ tos.
+-type sctp_socket() :: port().
+
+-export_type([option/0, option_name/0]).
+
+-spec open() -> {ok, Socket} | {error, inet:posix()} when
Socket :: sctp_socket().
open() ->
open([]).
--spec open(Port) -> {ok, Socket} | {error, posix()} when
- Port :: port_number(),
+-spec open(Port) -> {ok, Socket} | {error, inet:posix()} when
+ Port :: inet:port_number(),
Socket :: sctp_socket();
- (Opts) -> {ok, Socket} | {error, posix()} when
+ (Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Opts) when is_list(Opts) ->
@@ -98,11 +128,15 @@ open(Port) when is_integer(Port) ->
open(X) ->
erlang:error(badarg, [X]).
--spec open(Port, Opts) -> {ok, Socket} | {error, posix()} when
+-spec open(Port, Opts) -> {ok, Socket} | {error, inet:posix()} when
Opts :: [Opt],
- Opt :: {ip,IP} | {ifaddr,IP} | {port,Port} | sctp_option(),
- IP :: ip_address() | any | loopback,
- Port :: port_number(),
+ Opt :: {ip,IP}
+ | {ifaddr,IP}
+ | inet:address_family()
+ | {port,Port}
+ | option(),
+ IP :: inet:ip_address() | any | loopback,
+ Port :: inet:port_number(),
Socket :: sctp_socket().
open(Port, Opts) when is_integer(Port), is_list(Opts) ->
@@ -110,7 +144,7 @@ open(Port, Opts) when is_integer(Port), is_list(Opts) ->
open(Port, Opts) ->
erlang:error(badarg, [Port,Opts]).
--spec close(Socket) -> ok | {error, posix()} when
+-spec close(Socket) -> ok | {error, inet:posix()} when
Socket :: sctp_socket().
close(S) when is_port(S) ->
@@ -138,22 +172,22 @@ listen(S, Flag) when is_port(S), is_boolean(Flag) ->
listen(S, Flag) ->
erlang:error(badarg, [S,Flag]).
--spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, posix()} when
+-spec connect(Socket, Addr, Port, Opts) -> {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Assoc :: #sctp_assoc_change{}.
connect(S, Addr, Port, Opts) ->
connect(S, Addr, Port, Opts, infinity).
-spec connect(Socket, Addr, Port, Opts, Timeout) ->
- {ok, Assoc} | {error, posix()} when
+ {ok, Assoc} | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [Opt :: sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [Opt :: option()],
Timeout :: timeout(),
Assoc :: #sctp_assoc_change{}.
@@ -166,21 +200,21 @@ connect(S, Addr, Port, Opts, Timeout) ->
end.
-spec connect_init(Socket, Addr, Port, Opts) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()].
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()].
connect_init(S, Addr, Port, Opts) ->
connect_init(S, Addr, Port, Opts, infinity).
-spec connect_init(Socket, Addr, Port, Opts, Timeout) ->
- ok | {error, posix()} when
+ ok | {error, inet:posix()} when
Socket :: sctp_socket(),
- Addr :: ip_address() | hostname(),
- Port :: port_number(),
- Opts :: [sctp_option()],
+ Addr :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Opts :: [option()],
Timeout :: timeout().
connect_init(S, Addr, Port, Opts, Timeout) ->
@@ -232,7 +266,7 @@ eof(S, #sctp_assoc_change{assoc_id=AssocId}) when is_port(S) ->
eof(S, Assoc) ->
erlang:error(badarg, [S,Assoc]).
--spec abort(Socket, Assoc) -> ok | {error, posix()} when
+-spec abort(Socket, Assoc) -> ok | {error, inet:posix()} when
Socket :: sctp_socket(),
Assoc :: #sctp_assoc_change{}.
@@ -294,13 +328,13 @@ send(S, AssocChange, Stream, Data) ->
-spec recv(Socket) -> {ok, {FromIP, FromPort, AncData, Data}}
| {error, Reason} when
Socket :: sctp_socket(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
@@ -311,13 +345,13 @@ recv(S) ->
| {error, Reason} when
Socket :: sctp_socket(),
Timeout :: timeout(),
- FromIP :: ip_address(),
- FromPort :: port_number(),
+ FromIP :: inet:ip_address(),
+ FromPort :: inet:port_number(),
AncData :: [#sctp_sndrcvinfo{}],
Data :: binary() | string() | #sctp_sndrcvinfo{}
| #sctp_assoc_change{} | #sctp_paddr_change{}
| #sctp_adaptation_event{},
- Reason :: posix() | #sctp_send_failed{} | #sctp_paddr_change{}
+ Reason :: inet:posix() | #sctp_send_failed{} | #sctp_paddr_change{}
| #sctp_pdapi_event{} | #sctp_remote_error{}
| #sctp_shutdown_event{}.
diff --git a/lib/kernel/src/gen_tcp.erl b/lib/kernel/src/gen_tcp.erl
index bee61ca84a..df326b59d6 100644
--- a/lib/kernel/src/gen_tcp.erl
+++ b/lib/kernel/src/gen_tcp.erl
@@ -28,34 +28,108 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {bit8, clear | set | on | off} |
+ {buffer, non_neg_integer()} |
+ {delay_send, boolean()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {exit_on_close, boolean()} |
+ {header, non_neg_integer()} |
+ {high_watermark, non_neg_integer()} |
+ {keepalive, boolean()} |
+ {linger, {boolean(), non_neg_integer()}} |
+ {low_watermark, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {nodelay, boolean()} |
+ {packet,
+ 0 | 1 | 2 | 4 | raw | sunrm | asn1 |
+ cdr | fcgi | line | tpkt | http | httph | http_bin | httph_bin } |
+ {packet_size, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {send_timeout, non_neg_integer() | infinity} |
+ {send_timeout_close, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ bit8 |
+ buffer |
+ delay_send |
+ deliver |
+ dontroute |
+ exit_on_close |
+ header |
+ high_watermark |
+ keepalive |
+ linger |
+ low_watermark |
+ mode |
+ nodelay |
+ packet |
+ packet_size |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ recbuf |
+ reuseaddr |
+ send_timeout |
+ send_timeout_close |
+ sndbuf |
+ tos.
+-type connect_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {tcp_module, module()} |
+ option().
+-type listen_option() ::
+ {ip, inet:ip_address()} |
+ {fd, Fd :: non_neg_integer()} |
+ {ifaddr, inet:ip_address()} |
+ inet:address_family() |
+ {port, inet:port_number()} |
+ {backlog, B :: non_neg_integer()} |
+ {tcp_module, module()} |
+ option().
-type socket() :: port().
+-export_type([option/0, option_name/0, connect_option/0, listen_option/0]).
+
%%
%% Connect a socket
%%
-spec connect(Address, Port, Options) -> {ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts) ->
connect(Address,Port,Opts,infinity).
-spec connect(Address, Port, Options, Timeout) ->
{ok, Socket} | {error, Reason} when
- Address :: ip_address() | hostname(),
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
+ Options :: [connect_option()],
Timeout :: timeout(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
connect(Address, Port, Opts, Time) ->
Timer = inet:start_timer(Time),
@@ -97,10 +171,10 @@ try_connect([], _Port, _Opts, _Timer, _Mod, Err) ->
%%
-spec listen(Port, Options) -> {ok, ListenSocket} | {error, Reason} when
- Port :: port_number(),
- Options :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Options :: [listen_option()],
ListenSocket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
listen(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -119,7 +193,7 @@ listen(Port, Opts) ->
-spec accept(ListenSocket) -> {ok, Socket} | {error, Reason} when
ListenSocket :: socket(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S) ->
case inet_db:lookup_socket(S) of
@@ -133,7 +207,7 @@ accept(S) ->
ListenSocket :: socket(),
Timeout :: timeout(),
Socket :: socket(),
- Reason :: closed | timeout | posix().
+ Reason :: closed | timeout | inet:posix().
accept(S, Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -150,7 +224,7 @@ accept(S, Time) when is_port(S) ->
-spec shutdown(Socket, How) -> ok | {error, Reason} when
Socket :: socket(),
How :: read | write | read_write,
- Reason :: posix().
+ Reason :: inet:posix().
shutdown(S, How) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -177,7 +251,7 @@ close(S) ->
-spec send(Socket, Packet) -> ok | {error, Reason} when
Socket :: socket(),
Packet :: string() | binary(),
- Reason :: posix().
+ Reason :: inet:posix().
send(S, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -195,7 +269,7 @@ send(S, Packet) when is_port(S) ->
Socket :: socket(),
Length :: non_neg_integer(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length) when is_port(S) ->
@@ -211,7 +285,7 @@ recv(S, Length) when is_port(S) ->
Length :: non_neg_integer(),
Timeout :: timeout(),
Packet :: string() | binary() | HttpPacket,
- Reason :: closed | posix(),
+ Reason :: closed | inet:posix(),
HttpPacket :: term().
recv(S, Length, Time) when is_port(S) ->
@@ -237,7 +311,7 @@ unrecv(S, Data) when is_port(S) ->
-spec controlling_process(Socket, Pid) -> ok | {error, Reason} when
Socket :: socket(),
Pid :: pid(),
- Reason :: closed | not_owner | posix().
+ Reason :: closed | not_owner | inet:posix().
controlling_process(S, NewOwner) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/gen_udp.erl b/lib/kernel/src/gen_udp.erl
index 7d14615c04..554f4ece4a 100644
--- a/lib/kernel/src/gen_udp.erl
+++ b/lib/kernel/src/gen_udp.erl
@@ -25,25 +25,74 @@
-include("inet_int.hrl").
--type hostname() :: inet:hostname().
--type ip_address() :: inet:ip_address().
--type port_number() :: 0..65535.
--type posix() :: inet:posix().
+-type option() ::
+ {active, true | false | once} |
+ {add_membership, {inet:ip_address(), inet:ip_address()}} |
+ {broadcast, boolean()} |
+ {buffer, non_neg_integer()} |
+ {deliver, port | term} |
+ {dontroute, boolean()} |
+ {drop_membership, {inet:ip_address(), inet:ip_address()}} |
+ {header, non_neg_integer()} |
+ {mode, list | binary} | list | binary |
+ {multicast_if, inet:ip_address()} |
+ {multicast_loop, boolean()} |
+ {multicast_ttl, non_neg_integer()} |
+ {priority, non_neg_integer()} |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueBin :: binary()} |
+ {read_packets, non_neg_integer()} |
+ {recbuf, non_neg_integer()} |
+ {reuseaddr, boolean()} |
+ {sndbuf, non_neg_integer()} |
+ {tos, non_neg_integer()}.
+-type option_name() ::
+ active |
+ broadcast |
+ buffer |
+ deliver |
+ dontroute |
+ header |
+ mode |
+ multicast_if |
+ multicast_loop |
+ multicast_ttl |
+ priority |
+ {raw,
+ Protocol :: non_neg_integer(),
+ OptionNum :: non_neg_integer(),
+ ValueSpec :: (ValueSize :: non_neg_integer()) |
+ (ValueBin :: binary())} |
+ read_packets |
+ recbuf |
+ reuseaddr |
+ sndbuf |
+ tos.
-type socket() :: port().
+-export_type([option/0, option_name/0]).
+
-spec open(Port) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
+ Port :: inet:port_number(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port) ->
open(Port, []).
-spec open(Port, Opts) -> {ok, Socket} | {error, Reason} when
- Port :: port_number(),
- Opts :: [Opt :: term()],
+ Port :: inet:port_number(),
+ Opts :: [Option],
+ Option :: {ip, inet:ip_address()}
+ | {fd, non_neg_integer()}
+ | {ifaddr, inet:ip_address()}
+ | inet:address_family()
+ | {port, inet:port_number()}
+ | option(),
Socket :: socket(),
- Reason :: posix().
+ Reason :: inet:posix().
open(Port, Opts) ->
Mod = mod(Opts, undefined),
@@ -58,10 +107,10 @@ close(S) ->
-spec send(Socket, Address, Port, Packet) -> ok | {error, Reason} when
Socket :: socket(),
- Address :: ip_address() | hostname(),
- Port :: port_number(),
+ Address :: inet:ip_address() | inet:hostname(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
send(S, Address, Port, Packet) when is_port(S) ->
case inet_db:lookup_socket(S) of
@@ -92,10 +141,10 @@ send(S, Packet) when is_port(S) ->
{ok, {Address, Port, Packet}} | {error, Reason} when
Socket :: socket(),
Length :: non_neg_integer(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len) when is_port(S), is_integer(Len) ->
case inet_db:lookup_socket(S) of
@@ -110,10 +159,10 @@ recv(S,Len) when is_port(S), is_integer(Len) ->
Socket :: socket(),
Length :: non_neg_integer(),
Timeout :: timeout(),
- Address :: ip_address(),
- Port :: port_number(),
+ Address :: inet:ip_address(),
+ Port :: inet:port_number(),
Packet :: string() | binary(),
- Reason :: not_owner | posix().
+ Reason :: not_owner | inet:posix().
recv(S,Len,Time) when is_port(S) ->
case inet_db:lookup_socket(S) of
diff --git a/lib/kernel/src/inet.erl b/lib/kernel/src/inet.erl
index 5649188c38..48a6f3db65 100644
--- a/lib/kernel/src/inet.erl
+++ b/lib/kernel/src/inet.erl
@@ -63,8 +63,9 @@
%% timer interface
-export([start_timer/1, timeout/1, timeout/2, stop_timer/1]).
--export_type([family_option/0, hostent/0, hostname/0, ip4_address/0,
- ip6_address/0, ip_address/0, posix/0, socket/0]).
+-export_type([address_family/0, hostent/0, hostname/0, ip4_address/0,
+ ip6_address/0, ip_address/0, posix/0, socket/0,
+ port_number/0]).
%% imports
-import(lists, [append/1, duplicate/2, filter/2, foldl/3]).
@@ -87,98 +88,15 @@
-type ip6_address() :: {0..65535,0..65535,0..65535,0..65535,
0..65535,0..65535,0..65535,0..65535}.
-type ip_address() :: ip4_address() | ip6_address().
--type ip_port() :: 0..65535.
+-type port_number() :: 0..65535.
-type posix() :: exbadport | exbadseq | file:posix().
-type socket() :: port().
-type socket_setopt() ::
- {'raw', non_neg_integer(), non_neg_integer(), binary()} |
- %% TCP/UDP options
- {'reuseaddr', boolean()} |
- {'keepalive', boolean()} |
- {'dontroute', boolean()} |
- {'linger', {boolean(), non_neg_integer()}} |
- {'broadcast', boolean()} |
- {'sndbuf', non_neg_integer()} |
- {'recbuf', non_neg_integer()} |
- {'priority', non_neg_integer()} |
- {'tos', non_neg_integer()} |
- {'nodelay', boolean()} |
- {'multicast_ttl', non_neg_integer()} |
- {'multicast_loop', boolean()} |
- {'multicast_if', ip_address()} |
- {'add_membership', {ip_address(), ip_address()}} |
- {'drop_membership', {ip_address(), ip_address()}} |
- {'header', non_neg_integer()} |
- {'buffer', non_neg_integer()} |
- {'active', boolean() | 'once'} |
- {'packet',
- 0 | 1 | 2 | 4 | 'raw' | 'sunrm' | 'asn1' |
- 'cdr' | 'fcgi' | 'line' | 'tpkt' | 'http' | 'httph' | 'http_bin' | 'httph_bin' } |
- {'mode', 'list' | 'binary'} |
- {'port', 'port', 'term'} |
- {'exit_on_close', boolean()} |
- {'low_watermark', non_neg_integer()} |
- {'high_watermark', non_neg_integer()} |
- {'bit8', 'clear' | 'set' | 'on' | 'off'} |
- {'send_timeout', non_neg_integer() | 'infinity'} |
- {'send_timeout_close', boolean()} |
- {'delay_send', boolean()} |
- {'packet_size', non_neg_integer()} |
- {'read_packets', non_neg_integer()} |
- %% SCTP options
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- {'sctp_associnfo', #sctp_assocparams{}} |
- {'sctp_initmsg', #sctp_initmsg{}} |
- {'sctp_nodelay', boolean()} |
- {'sctp_autoclose', non_neg_integer()} |
- {'sctp_disable_fragments', boolean()} |
- {'sctp_i_want_mapped_v4_addr', boolean()} |
- {'sctp_maxseg', non_neg_integer()} |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- {'sctp_events', #sctp_event_subscribe{}} |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
+ gen_sctp:option() | gen_tcp:option() | gen_udp:option().
-type socket_getopt() ::
- {'raw',
- non_neg_integer(), non_neg_integer(), binary()|non_neg_integer()} |
- %% TCP/UDP options
- 'reuseaddr' | 'keepalive' | 'dontroute' | 'linger' |
- 'broadcast' | 'sndbuf' | 'recbuf' | 'priority' | 'tos' | 'nodelay' |
- 'multicast_ttl' | 'multicast_loop' | 'multicast_if' |
- 'add_membership' | 'drop_membership' |
- 'header' | 'buffer' | 'active' | 'packet' | 'mode' | 'port' |
- 'exit_on_close' | 'low_watermark' | 'high_watermark' | 'bit8' |
- 'send_timeout' | 'send_timeout_close' |
- 'delay_send' | 'packet_size' | 'read_packets' |
- %% SCTP options
- {'sctp_status', #sctp_status{}} |
- 'sctp_get_peer_addr_info' |
- {'sctp_get_peer_addr_info', #sctp_status{}} |
- 'sctp_rtoinfo' |
- {'sctp_rtoinfo', #sctp_rtoinfo{}} |
- 'sctp_associnfo' |
- {'sctp_associnfo', #sctp_assocparams{}} |
- 'sctp_initmsg' |
- {'sctp_initmsg', #sctp_initmsg{}} |
- 'sctp_nodelay' | 'sctp_autoclose' | 'sctp_disable_fragments' |
- 'sctp_i_want_mapped_v4_addr' | 'sctp_maxseg' |
- {'sctp_primary_addr', #sctp_prim{}} |
- {'sctp_set_peer_primary_addr', #sctp_setpeerprim{}} |
- 'sctp_adaptation_layer' |
- {'sctp_adaptation_layer', #sctp_setadaptation{}} |
- {'sctp_peer_addr_params', #sctp_paddrparams{}} |
- 'sctp_default_send_param' |
- {'sctp_default_send_param', #sctp_sndrcvinfo{}} |
- 'sctp_events' |
- {'sctp_events', #sctp_event_subscribe{}} |
- 'sctp_delayed_ack_time' |
- {'sctp_delayed_ack_time', #sctp_assoc_value{}}.
-
+ gen_sctp:option_name() | gen_tcp:option_name() | gen_udp:option_name().
-type ether_address() :: [0..255].
-type if_setopt() ::
@@ -196,7 +114,7 @@
'addr' | 'broadaddr' | 'dstaddr' |
'mtu' | 'netmask' | 'flags' |'hwaddr'.
--type family_option() :: 'inet' | 'inet6'.
+-type address_family() :: 'inet' | 'inet6'.
-type protocol_option() :: 'tcp' | 'udp' | 'sctp'.
-type stat_option() ::
'recv_cnt' | 'recv_max' | 'recv_avg' | 'recv_oct' | 'recv_dvi' |
@@ -229,7 +147,7 @@ close(Socket) ->
peername(Socket) ->
prim_inet:peername(Socket).
--spec setpeername(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setpeername(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setpeername(Socket, {IP,Port}) ->
@@ -246,7 +164,7 @@ setpeername(Socket, undefined) ->
sockname(Socket) ->
prim_inet:sockname(Socket).
--spec setsockname(Socket :: socket(), Address :: {ip_address(), ip_port()}) ->
+-spec setsockname(Socket :: socket(), Address :: {ip_address(), port_number()}) ->
'ok' | {'error', any()}.
setsockname(Socket, {IP,Port}) ->
@@ -254,7 +172,9 @@ setsockname(Socket, {IP,Port}) ->
setsockname(Socket, undefined) ->
prim_inet:setsockname(Socket, undefined).
--spec port(Socket :: socket()) -> {'ok', ip_port()} | {'error', any()}.
+-spec port(Socket) -> {'ok', Port} | {'error', any()} when
+ Socket :: socket(),
+ Port :: port_number().
port(Socket) ->
case prim_inet:sockname(Socket) of
@@ -268,16 +188,18 @@ port(Socket) ->
send(Socket, Packet) ->
prim_inet:send(Socket, Packet).
--spec setopts(Socket :: socket(), Opts :: [socket_setopt()]) ->
- 'ok' | {'error', posix()}.
+-spec setopts(Socket, Options) -> ok | {error, posix()} when
+ Socket :: socket(),
+ Options :: [socket_setopt()].
setopts(Socket, Opts) ->
prim_inet:setopts(Socket, Opts).
-spec getopts(Socket, Options) ->
- {'ok', [socket_setopt()]} | {'error', posix()} when
+ {'ok', OptionValues} | {'error', posix()} when
Socket :: socket(),
- Options :: [socket_getopt()].
+ Options :: [socket_getopt()],
+ OptionValues :: [socket_setopt()].
getopts(Socket, Opts) ->
prim_inet:getopts(Socket, Opts).
@@ -419,14 +341,19 @@ gethostname() ->
gethostname(Socket) ->
prim_inet:gethostname(Socket).
--spec getstat(Socket :: socket()) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket) ->
prim_inet:getstat(Socket, stats()).
--spec getstat(Socket :: socket(), Statoptions :: [stat_option()]) ->
- {'ok', [{stat_option(), integer()}]} | {'error', posix()}.
+-spec getstat(Socket, Options) ->
+ {ok, OptionValues} | {error, posix()} when
+ Socket :: socket(),
+ Options :: [stat_option()],
+ OptionValues :: [{stat_option(), integer()}].
getstat(Socket,What) ->
prim_inet:getstat(Socket, What).
@@ -441,14 +368,14 @@ gethostbyname(Name) ->
-spec gethostbyname(Hostname, Family) ->
{ok, Hostent} | {error, posix()} when
Hostname :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Hostent :: hostent().
gethostbyname(Name,Family) ->
gethostbyname_tm(Name, Family, false).
-spec gethostbyname(Name :: hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', #hostent{}} | {'error', posix()}.
@@ -527,14 +454,14 @@ getfd(Socket) ->
-spec getaddr(Host, Family) -> {ok, Address} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Address :: ip_address().
getaddr(Address, Family) ->
getaddr(Address, Family, infinity).
-spec getaddr(Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', ip_address()} | {'error', posix()}.
@@ -553,14 +480,14 @@ getaddr_tm(Address, Family, Timer) ->
-spec getaddrs(Host, Family) ->
{ok, Addresses} | {error, posix()} when
Host :: ip_address() | hostname(),
- Family :: family_option(),
+ Family :: address_family(),
Addresses :: [ip_address()].
getaddrs(Address, Family) ->
getaddrs(Address, Family, infinity).
-spec getaddrs(Host :: ip_address() | string() | atom(),
- Family :: family_option(),
+ Family :: address_family(),
Timeout :: non_neg_integer() | 'infinity') ->
{'ok', [ip_address()]} | {'error', posix()}.
@@ -570,7 +497,7 @@ getaddrs(Address, Family, Timeout) ->
stop_timer(Timer),
Res.
--spec getservbyport(Port :: ip_port(), Protocol :: atom() | string()) ->
+-spec getservbyport(Port :: port_number(), Protocol :: atom() | string()) ->
{'ok', string()} | {'error', posix()}.
getservbyport(Port, Proto) ->
@@ -584,7 +511,7 @@ getservbyport(Port, Proto) ->
-spec getservbyname(Name :: atom() | string(),
Protocol :: atom() | string()) ->
- {'ok', ip_port()} | {'error', posix()}.
+ {'ok', port_number()} | {'error', posix()}.
getservbyname(Name, Protocol) when is_atom(Name) ->
case inet_udp:open(0, []) of
@@ -1067,7 +994,7 @@ gethostbyaddr_tm_native(Addr, Timer, Opts) ->
-spec open(Fd :: integer(),
Addr :: ip_address(),
- Port :: ip_port(),
+ Port :: port_number(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
Family :: 'inet' | 'inet6',
@@ -1108,7 +1035,7 @@ open(Fd, _Addr, _Port, Opts, Protocol, Family, Module) ->
-spec fdopen(Fd :: non_neg_integer(),
Opts :: [socket_setopt()],
Protocol :: protocol_option(),
- Family :: family_option(),
+ Family :: address_family(),
Module :: atom()) ->
{'ok', socket()} | {'error', posix()}.
diff --git a/lib/kernel/src/inet_res.erl b/lib/kernel/src/inet_res.erl
index d1f5644ff7..59ba408d7a 100644
--- a/lib/kernel/src/inet_res.erl
+++ b/lib/kernel/src/inet_res.erl
@@ -407,7 +407,7 @@ gethostbyname(Name) ->
-spec gethostbyname(Name, Family) -> {ok, Hostent} | {error, Reason} when
Name :: dns_name(),
Hostent :: inet:hostent(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family) ->
@@ -418,7 +418,7 @@ gethostbyname(Name,Family) ->
Name :: dns_name(),
Hostent :: inet:hostent(),
Timeout :: timeout(),
- Family :: inet:family_option(),
+ Family :: inet:address_family(),
Reason :: inet:posix() | res_error().
gethostbyname(Name,Family,Timeout) ->
diff --git a/lib/kernel/test/code_SUITE.erl b/lib/kernel/test/code_SUITE.erl
index 3ad49254f1..531ce780a9 100644
--- a/lib/kernel/test/code_SUITE.erl
+++ b/lib/kernel/test/code_SUITE.erl
@@ -984,9 +984,9 @@ purge_stacktrace(Config) when is_list(Config) ->
error:function_clause ->
?line code:load_file(code_b_test),
?line case erlang:get_stacktrace() of
- [{?MODULE,_,[a]},
- {code_b_test,call,2},
- {?MODULE,purge_stacktrace,1}|_] ->
+ [{?MODULE,_,[a],_},
+ {code_b_test,call,2,_},
+ {?MODULE,purge_stacktrace,1,_}|_] ->
?line false = code:purge(code_b_test),
?line [] = erlang:get_stacktrace()
end
@@ -996,8 +996,8 @@ purge_stacktrace(Config) when is_list(Config) ->
error:function_clause ->
?line code:load_file(code_b_test),
?line case erlang:get_stacktrace() of
- [{code_b_test,call,[nofun,2]},
- {?MODULE,purge_stacktrace,1}|_] ->
+ [{code_b_test,call,[nofun,2],_},
+ {?MODULE,purge_stacktrace,1,_}|_] ->
?line false = code:purge(code_b_test),
?line [] = erlang:get_stacktrace()
end
@@ -1008,8 +1008,8 @@ purge_stacktrace(Config) when is_list(Config) ->
error:badarg ->
?line code:load_file(code_b_test),
?line case erlang:get_stacktrace() of
- [{code_b_test,call,Args},
- {?MODULE,purge_stacktrace,1}|_] ->
+ [{code_b_test,call,Args,_},
+ {?MODULE,purge_stacktrace,1,_}|_] ->
?line false = code:purge(code_b_test),
?line [] = erlang:get_stacktrace()
end
@@ -1470,7 +1470,7 @@ do_on_load_error(ReturnValue) ->
?line ErrorPid ! ReturnValue,
receive
{'DOWN',Ref,process,_,Exit} ->
- ?line {undef,[{on_load_error,main,[]}|_]} = Exit
+ ?line {undef,[{on_load_error,main,[],_}|_]} = Exit
end.
native_early_modules(suite) -> [];
diff --git a/lib/kernel/test/gen_udp_SUITE.erl b/lib/kernel/test/gen_udp_SUITE.erl
index d8a5519195..b734d7fd98 100644
--- a/lib/kernel/test/gen_udp_SUITE.erl
+++ b/lib/kernel/test/gen_udp_SUITE.erl
@@ -400,6 +400,7 @@ open_fd(Config) when is_list(Config) ->
{ok,S1} = gen_udp:open(0),
{ok,P2} = inet:port(S1),
{ok,FD} = prim_inet:getfd(S1),
+ {error,einval} = gen_udp:open(P2, [inet6, {fd,FD}]),
{ok,S2} = gen_udp:open(P2, [{fd,FD}]),
{ok,S3} = gen_udp:open(0),
{ok,P3} = inet:port(S3),
diff --git a/lib/kernel/test/zlib_SUITE.erl b/lib/kernel/test/zlib_SUITE.erl
index 9eb84c9167..d367f3958a 100644
--- a/lib/kernel/test/zlib_SUITE.erl
+++ b/lib/kernel/test/zlib_SUITE.erl
@@ -42,8 +42,8 @@
end
end()).
--define(BARG, {'EXIT',{badarg,[{zlib,_,_}|_]}}).
--define(DATA_ERROR, {'EXIT',{data_error,[{zlib,_,_}|_]}}).
+-define(BARG, {'EXIT',{badarg,[{zlib,_,_,_}|_]}}).
+-define(DATA_ERROR, {'EXIT',{data_error,[{zlib,_,_,_}|_]}}).
init_per_testcase(_Func, Config) ->
Dog = test_server:timetrap(test_server:seconds(60)),
diff --git a/lib/megaco/src/binary/depend.mk b/lib/megaco/src/binary/depend.mk
index 5ec4977175..d12bd8bad0 100644
--- a/lib/megaco/src/binary/depend.mk
+++ b/lib/megaco/src/binary/depend.mk
@@ -83,17 +83,16 @@ PER_BIN_DRV_V3_FLAGS = $(ASN1_CT_OPTS) +optimize
# --- Version 1 ---
-$(BER_ASN1_V1_SPEC).erl $(BER_ASN1_V1_SPEC).hrl: \
+$(BER_ASN1_V1_SPEC).erl: \
$(BER_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(BER_ASN1_V1_SPEC):"
$(ERLC) -bber $(BER_V1_FLAGS) $(BER_ASN1_V1_SPEC).set.asn
$(EBIN)/$(BER_ASN1_V1_SPEC).$(EMULATOR): \
- $(BER_ASN1_V1_SPEC).erl \
- $(BER_ASN1_V1_SPEC).hrl
+ $(BER_ASN1_V1_SPEC).erl
-$(BER_BIN_ASN1_V1_SPEC).erl $(BER_BIN_ASN1_V1_SPEC).hrl: \
+$(BER_BIN_ASN1_V1_SPEC).erl: \
$(BER_BIN_ASN1_V1_SPEC).set.asn \
$(BER_BIN_ASN1_V1_SPEC).asn1config \
$(ASN1_V1_SPEC).asn
@@ -101,10 +100,9 @@ $(BER_BIN_ASN1_V1_SPEC).erl $(BER_BIN_ASN1_V1_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_V1_FLAGS) $(BER_BIN_ASN1_V1_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_V1_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_V1_SPEC).erl \
- $(BER_BIN_ASN1_V1_SPEC).hrl
+ $(BER_BIN_ASN1_V1_SPEC).erl
-$(BER_BIN_DRV_ASN1_V1_SPEC).erl $(BER_BIN_DRV_ASN1_V1_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_V1_SPEC).erl: \
$(BER_BIN_DRV_ASN1_V1_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_V1_SPEC).asn1config \
$(ASN1_V1_SPEC).asn
@@ -112,53 +110,48 @@ $(BER_BIN_DRV_ASN1_V1_SPEC).erl $(BER_BIN_DRV_ASN1_V1_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_V1_FLAGS) $(BER_BIN_DRV_ASN1_V1_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_V1_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_V1_SPEC).erl \
- $(BER_BIN_DRV_ASN1_V1_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_V1_SPEC).erl
-$(PER_ASN1_V1_SPEC).erl $(PER_ASN1_V1_SPEC).hrl: \
+$(PER_ASN1_V1_SPEC).erl: \
$(PER_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(PER_ASN1_V1_SPEC):"
$(ERLC) -bper $(PER_V1_FLAGS) $(PER_ASN1_V1_SPEC).set.asn
$(EBIN)/$(PER_ASN1_V1_SPEC).$(EMULATOR): \
- $(PER_ASN1_V1_SPEC).erl \
- $(PER_ASN1_V1_SPEC).hrl
+ $(PER_ASN1_V1_SPEC).erl
-$(PER_BIN_ASN1_V1_SPEC).erl $(PER_BIN_ASN1_V1_SPEC).hrl: \
+$(PER_BIN_ASN1_V1_SPEC).erl: \
$(PER_BIN_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(PER_BIN_ASN1_V1_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_V1_FLAGS) $(PER_BIN_ASN1_V1_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_V1_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_V1_SPEC).erl \
- $(PER_BIN_ASN1_V1_SPEC).hrl
+ $(PER_BIN_ASN1_V1_SPEC).erl
-$(PER_BIN_DRV_ASN1_V1_SPEC).erl $(PER_BIN_DRV_ASN1_V1_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_V1_SPEC).erl: \
$(PER_BIN_DRV_ASN1_V1_SPEC).set.asn \
$(ASN1_V1_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_V1_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_V1_FLAGS) $(PER_BIN_DRV_ASN1_V1_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_V1_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_V1_SPEC).erl \
- $(PER_BIN_DRV_ASN1_V1_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_V1_SPEC).erl
# --- Version 2 ---
-$(BER_ASN1_V2_SPEC).erl $(BER_ASN1_V2_SPEC).hrl: \
+$(BER_ASN1_V2_SPEC).erl: \
$(BER_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(BER_ASN1_V2_SPEC):"
$(ERLC) -bber $(BER_V2_FLAGS) $(BER_ASN1_V2_SPEC).set.asn
$(EBIN)/$(BER_ASN1_V2_SPEC).$(EMULATOR): \
- $(BER_ASN1_V2_SPEC).erl \
- $(BER_ASN1_V2_SPEC).hrl
+ $(BER_ASN1_V2_SPEC).erl
-$(BER_BIN_ASN1_V2_SPEC).erl $(BER_BIN_ASN1_V2_SPEC).hrl: \
+$(BER_BIN_ASN1_V2_SPEC).erl: \
$(BER_BIN_ASN1_V2_SPEC).set.asn \
$(BER_BIN_ASN1_V2_SPEC).asn1config \
$(ASN1_V2_SPEC).asn
@@ -166,10 +159,9 @@ $(BER_BIN_ASN1_V2_SPEC).erl $(BER_BIN_ASN1_V2_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_V2_FLAGS) $(BER_BIN_ASN1_V2_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_V2_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_V2_SPEC).erl \
- $(BER_BIN_ASN1_V2_SPEC).hrl
+ $(BER_BIN_ASN1_V2_SPEC).erl
-$(BER_BIN_DRV_ASN1_V2_SPEC).erl $(BER_BIN_DRV_ASN1_V2_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_V2_SPEC).erl: \
$(BER_BIN_DRV_ASN1_V2_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_V2_SPEC).asn1config \
$(ASN1_V2_SPEC).asn
@@ -177,55 +169,50 @@ $(BER_BIN_DRV_ASN1_V2_SPEC).erl $(BER_BIN_DRV_ASN1_V2_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_V2_FLAGS) $(BER_BIN_DRV_ASN1_V2_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_V2_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_V2_SPEC).erl \
- $(BER_BIN_DRV_ASN1_V2_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_V2_SPEC).erl
-$(PER_ASN1_V2_SPEC).erl $(PER_ASN1_V2_SPEC).hrl: \
+$(PER_ASN1_V2_SPEC).erl: \
$(PER_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(PER_ASN1_V2_SPEC):"
$(ERLC) -bper $(PER_V2_FLAGS) $(PER_ASN1_V2_SPEC).set.asn
$(EBIN)/$(PER_ASN1_V2_SPEC).$(EMULATOR): \
- $(PER_ASN1_V2_SPEC).erl \
- $(PER_ASN1_V2_SPEC).hrl
+ $(PER_ASN1_V2_SPEC).erl
-$(PER_BIN_ASN1_V2_SPEC).erl $(PER_BIN_ASN1_V2_SPEC).hrl: \
+$(PER_BIN_ASN1_V2_SPEC).erl: \
$(PER_BIN_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(PER_BIN_ASN1_V2_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_V2_FLAGS) $(PER_BIN_ASN1_V2_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_V2_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_V2_SPEC).erl \
- $(PER_BIN_ASN1_V2_SPEC).hrl
+ $(PER_BIN_ASN1_V2_SPEC).erl
-$(PER_BIN_DRV_ASN1_V2_SPEC).erl $(PER_BIN_DRV_ASN1_V2_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_V2_SPEC).erl: \
$(PER_BIN_DRV_ASN1_V2_SPEC).set.asn \
$(ASN1_V2_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_V2_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_V2_FLAGS) $(PER_BIN_DRV_ASN1_V2_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_V2_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_V2_SPEC).erl \
- $(PER_BIN_DRV_ASN1_V2_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_V2_SPEC).erl
# --- Version 3 ---
# -- (prev3a) --
-$(BER_ASN1_PREV3A_SPEC).erl $(BER_ASN1_PREV3A_SPEC).hrl: \
+$(BER_ASN1_PREV3A_SPEC).erl: \
$(BER_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(BER_ASN1_PREV3A_SPEC):"
$(ERLC) -bber $(BER_PREV3A_FLAGS) $(BER_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(BER_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(BER_ASN1_PREV3A_SPEC).erl \
- $(BER_ASN1_PREV3A_SPEC).hrl
+ $(BER_ASN1_PREV3A_SPEC).erl
-$(BER_BIN_ASN1_PREV3A_SPEC).erl $(BER_BIN_ASN1_PREV3A_SPEC).hrl: \
+$(BER_BIN_ASN1_PREV3A_SPEC).erl: \
$(BER_BIN_ASN1_PREV3A_SPEC).set.asn \
$(BER_BIN_ASN1_PREV3A_SPEC).asn1config \
$(ASN1_PREV3A_SPEC).asn
@@ -233,10 +220,9 @@ $(BER_BIN_ASN1_PREV3A_SPEC).erl $(BER_BIN_ASN1_PREV3A_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_PREV3A_FLAGS) $(BER_BIN_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_PREV3A_SPEC).erl \
- $(BER_BIN_ASN1_PREV3A_SPEC).hrl
+ $(BER_BIN_ASN1_PREV3A_SPEC).erl
-$(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3A_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl: \
$(BER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_PREV3A_SPEC).asn1config \
$(ASN1_PREV3A_SPEC).asn
@@ -244,52 +230,47 @@ $(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3A_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_PREV3A_FLAGS) $(BER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl \
- $(BER_BIN_DRV_ASN1_PREV3A_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_PREV3A_SPEC).erl
-$(PER_ASN1_PREV3A_SPEC).erl $(PER_ASN1_PREV3A_SPEC).hrl: \
+$(PER_ASN1_PREV3A_SPEC).erl: \
$(PER_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(PER_ASN1_PREV3A_SPEC):"
$(ERLC) -bper $(PER_PREV3A_FLAGS) $(PER_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(PER_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(PER_ASN1_PREV3A_SPEC).erl \
- $(PER_ASN1_PREV3A_SPEC).hrl
+ $(PER_ASN1_PREV3A_SPEC).erl
-$(PER_BIN_ASN1_PREV3A_SPEC).erl $(PER_BIN_ASN1_PREV3A_SPEC).hrl: \
+$(PER_BIN_ASN1_PREV3A_SPEC).erl: \
$(PER_BIN_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(PER_BIN_ASN1_PREV3A_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_PREV3A_FLAGS) $(PER_BIN_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_PREV3A_SPEC).erl \
- $(PER_BIN_ASN1_PREV3A_SPEC).hrl
+ $(PER_BIN_ASN1_PREV3A_SPEC).erl
-$(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl $(PER_BIN_DRV_ASN1_PREV3A_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl: \
$(PER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn \
$(ASN1_PREV3A_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_PREV3A_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_PREV3A_FLAGS) $(PER_BIN_DRV_ASN1_PREV3A_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_PREV3A_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl \
- $(PER_BIN_DRV_ASN1_PREV3A_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_PREV3A_SPEC).erl
# -- (prev3b) --
-$(BER_ASN1_PREV3B_SPEC).erl $(BER_ASN1_PREV3B_SPEC).hrl: \
+$(BER_ASN1_PREV3B_SPEC).erl: \
$(BER_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(BER_ASN1_PREV3B_SPEC):"
$(ERLC) -bber $(BER_PREV3B_FLAGS) $(BER_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(BER_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(BER_ASN1_PREV3B_SPEC).erl \
- $(BER_ASN1_PREV3B_SPEC).hrl
+ $(BER_ASN1_PREV3B_SPEC).erl
-$(BER_BIN_ASN1_PREV3B_SPEC).erl $(BER_BIN_ASN1_PREV3B_SPEC).hrl: \
+$(BER_BIN_ASN1_PREV3B_SPEC).erl: \
$(BER_BIN_ASN1_PREV3B_SPEC).set.asn \
$(BER_BIN_ASN1_PREV3B_SPEC).asn1config \
$(ASN1_PREV3B_SPEC).asn
@@ -297,10 +278,9 @@ $(BER_BIN_ASN1_PREV3B_SPEC).erl $(BER_BIN_ASN1_PREV3B_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_PREV3B_FLAGS) $(BER_BIN_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_PREV3B_SPEC).erl \
- $(BER_BIN_ASN1_PREV3B_SPEC).hrl
+ $(BER_BIN_ASN1_PREV3B_SPEC).erl
-$(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3B_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl: \
$(BER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_PREV3B_SPEC).asn1config \
$(ASN1_PREV3B_SPEC).asn
@@ -308,53 +288,48 @@ $(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3B_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_PREV3B_FLAGS) $(BER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl \
- $(BER_BIN_DRV_ASN1_PREV3B_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_PREV3B_SPEC).erl
-$(PER_ASN1_PREV3B_SPEC).erl $(PER_ASN1_PREV3B_SPEC).hrl: \
+$(PER_ASN1_PREV3B_SPEC).erl: \
$(PER_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(PER_ASN1_PREV3B_SPEC):"
$(ERLC) -bper $(PER_PREV3B_FLAGS) $(PER_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(PER_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(PER_ASN1_PREV3B_SPEC).erl \
- $(PER_ASN1_PREV3B_SPEC).hrl
+ $(PER_ASN1_PREV3B_SPEC).erl
-$(PER_BIN_ASN1_PREV3B_SPEC).erl $(PER_BIN_ASN1_PREV3B_SPEC).hrl: \
+$(PER_BIN_ASN1_PREV3B_SPEC).erl: \
$(PER_BIN_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(PER_BIN_ASN1_PREV3B_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_PREV3B_FLAGS) $(PER_BIN_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_PREV3B_SPEC).erl \
- $(PER_BIN_ASN1_PREV3B_SPEC).hrl
+ $(PER_BIN_ASN1_PREV3B_SPEC).erl
-$(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl $(PER_BIN_DRV_ASN1_PREV3B_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl: \
$(PER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn \
$(ASN1_PREV3B_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_PREV3B_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_PREV3B_FLAGS) $(PER_BIN_DRV_ASN1_PREV3B_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_PREV3B_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl \
- $(PER_BIN_DRV_ASN1_PREV3B_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_PREV3B_SPEC).erl
# -- (prev3c) --
-$(BER_ASN1_PREV3C_SPEC).erl $(BER_ASN1_PREV3C_SPEC).hrl: \
+$(BER_ASN1_PREV3C_SPEC).erl: \
$(BER_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(BER_ASN1_PREV3C_SPEC):"
$(ERLC) -bber $(BER_PREV3C_FLAGS) $(BER_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(BER_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(BER_ASN1_PREV3C_SPEC).erl \
- $(BER_ASN1_PREV3C_SPEC).hrl
+ $(BER_ASN1_PREV3C_SPEC).erl
-$(BER_BIN_ASN1_PREV3C_SPEC).erl $(BER_BIN_ASN1_PREV3C_SPEC).hrl: \
+$(BER_BIN_ASN1_PREV3C_SPEC).erl: \
$(BER_BIN_ASN1_PREV3C_SPEC).set.asn \
$(BER_BIN_ASN1_PREV3C_SPEC).asn1config \
$(ASN1_PREV3C_SPEC).asn
@@ -362,10 +337,9 @@ $(BER_BIN_ASN1_PREV3C_SPEC).erl $(BER_BIN_ASN1_PREV3C_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_PREV3C_FLAGS) $(BER_BIN_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_PREV3C_SPEC).erl \
- $(BER_BIN_ASN1_PREV3C_SPEC).hrl
+ $(BER_BIN_ASN1_PREV3C_SPEC).erl
-$(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3C_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl: \
$(BER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_PREV3C_SPEC).asn1config \
$(ASN1_PREV3C_SPEC).asn
@@ -373,53 +347,48 @@ $(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl $(BER_BIN_DRV_ASN1_PREV3C_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_PREV3C_FLAGS) $(BER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl \
- $(BER_BIN_DRV_ASN1_PREV3C_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_PREV3C_SPEC).erl
-$(PER_ASN1_PREV3C_SPEC).erl $(PER_ASN1_PREV3C_SPEC).hrl: \
+$(PER_ASN1_PREV3C_SPEC).erl: \
$(PER_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(PER_ASN1_PREV3C_SPEC):"
$(ERLC) -bper $(PER_PREV3C_FLAGS) $(PER_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(PER_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(PER_ASN1_PREV3C_SPEC).erl \
- $(PER_ASN1_PREV3C_SPEC).hrl
+ $(PER_ASN1_PREV3C_SPEC).erl
-$(PER_BIN_ASN1_PREV3C_SPEC).erl $(PER_BIN_ASN1_PREV3C_SPEC).hrl: \
+$(PER_BIN_ASN1_PREV3C_SPEC).erl: \
$(PER_BIN_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(PER_BIN_ASN1_PREV3C_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_PREV3C_FLAGS) $(PER_BIN_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_PREV3C_SPEC).erl \
- $(PER_BIN_ASN1_PREV3C_SPEC).hrl
+ $(PER_BIN_ASN1_PREV3C_SPEC).erl
-$(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl $(PER_BIN_DRV_ASN1_PREV3C_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl: \
$(PER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn \
$(ASN1_PREV3C_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_PREV3C_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_PREV3C_FLAGS) $(PER_BIN_DRV_ASN1_PREV3C_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_PREV3C_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl \
- $(PER_BIN_DRV_ASN1_PREV3C_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_PREV3C_SPEC).erl
# -- (v3) --
-$(BER_ASN1_V3_SPEC).erl $(BER_ASN1_V3_SPEC).hrl: \
+$(BER_ASN1_V3_SPEC).erl: \
$(BER_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(BER_ASN1_V3_SPEC):"
$(ERLC) -bber $(BER_V3_FLAGS) $(BER_ASN1_V3_SPEC).set.asn
$(EBIN)/$(BER_ASN1_V3_SPEC).$(EMULATOR): \
- $(BER_ASN1_V3_SPEC).erl \
- $(BER_ASN1_V3_SPEC).hrl
+ $(BER_ASN1_V3_SPEC).erl
-$(BER_BIN_ASN1_V3_SPEC).erl $(BER_BIN_ASN1_V3_SPEC).hrl: \
+$(BER_BIN_ASN1_V3_SPEC).erl: \
$(BER_BIN_ASN1_V3_SPEC).set.asn \
$(BER_BIN_ASN1_V3_SPEC).asn1config \
$(ASN1_V3_SPEC).asn
@@ -427,10 +396,9 @@ $(BER_BIN_ASN1_V3_SPEC).erl $(BER_BIN_ASN1_V3_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_V3_FLAGS) $(BER_BIN_ASN1_V3_SPEC).set.asn
$(EBIN)/$(BER_BIN_ASN1_V3_SPEC).$(EMULATOR): \
- $(BER_BIN_ASN1_V3_SPEC).erl \
- $(BER_BIN_ASN1_V3_SPEC).hrl
+ $(BER_BIN_ASN1_V3_SPEC).erl
-$(BER_BIN_DRV_ASN1_V3_SPEC).erl $(BER_BIN_DRV_ASN1_V3_SPEC).hrl: \
+$(BER_BIN_DRV_ASN1_V3_SPEC).erl: \
$(BER_BIN_DRV_ASN1_V3_SPEC).set.asn \
$(BER_BIN_DRV_ASN1_V3_SPEC).asn1config \
$(ASN1_V3_SPEC).asn
@@ -438,38 +406,34 @@ $(BER_BIN_DRV_ASN1_V3_SPEC).erl $(BER_BIN_DRV_ASN1_V3_SPEC).hrl: \
$(ERLC) -bber_bin $(BER_BIN_DRV_V3_FLAGS) $(BER_BIN_DRV_ASN1_V3_SPEC).set.asn
$(EBIN)/$(BER_BIN_DRV_ASN1_V3_SPEC).$(EMULATOR): \
- $(BER_BIN_DRV_ASN1_V3_SPEC).erl \
- $(BER_BIN_DRV_ASN1_V3_SPEC).hrl
+ $(BER_BIN_DRV_ASN1_V3_SPEC).erl
-$(PER_ASN1_V3_SPEC).erl $(PER_ASN1_V3_SPEC).hrl: \
+$(PER_ASN1_V3_SPEC).erl: \
$(PER_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(PER_ASN1_V3_SPEC):"
$(ERLC) -bper $(PER_V3_FLAGS) $(PER_ASN1_V3_SPEC).set.asn
$(EBIN)/$(PER_ASN1_V3_SPEC).$(EMULATOR): \
- $(PER_ASN1_V3_SPEC).erl \
- $(PER_ASN1_V3_SPEC).hrl
+ $(PER_ASN1_V3_SPEC).erl
-$(PER_BIN_ASN1_V3_SPEC).erl $(PER_BIN_ASN1_V3_SPEC).hrl: \
+$(PER_BIN_ASN1_V3_SPEC).erl: \
$(PER_BIN_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(PER_BIN_ASN1_V3_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_V3_FLAGS) $(PER_BIN_ASN1_V3_SPEC).set.asn
$(EBIN)/$(PER_BIN_ASN1_V3_SPEC).$(EMULATOR): \
- $(PER_BIN_ASN1_V3_SPEC).erl \
- $(PER_BIN_ASN1_V3_SPEC).hrl
+ $(PER_BIN_ASN1_V3_SPEC).erl
-$(PER_BIN_DRV_ASN1_V3_SPEC).erl $(PER_BIN_DRV_ASN1_V3_SPEC).hrl: \
+$(PER_BIN_DRV_ASN1_V3_SPEC).erl: \
$(PER_BIN_DRV_ASN1_V3_SPEC).set.asn \
$(ASN1_V3_SPEC).asn
@echo "$(PER_BIN_DRV_ASN1_V3_SPEC):"
$(ERLC) -bper_bin $(PER_BIN_DRV_V3_FLAGS) $(PER_BIN_DRV_ASN1_V3_SPEC).set.asn
$(EBIN)/$(PER_BIN_DRV_ASN1_V3_SPEC).$(EMULATOR): \
- $(PER_BIN_DRV_ASN1_V3_SPEC).erl \
- $(PER_BIN_DRV_ASN1_V3_SPEC).hrl
+ $(PER_BIN_DRV_ASN1_V3_SPEC).erl
# -------------
diff --git a/lib/megaco/src/flex/Makefile.in b/lib/megaco/src/flex/Makefile.in
index 5af651d89b..2c46a673e4 100644
--- a/lib/megaco/src/flex/Makefile.in
+++ b/lib/megaco/src/flex/Makefile.in
@@ -391,7 +391,9 @@ $(STD_DRV).c: $(STD_DRV).flex
$(MT_DRV).c: $(MT_DRV).flex
$(LEX) $(MT_LEX_FLAGS) -P$* -o$@ $<
-solibs: $(LIBDIR) $(OBJDIR) $(SOLIBS)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
+
+solibs: $(SOLIBS)
$(OBJDIR)/$(STD_DRV).o: $(STD_DRV).c
@echo "compiling std driver:"
@@ -411,10 +413,3 @@ $(LIBDIR)/$(STD_DRV).$(DED_EXT): $(OBJDIR)/$(STD_DRV).o
$(LIBDIR)/$(MT_DRV).$(DED_EXT): $(OBJDIR)/$(MT_DRV).o
@echo "linking multi-threaded driver:"
$(LD) $(LDFLAGS) -o $@ $<
-
-$(LIBDIR):
- -mkdir -p $(LIBDIR)
-
-$(OBJDIR):
- -mkdir -p $(OBJDIR)
-
diff --git a/lib/mnesia/src/mnesia_lib.erl b/lib/mnesia/src/mnesia_lib.erl
index 7e926a6258..775d370d0f 100644
--- a/lib/mnesia/src/mnesia_lib.erl
+++ b/lib/mnesia/src/mnesia_lib.erl
@@ -413,7 +413,7 @@ pr_other(Var, Other) ->
[self(), process_info(self(), registered_name),
Var, Other, Why]),
case Other of
- {badarg, [{ets, lookup_element, _}|_]} ->
+ {badarg, [{ets, lookup_element, _, _}|_]} ->
exit(Why);
_ ->
erlang:error(Why)
diff --git a/lib/mnesia/src/mnesia_loader.erl b/lib/mnesia/src/mnesia_loader.erl
index e785b795d1..607e205fef 100644
--- a/lib/mnesia/src/mnesia_loader.erl
+++ b/lib/mnesia/src/mnesia_loader.erl
@@ -464,7 +464,7 @@ init_table(Tab, disc_only_copies, Fun, false, DetsInfo,Sender) ->
{ErtsVer, DetsData} ->
Res = (catch dets:is_compatible_bchunk_format(Tab, DetsData)),
case Res of
- {'EXIT',{undef,[{dets,_,_}|_]}} ->
+ {'EXIT',{undef,[{dets,_,_,_}|_]}} ->
Sender ! {self(), {old_protocol, Tab}},
dets:init_table(Tab, Fun); %% Old dets version
{'EXIT', What} ->
diff --git a/lib/odbc/test/mysql.erl b/lib/odbc/test/mysql.erl
index 49068c4356..c990793213 100644
--- a/lib/odbc/test/mysql.erl
+++ b/lib/odbc/test/mysql.erl
@@ -26,7 +26,22 @@
%-------------------------------------------------------------------------
connection_string() ->
- "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';".
+ case test_server:os_type() of
+ {unix, linux} ->
+ "DSN=MySQL;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ {unix, sunos} ->
+ solaris_str();
+ {unix, darwin} ->
+ "DSN=MySQLMac;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
+
+solaris_str() ->
+ case erlang:system_info(system_architecture) of
+ "sparc" ++ _ ->
+ "DSN=MySQLSolaris10;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';";
+ "i386" ++ _ ->
+ "DSN=MySQLSolaris10i386;Database=odbctest;Uid=odbctest;Pwd=gurka;CHARSET=utf8;SSTMT=SET NAMES 'utf8';"
+ end.
%-------------------------------------------------------------------------
insert_result() ->
diff --git a/lib/odbc/test/odbc_connect_SUITE.erl b/lib/odbc/test/odbc_connect_SUITE.erl
index e59be772e3..a076c4dfff 100644
--- a/lib/odbc/test/odbc_connect_SUITE.erl
+++ b/lib/odbc/test/odbc_connect_SUITE.erl
@@ -76,20 +76,26 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- case (catch odbc:start()) of
- ok ->
- case catch odbc:connect(?RDBMS:connection_string(),
- [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
- {ok, Ref} ->
- odbc:disconnect(Ref),
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC is not properly setup"}
- end;
- _ ->
- {skip,"ODBC not startable"}
- end.
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ case catch odbc:connect(?RDBMS:connection_string(),
+ [{auto_commit, off}] ++ odbc_test_lib:platform_options()) of
+ {ok, Ref} ->
+ odbc:disconnect(Ref),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config];
+ _ ->
+ {skip, "ODBC is not properly setup"}
+ end;
+ _ ->
+ {skip,"ODBC not startable"}
+ end
+ end.
+
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
diff --git a/lib/odbc/test/odbc_data_type_SUITE.erl b/lib/odbc/test/odbc_data_type_SUITE.erl
index 099ae0aa7d..d61a91f973 100644
--- a/lib/odbc/test/odbc_data_type_SUITE.erl
+++ b/lib/odbc/test/odbc_data_type_SUITE.erl
@@ -89,17 +89,15 @@ init_per_group(GroupName, Config) when GroupName == fixed_char;
end;
init_per_group(unicode, Config) ->
- %% Uses parameterized queries
- case {os:type(), erlang:system_info(wordsize)} of
+ case {os:type(), erlang:system_info({wordsize, external})} of
{{unix, _}, 4} ->
Config;
{{unix, _}, _} ->
- {skip, "Not supported by driver"};
+ {skip, "Postgres drivers pre version psqlODBC 08.04.0200 have utf8-problems"};
_ ->
Config
end;
-
init_per_group(_GroupName, Config) ->
Config.
@@ -115,14 +113,18 @@ end_per_group(_GroupName, Config) ->
%% Note: This function is free to add any key/value pairs to the Config
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
-init_per_suite(Config) ->
- case (catch odbc:start()) of
- ok ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config];
- _ ->
- {skip, "ODBC not startable"}
+init_per_suite(Config) when is_list(Config) ->
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
end.
-
%%--------------------------------------------------------------------
%% Function: end_per_suite(Config) -> _
%% Config - [tuple()]
diff --git a/lib/odbc/test/odbc_query_SUITE.erl b/lib/odbc/test/odbc_query_SUITE.erl
index 76a214d553..1852678b4b 100644
--- a/lib/odbc/test/odbc_query_SUITE.erl
+++ b/lib/odbc/test/odbc_query_SUITE.erl
@@ -89,6 +89,7 @@ init_per_group(scrollable_cursors, Config) ->
_ ->
Config
end;
+
init_per_group(_,Config) ->
Config.
@@ -105,11 +106,16 @@ end_per_group(_GroupName, Config) ->
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) when is_list(Config) ->
- case (catch odbc:start()) of
- ok ->
- [{tableName, odbc_test_lib:unique_table_name()}| Config];
- _ ->
- {skip, "ODBC not startable"}
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case (catch odbc:start()) of
+ ok ->
+ [{tableName, odbc_test_lib:unique_table_name()}| Config];
+ _ ->
+ {skip, "ODBC not startable"}
+ end
end.
%%--------------------------------------------------------------------
diff --git a/lib/odbc/test/odbc_start_SUITE.erl b/lib/odbc/test/odbc_start_SUITE.erl
index 440c0ca921..e3a3440559 100644
--- a/lib/odbc/test/odbc_start_SUITE.erl
+++ b/lib/odbc/test/odbc_start_SUITE.erl
@@ -39,11 +39,18 @@
%% variable, but should NOT alter/remove any existing entries.
%%--------------------------------------------------------------------
init_per_suite(Config) ->
- case code:which(odbc) of
- non_existing ->
- {skip, "No ODBC built"};
- _ ->
- [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ case odbc_test_lib:skip() of
+ true ->
+ {skip, "ODBC not supported"};
+ false ->
+ case code:which(odbc) of
+ non_existing ->
+ {skip, "No ODBC built"};
+ _ ->
+ %% Make sure odbc is not already started
+ odbc:stop(),
+ [{tableName, odbc_test_lib:unique_table_name()} | Config]
+ end
end.
%%--------------------------------------------------------------------
diff --git a/lib/odbc/test/odbc_test.hrl b/lib/odbc/test/odbc_test.hrl
index 397d04756b..f7bb338a7f 100644
--- a/lib/odbc/test/odbc_test.hrl
+++ b/lib/odbc/test/odbc_test.hrl
@@ -25,14 +25,16 @@
-define(RDBMS, case os:type() of
{unix, sunos} ->
- postgres;
+ mysql;
{unix,linux} ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
mysql;
_ ->
postgres
end;
+ {unix, darwin} ->
+ mysql;
{win32, _} ->
sqlserver
end).
diff --git a/lib/odbc/test/odbc_test_lib.erl b/lib/odbc/test/odbc_test_lib.erl
index 3e78105cf3..2d6bf5fcac 100644
--- a/lib/odbc/test/odbc_test_lib.erl
+++ b/lib/odbc/test/odbc_test_lib.erl
@@ -36,7 +36,7 @@ match_float(Float, Match, Delta) ->
(Float < Match + Delta) and (Float > Match - Delta).
odbc_check() ->
- case erlang:system_info(wordsize) of
+ case erlang:system_info({wordsize, external}) of
4 ->
ok;
Other ->
@@ -71,9 +71,36 @@ strict(_,_) ->
ok.
platform_options() ->
+ [].
+
+skip() ->
case os:type() of
+ {unix, linux} ->
+ Issue = linux_issue(),
+ is_sles9(Issue);
{unix, sunos} ->
- [{scrollable_cursors, off}];
+ not supported_solaris();
+ _ ->
+ false
+ end.
+
+supported_solaris() ->
+ case os:version() of
+ {_,10,_} ->
+ true;
_ ->
- []
+ false
end.
+
+linux_issue() ->
+ {ok, Binary} = file:read_file("/etc/issue"),
+ string:tokens(binary_to_list(Binary), " ").
+
+is_sles11(IssueTokens) ->
+ lists:member(11, IssueTokens).
+
+is_sles10(IssueTokens) ->
+ lists:member(10, IssueTokens).
+
+is_sles9(IssueTokens) ->
+ lists:member(9, IssueTokens).
diff --git a/lib/odbc/test/postgres.erl b/lib/odbc/test/postgres.erl
index 26a2913d46..d564dbd5ff 100644
--- a/lib/odbc/test/postgres.erl
+++ b/lib/odbc/test/postgres.erl
@@ -30,7 +30,7 @@ connection_string() ->
{unix, sunos} ->
"DSN=Postgres;UID=odbctest";
{unix, linux} ->
- Size = erlang:system_info(wordsize),
+ Size = erlang:system_info({wordsize, external}),
linux_dist_connection_string(Size)
end.
@@ -43,7 +43,12 @@ linux_dist_connection_string(4) ->
end;
linux_dist_connection_string(_) ->
- "DSN=PostgresLinux64;UID=odbctest".
+ case linux_dist() of
+ "ubuntu" ->
+ "DSN=PostgresLinux64Ubuntu;UID=odbctest";
+ _ ->
+ "DSN=PostgresLinux64;UID=odbctest"
+ end.
linux_dist() ->
case file:read_file("/etc/issue") of
diff --git a/lib/orber/COSS/CosNaming/Makefile b/lib/orber/COSS/CosNaming/Makefile
index d3deec7600..28b4d9cacc 100644
--- a/lib/orber/COSS/CosNaming/Makefile
+++ b/lib/orber/COSS/CosNaming/Makefile
@@ -124,13 +124,15 @@ docs:
# ----------------------------------------------------
# Special Build Targets
# ----------------------------------------------------
-$(GEN_FILES): cos_naming_ext.idl cos_naming.idl
+IDL-GENERATED: cos_naming_ext.idl cos_naming.idl
erlc $(ERL_IDL_FLAGS) +'{this,"CosNaming::NamingContext"}' \
+'{this,"CosNaming::NamingContextExt"}' cos_naming_ext.idl
erlc $(ERL_IDL_FLAGS) +'{this,"CosNaming::NamingContext"}' cos_naming.idl
+ >IDL-GENERATED
-# echo "ic:gen(cos_naming, [{this, \"CosNaming::NamingContext\"}]), halt()."| $(ERL) $(ERL_IDL_FLAGS)
+$(GEN_FILES): IDL-GENERATED
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/orber/doc/src/Orber/ignore_config_record.inf b/lib/orber/doc/src/Orber/ignore_config_record.inf
deleted file mode 100644
index 0a5053eba3..0000000000
--- a/lib/orber/doc/src/Orber/ignore_config_record.inf
+++ /dev/null
@@ -1 +0,0 @@
-This file makes clearmake use the -T switch for this subdirectory
diff --git a/lib/orber/examples/Stack/Makefile b/lib/orber/examples/Stack/Makefile
index 6e7f292a04..ccb65038a3 100644
--- a/lib/orber/examples/Stack/Makefile
+++ b/lib/orber/examples/Stack/Makefile
@@ -64,6 +64,8 @@ HRL_FILES=
ERL_FILES= $(MODULES:%=%.erl)
+GEN_FILES = $(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES)
+
JAVA_CLASSES = \
StackClient
@@ -101,9 +103,13 @@ docs:
test: $(TEST_TARGET_FILES)
-
-$(GEN_ERL_MODULES:%=%.erl) $(GEN_HRL_FILES): stack.idl
+IDL-GENERATED: stack.idl
erlc $(ERL_IDL_FLAGS) stack.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Target
diff --git a/lib/orber/src/Makefile b/lib/orber/src/Makefile
index ccc449333c..ed62c94b98 100644
--- a/lib/orber/src/Makefile
+++ b/lib/orber/src/Makefile
@@ -227,15 +227,14 @@ docs:
# Special Build Targets
# ----------------------------------------------------
-$(GEN_ERL_FILES1) $(GEN_HRL_FILES1): $(ERL_TOP)/lib/ic/include/erlang.idl
+IDL-GENERATED: $(ERL_TOP)/lib/ic/include/erlang.idl CORBA.idl OrberIFR.idl
erlc $(ERL_IDL_FLAGS) $(ERL_TOP)/lib/ic/include/erlang.idl
-
-$(GEN_ERL_FILES2) $(GEN_HRL_FILES2): CORBA.idl
erlc $(ERL_IDL_FLAGS) CORBA.idl
+ erlc $(ERL_IDL_FLAGS) +'{this,"Orber::IFR"}' OrberIFR.idl
+ >IDL-GENERATED
-$(GEN_ERL_FILES3) $(GEN_HRL_FILES3): OrberIFR.idl
- erlc $(ERL_IDL_FLAGS) +'{this,"Orber::IFR"}' \
- OrberIFR.idl
+$(GEN_ERL_FILES): IDL-GENERATED
+$(TARGET_FILES): IDL-GENERATED
$(GEN_ASN_ERL) $(GEN_ASN_HRL): OrberCSIv2.asn1 OrberCSIv2.set.asn
erlc $(ERL_COMPILE_FLAGS) $(ASN_FLAGS) +'{inline,"OrberCSIv2"}' OrberCSIv2.set.asn
diff --git a/lib/orber/src/corba.erl b/lib/orber/src/corba.erl
index ecec768544..989e84f581 100644
--- a/lib/orber/src/corba.erl
+++ b/lib/orber/src/corba.erl
@@ -947,7 +947,7 @@ handle_cast2(M, F, A, InternalState, State, Ctx) ->
{noreply, {InternalState, NewState}}
end.
-handle_exit(InternalState, State, {undef, [{M, F, _}|_]} = Reason,
+handle_exit(InternalState, State, {undef, [{M, F, _, _}|_]} = Reason,
OnewayOp, {M, F}, A) ->
case catch check_exports(M:module_info(exports), F) of
{'EXIT',{undef,_}} ->
@@ -979,7 +979,7 @@ handle_exit(InternalState, State, {undef, [{M, F, _}|_]} = Reason,
#'OBJ_ADAPTER'{minor=(?ORBER_VMCID bor 4),
completion_status=?COMPLETED_MAYBE})
end;
-handle_exit(InternalState, State, {undef, [{M2, F2, A2}|_]} = Reason,
+handle_exit(InternalState, State, {undef, [{M2, F2, A2, _}|_]} = Reason,
OnewayOp, {M, F}, A) ->
case catch check_exports(M2:module_info(exports), F2) of
{'EXIT',{undef,_}} ->
diff --git a/lib/orber/src/orber_diagnostics.erl b/lib/orber/src/orber_diagnostics.erl
index c12dbfa896..c115d79524 100644
--- a/lib/orber/src/orber_diagnostics.erl
+++ b/lib/orber/src/orber_diagnostics.erl
@@ -130,10 +130,10 @@ missing_modules_helper([[Mod, Type]|T], ErrorsFound) when Type == ?IFR_StructDef
end;
missing_modules_helper([[Mod, Type]|T], ErrorsFound) when Type == ?IFR_InterfaceDef ->
case catch Mod:oe_get_interface() of
- {'EXIT', {undef,[{Mod, _, _}|_]}} ->
+ {'EXIT', {undef,[{Mod, _, _, _}|_]}} ->
io:format("Missing (Interface): ~p~n", [Mod]),
missing_modules_helper(T, ErrorsFound + 1);
- {'EXIT', {undef,[{OtherMod, _, _}|_]}} ->
+ {'EXIT', {undef,[{OtherMod, _, _, _}|_]}} ->
io:format("Missing (Inherited by the ~p Interface): ~p~n",
[Mod, OtherMod]),
missing_modules_helper(T, ErrorsFound + 1);
diff --git a/lib/orber/src/orber_ifr.erl b/lib/orber/src/orber_ifr.erl
index e56672be93..9631a268e4 100644
--- a/lib/orber/src/orber_ifr.erl
+++ b/lib/orber/src/orber_ifr.erl
@@ -500,7 +500,7 @@ get_tc(Id, Type) ->
case catch Module:tc() of
{'EXIT', Reason} ->
case Reason of
- {undef,[{Module, tc,[]}|_]} ->
+ {undef,[{Module, tc,[],_}|_]} ->
orber:dbg("[~p] ~p:get_tc(~p);~nMissing ~p:tc()~n",
[?LINE, ?MODULE, Id, Module], ?DEBUG_LEVEL),
corba:raise(#'UNKNOWN'{minor=(?ORBER_VMCID bor 1),
diff --git a/lib/orber/test/Makefile b/lib/orber/test/Makefile
index b682bcf24b..996d0d1874 100644
--- a/lib/orber/test/Makefile
+++ b/lib/orber/test/Makefile
@@ -184,31 +184,17 @@ docs:
# Special Targets
# ----------------------------------------------------
-#
-# Each IDL file produces many target files so no pattern
-# rule can be used.
-#
-TGT_ORBER = \
- $(GEN_HRL_ORBER:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_ORBER:%=$(IDLOUTDIR)/%.erl)
-TGT_IIOP = \
- $(GEN_HRL_IIOP:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_IIOP:%=$(IDLOUTDIR)/%.erl)
-
-TGT_TEST_SERVER = \
- $(GEN_HRL_TEST_SERVER:%=$(IDLOUTDIR)/%) \
- $(GEN_MOD_TEST_SERVER:%=$(IDLOUTDIR)/%.erl)
-
-$(TGT_ORBER): orber_test.idl
+IDL-GENERATED: orber_test.idl iiop_test.idl orber_test_server.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) orber_test.idl
-
-$(TGT_IIOP): iiop_test.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) \
+'{preproc_flags,"-I../COSS/CosNaming"}' iiop_test.idl
-
-$(TGT_TEST_SERVER): orber_test_server.idl
erlc $(ERL_IDL_FLAGS) -o$(IDLOUTDIR) \
+'{cfgfile,"orber_test_server.cfg"}' orber_test_server.idl
+ >IDL-GENERATED
+
+$(GEN_FILES): IDL-GENERATED
+
+$(TARGET_FILES): IDL-GENERATED
# ----------------------------------------------------
# Release Targets
diff --git a/lib/os_mon/c_src/Makefile.in b/lib/os_mon/c_src/Makefile.in
index 1a371eb380..b81d3f564b 100644
--- a/lib/os_mon/c_src/Makefile.in
+++ b/lib/os_mon/c_src/Makefile.in
@@ -82,13 +82,9 @@ ALL_CFLAGS = @CFLAGS@ @DEFS@ $(CFLAGS)
# Targets
# ----------------------------------------------------
-debug opt: $(OBJDIR) $(BINDIR) $(TARGET_FILES)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(BINDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(BINDIR):
- -@mkdir -p $(BINDIR)
+debug opt: $(TARGET_FILES)
clean:
rm -f $(TARGET_FILES)
diff --git a/lib/os_mon/mibs/Makefile b/lib/os_mon/mibs/Makefile
index cbbc337491..a361fef378 100644
--- a/lib/os_mon/mibs/Makefile
+++ b/lib/os_mon/mibs/Makefile
@@ -78,6 +78,9 @@ $(SNMP_BIN_TARGET_DIR)/OTP-MIB.bin: $(ERL_TOP)/lib/$(OTP_MIBDIR)/mibs/OTP-MI
v1/%.mib.v1: %.mib
$(ERL_TOP)/lib/snmp/bin/snmp-v2tov1 -o $@ $<
+$(SNMP_BIN_TARGET_DIR)/OTP-OS-MON-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/OTP-REG.bin \
+ $(SNMP_BIN_TARGET_DIR)/OTP-MIB.bin \
# ----------------------------------------------------
# Release Target
diff --git a/lib/parsetools/doc/src/yecc.xml b/lib/parsetools/doc/src/yecc.xml
index c712609cf4..1d2a985d7d 100644
--- a/lib/parsetools/doc/src/yecc.xml
+++ b/lib/parsetools/doc/src/yecc.xml
@@ -425,9 +425,9 @@ myparser:parse_and_scan({Mod, Tokenizer, Args}) </code>
Nonterminals E T F.
Terminals '+' '*' '(' ')' number.
Rootsymbol E.
-E -> E '+' T: ['$1', '$2', '$3'].
+E -> E '+' T: ['$2', '$1', '$3'].
E -> T : '$1'.
-T -> T '*' F: ['$1', '$2', '$3'].
+T -> T '*' F: ['$2', '$1', '$3'].
T -> F : '$1'.
F -> '(' E ')' : '$2'.
F -> number : '$1'. </code>
@@ -438,8 +438,8 @@ Terminals '+' '*' '(' ')' number.
Rootsymbol E.
Left 100 '+'.
Left 200 '*'.
-E -> E '+' E : ['$1', '$2', '$3'].
-E -> E '*' E : ['$1', '$2', '$3'].
+E -> E '+' E : ['$2', '$1', '$3'].
+E -> E '*' E : ['$2', '$1', '$3'].
E -> '(' E ')' : '$2'.
E -> number : '$1'. </code>
<p>3. An overloaded minus operator:</p>
diff --git a/lib/parsetools/include/yeccpre.hrl b/lib/parsetools/include/yeccpre.hrl
index 80a3afbdb6..f638529aa4 100644
--- a/lib/parsetools/include/yeccpre.hrl
+++ b/lib/parsetools/include/yeccpre.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -67,7 +67,7 @@ yeccpars0(Tokens, Tzr, State, States, Vstack) ->
Error
end.
-yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs} | _]) ->
+yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs,_} | _]) ->
case atom_to_list(F) of
"yeccgoto_" ++ SymbolL ->
{ok,[{atom,_,Symbol}],_} = erl_scan:string(SymbolL),
diff --git a/lib/parsetools/src/yeccparser.erl b/lib/parsetools/src/yeccparser.erl
index 63127802ee..e4b8b06db5 100644
--- a/lib/parsetools/src/yeccparser.erl
+++ b/lib/parsetools/src/yeccparser.erl
@@ -17,7 +17,7 @@ line_of(Token) ->
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2010. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -83,7 +83,7 @@ yeccpars0(Tokens, Tzr, State, States, Vstack) ->
Error
end.
-yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs} | _]) ->
+yecc_error_type(function_clause, [{?MODULE,F,ArityOrArgs,_} | _]) ->
case atom_to_list(F) of
"yeccgoto_" ++ SymbolL ->
{ok,[{atom,_,Symbol}],_} = erl_scan:string(SymbolL),
diff --git a/lib/percept/src/percept_db.erl b/lib/percept/src/percept_db.erl
index 52e9afb78f..61b68ce44f 100644
--- a/lib/percept/src/percept_db.erl
+++ b/lib/percept/src/percept_db.erl
@@ -92,7 +92,7 @@ restart(PerceptDB)->
stop_sync(PerceptDB),
do_start().
-%% @spec do_start(pid()) -> pid()
+%% @spec do_start() -> pid()
%% @private
%% @doc starts the percept database.
@@ -131,6 +131,7 @@ stop_sync(Pid)->
{'DOWN', MonitorRef, _Type, Pid, _Info}->
true
after ?STOP_TIMEOUT->
+ erlang:demonitor(MonitorRef, [flush]),
exit(Pid, kill)
end.
@@ -166,14 +167,14 @@ insert(Trace) ->
select(Query) ->
percept_db ! {select, self(), Query},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec select(atom(), list()) -> Result
%% @equiv select({Table,Options})
select(Table, Options) ->
percept_db ! {select, self(), {Table, Options}},
- receive Match -> Match end.
+ receive {result, Match} -> Match end.
%% @spec consolidate() -> Result
%% @doc Checks timestamp and state-flow inconsistencies in the
@@ -213,7 +214,7 @@ loop_percept_db() ->
insert_trace(clean_trace(Trace)),
loop_percept_db();
{select, Pid, Query} ->
- Pid ! select_query(Query),
+ Pid ! {result, select_query(Query)},
loop_percept_db();
{action, stop} ->
stopped;
@@ -222,7 +223,7 @@ loop_percept_db() ->
loop_percept_db();
{operate, Pid, {Table, {Fun, Start}}} ->
Result = ets:foldl(Fun, Start, Table),
- Pid ! Result,
+ Pid ! {result, Result},
loop_percept_db();
Unhandled ->
io:format("loop_percept_db, unhandled query: ~p~n", [Unhandled]),
diff --git a/lib/public_key/asn1/Makefile b/lib/public_key/asn1/Makefile
index 6b2a2bc3d9..c4f8d65aa7 100644
--- a/lib/public_key/asn1/Makefile
+++ b/lib/public_key/asn1/Makefile
@@ -79,7 +79,7 @@ clean:
docs:
-%.erl: %.set.asn
+%.erl %.hrl: %.set.asn
erlc $(ASN_FLAGS) $<
$(HRL_FILES): $(ASN_HRLS)
diff --git a/lib/public_key/asn1/README b/lib/public_key/asn1/README
index 5fb8cf9725..2a880e2d51 100644
--- a/lib/public_key/asn1/README
+++ b/lib/public_key/asn1/README
@@ -46,6 +46,6 @@ diff -r1.1 PKIXAttributeCertificate.asn1
---
> version AttCertVersion, -- version is v2
-4. Defenitions of publuic keys from PKCS-1.asn1 present in
+4. Definitions of public keys from PKCS-1.asn1 present in
PKIX1Algorithms88.asn1 where removed as we take them directly from
PKCS-1.asn1 \ No newline at end of file
diff --git a/lib/public_key/doc/src/public_key.xml b/lib/public_key/doc/src/public_key.xml
index d60d91cd83..9a3832c68b 100644
--- a/lib/public_key/doc/src/public_key.xml
+++ b/lib/public_key/doc/src/public_key.xml
@@ -63,7 +63,7 @@
<p><code>pki_asn1_type() = 'Certificate' | 'RSAPrivateKey'| 'RSAPublicKey'
'DSAPrivateKey' | 'DSAPublicKey' | 'DHParameter' | 'SubjectPublicKeyInfo'</code></p>
- <p><code>pem_entry () = {pki_asn1_type(), binary() %% DER or encrypted DER
+ <p><code>pem_entry () = {pki_asn1_type(), binary(), %% DER or encrypted DER
not_encrypted | {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}}.</code></p>
<p><code>rsa_public_key() = #'RSAPublicKey'{}</code></p>
@@ -72,8 +72,6 @@
<p><code>dsa_public_key() = {integer(), #'Dss-Parms'{}} </code></p>
- <p><code>rsa_private_key() = #'RSAPrivateKey'{} </code></p>
-
<p><code>dsa_private_key() = #'DSAPrivateKey'{}</code></p>
<p><code> public_crypt_options() = [{rsa_pad, rsa_padding()}]. </code></p>
@@ -149,7 +147,7 @@
<name>der_decode(Asn1type, Der) -> term()</name>
<fsummary> Decodes a public key asn1 der encoded entity.</fsummary>
<type>
- <v>Asn1Type = atom() -</v>
+ <v>Asn1Type = atom()</v>
<d> ASN.1 type present in the public_key applications
asn1 specifications.</d>
<v>Der = der_encoded()</v>
@@ -166,7 +164,8 @@
<v>Asn1Type = atom()</v>
<d> Asn1 type present in the public_key applications
ASN.1 specifications.</d>
- <v>Entity = term() - The erlang representation of <c> Asn1Type</c></v>
+ <v>Entity = term()</v>
+ <d>The erlang representation of <c>Asn1Type</c></d>
</type>
<desc>
<p> Encodes a public key entity with ASN.1 DER encoding.</p>
@@ -218,12 +217,13 @@
<fsummary> Creates a pem entry that can be fed to pem_encode/1.</fsummary>
<type>
<v>Asn1Type = pki_asn1_type()</v>
- <v>Entity = term() - The Erlang representation of
+ <v>Entity = term()</v>
+ <d>The Erlang representation of
<c>Asn1Type</c>. If <c>Asn1Type</c> is 'SubjectPublicKeyInfo'
then <c>Entity</c> must be either an rsa_public_key() or a
dsa_public_key() and this function will create the appropriate
'SubjectPublicKeyInfo' entry.
- </v>
+ </d>
<v>CipherInfo = {"DES-CBC" | "DES-EDE3-CBC", crypto:rand_bytes(8)}</v>
<v>Password = string()</v>
</type>
@@ -281,7 +281,7 @@
<desc>
<p>Der encodes a pkix x509 certificate or part of such a
certificate. This function must be used for encoding certificates or parts of certificates
- that are decoded/created on the otp format, whereas for the plain format this
+ that are decoded/created in the otp format, whereas for the plain format this
function will directly call der_encode/2. </p>
</desc>
</func>
diff --git a/lib/public_key/src/public_key.erl b/lib/public_key/src/public_key.erl
index 2901020e83..33fcce2c44 100644
--- a/lib/public_key/src/public_key.erl
+++ b/lib/public_key/src/public_key.erl
@@ -488,9 +488,10 @@ pkix_path_validation(PathErr, [Cert | Chain], Options0) when is_atom(PathErr)->
_:_ ->
{error, Reason}
end;
-pkix_path_validation(TrustedCert, CertChain, Options) when
- is_binary(TrustedCert) -> OtpCert = pkix_decode_cert(TrustedCert,
- otp), pkix_path_validation(OtpCert, CertChain, Options);
+pkix_path_validation(TrustedCert, CertChain, Options)
+ when is_binary(TrustedCert) ->
+ OtpCert = pkix_decode_cert(TrustedCert, otp),
+ pkix_path_validation(OtpCert, CertChain, Options);
pkix_path_validation(#'OTPCertificate'{} = TrustedCert, CertChain, Options)
when is_list(CertChain), is_list(Options) ->
diff --git a/lib/runtime_tools/c_src/Makefile.in b/lib/runtime_tools/c_src/Makefile.in
index 840de39f07..73ab6cdc11 100644
--- a/lib/runtime_tools/c_src/Makefile.in
+++ b/lib/runtime_tools/c_src/Makefile.in
@@ -89,42 +89,31 @@ endif
# Targets
# ----------------------------------------------------
-debug opt: $(OBJDIR) $(BINDIR) $(SOLIBS)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(LIBDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(BINDIR):
- -@mkdir -p $(BINDIR)
+debug opt: $(SOLIBS)
$(OBJDIR)/%.o: %.c
- $(INSTALL_DIR) $(OBJDIR)
$(CC) -c -o $@ $(ALL_CFLAGS) $<
$(LIBDIR)/trace_ip_drv.so: $(TRACE_IP_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ -lc $(LIBS)
$(LIBDIR)/trace_file_drv.so: $(TRACE_FILE_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ -lc $(LIBS)
$(LIBDIR)/trace_ip_drv.dll: $(TRACE_IP_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ $(LIBS)
$(LIBDIR)/trace_file_drv.dll: $(TRACE_FILE_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^ $(LIBS)
#
# VxWorks is simply to different from Unix in this sense.
# Here are the inference rules for VxWorks
#
$(LIBDIR)/trace_ip_drv.eld: $(TRACE_IP_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^
$(LIBDIR)/trace_file_drv.eld: $(TRACE_FILE_DRV_OBJS)
- $(INSTALL_DIR) $(LIBDIR)
$(LD) $(LDFLAGS) -o $@ $^
clean:
diff --git a/lib/sasl/examples/src/Makefile b/lib/sasl/examples/src/Makefile
index 4a4e04a536..c58f651696 100644
--- a/lib/sasl/examples/src/Makefile
+++ b/lib/sasl/examples/src/Makefile
@@ -66,7 +66,7 @@ release_spec: opt
$(INSTALL_DIR) $(RELSYSDIR)/examples/src
$(INSTALL_DIR) $(RELSYSDIR)/examples/ebin
(cd ..; tar cf - src ebin | (cd $(RELSYSDIR)/examples; tar xf -))
- chmod -f -R ug+w $(RELSYSDIR)/examples
+ chmod -R ug+w $(RELSYSDIR)/examples
release_docs_spec:
diff --git a/lib/sasl/test/Makefile b/lib/sasl/test/Makefile
index 0bdb79a06a..65be134462 100644
--- a/lib/sasl/test/Makefile
+++ b/lib/sasl/test/Makefile
@@ -86,7 +86,7 @@ release_tests_spec: make_emakefile
$(INSTALL_DIR) $(RELSYSDIR)
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) sasl.spec sasl.cover $(EMAKEFILE) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cfh - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/snmp/mibs/Makefile.in b/lib/snmp/mibs/Makefile.in
index 3af74eca75..993a67c6f2 100644
--- a/lib/snmp/mibs/Makefile.in
+++ b/lib/snmp/mibs/Makefile.in
@@ -41,8 +41,7 @@ RELSYSDIR = $(RELEASE_PATH)/lib/snmp-$(VSN)
# ----------------------------------------------------
# NOTE:
-# 1) Order is important; some MIBs include others
-# 2) The OTP-REG mib actually belongs to another
+# The OTP-REG mib actually belongs to another
# application (otp_mibs), and is exported by this
# app. But since that app is built later, we have
# to built it here in order to be able to build
@@ -148,6 +147,35 @@ $(ERL_TOP)/lib/snmp/bin/snmp-v2tov1: $(ERL_TOP)/lib/snmp/bin/snmp-v2tov1.src
$(SNMP_BIN_TARGET_DIR)/OTP-REG.bin: $(ERL_TOP)/lib/$(OTP_MIBDIR)/mibs/OTP-REG.mib
$(ERLC) -pa $(SNMP_TOOLKIT)/ebin -I $(SNMP_TOOLKIT)/priv/mibs $(SNMP_FLAGS) -o $(SNMP_BIN_TARGET_DIR) $<
+# To support parallel make, we'll need explicit dependencies
+# to ensure that an imported MIB has been compiled when it's needed.
+
+$(SNMP_BIN_TARGET_DIR)/STANDARD-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/RFC1213-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-TARGET-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-NOTIFICATION-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-TARGET-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-COMMUNITY-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-TARGET-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-USER-BASED-SM-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-VIEW-BASED-ACM-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/SNMP-USM-AES-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/SNMP-FRAMEWORK-MIB.bin
+
+$(SNMP_BIN_TARGET_DIR)/OTP-SNMPEA-MIB.bin: \
+ $(SNMP_BIN_TARGET_DIR)/OTP-REG.bin
+
clean:
rm -f $(TARGET_FILES)
@@ -185,7 +213,7 @@ info:
@echo "VSN = $(VSN)"
@echo "RELSYSDIR = $(RELSYSDIR)"
-v1/%.mib.v1: %.mib
+v1/%.mib.v1: %.mib $(ERL_TOP)/lib/snmp/bin/snmp-v2tov1
$(ERL_TOP)/lib/snmp/bin/snmp-v2tov1 -o $@ $<
diff --git a/lib/snmp/src/agent/snmpa_set_lib.erl b/lib/snmp/src/agent/snmpa_set_lib.erl
index 191029f6db..00c77a0cdb 100644
--- a/lib/snmp/src/agent/snmpa_set_lib.erl
+++ b/lib/snmp/src/agent/snmpa_set_lib.erl
@@ -378,15 +378,15 @@ dbg_apply(M,F,A) ->
Res
end,
case Result of
- {'EXIT', {undef, [{M, F, A} | _]}} ->
+ {'EXIT', {undef, [{M, F, A, _} | _]}} ->
{'EXIT', {hook_undef, {M, F, A}}};
- {'EXIT', {function_clause, [{M, F, A} | _]}} ->
+ {'EXIT', {function_clause, [{M, F, A, _} | _]}} ->
{'EXIT', {hook_function_clause, {M, F, A}}};
% XXX: Old format for compatibility
- {'EXIT', {undef, {M, F, A}}} ->
+ {'EXIT', {undef, {M, F, A, _}}} ->
{'EXIT', {hook_undef, {M, F, A}}};
- {'EXIT', {function_clause, {M, F, A}}} ->
+ {'EXIT', {function_clause, {M, F, A, _}}} ->
{'EXIT', {hook_function_clause, {M, F, A}}};
Result ->
diff --git a/lib/snmp/test/Makefile b/lib/snmp/test/Makefile
index 5530805bc1..78ffb1c255 100644
--- a/lib/snmp/test/Makefile
+++ b/lib/snmp/test/Makefile
@@ -220,6 +220,10 @@ appup: make
$(MAYBE_ESTOP)
+$(SNMP_BIN_TARGET_DIR)/Klas4.bin: $(SNMP_BIN_TARGET_DIR)/Klas3.bin
+
+$(SNMP_BIN_TARGET_DIR)/SA-MIB.bin: $(SNMP_BIN_TARGET_DIR)/OLD-SNMPEA-MIB.bin
+
# ----------------------------------------------------
# Release Target
# ----------------------------------------------------
diff --git a/lib/snmp/test/test_config/Makefile b/lib/snmp/test/test_config/Makefile
index d7bebbc431..d65bb8abe2 100644
--- a/lib/snmp/test/test_config/Makefile
+++ b/lib/snmp/test/test_config/Makefile
@@ -155,23 +155,23 @@ release_spec:
release_tests_spec: clean opt
$(INSTALL_DIR) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
$(INSTALL_DIR) $(RELSYSDIR)/agent
- chmod -f -R u+w $(RELSYSDIR)/agent
+ chmod -R u+w $(RELSYSDIR)/agent
$(INSTALL_DIR) $(RELSYSDIR)/agent/conf
- chmod -f -R u+w $(RELSYSDIR)/agent/conf
+ chmod -R u+w $(RELSYSDIR)/agent/conf
$(INSTALL_DIR) $(RELSYSDIR)/agent/db
- chmod -f -R u+w $(RELSYSDIR)/agent/db
+ chmod -R u+w $(RELSYSDIR)/agent/db
$(INSTALL_DIR) $(RELSYSDIR)/agent/log
- chmod -f -R u+w $(RELSYSDIR)/agent/log
+ chmod -R u+w $(RELSYSDIR)/agent/log
$(INSTALL_DIR) $(RELSYSDIR)/manager
- chmod -f -R u+w $(RELSYSDIR)/manager
+ chmod -R u+w $(RELSYSDIR)/manager
$(INSTALL_DIR) $(RELSYSDIR)/manager/conf
- chmod -f -R u+w $(RELSYSDIR)/manager/conf
+ chmod -R u+w $(RELSYSDIR)/manager/conf
$(INSTALL_DIR) $(RELSYSDIR)/manager/db
- chmod -f -R u+w $(RELSYSDIR)/manager/db
+ chmod -R u+w $(RELSYSDIR)/manager/db
$(INSTALL_DIR) $(RELSYSDIR)/manager/log
- chmod -f -R u+w $(RELSYSDIR)/manager/log
+ chmod -R u+w $(RELSYSDIR)/manager/log
$(INSTALL_DATA) $(SYS_CONFIG_FILES) $(RELSYSDIR)
$(INSTALL_DATA) $(AGENT_CONFIG_FILES) $(RELSYSDIR)/agent/conf
$(INSTALL_DATA) $(MANAGER_CONFIG_FILES) $(RELSYSDIR)/manager/conf
diff --git a/lib/ssh/doc/src/notes.xml b/lib/ssh/doc/src/notes.xml
index 71f3941577..6fc4fdc43d 100644
--- a/lib/ssh/doc/src/notes.xml
+++ b/lib/ssh/doc/src/notes.xml
@@ -29,6 +29,20 @@
<file>notes.xml</file>
</header>
+<section><title>Ssh 2.0.8</title>
+ <section><title>Fixed Bugs and Malfunctions</title>
+ <list>
+ <item>
+ <p>
+ Calling ssh_sftp:stop_channel/1 resulted in that the trap_exit flag was
+ set to true for the invoking process.</p>
+ <p>
+ Own Id: OTP-9386 Aux Id: seq11865</p>
+ </item>
+ </list>
+ </section>
+</section>
+
<section><title>Ssh 2.0.7</title>
<section><title>Fixed Bugs and Malfunctions</title>
<list>
diff --git a/lib/ssh/src/Makefile b/lib/ssh/src/Makefile
index 42880fa80b..e7cf2c6723 100644
--- a/lib/ssh/src/Makefile
+++ b/lib/ssh/src/Makefile
@@ -127,13 +127,10 @@ $(APP_TARGET): $(APP_SRC) ../vsn.mk
$(APPUP_TARGET): $(APPUP_SRC) ../vsn.mk
sed -e 's;%VSN%;$(VSN);' $< > $@
-%.hrl: %.asn1
- erlc $(ASN_FLAGS) $<
+%.erl %.hrl: %.asn1
+ $(ERLC) $(ASN_FLAGS) $<
-DSS.hrl DSS.erl: DSS.asn1
-PKCS-1.hrl PKCS-1.erl: PKCS-1.asn1
-
-$(EBIN)/ssh_file.$(EMULATOR): $(ASN_HRLS)
+$(EBIN)/ssh_file.$(EMULATOR) $(EBIN)/ssh_rsa.$(EMULATOR): $(ASN_HRLS)
docs:
diff --git a/lib/ssh/src/ssh.appup.src b/lib/ssh/src/ssh.appup.src
index 974145836c..150b7d86dd 100644
--- a/lib/ssh/src/ssh.appup.src
+++ b/lib/ssh/src/ssh.appup.src
@@ -19,13 +19,19 @@
{"%VSN%",
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
],
[
- {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []}]},
+ {"2.0.7", [{load_module, ssh_sftp, soft_purge, soft_purge, []}]},
+ {"2.0.6", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []}]},
{"2.0.5", [{load_module, ssh_userreg, soft_purge, soft_purge, []},
+ {load_module, ssh_sftp, soft_purge, soft_purge, []},
{load_module, ssh_connection_handler, soft_purge, soft_purge, [ssh_userreg]}]}
]
}.
diff --git a/lib/ssh/src/ssh_sftp.erl b/lib/ssh/src/ssh_sftp.erl
index 59e09fdd0f..f000558100 100755
--- a/lib/ssh/src/ssh_sftp.erl
+++ b/lib/ssh/src/ssh_sftp.erl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2005-2010. All Rights Reserved.
+%% Copyright Ericsson AB 2005-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -130,9 +130,9 @@ start_channel(Host, Port, Opts) ->
end.
stop_channel(Pid) ->
- case process_info(Pid, [trap_exit]) of
- [{trap_exit, Bool}] ->
- process_flag(trap_exit, true),
+ case is_process_alive(Pid) of
+ true ->
+ OldValue = process_flag(trap_exit, true),
link(Pid),
exit(Pid, ssh_sftp_stop_channel),
receive
@@ -145,9 +145,9 @@ stop_channel(Pid) ->
ok
end
end,
- process_flag(trap_exit, Bool),
+ process_flag(trap_exit, OldValue),
ok;
- undefined ->
+ false ->
ok
end.
diff --git a/lib/ssh/test/Makefile b/lib/ssh/test/Makefile
index 5a2a6de24a..1820924ed6 100644
--- a/lib/ssh/test/Makefile
+++ b/lib/ssh/test/Makefile
@@ -115,7 +115,7 @@ release_tests_spec: opt
$(INSTALL_DATA) $(ERL_FILES) $(RELSYSDIR)
$(INSTALL_DATA) ssh.spec ssh.cover $(RELSYSDIR)
$(INSTALL_DATA) $(HRL_FILES_NEEDED_IN_TEST) $(RELSYSDIR)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
@tar cf - *_SUITE_data | (cd $(RELSYSDIR); tar xf -)
release_docs_spec:
diff --git a/lib/ssh/vsn.mk b/lib/ssh/vsn.mk
index d79038df29..fe2b915d17 100644
--- a/lib/ssh/vsn.mk
+++ b/lib/ssh/vsn.mk
@@ -1,5 +1,5 @@
#-*-makefile-*- ; force emacs to enter makefile-mode
-SSH_VSN = 2.0.7
+SSH_VSN = 2.0.8
APP_VSN = "ssh-$(SSH_VSN)"
diff --git a/lib/ssl/c_src/Makefile.in b/lib/ssl/c_src/Makefile.in
index 6e413e7e8e..a894e6dcd7 100644
--- a/lib/ssl/c_src/Makefile.in
+++ b/lib/ssl/c_src/Makefile.in
@@ -157,13 +157,9 @@ endif
# Targets
# ----------------------------------------------------
-debug opt: $(OBJDIR) $(BINDIR) $(OBJS) $(PORT_PROGRAM) $(SSL_MAKEFILE)
+_create_dirs := $(shell mkdir -p $(OBJDIR) $(BINDIR))
-$(OBJDIR):
- -@mkdir -p $(OBJDIR)
-
-$(BINDIR):
- -@mkdir -p $(BINDIR)
+debug opt: $(OBJS) $(PORT_PROGRAM) $(SSL_MAKEFILE)
$(OBJDIR)/esock_openssl$(obj): esock_openssl.c
$(CC) -c -o $@ $(ALL_CFLAGS) $(SSL_INCLUDE) $<
diff --git a/lib/ssl/c_src/esock_openssl.c b/lib/ssl/c_src/esock_openssl.c
index 2621c9934e..0bc42958f0 100644
--- a/lib/ssl/c_src/esock_openssl.c
+++ b/lib/ssl/c_src/esock_openssl.c
@@ -1024,7 +1024,7 @@ static void info_callback(const SSL *ssl, int where, int ret)
}
}
-/* This function is called whenever a SSL_CTX *ctx structure is
+/* This function is called whenever an SSL_CTX *ctx structure is
* freed.
*/
static void callback_data_free(void *parent, void *ptr, CRYPTO_EX_DATA *ad,
diff --git a/lib/ssl/doc/src/notes.xml b/lib/ssl/doc/src/notes.xml
index b2d17925fd..e090b4e1ef 100644
--- a/lib/ssl/doc/src/notes.xml
+++ b/lib/ssl/doc/src/notes.xml
@@ -554,7 +554,7 @@
Own Id: OTP-8224</p>
</item>
<item>
- <p>A ssl:ssl_accept/3 could crash a connection if the
+ <p>An ssl:ssl_accept/3 could crash a connection if the
timing was wrong.</p> <p>Removed info message if the
socket closed without a proper disconnect from the ssl
layer. </p> <p>ssl:send/2 is now blocking until the
@@ -770,7 +770,7 @@
<item>
<p>
The new ssl implementation released as a alfa in this
- version supports upgrading of a tcp connection to a ssl
+ version supports upgrading of a tcp connection to an ssl
connection so that http client and servers may implement
RFC 2817.</p>
<p>
@@ -789,7 +789,7 @@
very crippled as the control of the ssl-socket was deep
down in openssl making it hard if not impossible to
support all inet options, ipv6 and upgrade of a tcp
- connection to a ssl connection. The alfa version has a
+ connection to an ssl connection. The alfa version has a
few limitations that will be removed before the ssl-4.0
release. Main differences and limitations in the alfa are
listed below.</p>
diff --git a/lib/ssl/doc/src/ssl.xml b/lib/ssl/doc/src/ssl.xml
index 566068beaf..0c4c8796be 100644
--- a/lib/ssl/doc/src/ssl.xml
+++ b/lib/ssl/doc/src/ssl.xml
@@ -35,7 +35,7 @@
<title>SSL</title>
<list type="bulleted">
- <item>ssl requires the crypto an public_key applications.</item>
+ <item>ssl requires the crypto and public_key applications.</item>
<item>Supported SSL/TLS-versions are SSL-3.0 and TLS-1.0 </item>
<item>For security reasons sslv2 is not supported.</item>
<item>Ephemeral Diffie-Hellman cipher suites are supported
@@ -216,7 +216,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
application is encountered. Additionally it will be called
when a certificate is considered valid by the path validation
to allow access to each certificate in the path to the user
- application. Note that the it will differentiate between the
+ application. Note that it will differentiate between the
peer certificate and CA certificates by using valid_peer or
valid as the second argument to the verify fun. See <seealso
marker="public_key:cert_records">the public_key User's
@@ -326,10 +326,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</item>
<tag>{fail_if_no_peer_cert, boolean()}</tag>
- <item>Used together with {verify, verify_peer} by a ssl server.
+ <item>Used together with {verify, verify_peer} by an ssl server.
If set to true, the server will fail if the client does not have
a certificate to send, i.e. sends a empty certificate, if set to
- false it will only fail if the client sends a invalid
+ false it will only fail if the client sends an invalid
certificate (an empty certificate is considered valid).
</item>
@@ -343,10 +343,10 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
PeerCert, Compression, CipherSuite) -> boolean()}</tag>
<item>Enables the ssl server to have a local policy
for deciding if a session should be reused or not,
- only meaning full if <c>reuse_sessions</c> is set to true.
+ only meaningful if <c>reuse_sessions</c> is set to true.
SuggestedSessionId is a binary(), PeerCert is a DER encoded
certificate, Compression is an enumeration integer
- and CipherSuite of type ciphersuite().
+ and CipherSuite is of type ciphersuite().
</item>
</taglist>
@@ -355,7 +355,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<section>
<title>General</title>
- <p>When a ssl socket is in active mode (the default), data from the
+ <p>When an ssl socket is in active mode (the default), data from the
socket is delivered to the owner of the socket in the form of
messages:
</p>
@@ -396,7 +396,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<name>connect(Socket, SslOptions, Timeout) -> {ok, SslSocket}
| {error, Reason}</name>
<fsummary> Upgrades a gen_tcp, or
- equivalent, connected socket to a ssl socket. </fsummary>
+ equivalent, connected socket to an ssl socket. </fsummary>
<type>
<v>Socket = socket()</v>
<v>SslOptions = [ssloption()]</v>
@@ -405,7 +405,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc> <p>Upgrades a gen_tcp, or equivalent,
- connected socket to a ssl socket i.e. performs the
+ connected socket to an ssl socket i.e. performs the
client-side ssl handshake.</p>
</desc>
</func>
@@ -428,12 +428,12 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>close(SslSocket) -> ok | {error, Reason}</name>
- <fsummary>Close a ssl connection</fsummary>
+ <fsummary>Close an ssl connection</fsummary>
<type>
<v>SslSocket = sslsocket()</v>
<v>Reason = term()</v>
</type>
- <desc><p>Close a ssl connection.</p>
+ <desc><p>Close an ssl connection.</p>
</desc>
</func>
@@ -450,7 +450,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<v>Reason = term()</v>
</type>
<desc><p>Assigns a new controlling process to the ssl-socket. A
- controlling process is the owner of a ssl-socket, and receives
+ controlling process is the owner of an ssl-socket, and receives
all messages from the socket.</p>
</desc>
</func>
@@ -496,14 +496,14 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
<func>
<name>listen(Port, Options) ->
{ok, ListenSocket} | {error, Reason}</name>
- <fsummary>Creates a ssl listen socket.</fsummary>
+ <fsummary>Creates an ssl listen socket.</fsummary>
<type>
<v>Port = integer()</v>
<v>Options = options()</v>
<v>ListenSocket = sslsocket()</v>
</type>
<desc>
- <p>Creates a ssl listen socket.</p>
+ <p>Creates an ssl listen socket.</p>
</desc>
</func>
@@ -587,6 +587,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
the socket is closed.</p>
</desc>
</func>
+
<func>
<name>setopts(Socket, Options) -> ok | {error, Reason}</name>
<fsummary>Set socket options.</fsummary>
@@ -646,7 +647,7 @@ fun(OtpCert :: #'OTPCertificate'{}, Event :: {bad_cert, Reason :: atom()} |
</type>
<desc>
<p> Upgrades a gen_tcp, or
- equivalent, socket to a ssl socket i.e. performs the
+ equivalent, socket to an ssl socket i.e. performs the
ssl server-side handshake.</p>
<p><warning>Note that the listen socket should be in {active, false} mode
before telling the client that the server is ready to upgrade
diff --git a/lib/ssl/doc/src/ssl_protocol.xml b/lib/ssl/doc/src/ssl_protocol.xml
index 6936408881..ca5cc8bc7a 100644
--- a/lib/ssl/doc/src/ssl_protocol.xml
+++ b/lib/ssl/doc/src/ssl_protocol.xml
@@ -31,11 +31,11 @@
</p>
<p>By default erlang ssl is run over the TCP/IP protocol even
- though you could plug in an other reliable transport protocol
+ though you could plug in any other reliable transport protocol
with the same API as gen_tcp.</p>
<p>If a client and server wants to use an upgrade mechanism, such as
- defined by RFC2817, to upgrade a regular TCP/IP connection to a ssl
+ defined by RFC2817, to upgrade a regular TCP/IP connection to an ssl
connection the erlang ssl API supports this. This can be useful for
things such as supporting HTTP and HTTPS on the same port and
implementing virtual hosting.
diff --git a/lib/ssl/doc/src/using_ssl.xml b/lib/ssl/doc/src/using_ssl.xml
index 605290b6f9..ab837a156a 100644
--- a/lib/ssl/doc/src/using_ssl.xml
+++ b/lib/ssl/doc/src/using_ssl.xml
@@ -56,7 +56,7 @@
<code type="erl">1 server> ssl:start().
ok</code>
- <p>Create a ssl listen socket</p>
+ <p>Create an ssl listen socket</p>
<code type="erl">2 server> {ok, ListenSocket} =
ssl:listen(9999, [{certfile, "cert.pem"}, {keyfile, "key.pem"},{reuseaddr, true}]).
{ok,{sslsocket, [...]}}</code>
@@ -90,7 +90,7 @@ ok</code>
<section>
<title>Upgrade example</title>
- <note><p> To upgrade a TCP/IP connection to a ssl connection the
+ <note><p> To upgrade a TCP/IP connection to an ssl connection the
client and server have to aggre to do so. Agreement
may be accompliced by using a protocol such the one used by HTTP
specified in RFC 2817.</p> </note>
@@ -114,7 +114,7 @@ ok</code>
<code type="erl">2 client> {ok, Socket} = gen_tcp:connect("localhost", 9999, [], infinity).</code>
<p>Make sure active is set to false before trying
- to upgrade a connection to a ssl connection, otherwhise
+ to upgrade a connection to an ssl connection, otherwhise
ssl handshake messages may be deliverd to the wrong process.</p>
<code type="erl">4 server> inet:setopts(Socket, [{active, false}]).
ok</code>
@@ -124,7 +124,7 @@ ok</code>
{certfile, "cert.pem"}, {keyfile, "key.pem"}]).
{ok,{sslsocket,[...]}}</code>
- <p> Upgrade to a ssl connection. Note that the client and server
+ <p> Upgrade to an ssl connection. Note that the client and server
must agree upon the upgrade and the server must call
ssl:accept/2 before the client calls ssl:connect/3.</p>
<code type="erl">3 client>{ok, SSLSocket} = ssl:connect(Socket, [{cacertfile, "cacerts.pem"},
diff --git a/lib/ssl/src/ssl.erl b/lib/ssl/src/ssl.erl
index a0aedbbbee..46e4b98c98 100644
--- a/lib/ssl/src/ssl.erl
+++ b/lib/ssl/src/ssl.erl
@@ -104,7 +104,7 @@ stop() ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Socket, SslOptions) when is_port(Socket) ->
connect(Socket, SslOptions, infinity).
@@ -151,7 +151,7 @@ connect(Host, Port, Options0, Timeout) ->
-spec listen(port_num(), [option()]) ->{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Creates a ssl listen socket.
+%% Description: Creates an ssl listen socket.
%%--------------------------------------------------------------------
listen(_Port, []) ->
{error, enooptions};
@@ -177,7 +177,7 @@ listen(Port, Options0) ->
-spec transport_accept(#sslsocket{}, timeout()) -> {ok, #sslsocket{}} |
{error, reason()}.
%%
-%% Description: Performs transport accept on a ssl listen socket
+%% Description: Performs transport accept on an ssl listen socket
%%--------------------------------------------------------------------
transport_accept(ListenSocket) ->
transport_accept(ListenSocket, infinity).
@@ -218,7 +218,7 @@ transport_accept(#sslsocket{} = ListenSocket, Timeout) ->
ok | {ok, #sslsocket{}} | {error, reason()}.
-spec ssl_accept(port(), [option()], timeout()) -> {ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(ListenSocket) ->
@@ -252,7 +252,7 @@ ssl_accept(Socket, SslOptions, Timeout) when is_port(Socket) ->
%%--------------------------------------------------------------------
-spec close(#sslsocket{}) -> term().
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(#sslsocket{pid = {ListenSocket, #config{cb={CbMod,_, _, _}}}, fd = new_ssl}) ->
CbMod:close(ListenSocket);
diff --git a/lib/ssl/src/ssl_connection.erl b/lib/ssl/src/ssl_connection.erl
index 21b021afb0..79570c520a 100644
--- a/lib/ssl/src/ssl_connection.erl
+++ b/lib/ssl/src/ssl_connection.erl
@@ -131,7 +131,7 @@ recv(Pid, Length, Timeout) ->
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Connect to a ssl server.
+%% Description: Connect to an ssl server.
%%--------------------------------------------------------------------
connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
try start_fsm(client, Host, Port, Socket, Options, User, CbInfo,
@@ -145,7 +145,7 @@ connect(Host, Port, Socket, Options, User, CbInfo, Timeout) ->
pid(), tuple(), timeout()) ->
{ok, #sslsocket{}} | {error, reason()}.
%%
-%% Description: Performs accept on a ssl listen socket. e.i. performs
+%% Description: Performs accept on an ssl listen socket. e.i. performs
%% ssl handshake.
%%--------------------------------------------------------------------
ssl_accept(Port, Socket, Opts, User, CbInfo, Timeout) ->
@@ -185,7 +185,7 @@ socket_control(Socket, Pid, CbModule) ->
%%--------------------------------------------------------------------
-spec close(pid()) -> ok | {error, reason()}.
%%
-%% Description: Close a ssl connection
+%% Description: Close an ssl connection
%%--------------------------------------------------------------------
close(ConnectionPid) ->
case sync_send_all_state_event(ConnectionPid, close) of
diff --git a/lib/ssl/src/ssl_handshake.erl b/lib/ssl/src/ssl_handshake.erl
index 4e74aec4ac..dfda3e7bc4 100644
--- a/lib/ssl/src/ssl_handshake.erl
+++ b/lib/ssl/src/ssl_handshake.erl
@@ -383,8 +383,9 @@ master_secret(Version, #session{master_secret = Mastersecret},
ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Key calculation failed due to ~p",
- [Reason]),
+ Report = io_lib:format("Key calculation failed due to ~p",
+ [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end;
@@ -400,8 +401,9 @@ master_secret(Version, PremasterSecret, ConnectionStates, Role) ->
SecParams, ConnectionStates, Role)
catch
exit:Reason ->
- error_logger:error_report("Master secret calculation failed"
- " due to ~p", [Reason]),
+ Report = io_lib:format("Master secret calculation failed"
+ " due to ~p", [Reason]),
+ error_logger:error_report(Report),
?ALERT_REC(?FATAL, ?HANDSHAKE_FAILURE)
end.
diff --git a/lib/ssl/src/ssl_record.erl b/lib/ssl/src/ssl_record.erl
index 4c3c0b9c58..72091fdd5f 100644
--- a/lib/ssl/src/ssl_record.erl
+++ b/lib/ssl/src/ssl_record.erl
@@ -342,7 +342,7 @@ get_tls_records_aux(<<?BYTE(?CHANGE_CIPHER_SPEC),?BYTE(MajVer),?BYTE(MinVer),
get_tls_records_aux(Rest, [#ssl_tls{type = ?CHANGE_CIPHER_SPEC,
version = {MajVer, MinVer},
fragment = Data} | Acc]);
-%% Matches a ssl v2 client hello message.
+%% Matches an ssl v2 client hello message.
%% The server must be able to receive such messages, from clients that
%% are willing to use ssl v3 or higher, but have ssl v2 compatibility.
get_tls_records_aux(<<1:1, Length0:15, Data0:Length0/binary, Rest/binary>>,
diff --git a/lib/ssl/src/ssl_ssl2.erl b/lib/ssl/src/ssl_ssl2.erl
index b1005b1acb..30a3a5fc98 100644
--- a/lib/ssl/src/ssl_ssl2.erl
+++ b/lib/ssl/src/ssl_ssl2.erl
@@ -20,7 +20,7 @@
%%
%%----------------------------------------------------------------------
%% Purpose: Handles sslv2 hello as clients supporting sslv2 and higher
-%% will send a sslv2 hello.
+%% will send an sslv2 hello.
%%----------------------------------------------------------------------
-module(ssl_ssl2).
diff --git a/lib/stdlib/doc/src/gen_fsm.xml b/lib/stdlib/doc/src/gen_fsm.xml
index d15383c621..e35b5adace 100644
--- a/lib/stdlib/doc/src/gen_fsm.xml
+++ b/lib/stdlib/doc/src/gen_fsm.xml
@@ -438,7 +438,7 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<fsummary>Initialize process and internal state name and state data.</fsummary>
<type>
<v>Args = term()</v>
- <v>Return = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
+ <v>Result = {ok,StateName,StateData} | {ok,StateName,StateData,Timeout}</v>
<v>&nbsp;&nbsp;| {ok,StateName,StateData,hibernate}</v>
<v>&nbsp;&nbsp;| {stop,Reason} | ignore</v>
<v>&nbsp;StateName = atom()</v>
@@ -639,9 +639,9 @@ gen_fsm:sync_send_all_state_event -----> Module:handle_sync_event/4
<v>StateName = atom()</v>
<v>StateData = term()</v>
<v>Result = {next_state,NextStateName,NewStateData}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
- <v>&nbsp;>&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
- <v>&nbsp;>&nbsp;| {stop,Reason,NewStateData}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,Timeout}</v>
+ <v>&nbsp;&nbsp;| {next_state,NextStateName,NewStateData,hibernate}</v>
+ <v>&nbsp;&nbsp;| {stop,Reason,NewStateData}</v>
<v>&nbsp;NextStateName = atom()</v>
<v>&nbsp;NewStateData = term()</v>
<v>&nbsp;Timeout = int()>0 | infinity</v>
diff --git a/lib/stdlib/doc/src/supervisor.xml b/lib/stdlib/doc/src/supervisor.xml
index 009aa60faa..edd119d37a 100644
--- a/lib/stdlib/doc/src/supervisor.xml
+++ b/lib/stdlib/doc/src/supervisor.xml
@@ -150,9 +150,12 @@ child_spec() = {Id,StartFunc,Restart,Shutdown,Type,Modules}
<p><c>Restart</c> defines when a terminated child process
should be restarted. A <c>permanent</c> child process should
always be restarted, a <c>temporary</c> child process should
- never be restarted and a <c>transient</c> child process
- should be restarted only if it terminates abnormally, i.e.
- with another exit reason than <c>normal</c>.</p>
+ never be restarted (even when the supervisor's restart strategy
+ is <c>rest_for_one</c> or <c>one_for_all</c> and a sibling's
+ death causes the temporary process to be terminated) and a
+ <c>transient</c> child process should be restarted only if
+ it terminates abnormally, i.e. with another exit reason
+ than <c>normal</c>.</p>
</item>
<item>
<p><c>Shutdown</c> defines how a child process should be
diff --git a/lib/stdlib/doc/src/unicode_usage.xml b/lib/stdlib/doc/src/unicode_usage.xml
index 416df1f02c..b48ad8c1f3 100644
--- a/lib/stdlib/doc/src/unicode_usage.xml
+++ b/lib/stdlib/doc/src/unicode_usage.xml
@@ -52,7 +52,7 @@
<tag>UCS-4</tag>
<item>Basically the same as UTF-32, but without some Unicode semantics, defined by IEEE and has little use as a separate encoding standard. For all normal (and possibly abnormal) usages, UTF-32 and UCS-4 are interchangeable.</item>
</taglist>
-<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a whole in the Unicode range to cope with backward compatibility.</p>
+<p>Certain ranges of characters are left unused and certain ranges are even deemed invalid. The most notable invalid range is 16#D800 - 16#DFFF, as the UTF-16 encoding does not allow for encoding of these numbers. It can be speculated that the UTF-16 encoding standard was, from the beginning, expected to be able to hold all Unicode characters in one 16-bit entity, but then had to be extended, leaving a hole in the Unicode range to cope with backward compatibility.</p>
<p>Additionally, the codepoint 16#FEFF is used for byte order marks (BOM's) and use of that character is not encouraged in other contexts than that. It actually is valid though, as the character "ZWNBS" (Zero Width Non Breaking Space). BOM's are used to identify encodings and byte order for programs where such parameters are not known in advance. Byte order marks are more seldom used than one could expect, put their use is becoming more widely spread as they provide the means for programs to make educated guesses about the Unicode format of a certain file.</p>
</section>
<section>
diff --git a/lib/stdlib/src/beam_lib.erl b/lib/stdlib/src/beam_lib.erl
index d9c645d787..9077e59fdc 100644
--- a/lib/stdlib/src/beam_lib.erl
+++ b/lib/stdlib/src/beam_lib.erl
@@ -224,7 +224,7 @@ version(File) ->
MD5 :: binary().
md5(File) ->
- case catch read_significant_chunks(File) of
+ case catch read_significant_chunks(File, md5_chunks()) of
{ok, {Module, Chunks0}} ->
Chunks = filter_funtab(Chunks0),
{ok, {Module, erlang:md5([C || {_Id, C} <- Chunks])}};
@@ -395,7 +395,7 @@ strip_fils(Files) ->
%% -> {ok, {Mod, FileName}} | {ok, {Mod, binary()}} | throw(Error)
strip_file(File) ->
- {ok, {Mod, Chunks}} = read_significant_chunks(File),
+ {ok, {Mod, Chunks}} = read_significant_chunks(File, significant_chunks()),
{ok, Stripped0} = build_module(Chunks),
Stripped = compress(Stripped0),
case File of
@@ -453,8 +453,8 @@ is_useless_chunk("CInf") -> true;
is_useless_chunk(_) -> false.
%% -> {ok, {Module, Chunks}} | throw(Error)
-read_significant_chunks(File) ->
- case read_chunk_data(File, significant_chunks(), [allow_missing_chunks]) of
+read_significant_chunks(File, ChunkList) ->
+ case read_chunk_data(File, ChunkList, [allow_missing_chunks]) of
{ok, {Module, Chunks0}} ->
Mandatory = mandatory_chunks(),
Chunks = filter_significant_chunks(Chunks0, Mandatory, File, Module),
@@ -835,12 +835,15 @@ file_error(FileName, {error, Reason}) ->
error(Reason) ->
throw({error, ?MODULE, Reason}).
-
-%% The following chunks are significant when calculating the MD5 for a module,
-%% and also the modules that must be retained when stripping a file.
-%% They are listed in the order that they should be MD5:ed.
+%% The following chunks must be kept when stripping a BEAM file.
significant_chunks() ->
+ ["Line" | md5_chunks()].
+
+%% The following chunks are significant when calculating the MD5
+%% for a module. They are listed in the order that they should be MD5:ed.
+
+md5_chunks() ->
["Atom", "Code", "StrT", "ImpT", "ExpT", "FunT", "LitT"].
%% The following chunks are mandatory in every Beam file.
diff --git a/lib/stdlib/src/c.erl b/lib/stdlib/src/c.erl
index febfdd6285..a920921a5e 100644
--- a/lib/stdlib/src/c.erl
+++ b/lib/stdlib/src/c.erl
@@ -797,7 +797,7 @@ appcall(App, M, F, Args) ->
catch
error:undef ->
case erlang:get_stacktrace() of
- [{M,F,Args}|_] ->
+ [{M,F,Args,_}|_] ->
Arity = length(Args),
io:format("Call to ~w:~w/~w in application ~w failed.\n",
[M,F,Arity,App]);
diff --git a/lib/stdlib/src/epp.erl b/lib/stdlib/src/epp.erl
index d804c1dee5..230a4a0612 100644
--- a/lib/stdlib/src/epp.erl
+++ b/lib/stdlib/src/epp.erl
@@ -684,7 +684,7 @@ scan_include_lib([{'(',_Llp},{string,_Lf,NewName0},{')',_Lrp},{dot,_Ld}],
{error,_E1} ->
case catch find_lib_dir(NewName) of
{LibDir, Rest} when is_list(LibDir) ->
- LibName = filename:join([LibDir | Rest]),
+ LibName = fname_join([LibDir | Rest]),
case file:open(LibName, [read]) of
{ok,NewF} ->
ExtraPath = [filename:dirname(LibName)],
@@ -1154,7 +1154,12 @@ expand_var1(NewName) ->
[[$$ | Var] | Rest] = filename:split(NewName),
Value = os:getenv(Var),
true = Value =/= false,
- {ok, filename:join([Value | Rest])}.
+ {ok, fname_join([Value | Rest])}.
+
+fname_join(["." | [_|_]=Rest]) ->
+ fname_join(Rest);
+fname_join(Components) ->
+ filename:join(Components).
%% The line only. (Other tokens may have the column and text as well...)
loc_attr(Line) when is_integer(Line) ->
diff --git a/lib/stdlib/src/erl_eval.erl b/lib/stdlib/src/erl_eval.erl
index 515ea2ebb7..4f4fa16040 100644
--- a/lib/stdlib/src/erl_eval.erl
+++ b/lib/stdlib/src/erl_eval.erl
@@ -621,7 +621,7 @@ eval_generate(Term, _P, _Bs0, _Lf, _Ef, _CompFun, _Acc) ->
erlang:raise(error, {bad_generator,Term}, stacktrace()).
eval_b_generate(<<_/bitstring>>=Bin, P, Bs0, Lf, Ef, CompFun, Acc) ->
- Mfun = fun(L, R, Bs) -> match1(L, R, Bs, Bs0) end,
+ Mfun = match_fun(Bs0),
Efun = fun(Exp, Bs) -> expr(Exp, Bs, Lf, Ef, none) end,
case eval_bits:bin_gen(P, Bin, new_bindings(), Bs0, Mfun, Efun) of
{match, Rest, Bs1} ->
@@ -1024,7 +1024,7 @@ match1({tuple,_,_}, _, _Bs, _BBs) ->
throw(nomatch);
match1({bin, _, Fs}, <<_/bitstring>>=B, Bs0, BBs) ->
eval_bits:match_bits(Fs, B, Bs0, BBs,
- fun(L, R, Bs) -> match1(L, R, Bs, BBs) end,
+ match_fun(BBs),
fun(E, Bs) -> expr(E, Bs, none, none, none) end);
match1({bin,_,_}, _, _Bs, _BBs) ->
throw(nomatch);
@@ -1053,6 +1053,12 @@ match1({op,Line,Op,L,R}, Term, Bs, BBs) ->
match1(_, _, _Bs, _BBs) ->
throw(invalid).
+match_fun(BBs) ->
+ fun(match, {L,R,Bs}) -> match1(L, R, Bs, BBs);
+ (binding, {Name,Bs}) -> binding(Name, Bs);
+ (add_binding, {Name,Val,Bs}) -> add_binding(Name, Val, Bs)
+ end.
+
match_tuple([E|Es], Tuple, I, Bs0, BBs) ->
{match,Bs} = match1(E, element(I, Tuple), Bs0, BBs),
match_tuple(Es, Tuple, I+1, Bs, BBs);
diff --git a/lib/stdlib/src/escript.erl b/lib/stdlib/src/escript.erl
index d67617260e..2325bb63e5 100644
--- a/lib/stdlib/src/escript.erl
+++ b/lib/stdlib/src/escript.erl
@@ -866,7 +866,7 @@ hidden_apply(App, M, F, Args) ->
catch
error:undef ->
case erlang:get_stacktrace() of
- [{M,F,Args} | _] ->
+ [{M,F,Args,_} | _] ->
Arity = length(Args),
Text = io_lib:format("Call to ~w:~w/~w in application ~w failed.\n",
[M, F, Arity, App]),
diff --git a/lib/stdlib/src/eval_bits.erl b/lib/stdlib/src/eval_bits.erl
index 2cbd6cdae7..ddce4bd75a 100644
--- a/lib/stdlib/src/eval_bits.erl
+++ b/lib/stdlib/src/eval_bits.erl
@@ -31,8 +31,9 @@
%% @type evalfun(). A closure which evaluates an expression given an
%% environment
%%
-%% @type matchfun(). A closure which performs a match given a value, a
-%% pattern and an environment
+%% @type matchfun(). A closure which depending on its first argument
+%% can perform a match (given a value, a pattern and an environment),
+%% lookup a variable in the bindings, or add a new binding
%%
%% @type field() represents a field in a "bin"
@@ -144,7 +145,8 @@ eval_exp_field(Val, Size, Unit, binary, _, _) ->
bin_gen({bin,_,Fs}, Bin, Bs0, BBs0, Mfun, Efun) ->
bin_gen(Fs, Bin, Bs0, BBs0, Mfun, Efun, true).
-bin_gen([F|Fs], Bin, Bs0, BBs0, Mfun, Efun, Flag) ->
+bin_gen([F|Fs], Bin, Bs0, BBs0, Mfun, Efun, Flag)
+ when is_function(Mfun, 2), is_function(Efun, 2) ->
case bin_gen_field(F, Bin, Bs0, BBs0, Mfun, Efun) of
{match,Bs,BBs,Rest} ->
bin_gen(Fs, Rest, Bs, BBs, Mfun, Efun, Flag);
@@ -175,14 +177,14 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
{Size1, [Type,{unit,Unit},Sign,Endian]} =
make_bit_type(Line, Size0, Options0),
V = erl_eval:partial_eval(VE),
- match_check_size(Size1, BBs0),
+ match_check_size(Mfun, Size1, BBs0),
{value, Size, _BBs} = Efun(Size1, BBs0),
case catch get_value(Bin, Type, Size, Unit, Sign, Endian) of
{Val,<<_/bitstring>>=Rest} ->
NewV = coerce_to_float(V, Type),
- case catch Mfun(NewV, Val, Bs0) of
+ case catch Mfun(match, {NewV,Val,Bs0}) of
{match,Bs} ->
- BBs = add_bin_binding(NewV, Bs, BBs0),
+ BBs = add_bin_binding(Mfun, NewV, Bs, BBs0),
{match,Bs,BBs,Rest};
_ ->
{nomatch,Rest}
@@ -205,7 +207,8 @@ bin_gen_field({bin_element,Line,VE,Size0,Options0},
match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun, _) ->
match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun).
-match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun) ->
+match_bits(Fs, Bin, Bs0, BBs, Mfun, Efun)
+ when is_function(Mfun, 2), is_function(Efun, 2) ->
case catch match_bits_1(Fs, Bin, Bs0, BBs, Mfun, Efun) of
{match,Bs} -> {match,Bs};
invalid -> throw(invalid);
@@ -230,12 +233,12 @@ match_field_1({bin_element,Line,VE,Size0,Options0},
make_bit_type(Line, Size0, Options0),
V = erl_eval:partial_eval(VE),
Size2 = erl_eval:partial_eval(Size1),
- match_check_size(Size2, BBs0),
+ match_check_size(Mfun, Size2, BBs0),
{value, Size, _BBs} = Efun(Size2, BBs0),
{Val,Rest} = get_value(Bin, Type, Size, Unit, Sign, Endian),
NewV = coerce_to_float(V, Type),
- {match,Bs} = Mfun(NewV, Val, Bs0),
- BBs = add_bin_binding(NewV, Bs, BBs0),
+ {match,Bs} = Mfun(match, {NewV,Val,Bs0}),
+ BBs = add_bin_binding(Mfun, NewV, Bs, BBs0),
{Bs,BBs,Rest}.
%% Almost identical to the one in sys_pre_expand.
@@ -249,12 +252,12 @@ coerce_to_float({integer,L,I}=E, float) ->
coerce_to_float(E, _Type) ->
E.
-add_bin_binding({var,_,'_'}, _Bs, BBs) ->
+add_bin_binding(_, {var,_,'_'}, _Bs, BBs) ->
BBs;
-add_bin_binding({var,_,Name}, Bs, BBs) ->
- {value,Value} = erl_eval:binding(Name, Bs),
- erl_eval:add_binding(Name, Value, BBs);
-add_bin_binding(_, _Bs, BBs) ->
+add_bin_binding(Mfun, {var,_,Name}, Bs, BBs) ->
+ {value,Value} = Mfun(binding, {Name,Bs}),
+ Mfun(add_binding, {Name,Value,BBs});
+add_bin_binding(_, _, _Bs, BBs) ->
BBs.
get_value(Bin, integer, Size, Unit, Sign, Endian) ->
@@ -327,20 +330,20 @@ make_bit_type(_Line, Size, Type0) -> %Size evaluates to an integer or 'all'
{error,Reason} -> error(Reason)
end.
-match_check_size({var,_,V}, Bs) ->
- case erl_eval:binding(V, Bs) of
+match_check_size(Mfun, {var,_,V}, Bs) ->
+ case Mfun(binding, {V,Bs}) of
{value,_} -> ok;
unbound -> throw(invalid) % or, rather, error({unbound,V})
end;
-match_check_size({atom,_,all}, _Bs) ->
+match_check_size(_, {atom,_,all}, _Bs) ->
ok;
-match_check_size({atom,_,undefined}, _Bs) ->
+match_check_size(_, {atom,_,undefined}, _Bs) ->
ok;
-match_check_size({integer,_,_}, _Bs) ->
+match_check_size(_, {integer,_,_}, _Bs) ->
ok;
-match_check_size({value,_,_}, _Bs) ->
+match_check_size(_, {value,_,_}, _Bs) ->
ok; %From the debugger.
-match_check_size(_, _Bs) ->
+match_check_size(_, _, _Bs) ->
throw(invalid).
%% error(Reason) -> exception thrown
diff --git a/lib/stdlib/src/gen_event.erl b/lib/stdlib/src/gen_event.erl
index 1c4a73680b..d1dd074fba 100644
--- a/lib/stdlib/src/gen_event.erl
+++ b/lib/stdlib/src/gen_event.erl
@@ -667,16 +667,16 @@ report_error(_Handler, {swapped,_,_}, _, _, _) -> ok;
report_error(Handler, Reason, State, LastIn, SName) ->
Reason1 =
case Reason of
- {'EXIT',{undef,[{M,F,A}|MFAs]}} ->
+ {'EXIT',{undef,[{M,F,A,L}|MFAs]}} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
- {undef,[{M,F,A}|MFAs]};
+ {undef,[{M,F,A,L}|MFAs]};
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
{'EXIT',Why} ->
diff --git a/lib/stdlib/src/gen_fsm.erl b/lib/stdlib/src/gen_fsm.erl
index f2f1365d3d..ea21136bdb 100644
--- a/lib/stdlib/src/gen_fsm.erl
+++ b/lib/stdlib/src/gen_fsm.erl
@@ -561,16 +561,16 @@ terminate(Reason, Name, Msg, Mod, StateName, StateData, Debug) ->
error_info(Reason, Name, Msg, StateName, StateData, Debug) ->
Reason1 =
case Reason of
- {undef,[{M,F,A}|MFAs]} ->
+ {undef,[{M,F,A,L}|MFAs]} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
Reason;
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
_ ->
diff --git a/lib/stdlib/src/gen_server.erl b/lib/stdlib/src/gen_server.erl
index 09d94a9c40..b8ea3a4de2 100644
--- a/lib/stdlib/src/gen_server.erl
+++ b/lib/stdlib/src/gen_server.erl
@@ -729,16 +729,16 @@ error_info(_Reason, application_controller, _Msg, _State, _Debug) ->
error_info(Reason, Name, Msg, State, Debug) ->
Reason1 =
case Reason of
- {undef,[{M,F,A}|MFAs]} ->
+ {undef,[{M,F,A,L}|MFAs]} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
Reason;
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
_ ->
diff --git a/lib/stdlib/src/lib.erl b/lib/stdlib/src/lib.erl
index c303ae60b5..314fd60903 100644
--- a/lib/stdlib/src/lib.erl
+++ b/lib/stdlib/src/lib.erl
@@ -173,12 +173,12 @@ format_fun(Fun) when is_function(Fun) ->
analyze_exception(error, Term, Stack) ->
case {is_stacktrace(Stack), Stack, Term} of
- {true, [{_M,_F,As}=MFA|MFAs], function_clause} when is_list(As) ->
- {Term,[MFA],MFAs};
- {true, [{shell,F,A}], function_clause} when is_integer(A) ->
+ {true, [{_,_,As,_}=MFAL|MFAs], function_clause} when is_list(As) ->
+ {Term,[MFAL],MFAs};
+ {true, [{shell,F,A,_}], function_clause} when is_integer(A) ->
{Term, [{F,A}], []};
- {true, [{_M,_F,_AorAs}=MFA|MFAs], undef} ->
- {Term,[MFA],MFAs};
+ {true, [{_,_,_,_}=MFAL|MFAs], undef} ->
+ {Term,[MFAL],MFAs};
{true, _, _} ->
{Term,[],Stack};
{false, _, _} ->
@@ -194,9 +194,11 @@ analyze_exception(_Class, Term, Stack) ->
is_stacktrace([]) ->
true;
-is_stacktrace([{M,F,A}|Fs]) when is_atom(M), is_atom(F), is_integer(A) ->
+is_stacktrace([{M,F,A,I}|Fs])
+ when is_atom(M), is_atom(F), is_integer(A), is_list(I) ->
is_stacktrace(Fs);
-is_stacktrace([{M,F,As}|Fs]) when is_atom(M), is_atom(F), length(As) >= 0 ->
+is_stacktrace([{M,F,As,I}|Fs])
+ when is_atom(M), is_atom(F), length(As) >= 0, is_list(I) ->
is_stacktrace(Fs);
is_stacktrace(_) ->
false.
@@ -225,9 +227,9 @@ explain_reason(function_clause, error, [{F,A}], _PF, _S) ->
%% Shell commands
FAs = io_lib:fwrite(<<"~w/~w">>, [F, A]),
[<<"no function clause matching call to ">> | FAs];
-explain_reason(function_clause, error=Cl, [{M,F,As}], PF, S) ->
+explain_reason(function_clause, error=Cl, [{M,F,As,Loc}], PF, S) ->
Str = <<"no function clause matching ">>,
- format_errstr_call(Str, Cl, {M,F}, As, PF, S);
+ [format_errstr_call(Str, Cl, {M,F}, As, PF, S),$\s|location(Loc)];
explain_reason(if_clause, error, [], _PF, _S) ->
<<"no true branch found when evaluating an if expression">>;
explain_reason(noproc, error, [], _PF, _S) ->
@@ -242,11 +244,11 @@ explain_reason({try_clause,V}, error=Cl, [], PF, S) ->
%% "there is no try clause with a true guard sequence and a
%% pattern matching..."
format_value(V, <<"no try clause matching ">>, Cl, PF, S);
-explain_reason(undef, error, [{M,F,A}], _PF, _S) ->
+explain_reason(undef, error, [{M,F,A,_}], _PF, _S) ->
%% Only the arity is displayed, not the arguments, if there are any.
io_lib:fwrite(<<"undefined function ~s">>,
[mfa_to_string(M, F, n_args(A))]);
-explain_reason({shell_undef,F,A}, error, [], _PF, _S) ->
+explain_reason({shell_undef,F,A,_}, error, [], _PF, _S) ->
%% Give nicer reports for undefined shell functions
%% (but not when the user actively calls shell_default:F(...)).
io_lib:fwrite(<<"undefined shell command ~s/~w">>, [F, n_args(A)]);
@@ -292,17 +294,19 @@ argss(I) ->
io_lib:fwrite(<<"~w arguments">>, [I]).
format_stacktrace1(S0, Stack0, PF, SF) ->
- Stack1 = lists:dropwhile(fun({M,F,A}) -> SF(M, F, A)
+ Stack1 = lists:dropwhile(fun({M,F,A,_}) -> SF(M, F, A)
end, lists:reverse(Stack0)),
S = [" " | S0],
Stack = lists:reverse(Stack1),
format_stacktrace2(S, Stack, 1, PF).
-format_stacktrace2(S, [{M,F,A}|Fs], N, PF) when is_integer(A) ->
- [io_lib:fwrite(<<"~s~s ~s">>,
- [sep(N, S), origin(N, M, F, A), mfa_to_string(M, F, A)])
+format_stacktrace2(S, [{M,F,A,L}|Fs], N, PF) when is_integer(A) ->
+ [io_lib:fwrite(<<"~s~s ~s ~s">>,
+ [sep(N, S), origin(N, M, F, A),
+ mfa_to_string(M, F, A),
+ location(L)])
| format_stacktrace2(S, Fs, N + 1, PF)];
-format_stacktrace2(S, [{M,F,As}|Fs], N, PF) when is_list(As) ->
+format_stacktrace2(S, [{M,F,As,_}|Fs], N, PF) when is_list(As) ->
A = length(As),
CalledAs = [S,<<" called as ">>],
C = format_call("", CalledAs, {M,F}, As, PF),
@@ -313,6 +317,16 @@ format_stacktrace2(S, [{M,F,As}|Fs], N, PF) when is_list(As) ->
format_stacktrace2(_S, [], _N, _PF) ->
"".
+location(L) ->
+ File = proplists:get_value(file, L),
+ Line = proplists:get_value(line, L),
+ if
+ File =/= undefined, Line =/= undefined ->
+ io_lib:format("(~s, line ~w)", [File, Line]);
+ true ->
+ ""
+ end.
+
sep(1, S) -> S;
sep(_, S) -> [$\n | S].
diff --git a/lib/stdlib/src/proplists.erl b/lib/stdlib/src/proplists.erl
index 68697d0da2..e3eda5d932 100644
--- a/lib/stdlib/src/proplists.erl
+++ b/lib/stdlib/src/proplists.erl
@@ -49,9 +49,10 @@
%% ---------------------------------------------------------------------
--export_type([property/0]).
+-export_type([property/0, proplist/0]).
-type property() :: atom() | tuple().
+-type proplist() :: [property()].
%% ---------------------------------------------------------------------
diff --git a/lib/stdlib/src/qlc.erl b/lib/stdlib/src/qlc.erl
index 5ca04ff023..f5e180b4bd 100644
--- a/lib/stdlib/src/qlc.erl
+++ b/lib/stdlib/src/qlc.erl
@@ -123,7 +123,7 @@
-record(setup, {parent}).
--define(THROWN_ERROR, {?MODULE, throw_error, _}).
+-define(THROWN_ERROR, {?MODULE, throw_error, _, _}).
-export_type([query_handle/0]).
@@ -3701,7 +3701,8 @@ lookup_join(F1, C1, LuF, C2, Rev) ->
maybe_error_logger(allowed, _) ->
ok;
maybe_error_logger(Name, Why) ->
- [_, _, {?MODULE,maybe_error_logger,_} | Stacktrace] = expand_stacktrace(),
+ [_, _, {?MODULE,maybe_error_logger,_,_} | Stacktrace] =
+ expand_stacktrace(),
Trimmer = fun(M, _F, _A) -> M =:= erl_eval end,
Formater = fun(Term, I) -> io_lib:print(Term, I, 80, -1) end,
X = lib:format_stacktrace(1, Stacktrace, Trimmer, Formater),
@@ -3720,7 +3721,7 @@ expand_stacktrace() ->
expand_stacktrace(D) ->
_ = erlang:system_flag(backtrace_depth, D),
{'EXIT', {foo, Stacktrace}} = (catch erlang:error(foo)),
- L = lists:takewhile(fun({M,_,_}) -> M =/= ?MODULE
+ L = lists:takewhile(fun({M,_,_,_}) -> M =/= ?MODULE
end, lists:reverse(Stacktrace)),
if
length(L) < 3 andalso length(Stacktrace) =:= D ->
diff --git a/lib/stdlib/src/re.erl b/lib/stdlib/src/re.erl
index e08258a535..99bcbd722e 100644
--- a/lib/stdlib/src/re.erl
+++ b/lib/stdlib/src/re.erl
@@ -573,10 +573,10 @@ ucompile(RE,Options) ->
re:compile(unicode:characters_to_binary(RE,unicode),Options)
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[RE,Options])),
- erlang:raise(error,AnyError,[{Mod,compile,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,compile,L,Loc}|Rest])
end.
@@ -585,10 +585,10 @@ urun(Subject,RE,Options) ->
urun2(Subject,RE,Options)
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[Subject,RE,Options])),
- erlang:raise(error,AnyError,[{Mod,run,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,run,L,Loc}|Rest])
end.
urun2(Subject0,RE0,Options0) ->
@@ -625,20 +625,20 @@ grun(Subject,RE,{Options,NeedClean}) ->
grun2(Subject,RE,{Options,NeedClean})
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[Subject,RE,Options])),
- erlang:raise(error,AnyError,[{Mod,run,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,run,L,Loc}|Rest])
end;
grun(Subject,RE,{Options,NeedClean,OrigRE}) ->
try
grun2(Subject,RE,{Options,NeedClean})
catch
error:AnyError ->
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,Loc}|Rest]}} =
(catch erlang:error(new_stacktrace,
[Subject,OrigRE,Options])),
- erlang:raise(error,AnyError,[{Mod,run,L}|Rest])
+ erlang:raise(error,AnyError,[{Mod,run,L,Loc}|Rest])
end.
grun2(Subject,RE,{Options,NeedClean}) ->
diff --git a/lib/stdlib/src/shell.erl b/lib/stdlib/src/shell.erl
index e3e23e09bc..964697cae6 100644
--- a/lib/stdlib/src/shell.erl
+++ b/lib/stdlib/src/shell.erl
@@ -1088,7 +1088,7 @@ shell_default(F,As,Bs) ->
end.
shell_undef(F,A) ->
- erlang:error({shell_undef,F,A}).
+ erlang:error({shell_undef,F,A,[]}).
local_func_handler(Shell, RT, Ef) ->
H = fun(Lf) ->
diff --git a/lib/stdlib/src/supervisor.erl b/lib/stdlib/src/supervisor.erl
index 023183c5f0..36cc7f4f4b 100644
--- a/lib/stdlib/src/supervisor.erl
+++ b/lib/stdlib/src/supervisor.erl
@@ -738,6 +738,13 @@ restart(one_for_all, Child, State) ->
terminate_children(Children, SupName) ->
terminate_children(Children, SupName, []).
+%% Temporary children should not be restarted and thus should
+%% be skipped when building the list of terminated children, although
+%% we do want them to be shut down as many functions from this module
+%% use this function to just clear everything.
+terminate_children([Child = #child{restart_type=temporary} | Children], SupName, Res) ->
+ do_terminate(Child, SupName),
+ terminate_children(Children, SupName, Res);
terminate_children([Child | Children], SupName, Res) ->
NChild = do_terminate(Child, SupName),
terminate_children(Children, SupName, [NChild | Res]);
diff --git a/lib/stdlib/src/timer.erl b/lib/stdlib/src/timer.erl
index e3d6c905b6..689e42051f 100644
--- a/lib/stdlib/src/timer.erl
+++ b/lib/stdlib/src/timer.erl
@@ -199,7 +199,7 @@ tc(M, F, A) ->
%% Calculate the time difference (in microseconds) of two
%% erlang:now() timestamps, T2-T1.
%%
--spec now_diff(T1, T2) -> Tdiff when
+-spec now_diff(T2, T1) -> Tdiff when
T1 :: erlang:timestamp(),
T2 :: erlang:timestamp(),
Tdiff :: integer().
diff --git a/lib/stdlib/src/unicode.erl b/lib/stdlib/src/unicode.erl
index a5d9965ca2..e9b90befe6 100644
--- a/lib/stdlib/src/unicode.erl
+++ b/lib/stdlib/src/unicode.erl
@@ -73,7 +73,7 @@ characters_to_list_int(ML, Encoding) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,Encoding])),
erlang:raise(error,TheError,[{Mod,characters_to_list,L}|Rest])
@@ -109,7 +109,7 @@ characters_to_binary(ML) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML])),
erlang:raise(error,TheError,[{Mod,characters_to_binary,L}|Rest])
@@ -127,7 +127,7 @@ characters_to_binary_int(ML,InEncoding) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,InEncoding])),
erlang:raise(error,TheError,[{Mod,characters_to_binary,L}|Rest])
@@ -159,7 +159,7 @@ characters_to_binary(ML, latin1, Uni) when is_binary(ML) and ((Uni =:= utf8) or
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,latin1,Uni])),
erlang:raise(error,TheError,
@@ -181,7 +181,7 @@ characters_to_binary(ML,Uni,latin1) when is_binary(ML) and ((Uni =:= utf8) or
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,Uni,latin1])),
erlang:raise(error,TheError,
@@ -200,7 +200,7 @@ characters_to_binary(ML, InEncoding, OutEncoding) ->
_ ->
badarg
end,
- {'EXIT',{new_stacktrace,[{Mod,_,L}|Rest]}} =
+ {'EXIT',{new_stacktrace,[{Mod,_,L,_}|Rest]}} =
(catch erlang:error(new_stacktrace,
[ML,InEncoding,OutEncoding])),
erlang:raise(error,TheError,[{Mod,characters_to_binary,L}|Rest])
diff --git a/lib/stdlib/src/zip.erl b/lib/stdlib/src/zip.erl
index 524d709431..c82c8159b6 100644
--- a/lib/stdlib/src/zip.erl
+++ b/lib/stdlib/src/zip.erl
@@ -223,7 +223,7 @@ openzip_open(F, Options) ->
do_openzip_open(F, Options) ->
Opts = get_openzip_options(Options),
#openzip_opts{output = Output, open_opts = OpO, cwd = CWD} = Opts,
- Input = get_zip_input(F),
+ Input = get_input(F),
In0 = Input({open, F, OpO -- [write]}, []),
{[#zip_comment{comment = C} | Files], In1} =
get_central_dir(In0, fun raw_file_info_etc/5, Input),
@@ -489,7 +489,7 @@ do_list_dir(F, Options) ->
%% Print zip directory in short form
-spec(t(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
t(F) when is_pid(F) -> zip_t(F);
@@ -513,7 +513,7 @@ do_t(F, RawPrint) ->
%% Print zip directory in long form (like ls -l)
-spec(tt(Archive) -> ok when
- Archive :: file:name() | binary | ZipHandle,
+ Archive :: file:name() | binary() | ZipHandle,
ZipHandle :: pid()).
tt(F) when is_pid(F) -> zip_tt(F);
@@ -1174,7 +1174,7 @@ zip_get(Pid) when is_pid(Pid) ->
zip_close(Pid) when is_pid(Pid) ->
request(self(), Pid, close).
--spec(zip_get(FileName, ZipHandle) -> {ok, [Result]} | {error, Reason} when
+-spec(zip_get(FileName, ZipHandle) -> {ok, Result} | {error, Reason} when
FileName :: file:name(),
ZipHandle :: pid(),
Result :: file:name() | {file:name(), binary()},
@@ -1183,7 +1183,7 @@ zip_close(Pid) when is_pid(Pid) ->
zip_get(FileName, Pid) when is_pid(Pid) ->
request(self(), Pid, {get, FileName}).
--spec(zip_list_dir(ZipHandle) -> Result | {error, Reason} when
+-spec(zip_list_dir(ZipHandle) -> {ok, Result} | {error, Reason} when
Result :: [zip_comment() | zip_file()],
ZipHandle :: pid(),
Reason :: term()).
diff --git a/lib/stdlib/test/beam_lib_SUITE.erl b/lib/stdlib/test/beam_lib_SUITE.erl
index 4ccc863795..e42dd341c0 100644
--- a/lib/stdlib/test/beam_lib_SUITE.erl
+++ b/lib/stdlib/test/beam_lib_SUITE.erl
@@ -330,6 +330,7 @@ strip(Conf) when is_list(Conf) ->
?line {Source2D1, BeamFile2D1} = make_beam(PrivDir, simple2, concat),
?line {Source3D1, BeamFile3D1} = make_beam(PrivDir, make_fun, make_fun),
?line {Source4D1, BeamFile4D1} = make_beam(PrivDir, constant, constant),
+ ?line {Source5D1, BeamFile5D1} = make_beam(PrivDir, lines, lines),
?line NoOfTables = length(ets:all()),
?line P0 = pps(),
@@ -360,13 +361,25 @@ strip(Conf) when is_list(Conf) ->
?line {module, make_fun} = code:load_abs(filename:rootname(BeamFile3D1)),
?line {module, constant} = code:load_abs(filename:rootname(BeamFile4D1)),
+ %% check that line number information is still present after stripping
+ ?line {module, lines} = code:load_abs(filename:rootname(BeamFile5D1)),
+ ?line {'EXIT',{badarith,[{lines,t,1,Info}|_]}} =
+ (catch lines:t(atom)),
+ ?line true = code:delete(lines),
+ ?line false = code:purge(lines),
+ ?line {ok, {lines,BeamFile5D1}} = beam_lib:strip(BeamFile5D1),
+ ?line {module, lines} = code:load_abs(filename:rootname(BeamFile5D1)),
+ ?line {'EXIT',{badarith,[{lines,t,1,Info}|_]}} =
+ (catch lines:t(atom)),
+
?line true = (P0 == pps()),
?line NoOfTables = length(ets:all()),
?line delete_files([SourceD1, BeamFileD1,
Source2D1, BeamFile2D1,
Source3D1, BeamFile3D1,
- Source4D1, BeamFile4D1]),
+ Source4D1, BeamFile4D1,
+ Source5D1, BeamFile5D1]),
ok.
@@ -773,6 +786,12 @@ simple_file(File, Module, constant2) ->
"t(A) -> "
" {a,b,[2,3],x,y}. "]),
ok = file:write_file(File, B);
+simple_file(File, Module, lines) ->
+ B = list_to_binary(["-module(", atom_to_list(Module), ").\n"
+ "-export([t/1]).\n"
+ "t(A) ->\n"
+ " A+1.\n"]),
+ ok = file:write_file(File, B);
simple_file(File, Module, F) ->
B = list_to_binary(["-module(", atom_to_list(Module), "). "
"-export([t/0]). "
diff --git a/lib/stdlib/test/dets_SUITE.erl b/lib/stdlib/test/dets_SUITE.erl
index 698070368f..272a8d3950 100644
--- a/lib/stdlib/test/dets_SUITE.erl
+++ b/lib/stdlib/test/dets_SUITE.erl
@@ -1857,9 +1857,9 @@ fixtable(Config, Version) when is_list(Config) ->
?line {ok, _} = dets:open_file(T, Args),
%% badarg
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:safe_fixtable(no_table,true)),
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[T,undefined]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[T,undefined],_}|_]}} =
(catch dets:safe_fixtable(T,undefined)),
%% The table is not allowed to grow while the elements are inserted:
@@ -1940,21 +1940,21 @@ match(Config, Version) ->
%% match, badarg
MSpec = [{'_',[],['$_']}],
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:match(no_table, '_')),
- ?line {'EXIT', {badarg, [{dets,match,[T,'_',not_a_number]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match,[T,'_',not_a_number],_}|_]}} =
(catch dets:match(T, '_', not_a_number)),
?line {EC1, _} = dets:select(T, MSpec, 1),
- ?line {'EXIT', {badarg, [{dets,match,[EC1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match,[EC1],_}|_]}} =
(catch dets:match(EC1)),
%% match_object, badarg
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:match_object(no_table, '_')),
- ?line {'EXIT', {badarg, [{dets,match_object,[T,'_',not_a_number]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match_object,[T,'_',not_a_number],_}|_]}} =
(catch dets:match_object(T, '_', not_a_number)),
?line {EC2, _} = dets:select(T, MSpec, 1),
- ?line {'EXIT', {badarg, [{dets,match_object,[EC2]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,match_object,[EC2],_}|_]}} =
(catch dets:match_object(EC2)),
dets:safe_fixtable(T, true),
@@ -2118,16 +2118,16 @@ select(Config, Version) ->
%% badarg
MSpec = [{'_',[],['$_']}],
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:select(no_table, MSpec)),
- ?line {'EXIT', {badarg, [{dets,select,[T,<<17>>]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[T,<<17>>],_}|_]}} =
(catch dets:select(T, <<17>>)),
- ?line {'EXIT', {badarg, [{dets,select,[T,[]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[T,[]],_}|_]}} =
(catch dets:select(T, [])),
- ?line {'EXIT', {badarg, [{dets,select,[T,MSpec,not_a_number]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[T,MSpec,not_a_number],_}|_]}} =
(catch dets:select(T, MSpec, not_a_number)),
?line {EC, _} = dets:match(T, '_', 1),
- ?line {'EXIT', {badarg, [{dets,select,[EC]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select,[EC],_}|_]}} =
(catch dets:select(EC)),
AllSpec = [{'_',[],['$_']}],
@@ -2210,7 +2210,7 @@ update_counter(Config) when is_list(Config) ->
?line file:delete(Fname),
P0 = pps(),
- ?line {'EXIT', {badarg, [{dets,update_counter,[no_table,1,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,update_counter,[no_table,1,1],_}|_]}} =
(catch dets:update_counter(no_table, 1, 1)),
Args = [{file,Fname},{keypos,2}],
@@ -2254,65 +2254,66 @@ badarg(Config) when is_list(Config) ->
%% badargs are tested in match, select and fixtable too.
%% open
- ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple},[]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple},[]],_}|_]}} =
(catch dets:open_file({a,tuple},[])),
- ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,open_file,[{a,tuple}],_}|_]}} =
(catch dets:open_file({a,tuple})),
- ?line {'EXIT', {badarg, [{dets,open_file,[file,[foo]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,open_file,[file,[foo]],_}|_]}} =
(catch dets:open_file(file,[foo])),
- ?line {'EXIT', {badarg,[{dets,open_file,[{hej,san},[{type,set}|3]]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,open_file,
+ [{hej,san},[{type,set}|3]],_}|_]}} =
(catch dets:open_file({hej,san},[{type,set}|3])),
%% insert
- ?line {'EXIT', {badarg, [{dets,insert,[no_table,{1,2}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[no_table,{1,2}],_}|_]}} =
(catch dets:insert(no_table, {1,2})),
- ?line {'EXIT', {badarg, [{dets,insert,[no_table,[{1,2}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[no_table,[{1,2}]],_}|_]}} =
(catch dets:insert(no_table, [{1,2}])),
- ?line {'EXIT', {badarg, [{dets,insert,[T,{1,2}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[T,{1,2}],_}|_]}} =
(catch dets:insert(T, {1,2})),
- ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2}]],_}|_]}} =
(catch dets:insert(T, [{1,2}])),
- ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2,3}|3]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,insert,[T,[{1,2,3}|3]],_}|_]}} =
(catch dets:insert(T, [{1,2,3} | 3])),
%% lookup{_keys}
- ?line {'EXIT', {badarg, [{dets,lookup_keys,[badarg,[]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,lookup_keys,[badarg,[]],_}|_]}} =
(catch dets:lookup_keys(T, [])),
- ?line {'EXIT', {badarg, [{dets,lookup,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,lookup,[no_table,1],_}|_]}} =
(catch dets:lookup(no_table, 1)),
- ?line {'EXIT', {badarg, [{dets,lookup_keys,[T,[1|2]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,lookup_keys,[T,[1|2]],_}|_]}} =
(catch dets:lookup_keys(T, [1 | 2])),
%% member
- ?line {'EXIT', {badarg, [{dets,member,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,member,[no_table,1],_}|_]}} =
(catch dets:member(no_table, 1)),
%% sync
- ?line {'EXIT', {badarg, [{dets,sync,[no_table]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,sync,[no_table],_}|_]}} =
(catch dets:sync(no_table)),
%% delete{_keys}
- ?line {'EXIT', {badarg, [{dets,delete,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete,[no_table,1],_}|_]}} =
(catch dets:delete(no_table, 1)),
%% delete_object
- ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,{1,2,3}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,{1,2,3}],_}|_]}} =
(catch dets:delete_object(no_table, {1,2,3})),
- ?line {'EXIT', {badarg, [{dets,delete_object,[T,{1,2}]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[T,{1,2}],_}|_]}} =
(catch dets:delete_object(T, {1,2})),
- ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,[{1,2,3}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[no_table,[{1,2,3}]],_}|_]}} =
(catch dets:delete_object(no_table, [{1,2,3}])),
- ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2}]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2}]],_}|_]}} =
(catch dets:delete_object(T, [{1,2}])),
- ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2,3}|3]]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_object,[T,[{1,2,3}|3]],_}|_]}} =
(catch dets:delete_object(T, [{1,2,3} | 3])),
%% first,next,slot
- ?line {'EXIT', {badarg, [{dets,first,[no_table]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,first,[no_table],_}|_]}} =
(catch dets:first(no_table)),
- ?line {'EXIT', {badarg, [{dets,next,[no_table,1]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,next,[no_table,1],_}|_]}} =
(catch dets:next(no_table, 1)),
- ?line {'EXIT', {badarg, [{dets,slot,[no_table,0]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,slot,[no_table,0],_}|_]}} =
(catch dets:slot(no_table, 0)),
%% info
@@ -2321,26 +2322,26 @@ badarg(Config) when is_list(Config) ->
?line undefined = dets:info(T, foo),
%% match_delete
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:match_delete(no_table, '_')),
%% delete_all_objects
- ?line {'EXIT', {badarg, [{dets,delete_all_objects,[no_table]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,delete_all_objects,[no_table],_}|_]}} =
(catch dets:delete_all_objects(no_table)),
%% select_delete
MSpec = [{'_',[],['$_']}],
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:select_delete(no_table, MSpec)),
- ?line {'EXIT', {badarg, [{dets,select_delete,[T, <<17>>]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,select_delete,[T, <<17>>],_}|_]}} =
(catch dets:select_delete(T, <<17>>)),
%% traverse, fold
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:traverse(no_table, fun(_) -> continue end)),
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:foldl(fun(_, A) -> A end, [], no_table)),
- ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true]}|_]}} =
+ ?line {'EXIT', {badarg, [{dets,safe_fixtable,[no_table,true],_}|_]}} =
(catch dets:foldr(fun(_, A) -> A end, [], no_table)),
%% close
@@ -2349,14 +2350,14 @@ badarg(Config) when is_list(Config) ->
?line {error, not_owner} = dets:close(T),
%% init_table
- ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]],_}|_]}} =
(catch dets:init_table(no_table, fun(X) -> X end)),
- ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,init_table,[no_table,_,[]],_}|_]}} =
(catch dets:init_table(no_table, fun(X) -> X end, [])),
%% from_ets
Ets = ets:new(ets,[]),
- ?line {'EXIT', {badarg,[{dets,from_ets,[no_table,_]}|_]}} =
+ ?line {'EXIT', {badarg,[{dets,from_ets,[no_table,_],_}|_]}} =
(catch dets:from_ets(no_table, Ets)),
ets:delete(Ets),
diff --git a/lib/stdlib/test/ets_SUITE.erl b/lib/stdlib/test/ets_SUITE.erl
index 9341300f90..02e97fb3a8 100644
--- a/lib/stdlib/test/ets_SUITE.erl
+++ b/lib/stdlib/test/ets_SUITE.erl
@@ -795,16 +795,16 @@ t_ets_dets(Config, Opts) ->
?line true = ets:from_dets(ETab,DTab),
?line 3000 = ets:info(ETab,size),
?line ets:delete(ETab),
- ?line {'EXIT',{badarg,[{ets,to_dets,[ETab,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,to_dets,[ETab,DTab],_}|_]}} =
(catch ets:to_dets(ETab,DTab)),
- ?line {'EXIT',{badarg,[{ets,from_dets,[ETab,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,from_dets,[ETab,DTab],_}|_]}} =
(catch ets:from_dets(ETab,DTab)),
?line ETab2 = ets_new(x,Opts),
?line filltabint(ETab2,3000),
?line dets:close(DTab),
- ?line {'EXIT',{badarg,[{ets,to_dets,[ETab2,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,to_dets,[ETab2,DTab],_}|_]}} =
(catch ets:to_dets(ETab2,DTab)),
- ?line {'EXIT',{badarg,[{ets,from_dets,[ETab2,DTab]}|_]}} =
+ ?line {'EXIT',{badarg,[{ets,from_dets,[ETab2,DTab],_}|_]}} =
(catch ets:from_dets(ETab2,DTab)),
?line ets:delete(ETab2),
?line (catch file:delete(Fname)),
@@ -2644,7 +2644,7 @@ maybe_sort(L) when is_list(L) ->
%maybe_sort({'EXIT',{Reason, [{Module, Function, _}|_]}}) ->
% {'EXIT',{Reason, [{Module, Function, '_'}]}};
maybe_sort({'EXIT',{Reason, List}}) when is_list(List) ->
- {'EXIT',{Reason, lists:map(fun({Module, Function, _}) ->
+ {'EXIT',{Reason, lists:map(fun({Module, Function, _, _}) ->
{Module, Function, '_'}
end,
List)}};
diff --git a/lib/stdlib/test/filelib_SUITE.erl b/lib/stdlib/test/filelib_SUITE.erl
index a355097fe2..dc4563967c 100644
--- a/lib/stdlib/test/filelib_SUITE.erl
+++ b/lib/stdlib/test/filelib_SUITE.erl
@@ -97,11 +97,12 @@ wildcard_errors(Config) when is_list(Config) ->
wcc(Wc, Error) ->
{'EXIT',{{badpattern,Error},
- [{filelib,compile_wildcard,1}|_]}} = (catch filelib:compile_wildcard(Wc)),
+ [{filelib,compile_wildcard,1,_}|_]}} =
+ (catch filelib:compile_wildcard(Wc)),
{'EXIT',{{badpattern,Error},
- [{filelib,wildcard,1}|_]}} = (catch filelib:wildcard(Wc)),
+ [{filelib,wildcard,1,_}|_]}} = (catch filelib:wildcard(Wc)),
{'EXIT',{{badpattern,Error},
- [{filelib,wildcard,2}|_]}} = (catch filelib:wildcard(Wc, ".")).
+ [{filelib,wildcard,2,_}|_]}} = (catch filelib:wildcard(Wc, ".")).
do_wildcard_1(Dir, Wcf0) ->
do_wildcard_2(Dir, Wcf0),
diff --git a/lib/stdlib/test/proc_lib_SUITE.erl b/lib/stdlib/test/proc_lib_SUITE.erl
index 1565aa9bba..c95089117c 100644
--- a/lib/stdlib/test/proc_lib_SUITE.erl
+++ b/lib/stdlib/test/proc_lib_SUITE.erl
@@ -328,7 +328,7 @@ otp_6345(doc) ->
["'monitor' spawn_opt option"];
otp_6345(Config) when is_list(Config) ->
Opts = [link,monitor],
- {'EXIT', {badarg,[{proc_lib,check_for_monitor,_}|_Stack]}} =
+ {'EXIT', {badarg,[{proc_lib,check_for_monitor,_,_}|_Stack]}} =
(catch proc_lib:start(?MODULE, otp_6345_init, [self()],
1000, Opts)),
ok.
diff --git a/lib/stdlib/test/re_SUITE.erl b/lib/stdlib/test/re_SUITE.erl
index c4817c0d38..3b2e637c84 100644
--- a/lib/stdlib/test/re_SUITE.erl
+++ b/lib/stdlib/test/re_SUITE.erl
@@ -454,115 +454,115 @@ error_handling(Config) when is_list(Config) ->
% The malformed precomiled RE is detected after
% the trap to re:grun from grun, in the grun function clause
% that handles precompiled expressions
- ?line {'EXIT',{badarg,[{re,run,["apa",{1,2,3,4},[global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,["apa",{1,2,3,4},[global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run("apa",{1,2,3,4},[global])),
% An invalid capture list will also cause a badarg late,
% but with a non pre compiled RE, the exception should be thrown by the
% grun function clause that handles RE's compiled implicitly by
% the run/3 BIF before trapping.
- ?line {'EXIT',{badarg,[{re,run,["apa","p",[{capture,[1,{a}]},global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,["apa","p",[{capture,[1,{a}]},global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run("apa","p",[{capture,[1,{a}]},global])),
% And so the case of a precompiled expression together with
% a compile-option (binary and list subject):
?line {ok,RE} = re:compile("(p)"),
?line {match,[[{1,1},{1,1}]]} = re:run(<<"apa">>,RE,[global]),
?line {match,[[{1,1},{1,1}]]} = re:run("apa",RE,[global]),
- {'EXIT',{badarg,[{re,run,
- [<<"apa">>,
- {re_pattern,1,0,_},
- [global,unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,
+ [<<"apa">>,
+ {re_pattern,1,0,_},
+ [global,unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run(<<"apa">>,RE,[global,unicode])),
- {'EXIT',{badarg,[{re,run,
- ["apa",
- {re_pattern,1,0,_},
- [global,unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,run,
+ ["apa",
+ {re_pattern,1,0,_},
+ [global,unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:run("apa",RE,[global,unicode])),
?line {'EXIT',{badarg,_}} = (catch re:run("apa","(p",[])),
?line {'EXIT',{badarg,_}} = (catch re:run("apa","(p",[global])),
% The replace errors:
- ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:replace("apa",{1,2,3,4},"X",[])),
- ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,replace,["apa",{1,2,3,4},"X",[global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:replace("apa",{1,2,3,4},"X",[global])),
?line {'EXIT',{badarg,[{re,replace,
["apa",
{re_pattern,1,0,_},
"X",
- [unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ [unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:replace("apa",RE,"X",[unicode])),
?line <<"aXa">> = iolist_to_binary(re:replace("apa","p","X",[])),
?line {'EXIT',{badarg,[{re,replace,
- ["apa","p","X",[{capture,all,binary}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","p","X",[{capture,all,binary}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","p","X",
[{capture,all,binary}]))),
?line {'EXIT',{badarg,[{re,replace,
- ["apa","p","X",[{capture,all}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","p","X",[{capture,all}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","p","X",
[{capture,all}]))),
?line {'EXIT',{badarg,[{re,replace,
- ["apa","p","X",[{return,banana}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","p","X",[{return,banana}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","p","X",
[{return,banana}]))),
?line {'EXIT',{badarg,_}} = (catch re:replace("apa","(p","X",[])),
% Badarg, not compile error.
?line {'EXIT',{badarg,[{re,replace,
- ["apa","(p","X",[{return,banana}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ["apa","(p","X",[{return,banana}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch iolist_to_binary(re:replace("apa","(p","X",
[{return,banana}]))),
% And the split errors:
?line [<<"a">>,<<"a">>] = (catch re:split("apa","p",[])),
?line [<<"a">>,<<"p">>,<<"a">>] = (catch re:split("apa",RE,[])),
- ?line {'EXIT',{badarg,[{re,split,["apa","p",[global]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa","p",[global]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa","p",[global])),
- ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa","p",[{capture,all}])),
- ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all,binary}]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa","p",[{capture,all,binary}]],_},
+ {?MODULE, error_handling,1,_} | _]}} =
(catch re:split("apa","p",[{capture,all,binary}])),
- ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",{1,2,3,4})),
- ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]]},
- {?MODULE, error_handling,1} | _]}} =
+ ?line {'EXIT',{badarg,[{re,split,["apa",{1,2,3,4},[]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",{1,2,3,4},[])),
?line {'EXIT',{badarg,[{re,split,
["apa",
RE,
- [unicode]]},
- {?MODULE, error_handling,1} | _]}} =
+ [unicode]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",RE,[unicode])),
?line {'EXIT',{badarg,[{re,split,
["apa",
RE,
- [{return,banana}]]},
- {?MODULE, error_handling,1} | _]}} =
+ [{return,banana}]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",RE,[{return,banana}])),
?line {'EXIT',{badarg,[{re,split,
["apa",
RE,
- [banana]]},
- {?MODULE, error_handling,1} | _]}} =
+ [banana]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa",RE,[banana])),
?line {'EXIT',{badarg,_}} = (catch re:split("apa","(p")),
%Exception on bad argument, not compilation error
?line {'EXIT',{badarg,[{re,split,
["apa",
"(p",
- [banana]]},
- {?MODULE, error_handling,1} | _]}} =
+ [banana]],_},
+ {?MODULE,error_handling,1,_} | _]}} =
(catch re:split("apa","(p",[banana])),
?t:timetrap_cancel(Dog),
ok.
diff --git a/lib/stdlib/test/shell_SUITE.erl b/lib/stdlib/test/shell_SUITE.erl
index 8273377ba1..b6019b86f0 100644
--- a/lib/stdlib/test/shell_SUITE.erl
+++ b/lib/stdlib/test/shell_SUITE.erl
@@ -2388,12 +2388,12 @@ otp_6554(Config) when is_list(Config) ->
comm_err(<<"V = lists:seq(1, 20), case V of a -> ok end.">>),
?line "exception error: no function clause matching" =
comm_err(<<"fun(P) when is_pid(P) -> true end(a).">>),
- ?line "exception error: {function_clause,[{erl_eval,do_apply,[unproper|list]}"++_ =
+ ?line "exception error: {function_clause," =
comm_err(<<"erlang:error(function_clause, [unproper | list]).">>),
?line "exception error: function_clause" =
comm_err(<<"erlang:error(function_clause, 4).">>),
%% Cheating:
- ?line "exception error: no function clause matching erl_eval:do_apply(4)" =
+ ?line "exception error: no function clause matching erl_eval:do_apply(4)" ++ _ =
comm_err(<<"erlang:error(function_clause, [4]).">>),
?line "exception error: no function clause matching" ++ _ =
comm_err(<<"fun(a, b, c, d) -> foo end"
@@ -2406,7 +2406,7 @@ otp_6554(Config) when is_list(Config) ->
comm_err(<<"fun(P, q) when is_pid(P) -> true end(a, b).">>),
?line "exception error: no function clause matching lists:reverse(" ++ _ =
comm_err(<<"F=fun() -> hello end, lists:reverse(F).">>),
- ?line "exception error: no function clause matching lists:reverse(34)" =
+ ?line "exception error: no function clause matching lists:reverse(34) (lists.erl, line " ++ _ =
comm_err(<<"lists:reverse(34).">>),
?line "exception error: no true branch found when evaluating an if expression" =
comm_err(<<"if length([a,b]) > 17 -> a end.">>),
diff --git a/lib/stdlib/test/sofs_SUITE.erl b/lib/stdlib/test/sofs_SUITE.erl
index d6f88a655e..73b282149a 100644
--- a/lib/stdlib/test/sofs_SUITE.erl
+++ b/lib/stdlib/test/sofs_SUITE.erl
@@ -1879,11 +1879,11 @@ digraph(Conf) when is_list(Conf) ->
?line {'EXIT', {badarg, _}} =
(catch family_to_digraph(set([a]))),
- ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_]}|_]}} =
+ ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_],_}|_]}} =
(catch family_to_digraph(set([a]), [foo])),
- ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_]}|_]}} =
+ ?line {'EXIT', {badarg, [{sofs,family_to_digraph,[_,_],_}|_]}} =
(catch family_to_digraph(F, [foo])),
- ?line {'EXIT', {cyclic, [{sofs,family_to_digraph,[_,_]}|_]}} =
+ ?line {'EXIT', {cyclic, [{sofs,family_to_digraph,[_,_],_}|_]}} =
(catch family_to_digraph(family([{a,[a]}]),[acyclic])),
?line G1 = family_to_digraph(E),
diff --git a/lib/stdlib/test/supervisor_SUITE.erl b/lib/stdlib/test/supervisor_SUITE.erl
index 7a75114cb6..2aa3131aeb 100644
--- a/lib/stdlib/test/supervisor_SUITE.erl
+++ b/lib/stdlib/test/supervisor_SUITE.erl
@@ -44,7 +44,7 @@
permanent_shutdown/1, transient_shutdown/1,
temporary_shutdown/1,
permanent_abnormal/1, transient_abnormal/1,
- temporary_abnormal/1]).
+ temporary_abnormal/1, temporary_bystander/1]).
%% Restart strategy tests
-export([ one_for_one/1,
@@ -77,7 +77,7 @@ all() ->
{group, abnormal_termination}, child_unlink, tree,
count_children_memory, do_not_save_start_parameters_for_temporary_children,
do_not_save_child_specs_for_temporary_children,
- simple_one_for_one_scale_many_temporary_children].
+ simple_one_for_one_scale_many_temporary_children, temporary_bystander].
groups() ->
[{sup_start, [],
@@ -693,6 +693,37 @@ temporary_abnormal(Config) when is_list(Config) ->
[0,0,0,0] = get_child_counts(sup_test).
%%-------------------------------------------------------------------------
+temporary_bystander(doc) ->
+ ["A temporary process killed as part of a rest_for_one or one_for_all "
+ "restart strategy should not be restarted given its args are not "
+ " saved. Otherwise the supervisor hits its limit and crashes."];
+temporary_bystander(suite) -> [];
+temporary_bystander(_Config) ->
+ Child1 = {child1, {supervisor_1, start_child, []}, permanent, 100,
+ worker, []},
+ Child2 = {child2, {supervisor_1, start_child, []}, temporary, 100,
+ worker, []},
+ {ok, SupPid1} = supervisor:start_link(?MODULE, {ok, {{one_for_all, 2, 300}, []}}),
+ {ok, SupPid2} = supervisor:start_link(?MODULE, {ok, {{rest_for_one, 2, 300}, []}}),
+ unlink(SupPid1), % otherwise we crash with it
+ unlink(SupPid2), % otherwise we crash with it
+ {ok, CPid1} = supervisor:start_child(SupPid1, Child1),
+ {ok, _CPid2} = supervisor:start_child(SupPid1, Child2),
+ {ok, CPid3} = supervisor:start_child(SupPid2, Child1),
+ {ok, _CPid4} = supervisor:start_child(SupPid2, Child2),
+ terminate(SupPid1, CPid1, child1, normal),
+ terminate(SupPid2, CPid3, child1, normal),
+ timer:sleep(350),
+ catch link(SupPid1),
+ catch link(SupPid2),
+ %% The supervisor would die attempting to restart child2
+ true = erlang:is_process_alive(SupPid1),
+ true = erlang:is_process_alive(SupPid2),
+ %% Child2 has not been restarted
+ [{child1, _, _, _}] = supervisor:which_children(SupPid1),
+ [{child1, _, _, _}] = supervisor:which_children(SupPid2).
+
+%%-------------------------------------------------------------------------
one_for_one(doc) ->
["Test the one_for_one base case."];
one_for_one(suite) -> [];
diff --git a/lib/stdlib/test/zip_SUITE.erl b/lib/stdlib/test/zip_SUITE.erl
index d5f2cd52d4..7233c061ef 100644
--- a/lib/stdlib/test/zip_SUITE.erl
+++ b/lib/stdlib/test/zip_SUITE.erl
@@ -375,7 +375,8 @@ zip_options(Config) when is_list(Config) ->
ok = file:set_cwd(?config(data_dir, Config)),
%% Create a zip archive
- {ok, Zip} = zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
+ {ok, {_,Zip}} =
+ zip:zip("filename_not_used.zip", Names, [memory, {cwd, PrivDir}]),
%% Open archive
{ok, ZipSrv} = zip:zip_open(Zip, [memory]),
diff --git a/lib/test_server/include/test_server.hrl b/lib/test_server/include/test_server.hrl
index 4b96d84ace..36e7e1f83d 100644
--- a/lib/test_server/include/test_server.hrl
+++ b/lib/test_server/include/test_server.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 1996-2009. All Rights Reserved.
+%% Copyright Ericsson AB 1996-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -20,11 +20,10 @@
-ifdef(line_trace).
-line_trace(true).
-define(line,
- put(test_server_loc,{?MODULE,?LINE}),
io:format(lists:concat([?MODULE,",",integer_to_list(?LINE),": ~p"]),
[erlang:now()]),).
-else.
--define(line,put(test_server_loc,{?MODULE,?LINE}),).
+-define(line,).
-endif.
-define(t,test_server).
-define(config,test_server:lookup_config).
diff --git a/lib/test_server/include/test_server_line.hrl b/lib/test_server/include/test_server_line.hrl
index 60ef860883..3c309d3ee5 100644
--- a/lib/test_server/include/test_server_line.hrl
+++ b/lib/test_server/include/test_server_line.hrl
@@ -1,7 +1,7 @@
%%
%% %CopyrightBegin%
%%
-%% Copyright Ericsson AB 2004-2009. All Rights Reserved.
+%% Copyright Ericsson AB 2004-2011. All Rights Reserved.
%%
%% The contents of this file are subject to the Erlang Public License,
%% Version 1.1, (the "License"); you may not use this file except in
@@ -16,5 +16,4 @@
%%
%% %CopyrightEnd%
%%
--compile({parse_transform,test_server_line}).
diff --git a/lib/test_server/src/Makefile b/lib/test_server/src/Makefile
index 63a585d526..4bc51873c2 100644
--- a/lib/test_server/src/Makefile
+++ b/lib/test_server/src/Makefile
@@ -43,7 +43,6 @@ MODULES= test_server_ctrl \
test_server_node \
test_server \
test_server_sup \
- test_server_line \
test_server_h \
erl2html2 \
vxworks_client
diff --git a/lib/test_server/src/test_server.app.src b/lib/test_server/src/test_server.app.src
index af2d4dc2cb..7e87583a7b 100644
--- a/lib/test_server/src/test_server.app.src
+++ b/lib/test_server/src/test_server.app.src
@@ -24,7 +24,6 @@
test_server_ctrl,
test_server,
test_server_h,
- test_server_line,
test_server_node,
test_server_sup
]},
diff --git a/lib/test_server/src/test_server.erl b/lib/test_server/src/test_server.erl
index 591329b361..04f92c5738 100644
--- a/lib/test_server/src/test_server.erl
+++ b/lib/test_server/src/test_server.erl
@@ -759,7 +759,6 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
run_test_case_msgloop(Ref,Pid,CaptureStdout,Terminate,
Comment,undefined);
Loc1 ->
- {Mod,Func} = get_mf(Loc1),
%% call end_per_testcase on a separate process,
%% only so that the user has a chance to clean up
%% after init_per_testcase, even after a timetrap timeout
@@ -775,6 +774,7 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
TVal),
{EndConfPid,{Mod,Func},Conf};
_ ->
+ {Mod,Func} = get_mf(Loc1),
%% The framework functions mustn't execute on this
%% group leader process or io will cause deadlock,
%% so we spawn a dedicated process for the operation
@@ -810,7 +810,6 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
run_test_case_msgloop(Ref,Pid,CaptureStdout,Terminate,
Comment,undefined);
Loc1 ->
- {Mod,Func} = get_mf(Loc1),
%% call end_per_testcase on a separate process, only so
%% that the user has a chance to clean up after init_per_testcase,
%% even after abortion
@@ -828,6 +827,7 @@ run_test_case_msgloop(Ref, Pid, CaptureStdout, Terminate, Comment, CurrConf) ->
TVal),
{EndConfPid,{Mod,Func},Conf};
_ ->
+ {Mod,Func} = get_mf(Loc1),
spawn_fw_call(Mod,Func,Pid,ErrorMsg,
Loc1,self(),Comment),
undefined
@@ -1307,57 +1307,62 @@ init_per_testcase(Mod, Func, Args) ->
false -> code:load_file(Mod);
_ -> ok
end,
- %% init_per_testcase defined, returns new configuration
- case erlang:function_exported(Mod,init_per_testcase,2) of
+ case erlang:function_exported(Mod, init_per_testcase, 2) of
true ->
- case catch my_apply(Mod, init_per_testcase, [Func|Args]) of
- {'$test_server_ok',{Skip,Reason}} when Skip==skip;
- Skip==skipped ->
- {skip,Reason};
- {'$test_server_ok',Res={skip_and_save,_,_}} ->
- Res;
- {'$test_server_ok',NewConf} when is_list(NewConf) ->
- case lists:filter(fun(T) when is_tuple(T) -> false;
- (_) -> true end, NewConf) of
- [] ->
- {ok,NewConf};
- Bad ->
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase has returned "
- "bad elements in Config: ~p\n",[Bad]},
- {skip,{failed,{Mod,init_per_testcase,bad_return}}}
- end;
- {'$test_server_ok',Res={fail,_Reason}} ->
- Res;
- {'$test_server_ok',_Other} ->
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase did not return "
- "a Config list.\n",[]},
- {skip,{failed,{Mod,init_per_testcase,bad_return}}};
- {'EXIT',Reason} ->
- Line = get_loc(),
- FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase crashed!\n"
- "\tLocation: ~s\n\tReason: ~p\n",
- [FormattedLoc,Reason]},
- {skip,{failed,{Mod,init_per_testcase,Reason}}};
- Other ->
- Line = get_loc(),
- FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
- group_leader() ! {printout,12,
- "ERROR! init_per_testcase thrown!\n"
- "\tLocation: ~s\n\tReason: ~p\n",
- [FormattedLoc, Other]},
- {skip,{failed,{Mod,init_per_testcase,Other}}}
- end;
+ do_init_per_testcase(Mod, [Func|Args]);
false ->
-%% Optional init_per_testcase not defined
-%% keep quiet.
+ %% Optional init_per_testcase is not defined -- keep quiet.
[Config] = Args,
{ok, Config}
end.
+do_init_per_testcase(Mod, Args) ->
+ try apply(Mod, init_per_testcase, Args) of
+ {Skip,Reason} when Skip =:= skip; Skip =:= skipped ->
+ {skip,Reason};
+ {skip_and_save,_,_}=Res ->
+ Res;
+ NewConf when is_list(NewConf) ->
+ case lists:filter(fun(T) when is_tuple(T) -> false;
+ (_) -> true end, NewConf) of
+ [] ->
+ {ok,NewConf};
+ Bad ->
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase has returned "
+ "bad elements in Config: ~p\n",[Bad]},
+ {skip,{failed,{Mod,init_per_testcase,bad_return}}}
+ end;
+ {fail,_Reason}=Res ->
+ Res;
+ _Other ->
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase did not return "
+ "a Config list.\n",[]},
+ {skip,{failed,{Mod,init_per_testcase,bad_return}}}
+ catch
+ throw:Other ->
+ set_loc(erlang:get_stacktrace()),
+ Line = get_loc(),
+ FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase thrown!\n"
+ "\tLocation: ~s\n\tReason: ~p\n",
+ [FormattedLoc, Other]},
+ {skip,{failed,{Mod,init_per_testcase,Other}}};
+ _:Reason0 ->
+ Stk = erlang:get_stacktrace(),
+ Reason = {Reason0,Stk},
+ set_loc(Stk),
+ Line = get_loc(),
+ FormattedLoc = test_server_sup:format_loc(mod_loc(Line)),
+ group_leader() ! {printout,12,
+ "ERROR! init_per_testcase crashed!\n"
+ "\tLocation: ~s\n\tReason: ~p\n",
+ [FormattedLoc,Reason]},
+ {skip,{failed,{Mod,init_per_testcase,Reason}}}
+ end.
+
end_per_testcase(Mod, Func, Conf) ->
case erlang:function_exported(Mod,end_per_testcase,2) of
true ->
@@ -1375,57 +1380,79 @@ end_per_testcase(Mod, Func, Conf) ->
do_end_per_testcase(Mod,EndFunc,Func,Conf) ->
put(test_server_init_or_end_conf,{EndFunc,Func}),
put(test_server_loc, {Mod,{EndFunc,Func}}),
- case catch my_apply(Mod, EndFunc, [Func,Conf]) of
- {'$test_server_ok',SaveCfg={save_config,_}} ->
+ try Mod:EndFunc(Func, Conf) of
+ {save_config,_}=SaveCfg ->
SaveCfg;
- {'$test_server_ok',{fail,_}=Fail} ->
+ {fail,_}=Fail ->
Fail;
- {'$test_server_ok',_} ->
- ok;
- {'EXIT',Reason} = Why ->
+ _ ->
+ ok
+ catch
+ throw:Other ->
+ set_loc(erlang:get_stacktrace()),
comment(io_lib:format("<font color=\"red\">"
- "WARNING: ~w crashed!"
+ "WARNING: ~w thrown!"
"</font>\n",[EndFunc])),
group_leader() ! {printout,12,
- "WARNING: ~w crashed!\n"
+ "WARNING: ~w thrown!\n"
"Reason: ~p\n"
"Line: ~s\n",
- [EndFunc, Reason,
+ [EndFunc, Other,
test_server_sup:format_loc(
mod_loc(get_loc()))]},
- {failed,{Mod,end_per_testcase,Why}};
- Other ->
+ {failed,{Mod,end_per_testcase,Other}};
+ Class:Reason ->
+ Stk = erlang:get_stacktrace(),
+ set_loc(Stk),
+ Why = case Class of
+ exit -> {'EXIT',Reason};
+ error -> {'EXIT',{Reason,Stk}}
+ end,
comment(io_lib:format("<font color=\"red\">"
- "WARNING: ~w thrown!"
+ "WARNING: ~w crashed!"
"</font>\n",[EndFunc])),
group_leader() ! {printout,12,
- "WARNING: ~w thrown!\n"
+ "WARNING: ~w crashed!\n"
"Reason: ~p\n"
"Line: ~s\n",
- [EndFunc, Other,
+ [EndFunc, Reason,
test_server_sup:format_loc(
mod_loc(get_loc()))]},
- {failed,{Mod,end_per_testcase,Other}}
+ {failed,{Mod,end_per_testcase,Why}}
end.
get_loc() ->
- case catch test_server_line:get_lines() of
- [] ->
- get(test_server_loc);
- {'EXIT',_} ->
- get(test_server_loc);
- Loc ->
- Loc
- end.
+ get(test_server_loc).
get_loc(Pid) ->
- {dictionary,Dict} = process_info(Pid, dictionary),
- lists:foreach(fun({Key,Val}) -> put(Key,Val) end,Dict),
+ [{current_stacktrace,Stk0},{dictionary,Dict}] =
+ process_info(Pid, [current_stacktrace,dictionary]),
+ lists:foreach(fun({Key,Val}) -> put(Key, Val) end, Dict),
+ Stk = [rewrite_loc_item(Loc) || Loc <- Stk0],
+ put(test_server_loc, Stk),
get_loc().
-get_mf([{M,F,_}|_]) -> {M,F};
-get_mf([{M,F}|_]) -> {M,F};
-get_mf(_) -> {undefined,undefined}.
+%% find the latest known Suite:Testcase
+get_mf(MFs) ->
+ get_mf(MFs, {undefined,undefined}).
+
+get_mf([MF|MFs], Found) when is_tuple(MF) ->
+ ModFunc = {Mod,_} = case MF of
+ {M,F,_} -> {M,F};
+ MF -> MF
+ end,
+ case is_suite(Mod) of
+ true -> ModFunc;
+ false -> get_mf(MFs, ModFunc)
+ end;
+get_mf(_, Found) ->
+ Found.
+
+is_suite(Mod) ->
+ case lists:reverse(atom_to_list(Mod)) of
+ "ETIUS" ++ _ -> true;
+ _ -> false
+ end.
mod_loc(Loc) ->
%% handle diff line num versions
@@ -1498,16 +1525,22 @@ lookup_config(Key,Config) ->
%% timer:tc/3
ts_tc(M, F, A) ->
Before = erlang:now(),
- Val = (catch my_apply(M, F, A)),
+ Result = try
+ apply(M, F, A)
+ catch
+ Type:Reason ->
+ Stk = erlang:get_stacktrace(),
+ set_loc(Stk),
+ case Type of
+ throw ->
+ {failed,{thrown,Reason}};
+ error ->
+ {'EXIT',{Reason,Stk}};
+ exit ->
+ {'EXIT',Reason}
+ end
+ end,
After = erlang:now(),
- Result = case Val of
- {'$test_server_ok', R} ->
- R; % test case ok
- {'EXIT',_Reason} = R ->
- R; % test case crashed
- Other ->
- {failed, {thrown,Other}} % test case was thrown
- end,
Elapsed =
(element(1,After)*1000000000000
+element(2,After)*1000000+element(3,After)) -
@@ -1515,8 +1548,12 @@ ts_tc(M, F, A) ->
+element(2,Before)*1000000+element(3,Before)),
{Elapsed, Result}.
-my_apply(M, F, A) ->
- {'$test_server_ok',apply(M, F, A)}.
+set_loc(Stk) ->
+ Loc = [rewrite_loc_item(I) || {_,_,_,_}=I <- Stk],
+ put(test_server_loc, Loc).
+
+rewrite_loc_item({M,F,_,Loc}) ->
+ {M,F,proplists:get_value(line, Loc, 0)}.
%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%%
diff --git a/lib/test_server/src/test_server_line.erl b/lib/test_server/src/test_server_line.erl
deleted file mode 100644
index 848a9c23dd..0000000000
--- a/lib/test_server/src/test_server_line.erl
+++ /dev/null
@@ -1,387 +0,0 @@
-%%
-%% %CopyrightBegin%
-%%
-%% Copyright Ericsson AB 2004-2010. All Rights Reserved.
-%%
-%% The contents of this file are subject to the Erlang Public License,
-%% Version 1.1, (the "License"); you may not use this file except in
-%% compliance with the License. You should have received a copy of the
-%% Erlang Public License along with this software. If not, it can be
-%% retrieved online at http://www.erlang.org/.
-%%
-%% Software distributed under the License is distributed on an "AS IS"
-%% basis, WITHOUT WARRANTY OF ANY KIND, either express or implied. See
-%% the License for the specific language governing rights and limitations
-%% under the License.
-%%
-%% %CopyrightEnd%
-%%
--module(test_server_line).
-
-%% User interface
--export([get_lines/0]).
--export([clear/0]).
-
-%% Parse transform functions
--export([parse_transform/2]).
--export(['$test_server_line'/3]).
--export(['$test_server_lineQ'/3]).
--export([trace_line/3]).
-
--define(TEST_SERVER_LINE_SIZE, 10).
-%-define(STORAGE_FUNCTION, '$test_server_line').
--define(STORAGE_FUNCTION, '$test_server_lineQ').
-
--include("test_server.hrl").
-
--record(vars, {module, % atom() Module name
- function, % atom() Function name
- arity, % int() Function arity
- lines, % [int()] seen lines
- is_guard=false, % boolean()
- no_lines=[], % [{atom(),integer()}]
- % Functions to exclude
- line_trace=false
- }).
-
-
-
-
-%% Process dictionary littering variant
-%%
-
-'$test_server_line'(Mod, Func, Line) ->
- {Prev,Next} =
- case get('$test_server_line') of
- I when is_integer(I) ->
- if 1 =< I, I < ?TEST_SERVER_LINE_SIZE -> {I,I+1};
- true -> {?TEST_SERVER_LINE_SIZE,1}
- end;
- _ -> {?TEST_SERVER_LINE_SIZE,1}
- end,
- PrevTag = {'$test_server_line',Prev},
- case get(PrevTag) of
- {Mod,Func,_} -> put(PrevTag, {Mod,Func,Line});
- _ ->
- put({'$test_server_line',Next}, {Mod,Func,Line}),
- put('$test_server_line', Next)
- end, ok.
-
-test_server_line_get() ->
- case get('$test_server_line') of
- I when is_integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
- test_server_line_get_1(?TEST_SERVER_LINE_SIZE, I, []);
- _ -> []
- end.
-
-test_server_line_get_1(0, _I, R) ->
- R;
-test_server_line_get_1(Cnt, I, R) ->
- J = if I < ?TEST_SERVER_LINE_SIZE -> I+1;
- true -> 1 end,
- case get({'$test_server_line',J}) of
- undefined ->
- %% Less than ?TEST_SERVER_LINE_SIZE number of lines stored
- %% Start from line 1 and stop at actutual number of lines
- case get({'$test_server_line',1}) of
- undefined -> R; % no lines at all stored
- E -> test_server_line_get_1(I-1,1,[E|R])
- end;
- E ->
- test_server_line_get_1(Cnt-1, J, [E|R])
- end.
-
-test_server_line_clear() ->
- Is = lists:seq(1,?TEST_SERVER_LINE_SIZE),
- lists:foreach(fun (I) -> erase({'$test_server_line',I}) end, Is),
- erase('$test_server_line'),
- ok.
-
-
-%% Queue variant, uses just one process dictionary entry
-%%
-
-'$test_server_lineQ'(Mod, Func, Line) ->
- case get('$test_server_lineQ') of
- {I,Q} when is_integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
- case queue:head(Q) of
- {Mod,Func,_} ->
- %% Replace queue head
- put('$test_server_lineQ',
- {I,queue:cons({Mod,Func,Line}, queue:tail(Q))});
- _ when I < ?TEST_SERVER_LINE_SIZE ->
- put('$test_server_lineQ',
- {I+1,queue:cons({Mod,Func,Line}, Q)});
- _ ->
- %% Waste last in queue
- put('$test_server_lineQ',
- {I,queue:cons({Mod,Func,Line}, queue:lait(Q))})
- end;
- _ ->
- Q = queue:new(),
- put('$test_server_lineQ', {1,queue:cons({Mod,Func,Line}, Q)})
- end, ok.
-
-%test_server_lineQ_get() ->
-% case get('$test_server_lineQ') of
-% {I,Q} when integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
-% queue:to_list(Q);
-% _ -> []
-% end.
-
-test_server_lineQ_clear() ->
- erase('$test_server_lineQ'),
- ok.
-
-
-%% Get line - check if queue or dictionary is used, then get the lines
-%%
-
-get_lines() ->
- case get('$test_server_lineQ') of
- {I,Q} when is_integer(I), 1 =< I, I =< ?TEST_SERVER_LINE_SIZE ->
- queue:to_list(Q);
- _ ->
- test_server_line_get()
- end.
-
-%% Clear all dictionary entries
-%%
-clear() ->
- test_server_line_clear(),
- test_server_lineQ_clear().
-
-
-trace_line(Mod,Func,Line) ->
- io:format(lists:concat([Mod,":",Func,",",integer_to_list(Line),": ~p"]),
- [erlang:now()]).
-
-
-%%%=================================================================
-%%%========= **** PARSE TRANSFORM **** ========================
-%%%=================================================================
-parse_transform(Forms, _Options) ->
- transform(Forms, _Options).
-
-%% forms(Fs) -> lists:map(fun (F) -> form(F) end, Fs).
-
-transform(Forms, _Options)->
- Vars0 = #vars{},
- {ok, MungedForms, _Vars} = transform(Forms, [], Vars0),
- MungedForms.
-
-
-transform([Form|Forms], MungedForms, Vars) ->
- case munge(Form, Vars) of
- ignore ->
- transform(Forms, MungedForms, Vars);
- {MungedForm, Vars2} ->
- transform(Forms, [MungedForm|MungedForms], Vars2)
- end;
-transform([], MungedForms, Vars) ->
- {ok, lists:reverse(MungedForms), Vars}.
-
-%% This code traverses the abstract code, stored as the abstract_code
-%% chunk in the BEAM file, as described in absform(3) for Erlang/OTP R8B
-%% (Vsn=abstract_v2).
-%% The abstract format after preprocessing differs slightly from the abstract
-%% format given eg using epp:parse_form, this has been noted in comments.
-munge(Form={attribute,_,module,Module}, Vars) ->
- Vars2 = Vars#vars{module=Module},
- {Form, Vars2};
-
-munge(Form={attribute,_,no_lines,Funcs}, Vars) ->
- Vars2 = Vars#vars{no_lines=Funcs},
- {Form, Vars2};
-
-munge(Form={attribute,_,line_trace,_}, Vars) ->
- Vars2 = Vars#vars{line_trace=true},
- {Form, Vars2};
-
-munge({function,0,module_info,_Arity,_Clauses}, _Vars) ->
- ignore; % module_info will be added again when the forms are recompiled
-munge(Form = {function,Line,Function,Arity,Clauses}, Vars) ->
- case lists:member({Function,Arity},Vars#vars.no_lines) of
- true ->
- %% Line numbers in this function shall not be stored
- {Form,Vars};
- false ->
- Vars2 = Vars#vars{function=Function,
- arity=Arity,
- lines=[]},
- {MungedClauses, Vars3} = munge_clauses(Clauses, Vars2, []),
- {{function,Line,Function,Arity,MungedClauses}, Vars3}
- end;
-munge(Form, Vars) -> % attributes
- {Form, Vars}.
-
-munge_clauses([{clause,Line,Pattern,Guards,Body}|Clauses], Vars, MClauses) ->
- {MungedGuards, _Vars} = munge_exprs(Guards, Vars#vars{is_guard=true},[]),
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- munge_clauses(Clauses, Vars2,
- [{clause,Line,Pattern,MungedGuards,MungedBody}|
- MClauses]);
-munge_clauses([], Vars, MungedClauses) ->
- {lists:reverse(MungedClauses), Vars}.
-
-munge_body([Expr|Body], Vars, MungedBody) ->
- %% Here is the place to add a call to storage function!
- Line = element(2, Expr),
- Lines = Vars#vars.lines,
- case lists:member(Line,Lines) of
- true -> % already a bump at this line!
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_body(Body, Vars2, [MungedExpr|MungedBody]);
- false ->
- Bump = {call, 0, {remote,0,
- {atom,0,?MODULE},
- {atom,0,?STORAGE_FUNCTION}},
- [{atom,0,Vars#vars.module},
- {atom, 0, Vars#vars.function},
- {integer, 0, Line}]},
- Lines2 = [Line|Lines],
-
- {MungedExpr, Vars2} = munge_expr(Expr, Vars#vars{lines=Lines2}),
- MungedBody2 =
- if Vars#vars.line_trace ->
- LineTrace = {call, 0, {remote,0,
- {atom,0,?MODULE},
- {atom,0,trace_line}},
- [{atom,0,Vars#vars.module},
- {atom, 0, Vars#vars.function},
- {integer, 0, Line}]},
- [MungedExpr,LineTrace,Bump|MungedBody];
- true ->
- [MungedExpr,Bump|MungedBody]
- end,
- munge_body(Body, Vars2, MungedBody2)
- end;
-munge_body([], Vars, MungedBody) ->
- {lists:reverse(MungedBody), Vars}.
-
-munge_expr({match,Line,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{match,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({tuple,Line,Exprs}, Vars) ->
- {MungedExprs, Vars2} = munge_exprs(Exprs, Vars, []),
- {{tuple,Line,MungedExprs}, Vars2};
-munge_expr({record,Line,Expr,Exprs}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprName, Vars2} = munge_expr(Expr, Vars),
- {MungedExprFields, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{record,Line,MungedExprName,MungedExprFields}, Vars3};
-munge_expr({record_field,Line,ExprL,ExprR}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{record_field,Line,MungedExprL,MungedExprR}, Vars3};
-munge_expr({cons,Line,ExprH,ExprT}, Vars) ->
- {MungedExprH, Vars2} = munge_expr(ExprH, Vars),
- {MungedExprT, Vars3} = munge_expr(ExprT, Vars2),
- {{cons,Line,MungedExprH,MungedExprT}, Vars3};
-munge_expr({op,Line,Op,ExprL,ExprR}, Vars) ->
- {MungedExprL, Vars2} = munge_expr(ExprL, Vars),
- {MungedExprR, Vars3} = munge_expr(ExprR, Vars2),
- {{op,Line,Op,MungedExprL,MungedExprR}, Vars3};
-munge_expr({op,Line,Op,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{op,Line,Op,MungedExpr}, Vars2};
-munge_expr({'catch',Line,Expr}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {{'catch',Line,MungedExpr}, Vars2};
-munge_expr({call,Line1,{remote,Line2,ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==false->
- {MungedExprM, Vars2} = munge_expr(ExprM, Vars),
- {MungedExprF, Vars3} = munge_expr(ExprF, Vars2),
- {MungedExprs, Vars4} = munge_exprs(Exprs, Vars3, []),
- {{call,Line1,{remote,Line2,MungedExprM,MungedExprF},MungedExprs}, Vars4};
-munge_expr({call,Line1,{remote,_Line2,_ExprM,ExprF},Exprs},
- Vars) when Vars#vars.is_guard==true ->
- %% Difference in abstract format after preprocessing: BIF calls in guards
- %% are translated to {remote,...} (which is not allowed as source form)
- %% NOT NECESSARY FOR Vsn=raw_abstract_v1
- munge_expr({call,Line1,ExprF,Exprs}, Vars);
-munge_expr({call,Line,Expr,Exprs}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedExprs, Vars3} = munge_exprs(Exprs, Vars2, []),
- {{call,Line,MungedExpr,MungedExprs}, Vars3};
-munge_expr({lc,Line,Expr,LC}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedLC, Vars3} = munge_lc(LC, Vars2, []),
- {{lc,Line,MungedExpr,MungedLC}, Vars3};
-munge_expr({block,Line,Body}, Vars) ->
- {MungedBody, Vars2} = munge_body(Body, Vars, []),
- {{block,Line,MungedBody}, Vars2};
-munge_expr({'if',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'if',Line,MungedClauses}, Vars2};
-munge_expr({'case',Line,Expr,Clauses}, Vars) ->
- {MungedExpr,Vars2} = munge_expr(Expr,Vars),
- {MungedClauses,Vars3} = munge_clauses(Clauses, Vars2, []),
- {{'case',Line,MungedExpr,MungedClauses}, Vars3};
-munge_expr({'receive',Line,Clauses}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {{'receive',Line,MungedClauses}, Vars2};
-munge_expr({'receive',Line,Clauses,Expr,Body}, Vars) ->
- {MungedClauses,Vars2} = munge_clauses(Clauses, Vars, []),
- {MungedExpr, Vars3} = munge_expr(Expr, Vars2),
- {MungedBody, Vars4} = munge_body(Body, Vars3, []),
- {{'receive',Line,MungedClauses,MungedExpr,MungedBody}, Vars4};
-munge_expr({'try',Line,Exprs,Clauses,CatchClauses,After}, Vars) ->
- {MungedExprs, Vars1} = munge_exprs(Exprs, Vars, []),
- {MungedClauses, Vars2} = munge_clauses(Clauses, Vars1, []),
- {MungedCatchClauses, Vars3} = munge_clauses(CatchClauses, Vars2, []),
- {MungedAfter, Vars4} = munge_body(After, Vars3, []),
- {{'try',Line,MungedExprs,MungedClauses,MungedCatchClauses,MungedAfter},
- Vars4};
-%% Difference in abstract format after preprocessing: Funs get an extra
-%% element Extra.
-%% NOT NECESSARY FOR Vsn=raw_abstract_v1
-munge_expr({'fun',Line,{function,Name,Arity},_Extra}, Vars) ->
- {{'fun',Line,{function,Name,Arity}}, Vars};
-munge_expr({'fun',Line,{clauses,Clauses},_Extra}, Vars) ->
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr({'fun',Line,{clauses,Clauses}}, Vars) ->
- %% Only for Vsn=raw_abstract_v1
- {MungedClauses,Vars2}=munge_clauses(Clauses, Vars, []),
- {{'fun',Line,{clauses,MungedClauses}}, Vars2};
-munge_expr({bc,Line,Expr,LC}, Vars) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- {MungedLC, Vars3} = munge_lc(LC, Vars2, []),
- {{bc,Line,MungedExpr,MungedLC}, Vars3};
-munge_expr(Form, Vars) -> % var|char|integer|float|string|atom|nil|bin|eof
- {Form, Vars}.
-
-munge_exprs([Expr|Exprs], Vars, MungedExprs) when Vars#vars.is_guard==true,
- is_list(Expr) ->
- {MungedExpr, _Vars} = munge_exprs(Expr, Vars, []),
- munge_exprs(Exprs, Vars, [MungedExpr|MungedExprs]);
-munge_exprs([Expr|Exprs], Vars, MungedExprs) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_exprs(Exprs, Vars2, [MungedExpr|MungedExprs]);
-munge_exprs([], Vars, MungedExprs) ->
- {lists:reverse(MungedExprs), Vars}.
-
-munge_lc([{generate,Line,Pattern,Expr}|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [{generate,Line,Pattern,MungedExpr}|MungedLC]);
-munge_lc([{b_generate,Line,Pattern,Expr}|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [{b_generate,Line,Pattern,MungedExpr}|MungedLC]);
-munge_lc([Expr|LC], Vars, MungedLC) ->
- {MungedExpr, Vars2} = munge_expr(Expr, Vars),
- munge_lc(LC, Vars2, [MungedExpr|MungedLC]);
-munge_lc([], Vars, MungedLC) ->
- {lists:reverse(MungedLC), Vars}.
-
-
-
-
-
-
-
-
-
-
diff --git a/lib/test_server/src/test_server_sup.erl b/lib/test_server/src/test_server_sup.erl
index 53dfb45e3a..ec9be52bd3 100644
--- a/lib/test_server/src/test_server_sup.erl
+++ b/lib/test_server/src/test_server_sup.erl
@@ -51,18 +51,19 @@ timetrap(Timeout0, Scale, Pid) ->
Timeout = if not Scale -> Timeout0;
true -> test_server:timetrap_scale_factor() * Timeout0
end,
+ TruncTO = trunc(Timeout),
receive
- after trunc(Timeout) ->
- Line = test_server:get_loc(Pid),
+ after TruncTO ->
+ MFLs = test_server:get_loc(Pid),
Mon = erlang:monitor(process, Pid),
Trap =
case get(test_server_init_or_end_conf) of
undefined ->
- {timetrap_timeout,trunc(Timeout),Line};
+ {timetrap_timeout,TruncTO,MFLs};
InitOrEnd ->
- {timetrap_timeout,trunc(Timeout),Line,InitOrEnd}
+ {timetrap_timeout,TruncTO,MFLs,InitOrEnd}
end,
- exit(Pid,Trap),
+ exit(Pid, Trap),
receive
{'DOWN', Mon, process, Pid, _} ->
ok
diff --git a/lib/test_server/src/ts_install_cth.erl b/lib/test_server/src/ts_install_cth.erl
index c5444a342f..0770190c36 100644
--- a/lib/test_server/src/ts_install_cth.erl
+++ b/lib/test_server/src/ts_install_cth.erl
@@ -49,8 +49,7 @@
-include_lib("kernel/include/file.hrl").
--type proplist() :: list({atom(),term()}).
--type config() :: proplist().
+-type config() :: proplists:proplist().
-type reason() :: term().
-type skip_or_fail() :: {skip, reason()} |
{auto_skip, reason()} |
@@ -65,7 +64,7 @@ id(_Opts) ->
?MODULE.
%% @doc Always called before any other callback function.
--spec init(Id :: term(), Opts :: proplist()) ->
+-spec init(Id :: term(), Opts :: proplists:proplist()) ->
State :: #state{}.
init(_Id, Opts) ->
Nodenames = proplists:get_value(nodenames, Opts, 0),
diff --git a/lib/tools/emacs/erlang.el b/lib/tools/emacs/erlang.el
index 6728bef2a4..a8dd3ec3ac 100644
--- a/lib/tools/emacs/erlang.el
+++ b/lib/tools/emacs/erlang.el
@@ -523,6 +523,32 @@ This is an elisp list of options. Each option can be either:
- a string
Example: '(bin_opt_info (i . \"/path1/include\") (i . \"/path2/include\"))")
+(defvar erlang-compile-command-function-alist
+ '((".erl\\'" . inferior-erlang-compute-erl-compile-command)
+ (".xrl\\'" . inferior-erlang-compute-leex-compile-command)
+ (".yrl\\'" . inferior-erlang-compute-yecc-compile-command)
+ ("." . inferior-erlang-compute-erl-compile-command))
+ "*Alist of filename patterns vs corresponding compilation functions.
+Each element looks like (REGEXP . FUNCTION). Compiling a file whose name
+matches REGEXP specifies FUNCTION to use to compute the compilation
+command. The FUNCTION will be called with two arguments: module name and
+default compilation options, like output directory. The FUNCTION
+is expected to return a string.")
+
+(defvar erlang-leex-compile-opts '()
+ "*Options to pass to leex when compiling xrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
+(defvar erlang-yecc-compile-opts '()
+ "*Options to pass to yecc when compiling yrl files.
+This is an elisp list of options. Each option can be either:
+- an atom
+- a dotted pair
+- a string")
+
(eval-and-compile
(defvar erlang-regexp-modern-p
(if (> erlang-emacs-major-version 21) t nil)
@@ -5276,6 +5302,22 @@ unless the optional NO-DISPLAY is non-nil."
(file-name-as-directory buffer-dir))))
(defun inferior-erlang-compute-compile-command (module-name opts)
+ (let ((ccfn erlang-compile-command-function-alist)
+ (res (inferior-erlang-compute-erl-compile-command module-name opts))
+ ccfn-entry
+ done)
+ (if (not (null (buffer-file-name)))
+ (while (and (not done) (not (null ccfn)))
+ (setq ccfn-entry (car ccfn))
+ (setq ccfn (cdr ccfn))
+ (if (string-match (car ccfn-entry) (buffer-file-name))
+ (let ((c-fn (cdr ccfn-entry)))
+ (setq done t)
+ (if (not (null c-fn))
+ (setq result (funcall c-fn module-name opts)))))))
+ result))
+
+(defun inferior-erlang-compute-erl-compile-command (module-name opts)
(let* ((out-dir-opt (assoc 'outdir opts))
(out-dir (cdr out-dir-opt)))
(if erlang-compile-use-outdir
@@ -5299,6 +5341,48 @@ unless the optional NO-DISPLAY is non-nil."
(remq out-dir-opt opts))
tmpvar tmpvar tmpvar2)))))
+(defun inferior-erlang-compute-leex-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(LErr1__), f(LErr2__), "
+ "case case leex:file(\"%s\", [%s]) of"
+ " ok -> ok;"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " LErr1__ -> LErr1__ "
+ "end of"
+ " ok -> %s;"
+ " LErr2__ -> LErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-leex-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-compute-yecc-compile-command (module-name opts)
+ (let ((file-name (buffer-file-name))
+ (erl-compile-expr (inferior-erlang-remove-any-trailing-dot
+ (inferior-erlang-compute-erl-compile-command
+ module-name opts))))
+ (format (concat "f(YErr1__), f(YErr2__), "
+ "case case yecc:file(\"%s\", [%s]) of"
+ " {ok,_} -> ok;"
+ " {ok,_,_} -> ok;"
+ " YErr1__ -> YErr1__ "
+ "end of"
+ " ok -> %s;"
+ " YErr2__ -> YErr2__ "
+ "end.")
+ file-name
+ (inferior-erlang-format-comma-opts erlang-yecc-compile-opts)
+ erl-compile-expr)))
+
+(defun inferior-erlang-remove-any-trailing-dot (str)
+ (if (string= (substring str -1) ".")
+ (substring str 0 (1- (length str)))
+ str))
+
(defun inferior-erlang-format-comma-opts (opts)
(if (null opts)
""
diff --git a/lib/tv/src/tv_main.erl b/lib/tv/src/tv_main.erl
index 2f743c2397..283ba4c967 100644
--- a/lib/tv/src/tv_main.erl
+++ b/lib/tv/src/tv_main.erl
@@ -312,7 +312,7 @@ analyze_error(Cause, Node, Table) ->
handle_error(mnesia_not_started, Node, Table);
{badrpc, {'EXIT', {aborted, {node_not_running,_ErrNode}}}} ->
handle_error(mnesia_not_started, Node, Table);
- {'EXIT', {undef, {mnesia,_Fcn,_Args}}} ->
+ {'EXIT', {undef, {mnesia,_Fcn,_Args,_}}} ->
handle_error(mnesia_not_started, Node, Table);
{'EXIT', Reason} ->
diff --git a/lib/tv/src/tv_mnesia_rpc.erl b/lib/tv/src/tv_mnesia_rpc.erl
index a2385714ec..4a75994145 100644
--- a/lib/tv/src/tv_mnesia_rpc.erl
+++ b/lib/tv/src/tv_mnesia_rpc.erl
@@ -87,6 +87,8 @@ chk(Result) ->
throw(mnesia_not_started);
{badrpc, _Reason} ->
throw(mnesia_not_started);
+ {'EXIT', {undef, {mnesia,_Fcn,_Args,_}}} ->
+ throw(mnesia_not_started);
{'EXIT', {undef, {mnesia,_Fcn,_Args}}} ->
throw(mnesia_not_started);
diff --git a/lib/wx/src/wx_object.erl b/lib/wx/src/wx_object.erl
index bfd38960dd..82c4cfbad5 100644
--- a/lib/wx/src/wx_object.erl
+++ b/lib/wx/src/wx_object.erl
@@ -537,16 +537,16 @@ error_info(_Reason, application_controller, _Msg, _State, _Debug) ->
error_info(Reason, Name, Msg, State, Debug) ->
Reason1 =
case Reason of
- {undef,[{M,F,A}|MFAs]} ->
+ {undef,[{M,F,A,L}|MFAs]} ->
case code:is_loaded(M) of
false ->
- {'module could not be loaded',[{M,F,A}|MFAs]};
+ {'module could not be loaded',[{M,F,A,L}|MFAs]};
_ ->
case erlang:function_exported(M, F, length(A)) of
true ->
Reason;
false ->
- {'function not exported',[{M,F,A}|MFAs]}
+ {'function not exported',[{M,F,A,L}|MFAs]}
end
end;
_ ->
diff --git a/lib/xmerl/include/xmerl_xsd.hrl b/lib/xmerl/include/xmerl_xsd.hrl
index b527accc8c..6dad7d8ff0 100644
--- a/lib/xmerl/include/xmerl_xsd.hrl
+++ b/lib/xmerl/include/xmerl_xsd.hrl
@@ -36,6 +36,7 @@
schema_name,
vsn,
schema_preprocessed=false,
+ external_xsd_base=false,
xsd_base,
xml_options=[],
scope=[],
diff --git a/lib/xmerl/src/xmerl.erl b/lib/xmerl/src/xmerl.erl
index cf78f7bdf7..2332517988 100644
--- a/lib/xmerl/src/xmerl.erl
+++ b/lib/xmerl/src/xmerl.erl
@@ -307,7 +307,7 @@ apply_cb(Ms, F, Df, Args) ->
apply_cb([M|Ms], F, Df, Args, Ms0) ->
case catch apply(M, F, Args) of
- {'EXIT', {undef,[{M,F,_}|_]}} ->
+ {'EXIT', {undef,[{M,F,_,_}|_]}} ->
apply_cb(Ms, F, Df, Args, Ms0);
{'EXIT', Reason} ->
exit(Reason);
diff --git a/lib/xmerl/src/xmerl_scan.erl b/lib/xmerl/src/xmerl_scan.erl
index 059c8f21b6..e598c5f56d 100644
--- a/lib/xmerl/src/xmerl_scan.erl
+++ b/lib/xmerl/src/xmerl_scan.erl
@@ -2276,7 +2276,7 @@ scan_att_chars([H|T], S0, H, Acc, TmpAcc,AttType,IsNorm) -> % End quote
true ->
normalize(Acc,S,IsNorm)
end,
- {lists:reverse(Acc2), T, S2,IsNorm2};
+ {lists:flatten(lists:reverse(Acc2)), T, S2,IsNorm2};
scan_att_chars("&" ++ T, S0, Delim, Acc, TmpAcc,AT,IsNorm) -> % Reference
?bump_col(1),
{ExpRef, T1, S1} = scan_reference(T, S),
diff --git a/lib/xmerl/src/xmerl_xsd.erl b/lib/xmerl/src/xmerl_xsd.erl
index e56f1470c0..f003cc74ba 100644
--- a/lib/xmerl/src/xmerl_xsd.erl
+++ b/lib/xmerl/src/xmerl_xsd.erl
@@ -287,10 +287,19 @@ process_schema(Schema) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schema(Schema,Options) when is_list(Options) ->
- S = initiate_state(Options,Schema),
- process_schema2(xmerl_scan:file(filename:join(S#xsd_state.xsd_base, Schema)),S,Schema);
-process_schema(Schema,State) when is_record(State,xsd_state) ->
- process_schema2(xmerl_scan:file(filename:join(State#xsd_state.xsd_base, Schema)),State,Schema).
+ State = initiate_state(Options,Schema),
+ process_schema(Schema, State);
+process_schema(Schema, State=#xsd_state{fetch_fun=Fetch})->
+ case Fetch(Schema, State) of
+ {ok,{file,File},_} ->
+ process_schema2(xmerl_scan:file(File), State, Schema);
+ {ok,{string,Str},_} ->
+ process_schema2(xmerl_scan:string(Str), State, Schema);
+ {ok,[],_} ->
+ {error,enoent};
+ Err ->
+ Err
+ end.
process_schema2(Err={error,_},_,_) ->
Err;
@@ -319,12 +328,9 @@ process_schemas(Schemas) ->
%% error reason. The error reason may be a list of several errors
%% or a single error encountered during the processing.
process_schemas(Schemas=[{_,Schema}|_],Options) when is_list(Options) ->
- process_schemas(Schemas,initiate_state(Options,Schema));
+ State = initiate_state(Options,Schema),
+ process_schemas(Schemas, State);
process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
-%% case process_external_schema_once(Schema,if_list_to_atom(NS),State) of
-%% S when is_record(S,xsd_state) ->
-%% case process_schema(filename:join([State#xsd_state.xsd_base,Schema]),State) of
-%% {ok,S} ->
Res=
case Fetch(Schema,State) of
{ok,{file,File},_} ->
@@ -345,20 +351,20 @@ process_schemas([{_NS,Schema}|Rest],State=#xsd_state{fetch_fun=Fetch}) ->
process_schemas([],S) when is_record(S,xsd_state) ->
{ok,S}.
-
initiate_state(Opts,Schema) ->
XSDBase = filename:dirname(Schema),
{{state,S},RestOpts}=new_state(Opts),
S2 = create_tables(S),
- initiate_state2(S2#xsd_state{schema_name = Schema,
- xsd_base = XSDBase,
- fetch_fun = fun fetch/2},RestOpts).
+ S3 = initiate_state2(S2#xsd_state{schema_name = Schema, xsd_base=XSDBase,
+ fetch_fun = fun fetch/2},
+ RestOpts).
+
initiate_state2(S,[]) ->
S;
initiate_state2(S,[{tab2file,Bool}|T]) ->
initiate_state2(S#xsd_state{tab2file=Bool},T);
-initiate_state2(S,[{xsdbase,XSDBase}|T]) ->
- initiate_state2(S#xsd_state{xsd_base=XSDBase},T);
+initiate_state2(S,[{xsdbase, XSDBase}|T]) ->
+ initiate_state2(S#xsd_state{xsd_base=XSDBase, external_xsd_base=true},T);
initiate_state2(S,[{fetch_fun,FetchFun}|T]) ->
initiate_state2(S#xsd_state{fetch_fun=FetchFun},T);
initiate_state2(S,[{fetch_path,FetchPath}|T]) ->
@@ -5232,7 +5238,12 @@ fetch(URI,S) ->
[] -> %% empty systemliteral
[];
_ ->
- filename:join(S#xsd_state.xsd_base, URI)
+ case S#xsd_state.external_xsd_base of
+ true ->
+ filename:join(S#xsd_state.xsd_base, URI);
+ false ->
+ filename:join(S#xsd_state.xsd_base, filename:basename(URI))
+ end
end,
Path = path_locate(S#xsd_state.fetch_path, Filename, Fullname),
?dbg("fetch(~p) -> {file, ~p}.~n", [URI, Path]),
diff --git a/lib/xmerl/test/Makefile b/lib/xmerl/test/Makefile
index 9715aa054a..5a2a585841 100644
--- a/lib/xmerl/test/Makefile
+++ b/lib/xmerl/test/Makefile
@@ -124,4 +124,4 @@ release_tests_spec: opt
@tar cfh - xmerl_xsd_MS2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_NIST2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
@tar cfh - xmerl_xsd_Sun2002-01-16_SUITE_data | (cd $(RELSYSDIR); tar xf -)
- chmod -f -R u+w $(RELSYSDIR)
+ chmod -R u+w $(RELSYSDIR)
diff --git a/lib/xmerl/test/xmerl_SUITE.erl b/lib/xmerl/test/xmerl_SUITE.erl
index 392b2522e8..0c809dbcb6 100644
--- a/lib/xmerl/test/xmerl_SUITE.erl
+++ b/lib/xmerl/test/xmerl_SUITE.erl
@@ -57,7 +57,8 @@ groups() ->
{eventp_tests, [], [sax_parse_and_export]},
{ticket_tests, [],
[ticket_5998, ticket_7211, ticket_7214, ticket_7430,
- ticket_6873, ticket_7496, ticket_8156, ticket_8697]},
+ ticket_6873, ticket_7496, ticket_8156, ticket_8697,
+ ticket_9411]},
{app_test, [], [{xmerl_app_test, all}]},
{appup_test, [], [{xmerl_appup_test, all}]}].
@@ -575,7 +576,17 @@ ticket_8697(Config) ->
?line [16#545C] = HexEntityText,
ok.
+ticket_9411(suite) -> [];
+ticket_9411(doc) ->
+ ["Test that xmerl_scan handles attribute that contains for example &quot"];
+ticket_9411(Config) ->
+ DataDir = ?config(data_dir,Config),
+ ?line {ok, Schema} = xmerl_xsd:process_schema(filename:join([DataDir,"misc/ticket_9411.xsd"])),
+ ?line {ok, Bin} = file:read_file(filename:join([DataDir,"misc/ticket_9411.xml"])),
+ ?line Xml = erlang:binary_to_list(Bin),
+ ?line {E, _} = xmerl_scan:string(Xml),
+ ?line {E, _} = xmerl_xsd:validate(E, Schema).
diff --git a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
index c48a6f897b..fef7431845 100644
--- a/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
+++ b/lib/xmerl/test/xmerl_SUITE_data/misc.tar.gz
Binary files differ
diff --git a/lib/xmerl/test/xmerl_xsd_SUITE.erl b/lib/xmerl/test/xmerl_xsd_SUITE.erl
index a0d3b1e667..421fa48054 100644
--- a/lib/xmerl/test/xmerl_xsd_SUITE.erl
+++ b/lib/xmerl/test/xmerl_xsd_SUITE.erl
@@ -62,7 +62,7 @@ groups() ->
sis2, state2file_file2state, union]},
{ticket_tests, [],
[ticket_6910, ticket_7165, ticket_7190, ticket_7288,
- ticket_7736, ticket_8599]},
+ ticket_7736, ticket_8599, ticket_9410]},
{facets, [],
[length, minLength, maxLength, pattern, enumeration,
whiteSpace, maxInclusive, maxExclusive, minExclusive,
@@ -1146,3 +1146,8 @@ ticket_8599(Config) ->
?line {{xmlElement,persons,persons,_,_,_,_,_,_,_,_,_},_GlobalState} = xmerl_xsd:validate(E, S).
+
+ticket_9410(suite) -> [];
+ticket_9410(Config) ->
+ file:set_cwd(filename:join([?config(data_dir,Config),".."])),
+ ?line {ok, _S} = xmerl_xsd:process_schema("xmerl_xsd_SUITE_data/small.xsd").